diff options
Diffstat (limited to 'rich')
72 files changed, 21024 insertions, 0 deletions
diff --git a/rich/__init__.py b/rich/__init__.py new file mode 100644 index 0000000..b0e4c8d --- /dev/null +++ b/rich/__init__.py @@ -0,0 +1,120 @@ +"""Rich text and beautiful formatting in the terminal.""" + +import os +from typing import Any, IO, Optional, TYPE_CHECKING + +__all__ = ["get_console", "reconfigure", "print", "inspect"] + +if TYPE_CHECKING: + from .console import Console + +# Global console used by alternative print +_console: Optional["Console"] = None + +_IMPORT_CWD = os.path.abspath(os.getcwd()) + + +def get_console() -> "Console": + """Get a global :class:`~rich.console.Console` instance. This function is used when Rich requires a Console, + and hasn't been explicitly given one. + + Returns: + Console: A console instance. + """ + global _console + if _console is None: + from .console import Console + + _console = Console() + + return _console + + +def reconfigure(*args, **kwargs) -> None: + """Reconfigures the global console bu replacing it with another. + + Args: + console (Console): Replacement console instance. + """ + from rich.console import Console + + new_console = Console(*args, **kwargs) + _console.__dict__ = new_console.__dict__ + + +def print(*objects: Any, sep=" ", end="\n", file: IO[str] = None, flush: bool = False): + r"""Print object(s) supplied via positional arguments. + This function has an identical signature to the built-in print. + For more advanced features, see the :class:`~rich.console.Console` class. + + Args: + sep (str, optional): Separator between printed objects. Defaults to " ". + end (str, optional): Character to write at end of output. Defaults to "\\n". + file (IO[str], optional): File to write to, or None for stdout. Defaults to None. + flush (bool, optional): Has no effect as Rich always flushes output. Defaults to False. + + """ + from .console import Console + + write_console = get_console() if file is None else Console(file=file) + return write_console.print(*objects, sep=sep, end=end) + + +def inspect( + obj: Any, + *, + console: "Console" = None, + title: str = None, + help: bool = False, + methods: bool = False, + docs: bool = True, + private: bool = False, + dunder: bool = False, + sort: bool = True, + all: bool = False, + value: bool = True +): + """Inspect any Python object. + + * inspect(<OBJECT>) to see summarized info. + * inspect(<OBJECT>, methods=True) to see methods. + * inspect(<OBJECT>, help=True) to see full (non-abbreviated) help. + * inspect(<OBJECT>, private=True) to see private attributes (single underscore). + * inspect(<OBJECT>, dunder=True) to see attributes beginning with double underscore. + * inspect(<OBJECT>, all=True) to see all attributes. + + Args: + obj (Any): An object to inspect. + title (str, optional): Title to display over inspect result, or None use type. Defaults to None. + help (bool, optional): Show full help text rather than just first paragraph. Defaults to False. + methods (bool, optional): Enable inspection of callables. Defaults to False. + docs (bool, optional): Also render doc strings. Defaults to True. + private (bool, optional): Show private attributes (beginning with underscore). Defaults to False. + dunder (bool, optional): Show attributes starting with double underscore. Defaults to False. + sort (bool, optional): Sort attributes alphabetically. Defaults to True. + all (bool, optional): Show all attributes. Defaults to False. + value (bool, optional): Pretty print value. Defaults to True. + """ + _console = console or get_console() + from rich._inspect import Inspect + + # Special case for inspect(inspect) + is_inspect = obj is inspect + + _inspect = Inspect( + obj, + title=title, + help=is_inspect or help, + methods=is_inspect or methods, + docs=is_inspect or docs, + private=private, + dunder=dunder, + sort=sort, + all=all, + value=value, + ) + _console.print(_inspect) + + +if __name__ == "__main__": # pragma: no cover + print("Hello, **World**") diff --git a/rich/__main__.py b/rich/__main__.py new file mode 100644 index 0000000..411c1f5 --- /dev/null +++ b/rich/__main__.py @@ -0,0 +1,277 @@ +import colorsys +import io +from time import process_time + +from rich import box +from rich.color import Color +from rich.console import Console, ConsoleOptions, RenderGroup, RenderResult +from rich.markdown import Markdown +from rich.measure import Measurement +from rich.pretty import Pretty +from rich.segment import Segment +from rich.style import Style +from rich.syntax import Syntax +from rich.table import Table +from rich.text import Text + + +class ColorBox: + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + for y in range(0, 5): + for x in range(options.max_width): + h = x / options.max_width + l = 0.1 + ((y / 5) * 0.7) + r1, g1, b1 = colorsys.hls_to_rgb(h, l, 1.0) + r2, g2, b2 = colorsys.hls_to_rgb(h, l + 0.7 / 10, 1.0) + bgcolor = Color.from_rgb(r1 * 255, g1 * 255, b1 * 255) + color = Color.from_rgb(r2 * 255, g2 * 255, b2 * 255) + yield Segment("▄", Style(color=color, bgcolor=bgcolor)) + yield Segment.line() + + def __rich_measure__(self, console: "Console", max_width: int) -> Measurement: + return Measurement(1, max_width) + + +def make_test_card() -> Table: + """Get a renderable that demonstrates a number of features.""" + table = Table.grid(padding=1, pad_edge=True) + table.title = "Rich features" + table.add_column("Feature", no_wrap=True, justify="center", style="bold red") + table.add_column("Demonstration") + + color_table = Table( + box=None, + expand=False, + show_header=False, + show_edge=False, + pad_edge=False, + ) + color_table.add_row( + # "[bold yellow]256[/] colors or [bold green]16.7 million[/] colors [blue](if supported by your terminal)[/].", + ( + "✓ [bold green]4-bit color[/]\n" + "✓ [bold blue]8-bit color[/]\n" + "✓ [bold magenta]Truecolor (16.7 million)[/]\n" + "✓ [bold yellow]Dumb terminals[/]\n" + "✓ [bold cyan]Automatic color conversion" + ), + ColorBox(), + ) + + table.add_row("Colors", color_table) + + table.add_row( + "Styles", + "All ansi styles: [bold]bold[/], [dim]dim[/], [italic]italic[/italic], [underline]underline[/], [strike]strikethrough[/], [reverse]reverse[/], and even [blink]blink[/].", + ) + + lorem = "Lorem ipsum dolor sit amet, consectetur adipiscing elit. Quisque in metus sed sapien ultricies pretium a at justo. Maecenas luctus velit et auctor maximus." + lorem_table = Table.grid(padding=1, collapse_padding=True) + lorem_table.pad_edge = False + lorem_table.add_row( + Text(lorem, justify="left", style="green"), + Text(lorem, justify="center", style="yellow"), + Text(lorem, justify="right", style="blue"), + Text(lorem, justify="full", style="red"), + ) + table.add_row( + "Text", + RenderGroup( + Text.from_markup( + """Word wrap text. Justify [green]left[/], [yellow]center[/], [blue]right[/] or [red]full[/].\n""" + ), + lorem_table, + ), + ) + + def comparison(renderable1, renderable2) -> Table: + table = Table(show_header=False, pad_edge=False, box=None, expand=True) + table.add_column("1", ratio=1) + table.add_column("2", ratio=1) + table.add_row(renderable1, renderable2) + return table + + table.add_row( + "Asian\nlanguage\nsupport", + ":flag_for_china: 该库支持中文，日文和韩文文本！\n:flag_for_japan: ライブラリは中国語、日本語、韓国語のテキストをサポートしています\n:flag_for_south_korea: 이 라이브러리는 중국어, 일본어 및 한국어 텍스트를 지원합니다", + ) + + markup_example = ( + "[bold magenta]Rich[/] supports a simple [i]bbcode[/i] like [b]markup[/b] for [yellow]color[/], [underline]style[/], and emoji! " + ":+1: :apple: :ant: :bear: :baguette_bread: :bus: " + ) + table.add_row("Markup", markup_example) + + example_table = Table( + show_edge=False, + show_header=True, + expand=False, + row_styles=["none", "dim"], + box=box.SIMPLE, + ) + example_table.add_column("[green]Date", style="green", no_wrap=True) + example_table.add_column("[blue]Title", style="blue") + example_table.add_column( + "[cyan]Production Budget", + style="cyan", + justify="right", + no_wrap=True, + ) + example_table.add_column( + "[magenta]Box Office", + style="magenta", + justify="right", + no_wrap=True, + ) + example_table.add_row( + "Dec 20, 2019", + "Star Wars: The Rise of Skywalker", + "$275,000,000", + "$375,126,118", + ) + example_table.add_row( + "May 25, 2018", + "[b]Solo[/]: A Star Wars Story", + "$275,000,000", + "$393,151,347", + ) + example_table.add_row( + "Dec 15, 2017", + "Star Wars Ep. VIII: The Last Jedi", + "$262,000,000", + "[bold]$1,332,539,889[/bold]", + ) + example_table.add_row( + "May 19, 1999", + "Star Wars Ep. [b]I[/b]: [i]The phantom Menace", + "$115,000,000", + "$1,027,044,677", + ) + + table.add_row("Tables", example_table) + + code = '''\ +def iter_last(values: Iterable[T]) -> Iterable[Tuple[bool, T]]: + """Iterate and generate a tuple with a flag for last value.""" + iter_values = iter(values) + try: + previous_value = next(iter_values) + except StopIteration: + return + for value in iter_values: + yield False, previous_value + previous_value = value + yield True, previous_value''' + + pretty_data = { + "foo": [ + 3.1427, + ( + "Paul Atriedies", + "Vladimir Harkonnen", + "Thufir Haway", + ), + ], + "atomic": (False, True, None), + } + table.add_row( + "Syntax\nhighlighting\n&\npretty\nprinting", + comparison( + Syntax(code, "python3", line_numbers=True, indent_guides=True), + Pretty(pretty_data, indent_guides=True), + ), + ) + + markdown_example = """\ +# Markdown + +Supports much of the *markdown*, __syntax__! + +- Headers +- Basic formatting: **bold**, *italic*, `code` +- Block quotes +- Lists, and more... + """ + table.add_row( + "Markdown", comparison("[cyan]" + markdown_example, Markdown(markdown_example)) + ) + + table.add_row( + "+more!", + """Progress bars, columns, styled logging handler, tracebacks, etc...""", + ) + return table + + +if __name__ == "__main__": # pragma: no cover + + console = Console( + file=io.StringIO(), + force_terminal=True, + ) + test_card = make_test_card() + + # Print once to warm cache + console.print(test_card) + console.file = io.StringIO() + + start = process_time() + console.print(test_card) + taken = round((process_time() - start) * 1000.0, 1) + + text = console.file.getvalue() + # https://bugs.python.org/issue37871 + for line in text.splitlines(): + print(line) + + print(f"rendered in {taken}ms") + + from rich.panel import Panel + + console = Console() + + sponsor_message = Table.grid(padding=1) + sponsor_message.add_column(style="green", justify="right") + sponsor_message.add_column(no_wrap=True) + sponsor_message.add_row( + "Sponsor me", + "[u blue link=https://github.com/sponsors/willmcgugan]https://github.com/sponsors/willmcgugan", + ) + sponsor_message.add_row( + "Buy me a :coffee:", + "[u blue link=https://ko-fi.com/willmcgugan]https://ko-fi.com/willmcgugan", + ) + sponsor_message.add_row( + "Twitter", + "[u blue link=https://twitter.com/willmcgugan]https://twitter.com/willmcgugan", + ) + sponsor_message.add_row( + "Blog", "[u blue link=https://www.willmcgugan.com]https://www.willmcgugan.com" + ) + + intro_message = Text.from_markup( + """\ +It takes a lot of time to develop Rich and to provide support. + +Consider supporting my work via Github Sponsors (ask your company / organization), or buy me a coffee to say thanks. + +- Will McGugan""" + ) + + message = Table.grid(padding=2) + message.add_column() + message.add_column(no_wrap=True) + message.add_row(intro_message, sponsor_message) + + console.print( + Panel.fit( + message, + box=box.ROUNDED, + padding=(1, 2), + title="[b red]Thanks for trying out Rich!", + border_style="bright_blue", + ), + justify="center", + ) diff --git a/rich/_cell_widths.py b/rich/_cell_widths.py new file mode 100644 index 0000000..36286df --- /dev/null +++ b/rich/_cell_widths.py @@ -0,0 +1,451 @@ +# Auto generated by make_terminal_widths.py + +CELL_WIDTHS = [ + (0, 0, 0), + (1, 31, -1), + (127, 159, -1), + (768, 879, 0), + (1155, 1161, 0), + (1425, 1469, 0), + (1471, 1471, 0), + (1473, 1474, 0), + (1476, 1477, 0), + (1479, 1479, 0), + (1552, 1562, 0), + (1611, 1631, 0), + (1648, 1648, 0), + (1750, 1756, 0), + (1759, 1764, 0), + (1767, 1768, 0), + (1770, 1773, 0), + (1809, 1809, 0), + (1840, 1866, 0), + (1958, 1968, 0), + (2027, 2035, 0), + (2045, 2045, 0), + (2070, 2073, 0), + (2075, 2083, 0), + (2085, 2087, 0), + (2089, 2093, 0), + (2137, 2139, 0), + (2259, 2273, 0), + (2275, 2306, 0), + (2362, 2362, 0), + (2364, 2364, 0), + (2369, 2376, 0), + (2381, 2381, 0), + (2385, 2391, 0), + (2402, 2403, 0), + (2433, 2433, 0), + (2492, 2492, 0), + (2497, 2500, 0), + (2509, 2509, 0), + (2530, 2531, 0), + (2558, 2558, 0), + (2561, 2562, 0), + (2620, 2620, 0), + (2625, 2626, 0), + (2631, 2632, 0), + (2635, 2637, 0), + (2641, 2641, 0), + (2672, 2673, 0), + (2677, 2677, 0), + (2689, 2690, 0), + (2748, 2748, 0), + (2753, 2757, 0), + (2759, 2760, 0), + (2765, 2765, 0), + (2786, 2787, 0), + (2810, 2815, 0), + (2817, 2817, 0), + (2876, 2876, 0), + (2879, 2879, 0), + (2881, 2884, 0), + (2893, 2893, 0), + (2901, 2902, 0), + (2914, 2915, 0), + (2946, 2946, 0), + (3008, 3008, 0), + (3021, 3021, 0), + (3072, 3072, 0), + (3076, 3076, 0), + (3134, 3136, 0), + (3142, 3144, 0), + (3146, 3149, 0), + (3157, 3158, 0), + (3170, 3171, 0), + (3201, 3201, 0), + (3260, 3260, 0), + (3263, 3263, 0), + (3270, 3270, 0), + (3276, 3277, 0), + (3298, 3299, 0), + (3328, 3329, 0), + (3387, 3388, 0), + (3393, 3396, 0), + (3405, 3405, 0), + (3426, 3427, 0), + (3457, 3457, 0), + (3530, 3530, 0), + (3538, 3540, 0), + (3542, 3542, 0), + (3633, 3633, 0), + (3636, 3642, 0), + (3655, 3662, 0), + (3761, 3761, 0), + (3764, 3772, 0), + (3784, 3789, 0), + (3864, 3865, 0), + (3893, 3893, 0), + (3895, 3895, 0), + (3897, 3897, 0), + (3953, 3966, 0), + (3968, 3972, 0), + (3974, 3975, 0), + (3981, 3991, 0), + (3993, 4028, 0), + (4038, 4038, 0), + (4141, 4144, 0), + (4146, 4151, 0), + (4153, 4154, 0), + (4157, 4158, 0), + (4184, 4185, 0), + (4190, 4192, 0), + (4209, 4212, 0), + (4226, 4226, 0), + (4229, 4230, 0), + (4237, 4237, 0), + (4253, 4253, 0), + (4352, 4447, 2), + (4957, 4959, 0), + (5906, 5908, 0), + (5938, 5940, 0), + (5970, 5971, 0), + (6002, 6003, 0), + (6068, 6069, 0), + (6071, 6077, 0), + (6086, 6086, 0), + (6089, 6099, 0), + (6109, 6109, 0), + (6155, 6157, 0), + (6277, 6278, 0), + (6313, 6313, 0), + (6432, 6434, 0), + (6439, 6440, 0), + (6450, 6450, 0), + (6457, 6459, 0), + (6679, 6680, 0), + (6683, 6683, 0), + (6742, 6742, 0), + (6744, 6750, 0), + (6752, 6752, 0), + (6754, 6754, 0), + (6757, 6764, 0), + (6771, 6780, 0), + (6783, 6783, 0), + (6832, 6848, 0), + (6912, 6915, 0), + (6964, 6964, 0), + (6966, 6970, 0), + (6972, 6972, 0), + (6978, 6978, 0), + (7019, 7027, 0), + (7040, 7041, 0), + (7074, 7077, 0), + (7080, 7081, 0), + (7083, 7085, 0), + (7142, 7142, 0), + (7144, 7145, 0), + (7149, 7149, 0), + (7151, 7153, 0), + (7212, 7219, 0), + (7222, 7223, 0), + (7376, 7378, 0), + (7380, 7392, 0), + (7394, 7400, 0), + (7405, 7405, 0), + (7412, 7412, 0), + (7416, 7417, 0), + (7616, 7673, 0), + (7675, 7679, 0), + (8203, 8207, 0), + (8232, 8238, 0), + (8288, 8291, 0), + (8400, 8432, 0), + (8986, 8987, 2), + (9001, 9002, 2), + (9193, 9196, 2), + (9200, 9200, 2), + (9203, 9203, 2), + (9725, 9726, 2), + (9748, 9749, 2), + (9800, 9811, 2), + (9855, 9855, 2), + (9875, 9875, 2), + (9889, 9889, 2), + (9898, 9899, 2), + (9917, 9918, 2), + (9924, 9925, 2), + (9934, 9934, 2), + (9940, 9940, 2), + (9962, 9962, 2), + (9970, 9971, 2), + (9973, 9973, 2), + (9978, 9978, 2), + (9981, 9981, 2), + (9989, 9989, 2), + (9994, 9995, 2), + (10024, 10024, 2), + (10060, 10060, 2), + (10062, 10062, 2), + (10067, 10069, 2), + (10071, 10071, 2), + (10133, 10135, 2), + (10160, 10160, 2), + (10175, 10175, 2), + (11035, 11036, 2), + (11088, 11088, 2), + (11093, 11093, 2), + (11503, 11505, 0), + (11647, 11647, 0), + (11744, 11775, 0), + (11904, 11929, 2), + (11931, 12019, 2), + (12032, 12245, 2), + (12272, 12283, 2), + (12288, 12329, 2), + (12330, 12333, 0), + (12334, 12350, 2), + (12353, 12438, 2), + (12441, 12442, 0), + (12443, 12543, 2), + (12549, 12591, 2), + (12593, 12686, 2), + (12688, 12771, 2), + (12784, 12830, 2), + (12832, 12871, 2), + (12880, 19903, 2), + (19968, 42124, 2), + (42128, 42182, 2), + (42607, 42610, 0), + (42612, 42621, 0), + (42654, 42655, 0), + (42736, 42737, 0), + (43010, 43010, 0), + (43014, 43014, 0), + (43019, 43019, 0), + (43045, 43046, 0), + (43052, 43052, 0), + (43204, 43205, 0), + (43232, 43249, 0), + (43263, 43263, 0), + (43302, 43309, 0), + (43335, 43345, 0), + (43360, 43388, 2), + (43392, 43394, 0), + (43443, 43443, 0), + (43446, 43449, 0), + (43452, 43453, 0), + (43493, 43493, 0), + (43561, 43566, 0), + (43569, 43570, 0), + (43573, 43574, 0), + (43587, 43587, 0), + (43596, 43596, 0), + (43644, 43644, 0), + (43696, 43696, 0), + (43698, 43700, 0), + (43703, 43704, 0), + (43710, 43711, 0), + (43713, 43713, 0), + (43756, 43757, 0), + (43766, 43766, 0), + (44005, 44005, 0), + (44008, 44008, 0), + (44013, 44013, 0), + (44032, 55203, 2), + (63744, 64255, 2), + (64286, 64286, 0), + (65024, 65039, 0), + (65040, 65049, 2), + (65056, 65071, 0), + (65072, 65106, 2), + (65108, 65126, 2), + (65128, 65131, 2), + (65281, 65376, 2), + (65504, 65510, 2), + (66045, 66045, 0), + (66272, 66272, 0), + (66422, 66426, 0), + (68097, 68099, 0), + (68101, 68102, 0), + (68108, 68111, 0), + (68152, 68154, 0), + (68159, 68159, 0), + (68325, 68326, 0), + (68900, 68903, 0), + (69291, 69292, 0), + (69446, 69456, 0), + (69633, 69633, 0), + (69688, 69702, 0), + (69759, 69761, 0), + (69811, 69814, 0), + (69817, 69818, 0), + (69888, 69890, 0), + (69927, 69931, 0), + (69933, 69940, 0), + (70003, 70003, 0), + (70016, 70017, 0), + (70070, 70078, 0), + (70089, 70092, 0), + (70095, 70095, 0), + (70191, 70193, 0), + (70196, 70196, 0), + (70198, 70199, 0), + (70206, 70206, 0), + (70367, 70367, 0), + (70371, 70378, 0), + (70400, 70401, 0), + (70459, 70460, 0), + (70464, 70464, 0), + (70502, 70508, 0), + (70512, 70516, 0), + (70712, 70719, 0), + (70722, 70724, 0), + (70726, 70726, 0), + (70750, 70750, 0), + (70835, 70840, 0), + (70842, 70842, 0), + (70847, 70848, 0), + (70850, 70851, 0), + (71090, 71093, 0), + (71100, 71101, 0), + (71103, 71104, 0), + (71132, 71133, 0), + (71219, 71226, 0), + (71229, 71229, 0), + (71231, 71232, 0), + (71339, 71339, 0), + (71341, 71341, 0), + (71344, 71349, 0), + (71351, 71351, 0), + (71453, 71455, 0), + (71458, 71461, 0), + (71463, 71467, 0), + (71727, 71735, 0), + (71737, 71738, 0), + (71995, 71996, 0), + (71998, 71998, 0), + (72003, 72003, 0), + (72148, 72151, 0), + (72154, 72155, 0), + (72160, 72160, 0), + (72193, 72202, 0), + (72243, 72248, 0), + (72251, 72254, 0), + (72263, 72263, 0), + (72273, 72278, 0), + (72281, 72283, 0), + (72330, 72342, 0), + (72344, 72345, 0), + (72752, 72758, 0), + (72760, 72765, 0), + (72767, 72767, 0), + (72850, 72871, 0), + (72874, 72880, 0), + (72882, 72883, 0), + (72885, 72886, 0), + (73009, 73014, 0), + (73018, 73018, 0), + (73020, 73021, 0), + (73023, 73029, 0), + (73031, 73031, 0), + (73104, 73105, 0), + (73109, 73109, 0), + (73111, 73111, 0), + (73459, 73460, 0), + (92912, 92916, 0), + (92976, 92982, 0), + (94031, 94031, 0), + (94095, 94098, 0), + (94176, 94179, 2), + (94180, 94180, 0), + (94192, 94193, 2), + (94208, 100343, 2), + (100352, 101589, 2), + (101632, 101640, 2), + (110592, 110878, 2), + (110928, 110930, 2), + (110948, 110951, 2), + (110960, 111355, 2), + (113821, 113822, 0), + (119143, 119145, 0), + (119163, 119170, 0), + (119173, 119179, 0), + (119210, 119213, 0), + (119362, 119364, 0), + (121344, 121398, 0), + (121403, 121452, 0), + (121461, 121461, 0), + (121476, 121476, 0), + (121499, 121503, 0), + (121505, 121519, 0), + (122880, 122886, 0), + (122888, 122904, 0), + (122907, 122913, 0), + (122915, 122916, 0), + (122918, 122922, 0), + (123184, 123190, 0), + (123628, 123631, 0), + (125136, 125142, 0), + (125252, 125258, 0), + (126980, 126980, 2), + (127183, 127183, 2), + (127374, 127374, 2), + (127377, 127386, 2), + (127488, 127490, 2), + (127504, 127547, 2), + (127552, 127560, 2), + (127568, 127569, 2), + (127584, 127589, 2), + (127744, 127776, 2), + (127789, 127797, 2), + (127799, 127868, 2), + (127870, 127891, 2), + (127904, 127946, 2), + (127951, 127955, 2), + (127968, 127984, 2), + (127988, 127988, 2), + (127992, 128062, 2), + (128064, 128064, 2), + (128066, 128252, 2), + (128255, 128317, 2), + (128331, 128334, 2), + (128336, 128359, 2), + (128378, 128378, 2), + (128405, 128406, 2), + (128420, 128420, 2), + (128507, 128591, 2), + (128640, 128709, 2), + (128716, 128716, 2), + (128720, 128722, 2), + (128725, 128727, 2), + (128747, 128748, 2), + (128756, 128764, 2), + (128992, 129003, 2), + (129292, 129338, 2), + (129340, 129349, 2), + (129351, 129400, 2), + (129402, 129483, 2), + (129485, 129535, 2), + (129648, 129652, 2), + (129656, 129658, 2), + (129664, 129670, 2), + (129680, 129704, 2), + (129712, 129718, 2), + (129728, 129730, 2), + (129744, 129750, 2), + (131072, 196605, 2), + (196608, 262141, 2), + (917760, 917999, 0), +] diff --git a/rich/_emoji_codes.py b/rich/_emoji_codes.py new file mode 100644 index 0000000..1f2877b --- /dev/null +++ b/rich/_emoji_codes.py @@ -0,0 +1,3610 @@ +EMOJI = { + "1st_place_medal": "🥇", + "2nd_place_medal": "🥈", + "3rd_place_medal": "🥉", + "ab_button_(blood_type)": "🆎", + "atm_sign": "🏧", + "a_button_(blood_type)": "🅰", + "afghanistan": "🇦🇫", + "albania": "🇦🇱", + "algeria": "🇩🇿", + "american_samoa": "🇦🇸", + "andorra": "🇦🇩", + "angola": "🇦🇴", + "anguilla": "🇦🇮", + "antarctica": "🇦🇶", + "antigua_&_barbuda": "🇦🇬", + "aquarius": "♒", + "argentina": "🇦🇷", + "aries": "♈", + "armenia": "🇦🇲", + "aruba": "🇦🇼", + "ascension_island": "🇦🇨", + "australia": "🇦🇺", + "austria": "🇦🇹", + "azerbaijan": "🇦🇿", + "back_arrow": "🔙", + "b_button_(blood_type)": "🅱", + "bahamas": "🇧🇸", + "bahrain": "🇧🇭", + "bangladesh": "🇧🇩", + "barbados": "🇧🇧", + "belarus": "🇧🇾", + "belgium": "🇧🇪", + "belize": "🇧🇿", + "benin": "🇧🇯", + "bermuda": "🇧🇲", + "bhutan": "🇧🇹", + "bolivia": "🇧🇴", + "bosnia_&_herzegovina": "🇧🇦", + "botswana": "🇧🇼", + "bouvet_island": "🇧🇻", + "brazil": "🇧🇷", + "british_indian_ocean_territory": "🇮🇴", + "british_virgin_islands": "🇻🇬", + "brunei": "🇧🇳", + "bulgaria": "🇧🇬", + "burkina_faso": "🇧🇫", + "burundi": "🇧🇮", + "cl_button": "🆑", + "cool_button": "🆒", + "cambodia": "🇰🇭", + "cameroon": "🇨🇲", + "canada": "🇨🇦", + "canary_islands": "🇮🇨", + "cancer": "♋", + "cape_verde": "🇨🇻", + "capricorn": "♑", + "caribbean_netherlands": "🇧🇶", + "cayman_islands": "🇰🇾", + "central_african_republic": "🇨🇫", + "ceuta_&_melilla": "🇪🇦", + "chad": "🇹🇩", + "chile": "🇨🇱", + "china": "🇨🇳", + "christmas_island": "🇨🇽", + "christmas_tree": "🎄", + "clipperton_island": "🇨🇵", + "cocos_(keeling)_islands": "🇨🇨", + "colombia": "🇨🇴", + "comoros": "🇰🇲", + "congo_-_brazzaville": "🇨🇬", + "congo_-_kinshasa": "🇨🇩", + "cook_islands": "🇨🇰", + "costa_rica": "🇨🇷", + "croatia": "🇭🇷", + "cuba": "🇨🇺", + "curaçao": "🇨🇼", + "cyprus": "🇨🇾", + "czechia": "🇨🇿", + "côte_d’ivoire": "🇨🇮", + "denmark": "🇩🇰", + "diego_garcia": "🇩🇬", + "djibouti": "🇩🇯", + "dominica": "🇩🇲", + "dominican_republic": "🇩🇴", + "end_arrow": "🔚", + "ecuador": "🇪🇨", + "egypt": "🇪🇬", + "el_salvador": "🇸🇻", + "england": "🏴\U000e0067\U000e0062\U000e0065\U000e006e\U000e0067\U000e007f", + "equatorial_guinea": "🇬🇶", + "eritrea": "🇪🇷", + "estonia": "🇪🇪", + "ethiopia": "🇪🇹", + "european_union": "🇪🇺", + "free_button": "🆓", + "falkland_islands": "🇫🇰", + "faroe_islands": "🇫🇴", + "fiji": "🇫🇯", + "finland": "🇫🇮", + "france": "🇫🇷", + "french_guiana": "🇬🇫", + "french_polynesia": "🇵🇫", + "french_southern_territories": "🇹🇫", + "gabon": "🇬🇦", + "gambia": "🇬🇲", + "gemini": "♊", + "georgia": "🇬🇪", + "germany": "🇩🇪", + "ghana": "🇬🇭", + "gibraltar": "🇬🇮", + "greece": "🇬🇷", + "greenland": "🇬🇱", + "grenada": "🇬🇩", + "guadeloupe": "🇬🇵", + "guam": "🇬🇺", + "guatemala": "🇬🇹", + "guernsey": "🇬🇬", + "guinea": "🇬🇳", + "guinea-bissau": "🇬🇼", + "guyana": "🇬🇾", + "haiti": "🇭🇹", + "heard_&_mcdonald_islands": "🇭🇲", + "honduras": "🇭🇳", + "hong_kong_sar_china": "🇭🇰", + "hungary": "🇭🇺", + "id_button": "🆔", + "iceland": "🇮🇸", + "india": "🇮🇳", + "indonesia": "🇮🇩", + "iran": "🇮🇷", + "iraq": "🇮🇶", + "ireland": "🇮🇪", + "isle_of_man": "🇮🇲", + "israel": "🇮🇱", + "italy": "🇮🇹", + "jamaica": "🇯🇲", + "japan": "🗾", + "japanese_acceptable_button": "🉑", + "japanese_application_button": "🈸", + "japanese_bargain_button": "🉐", + "japanese_castle": "🏯", + "japanese_congratulations_button": "㊗", + "japanese_discount_button": "🈹", + "japanese_dolls": "🎎", + "japanese_free_of_charge_button": "🈚", + "japanese_here_button": "🈁", + "japanese_monthly_amount_button": "🈷", + "japanese_no_vacancy_button": "🈵", + "japanese_not_free_of_charge_button": "🈶", + "japanese_open_for_business_button": "🈺", + "japanese_passing_grade_button": "🈴", + "japanese_post_office": "🏣", + "japanese_prohibited_button": "🈲", + "japanese_reserved_button": "🈯", + "japanese_secret_button": "㊙", + "japanese_service_charge_button": "🈂", + "japanese_symbol_for_beginner": "🔰", + "japanese_vacancy_button": "🈳", + "jersey": "🇯🇪", + "jordan": "🇯🇴", + "kazakhstan": "🇰🇿", + "kenya": "🇰🇪", + "kiribati": "🇰🇮", + "kosovo": "🇽🇰", + "kuwait": "🇰🇼", + "kyrgyzstan": "🇰🇬", + "laos": "🇱🇦", + "latvia": "🇱🇻", + "lebanon": "🇱🇧", + "leo": "♌", + "lesotho": "🇱🇸", + "liberia": "🇱🇷", + "libra": "♎", + "libya": "🇱🇾", + "liechtenstein": "🇱🇮", + "lithuania": "🇱🇹", + "luxembourg": "🇱🇺", + "macau_sar_china": "🇲🇴", + "macedonia": "🇲🇰", + "madagascar": "🇲🇬", + "malawi": "🇲🇼", + "malaysia": "🇲🇾", + "maldives": "🇲🇻", + "mali": "🇲🇱", + "malta": "🇲🇹", + "marshall_islands": "🇲🇭", + "martinique": "🇲🇶", + "mauritania": "🇲🇷", + "mauritius": "🇲🇺", + "mayotte": "🇾🇹", + "mexico": "🇲🇽", + "micronesia": "🇫🇲", + "moldova": "🇲🇩", + "monaco": "🇲🇨", + "mongolia": "🇲🇳", + "montenegro": "🇲🇪", + "montserrat": "🇲🇸", + "morocco": "🇲🇦", + "mozambique": "🇲🇿", + "mrs._claus": "🤶", + "mrs._claus_dark_skin_tone": "🤶🏿", + "mrs._claus_light_skin_tone": "🤶🏻", + "mrs._claus_medium-dark_skin_tone": "🤶🏾", + "mrs._claus_medium-light_skin_tone": "🤶🏼", + "mrs._claus_medium_skin_tone": "🤶🏽", + "myanmar_(burma)": "🇲🇲", + "new_button": "🆕", + "ng_button": "🆖", + "namibia": "🇳🇦", + "nauru": "🇳🇷", + "nepal": "🇳🇵", + "netherlands": "🇳🇱", + "new_caledonia": "🇳🇨", + "new_zealand": "🇳🇿", + "nicaragua": "🇳🇮", + "niger": "🇳🇪", + "nigeria": "🇳🇬", + "niue": "🇳🇺", + "norfolk_island": "🇳🇫", + "north_korea": "🇰🇵", + "northern_mariana_islands": "🇲🇵", + "norway": "🇳🇴", + "ok_button": "🆗", + "ok_hand": "👌", + "ok_hand_dark_skin_tone": "👌🏿", + "ok_hand_light_skin_tone": "👌🏻", + "ok_hand_medium-dark_skin_tone": "👌🏾", + "ok_hand_medium-light_skin_tone": "👌🏼", + "ok_hand_medium_skin_tone": "👌🏽", + "on!_arrow": "🔛", + "o_button_(blood_type)": "🅾", + "oman": "🇴🇲", + "ophiuchus": "⛎", + "p_button": "🅿", + "pakistan": "🇵🇰", + "palau": "🇵🇼", + "palestinian_territories": "🇵🇸", + "panama": "🇵🇦", + "papua_new_guinea": "🇵🇬", + "paraguay": "🇵🇾", + "peru": "🇵🇪", + "philippines": "🇵🇭", + "pisces": "♓", + "pitcairn_islands": "🇵🇳", + "poland": "🇵🇱", + "portugal": "🇵🇹", + "puerto_rico": "🇵🇷", + "qatar": "🇶🇦", + "romania": "🇷🇴", + "russia": "🇷🇺", + "rwanda": "🇷🇼", + "réunion": "🇷🇪", + "soon_arrow": "🔜", + "sos_button": "🆘", + "sagittarius": "♐", + "samoa": "🇼🇸", + "san_marino": "🇸🇲", + "santa_claus": "🎅", + "santa_claus_dark_skin_tone": "🎅🏿", + "santa_claus_light_skin_tone": "🎅🏻", + "santa_claus_medium-dark_skin_tone": "🎅🏾", + "santa_claus_medium-light_skin_tone": "🎅🏼", + "santa_claus_medium_skin_tone": "🎅🏽", + "saudi_arabia": "🇸🇦", + "scorpio": "♏", + "scotland": "🏴\U000e0067\U000e0062\U000e0073\U000e0063\U000e0074\U000e007f", + "senegal": "🇸🇳", + "serbia": "🇷🇸", + "seychelles": "🇸🇨", + "sierra_leone": "🇸🇱", + "singapore": "🇸🇬", + "sint_maarten": "🇸🇽", + "slovakia": "🇸🇰", + "slovenia": "🇸🇮", + "solomon_islands": "🇸🇧", + "somalia": "🇸🇴", + "south_africa": "🇿🇦", + "south_georgia_&_south_sandwich_islands": "🇬🇸", + "south_korea": "🇰🇷", + "south_sudan": "🇸🇸", + "spain": "🇪🇸", + "sri_lanka": "🇱🇰", + "st._barthélemy": "🇧🇱", + "st._helena": "🇸🇭", + "st._kitts_&_nevis": "🇰🇳", + "st._lucia": "🇱🇨", + "st._martin": "🇲🇫", + "st._pierre_&_miquelon": "🇵🇲", + "st._vincent_&_grenadines": "🇻🇨", + "statue_of_liberty": "🗽", + "sudan": "🇸🇩", + "suriname": "🇸🇷", + "svalbard_&_jan_mayen": "🇸🇯", + "swaziland": "🇸🇿", + "sweden": "🇸🇪", + "switzerland": "🇨🇭", + "syria": "🇸🇾", + "são_tomé_&_príncipe": "🇸🇹", + "t-rex": "🦖", + "top_arrow": "🔝", + "taiwan": "🇹🇼", + "tajikistan": "🇹🇯", + "tanzania": "🇹🇿", + "taurus": "♉", + "thailand": "🇹🇭", + "timor-leste": "🇹🇱", + "togo": "🇹🇬", + "tokelau": "🇹🇰", + "tokyo_tower": "🗼", + "tonga": "🇹🇴", + "trinidad_&_tobago": "🇹🇹", + "tristan_da_cunha": "🇹🇦", + "tunisia": "🇹🇳", + "turkey": "🦃", + "turkmenistan": "🇹🇲", + "turks_&_caicos_islands": "🇹🇨", + "tuvalu": "🇹🇻", + "u.s._outlying_islands": "🇺🇲", + "u.s._virgin_islands": "🇻🇮", + "up!_button": "🆙", + "uganda": "🇺🇬", + "ukraine": "🇺🇦", + "united_arab_emirates": "🇦🇪", + "united_kingdom": "🇬🇧", + "united_nations": "🇺🇳", + "united_states": "🇺🇸", + "uruguay": "🇺🇾", + "uzbekistan": "🇺🇿", + "vs_button": "🆚", + "vanuatu": "🇻🇺", + "vatican_city": "🇻🇦", + "venezuela": "🇻🇪", + "vietnam": "🇻🇳", + "virgo": "♍", + "wales": "🏴\U000e0067\U000e0062\U000e0077\U000e006c\U000e0073\U000e007f", + "wallis_&_futuna": "🇼🇫", + "western_sahara": "🇪🇭", + "yemen": "🇾🇪", + "zambia": "🇿🇲", + "zimbabwe": "🇿🇼", + "abacus": "🧮", + "adhesive_bandage": "🩹", + "admission_tickets": "🎟", + "adult": "🧑", + "adult_dark_skin_tone": "🧑🏿", + "adult_light_skin_tone": "🧑🏻", + "adult_medium-dark_skin_tone": "🧑🏾", + "adult_medium-light_skin_tone": "🧑🏼", + "adult_medium_skin_tone": "🧑🏽", + "aerial_tramway": "🚡", + "airplane": "✈", + "airplane_arrival": "🛬", + "airplane_departure": "🛫", + "alarm_clock": "⏰", + "alembic": "⚗", + "alien": "👽", + "alien_monster": "👾", + "ambulance": "🚑", + "american_football": "🏈", + "amphora": "🏺", + "anchor": "⚓", + "anger_symbol": "💢", + "angry_face": "😠", + "angry_face_with_horns": "👿", + "anguished_face": "😧", + "ant": "🐜", + "antenna_bars": "📶", + "anxious_face_with_sweat": "😰", + "articulated_lorry": "🚛", + "artist_palette": "🎨", + "astonished_face": "😲", + "atom_symbol": "⚛", + "auto_rickshaw": "🛺", + "automobile": "🚗", + "avocado": "🥑", + "axe": "🪓", + "baby": "👶", + "baby_angel": "👼", + "baby_angel_dark_skin_tone": "👼🏿", + "baby_angel_light_skin_tone": "👼🏻", + "baby_angel_medium-dark_skin_tone": "👼🏾", + "baby_angel_medium-light_skin_tone": "👼🏼", + "baby_angel_medium_skin_tone": "👼🏽", + "baby_bottle": "🍼", + "baby_chick": "🐤", + "baby_dark_skin_tone": "👶🏿", + "baby_light_skin_tone": "👶🏻", + "baby_medium-dark_skin_tone": "👶🏾", + "baby_medium-light_skin_tone": "👶🏼", + "baby_medium_skin_tone": "👶🏽", + "baby_symbol": "🚼", + "backhand_index_pointing_down": "👇", + "backhand_index_pointing_down_dark_skin_tone": "👇🏿", + "backhand_index_pointing_down_light_skin_tone": "👇🏻", + "backhand_index_pointing_down_medium-dark_skin_tone": "👇🏾", + "backhand_index_pointing_down_medium-light_skin_tone": "👇🏼", + "backhand_index_pointing_down_medium_skin_tone": "👇🏽", + "backhand_index_pointing_left": "👈", + "backhand_index_pointing_left_dark_skin_tone": "👈🏿", + "backhand_index_pointing_left_light_skin_tone": "👈🏻", + "backhand_index_pointing_left_medium-dark_skin_tone": "👈🏾", + "backhand_index_pointing_left_medium-light_skin_tone": "👈🏼", + "backhand_index_pointing_left_medium_skin_tone": "👈🏽", + "backhand_index_pointing_right": "👉", + "backhand_index_pointing_right_dark_skin_tone": "👉🏿", + "backhand_index_pointing_right_light_skin_tone": "👉🏻", + "backhand_index_pointing_right_medium-dark_skin_tone": "👉🏾", + "backhand_index_pointing_right_medium-light_skin_tone": "👉🏼", + "backhand_index_pointing_right_medium_skin_tone": "👉🏽", + "backhand_index_pointing_up": "👆", + "backhand_index_pointing_up_dark_skin_tone": "👆🏿", + "backhand_index_pointing_up_light_skin_tone": "👆🏻", + "backhand_index_pointing_up_medium-dark_skin_tone": "👆🏾", + "backhand_index_pointing_up_medium-light_skin_tone": "👆🏼", + "backhand_index_pointing_up_medium_skin_tone": "👆🏽", + "bacon": "🥓", + "badger": "🦡", + "badminton": "🏸", + "bagel": "🥯", + "baggage_claim": "🛄", + "baguette_bread": "🥖", + "balance_scale": "⚖", + "bald": "🦲", + "bald_man": "👨\u200d🦲", + "bald_woman": "👩\u200d🦲", + "ballet_shoes": "🩰", + "balloon": "🎈", + "ballot_box_with_ballot": "🗳", + "ballot_box_with_check": "☑", + "banana": "🍌", + "banjo": "🪕", + "bank": "🏦", + "bar_chart": "📊", + "barber_pole": "💈", + "baseball": "⚾", + "basket": "🧺", + "basketball": "🏀", + "bat": "🦇", + "bathtub": "🛁", + "battery": "🔋", + "beach_with_umbrella": "🏖", + "beaming_face_with_smiling_eyes": "😁", + "bear_face": "🐻", + "bearded_person": "🧔", + "bearded_person_dark_skin_tone": "🧔🏿", + "bearded_person_light_skin_tone": "🧔🏻", + "bearded_person_medium-dark_skin_tone": "🧔🏾", + "bearded_person_medium-light_skin_tone": "🧔🏼", + "bearded_person_medium_skin_tone": "🧔🏽", + "beating_heart": "💓", + "bed": "🛏", + "beer_mug": "🍺", + "bell": "🔔", + "bell_with_slash": "🔕", + "bellhop_bell": "🛎", + "bento_box": "🍱", + "beverage_box": "🧃", + "bicycle": "🚲", + "bikini": "👙", + "billed_cap": "🧢", + "biohazard": "☣", + "bird": "🐦", + "birthday_cake": "🎂", + "black_circle": "⚫", + "black_flag": "🏴", + "black_heart": "🖤", + "black_large_square": "⬛", + "black_medium-small_square": "◾", + "black_medium_square": "◼", + "black_nib": "✒", + "black_small_square": "▪", + "black_square_button": "🔲", + "blond-haired_man": "👱\u200d♂️", + "blond-haired_man_dark_skin_tone": "👱🏿\u200d♂️", + "blond-haired_man_light_skin_tone": "👱🏻\u200d♂️", + "blond-haired_man_medium-dark_skin_tone": "👱🏾\u200d♂️", + "blond-haired_man_medium-light_skin_tone": "👱🏼\u200d♂️", + "blond-haired_man_medium_skin_tone": "👱🏽\u200d♂️", + "blond-haired_person": "👱", + "blond-haired_person_dark_skin_tone": "👱🏿", + "blond-haired_person_light_skin_tone": "👱🏻", + "blond-haired_person_medium-dark_skin_tone": "👱🏾", + "blond-haired_person_medium-light_skin_tone": "👱🏼", + "blond-haired_person_medium_skin_tone": "👱🏽", + "blond-haired_woman": "👱\u200d♀️", + "blond-haired_woman_dark_skin_tone": "👱🏿\u200d♀️", + "blond-haired_woman_light_skin_tone": "👱🏻\u200d♀️", + "blond-haired_woman_medium-dark_skin_tone": "👱🏾\u200d♀️", + "blond-haired_woman_medium-light_skin_tone": "👱🏼\u200d♀️", + "blond-haired_woman_medium_skin_tone": "👱🏽\u200d♀️", + "blossom": "🌼", + "blowfish": "🐡", + "blue_book": "📘", + "blue_circle": "🔵", + "blue_heart": "💙", + "blue_square": "🟦", + "boar": "🐗", + "bomb": "💣", + "bone": "🦴", + "bookmark": "🔖", + "bookmark_tabs": "📑", + "books": "📚", + "bottle_with_popping_cork": "🍾", + "bouquet": "💐", + "bow_and_arrow": "🏹", + "bowl_with_spoon": "🥣", + "bowling": "🎳", + "boxing_glove": "🥊", + "boy": "👦", + "boy_dark_skin_tone": "👦🏿", + "boy_light_skin_tone": "👦🏻", + "boy_medium-dark_skin_tone": "👦🏾", + "boy_medium-light_skin_tone": "👦🏼", + "boy_medium_skin_tone": "👦🏽", + "brain": "🧠", + "bread": "🍞", + "breast-feeding": "🤱", + "breast-feeding_dark_skin_tone": "🤱🏿", + "breast-feeding_light_skin_tone": "🤱🏻", + "breast-feeding_medium-dark_skin_tone": "🤱🏾", + "breast-feeding_medium-light_skin_tone": "🤱🏼", + "breast-feeding_medium_skin_tone": "🤱🏽", + "brick": "🧱", + "bride_with_veil": "👰", + "bride_with_veil_dark_skin_tone": "👰🏿", + "bride_with_veil_light_skin_tone": "👰🏻", + "bride_with_veil_medium-dark_skin_tone": "👰🏾", + "bride_with_veil_medium-light_skin_tone": "👰🏼", + "bride_with_veil_medium_skin_tone": "👰🏽", + "bridge_at_night": "🌉", + "briefcase": "💼", + "briefs": "🩲", + "bright_button": "🔆", + "broccoli": "🥦", + "broken_heart": "💔", + "broom": "🧹", + "brown_circle": "🟤", + "brown_heart": "🤎", + "brown_square": "🟫", + "bug": "🐛", + "building_construction": "🏗", + "bullet_train": "🚅", + "burrito": "🌯", + "bus": "🚌", + "bus_stop": "🚏", + "bust_in_silhouette": "👤", + "busts_in_silhouette": "👥", + "butter": "🧈", + "butterfly": "🦋", + "cactus": "🌵", + "calendar": "📆", + "call_me_hand": "🤙", + "call_me_hand_dark_skin_tone": "🤙🏿", + "call_me_hand_light_skin_tone": "🤙🏻", + "call_me_hand_medium-dark_skin_tone": "🤙🏾", + "call_me_hand_medium-light_skin_tone": "🤙🏼", + "call_me_hand_medium_skin_tone": "🤙🏽", + "camel": "🐫", + "camera": "📷", + "camera_with_flash": "📸", + "camping": "🏕", + "candle": "🕯", + "candy": "🍬", + "canned_food": "🥫", + "canoe": "🛶", + "card_file_box": "🗃", + "card_index": "📇", + "card_index_dividers": "🗂", + "carousel_horse": "🎠", + "carp_streamer": "🎏", + "carrot": "🥕", + "castle": "🏰", + "cat": "🐱", + "cat_face": "🐱", + "cat_face_with_tears_of_joy": "😹", + "cat_face_with_wry_smile": "😼", + "chains": "⛓", + "chair": "🪑", + "chart_decreasing": "📉", + "chart_increasing": "📈", + "chart_increasing_with_yen": "💹", + "cheese_wedge": "🧀", + "chequered_flag": "🏁", + "cherries": "🍒", + "cherry_blossom": "🌸", + "chess_pawn": "♟", + "chestnut": "🌰", + "chicken": "🐔", + "child": "🧒", + "child_dark_skin_tone": "🧒🏿", + "child_light_skin_tone": "🧒🏻", + "child_medium-dark_skin_tone": "🧒🏾", + "child_medium-light_skin_tone": "🧒🏼", + "child_medium_skin_tone": "🧒🏽", + "children_crossing": "🚸", + "chipmunk": "🐿", + "chocolate_bar": "🍫", + "chopsticks": "🥢", + "church": "⛪", + "cigarette": "🚬", + "cinema": "🎦", + "circled_m": "Ⓜ", + "circus_tent": "🎪", + "cityscape": "🏙", + "cityscape_at_dusk": "🌆", + "clamp": "🗜", + "clapper_board": "🎬", + "clapping_hands": "👏", + "clapping_hands_dark_skin_tone": "👏🏿", + "clapping_hands_light_skin_tone": "👏🏻", + "clapping_hands_medium-dark_skin_tone": "👏🏾", + "clapping_hands_medium-light_skin_tone": "👏🏼", + "clapping_hands_medium_skin_tone": "👏🏽", + "classical_building": "🏛", + "clinking_beer_mugs": "🍻", + "clinking_glasses": "🥂", + "clipboard": "📋", + "clockwise_vertical_arrows": "🔃", + "closed_book": "📕", + "closed_mailbox_with_lowered_flag": "📪", + "closed_mailbox_with_raised_flag": "📫", + "closed_umbrella": "🌂", + "cloud": "☁", + "cloud_with_lightning": "🌩", + "cloud_with_lightning_and_rain": "⛈", + "cloud_with_rain": "🌧", + "cloud_with_snow": "🌨", + "clown_face": "🤡", + "club_suit": "♣", + "clutch_bag": "👝", + "coat": "🧥", + "cocktail_glass": "🍸", + "coconut": "🥥", + "coffin": "⚰", + "cold_face": "🥶", + "collision": "💥", + "comet": "☄", + "compass": "🧭", + "computer_disk": "💽", + "computer_mouse": "🖱", + "confetti_ball": "🎊", + "confounded_face": "😖", + "confused_face": "😕", + "construction": "🚧", + "construction_worker": "👷", + "construction_worker_dark_skin_tone": "👷🏿", + "construction_worker_light_skin_tone": "👷🏻", + "construction_worker_medium-dark_skin_tone": "👷🏾", + "construction_worker_medium-light_skin_tone": "👷🏼", + "construction_worker_medium_skin_tone": "👷🏽", + "control_knobs": "🎛", + "convenience_store": "🏪", + "cooked_rice": "🍚", + "cookie": "🍪", + "cooking": "🍳", + "copyright": "©", + "couch_and_lamp": "🛋", + "counterclockwise_arrows_button": "🔄", + "couple_with_heart": "💑", + "couple_with_heart_man_man": "👨\u200d❤️\u200d👨", + "couple_with_heart_woman_man": "👩\u200d❤️\u200d👨", + "couple_with_heart_woman_woman": "👩\u200d❤️\u200d👩", + "cow": "🐮", + "cow_face": "🐮", + "cowboy_hat_face": "🤠", + "crab": "🦀", + "crayon": "🖍", + "credit_card": "💳", + "crescent_moon": "🌙", + "cricket": "🦗", + "cricket_game": "🏏", + "crocodile": "🐊", + "croissant": "🥐", + "cross_mark": "❌", + "cross_mark_button": "❎", + "crossed_fingers": "🤞", + "crossed_fingers_dark_skin_tone": "🤞🏿", + "crossed_fingers_light_skin_tone": "🤞🏻", + "crossed_fingers_medium-dark_skin_tone": "🤞🏾", + "crossed_fingers_medium-light_skin_tone": "🤞🏼", + "crossed_fingers_medium_skin_tone": "🤞🏽", + "crossed_flags": "🎌", + "crossed_swords": "⚔", + "crown": "👑", + "crying_cat_face": "😿", + "crying_face": "😢", + "crystal_ball": "🔮", + "cucumber": "🥒", + "cupcake": "🧁", + "cup_with_straw": "🥤", + "curling_stone": "🥌", + "curly_hair": "🦱", + "curly-haired_man": "👨\u200d🦱", + "curly-haired_woman": "👩\u200d🦱", + "curly_loop": "➰", + "currency_exchange": "💱", + "curry_rice": "🍛", + "custard": "🍮", + "customs": "🛃", + "cut_of_meat": "🥩", + "cyclone": "🌀", + "dagger": "🗡", + "dango": "🍡", + "dashing_away": "💨", + "deaf_person": "🧏", + "deciduous_tree": "🌳", + "deer": "🦌", + "delivery_truck": "🚚", + "department_store": "🏬", + "derelict_house": "🏚", + "desert": "🏜", + "desert_island": "🏝", + "desktop_computer": "🖥", + "detective": "🕵", + "detective_dark_skin_tone": "🕵🏿", + "detective_light_skin_tone": "🕵🏻", + "detective_medium-dark_skin_tone": "🕵🏾", + "detective_medium-light_skin_tone": "🕵🏼", + "detective_medium_skin_tone": "🕵🏽", + "diamond_suit": "♦", + "diamond_with_a_dot": "💠", + "dim_button": "🔅", + "direct_hit": "🎯", + "disappointed_face": "😞", + "diving_mask": "🤿", + "diya_lamp": "🪔", + "dizzy": "💫", + "dizzy_face": "😵", + "dna": "🧬", + "dog": "🐶", + "dog_face": "🐶", + "dollar_banknote": "💵", + "dolphin": "🐬", + "door": "🚪", + "dotted_six-pointed_star": "🔯", + "double_curly_loop": "➿", + "double_exclamation_mark": "‼", + "doughnut": "🍩", + "dove": "🕊", + "down-left_arrow": "↙", + "down-right_arrow": "↘", + "down_arrow": "⬇", + "downcast_face_with_sweat": "😓", + "downwards_button": "🔽", + "dragon": "🐉", + "dragon_face": "🐲", + "dress": "👗", + "drooling_face": "🤤", + "drop_of_blood": "🩸", + "droplet": "💧", + "drum": "🥁", + "duck": "🦆", + "dumpling": "🥟", + "dvd": "📀", + "e-mail": "📧", + "eagle": "🦅", + "ear": "👂", + "ear_dark_skin_tone": "👂🏿", + "ear_light_skin_tone": "👂🏻", + "ear_medium-dark_skin_tone": "👂🏾", + "ear_medium-light_skin_tone": "👂🏼", + "ear_medium_skin_tone": "👂🏽", + "ear_of_corn": "🌽", + "ear_with_hearing_aid": "🦻", + "egg": "🍳", + "eggplant": "🍆", + "eight-pointed_star": "✴", + "eight-spoked_asterisk": "✳", + "eight-thirty": "🕣", + "eight_o’clock": "🕗", + "eject_button": "⏏", + "electric_plug": "🔌", + "elephant": "🐘", + "eleven-thirty": "🕦", + "eleven_o’clock": "🕚", + "elf": "🧝", + "elf_dark_skin_tone": "🧝🏿", + "elf_light_skin_tone": "🧝🏻", + "elf_medium-dark_skin_tone": "🧝🏾", + "elf_medium-light_skin_tone": "🧝🏼", + "elf_medium_skin_tone": "🧝🏽", + "envelope": "✉", + "envelope_with_arrow": "📩", + "euro_banknote": "💶", + "evergreen_tree": "🌲", + "ewe": "🐑", + "exclamation_mark": "❗", + "exclamation_question_mark": "⁉", + "exploding_head": "🤯", + "expressionless_face": "😑", + "eye": "👁", + "eye_in_speech_bubble": "👁️\u200d🗨️", + "eyes": "👀", + "face_blowing_a_kiss": "😘", + "face_savoring_food": "😋", + "face_screaming_in_fear": "😱", + "face_vomiting": "🤮", + "face_with_hand_over_mouth": "🤭", + "face_with_head-bandage": "🤕", + "face_with_medical_mask": "😷", + "face_with_monocle": "🧐", + "face_with_open_mouth": "😮", + "face_with_raised_eyebrow": "🤨", + "face_with_rolling_eyes": "🙄", + "face_with_steam_from_nose": "😤", + "face_with_symbols_on_mouth": "🤬", + "face_with_tears_of_joy": "😂", + "face_with_thermometer": "🤒", + "face_with_tongue": "😛", + "face_without_mouth": "😶", + "factory": "🏭", + "fairy": "🧚", + "fairy_dark_skin_tone": "🧚🏿", + "fairy_light_skin_tone": "🧚🏻", + "fairy_medium-dark_skin_tone": "🧚🏾", + "fairy_medium-light_skin_tone": "🧚🏼", + "fairy_medium_skin_tone": "🧚🏽", + "falafel": "🧆", + "fallen_leaf": "🍂", + "family": "👪", + "family_man_boy": "👨\u200d👦", + "family_man_boy_boy": "👨\u200d👦\u200d👦", + "family_man_girl": "👨\u200d👧", + "family_man_girl_boy": "👨\u200d👧\u200d👦", + "family_man_girl_girl": "👨\u200d👧\u200d👧", + "family_man_man_boy": "👨\u200d👨\u200d👦", + "family_man_man_boy_boy": "👨\u200d👨\u200d👦\u200d👦", + "family_man_man_girl": "👨\u200d👨\u200d👧", + "family_man_man_girl_boy": "👨\u200d👨\u200d👧\u200d👦", + "family_man_man_girl_girl": "👨\u200d👨\u200d👧\u200d👧", + "family_man_woman_boy": "👨\u200d👩\u200d👦", + "family_man_woman_boy_boy": "👨\u200d👩\u200d👦\u200d👦", + "family_man_woman_girl": "👨\u200d👩\u200d👧", + "family_man_woman_girl_boy": "👨\u200d👩\u200d👧\u200d👦", + "family_man_woman_girl_girl": "👨\u200d👩\u200d👧\u200d👧", + "family_woman_boy": "👩\u200d👦", + "family_woman_boy_boy": "👩\u200d👦\u200d👦", + "family_woman_girl": "👩\u200d👧", + "family_woman_girl_boy": "👩\u200d👧\u200d👦", + "family_woman_girl_girl": "👩\u200d👧\u200d👧", + "family_woman_woman_boy": "👩\u200d👩\u200d👦", + "family_woman_woman_boy_boy": "👩\u200d👩\u200d👦\u200d👦", + "family_woman_woman_girl": "👩\u200d👩\u200d👧", + "family_woman_woman_girl_boy": "👩\u200d👩\u200d👧\u200d👦", + "family_woman_woman_girl_girl": "👩\u200d👩\u200d👧\u200d👧", + "fast-forward_button": "⏩", + "fast_down_button": "⏬", + "fast_reverse_button": "⏪", + "fast_up_button": "⏫", + "fax_machine": "📠", + "fearful_face": "😨", + "female_sign": "♀", + "ferris_wheel": "🎡", + "ferry": "⛴", + "field_hockey": "🏑", + "file_cabinet": "🗄", + "file_folder": "📁", + "film_frames": "🎞", + "film_projector": "📽", + "fire": "🔥", + "fire_extinguisher": "🧯", + "firecracker": "🧨", + "fire_engine": "🚒", + "fireworks": "🎆", + "first_quarter_moon": "🌓", + "first_quarter_moon_face": "🌛", + "fish": "🐟", + "fish_cake_with_swirl": "🍥", + "fishing_pole": "🎣", + "five-thirty": "🕠", + "five_o’clock": "🕔", + "flag_in_hole": "⛳", + "flamingo": "🦩", + "flashlight": "🔦", + "flat_shoe": "🥿", + "fleur-de-lis": "⚜", + "flexed_biceps": "💪", + "flexed_biceps_dark_skin_tone": "💪🏿", + "flexed_biceps_light_skin_tone": "💪🏻", + "flexed_biceps_medium-dark_skin_tone": "💪🏾", + "flexed_biceps_medium-light_skin_tone": "💪🏼", + "flexed_biceps_medium_skin_tone": "💪🏽", + "floppy_disk": "💾", + "flower_playing_cards": "🎴", + "flushed_face": "😳", + "flying_disc": "🥏", + "flying_saucer": "🛸", + "fog": "🌫", + "foggy": "🌁", + "folded_hands": "🙏", + "folded_hands_dark_skin_tone": "🙏🏿", + "folded_hands_light_skin_tone": "🙏🏻", + "folded_hands_medium-dark_skin_tone": "🙏🏾", + "folded_hands_medium-light_skin_tone": "🙏🏼", + "folded_hands_medium_skin_tone": "🙏🏽", + "foot": "🦶", + "footprints": "👣", + "fork_and_knife": "🍴", + "fork_and_knife_with_plate": "🍽", + "fortune_cookie": "🥠", + "fountain": "⛲", + "fountain_pen": "🖋", + "four-thirty": "🕟", + "four_leaf_clover": "🍀", + "four_o’clock": "🕓", + "fox_face": "🦊", + "framed_picture": "🖼", + "french_fries": "🍟", + "fried_shrimp": "🍤", + "frog_face": "🐸", + "front-facing_baby_chick": "🐥", + "frowning_face": "☹", + "frowning_face_with_open_mouth": "😦", + "fuel_pump": "⛽", + "full_moon": "🌕", + "full_moon_face": "🌝", + "funeral_urn": "⚱", + "game_die": "🎲", + "garlic": "🧄", + "gear": "⚙", + "gem_stone": "💎", + "genie": "🧞", + "ghost": "👻", + "giraffe": "🦒", + "girl": "👧", + "girl_dark_skin_tone": "👧🏿", + "girl_light_skin_tone": "👧🏻", + "girl_medium-dark_skin_tone": "👧🏾", + "girl_medium-light_skin_tone": "👧🏼", + "girl_medium_skin_tone": "👧🏽", + "glass_of_milk": "🥛", + "glasses": "👓", + "globe_showing_americas": "🌎", + "globe_showing_asia-australia": "🌏", + "globe_showing_europe-africa": "🌍", + "globe_with_meridians": "🌐", + "gloves": "🧤", + "glowing_star": "🌟", + "goal_net": "🥅", + "goat": "🐐", + "goblin": "👺", + "goggles": "🥽", + "gorilla": "🦍", + "graduation_cap": "🎓", + "grapes": "🍇", + "green_apple": "🍏", + "green_book": "📗", + "green_circle": "🟢", + "green_heart": "💚", + "green_salad": "🥗", + "green_square": "🟩", + "grimacing_face": "😬", + "grinning_cat_face": "😺", + "grinning_cat_face_with_smiling_eyes": "😸", + "grinning_face": "😀", + "grinning_face_with_big_eyes": "😃", + "grinning_face_with_smiling_eyes": "😄", + "grinning_face_with_sweat": "😅", + "grinning_squinting_face": "😆", + "growing_heart": "💗", + "guard": "💂", + "guard_dark_skin_tone": "💂🏿", + "guard_light_skin_tone": "💂🏻", + "guard_medium-dark_skin_tone": "💂🏾", + "guard_medium-light_skin_tone": "💂🏼", + "guard_medium_skin_tone": "💂🏽", + "guide_dog": "🦮", + "guitar": "🎸", + "hamburger": "🍔", + "hammer": "🔨", + "hammer_and_pick": "⚒", + "hammer_and_wrench": "🛠", + "hamster_face": "🐹", + "hand_with_fingers_splayed": "🖐", + "hand_with_fingers_splayed_dark_skin_tone": "🖐🏿", + "hand_with_fingers_splayed_light_skin_tone": "🖐🏻", + "hand_with_fingers_splayed_medium-dark_skin_tone": "🖐🏾", + "hand_with_fingers_splayed_medium-light_skin_tone": "🖐🏼", + "hand_with_fingers_splayed_medium_skin_tone": "🖐🏽", + "handbag": "👜", + "handshake": "🤝", + "hatching_chick": "🐣", + "headphone": "🎧", + "hear-no-evil_monkey": "🙉", + "heart_decoration": "💟", + "heart_suit": "♥", + "heart_with_arrow": "💘", + "heart_with_ribbon": "💝", + "heavy_check_mark": "✔", + "heavy_division_sign": "➗", + "heavy_dollar_sign": "💲", + "heavy_heart_exclamation": "❣", + "heavy_large_circle": "⭕", + "heavy_minus_sign": "➖", + "heavy_multiplication_x": "✖", + "heavy_plus_sign": "➕", + "hedgehog": "🦔", + "helicopter": "🚁", + "herb": "🌿", + "hibiscus": "🌺", + "high-heeled_shoe": "👠", + "high-speed_train": "🚄", + "high_voltage": "⚡", + "hiking_boot": "🥾", + "hindu_temple": "🛕", + "hippopotamus": "🦛", + "hole": "🕳", + "honey_pot": "🍯", + "honeybee": "🐝", + "horizontal_traffic_light": "🚥", + "horse": "🐴", + "horse_face": "🐴", + "horse_racing": "🏇", + "horse_racing_dark_skin_tone": "🏇🏿", + "horse_racing_light_skin_tone": "🏇🏻", + "horse_racing_medium-dark_skin_tone": "🏇🏾", + "horse_racing_medium-light_skin_tone": "🏇🏼", + "horse_racing_medium_skin_tone": "🏇🏽", + "hospital": "🏥", + "hot_beverage": "☕", + "hot_dog": "🌭", + "hot_face": "🥵", + "hot_pepper": "🌶", + "hot_springs": "♨", + "hotel": "🏨", + "hourglass_done": "⌛", + "hourglass_not_done": "⏳", + "house": "🏠", + "house_with_garden": "🏡", + "houses": "🏘", + "hugging_face": "🤗", + "hundred_points": "💯", + "hushed_face": "😯", + "ice": "🧊", + "ice_cream": "🍨", + "ice_hockey": "🏒", + "ice_skate": "⛸", + "inbox_tray": "📥", + "incoming_envelope": "📨", + "index_pointing_up": "☝", + "index_pointing_up_dark_skin_tone": "☝🏿", + "index_pointing_up_light_skin_tone": "☝🏻", + "index_pointing_up_medium-dark_skin_tone": "☝🏾", + "index_pointing_up_medium-light_skin_tone": "☝🏼", + "index_pointing_up_medium_skin_tone": "☝🏽", + "infinity": "♾", + "information": "ℹ", + "input_latin_letters": "🔤", + "input_latin_lowercase": "🔡", + "input_latin_uppercase": "🔠", + "input_numbers": "🔢", + "input_symbols": "🔣", + "jack-o-lantern": "🎃", + "jeans": "👖", + "jigsaw": "🧩", + "joker": "🃏", + "joystick": "🕹", + "kaaba": "🕋", + "kangaroo": "🦘", + "key": "🔑", + "keyboard": "⌨", + "keycap_#": "#️⃣", + "keycap_*": "*️⃣", + "keycap_0": "0️⃣", + "keycap_1": "1️⃣", + "keycap_10": "🔟", + "keycap_2": "2️⃣", + "keycap_3": "3️⃣", + "keycap_4": "4️⃣", + "keycap_5": "5️⃣", + "keycap_6": "6️⃣", + "keycap_7": "7️⃣", + "keycap_8": "8️⃣", + "keycap_9": "9️⃣", + "kick_scooter": "🛴", + "kimono": "👘", + "kiss": "💋", + "kiss_man_man": "👨\u200d❤️\u200d💋\u200d👨", + "kiss_mark": "💋", + "kiss_woman_man": "👩\u200d❤️\u200d💋\u200d👨", + "kiss_woman_woman": "👩\u200d❤️\u200d💋\u200d👩", + "kissing_cat_face": "😽", + "kissing_face": "😗", + "kissing_face_with_closed_eyes": "😚", + "kissing_face_with_smiling_eyes": "😙", + "kitchen_knife": "🔪", + "kite": "🪁", + "kiwi_fruit": "🥝", + "koala": "🐨", + "lab_coat": "🥼", + "label": "🏷", + "lacrosse": "🥍", + "lady_beetle": "🐞", + "laptop_computer": "💻", + "large_blue_diamond": "🔷", + "large_orange_diamond": "🔶", + "last_quarter_moon": "🌗", + "last_quarter_moon_face": "🌜", + "last_track_button": "⏮", + "latin_cross": "✝", + "leaf_fluttering_in_wind": "🍃", + "leafy_green": "🥬", + "ledger": "📒", + "left-facing_fist": "🤛", + "left-facing_fist_dark_skin_tone": "🤛🏿", + "left-facing_fist_light_skin_tone": "🤛🏻", + "left-facing_fist_medium-dark_skin_tone": "🤛🏾", + "left-facing_fist_medium-light_skin_tone": "🤛🏼", + "left-facing_fist_medium_skin_tone": "🤛🏽", + "left-right_arrow": "↔", + "left_arrow": "⬅", + "left_arrow_curving_right": "↪", + "left_luggage": "🛅", + "left_speech_bubble": "🗨", + "leg": "🦵", + "lemon": "🍋", + "leopard": "🐆", + "level_slider": "🎚", + "light_bulb": "💡", + "light_rail": "🚈", + "link": "🔗", + "linked_paperclips": "🖇", + "lion_face": "🦁", + "lipstick": "💄", + "litter_in_bin_sign": "🚮", + "lizard": "🦎", + "llama": "🦙", + "lobster": "🦞", + "locked": "🔒", + "locked_with_key": "🔐", + "locked_with_pen": "🔏", + "locomotive": "🚂", + "lollipop": "🍭", + "lotion_bottle": "🧴", + "loudly_crying_face": "😭", + "loudspeaker": "📢", + "love-you_gesture": "🤟", + "love-you_gesture_dark_skin_tone": "🤟🏿", + "love-you_gesture_light_skin_tone": "🤟🏻", + "love-you_gesture_medium-dark_skin_tone": "🤟🏾", + "love-you_gesture_medium-light_skin_tone": "🤟🏼", + "love-you_gesture_medium_skin_tone": "🤟🏽", + "love_hotel": "🏩", + "love_letter": "💌", + "luggage": "🧳", + "lying_face": "🤥", + "mage": "🧙", + "mage_dark_skin_tone": "🧙🏿", + "mage_light_skin_tone": "🧙🏻", + "mage_medium-dark_skin_tone": "🧙🏾", + "mage_medium-light_skin_tone": "🧙🏼", + "mage_medium_skin_tone": "🧙🏽", + "magnet": "🧲", + "magnifying_glass_tilted_left": "🔍", + "magnifying_glass_tilted_right": "🔎", + "mahjong_red_dragon": "🀄", + "male_sign": "♂", + "man": "👨", + "man_and_woman_holding_hands": "👫", + "man_artist": "👨\u200d🎨", + "man_artist_dark_skin_tone": "👨🏿\u200d🎨", + "man_artist_light_skin_tone": "👨🏻\u200d🎨", + "man_artist_medium-dark_skin_tone": "👨🏾\u200d🎨", + "man_artist_medium-light_skin_tone": "👨🏼\u200d🎨", + "man_artist_medium_skin_tone": "👨🏽\u200d🎨", + "man_astronaut": "👨\u200d🚀", + "man_astronaut_dark_skin_tone": "👨🏿\u200d🚀", + "man_astronaut_light_skin_tone": "👨🏻\u200d🚀", + "man_astronaut_medium-dark_skin_tone": "👨🏾\u200d🚀", + "man_astronaut_medium-light_skin_tone": "👨🏼\u200d🚀", + "man_astronaut_medium_skin_tone": "👨🏽\u200d🚀", + "man_biking": "🚴\u200d♂️", + "man_biking_dark_skin_tone": "🚴🏿\u200d♂️", + "man_biking_light_skin_tone": "🚴🏻\u200d♂️", + "man_biking_medium-dark_skin_tone": "🚴🏾\u200d♂️", + "man_biking_medium-light_skin_tone": "🚴🏼\u200d♂️", + "man_biking_medium_skin_tone": "🚴🏽\u200d♂️", + "man_bouncing_ball": "⛹️\u200d♂️", + "man_bouncing_ball_dark_skin_tone": "⛹🏿\u200d♂️", + "man_bouncing_ball_light_skin_tone": "⛹🏻\u200d♂️", + "man_bouncing_ball_medium-dark_skin_tone": "⛹🏾\u200d♂️", + "man_bouncing_ball_medium-light_skin_tone": "⛹🏼\u200d♂️", + "man_bouncing_ball_medium_skin_tone": "⛹🏽\u200d♂️", + "man_bowing": "🙇\u200d♂️", + "man_bowing_dark_skin_tone": "🙇🏿\u200d♂️", + "man_bowing_light_skin_tone": "🙇🏻\u200d♂️", + "man_bowing_medium-dark_skin_tone": "🙇🏾\u200d♂️", + "man_bowing_medium-light_skin_tone": "🙇🏼\u200d♂️", + "man_bowing_medium_skin_tone": "🙇🏽\u200d♂️", + "man_cartwheeling": "🤸\u200d♂️", + "man_cartwheeling_dark_skin_tone": "🤸🏿\u200d♂️", + "man_cartwheeling_light_skin_tone": "🤸🏻\u200d♂️", + "man_cartwheeling_medium-dark_skin_tone": "🤸🏾\u200d♂️", + "man_cartwheeling_medium-light_skin_tone": "🤸🏼\u200d♂️", + "man_cartwheeling_medium_skin_tone": "🤸🏽\u200d♂️", + "man_climbing": "🧗\u200d♂️", + "man_climbing_dark_skin_tone": "🧗🏿\u200d♂️", + "man_climbing_light_skin_tone": "🧗🏻\u200d♂️", + "man_climbing_medium-dark_skin_tone": "🧗🏾\u200d♂️", + "man_climbing_medium-light_skin_tone": "🧗🏼\u200d♂️", + "man_climbing_medium_skin_tone": "🧗🏽\u200d♂️", + "man_construction_worker": "👷\u200d♂️", + "man_construction_worker_dark_skin_tone": "👷🏿\u200d♂️", + "man_construction_worker_light_skin_tone": "👷🏻\u200d♂️", + "man_construction_worker_medium-dark_skin_tone": "👷🏾\u200d♂️", + "man_construction_worker_medium-light_skin_tone": "👷🏼\u200d♂️", + "man_construction_worker_medium_skin_tone": "👷🏽\u200d♂️", + "man_cook": "👨\u200d🍳", + "man_cook_dark_skin_tone": "👨🏿\u200d🍳", + "man_cook_light_skin_tone": "👨🏻\u200d🍳", + "man_cook_medium-dark_skin_tone": "👨🏾\u200d🍳", + "man_cook_medium-light_skin_tone": "👨🏼\u200d🍳", + "man_cook_medium_skin_tone": "👨🏽\u200d🍳", + "man_dancing": "🕺", + "man_dancing_dark_skin_tone": "🕺🏿", + "man_dancing_light_skin_tone": "🕺🏻", + "man_dancing_medium-dark_skin_tone": "🕺🏾", + "man_dancing_medium-light_skin_tone": "🕺🏼", + "man_dancing_medium_skin_tone": "🕺🏽", + "man_dark_skin_tone": "👨🏿", + "man_detective": "🕵️\u200d♂️", + "man_detective_dark_skin_tone": "🕵🏿\u200d♂️", + "man_detective_light_skin_tone": "🕵🏻\u200d♂️", + "man_detective_medium-dark_skin_tone": "🕵🏾\u200d♂️", + "man_detective_medium-light_skin_tone": "🕵🏼\u200d♂️", + "man_detective_medium_skin_tone": "🕵🏽\u200d♂️", + "man_elf": "🧝\u200d♂️", + "man_elf_dark_skin_tone": "🧝🏿\u200d♂️", + "man_elf_light_skin_tone": "🧝🏻\u200d♂️", + "man_elf_medium-dark_skin_tone": "🧝🏾\u200d♂️", + "man_elf_medium-light_skin_tone": "🧝🏼\u200d♂️", + "man_elf_medium_skin_tone": "🧝🏽\u200d♂️", + "man_facepalming": "🤦\u200d♂️", + "man_facepalming_dark_skin_tone": "🤦🏿\u200d♂️", + "man_facepalming_light_skin_tone": "🤦🏻\u200d♂️", + "man_facepalming_medium-dark_skin_tone": "🤦🏾\u200d♂️", + "man_facepalming_medium-light_skin_tone": "🤦🏼\u200d♂️", + "man_facepalming_medium_skin_tone": "🤦🏽\u200d♂️", + "man_factory_worker": "👨\u200d🏭", + "man_factory_worker_dark_skin_tone": "👨🏿\u200d🏭", + "man_factory_worker_light_skin_tone": "👨🏻\u200d🏭", + "man_factory_worker_medium-dark_skin_tone": "👨🏾\u200d🏭", + "man_factory_worker_medium-light_skin_tone": "👨🏼\u200d🏭", + "man_factory_worker_medium_skin_tone": "👨🏽\u200d🏭", + "man_fairy": "🧚\u200d♂️", + "man_fairy_dark_skin_tone": "🧚🏿\u200d♂️", + "man_fairy_light_skin_tone": "🧚🏻\u200d♂️", + "man_fairy_medium-dark_skin_tone": "🧚🏾\u200d♂️", + "man_fairy_medium-light_skin_tone": "🧚🏼\u200d♂️", + "man_fairy_medium_skin_tone": "🧚🏽\u200d♂️", + "man_farmer": "👨\u200d🌾", + "man_farmer_dark_skin_tone": "👨🏿\u200d🌾", + "man_farmer_light_skin_tone": "👨🏻\u200d🌾", + "man_farmer_medium-dark_skin_tone": "👨🏾\u200d🌾", + "man_farmer_medium-light_skin_tone": "👨🏼\u200d🌾", + "man_farmer_medium_skin_tone": "👨🏽\u200d🌾", + "man_firefighter": "👨\u200d🚒", + "man_firefighter_dark_skin_tone": "👨🏿\u200d🚒", + "man_firefighter_light_skin_tone": "👨🏻\u200d🚒", + "man_firefighter_medium-dark_skin_tone": "👨🏾\u200d🚒", + "man_firefighter_medium-light_skin_tone": "👨🏼\u200d🚒", + "man_firefighter_medium_skin_tone": "👨🏽\u200d🚒", + "man_frowning": "🙍\u200d♂️", + "man_frowning_dark_skin_tone": "🙍🏿\u200d♂️", + "man_frowning_light_skin_tone": "🙍🏻\u200d♂️", + "man_frowning_medium-dark_skin_tone": "🙍🏾\u200d♂️", + "man_frowning_medium-light_skin_tone": "🙍🏼\u200d♂️", + "man_frowning_medium_skin_tone": "🙍🏽\u200d♂️", + "man_genie": "🧞\u200d♂️", + "man_gesturing_no": "🙅\u200d♂️", + "man_gesturing_no_dark_skin_tone": "🙅🏿\u200d♂️", + "man_gesturing_no_light_skin_tone": "🙅🏻\u200d♂️", + "man_gesturing_no_medium-dark_skin_tone": "🙅🏾\u200d♂️", + "man_gesturing_no_medium-light_skin_tone": "🙅🏼\u200d♂️", + "man_gesturing_no_medium_skin_tone": "🙅🏽\u200d♂️", + "man_gesturing_ok": "🙆\u200d♂️", + "man_gesturing_ok_dark_skin_tone": "🙆🏿\u200d♂️", + "man_gesturing_ok_light_skin_tone": "🙆🏻\u200d♂️", + "man_gesturing_ok_medium-dark_skin_tone": "🙆🏾\u200d♂️", + "man_gesturing_ok_medium-light_skin_tone": "🙆🏼\u200d♂️", + "man_gesturing_ok_medium_skin_tone": "🙆🏽\u200d♂️", + "man_getting_haircut": "💇\u200d♂️", + "man_getting_haircut_dark_skin_tone": "💇🏿\u200d♂️", + "man_getting_haircut_light_skin_tone": "💇🏻\u200d♂️", + "man_getting_haircut_medium-dark_skin_tone": "💇🏾\u200d♂️", + "man_getting_haircut_medium-light_skin_tone": "💇🏼\u200d♂️", + "man_getting_haircut_medium_skin_tone": "💇🏽\u200d♂️", + "man_getting_massage": "💆\u200d♂️", + "man_getting_massage_dark_skin_tone": "💆🏿\u200d♂️", + "man_getting_massage_light_skin_tone": "💆🏻\u200d♂️", + "man_getting_massage_medium-dark_skin_tone": "💆🏾\u200d♂️", + "man_getting_massage_medium-light_skin_tone": "💆🏼\u200d♂️", + "man_getting_massage_medium_skin_tone": "💆🏽\u200d♂️", + "man_golfing": "🏌️\u200d♂️", + "man_golfing_dark_skin_tone": "🏌🏿\u200d♂️", + "man_golfing_light_skin_tone": "🏌🏻\u200d♂️", + "man_golfing_medium-dark_skin_tone": "🏌🏾\u200d♂️", + "man_golfing_medium-light_skin_tone": "🏌🏼\u200d♂️", + "man_golfing_medium_skin_tone": "🏌🏽\u200d♂️", + "man_guard": "💂\u200d♂️", + "man_guard_dark_skin_tone": "💂🏿\u200d♂️", + "man_guard_light_skin_tone": "💂🏻\u200d♂️", + "man_guard_medium-dark_skin_tone": "💂🏾\u200d♂️", + "man_guard_medium-light_skin_tone": "💂🏼\u200d♂️", + "man_guard_medium_skin_tone": "💂🏽\u200d♂️", + "man_health_worker": "👨\u200d⚕️", + "man_health_worker_dark_skin_tone": "👨🏿\u200d⚕️", + "man_health_worker_light_skin_tone": "👨🏻\u200d⚕️", + "man_health_worker_medium-dark_skin_tone": "👨🏾\u200d⚕️", + "man_health_worker_medium-light_skin_tone": "👨🏼\u200d⚕️", + "man_health_worker_medium_skin_tone": "👨🏽\u200d⚕️", + "man_in_lotus_position": "🧘\u200d♂️", + "man_in_lotus_position_dark_skin_tone": "🧘🏿\u200d♂️", + "man_in_lotus_position_light_skin_tone": "🧘🏻\u200d♂️", + "man_in_lotus_position_medium-dark_skin_tone": "🧘🏾\u200d♂️", + "man_in_lotus_position_medium-light_skin_tone": "🧘🏼\u200d♂️", + "man_in_lotus_position_medium_skin_tone": "🧘🏽\u200d♂️", + "man_in_manual_wheelchair": "👨\u200d🦽", + "man_in_motorized_wheelchair": "👨\u200d🦼", + "man_in_steamy_room": "🧖\u200d♂️", + "man_in_steamy_room_dark_skin_tone": "🧖🏿\u200d♂️", + "man_in_steamy_room_light_skin_tone": "🧖🏻\u200d♂️", + "man_in_steamy_room_medium-dark_skin_tone": "🧖🏾\u200d♂️", + "man_in_steamy_room_medium-light_skin_tone": "🧖🏼\u200d♂️", + "man_in_steamy_room_medium_skin_tone": "🧖🏽\u200d♂️", + "man_in_suit_levitating": "🕴", + "man_in_suit_levitating_dark_skin_tone": "🕴🏿", + "man_in_suit_levitating_light_skin_tone": "🕴🏻", + "man_in_suit_levitating_medium-dark_skin_tone": "🕴🏾", + "man_in_suit_levitating_medium-light_skin_tone": "🕴🏼", + "man_in_suit_levitating_medium_skin_tone": "🕴🏽", + "man_in_tuxedo": "🤵", + "man_in_tuxedo_dark_skin_tone": "🤵🏿", + "man_in_tuxedo_light_skin_tone": "🤵🏻", + "man_in_tuxedo_medium-dark_skin_tone": "🤵🏾", + "man_in_tuxedo_medium-light_skin_tone": "🤵🏼", + "man_in_tuxedo_medium_skin_tone": "🤵🏽", + "man_judge": "👨\u200d⚖️", + "man_judge_dark_skin_tone": "👨🏿\u200d⚖️", + "man_judge_light_skin_tone": "👨🏻\u200d⚖️", + "man_judge_medium-dark_skin_tone": "👨🏾\u200d⚖️", + "man_judge_medium-light_skin_tone": "👨🏼\u200d⚖️", + "man_judge_medium_skin_tone": "👨🏽\u200d⚖️", + "man_juggling": "🤹\u200d♂️", + "man_juggling_dark_skin_tone": "🤹🏿\u200d♂️", + "man_juggling_light_skin_tone": "🤹🏻\u200d♂️", + "man_juggling_medium-dark_skin_tone": "🤹🏾\u200d♂️", + "man_juggling_medium-light_skin_tone": "🤹🏼\u200d♂️", + "man_juggling_medium_skin_tone": "🤹🏽\u200d♂️", + "man_lifting_weights": "🏋️\u200d♂️", + "man_lifting_weights_dark_skin_tone": "🏋🏿\u200d♂️", + "man_lifting_weights_light_skin_tone": "🏋🏻\u200d♂️", + "man_lifting_weights_medium-dark_skin_tone": "🏋🏾\u200d♂️", + "man_lifting_weights_medium-light_skin_tone": "🏋🏼\u200d♂️", + "man_lifting_weights_medium_skin_tone": "🏋🏽\u200d♂️", + "man_light_skin_tone": "👨🏻", + "man_mage": "🧙\u200d♂️", + "man_mage_dark_skin_tone": "🧙🏿\u200d♂️", + "man_mage_light_skin_tone": "🧙🏻\u200d♂️", + "man_mage_medium-dark_skin_tone": "🧙🏾\u200d♂️", + "man_mage_medium-light_skin_tone": "🧙🏼\u200d♂️", + "man_mage_medium_skin_tone": "🧙🏽\u200d♂️", + "man_mechanic": "👨\u200d🔧", + "man_mechanic_dark_skin_tone": "👨🏿\u200d🔧", + "man_mechanic_light_skin_tone": "👨🏻\u200d🔧", + "man_mechanic_medium-dark_skin_tone": "👨🏾\u200d🔧", + "man_mechanic_medium-light_skin_tone": "👨🏼\u200d🔧", + "man_mechanic_medium_skin_tone": "👨🏽\u200d🔧", + "man_medium-dark_skin_tone": "👨🏾", + "man_medium-light_skin_tone": "👨🏼", + "man_medium_skin_tone": "👨🏽", + "man_mountain_biking": "🚵\u200d♂️", + "man_mountain_biking_dark_skin_tone": "🚵🏿\u200d♂️", + "man_mountain_biking_light_skin_tone": "🚵🏻\u200d♂️", + "man_mountain_biking_medium-dark_skin_tone": "🚵🏾\u200d♂️", + "man_mountain_biking_medium-light_skin_tone": "🚵🏼\u200d♂️", + "man_mountain_biking_medium_skin_tone": "🚵🏽\u200d♂️", + "man_office_worker": "👨\u200d💼", + "man_office_worker_dark_skin_tone": "👨🏿\u200d💼", + "man_office_worker_light_skin_tone": "👨🏻\u200d💼", + "man_office_worker_medium-dark_skin_tone": "👨🏾\u200d💼", + "man_office_worker_medium-light_skin_tone": "👨🏼\u200d💼", + "man_office_worker_medium_skin_tone": "👨🏽\u200d💼", + "man_pilot": "👨\u200d✈️", + "man_pilot_dark_skin_tone": "👨🏿\u200d✈️", + "man_pilot_light_skin_tone": "👨🏻\u200d✈️", + "man_pilot_medium-dark_skin_tone": "👨🏾\u200d✈️", + "man_pilot_medium-light_skin_tone": "👨🏼\u200d✈️", + "man_pilot_medium_skin_tone": "👨🏽\u200d✈️", + "man_playing_handball": "🤾\u200d♂️", + "man_playing_handball_dark_skin_tone": "🤾🏿\u200d♂️", + "man_playing_handball_light_skin_tone": "🤾🏻\u200d♂️", + "man_playing_handball_medium-dark_skin_tone": "🤾🏾\u200d♂️", + "man_playing_handball_medium-light_skin_tone": "🤾🏼\u200d♂️", + "man_playing_handball_medium_skin_tone": "🤾🏽\u200d♂️", + "man_playing_water_polo": "🤽\u200d♂️", + "man_playing_water_polo_dark_skin_tone": "🤽🏿\u200d♂️", + "man_playing_water_polo_light_skin_tone": "🤽🏻\u200d♂️", + "man_playing_water_polo_medium-dark_skin_tone": "🤽🏾\u200d♂️", + "man_playing_water_polo_medium-light_skin_tone": "🤽🏼\u200d♂️", + "man_playing_water_polo_medium_skin_tone": "🤽🏽\u200d♂️", + "man_police_officer": "👮\u200d♂️", + "man_police_officer_dark_skin_tone": "👮🏿\u200d♂️", + "man_police_officer_light_skin_tone": "👮🏻\u200d♂️", + "man_police_officer_medium-dark_skin_tone": "👮🏾\u200d♂️", + "man_police_officer_medium-light_skin_tone": "👮🏼\u200d♂️", + "man_police_officer_medium_skin_tone": "👮🏽\u200d♂️", + "man_pouting": "🙎\u200d♂️", + "man_pouting_dark_skin_tone": "🙎🏿\u200d♂️", + "man_pouting_light_skin_tone": "🙎🏻\u200d♂️", + "man_pouting_medium-dark_skin_tone": "🙎🏾\u200d♂️", + "man_pouting_medium-light_skin_tone": "🙎🏼\u200d♂️", + "man_pouting_medium_skin_tone": "🙎🏽\u200d♂️", + "man_raising_hand": "🙋\u200d♂️", + "man_raising_hand_dark_skin_tone": "🙋🏿\u200d♂️", + "man_raising_hand_light_skin_tone": "🙋🏻\u200d♂️", + "man_raising_hand_medium-dark_skin_tone": "🙋🏾\u200d♂️", + "man_raising_hand_medium-light_skin_tone": "🙋🏼\u200d♂️", + "man_raising_hand_medium_skin_tone": "🙋🏽\u200d♂️", + "man_rowing_boat": "🚣\u200d♂️", + "man_rowing_boat_dark_skin_tone": "🚣🏿\u200d♂️", + "man_rowing_boat_light_skin_tone": "🚣🏻\u200d♂️", + "man_rowing_boat_medium-dark_skin_tone": "🚣🏾\u200d♂️", + "man_rowing_boat_medium-light_skin_tone": "🚣🏼\u200d♂️", + "man_rowing_boat_medium_skin_tone": "🚣🏽\u200d♂️", + "man_running": "🏃\u200d♂️", + "man_running_dark_skin_tone": "🏃🏿\u200d♂️", + "man_running_light_skin_tone": "🏃🏻\u200d♂️", + "man_running_medium-dark_skin_tone": "🏃🏾\u200d♂️", + "man_running_medium-light_skin_tone": "🏃🏼\u200d♂️", + "man_running_medium_skin_tone": "🏃🏽\u200d♂️", + "man_scientist": "👨\u200d🔬", + "man_scientist_dark_skin_tone": "👨🏿\u200d🔬", + "man_scientist_light_skin_tone": "👨🏻\u200d🔬", + "man_scientist_medium-dark_skin_tone": "👨🏾\u200d🔬", + "man_scientist_medium-light_skin_tone": "👨🏼\u200d🔬", + "man_scientist_medium_skin_tone": "👨🏽\u200d🔬", + "man_shrugging": "🤷\u200d♂️", + "man_shrugging_dark_skin_tone": "🤷🏿\u200d♂️", + "man_shrugging_light_skin_tone": "🤷🏻\u200d♂️", + "man_shrugging_medium-dark_skin_tone": "🤷🏾\u200d♂️", + "man_shrugging_medium-light_skin_tone": "🤷🏼\u200d♂️", + "man_shrugging_medium_skin_tone": "🤷🏽\u200d♂️", + "man_singer": "👨\u200d🎤", + "man_singer_dark_skin_tone": "👨🏿\u200d🎤", + "man_singer_light_skin_tone": "👨🏻\u200d🎤", + "man_singer_medium-dark_skin_tone": "👨🏾\u200d🎤", + "man_singer_medium-light_skin_tone": "👨🏼\u200d🎤", + "man_singer_medium_skin_tone": "👨🏽\u200d🎤", + "man_student": "👨\u200d🎓", + "man_student_dark_skin_tone": "👨🏿\u200d🎓", + "man_student_light_skin_tone": "👨🏻\u200d🎓", + "man_student_medium-dark_skin_tone": "👨🏾\u200d🎓", + "man_student_medium-light_skin_tone": "👨🏼\u200d🎓", + "man_student_medium_skin_tone": "👨🏽\u200d🎓", + "man_surfing": "🏄\u200d♂️", + "man_surfing_dark_skin_tone": "🏄🏿\u200d♂️", + "man_surfing_light_skin_tone": "🏄🏻\u200d♂️", + "man_surfing_medium-dark_skin_tone": "🏄🏾\u200d♂️", + "man_surfing_medium-light_skin_tone": "🏄🏼\u200d♂️", + "man_surfing_medium_skin_tone": "🏄🏽\u200d♂️", + "man_swimming": "🏊\u200d♂️", + "man_swimming_dark_skin_tone": "🏊🏿\u200d♂️", + "man_swimming_light_skin_tone": "🏊🏻\u200d♂️", + "man_swimming_medium-dark_skin_tone": "🏊🏾\u200d♂️", + "man_swimming_medium-light_skin_tone": "🏊🏼\u200d♂️", + "man_swimming_medium_skin_tone": "🏊🏽\u200d♂️", + "man_teacher": "👨\u200d🏫", + "man_teacher_dark_skin_tone": "👨🏿\u200d🏫", + "man_teacher_light_skin_tone": "👨🏻\u200d🏫", + "man_teacher_medium-dark_skin_tone": "👨🏾\u200d🏫", + "man_teacher_medium-light_skin_tone": "👨🏼\u200d🏫", + "man_teacher_medium_skin_tone": "👨🏽\u200d🏫", + "man_technologist": "👨\u200d💻", + "man_technologist_dark_skin_tone": "👨🏿\u200d💻", + "man_technologist_light_skin_tone": "👨🏻\u200d💻", + "man_technologist_medium-dark_skin_tone": "👨🏾\u200d💻", + "man_technologist_medium-light_skin_tone": "👨🏼\u200d💻", + "man_technologist_medium_skin_tone": "👨🏽\u200d💻", + "man_tipping_hand": "💁\u200d♂️", + "man_tipping_hand_dark_skin_tone": "💁🏿\u200d♂️", + "man_tipping_hand_light_skin_tone": "💁🏻\u200d♂️", + "man_tipping_hand_medium-dark_skin_tone": "💁🏾\u200d♂️", + "man_tipping_hand_medium-light_skin_tone": "💁🏼\u200d♂️", + "man_tipping_hand_medium_skin_tone": "💁🏽\u200d♂️", + "man_vampire": "🧛\u200d♂️", + "man_vampire_dark_skin_tone": "🧛🏿\u200d♂️", + "man_vampire_light_skin_tone": "🧛🏻\u200d♂️", + "man_vampire_medium-dark_skin_tone": "🧛🏾\u200d♂️", + "man_vampire_medium-light_skin_tone": "🧛🏼\u200d♂️", + "man_vampire_medium_skin_tone": "🧛🏽\u200d♂️", + "man_walking": "🚶\u200d♂️", + "man_walking_dark_skin_tone": "🚶🏿\u200d♂️", + "man_walking_light_skin_tone": "🚶🏻\u200d♂️", + "man_walking_medium-dark_skin_tone": "🚶🏾\u200d♂️", + "man_walking_medium-light_skin_tone": "🚶🏼\u200d♂️", + "man_walking_medium_skin_tone": "🚶🏽\u200d♂️", + "man_wearing_turban": "👳\u200d♂️", + "man_wearing_turban_dark_skin_tone": "👳🏿\u200d♂️", + "man_wearing_turban_light_skin_tone": "👳🏻\u200d♂️", + "man_wearing_turban_medium-dark_skin_tone": "👳🏾\u200d♂️", + "man_wearing_turban_medium-light_skin_tone": "👳🏼\u200d♂️", + "man_wearing_turban_medium_skin_tone": "👳🏽\u200d♂️", + "man_with_probing_cane": "👨\u200d🦯", + "man_with_chinese_cap": "👲", + "man_with_chinese_cap_dark_skin_tone": "👲🏿", + "man_with_chinese_cap_light_skin_tone": "👲🏻", + "man_with_chinese_cap_medium-dark_skin_tone": "👲🏾", + "man_with_chinese_cap_medium-light_skin_tone": "👲🏼", + "man_with_chinese_cap_medium_skin_tone": "👲🏽", + "man_zombie": "🧟\u200d♂️", + "mango": "🥭", + "mantelpiece_clock": "🕰", + "manual_wheelchair": "🦽", + "man’s_shoe": "👞", + "map_of_japan": "🗾", + "maple_leaf": "🍁", + "martial_arts_uniform": "🥋", + "mate": "🧉", + "meat_on_bone": "🍖", + "mechanical_arm": "🦾", + "mechanical_leg": "🦿", + "medical_symbol": "⚕", + "megaphone": "📣", + "melon": "🍈", + "memo": "📝", + "men_with_bunny_ears": "👯\u200d♂️", + "men_wrestling": "🤼\u200d♂️", + "menorah": "🕎", + "men’s_room": "🚹", + "mermaid": "🧜\u200d♀️", + "mermaid_dark_skin_tone": "🧜🏿\u200d♀️", + "mermaid_light_skin_tone": "🧜🏻\u200d♀️", + "mermaid_medium-dark_skin_tone": "🧜🏾\u200d♀️", + "mermaid_medium-light_skin_tone": "🧜🏼\u200d♀️", + "mermaid_medium_skin_tone": "🧜🏽\u200d♀️", + "merman": "🧜\u200d♂️", + "merman_dark_skin_tone": "🧜🏿\u200d♂️", + "merman_light_skin_tone": "🧜🏻\u200d♂️", + "merman_medium-dark_skin_tone": "🧜🏾\u200d♂️", + "merman_medium-light_skin_tone": "🧜🏼\u200d♂️", + "merman_medium_skin_tone": "🧜🏽\u200d♂️", + "merperson": "🧜", + "merperson_dark_skin_tone": "🧜🏿", + "merperson_light_skin_tone": "🧜🏻", + "merperson_medium-dark_skin_tone": "🧜🏾", + "merperson_medium-light_skin_tone": "🧜🏼", + "merperson_medium_skin_tone": "🧜🏽", + "metro": "🚇", + "microbe": "🦠", + "microphone": "🎤", + "microscope": "🔬", + "middle_finger": "🖕", + "middle_finger_dark_skin_tone": "🖕🏿", + "middle_finger_light_skin_tone": "🖕🏻", + "middle_finger_medium-dark_skin_tone": "🖕🏾", + "middle_finger_medium-light_skin_tone": "🖕🏼", + "middle_finger_medium_skin_tone": "🖕🏽", + "military_medal": "🎖", + "milky_way": "🌌", + "minibus": "🚐", + "moai": "🗿", + "mobile_phone": "📱", + "mobile_phone_off": "📴", + "mobile_phone_with_arrow": "📲", + "money-mouth_face": "🤑", + "money_bag": "💰", + "money_with_wings": "💸", + "monkey": "🐒", + "monkey_face": "🐵", + "monorail": "🚝", + "moon_cake": "🥮", + "moon_viewing_ceremony": "🎑", + "mosque": "🕌", + "mosquito": "🦟", + "motor_boat": "🛥", + "motor_scooter": "🛵", + "motorcycle": "🏍", + "motorized_wheelchair": "🦼", + "motorway": "🛣", + "mount_fuji": "🗻", + "mountain": "⛰", + "mountain_cableway": "🚠", + "mountain_railway": "🚞", + "mouse": "🐭", + "mouse_face": "🐭", + "mouth": "👄", + "movie_camera": "🎥", + "mushroom": "🍄", + "musical_keyboard": "🎹", + "musical_note": "🎵", + "musical_notes": "🎶", + "musical_score": "🎼", + "muted_speaker": "🔇", + "nail_polish": "💅", + "nail_polish_dark_skin_tone": "💅🏿", + "nail_polish_light_skin_tone": "💅🏻", + "nail_polish_medium-dark_skin_tone": "💅🏾", + "nail_polish_medium-light_skin_tone": "💅🏼", + "nail_polish_medium_skin_tone": "💅🏽", + "name_badge": "📛", + "national_park": "🏞", + "nauseated_face": "🤢", + "nazar_amulet": "🧿", + "necktie": "👔", + "nerd_face": "🤓", + "neutral_face": "😐", + "new_moon": "🌑", + "new_moon_face": "🌚", + "newspaper": "📰", + "next_track_button": "⏭", + "night_with_stars": "🌃", + "nine-thirty": "🕤", + "nine_o’clock": "🕘", + "no_bicycles": "🚳", + "no_entry": "⛔", + "no_littering": "🚯", + "no_mobile_phones": "📵", + "no_one_under_eighteen": "🔞", + "no_pedestrians": "🚷", + "no_smoking": "🚭", + "non-potable_water": "🚱", + "nose": "👃", + "nose_dark_skin_tone": "👃🏿", + "nose_light_skin_tone": "👃🏻", + "nose_medium-dark_skin_tone": "👃🏾", + "nose_medium-light_skin_tone": "👃🏼", + "nose_medium_skin_tone": "👃🏽", + "notebook": "📓", + "notebook_with_decorative_cover": "📔", + "nut_and_bolt": "🔩", + "octopus": "🐙", + "oden": "🍢", + "office_building": "🏢", + "ogre": "👹", + "oil_drum": "🛢", + "old_key": "🗝", + "old_man": "👴", + "old_man_dark_skin_tone": "👴🏿", + "old_man_light_skin_tone": "👴🏻", + "old_man_medium-dark_skin_tone": "👴🏾", + "old_man_medium-light_skin_tone": "👴🏼", + "old_man_medium_skin_tone": "👴🏽", + "old_woman": "👵", + "old_woman_dark_skin_tone": "👵🏿", + "old_woman_light_skin_tone": "👵🏻", + "old_woman_medium-dark_skin_tone": "👵🏾", + "old_woman_medium-light_skin_tone": "👵🏼", + "old_woman_medium_skin_tone": "👵🏽", + "older_adult": "🧓", + "older_adult_dark_skin_tone": "🧓🏿", + "older_adult_light_skin_tone": "🧓🏻", + "older_adult_medium-dark_skin_tone": "🧓🏾", + "older_adult_medium-light_skin_tone": "🧓🏼", + "older_adult_medium_skin_tone": "🧓🏽", + "om": "🕉", + "oncoming_automobile": "🚘", + "oncoming_bus": "🚍", + "oncoming_fist": "👊", + "oncoming_fist_dark_skin_tone": "👊🏿", + "oncoming_fist_light_skin_tone": "👊🏻", + "oncoming_fist_medium-dark_skin_tone": "👊🏾", + "oncoming_fist_medium-light_skin_tone": "👊🏼", + "oncoming_fist_medium_skin_tone": "👊🏽", + "oncoming_police_car": "🚔", + "oncoming_taxi": "🚖", + "one-piece_swimsuit": "🩱", + "one-thirty": "🕜", + "one_o’clock": "🕐", + "onion": "🧅", + "open_book": "📖", + "open_file_folder": "📂", + "open_hands": "👐", + "open_hands_dark_skin_tone": "👐🏿", + "open_hands_light_skin_tone": "👐🏻", + "open_hands_medium-dark_skin_tone": "👐🏾", + "open_hands_medium-light_skin_tone": "👐🏼", + "open_hands_medium_skin_tone": "👐🏽", + "open_mailbox_with_lowered_flag": "📭", + "open_mailbox_with_raised_flag": "📬", + "optical_disk": "💿", + "orange_book": "📙", + "orange_circle": "🟠", + "orange_heart": "🧡", + "orange_square": "🟧", + "orangutan": "🦧", + "orthodox_cross": "☦", + "otter": "🦦", + "outbox_tray": "📤", + "owl": "🦉", + "ox": "🐂", + "oyster": "🦪", + "package": "📦", + "page_facing_up": "📄", + "page_with_curl": "📃", + "pager": "📟", + "paintbrush": "🖌", + "palm_tree": "🌴", + "palms_up_together": "🤲", + "palms_up_together_dark_skin_tone": "🤲🏿", + "palms_up_together_light_skin_tone": "🤲🏻", + "palms_up_together_medium-dark_skin_tone": "🤲🏾", + "palms_up_together_medium-light_skin_tone": "🤲🏼", + "palms_up_together_medium_skin_tone": "🤲🏽", + "pancakes": "🥞", + "panda_face": "🐼", + "paperclip": "📎", + "parrot": "🦜", + "part_alternation_mark": "〽", + "party_popper": "🎉", + "partying_face": "🥳", + "passenger_ship": "🛳", + "passport_control": "🛂", + "pause_button": "⏸", + "paw_prints": "🐾", + "peace_symbol": "☮", + "peach": "🍑", + "peacock": "🦚", + "peanuts": "🥜", + "pear": "🍐", + "pen": "🖊", + "pencil": "📝", + "penguin": "🐧", + "pensive_face": "😔", + "people_holding_hands": "🧑\u200d🤝\u200d🧑", + "people_with_bunny_ears": "👯", + "people_wrestling": "🤼", + "performing_arts": "🎭", + "persevering_face": "😣", + "person_biking": "🚴", + "person_biking_dark_skin_tone": "🚴🏿", + "person_biking_light_skin_tone": "🚴🏻", + "person_biking_medium-dark_skin_tone": "🚴🏾", + "person_biking_medium-light_skin_tone": "🚴🏼", + "person_biking_medium_skin_tone": "🚴🏽", + "person_bouncing_ball": "⛹", + "person_bouncing_ball_dark_skin_tone": "⛹🏿", + "person_bouncing_ball_light_skin_tone": "⛹🏻", + "person_bouncing_ball_medium-dark_skin_tone": "⛹🏾", + "person_bouncing_ball_medium-light_skin_tone": "⛹🏼", + "person_bouncing_ball_medium_skin_tone": "⛹🏽", + "person_bowing": "🙇", + "person_bowing_dark_skin_tone": "🙇🏿", + "person_bowing_light_skin_tone": "🙇🏻", + "person_bowing_medium-dark_skin_tone": "🙇🏾", + "person_bowing_medium-light_skin_tone": "🙇🏼", + "person_bowing_medium_skin_tone": "🙇🏽", + "person_cartwheeling": "🤸", + "person_cartwheeling_dark_skin_tone": "🤸🏿", + "person_cartwheeling_light_skin_tone": "🤸🏻", + "person_cartwheeling_medium-dark_skin_tone": "🤸🏾", + "person_cartwheeling_medium-light_skin_tone": "🤸🏼", + "person_cartwheeling_medium_skin_tone": "🤸🏽", + "person_climbing": "🧗", + "person_climbing_dark_skin_tone": "🧗🏿", + "person_climbing_light_skin_tone": "🧗🏻", + "person_climbing_medium-dark_skin_tone": "🧗🏾", + "person_climbing_medium-light_skin_tone": "🧗🏼", + "person_climbing_medium_skin_tone": "🧗🏽", + "person_facepalming": "🤦", + "person_facepalming_dark_skin_tone": "🤦🏿", + "person_facepalming_light_skin_tone": "🤦🏻", + "person_facepalming_medium-dark_skin_tone": "🤦🏾", + "person_facepalming_medium-light_skin_tone": "🤦🏼", + "person_facepalming_medium_skin_tone": "🤦🏽", + "person_fencing": "🤺", + "person_frowning": "🙍", + "person_frowning_dark_skin_tone": "🙍🏿", + "person_frowning_light_skin_tone": "🙍🏻", + "person_frowning_medium-dark_skin_tone": "🙍🏾", + "person_frowning_medium-light_skin_tone": "🙍🏼", + "person_frowning_medium_skin_tone": "🙍🏽", + "person_gesturing_no": "🙅", + "person_gesturing_no_dark_skin_tone": "🙅🏿", + "person_gesturing_no_light_skin_tone": "🙅🏻", + "person_gesturing_no_medium-dark_skin_tone": "🙅🏾", + "person_gesturing_no_medium-light_skin_tone": "🙅🏼", + "person_gesturing_no_medium_skin_tone": "🙅🏽", + "person_gesturing_ok": "🙆", + "person_gesturing_ok_dark_skin_tone": "🙆🏿", + "person_gesturing_ok_light_skin_tone": "🙆🏻", + "person_gesturing_ok_medium-dark_skin_tone": "🙆🏾", + "person_gesturing_ok_medium-light_skin_tone": "🙆🏼", + "person_gesturing_ok_medium_skin_tone": "🙆🏽", + "person_getting_haircut": "💇", + "person_getting_haircut_dark_skin_tone": "💇🏿", + "person_getting_haircut_light_skin_tone": "💇🏻", + "person_getting_haircut_medium-dark_skin_tone": "💇🏾", + "person_getting_haircut_medium-light_skin_tone": "💇🏼", + "person_getting_haircut_medium_skin_tone": "💇🏽", + "person_getting_massage": "💆", + "person_getting_massage_dark_skin_tone": "💆🏿", + "person_getting_massage_light_skin_tone": "💆🏻", + "person_getting_massage_medium-dark_skin_tone": "💆🏾", + "person_getting_massage_medium-light_skin_tone": "💆🏼", + "person_getting_massage_medium_skin_tone": "💆🏽", + "person_golfing": "🏌", + "person_golfing_dark_skin_tone": "🏌🏿", + "person_golfing_light_skin_tone": "🏌🏻", + "person_golfing_medium-dark_skin_tone": "🏌🏾", + "person_golfing_medium-light_skin_tone": "🏌🏼", + "person_golfing_medium_skin_tone": "🏌🏽", + "person_in_bed": "🛌", + "person_in_bed_dark_skin_tone": "🛌🏿", + "person_in_bed_light_skin_tone": "🛌🏻", + "person_in_bed_medium-dark_skin_tone": "🛌🏾", + "person_in_bed_medium-light_skin_tone": "🛌🏼", + "person_in_bed_medium_skin_tone": "🛌🏽", + "person_in_lotus_position": "🧘", + "person_in_lotus_position_dark_skin_tone": "🧘🏿", + "person_in_lotus_position_light_skin_tone": "🧘🏻", + "person_in_lotus_position_medium-dark_skin_tone": "🧘🏾", + "person_in_lotus_position_medium-light_skin_tone": "🧘🏼", + "person_in_lotus_position_medium_skin_tone": "🧘🏽", + "person_in_steamy_room": "🧖", + "person_in_steamy_room_dark_skin_tone": "🧖🏿", + "person_in_steamy_room_light_skin_tone": "🧖🏻", + "person_in_steamy_room_medium-dark_skin_tone": "🧖🏾", + "person_in_steamy_room_medium-light_skin_tone": "🧖🏼", + "person_in_steamy_room_medium_skin_tone": "🧖🏽", + "person_juggling": "🤹", + "person_juggling_dark_skin_tone": "🤹🏿", + "person_juggling_light_skin_tone": "🤹🏻", + "person_juggling_medium-dark_skin_tone": "🤹🏾", + "person_juggling_medium-light_skin_tone": "🤹🏼", + "person_juggling_medium_skin_tone": "🤹🏽", + "person_kneeling": "🧎", + "person_lifting_weights": "🏋", + "person_lifting_weights_dark_skin_tone": "🏋🏿", + "person_lifting_weights_light_skin_tone": "🏋🏻", + "person_lifting_weights_medium-dark_skin_tone": "🏋🏾", + "person_lifting_weights_medium-light_skin_tone": "🏋🏼", + "person_lifting_weights_medium_skin_tone": "🏋🏽", + "person_mountain_biking": "🚵", + "person_mountain_biking_dark_skin_tone": "🚵🏿", + "person_mountain_biking_light_skin_tone": "🚵🏻", + "person_mountain_biking_medium-dark_skin_tone": "🚵🏾", + "person_mountain_biking_medium-light_skin_tone": "🚵🏼", + "person_mountain_biking_medium_skin_tone": "🚵🏽", + "person_playing_handball": "🤾", + "person_playing_handball_dark_skin_tone": "🤾🏿", + "person_playing_handball_light_skin_tone": "🤾🏻", + "person_playing_handball_medium-dark_skin_tone": "🤾🏾", + "person_playing_handball_medium-light_skin_tone": "🤾🏼", + "person_playing_handball_medium_skin_tone": "🤾🏽", + "person_playing_water_polo": "🤽", + "person_playing_water_polo_dark_skin_tone": "🤽🏿", + "person_playing_water_polo_light_skin_tone": "🤽🏻", + "person_playing_water_polo_medium-dark_skin_tone": "🤽🏾", + "person_playing_water_polo_medium-light_skin_tone": "🤽🏼", + "person_playing_water_polo_medium_skin_tone": "🤽🏽", + "person_pouting": "🙎", + "person_pouting_dark_skin_tone": "🙎🏿", + "person_pouting_light_skin_tone": "🙎🏻", + "person_pouting_medium-dark_skin_tone": "🙎🏾", + "person_pouting_medium-light_skin_tone": "🙎🏼", + "person_pouting_medium_skin_tone": "🙎🏽", + "person_raising_hand": "🙋", + "person_raising_hand_dark_skin_tone": "🙋🏿", + "person_raising_hand_light_skin_tone": "🙋🏻", + "person_raising_hand_medium-dark_skin_tone": "🙋🏾", + "person_raising_hand_medium-light_skin_tone": "🙋🏼", + "person_raising_hand_medium_skin_tone": "🙋🏽", + "person_rowing_boat": "🚣", + "person_rowing_boat_dark_skin_tone": "🚣🏿", + "person_rowing_boat_light_skin_tone": "🚣🏻", + "person_rowing_boat_medium-dark_skin_tone": "🚣🏾", + "person_rowing_boat_medium-light_skin_tone": "🚣🏼", + "person_rowing_boat_medium_skin_tone": "🚣🏽", + "person_running": "🏃", + "person_running_dark_skin_tone": "🏃🏿", + "person_running_light_skin_tone": "🏃🏻", + "person_running_medium-dark_skin_tone": "🏃🏾", + "person_running_medium-light_skin_tone": "🏃🏼", + "person_running_medium_skin_tone": "🏃🏽", + "person_shrugging": "🤷", + "person_shrugging_dark_skin_tone": "🤷🏿", + "person_shrugging_light_skin_tone": "🤷🏻", + "person_shrugging_medium-dark_skin_tone": "🤷🏾", + "person_shrugging_medium-light_skin_tone": "🤷🏼", + "person_shrugging_medium_skin_tone": "🤷🏽", + "person_standing": "🧍", + "person_surfing": "🏄", + "person_surfing_dark_skin_tone": "🏄🏿", + "person_surfing_light_skin_tone": "🏄🏻", + "person_surfing_medium-dark_skin_tone": "🏄🏾", + "person_surfing_medium-light_skin_tone": "🏄🏼", + "person_surfing_medium_skin_tone": "🏄🏽", + "person_swimming": "🏊", + "person_swimming_dark_skin_tone": "🏊🏿", + "person_swimming_light_skin_tone": "🏊🏻", + "person_swimming_medium-dark_skin_tone": "🏊🏾", + "person_swimming_medium-light_skin_tone": "🏊🏼", + "person_swimming_medium_skin_tone": "🏊🏽", + "person_taking_bath": "🛀", + "person_taking_bath_dark_skin_tone": "🛀🏿", + "person_taking_bath_light_skin_tone": "🛀🏻", + "person_taking_bath_medium-dark_skin_tone": "🛀🏾", + "person_taking_bath_medium-light_skin_tone": "🛀🏼", + "person_taking_bath_medium_skin_tone": "🛀🏽", + "person_tipping_hand": "💁", + "person_tipping_hand_dark_skin_tone": "💁🏿", + "person_tipping_hand_light_skin_tone": "💁🏻", + "person_tipping_hand_medium-dark_skin_tone": "💁🏾", + "person_tipping_hand_medium-light_skin_tone": "💁🏼", + "person_tipping_hand_medium_skin_tone": "💁🏽", + "person_walking": "🚶", + "person_walking_dark_skin_tone": "🚶🏿", + "person_walking_light_skin_tone": "🚶🏻", + "person_walking_medium-dark_skin_tone": "🚶🏾", + "person_walking_medium-light_skin_tone": "🚶🏼", + "person_walking_medium_skin_tone": "🚶🏽", + "person_wearing_turban": "👳", + "person_wearing_turban_dark_skin_tone": "👳🏿", + "person_wearing_turban_light_skin_tone": "👳🏻", + "person_wearing_turban_medium-dark_skin_tone": "👳🏾", + "person_wearing_turban_medium-light_skin_tone": "👳🏼", + "person_wearing_turban_medium_skin_tone": "👳🏽", + "petri_dish": "🧫", + "pick": "⛏", + "pie": "🥧", + "pig": "🐷", + "pig_face": "🐷", + "pig_nose": "🐽", + "pile_of_poo": "💩", + "pill": "💊", + "pinching_hand": "🤏", + "pine_decoration": "🎍", + "pineapple": "🍍", + "ping_pong": "🏓", + "pirate_flag": "🏴\u200d☠️", + "pistol": "🔫", + "pizza": "🍕", + "place_of_worship": "🛐", + "play_button": "▶", + "play_or_pause_button": "⏯", + "pleading_face": "🥺", + "police_car": "🚓", + "police_car_light": "🚨", + "police_officer": "👮", + "police_officer_dark_skin_tone": "👮🏿", + "police_officer_light_skin_tone": "👮🏻", + "police_officer_medium-dark_skin_tone": "👮🏾", + "police_officer_medium-light_skin_tone": "👮🏼", + "police_officer_medium_skin_tone": "👮🏽", + "poodle": "🐩", + "pool_8_ball": "🎱", + "popcorn": "🍿", + "post_office": "🏣", + "postal_horn": "📯", + "postbox": "📮", + "pot_of_food": "🍲", + "potable_water": "🚰", + "potato": "🥔", + "poultry_leg": "🍗", + "pound_banknote": "💷", + "pouting_cat_face": "😾", + "pouting_face": "😡", + "prayer_beads": "📿", + "pregnant_woman": "🤰", + "pregnant_woman_dark_skin_tone": "🤰🏿", + "pregnant_woman_light_skin_tone": "🤰🏻", + "pregnant_woman_medium-dark_skin_tone": "🤰🏾", + "pregnant_woman_medium-light_skin_tone": "🤰🏼", + "pregnant_woman_medium_skin_tone": "🤰🏽", + "pretzel": "🥨", + "probing_cane": "🦯", + "prince": "🤴", + "prince_dark_skin_tone": "🤴🏿", + "prince_light_skin_tone": "🤴🏻", + "prince_medium-dark_skin_tone": "🤴🏾", + "prince_medium-light_skin_tone": "🤴🏼", + "prince_medium_skin_tone": "🤴🏽", + "princess": "👸", + "princess_dark_skin_tone": "👸🏿", + "princess_light_skin_tone": "👸🏻", + "princess_medium-dark_skin_tone": "👸🏾", + "princess_medium-light_skin_tone": "👸🏼", + "princess_medium_skin_tone": "👸🏽", + "printer": "🖨", + "prohibited": "🚫", + "purple_circle": "🟣", + "purple_heart": "💜", + "purple_square": "🟪", + "purse": "👛", + "pushpin": "📌", + "question_mark": "❓", + "rabbit": "🐰", + "rabbit_face": "🐰", + "raccoon": "🦝", + "racing_car": "🏎", + "radio": "📻", + "radio_button": "🔘", + "radioactive": "☢", + "railway_car": "🚃", + "railway_track": "🛤", + "rainbow": "🌈", + "rainbow_flag": "🏳️\u200d🌈", + "raised_back_of_hand": "🤚", + "raised_back_of_hand_dark_skin_tone": "🤚🏿", + "raised_back_of_hand_light_skin_tone": "🤚🏻", + "raised_back_of_hand_medium-dark_skin_tone": "🤚🏾", + "raised_back_of_hand_medium-light_skin_tone": "🤚🏼", + "raised_back_of_hand_medium_skin_tone": "🤚🏽", + "raised_fist": "✊", + "raised_fist_dark_skin_tone": "✊🏿", + "raised_fist_light_skin_tone": "✊🏻", + "raised_fist_medium-dark_skin_tone": "✊🏾", + "raised_fist_medium-light_skin_tone": "✊🏼", + "raised_fist_medium_skin_tone": "✊🏽", + "raised_hand": "✋", + "raised_hand_dark_skin_tone": "✋🏿", + "raised_hand_light_skin_tone": "✋🏻", + "raised_hand_medium-dark_skin_tone": "✋🏾", + "raised_hand_medium-light_skin_tone": "✋🏼", + "raised_hand_medium_skin_tone": "✋🏽", + "raising_hands": "🙌", + "raising_hands_dark_skin_tone": "🙌🏿", + "raising_hands_light_skin_tone": "🙌🏻", + "raising_hands_medium-dark_skin_tone": "🙌🏾", + "raising_hands_medium-light_skin_tone": "🙌🏼", + "raising_hands_medium_skin_tone": "🙌🏽", + "ram": "🐏", + "rat": "🐀", + "razor": "🪒", + "ringed_planet": "🪐", + "receipt": "🧾", + "record_button": "⏺", + "recycling_symbol": "♻", + "red_apple": "🍎", + "red_circle": "🔴", + "red_envelope": "🧧", + "red_hair": "🦰", + "red-haired_man": "👨\u200d🦰", + "red-haired_woman": "👩\u200d🦰", + "red_heart": "❤", + "red_paper_lantern": "🏮", + "red_square": "🟥", + "red_triangle_pointed_down": "🔻", + "red_triangle_pointed_up": "🔺", + "registered": "®", + "relieved_face": "😌", + "reminder_ribbon": "🎗", + "repeat_button": "🔁", + "repeat_single_button": "🔂", + "rescue_worker’s_helmet": "⛑", + "restroom": "🚻", + "reverse_button": "◀", + "revolving_hearts": "💞", + "rhinoceros": "🦏", + "ribbon": "🎀", + "rice_ball": "🍙", + "rice_cracker": "🍘", + "right-facing_fist": "🤜", + "right-facing_fist_dark_skin_tone": "🤜🏿", + "right-facing_fist_light_skin_tone": "🤜🏻", + "right-facing_fist_medium-dark_skin_tone": "🤜🏾", + "right-facing_fist_medium-light_skin_tone": "🤜🏼", + "right-facing_fist_medium_skin_tone": "🤜🏽", + "right_anger_bubble": "🗯", + "right_arrow": "➡", + "right_arrow_curving_down": "⤵", + "right_arrow_curving_left": "↩", + "right_arrow_curving_up": "⤴", + "ring": "💍", + "roasted_sweet_potato": "🍠", + "robot_face": "🤖", + "rocket": "🚀", + "roll_of_paper": "🧻", + "rolled-up_newspaper": "🗞", + "roller_coaster": "🎢", + "rolling_on_the_floor_laughing": "🤣", + "rooster": "🐓", + "rose": "🌹", + "rosette": "🏵", + "round_pushpin": "📍", + "rugby_football": "🏉", + "running_shirt": "🎽", + "running_shoe": "👟", + "sad_but_relieved_face": "😥", + "safety_pin": "🧷", + "safety_vest": "🦺", + "salt": "🧂", + "sailboat": "⛵", + "sake": "🍶", + "sandwich": "🥪", + "sari": "🥻", + "satellite": "📡", + "satellite_antenna": "📡", + "sauropod": "🦕", + "saxophone": "🎷", + "scarf": "🧣", + "school": "🏫", + "school_backpack": "🎒", + "scissors": "✂", + "scorpion": "🦂", + "scroll": "📜", + "seat": "💺", + "see-no-evil_monkey": "🙈", + "seedling": "🌱", + "selfie": "🤳", + "selfie_dark_skin_tone": "🤳🏿", + "selfie_light_skin_tone": "🤳🏻", + "selfie_medium-dark_skin_tone": "🤳🏾", + "selfie_medium-light_skin_tone": "🤳🏼", + "selfie_medium_skin_tone": "🤳🏽", + "service_dog": "🐕\u200d🦺", + "seven-thirty": "🕢", + "seven_o’clock": "🕖", + "shallow_pan_of_food": "🥘", + "shamrock": "☘", + "shark": "🦈", + "shaved_ice": "🍧", + "sheaf_of_rice": "🌾", + "shield": "🛡", + "shinto_shrine": "⛩", + "ship": "🚢", + "shooting_star": "🌠", + "shopping_bags": "🛍", + "shopping_cart": "🛒", + "shortcake": "🍰", + "shorts": "🩳", + "shower": "🚿", + "shrimp": "🦐", + "shuffle_tracks_button": "🔀", + "shushing_face": "🤫", + "sign_of_the_horns": "🤘", + "sign_of_the_horns_dark_skin_tone": "🤘🏿", + "sign_of_the_horns_light_skin_tone": "🤘🏻", + "sign_of_the_horns_medium-dark_skin_tone": "🤘🏾", + "sign_of_the_horns_medium-light_skin_tone": "🤘🏼", + "sign_of_the_horns_medium_skin_tone": "🤘🏽", + "six-thirty": "🕡", + "six_o’clock": "🕕", + "skateboard": "🛹", + "skier": "⛷", + "skis": "🎿", + "skull": "💀", + "skull_and_crossbones": "☠", + "skunk": "🦨", + "sled": "🛷", + "sleeping_face": "😴", + "sleepy_face": "😪", + "slightly_frowning_face": "🙁", + "slightly_smiling_face": "🙂", + "slot_machine": "🎰", + "sloth": "🦥", + "small_airplane": "🛩", + "small_blue_diamond": "🔹", + "small_orange_diamond": "🔸", + "smiling_cat_face_with_heart-eyes": "😻", + "smiling_face": "☺", + "smiling_face_with_halo": "😇", + "smiling_face_with_3_hearts": "🥰", + "smiling_face_with_heart-eyes": "😍", + "smiling_face_with_horns": "😈", + "smiling_face_with_smiling_eyes": "😊", + "smiling_face_with_sunglasses": "😎", + "smirking_face": "😏", + "snail": "🐌", + "snake": "🐍", + "sneezing_face": "🤧", + "snow-capped_mountain": "🏔", + "snowboarder": "🏂", + "snowboarder_dark_skin_tone": "🏂🏿", + "snowboarder_light_skin_tone": "🏂🏻", + "snowboarder_medium-dark_skin_tone": "🏂🏾", + "snowboarder_medium-light_skin_tone": "🏂🏼", + "snowboarder_medium_skin_tone": "🏂🏽", + "snowflake": "❄", + "snowman": "☃", + "snowman_without_snow": "⛄", + "soap": "🧼", + "soccer_ball": "⚽", + "socks": "🧦", + "softball": "🥎", + "soft_ice_cream": "🍦", + "spade_suit": "♠", + "spaghetti": "🍝", + "sparkle": "❇", + "sparkler": "🎇", + "sparkles": "✨", + "sparkling_heart": "💖", + "speak-no-evil_monkey": "🙊", + "speaker_high_volume": "🔊", + "speaker_low_volume": "🔈", + "speaker_medium_volume": "🔉", + "speaking_head": "🗣", + "speech_balloon": "💬", + "speedboat": "🚤", + "spider": "🕷", + "spider_web": "🕸", + "spiral_calendar": "🗓", + "spiral_notepad": "🗒", + "spiral_shell": "🐚", + "spoon": "🥄", + "sponge": "🧽", + "sport_utility_vehicle": "🚙", + "sports_medal": "🏅", + "spouting_whale": "🐳", + "squid": "🦑", + "squinting_face_with_tongue": "😝", + "stadium": "🏟", + "star-struck": "🤩", + "star_and_crescent": "☪", + "star_of_david": "✡", + "station": "🚉", + "steaming_bowl": "🍜", + "stethoscope": "🩺", + "stop_button": "⏹", + "stop_sign": "🛑", + "stopwatch": "⏱", + "straight_ruler": "📏", + "strawberry": "🍓", + "studio_microphone": "🎙", + "stuffed_flatbread": "🥙", + "sun": "☀", + "sun_behind_cloud": "⛅", + "sun_behind_large_cloud": "🌥", + "sun_behind_rain_cloud": "🌦", + "sun_behind_small_cloud": "🌤", + "sun_with_face": "🌞", + "sunflower": "🌻", + "sunglasses": "😎", + "sunrise": "🌅", + "sunrise_over_mountains": "🌄", + "sunset": "🌇", + "superhero": "🦸", + "supervillain": "🦹", + "sushi": "🍣", + "suspension_railway": "🚟", + "swan": "🦢", + "sweat_droplets": "💦", + "synagogue": "🕍", + "syringe": "💉", + "t-shirt": "👕", + "taco": "🌮", + "takeout_box": "🥡", + "tanabata_tree": "🎋", + "tangerine": "🍊", + "taxi": "🚕", + "teacup_without_handle": "🍵", + "tear-off_calendar": "📆", + "teddy_bear": "🧸", + "telephone": "☎", + "telephone_receiver": "📞", + "telescope": "🔭", + "television": "📺", + "ten-thirty": "🕥", + "ten_o’clock": "🕙", + "tennis": "🎾", + "tent": "⛺", + "test_tube": "🧪", + "thermometer": "🌡", + "thinking_face": "🤔", + "thought_balloon": "💭", + "thread": "🧵", + "three-thirty": "🕞", + "three_o’clock": "🕒", + "thumbs_down": "👎", + "thumbs_down_dark_skin_tone": "👎🏿", + "thumbs_down_light_skin_tone": "👎🏻", + "thumbs_down_medium-dark_skin_tone": "👎🏾", + "thumbs_down_medium-light_skin_tone": "👎🏼", + "thumbs_down_medium_skin_tone": "👎🏽", + "thumbs_up": "👍", + "thumbs_up_dark_skin_tone": "👍🏿", + "thumbs_up_light_skin_tone": "👍🏻", + "thumbs_up_medium-dark_skin_tone": "👍🏾", + "thumbs_up_medium-light_skin_tone": "👍🏼", + "thumbs_up_medium_skin_tone": "👍🏽", + "ticket": "🎫", + "tiger": "🐯", + "tiger_face": "🐯", + "timer_clock": "⏲", + "tired_face": "😫", + "toolbox": "🧰", + "toilet": "🚽", + "tomato": "🍅", + "tongue": "👅", + "tooth": "🦷", + "top_hat": "🎩", + "tornado": "🌪", + "trackball": "🖲", + "tractor": "🚜", + "trade_mark": "™", + "train": "🚋", + "tram": "🚊", + "tram_car": "🚋", + "triangular_flag": "🚩", + "triangular_ruler": "📐", + "trident_emblem": "🔱", + "trolleybus": "🚎", + "trophy": "🏆", + "tropical_drink": "🍹", + "tropical_fish": "🐠", + "trumpet": "🎺", + "tulip": "🌷", + "tumbler_glass": "🥃", + "turtle": "🐢", + "twelve-thirty": "🕧", + "twelve_o’clock": "🕛", + "two-hump_camel": "🐫", + "two-thirty": "🕝", + "two_hearts": "💕", + "two_men_holding_hands": "👬", + "two_o’clock": "🕑", + "two_women_holding_hands": "👭", + "umbrella": "☂", + "umbrella_on_ground": "⛱", + "umbrella_with_rain_drops": "☔", + "unamused_face": "😒", + "unicorn_face": "🦄", + "unlocked": "🔓", + "up-down_arrow": "↕", + "up-left_arrow": "↖", + "up-right_arrow": "↗", + "up_arrow": "⬆", + "upside-down_face": "🙃", + "upwards_button": "🔼", + "vampire": "🧛", + "vampire_dark_skin_tone": "🧛🏿", + "vampire_light_skin_tone": "🧛🏻", + "vampire_medium-dark_skin_tone": "🧛🏾", + "vampire_medium-light_skin_tone": "🧛🏼", + "vampire_medium_skin_tone": "🧛🏽", + "vertical_traffic_light": "🚦", + "vibration_mode": "📳", + "victory_hand": "✌", + "victory_hand_dark_skin_tone": "✌🏿", + "victory_hand_light_skin_tone": "✌🏻", + "victory_hand_medium-dark_skin_tone": "✌🏾", + "victory_hand_medium-light_skin_tone": "✌🏼", + "victory_hand_medium_skin_tone": "✌🏽", + "video_camera": "📹", + "video_game": "🎮", + "videocassette": "📼", + "violin": "🎻", + "volcano": "🌋", + "volleyball": "🏐", + "vulcan_salute": "🖖", + "vulcan_salute_dark_skin_tone": "🖖🏿", + "vulcan_salute_light_skin_tone": "🖖🏻", + "vulcan_salute_medium-dark_skin_tone": "🖖🏾", + "vulcan_salute_medium-light_skin_tone": "🖖🏼", + "vulcan_salute_medium_skin_tone": "🖖🏽", + "waffle": "🧇", + "waning_crescent_moon": "🌘", + "waning_gibbous_moon": "🌖", + "warning": "⚠", + "wastebasket": "🗑", + "watch": "⌚", + "water_buffalo": "🐃", + "water_closet": "🚾", + "water_wave": "🌊", + "watermelon": "🍉", + "waving_hand": "👋", + "waving_hand_dark_skin_tone": "👋🏿", + "waving_hand_light_skin_tone": "👋🏻", + "waving_hand_medium-dark_skin_tone": "👋🏾", + "waving_hand_medium-light_skin_tone": "👋🏼", + "waving_hand_medium_skin_tone": "👋🏽", + "wavy_dash": "〰", + "waxing_crescent_moon": "🌒", + "waxing_gibbous_moon": "🌔", + "weary_cat_face": "🙀", + "weary_face": "😩", + "wedding": "💒", + "whale": "🐳", + "wheel_of_dharma": "☸", + "wheelchair_symbol": "♿", + "white_circle": "⚪", + "white_exclamation_mark": "❕", + "white_flag": "🏳", + "white_flower": "💮", + "white_hair": "🦳", + "white-haired_man": "👨\u200d🦳", + "white-haired_woman": "👩\u200d🦳", + "white_heart": "🤍", + "white_heavy_check_mark": "✅", + "white_large_square": "⬜", + "white_medium-small_square": "◽", + "white_medium_square": "◻", + "white_medium_star": "⭐", + "white_question_mark": "❔", + "white_small_square": "▫", + "white_square_button": "🔳", + "wilted_flower": "🥀", + "wind_chime": "🎐", + "wind_face": "🌬", + "wine_glass": "🍷", + "winking_face": "😉", + "winking_face_with_tongue": "😜", + "wolf_face": "🐺", + "woman": "👩", + "woman_artist": "👩\u200d🎨", + "woman_artist_dark_skin_tone": "👩🏿\u200d🎨", + "woman_artist_light_skin_tone": "👩🏻\u200d🎨", + "woman_artist_medium-dark_skin_tone": "👩🏾\u200d🎨", + "woman_artist_medium-light_skin_tone": "👩🏼\u200d🎨", + "woman_artist_medium_skin_tone": "👩🏽\u200d🎨", + "woman_astronaut": "👩\u200d🚀", + "woman_astronaut_dark_skin_tone": "👩🏿\u200d🚀", + "woman_astronaut_light_skin_tone": "👩🏻\u200d🚀", + "woman_astronaut_medium-dark_skin_tone": "👩🏾\u200d🚀", + "woman_astronaut_medium-light_skin_tone": "👩🏼\u200d🚀", + "woman_astronaut_medium_skin_tone": "👩🏽\u200d🚀", + "woman_biking": "🚴\u200d♀️", + "woman_biking_dark_skin_tone": "🚴🏿\u200d♀️", + "woman_biking_light_skin_tone": "🚴🏻\u200d♀️", + "woman_biking_medium-dark_skin_tone": "🚴🏾\u200d♀️", + "woman_biking_medium-light_skin_tone": "🚴🏼\u200d♀️", + "woman_biking_medium_skin_tone": "🚴🏽\u200d♀️", + "woman_bouncing_ball": "⛹️\u200d♀️", + "woman_bouncing_ball_dark_skin_tone": "⛹🏿\u200d♀️", + "woman_bouncing_ball_light_skin_tone": "⛹🏻\u200d♀️", + "woman_bouncing_ball_medium-dark_skin_tone": "⛹🏾\u200d♀️", + "woman_bouncing_ball_medium-light_skin_tone": "⛹🏼\u200d♀️", + "woman_bouncing_ball_medium_skin_tone": "⛹🏽\u200d♀️", + "woman_bowing": "🙇\u200d♀️", + "woman_bowing_dark_skin_tone": "🙇🏿\u200d♀️", + "woman_bowing_light_skin_tone": "🙇🏻\u200d♀️", + "woman_bowing_medium-dark_skin_tone": "🙇🏾\u200d♀️", + "woman_bowing_medium-light_skin_tone": "🙇🏼\u200d♀️", + "woman_bowing_medium_skin_tone": "🙇🏽\u200d♀️", + "woman_cartwheeling": "🤸\u200d♀️", + "woman_cartwheeling_dark_skin_tone": "🤸🏿\u200d♀️", + "woman_cartwheeling_light_skin_tone": "🤸🏻\u200d♀️", + "woman_cartwheeling_medium-dark_skin_tone": "🤸🏾\u200d♀️", + "woman_cartwheeling_medium-light_skin_tone": "🤸🏼\u200d♀️", + "woman_cartwheeling_medium_skin_tone": "🤸🏽\u200d♀️", + "woman_climbing": "🧗\u200d♀️", + "woman_climbing_dark_skin_tone": "🧗🏿\u200d♀️", + "woman_climbing_light_skin_tone": "🧗🏻\u200d♀️", + "woman_climbing_medium-dark_skin_tone": "🧗🏾\u200d♀️", + "woman_climbing_medium-light_skin_tone": "🧗🏼\u200d♀️", + "woman_climbing_medium_skin_tone": "🧗🏽\u200d♀️", + "woman_construction_worker": "👷\u200d♀️", + "woman_construction_worker_dark_skin_tone": "👷🏿\u200d♀️", + "woman_construction_worker_light_skin_tone": "👷🏻\u200d♀️", + "woman_construction_worker_medium-dark_skin_tone": "👷🏾\u200d♀️", + "woman_construction_worker_medium-light_skin_tone": "👷🏼\u200d♀️", + "woman_construction_worker_medium_skin_tone": "👷🏽\u200d♀️", + "woman_cook": "👩\u200d🍳", + "woman_cook_dark_skin_tone": "👩🏿\u200d🍳", + "woman_cook_light_skin_tone": "👩🏻\u200d🍳", + "woman_cook_medium-dark_skin_tone": "👩🏾\u200d🍳", + "woman_cook_medium-light_skin_tone": "👩🏼\u200d🍳", + "woman_cook_medium_skin_tone": "👩🏽\u200d🍳", + "woman_dancing": "💃", + "woman_dancing_dark_skin_tone": "💃🏿", + "woman_dancing_light_skin_tone": "💃🏻", + "woman_dancing_medium-dark_skin_tone": "💃🏾", + "woman_dancing_medium-light_skin_tone": "💃🏼", + "woman_dancing_medium_skin_tone": "💃🏽", + "woman_dark_skin_tone": "👩🏿", + "woman_detective": "🕵️\u200d♀️", + "woman_detective_dark_skin_tone": "🕵🏿\u200d♀️", + "woman_detective_light_skin_tone": "🕵🏻\u200d♀️", + "woman_detective_medium-dark_skin_tone": "🕵🏾\u200d♀️", + "woman_detective_medium-light_skin_tone": "🕵🏼\u200d♀️", + "woman_detective_medium_skin_tone": "🕵🏽\u200d♀️", + "woman_elf": "🧝\u200d♀️", + "woman_elf_dark_skin_tone": "🧝🏿\u200d♀️", + "woman_elf_light_skin_tone": "🧝🏻\u200d♀️", + "woman_elf_medium-dark_skin_tone": "🧝🏾\u200d♀️", + "woman_elf_medium-light_skin_tone": "🧝🏼\u200d♀️", + "woman_elf_medium_skin_tone": "🧝🏽\u200d♀️", + "woman_facepalming": "🤦\u200d♀️", + "woman_facepalming_dark_skin_tone": "🤦🏿\u200d♀️", + "woman_facepalming_light_skin_tone": "🤦🏻\u200d♀️", + "woman_facepalming_medium-dark_skin_tone": "🤦🏾\u200d♀️", + "woman_facepalming_medium-light_skin_tone": "🤦🏼\u200d♀️", + "woman_facepalming_medium_skin_tone": "🤦🏽\u200d♀️", + "woman_factory_worker": "👩\u200d🏭", + "woman_factory_worker_dark_skin_tone": "👩🏿\u200d🏭", + "woman_factory_worker_light_skin_tone": "👩🏻\u200d🏭", + "woman_factory_worker_medium-dark_skin_tone": "👩🏾\u200d🏭", + "woman_factory_worker_medium-light_skin_tone": "👩🏼\u200d🏭", + "woman_factory_worker_medium_skin_tone": "👩🏽\u200d🏭", + "woman_fairy": "🧚\u200d♀️", + "woman_fairy_dark_skin_tone": "🧚🏿\u200d♀️", + "woman_fairy_light_skin_tone": "🧚🏻\u200d♀️", + "woman_fairy_medium-dark_skin_tone": "🧚🏾\u200d♀️", + "woman_fairy_medium-light_skin_tone": "🧚🏼\u200d♀️", + "woman_fairy_medium_skin_tone": "🧚🏽\u200d♀️", + "woman_farmer": "👩\u200d🌾", + "woman_farmer_dark_skin_tone": "👩🏿\u200d🌾", + "woman_farmer_light_skin_tone": "👩🏻\u200d🌾", + "woman_farmer_medium-dark_skin_tone": "👩🏾\u200d🌾", + "woman_farmer_medium-light_skin_tone": "👩🏼\u200d🌾", + "woman_farmer_medium_skin_tone": "👩🏽\u200d🌾", + "woman_firefighter": "👩\u200d🚒", + "woman_firefighter_dark_skin_tone": "👩🏿\u200d🚒", + "woman_firefighter_light_skin_tone": "👩🏻\u200d🚒", + "woman_firefighter_medium-dark_skin_tone": "👩🏾\u200d🚒", + "woman_firefighter_medium-light_skin_tone": "👩🏼\u200d🚒", + "woman_firefighter_medium_skin_tone": "👩🏽\u200d🚒", + "woman_frowning": "🙍\u200d♀️", + "woman_frowning_dark_skin_tone": "🙍🏿\u200d♀️", + "woman_frowning_light_skin_tone": "🙍🏻\u200d♀️", + "woman_frowning_medium-dark_skin_tone": "🙍🏾\u200d♀️", + "woman_frowning_medium-light_skin_tone": "🙍🏼\u200d♀️", + "woman_frowning_medium_skin_tone": "🙍🏽\u200d♀️", + "woman_genie": "🧞\u200d♀️", + "woman_gesturing_no": "🙅\u200d♀️", + "woman_gesturing_no_dark_skin_tone": "🙅🏿\u200d♀️", + "woman_gesturing_no_light_skin_tone": "🙅🏻\u200d♀️", + "woman_gesturing_no_medium-dark_skin_tone": "🙅🏾\u200d♀️", + "woman_gesturing_no_medium-light_skin_tone": "🙅🏼\u200d♀️", + "woman_gesturing_no_medium_skin_tone": "🙅🏽\u200d♀️", + "woman_gesturing_ok": "🙆\u200d♀️", + "woman_gesturing_ok_dark_skin_tone": "🙆🏿\u200d♀️", + "woman_gesturing_ok_light_skin_tone": "🙆🏻\u200d♀️", + "woman_gesturing_ok_medium-dark_skin_tone": "🙆🏾\u200d♀️", + "woman_gesturing_ok_medium-light_skin_tone": "🙆🏼\u200d♀️", + "woman_gesturing_ok_medium_skin_tone": "🙆🏽\u200d♀️", + "woman_getting_haircut": "💇\u200d♀️", + "woman_getting_haircut_dark_skin_tone": "💇🏿\u200d♀️", + "woman_getting_haircut_light_skin_tone": "💇🏻\u200d♀️", + "woman_getting_haircut_medium-dark_skin_tone": "💇🏾\u200d♀️", + "woman_getting_haircut_medium-light_skin_tone": "💇🏼\u200d♀️", + "woman_getting_haircut_medium_skin_tone": "💇🏽\u200d♀️", + "woman_getting_massage": "💆\u200d♀️", + "woman_getting_massage_dark_skin_tone": "💆🏿\u200d♀️", + "woman_getting_massage_light_skin_tone": "💆🏻\u200d♀️", + "woman_getting_massage_medium-dark_skin_tone": "💆🏾\u200d♀️", + "woman_getting_massage_medium-light_skin_tone": "💆🏼\u200d♀️", + "woman_getting_massage_medium_skin_tone": "💆🏽\u200d♀️", + "woman_golfing": "🏌️\u200d♀️", + "woman_golfing_dark_skin_tone": "🏌🏿\u200d♀️", + "woman_golfing_light_skin_tone": "🏌🏻\u200d♀️", + "woman_golfing_medium-dark_skin_tone": "🏌🏾\u200d♀️", + "woman_golfing_medium-light_skin_tone": "🏌🏼\u200d♀️", + "woman_golfing_medium_skin_tone": "🏌🏽\u200d♀️", + "woman_guard": "💂\u200d♀️", + "woman_guard_dark_skin_tone": "💂🏿\u200d♀️", + "woman_guard_light_skin_tone": "💂🏻\u200d♀️", + "woman_guard_medium-dark_skin_tone": "💂🏾\u200d♀️", + "woman_guard_medium-light_skin_tone": "💂🏼\u200d♀️", + "woman_guard_medium_skin_tone": "💂🏽\u200d♀️", + "woman_health_worker": "👩\u200d⚕️", + "woman_health_worker_dark_skin_tone": "👩🏿\u200d⚕️", + "woman_health_worker_light_skin_tone": "👩🏻\u200d⚕️", + "woman_health_worker_medium-dark_skin_tone": "👩🏾\u200d⚕️", + "woman_health_worker_medium-light_skin_tone": "👩🏼\u200d⚕️", + "woman_health_worker_medium_skin_tone": "👩🏽\u200d⚕️", + "woman_in_lotus_position": "🧘\u200d♀️", + "woman_in_lotus_position_dark_skin_tone": "🧘🏿\u200d♀️", + "woman_in_lotus_position_light_skin_tone": "🧘🏻\u200d♀️", + "woman_in_lotus_position_medium-dark_skin_tone": "🧘🏾\u200d♀️", + "woman_in_lotus_position_medium-light_skin_tone": "🧘🏼\u200d♀️", + "woman_in_lotus_position_medium_skin_tone": "🧘🏽\u200d♀️", + "woman_in_manual_wheelchair": "👩\u200d🦽", + "woman_in_motorized_wheelchair": "👩\u200d🦼", + "woman_in_steamy_room": "🧖\u200d♀️", + "woman_in_steamy_room_dark_skin_tone": "🧖🏿\u200d♀️", + "woman_in_steamy_room_light_skin_tone": "🧖🏻\u200d♀️", + "woman_in_steamy_room_medium-dark_skin_tone": "🧖🏾\u200d♀️", + "woman_in_steamy_room_medium-light_skin_tone": "🧖🏼\u200d♀️", + "woman_in_steamy_room_medium_skin_tone": "🧖🏽\u200d♀️", + "woman_judge": "👩\u200d⚖️", + "woman_judge_dark_skin_tone": "👩🏿\u200d⚖️", + "woman_judge_light_skin_tone": "👩🏻\u200d⚖️", + "woman_judge_medium-dark_skin_tone": "👩🏾\u200d⚖️", + "woman_judge_medium-light_skin_tone": "👩🏼\u200d⚖️", + "woman_judge_medium_skin_tone": "👩🏽\u200d⚖️", + "woman_juggling": "🤹\u200d♀️", + "woman_juggling_dark_skin_tone": "🤹🏿\u200d♀️", + "woman_juggling_light_skin_tone": "🤹🏻\u200d♀️", + "woman_juggling_medium-dark_skin_tone": "🤹🏾\u200d♀️", + "woman_juggling_medium-light_skin_tone": "🤹🏼\u200d♀️", + "woman_juggling_medium_skin_tone": "🤹🏽\u200d♀️", + "woman_lifting_weights": "🏋️\u200d♀️", + "woman_lifting_weights_dark_skin_tone": "🏋🏿\u200d♀️", + "woman_lifting_weights_light_skin_tone": "🏋🏻\u200d♀️", + "woman_lifting_weights_medium-dark_skin_tone": "🏋🏾\u200d♀️", + "woman_lifting_weights_medium-light_skin_tone": "🏋🏼\u200d♀️", + "woman_lifting_weights_medium_skin_tone": "🏋🏽\u200d♀️", + "woman_light_skin_tone": "👩🏻", + "woman_mage": "🧙\u200d♀️", + "woman_mage_dark_skin_tone": "🧙🏿\u200d♀️", + "woman_mage_light_skin_tone": "🧙🏻\u200d♀️", + "woman_mage_medium-dark_skin_tone": "🧙🏾\u200d♀️", + "woman_mage_medium-light_skin_tone": "🧙🏼\u200d♀️", + "woman_mage_medium_skin_tone": "🧙🏽\u200d♀️", + "woman_mechanic": "👩\u200d🔧", + "woman_mechanic_dark_skin_tone": "👩🏿\u200d🔧", + "woman_mechanic_light_skin_tone": "👩🏻\u200d🔧", + "woman_mechanic_medium-dark_skin_tone": "👩🏾\u200d🔧", + "woman_mechanic_medium-light_skin_tone": "👩🏼\u200d🔧", + "woman_mechanic_medium_skin_tone": "👩🏽\u200d🔧", + "woman_medium-dark_skin_tone": "👩🏾", + "woman_medium-light_skin_tone": "👩🏼", + "woman_medium_skin_tone": "👩🏽", + "woman_mountain_biking": "🚵\u200d♀️", + "woman_mountain_biking_dark_skin_tone": "🚵🏿\u200d♀️", + "woman_mountain_biking_light_skin_tone": "🚵🏻\u200d♀️", + "woman_mountain_biking_medium-dark_skin_tone": "🚵🏾\u200d♀️", + "woman_mountain_biking_medium-light_skin_tone": "🚵🏼\u200d♀️", + "woman_mountain_biking_medium_skin_tone": "🚵🏽\u200d♀️", + "woman_office_worker": "👩\u200d💼", + "woman_office_worker_dark_skin_tone": "👩🏿\u200d💼", + "woman_office_worker_light_skin_tone": "👩🏻\u200d💼", + "woman_office_worker_medium-dark_skin_tone": "👩🏾\u200d💼", + "woman_office_worker_medium-light_skin_tone": "👩🏼\u200d💼", + "woman_office_worker_medium_skin_tone": "👩🏽\u200d💼", + "woman_pilot": "👩\u200d✈️", + "woman_pilot_dark_skin_tone": "👩🏿\u200d✈️", + "woman_pilot_light_skin_tone": "👩🏻\u200d✈️", + "woman_pilot_medium-dark_skin_tone": "👩🏾\u200d✈️", + "woman_pilot_medium-light_skin_tone": "👩🏼\u200d✈️", + "woman_pilot_medium_skin_tone": "👩🏽\u200d✈️", + "woman_playing_handball": "🤾\u200d♀️", + "woman_playing_handball_dark_skin_tone": "🤾🏿\u200d♀️", + "woman_playing_handball_light_skin_tone": "🤾🏻\u200d♀️", + "woman_playing_handball_medium-dark_skin_tone": "🤾🏾\u200d♀️", + "woman_playing_handball_medium-light_skin_tone": "🤾🏼\u200d♀️", + "woman_playing_handball_medium_skin_tone": "🤾🏽\u200d♀️", + "woman_playing_water_polo": "🤽\u200d♀️", + "woman_playing_water_polo_dark_skin_tone": "🤽🏿\u200d♀️", + "woman_playing_water_polo_light_skin_tone": "🤽🏻\u200d♀️", + "woman_playing_water_polo_medium-dark_skin_tone": "🤽🏾\u200d♀️", + "woman_playing_water_polo_medium-light_skin_tone": "🤽🏼\u200d♀️", + "woman_playing_water_polo_medium_skin_tone": "🤽🏽\u200d♀️", + "woman_police_officer": "👮\u200d♀️", + "woman_police_officer_dark_skin_tone": "👮🏿\u200d♀️", + "woman_police_officer_light_skin_tone": "👮🏻\u200d♀️", + "woman_police_officer_medium-dark_skin_tone": "👮🏾\u200d♀️", + "woman_police_officer_medium-light_skin_tone": "👮🏼\u200d♀️", + "woman_police_officer_medium_skin_tone": "👮🏽\u200d♀️", + "woman_pouting": "🙎\u200d♀️", + "woman_pouting_dark_skin_tone": "🙎🏿\u200d♀️", + "woman_pouting_light_skin_tone": "🙎🏻\u200d♀️", + "woman_pouting_medium-dark_skin_tone": "🙎🏾\u200d♀️", + "woman_pouting_medium-light_skin_tone": "🙎🏼\u200d♀️", + "woman_pouting_medium_skin_tone": "🙎🏽\u200d♀️", + "woman_raising_hand": "🙋\u200d♀️", + "woman_raising_hand_dark_skin_tone": "🙋🏿\u200d♀️", + "woman_raising_hand_light_skin_tone": "🙋🏻\u200d♀️", + "woman_raising_hand_medium-dark_skin_tone": "🙋🏾\u200d♀️", + "woman_raising_hand_medium-light_skin_tone": "🙋🏼\u200d♀️", + "woman_raising_hand_medium_skin_tone": "🙋🏽\u200d♀️", + "woman_rowing_boat": "🚣\u200d♀️", + "woman_rowing_boat_dark_skin_tone": "🚣🏿\u200d♀️", + "woman_rowing_boat_light_skin_tone": "🚣🏻\u200d♀️", + "woman_rowing_boat_medium-dark_skin_tone": "🚣🏾\u200d♀️", + "woman_rowing_boat_medium-light_skin_tone": "🚣🏼\u200d♀️", + "woman_rowing_boat_medium_skin_tone": "🚣🏽\u200d♀️", + "woman_running": "🏃\u200d♀️", + "woman_running_dark_skin_tone": "🏃🏿\u200d♀️", + "woman_running_light_skin_tone": "🏃🏻\u200d♀️", + "woman_running_medium-dark_skin_tone": "🏃🏾\u200d♀️", + "woman_running_medium-light_skin_tone": "🏃🏼\u200d♀️", + "woman_running_medium_skin_tone": "🏃🏽\u200d♀️", + "woman_scientist": "👩\u200d🔬", + "woman_scientist_dark_skin_tone": "👩🏿\u200d🔬", + "woman_scientist_light_skin_tone": "👩🏻\u200d🔬", + "woman_scientist_medium-dark_skin_tone": "👩🏾\u200d🔬", + "woman_scientist_medium-light_skin_tone": "👩🏼\u200d🔬", + "woman_scientist_medium_skin_tone": "👩🏽\u200d🔬", + "woman_shrugging": "🤷\u200d♀️", + "woman_shrugging_dark_skin_tone": "🤷🏿\u200d♀️", + "woman_shrugging_light_skin_tone": "🤷🏻\u200d♀️", + "woman_shrugging_medium-dark_skin_tone": "🤷🏾\u200d♀️", + "woman_shrugging_medium-light_skin_tone": "🤷🏼\u200d♀️", + "woman_shrugging_medium_skin_tone": "🤷🏽\u200d♀️", + "woman_singer": "👩\u200d🎤", + "woman_singer_dark_skin_tone": "👩🏿\u200d🎤", + "woman_singer_light_skin_tone": "👩🏻\u200d🎤", + "woman_singer_medium-dark_skin_tone": "👩🏾\u200d🎤", + "woman_singer_medium-light_skin_tone": "👩🏼\u200d🎤", + "woman_singer_medium_skin_tone": "👩🏽\u200d🎤", + "woman_student": "👩\u200d🎓", + "woman_student_dark_skin_tone": "👩🏿\u200d🎓", + "woman_student_light_skin_tone": "👩🏻\u200d🎓", + "woman_student_medium-dark_skin_tone": "👩🏾\u200d🎓", + "woman_student_medium-light_skin_tone": "👩🏼\u200d🎓", + "woman_student_medium_skin_tone": "👩🏽\u200d🎓", + "woman_surfing": "🏄\u200d♀️", + "woman_surfing_dark_skin_tone": "🏄🏿\u200d♀️", + "woman_surfing_light_skin_tone": "🏄🏻\u200d♀️", + "woman_surfing_medium-dark_skin_tone": "🏄🏾\u200d♀️", + "woman_surfing_medium-light_skin_tone": "🏄🏼\u200d♀️", + "woman_surfing_medium_skin_tone": "🏄🏽\u200d♀️", + "woman_swimming": "🏊\u200d♀️", + "woman_swimming_dark_skin_tone": "🏊🏿\u200d♀️", + "woman_swimming_light_skin_tone": "🏊🏻\u200d♀️", + "woman_swimming_medium-dark_skin_tone": "🏊🏾\u200d♀️", + "woman_swimming_medium-light_skin_tone": "🏊🏼\u200d♀️", + "woman_swimming_medium_skin_tone": "🏊🏽\u200d♀️", + "woman_teacher": "👩\u200d🏫", + "woman_teacher_dark_skin_tone": "👩🏿\u200d🏫", + "woman_teacher_light_skin_tone": "👩🏻\u200d🏫", + "woman_teacher_medium-dark_skin_tone": "👩🏾\u200d🏫", + "woman_teacher_medium-light_skin_tone": "👩🏼\u200d🏫", + "woman_teacher_medium_skin_tone": "👩🏽\u200d🏫", + "woman_technologist": "👩\u200d💻", + "woman_technologist_dark_skin_tone": "👩🏿\u200d💻", + "woman_technologist_light_skin_tone": "👩🏻\u200d💻", + "woman_technologist_medium-dark_skin_tone": "👩🏾\u200d💻", + "woman_technologist_medium-light_skin_tone": "👩🏼\u200d💻", + "woman_technologist_medium_skin_tone": "👩🏽\u200d💻", + "woman_tipping_hand": "💁\u200d♀️", + "woman_tipping_hand_dark_skin_tone": "💁🏿\u200d♀️", + "woman_tipping_hand_light_skin_tone": "💁🏻\u200d♀️", + "woman_tipping_hand_medium-dark_skin_tone": "💁🏾\u200d♀️", + "woman_tipping_hand_medium-light_skin_tone": "💁🏼\u200d♀️", + "woman_tipping_hand_medium_skin_tone": "💁🏽\u200d♀️", + "woman_vampire": "🧛\u200d♀️", + "woman_vampire_dark_skin_tone": "🧛🏿\u200d♀️", + "woman_vampire_light_skin_tone": "🧛🏻\u200d♀️", + "woman_vampire_medium-dark_skin_tone": "🧛🏾\u200d♀️", + "woman_vampire_medium-light_skin_tone": "🧛🏼\u200d♀️", + "woman_vampire_medium_skin_tone": "🧛🏽\u200d♀️", + "woman_walking": "🚶\u200d♀️", + "woman_walking_dark_skin_tone": "🚶🏿\u200d♀️", + "woman_walking_light_skin_tone": "🚶🏻\u200d♀️", + "woman_walking_medium-dark_skin_tone": "🚶🏾\u200d♀️", + "woman_walking_medium-light_skin_tone": "🚶🏼\u200d♀️", + "woman_walking_medium_skin_tone": "🚶🏽\u200d♀️", + "woman_wearing_turban": "👳\u200d♀️", + "woman_wearing_turban_dark_skin_tone": "👳🏿\u200d♀️", + "woman_wearing_turban_light_skin_tone": "👳🏻\u200d♀️", + "woman_wearing_turban_medium-dark_skin_tone": "👳🏾\u200d♀️", + "woman_wearing_turban_medium-light_skin_tone": "👳🏼\u200d♀️", + "woman_wearing_turban_medium_skin_tone": "👳🏽\u200d♀️", + "woman_with_headscarf": "🧕", + "woman_with_headscarf_dark_skin_tone": "🧕🏿", + "woman_with_headscarf_light_skin_tone": "🧕🏻", + "woman_with_headscarf_medium-dark_skin_tone": "🧕🏾", + "woman_with_headscarf_medium-light_skin_tone": "🧕🏼", + "woman_with_headscarf_medium_skin_tone": "🧕🏽", + "woman_with_probing_cane": "👩\u200d🦯", + "woman_zombie": "🧟\u200d♀️", + "woman’s_boot": "👢", + "woman’s_clothes": "👚", + "woman’s_hat": "👒", + "woman’s_sandal": "👡", + "women_with_bunny_ears": "👯\u200d♀️", + "women_wrestling": "🤼\u200d♀️", + "women’s_room": "🚺", + "woozy_face": "🥴", + "world_map": "🗺", + "worried_face": "😟", + "wrapped_gift": "🎁", + "wrench": "🔧", + "writing_hand": "✍", + "writing_hand_dark_skin_tone": "✍🏿", + "writing_hand_light_skin_tone": "✍🏻", + "writing_hand_medium-dark_skin_tone": "✍🏾", + "writing_hand_medium-light_skin_tone": "✍🏼", + "writing_hand_medium_skin_tone": "✍🏽", + "yarn": "🧶", + "yawning_face": "🥱", + "yellow_circle": "🟡", + "yellow_heart": "💛", + "yellow_square": "🟨", + "yen_banknote": "💴", + "yo-yo": "🪀", + "yin_yang": "☯", + "zany_face": "🤪", + "zebra": "🦓", + "zipper-mouth_face": "🤐", + "zombie": "🧟", + "zzz": "💤", + "åland_islands": "🇦🇽", + "keycap_asterisk": "*⃣", + "keycap_digit_eight": "8⃣", + "keycap_digit_five": "5⃣", + "keycap_digit_four": "4⃣", + "keycap_digit_nine": "9⃣", + "keycap_digit_one": "1⃣", + "keycap_digit_seven": "7⃣", + "keycap_digit_six": "6⃣", + "keycap_digit_three": "3⃣", + "keycap_digit_two": "2⃣", + "keycap_digit_zero": "0⃣", + "keycap_number_sign": "#⃣", + "light_skin_tone": "🏻", + "medium_light_skin_tone": "🏼", + "medium_skin_tone": "🏽", + "medium_dark_skin_tone": "🏾", + "dark_skin_tone": "🏿", + "regional_indicator_symbol_letter_a": "🇦", + "regional_indicator_symbol_letter_b": "🇧", + "regional_indicator_symbol_letter_c": "🇨", + "regional_indicator_symbol_letter_d": "🇩", + "regional_indicator_symbol_letter_e": "🇪", + "regional_indicator_symbol_letter_f": "🇫", + "regional_indicator_symbol_letter_g": "🇬", + "regional_indicator_symbol_letter_h": "🇭", + "regional_indicator_symbol_letter_i": "🇮", + "regional_indicator_symbol_letter_j": "🇯", + "regional_indicator_symbol_letter_k": "🇰", + "regional_indicator_symbol_letter_l": "🇱", + "regional_indicator_symbol_letter_m": "🇲", + "regional_indicator_symbol_letter_n": "🇳", + "regional_indicator_symbol_letter_o": "🇴", + "regional_indicator_symbol_letter_p": "🇵", + "regional_indicator_symbol_letter_q": "🇶", + "regional_indicator_symbol_letter_r": "🇷", + "regional_indicator_symbol_letter_s": "🇸", + "regional_indicator_symbol_letter_t": "🇹", + "regional_indicator_symbol_letter_u": "🇺", + "regional_indicator_symbol_letter_v": "🇻", + "regional_indicator_symbol_letter_w": "🇼", + "regional_indicator_symbol_letter_x": "🇽", + "regional_indicator_symbol_letter_y": "🇾", + "regional_indicator_symbol_letter_z": "🇿", + "airplane_arriving": "🛬", + "space_invader": "👾", + "football": "🏈", + "anger": "💢", + "angry": "😠", + "anguished": "😧", + "signal_strength": "📶", + "arrows_counterclockwise": "🔄", + "arrow_heading_down": "⤵", + "arrow_heading_up": "⤴", + "art": "🎨", + "astonished": "😲", + "athletic_shoe": "👟", + "atm": "🏧", + "car": "🚗", + "red_car": "🚗", + "angel": "👼", + "back": "🔙", + "badminton_racquet_and_shuttlecock": "🏸", + "dollar": "💵", + "euro": "💶", + "pound": "💷", + "yen": "💴", + "barber": "💈", + "bath": "🛀", + "bear": "🐻", + "heartbeat": "💓", + "beer": "🍺", + "no_bell": "🔕", + "bento": "🍱", + "bike": "🚲", + "bicyclist": "🚴", + "8ball": "🎱", + "biohazard_sign": "☣", + "birthday": "🎂", + "black_circle_for_record": "⏺", + "clubs": "♣", + "diamonds": "♦", + "arrow_double_down": "⏬", + "hearts": "♥", + "rewind": "⏪", + "black_left__pointing_double_triangle_with_vertical_bar": "⏮", + "arrow_backward": "◀", + "black_medium_small_square": "◾", + "question": "❓", + "fast_forward": "⏩", + "black_right__pointing_double_triangle_with_vertical_bar": "⏭", + "arrow_forward": "▶", + "black_right__pointing_triangle_with_double_vertical_bar": "⏯", + "arrow_right": "➡", + "spades": "♠", + "black_square_for_stop": "⏹", + "sunny": "☀", + "phone": "☎", + "recycle": "♻", + "arrow_double_up": "⏫", + "busstop": "🚏", + "date": "📅", + "flags": "🎏", + "cat2": "🐈", + "joy_cat": "😹", + "smirk_cat": "😼", + "chart_with_downwards_trend": "📉", + "chart_with_upwards_trend": "📈", + "chart": "💹", + "mega": "📣", + "checkered_flag": "🏁", + "accept": "🉑", + "ideograph_advantage": "🉐", + "congratulations": "㊗", + "secret": "㊙", + "m": "Ⓜ", + "city_sunset": "🌆", + "clapper": "🎬", + "clap": "👏", + "beers": "🍻", + "clock830": "🕣", + "clock8": "🕗", + "clock1130": "🕦", + "clock11": "🕚", + "clock530": "🕠", + "clock5": "🕔", + "clock430": "🕟", + "clock4": "🕓", + "clock930": "🕤", + "clock9": "🕘", + "clock130": "🕜", + "clock1": "🕐", + "clock730": "🕢", + "clock7": "🕖", + "clock630": "🕡", + "clock6": "🕕", + "clock1030": "🕥", + "clock10": "🕙", + "clock330": "🕞", + "clock3": "🕒", + "clock1230": "🕧", + "clock12": "🕛", + "clock230": "🕝", + "clock2": "🕑", + "arrows_clockwise": "🔃", + "repeat": "🔁", + "repeat_one": "🔂", + "closed_lock_with_key": "🔐", + "mailbox_closed": "📪", + "mailbox": "📫", + "cloud_with_tornado": "🌪", + "cocktail": "🍸", + "boom": "💥", + "compression": "🗜", + "confounded": "😖", + "confused": "😕", + "rice": "🍚", + "cow2": "🐄", + "cricket_bat_and_ball": "🏏", + "x": "❌", + "cry": "😢", + "curry": "🍛", + "dagger_knife": "🗡", + "dancer": "💃", + "dark_sunglasses": "🕶", + "dash": "💨", + "truck": "🚚", + "derelict_house_building": "🏚", + "diamond_shape_with_a_dot_inside": "💠", + "dart": "🎯", + "disappointed_relieved": "😥", + "disappointed": "😞", + "do_not_litter": "🚯", + "dog2": "🐕", + "flipper": "🐬", + "loop": "➿", + "bangbang": "‼", + "double_vertical_bar": "⏸", + "dove_of_peace": "🕊", + "small_red_triangle_down": "🔻", + "arrow_down_small": "🔽", + "arrow_down": "⬇", + "dromedary_camel": "🐪", + "e__mail": "📧", + "corn": "🌽", + "ear_of_rice": "🌾", + "earth_americas": "🌎", + "earth_asia": "🌏", + "earth_africa": "🌍", + "eight_pointed_black_star": "✴", + "eight_spoked_asterisk": "✳", + "eject_symbol": "⏏", + "bulb": "💡", + "emoji_modifier_fitzpatrick_type__1__2": "🏻", + "emoji_modifier_fitzpatrick_type__3": "🏼", + "emoji_modifier_fitzpatrick_type__4": "🏽", + "emoji_modifier_fitzpatrick_type__5": "🏾", + "emoji_modifier_fitzpatrick_type__6": "🏿", + "end": "🔚", + "email": "✉", + "european_castle": "🏰", + "european_post_office": "🏤", + "interrobang": "⁉", + "expressionless": "😑", + "eyeglasses": "👓", + "massage": "💆", + "yum": "😋", + "scream": "😱", + "kissing_heart": "😘", + "sweat": "😓", + "face_with_head__bandage": "🤕", + "triumph": "😤", + "mask": "😷", + "no_good": "🙅", + "ok_woman": "🙆", + "open_mouth": "😮", + "cold_sweat": "😰", + "stuck_out_tongue": "😛", + "stuck_out_tongue_closed_eyes": "😝", + "stuck_out_tongue_winking_eye": "😜", + "joy": "😂", + "no_mouth": "😶", + "santa": "🎅", + "fax": "📠", + "fearful": "😨", + "field_hockey_stick_and_ball": "🏑", + "first_quarter_moon_with_face": "🌛", + "fish_cake": "🍥", + "fishing_pole_and_fish": "🎣", + "facepunch": "👊", + "punch": "👊", + "flag_for_afghanistan": "🇦🇫", + "flag_for_albania": "🇦🇱", + "flag_for_algeria": "🇩🇿", + "flag_for_american_samoa": "🇦🇸", + "flag_for_andorra": "🇦🇩", + "flag_for_angola": "🇦🇴", + "flag_for_anguilla": "🇦🇮", + "flag_for_antarctica": "🇦🇶", + "flag_for_antigua_&_barbuda": "🇦🇬", + "flag_for_argentina": "🇦🇷", + "flag_for_armenia": "🇦🇲", + "flag_for_aruba": "🇦🇼", + "flag_for_ascension_island": "🇦🇨", + "flag_for_australia": "🇦🇺", + "flag_for_austria": "🇦🇹", + "flag_for_azerbaijan": "🇦🇿", + "flag_for_bahamas": "🇧🇸", + "flag_for_bahrain": "🇧🇭", + "flag_for_bangladesh": "🇧🇩", + "flag_for_barbados": "🇧🇧", + "flag_for_belarus": "🇧🇾", + "flag_for_belgium": "🇧🇪", + "flag_for_belize": "🇧🇿", + "flag_for_benin": "🇧🇯", + "flag_for_bermuda": "🇧🇲", + "flag_for_bhutan": "🇧🇹", + "flag_for_bolivia": "🇧🇴", + "flag_for_bosnia_&_herzegovina": "🇧🇦", + "flag_for_botswana": "🇧🇼", + "flag_for_bouvet_island": "🇧🇻", + "flag_for_brazil": "🇧🇷", + "flag_for_british_indian_ocean_territory": "🇮🇴", + "flag_for_british_virgin_islands": "🇻🇬", + "flag_for_brunei": "🇧🇳", + "flag_for_bulgaria": "🇧🇬", + "flag_for_burkina_faso": "🇧🇫", + "flag_for_burundi": "🇧🇮", + "flag_for_cambodia": "🇰🇭", + "flag_for_cameroon": "🇨🇲", + "flag_for_canada": "🇨🇦", + "flag_for_canary_islands": "🇮🇨", + "flag_for_cape_verde": "🇨🇻", + "flag_for_caribbean_netherlands": "🇧🇶", + "flag_for_cayman_islands": "🇰🇾", + "flag_for_central_african_republic": "🇨🇫", + "flag_for_ceuta_&_melilla": "🇪🇦", + "flag_for_chad": "🇹🇩", + "flag_for_chile": "🇨🇱", + "flag_for_china": "🇨🇳", + "flag_for_christmas_island": "🇨🇽", + "flag_for_clipperton_island": "🇨🇵", + "flag_for_cocos__islands": "🇨🇨", + "flag_for_colombia": "🇨🇴", + "flag_for_comoros": "🇰🇲", + "flag_for_congo____brazzaville": "🇨🇬", + "flag_for_congo____kinshasa": "🇨🇩", + "flag_for_cook_islands": "🇨🇰", + "flag_for_costa_rica": "🇨🇷", + "flag_for_croatia": "🇭🇷", + "flag_for_cuba": "🇨🇺", + "flag_for_curaçao": "🇨🇼", + "flag_for_cyprus": "🇨🇾", + "flag_for_czech_republic": "🇨🇿", + "flag_for_côte_d’ivoire": "🇨🇮", + "flag_for_denmark": "🇩🇰", + "flag_for_diego_garcia": "🇩🇬", + "flag_for_djibouti": "🇩🇯", + "flag_for_dominica": "🇩🇲", + "flag_for_dominican_republic": "🇩🇴", + "flag_for_ecuador": "🇪🇨", + "flag_for_egypt": "🇪🇬", + "flag_for_el_salvador": "🇸🇻", + "flag_for_equatorial_guinea": "🇬🇶", + "flag_for_eritrea": "🇪🇷", + "flag_for_estonia": "🇪🇪", + "flag_for_ethiopia": "🇪🇹", + "flag_for_european_union": "🇪🇺", + "flag_for_falkland_islands": "🇫🇰", + "flag_for_faroe_islands": "🇫🇴", + "flag_for_fiji": "🇫🇯", + "flag_for_finland": "🇫🇮", + "flag_for_france": "🇫🇷", + "flag_for_french_guiana": "🇬🇫", + "flag_for_french_polynesia": "🇵🇫", + "flag_for_french_southern_territories": "🇹🇫", + "flag_for_gabon": "🇬🇦", + "flag_for_gambia": "🇬🇲", + "flag_for_georgia": "🇬🇪", + "flag_for_germany": "🇩🇪", + "flag_for_ghana": "🇬🇭", + "flag_for_gibraltar": "🇬🇮", + "flag_for_greece": "🇬🇷", + "flag_for_greenland": "🇬🇱", + "flag_for_grenada": "🇬🇩", + "flag_for_guadeloupe": "🇬🇵", + "flag_for_guam": "🇬🇺", + "flag_for_guatemala": "🇬🇹", + "flag_for_guernsey": "🇬🇬", + "flag_for_guinea": "🇬🇳", + "flag_for_guinea__bissau": "🇬🇼", + "flag_for_guyana": "🇬🇾", + "flag_for_haiti": "🇭🇹", + "flag_for_heard_&_mcdonald_islands": "🇭🇲", + "flag_for_honduras": "🇭🇳", + "flag_for_hong_kong": "🇭🇰", + "flag_for_hungary": "🇭🇺", + "flag_for_iceland": "🇮🇸", + "flag_for_india": "🇮🇳", + "flag_for_indonesia": "🇮🇩", + "flag_for_iran": "🇮🇷", + "flag_for_iraq": "🇮🇶", + "flag_for_ireland": "🇮🇪", + "flag_for_isle_of_man": "🇮🇲", + "flag_for_israel": "🇮🇱", + "flag_for_italy": "🇮🇹", + "flag_for_jamaica": "🇯🇲", + "flag_for_japan": "🇯🇵", + "flag_for_jersey": "🇯🇪", + "flag_for_jordan": "🇯🇴", + "flag_for_kazakhstan": "🇰🇿", + "flag_for_kenya": "🇰🇪", + "flag_for_kiribati": "🇰🇮", + "flag_for_kosovo": "🇽🇰", + "flag_for_kuwait": "🇰🇼", + "flag_for_kyrgyzstan": "🇰🇬", + "flag_for_laos": "🇱🇦", + "flag_for_latvia": "🇱🇻", + "flag_for_lebanon": "🇱🇧", + "flag_for_lesotho": "🇱🇸", + "flag_for_liberia": "🇱🇷", + "flag_for_libya": "🇱🇾", + "flag_for_liechtenstein": "🇱🇮", + "flag_for_lithuania": "🇱🇹", + "flag_for_luxembourg": "🇱🇺", + "flag_for_macau": "🇲🇴", + "flag_for_macedonia": "🇲🇰", + "flag_for_madagascar": "🇲🇬", + "flag_for_malawi": "🇲🇼", + "flag_for_malaysia": "🇲🇾", + "flag_for_maldives": "🇲🇻", + "flag_for_mali": "🇲🇱", + "flag_for_malta": "🇲🇹", + "flag_for_marshall_islands": "🇲🇭", + "flag_for_martinique": "🇲🇶", + "flag_for_mauritania": "🇲🇷", + "flag_for_mauritius": "🇲🇺", + "flag_for_mayotte": "🇾🇹", + "flag_for_mexico": "🇲🇽", + "flag_for_micronesia": "🇫🇲", + "flag_for_moldova": "🇲🇩", + "flag_for_monaco": "🇲🇨", + "flag_for_mongolia": "🇲🇳", + "flag_for_montenegro": "🇲🇪", + "flag_for_montserrat": "🇲🇸", + "flag_for_morocco": "🇲🇦", + "flag_for_mozambique": "🇲🇿", + "flag_for_myanmar": "🇲🇲", + "flag_for_namibia": "🇳🇦", + "flag_for_nauru": "🇳🇷", + "flag_for_nepal": "🇳🇵", + "flag_for_netherlands": "🇳🇱", + "flag_for_new_caledonia": "🇳🇨", + "flag_for_new_zealand": "🇳🇿", + "flag_for_nicaragua": "🇳🇮", + "flag_for_niger": "🇳🇪", + "flag_for_nigeria": "🇳🇬", + "flag_for_niue": "🇳🇺", + "flag_for_norfolk_island": "🇳🇫", + "flag_for_north_korea": "🇰🇵", + "flag_for_northern_mariana_islands": "🇲🇵", + "flag_for_norway": "🇳🇴", + "flag_for_oman": "🇴🇲", + "flag_for_pakistan": "🇵🇰", + "flag_for_palau": "🇵🇼", + "flag_for_palestinian_territories": "🇵🇸", + "flag_for_panama": "🇵🇦", + "flag_for_papua_new_guinea": "🇵🇬", + "flag_for_paraguay": "🇵🇾", + "flag_for_peru": "🇵🇪", + "flag_for_philippines": "🇵🇭", + "flag_for_pitcairn_islands": "🇵🇳", + "flag_for_poland": "🇵🇱", + "flag_for_portugal": "🇵🇹", + "flag_for_puerto_rico": "🇵🇷", + "flag_for_qatar": "🇶🇦", + "flag_for_romania": "🇷🇴", + "flag_for_russia": "🇷🇺", + "flag_for_rwanda": "🇷🇼", + "flag_for_réunion": "🇷🇪", + "flag_for_samoa": "🇼🇸", + "flag_for_san_marino": "🇸🇲", + "flag_for_saudi_arabia": "🇸🇦", + "flag_for_senegal": "🇸🇳", + "flag_for_serbia": "🇷🇸", + "flag_for_seychelles": "🇸🇨", + "flag_for_sierra_leone": "🇸🇱", + "flag_for_singapore": "🇸🇬", + "flag_for_sint_maarten": "🇸🇽", + "flag_for_slovakia": "🇸🇰", + "flag_for_slovenia": "🇸🇮", + "flag_for_solomon_islands": "🇸🇧", + "flag_for_somalia": "🇸🇴", + "flag_for_south_africa": "🇿🇦", + "flag_for_south_georgia_&_south_sandwich_islands": "🇬🇸", + "flag_for_south_korea": "🇰🇷", + "flag_for_south_sudan": "🇸🇸", + "flag_for_spain": "🇪🇸", + "flag_for_sri_lanka": "🇱🇰", + "flag_for_st._barthélemy": "🇧🇱", + "flag_for_st._helena": "🇸🇭", + "flag_for_st._kitts_&_nevis": "🇰🇳", + "flag_for_st._lucia": "🇱🇨", + "flag_for_st._martin": "🇲🇫", + "flag_for_st._pierre_&_miquelon": "🇵🇲", + "flag_for_st._vincent_&_grenadines": "🇻🇨", + "flag_for_sudan": "🇸🇩", + "flag_for_suriname": "🇸🇷", + "flag_for_svalbard_&_jan_mayen": "🇸🇯", + "flag_for_swaziland": "🇸🇿", + "flag_for_sweden": "🇸🇪", + "flag_for_switzerland": "🇨🇭", + "flag_for_syria": "🇸🇾", + "flag_for_são_tomé_&_príncipe": "🇸🇹", + "flag_for_taiwan": "🇹🇼", + "flag_for_tajikistan": "🇹🇯", + "flag_for_tanzania": "🇹🇿", + "flag_for_thailand": "🇹🇭", + "flag_for_timor__leste": "🇹🇱", + "flag_for_togo": "🇹🇬", + "flag_for_tokelau": "🇹🇰", + "flag_for_tonga": "🇹🇴", + "flag_for_trinidad_&_tobago": "🇹🇹", + "flag_for_tristan_da_cunha": "🇹🇦", + "flag_for_tunisia": "🇹🇳", + "flag_for_turkey": "🇹🇷", + "flag_for_turkmenistan": "🇹🇲", + "flag_for_turks_&_caicos_islands": "🇹🇨", + "flag_for_tuvalu": "🇹🇻", + "flag_for_u.s._outlying_islands": "🇺🇲", + "flag_for_u.s._virgin_islands": "🇻🇮", + "flag_for_uganda": "🇺🇬", + "flag_for_ukraine": "🇺🇦", + "flag_for_united_arab_emirates": "🇦🇪", + "flag_for_united_kingdom": "🇬🇧", + "flag_for_united_states": "🇺🇸", + "flag_for_uruguay": "🇺🇾", + "flag_for_uzbekistan": "🇺🇿", + "flag_for_vanuatu": "🇻🇺", + "flag_for_vatican_city": "🇻🇦", + "flag_for_venezuela": "🇻🇪", + "flag_for_vietnam": "🇻🇳", + "flag_for_wallis_&_futuna": "🇼🇫", + "flag_for_western_sahara": "🇪🇭", + "flag_for_yemen": "🇾🇪", + "flag_for_zambia": "🇿🇲", + "flag_for_zimbabwe": "🇿🇼", + "flag_for_åland_islands": "🇦🇽", + "golf": "⛳", + "fleur__de__lis": "⚜", + "muscle": "💪", + "flushed": "😳", + "frame_with_picture": "🖼", + "fries": "🍟", + "frog": "🐸", + "hatched_chick": "🐥", + "frowning": "😦", + "fuelpump": "⛽", + "full_moon_with_face": "🌝", + "gem": "💎", + "star2": "🌟", + "golfer": "🏌", + "mortar_board": "🎓", + "grimacing": "😬", + "smile_cat": "😸", + "grinning": "😀", + "grin": "😁", + "heartpulse": "💗", + "guardsman": "💂", + "haircut": "💇", + "hamster": "🐹", + "raising_hand": "🙋", + "headphones": "🎧", + "hear_no_evil": "🙉", + "cupid": "💘", + "gift_heart": "💝", + "heart": "❤", + "exclamation": "❗", + "heavy_exclamation_mark": "❗", + "heavy_heart_exclamation_mark_ornament": "❣", + "o": "⭕", + "helm_symbol": "⎈", + "helmet_with_white_cross": "⛑", + "high_heel": "👠", + "bullettrain_side": "🚄", + "bullettrain_front": "🚅", + "high_brightness": "🔆", + "zap": "⚡", + "hocho": "🔪", + "knife": "🔪", + "bee": "🐝", + "traffic_light": "🚥", + "racehorse": "🐎", + "coffee": "☕", + "hotsprings": "♨", + "hourglass": "⌛", + "hourglass_flowing_sand": "⏳", + "house_buildings": "🏘", + "100": "💯", + "hushed": "😯", + "ice_hockey_stick_and_puck": "🏒", + "imp": "👿", + "information_desk_person": "💁", + "information_source": "ℹ", + "capital_abcd": "🔠", + "abc": "🔤", + "abcd": "🔡", + "1234": "🔢", + "symbols": "🔣", + "izakaya_lantern": "🏮", + "lantern": "🏮", + "jack_o_lantern": "🎃", + "dolls": "🎎", + "japanese_goblin": "👺", + "japanese_ogre": "👹", + "beginner": "🔰", + "zero": "0️⃣", + "one": "1️⃣", + "ten": "🔟", + "two": "2️⃣", + "three": "3️⃣", + "four": "4️⃣", + "five": "5️⃣", + "six": "6️⃣", + "seven": "7️⃣", + "eight": "8️⃣", + "nine": "9️⃣", + "couplekiss": "💏", + "kissing_cat": "😽", + "kissing": "😗", + "kissing_closed_eyes": "😚", + "kissing_smiling_eyes": "😙", + "beetle": "🐞", + "large_blue_circle": "🔵", + "last_quarter_moon_with_face": "🌜", + "leaves": "🍃", + "mag": "🔍", + "left_right_arrow": "↔", + "leftwards_arrow_with_hook": "↩", + "arrow_left": "⬅", + "lock": "🔒", + "lock_with_ink_pen": "🔏", + "sob": "😭", + "low_brightness": "🔅", + "lower_left_ballpoint_pen": "🖊", + "lower_left_crayon": "🖍", + "lower_left_fountain_pen": "🖋", + "lower_left_paintbrush": "🖌", + "mahjong": "🀄", + "couple": "👫", + "man_in_business_suit_levitating": "🕴", + "man_with_gua_pi_mao": "👲", + "man_with_turban": "👳", + "mans_shoe": "👞", + "shoe": "👞", + "menorah_with_nine_branches": "🕎", + "mens": "🚹", + "minidisc": "💽", + "iphone": "📱", + "calling": "📲", + "money__mouth_face": "🤑", + "moneybag": "💰", + "rice_scene": "🎑", + "mountain_bicyclist": "🚵", + "mouse2": "🐁", + "lips": "👄", + "moyai": "🗿", + "notes": "🎶", + "nail_care": "💅", + "ab": "🆎", + "negative_squared_cross_mark": "❎", + "a": "🅰", + "b": "🅱", + "o2": "🅾", + "parking": "🅿", + "new_moon_with_face": "🌚", + "no_entry_sign": "🚫", + "underage": "🔞", + "non__potable_water": "🚱", + "arrow_upper_right": "↗", + "arrow_upper_left": "↖", + "office": "🏢", + "older_man": "👴", + "older_woman": "👵", + "om_symbol": "🕉", + "on": "🔛", + "book": "📖", + "unlock": "🔓", + "mailbox_with_no_mail": "📭", + "mailbox_with_mail": "📬", + "cd": "💿", + "tada": "🎉", + "feet": "🐾", + "walking": "🚶", + "pencil2": "✏", + "pensive": "😔", + "persevere": "😣", + "bow": "🙇", + "raised_hands": "🙌", + "person_with_ball": "⛹", + "person_with_blond_hair": "👱", + "pray": "🙏", + "person_with_pouting_face": "🙎", + "computer": "💻", + "pig2": "🐖", + "hankey": "💩", + "poop": "💩", + "shit": "💩", + "bamboo": "🎍", + "gun": "🔫", + "black_joker": "🃏", + "rotating_light": "🚨", + "cop": "👮", + "stew": "🍲", + "pouch": "👝", + "pouting_cat": "😾", + "rage": "😡", + "put_litter_in_its_place": "🚮", + "rabbit2": "🐇", + "racing_motorcycle": "🏍", + "radioactive_sign": "☢", + "fist": "✊", + "hand": "✋", + "raised_hand_with_fingers_splayed": "🖐", + "raised_hand_with_part_between_middle_and_ring_fingers": "🖖", + "blue_car": "🚙", + "apple": "🍎", + "relieved": "😌", + "reversed_hand_with_middle_finger_extended": "🖕", + "mag_right": "🔎", + "arrow_right_hook": "↪", + "sweet_potato": "🍠", + "robot": "🤖", + "rolled__up_newspaper": "🗞", + "rowboat": "🚣", + "runner": "🏃", + "running": "🏃", + "running_shirt_with_sash": "🎽", + "boat": "⛵", + "scales": "⚖", + "school_satchel": "🎒", + "scorpius": "♏", + "see_no_evil": "🙈", + "sheep": "🐑", + "stars": "🌠", + "cake": "🍰", + "six_pointed_star": "🔯", + "ski": "🎿", + "sleeping_accommodation": "🛌", + "sleeping": "😴", + "sleepy": "😪", + "sleuth_or_spy": "🕵", + "heart_eyes_cat": "😻", + "smiley_cat": "😺", + "innocent": "😇", + "heart_eyes": "😍", + "smiling_imp": "😈", + "smiley": "😃", + "sweat_smile": "😅", + "smile": "😄", + "laughing": "😆", + "satisfied": "😆", + "blush": "😊", + "smirk": "😏", + "smoking": "🚬", + "snow_capped_mountain": "🏔", + "soccer": "⚽", + "icecream": "🍦", + "soon": "🔜", + "arrow_lower_right": "↘", + "arrow_lower_left": "↙", + "speak_no_evil": "🙊", + "speaker": "🔈", + "mute": "🔇", + "sound": "🔉", + "loud_sound": "🔊", + "speaking_head_in_silhouette": "🗣", + "spiral_calendar_pad": "🗓", + "spiral_note_pad": "🗒", + "shell": "🐚", + "sweat_drops": "💦", + "u5272": "🈹", + "u5408": "🈴", + "u55b6": "🈺", + "u6307": "🈯", + "u6708": "🈷", + "u6709": "🈶", + "u6e80": "🈵", + "u7121": "🈚", + "u7533": "🈸", + "u7981": "🈲", + "u7a7a": "🈳", + "cl": "🆑", + "cool": "🆒", + "free": "🆓", + "id": "🆔", + "koko": "🈁", + "sa": "🈂", + "new": "🆕", + "ng": "🆖", + "ok": "🆗", + "sos": "🆘", + "up": "🆙", + "vs": "🆚", + "steam_locomotive": "🚂", + "ramen": "🍜", + "partly_sunny": "⛅", + "city_sunrise": "🌇", + "surfer": "🏄", + "swimmer": "🏊", + "shirt": "👕", + "tshirt": "👕", + "table_tennis_paddle_and_ball": "🏓", + "tea": "🍵", + "tv": "📺", + "three_button_mouse": "🖱", + "+1": "👍", + "thumbsup": "👍", + "__1": "👎", + "-1": "👎", + "thumbsdown": "👎", + "thunder_cloud_and_rain": "⛈", + "tiger2": "🐅", + "tophat": "🎩", + "top": "🔝", + "tm": "™", + "train2": "🚆", + "triangular_flag_on_post": "🚩", + "trident": "🔱", + "twisted_rightwards_arrows": "🔀", + "unamused": "😒", + "small_red_triangle": "🔺", + "arrow_up_small": "🔼", + "arrow_up_down": "↕", + "upside__down_face": "🙃", + "arrow_up": "⬆", + "v": "✌", + "vhs": "📼", + "wc": "🚾", + "ocean": "🌊", + "waving_black_flag": "🏴", + "wave": "👋", + "waving_white_flag": "🏳", + "moon": "🌔", + "scream_cat": "🙀", + "weary": "😩", + "weight_lifter": "🏋", + "whale2": "🐋", + "wheelchair": "♿", + "point_down": "👇", + "grey_exclamation": "❕", + "white_frowning_face": "☹", + "white_check_mark": "✅", + "point_left": "👈", + "white_medium_small_square": "◽", + "star": "⭐", + "grey_question": "❔", + "point_right": "👉", + "relaxed": "☺", + "white_sun_behind_cloud": "🌥", + "white_sun_behind_cloud_with_rain": "🌦", + "white_sun_with_small_cloud": "🌤", + "point_up_2": "👆", + "point_up": "☝", + "wind_blowing_face": "🌬", + "wink": "😉", + "wolf": "🐺", + "dancers": "👯", + "boot": "👢", + "womans_clothes": "👚", + "womans_hat": "👒", + "sandal": "👡", + "womens": "🚺", + "worried": "😟", + "gift": "🎁", + "zipper__mouth_face": "🤐", + "regional_indicator_a": "🇦", + "regional_indicator_b": "🇧", + "regional_indicator_c": "🇨", + "regional_indicator_d": "🇩", + "regional_indicator_e": "🇪", + "regional_indicator_f": "🇫", + "regional_indicator_g": "🇬", + "regional_indicator_h": "🇭", + "regional_indicator_i": "🇮", + "regional_indicator_j": "🇯", + "regional_indicator_k": "🇰", + "regional_indicator_l": "🇱", + "regional_indicator_m": "🇲", + "regional_indicator_n": "🇳", + "regional_indicator_o": "🇴", + "regional_indicator_p": "🇵", + "regional_indicator_q": "🇶", + "regional_indicator_r": "🇷", + "regional_indicator_s": "🇸", + "regional_indicator_t": "🇹", + "regional_indicator_u": "🇺", + "regional_indicator_v": "🇻", + "regional_indicator_w": "🇼", + "regional_indicator_x": "🇽", + "regional_indicator_y": "🇾", + "regional_indicator_z": "🇿", +} diff --git a/rich/_emoji_replace.py b/rich/_emoji_replace.py new file mode 100644 index 0000000..ee8cde0 --- /dev/null +++ b/rich/_emoji_replace.py @@ -0,0 +1,17 @@ +from typing import Match + +import re + +from ._emoji_codes import EMOJI + + +def _emoji_replace(text: str, _emoji_sub=re.compile(r"(:(\S*?):)").sub) -> str: + """Replace emoji code in text.""" + get_emoji = EMOJI.get + + def do_replace(match: Match[str]) -> str: + """Called by re.sub to do the replacement.""" + emoji_code, emoji_name = match.groups() + return get_emoji(emoji_name.lower(), emoji_code) + + return _emoji_sub(do_replace, text) diff --git a/rich/_inspect.py b/rich/_inspect.py new file mode 100644 index 0000000..c1c9eec --- /dev/null +++ b/rich/_inspect.py @@ -0,0 +1,251 @@ +from __future__ import absolute_import + +from inspect import cleandoc, getdoc, getfile, isclass, ismodule, signature +from typing import Any, Iterable, Optional, Tuple + +from .console import RenderableType, RenderGroup +from .highlighter import ReprHighlighter +from .jupyter import JupyterMixin +from .panel import Panel +from .pretty import Pretty +from .table import Table +from .text import Text, TextType + + +def _first_paragraph(doc: str) -> str: + """Get the first paragraph from a docstring.""" + paragraph, _, _ = doc.partition("\n\n") + return paragraph + + +def _reformat_doc(doc: str) -> str: + """Reformat docstring.""" + doc = cleandoc(doc).strip() + return doc + + +class Inspect(JupyterMixin): + """A renderable to inspect any Python Object. + + Args: + obj (Any): An object to inspect. + title (str, optional): Title to display over inspect result, or None use type. Defaults to None. + help (bool, optional): Show full help text rather than just first paragraph. Defaults to False. + methods (bool, optional): Enable inspection of callables. Defaults to False. + docs (bool, optional): Also render doc strings. Defaults to True. + private (bool, optional): Show private attributes (beginning with underscore). Defaults to False. + dunder (bool, optional): Show attributes starting with double underscore. Defaults to False. + sort (bool, optional): Sort attributes alphabetically. Defaults to True. + all (bool, optional): Show all attributes. Defaults to False. + value (bool, optional): Pretty print value of object. Defaults to True. + """ + + def __init__( + self, + obj: Any, + *, + title: TextType = None, + help: bool = False, + methods: bool = False, + docs: bool = True, + private: bool = False, + dunder: bool = False, + sort: bool = True, + all: bool = True, + value: bool = True, + ) -> None: + self.highlighter = ReprHighlighter() + self.obj = obj + self.title = title or self._make_title(obj) + if all: + methods = private = dunder = True + self.help = help + self.methods = methods + self.docs = docs or help + self.private = private or dunder + self.dunder = dunder + self.sort = sort + self.value = value + + def _make_title(self, obj: Any) -> Text: + """Make a default title.""" + title_str = ( + str(obj) + if (isclass(obj) or callable(obj) or ismodule(obj)) + else str(type(obj)) + ) + title_text = self.highlighter(title_str) + return title_text + + def __rich__(self) -> Panel: + return Panel.fit( + RenderGroup(*self._render()), + title=self.title, + border_style="scope.border", + padding=(0, 1), + ) + + def _get_signature(self, name: str, obj: Any) -> Optional[Text]: + """Get a signature for a callable.""" + try: + _signature = str(signature(obj)) + ":" + except ValueError: + _signature = "(...)" + except TypeError: + return None + + source_filename: Optional[str] = None + try: + source_filename = getfile(obj) + except TypeError: + pass + + callable_name = Text(name, style="inspect.callable") + if source_filename: + callable_name.stylize(f"link file://{source_filename}") + signature_text = self.highlighter(_signature) + + qualname = name or getattr(obj, "__qualname__", name) + qual_signature = Text.assemble( + ("def ", "inspect.def"), (qualname, "inspect.callable"), signature_text + ) + + return qual_signature + + def _render(self) -> Iterable[RenderableType]: + """Render object.""" + + def sort_items(item: Tuple[str, Any]) -> Tuple[bool, str]: + key, (_error, value) = item + return (callable(value), key.strip("_").lower()) + + def safe_getattr(attr_name: str) -> Tuple[Any, Any]: + """Get attribute or any exception.""" + try: + return (None, getattr(obj, attr_name)) + except Exception as error: + return (error, None) + + obj = self.obj + keys = dir(obj) + total_items = len(keys) + if not self.dunder: + keys = [key for key in keys if not key.startswith("__")] + if not self.private: + keys = [key for key in keys if not key.startswith("_")] + not_shown_count = total_items - len(keys) + items = [(key, safe_getattr(key)) for key in keys] + if self.sort: + items.sort(key=sort_items) + + items_table = Table.grid(padding=(0, 1), expand=False) + items_table.add_column(justify="right") + add_row = items_table.add_row + highlighter = self.highlighter + + if callable(obj): + signature = self._get_signature("", obj) + if signature is not None: + yield signature + yield "" + + _doc = getdoc(obj) + if _doc is not None: + if not self.help: + _doc = _first_paragraph(_doc) + doc_text = Text(_reformat_doc(_doc), style="inspect.help") + doc_text = highlighter(doc_text) + yield doc_text + yield "" + + if self.value and not (isclass(obj) or callable(obj) or ismodule(obj)): + yield Panel( + Pretty(obj, indent_guides=True, max_length=10, max_string=60), + border_style="inspect.value.border", + ) + yield "" + + for key, (error, value) in items: + key_text = Text.assemble( + ( + key, + "inspect.attr.dunder" if key.startswith("__") else "inspect.attr", + ), + (" =", "inspect.equals"), + ) + if error is not None: + warning = key_text.copy() + warning.stylize("inspect.error") + add_row(warning, highlighter(repr(error))) + continue + + if callable(value): + if not self.methods: + continue + + _signature_text = self._get_signature(key, value) + if _signature_text is None: + add_row(key_text, Pretty(value, highlighter=highlighter)) + else: + if self.docs: + docs = getdoc(value) + if docs is not None: + _doc = _reformat_doc(str(docs)) + if not self.help: + _doc = _first_paragraph(_doc) + _signature_text.append("\n" if "\n" in _doc else " ") + doc = highlighter(_doc) + doc.stylize("inspect.doc") + _signature_text.append(doc) + + add_row(key_text, _signature_text) + else: + add_row(key_text, Pretty(value, highlighter=highlighter)) + if items_table.row_count: + yield items_table + else: + yield self.highlighter( + Text.from_markup( + f"[i][b]{not_shown_count}[/b] attribute(s) not shown.[/i] Run [b][red]inspect[/red]([not b]inspect[/])[/b] for options." + ) + ) + + +if __name__ == "__main__": # type: ignore + from rich import print + + inspect = Inspect({}, docs=True, methods=True, dunder=True) + print(inspect) + + t = Text("Hello, World") + print(Inspect(t)) + + from rich.style import Style + from rich.color import Color + + print(Inspect(Style.parse("bold red on black"), methods=True, docs=True)) + print(Inspect(Color.parse("#ffe326"), methods=True, docs=True)) + + from rich import get_console + + print(Inspect(get_console(), methods=False)) + + print(Inspect(open("foo.txt", "wt"), methods=False)) + + print(Inspect("Hello", methods=False, dunder=True)) + print(Inspect(inspect, methods=False, dunder=False, docs=False)) + + class Foo: + @property + def broken(self): + 1 / 0 + + f = Foo() + print(Inspect(f)) + + print(Inspect(object, dunder=True)) + + print(Inspect(None, dunder=False)) + + print(Inspect(str, help=True)) + print(Inspect(1, help=False)) diff --git a/rich/_log_render.py b/rich/_log_render.py new file mode 100644 index 0000000..2caad0b --- /dev/null +++ b/rich/_log_render.py @@ -0,0 +1,88 @@ +from datetime import datetime +from typing import Iterable, List, Optional, TYPE_CHECKING, Union, Callable + + +from .text import Text, TextType + +if TYPE_CHECKING: + from .console import Console, ConsoleRenderable, RenderableType + from .table import Table + +FormatTimeCallable = Callable[[datetime], Text] + + +class LogRender: + def __init__( + self, + show_time: bool = True, + show_level: bool = False, + show_path: bool = True, + time_format: Union[str, FormatTimeCallable] = "[%x %X]", + level_width: Optional[int] = 8, + ) -> None: + self.show_time = show_time + self.show_level = show_level + self.show_path = show_path + self.time_format = time_format + self.level_width = level_width + self._last_time: Optional[Text] = None + + def __call__( + self, + console: "Console", + renderables: Iterable["ConsoleRenderable"], + log_time: datetime = None, + time_format: Union[str, FormatTimeCallable] = None, + level: TextType = "", + path: str = None, + line_no: int = None, + link_path: str = None, + ) -> "Table": + from .containers import Renderables + from .table import Table + + output = Table.grid(padding=(0, 1)) + output.expand = True + if self.show_time: + output.add_column(style="log.time") + if self.show_level: + output.add_column(style="log.level", width=self.level_width) + output.add_column(ratio=1, style="log.message", overflow="fold") + if self.show_path and path: + output.add_column(style="log.path") + row: List["RenderableType"] = [] + if self.show_time: + log_time = log_time or console.get_datetime() + time_format = time_format or self.time_format + if callable(time_format): + log_time_display = time_format(log_time) + else: + log_time_display = Text(log_time.strftime(time_format)) + if log_time_display == self._last_time: + row.append(Text(" " * len(log_time_display))) + else: + row.append(log_time_display) + self._last_time = log_time_display + if self.show_level: + row.append(level) + + row.append(Renderables(renderables)) + if self.show_path and path: + path_text = Text() + path_text.append( + path, style=f"link file://{link_path}" if link_path else "" + ) + if line_no: + path_text.append(f":{line_no}") + row.append(path_text) + + output.add_row(*row) + return output + + +if __name__ == "__main__": # pragma: no cover + from rich.console import Console + + c = Console() + c.print("[on blue]Hello", justify="right") + c.log("[on blue]hello", justify="right") diff --git a/rich/_loop.py b/rich/_loop.py new file mode 100644 index 0000000..01c6caf --- /dev/null +++ b/rich/_loop.py @@ -0,0 +1,43 @@ +from typing import Iterable, Tuple, TypeVar + +T = TypeVar("T") + + +def loop_first(values: Iterable[T]) -> Iterable[Tuple[bool, T]]: + """Iterate and generate a tuple with a flag for first value.""" + iter_values = iter(values) + try: + value = next(iter_values) + except StopIteration: + return + yield True, value + for value in iter_values: + yield False, value + + +def loop_last(values: Iterable[T]) -> Iterable[Tuple[bool, T]]: + """Iterate and generate a tuple with a flag for last value.""" + iter_values = iter(values) + try: + previous_value = next(iter_values) + except StopIteration: + return + for value in iter_values: + yield False, previous_value + previous_value = value + yield True, previous_value + + +def loop_first_last(values: Iterable[T]) -> Iterable[Tuple[bool, bool, T]]: + """Iterate and generate a tuple with a flag for first and last value.""" + iter_values = iter(values) + try: + previous_value = next(iter_values) + except StopIteration: + return + first = True + for value in iter_values: + yield first, False, previous_value + first = False + previous_value = value + yield first, True, previous_value diff --git a/rich/_lru_cache.py b/rich/_lru_cache.py new file mode 100644 index 0000000..b77c337 --- /dev/null +++ b/rich/_lru_cache.py @@ -0,0 +1,34 @@ +from collections import OrderedDict +from typing import Dict, Generic, TypeVar + + +CacheKey = TypeVar("CacheKey") +CacheValue = TypeVar("CacheValue") + + +class LRUCache(Generic[CacheKey, CacheValue], OrderedDict): + """ + A dictionary-like container that stores a given maximum items. + + If an additional item is added when the LRUCache is full, the least + recently used key is discarded to make room for the new item. + + """ + + def __init__(self, cache_size: int) -> None: + self.cache_size = cache_size + super(LRUCache, self).__init__() + + def __setitem__(self, key: CacheKey, value: CacheValue) -> None: + """Store a new views, potentially discarding an old value.""" + if key not in self: + if len(self) >= self.cache_size: + self.popitem(last=False) + OrderedDict.__setitem__(self, key, value) + + def __getitem__(self: Dict[CacheKey, CacheValue], key: CacheKey) -> CacheValue: + """Gets the item, but also makes it most recent.""" + value: CacheValue = OrderedDict.__getitem__(self, key) + OrderedDict.__delitem__(self, key) + OrderedDict.__setitem__(self, key, value) + return value diff --git a/rich/_palettes.py b/rich/_palettes.py new file mode 100644 index 0000000..3c748d3 --- /dev/null +++ b/rich/_palettes.py @@ -0,0 +1,309 @@ +from .palette import Palette + + +# Taken from https://en.wikipedia.org/wiki/ANSI_escape_code (Windows 10 column) +WINDOWS_PALETTE = Palette( + [ + (12, 12, 12), + (197, 15, 31), + (19, 161, 14), + (193, 156, 0), + (0, 55, 218), + (136, 23, 152), + (58, 150, 221), + (204, 204, 204), + (118, 118, 118), + (231, 72, 86), + (22, 198, 12), + (249, 241, 165), + (59, 120, 255), + (180, 0, 158), + (97, 214, 214), + (242, 242, 242), + ] +) + +# # The standard ansi colors (including bright variants) +STANDARD_PALETTE = Palette( + [ + (0, 0, 0), + (170, 0, 0), + (0, 170, 0), + (170, 85, 0), + (0, 0, 170), + (170, 0, 170), + (0, 170, 170), + (170, 170, 170), + (85, 85, 85), + (255, 85, 85), + (85, 255, 85), + (255, 255, 85), + (85, 85, 255), + (255, 85, 255), + (85, 255, 255), + (255, 255, 255), + ] +) + + +# The 256 color palette +EIGHT_BIT_PALETTE = Palette( + [ + (0, 0, 0), + (128, 0, 0), + (0, 128, 0), + (128, 128, 0), + (0, 0, 128), + (128, 0, 128), + (0, 128, 128), + (192, 192, 192), + (128, 128, 128), + (255, 0, 0), + (0, 255, 0), + (255, 255, 0), + (0, 0, 255), + (255, 0, 255), + (0, 255, 255), + (255, 255, 255), + (0, 0, 0), + (0, 0, 95), + (0, 0, 135), + (0, 0, 175), + (0, 0, 215), + (0, 0, 255), + (0, 95, 0), + (0, 95, 95), + (0, 95, 135), + (0, 95, 175), + (0, 95, 215), + (0, 95, 255), + (0, 135, 0), + (0, 135, 95), + (0, 135, 135), + (0, 135, 175), + (0, 135, 215), + (0, 135, 255), + (0, 175, 0), + (0, 175, 95), + (0, 175, 135), + (0, 175, 175), + (0, 175, 215), + (0, 175, 255), + (0, 215, 0), + (0, 215, 95), + (0, 215, 135), + (0, 215, 175), + (0, 215, 215), + (0, 215, 255), + (0, 255, 0), + (0, 255, 95), + (0, 255, 135), + (0, 255, 175), + (0, 255, 215), + (0, 255, 255), + (95, 0, 0), + (95, 0, 95), + (95, 0, 135), + (95, 0, 175), + (95, 0, 215), + (95, 0, 255), + (95, 95, 0), + (95, 95, 95), + (95, 95, 135), + (95, 95, 175), + (95, 95, 215), + (95, 95, 255), + (95, 135, 0), + (95, 135, 95), + (95, 135, 135), + (95, 135, 175), + (95, 135, 215), + (95, 135, 255), + (95, 175, 0), + (95, 175, 95), + (95, 175, 135), + (95, 175, 175), + (95, 175, 215), + (95, 175, 255), + (95, 215, 0), + (95, 215, 95), + (95, 215, 135), + (95, 215, 175), + (95, 215, 215), + (95, 215, 255), + (95, 255, 0), + (95, 255, 95), + (95, 255, 135), + (95, 255, 175), + (95, 255, 215), + (95, 255, 255), + (135, 0, 0), + (135, 0, 95), + (135, 0, 135), + (135, 0, 175), + (135, 0, 215), + (135, 0, 255), + (135, 95, 0), + (135, 95, 95), + (135, 95, 135), + (135, 95, 175), + (135, 95, 215), + (135, 95, 255), + (135, 135, 0), + (135, 135, 95), + (135, 135, 135), + (135, 135, 175), + (135, 135, 215), + (135, 135, 255), + (135, 175, 0), + (135, 175, 95), + (135, 175, 135), + (135, 175, 175), + (135, 175, 215), + (135, 175, 255), + (135, 215, 0), + (135, 215, 95), + (135, 215, 135), + (135, 215, 175), + (135, 215, 215), + (135, 215, 255), + (135, 255, 0), + (135, 255, 95), + (135, 255, 135), + (135, 255, 175), + (135, 255, 215), + (135, 255, 255), + (175, 0, 0), + (175, 0, 95), + (175, 0, 135), + (175, 0, 175), + (175, 0, 215), + (175, 0, 255), + (175, 95, 0), + (175, 95, 95), + (175, 95, 135), + (175, 95, 175), + (175, 95, 215), + (175, 95, 255), + (175, 135, 0), + (175, 135, 95), + (175, 135, 135), + (175, 135, 175), + (175, 135, 215), + (175, 135, 255), + (175, 175, 0), + (175, 175, 95), + (175, 175, 135), + (175, 175, 175), + (175, 175, 215), + (175, 175, 255), + (175, 215, 0), + (175, 215, 95), + (175, 215, 135), + (175, 215, 175), + (175, 215, 215), + (175, 215, 255), + (175, 255, 0), + (175, 255, 95), + (175, 255, 135), + (175, 255, 175), + (175, 255, 215), + (175, 255, 255), + (215, 0, 0), + (215, 0, 95), + (215, 0, 135), + (215, 0, 175), + (215, 0, 215), + (215, 0, 255), + (215, 95, 0), + (215, 95, 95), + (215, 95, 135), + (215, 95, 175), + (215, 95, 215), + (215, 95, 255), + (215, 135, 0), + (215, 135, 95), + (215, 135, 135), + (215, 135, 175), + (215, 135, 215), + (215, 135, 255), + (215, 175, 0), + (215, 175, 95), + (215, 175, 135), + (215, 175, 175), + (215, 175, 215), + (215, 175, 255), + (215, 215, 0), + (215, 215, 95), + (215, 215, 135), + (215, 215, 175), + (215, 215, 215), + (215, 215, 255), + (215, 255, 0), + (215, 255, 95), + (215, 255, 135), + (215, 255, 175), + (215, 255, 215), + (215, 255, 255), + (255, 0, 0), + (255, 0, 95), + (255, 0, 135), + (255, 0, 175), + (255, 0, 215), + (255, 0, 255), + (255, 95, 0), + (255, 95, 95), + (255, 95, 135), + (255, 95, 175), + (255, 95, 215), + (255, 95, 255), + (255, 135, 0), + (255, 135, 95), + (255, 135, 135), + (255, 135, 175), + (255, 135, 215), + (255, 135, 255), + (255, 175, 0), + (255, 175, 95), + (255, 175, 135), + (255, 175, 175), + (255, 175, 215), + (255, 175, 255), + (255, 215, 0), + (255, 215, 95), + (255, 215, 135), + (255, 215, 175), + (255, 215, 215), + (255, 215, 255), + (255, 255, 0), + (255, 255, 95), + (255, 255, 135), + (255, 255, 175), + (255, 255, 215), + (255, 255, 255), + (8, 8, 8), + (18, 18, 18), + (28, 28, 28), + (38, 38, 38), + (48, 48, 48), + (58, 58, 58), + (68, 68, 68), + (78, 78, 78), + (88, 88, 88), + (98, 98, 98), + (108, 108, 108), + (118, 118, 118), + (128, 128, 128), + (138, 138, 138), + (148, 148, 148), + (158, 158, 158), + (168, 168, 168), + (178, 178, 178), + (188, 188, 188), + (198, 198, 198), + (208, 208, 208), + (218, 218, 218), + (228, 228, 228), + (238, 238, 238), + ] +) diff --git a/rich/_pick.py b/rich/_pick.py new file mode 100644 index 0000000..4f6d8b2 --- /dev/null +++ b/rich/_pick.py @@ -0,0 +1,17 @@ +from typing import Optional + + +def pick_bool(*values: Optional[bool]) -> bool: + """Pick the first non-none bool or return the last value. + + Args: + *values (bool): Any number of boolean or None values. + + Returns: + bool: First non-none boolean. + """ + assert values, "1 or more values required" + for value in values: + if value is not None: + return value + return bool(value) diff --git a/rich/_ratio.py b/rich/_ratio.py new file mode 100644 index 0000000..f293aba --- /dev/null +++ b/rich/_ratio.py @@ -0,0 +1,134 @@ +from math import ceil, modf +from typing import cast, List, Optional, Sequence +from typing_extensions import Protocol + + +class Edge(Protocol): + """Any object that defines an edge (such as Layout).""" + + size: Optional[int] = None + ratio: int = 1 + minimum_size: int = 1 + + +def ratio_resolve(total: int, edges: Sequence[Edge]) -> List[int]: + """Divide total space to satisfy size, ratio, and minimum_size, constraints. + + The returned list of integers should add up to total in most cases, unless it is + impossible to satisfy all the constraints. For instance, if there are two edges + with a minimum size of 20 each and `total` is 30 then the returned list will be + greater than total. In practice, this would mean that a Layout object would + clip the rows that would overflow the screen height. + + Args: + total (int): Total number of characters. + edges (List[Edge]): Edges within total space. + + Returns: + List[int]: Number of characters for each edge. + """ + # Size of edge or None for yet to be determined + sizes = [(edge.size or None) for edge in edges] + + # While any edges haven't been calculated + while None in sizes: + # Get flexible edges and index to map these back on to sizes list + flexible_edges = [ + (index, edge) + for index, (size, edge) in enumerate(zip(sizes, edges)) + if size is None + ] + # Remaining space in total + remaining = total - sum(size or 0 for size in sizes) + if remaining <= 0: + # No room for flexible edges + return [(size or 1) for size in sizes] + # Calculate number of characters in a ratio portion + portion = remaining / sum((edge.ratio or 1) for _, edge in flexible_edges) + + # If any edges will be less than their minimum, replace size with the minimum + for index, edge in flexible_edges: + if portion * edge.ratio <= edge.minimum_size: + sizes[index] = edge.minimum_size + # New fixed size will invalidate calculations, so we need to repeat the process + break + else: + # Distribute flexible space and compensate for rounding error + # Since edge sizes can only be integers we need to add the remainder + # to the following line + _modf = modf + remainder = 0.0 + for index, edge in flexible_edges: + remainder, size = _modf(portion * edge.ratio + remainder) + sizes[index] = int(size) + break + # Sizes now contains integers only + return cast(List[int], sizes) + + +def ratio_reduce( + total: int, ratios: List[int], maximums: List[int], values: List[int] +) -> List[int]: + """Divide an integer total in to parts based on ratios. + + Args: + total (int): The total to divide. + ratios (List[int]): A list of integer ratios. + maximums (List[int]): List of maximums values for each slot. + values (List[int]): List of values + + Returns: + List[int]: A list of integers guaranteed to sum to total. + """ + ratios = [ratio if _max else 0 for ratio, _max in zip(ratios, maximums)] + total_ratio = sum(ratios) + if not total_ratio: + return values[:] + total_remaining = total + result: List[int] = [] + append = result.append + for ratio, maximum, value in zip(ratios, maximums, values): + if ratio and total_ratio > 0: + distributed = min(maximum, round(ratio * total_remaining / total_ratio)) + append(value - distributed) + total_remaining -= distributed + total_ratio -= ratio + else: + append(value) + return result + + +def ratio_distribute( + total: int, ratios: List[int], minimums: List[int] = None +) -> List[int]: + """Distribute an integer total in to parts based on ratios. + + Args: + total (int): The total to divide. + ratios (List[int]): A list of integer ratios. + minimums (List[int]): List of minimum values for each slot. + + Returns: + List[int]: A list of integers guaranteed to sum to total. + """ + if minimums: + ratios = [ratio if _min else 0 for ratio, _min in zip(ratios, minimums)] + total_ratio = sum(ratios) + assert total_ratio > 0, "Sum of ratios must be > 0" + + total_remaining = total + distributed_total: List[int] = [] + append = distributed_total.append + if minimums is None: + _minimums = [0] * len(ratios) + else: + _minimums = minimums + for ratio, minimum in zip(ratios, _minimums): + if total_ratio > 0: + distributed = max(minimum, ceil(ratio * total_remaining / total_ratio)) + else: + distributed = total_remaining + append(distributed) + total_ratio -= ratio + total_remaining -= distributed + return distributed_total diff --git a/rich/_spinners.py b/rich/_spinners.py new file mode 100644 index 0000000..dc1db07 --- /dev/null +++ b/rich/_spinners.py @@ -0,0 +1,848 @@ +""" +Spinners are from: +* cli-spinners: + MIT License + Copyright (c) Sindre Sorhus <sindresorhus@gmail.com> (sindresorhus.com) + Permission is hereby granted, free of charge, to any person obtaining a copy + of this software and associated documentation files (the "Software"), to deal + in the Software without restriction, including without limitation the rights to + use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of + the Software, and to permit persons to whom the Software is furnished to do so, + subject to the following conditions: + The above copyright notice and this permission notice shall be included + in all copies or substantial portions of the Software. + THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, + INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR + PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE + FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, + ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS + IN THE SOFTWARE. +""" + +SPINNERS = { + "dots": { + "interval": 80, + "frames": ["⠋", "⠙", "⠹", "⠸", "⠼", "⠴", "⠦", "⠧", "⠇", "⠏"], + }, + "dots2": {"interval": 80, "frames": ["⣾", "⣽", "⣻", "⢿", "⡿", "⣟", "⣯", "⣷"]}, + "dots3": { + "interval": 80, + "frames": ["⠋", "⠙", "⠚", "⠞", "⠖", "⠦", "⠴", "⠲", "⠳", "⠓"], + }, + "dots4": { + "interval": 80, + "frames": [ + "⠄", + "⠆", + "⠇", + "⠋", + "⠙", + "⠸", + "⠰", + "⠠", + "⠰", + "⠸", + "⠙", + "⠋", + "⠇", + "⠆", + ], + }, + "dots5": { + "interval": 80, + "frames": [ + "⠋", + "⠙", + "⠚", + "⠒", + "⠂", + "⠂", + "⠒", + "⠲", + "⠴", + "⠦", + "⠖", + "⠒", + "⠐", + "⠐", + "⠒", + "⠓", + "⠋", + ], + }, + "dots6": { + "interval": 80, + "frames": [ + "⠁", + "⠉", + "⠙", + "⠚", + "⠒", + "⠂", + "⠂", + "⠒", + "⠲", + "⠴", + "⠤", + "⠄", + "⠄", + "⠤", + "⠴", + "⠲", + "⠒", + "⠂", + "⠂", + "⠒", + "⠚", + "⠙", + "⠉", + "⠁", + ], + }, + "dots7": { + "interval": 80, + "frames": [ + "⠈", + "⠉", + "⠋", + "⠓", + "⠒", + "⠐", + "⠐", + "⠒", + "⠖", + "⠦", + "⠤", + "⠠", + "⠠", + "⠤", + "⠦", + "⠖", + "⠒", + "⠐", + "⠐", + "⠒", + "⠓", + "⠋", + "⠉", + "⠈", + ], + }, + "dots8": { + "interval": 80, + "frames": [ + "⠁", + "⠁", + "⠉", + "⠙", + "⠚", + "⠒", + "⠂", + "⠂", + "⠒", + "⠲", + "⠴", + "⠤", + "⠄", + "⠄", + "⠤", + "⠠", + "⠠", + "⠤", + "⠦", + "⠖", + "⠒", + "⠐", + "⠐", + "⠒", + "⠓", + "⠋", + "⠉", + "⠈", + "⠈", + ], + }, + "dots9": {"interval": 80, "frames": ["⢹", "⢺", "⢼", "⣸", "⣇", "⡧", "⡗", "⡏"]}, + "dots10": {"interval": 80, "frames": ["⢄", "⢂", "⢁", "⡁", "⡈", "⡐", "⡠"]}, + "dots11": {"interval": 100, "frames": ["⠁", "⠂", "⠄", "⡀", "⢀", "⠠", "⠐", "⠈"]}, + "dots12": { + "interval": 80, + "frames": [ + "⢀⠀", + "⡀⠀", + "⠄⠀", + "⢂⠀", + "⡂⠀", + "⠅⠀", + "⢃⠀", + "⡃⠀", + "⠍⠀", + "⢋⠀", + "⡋⠀", + "⠍⠁", + "⢋⠁", + "⡋⠁", + "⠍⠉", + "⠋⠉", + "⠋⠉", + "⠉⠙", + "⠉⠙", + "⠉⠩", + "⠈⢙", + "⠈⡙", + "⢈⠩", + "⡀⢙", + "⠄⡙", + "⢂⠩", + "⡂⢘", + "⠅⡘", + "⢃⠨", + "⡃⢐", + "⠍⡐", + "⢋⠠", + "⡋⢀", + "⠍⡁", + "⢋⠁", + "⡋⠁", + "⠍⠉", + "⠋⠉", + "⠋⠉", + "⠉⠙", + "⠉⠙", + "⠉⠩", + "⠈⢙", + "⠈⡙", + "⠈⠩", + "⠀⢙", + "⠀⡙", + "⠀⠩", + "⠀⢘", + "⠀⡘", + "⠀⠨", + "⠀⢐", + "⠀⡐", + "⠀⠠", + "⠀⢀", + "⠀⡀", + ], + }, + "dots8Bit": { + "interval": 80, + "frames": [ + "⠀", + "⠁", + "⠂", + "⠃", + "⠄", + "⠅", + "⠆", + "⠇", + "⡀", + "⡁", + "⡂", + "⡃", + "⡄", + "⡅", + "⡆", + "⡇", + "⠈", + "⠉", + "⠊", + "⠋", + "⠌", + "⠍", + "⠎", + "⠏", + "⡈", + "⡉", + "⡊", + "⡋", + "⡌", + "⡍", + "⡎", + "⡏", + "⠐", + "⠑", + "⠒", + "⠓", + "⠔", + "⠕", + "⠖", + "⠗", + "⡐", + "⡑", + "⡒", + "⡓", + "⡔", + "⡕", + "⡖", + "⡗", + "⠘", + "⠙", + "⠚", + "⠛", + "⠜", + "⠝", + "⠞", + "⠟", + "⡘", + "⡙", + "⡚", + "⡛", + "⡜", + "⡝", + "⡞", + "⡟", + "⠠", + "⠡", + "⠢", + "⠣", + "⠤", + "⠥", + "⠦", + "⠧", + "⡠", + "⡡", + "⡢", + "⡣", + "⡤", + "⡥", + "⡦", + "⡧", + "⠨", + "⠩", + "⠪", + "⠫", + "⠬", + "⠭", + "⠮", + "⠯", + "⡨", + "⡩", + "⡪", + "⡫", + "⡬", + "⡭", + "⡮", + "⡯", + "⠰", + "⠱", + "⠲", + "⠳", + "⠴", + "⠵", + "⠶", + "⠷", + "⡰", + "⡱", + "⡲", + "⡳", + "⡴", + "⡵", + "⡶", + "⡷", + "⠸", + "⠹", + "⠺", + "⠻", + "⠼", + "⠽", + "⠾", + "⠿", + "⡸", + "⡹", + "⡺", + "⡻", + "⡼", + "⡽", + "⡾", + "⡿", + "⢀", + "⢁", + "⢂", + "⢃", + "⢄", + "⢅", + "⢆", + "⢇", + "⣀", + "⣁", + "⣂", + "⣃", + "⣄", + "⣅", + "⣆", + "⣇", + "⢈", + "⢉", + "⢊", + "⢋", + "⢌", + "⢍", + "⢎", + "⢏", + "⣈", + "⣉", + "⣊", + "⣋", + "⣌", + "⣍", + "⣎", + "⣏", + "⢐", + "⢑", + "⢒", + "⢓", + "⢔", + "⢕", + "⢖", + "⢗", + "⣐", + "⣑", + "⣒", + "⣓", + "⣔", + "⣕", + "⣖", + "⣗", + "⢘", + "⢙", + "⢚", + "⢛", + "⢜", + "⢝", + "⢞", + "⢟", + "⣘", + "⣙", + "⣚", + "⣛", + "⣜", + "⣝", + "⣞", + "⣟", + "⢠", + "⢡", + "⢢", + "⢣", + "⢤", + "⢥", + "⢦", + "⢧", + "⣠", + "⣡", + "⣢", + "⣣", + "⣤", + "⣥", + "⣦", + "⣧", + "⢨", + "⢩", + "⢪", + "⢫", + "⢬", + "⢭", + "⢮", + "⢯", + "⣨", + "⣩", + "⣪", + "⣫", + "⣬", + "⣭", + "⣮", + "⣯", + "⢰", + "⢱", + "⢲", + "⢳", + "⢴", + "⢵", + "⢶", + "⢷", + "⣰", + "⣱", + "⣲", + "⣳", + "⣴", + "⣵", + "⣶", + "⣷", + "⢸", + "⢹", + "⢺", + "⢻", + "⢼", + "⢽", + "⢾", + "⢿", + "⣸", + "⣹", + "⣺", + "⣻", + "⣼", + "⣽", + "⣾", + "⣿", + ], + }, + "line": {"interval": 130, "frames": ["-", "\\", "|", "/"]}, + "line2": {"interval": 100, "frames": ["⠂", "-", "–", "—", "–", "-"]}, + "pipe": {"interval": 100, "frames": ["┤", "┘", "┴", "└", "├", "┌", "┬", "┐"]}, + "simpleDots": {"interval": 400, "frames": [". ", ".. ", "...", " "]}, + "simpleDotsScrolling": { + "interval": 200, + "frames": [". ", ".. ", "...", " ..", " .", " "], + }, + "star": {"interval": 70, "frames": ["✶", "✸", "✹", "✺", "✹", "✷"]}, + "star2": {"interval": 80, "frames": ["+", "x", "*"]}, + "flip": { + "interval": 70, + "frames": ["_", "_", "_", "-", "`", "`", "'", "´", "-", "_", "_", "_"], + }, + "hamburger": {"interval": 100, "frames": ["☱", "☲", "☴"]}, + "growVertical": { + "interval": 120, + "frames": ["▁", "▃", "▄", "▅", "▆", "▇", "▆", "▅", "▄", "▃"], + }, + "growHorizontal": { + "interval": 120, + "frames": ["▏", "▎", "▍", "▌", "▋", "▊", "▉", "▊", "▋", "▌", "▍", "▎"], + }, + "balloon": {"interval": 140, "frames": [" ", ".", "o", "O", "@", "*", " "]}, + "balloon2": {"interval": 120, "frames": [".", "o", "O", "°", "O", "o", "."]}, + "noise": {"interval": 100, "frames": ["▓", "▒", "░"]}, + "bounce": {"interval": 120, "frames": ["⠁", "⠂", "⠄", "⠂"]}, + "boxBounce": {"interval": 120, "frames": ["▖", "▘", "▝", "▗"]}, + "boxBounce2": {"interval": 100, "frames": ["▌", "▀", "▐", "▄"]}, + "triangle": {"interval": 50, "frames": ["◢", "◣", "◤", "◥"]}, + "arc": {"interval": 100, "frames": ["◜", "◠", "◝", "◞", "◡", "◟"]}, + "circle": {"interval": 120, "frames": ["◡", "⊙", "◠"]}, + "squareCorners": {"interval": 180, "frames": ["◰", "◳", "◲", "◱"]}, + "circleQuarters": {"interval": 120, "frames": ["◴", "◷", "◶", "◵"]}, + "circleHalves": {"interval": 50, "frames": ["◐", "◓", "◑", "◒"]}, + "squish": {"interval": 100, "frames": ["╫", "╪"]}, + "toggle": {"interval": 250, "frames": ["⊶", "⊷"]}, + "toggle2": {"interval": 80, "frames": ["▫", "▪"]}, + "toggle3": {"interval": 120, "frames": ["□", "■"]}, + "toggle4": {"interval": 100, "frames": ["■", "□", "▪", "▫"]}, + "toggle5": {"interval": 100, "frames": ["▮", "▯"]}, + "toggle6": {"interval": 300, "frames": ["ဝ", "၀"]}, + "toggle7": {"interval": 80, "frames": ["⦾", "⦿"]}, + "toggle8": {"interval": 100, "frames": ["◍", "◌"]}, + "toggle9": {"interval": 100, "frames": ["◉", "◎"]}, + "toggle10": {"interval": 100, "frames": ["㊂", "㊀", "㊁"]}, + "toggle11": {"interval": 50, "frames": ["⧇", "⧆"]}, + "toggle12": {"interval": 120, "frames": ["☗", "☖"]}, + "toggle13": {"interval": 80, "frames": ["=", "*", "-"]}, + "arrow": {"interval": 100, "frames": ["←", "↖", "↑", "↗", "→", "↘", "↓", "↙"]}, + "arrow2": { + "interval": 80, + "frames": ["⬆️ ", "↗️ ", "➡️ ", "↘️ ", "⬇️ ", "↙️ ", "⬅️ ", "↖️ "], + }, + "arrow3": { + "interval": 120, + "frames": ["▹▹▹▹▹", "▸▹▹▹▹", "▹▸▹▹▹", "▹▹▸▹▹", "▹▹▹▸▹", "▹▹▹▹▸"], + }, + "bouncingBar": { + "interval": 80, + "frames": [ + "[ ]", + "[= ]", + "[== ]", + "[=== ]", + "[ ===]", + "[ ==]", + "[ =]", + "[ ]", + "[ =]", + "[ ==]", + "[ ===]", + "[====]", + "[=== ]", + "[== ]", + "[= ]", + ], + }, + "bouncingBall": { + "interval": 80, + "frames": [ + "( ● )", + "( ● )", + "( ● )", + "( ● )", + "( ●)", + "( ● )", + "( ● )", + "( ● )", + "( ● )", + "(● )", + ], + }, + "smiley": {"interval": 200, "frames": ["😄 ", "😝 "]}, + "monkey": {"interval": 300, "frames": ["🙈 ", "🙈 ", "🙉 ", "🙊 "]}, + "hearts": {"interval": 100, "frames": ["💛 ", "💙 ", "💜 ", "💚 ", "❤️ "]}, + "clock": { + "interval": 100, + "frames": [ + "🕛 ", + "🕐 ", + "🕑 ", + "🕒 ", + "🕓 ", + "🕔 ", + "🕕 ", + "🕖 ", + "🕗 ", + "🕘 ", + "🕙 ", + "🕚 ", + ], + }, + "earth": {"interval": 180, "frames": ["🌍 ", "🌎 ", "🌏 "]}, + "material": { + "interval": 17, + "frames": [ + "█▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁", + "██▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁", + "███▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁", + "████▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁", + "██████▁▁▁▁▁▁▁▁▁▁▁▁▁▁", + "██████▁▁▁▁▁▁▁▁▁▁▁▁▁▁", + "███████▁▁▁▁▁▁▁▁▁▁▁▁▁", + "████████▁▁▁▁▁▁▁▁▁▁▁▁", + "█████████▁▁▁▁▁▁▁▁▁▁▁", + "█████████▁▁▁▁▁▁▁▁▁▁▁", + "██████████▁▁▁▁▁▁▁▁▁▁", + "███████████▁▁▁▁▁▁▁▁▁", + "█████████████▁▁▁▁▁▁▁", + "██████████████▁▁▁▁▁▁", + "██████████████▁▁▁▁▁▁", + "▁██████████████▁▁▁▁▁", + "▁██████████████▁▁▁▁▁", + "▁██████████████▁▁▁▁▁", + "▁▁██████████████▁▁▁▁", + "▁▁▁██████████████▁▁▁", + "▁▁▁▁█████████████▁▁▁", + "▁▁▁▁██████████████▁▁", + "▁▁▁▁██████████████▁▁", + "▁▁▁▁▁██████████████▁", + "▁▁▁▁▁██████████████▁", + "▁▁▁▁▁██████████████▁", + "▁▁▁▁▁▁██████████████", + "▁▁▁▁▁▁██████████████", + "▁▁▁▁▁▁▁█████████████", + "▁▁▁▁▁▁▁█████████████", + "▁▁▁▁▁▁▁▁████████████", + "▁▁▁▁▁▁▁▁████████████", + "▁▁▁▁▁▁▁▁▁███████████", + "▁▁▁▁▁▁▁▁▁███████████", + "▁▁▁▁▁▁▁▁▁▁██████████", + "▁▁▁▁▁▁▁▁▁▁██████████", + "▁▁▁▁▁▁▁▁▁▁▁▁████████", + "▁▁▁▁▁▁▁▁▁▁▁▁▁███████", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁██████", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁█████", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁█████", + "█▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁████", + "██▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁███", + "██▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁███", + "███▁▁▁▁▁▁▁▁▁▁▁▁▁▁███", + "████▁▁▁▁▁▁▁▁▁▁▁▁▁▁██", + "█████▁▁▁▁▁▁▁▁▁▁▁▁▁▁█", + "█████▁▁▁▁▁▁▁▁▁▁▁▁▁▁█", + "██████▁▁▁▁▁▁▁▁▁▁▁▁▁█", + "████████▁▁▁▁▁▁▁▁▁▁▁▁", + "█████████▁▁▁▁▁▁▁▁▁▁▁", + "█████████▁▁▁▁▁▁▁▁▁▁▁", + "█████████▁▁▁▁▁▁▁▁▁▁▁", + "█████████▁▁▁▁▁▁▁▁▁▁▁", + "███████████▁▁▁▁▁▁▁▁▁", + "████████████▁▁▁▁▁▁▁▁", + "████████████▁▁▁▁▁▁▁▁", + "██████████████▁▁▁▁▁▁", + "██████████████▁▁▁▁▁▁", + "▁██████████████▁▁▁▁▁", + "▁██████████████▁▁▁▁▁", + "▁▁▁█████████████▁▁▁▁", + "▁▁▁▁▁████████████▁▁▁", + "▁▁▁▁▁████████████▁▁▁", + "▁▁▁▁▁▁███████████▁▁▁", + "▁▁▁▁▁▁▁▁█████████▁▁▁", + "▁▁▁▁▁▁▁▁█████████▁▁▁", + "▁▁▁▁▁▁▁▁▁█████████▁▁", + "▁▁▁▁▁▁▁▁▁█████████▁▁", + "▁▁▁▁▁▁▁▁▁▁█████████▁", + "▁▁▁▁▁▁▁▁▁▁▁████████▁", + "▁▁▁▁▁▁▁▁▁▁▁████████▁", + "▁▁▁▁▁▁▁▁▁▁▁▁███████▁", + "▁▁▁▁▁▁▁▁▁▁▁▁███████▁", + "▁▁▁▁▁▁▁▁▁▁▁▁▁███████", + "▁▁▁▁▁▁▁▁▁▁▁▁▁███████", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁█████", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁████", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁████", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁████", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁███", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁███", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁██", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁██", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁██", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁█", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁█", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁█", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁", + ], + }, + "moon": { + "interval": 80, + "frames": ["🌑 ", "🌒 ", "🌓 ", "🌔 ", "🌕 ", "🌖 ", "🌗 ", "🌘 "], + }, + "runner": {"interval": 140, "frames": ["🚶 ", "🏃 "]}, + "pong": { + "interval": 80, + "frames": [ + "▐⠂ ▌", + "▐⠈ ▌", + "▐ ⠂ ▌", + "▐ ⠠ ▌", + "▐ ⡀ ▌", + "▐ ⠠ ▌", + "▐ ⠂ ▌", + "▐ ⠈ ▌", + "▐ ⠂ ▌", + "▐ ⠠ ▌", + "▐ ⡀ ▌", + "▐ ⠠ ▌", + "▐ ⠂ ▌", + "▐ ⠈ ▌", + "▐ ⠂▌", + "▐ ⠠▌", + "▐ ⡀▌", + "▐ ⠠ ▌", + "▐ ⠂ ▌", + "▐ ⠈ ▌", + "▐ ⠂ ▌", + "▐ ⠠ ▌", + "▐ ⡀ ▌", + "▐ ⠠ ▌", + "▐ ⠂ ▌", + "▐ ⠈ ▌", + "▐ ⠂ ▌", + "▐ ⠠ ▌", + "▐ ⡀ ▌", + "▐⠠ ▌", + ], + }, + "shark": { + "interval": 120, + "frames": [ + "▐|\\____________▌", + "▐_|\\___________▌", + "▐__|\\__________▌", + "▐___|\\_________▌", + "▐____|\\________▌", + "▐_____|\\_______▌", + "▐______|\\______▌", + "▐_______|\\_____▌", + "▐________|\\____▌", + "▐_________|\\___▌", + "▐__________|\\__▌", + "▐___________|\\_▌", + "▐____________|\\▌", + "▐____________/|▌", + "▐___________/|_▌", + "▐__________/|__▌", + "▐_________/|___▌", + "▐________/|____▌", + "▐_______/|_____▌", + "▐______/|______▌", + "▐_____/|_______▌", + "▐____/|________▌", + "▐___/|_________▌", + "▐__/|__________▌", + "▐_/|___________▌", + "▐/|____________▌", + ], + }, + "dqpb": {"interval": 100, "frames": ["d", "q", "p", "b"]}, + "weather": { + "interval": 100, + "frames": [ + "☀️ ", + "☀️ ", + "☀️ ", + "🌤 ", + "⛅️ ", + "🌥 ", + "☁️ ", + "🌧 ", + "🌨 ", + "🌧 ", + "🌨 ", + "🌧 ", + "🌨 ", + "⛈ ", + "🌨 ", + "🌧 ", + "🌨 ", + "☁️ ", + "🌥 ", + "⛅️ ", + "🌤 ", + "☀️ ", + "☀️ ", + ], + }, + "christmas": {"interval": 400, "frames": ["🌲", "🎄"]}, + "grenade": { + "interval": 80, + "frames": [ + "، ", + "′ ", + " ´ ", + " ‾ ", + " ⸌", + " ⸊", + " |", + " ⁎", + " ⁕", + " ෴ ", + " ⁓", + " ", + " ", + " ", + ], + }, + "point": {"interval": 125, "frames": ["∙∙∙", "●∙∙", "∙●∙", "∙∙●", "∙∙∙"]}, + "layer": {"interval": 150, "frames": ["-", "=", "≡"]}, + "betaWave": { + "interval": 80, + "frames": [ + "ρββββββ", + "βρβββββ", + "ββρββββ", + "βββρβββ", + "ββββρββ", + "βββββρβ", + "ββββββρ", + ], + }, + "aesthetic": { + "interval": 80, + "frames": [ + "▰▱▱▱▱▱▱", + "▰▰▱▱▱▱▱", + "▰▰▰▱▱▱▱", + "▰▰▰▰▱▱▱", + "▰▰▰▰▰▱▱", + "▰▰▰▰▰▰▱", + "▰▰▰▰▰▰▰", + "▰▱▱▱▱▱▱", + ], + }, +} diff --git a/rich/_stack.py b/rich/_stack.py new file mode 100644 index 0000000..194564e --- /dev/null +++ b/rich/_stack.py @@ -0,0 +1,16 @@ +from typing import List, TypeVar + +T = TypeVar("T") + + +class Stack(List[T]): + """A small shim over builtin list.""" + + @property + def top(self) -> T: + """Get top of stack.""" + return self[-1] + + def push(self, item: T) -> None: + """Push an item on to the stack (append in stack nomenclature).""" + self.append(item) diff --git a/rich/_timer.py b/rich/_timer.py new file mode 100644 index 0000000..b30d374 --- /dev/null +++ b/rich/_timer.py @@ -0,0 +1,18 @@ +""" +Timer context manager, only used in debug. + +""" + +from time import time + +import contextlib + + +@contextlib.contextmanager +def timer(subject: str = "time"): + """print the elapsed time. (only used in debugging)""" + start = time() + yield + elapsed = time() - start + elapsed_ms = elapsed * 1000 + print(f"{subject} elapsed {elapsed_ms:.1f}ms") diff --git a/rich/_windows.py b/rich/_windows.py new file mode 100644 index 0000000..d252d1f --- /dev/null +++ b/rich/_windows.py @@ -0,0 +1,71 @@ +import sys + +from dataclasses import dataclass + + +@dataclass +class WindowsConsoleFeatures: + """Windows features available.""" + + vt: bool = False + """The console supports VT codes.""" + truecolor: bool = False + """The console supports truecolor.""" + + +try: + import ctypes + from ctypes import wintypes + from ctypes import LibraryLoader + + windll = LibraryLoader(ctypes.WinDLL) # type: ignore +except (AttributeError, ImportError, ValueError): + + # Fallback if we can't load the Windows DLL + def get_windows_console_features() -> WindowsConsoleFeatures: + features = WindowsConsoleFeatures() + return features + + +else: + + STDOUT = -11 + ENABLE_VIRTUAL_TERMINAL_PROCESSING = 4 + _GetConsoleMode = windll.kernel32.GetConsoleMode + _GetConsoleMode.argtypes = [wintypes.HANDLE, wintypes.LPDWORD] + _GetConsoleMode.restype = wintypes.BOOL + + _GetStdHandle = windll.kernel32.GetStdHandle + _GetStdHandle.argtypes = [ + wintypes.DWORD, + ] + _GetStdHandle.restype = wintypes.HANDLE + + def get_windows_console_features() -> WindowsConsoleFeatures: + """Get windows console features. + + Returns: + WindowsConsoleFeatures: An instance of WindowsConsoleFeatures. + """ + handle = _GetStdHandle(STDOUT) + console_mode = wintypes.DWORD() + result = _GetConsoleMode(handle, console_mode) + vt = bool(result and console_mode.value & ENABLE_VIRTUAL_TERMINAL_PROCESSING) + truecolor = False + if vt: + win_version = sys.getwindowsversion() # type: ignore + truecolor = win_version.major > 10 or ( + win_version.major == 10 and win_version.build >= 15063 + ) + features = WindowsConsoleFeatures(vt=vt, truecolor=truecolor) + return features + + +if __name__ == "__main__": + import platform + + features = get_windows_console_features() + from rich import print + + print(f'platform="{platform.system()}"') + print(repr(features)) diff --git a/rich/_wrap.py b/rich/_wrap.py new file mode 100644 index 0000000..b537757 --- /dev/null +++ b/rich/_wrap.py @@ -0,0 +1,55 @@ +import re +from typing import Iterable, List, Tuple + +from .cells import cell_len, chop_cells +from ._loop import loop_last + +re_word = re.compile(r"\s*\S+\s*") + + +def words(text: str) -> Iterable[Tuple[int, int, str]]: + position = 0 + word_match = re_word.match(text, position) + while word_match is not None: + start, end = word_match.span() + word = word_match.group(0) + yield start, end, word + word_match = re_word.match(text, end) + + +def divide_line(text: str, width: int, fold: bool = True) -> List[int]: + divides: List[int] = [] + append = divides.append + line_position = 0 + _cell_len = cell_len + for start, _end, word in words(text): + word_length = _cell_len(word.rstrip()) + if line_position + word_length > width: + if word_length > width: + if fold: + for last, line in loop_last( + chop_cells(word, width, position=line_position) + ): + if last: + line_position = _cell_len(line) + else: + start += len(line) + append(start) + else: + if start: + append(start) + line_position = _cell_len(word) + elif line_position and start: + append(start) + line_position = _cell_len(word) + else: + line_position += _cell_len(word) + return divides + + +if __name__ == "__main__": # pragma: no cover + from .console import Console + + console = Console(width=10) + console.print("12345 abcdefghijklmnopqrstuvwyxzABCDEFGHIJKLMNOPQRSTUVWXYZ 12345") + print(chop_cells("abcdefghijklmnopqrstuvwxyz", 10, position=2)) diff --git a/rich/abc.py b/rich/abc.py new file mode 100644 index 0000000..42db7c0 --- /dev/null +++ b/rich/abc.py @@ -0,0 +1,33 @@ +from abc import ABC + + +class RichRenderable(ABC): + """An abstract base class for Rich renderables. + + Note that there is no need to extend this class, the intended use is to check if an + object supports the Rich renderable protocol. For example:: + + if isinstance(my_object, RichRenderable): + console.print(my_object) + + """ + + @classmethod + def __subclasshook__(cls, other: type) -> bool: + """Check if this class supports the rich render protocol.""" + return hasattr(other, "__rich_console__") or hasattr(other, "__rich__") + + +if __name__ == "__main__": # pragma: no cover + from rich.text import Text + + t = Text() + print(isinstance(Text, RichRenderable)) + print(isinstance(t, RichRenderable)) + + class Foo: + pass + + f = Foo() + print(isinstance(f, RichRenderable)) + print(isinstance("", RichRenderable)) diff --git a/rich/align.py b/rich/align.py new file mode 100644 index 0000000..05657d7 --- /dev/null +++ b/rich/align.py @@ -0,0 +1,304 @@ +from itertools import chain +from typing import Iterable, TYPE_CHECKING + +from typing_extensions import Literal +from .constrain import Constrain +from .jupyter import JupyterMixin +from .measure import Measurement +from .segment import Segment +from .style import StyleType + + +if TYPE_CHECKING: + from .console import Console, ConsoleOptions, RenderResult, RenderableType + +AlignMethod = Literal["left", "center", "right"] +VerticalAlignMethod = Literal["top", "middle", "bottom"] +AlignValues = AlignMethod # TODO: deprecate AlignValues + + +class Align(JupyterMixin): + """Align a renderable by adding spaces if necessary. + + Args: + renderable (RenderableType): A console renderable. + align (AlignMethod): One of "left", "center", or "right"" + style (StyleType, optional): An optional style to apply to the background. + vertical (Optional[VerticalAlginMethod], optional): Optional vertical align, one of "top", "middle", or "bottom". Defaults to None. + pad (bool, optional): Pad the right with spaces. Defaults to True. + width (int, optional): Restrict contents to given width, or None to use default width. Defaults to None. + height (int, optional): Set height of align renderable, or None to fit to contents. Defaults to None. + + Raises: + ValueError: if ``align`` is not one of the expected values. + """ + + def __init__( + self, + renderable: "RenderableType", + align: AlignMethod = "left", + style: StyleType = None, + *, + vertical: VerticalAlignMethod = None, + pad: bool = True, + width: int = None, + height: int = None, + ) -> None: + if align not in ("left", "center", "right"): + raise ValueError( + f'invalid value for align, expected "left", "center", or "right" (not {align!r})' + ) + if vertical is not None and vertical not in ("top", "middle", "bottom"): + raise ValueError( + f'invalid value for vertical, expected "top", "middle", or "bottom" (not {vertical!r})' + ) + self.renderable = renderable + self.align = align + self.style = style + self.vertical = vertical + self.pad = pad + self.width = width + self.height = height + + def __repr__(self) -> str: + return f"Align({self.renderable!r}, {self.align!r})" + + @classmethod + def left( + cls, + renderable: "RenderableType", + style: StyleType = None, + *, + vertical: VerticalAlignMethod = None, + pad: bool = True, + width: int = None, + height: int = None, + ) -> "Align": + """Align a renderable to the left.""" + return cls( + renderable, + "left", + style=style, + vertical=vertical, + pad=pad, + width=width, + height=height, + ) + + @classmethod + def center( + cls, + renderable: "RenderableType", + style: StyleType = None, + *, + vertical: VerticalAlignMethod = None, + pad: bool = True, + width: int = None, + height: int = None, + ) -> "Align": + """Align a renderable to the center.""" + return cls( + renderable, + "center", + style=style, + vertical=vertical, + pad=pad, + width=width, + height=height, + ) + + @classmethod + def right( + cls, + renderable: "RenderableType", + style: StyleType = None, + *, + vertical: VerticalAlignMethod = None, + pad: bool = True, + width: int = None, + height: int = None, + ) -> "Align": + """Align a renderable to the right.""" + return cls( + renderable, + "right", + style=style, + vertical=vertical, + pad=pad, + width=width, + height=height, + ) + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + align = self.align + width = Measurement.get(console, self.renderable).maximum + rendered = console.render( + Constrain( + self.renderable, width if self.width is None else min(width, self.width) + ), + options, + ) + lines = list(Segment.split_lines(rendered)) + width, height = Segment.get_shape(lines) + lines = Segment.set_shape(lines, width, height) + new_line = Segment.line() + excess_space = options.max_width - width + style = console.get_style(self.style) if self.style is not None else None + + def generate_segments() -> Iterable[Segment]: + if excess_space <= 0: + # Exact fit + for line in lines: + yield from line + yield new_line + + elif align == "left": + # Pad on the right + pad = Segment(" " * excess_space, style) if self.pad else None + for line in lines: + yield from line + if pad: + yield pad + yield new_line + + elif align == "center": + # Pad left and right + left = excess_space // 2 + pad = Segment(" " * left, style) + pad_right = ( + Segment(" " * (excess_space - left), style) if self.pad else None + ) + for line in lines: + if left: + yield pad + yield from line + if pad_right: + yield pad_right + yield new_line + + elif align == "right": + # Padding on left + pad = Segment(" " * excess_space, style) + for line in lines: + yield pad + yield from line + yield new_line + + blank_line = ( + Segment(f"{' ' * (self.width or options.max_width)}\n", style) + if self.pad + else Segment("\n") + ) + + def blank_lines(count) -> Iterable[Segment]: + if count > 0: + for _ in range(count): + yield blank_line + + vertical_height = self.height or options.height + iter_segments: Iterable[Segment] + if self.vertical and vertical_height is not None: + if self.vertical == "top": + bottom_space = vertical_height - height + iter_segments = chain(generate_segments(), blank_lines(bottom_space)) + elif self.vertical == "middle": + top_space = (vertical_height - height) // 2 + bottom_space = vertical_height - top_space - height + iter_segments = chain( + blank_lines(top_space), + generate_segments(), + blank_lines(bottom_space), + ) + else: # self.vertical == "bottom": + top_space = vertical_height - height + iter_segments = chain(blank_lines(top_space), generate_segments()) + else: + iter_segments = generate_segments() + if self.style is not None: + style = console.get_style(self.style) + iter_segments = Segment.apply_style(iter_segments, style) + yield from iter_segments + + def __rich_measure__(self, console: "Console", max_width: int) -> Measurement: + measurement = Measurement.get(console, self.renderable, max_width) + return measurement + + +class VerticalCenter(JupyterMixin): + """Vertically aligns a renderable. + + Warn: + This class is deprecated and may be removed in a future version. Use Align class with + `vertical="middle"`. + + Args: + renderable (RenderableType): A renderable object. + """ + + def __init__( + self, + renderable: "RenderableType", + style: StyleType = None, + ) -> None: + self.renderable = renderable + self.style = style + + def __repr__(self) -> str: + return f"VerticalCenter({self.renderable!r})" + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + style = console.get_style(self.style) if self.style is not None else None + lines = console.render_lines( + self.renderable, options.update(height=None), pad=False + ) + width, _height = Segment.get_shape(lines) + new_line = Segment.line() + height = options.height or options.size.height + top_space = (height - len(lines)) // 2 + bottom_space = height - top_space - len(lines) + blank_line = Segment(f"{' ' * width}", style) + + def blank_lines(count) -> Iterable[Segment]: + for _ in range(count): + yield blank_line + yield new_line + + if top_space > 0: + yield from blank_lines(top_space) + for line in lines: + yield from line + yield new_line + if bottom_space > 0: + yield from blank_lines(bottom_space) + + def __rich_measure__(self, console: "Console", max_width: int) -> Measurement: + measurement = Measurement.get(console, self.renderable, max_width) + return measurement + + +if __name__ == "__main__": # pragma: no cover + from rich.console import Console, RenderGroup + from rich.highlighter import ReprHighlighter + from rich.panel import Panel + + highlighter = ReprHighlighter() + console = Console() + + panel = Panel( + RenderGroup( + Align.left(highlighter("align='left'")), + Align.center(highlighter("align='center'")), + Align.right(highlighter("align='right'")), + ), + width=60, + style="on dark_blue", + title="Algin", + ) + + console.print( + Align.center(panel, vertical="middle", style="on red", height=console.height) + ) diff --git a/rich/ansi.py b/rich/ansi.py new file mode 100644 index 0000000..85410de --- /dev/null +++ b/rich/ansi.py @@ -0,0 +1,228 @@ +from contextlib import suppress +import re +from typing import Iterable, NamedTuple + +from .color import Color +from .style import Style +from .text import Text + +re_ansi = re.compile(r"(?:\x1b\[(.*?)m)|(?:\x1b\](.*?)\x1b\\)") +re_csi = re.compile(r"\x1B(?:[@-Z\\-_]|\[[0-?]*[ -/]*[@-~])") + + +class _AnsiToken(NamedTuple): + """Result of ansi tokenized string.""" + + plain: str = "" + sgr: str = "" + osc: str = "" + + +def _ansi_tokenize(ansi_text: str) -> Iterable[_AnsiToken]: + """Tokenize a string in to plain text and ANSI codes. + + Args: + ansi_text (str): A String containing ANSI codes. + + Yields: + AnsiToken: A named tuple of (plain, sgr, osc) + """ + + def remove_csi(ansi_text: str) -> str: + """Remove unknown CSI sequences.""" + return re_csi.sub("", ansi_text) + + position = 0 + for match in re_ansi.finditer(ansi_text): + start, end = match.span(0) + sgr, osc = match.groups() + if start > position: + yield _AnsiToken(remove_csi(ansi_text[position:start])) + yield _AnsiToken("", sgr, osc) + position = end + if position < len(ansi_text): + yield _AnsiToken(remove_csi(ansi_text[position:])) + + +SGR_STYLE_MAP = { + 1: "bold", + 2: "dim", + 3: "italic", + 4: "underline", + 5: "blink", + 6: "blink2", + 7: "reverse", + 8: "conceal", + 9: "strike", + 21: "underline2", + 22: "not dim not bold", + 23: "not italic", + 24: "not underline", + 25: "not blink", + 26: "not blink2", + 27: "not reverse", + 28: "not conceal", + 29: "not strike", + 30: "color(0)", + 31: "color(1)", + 32: "color(2)", + 33: "color(3)", + 34: "color(4)", + 35: "color(5)", + 36: "color(6)", + 37: "color(7)", + 39: "default", + 40: "on color(0)", + 41: "on color(1)", + 42: "on color(2)", + 43: "on color(3)", + 44: "on color(4)", + 45: "on color(5)", + 46: "on color(6)", + 47: "on color(7)", + 49: "on default", + 51: "frame", + 52: "encircle", + 53: "overline", + 54: "not frame not encircle", + 55: "not overline", + 90: "color(8)", + 91: "color(9)", + 92: "color(10)", + 93: "color(11)", + 94: "color(12)", + 95: "color(13)", + 96: "color(14)", + 97: "color(15)", + 100: "on color(8)", + 101: "on color(9)", + 102: "on color(10)", + 103: "on color(11)", + 104: "on color(12)", + 105: "on color(13)", + 106: "on color(14)", + 107: "on color(15)", +} + + +class AnsiDecoder: + """Translate ANSI code in to styled Text.""" + + def __init__(self) -> None: + self.style = Style.null() + + def decode(self, terminal_text: str) -> Iterable[Text]: + """Decode ANSI codes in an interable of lines. + + Args: + lines (Iterable[str]): An iterable of lines of terminal output. + + Yields: + Text: Marked up Text. + """ + for line in terminal_text.splitlines(): + yield self.decode_line(line) + + def decode_line(self, line: str) -> Text: + """Decode a line containing ansi codes. + + Args: + line (str): A line of terminal output. + + Returns: + Text: A Text instance marked up according to ansi codes. + """ + from_ansi = Color.from_ansi + from_rgb = Color.from_rgb + _Style = Style + text = Text() + append = text.append + line = line.rsplit("\r", 1)[-1] + for token in _ansi_tokenize(line): + plain_text, sgr, osc = token + if plain_text: + append(plain_text, self.style or None) + elif osc: + if osc.startswith("8;"): + _params, semicolon, link = osc[2:].partition(";") + if semicolon: + self.style = self.style.update_link(link or None) + elif sgr: + # Translate in to semi-colon separated codes + # Ignore invalid codes, because we want to be lenient + codes = [ + min(255, int(_code)) for _code in sgr.split(";") if _code.isdigit() + ] + iter_codes = iter(codes) + for code in iter_codes: + if code == 0: + # reset + self.style = _Style.null() + elif code in SGR_STYLE_MAP: + # styles + self.style += _Style.parse(SGR_STYLE_MAP[code]) + elif code == 38: + # Foreground + with suppress(StopIteration): + color_type = next(iter_codes) + if color_type == 5: + self.style += _Style.from_color( + from_ansi(next(iter_codes)) + ) + elif color_type == 2: + self.style += _Style.from_color( + from_rgb( + next(iter_codes), + next(iter_codes), + next(iter_codes), + ) + ) + elif code == 48: + # Background + with suppress(StopIteration): + color_type = next(iter_codes) + if color_type == 5: + self.style += _Style.from_color( + None, from_ansi(next(iter_codes)) + ) + elif color_type == 2: + self.style += _Style.from_color( + None, + from_rgb( + next(iter_codes), + next(iter_codes), + next(iter_codes), + ), + ) + + return text + + +if __name__ == "__main__": # pragma: no cover + import pty + import io + import os + import sys + + decoder = AnsiDecoder() + + stdout = io.BytesIO() + + def read(fd): + data = os.read(fd, 1024) + stdout.write(data) + return data + + pty.spawn(sys.argv[1:], read) + + from .console import Console + + console = Console(record=True) + + stdout_result = stdout.getvalue().decode("utf-8") + print(stdout_result) + + for line in decoder.decode(stdout_result): + console.print(line) + + console.save_html("stdout.html") diff --git a/rich/bar.py b/rich/bar.py new file mode 100644 index 0000000..5764b85 --- /dev/null +++ b/rich/bar.py @@ -0,0 +1,89 @@ +from typing import Union + +from .color import Color +from .console import Console, ConsoleOptions, RenderResult +from .jupyter import JupyterMixin +from .measure import Measurement +from .segment import Segment +from .style import Style + +# There are left-aligned characters for 1/8 to 7/8, but +# the right-aligned characters exist only for 1/8 and 4/8. +BEGIN_BLOCK_ELEMENTS = ["█", "█", "█", "▐", "▐", "▐", "▕", "▕"] +END_BLOCK_ELEMENTS = [" ", "▏", "▎", "▍", "▌", "▋", "▊", "▉"] +FULL_BLOCK = "█" + + +class Bar(JupyterMixin): + """Renders a solid block bar. + + Args: + size (float): Value for the end of the bar. + begin (float): Begin point (between 0 and size, inclusive). + end (float): End point (between 0 and size, inclusive). + width (int, optional): Width of the bar, or ``None`` for maximum width. Defaults to None. + color (Union[Color, str], optional): Color of the bar. Defaults to "default". + bgcolor (Union[Color, str], optional): Color of bar background. Defaults to "default". + """ + + def __init__( + self, + size: float, + begin: float, + end: float, + *, + width: int = None, + color: Union[Color, str] = "default", + bgcolor: Union[Color, str] = "default", + ): + self.size = size + self.begin = max(begin, 0) + self.end = min(end, size) + self.width = width + self.style = Style(color=color, bgcolor=bgcolor) + + def __repr__(self) -> str: + return f"Bar({self.size}, {self.begin}, {self.end})" + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + + width = min(self.width or options.max_width, options.max_width) + + if self.begin >= self.end: + yield Segment(" " * width, self.style) + yield Segment.line() + return + + prefix_complete_eights = int(width * 8 * self.begin / self.size) + prefix_bar_count = prefix_complete_eights // 8 + prefix_eights_count = prefix_complete_eights % 8 + + body_complete_eights = int(width * 8 * self.end / self.size) + body_bar_count = body_complete_eights // 8 + body_eights_count = body_complete_eights % 8 + + # When start and end fall into the same cell, we ideally should render + # a symbol that's "center-aligned", but there is no good symbol in Unicode. + # In this case, we fall back to right-aligned block symbol for simplicity. + + prefix = " " * prefix_bar_count + if prefix_eights_count: + prefix += BEGIN_BLOCK_ELEMENTS[prefix_eights_count] + + body = FULL_BLOCK * body_bar_count + if body_eights_count: + body += END_BLOCK_ELEMENTS[body_eights_count] + + suffix = " " * (width - len(body)) + + yield Segment(prefix + body[len(prefix) :] + suffix, self.style) + yield Segment.line() + + def __rich_measure__(self, console: Console, max_width: int) -> Measurement: + return ( + Measurement(self.width, self.width) + if self.width is not None + else Measurement(4, max_width) + ) diff --git a/rich/box.py b/rich/box.py new file mode 100644 index 0000000..b70b5c2 --- /dev/null +++ b/rich/box.py @@ -0,0 +1,478 @@ +from typing import TYPE_CHECKING, Iterable, List + +from typing_extensions import Literal + +from ._loop import loop_last + +if TYPE_CHECKING: + from rich.console import ConsoleOptions + + +class Box: + """Defines characters to render boxes. + + ┌─┬┐ top + │ ││ head + ├─┼┤ head_row + │ ││ mid + ├─┼┤ row + ├─┼┤ foot_row + │ ││ foot + └─┴┘ bottom + + Args: + box (str): Characters making up box. + ascii (bool, optional): True if this box uses ascii characters only. Default is False. + """ + + def __init__(self, box: str, *, ascii: bool = False) -> None: + self._box = box + self.ascii = ascii + line1, line2, line3, line4, line5, line6, line7, line8 = box.splitlines() + # top + self.top_left, self.top, self.top_divider, self.top_right = iter(line1) + # head + self.head_left, _, self.head_vertical, self.head_right = iter(line2) + # head_row + ( + self.head_row_left, + self.head_row_horizontal, + self.head_row_cross, + self.head_row_right, + ) = iter(line3) + + # mid + self.mid_left, _, self.mid_vertical, self.mid_right = iter(line4) + # row + self.row_left, self.row_horizontal, self.row_cross, self.row_right = iter(line5) + # foot_row + ( + self.foot_row_left, + self.foot_row_horizontal, + self.foot_row_cross, + self.foot_row_right, + ) = iter(line6) + # foot + self.foot_left, _, self.foot_vertical, self.foot_right = iter(line7) + # bottom + self.bottom_left, self.bottom, self.bottom_divider, self.bottom_right = iter( + line8 + ) + + def __repr__(self) -> str: + return "Box(...)" + + def __str__(self) -> str: + return self._box + + def substitute(self, options: "ConsoleOptions", safe: bool = True) -> "Box": + """Substitute this box for another if it won't render due to platform issues. + + Args: + options (ConsoleOptions): Console options used in rendering. + safe (bool, optional): Substitute this for another Box if there are known problems + displaying on the platform (currently only relevant on Windows). Default is True. + + Returns: + Box: A different Box or the same Box. + """ + box = self + if options.legacy_windows and safe: + box = LEGACY_WINDOWS_SUBSTITUTIONS.get(box, box) + if options.ascii_only and not box.ascii: + box = ASCII + return box + + def get_top(self, widths: Iterable[int]) -> str: + """Get the top of a simple box. + + Args: + widths (List[int]): Widths of columns. + + Returns: + str: A string of box characters. + """ + + parts: List[str] = [] + append = parts.append + append(self.top_left) + for last, width in loop_last(widths): + append(self.top * width) + if not last: + append(self.top_divider) + append(self.top_right) + return "".join(parts) + + def get_row( + self, + widths: Iterable[int], + level: Literal["head", "row", "foot", "mid"] = "row", + edge: bool = True, + ) -> str: + """Get the top of a simple box. + + Args: + width (List[int]): Widths of columns. + + Returns: + str: A string of box characters. + """ + if level == "head": + left = self.head_row_left + horizontal = self.head_row_horizontal + cross = self.head_row_cross + right = self.head_row_right + elif level == "row": + left = self.row_left + horizontal = self.row_horizontal + cross = self.row_cross + right = self.row_right + elif level == "mid": + left = self.mid_left + horizontal = " " + cross = self.mid_vertical + right = self.mid_right + elif level == "foot": + left = self.foot_row_left + horizontal = self.foot_row_horizontal + cross = self.foot_row_cross + right = self.foot_row_right + else: + raise ValueError("level must be 'head', 'row' or 'foot'") + + parts: List[str] = [] + append = parts.append + if edge: + append(left) + for last, width in loop_last(widths): + append(horizontal * width) + if not last: + append(cross) + if edge: + append(right) + return "".join(parts) + + def get_bottom(self, widths: Iterable[int]) -> str: + """Get the bottom of a simple box. + + Args: + widths (List[int]): Widths of columns. + + Returns: + str: A string of box characters. + """ + + parts: List[str] = [] + append = parts.append + append(self.bottom_left) + for last, width in loop_last(widths): + append(self.bottom * width) + if not last: + append(self.bottom_divider) + append(self.bottom_right) + return "".join(parts) + + +ASCII: Box = Box( + """\ ++--+ +| || +|-+| +| || +|-+| +|-+| +| || ++--+ +""", + ascii=True, +) + +ASCII2: Box = Box( + """\ ++-++ +| || ++-++ +| || ++-++ ++-++ +| || ++-++ +""", + ascii=True, +) + +ASCII_DOUBLE_HEAD: Box = Box( + """\ ++-++ +| || ++=++ +| || ++-++ ++-++ +| || ++-++ +""", + ascii=True, +) + +SQUARE: Box = Box( + """\ +┌─┬┐ +│ ││ +├─┼┤ +│ ││ +├─┼┤ +├─┼┤ +│ ││ +└─┴┘ +""" +) + +SQUARE_DOUBLE_HEAD: Box = Box( + """\ +┌─┬┐ +│ ││ +╞═╪╡ +│ ││ +├─┼┤ +├─┼┤ +│ ││ +└─┴┘ +""" +) + +MINIMAL: Box = Box( + """\ + ╷ + │ +╶─┼╴ + │ +╶─┼╴ +╶─┼╴ + │ + ╵ +""" +) + + +MINIMAL_HEAVY_HEAD: Box = Box( + """\ + ╷ + │ +╺━┿╸ + │ +╶─┼╴ +╶─┼╴ + │ + ╵ +""" +) + +MINIMAL_DOUBLE_HEAD: Box = Box( + """\ + ╷ + │ + ═╪ + │ + ─┼ + ─┼ + │ + ╵ +""" +) + + +SIMPLE: Box = Box( + """\ + + + ── + + + ── + + +""" +) + +SIMPLE_HEAD: Box = Box( + """\ + + + ── + + + + + +""" +) + + +SIMPLE_HEAVY: Box = Box( + """\ + + + ━━ + + + ━━ + + +""" +) + + +HORIZONTALS: Box = Box( + """\ + ── + + ── + + ── + ── + + ── +""" +) + +ROUNDED: Box = Box( + """\ +╭─┬╮ +│ ││ +├─┼┤ +│ ││ +├─┼┤ +├─┼┤ +│ ││ +╰─┴╯ +""" +) + +HEAVY: Box = Box( + """\ +┏━┳┓ +┃ ┃┃ +┣━╋┫ +┃ ┃┃ +┣━╋┫ +┣━╋┫ +┃ ┃┃ +┗━┻┛ +""" +) + +HEAVY_EDGE: Box = Box( + """\ +┏━┯┓ +┃ │┃ +┠─┼┨ +┃ │┃ +┠─┼┨ +┠─┼┨ +┃ │┃ +┗━┷┛ +""" +) + +HEAVY_HEAD: Box = Box( + """\ +┏━┳┓ +┃ ┃┃ +┡━╇┩ +│ ││ +├─┼┤ +├─┼┤ +│ ││ +└─┴┘ +""" +) + +DOUBLE: Box = Box( + """\ +╔═╦╗ +║ ║║ +╠═╬╣ +║ ║║ +╠═╬╣ +╠═╬╣ +║ ║║ +╚═╩╝ +""" +) + +DOUBLE_EDGE: Box = Box( + """\ +╔═╤╗ +║ │║ +╟─┼╢ +║ │║ +╟─┼╢ +╟─┼╢ +║ │║ +╚═╧╝ +""" +) + +# Map Boxes that don't render with raster fonts on to equivalent that do +LEGACY_WINDOWS_SUBSTITUTIONS = { + ROUNDED: SQUARE, + MINIMAL_HEAVY_HEAD: MINIMAL, + SIMPLE_HEAVY: SIMPLE, + HEAVY: SQUARE, + HEAVY_EDGE: SQUARE, + HEAVY_HEAD: SQUARE, +} + + +if __name__ == "__main__": # pragma: no cover + + from rich.columns import Columns + from rich.panel import Panel + + from . import box + from .console import Console + from .table import Table + from .text import Text + + console = Console(record=True) + + BOXES = [ + "ASCII", + "ASCII2", + "ASCII_DOUBLE_HEAD", + "SQUARE", + "SQUARE_DOUBLE_HEAD", + "MINIMAL", + "MINIMAL_HEAVY_HEAD", + "MINIMAL_DOUBLE_HEAD", + "SIMPLE", + "SIMPLE_HEAD", + "SIMPLE_HEAVY", + "HORIZONTALS", + "ROUNDED", + "HEAVY", + "HEAVY_EDGE", + "HEAVY_HEAD", + "DOUBLE", + "DOUBLE_EDGE", + ] + + console.print(Panel("[bold green]Box Constants", style="green"), justify="center") + console.print() + + columns = Columns(expand=True, padding=2) + for box_name in sorted(BOXES): + table = Table( + show_footer=True, style="dim", border_style="not dim", expand=True + ) + table.add_column("Header 1", "Footer 1") + table.add_column("Header 2", "Footer 2") + table.add_row("Cell", "Cell") + table.add_row("Cell", "Cell") + table.box = getattr(box, box_name) + table.title = Text(f"box.{box_name}", style="magenta") + columns.add_renderable(table) + console.print(columns) + + # console.save_html("box.html", inline_styles=True) diff --git a/rich/cells.py b/rich/cells.py new file mode 100644 index 0000000..1a0ebcc --- /dev/null +++ b/rich/cells.py @@ -0,0 +1,124 @@ +from functools import lru_cache +from typing import Dict, List + +from ._cell_widths import CELL_WIDTHS +from ._lru_cache import LRUCache + + +def cell_len(text: str, _cache: Dict[str, int] = LRUCache(1024 * 4)) -> int: + """Get the number of cells required to display text. + + Args: + text (str): Text to display. + + Returns: + int: Number of cells required to display the text. + """ + cached_result = _cache.get(text, None) + if cached_result is not None: + return cached_result + + _get_size = get_character_cell_size + total_size = sum(_get_size(character) for character in text) + if len(text) <= 64: + _cache[text] = total_size + return total_size + + +def get_character_cell_size(character: str) -> int: + """Get the cell size of a character. + + Args: + character (str): A single character. + + Returns: + int: Number of cells (0, 1 or 2) occupied by that character. + """ + + codepoint = ord(character) + if 127 > codepoint > 31: + # Shortcut for ascii + return 1 + return _get_codepoint_cell_size(codepoint) + + +@lru_cache(maxsize=4096) +def _get_codepoint_cell_size(codepoint: int) -> int: + """Get the cell size of a character. + + Args: + character (str): A single character. + + Returns: + int: Number of cells (0, 1 or 2) occupied by that character. + """ + + _table = CELL_WIDTHS + lower_bound = 0 + upper_bound = len(_table) - 1 + index = (lower_bound + upper_bound) // 2 + while True: + start, end, width = _table[index] + if codepoint < start: + upper_bound = index - 1 + elif codepoint > end: + lower_bound = index + 1 + else: + return 0 if width == -1 else width + if upper_bound < lower_bound: + break + index = (lower_bound + upper_bound) // 2 + return 1 + + +def set_cell_size(text: str, total: int) -> str: + """Set the length of a string to fit within given number of cells.""" + cell_size = cell_len(text) + if cell_size == total: + return text + if cell_size < total: + return text + " " * (total - cell_size) + + _get_character_cell_size = get_character_cell_size + character_sizes = [_get_character_cell_size(character) for character in text] + excess = cell_size - total + pop = character_sizes.pop + while excess > 0 and character_sizes: + excess -= pop() + text = text[: len(character_sizes)] + if excess == -1: + text += " " + return text + + +def chop_cells(text: str, max_size: int, position: int = 0) -> List[str]: + """Break text in to equal (cell) length strings.""" + _get_character_cell_size = get_character_cell_size + characters = [ + (character, _get_character_cell_size(character)) for character in text + ][::-1] + total_size = position + lines: List[List[str]] = [[]] + append = lines[-1].append + + pop = characters.pop + while characters: + character, size = pop() + if total_size + size > max_size: + lines.append([character]) + append = lines[-1].append + total_size = size + else: + total_size += size + append(character) + return ["".join(line) for line in lines] + + +if __name__ == "__main__": # pragma: no cover + + print(get_character_cell_size("😽")) + for line in chop_cells("""这是对亚洲语言支持的测试。面对模棱两可的想法，拒绝猜测的诱惑。""", 8): + print(line) + for n in range(80, 1, -1): + print(set_cell_size("""这是对亚洲语言支持的测试。面对模棱两可的想法，拒绝猜测的诱惑。""", n) + "|") + print("x" * n) diff --git a/rich/color.py b/rich/color.py new file mode 100644 index 0000000..3421061 --- /dev/null +++ b/rich/color.py @@ -0,0 +1,575 @@ +import platform +import re +from colorsys import rgb_to_hls +from enum import IntEnum +from functools import lru_cache +from typing import TYPE_CHECKING, NamedTuple, Optional, Tuple + +from ._palettes import EIGHT_BIT_PALETTE, STANDARD_PALETTE, WINDOWS_PALETTE +from .color_triplet import ColorTriplet +from .terminal_theme import DEFAULT_TERMINAL_THEME + +if TYPE_CHECKING: # pragma: no cover + from .terminal_theme import TerminalTheme + from .text import Text + + +WINDOWS = platform.system() == "Windows" + + +class ColorSystem(IntEnum): + """One of the 3 color system supported by terminals.""" + + STANDARD = 1 + EIGHT_BIT = 2 + TRUECOLOR = 3 + WINDOWS = 4 + + +class ColorType(IntEnum): + """Type of color stored in Color class.""" + + DEFAULT = 0 + STANDARD = 1 + EIGHT_BIT = 2 + TRUECOLOR = 3 + WINDOWS = 4 + + +ANSI_COLOR_NAMES = { + "black": 0, + "red": 1, + "green": 2, + "yellow": 3, + "blue": 4, + "magenta": 5, + "cyan": 6, + "white": 7, + "bright_black": 8, + "bright_red": 9, + "bright_green": 10, + "bright_yellow": 11, + "bright_blue": 12, + "bright_magenta": 13, + "bright_cyan": 14, + "bright_white": 15, + "grey0": 16, + "navy_blue": 17, + "dark_blue": 18, + "blue3": 20, + "blue1": 21, + "dark_green": 22, + "deep_sky_blue4": 25, + "dodger_blue3": 26, + "dodger_blue2": 27, + "green4": 28, + "spring_green4": 29, + "turquoise4": 30, + "deep_sky_blue3": 32, + "dodger_blue1": 33, + "green3": 40, + "spring_green3": 41, + "dark_cyan": 36, + "light_sea_green": 37, + "deep_sky_blue2": 38, + "deep_sky_blue1": 39, + "spring_green2": 47, + "cyan3": 43, + "dark_turquoise": 44, + "turquoise2": 45, + "green1": 46, + "spring_green1": 48, + "medium_spring_green": 49, + "cyan2": 50, + "cyan1": 51, + "dark_red": 88, + "deep_pink4": 125, + "purple4": 55, + "purple3": 56, + "blue_violet": 57, + "orange4": 94, + "grey37": 59, + "medium_purple4": 60, + "slate_blue3": 62, + "royal_blue1": 63, + "chartreuse4": 64, + "dark_sea_green4": 71, + "pale_turquoise4": 66, + "steel_blue": 67, + "steel_blue3": 68, + "cornflower_blue": 69, + "chartreuse3": 76, + "cadet_blue": 73, + "sky_blue3": 74, + "steel_blue1": 81, + "pale_green3": 114, + "sea_green3": 78, + "aquamarine3": 79, + "medium_turquoise": 80, + "chartreuse2": 112, + "sea_green2": 83, + "sea_green1": 85, + "aquamarine1": 122, + "dark_slate_gray2": 87, + "dark_magenta": 91, + "dark_violet": 128, + "purple": 129, + "light_pink4": 95, + "plum4": 96, + "medium_purple3": 98, + "slate_blue1": 99, + "yellow4": 106, + "wheat4": 101, + "grey53": 102, + "light_slate_grey": 103, + "medium_purple": 104, + "light_slate_blue": 105, + "dark_olive_green3": 149, + "dark_sea_green": 108, + "light_sky_blue3": 110, + "sky_blue2": 111, + "dark_sea_green3": 150, + "dark_slate_gray3": 116, + "sky_blue1": 117, + "chartreuse1": 118, + "light_green": 120, + "pale_green1": 156, + "dark_slate_gray1": 123, + "red3": 160, + "medium_violet_red": 126, + "magenta3": 164, + "dark_orange3": 166, + "indian_red": 167, + "hot_pink3": 168, + "medium_orchid3": 133, + "medium_orchid": 134, + "medium_purple2": 140, + "dark_goldenrod": 136, + "light_salmon3": 173, + "rosy_brown": 138, + "grey63": 139, + "medium_purple1": 141, + "gold3": 178, + "dark_khaki": 143, + "navajo_white3": 144, + "grey69": 145, + "light_steel_blue3": 146, + "light_steel_blue": 147, + "yellow3": 184, + "dark_sea_green2": 157, + "light_cyan3": 152, + "light_sky_blue1": 153, + "green_yellow": 154, + "dark_olive_green2": 155, + "dark_sea_green1": 193, + "pale_turquoise1": 159, + "deep_pink3": 162, + "magenta2": 200, + "hot_pink2": 169, + "orchid": 170, + "medium_orchid1": 207, + "orange3": 172, + "light_pink3": 174, + "pink3": 175, + "plum3": 176, + "violet": 177, + "light_goldenrod3": 179, + "tan": 180, + "misty_rose3": 181, + "thistle3": 182, + "plum2": 183, + "khaki3": 185, + "light_goldenrod2": 222, + "light_yellow3": 187, + "grey84": 188, + "light_steel_blue1": 189, + "yellow2": 190, + "dark_olive_green1": 192, + "honeydew2": 194, + "light_cyan1": 195, + "red1": 196, + "deep_pink2": 197, + "deep_pink1": 199, + "magenta1": 201, + "orange_red1": 202, + "indian_red1": 204, + "hot_pink": 206, + "dark_orange": 208, + "salmon1": 209, + "light_coral": 210, + "pale_violet_red1": 211, + "orchid2": 212, + "orchid1": 213, + "orange1": 214, + "sandy_brown": 215, + "light_salmon1": 216, + "light_pink1": 217, + "pink1": 218, + "plum1": 219, + "gold1": 220, + "navajo_white1": 223, + "misty_rose1": 224, + "thistle1": 225, + "yellow1": 226, + "light_goldenrod1": 227, + "khaki1": 228, + "wheat1": 229, + "cornsilk1": 230, + "grey100": 231, + "grey3": 232, + "grey7": 233, + "grey11": 234, + "grey15": 235, + "grey19": 236, + "grey23": 237, + "grey27": 238, + "grey30": 239, + "grey35": 240, + "grey39": 241, + "grey42": 242, + "grey46": 243, + "grey50": 244, + "grey54": 245, + "grey58": 246, + "grey62": 247, + "grey66": 248, + "grey70": 249, + "grey74": 250, + "grey78": 251, + "grey82": 252, + "grey85": 253, + "grey89": 254, + "grey93": 255, +} + + +class ColorParseError(Exception): + """The color could not be parsed.""" + + +RE_COLOR = re.compile( + r"""^ +\#([0-9a-f]{6})$| +color\(([0-9]{1,3})\)$| +rgb\(([\d\s,]+)\)$ +""", + re.VERBOSE, +) + + +class Color(NamedTuple): + """Terminal color definition.""" + + name: str + """The name of the color (typically the input to Color.parse).""" + type: ColorType + """The type of the color.""" + number: Optional[int] = None + """The color number, if a standard color, or None.""" + triplet: Optional[ColorTriplet] = None + """A triplet of color components, if an RGB color.""" + + def __repr__(self) -> str: + return ( + f"<color {self.name!r} ({self.type.name.lower()})>" + if self.number is None + else f"<color {self.name!r} {self.number} ({self.type.name.lower()})>" + ) + + def __rich__(self) -> "Text": + """Dispays the actual color if Rich printed.""" + from .text import Text + from .style import Style + + return Text.assemble( + f"<color {self.name!r} ({self.type.name.lower()})", + ("⬤", Style(color=self)), + " >", + ) + + @property + def system(self) -> ColorSystem: + """Get the native color system for this color.""" + if self.type == ColorType.DEFAULT: + return ColorSystem.STANDARD + return ColorSystem(int(self.type)) + + @property + def is_system_defined(self) -> bool: + """Check if the color is ultimately defined by the system.""" + return self.system not in (ColorSystem.EIGHT_BIT, ColorSystem.TRUECOLOR) + + @property + def is_default(self) -> bool: + """Check if the color is a default color.""" + return self.type == ColorType.DEFAULT + + def get_truecolor( + self, theme: "TerminalTheme" = None, foreground=True + ) -> ColorTriplet: + """Get an equivalent color triplet for this color. + + Args: + theme (TerminalTheme, optional): Optional terminal theme, or None to use default. Defaults to None. + foreground (bool, optional): True for a foreground color, or False for background. Defaults to True. + + Returns: + ColorTriplet: A color triplet containing RGB components. + """ + + if theme is None: + theme = DEFAULT_TERMINAL_THEME + if self.type == ColorType.TRUECOLOR: + assert self.triplet is not None + return self.triplet + elif self.type == ColorType.EIGHT_BIT: + assert self.number is not None + return EIGHT_BIT_PALETTE[self.number] + elif self.type == ColorType.STANDARD: + assert self.number is not None + return theme.ansi_colors[self.number] + elif self.type == ColorType.WINDOWS: + assert self.number is not None + return WINDOWS_PALETTE[self.number] + else: # self.type == ColorType.DEFAULT: + assert self.number is None + return theme.foreground_color if foreground else theme.background_color + + @classmethod + def from_ansi(cls, number: int) -> "Color": + """Create a Color number from it's 8-bit ansi number. + + Args: + number (int): A number between 0-255 inclusive. + + Returns: + Color: A new Color instance. + """ + return cls( + name=f"color({number})", + type=(ColorType.STANDARD if number < 16 else ColorType.EIGHT_BIT), + number=number, + ) + + @classmethod + def from_triplet(cls, triplet: "ColorTriplet") -> "Color": + """Create a truecolor RGB color from a triplet of values. + + Args: + triplet (ColorTriplet): A color triplet containing red, green and blue components. + + Returns: + Color: A new color object. + """ + return cls(name=triplet.hex, type=ColorType.TRUECOLOR, triplet=triplet) + + @classmethod + def from_rgb(cls, red: float, green: float, blue: float) -> "Color": + """Create a truecolor from three color components in the range(0->255). + + Args: + red (float): Red component in range 0-255. + green (float): Green component in range 0-255. + blue (float): Blue component in range 0-255. + + Returns: + Color: A new color object. + """ + return cls.from_triplet(ColorTriplet(int(red), int(green), int(blue))) + + @classmethod + def default(cls) -> "Color": + """Get a Color instance representing the default color. + + Returns: + Color: Default color. + """ + return cls(name="default", type=ColorType.DEFAULT) + + @classmethod + @lru_cache(maxsize=1024) + def parse(cls, color: str) -> "Color": + """Parse a color definition.""" + original_color = color + color = color.lower().strip() + + if color == "default": + return cls(color, type=ColorType.DEFAULT) + + color_number = ANSI_COLOR_NAMES.get(color) + if color_number is not None: + return cls( + color, + type=(ColorType.STANDARD if color_number < 16 else ColorType.EIGHT_BIT), + number=color_number, + ) + + color_match = RE_COLOR.match(color) + if color_match is None: + raise ColorParseError(f"{original_color!r} is not a valid color") + + color_24, color_8, color_rgb = color_match.groups() + if color_24: + triplet = ColorTriplet( + int(color_24[0:2], 16), int(color_24[2:4], 16), int(color_24[4:6], 16) + ) + return cls(color, ColorType.TRUECOLOR, triplet=triplet) + + elif color_8: + number = int(color_8) + if number > 255: + raise ColorParseError(f"color number must be <= 255 in {color!r}") + return cls( + color, + type=(ColorType.STANDARD if number < 16 else ColorType.EIGHT_BIT), + number=number, + ) + + else: # color_rgb: + components = color_rgb.split(",") + if len(components) != 3: + raise ColorParseError( + f"expected three components in {original_color!r}" + ) + red, green, blue = components + triplet = ColorTriplet(int(red), int(green), int(blue)) + if not all(component <= 255 for component in triplet): + raise ColorParseError( + f"color components must be <= 255 in {original_color!r}" + ) + return cls(color, ColorType.TRUECOLOR, triplet=triplet) + + @lru_cache(maxsize=1024) + def get_ansi_codes(self, foreground: bool = True) -> Tuple[str, ...]: + """Get the ANSI escape codes for this color.""" + _type = self.type + if _type == ColorType.DEFAULT: + return ("39" if foreground else "49",) + + elif _type == ColorType.WINDOWS: + number = self.number + assert number is not None + fore, back = (30, 40) if number < 8 else (82, 92) + return (str(fore + number if foreground else back + number),) + + elif _type == ColorType.STANDARD: + number = self.number + assert number is not None + fore, back = (30, 40) if number < 8 else (82, 92) + return (str(fore + number if foreground else back + number),) + + elif _type == ColorType.EIGHT_BIT: + assert self.number is not None + return ("38" if foreground else "48", "5", str(self.number)) + + else: # self.standard == ColorStandard.TRUECOLOR: + assert self.triplet is not None + red, green, blue = self.triplet + return ("38" if foreground else "48", "2", str(red), str(green), str(blue)) + + @lru_cache(maxsize=1024) + def downgrade(self, system: ColorSystem) -> "Color": + """Downgrade a color system to a system with fewer colors.""" + + if self.type == ColorType.DEFAULT or self.type == system: + return self + # Convert to 8-bit color from truecolor color + if system == ColorSystem.EIGHT_BIT and self.system == ColorSystem.TRUECOLOR: + assert self.triplet is not None + red, green, blue = self.triplet.normalized + _h, l, s = rgb_to_hls(red, green, blue) + # If saturation is under 10% assume it is grayscale + if s < 0.1: + gray = round(l * 25.0) + if gray == 0: + color_number = 16 + elif gray == 25: + color_number = 231 + else: + color_number = 231 + gray + return Color(self.name, ColorType.EIGHT_BIT, number=color_number) + + color_number = ( + 16 + 36 * round(red * 5.0) + 6 * round(green * 5.0) + round(blue * 5.0) + ) + return Color(self.name, ColorType.EIGHT_BIT, number=color_number) + + # Convert to standard from truecolor or 8-bit + elif system == ColorSystem.STANDARD: + if self.system == ColorSystem.TRUECOLOR: + assert self.triplet is not None + triplet = self.triplet + else: # self.system == ColorSystem.EIGHT_BIT + assert self.number is not None + triplet = ColorTriplet(*EIGHT_BIT_PALETTE[self.number]) + + color_number = STANDARD_PALETTE.match(triplet) + return Color(self.name, ColorType.STANDARD, number=color_number) + + elif system == ColorSystem.WINDOWS: + if self.system == ColorSystem.TRUECOLOR: + assert self.triplet is not None + triplet = self.triplet + else: # self.system == ColorSystem.EIGHT_BIT + assert self.number is not None + if self.number < 16: + return Color(self.name, ColorType.WINDOWS, number=self.number) + triplet = ColorTriplet(*EIGHT_BIT_PALETTE[self.number]) + + color_number = WINDOWS_PALETTE.match(triplet) + return Color(self.name, ColorType.WINDOWS, number=color_number) + + return self + + +def parse_rgb_hex(hex_color: str) -> ColorTriplet: + """Parse six hex characters in to RGB triplet.""" + assert len(hex_color) == 6, "must be 6 characters" + color = ColorTriplet( + int(hex_color[0:2], 16), int(hex_color[2:4], 16), int(hex_color[4:6], 16) + ) + return color + + +def blend_rgb( + color1: ColorTriplet, color2: ColorTriplet, cross_fade: float = 0.5 +) -> ColorTriplet: + """Blend one RGB color in to another.""" + r1, g1, b1 = color1 + r2, g2, b2 = color2 + new_color = ColorTriplet( + int(r1 + (r2 - r1) * cross_fade), + int(g1 + (g2 - g1) * cross_fade), + int(b1 + (b2 - b1) * cross_fade), + ) + return new_color + + +if __name__ == "__main__": # pragma: no cover + + from .console import Console + from .table import Table + from .text import Text + from . import box + + console = Console() + + table = Table(show_footer=False, show_edge=True) + table.add_column("Color", width=10, overflow="ellipsis") + table.add_column("Number", justify="right", style="yellow") + table.add_column("Name", style="green") + table.add_column("Hex", style="blue") + table.add_column("RGB", style="magenta") + + colors = sorted((v, k) for k, v in ANSI_COLOR_NAMES.items()) + for color_number, name in colors: + color_cell = Text(" " * 10, style=f"on {name}") + if color_number < 16: + table.add_row(color_cell, f"{color_number}", Text(f'"{name}"')) + else: + color = EIGHT_BIT_PALETTE[color_number] # type: ignore + table.add_row( + color_cell, str(color_number), Text(f'"{name}"'), color.hex, color.rgb + ) + + console.print(table) diff --git a/rich/color_triplet.py b/rich/color_triplet.py new file mode 100644 index 0000000..75c03d2 --- /dev/null +++ b/rich/color_triplet.py @@ -0,0 +1,38 @@ +from typing import NamedTuple, Tuple + + +class ColorTriplet(NamedTuple): + """The red, green, and blue components of a color.""" + + red: int + """Red component in 0 to 255 range.""" + green: int + """Green component in 0 to 255 range.""" + blue: int + """Blue component in 0 to 255 range.""" + + @property + def hex(self) -> str: + """get the color triplet in CSS style.""" + red, green, blue = self + return f"#{red:02x}{green:02x}{blue:02x}" + + @property + def rgb(self) -> str: + """The color in RGB format. + + Returns: + str: An rgb color, e.g. ``"rgb(100,23,255)"``. + """ + red, green, blue = self + return f"rgb({red},{green},{blue})" + + @property + def normalized(self) -> Tuple[float, float, float]: + """Covert components in to floats between 0 and 1. + + Returns: + Tuple[float, float, float]: A tuple of three normalized colour components. + """ + red, green, blue = self + return red / 255.0, green / 255.0, blue / 255.0 diff --git a/rich/columns.py b/rich/columns.py new file mode 100644 index 0000000..d152dcd --- /dev/null +++ b/rich/columns.py @@ -0,0 +1,189 @@ +from collections import defaultdict +from itertools import chain +from operator import itemgetter +from typing import Dict, Iterable, List, Optional, Tuple + +from .align import Align, AlignMethod +from .console import Console, ConsoleOptions, RenderableType, RenderResult +from .constrain import Constrain +from .measure import Measurement +from .padding import Padding, PaddingDimensions +from .table import Table +from .text import TextType +from .jupyter import JupyterMixin + + +class Columns(JupyterMixin): + """Display renderables in neat columns. + + Args: + renderables (Iterable[RenderableType]): Any number of Rich renderables (including str). + width (int, optional): The desired width of the columns, or None to auto detect. Defaults to None. + padding (PaddingDimensions, optional): Optional padding around cells. Defaults to (0, 1). + expand (bool, optional): Expand columns to full width. Defaults to False. + equal (bool, optional): Arrange in to equal sized columns. Defaults to False. + column_first (bool, optional): Align items from top to bottom (rather than left to right). Defaults to False. + right_to_left (bool, optional): Start column from right hand side. Defaults to False. + align (str, optional): Align value ("left", "right", or "center") or None for default. Defaults to None. + title (TextType, optional): Optional title for Columns. + """ + + def __init__( + self, + renderables: Iterable[RenderableType] = None, + padding: PaddingDimensions = (0, 1), + *, + width: int = None, + expand: bool = False, + equal: bool = False, + column_first: bool = False, + right_to_left: bool = False, + align: AlignMethod = None, + title: TextType = None, + ) -> None: + self.renderables = list(renderables or []) + self.width = width + self.padding = padding + self.expand = expand + self.equal = equal + self.column_first = column_first + self.right_to_left = right_to_left + self.align = align + self.title = title + + def add_renderable(self, renderable: RenderableType) -> None: + """Add a renderable to the columns. + + Args: + renderable (RenderableType): Any renderable object. + """ + self.renderables.append(renderable) + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + render_str = console.render_str + renderables = [ + render_str(renderable) if isinstance(renderable, str) else renderable + for renderable in self.renderables + ] + if not renderables: + return + _top, right, _bottom, left = Padding.unpack(self.padding) + width_padding = max(left, right) + max_width = options.max_width + widths: Dict[int, int] = defaultdict(int) + column_count = len(renderables) + + get_measurement = Measurement.get + renderable_widths = [ + get_measurement(console, renderable, max_width).maximum + for renderable in renderables + ] + if self.equal: + renderable_widths = [max(renderable_widths)] * len(renderable_widths) + + def iter_renderables( + column_count: int, + ) -> Iterable[Tuple[int, Optional[RenderableType]]]: + item_count = len(renderables) + if self.column_first: + width_renderables = list(zip(renderable_widths, renderables)) + + column_lengths: List[int] = [item_count // column_count] * column_count + for col_no in range(item_count % column_count): + column_lengths[col_no] += 1 + + row_count = (item_count + column_count - 1) // column_count + cells = [[-1] * column_count for _ in range(row_count)] + row = col = 0 + for index in range(item_count): + cells[row][col] = index + column_lengths[col] -= 1 + if column_lengths[col]: + row += 1 + else: + col += 1 + row = 0 + for index in chain.from_iterable(cells): + if index == -1: + break + yield width_renderables[index] + else: + yield from zip(renderable_widths, renderables) + # Pad odd elements with spaces + if item_count % column_count: + for _ in range(column_count - (item_count % column_count)): + yield 0, None + + table = Table.grid(padding=self.padding, collapse_padding=True, pad_edge=False) + table.expand = self.expand + table.title = self.title + + if self.width is not None: + column_count = (max_width) // (self.width + width_padding) + for _ in range(column_count): + table.add_column(width=self.width) + else: + while column_count > 1: + widths.clear() + column_no = 0 + for renderable_width, _ in iter_renderables(column_count): + widths[column_no] = max(widths[column_no], renderable_width) + total_width = sum(widths.values()) + width_padding * ( + len(widths) - 1 + ) + if total_width > max_width: + column_count = len(widths) - 1 + break + else: + column_no = (column_no + 1) % column_count + else: + break + + get_renderable = itemgetter(1) + _renderables = [ + get_renderable(_renderable) + for _renderable in iter_renderables(column_count) + ] + if self.equal: + _renderables = [ + None + if renderable is None + else Constrain(renderable, renderable_widths[0]) + for renderable in _renderables + ] + if self.align: + align = self.align + _Align = Align + _renderables = [ + None if renderable is None else _Align(renderable, align) + for renderable in _renderables + ] + + right_to_left = self.right_to_left + add_row = table.add_row + for start in range(0, len(_renderables), column_count): + row = _renderables[start : start + column_count] + if right_to_left: + row = row[::-1] + add_row(*row) + yield table + + +if __name__ == "__main__": # pragma: no cover + import os + + console = Console() + + from rich.panel import Panel + + files = [f"{i} {s}" for i, s in enumerate(sorted(os.listdir()))] + columns = Columns(files, padding=(0, 1), expand=False, equal=False) + console.print(columns) + console.rule() + columns.column_first = True + console.print(columns) + columns.right_to_left = True + console.rule() + console.print(columns) diff --git a/rich/console.py b/rich/console.py new file mode 100644 index 0000000..a59dbd6 --- /dev/null +++ b/rich/console.py @@ -0,0 +1,1821 @@ +import inspect +import os +import platform +import shutil +import sys +import threading +from abc import ABC, abstractmethod +from collections import abc +from dataclasses import dataclass, field, replace +from datetime import datetime +from functools import wraps +from getpass import getpass +from itertools import islice +from time import monotonic +from typing import ( + IO, + TYPE_CHECKING, + Any, + Callable, + Dict, + Iterable, + List, + NamedTuple, + Optional, + TextIO, + Tuple, + Union, + cast, +) + +from typing_extensions import Literal, Protocol, runtime_checkable + +from . import errors, themes +from ._emoji_replace import _emoji_replace +from ._log_render import LogRender, FormatTimeCallable +from .align import Align, AlignMethod +from .color import ColorSystem +from .control import Control +from .highlighter import NullHighlighter, ReprHighlighter +from .markup import render as render_markup +from .measure import Measurement, measure_renderables +from .pager import Pager, SystemPager +from .pretty import Pretty +from .scope import render_scope +from .screen import Screen +from .segment import Segment +from .style import Style, StyleType +from .styled import Styled +from .terminal_theme import DEFAULT_TERMINAL_THEME, TerminalTheme +from .text import Text, TextType +from .theme import Theme, ThemeStack + +if TYPE_CHECKING: + from ._windows import WindowsConsoleFeatures + from .live import Live + from .status import Status + +WINDOWS = platform.system() == "Windows" + +HighlighterType = Callable[[Union[str, "Text"]], "Text"] +JustifyMethod = Literal["default", "left", "center", "right", "full"] +OverflowMethod = Literal["fold", "crop", "ellipsis", "ignore"] + + +class NoChange: + pass + + +NO_CHANGE = NoChange() + + +CONSOLE_HTML_FORMAT = """\ +<!DOCTYPE html> +<head> +<meta charset="UTF-8"> +<style> +{stylesheet} +body {{ + color: {foreground}; + background-color: {background}; +}} +</style> +</head> +<html> +<body> + <code> + <pre style="font-family:Menlo,'DejaVu Sans Mono',consolas,'Courier New',monospace">{code}</pre> + </code> +</body> +</html> +""" + +_TERM_COLORS = {"256color": ColorSystem.EIGHT_BIT, "16color": ColorSystem.STANDARD} + + +class ConsoleDimensions(NamedTuple): + """Size of the terminal.""" + + width: int + """The width of the console in 'cells'.""" + height: int + """The height of the console in lines.""" + + +@dataclass +class ConsoleOptions: + """Options for __rich_console__ method.""" + + size: ConsoleDimensions + """Size of console.""" + legacy_windows: bool + """legacy_windows: flag for legacy windows.""" + min_width: int + """Minimum width of renderable.""" + max_width: int + """Maximum width of renderable.""" + is_terminal: bool + """True if the target is a terminal, otherwise False.""" + encoding: str + """Encoding of terminal.""" + justify: Optional[JustifyMethod] = None + """Justify value override for renderable.""" + overflow: Optional[OverflowMethod] = None + """Overflow value override for renderable.""" + no_wrap: Optional[bool] = False + """Disable wrapping for text.""" + highlight: Optional[bool] = None + """Highlight override for render_str.""" + height: Optional[int] = None + """Height available, or None for no height limit.""" + + @property + def ascii_only(self) -> bool: + """Check if renderables should use ascii only.""" + return not self.encoding.startswith("utf") + + def update( + self, + width: Union[int, NoChange] = NO_CHANGE, + min_width: Union[int, NoChange] = NO_CHANGE, + max_width: Union[int, NoChange] = NO_CHANGE, + justify: Union[Optional[JustifyMethod], NoChange] = NO_CHANGE, + overflow: Union[Optional[OverflowMethod], NoChange] = NO_CHANGE, + no_wrap: Union[Optional[bool], NoChange] = NO_CHANGE, + highlight: Union[Optional[bool], NoChange] = NO_CHANGE, + height: Union[Optional[int], NoChange] = NO_CHANGE, + ) -> "ConsoleOptions": + """Update values, return a copy.""" + options = replace(self) + if not isinstance(width, NoChange): + options.min_width = options.max_width = width + if not isinstance(min_width, NoChange): + options.min_width = min_width + if not isinstance(max_width, NoChange): + options.max_width = max_width + if not isinstance(justify, NoChange): + options.justify = justify + if not isinstance(overflow, NoChange): + options.overflow = overflow + if not isinstance(no_wrap, NoChange): + options.no_wrap = no_wrap + if not isinstance(highlight, NoChange): + options.highlight = highlight + if not isinstance(height, NoChange): + options.height = height + return options + + def update_width(self, width: int) -> "ConsoleOptions": + """Update just the width, return a copy. + + Args: + width (int): New width (sets both min_width and max_width) + + Returns: + ~ConsoleOptions: New console options instance + """ + options = replace(self, min_width=width, max_width=width) + return options + + +@runtime_checkable +class RichCast(Protocol): + """An object that may be 'cast' to a console renderable.""" + + def __rich__(self) -> Union["ConsoleRenderable", str]: # pragma: no cover + ... + + +@runtime_checkable +class ConsoleRenderable(Protocol): + """An object that supports the console protocol.""" + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": # pragma: no cover + ... + + +RenderableType = Union[ConsoleRenderable, RichCast, str] +"""A type that may be rendered by Console.""" + +RenderResult = Iterable[Union[RenderableType, Segment]] +"""The result of calling a __rich_console__ method.""" + + +_null_highlighter = NullHighlighter() + + +class CaptureError(Exception): + """An error in the Capture context manager.""" + + +class Capture: + """Context manager to capture the result of printing to the console. + See :meth:`~rich.console.Console.capture` for how to use. + + Args: + console (Console): A console instance to capture output. + """ + + def __init__(self, console: "Console") -> None: + self._console = console + self._result: Optional[str] = None + + def __enter__(self) -> "Capture": + self._console.begin_capture() + return self + + def __exit__(self, exc_type, exc_val, exc_tb) -> None: + self._result = self._console.end_capture() + + def get(self) -> str: + """Get the result of the capture.""" + if self._result is None: + raise CaptureError( + "Capture result is not available until context manager exits." + ) + return self._result + + +class ThemeContext: + """A context manager to use a temporary theme. See :meth:`~rich.console.Console.use_theme` for usage.""" + + def __init__(self, console: "Console", theme: Theme, inherit: bool = True) -> None: + self.console = console + self.theme = theme + self.inherit = inherit + + def __enter__(self) -> "ThemeContext": + self.console.push_theme(self.theme) + return self + + def __exit__(self, exc_type, exc_val, exc_tb) -> None: + self.console.pop_theme() + + +class PagerContext: + """A context manager that 'pages' content. See :meth:`~rich.console.Console.pager` for usage.""" + + def __init__( + self, + console: "Console", + pager: Pager = None, + styles: bool = False, + links: bool = False, + ) -> None: + self._console = console + self.pager = SystemPager() if pager is None else pager + self.styles = styles + self.links = links + + def __enter__(self) -> "PagerContext": + self._console._enter_buffer() + return self + + def __exit__(self, exc_type, exc_val, exc_tb) -> None: + if exc_type is None: + with self._console._lock: + buffer: List[Segment] = self._console._buffer[:] + del self._console._buffer[:] + segments: Iterable[Segment] = buffer + if not self.styles: + segments = Segment.strip_styles(segments) + elif not self.links: + segments = Segment.strip_links(segments) + content = self._console._render_buffer(segments) + self.pager.show(content) + self._console._exit_buffer() + + +class ScreenContext: + """A context manager that enables an alternative screen. See :meth:`~rich.console.Console.screen` for usage.""" + + def __init__( + self, console: "Console", hide_cursor: bool, style: StyleType = "" + ) -> None: + self.console = console + self.hide_cursor = hide_cursor + self.screen = Screen(style=style) + self._changed = False + + def update( + self, renderable: RenderableType = None, style: StyleType = None + ) -> None: + """Update the screen. + + Args: + renderable (RenderableType, optional): Optional renderable to replace current renderable, + or None for no change. Defaults to None. + style: (Style, optional): Replacement style, or None for no change. Defaults to None. + """ + if renderable is not None: + self.screen.renderable = renderable + if style is not None: + self.screen.style = style + self.console.print(self.screen, end="") + + def __enter__(self) -> "ScreenContext": + self._changed = self.console.set_alt_screen(True) + if self._changed and self.hide_cursor: + self.console.show_cursor(False) + return self + + def __exit__(self, exc_type, exc_val, exc_tb) -> None: + if self._changed: + self.console.set_alt_screen(False) + if self.hide_cursor: + self.console.show_cursor(True) + + +class RenderGroup: + """Takes a group of renderables and returns a renderable object that renders the group. + + Args: + renderables (Iterable[RenderableType]): An iterable of renderable objects. + fit (bool, optional): Fit dimension of group to contents, or fill available space. Defaults to True. + """ + + def __init__(self, *renderables: "RenderableType", fit: bool = True) -> None: + self._renderables = renderables + self.fit = fit + self._render: Optional[List[RenderableType]] = None + + @property + def renderables(self) -> List["RenderableType"]: + if self._render is None: + self._render = list(self._renderables) + return self._render + + def __rich_measure__(self, console: "Console", max_width: int) -> "Measurement": + if self.fit: + return measure_renderables(console, self.renderables, max_width) + else: + return Measurement(max_width, max_width) + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> RenderResult: + yield from self.renderables + + +def render_group(fit: bool = True) -> Callable: + """A decorator that turns an iterable of renderables in to a group. + + Args: + fit (bool, optional): Fit dimension of group to contents, or fill available space. Defaults to True. + """ + + def decorator(method): + """Convert a method that returns an iterable of renderables in to a RenderGroup.""" + + @wraps(method) + def _replace(*args, **kwargs): + renderables = method(*args, **kwargs) + return RenderGroup(*renderables, fit=fit) + + return _replace + + return decorator + + +def _is_jupyter() -> bool: # pragma: no cover + """Check if we're running in a Jupyter notebook.""" + try: + get_ipython # type: ignore + except NameError: + return False + shell = get_ipython().__class__.__name__ # type: ignore + if shell == "ZMQInteractiveShell": + return True # Jupyter notebook or qtconsole + elif shell == "TerminalInteractiveShell": + return False # Terminal running IPython + else: + return False # Other type (?) + + +COLOR_SYSTEMS = { + "standard": ColorSystem.STANDARD, + "256": ColorSystem.EIGHT_BIT, + "truecolor": ColorSystem.TRUECOLOR, + "windows": ColorSystem.WINDOWS, +} + + +_COLOR_SYSTEMS_NAMES = {system: name for name, system in COLOR_SYSTEMS.items()} + + +@dataclass +class ConsoleThreadLocals(threading.local): + """Thread local values for Console context.""" + + theme_stack: ThemeStack + buffer: List[Segment] = field(default_factory=list) + buffer_index: int = 0 + + +class RenderHook(ABC): + """Provides hooks in to the render process.""" + + @abstractmethod + def process_renderables( + self, renderables: List[ConsoleRenderable] + ) -> List[ConsoleRenderable]: + """Called with a list of objects to render. + + This method can return a new list of renderables, or modify and return the same list. + + Args: + renderables (List[ConsoleRenderable]): A number of renderable objects. + + Returns: + List[ConsoleRenderable]: A replacement list of renderables. + """ + + +_windows_console_features: Optional["WindowsConsoleFeatures"] = None + + +def get_windows_console_features() -> "WindowsConsoleFeatures": # pragma: no cover + global _windows_console_features + if _windows_console_features is not None: + return _windows_console_features + from ._windows import get_windows_console_features + + _windows_console_features = get_windows_console_features() + return _windows_console_features + + +def detect_legacy_windows() -> bool: + """Detect legacy Windows.""" + return WINDOWS and not get_windows_console_features().vt + + +if detect_legacy_windows(): # pragma: no cover + from colorama import init + + init() + + +class Console: + """A high level console interface. + + Args: + color_system (str, optional): The color system supported by your terminal, + either ``"standard"``, ``"256"`` or ``"truecolor"``. Leave as ``"auto"`` to autodetect. + force_terminal (Optional[bool], optional): Enable/disable terminal control codes, or None to auto-detect terminal. Defaults to None. + force_jupyter (Optional[bool], optional): Enable/disable Jupyter rendering, or None to auto-detect Jupyter. Defaults to None. + force_interactive (Optional[bool], optional): Enable/disable interactive mode, or None to auto detect. Defaults to None. + soft_wrap (Optional[bool], optional): Set soft wrap default on print method. Defaults to False. + theme (Theme, optional): An optional style theme object, or ``None`` for default theme. + stderr (bool, optional): Use stderr rather than stdout if ``file`` is not specified. Defaults to False. + file (IO, optional): A file object where the console should write to. Defaults to stdout. + quiet (bool, Optional): Boolean to suppress all output. Defaults to False. + width (int, optional): The width of the terminal. Leave as default to auto-detect width. + height (int, optional): The height of the terminal. Leave as default to auto-detect height. + style (StyleType, optional): Style to apply to all output, or None for no style. Defaults to None. + no_color (Optional[bool], optional): Enabled no color mode, or None to auto detect. Defaults to None. + tab_size (int, optional): Number of spaces used to replace a tab character. Defaults to 8. + record (bool, optional): Boolean to enable recording of terminal output, + required to call :meth:`export_html` and :meth:`export_text`. Defaults to False. + markup (bool, optional): Boolean to enable :ref:`console_markup`. Defaults to True. + emoji (bool, optional): Enable emoji code. Defaults to True. + highlight (bool, optional): Enable automatic highlighting. Defaults to True. + log_time (bool, optional): Boolean to enable logging of time by :meth:`log` methods. Defaults to True. + log_path (bool, optional): Boolean to enable the logging of the caller by :meth:`log`. Defaults to True. + log_time_format (Union[str, TimeFormatterCallable], optional): If ``log_time`` is enabled, either string for strftime or callable that formats the time. Defaults to "[%X] ". + highlighter (HighlighterType, optional): Default highlighter. + legacy_windows (bool, optional): Enable legacy Windows mode, or ``None`` to auto detect. Defaults to ``None``. + safe_box (bool, optional): Restrict box options that don't render on legacy Windows. + get_datetime (Callable[[], datetime], optional): Callable that gets the current time as a datetime.datetime object (used by Console.log), + or None for datetime.now. + get_time (Callable[[], time], optional): Callable that gets the current time in seconds, default uses time.monotonic. + """ + + def __init__( + self, + *, + color_system: Optional[ + Literal["auto", "standard", "256", "truecolor", "windows"] + ] = "auto", + force_terminal: bool = None, + force_jupyter: bool = None, + force_interactive: bool = None, + soft_wrap: bool = False, + theme: Theme = None, + stderr: bool = False, + file: IO[str] = None, + quiet: bool = False, + width: int = None, + height: int = None, + style: StyleType = None, + no_color: bool = None, + tab_size: int = 8, + record: bool = False, + markup: bool = True, + emoji: bool = True, + highlight: bool = True, + log_time: bool = True, + log_path: bool = True, + log_time_format: Union[str, FormatTimeCallable] = "[%X]", + highlighter: Optional["HighlighterType"] = ReprHighlighter(), + legacy_windows: bool = None, + safe_box: bool = True, + get_datetime: Callable[[], datetime] = None, + get_time: Callable[[], float] = None, + _environ: Dict[str, str] = None, + ): + # Copy of os.environ allows us to replace it for testing + self._environ = os.environ if _environ is None else _environ + + self.is_jupyter = _is_jupyter() if force_jupyter is None else force_jupyter + if self.is_jupyter: + width = width or 93 + height = height or 100 + self.soft_wrap = soft_wrap + self._width = width + self._height = height + self.tab_size = tab_size + self.record = record + self._markup = markup + self._emoji = emoji + self._highlight = highlight + self.legacy_windows: bool = ( + (detect_legacy_windows() and not self.is_jupyter) + if legacy_windows is None + else legacy_windows + ) + + self._color_system: Optional[ColorSystem] + self._force_terminal = force_terminal + self._file = file + self.quiet = quiet + self.stderr = stderr + + if color_system is None: + self._color_system = None + elif color_system == "auto": + self._color_system = self._detect_color_system() + else: + self._color_system = COLOR_SYSTEMS[color_system] + + self._lock = threading.RLock() + self._log_render = LogRender( + show_time=log_time, + show_path=log_path, + time_format=log_time_format, + ) + self.highlighter: HighlighterType = highlighter or _null_highlighter + self.safe_box = safe_box + self.get_datetime = get_datetime or datetime.now + self.get_time = get_time or monotonic + self.style = style + self.no_color = ( + no_color if no_color is not None else "NO_COLOR" in self._environ + ) + self.is_interactive = ( + (self.is_terminal and not self.is_dumb_terminal) + if force_interactive is None + else force_interactive + ) + + self._record_buffer_lock = threading.RLock() + self._thread_locals = ConsoleThreadLocals( + theme_stack=ThemeStack(themes.DEFAULT if theme is None else theme) + ) + self._record_buffer: List[Segment] = [] + self._render_hooks: List[RenderHook] = [] + self._live: Optional["Live"] = None + + def __repr__(self) -> str: + return f"<console width={self.width} {str(self._color_system)}>" + + @property + def file(self) -> IO[str]: + """Get the file object to write to.""" + file = self._file or (sys.stderr if self.stderr else sys.stdout) + file = getattr(file, "rich_proxied_file", file) + return file + + @file.setter + def file(self, new_file: IO[str]) -> None: + """Set a new file object.""" + self._file = new_file + + @property + def _buffer(self) -> List[Segment]: + """Get a thread local buffer.""" + return self._thread_locals.buffer + + @property + def _buffer_index(self) -> int: + """Get a thread local buffer.""" + return self._thread_locals.buffer_index + + @_buffer_index.setter + def _buffer_index(self, value: int) -> None: + self._thread_locals.buffer_index = value + + @property + def _theme_stack(self) -> ThemeStack: + """Get the thread local theme stack.""" + return self._thread_locals.theme_stack + + def _detect_color_system(self) -> Optional[ColorSystem]: + """Detect color system from env vars.""" + if self.is_jupyter: + return ColorSystem.TRUECOLOR + if not self.is_terminal or self.is_dumb_terminal: + return None + if WINDOWS: # pragma: no cover + if self.legacy_windows: # pragma: no cover + return ColorSystem.WINDOWS + windows_console_features = get_windows_console_features() + return ( + ColorSystem.TRUECOLOR + if windows_console_features.truecolor + else ColorSystem.EIGHT_BIT + ) + else: + color_term = self._environ.get("COLORTERM", "").strip().lower() + if color_term in ("truecolor", "24bit"): + return ColorSystem.TRUECOLOR + term = self._environ.get("TERM", "").strip().lower() + _term_name, _hyphen, colors = term.partition("-") + color_system = _TERM_COLORS.get(colors, ColorSystem.STANDARD) + return color_system + + def _enter_buffer(self) -> None: + """Enter in to a buffer context, and buffer all output.""" + self._buffer_index += 1 + + def _exit_buffer(self) -> None: + """Leave buffer context, and render content if required.""" + self._buffer_index -= 1 + self._check_buffer() + + def set_live(self, live: "Live") -> None: + """Set Live instance. Used by Live context manager. + + Args: + live (Live): Live instance using this Console. + + Raises: + errors.LiveError: If this Console has a Live context currently active. + """ + with self._lock: + if self._live is not None: + raise errors.LiveError("Only one live display may be active at once") + self._live = live + + def clear_live(self) -> None: + """Clear the Live instance.""" + with self._lock: + self._live = None + + def push_render_hook(self, hook: RenderHook) -> None: + """Add a new render hook to the stack. + + Args: + hook (RenderHook): Render hook instance. + """ + + self._render_hooks.append(hook) + + def pop_render_hook(self) -> None: + """Pop the last renderhook from the stack.""" + self._render_hooks.pop() + + def __enter__(self) -> "Console": + """Own context manager to enter buffer context.""" + self._enter_buffer() + return self + + def __exit__(self, exc_type, exc_value, traceback) -> None: + """Exit buffer context.""" + self._exit_buffer() + + def begin_capture(self) -> None: + """Begin capturing console output. Call :meth:`end_capture` to exit capture mode and return output.""" + self._enter_buffer() + + def end_capture(self) -> str: + """End capture mode and return captured string. + + Returns: + str: Console output. + """ + render_result = self._render_buffer(self._buffer) + del self._buffer[:] + self._exit_buffer() + return render_result + + def push_theme(self, theme: Theme, *, inherit: bool = True) -> None: + """Push a new theme on to the top of the stack, replacing the styles from the previous theme. + Generally speaking, you should call :meth:`~rich.console.Console.use_theme` to get a context manager, rather + than calling this method directly. + + Args: + theme (Theme): A theme instance. + inherit (bool, optional): Inherit existing styles. Defaults to True. + """ + self._theme_stack.push_theme(theme, inherit=inherit) + + def pop_theme(self) -> None: + """Remove theme from top of stack, restoring previous theme.""" + self._theme_stack.pop_theme() + + def use_theme(self, theme: Theme, *, inherit: bool = True) -> ThemeContext: + """Use a different theme for the duration of the context manager. + + Args: + theme (Theme): Theme instance to user. + inherit (bool, optional): Inherit existing console styles. Defaults to True. + + Returns: + ThemeContext: [description] + """ + return ThemeContext(self, theme, inherit) + + @property + def color_system(self) -> Optional[str]: + """Get color system string. + + Returns: + Optional[str]: "standard", "256" or "truecolor". + """ + + if self._color_system is not None: + return _COLOR_SYSTEMS_NAMES[self._color_system] + else: + return None + + @property + def encoding(self) -> str: + """Get the encoding of the console file, e.g. ``"utf-8"``. + + Returns: + str: A standard encoding string. + """ + return (getattr(self.file, "encoding", "utf-8") or "utf-8").lower() + + @property + def is_terminal(self) -> bool: + """Check if the console is writing to a terminal. + + Returns: + bool: True if the console writing to a device capable of + understanding terminal codes, otherwise False. + """ + if self._force_terminal is not None: + return self._force_terminal + isatty = getattr(self.file, "isatty", None) + return False if isatty is None else isatty() + + @property + def is_dumb_terminal(self) -> bool: + """Detect dumb terminal. + + Returns: + bool: True if writing to a dumb terminal, otherwise False. + + """ + _term = self._environ.get("TERM", "") + is_dumb = _term.lower() in ("dumb", "unknown") + return self.is_terminal and is_dumb + + @property + def options(self) -> ConsoleOptions: + """Get default console options.""" + return ConsoleOptions( + size=self.size, + legacy_windows=self.legacy_windows, + min_width=1, + max_width=self.width, + encoding=self.encoding, + is_terminal=self.is_terminal, + ) + + @property + def size(self) -> ConsoleDimensions: + """Get the size of the console. + + Returns: + ConsoleDimensions: A named tuple containing the dimensions. + """ + + if self._width is not None and self._height is not None: + return ConsoleDimensions(self._width, self._height) + + if self.is_dumb_terminal: + return ConsoleDimensions(80, 25) + + width: Optional[int] = None + height: Optional[int] = None + if WINDOWS: # pragma: no cover + width, height = shutil.get_terminal_size() + else: + try: + width, height = os.get_terminal_size(sys.stdin.fileno()) + except (AttributeError, ValueError, OSError): + try: + width, height = os.get_terminal_size(sys.stdout.fileno()) + except (AttributeError, ValueError, OSError): + pass + + # get_terminal_size can report 0, 0 if run from pseudo-terminal + width = width or 80 + height = height or 25 + return ConsoleDimensions( + (width - self.legacy_windows) if self._width is None else self._width, + height if self._height is None else self._height, + ) + + @property + def width(self) -> int: + """Get the width of the console. + + Returns: + int: The width (in characters) of the console. + """ + width, _ = self.size + return width + + @property + def height(self) -> int: + """Get the height of the console. + + Returns: + int: The height (in lines) of the console. + """ + _, height = self.size + return height + + def bell(self) -> None: + """Play a 'bell' sound (if supported by the terminal).""" + self.control("\x07") + + def capture(self) -> Capture: + """A context manager to *capture* the result of print() or log() in a string, + rather than writing it to the console. + + Example: + >>> from rich.console import Console + >>> console = Console() + >>> with console.capture() as capture: + ... console.print("[bold magenta]Hello World[/]") + >>> print(capture.get()) + + Returns: + Capture: Context manager with disables writing to the terminal. + """ + capture = Capture(self) + return capture + + def pager( + self, pager: Pager = None, styles: bool = False, links: bool = False + ) -> PagerContext: + """A context manager to display anything printed within a "pager". The pager application + is defined by the system and will typically support at least pressing a key to scroll. + + Args: + pager (Pager, optional): A pager object, or None to use :class:~rich.pager.SystemPager`. Defaults to None. + styles (bool, optional): Show styles in pager. Defaults to False. + links (bool, optional): Show links in pager. Defaults to False. + + Example: + >>> from rich.console import Console + >>> from rich.__main__ import make_test_card + >>> console = Console() + >>> with console.pager(): + console.print(make_test_card()) + + Returns: + PagerContext: A context manager. + """ + return PagerContext(self, pager=pager, styles=styles, links=links) + + def line(self, count: int = 1) -> None: + """Write new line(s). + + Args: + count (int, optional): Number of new lines. Defaults to 1. + """ + + assert count >= 0, "count must be >= 0" + if count: + self._buffer.append(Segment("\n" * count)) + self._check_buffer() + + def clear(self, home: bool = True) -> None: + """Clear the screen. + + Args: + home (bool, optional): Also move the cursor to 'home' position. Defaults to True. + """ + self.control("\033[2J\033[H" if home else "\033[2J") + + def status( + self, + status: RenderableType, + *, + spinner: str = "dots", + spinner_style: str = "status.spinner", + speed: float = 1.0, + refresh_per_second: float = 12.5, + ) -> "Status": + """Display a status and spinner. + + Args: + status (RenderableType): A status renderable (str or Text typically). + console (Console, optional): Console instance to use, or None for global console. Defaults to None. + spinner (str, optional): Name of spinner animation (see python -m rich.spinner). Defaults to "dots". + spinner_style (StyleType, optional): Style of spinner. Defaults to "status.spinner". + speed (float, optional): Speed factor for spinner animation. Defaults to 1.0. + refresh_per_second (float, optional): Number of refreshes per second. Defaults to 12.5. + + Returns: + Status: A Status object that may be used as a context manager. + """ + from .status import Status + + status_renderable = Status( + status, + console=self, + spinner=spinner, + spinner_style=spinner_style, + speed=speed, + refresh_per_second=refresh_per_second, + ) + return status_renderable + + def show_cursor(self, show: bool = True) -> bool: + """Show or hide the cursor. + + Args: + show (bool, optional): Set visibility of the cursor. + """ + if self.is_terminal and not self.legacy_windows: + self.control("\033[?25h" if show else "\033[?25l") + return True + return False + + def set_alt_screen(self, enable: bool = True) -> bool: + """Enables alternative screen mode. + + Note, if you enable this mode, you should ensure that is disabled before + the application exits. See :meth:`~rich.Console.screen` for a context manager + that handles this for you. + + Args: + enable (bool, optional): Enable (True) or disable (False) alternate screen. Defaults to True. + + Returns: + bool: True if the control codes were written. + + """ + changed = False + if self.is_terminal and not self.legacy_windows: + self.control("\033[?1049h\033[H" if enable else "\033[?1049l") + changed = True + return changed + + def screen( + self, hide_cursor: bool = True, style: StyleType = None + ) -> "ScreenContext": + """Context manager to enable and disable 'alternative screen' mode. + + Args: + hide_cursor (bool, optional): Also hide the cursor. Defaults to False. + style (Style, optional): Optional style for screen. Defaults to None. + + Returns: + ~ScreenContext: Context which enables alternate screen on enter, and disables it on exit. + """ + return ScreenContext(self, hide_cursor=hide_cursor, style=style or "") + + def render( + self, renderable: RenderableType, options: ConsoleOptions = None + ) -> Iterable[Segment]: + """Render an object in to an iterable of `Segment` instances. + + This method contains the logic for rendering objects with the console protocol. + You are unlikely to need to use it directly, unless you are extending the library. + + Args: + renderable (RenderableType): An object supporting the console protocol, or + an object that may be converted to a string. + options (ConsoleOptions, optional): An options object, or None to use self.options. Defaults to None. + + Returns: + Iterable[Segment]: An iterable of segments that may be rendered. + """ + + _options = options or self.options + if _options.max_width < 1: + # No space to render anything. This prevents potential recursion errors. + return + render_iterable: RenderResult + if isinstance(renderable, RichCast): + renderable = renderable.__rich__() + if isinstance(renderable, ConsoleRenderable): + render_iterable = renderable.__rich_console__(self, _options) + elif isinstance(renderable, str): + yield from self.render( + self.render_str(renderable, highlight=_options.highlight), _options + ) + return + else: + raise errors.NotRenderableError( + f"Unable to render {renderable!r}; " + "A str, Segment or object with __rich_console__ method is required" + ) + + try: + iter_render = iter(render_iterable) + except TypeError: + raise errors.NotRenderableError( + f"object {render_iterable!r} is not renderable" + ) + for render_output in iter_render: + if isinstance(render_output, Segment): + yield render_output + else: + yield from self.render(render_output, _options) + + def render_lines( + self, + renderable: RenderableType, + options: Optional[ConsoleOptions] = None, + *, + style: Optional[Style] = None, + pad: bool = True, + ) -> List[List[Segment]]: + """Render objects in to a list of lines. + + The output of render_lines is useful when further formatting of rendered console text + is required, such as the Panel class which draws a border around any renderable object. + + Args: + renderable (RenderableType): Any object renderable in the console. + options (Optional[ConsoleOptions], optional): Console options, or None to use self.options. Default to ``None``. + style (Style, optional): Optional style to apply to renderables. Defaults to ``None``. + pad (bool, optional): Pad lines shorter than render width. Defaults to ``True``. + range (Optional[Tuple[int, int]], optional): Range of lines to render, or ``None`` for all line. Defaults to ``None`` + + Returns: + List[List[Segment]]: A list of lines, where a line is a list of Segment objects. + """ + render_options = options or self.options + _rendered = self.render(renderable, render_options) + if style is not None: + _rendered = Segment.apply_style(_rendered, style) + lines = list( + Segment.split_and_crop_lines( + _rendered, render_options.max_width, include_new_lines=False, pad=pad + ) + ) + if render_options.height is not None: + lines = Segment.set_shape( + lines, render_options.max_width, render_options.height, style=style + ) + return lines + + def render_str( + self, + text: str, + *, + style: Union[str, Style] = "", + justify: JustifyMethod = None, + overflow: OverflowMethod = None, + emoji: bool = None, + markup: bool = None, + highlight: bool = None, + highlighter: HighlighterType = None, + ) -> "Text": + """Convert a string to a Text instance. This is is called automatically if + you print or log a string. + + Args: + text (str): Text to render. + style (Union[str, Style], optional): Style to apply to rendered text. + justify (str, optional): Justify method: "default", "left", "center", "full", or "right". Defaults to ``None``. + overflow (str, optional): Overflow method: "crop", "fold", or "ellipsis". Defaults to ``None``. + emoji (Optional[bool], optional): Enable emoji, or ``None`` to use Console default. + markup (Optional[bool], optional): Enable markup, or ``None`` to use Console default. + highlight (Optional[bool], optional): Enable highlighting, or ``None`` to use Console default. + highlighter (HighlighterType, optional): Optional highlighter to apply. + Returns: + ConsoleRenderable: Renderable object. + + """ + emoji_enabled = emoji or (emoji is None and self._emoji) + markup_enabled = markup or (markup is None and self._markup) + highlight_enabled = highlight or (highlight is None and self._highlight) + + if markup_enabled: + rich_text = render_markup(text, style=style, emoji=emoji_enabled) + rich_text.justify = justify + rich_text.overflow = overflow + else: + rich_text = Text( + _emoji_replace(text) if emoji_enabled else text, + justify=justify, + overflow=overflow, + style=style, + ) + + _highlighter = (highlighter or self.highlighter) if highlight_enabled else None + if _highlighter is not None: + highlight_text = _highlighter(str(rich_text)) + highlight_text.copy_styles(rich_text) + return highlight_text + + return rich_text + + def get_style( + self, name: Union[str, Style], *, default: Union[Style, str] = None + ) -> Style: + """Get a Style instance by it's theme name or parse a definition. + + Args: + name (str): The name of a style or a style definition. + + Returns: + Style: A Style object. + + Raises: + MissingStyle: If no style could be parsed from name. + + """ + if isinstance(name, Style): + return name + + try: + style = self._theme_stack.get(name) + if style is None: + style = Style.parse(name) + return style.copy() if style.link else style + except errors.StyleSyntaxError as error: + if default is not None: + return self.get_style(default) + raise errors.MissingStyle( + f"Failed to get style {name!r}; {error}" + ) from None + + def _collect_renderables( + self, + objects: Iterable[Any], + sep: str, + end: str, + *, + justify: JustifyMethod = None, + emoji: bool = None, + markup: bool = None, + highlight: bool = None, + ) -> List[ConsoleRenderable]: + """Combine a number of renderables and text into one renderable. + + Args: + objects (Iterable[Any]): Anything that Rich can render. + sep (str): String to write between print data. + end (str): String to write at end of print data. + justify (str, optional): One of "left", "right", "center", or "full". Defaults to ``None``. + emoji (Optional[bool], optional): Enable emoji code, or ``None`` to use console default. + markup (Optional[bool], optional): Enable markup, or ``None`` to use console default. + highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use console default. + + Returns: + List[ConsoleRenderable]: A list of things to render. + """ + renderables: List[ConsoleRenderable] = [] + _append = renderables.append + text: List[Text] = [] + append_text = text.append + + append = _append + if justify in ("left", "center", "right"): + + def align_append(renderable: RenderableType) -> None: + _append(Align(renderable, cast(AlignMethod, justify))) + + append = align_append + + _highlighter: HighlighterType = _null_highlighter + if highlight or (highlight is None and self._highlight): + _highlighter = self.highlighter + + def check_text() -> None: + if text: + sep_text = Text(sep, justify=justify, end=end) + append(sep_text.join(text)) + del text[:] + + for renderable in objects: + # I promise this is sane + # This detects an object which claims to have all attributes, such as MagicMock.mock_calls + if hasattr( + renderable, "jwevpw_eors4dfo6mwo345ermk7kdnfnwerwer" + ): # pragma: no cover + renderable = repr(renderable) + rich_cast = getattr(renderable, "__rich__", None) + if rich_cast: + renderable = rich_cast() + if isinstance(renderable, str): + append_text( + self.render_str( + renderable, emoji=emoji, markup=markup, highlighter=_highlighter + ) + ) + elif isinstance(renderable, ConsoleRenderable): + check_text() + append(renderable) + elif isinstance(renderable, (abc.Mapping, abc.Sequence, abc.Set)): + check_text() + append(Pretty(renderable, highlighter=_highlighter)) + else: + append_text(_highlighter(str(renderable))) + + check_text() + + if self.style is not None: + style = self.get_style(self.style) + renderables = [Styled(renderable, style) for renderable in renderables] + + return renderables + + def rule( + self, + title: TextType = "", + *, + characters: str = "─", + style: Union[str, Style] = "rule.line", + align: AlignMethod = "center", + ) -> None: + """Draw a line with optional centered title. + + Args: + title (str, optional): Text to render over the rule. Defaults to "". + characters (str, optional): Character(s) to form the line. Defaults to "─". + style (str, optional): Style of line. Defaults to "rule.line". + align (str, optional): How to align the title, one of "left", "center", or "right". Defaults to "center". + """ + from .rule import Rule + + rule = Rule(title=title, characters=characters, style=style, align=align) + self.print(rule) + + def control(self, control_codes: Union["Control", str]) -> None: + """Insert non-printing control codes. + + Args: + control_codes (str): Control codes, such as those that may move the cursor. + """ + if not self.is_dumb_terminal: + self._buffer.append(Segment.control(str(control_codes))) + self._check_buffer() + + def out( + self, + *objects: Any, + sep=" ", + end="\n", + style: Union[str, Style] = None, + highlight: bool = None, + ) -> None: + """Output to the terminal. This is a low-level way of writing to the terminal which unlike + :meth:`~rich.console.Console.print` won't pretty print, wrap text, or apply markup, but will + optionally apply highlighting and a basic style. + + Args: + sep (str, optional): String to write between print data. Defaults to " ". + end (str, optional): String to write at end of print data. Defaults to "\\\\n". + style (Union[str, Style], optional): A style to apply to output. Defaults to None. + highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use + console default. Defaults to ``None``. + """ + raw_output: str = sep.join(str(_object) for _object in objects) + self.print( + raw_output, + style=style, + highlight=highlight, + emoji=False, + markup=False, + no_wrap=True, + overflow="ignore", + crop=False, + end=end, + ) + + def print( + self, + *objects: Any, + sep=" ", + end="\n", + style: Union[str, Style] = None, + justify: JustifyMethod = None, + overflow: OverflowMethod = None, + no_wrap: bool = None, + emoji: bool = None, + markup: bool = None, + highlight: bool = None, + width: int = None, + height: int = None, + crop: bool = True, + soft_wrap: bool = None, + ) -> None: + """Print to the console. + + Args: + objects (positional args): Objects to log to the terminal. + sep (str, optional): String to write between print data. Defaults to " ". + end (str, optional): String to write at end of print data. Defaults to "\\\\n". + style (Union[str, Style], optional): A style to apply to output. Defaults to None. + justify (str, optional): Justify method: "default", "left", "right", "center", or "full". Defaults to ``None``. + overflow (str, optional): Overflow method: "ignore", "crop", "fold", or "ellipsis". Defaults to None. + no_wrap (Optional[bool], optional): Disable word wrapping. Defaults to None. + emoji (Optional[bool], optional): Enable emoji code, or ``None`` to use console default. Defaults to ``None``. + markup (Optional[bool], optional): Enable markup, or ``None`` to use console default. Defaults to ``None``. + highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use console default. Defaults to ``None``. + width (Optional[int], optional): Width of output, or ``None`` to auto-detect. Defaults to ``None``. + crop (Optional[bool], optional): Crop output to width of terminal. Defaults to True. + soft_wrap (bool, optional): Enable soft wrap mode which disables word wrapping and cropping of text or None for + Console default. Defaults to ``None``. + """ + if not objects: + self.line() + return + + if soft_wrap is None: + soft_wrap = self.soft_wrap + if soft_wrap: + if no_wrap is None: + no_wrap = True + if overflow is None: + overflow = "ignore" + crop = False + + with self: + renderables = self._collect_renderables( + objects, + sep, + end, + justify=justify, + emoji=emoji, + markup=markup, + highlight=highlight, + ) + for hook in self._render_hooks: + renderables = hook.process_renderables(renderables) + render_options = self.options.update( + justify="default", + overflow=overflow, + width=min(width, self.width) if width else NO_CHANGE, + height=height, + no_wrap=no_wrap, + ) + + new_segments: List[Segment] = [] + extend = new_segments.extend + render = self.render + if style is None: + for renderable in renderables: + extend(render(renderable, render_options)) + else: + for renderable in renderables: + extend( + Segment.apply_style( + render(renderable, render_options), self.get_style(style) + ) + ) + if crop: + buffer_extend = self._buffer.extend + for line in Segment.split_and_crop_lines( + new_segments, self.width, pad=False + ): + buffer_extend(line) + else: + self._buffer.extend(new_segments) + + def print_exception( + self, + *, + width: Optional[int] = 100, + extra_lines: int = 3, + theme: Optional[str] = None, + word_wrap: bool = False, + show_locals: bool = False, + ) -> None: + """Prints a rich render of the last exception and traceback. + + Args: + width (Optional[int], optional): Number of characters used to render code. Defaults to 88. + extra_lines (int, optional): Additional lines of code to render. Defaults to 3. + theme (str, optional): Override pygments theme used in traceback + word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False. + show_locals (bool, optional): Enable display of local variables. Defaults to False. + """ + from .traceback import Traceback + + traceback = Traceback( + width=width, + extra_lines=extra_lines, + theme=theme, + word_wrap=word_wrap, + show_locals=show_locals, + ) + self.print(traceback) + + def log( + self, + *objects: Any, + sep=" ", + end="\n", + style: Union[str, Style] = None, + justify: JustifyMethod = None, + emoji: bool = None, + markup: bool = None, + highlight: bool = None, + log_locals: bool = False, + _stack_offset=1, + ) -> None: + """Log rich content to the terminal. + + Args: + objects (positional args): Objects to log to the terminal. + sep (str, optional): String to write between print data. Defaults to " ". + end (str, optional): String to write at end of print data. Defaults to "\\\\n". + style (Union[str, Style], optional): A style to apply to output. Defaults to None. + justify (str, optional): One of "left", "right", "center", or "full". Defaults to ``None``. + overflow (str, optional): Overflow method: "crop", "fold", or "ellipsis". Defaults to None. + emoji (Optional[bool], optional): Enable emoji code, or ``None`` to use console default. Defaults to None. + markup (Optional[bool], optional): Enable markup, or ``None`` to use console default. Defaults to None. + highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use console default. Defaults to None. + log_locals (bool, optional): Boolean to enable logging of locals where ``log()`` + was called. Defaults to False. + _stack_offset (int, optional): Offset of caller from end of call stack. Defaults to 1. + """ + if not objects: + self.line() + return + with self: + renderables = self._collect_renderables( + objects, + sep, + end, + justify=justify, + emoji=emoji, + markup=markup, + highlight=highlight, + ) + if style is not None: + renderables = [Styled(renderable, style) for renderable in renderables] + + caller = inspect.stack()[_stack_offset] + link_path = ( + None + if caller.filename.startswith("<") + else os.path.abspath(caller.filename) + ) + path = caller.filename.rpartition(os.sep)[-1] + line_no = caller.lineno + if log_locals: + locals_map = { + key: value + for key, value in caller.frame.f_locals.items() + if not key.startswith("__") + } + renderables.append(render_scope(locals_map, title="[i]locals")) + + renderables = [ + self._log_render( + self, + renderables, + log_time=self.get_datetime(), + path=path, + line_no=line_no, + link_path=link_path, + ) + ] + for hook in self._render_hooks: + renderables = hook.process_renderables(renderables) + new_segments: List[Segment] = [] + extend = new_segments.extend + render = self.render + render_options = self.options + for renderable in renderables: + extend(render(renderable, render_options)) + buffer_extend = self._buffer.extend + for line in Segment.split_and_crop_lines( + new_segments, self.width, pad=False + ): + buffer_extend(line) + + def _check_buffer(self) -> None: + """Check if the buffer may be rendered.""" + if self.quiet: + del self._buffer[:] + return + with self._lock: + if self._buffer_index == 0: + if self.is_jupyter: # pragma: no cover + from .jupyter import display + + display(self._buffer) + del self._buffer[:] + else: + text = self._render_buffer(self._buffer[:]) + del self._buffer[:] + if text: + try: + if WINDOWS: # pragma: no cover + # https://bugs.python.org/issue37871 + write = self.file.write + for line in text.splitlines(True): + write(line) + else: + self.file.write(text) + self.file.flush() + except UnicodeEncodeError as error: + error.reason = f"{error.reason}\n*** You may need to add PYTHONIOENCODING=utf-8 to your environment ***" + raise + + def _render_buffer(self, buffer: Iterable[Segment]) -> str: + """Render buffered output, and clear buffer.""" + output: List[str] = [] + append = output.append + color_system = self._color_system + legacy_windows = self.legacy_windows + if self.record: + with self._record_buffer_lock: + self._record_buffer.extend(buffer) + not_terminal = not self.is_terminal + if self.no_color and color_system: + buffer = Segment.remove_color(buffer) + for text, style, is_control in buffer: + if style: + append( + style.render( + text, + color_system=color_system, + legacy_windows=legacy_windows, + ) + ) + elif not (not_terminal and is_control): + append(text) + + rendered = "".join(output) + return rendered + + def input( + self, + prompt: TextType = "", + *, + markup: bool = True, + emoji: bool = True, + password: bool = False, + stream: TextIO = None, + ) -> str: + """Displays a prompt and waits for input from the user. The prompt may contain color / style. + + Args: + prompt (Union[str, Text]): Text to render in the prompt. + markup (bool, optional): Enable console markup (requires a str prompt). Defaults to True. + emoji (bool, optional): Enable emoji (requires a str prompt). Defaults to True. + password: (bool, optional): Hide typed text. Defaults to False. + stream: (TextIO, optional): Optional file to read input from (rather than stdin). Defaults to None. + + Returns: + str: Text read from stdin. + """ + prompt_str = "" + if prompt: + with self.capture() as capture: + self.print(prompt, markup=markup, emoji=emoji, end="") + prompt_str = capture.get() + if self.legacy_windows: + # Legacy windows doesn't like ANSI codes in getpass or input (colorama bug)? + self.file.write(prompt_str) + prompt_str = "" + if password: + result = getpass(prompt_str, stream=stream) + else: + if stream: + self.file.write(prompt_str) + result = stream.readline() + else: + result = input(prompt_str) + return result + + def export_text(self, *, clear: bool = True, styles: bool = False) -> str: + """Generate text from console contents (requires record=True argument in constructor). + + Args: + clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``. + styles (bool, optional): If ``True``, ansi escape codes will be included. ``False`` for plain text. + Defaults to ``False``. + + Returns: + str: String containing console contents. + + """ + assert ( + self.record + ), "To export console contents set record=True in the constructor or instance" + + with self._record_buffer_lock: + if styles: + text = "".join( + (style.render(text) if style else text) + for text, style, _ in self._record_buffer + ) + else: + text = "".join( + segment.text + for segment in self._record_buffer + if not segment.is_control + ) + if clear: + del self._record_buffer[:] + return text + + def save_text(self, path: str, *, clear: bool = True, styles: bool = False) -> None: + """Generate text from console and save to a given location (requires record=True argument in constructor). + + Args: + path (str): Path to write text files. + clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``. + styles (bool, optional): If ``True``, ansi style codes will be included. ``False`` for plain text. + Defaults to ``False``. + + """ + text = self.export_text(clear=clear, styles=styles) + with open(path, "wt", encoding="utf-8") as write_file: + write_file.write(text) + + def export_html( + self, + *, + theme: TerminalTheme = None, + clear: bool = True, + code_format: str = None, + inline_styles: bool = False, + ) -> str: + """Generate HTML from console contents (requires record=True argument in constructor). + + Args: + theme (TerminalTheme, optional): TerminalTheme object containing console colors. + clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``. + code_format (str, optional): Format string to render HTML, should contain {foreground} + {background} and {code}. + inline_styles (bool, optional): If ``True`` styles will be inlined in to spans, which makes files + larger but easier to cut and paste markup. If ``False``, styles will be embedded in a style tag. + Defaults to False. + + Returns: + str: String containing console contents as HTML. + """ + assert ( + self.record + ), "To export console contents set record=True in the constructor or instance" + fragments: List[str] = [] + append = fragments.append + _theme = theme or DEFAULT_TERMINAL_THEME + stylesheet = "" + + def escape(text: str) -> str: + """Escape html.""" + return text.replace("&", "&").replace("<", "<").replace(">", ">") + + render_code_format = CONSOLE_HTML_FORMAT if code_format is None else code_format + + with self._record_buffer_lock: + if inline_styles: + for text, style, _ in Segment.filter_control( + Segment.simplify(self._record_buffer) + ): + text = escape(text) + if style: + rule = style.get_html_style(_theme) + text = f'<span style="{rule}">{text}</span>' if rule else text + if style.link: + text = f'<a href="{style.link}">{text}</a>' + append(text) + else: + styles: Dict[str, int] = {} + for text, style, _ in Segment.filter_control( + Segment.simplify(self._record_buffer) + ): + text = escape(text) + if style: + rule = style.get_html_style(_theme) + if rule: + style_number = styles.setdefault(rule, len(styles) + 1) + text = f'<span class="r{style_number}">{text}</span>' + if style.link: + text = f'<a href="{style.link}">{text}</a>' + append(text) + stylesheet_rules: List[str] = [] + stylesheet_append = stylesheet_rules.append + for style_rule, style_number in styles.items(): + if style_rule: + stylesheet_append(f".r{style_number} {{{style_rule}}}") + stylesheet = "\n".join(stylesheet_rules) + + rendered_code = render_code_format.format( + code="".join(fragments), + stylesheet=stylesheet, + foreground=_theme.foreground_color.hex, + background=_theme.background_color.hex, + ) + if clear: + del self._record_buffer[:] + return rendered_code + + def save_html( + self, + path: str, + *, + theme: TerminalTheme = None, + clear: bool = True, + code_format=CONSOLE_HTML_FORMAT, + inline_styles: bool = False, + ) -> None: + """Generate HTML from console contents and write to a file (requires record=True argument in constructor). + + Args: + path (str): Path to write html file. + theme (TerminalTheme, optional): TerminalTheme object containing console colors. + clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``. + code_format (str, optional): Format string to render HTML, should contain {foreground} + {background} and {code}. + inline_styles (bool, optional): If ``True`` styles will be inlined in to spans, which makes files + larger but easier to cut and paste markup. If ``False``, styles will be embedded in a style tag. + Defaults to False. + + """ + html = self.export_html( + theme=theme, + clear=clear, + code_format=code_format, + inline_styles=inline_styles, + ) + with open(path, "wt", encoding="utf-8") as write_file: + write_file.write(html) + + +if __name__ == "__main__": # pragma: no cover + console = Console() + + console.log( + "JSONRPC [i]request[/i]", + 5, + 1.3, + True, + False, + None, + { + "jsonrpc": "2.0", + "method": "subtract", + "params": {"minuend": 42, "subtrahend": 23}, + "id": 3, + }, + ) + + console.log("Hello, World!", "{'a': 1}", repr(console)) + + console.print( + { + "name": None, + "empty": [], + "quiz": { + "sport": { + "answered": True, + "q1": { + "question": "Which one is correct team name in NBA?", + "options": [ + "New York Bulls", + "Los Angeles Kings", + "Golden State Warriors", + "Huston Rocket", + ], + "answer": "Huston Rocket", + }, + }, + "maths": { + "answered": False, + "q1": { + "question": "5 + 7 = ?", + "options": [10, 11, 12, 13], + "answer": 12, + }, + "q2": { + "question": "12 - 8 = ?", + "options": [1, 2, 3, 4], + "answer": 4, + }, + }, + }, + } + ) + console.log("foo") diff --git a/rich/constrain.py b/rich/constrain.py new file mode 100644 index 0000000..c96233a --- /dev/null +++ b/rich/constrain.py @@ -0,0 +1,35 @@ +from typing import Optional, TYPE_CHECKING + +from .jupyter import JupyterMixin +from .measure import Measurement + +if TYPE_CHECKING: + from .console import Console, ConsoleOptions, RenderableType, RenderResult + + +class Constrain(JupyterMixin): + """Constrain the width of a renderable to a given number of characters. + + Args: + renderable (RenderableType): A renderable object. + width (int, optional): The maximum width (in characters) to render. Defaults to 80. + """ + + def __init__(self, renderable: "RenderableType", width: Optional[int] = 80) -> None: + self.renderable = renderable + self.width = width + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + if self.width is None: + yield self.renderable + else: + child_options = options.update(width=min(self.width, options.max_width)) + yield from console.render(self.renderable, child_options) + + def __rich_measure__(self, console: "Console", max_width: int) -> "Measurement": + if self.width is not None: + max_width = min(self.width, max_width) + measurement = Measurement.get(console, self.renderable, max_width) + return measurement diff --git a/rich/containers.py b/rich/containers.py new file mode 100644 index 0000000..c42c814 --- /dev/null +++ b/rich/containers.py @@ -0,0 +1,161 @@ +from itertools import zip_longest +from typing import ( + Iterator, + Iterable, + List, + overload, + TypeVar, + TYPE_CHECKING, +) + +if TYPE_CHECKING: + from .console import ( + Console, + ConsoleOptions, + JustifyMethod, + OverflowMethod, + RenderResult, + RenderableType, + ) + from .text import Text + +from .cells import cell_len +from .measure import Measurement + +T = TypeVar("T") + + +class Renderables: + """A list subclass which renders its contents to the console.""" + + def __init__(self, renderables: Iterable["RenderableType"] = None) -> None: + self._renderables: List["RenderableType"] = ( + list(renderables) if renderables is not None else [] + ) + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + """Console render method to insert line-breaks.""" + yield from self._renderables + + def __rich_measure__(self, console: "Console", max_width: int) -> "Measurement": + dimensions = [ + Measurement.get(console, renderable, max_width) + for renderable in self._renderables + ] + if not dimensions: + return Measurement(1, 1) + _min = max(dimension.minimum for dimension in dimensions) + _max = max(dimension.maximum for dimension in dimensions) + return Measurement(_min, _max) + + def append(self, renderable: "RenderableType") -> None: + self._renderables.append(renderable) + + def __iter__(self) -> Iterable["RenderableType"]: + return iter(self._renderables) + + +class Lines: + """A list subclass which can render to the console.""" + + def __init__(self, lines: Iterable["Text"] = ()) -> None: + self._lines: List["Text"] = list(lines) + + def __repr__(self) -> str: + return f"Lines({self._lines!r})" + + def __iter__(self) -> Iterator["Text"]: + return iter(self._lines) + + @overload + def __getitem__(self, index: int) -> "Text": + ... + + @overload + def __getitem__(self, index: slice) -> "Lines": + ... + + def __getitem__(self, index): + return self._lines[index] + + def __setitem__(self, index: int, value: "Text") -> "Lines": + self._lines[index] = value + return self + + def __len__(self) -> int: + return self._lines.__len__() + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + """Console render method to insert line-breaks.""" + yield from self._lines + + def append(self, line: "Text") -> None: + self._lines.append(line) + + def extend(self, lines: Iterable["Text"]) -> None: + self._lines.extend(lines) + + def pop(self, index=-1) -> "Text": + return self._lines.pop(index) + + def justify( + self, + console: "Console", + width: int, + justify: "JustifyMethod" = "left", + overflow: "OverflowMethod" = "fold", + ) -> None: + """Justify and overflow text to a given width. + + Args: + console (Console): Console instance. + width (int): Number of characters per line. + justify (str, optional): Default justify method for text: "left", "center", "full" or "right". Defaults to "left". + overflow (str, optional): Default overflow for text: "crop", "fold", or "ellipsis". Defaults to "fold". + + """ + from .text import Text + + if justify == "left": + for line in self._lines: + line.truncate(width, overflow=overflow, pad=True) + elif justify == "center": + for line in self._lines: + line.rstrip() + line.truncate(width, overflow=overflow) + line.pad_left((width - cell_len(line.plain)) // 2) + line.pad_right(width - cell_len(line.plain)) + elif justify == "right": + for line in self._lines: + line.rstrip() + line.truncate(width, overflow=overflow) + line.pad_left(width - cell_len(line.plain)) + elif justify == "full": + for line_index, line in enumerate(self._lines): + if line_index == len(self._lines) - 1: + break + words = line.split(" ") + words_size = sum(cell_len(word.plain) for word in words) + num_spaces = len(words) - 1 + spaces = [1 for _ in range(num_spaces)] + index = 0 + if spaces: + while words_size + num_spaces < width: + spaces[len(spaces) - index - 1] += 1 + num_spaces += 1 + index = (index + 1) % len(spaces) + tokens: List[Text] = [] + for index, (word, next_word) in enumerate( + zip_longest(words, words[1:]) + ): + tokens.append(word) + if index < len(spaces): + style = word.get_style_at_offset(console, -1) + next_style = next_word.get_style_at_offset(console, 0) + space_style = style if style == next_style else line.style + tokens.append(Text(" " * spaces[index], style=space_style)) + self[line_index] = Text("").join(tokens) diff --git a/rich/control.py b/rich/control.py new file mode 100644 index 0000000..f4cfd44 --- /dev/null +++ b/rich/control.py @@ -0,0 +1,57 @@ +from typing import TYPE_CHECKING + +from .segment import Segment + +if TYPE_CHECKING: + from .console import Console, ConsoleOptions, RenderResult + +STRIP_CONTROL_CODES = [ + 8, # Backspace + 11, # Vertical tab + 12, # Form feed + 13, # Carriage return +] +_CONTROL_TRANSLATE = {_codepoint: None for _codepoint in STRIP_CONTROL_CODES} + + +class Control: + """A renderable that inserts a control code (non printable but may move cursor). + + Args: + control_codes (str): A string containing control codes. + """ + + __slots__ = ["_control_codes"] + + def __init__(self, control_codes: str) -> None: + self._control_codes = Segment.control(control_codes) + + @classmethod + def home(cls) -> "Control": + """Move cursor to 'home' position.""" + return cls("\033[H") + + def __str__(self) -> str: + return self._control_codes.text + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + yield self._control_codes + + +def strip_control_codes(text: str, _translate_table=_CONTROL_TRANSLATE) -> str: + """Remove control codes from text. + + Args: + text (str): A string possibly contain control codes. + + Returns: + str: String with control codes removed. + """ + return text.translate(_translate_table) + + +if __name__ == "__main__": # pragma: no cover + + print(strip_control_codes("hello\rWorld")) diff --git a/rich/default_styles.py b/rich/default_styles.py new file mode 100644 index 0000000..6413f8e --- /dev/null +++ b/rich/default_styles.py @@ -0,0 +1,154 @@ +from typing import Dict + +from .style import Style + +DEFAULT_STYLES: Dict[str, Style] = { + "none": Style.null(), + "reset": Style( + color="default", + bgcolor="default", + dim=False, + bold=False, + italic=False, + underline=False, + blink=False, + blink2=False, + reverse=False, + conceal=False, + strike=False, + ), + "dim": Style(dim=True), + "bright": Style(dim=False), + "bold": Style(bold=True), + "strong": Style(bold=True), + "code": Style(reverse=True, bold=True), + "italic": Style(italic=True), + "emphasize": Style(italic=True), + "underline": Style(underline=True), + "blink": Style(blink=True), + "blink2": Style(blink2=True), + "reverse": Style(reverse=True), + "strike": Style(strike=True), + "black": Style(color="black"), + "red": Style(color="red"), + "green": Style(color="green"), + "yellow": Style(color="yellow"), + "magenta": Style(color="magenta"), + "cyan": Style(color="cyan"), + "white": Style(color="white"), + "inspect.attr": Style(color="yellow", italic=True), + "inspect.attr.dunder": Style(color="yellow", italic=True, dim=True), + "inspect.callable": Style(bold=True, color="red"), + "inspect.def": Style(italic=True, color="bright_cyan"), + "inspect.error": Style(bold=True, color="red"), + "inspect.equals": Style(), + "inspect.help": Style(color="cyan"), + "inspect.doc": Style(dim=True), + "inspect.value.border": Style(color="green"), + "live.ellipsis": Style(bold=True, color="red"), + "logging.keyword": Style(bold=True, color="yellow"), + "logging.level.notset": Style(dim=True), + "logging.level.debug": Style(color="green"), + "logging.level.info": Style(color="blue"), + "logging.level.warning": Style(color="red"), + "logging.level.error": Style(color="red", bold=True), + "logging.level.critical": Style(color="red", bold=True, reverse=True), + "log.level": Style.null(), + "log.time": Style(color="cyan", dim=True), + "log.message": Style.null(), + "log.path": Style(dim=True), + "repr.ellipsis": Style(color="yellow"), + "repr.indent": Style(color="green", dim=True), + "repr.error": Style(color="red", bold=True), + "repr.str": Style(color="green", italic=False, bold=False), + "repr.brace": Style(bold=True), + "repr.comma": Style(bold=True), + "repr.ipv4": Style(bold=True, color="bright_green"), + "repr.ipv6": Style(bold=True, color="bright_green"), + "repr.eui48": Style(bold=True, color="bright_green"), + "repr.eui64": Style(bold=True, color="bright_green"), + "repr.tag_start": Style(bold=True), + "repr.tag_name": Style(color="bright_magenta", bold=True), + "repr.tag_contents": Style(color="default"), + "repr.tag_end": Style(bold=True), + "repr.attrib_name": Style(color="yellow", italic=False), + "repr.attrib_equal": Style(bold=True), + "repr.attrib_value": Style(color="magenta", italic=False), + "repr.number": Style(color="blue", bold=True, italic=False), + "repr.bool_true": Style(color="bright_green", italic=True), + "repr.bool_false": Style(color="bright_red", italic=True), + "repr.none": Style(color="magenta", italic=True), + "repr.url": Style(underline=True, color="bright_blue", italic=False, bold=False), + "repr.uuid": Style(color="bright_yellow", bold=False), + "rule.line": Style(color="bright_green"), + "rule.text": Style.null(), + "prompt": Style.null(), + "prompt.choices": Style(color="magenta", bold=True), + "prompt.default": Style(color="cyan", bold=True), + "prompt.invalid": Style(color="red"), + "prompt.invalid.choice": Style(color="red"), + "pretty": Style.null(), + "scope.border": Style(color="blue"), + "scope.key": Style(color="yellow", italic=True), + "scope.key.special": Style(color="yellow", italic=True, dim=True), + "scope.equals": Style(color="red"), + "repr.path": Style(color="magenta"), + "repr.filename": Style(color="bright_magenta"), + "table.header": Style(bold=True), + "table.footer": Style(bold=True), + "table.cell": Style.null(), + "table.title": Style(italic=True), + "table.caption": Style(italic=True, dim=True), + "traceback.error": Style(color="red", italic=True), + "traceback.border.syntax_error": Style(color="bright_red"), + "traceback.border": Style(color="red"), + "traceback.text": Style.null(), + "traceback.title": Style(color="red", bold=True), + "traceback.exc_type": Style(color="bright_red", bold=True), + "traceback.exc_value": Style.null(), + "traceback.offset": Style(color="bright_red", bold=True), + "bar.back": Style(color="grey23"), + "bar.complete": Style(color="rgb(249,38,114)"), + "bar.finished": Style(color="rgb(114,156,31)"), + "bar.pulse": Style(color="rgb(249,38,114)"), + "progress.description": Style.null(), + "progress.filesize": Style(color="green"), + "progress.filesize.total": Style(color="green"), + "progress.download": Style(color="green"), + "progress.elapsed": Style(color="yellow"), + "progress.percentage": Style(color="magenta"), + "progress.remaining": Style(color="cyan"), + "progress.data.speed": Style(color="red"), + "progress.spinner": Style(color="green"), + "status.spinner": Style(color="green"), + "tree": Style(), + "tree.line": Style(), +} + +MARKDOWN_STYLES = { + "markdown.paragraph": Style(), + "markdown.text": Style(), + "markdown.emph": Style(italic=True), + "markdown.strong": Style(bold=True), + "markdown.code": Style(bgcolor="black", color="bright_white"), + "markdown.code_block": Style(dim=True, color="cyan", bgcolor="black"), + "markdown.block_quote": Style(color="magenta"), + "markdown.list": Style(color="cyan"), + "markdown.item": Style(), + "markdown.item.bullet": Style(color="yellow", bold=True), + "markdown.item.number": Style(color="yellow", bold=True), + "markdown.hr": Style(color="yellow"), + "markdown.h1.border": Style(), + "markdown.h1": Style(bold=True), + "markdown.h2": Style(bold=True, underline=True), + "markdown.h3": Style(bold=True), + "markdown.h4": Style(bold=True, dim=True), + "markdown.h5": Style(underline=True), + "markdown.h6": Style(italic=True), + "markdown.h7": Style(italic=True, dim=True), + "markdown.link": Style(color="bright_blue"), + "markdown.link_url": Style(color="blue"), +} + + +DEFAULT_STYLES.update(MARKDOWN_STYLES) diff --git a/rich/diagnose.py b/rich/diagnose.py new file mode 100644 index 0000000..455e11d --- /dev/null +++ b/rich/diagnose.py @@ -0,0 +1,6 @@ +if __name__ == "__main__": # pragma: no cover + from rich.console import Console + from rich import inspect + + console = Console() + inspect(console) diff --git a/rich/emoji.py b/rich/emoji.py new file mode 100644 index 0000000..4c1e200 --- /dev/null +++ b/rich/emoji.py @@ -0,0 +1,74 @@ +from typing import Union + +from .console import Console, ConsoleOptions, RenderResult +from .jupyter import JupyterMixin +from .segment import Segment +from .style import Style +from ._emoji_codes import EMOJI +from ._emoji_replace import _emoji_replace + + +class NoEmoji(Exception): + """No emoji by that name.""" + + +class Emoji(JupyterMixin): + __slots__ = ["name", "style", "_char"] + + def __init__(self, name: str, style: Union[str, Style] = "none") -> None: + """A single emoji character. + + Args: + name (str): Name of emoji. + style (Union[str, Style], optional): Optional style. Defaults to None. + + Raises: + NoEmoji: If the emoji doesn't exist. + """ + self.name = name + self.style = style + try: + self._char = EMOJI[name] + except KeyError: + raise NoEmoji(f"No emoji called {name!r}") + + @classmethod + def replace(cls, text: str) -> str: + """Replace emoji markup with corresponding unicode characters. + + Args: + text (str): A string with emojis codes, e.g. "Hello :smiley:!" + + Returns: + str: A string with emoji codes replaces with actual emoji. + """ + return _emoji_replace(text) + + def __repr__(self) -> str: + return f"<emoji {self.name!r}>" + + def __str__(self) -> str: + return self._char + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + yield Segment(self._char, console.get_style(self.style)) + + +if __name__ == "__main__": # pragma: no cover + import sys + + from rich.columns import Columns + from rich.console import Console + + console = Console(record=True) + + columns = Columns( + (f":{name}: {name}" for name in sorted(EMOJI.keys()) if "\u200D" not in name), + column_first=True, + ) + + console.print(columns) + if len(sys.argv) > 1: + console.save_html(sys.argv[1]) diff --git a/rich/errors.py b/rich/errors.py new file mode 100644 index 0000000..e295fbc --- /dev/null +++ b/rich/errors.py @@ -0,0 +1,30 @@ +class ConsoleError(Exception): + """An error in console operation.""" + + +class StyleError(Exception): + """An error in styles.""" + + +class StyleSyntaxError(ConsoleError): + """Style was badly formatted.""" + + +class MissingStyle(StyleError): + """No such style.""" + + +class StyleStackError(ConsoleError): + """Style stack is invalid.""" + + +class NotRenderableError(ConsoleError): + """Object is not renderable.""" + + +class MarkupError(ConsoleError): + """Markup was badly formatted.""" + + +class LiveError(ConsoleError): + """Error related to Live display.""" diff --git a/rich/file_proxy.py b/rich/file_proxy.py new file mode 100644 index 0000000..99a6922 --- /dev/null +++ b/rich/file_proxy.py @@ -0,0 +1,54 @@ +import io +from typing import List, Any, IO, TYPE_CHECKING + +from .ansi import AnsiDecoder +from .text import Text + +if TYPE_CHECKING: + from .console import Console + + +class FileProxy(io.TextIOBase): + """Wraps a file (e.g. sys.stdout) and redirects writes to a console.""" + + def __init__(self, console: "Console", file: IO[str]) -> None: + self.__console = console + self.__file = file + self.__buffer: List[str] = [] + self.__ansi_decoder = AnsiDecoder() + + @property + def rich_proxied_file(self) -> IO[str]: + """Get proxied file.""" + return self.__file + + def __getattr__(self, name: str) -> Any: + return getattr(self.__file, name) + + def write(self, text: str) -> int: + if not isinstance(text, str): + raise TypeError(f"write() argument must be str, not {type(text).__name__}") + buffer = self.__buffer + lines: List[str] = [] + while text: + line, new_line, text = text.partition("\n") + if new_line: + lines.append("".join(buffer) + line) + del buffer[:] + else: + buffer.append(line) + break + if lines: + console = self.__console + with console: + output = Text("\n").join( + self.__ansi_decoder.decode_line(line) for line in lines + ) + console.print(output, markup=False, emoji=False, highlight=False) + return len(text) + + def flush(self) -> None: + buffer = self.__buffer + if buffer: + self.__console.print("".join(buffer)) + del buffer[:] diff --git a/rich/filesize.py b/rich/filesize.py new file mode 100644 index 0000000..4876823 --- /dev/null +++ b/rich/filesize.py @@ -0,0 +1,62 @@ +# coding: utf-8 +"""Functions for reporting filesizes. Borrowed from https://github.com/PyFilesystem/pyfilesystem2 + +The functions declared in this module should cover the different +usecases needed to generate a string representation of a file size +using several different units. Since there are many standards regarding +file size units, three different functions have been implemented. + +See Also: + * `Wikipedia: Binary prefix <https://en.wikipedia.org/wiki/Binary_prefix>`_ + +""" + +__all__ = ["decimal"] + +from typing import Iterable, List, Tuple + + +def _to_str(size: int, suffixes: Iterable[str], base: int) -> str: + if size == 1: + return "1 byte" + elif size < base: + return "{:,} bytes".format(size) + + for i, suffix in enumerate(suffixes, 2): # noqa: B007 + unit = base ** i + if size < unit: + break + return "{:,.1f} {}".format((base * size / unit), suffix) + + +def pick_unit_and_suffix(size: int, suffixes: List[str], base: int) -> Tuple[int, str]: + """Pick a suffix and base for the given size.""" + for i, suffix in enumerate(suffixes): + unit = base ** i + if size < unit * base: + break + return unit, suffix + + +def decimal(size: int) -> str: + """Convert a filesize in to a string (powers of 1000, SI prefixes). + + In this convention, ``1000 B = 1 kB``. + + This is typically the format used to advertise the storage + capacity of USB flash drives and the like (*256 MB* meaning + actually a storage capacity of more than *256 000 000 B*), + or used by **Mac OS X** since v10.6 to report file sizes. + + Arguments: + int (size): A file size. + + Returns: + `str`: A string containing a abbreviated file size and units. + + Example: + >>> filesize.decimal(30000) + '30.0 kB' + + """ + return _to_str(size, ("kB", "MB", "GB", "TB", "PB", "EB", "ZB", "YB"), 1000) diff --git a/rich/highlighter.py b/rich/highlighter.py new file mode 100644 index 0000000..37b36f6 --- /dev/null +++ b/rich/highlighter.py @@ -0,0 +1,131 @@ +from abc import ABC, abstractmethod +from typing import List, Union + +from .text import Text + + +def _combine_regex(*regexes: str) -> str: + """Combine a number of regexes in to a single regex. + + Returns: + str: New regex with all regexes ORed together. + """ + return "|".join(regexes) + + +class Highlighter(ABC): + """Abstract base class for highlighters.""" + + def __call__(self, text: Union[str, Text]) -> Text: + """Highlight a str or Text instance. + + Args: + text (Union[str, ~Text]): Text to highlight. + + Raises: + TypeError: If not called with text or str. + + Returns: + Text: A test instance with highlighting applied. + """ + if isinstance(text, str): + highlight_text = Text(text) + elif isinstance(text, Text): + highlight_text = text.copy() + else: + raise TypeError(f"str or Text instance required, not {text!r}") + self.highlight(highlight_text) + return highlight_text + + @abstractmethod + def highlight(self, text: Text) -> None: + """Apply highlighting in place to text. + + Args: + text (~Text): A text object highlight. + """ + + +class NullHighlighter(Highlighter): + """A highlighter object that doesn't highlight. + + May be used to disable highlighting entirely. + + """ + + def highlight(self, text: Text) -> None: + """Nothing to do""" + + +class RegexHighlighter(Highlighter): + """Applies highlighting from a list of regular expressions.""" + + highlights: List[str] = [] + base_style: str = "" + + def highlight(self, text: Text) -> None: + """Highlight :class:`rich.text.Text` using regular expressions. + + Args: + text (~Text): Text to highlighted. + + """ + + highlight_regex = text.highlight_regex + for re_highlight in self.highlights: + highlight_regex(re_highlight, style_prefix=self.base_style) + + +class ReprHighlighter(RegexHighlighter): + """Highlights the text typically produced from ``__repr__`` methods.""" + + base_style = "repr." + highlights = [ + r"(?P<tag_start>\<)(?P<tag_name>[\w\-\.\:]*)(?P<tag_contents>.*?)(?P<tag_end>\>)", + r"(?P<attrib_name>[\w_]{1,50})=(?P<attrib_value>\"?[\w_]+\"?)?", + _combine_regex( + r"(?P<ipv4>[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3})", + r"(?P<ipv6>([A-Fa-f0-9]{1,4}::?){1,7}[A-Fa-f0-9]{1,4})", + r"(?P<eui64>(?:[0-9A-Fa-f]{1,2}-){7}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{1,2}:){7}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{4}\.){3}[0-9A-Fa-f]{4})", + r"(?P<eui48>(?:[0-9A-Fa-f]{1,2}-){5}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{1,2}:){5}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{4}\.){2}[0-9A-Fa-f]{4})", + r"(?P<brace>[\{\[\(\)\]\}])", + r"(?P<bool_true>True)|(?P<bool_false>False)|(?P<none>None)", + r"(?P<ellipsis>\.\.\.)", + r"(?P<number>(?<!\w)\-?[0-9]+\.?[0-9]*(e[\-\+]?\d+?)?\b|0x[0-9a-fA-F]*)", + r"(?P<path>\B(\/[\w\.\-\_\+]+)*\/)(?P<filename>[\w\.\-\_\+]*)?", + r"(?<!\\)(?P<str>b?\'\'\'.*?(?<!\\)\'\'\'|b?\'.*?(?<!\\)\'|b?\"\"\".*?(?<!\\)\"\"\"|b?\".*?(?<!\\)\")", + r"(?P<uuid>[a-fA-F0-9]{8}\-[a-fA-F0-9]{4}\-[a-fA-F0-9]{4}\-[a-fA-F0-9]{4}\-[a-fA-F0-9]{12})", + r"(?P<url>https?:\/\/[0-9a-zA-Z\$\-\_\+\!`\(\)\,\.\?\/\;\:\&\=\%\#]*)", + ), + ] + + +if __name__ == "__main__": # pragma: no cover + from .console import Console + + console = Console() + console.print("[bold green]hello world![/bold green]") + console.print("'[bold green]hello world![/bold green]'") + + console.print(" /foo") + console.print("/foo/") + console.print("/foo/bar") + console.print("foo/bar/baz") + + console.print("/foo/bar/baz?foo=bar+egg&egg=baz") + console.print("/foo/bar/baz/") + console.print("/foo/bar/baz/egg") + console.print("/foo/bar/baz/egg.py") + console.print("/foo/bar/baz/egg.py word") + console.print(" /foo/bar/baz/egg.py word") + console.print("foo /foo/bar/baz/egg.py word") + console.print("foo /foo/bar/ba._++z/egg+.py word") + console.print("https://example.org?foo=bar#header") + + console.print(1234567.34) + console.print(1 / 2) + console.print(-1 / 123123123123) + + console.print( + "127.0.1.1 bar 192.168.1.4 2001:0db8:85a3:0000:0000:8a2e:0370:7334 foo" + ) diff --git a/rich/jupyter.py b/rich/jupyter.py new file mode 100644 index 0000000..f76380f --- /dev/null +++ b/rich/jupyter.py @@ -0,0 +1,79 @@ +from typing import Iterable, List, TYPE_CHECKING + +from . import get_console +from .segment import Segment +from .terminal_theme import DEFAULT_TERMINAL_THEME + +if TYPE_CHECKING: + from .console import RenderableType + +JUPYTER_HTML_FORMAT = """\ +<pre style="white-space:pre;overflow-x:auto;line-height:normal;font-family:Menlo,'DejaVu Sans Mono',consolas,'Courier New',monospace">{code}</pre> +""" + + +class JupyterRenderable: + """A shim to write html to Jupyter notebook.""" + + def __init__(self, html: str) -> None: + self.html = html + + @classmethod + def render(cls, rich_renderable: "RenderableType") -> str: + console = get_console() + segments = console.render(rich_renderable, console.options) + html = _render_segments(segments) + return html + + def _repr_html_(self) -> str: + return self.html + + +class JupyterMixin: + """Add to an Rich renderable to make it render in Jupyter notebook.""" + + def _repr_html_(self) -> str: + console = get_console() + segments = list(console.render(self, console.options)) # type: ignore + html = _render_segments(segments) + return html + + +def _render_segments(segments: Iterable[Segment]) -> str: + def escape(text: str) -> str: + """Escape html.""" + return text.replace("&", "&").replace("<", "<").replace(">", ">") + + fragments: List[str] = [] + append_fragment = fragments.append + theme = DEFAULT_TERMINAL_THEME + for text, style, is_control in Segment.simplify(segments): + if is_control: + continue + text = escape(text) + if style: + rule = style.get_html_style(theme) + text = f'<span style="{rule}">{text}</span>' if rule else text + if style.link: + text = f'<a href="{style.link}">{text}</a>' + append_fragment(text) + + code = "".join(fragments) + html = JUPYTER_HTML_FORMAT.format(code=code) + + return html + + +def display(segments: Iterable[Segment]) -> None: + """Render segments to Jupyter.""" + from IPython.display import display as ipython_display + + html = _render_segments(segments) + jupyter_renderable = JupyterRenderable(html) + ipython_display(jupyter_renderable) + + +def print(*args, **kwargs) -> None: + """Proxy for Console print.""" + console = get_console() + return console.print(*args, **kwargs) diff --git a/rich/layout.py b/rich/layout.py new file mode 100644 index 0000000..c528435 --- /dev/null +++ b/rich/layout.py @@ -0,0 +1,238 @@ +from .align import Align +from .console import Console, ConsoleOptions, RenderResult, RenderableType +from .highlighter import ReprHighlighter +from .panel import Panel +from .pretty import Pretty +from ._ratio import ratio_resolve +from .segment import Segment +from .style import StyleType + + +from typing import List, Optional, TYPE_CHECKING +from typing_extensions import Literal + +Direction = Literal["horizontal", "vertical"] + + +if TYPE_CHECKING: + from rich.tree import Tree + + +class _Placeholder: + """An internal renderable used as a Layout placeholder.""" + + highlighter = ReprHighlighter() + + def __init__(self, layout: "Layout", style: StyleType = "") -> None: + self.layout = layout + self.style = style + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + width = options.max_width + height = options.height or options.size.height + layout = self.layout + + layout_info = { + "size": layout.size, + "minimum_size": layout.minimum_size, + "ratio": layout.ratio, + "name": layout.name, + } + + title = ( + f"{layout.name!r} ({width} x {height})" + if layout.name + else f"({width} x {height})" + ) + yield Panel( + Align.center(Pretty(layout_info), vertical="middle"), + style=self.style, + title=self.highlighter(title), + border_style="blue", + ) + + +class Layout: + """A renderable to divide a fixed height in to rows or columns. + + Args: + renderable (RenderableType, optional): Renderable content, or None for placeholder. Defaults to None. + direction (str, optional): Direction of split, one of "vertical" or "horizontal". Defaults to "vertical". + size (int, optional): Optional fixed size of layout. Defaults to None. + minimum_size (int, optional): Minimum size of layout. Defaults to 1. + ratio (int, optional): Optional ratio for flexible layout. Defaults to 1. + name (str, optional): Optional identifier for Layout. Defaults to None. + visible (bool, optional): Visibility of layout. Defaults to True. + """ + + def __init__( + self, + renderable: RenderableType = None, + *, + direction: str = "vertical", + size: int = None, + minimum_size: int = 1, + ratio: int = 1, + name: str = None, + visible: bool = True, + ) -> None: + self._renderable = renderable or _Placeholder(self) + self.direction = direction + self.size = size + self.minimum_size = minimum_size + self.ratio = ratio + self.name = name + self.visible = visible + self._children: List[Layout] = [] + + def __repr__(self) -> str: + return f"Layout(size={self.size!r}, minimum_size={self.size!r}, ratio={self.ratio!r}, name={self.name!r}, visible={self.visible!r})" + + @property + def renderable(self) -> RenderableType: + """Layout renderable.""" + return self if self._children else self._renderable + + @property + def children(self) -> List["Layout"]: + """Gets (visible) layout children.""" + return [child for child in self._children if child.visible] + + def get(self, name: str) -> Optional["Layout"]: + """Get a named layout, or None if it doesn't exist. + + Args: + name (str): Name of layout. + + Returns: + Optional[Layout]: Layout instance or None if no layout was found. + """ + if self.name == name: + return self + else: + for child in self._children: + named_layout = child.get(name) + if named_layout is not None: + return named_layout + return None + + def __getitem__(self, name: str) -> "Layout": + layout = self.get(name) + if layout is None: + raise KeyError(f"No layout with name {name!r}") + return layout + + @property + def tree(self) -> "Tree": + """Get a tree renderable to show layout structure.""" + from rich.highlighter import ReprHighlighter + from rich.text import Text + from rich.tree import Tree + + highlighter = ReprHighlighter() + + def summary(layout) -> "Text": + name = repr(layout.name) + " " if layout.name else "" + direction = ( + ("➡" if layout.direction == "horizontal" else "⬇") + if layout._children + else "■" + ) + if layout.size: + _summary = highlighter(f"{direction} {name}(size={layout.size})") + else: + _summary = highlighter(f"{direction} {name}(ratio={layout.ratio})") + _summary.stylize("" if layout.visible else "dim") + return _summary + + layout = self + tree = Tree(summary(layout), highlight=True) + + def recurse(tree, layout): + for child in layout._children: + recurse(tree.add(summary(child)), child) + + recurse(tree, self) + return tree + + def split(self, *layouts, direction: Direction = None) -> None: + """Split the layout in to multiple sub-layours. + + Args: + *layouts (Layout): Positional arguments should be (sub) Layout instances. + direction (Direction, optional): One of "horizontal" or "vertical" or None for no change. Defaults to None. + """ + if direction is not None: + self.direction = direction + self._children.extend(layouts) + + def update(self, renderable: RenderableType) -> None: + """Update renderable. + + Args: + renderable (RenderableType): New renderable object. + """ + self._renderable = renderable + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + options = options.update(height=options.height or options.size.height) + if not self.children: + yield from console.render(self._renderable or "", options) + elif self.direction == "vertical": + yield from self._render_vertical(console, options) + elif self.direction == "horizontal": + yield from self._render_horizontal(console, options) + + def _render_horizontal( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + render_widths = ratio_resolve(options.max_width, self.children) + renders = [ + console.render_lines(child, options.update(width=render_width)) + for child, render_width in zip(self.children, render_widths) + ] + new_line = Segment.line() + for lines in zip(*renders): + for line in lines: + yield from line + yield new_line + + def _render_vertical( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + render_heights = ratio_resolve(options.height or console.height, self.children) + renders = [ + console.render_lines(child.renderable, options.update(height=render_height)) + for child, render_height in zip(self.children, render_heights) + ] + new_line = Segment.line() + for render in renders: + for line in render: + yield from line + yield new_line + + +if __name__ == "__main__": # type: ignore + from rich.console import Console + from rich.panel import Panel + + console = Console() + layout = Layout() + + layout.split( + Layout(name="header", size=3), + Layout(ratio=1, name="main"), + Layout(size=10, name="footer"), + ) + + layout["main"].split( + Layout(name="side"), Layout(name="body", ratio=2), direction="horizontal" + ) + + layout["side"].split(Layout(), Layout()) + + console.print(layout) diff --git a/rich/live.py b/rich/live.py new file mode 100644 index 0000000..696c2c7 --- /dev/null +++ b/rich/live.py @@ -0,0 +1,366 @@ +import sys +from threading import Event, RLock, Thread +from typing import IO, Any, Callable, List, Optional + +from . import get_console +from .console import Console, ConsoleRenderable, RenderableType, RenderHook +from .control import Control +from .file_proxy import FileProxy +from .jupyter import JupyterMixin +from .live_render import LiveRender, VerticalOverflowMethod +from .screen import Screen +from .text import Text + + +class _RefreshThread(Thread): + """A thread that calls refresh() at regular intervals.""" + + def __init__(self, live: "Live", refresh_per_second: float) -> None: + self.live = live + self.refresh_per_second = refresh_per_second + self.done = Event() + super().__init__(daemon=True) + + def stop(self) -> None: + self.done.set() + + def run(self) -> None: + while not self.done.wait(1 / self.refresh_per_second): + with self.live._lock: + if not self.done.is_set(): + self.live.refresh() + + +class Live(JupyterMixin, RenderHook): + """Renders an auto-updating live display of any given renderable. + + Args: + renderable (RenderableType, optional): The renderable to live display. Defaults to displaying nothing. + console (Console, optional): Optional Console instance. Default will an internal Console instance writing to stdout. + screen (bool, optional): Enable alternate screen mode. Defaults to False. + auto_refresh (bool, optional): Enable auto refresh. If disabled, you will need to call `refresh()` or `update()` with refresh flag. Defaults to True + refresh_per_second (float, optional): Number of times per second to refresh the live display. Defaults to 1. + transient (bool, optional): Clear the renderable on exit. Defaults to False. + redirect_stdout (bool, optional): Enable redirection of stdout, so ``print`` may be used. Defaults to True. + redirect_stderr (bool, optional): Enable redirection of stderr. Defaults to True. + vertical_overflow (VerticalOverflowMethod, optional): How to handle renderable when it is too tall for the console. Defaults to "ellipsis". + get_renderable (Callable[[], RenderableType], optional): Optional callable to get renderable. Defaults to None. + """ + + def __init__( + self, + renderable: RenderableType = None, + *, + console: Console = None, + screen: bool = False, + auto_refresh: bool = True, + refresh_per_second: float = 4, + transient: bool = False, + redirect_stdout: bool = True, + redirect_stderr: bool = True, + vertical_overflow: VerticalOverflowMethod = "ellipsis", + get_renderable: Callable[[], RenderableType] = None, + ) -> None: + assert refresh_per_second > 0, "refresh_per_second must be > 0" + self._renderable = renderable + self.console = console if console is not None else get_console() + self._screen = screen + self._alt_screen = False + + self._redirect_stdout = redirect_stdout + self._redirect_stderr = redirect_stderr + self._restore_stdout: Optional[IO[str]] = None + self._restore_stderr: Optional[IO[str]] = None + + self._lock = RLock() + self.ipy_widget: Optional[Any] = None + self.auto_refresh = auto_refresh + self._started: bool = False + self.transient = transient + + self._refresh_thread: Optional[_RefreshThread] = None + self.refresh_per_second = refresh_per_second + + self.vertical_overflow = vertical_overflow + self._get_renderable = get_renderable + self._live_render = LiveRender( + self.get_renderable(), vertical_overflow=vertical_overflow + ) + # cant store just clear_control as the live_render shape is lazily computed on render + + def get_renderable(self) -> RenderableType: + renderable = ( + self._get_renderable() + if self._get_renderable is not None + else self._renderable + ) + return renderable or "" + + def start(self, refresh=False) -> None: + """Start live rendering display. + + Args: + refresh (bool, optional): Also refresh. Defaults to False. + """ + with self._lock: + if self._started: + return + self.console.set_live(self) + self._started = True + if self._screen: + self._alt_screen = self.console.set_alt_screen(True) + self.console.show_cursor(False) + self._enable_redirect_io() + self.console.push_render_hook(self) + if refresh: + self.refresh() + if self.auto_refresh: + self._refresh_thread = _RefreshThread(self, self.refresh_per_second) + self._refresh_thread.start() + + def stop(self) -> None: + """Stop live rendering display.""" + with self._lock: + if not self._started: + return + self.console.clear_live() + self._started = False + try: + if self.auto_refresh and self._refresh_thread is not None: + self._refresh_thread.stop() + # allow it to fully render on the last even if overflow + self.vertical_overflow = "visible" + if not self._alt_screen: + if not self.console.is_jupyter: + self.refresh() + if self.console.is_terminal: + self.console.line() + finally: + self._disable_redirect_io() + self.console.pop_render_hook() + self.console.show_cursor(True) + if self._alt_screen: + self.console.set_alt_screen(False) + + if self._refresh_thread is not None: + self._refresh_thread.join() + self._refresh_thread = None + if self.transient and not self._screen: + self.console.control(self._live_render.restore_cursor()) + if self.ipy_widget is not None: # pragma: no cover + if self.transient: + self.ipy_widget.close() + else: + # jupyter last refresh must occur after console pop render hook + # i am not sure why this is needed + self.refresh() + + def __enter__(self) -> "Live": + self.start(refresh=self._renderable is not None) + return self + + def __exit__(self, exc_type, exc_val, exc_tb) -> None: + self.stop() + + def _enable_redirect_io(self): + """Enable redirecting of stdout / stderr.""" + if self.console.is_terminal: + if self._redirect_stdout and not isinstance(sys.stdout, FileProxy): # type: ignore + self._restore_stdout = sys.stdout + sys.stdout = FileProxy(self.console, sys.stdout) + if self._redirect_stderr and not isinstance(sys.stderr, FileProxy): # type: ignore + self._restore_stderr = sys.stderr + sys.stderr = FileProxy(self.console, sys.stderr) + + def _disable_redirect_io(self): + """Disable redirecting of stdout / stderr.""" + if self._restore_stdout: + sys.stdout = self._restore_stdout + self._restore_stdout = None + if self._restore_stderr: + sys.stderr = self._restore_stderr + self._restore_stderr = None + + @property + def renderable(self) -> RenderableType: + """Get the renderable that is being displayed + + Returns: + RenderableType: Displayed renderable. + """ + renderable = self.get_renderable() + return Screen(renderable) if self._alt_screen else renderable + + def update(self, renderable: RenderableType, *, refresh: bool = False) -> None: + """Update the renderable that is being displayed + + Args: + renderable (RenderableType): New renderable to use. + refresh (bool, optional): Refresh the display. Defaults to False. + """ + with self._lock: + self._renderable = renderable + if refresh: + self.refresh() + + def refresh(self) -> None: + """Update the display of the Live Render.""" + self._live_render.set_renderable(self.renderable) + if self.console.is_jupyter: # pragma: no cover + try: + from IPython.display import display + from ipywidgets import Output + except ImportError: + import warnings + + warnings.warn('install "ipywidgets" for Jupyter support') + else: + with self._lock: + if self.ipy_widget is None: + self.ipy_widget = Output() + display(self.ipy_widget) + + with self.ipy_widget: + self.ipy_widget.clear_output(wait=True) + self.console.print(self._live_render.renderable) + elif self.console.is_terminal and not self.console.is_dumb_terminal: + with self._lock, self.console: + self.console.print(Control("")) + elif ( + not self._started and not self.transient + ): # if it is finished allow files or dumb-terminals to see final result + with self.console: + self.console.print(Control("")) + + def process_renderables( + self, renderables: List[ConsoleRenderable] + ) -> List[ConsoleRenderable]: + """Process renderables to restore cursor and display progress.""" + self._live_render.vertical_overflow = self.vertical_overflow + if self.console.is_interactive: + # lock needs acquiring as user can modify live_render renderable at any time unlike in Progress. + with self._lock: + # determine the control command needed to clear previous rendering + reset = ( + Control.home() + if self._alt_screen + else self._live_render.position_cursor() + ) + renderables = [ + reset, + *renderables, + self._live_render, + ] + elif ( + not self._started and not self.transient + ): # if it is finished render the final output for files or dumb_terminals + renderables = [*renderables, self._live_render] + + return renderables + + +if __name__ == "__main__": # pragma: no cover + import random + import time + from itertools import cycle + from typing import Dict, List, Tuple + + from .align import Align + from .console import Console + from .live import Live + from .panel import Panel + from .rule import Rule + from .syntax import Syntax + from .table import Table + + console = Console() + + syntax = Syntax( + '''def loop_last(values: Iterable[T]) -> Iterable[Tuple[bool, T]]: + """Iterate and generate a tuple with a flag for last value.""" + iter_values = iter(values) + try: + previous_value = next(iter_values) + except StopIteration: + return + for value in iter_values: + yield False, previous_value + previous_value = value + yield True, previous_value''', + "python", + line_numbers=True, + ) + + table = Table("foo", "bar", "baz") + table.add_row("1", "2", "3") + + progress_renderables = [ + "You can make the terminal shorter and taller to see the live table hide" + "Text may be printed while the progress bars are rendering.", + Panel("In fact, [i]any[/i] renderable will work"), + "Such as [magenta]tables[/]...", + table, + "Pretty printed structures...", + {"type": "example", "text": "Pretty printed"}, + "Syntax...", + syntax, + Rule("Give it a try!"), + ] + + examples = cycle(progress_renderables) + + exchanges = [ + "SGD", + "MYR", + "EUR", + "USD", + "AUD", + "JPY", + "CNH", + "HKD", + "CAD", + "INR", + "DKK", + "GBP", + "RUB", + "NZD", + "MXN", + "IDR", + "TWD", + "THB", + "VND", + ] + with Live(console=console) as live_table: + exchange_rate_dict: Dict[Tuple[str, str], float] = {} + + for index in range(100): + select_exchange = exchanges[index % len(exchanges)] + + for exchange in exchanges: + if exchange == select_exchange: + continue + time.sleep(0.4) + if random.randint(0, 10) < 1: + console.log(next(examples)) + exchange_rate_dict[(select_exchange, exchange)] = 200 / ( + (random.random() * 320) + 1 + ) + if len(exchange_rate_dict) > len(exchanges) - 1: + exchange_rate_dict.pop(list(exchange_rate_dict.keys())[0]) + table = Table(title="Exchange Rates") + + table.add_column("Source Currency") + table.add_column("Destination Currency") + table.add_column("Exchange Rate") + + for ((source, dest), exchange_rate) in exchange_rate_dict.items(): + table.add_row( + source, + dest, + Text( + f"{exchange_rate:.4f}", + style="red" if exchange_rate < 1.0 else "green", + ), + ) + + live_table.update(Align.center(table)) diff --git a/rich/live_render.py b/rich/live_render.py new file mode 100644 index 0000000..8fea58b --- /dev/null +++ b/rich/live_render.py @@ -0,0 +1,93 @@ +from typing import Optional, Tuple + +from typing_extensions import Literal + +from ._loop import loop_last +from .console import Console, ConsoleOptions, RenderableType, RenderResult +from .control import Control +from .segment import Segment +from .style import StyleType +from .text import Text + +VerticalOverflowMethod = Literal["crop", "ellipsis", "visible"] + + +class LiveRender: + """Creates a renderable that may be updated. + + Args: + renderable (RenderableType): Any renderable object. + style (StyleType, optional): An optional style to apply to the renderable. Defaults to "". + """ + + def __init__( + self, + renderable: RenderableType, + style: StyleType = "", + vertical_overflow: VerticalOverflowMethod = "ellipsis", + ) -> None: + self.renderable = renderable + self.style = style + self.vertical_overflow = vertical_overflow + self._shape: Optional[Tuple[int, int]] = None + + def set_renderable(self, renderable: RenderableType) -> None: + """Set a new renderable. + + Args: + renderable (RenderableType): Any renderable object, including str. + """ + self.renderable = renderable + + def position_cursor(self) -> Control: + """Get control codes to move cursor to beginning of live render. + + Returns: + Control: A control instance that may be printed. + """ + if self._shape is not None: + _, height = self._shape + return Control("\r\x1b[2K" + "\x1b[1A\x1b[2K" * (height - 1)) + return Control("") + + def restore_cursor(self) -> Control: + """Get control codes to clear the render and restore the cursor to its previous position. + + Returns: + Control: A Control instance that may be printed. + """ + if self._shape is not None: + _, height = self._shape + return Control("\r" + "\x1b[1A\x1b[2K" * height) + return Control("") + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + _Segment = Segment + style = console.get_style(self.style) + lines = console.render_lines(self.renderable, options, style=style, pad=False) + shape = _Segment.get_shape(lines) + + _, height = shape + if height > options.size.height: + if self.vertical_overflow == "crop": + lines = lines[: options.size.height] + shape = _Segment.get_shape(lines) + elif self.vertical_overflow == "ellipsis": + lines = lines[: (options.size.height - 1)] + overflow_text = Text( + "...", + overflow="crop", + justify="center", + end="", + style="live.ellipsis", + ) + lines.append(list(console.render(overflow_text))) + shape = _Segment.get_shape(lines) + self._shape = shape + + for last, line in loop_last(lines): + yield from line + if not last: + yield _Segment.line() diff --git a/rich/logging.py b/rich/logging.py new file mode 100644 index 0000000..49c7498 --- /dev/null +++ b/rich/logging.py @@ -0,0 +1,256 @@ +import logging +from datetime import datetime +from logging import Handler, LogRecord +from pathlib import Path +from typing import ClassVar, List, Optional, Type, Union + +from . import get_console +from ._log_render import LogRender, FormatTimeCallable +from .console import Console, ConsoleRenderable +from .highlighter import Highlighter, ReprHighlighter +from .text import Text +from .traceback import Traceback + + +class RichHandler(Handler): + """A logging handler that renders output with Rich. The time / level / message and file are displayed in columns. + The level is color coded, and the message is syntax highlighted. + + Note: + Be careful when enabling console markup in log messages if you have configured logging for libraries not + under your control. If a dependency writes messages containing square brackets, it may not produce the intended output. + + Args: + level (Union[int, str], optional): Log level. Defaults to logging.NOTSET. + console (:class:`~rich.console.Console`, optional): Optional console instance to write logs. + Default will use a global console instance writing to stdout. + show_time (bool, optional): Show a column for the time. Defaults to True. + show_level (bool, optional): Show a column for the level. Defaults to True. + show_path (bool, optional): Show the path to the original log call. Defaults to True. + enable_link_path (bool, optional): Enable terminal link of path column to file. Defaults to True. + highlighter (Highlighter, optional): Highlighter to style log messages, or None to use ReprHighlighter. Defaults to None. + markup (bool, optional): Enable console markup in log messages. Defaults to False. + rich_tracebacks (bool, optional): Enable rich tracebacks with syntax highlighting and formatting. Defaults to False. + tracebacks_width (Optional[int], optional): Number of characters used to render tracebacks, or None for full width. Defaults to None. + tracebacks_extra_lines (int, optional): Additional lines of code to render tracebacks, or None for full width. Defaults to None. + tracebacks_theme (str, optional): Override pygments theme used in traceback. + tracebacks_word_wrap (bool, optional): Enable word wrapping of long tracebacks lines. Defaults to True. + tracebacks_show_locals (bool, optional): Enable display of locals in tracebacks. Defaults to False. + locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. + Defaults to 10. + locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80. + log_time_format (Union[str, TimeFormatterCallable], optional): If ``log_time`` is enabled, either string for strftime or callable that formats the time. Defaults to "[%x %X] ". + """ + + KEYWORDS: ClassVar[Optional[List[str]]] = [ + "GET", + "POST", + "HEAD", + "PUT", + "DELETE", + "OPTIONS", + "TRACE", + "PATCH", + ] + HIGHLIGHTER_CLASS: ClassVar[Type[Highlighter]] = ReprHighlighter + + def __init__( + self, + level: Union[int, str] = logging.NOTSET, + console: Console = None, + *, + show_time: bool = True, + show_level: bool = True, + show_path: bool = True, + enable_link_path: bool = True, + highlighter: Highlighter = None, + markup: bool = False, + rich_tracebacks: bool = False, + tracebacks_width: Optional[int] = None, + tracebacks_extra_lines: int = 3, + tracebacks_theme: Optional[str] = None, + tracebacks_word_wrap: bool = True, + tracebacks_show_locals: bool = False, + locals_max_length: int = 10, + locals_max_string: int = 80, + log_time_format: Union[str, FormatTimeCallable] = "[%x %X]", + ) -> None: + super().__init__(level=level) + self.console = console or get_console() + self.highlighter = highlighter or self.HIGHLIGHTER_CLASS() + self._log_render = LogRender( + show_time=show_time, + show_level=show_level, + show_path=show_path, + time_format=log_time_format, + level_width=None, + ) + self.enable_link_path = enable_link_path + self.markup = markup + self.rich_tracebacks = rich_tracebacks + self.tracebacks_width = tracebacks_width + self.tracebacks_extra_lines = tracebacks_extra_lines + self.tracebacks_theme = tracebacks_theme + self.tracebacks_word_wrap = tracebacks_word_wrap + self.tracebacks_show_locals = tracebacks_show_locals + self.locals_max_length = locals_max_length + self.locals_max_string = locals_max_string + + def get_level_text(self, record: LogRecord) -> Text: + """Get the level name from the record. + + Args: + record (LogRecord): LogRecord instance. + + Returns: + Text: A tuple of the style and level name. + """ + level_name = record.levelname + level_text = Text.styled( + level_name.ljust(8), f"logging.level.{level_name.lower()}" + ) + return level_text + + def emit(self, record: LogRecord) -> None: + """Invoked by logging.""" + message = self.format(record) + + traceback = None + if ( + self.rich_tracebacks + and record.exc_info + and record.exc_info != (None, None, None) + ): + exc_type, exc_value, exc_traceback = record.exc_info + assert exc_type is not None + assert exc_value is not None + traceback = Traceback.from_exception( + exc_type, + exc_value, + exc_traceback, + width=self.tracebacks_width, + extra_lines=self.tracebacks_extra_lines, + theme=self.tracebacks_theme, + word_wrap=self.tracebacks_word_wrap, + show_locals=self.tracebacks_show_locals, + locals_max_length=self.locals_max_length, + locals_max_string=self.locals_max_string, + ) + message = record.getMessage() + + message_renderable = self.render_message(record, message) + log_renderable = self.render( + record=record, traceback=traceback, message_renderable=message_renderable + ) + self.console.print(log_renderable) + + def render_message(self, record: LogRecord, message: str) -> "ConsoleRenderable": + """Render message text in to Text. + + record (LogRecord): logging Record. + message (str): String cotaining log message. + + Returns: + ConsoleRenderable: Renderable to display log message. + """ + use_markup = ( + getattr(record, "markup") if hasattr(record, "markup") else self.markup + ) + message_text = Text.from_markup(message) if use_markup else Text(message) + if self.highlighter: + message_text = self.highlighter(message_text) + if self.KEYWORDS: + message_text.highlight_words(self.KEYWORDS, "logging.keyword") + return message_text + + def render( + self, + *, + record: LogRecord, + traceback: Optional[Traceback], + message_renderable: "ConsoleRenderable", + ) -> "ConsoleRenderable": + """Render log for display. + + Args: + record (LogRecord): logging Record. + traceback (Optional[Traceback]): Traceback instance or None for no Traceback. + message_renderable (ConsoleRenderable): Renderable (typically Text) containing log message contents. + + Returns: + ConsoleRenderable: Renderable to display log. + """ + path = Path(record.pathname).name + level = self.get_level_text(record) + time_format = None if self.formatter is None else self.formatter.datefmt + log_time = datetime.fromtimestamp(record.created) + + log_renderable = self._log_render( + self.console, + [message_renderable] if not traceback else [message_renderable, traceback], + log_time=log_time, + time_format=time_format, + level=level, + path=path, + line_no=record.lineno, + link_path=record.pathname if self.enable_link_path else None, + ) + return log_renderable + + +if __name__ == "__main__": # pragma: no cover + from time import sleep + + FORMAT = "%(message)s" + # FORMAT = "%(asctime)-15s - %(level) - %(message)s" + logging.basicConfig( + level="NOTSET", + format=FORMAT, + datefmt="[%X]", + handlers=[RichHandler(rich_tracebacks=True, tracebacks_show_locals=True)], + ) + log = logging.getLogger("rich") + + log.info("Server starting...") + log.info("Listening on http://127.0.0.1:8080") + sleep(1) + + log.info("GET /index.html 200 1298") + log.info("GET /imgs/backgrounds/back1.jpg 200 54386") + log.info("GET /css/styles.css 200 54386") + log.warning("GET /favicon.ico 404 242") + sleep(1) + + log.debug( + "JSONRPC request\n--> %r\n<-- %r", + { + "version": "1.1", + "method": "confirmFruitPurchase", + "params": [["apple", "orange", "mangoes", "pomelo"], 1.123], + "id": "194521489", + }, + {"version": "1.1", "result": True, "error": None, "id": "194521489"}, + ) + log.debug( + "Loading configuration file /adasd/asdasd/qeqwe/qwrqwrqwr/sdgsdgsdg/werwerwer/dfgerert/ertertert/ertetert/werwerwer" + ) + log.error("Unable to find 'pomelo' in database!") + log.info("POST /jsonrpc/ 200 65532") + log.info("POST /admin/ 401 42234") + log.warning("password was rejected for admin site.") + + def divide(): + number = 1 + divisor = 0 + foos = ["foo"] * 100 + log.debug("in divide") + try: + number / divisor + except: + log.exception("An error of some kind occurred!") + + divide() + sleep(1) + log.critical("Out of memory!") + log.info("Server exited with code=-1") + log.info("[bold]EXITING...[/bold]", extra=dict(markup=True)) diff --git a/rich/markdown.py b/rich/markdown.py new file mode 100644 index 0000000..761215d --- /dev/null +++ b/rich/markdown.py @@ -0,0 +1,620 @@ +from typing import Any, ClassVar, Dict, List, Optional, Type, Union + +from commonmark.blocks import Parser + +from . import box +from ._loop import loop_first +from ._stack import Stack +from .console import Console, ConsoleOptions, JustifyMethod, RenderResult, Segment +from .containers import Renderables +from .jupyter import JupyterMixin +from .panel import Panel +from .rule import Rule +from .style import Style, StyleStack +from .syntax import Syntax +from .text import Text, TextType + + +class MarkdownElement: + + new_line: ClassVar[bool] = True + + @classmethod + def create(cls, markdown: "Markdown", node: Any) -> "MarkdownElement": + """Factory to create markdown element, + + Args: + markdown (Markdown): THe parent Markdown object. + node (Any): A node from Pygments. + + Returns: + MarkdownElement: A new markdown element + """ + return cls() + + def on_enter(self, context: "MarkdownContext"): + """Called when the node is entered. + + Args: + context (MarkdownContext): The markdown context. + """ + + def on_text(self, context: "MarkdownContext", text: TextType) -> None: + """Called when text is parsed. + + Args: + context (MarkdownContext): The markdown context. + """ + + def on_leave(self, context: "MarkdownContext") -> None: + """Called when the parser leaves the element. + + Args: + context (MarkdownContext): [description] + """ + + def on_child_close( + self, context: "MarkdownContext", child: "MarkdownElement" + ) -> bool: + """Called when a child element is closed. + + This method allows a parent element to take over rendering of its children. + + Args: + context (MarkdownContext): The markdown context. + child (MarkdownElement): The child markdown element. + + Returns: + bool: Return True to render the element, or False to not render the element. + """ + return True + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + return () + + +class UnknownElement(MarkdownElement): + """An unknown element. + + Hopefully there will be no unknown elements, and we will have a MarkdownElement for + everything in the document. + + """ + + +class TextElement(MarkdownElement): + """Base class for elements that render text.""" + + style_name = "none" + + def on_enter(self, context: "MarkdownContext") -> None: + self.style = context.enter_style(self.style_name) + self.text = Text(justify="left") + + def on_text(self, context: "MarkdownContext", text: TextType) -> None: + self.text.append(text, context.current_style if isinstance(text, str) else None) + + def on_leave(self, context: "MarkdownContext") -> None: + context.leave_style() + + +class Paragraph(TextElement): + """A Paragraph.""" + + style_name = "markdown.paragraph" + justify: JustifyMethod + + @classmethod + def create(cls, markdown: "Markdown", node) -> "Paragraph": + return cls(justify=markdown.justify or "left") + + def __init__(self, justify: JustifyMethod) -> None: + self.justify = justify + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + self.text.justify = self.justify + yield self.text + + +class Heading(TextElement): + """A heading.""" + + @classmethod + def create(cls, markdown: "Markdown", node: Any) -> "Heading": + heading = cls(node.level) + return heading + + def on_enter(self, context: "MarkdownContext") -> None: + self.text = Text() + context.enter_style(self.style_name) + + def __init__(self, level: int) -> None: + self.level = level + self.style_name = f"markdown.h{level}" + super().__init__() + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + text = self.text + text.justify = "center" + if self.level == 1: + # Draw a border around h1s + yield Panel( + text, + box=box.DOUBLE, + style="markdown.h1.border", + ) + else: + # Styled text for h2 and beyond + if self.level == 2: + yield Text("") + yield text + + +class CodeBlock(TextElement): + """A code block with syntax highlighting.""" + + style_name = "markdown.code_block" + + @classmethod + def create(cls, markdown: "Markdown", node: Any) -> "CodeBlock": + node_info = node.info or "" + lexer_name = node_info.partition(" ")[0] + return cls(lexer_name or "default", markdown.code_theme) + + def __init__(self, lexer_name: str, theme: str) -> None: + self.lexer_name = lexer_name + self.theme = theme + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + code = str(self.text).rstrip() + syntax = Panel( + Syntax(code, self.lexer_name, theme=self.theme), + border_style="dim", + box=box.SQUARE, + ) + yield syntax + + +class BlockQuote(TextElement): + """A block quote.""" + + style_name = "markdown.block_quote" + + def __init__(self) -> None: + self.elements: Renderables = Renderables() + + def on_child_close( + self, context: "MarkdownContext", child: "MarkdownElement" + ) -> bool: + self.elements.append(child) + return False + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + render_options = options.update(width=options.max_width - 4) + lines = console.render_lines(self.elements, render_options, style=self.style) + style = self.style + new_line = Segment("\n") + padding = Segment("▌ ", style) + for line in lines: + yield padding + yield from line + yield new_line + + +class HorizontalRule(MarkdownElement): + """A horizontal rule to divide sections.""" + + new_line = False + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + style = console.get_style("markdown.hr", default="none") + yield Rule(style=style) + + +class ListElement(MarkdownElement): + """A list element.""" + + @classmethod + def create(cls, markdown: "Markdown", node: Any) -> "ListElement": + list_data = node.list_data + return cls(list_data["type"], list_data["start"]) + + def __init__(self, list_type: str, list_start: Optional[int]) -> None: + self.items: List[ListItem] = [] + self.list_type = list_type + self.list_start = list_start + + def on_child_close( + self, context: "MarkdownContext", child: "MarkdownElement" + ) -> bool: + assert isinstance(child, ListItem) + self.items.append(child) + return False + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + if self.list_type == "bullet": + for item in self.items: + yield from item.render_bullet(console, options) + else: + number = 1 if self.list_start is None else self.list_start + last_number = number + len(self.items) + for item in self.items: + yield from item.render_number(console, options, number, last_number) + number += 1 + + +class ListItem(TextElement): + """An item in a list.""" + + style_name = "markdown.item" + + def __init__(self) -> None: + self.elements: Renderables = Renderables() + + def on_child_close( + self, context: "MarkdownContext", child: "MarkdownElement" + ) -> bool: + self.elements.append(child) + return False + + def render_bullet(self, console: Console, options: ConsoleOptions) -> RenderResult: + render_options = options.update(width=options.max_width - 3) + lines = console.render_lines(self.elements, render_options, style=self.style) + bullet_style = console.get_style("markdown.item.bullet", default="none") + + bullet = Segment(" • ", bullet_style) + padding = Segment(" " * 3, bullet_style) + new_line = Segment("\n") + for first, line in loop_first(lines): + yield bullet if first else padding + yield from line + yield new_line + + def render_number( + self, console: Console, options: ConsoleOptions, number: int, last_number: int + ) -> RenderResult: + number_width = len(str(last_number)) + 2 + render_options = options.update(width=options.max_width - number_width) + lines = console.render_lines(self.elements, render_options, style=self.style) + number_style = console.get_style("markdown.item.number", default="none") + + new_line = Segment("\n") + padding = Segment(" " * number_width, number_style) + numeral = Segment(f"{number}".rjust(number_width - 1) + " ", number_style) + for first, line in loop_first(lines): + yield numeral if first else padding + yield from line + yield new_line + + +class ImageItem(TextElement): + """Renders a placeholder for an image.""" + + new_line = False + + @classmethod + def create(cls, markdown: "Markdown", node: Any) -> "MarkdownElement": + """Factory to create markdown element, + + Args: + markdown (Markdown): THe parent Markdown object. + node (Any): A node from Pygments. + + Returns: + MarkdownElement: A new markdown element + """ + return cls(node.destination, markdown.hyperlinks) + + def __init__(self, destination: str, hyperlinks: bool) -> None: + self.destination = destination + self.hyperlinks = hyperlinks + self.link: Optional[str] = None + super().__init__() + + def on_enter(self, context: "MarkdownContext") -> None: + self.link = context.current_style.link + self.text = Text(justify="left") + super().on_enter(context) + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + link_style = Style(link=self.link or self.destination or None) + title = self.text or Text(self.destination.strip("/").rsplit("/", 1)[-1]) + if self.hyperlinks: + title.stylize(link_style) + yield Text.assemble("🌆 ", title, " ", end="") + + +class MarkdownContext: + """Manages the console render state.""" + + def __init__( + self, + console: Console, + options: ConsoleOptions, + style: Style, + inline_code_lexer: str = None, + inline_code_theme: str = "monokai", + ) -> None: + self.console = console + self.options = options + self.style_stack: StyleStack = StyleStack(style) + self.stack: Stack[MarkdownElement] = Stack() + + self._syntax: Optional[Syntax] = None + if inline_code_lexer is not None: + self._syntax = Syntax("", inline_code_lexer, theme=inline_code_theme) + + @property + def current_style(self) -> Style: + """Current style which is the product of all styles on the stack.""" + return self.style_stack.current + + def on_text(self, text: str, node_type: str) -> None: + """Called when the parser visits text.""" + if node_type == "code" and self._syntax is not None: + highlight_text = self._syntax.highlight(text) + highlight_text.rstrip() + self.stack.top.on_text( + self, Text.assemble(highlight_text, style=self.style_stack.current) + ) + else: + self.stack.top.on_text(self, text) + + def enter_style(self, style_name: Union[str, Style]) -> Style: + """Enter a style context.""" + style = self.console.get_style(style_name, default="none") + self.style_stack.push(style) + return self.current_style + + def leave_style(self) -> Style: + """Leave a style context.""" + style = self.style_stack.pop() + return style + + +class Markdown(JupyterMixin): + """A Markdown renderable. + + Args: + markup (str): A string containing markdown. + code_theme (str, optional): Pygments theme for code blocks. Defaults to "monokai". + justify (JustifyMethod, optional): Justify value for paragraphs. Defaults to None. + style (Union[str, Style], optional): Optional style to apply to markdown. + hyperlinks (bool, optional): Enable hyperlinks. Defaults to ``True``. + inline_code_lexer: (str, optional): Lexer to use if inline code highlighting is + enabled. Defaults to "python". + inline_code_theme: (Optional[str], optional): Pygments theme for inline code + highlighting, or None for no highlighting. Defaults to None. + """ + + elements: ClassVar[Dict[str, Type[MarkdownElement]]] = { + "paragraph": Paragraph, + "heading": Heading, + "code_block": CodeBlock, + "block_quote": BlockQuote, + "thematic_break": HorizontalRule, + "list": ListElement, + "item": ListItem, + "image": ImageItem, + } + inlines = {"emph", "strong", "code", "strike"} + + def __init__( + self, + markup: str, + code_theme: str = "monokai", + justify: JustifyMethod = None, + style: Union[str, Style] = "none", + hyperlinks: bool = True, + inline_code_lexer: str = None, + inline_code_theme: str = None, + ) -> None: + self.markup = markup + parser = Parser() + self.parsed = parser.parse(markup) + self.code_theme = code_theme + self.justify = justify + self.style = style + self.hyperlinks = hyperlinks + self.inline_code_lexer = inline_code_lexer + self.inline_code_theme = inline_code_theme or code_theme + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + """Render markdown to the console.""" + style = console.get_style(self.style, default="none") + context = MarkdownContext( + console, + options, + style, + inline_code_lexer=self.inline_code_lexer, + inline_code_theme=self.inline_code_theme, + ) + nodes = self.parsed.walker() + inlines = self.inlines + new_line = False + for current, entering in nodes: + node_type = current.t + if node_type in ("html_inline", "html_block", "text"): + context.on_text(current.literal.replace("\n", " "), node_type) + elif node_type == "linebreak": + if entering: + context.on_text("\n", node_type) + elif node_type == "softbreak": + if entering: + context.on_text(" ", node_type) + elif node_type == "link": + if entering: + link_style = console.get_style("markdown.link", default="none") + if self.hyperlinks: + link_style += Style(link=current.destination) + context.enter_style(link_style) + else: + context.leave_style() + if not self.hyperlinks: + context.on_text(" (", node_type) + style = Style(underline=True) + console.get_style( + "markdown.link_url", default="none" + ) + context.enter_style(style) + context.on_text(current.destination, node_type) + context.leave_style() + context.on_text(")", node_type) + elif node_type in inlines: + if current.is_container(): + if entering: + context.enter_style(f"markdown.{node_type}") + else: + context.leave_style() + else: + context.enter_style(f"markdown.{node_type}") + if current.literal: + context.on_text(current.literal, node_type) + context.leave_style() + else: + element_class = self.elements.get(node_type) or UnknownElement + if current.is_container(): + if entering: + element = element_class.create(self, current) + context.stack.push(element) + element.on_enter(context) + else: + element = context.stack.pop() + if context.stack: + if context.stack.top.on_child_close(context, element): + if new_line: + yield Segment("\n") + yield from console.render(element, context.options) + element.on_leave(context) + else: + element.on_leave(context) + else: + element.on_leave(context) + yield from console.render(element, context.options) + new_line = element.new_line + else: + element = element_class.create(self, current) + + context.stack.push(element) + element.on_enter(context) + if current.literal: + element.on_text(context, current.literal.rstrip()) + context.stack.pop() + if new_line: + yield Segment("\n") + yield from console.render(element, context.options) + element.on_leave(context) + new_line = element.new_line + + +if __name__ == "__main__": # pragma: no cover + + import argparse + import sys + + parser = argparse.ArgumentParser( + description="Render Markdown to the console with Rich" + ) + parser.add_argument( + "path", + metavar="PATH", + nargs="?", + help="path to markdown file", + ) + parser.add_argument( + "-c", + "--force-color", + dest="force_color", + action="store_true", + default=None, + help="force color for non-terminals", + ) + parser.add_argument( + "-t", + "--code-theme", + dest="code_theme", + default="monokai", + help="pygments code theme", + ) + parser.add_argument( + "-i", + "--inline-code-lexer", + dest="inline_code_lexer", + default=None, + help="inline_code_lexer", + ) + parser.add_argument( + "-y", + "--hyperlinks", + dest="hyperlinks", + action="store_true", + help="enable hyperlinks", + ) + parser.add_argument( + "-w", + "--width", + type=int, + dest="width", + default=None, + help="width of output (default will auto-detect)", + ) + parser.add_argument( + "-j", + "--justify", + dest="justify", + action="store_true", + help="enable full text justify", + ) + parser.add_argument( + "-p", + "--page", + dest="page", + action="store_true", + help="use pager to scroll output", + ) + args = parser.parse_args() + + from rich.console import Console + + if not args.path or args.path == "-": + markdown_body = sys.stdin.read() + else: + with open(args.path, "rt", encoding="utf-8") as markdown_file: + markdown_body = markdown_file.read() + markdown = Markdown( + markdown_body, + justify="full" if args.justify else "left", + code_theme=args.code_theme, + hyperlinks=args.hyperlinks, + inline_code_lexer=args.inline_code_lexer, + ) + if args.page: + import pydoc + import io + + console = Console( + file=io.StringIO(), force_terminal=args.force_color, width=args.width + ) + console.print(markdown) + pydoc.pager(console.file.getvalue()) # type: ignore + + else: + console = Console(force_terminal=args.force_color, width=args.width) + console.print(markdown) diff --git a/rich/markup.py b/rich/markup.py new file mode 100644 index 0000000..99d5663 --- /dev/null +++ b/rich/markup.py @@ -0,0 +1,179 @@ +import re +from typing import Iterable, List, Match, NamedTuple, Optional, Tuple, Union + +from .errors import MarkupError +from .style import Style +from .text import Span, Text +from ._emoji_replace import _emoji_replace + + +RE_TAGS = re.compile( + r"""((\\*)\[([a-z#\/].*?)\])""", + re.VERBOSE, +) + + +class Tag(NamedTuple): + """A tag in console markup.""" + + name: str + """The tag name. e.g. 'bold'.""" + parameters: Optional[str] + """Any additional parameters after the name.""" + + def __str__(self) -> str: + return ( + self.name if self.parameters is None else f"{self.name} {self.parameters}" + ) + + @property + def markup(self) -> str: + """Get the string representation of this tag.""" + return ( + f"[{self.name}]" + if self.parameters is None + else f"[{self.name}={self.parameters}]" + ) + + +def escape(markup: str, _escape=re.compile(r"(\\*)(\[[a-z#\/].*?\])").sub) -> str: + """Escapes text so that it won't be interpreted as markup. + + Args: + markup (str): Content to be inserted in to markup. + + Returns: + str: Markup with square brackets escaped. + """ + + def escape_backslashes(match: Match[str]) -> str: + """Called by re.sub replace matches.""" + backslashes, text = match.groups() + return f"{backslashes}{backslashes}\\{text}" + + markup = _escape(escape_backslashes, markup) + return markup + + +def _parse(markup: str) -> Iterable[Tuple[int, Optional[str], Optional[Tag]]]: + """Parse markup in to an iterable of tuples of (position, text, tag). + + Args: + markup (str): A string containing console markup + + """ + position = 0 + _divmod = divmod + _Tag = Tag + for match in RE_TAGS.finditer(markup): + full_text, escapes, tag_text = match.groups() + start, end = match.span() + if start > position: + yield start, markup[position:start], None + if escapes: + backslashes, escaped = _divmod(len(escapes), 2) + if backslashes: + # Literal backslashes + yield start, "\\" * backslashes, None + start += backslashes * 2 + if escaped: + # Escape of tag + yield start, full_text[len(escapes) :], None + position = end + continue + text, equals, parameters = tag_text.partition("=") + yield start, None, _Tag(text, parameters if equals else None) + position = end + if position < len(markup): + yield position, markup[position:], None + + +def render(markup: str, style: Union[str, Style] = "", emoji: bool = True) -> Text: + """Render console markup in to a Text instance. + + Args: + markup (str): A string containing console markup. + emoji (bool, optional): Also render emoji code. Defaults to True. + + Raises: + MarkupError: If there is a syntax error in the markup. + + Returns: + Text: A test instance. + """ + emoji_replace = _emoji_replace + if "[" not in markup: + return Text(emoji_replace(markup) if emoji else markup, style=style) + text = Text(style=style) + append = text.append + normalize = Style.normalize + + style_stack: List[Tuple[int, Tag]] = [] + pop = style_stack.pop + + spans: List[Span] = [] + append_span = spans.append + + _Span = Span + _Tag = Tag + + def pop_style(style_name: str) -> Tuple[int, Tag]: + """Pop tag matching given style name.""" + for index, (_, tag) in enumerate(reversed(style_stack), 1): + if tag.name == style_name: + return pop(-index) + raise KeyError(style_name) + + for position, plain_text, tag in _parse(markup): + if plain_text is not None: + append(emoji_replace(plain_text) if emoji else plain_text) + elif tag is not None: + if tag.name.startswith("/"): # Closing tag + style_name = tag.name[1:].strip() + if style_name: # explicit close + style_name = normalize(style_name) + try: + start, open_tag = pop_style(style_name) + except KeyError: + raise MarkupError( + f"closing tag '{tag.markup}' at position {position} doesn't match any open tag" + ) from None + else: # implicit close + try: + start, open_tag = pop() + except IndexError: + raise MarkupError( + f"closing tag '[/]' at position {position} has nothing to close" + ) from None + + append_span(_Span(start, len(text), str(open_tag))) + else: # Opening tag + normalized_tag = _Tag(normalize(tag.name), tag.parameters) + style_stack.append((len(text), normalized_tag)) + + text_length = len(text) + while style_stack: + start, tag = style_stack.pop() + append_span(_Span(start, text_length, str(tag))) + + text.spans = sorted(spans) + return text + + +if __name__ == "__main__": # pragma: no cover + + from rich.console import Console + from rich.text import Text + + console = Console(highlight=False) + + console.print("Hello [1], [1,2,3] ['hello']") + console.print("foo") + console.print("Hello [link=https://www.willmcgugan.com]W[b red]o[/]rld[/]!") + + from rich import print + + print(escape("[red]")) + print(escape(r"\[red]")) + print(escape(r"\\[red]")) + print(escape(r"\\\[red]")) diff --git a/rich/measure.py b/rich/measure.py new file mode 100644 index 0000000..8089bf0 --- /dev/null +++ b/rich/measure.py @@ -0,0 +1,149 @@ +from operator import itemgetter +from typing import Iterable, NamedTuple, TYPE_CHECKING + +from . import errors +from .protocol import is_renderable + +if TYPE_CHECKING: + from .console import Console, RenderableType + + +class Measurement(NamedTuple): + """Stores the minimum and maximum widths (in characters) required to render an object.""" + + minimum: int + """Minimum number of cells required to render.""" + maximum: int + """Maximum number of cells required to render.""" + + @property + def span(self) -> int: + """Get difference between maximum and minimum.""" + return self.maximum - self.minimum + + def normalize(self) -> "Measurement": + """Get measurement that ensures that minimum <= maximum and minimum >= 0 + + Returns: + Measurement: A normalized measurement. + """ + minimum, maximum = self + minimum = min(max(0, minimum), maximum) + return Measurement(max(0, minimum), max(0, max(minimum, maximum))) + + def with_maximum(self, width: int) -> "Measurement": + """Get a RenderableWith where the widths are <= width. + + Args: + width (int): Maximum desired width. + + Returns: + Measurement: New Measurement object. + """ + minimum, maximum = self + return Measurement(min(minimum, width), min(maximum, width)) + + def with_minimum(self, width: int) -> "Measurement": + """Get a RenderableWith where the widths are >= width. + + Args: + width (int): Minimum desired width. + + Returns: + Measurement: New Measurement object. + """ + minimum, maximum = self + width = max(0, width) + return Measurement(max(minimum, width), max(maximum, width)) + + def clamp(self, min_width: int = None, max_width: int = None) -> "Measurement": + """Clamp a measurement within the specified range. + + Args: + min_width (int): Minimum desired width, or ``None`` for no minimum. Defaults to None. + max_width (int): Maximum desired width, or ``None`` for no maximum. Defaults to None. + + Returns: + Measurement: New Measurement object. + """ + measurement = self + if min_width is not None: + measurement = measurement.with_minimum(min_width) + if max_width is not None: + measurement = measurement.with_maximum(max_width) + return measurement + + @classmethod + def get( + cls, console: "Console", renderable: "RenderableType", max_width: int = None + ) -> "Measurement": + """Get a measurement for a renderable. + + Args: + console (~rich.console.Console): Console instance. + renderable (RenderableType): An object that may be rendered with Rich. + max_width (int, optional): The maximum width available, or None to use console.width. + Defaults to None. + + Raises: + errors.NotRenderableError: If the object is not renderable. + + Returns: + Measurement: Measurement object containing range of character widths required to render the object. + """ + from rich.console import RichCast + + _max_width = console.width if max_width is None else max_width + if _max_width < 1: + return Measurement(0, 0) + if isinstance(renderable, str): + renderable = console.render_str(renderable) + + if isinstance(renderable, RichCast): + renderable = renderable.__rich__() + + if is_renderable(renderable): + get_console_width = getattr(renderable, "__rich_measure__", None) + if get_console_width is not None: + render_width = ( + get_console_width(console, _max_width) + .normalize() + .with_maximum(_max_width) + ) + if render_width.maximum < 1: + return Measurement(0, 0) + return render_width.normalize() + else: + return Measurement(0, _max_width) + else: + raise errors.NotRenderableError( + f"Unable to get render width for {renderable!r}; " + "a str, Segment, or object with __rich_console__ method is required" + ) + + +def measure_renderables( + console: "Console", renderables: Iterable["RenderableType"], max_width: int +) -> "Measurement": + """Get a measurement that would fit a number of renderables. + + Args: + console (~rich.console.Console): Console instance. + renderables (Iterable[RenderableType]): One or more renderable objects. + max_width (int): The maximum width available. + + Returns: + Measurement: Measurement object containing range of character widths required to + contain all given renderables. + """ + if not renderables: + return Measurement(0, 0) + get_measurement = Measurement.get + measurements = [ + get_measurement(console, renderable, max_width) for renderable in renderables + ] + measured_width = Measurement( + max(measurements, key=itemgetter(0)).minimum, + max(measurements, key=itemgetter(1)).maximum, + ) + return measured_width diff --git a/rich/padding.py b/rich/padding.py new file mode 100644 index 0000000..da30816 --- /dev/null +++ b/rich/padding.py @@ -0,0 +1,124 @@ +from typing import cast, Tuple, TYPE_CHECKING, Union + +if TYPE_CHECKING: + from .console import ( + Console, + ConsoleOptions, + RenderableType, + RenderResult, + ) +from .jupyter import JupyterMixin +from .measure import Measurement +from .style import Style +from .segment import Segment + + +PaddingDimensions = Union[int, Tuple[int], Tuple[int, int], Tuple[int, int, int, int]] + + +class Padding(JupyterMixin): + """Draw space around content. + + Example: + >>> print(Padding("Hello", (2, 4), style="on blue")) + + Args: + renderable (RenderableType): String or other renderable. + pad (Union[int, Tuple[int]]): Padding for top, right, bottom, and left borders. + May be specified with 1, 2, or 4 integers (CSS style). + style (Union[str, Style], optional): Style for padding characters. Defaults to "none". + expand (bool, optional): Expand padding to fit available width. Defaults to True. + """ + + def __init__( + self, + renderable: "RenderableType", + pad: "PaddingDimensions" = (0, 0, 0, 0), + *, + style: Union[str, Style] = "none", + expand: bool = True, + ): + self.renderable = renderable + self.top, self.right, self.bottom, self.left = self.unpack(pad) + self.style = style + self.expand = expand + + @classmethod + def indent(cls, renderable: "RenderableType", level: int) -> "Padding": + """Make padding instance to render an indent. + + Args: + renderable (RenderableType): String or other renderable. + level (int): Number of characters to indent. + + Returns: + Padding: A Padding instance. + """ + + return Padding(renderable, pad=(0, 0, 0, level), expand=False) + + @staticmethod + def unpack(pad: "PaddingDimensions") -> Tuple[int, int, int, int]: + """Unpack padding specified in CSS style.""" + if isinstance(pad, int): + return (pad, pad, pad, pad) + if len(pad) == 1: + _pad = pad[0] + return (_pad, _pad, _pad, _pad) + if len(pad) == 2: + pad_top, pad_right = cast(Tuple[int, int], pad) + return (pad_top, pad_right, pad_top, pad_right) + if len(pad) == 4: + top, right, bottom, left = cast(Tuple[int, int, int, int], pad) + return (top, right, bottom, left) + raise ValueError(f"1, 2 or 4 integers required for padding; {len(pad)} given") + + def __repr__(self) -> str: + return f"Padding({self.renderable!r}, ({self.top},{self.right},{self.bottom},{self.left}))" + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + + style = console.get_style(self.style) + if self.expand: + width = options.max_width + else: + width = min( + Measurement.get(console, self.renderable, options.max_width).maximum + + self.left + + self.right, + options.max_width, + ) + child_options = options.update_width(width - self.left - self.right) + lines = console.render_lines( + self.renderable, child_options, style=style, pad=False + ) + lines = Segment.set_shape(lines, child_options.max_width, style=style) + + blank_line = Segment(" " * width + "\n", style) + top = [blank_line] * self.top + bottom = [blank_line] * self.bottom + left = Segment(" " * self.left, style) if self.left else None + right = Segment(" " * self.right, style) if self.right else None + new_line = Segment.line() + yield from top + for line in lines: + if left is not None: + yield left + yield from line + if right is not None: + yield right + yield new_line + yield from bottom + + def __rich_measure__(self, console: "Console", max_width: int) -> "Measurement": + extra_width = self.left + self.right + if max_width - extra_width < 1: + return Measurement(max_width, max_width) + measure_min, measure_max = Measurement.get( + console, self.renderable, max(0, max_width - extra_width) + ) + measurement = Measurement(measure_min + extra_width, measure_max + extra_width) + measurement = measurement.with_maximum(max_width) + return measurement diff --git a/rich/pager.py b/rich/pager.py new file mode 100644 index 0000000..52e77ef --- /dev/null +++ b/rich/pager.py @@ -0,0 +1,33 @@ +from abc import ABC, abstractmethod +import pydoc + + +class Pager(ABC): + """Base class for a pager.""" + + @abstractmethod + def show(self, content: str) -> None: + """Show content in pager. + + Args: + content (str): Content to be displayed. + """ + + +class SystemPager(Pager): + """Uses the pager installed on the system.""" + + _pager = lambda self, content: pydoc.pager(content) + + def show(self, content: str) -> None: + """Use the same pager used by pydoc.""" + self._pager(content) + + +if __name__ == "__main__": # pragma: no cover + from .__main__ import make_test_card + from .console import Console + + console = Console() + with console.pager(styles=True): + console.print(make_test_card()) diff --git a/rich/palette.py b/rich/palette.py new file mode 100644 index 0000000..f295879 --- /dev/null +++ b/rich/palette.py @@ -0,0 +1,100 @@ +from math import sqrt +from functools import lru_cache +from typing import Sequence, Tuple, TYPE_CHECKING + +from .color_triplet import ColorTriplet + +if TYPE_CHECKING: + from rich.table import Table + + +class Palette: + """A palette of available colors.""" + + def __init__(self, colors: Sequence[Tuple[int, int, int]]): + self._colors = colors + + def __getitem__(self, number: int) -> ColorTriplet: + return ColorTriplet(*self._colors[number]) + + def __rich__(self) -> "Table": + from rich.color import Color + from rich.style import Style + from rich.text import Text + from rich.table import Table + + table = Table( + "index", + "RGB", + "Color", + title="Palette", + caption=f"{len(self._colors)} colors", + highlight=True, + caption_justify="right", + ) + for index, color in enumerate(self._colors): + table.add_row( + str(index), + repr(color), + Text(" " * 16, style=Style(bgcolor=Color.from_rgb(*color))), + ) + return table + + # This is somewhat inefficient and needs caching + @lru_cache(maxsize=1024) + def match(self, color: Tuple[int, int, int]) -> int: + """Find a color from a palette that most closely matches a given color. + + Args: + color (Tuple[int, int, int]): RGB components in range 0 > 255. + + Returns: + int: Index of closes matching color. + """ + red1, green1, blue1 = color + _sqrt = sqrt + get_color = self._colors.__getitem__ + + def get_color_distance(index: int) -> float: + """Get the distance to a color.""" + red2, green2, blue2 = get_color(index) + red_mean = (red1 + red2) // 2 + red = red1 - red2 + green = green1 - green2 + blue = blue1 - blue2 + return _sqrt( + (((512 + red_mean) * red * red) >> 8) + + 4 * green * green + + (((767 - red_mean) * blue * blue) >> 8) + ) + + min_index = min(range(len(self._colors)), key=get_color_distance) + return min_index + + +if __name__ == "__main__": # pragma: no cover + import colorsys + from typing import Iterable + from rich.color import Color + from rich.console import Console, ConsoleOptions + from rich.segment import Segment + from rich.style import Style + + class ColorBox: + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> Iterable[Segment]: + height = console.size.height - 3 + for y in range(0, height): + for x in range(options.max_width): + h = x / options.max_width + l = y / (height + 1) + r1, g1, b1 = colorsys.hls_to_rgb(h, l, 1.0) + r2, g2, b2 = colorsys.hls_to_rgb(h, l + (1 / height / 2), 1.0) + bgcolor = Color.from_rgb(r1 * 255, g1 * 255, b1 * 255) + color = Color.from_rgb(r2 * 255, g2 * 255, b2 * 255) + yield Segment("▄", Style(color=color, bgcolor=bgcolor)) + yield Segment.line() + + console = Console() + console.print(ColorBox()) diff --git a/rich/panel.py b/rich/panel.py new file mode 100644 index 0000000..2e54d9e --- /dev/null +++ b/rich/panel.py @@ -0,0 +1,206 @@ +from typing import Optional, TYPE_CHECKING + +from .box import Box, ROUNDED + +from .align import AlignMethod +from .jupyter import JupyterMixin +from .measure import Measurement, measure_renderables +from .padding import Padding, PaddingDimensions +from .style import StyleType +from .text import Text, TextType +from .segment import Segment + +if TYPE_CHECKING: + from .console import Console, ConsoleOptions, RenderableType, RenderResult + + +class Panel(JupyterMixin): + """A console renderable that draws a border around its contents. + + Example: + >>> console.print(Panel("Hello, World!")) + + Args: + renderable (RenderableType): A console renderable object. + box (Box, optional): A Box instance that defines the look of the border (see :ref:`appendix_box`. + Defaults to box.ROUNDED. + safe_box (bool, optional): Disable box characters that don't display on windows legacy terminal with *raster* fonts. Defaults to True. + expand (bool, optional): If True the panel will stretch to fill the console + width, otherwise it will be sized to fit the contents. Defaults to True. + style (str, optional): The style of the panel (border and contents). Defaults to "none". + border_style (str, optional): The style of the border. Defaults to "none". + width (Optional[int], optional): Optional width of panel. Defaults to None to auto-detect. + padding (Optional[PaddingDimensions]): Optional padding around renderable. Defaults to 0. + highlight (bool, optional): Enable automatic highlighting of panel title (if str). Defaults to False. + """ + + def __init__( + self, + renderable: "RenderableType", + box: Box = ROUNDED, + *, + title: TextType = None, + title_align: AlignMethod = "center", + safe_box: Optional[bool] = None, + expand: bool = True, + style: StyleType = "none", + border_style: StyleType = "none", + width: Optional[int] = None, + padding: PaddingDimensions = (0, 1), + highlight: bool = False, + ) -> None: + self.renderable = renderable + self.box = box + self.title = title + self.title_align = title_align + self.safe_box = safe_box + self.expand = expand + self.style = style + self.border_style = border_style + self.width = width + self.padding = padding + self.highlight = highlight + + @classmethod + def fit( + cls, + renderable: "RenderableType", + box: Box = ROUNDED, + *, + title: TextType = None, + title_align: AlignMethod = "center", + safe_box: Optional[bool] = None, + style: StyleType = "none", + border_style: StyleType = "none", + width: Optional[int] = None, + padding: PaddingDimensions = (0, 1), + ): + """An alternative constructor that sets expand=False.""" + return cls( + renderable, + box, + title=title, + title_align=title_align, + safe_box=safe_box, + style=style, + border_style=border_style, + width=width, + padding=padding, + expand=False, + ) + + @property + def _title(self) -> Optional[Text]: + if self.title: + title_text = ( + Text.from_markup(self.title) + if isinstance(self.title, str) + else self.title.copy() + ) + title_text.end = "" + title_text.plain = title_text.plain.replace("\n", " ") + title_text.no_wrap = True + title_text.expand_tabs() + title_text.pad(1) + return title_text + return None + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + _padding = Padding.unpack(self.padding) + renderable = ( + Padding(self.renderable, _padding) if any(_padding) else self.renderable + ) + style = console.get_style(self.style) + border_style = style + console.get_style(self.border_style) + width = ( + options.max_width + if self.width is None + else min(options.max_width, self.width) + ) + + safe_box: bool = console.safe_box if self.safe_box is None else self.safe_box # type: ignore + box = self.box.substitute(options, safe=safe_box) + + title_text = self._title + if title_text is not None: + title_text.style = border_style + + child_width = ( + width - 2 + if self.expand + else Measurement.get(console, renderable, width - 2).maximum + ) + child_height = None if options.height is None else options.height - 2 + if title_text is not None: + child_width = min( + options.max_width - 2, max(child_width, title_text.cell_len + 2) + ) + + width = child_width + 2 + child_options = options.update( + width=child_width, height=child_height, highlight=self.highlight + ) + lines = console.render_lines(renderable, child_options, style=style) + + line_start = Segment(box.mid_left, border_style) + line_end = Segment(f"{box.mid_right}", border_style) + new_line = Segment.line() + if title_text is None or width <= 4: + yield Segment(box.get_top([width - 2]), border_style) + else: + title_text.align(self.title_align, width - 4, character=box.top) + yield Segment(box.top_left + box.top, border_style) + yield from console.render(title_text) + yield Segment(box.top + box.top_right, border_style) + + yield new_line + for line in lines: + yield line_start + yield from line + yield line_end + yield new_line + yield Segment(box.get_bottom([width - 2]), border_style) + yield new_line + + def __rich_measure__(self, console: "Console", max_width: int) -> "Measurement": + _title = self._title + _, right, _, left = Padding.unpack(self.padding) + padding = left + right + renderables = [self.renderable, _title] if _title else [self.renderable] + + if self.width is None: + width = ( + measure_renderables( + console, renderables, max_width - padding - 2 + ).maximum + + padding + + 2 + ) + else: + width = self.width + return Measurement(width, width) + + +if __name__ == "__main__": # pragma: no cover + from .console import Console + + c = Console() + + from .padding import Padding + from .box import ROUNDED, DOUBLE + + p = Panel( + Panel.fit( + Text.from_markup("[bold magenta]Hello World!"), + box=ROUNDED, + safe_box=True, + style="on red", + ), + title="[b]Hello, World", + box=DOUBLE, + ) + + print(p) + c.print(p) diff --git a/rich/pretty.py b/rich/pretty.py new file mode 100644 index 0000000..8a05992 --- /dev/null +++ b/rich/pretty.py @@ -0,0 +1,585 @@ +import builtins +import os +import sys +from array import array +from collections import Counter, abc, defaultdict, deque +from dataclasses import dataclass +from itertools import islice +from typing import ( + TYPE_CHECKING, + Any, + Callable, + Dict, + Iterable, + List, + Optional, + Set, + Tuple, +) + +from rich.highlighter import ReprHighlighter + +from .abc import RichRenderable +from . import get_console +from ._pick import pick_bool +from .cells import cell_len +from .highlighter import ReprHighlighter +from .jupyter import JupyterRenderable +from .measure import Measurement +from .text import Text + +if TYPE_CHECKING: + from .console import ( + Console, + ConsoleOptions, + HighlighterType, + JustifyMethod, + OverflowMethod, + RenderResult, + ) + + +def install( + console: "Console" = None, + overflow: "OverflowMethod" = "ignore", + crop: bool = False, + indent_guides: bool = False, + max_length: int = None, + max_string: int = None, + expand_all: bool = False, +) -> None: + """Install automatic pretty printing in the Python REPL. + + Args: + console (Console, optional): Console instance or ``None`` to use global console. Defaults to None. + overflow (Optional[OverflowMethod], optional): Overflow method. Defaults to "ignore". + crop (Optional[bool], optional): Enable cropping of long lines. Defaults to False. + indent_guides (bool, optional): Enable indentation guides. Defaults to False. + max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. + Defaults to None. + max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to None. + expand_all (bool, optional): Expand all containers. Defaults to False + """ + from rich import get_console + from .console import ConsoleRenderable # needed here to prevent circular import + + console = console or get_console() + assert console is not None + + def display_hook(value: Any) -> None: + """Replacement sys.displayhook which prettifies objects with Rich.""" + if value is not None: + assert console is not None + builtins._ = None # type: ignore + console.print( + value + if isinstance(value, RichRenderable) + else Pretty( + value, + overflow=overflow, + indent_guides=indent_guides, + max_length=max_length, + max_string=max_string, + expand_all=expand_all, + ), + crop=crop, + ) + builtins._ = value # type: ignore + + def ipy_display_hook(value: Any) -> None: # pragma: no cover + assert console is not None + # always skip rich generated jupyter renderables or None values + if isinstance(value, JupyterRenderable) or value is None: + return + # on jupyter rich display, if using one of the special representations dont use rich + if console.is_jupyter and any(attr.startswith("_repr_") for attr in dir(value)): + return + + # certain renderables should start on a new line + if isinstance(value, ConsoleRenderable): + console.line() + + console.print( + value + if isinstance(value, RichRenderable) + else Pretty( + value, + overflow=overflow, + indent_guides=indent_guides, + max_length=max_length, + max_string=max_string, + expand_all=expand_all, + margin=12, + ), + crop=crop, + ) + + try: # pragma: no cover + ip = get_ipython() # type: ignore + from IPython.core.formatters import BaseFormatter + + # replace plain text formatter with rich formatter + rich_formatter = BaseFormatter() + rich_formatter.for_type(object, func=ipy_display_hook) + ip.display_formatter.formatters["text/plain"] = rich_formatter + except Exception: + sys.displayhook = display_hook + + +class Pretty: + """A rich renderable that pretty prints an object. + + Args: + _object (Any): An object to pretty print. + highlighter (HighlighterType, optional): Highlighter object to apply to result, or None for ReprHighlighter. Defaults to None. + indent_size (int, optional): Number of spaces in indent. Defaults to 4. + justify (JustifyMethod, optional): Justify method, or None for default. Defaults to None. + overflow (OverflowMethod, optional): Overflow method, or None for default. Defaults to None. + no_wrap (Optional[bool], optional): Disable word wrapping. Defaults to False. + indent_guides (bool, optional): Enable indentation guides. Defaults to False. + max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. + Defaults to None. + max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to None. + expand_all (bool, optional): Expand all containers. Defaults to False. + margin (int, optional): Subtrace a margin from width to force containers to expand earlier. Defaults to 0. + insert_line (bool, optional): Insert a new line if the output has multiple new lines. Defaults to False. + """ + + def __init__( + self, + _object: Any, + highlighter: "HighlighterType" = None, + *, + indent_size: int = 4, + justify: "JustifyMethod" = None, + overflow: Optional["OverflowMethod"] = None, + no_wrap: Optional[bool] = False, + indent_guides: bool = False, + max_length: int = None, + max_string: int = None, + expand_all: bool = False, + margin: int = 0, + insert_line: bool = False, + ) -> None: + self._object = _object + self.highlighter = highlighter or ReprHighlighter() + self.indent_size = indent_size + self.justify = justify + self.overflow = overflow + self.no_wrap = no_wrap + self.indent_guides = indent_guides + self.max_length = max_length + self.max_string = max_string + self.expand_all = expand_all + self.margin = margin + self.insert_line = insert_line + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + pretty_str = pretty_repr( + self._object, + max_width=options.max_width - self.margin, + indent_size=self.indent_size, + max_length=self.max_length, + max_string=self.max_string, + expand_all=self.expand_all, + ) + pretty_text = Text( + pretty_str, + justify=self.justify or options.justify, + overflow=self.overflow or options.overflow, + no_wrap=pick_bool(self.no_wrap, options.no_wrap), + style="pretty", + ) + pretty_text = self.highlighter(pretty_text) + if self.indent_guides and not options.ascii_only: + pretty_text = pretty_text.with_indent_guides( + self.indent_size, style="repr.indent" + ) + if self.insert_line and "\n" in pretty_text: + yield "" + yield pretty_text + + def __rich_measure__(self, console: "Console", max_width: int) -> "Measurement": + pretty_str = pretty_repr( + self._object, + max_width=max_width, + indent_size=self.indent_size, + max_length=self.max_length, + max_string=self.max_string, + ) + text_width = max(cell_len(line) for line in pretty_str.splitlines()) + return Measurement(text_width, text_width) + + +def _get_braces_for_defaultdict(_object: defaultdict) -> Tuple[str, str, str]: + return ( + f"defaultdict({_object.default_factory!r}, {{", + "})", + f"defaultdict({_object.default_factory!r}, {{}})", + ) + + +def _get_braces_for_array(_object: array) -> Tuple[str, str, str]: + return (f"array({_object.typecode!r}, [", "])", "array({_object.typecode!r})") + + +_BRACES: Dict[type, Callable[[Any], Tuple[str, str, str]]] = { + os._Environ: lambda _object: ("environ({", "})", "environ({})"), + array: _get_braces_for_array, + defaultdict: _get_braces_for_defaultdict, + Counter: lambda _object: ("Counter({", "})", "Counter()"), + deque: lambda _object: ("deque([", "])", "deque()"), + dict: lambda _object: ("{", "}", "{}"), + frozenset: lambda _object: ("frozenset({", "})", "frozenset()"), + list: lambda _object: ("[", "]", "[]"), + set: lambda _object: ("{", "}", "set()"), + tuple: lambda _object: ("(", ")", "()"), +} +_CONTAINERS = tuple(_BRACES.keys()) +_MAPPING_CONTAINERS = (dict, os._Environ) + + +@dataclass +class Node: + """A node in a repr tree. May be atomic or a container.""" + + key_repr: str = "" + value_repr: str = "" + open_brace: str = "" + close_brace: str = "" + empty: str = "" + last: bool = False + is_tuple: bool = False + children: Optional[List["Node"]] = None + + @property + def separator(self) -> str: + """Get separator between items.""" + return "" if self.last else "," + + def iter_tokens(self) -> Iterable[str]: + """Generate tokens for this node.""" + if self.key_repr: + yield self.key_repr + yield ": " + if self.value_repr: + yield self.value_repr + elif self.children is not None: + if self.children: + yield self.open_brace + if self.is_tuple and len(self.children) == 1: + yield from self.children[0].iter_tokens() + yield "," + else: + for child in self.children: + yield from child.iter_tokens() + if not child.last: + yield ", " + yield self.close_brace + else: + yield self.empty + + def check_length(self, start_length: int, max_length: int) -> bool: + """Check the length fits within a limit. + + Args: + start_length (int): Starting length of the line (indent, prefix, suffix). + max_length (int): Maximum length. + + Returns: + bool: True if the node can be rendered within max length, otherwise False. + """ + total_length = start_length + for token in self.iter_tokens(): + total_length += cell_len(token) + if total_length > max_length: + return False + return True + + def __str__(self) -> str: + repr_text = "".join(self.iter_tokens()) + return repr_text + + def render( + self, max_width: int = 80, indent_size: int = 4, expand_all: bool = False + ) -> str: + """Render the node to a pretty repr. + + Args: + max_width (int, optional): Maximum width of the repr. Defaults to 80. + indent_size (int, optional): Size of indents. Defaults to 4. + expand_all (bool, optional): Expand all levels. Defaults to False. + + Returns: + str: A repr string of the original object. + """ + lines = [_Line(node=self, is_root=True)] + line_no = 0 + while line_no < len(lines): + line = lines[line_no] + if line.expandable and not line.expanded: + if expand_all or not line.check_length(max_width): + lines[line_no : line_no + 1] = line.expand(indent_size) + line_no += 1 + + repr_str = "\n".join(str(line) for line in lines) + return repr_str + + +@dataclass +class _Line: + """A line in repr output.""" + + is_root: bool = False + node: Optional[Node] = None + text: str = "" + suffix: str = "" + whitespace: str = "" + expanded: bool = False + + @property + def expandable(self) -> bool: + """Check if the line may be expanded.""" + return bool(self.node is not None and self.node.children) + + def check_length(self, max_length: int) -> bool: + """Check this line fits within a given number of cells.""" + start_length = ( + len(self.whitespace) + cell_len(self.text) + cell_len(self.suffix) + ) + assert self.node is not None + return self.node.check_length(start_length, max_length) + + def expand(self, indent_size: int) -> Iterable["_Line"]: + """Expand this line by adding children on their own line.""" + node = self.node + assert node is not None + whitespace = self.whitespace + assert node.children + if node.key_repr: + yield _Line( + text=f"{node.key_repr}: {node.open_brace}", whitespace=whitespace + ) + else: + yield _Line(text=node.open_brace, whitespace=whitespace) + child_whitespace = self.whitespace + " " * indent_size + tuple_of_one = node.is_tuple and len(node.children) == 1 + for child in node.children: + separator = "," if tuple_of_one else child.separator + line = _Line( + node=child, + whitespace=child_whitespace, + suffix=separator, + ) + yield line + + yield _Line( + text=node.close_brace, + whitespace=whitespace, + suffix="," if (tuple_of_one and not self.is_root) else node.separator, + ) + + def __str__(self) -> str: + return f"{self.whitespace}{self.text}{self.node or ''}{self.suffix}" + + +def traverse(_object: Any, max_length: int = None, max_string: int = None) -> Node: + """Traverse object and generate a tree. + + Args: + _object (Any): Object to be traversed. + max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. + Defaults to None. + max_string (int, optional): Maximum length of string before truncating, or None to disable truncating. + Defaults to None. + + Returns: + Node: The root of a tree structure which can be used to render a pretty repr. + """ + + def to_repr(obj: Any) -> str: + """Get repr string for an object, but catch errors.""" + if ( + max_string is not None + and isinstance(obj, (bytes, str)) + and len(obj) > max_string + ): + truncated = len(obj) - max_string + obj_repr = f"{obj[:max_string]!r}+{truncated}" + else: + try: + obj_repr = repr(obj) + except Exception as error: + obj_repr = f"<repr-error '{error}'>" + return obj_repr + + visited_ids: Set[int] = set() + push_visited = visited_ids.add + pop_visited = visited_ids.remove + + def _traverse(obj: Any, root: bool = False) -> Node: + """Walk the object depth first.""" + obj_type = type(obj) + if obj_type in _CONTAINERS: + obj_id = id(obj) + + if obj_id in visited_ids: + # Recursion detected + return Node(value_repr="...") + push_visited(obj_id) + open_brace, close_brace, empty = _BRACES[obj_type](obj) + + if obj: + children: List[Node] = [] + node = Node( + open_brace=open_brace, + close_brace=close_brace, + children=children, + last=root, + ) + append = children.append + num_items = len(obj) + last_item_index = num_items - 1 + + if isinstance(obj, _MAPPING_CONTAINERS): + iter_items = iter(obj.items()) + if max_length is not None: + iter_items = islice(iter_items, max_length) + for index, (key, child) in enumerate(iter_items): + child_node = _traverse(child) + child_node.key_repr = to_repr(key) + child_node.last = index == last_item_index + append(child_node) + else: + iter_values = iter(obj) + if max_length is not None: + iter_values = islice(iter_values, max_length) + for index, child in enumerate(iter_values): + child_node = _traverse(child) + child_node.last = index == last_item_index + append(child_node) + if max_length is not None and num_items > max_length: + append(Node(value_repr=f"... +{num_items-max_length}", last=True)) + else: + node = Node(empty=empty, children=[], last=root) + + pop_visited(obj_id) + else: + node = Node(value_repr=to_repr(obj), last=root) + node.is_tuple = isinstance(obj, tuple) + return node + + node = _traverse(_object, root=True) + return node + + +def pretty_repr( + _object: Any, + *, + max_width: int = 80, + indent_size: int = 4, + max_length: int = None, + max_string: int = None, + expand_all: bool = False, +) -> str: + """Prettify repr string by expanding on to new lines to fit within a given width. + + Args: + _object (Any): Object to repr. + max_width (int, optional): Desired maximum width of repr string. Defaults to 80. + indent_size (int, optional): Number of spaces to indent. Defaults to 4. + max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. + Defaults to None. + max_string (int, optional): Maximum length of string before truncating, or None to disable truncating. + Defaults to None. + expand_all (bool, optional): Expand all containers regardless of available width. Defaults to False. + + Returns: + str: A possibly multi-line representation of the object. + """ + + if isinstance(_object, Node): + node = _object + else: + node = traverse(_object, max_length=max_length, max_string=max_string) + repr_str = node.render( + max_width=max_width, indent_size=indent_size, expand_all=expand_all + ) + return repr_str + + +def pprint( + _object: Any, + *, + console: "Console" = None, + indent_guides: bool = True, + max_length: int = None, + max_string: int = None, + expand_all: bool = False, +): + """A convenience function for pretty printing. + + Args: + _object (Any): Object to pretty print. + console (Console, optional): Console instance, or None to use default. Defaults to None. + max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. + Defaults to None. + max_string (int, optional): Maximum length of strings before truncating, or None to disable. Defaults to None. + indent_guides (bool, optional): Enable indentation guides. Defaults to True. + expand_all (bool, optional): Expand all containers. Defaults to False. + """ + _console = get_console() if console is None else console + _console.print( + Pretty( + _object, + max_length=max_length, + max_string=max_string, + indent_guides=indent_guides, + expand_all=expand_all, + overflow="ignore", + ), + soft_wrap=True, + ) + + +if __name__ == "__main__": # pragma: no cover + + class BrokenRepr: + def __repr__(self): + 1 / 0 + + d = defaultdict(int) + d["foo"] = 5 + data = { + "foo": [ + 1, + "Hello World!", + 100.123, + 323.232, + 432324.0, + {5, 6, 7, (1, 2, 3, 4), 8}, + ], + "bar": frozenset({1, 2, 3}), + "defaultdict": defaultdict( + list, {"crumble": ["apple", "rhubarb", "butter", "sugar", "flour"]} + ), + "counter": Counter( + [ + "apple", + "orange", + "pear", + "kumquat", + "kumquat", + "durian" * 100, + ] + ), + "atomic": (False, True, None), + "Broken": BrokenRepr(), + } + data["foo"].append(data) # type: ignore + + from rich import print + + print(Pretty(data, indent_guides=True, max_string=20)) diff --git a/rich/progress.py b/rich/progress.py new file mode 100644 index 0000000..2fd1f3d --- /dev/null +++ b/rich/progress.py @@ -0,0 +1,1019 @@ +import sys +from abc import ABC, abstractmethod +from collections import deque +from collections.abc import Sized +from dataclasses import dataclass, field +from datetime import timedelta +from math import ceil +from threading import Event, RLock, Thread +from typing import ( + Any, + Callable, + Deque, + Dict, + Iterable, + List, + NamedTuple, + NewType, + Optional, + Sequence, + Tuple, + TypeVar, + Union, +) + +from . import filesize, get_console +from .console import ( + Console, + JustifyMethod, + RenderableType, + RenderGroup, +) +from .jupyter import JupyterMixin +from .highlighter import Highlighter +from .live import Live +from .progress_bar import ProgressBar +from .spinner import Spinner +from .style import StyleType +from .table import Column, Table +from .text import Text, TextType + +TaskID = NewType("TaskID", int) + +ProgressType = TypeVar("ProgressType") + +GetTimeCallable = Callable[[], float] + + +class _TrackThread(Thread): + """A thread to periodically update progress.""" + + def __init__(self, progress: "Progress", task_id: "TaskID", update_period: float): + self.progress = progress + self.task_id = task_id + self.update_period = update_period + self.done = Event() + + self.completed = 0 + super().__init__() + + def run(self) -> None: + task_id = self.task_id + advance = self.progress.advance + update_period = self.update_period + last_completed = 0 + wait = self.done.wait + while not wait(update_period): + completed = self.completed + if last_completed != completed: + advance(task_id, completed - last_completed) + last_completed = completed + + self.progress.update(self.task_id, completed=self.completed, refresh=True) + + def __enter__(self) -> "_TrackThread": + self.start() + return self + + def __exit__(self, exc_type, exc_val, exc_tb) -> None: + self.done.set() + self.join() + + +def track( + sequence: Union[Sequence[ProgressType], Iterable[ProgressType]], + description="Working...", + total: int = None, + auto_refresh=True, + console: Optional[Console] = None, + transient: bool = False, + get_time: Callable[[], float] = None, + refresh_per_second: float = 10, + style: StyleType = "bar.back", + complete_style: StyleType = "bar.complete", + finished_style: StyleType = "bar.finished", + pulse_style: StyleType = "bar.pulse", + update_period: float = 0.1, + disable: bool = False, +) -> Iterable[ProgressType]: + """Track progress by iterating over a sequence. + + Args: + sequence (Iterable[ProgressType]): A sequence (must support "len") you wish to iterate over. + description (str, optional): Description of task show next to progress bar. Defaults to "Working". + total: (int, optional): Total number of steps. Default is len(sequence). + auto_refresh (bool, optional): Automatic refresh, disable to force a refresh after each iteration. Default is True. + transient: (bool, optional): Clear the progress on exit. Defaults to False. + console (Console, optional): Console to write to. Default creates internal Console instance. + refresh_per_second (float): Number of times per second to refresh the progress information. Defaults to 10. + style (StyleType, optional): Style for the bar background. Defaults to "bar.back". + complete_style (StyleType, optional): Style for the completed bar. Defaults to "bar.complete". + finished_style (StyleType, optional): Style for a finished bar. Defaults to "bar.done". + pulse_style (StyleType, optional): Style for pulsing bars. Defaults to "bar.pulse". + update_period (float, optional): Minimum time (in seconds) between calls to update(). Defaults to 0.1. + disable (bool, optional): Disable display of progress. + Returns: + Iterable[ProgressType]: An iterable of the values in the sequence. + + """ + + columns: List["ProgressColumn"] = ( + [TextColumn("[progress.description]{task.description}")] if description else [] + ) + columns.extend( + ( + BarColumn( + style=style, + complete_style=complete_style, + finished_style=finished_style, + pulse_style=pulse_style, + ), + TextColumn("[progress.percentage]{task.percentage:>3.0f}%"), + TimeRemainingColumn(), + ) + ) + progress = Progress( + *columns, + auto_refresh=auto_refresh, + console=console, + transient=transient, + get_time=get_time, + refresh_per_second=refresh_per_second or 10, + disable=disable, + ) + + with progress: + yield from progress.track( + sequence, total=total, description=description, update_period=update_period + ) + + +class ProgressColumn(ABC): + """Base class for a widget to use in progress display.""" + + max_refresh: Optional[float] = None + + def __init__(self, table_column: Column = None) -> None: + self._table_column = table_column + self._renderable_cache: Dict[TaskID, Tuple[float, RenderableType]] = {} + self._update_time: Optional[float] = None + + def get_table_column(self) -> Column: + """Get a table column, used to build tasks table.""" + return self._table_column or Column() + + def __call__(self, task: "Task") -> RenderableType: + """Called by the Progress object to return a renderable for the given task. + + Args: + task (Task): An object containing information regarding the task. + + Returns: + RenderableType: Anything renderable (including str). + """ + current_time = task.get_time() # type: ignore + if self.max_refresh is not None and not task.completed: + try: + timestamp, renderable = self._renderable_cache[task.id] + except KeyError: + pass + else: + if timestamp + self.max_refresh > current_time: + return renderable + + renderable = self.render(task) + self._renderable_cache[task.id] = (current_time, renderable) + return renderable + + @abstractmethod + def render(self, task: "Task") -> RenderableType: + """Should return a renderable object.""" + + +class RenderableColumn(ProgressColumn): + """A column to insert an arbitrary column. + + Args: + renderable (RenderableType, optional): Any renderable. Defaults to empty string. + """ + + def __init__(self, renderable: RenderableType = "", *, table_column: Column = None): + self.renderable = renderable + super().__init__(table_column=table_column) + + def render(self, task: "Task") -> RenderableType: + return self.renderable + + +class SpinnerColumn(ProgressColumn): + """A column with a 'spinner' animation. + + Args: + spinner_name (str, optional): Name of spinner animation. Defaults to "dots". + style (StyleType, optional): Style of spinner. Defaults to "progress.spinner". + speed (float, optional): Speed factor of spinner. Defaults to 1.0. + finished_text (TextType, optional): Text used when task is finished. Defaults to " ". + """ + + def __init__( + self, + spinner_name: str = "dots", + style: Optional[StyleType] = "progress.spinner", + speed: float = 1.0, + finished_text: TextType = " ", + table_column: Column = None, + ): + self.spinner = Spinner(spinner_name, style=style, speed=speed) + self.finished_text = ( + Text.from_markup(finished_text) + if isinstance(finished_text, str) + else finished_text + ) + super().__init__(table_column=table_column) + + def set_spinner( + self, + spinner_name: str, + spinner_style: Optional[StyleType] = "progress.spinner", + speed: float = 1.0, + ): + """Set a new spinner. + + Args: + spinner_name (str): Spinner name, see python -m rich.spinner. + spinner_style (Optional[StyleType], optional): Spinner style. Defaults to "progress.spinner". + speed (float, optional): Speed factor of spinner. Defaults to 1.0. + """ + self.spinner = Spinner(spinner_name, style=spinner_style, speed=speed) + + def render(self, task: "Task") -> Text: + text = ( + self.finished_text + if task.finished + else self.spinner.render(task.get_time()) + ) + return text + + +class TextColumn(ProgressColumn): + """A column containing text.""" + + def __init__( + self, + text_format: str, + style: StyleType = "none", + justify: JustifyMethod = "left", + markup: bool = True, + highlighter: Highlighter = None, + table_column: Column = None, + ) -> None: + self.text_format = text_format + self.justify = justify + self.style = style + self.markup = markup + self.highlighter = highlighter + super().__init__(table_column=table_column or Column(no_wrap=True)) + + def render(self, task: "Task") -> Text: + _text = self.text_format.format(task=task) + if self.markup: + text = Text.from_markup(_text, style=self.style, justify=self.justify) + else: + text = Text(_text, style=self.style, justify=self.justify) + if self.highlighter: + self.highlighter.highlight(text) + return text + + +class BarColumn(ProgressColumn): + """Renders a visual progress bar. + + Args: + bar_width (Optional[int], optional): Width of bar or None for full width. Defaults to 40. + style (StyleType, optional): Style for the bar background. Defaults to "bar.back". + complete_style (StyleType, optional): Style for the completed bar. Defaults to "bar.complete". + finished_style (StyleType, optional): Style for a finished bar. Defaults to "bar.done". + pulse_style (StyleType, optional): Style for pulsing bars. Defaults to "bar.pulse". + """ + + def __init__( + self, + bar_width: Optional[int] = 40, + style: StyleType = "bar.back", + complete_style: StyleType = "bar.complete", + finished_style: StyleType = "bar.finished", + pulse_style: StyleType = "bar.pulse", + table_column: Column = None, + ) -> None: + self.bar_width = bar_width + self.style = style + self.complete_style = complete_style + self.finished_style = finished_style + self.pulse_style = pulse_style + super().__init__(table_column=table_column) + + def render(self, task: "Task") -> ProgressBar: + """Gets a progress bar widget for a task.""" + return ProgressBar( + total=max(0, task.total), + completed=max(0, task.completed), + width=None if self.bar_width is None else max(1, self.bar_width), + pulse=not task.started, + animation_time=task.get_time(), + style=self.style, + complete_style=self.complete_style, + finished_style=self.finished_style, + pulse_style=self.pulse_style, + ) + + +class TimeElapsedColumn(ProgressColumn): + """Renders time elapsed.""" + + def render(self, task: "Task") -> Text: + """Show time remaining.""" + elapsed = task.finished_time if task.finished else task.elapsed + if elapsed is None: + return Text("-:--:--", style="progress.elapsed") + delta = timedelta(seconds=int(elapsed)) + return Text(str(delta), style="progress.elapsed") + + +class TimeRemainingColumn(ProgressColumn): + """Renders estimated time remaining.""" + + # Only refresh twice a second to prevent jitter + max_refresh = 0.5 + + def render(self, task: "Task") -> Text: + """Show time remaining.""" + remaining = task.time_remaining + if remaining is None: + return Text("-:--:--", style="progress.remaining") + remaining_delta = timedelta(seconds=int(remaining)) + return Text(str(remaining_delta), style="progress.remaining") + + +class FileSizeColumn(ProgressColumn): + """Renders completed filesize.""" + + def render(self, task: "Task") -> Text: + """Show data completed.""" + data_size = filesize.decimal(int(task.completed)) + return Text(data_size, style="progress.filesize") + + +class TotalFileSizeColumn(ProgressColumn): + """Renders total filesize.""" + + def render(self, task: "Task") -> Text: + """Show data completed.""" + data_size = filesize.decimal(int(task.total)) + return Text(data_size, style="progress.filesize.total") + + +class DownloadColumn(ProgressColumn): + """Renders file size downloaded and total, e.g. '0.5/2.3 GB'. + + Args: + binary_units (bool, optional): Use binary units, KiB, MiB etc. Defaults to False. + """ + + def __init__(self, binary_units: bool = False, table_column: Column = None) -> None: + self.binary_units = binary_units + super().__init__(table_column=table_column) + + def render(self, task: "Task") -> Text: + """Calculate common unit for completed and total.""" + completed = int(task.completed) + total = int(task.total) + if self.binary_units: + unit, suffix = filesize.pick_unit_and_suffix( + total, + ["bytes", "KiB", "MiB", "GiB", "TiB", "PiB", "EiB", "ZiB", "YiB"], + 1024, + ) + else: + unit, suffix = filesize.pick_unit_and_suffix( + total, ["bytes", "KB", "MB", "GB", "TB", "PB", "EB", "ZB", "YB"], 1000 + ) + completed_ratio = completed / unit + total_ratio = total / unit + precision = 0 if unit == 1 else 1 + completed_str = f"{completed_ratio:,.{precision}f}" + total_str = f"{total_ratio:,.{precision}f}" + download_status = f"{completed_str}/{total_str} {suffix}" + download_text = Text(download_status, style="progress.download") + return download_text + + +class TransferSpeedColumn(ProgressColumn): + """Renders human readable transfer speed.""" + + def render(self, task: "Task") -> Text: + """Show data transfer speed.""" + speed = task.speed + if speed is None: + return Text("?", style="progress.data.speed") + data_speed = filesize.decimal(int(speed)) + return Text(f"{data_speed}/s", style="progress.data.speed") + + +class ProgressSample(NamedTuple): + """Sample of progress for a given time.""" + + timestamp: float + """Timestamp of sample.""" + completed: float + """Number of steps completed.""" + + +@dataclass +class Task: + """Information regarding a progress task. + + This object should be considered read-only outside of the :class:`~Progress` class. + + """ + + id: TaskID + """Task ID associated with this task (used in Progress methods).""" + + description: str + """str: Description of the task.""" + + total: float + """str: Total number of steps in this task.""" + + completed: float + """float: Number of steps completed""" + + _get_time: GetTimeCallable + """Callable to get the current time.""" + + finished_time: Optional[float] = None + """float: Time task was finished.""" + + visible: bool = True + """bool: Indicates if this task is visible in the progress display.""" + + fields: Dict[str, Any] = field(default_factory=dict) + """dict: Arbitrary fields passed in via Progress.update.""" + + start_time: Optional[float] = field(default=None, init=False, repr=False) + """Optional[float]: Time this task was started, or None if not started.""" + + stop_time: Optional[float] = field(default=None, init=False, repr=False) + """Optional[float]: Time this task was stopped, or None if not stopped.""" + + _progress: Deque[ProgressSample] = field( + default_factory=deque, init=False, repr=False + ) + + _lock: RLock = field(repr=False, default_factory=RLock) + """Thread lock.""" + + def get_time(self) -> float: + """float: Get the current time, in seconds.""" + return self._get_time() # type: ignore + + @property + def started(self) -> bool: + """bool: Check if the task as started.""" + return self.start_time is not None + + @property + def remaining(self) -> float: + """float: Get the number of steps remaining.""" + return self.total - self.completed + + @property + def elapsed(self) -> Optional[float]: + """Optional[float]: Time elapsed since task was started, or ``None`` if the task hasn't started.""" + if self.start_time is None: + return None + if self.stop_time is not None: + return self.stop_time - self.start_time + return self.get_time() - self.start_time + + @property + def finished(self) -> bool: + """Check if the task has finished.""" + return self.finished_time is not None + + @property + def percentage(self) -> float: + """float: Get progress of task as a percentage.""" + if not self.total: + return 0.0 + completed = (self.completed / self.total) * 100.0 + completed = min(100.0, max(0.0, completed)) + return completed + + @property + def speed(self) -> Optional[float]: + """Optional[float]: Get the estimated speed in steps per second.""" + if self.start_time is None: + return None + with self._lock: + progress = self._progress + if not progress: + return None + total_time = progress[-1].timestamp - progress[0].timestamp + if total_time == 0: + return None + iter_progress = iter(progress) + next(iter_progress) + total_completed = sum(sample.completed for sample in iter_progress) + speed = total_completed / total_time + return speed + + @property + def time_remaining(self) -> Optional[float]: + """Optional[float]: Get estimated time to completion, or ``None`` if no data.""" + if self.finished: + return 0.0 + speed = self.speed + if not speed: + return None + estimate = ceil(self.remaining / speed) + return estimate + + def _reset(self) -> None: + """Reset progress.""" + self._progress.clear() + self.finished_time = None + + +class Progress(JupyterMixin): + """Renders an auto-updating progress bar(s). + + Args: + console (Console, optional): Optional Console instance. Default will an internal Console instance writing to stdout. + auto_refresh (bool, optional): Enable auto refresh. If disabled, you will need to call `refresh()`. + refresh_per_second (Optional[float], optional): Number of times per second to refresh the progress information or None to use default (10). Defaults to None. + speed_estimate_period: (float, optional): Period (in seconds) used to calculate the speed estimate. Defaults to 30. + transient: (bool, optional): Clear the progress on exit. Defaults to False. + redirect_stdout: (bool, optional): Enable redirection of stdout, so ``print`` may be used. Defaults to True. + redirect_stderr: (bool, optional): Enable redirection of stderr. Defaults to True. + get_time: (Callable, optional): A callable that gets the current time, or None to use Console.get_time. Defaults to None. + disable (bool, optional): Disable progress display. Defaults to False + expand (bool, optional): Expand tasks table to fit width. Defaults to False. + """ + + def __init__( + self, + *columns: Union[str, ProgressColumn], + console: Console = None, + auto_refresh: bool = True, + refresh_per_second: float = 10, + speed_estimate_period: float = 30.0, + transient: bool = False, + redirect_stdout: bool = True, + redirect_stderr: bool = True, + get_time: GetTimeCallable = None, + disable: bool = False, + expand: bool = False, + ) -> None: + assert ( + refresh_per_second is None or refresh_per_second > 0 # type: ignore + ), "refresh_per_second must be > 0" + self._lock = RLock() + self.columns = columns or ( + TextColumn("[progress.description]{task.description}"), + BarColumn(), + TextColumn("[progress.percentage]{task.percentage:>3.0f}%"), + TimeRemainingColumn(), + ) + self.speed_estimate_period = speed_estimate_period + + self.disable = disable + self.expand = expand + self._tasks: Dict[TaskID, Task] = {} + self._task_index: TaskID = TaskID(0) + self.live = Live( + console=console or get_console(), + auto_refresh=auto_refresh, + refresh_per_second=refresh_per_second, + transient=transient, + redirect_stdout=redirect_stdout, + redirect_stderr=redirect_stderr, + get_renderable=self.get_renderable, + ) + self.get_time = get_time or self.console.get_time + self.print = self.console.print + self.log = self.console.log + + @property + def console(self) -> Console: + return self.live.console + + @property + def tasks(self) -> List[Task]: + """Get a list of Task instances.""" + with self._lock: + return list(self._tasks.values()) + + @property + def task_ids(self) -> List[TaskID]: + """A list of task IDs.""" + with self._lock: + return list(self._tasks.keys()) + + @property + def finished(self) -> bool: + """Check if all tasks have been completed.""" + with self._lock: + if not self._tasks: + return True + return all(task.finished for task in self._tasks.values()) + + def start(self) -> None: + """Start the progress display.""" + self.live.start(refresh=True) + + def stop(self) -> None: + """Stop the progress display.""" + self.live.stop() + + def __enter__(self) -> "Progress": + self.start() + return self + + def __exit__(self, exc_type, exc_val, exc_tb) -> None: + self.stop() + + def track( + self, + sequence: Union[Iterable[ProgressType], Sequence[ProgressType]], + total: int = None, + task_id: Optional[TaskID] = None, + description="Working...", + update_period: float = 0.1, + ) -> Iterable[ProgressType]: + """Track progress by iterating over a sequence. + + Args: + sequence (Sequence[ProgressType]): A sequence of values you want to iterate over and track progress. + total: (int, optional): Total number of steps. Default is len(sequence). + task_id: (TaskID): Task to track. Default is new task. + description: (str, optional): Description of task, if new task is created. + update_period (float, optional): Minimum time (in seconds) between calls to update(). Defaults to 0.1. + + Returns: + Iterable[ProgressType]: An iterable of values taken from the provided sequence. + """ + + if total is None: + if isinstance(sequence, Sized): + task_total = len(sequence) + else: + raise ValueError( + f"unable to get size of {sequence!r}, please specify 'total'" + ) + else: + task_total = total + + if task_id is None: + task_id = self.add_task(description, total=task_total) + else: + self.update(task_id, total=task_total) + + if self.live.auto_refresh: + with _TrackThread(self, task_id, update_period) as track_thread: + for value in sequence: + yield value + track_thread.completed += 1 + else: + advance = self.advance + refresh = self.refresh + for value in sequence: + yield value + advance(task_id, 1) + refresh() + + def start_task(self, task_id: TaskID) -> None: + """Start a task. + + Starts a task (used when calculating elapsed time). You may need to call this manually, + if you called ``add_task`` with ``start=False``. + + Args: + task_id (TaskID): ID of task. + """ + with self._lock: + task = self._tasks[task_id] + if task.start_time is None: + task.start_time = self.get_time() + + def stop_task(self, task_id: TaskID) -> None: + """Stop a task. + + This will freeze the elapsed time on the task. + + Args: + task_id (TaskID): ID of task. + """ + with self._lock: + task = self._tasks[task_id] + current_time = self.get_time() + if task.start_time is None: + task.start_time = current_time + task.stop_time = current_time + + def update( + self, + task_id: TaskID, + *, + total: float = None, + completed: float = None, + advance: float = None, + description: str = None, + visible: bool = None, + refresh: bool = False, + **fields: Any, + ) -> None: + """Update information associated with a task. + + Args: + task_id (TaskID): Task id (returned by add_task). + total (float, optional): Updates task.total if not None. + completed (float, optional): Updates task.completed if not None. + advance (float, optional): Add a value to task.completed if not None. + description (str, optional): Change task description if not None. + visible (bool, optional): Set visible flag if not None. + refresh (bool): Force a refresh of progress information. Default is False. + **fields (Any): Additional data fields required for rendering. + """ + with self._lock: + task = self._tasks[task_id] + completed_start = task.completed + + if total is not None: + task.total = total + task._reset() + if advance is not None: + task.completed += advance + if completed is not None: + task.completed = completed + if description is not None: + task.description = description + if visible is not None: + task.visible = visible + task.fields.update(fields) + update_completed = task.completed - completed_start + + if refresh: + self.refresh() + + current_time = self.get_time() + old_sample_time = current_time - self.speed_estimate_period + _progress = task._progress + + popleft = _progress.popleft + while _progress and _progress[0].timestamp < old_sample_time: + popleft() + while len(_progress) > 1000: + popleft() + if update_completed > 0: + _progress.append(ProgressSample(current_time, update_completed)) + if task.completed >= task.total and task.finished_time is None: + task.finished_time = task.elapsed + + def reset( + self, + task_id: TaskID, + *, + start: bool = True, + total: Optional[int] = None, + completed: int = 0, + visible: Optional[bool] = None, + description: Optional[str] = None, + **fields: Any, + ) -> None: + """Reset a task so completed is 0 and the clock is reset. + + Args: + task_id (TaskID): ID of task. + start (bool, optional): Start the task after reset. Defaults to True. + total (int, optional): New total steps in task, or None to use current total. Defaults to None. + completed (int, optional): Number of steps completed. Defaults to 0. + **fields (str): Additional data fields required for rendering. + """ + current_time = self.get_time() + with self._lock: + task = self._tasks[task_id] + task._reset() + task.start_time = current_time if start else None + if total is not None: + task.total = total + task.completed = completed + if visible is not None: + task.visible = visible + if fields: + task.fields = fields + if description is not None: + task.description = description + task.finished_time = None + self.refresh() + + def advance(self, task_id: TaskID, advance: float = 1) -> None: + """Advance task by a number of steps. + + Args: + task_id (TaskID): ID of task. + advance (float): Number of steps to advance. Default is 1. + """ + current_time = self.get_time() + with self._lock: + task = self._tasks[task_id] + completed_start = task.completed + task.completed += advance + update_completed = task.completed - completed_start + old_sample_time = current_time - self.speed_estimate_period + _progress = task._progress + + popleft = _progress.popleft + while _progress and _progress[0].timestamp < old_sample_time: + popleft() + while len(_progress) > 1000: + popleft() + _progress.append(ProgressSample(current_time, update_completed)) + if task.completed >= task.total and task.finished_time is None: + task.finished_time = task.elapsed + + def refresh(self) -> None: + """Refresh (render) the progress information.""" + if not self.disable: + self.live.refresh() + + def get_renderable(self) -> RenderableType: + """Get a renderable for the progress display.""" + renderable = RenderGroup(*self.get_renderables()) + return renderable + + def get_renderables(self) -> Iterable[RenderableType]: + """Get a number of renderables for the progress display.""" + table = self.make_tasks_table(self.tasks) + yield table + + def make_tasks_table(self, tasks: Iterable[Task]) -> Table: + """Get a table to render the Progress display. + + Args: + tasks (Iterable[Task]): An iterable of Task instances, one per row of the table. + + Returns: + Table: A table instance. + """ + + table_columns = ( + ( + Column(no_wrap=True) + if isinstance(_column, str) + else _column.get_table_column().copy() + ) + for _column in self.columns + ) + table = Table.grid(*table_columns, padding=(0, 1), expand=self.expand) + + for task in tasks: + if task.visible: + table.add_row( + *( + ( + column.format(task=task) + if isinstance(column, str) + else column(task) + ) + for column in self.columns + ) + ) + return table + + def __rich__(self) -> RenderableType: + """Makes the Progress class itself renderable.""" + return self.get_renderable() + + def add_task( + self, + description: str, + start: bool = True, + total: int = 100, + completed: int = 0, + visible: bool = True, + **fields: Any, + ) -> TaskID: + """Add a new 'task' to the Progress display. + + Args: + description (str): A description of the task. + start (bool, optional): Start the task immediately (to calculate elapsed time). If set to False, + you will need to call `start` manually. Defaults to True. + total (int, optional): Number of total steps in the progress if know. Defaults to 100. + completed (int, optional): Number of steps completed so far.. Defaults to 0. + visible (bool, optional): Enable display of the task. Defaults to True. + **fields (str): Additional data fields required for rendering. + + Returns: + TaskID: An ID you can use when calling `update`. + """ + with self._lock: + task = Task( + self._task_index, + description, + total, + completed, + visible=visible, + fields=fields, + _get_time=self.get_time, + _lock=self._lock, + ) + self._tasks[self._task_index] = task + if start: + self.start_task(self._task_index) + self.refresh() + try: + return self._task_index + finally: + self._task_index = TaskID(int(self._task_index) + 1) + + def remove_task(self, task_id: TaskID) -> None: + """Delete a task if it exists. + + Args: + task_id (TaskID): A task ID. + + """ + with self._lock: + del self._tasks[task_id] + + +if __name__ == "__main__": # pragma: no coverage + + import random + import time + + from .panel import Panel + from .rule import Rule + from .syntax import Syntax + from .table import Table + + syntax = Syntax( + '''def loop_last(values: Iterable[T]) -> Iterable[Tuple[bool, T]]: + """Iterate and generate a tuple with a flag for last value.""" + iter_values = iter(values) + try: + previous_value = next(iter_values) + except StopIteration: + return + for value in iter_values: + yield False, previous_value + previous_value = value + yield True, previous_value''', + "python", + line_numbers=True, + ) + + table = Table("foo", "bar", "baz") + table.add_row("1", "2", "3") + + progress_renderables = [ + "Text may be printed while the progress bars are rendering.", + Panel("In fact, [i]any[/i] renderable will work"), + "Such as [magenta]tables[/]...", + table, + "Pretty printed structures...", + {"type": "example", "text": "Pretty printed"}, + "Syntax...", + syntax, + Rule("Give it a try!"), + ] + + from itertools import cycle + + examples = cycle(progress_renderables) + + console = Console(record=True) + + with Progress( + SpinnerColumn(), + TextColumn("[progress.description]{task.description}"), + BarColumn(), + TextColumn("[progress.percentage]{task.percentage:>3.0f}%"), + TimeRemainingColumn(), + TimeElapsedColumn(), + console=console, + transient=True, + ) as progress: + + task1 = progress.add_task("[red]Downloading", total=1000) + task2 = progress.add_task("[green]Processing", total=1000) + task3 = progress.add_task("[yellow]Thinking", total=1000, start=False) + + while not progress.finished: + progress.update(task1, advance=0.5) + progress.update(task2, advance=0.3) + time.sleep(0.01) + if random.randint(0, 100) < 1: + progress.log(next(examples)) diff --git a/rich/progress_bar.py b/rich/progress_bar.py new file mode 100644 index 0000000..63b0168 --- /dev/null +++ b/rich/progress_bar.py @@ -0,0 +1,214 @@ +import math +from functools import lru_cache +from time import monotonic +from typing import Iterable, List, Optional + +from .color import Color, blend_rgb +from .color_triplet import ColorTriplet +from .console import Console, ConsoleOptions, RenderResult +from .jupyter import JupyterMixin +from .measure import Measurement +from .segment import Segment +from .style import Style, StyleType + +# Number of characters before 'pulse' animation repeats +PULSE_SIZE = 20 + + +class ProgressBar(JupyterMixin): + """Renders a (progress) bar. Used by rich.progress. + + Args: + total (float, optional): Number of steps in the bar. Defaults to 100. + completed (float, optional): Number of steps completed. Defaults to 0. + width (int, optional): Width of the bar, or ``None`` for maximum width. Defaults to None. + pulse (bool, optional): Enable pulse effect. Defaults to False. + style (StyleType, optional): Style for the bar background. Defaults to "bar.back". + complete_style (StyleType, optional): Style for the completed bar. Defaults to "bar.complete". + finished_style (StyleType, optional): Style for a finished bar. Defaults to "bar.done". + pulse_style (StyleType, optional): Style for pulsing bars. Defaults to "bar.pulse". + animation_time (Optional[float], optional): Time in seconds to use for animation, or None to use system time. + """ + + def __init__( + self, + total: float = 100, + completed: float = 0, + width: int = None, + pulse: bool = False, + style: StyleType = "bar.back", + complete_style: StyleType = "bar.complete", + finished_style: StyleType = "bar.finished", + pulse_style: StyleType = "bar.pulse", + animation_time: float = None, + ): + self.total = total + self.completed = completed + self.width = width + self.pulse = pulse + self.style = style + self.complete_style = complete_style + self.finished_style = finished_style + self.pulse_style = pulse_style + self.animation_time = animation_time + + self._pulse_segments: Optional[List[Segment]] = None + + def __repr__(self) -> str: + return f"<Bar {self.completed!r} of {self.total!r}>" + + @property + def percentage_completed(self) -> float: + """Calculate percentage complete.""" + completed = (self.completed / self.total) * 100.0 + completed = min(100, max(0.0, completed)) + return completed + + @lru_cache(maxsize=16) + def _get_pulse_segments( + self, + fore_style: Style, + back_style: Style, + color_system: str, + no_color: bool, + ascii: bool = False, + ) -> List[Segment]: + """Get a list of segments to render a pulse animation. + + Returns: + List[Segment]: A list of segments, one segment per character. + """ + bar = "-" if ascii else "━" + segments: List[Segment] = [] + if color_system not in ("standard", "eight_bit", "truecolor") or no_color: + segments += [Segment(bar, fore_style)] * (PULSE_SIZE // 2) + segments += [Segment(" " if no_color else bar, back_style)] * ( + PULSE_SIZE - (PULSE_SIZE // 2) + ) + return segments + + append = segments.append + fore_color = ( + fore_style.color.get_truecolor() + if fore_style.color + else ColorTriplet(255, 0, 255) + ) + back_color = ( + back_style.color.get_truecolor() + if back_style.color + else ColorTriplet(0, 0, 0) + ) + cos = math.cos + pi = math.pi + _Segment = Segment + _Style = Style + from_triplet = Color.from_triplet + + for index in range(PULSE_SIZE): + position = index / PULSE_SIZE + fade = 0.5 + cos((position * pi * 2)) / 2.0 + color = blend_rgb(fore_color, back_color, cross_fade=fade) + append(_Segment(bar, _Style(color=from_triplet(color)))) + return segments + + def update(self, completed: float, total: float = None) -> None: + """Update progress with new values. + + Args: + completed (float): Number of steps completed. + total (float, optional): Total number of steps, or ``None`` to not change. Defaults to None. + """ + self.completed = completed + self.total = total if total is not None else self.total + + def _render_pulse( + self, console: Console, width: int, ascii: bool = False + ) -> Iterable[Segment]: + """Renders the pulse animation. + + Args: + console (Console): Console instance. + width (int): Width in characters of pulse animation. + + Returns: + RenderResult: [description] + + Yields: + Iterator[Segment]: Segments to render pulse + """ + fore_style = console.get_style(self.pulse_style, default="white") + back_style = console.get_style(self.style, default="black") + + pulse_segments = self._get_pulse_segments( + fore_style, back_style, console.color_system, console.no_color, ascii=ascii + ) + segment_count = len(pulse_segments) + current_time = ( + monotonic() if self.animation_time is None else self.animation_time + ) + segments = pulse_segments * (int(width / segment_count) + 2) + offset = int(-current_time * 15) % segment_count + segments = segments[offset : offset + width] + yield from segments + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + + width = min(self.width or options.max_width, options.max_width) + ascii = options.legacy_windows or options.ascii_only + if self.pulse: + yield from self._render_pulse(console, width, ascii=ascii) + return + + completed = min(self.total, max(0, self.completed)) + + bar = "-" if ascii else "━" + half_bar_right = " " if ascii else "╸" + half_bar_left = " " if ascii else "╺" + complete_halves = ( + int(width * 2 * completed / self.total) if self.total else width * 2 + ) + bar_count = complete_halves // 2 + half_bar_count = complete_halves % 2 + style = console.get_style(self.style) + complete_style = console.get_style( + self.complete_style if self.completed < self.total else self.finished_style + ) + _Segment = Segment + if bar_count: + yield _Segment(bar * bar_count, complete_style) + if half_bar_count: + yield _Segment(half_bar_right * half_bar_count, complete_style) + + if not console.no_color: + remaining_bars = width - bar_count - half_bar_count + if remaining_bars and console.color_system is not None: + if not half_bar_count and bar_count: + yield _Segment(half_bar_left, style) + remaining_bars -= 1 + if remaining_bars: + yield _Segment(bar * remaining_bars, style) + + def __rich_measure__(self, console: Console, max_width: int) -> Measurement: + return ( + Measurement(self.width, self.width) + if self.width is not None + else Measurement(4, max_width) + ) + + +if __name__ == "__main__": # pragma: no cover + console = Console() + bar = ProgressBar(width=50, total=100) + + import time + + console.show_cursor(False) + for n in range(0, 101, 1): + bar.update(n) + console.print(bar) + console.file.write("\r") + time.sleep(0.05) + console.show_cursor(True) + console.print() diff --git a/rich/prompt.py b/rich/prompt.py new file mode 100644 index 0000000..7db5d2d --- /dev/null +++ b/rich/prompt.py @@ -0,0 +1,378 @@ +from typing import Any, Generic, List, Optional, TextIO, TypeVar, Union, overload + +from . import get_console +from .console import Console +from .text import Text, TextType + +PromptType = TypeVar("PromptType") +DefaultType = TypeVar("DefaultType") + + +class PromptError(Exception): + """Exception base class for prompt related errors.""" + + +class InvalidResponse(PromptError): + """Exception to indicate a response was invalid. Raise this within process_response() to indicate an error + and provide an error message. + + Args: + message (Union[str, Text]): Error message. + """ + + def __init__(self, message: TextType) -> None: + self.message = message + + def __rich__(self) -> TextType: + return self.message + + +class PromptBase(Generic[PromptType]): + """Ask the user for input until a valid response is received. This is the base class, see one of + the concrete classes for examples. + + Args: + prompt (TextType, optional): Prompt text. Defaults to "". + console (Console, optional): A Console instance or None to use global console. Defaults to None. + password (bool, optional): Enable password input. Defaults to False. + choices (List[str], optional): A list of valid choices. Defaults to None. + show_default (bool, optional): Show default in prompt. Defaults to True. + show_choices (bool, optional): Show choices in prompt. Defaults to True. + """ + + response_type: type = str + + validate_error_message = "[prompt.invalid]Please enter a valid value" + illegal_choice_message = ( + "[prompt.invalid.choice]Please select one of the available options" + ) + prompt_suffix = ": " + + choices: Optional[List[str]] = None + + def __init__( + self, + prompt: TextType = "", + *, + console: Console = None, + password: bool = False, + choices: List[str] = None, + show_default: bool = True, + show_choices: bool = True, + ) -> None: + self.console = console or get_console() + self.prompt = ( + Text.from_markup(prompt, style="prompt") + if isinstance(prompt, str) + else prompt + ) + self.password = password + if choices is not None: + self.choices = choices + self.show_default = show_default + self.show_choices = show_choices + + @classmethod + @overload + def ask( + cls, + prompt: TextType = "", + *, + console: Console = None, + password: bool = False, + choices: List[str] = None, + show_default: bool = True, + show_choices: bool = True, + default: DefaultType, + stream: TextIO = None, + ) -> Union[DefaultType, PromptType]: + ... + + @classmethod + @overload + def ask( + cls, + prompt: TextType = "", + *, + console: Console = None, + password: bool = False, + choices: List[str] = None, + show_default: bool = True, + show_choices: bool = True, + stream: TextIO = None, + ) -> PromptType: + ... + + @classmethod + def ask( + cls, + prompt: TextType = "", + *, + console: Console = None, + password: bool = False, + choices: List[str] = None, + show_default: bool = True, + show_choices: bool = True, + default: Any = ..., + stream: TextIO = None, + ) -> Any: + """Shortcut to construct and run a prompt loop and return the result. + + Example: + >>> filename = Prompt.ask("Enter a filename") + + Args: + prompt (TextType, optional): Prompt text. Defaults to "". + console (Console, optional): A Console instance or None to use global console. Defaults to None. + password (bool, optional): Enable password input. Defaults to False. + choices (List[str], optional): A list of valid choices. Defaults to None. + show_default (bool, optional): Show default in prompt. Defaults to True. + show_choices (bool, optional): Show choices in prompt. Defaults to True. + stream (TextIO, optional): Optional text file open for reading to get input. Defaults to None. + """ + _prompt = cls( + prompt, + console=console, + password=password, + choices=choices, + show_default=show_default, + show_choices=show_choices, + ) + return _prompt(default=default, stream=stream) + + def render_default(self, default: DefaultType) -> Text: + """Turn the supplied default in to a Text instance. + + Args: + default (DefaultType): Default value. + + Returns: + Text: Text containing rendering of default value. + """ + return Text(f"({default})", "prompt.default") + + def make_prompt(self, default: DefaultType) -> Text: + """Make prompt text. + + Args: + default (DefaultType): Default value. + + Returns: + Text: Text to display in prompt. + """ + prompt = self.prompt.copy() + prompt.end = "" + + if self.show_choices and self.choices: + _choices = "/".join(self.choices) + choices = f"[{_choices}]" + prompt.append(" ") + prompt.append(choices, "prompt.choices") + + if ( + default != ... + and self.show_default + and isinstance(default, (str, self.response_type)) + ): + prompt.append(" ") + _default = self.render_default(default) + prompt.append(_default) + + prompt.append(self.prompt_suffix) + + return prompt + + @classmethod + def get_input( + cls, + console: Console, + prompt: TextType, + password: bool, + stream: TextIO = None, + ) -> str: + """Get input from user. + + Args: + console (Console): Console instance. + prompt (TextType): Prompt text. + password (bool): Enable password entry. + + Returns: + str: String from user. + """ + return console.input(prompt, password=password, stream=stream) + + def check_choice(self, value: str) -> bool: + """Check value is in the list of valid choices. + + Args: + value (str): Value entered by user. + + Returns: + bool: True if choice was valid, otherwise False. + """ + assert self.choices is not None + return value.strip() in self.choices + + def process_response(self, value: str) -> PromptType: + """Process response from user, convert to prompt type. + + Args: + value (str): String typed by user. + + Raises: + InvalidResponse: If ``value`` is invalid. + + Returns: + PromptType: The value to be returned from ask method. + """ + value = value.strip() + try: + return_value = self.response_type(value) + except ValueError: + raise InvalidResponse(self.validate_error_message) + + if self.choices is not None and not self.check_choice(value): + raise InvalidResponse(self.illegal_choice_message) + + return return_value + + def on_validate_error(self, value: str, error: InvalidResponse) -> None: + """Called to handle validation error. + + Args: + value (str): String entered by user. + error (InvalidResponse): Exception instance the initiated the error. + """ + self.console.print(error) + + def pre_prompt(self) -> None: + """Hook to display something before the prompt.""" + + @overload + def __call__(self, *, stream: TextIO = None) -> PromptType: + ... + + @overload + def __call__( + self, *, default: DefaultType, stream: TextIO = None + ) -> Union[PromptType, DefaultType]: + ... + + def __call__(self, *, default: Any = ..., stream: TextIO = None) -> Any: + """Run the prompt loop. + + Args: + default (Any, optional): Optional default value. + + Returns: + PromptType: Processed value. + """ + while True: + self.pre_prompt() + prompt = self.make_prompt(default) + value = self.get_input(self.console, prompt, self.password, stream=stream) + if value == "" and default != ...: + return default + try: + return_value = self.process_response(value) + except InvalidResponse as error: + self.on_validate_error(value, error) + continue + else: + return return_value + + +class Prompt(PromptBase[str]): + """A prompt that returns a str. + + Example: + >>> name = Prompt.ask("Enter your name") + + + """ + + response_type = str + + +class IntPrompt(PromptBase[int]): + """A prompt that returns an integer. + + Example: + >>> burrito_count = IntPrompt.ask("How many burritos do you want to order") + + """ + + response_type = int + validate_error_message = "[prompt.invalid]Please enter a valid integer number" + + +class FloatPrompt(PromptBase[int]): + """A prompt that returns a float. + + Example: + >>> temperature = FloatPrompt.ask("Enter desired temperature") + + """ + + response_type = float + validate_error_message = "[prompt.invalid]Please enter a number" + + +class Confirm(PromptBase[bool]): + """A yes / no confirmation prompt. + + Example: + >>> if Confirm.ask("Continue"): + run_job() + + """ + + response_type = bool + validate_error_message = "[prompt.invalid]Please enter Y or N" + choices = ["y", "n"] + + def render_default(self, default: DefaultType) -> Text: + """Render the default as (y) or (n) rather than True/False.""" + assert self.choices is not None + yes, no = self.choices + return Text(f"({yes})" if default else f"({no})", style="prompt.default") + + def process_response(self, value: str) -> bool: + """Convert choices to a bool.""" + value = value.strip().lower() + if value not in self.choices: + raise InvalidResponse(self.validate_error_message) + assert self.choices is not None + return value == self.choices[0] + + +if __name__ == "__main__": # pragma: no cover + + from rich import print + + if Confirm.ask("Run [i]prompt[/i] tests?", default=True): + while True: + result = IntPrompt.ask( + ":rocket: Enter a number between [b]1[/b] and [b]10[/b]", default=5 + ) + if result >= 1 and result <= 10: + break + print(":pile_of_poo: [prompt.invalid]Number must be between 1 and 10") + print(f"number={result}") + + while True: + password = Prompt.ask( + "Please enter a password [cyan](must be at least 5 characters)", + password=True, + ) + if len(password) >= 5: + break + print("[prompt.invalid]password too short") + print(f"password={password!r}") + + fruit = Prompt.ask("Enter a fruit", choices=["apple", "orange", "pear"]) + print(f"fruit={fruit!r}") + + else: + print("[b]OK :loudly_crying_face:") diff --git a/rich/protocol.py b/rich/protocol.py new file mode 100644 index 0000000..6468e53 --- /dev/null +++ b/rich/protocol.py @@ -0,0 +1,8 @@ +from typing import Any + +from .abc import RichRenderable + + +def is_renderable(check_object: Any) -> bool: + """Check if an object may be rendered by Rich.""" + return isinstance(check_object, str) or isinstance(check_object, RichRenderable) diff --git a/rich/py.typed b/rich/py.typed new file mode 100644 index 0000000..e69de29 --- /dev/null +++ b/rich/py.typed diff --git a/rich/rule.py b/rich/rule.py new file mode 100644 index 0000000..d14394f --- /dev/null +++ b/rich/rule.py @@ -0,0 +1,115 @@ +from typing import Union + +from .align import AlignMethod +from .cells import cell_len, set_cell_size +from .console import Console, ConsoleOptions, RenderResult +from .jupyter import JupyterMixin +from .style import Style +from .text import Text + + +class Rule(JupyterMixin): + """A console renderable to draw a horizontal rule (line). + + Args: + title (Union[str, Text], optional): Text to render in the rule. Defaults to "". + characters (str, optional): Character(s) used to draw the line. Defaults to "─". + style (StyleType, optional): Style of Rule. Defaults to "rule.line". + end (str, optional): Character at end of Rule. defaults to "\\\\n" + align (str, optional): How to align the title, one of "left", "center", or "right". Defaults to "center". + """ + + def __init__( + self, + title: Union[str, Text] = "", + *, + characters: str = "─", + style: Union[str, Style] = "rule.line", + end: str = "\n", + align: AlignMethod = "center", + ) -> None: + if cell_len(characters) < 1: + raise ValueError( + "'characters' argument must have a cell width of at least 1" + ) + if align not in ("left", "center", "right"): + raise ValueError( + f'invalid value for align, expected "left", "center", "right" (not {align!r})' + ) + self.title = title + self.characters = characters + self.style = style + self.end = end + self.align = align + + def __repr__(self) -> str: + return f"Rule({self.title!r}, {self.characters!r})" + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + width = options.max_width + + # Python3.6 doesn't have an isascii method on str + isascii = getattr(str, "isascii", None) or ( + lambda s: all(ord(c) < 128 for c in s) + ) + characters = ( + "-" + if (options.ascii_only and not isascii(self.characters)) + else self.characters + ) + + chars_len = cell_len(characters) + if not self.title: + rule_text = Text(characters * ((width // chars_len) + 1), self.style) + rule_text.truncate(width) + rule_text.plain = set_cell_size(rule_text.plain, width) + yield rule_text + return + + if isinstance(self.title, Text): + title_text = self.title + else: + title_text = console.render_str(self.title, style="rule.text") + + title_text.plain = title_text.plain.replace("\n", " ") + title_text.expand_tabs() + rule_text = Text(end=self.end) + + if self.align == "center": + title_text.truncate(width - 4, overflow="ellipsis") + side_width = (width - cell_len(title_text.plain)) // 2 + left = Text(characters * (side_width // chars_len + 1)) + left.truncate(side_width - 1) + right_length = width - cell_len(left.plain) - cell_len(title_text.plain) + right = Text(characters * (side_width // chars_len + 1)) + right.truncate(right_length) + rule_text.append(left.plain + " ", self.style) + rule_text.append(title_text) + rule_text.append(" " + right.plain, self.style) + elif self.align == "left": + title_text.truncate(width - 2, overflow="ellipsis") + rule_text.append(title_text) + rule_text.append(" ") + rule_text.append(characters * (width - rule_text.cell_len), self.style) + elif self.align == "right": + title_text.truncate(width - 2, overflow="ellipsis") + rule_text.append(characters * (width - title_text.cell_len - 1), self.style) + rule_text.append(" ") + rule_text.append(title_text) + + rule_text.plain = set_cell_size(rule_text.plain, width) + yield rule_text + + +if __name__ == "__main__": # pragma: no cover + from rich.console import Console + import sys + + try: + text = sys.argv[1] + except IndexError: + text = "Hello, World" + console = Console() + console.print(Rule(title=text)) diff --git a/rich/scope.py b/rich/scope.py new file mode 100644 index 0000000..4ab9525 --- /dev/null +++ b/rich/scope.py @@ -0,0 +1,86 @@ +from collections.abc import Mapping +from typing import TYPE_CHECKING, Any, Tuple + +from .highlighter import ReprHighlighter +from .panel import Panel +from .pretty import Pretty +from .table import Table +from .text import Text, TextType + +if TYPE_CHECKING: + from .console import ConsoleRenderable + + +def render_scope( + scope: Mapping, + *, + title: TextType = None, + sort_keys: bool = True, + indent_guides: bool = False, + max_length: int = None, + max_string: int = None, +) -> "ConsoleRenderable": + """Render python variables in a given scope. + + Args: + scope (Mapping): A mapping containing variable names and values. + title (str, optional): Optional title. Defaults to None. + sort_keys (bool, optional): Enable sorting of items. Defaults to True. + indent_guides (bool, optional): Enable indentaton guides. Defaults to False. + max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. + Defaults to None. + max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to None. + + Returns: + ConsoleRenderable: A renderable object. + """ + highlighter = ReprHighlighter() + items_table = Table.grid(padding=(0, 1), expand=False) + items_table.add_column(justify="right") + + def sort_items(item: Tuple[str, Any]) -> Tuple[bool, str]: + """Sort special variables first, then alphabetically.""" + key, _ = item + return (not key.startswith("__"), key.lower()) + + items = sorted(scope.items(), key=sort_items) if sort_keys else scope.items() + for key, value in items: + key_text = Text.assemble( + (key, "scope.key.special" if key.startswith("__") else "scope.key"), + (" =", "scope.equals"), + ) + items_table.add_row( + key_text, + Pretty( + value, + highlighter=highlighter, + indent_guides=indent_guides, + max_length=max_length, + max_string=max_string, + ), + ) + return Panel.fit( + items_table, + title=title, + border_style="scope.border", + padding=(0, 1), + ) + + +if __name__ == "__main__": # pragma: no cover + from rich import print + + print() + + def test(foo, bar): + list_of_things = [1, 2, 3, None, 4, True, False, "Hello World"] + dict_of_things = { + "version": "1.1", + "method": "confirmFruitPurchase", + "params": [["apple", "orange", "mangoes", "pomelo"], 1.123], + "id": "194521489", + } + print(render_scope(locals(), title="[i]locals", sort_keys=False)) + + test(20.3423, 3.1427) + print() diff --git a/rich/screen.py b/rich/screen.py new file mode 100644 index 0000000..3ca5355 --- /dev/null +++ b/rich/screen.py @@ -0,0 +1,40 @@ +from typing import TYPE_CHECKING + +from .segment import Segment +from .style import StyleType +from ._loop import loop_last + + +if TYPE_CHECKING: + from .console import Console, ConsoleOptions, RenderResult, RenderableType + + +class Screen: + """A renderable that fills the terminal screen and crops excess. + + Args: + renderable (RenderableType): Child renderable. + style (StyleType, optional): Optional background style. Defaults to None. + """ + + def __init__( + self, renderable: "RenderableType" = None, style: StyleType = None + ) -> None: + self.renderable = renderable + self.style = style + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + width, height = options.size + style = console.get_style(self.style) if self.style else None + render_options = options.update(width=width, height=height) + lines = console.render_lines( + self.renderable or "", render_options, style=style, pad=True + ) + lines = Segment.set_shape(lines, width, height, style=style) + new_line = Segment.line() + for last, line in loop_last(lines): + yield from line + if not last: + yield new_line diff --git a/rich/segment.py b/rich/segment.py new file mode 100644 index 0000000..ff4996a --- /dev/null +++ b/rich/segment.py @@ -0,0 +1,392 @@ +from typing import Dict, NamedTuple, Optional + +from .cells import cell_len, set_cell_size +from .style import Style + +from itertools import filterfalse, zip_longest +from operator import attrgetter +from typing import Iterable, List, Tuple + + +class Segment(NamedTuple): + """A piece of text with associated style. Segments are produced by the Console render process and + are ultimately converted in to strings to be written to the terminal. + + Args: + text (str): A piece of text. + style (:class:`~rich.style.Style`, optional): An optional style to apply to the text. + is_control (bool, optional): Boolean that marks segment as containing non-printable control codes. + """ + + text: str = "" + """Raw text.""" + style: Optional[Style] = None + """An optional style.""" + is_control: bool = False + """True if the segment contains control codes, otherwise False.""" + + def __repr__(self) -> str: + """Simplified repr.""" + if self.is_control: + return f"Segment.control({self.text!r}, {self.style!r})" + else: + return f"Segment({self.text!r}, {self.style!r})" + + def __bool__(self) -> bool: + """Check if the segment contains text.""" + return bool(self.text) + + @property + def cell_length(self) -> int: + """Get cell length of segment.""" + return 0 if self.is_control else cell_len(self.text) + + @classmethod + def control(cls, text: str, style: Optional[Style] = None) -> "Segment": + """Create a Segment with control codes. + + Args: + text (str): Text containing non-printable control codes. + style (Optional[style]): Optional style. + + Returns: + Segment: A Segment instance with ``is_control=True``. + """ + return cls(text, style, is_control=True) + + @classmethod + def make_control(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]: + """Convert all segments in to control segments. + + Returns: + Iterable[Segments]: Segments with is_control=True + """ + return [cls(text, style, True) for text, style, _ in segments] + + @classmethod + def line(cls, is_control: bool = False) -> "Segment": + """Make a new line segment.""" + return cls("\n", is_control=is_control) + + @classmethod + def apply_style( + cls, + segments: Iterable["Segment"], + style: Style = None, + post_style: Style = None, + ) -> Iterable["Segment"]: + """Apply style(s) to an iterable of segments. + + Returns an iterable of segments where the style is replaced by ``style + segment.style + post_style``. + + Args: + segments (Iterable[Segment]): Segments to process. + style (Style, optional): Base style. Defaults to None. + post_style (Style, optional): Style to apply on top of segment style. Defaults to None. + + Returns: + Iterable[Segments]: A new iterable of segments (possibly the same iterable). + """ + if style: + apply = style.__add__ + segments = ( + cls(text, None if is_control else apply(_style), is_control) + for text, _style, is_control in segments + ) + if post_style: + segments = ( + cls( + text, + None + if is_control + else (_style + post_style if _style else post_style), + is_control, + ) + for text, _style, is_control in segments + ) + return segments + + @classmethod + def filter_control( + cls, segments: Iterable["Segment"], is_control=False + ) -> Iterable["Segment"]: + """Filter segments by ``is_control`` attribute. + + Args: + segments (Iterable[Segment]): An iterable of Segment instances. + is_control (bool, optional): is_control flag to match in search. + + Returns: + Iterable[Segment]: And iterable of Segment instances. + + """ + if is_control: + return filter(attrgetter("is_control"), segments) + else: + return filterfalse(attrgetter("is_control"), segments) + + @classmethod + def split_lines(cls, segments: Iterable["Segment"]) -> Iterable[List["Segment"]]: + """Split a sequence of segments in to a list of lines. + + Args: + segments (Iterable[Segment]): Segments potentially containing line feeds. + + Yields: + Iterable[List[Segment]]: Iterable of segment lists, one per line. + """ + line: List[Segment] = [] + append = line.append + + for segment in segments: + if "\n" in segment.text and not segment.is_control: + text, style, _ = segment + while text: + _text, new_line, text = text.partition("\n") + if _text: + append(cls(_text, style)) + if new_line: + yield line + line = [] + append = line.append + else: + append(segment) + if line: + yield line + + @classmethod + def split_and_crop_lines( + cls, + segments: Iterable["Segment"], + length: int, + style: Style = None, + pad: bool = True, + include_new_lines: bool = True, + ) -> Iterable[List["Segment"]]: + """Split segments in to lines, and crop lines greater than a given length. + + Args: + segments (Iterable[Segment]): An iterable of segments, probably + generated from console.render. + length (int): Desired line length. + style (Style, optional): Style to use for any padding. + pad (bool): Enable padding of lines that are less than `length`. + + Returns: + Iterable[List[Segment]]: An iterable of lines of segments. + """ + line: List[Segment] = [] + append = line.append + + adjust_line_length = cls.adjust_line_length + new_line_segment = cls("\n") + + for segment in segments: + if "\n" in segment.text and not segment.is_control: + text, style, _ = segment + while text: + _text, new_line, text = text.partition("\n") + if _text: + append(cls(_text, style)) + if new_line: + cropped_line = adjust_line_length( + line, length, style=style, pad=pad + ) + if include_new_lines: + cropped_line.append(new_line_segment) + yield cropped_line + del line[:] + else: + append(segment) + if line: + yield adjust_line_length(line, length, style=style, pad=pad) + + @classmethod + def adjust_line_length( + cls, line: List["Segment"], length: int, style: Style = None, pad: bool = True + ) -> List["Segment"]: + """Adjust a line to a given width (cropping or padding as required). + + Args: + segments (Iterable[Segment]): A list of segments in a single line. + length (int): The desired width of the line. + style (Style, optional): The style of padding if used (space on the end). Defaults to None. + pad (bool, optional): Pad lines with spaces if they are shorter than `length`. Defaults to True. + + Returns: + List[Segment]: A line of segments with the desired length. + """ + line_length = sum(segment.cell_length for segment in line) + new_line: List[Segment] + + if line_length < length: + if pad: + new_line = line + [cls(" " * (length - line_length), style)] + else: + new_line = line[:] + elif line_length > length: + new_line = [] + append = new_line.append + line_length = 0 + for segment in line: + segment_length = segment.cell_length + if line_length + segment_length < length or segment.is_control: + append(segment) + line_length += segment_length + else: + text, segment_style, _ = segment + text = set_cell_size(text, length - line_length) + append(cls(text, segment_style)) + break + else: + new_line = line[:] + return new_line + + @classmethod + def get_line_length(cls, line: List["Segment"]) -> int: + """Get the length of list of segments. + + Args: + line (List[Segment]): A line encoded as a list of Segments (assumes no '\\\\n' characters), + + Returns: + int: The length of the line. + """ + return sum(segment.cell_length for segment in line) + + @classmethod + def get_shape(cls, lines: List[List["Segment"]]) -> Tuple[int, int]: + """Get the shape (enclosing rectangle) of a list of lines. + + Args: + lines (List[List[Segment]]): A list of lines (no '\\\\n' characters). + + Returns: + Tuple[int, int]: Width and height in characters. + """ + get_line_length = cls.get_line_length + max_width = max(get_line_length(line) for line in lines) if lines else 0 + return (max_width, len(lines)) + + @classmethod + def set_shape( + cls, + lines: List[List["Segment"]], + width: int, + height: int = None, + style: Style = None, + ) -> List[List["Segment"]]: + """Set the shape of a list of lines (enclosing rectangle). + + Args: + lines (List[List[Segment]]): A list of lines. + width (int): Desired width. + height (int, optional): Desired height or None for no change. + style (Style, optional): Style of any padding added. Defaults to None. + + Returns: + List[List[Segment]]: New list of lines that fits width x height. + """ + if height is None: + height = len(lines) + new_lines: List[List[Segment]] = [] + pad_line = [Segment(" " * width, style)] + append = new_lines.append + adjust_line_length = cls.adjust_line_length + line: Optional[List[Segment]] + iter_lines = iter(lines) + for _ in range(height): + line = next(iter_lines, None) + if line is None: + append(pad_line) + else: + append(adjust_line_length(line, width, style=style)) + return new_lines + + @classmethod + def simplify(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]: + """Simplify an iterable of segments by combining contiguous segments with the same style. + + Args: + segments (Iterable[Segment]): An iterable of segments. + + Returns: + Iterable[Segment]: A possibly smaller iterable of segments that will render the same way. + """ + iter_segments = iter(segments) + try: + last_segment = next(iter_segments) + except StopIteration: + return + + _Segment = Segment + for segment in iter_segments: + if last_segment.style == segment.style and not segment.is_control: + last_segment = _Segment( + last_segment.text + segment.text, last_segment.style + ) + else: + yield last_segment + last_segment = segment + yield last_segment + + @classmethod + def strip_links(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]: + """Remove all links from an iterable of styles. + + Args: + segments (Iterable[Segment]): An iterable segments. + + Yields: + Segment: Segments with link removed. + """ + for segment in segments: + if segment.is_control or segment.style is None: + yield segment + else: + text, style, _is_control = segment + yield cls(text, style.update_link(None) if style else None) + + @classmethod + def strip_styles(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]: + """Remove all styles from an iterable of segments. + + Args: + segments (Iterable[Segment]): An iterable segments. + + Yields: + Segment: Segments with styles replace with None + """ + for text, _style, is_control in segments: + yield cls(text, None, is_control) + + @classmethod + def remove_color(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]: + """Remove all color from an iterable of segments. + + Args: + segments (Iterable[Segment]): An iterable segments. + + Yields: + Segment: Segments with colorless style. + """ + + cache: Dict[Style, Style] = {} + for text, style, is_control in segments: + if style: + colorless_style = cache.get(style) + if colorless_style is None: + colorless_style = style.without_color + cache[style] = colorless_style + yield cls(text, colorless_style, is_control) + else: + yield cls(text, None, is_control) + + +if __name__ == "__main__": # pragma: no cover + lines = [[Segment("Hello")]] + lines = Segment.set_shape(lines, 50, 4, style=Style.parse("on blue")) + for line in lines: + print(line) + + print(Style.parse("on blue") + Style.parse("on red")) diff --git a/rich/spinner.py b/rich/spinner.py new file mode 100644 index 0000000..b236e0b --- /dev/null +++ b/rich/spinner.py @@ -0,0 +1,88 @@ +from typing import cast, List, Optional, TYPE_CHECKING + +from ._spinners import SPINNERS +from .console import Console +from .measure import Measurement +from .style import StyleType +from .text import Text, TextType + +if TYPE_CHECKING: + from .console import Console, ConsoleOptions, RenderResult + + +class Spinner: + def __init__( + self, name: str, text: TextType = "", *, style: StyleType = None, speed=1.0 + ) -> None: + """A spinner animation. + + Args: + name (str): Name of spinner (run python -m rich.spinner). + text (TextType, optional): Text to display at the right of the spinner. Defaults to "". + style (StyleType, optional): Style for sinner amimation. Defaults to None. + speed (float, optional): Speed factor for animation. Defaults to 1.0. + + Raises: + KeyError: If name isn't one of the supported spinner animations. + """ + try: + spinner = SPINNERS[name] + except KeyError: + raise KeyError(f"no spinner called {name!r}") + self.text = text + self.frames = cast(List[str], spinner["frames"])[:] + self.interval = cast(float, spinner["interval"]) + self.start_time: Optional[float] = None + self.style = style + self.speed = speed + self.time = 0.0 + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + time = console.get_time() + if self.start_time is None: + self.start_time = time + text = self.render(time - self.start_time) + yield text + + def __rich_measure__(self, console: "Console", max_width: int) -> Measurement: + text = self.render(0) + return Measurement.get(console, text, max_width) + + def render(self, time: float) -> Text: + """Render the spinner for a given time. + + Args: + time (float): Time in seconds. + + Returns: + Text: A Text instance containing animation frame. + """ + frame_no = int((time * self.speed) / (self.interval / 1000.0)) + frame = Text(self.frames[frame_no % len(self.frames)], style=self.style or "") + return Text.assemble(frame, " ", self.text) if self.text else frame + + +if __name__ == "__main__": # pragma: no cover + from time import sleep + + from .columns import Columns + from .panel import Panel + from .live import Live + + all_spinners = Columns( + [ + Spinner(spinner_name, text=Text(repr(spinner_name), style="green")) + for spinner_name in sorted(SPINNERS.keys()) + ], + column_first=True, + expand=True, + ) + + with Live( + Panel(all_spinners, title="Spinners", border_style="blue"), + refresh_per_second=20, + ) as live: + while True: + sleep(0.1) diff --git a/rich/status.py b/rich/status.py new file mode 100644 index 0000000..62f1ba9 --- /dev/null +++ b/rich/status.py @@ -0,0 +1,131 @@ +from typing import Optional + +from .console import Console, RenderableType +from .jupyter import JupyterMixin +from .live import Live +from .spinner import Spinner +from .style import StyleType +from .table import Table + + +class Status(JupyterMixin): + """Displays a status indicator with a 'spinner' animation. + + Args: + status (RenderableType): A status renderable (str or Text typically). + console (Console, optional): Console instance to use, or None for global console. Defaults to None. + spinner (str, optional): Name of spinner animation (see python -m rich.spinner). Defaults to "dots". + spinner_style (StyleType, optional): Style of spinner. Defaults to "status.spinner". + speed (float, optional): Speed factor for spinner animation. Defaults to 1.0. + refresh_per_second (float, optional): Number of refreshes per second. Defaults to 12.5. + """ + + def __init__( + self, + status: RenderableType, + *, + console: Console = None, + spinner: str = "dots", + spinner_style: StyleType = "status.spinner", + speed: float = 1.0, + refresh_per_second: float = 12.5, + ): + self.status = status + self.spinner = spinner + self.spinner_style = spinner_style + self.speed = speed + self._spinner = Spinner(spinner, style=spinner_style, speed=speed) + self._live = Live( + self.renderable, + console=console, + refresh_per_second=refresh_per_second, + transient=True, + ) + self.update( + status=status, spinner=spinner, spinner_style=spinner_style, speed=speed + ) + + @property + def renderable(self) -> Table: + """Get the renderable for the status (a table with spinner and status).""" + table = Table.grid(padding=1) + table.add_row(self._spinner, self.status) + return table + + @property + def console(self) -> "Console": + """Get the Console used by the Status objects.""" + return self._live.console + + def update( + self, + status: Optional[RenderableType] = None, + *, + spinner: Optional[str] = None, + spinner_style: Optional[StyleType] = None, + speed: Optional[float] = None, + ): + """Update status. + + Args: + status (Optional[RenderableType], optional): New status renderable or None for no change. Defaults to None. + spinner (Optional[str], optional): New spinner or None for no change. Defaults to None. + spinner_style (Optional[StyleType], optional): New spinner style or None for no change. Defaults to None. + speed (Optional[float], optional): Speed factor for spinner animation or None for no change. Defaults to None. + """ + if status is not None: + self.status = status + if spinner is not None: + self.spinner = spinner + if spinner_style is not None: + self.spinner_style = spinner_style + if speed is not None: + self.speed = speed + self._spinner = Spinner( + self.spinner, style=self.spinner_style, speed=self.speed + ) + self._live.update(self.renderable, refresh=True) + + def start(self) -> None: + """Start the status animation.""" + self._live.start() + + def stop(self) -> None: + """Stop the spinner animation.""" + self._live.stop() + + def __rich__(self) -> RenderableType: + return self.renderable + + def __enter__(self) -> "Status": + self.start() + return self + + def __exit__(self, exc_type, exc_val, exc_tb) -> None: + self.stop() + + +if __name__ == "__main__": # pragma: no cover + + from time import sleep + + from .console import Console + + console = Console() + with console.status("[magenta]Covid detector booting up") as status: + sleep(3) + console.log("Importing advanced AI") + sleep(3) + console.log("Advanced Covid AI Ready") + sleep(3) + status.update(status="[bold blue] Scanning for Covid", spinner="earth") + sleep(3) + console.log("Found 10,000,000,000 copies of Covid32.exe") + sleep(3) + status.update( + status="[bold red]Moving Covid32.exe to Trash", + spinner="bouncingBall", + spinner_style="yellow", + ) + sleep(5) + console.print("[bold green]Covid deleted successfully") diff --git a/rich/style.py b/rich/style.py new file mode 100644 index 0000000..a6b756b --- /dev/null +++ b/rich/style.py @@ -0,0 +1,694 @@ +import sys +from functools import lru_cache +from random import randint +from time import time +from typing import Any, Dict, Iterable, List, Optional, Type, Union + +from . import errors +from .color import Color, ColorParseError, ColorSystem, blend_rgb +from .terminal_theme import DEFAULT_TERMINAL_THEME, TerminalTheme + +# Style instances and style definitions are often interchangeable +StyleType = Union[str, "Style"] + + +class _Bit: + """A descriptor to get/set a style attribute bit.""" + + __slots__ = ["bit"] + + def __init__(self, bit_no: int) -> None: + self.bit = 1 << bit_no + + def __get__(self, obj: "Style", objtype: Type["Style"]) -> Optional[bool]: + if obj._set_attributes & self.bit: + return obj._attributes & self.bit != 0 + return None + + +class Style: + """A terminal style. + + A terminal style consists of a color (`color`), a background color (`bgcolor`), and a number of attributes, such + as bold, italic etc. The attributes have 3 states: they can either be on + (``True``), off (``False``), or not set (``None``). + + Args: + color (Union[Color, str], optional): Color of terminal text. Defaults to None. + bgcolor (Union[Color, str], optional): Color of terminal background. Defaults to None. + bold (bool, optional): Enable bold text. Defaults to None. + dim (bool, optional): Enable dim text. Defaults to None. + italic (bool, optional): Enable italic text. Defaults to None. + underline (bool, optional): Enable underlined text. Defaults to None. + blink (bool, optional): Enabled blinking text. Defaults to None. + blink2 (bool, optional): Enable fast blinking text. Defaults to None. + reverse (bool, optional): Enabled reverse text. Defaults to None. + conceal (bool, optional): Enable concealed text. Defaults to None. + strike (bool, optional): Enable strikethrough text. Defaults to None. + underline2 (bool, optional): Enable doubly underlined text. Defaults to None. + frame (bool, optional): Enable framed text. Defaults to None. + encircle (bool, optional): Enable encircled text. Defaults to None. + overline (bool, optional): Enable overlined text. Defaults to None. + link (str, link): Link URL. Defaults to None. + + """ + + _color: Optional[Color] + _bgcolor: Optional[Color] + _attributes: int + _set_attributes: int + _hash: int + _null: bool + + __slots__ = [ + "_color", + "_bgcolor", + "_attributes", + "_set_attributes", + "_link", + "_link_id", + "_ansi", + "_style_definition", + "_hash", + "_null", + ] + + # maps bits on to SGR parameter + _style_map = { + 0: "1", + 1: "2", + 2: "3", + 3: "4", + 4: "5", + 5: "6", + 6: "7", + 7: "8", + 8: "9", + 9: "21", + 10: "51", + 11: "52", + 12: "53", + } + + def __init__( + self, + *, + color: Union[Color, str] = None, + bgcolor: Union[Color, str] = None, + bold: bool = None, + dim: bool = None, + italic: bool = None, + underline: bool = None, + blink: bool = None, + blink2: bool = None, + reverse: bool = None, + conceal: bool = None, + strike: bool = None, + underline2: bool = None, + frame: bool = None, + encircle: bool = None, + overline: bool = None, + link: str = None, + ): + self._ansi: Optional[str] = None + self._style_definition: Optional[str] = None + + def _make_color(color: Union[Color, str]) -> Color: + return color if isinstance(color, Color) else Color.parse(color) + + self._color = None if color is None else _make_color(color) + self._bgcolor = None if bgcolor is None else _make_color(bgcolor) + self._set_attributes = sum( + ( + bold is not None, + dim is not None and 2, + italic is not None and 4, + underline is not None and 8, + blink is not None and 16, + blink2 is not None and 32, + reverse is not None and 64, + conceal is not None and 128, + strike is not None and 256, + underline2 is not None and 512, + frame is not None and 1024, + encircle is not None and 2048, + overline is not None and 4096, + ) + ) + self._attributes = ( + sum( + ( + bold and 1 or 0, + dim and 2 or 0, + italic and 4 or 0, + underline and 8 or 0, + blink and 16 or 0, + blink2 and 32 or 0, + reverse and 64 or 0, + conceal and 128 or 0, + strike and 256 or 0, + underline2 and 512 or 0, + frame and 1024 or 0, + encircle and 2048 or 0, + overline and 4096 or 0, + ) + ) + if self._set_attributes + else 0 + ) + + self._link = link + self._link_id = f"{time()}-{randint(0, 999999)}" if link else "" + self._hash = hash( + ( + self._color, + self._bgcolor, + self._attributes, + self._set_attributes, + link, + ) + ) + self._null = not (self._set_attributes or color or bgcolor or link) + + @classmethod + def null(cls) -> "Style": + """Create an 'null' style, equivalent to Style(), but more performant.""" + return NULL_STYLE + + @classmethod + def from_color(cls, color: Color = None, bgcolor: Color = None) -> "Style": + """Create a new style with colors and no attributes. + + Returns: + color (Optional[Color]): A (foreground) color, or None for no color. Defaults to None. + bgcolor (Optional[Color]): A (background) color, or None for no color. Defaults to None. + """ + style = cls.__new__(Style) + style._ansi = None + style._style_definition = None + style._color = color + style._bgcolor = bgcolor + style._set_attributes = 0 + style._attributes = 0 + style._link = None + style._link_id = "" + style._hash = hash( + ( + color, + bgcolor, + None, + None, + None, + ) + ) + style._null = not (color or bgcolor) + return style + + bold = _Bit(0) + dim = _Bit(1) + italic = _Bit(2) + underline = _Bit(3) + blink = _Bit(4) + blink2 = _Bit(5) + reverse = _Bit(6) + conceal = _Bit(7) + strike = _Bit(8) + underline2 = _Bit(9) + frame = _Bit(10) + encircle = _Bit(11) + overline = _Bit(12) + + @property + def link_id(self) -> str: + """Get a link id, used in ansi code for links.""" + return self._link_id + + def __str__(self) -> str: + """Re-generate style definition from attributes.""" + if self._style_definition is None: + attributes: List[str] = [] + append = attributes.append + bits = self._set_attributes + if bits & 0b0000000001111: + if bits & 1: + append("bold" if self.bold else "not bold") + if bits & (1 << 1): + append("dim" if self.dim else "not dim") + if bits & (1 << 2): + append("italic" if self.italic else "not italic") + if bits & (1 << 3): + append("underline" if self.underline else "not underline") + if bits & 0b0000111110000: + if bits & (1 << 4): + append("blink" if self.blink else "not blink") + if bits & (1 << 5): + append("blink2" if self.blink2 else "not blink2") + if bits & (1 << 6): + append("reverse" if self.reverse else "not reverse") + if bits & (1 << 7): + append("conceal" if self.conceal else "not conceal") + if bits & (1 << 8): + append("strike" if self.strike else "not strike") + if bits & 0b1111000000000: + if bits & (1 << 9): + append("underline2" if self.underline2 else "not underline2") + if bits & (1 << 10): + append("frame" if self.frame else "not frame") + if bits & (1 << 11): + append("encircle" if self.encircle else "not encircle") + if bits & (1 << 12): + append("overline" if self.overline else "not overline") + if self._color is not None: + append(self._color.name) + if self._bgcolor is not None: + append("on") + append(self._bgcolor.name) + if self._link: + append("link") + append(self._link) + self._style_definition = " ".join(attributes) or "none" + return self._style_definition + + def __bool__(self) -> bool: + """A Style is false if it has no attributes, colors, or links.""" + return not self._null + + def _make_ansi_codes(self, color_system: ColorSystem) -> str: + """Generate ANSI codes for this style. + + Args: + color_system (ColorSystem): Color system. + + Returns: + str: String containing codes. + """ + if self._ansi is None: + sgr: List[str] = [] + append = sgr.append + _style_map = self._style_map + attributes = self._attributes & self._set_attributes + if attributes: + if attributes & 1: + append(_style_map[0]) + if attributes & 2: + append(_style_map[1]) + if attributes & 4: + append(_style_map[2]) + if attributes & 8: + append(_style_map[3]) + if attributes & 0b0000111110000: + for bit in range(4, 9): + if attributes & (1 << bit): + append(_style_map[bit]) + if attributes & 0b1111000000000: + for bit in range(9, 13): + if attributes & (1 << bit): + append(_style_map[bit]) + if self._color is not None: + sgr.extend(self._color.downgrade(color_system).get_ansi_codes()) + if self._bgcolor is not None: + sgr.extend( + self._bgcolor.downgrade(color_system).get_ansi_codes( + foreground=False + ) + ) + self._ansi = ";".join(sgr) + return self._ansi + + @classmethod + @lru_cache(maxsize=1024) + def normalize(cls, style: str) -> str: + """Normalize a style definition so that styles with the same effect have the same string + representation. + + Args: + style (str): A style definition. + + Returns: + str: Normal form of style definition. + """ + try: + return str(cls.parse(style)) + except errors.StyleSyntaxError: + return style.strip().lower() + + @classmethod + def pick_first(cls, *values: Optional[StyleType]) -> StyleType: + """Pick first non-None style.""" + for value in values: + if value is not None: + return value + raise ValueError("expected at least one non-None style") + + def __repr__(self) -> str: + """Render a named style differently from an anonymous style.""" + return f'Style.parse("{self}")' + + def __eq__(self, other: Any) -> bool: + if not isinstance(other, Style): + return NotImplemented + return ( + self._color == other._color + and self._bgcolor == other._bgcolor + and self._set_attributes == other._set_attributes + and self._attributes == other._attributes + and self._link == other._link + ) + + def __hash__(self) -> int: + return self._hash + + @property + def color(self) -> Optional[Color]: + """The foreground color or None if it is not set.""" + return self._color + + @property + def bgcolor(self) -> Optional[Color]: + """The background color or None if it is not set.""" + return self._bgcolor + + @property + def link(self) -> Optional[str]: + """Link text, if set.""" + return self._link + + @property + def transparent_background(self) -> bool: + """Check if the style specified a transparent background.""" + return self.bgcolor is None or self.bgcolor.is_default + + @property + def background_style(self) -> "Style": + """A Style with background only.""" + return Style(bgcolor=self.bgcolor) + + @property + def without_color(self) -> "Style": + """Get a copy of the style with color removed.""" + if self._null: + return NULL_STYLE + style = self.__new__(Style) + style._ansi = None + style._style_definition = None + style._color = None + style._bgcolor = None + style._attributes = self._attributes + style._set_attributes = self._set_attributes + style._link = self._link + style._link_id = f"{time()}-{randint(0, 999999)}" if self._link else "" + style._hash = self._hash + style._null = False + return style + + @classmethod + @lru_cache(maxsize=4096) + def parse(cls, style_definition: str) -> "Style": + """Parse a style definition. + + Args: + style_definition (str): A string containing a style. + + Raises: + errors.StyleSyntaxError: If the style definition syntax is invalid. + + Returns: + `Style`: A Style instance. + """ + if style_definition.strip() == "none" or not style_definition: + return cls.null() + + style_attributes = { + "dim": "dim", + "d": "dim", + "bold": "bold", + "b": "bold", + "italic": "italic", + "i": "italic", + "underline": "underline", + "u": "underline", + "blink": "blink", + "blink2": "blink2", + "reverse": "reverse", + "r": "reverse", + "conceal": "conceal", + "c": "conceal", + "strike": "strike", + "s": "strike", + "underline2": "underline2", + "uu": "underline2", + "frame": "frame", + "encircle": "encircle", + "overline": "overline", + "o": "overline", + } + color: Optional[str] = None + bgcolor: Optional[str] = None + attributes: Dict[str, Optional[bool]] = {} + link: Optional[str] = None + + words = iter(style_definition.split()) + for original_word in words: + word = original_word.lower() + if word == "on": + word = next(words, "") + if not word: + raise errors.StyleSyntaxError("color expected after 'on'") + try: + Color.parse(word) is None + except ColorParseError as error: + raise errors.StyleSyntaxError( + f"unable to parse {word!r} as background color; {error}" + ) from None + bgcolor = word + + elif word == "not": + word = next(words, "") + attribute = style_attributes.get(word) + if attribute is None: + raise errors.StyleSyntaxError( + f"expected style attribute after 'not', found {word!r}" + ) + attributes[attribute] = False + + elif word == "link": + word = next(words, "") + if not word: + raise errors.StyleSyntaxError("URL expected after 'link'") + link = word + + elif word in style_attributes: + attributes[style_attributes[word]] = True + + else: + try: + Color.parse(word) + except ColorParseError as error: + raise errors.StyleSyntaxError( + f"unable to parse {word!r} as color; {error}" + ) from None + color = word + style = Style(color=color, bgcolor=bgcolor, link=link, **attributes) + return style + + @lru_cache(maxsize=1024) + def get_html_style(self, theme: TerminalTheme = None) -> str: + """Get a CSS style rule.""" + theme = theme or DEFAULT_TERMINAL_THEME + css: List[str] = [] + append = css.append + + color = self.color + bgcolor = self.bgcolor + if self.reverse: + color, bgcolor = bgcolor, color + if self.dim: + foreground_color = ( + theme.foreground_color if color is None else color.get_truecolor(theme) + ) + color = Color.from_triplet( + blend_rgb(foreground_color, theme.background_color, 0.5) + ) + if color is not None: + theme_color = color.get_truecolor(theme) + append(f"color: {theme_color.hex}") + if bgcolor is not None: + theme_color = bgcolor.get_truecolor(theme, foreground=False) + append(f"background-color: {theme_color.hex}") + if self.bold: + append("font-weight: bold") + if self.italic: + append("font-style: italic") + if self.underline: + append("text-decoration: underline") + if self.strike: + append("text-decoration: line-through") + if self.overline: + append("text-decoration: overline") + return "; ".join(css) + + @classmethod + def combine(cls, styles: Iterable["Style"]) -> "Style": + """Combine styles and get result. + + Args: + styles (Iterable[Style]): Styles to combine. + + Returns: + Style: A new style instance. + """ + iter_styles = iter(styles) + return sum(iter_styles, next(iter_styles)) + + @classmethod + def chain(cls, *styles: "Style") -> "Style": + """Combine styles from positional argument in to a single style. + + Args: + *styles (Iterable[Style]): Styles to combine. + + Returns: + Style: A new style instance. + """ + iter_styles = iter(styles) + return sum(iter_styles, next(iter_styles)) + + def copy(self) -> "Style": + """Get a copy of this style. + + Returns: + Style: A new Style instance with identical attributes. + """ + if self._null: + return NULL_STYLE + style = self.__new__(Style) + style._ansi = self._ansi + style._style_definition = self._style_definition + style._color = self._color + style._bgcolor = self._bgcolor + style._attributes = self._attributes + style._set_attributes = self._set_attributes + style._link = self._link + style._link_id = f"{time()}-{randint(0, 999999)}" if self._link else "" + style._hash = self._hash + style._null = False + return style + + def update_link(self, link: str = None) -> "Style": + """Get a copy with a different value for link. + + Args: + link (str, optional): New value for link. Defaults to None. + + Returns: + Style: A new Style instance. + """ + style = self.__new__(Style) + style._ansi = self._ansi + style._style_definition = self._style_definition + style._color = self._color + style._bgcolor = self._bgcolor + style._attributes = self._attributes + style._set_attributes = self._set_attributes + style._link = link + style._link_id = f"{time()}-{randint(0, 999999)}" if link else "" + style._hash = self._hash + style._null = False + return style + + def render( + self, + text: str = "", + *, + color_system: Optional[ColorSystem] = ColorSystem.TRUECOLOR, + legacy_windows: bool = False, + ) -> str: + """Render the ANSI codes for the style. + + Args: + text (str, optional): A string to style. Defaults to "". + color_system (Optional[ColorSystem], optional): Color system to render to. Defaults to ColorSystem.TRUECOLOR. + + Returns: + str: A string containing ANSI style codes. + """ + if not text or color_system is None: + return text + attrs = self._make_ansi_codes(color_system) + rendered = f"\x1b[{attrs}m{text}\x1b[0m" if attrs else text + if self._link and not legacy_windows: + rendered = ( + f"\x1b]8;id={self._link_id};{self._link}\x1b\\{rendered}\x1b]8;;\x1b\\" + ) + return rendered + + def test(self, text: Optional[str] = None) -> None: + """Write text with style directly to terminal. + + This method is for testing purposes only. + + Args: + text (Optional[str], optional): Text to style or None for style name. + + """ + text = text or str(self) + sys.stdout.write(f"{self.render(text)}\n") + + def __add__(self, style: Optional["Style"]) -> "Style": + if not (isinstance(style, Style) or style is None): + return NotImplemented # type: ignore + if style is None or style._null: + return self + if self._null: + return style + new_style = self.__new__(Style) + new_style._ansi = None + new_style._style_definition = None + new_style._color = style._color or self._color + new_style._bgcolor = style._bgcolor or self._bgcolor + new_style._attributes = (self._attributes & ~style._set_attributes) | ( + style._attributes & style._set_attributes + ) + new_style._set_attributes = self._set_attributes | style._set_attributes + new_style._link = style._link or self._link + new_style._link_id = style._link_id or self._link_id + new_style._hash = style._hash + new_style._null = self._null or style._null + return new_style + + +NULL_STYLE = Style() + + +class StyleStack: + """A stack of styles.""" + + __slots__ = ["_stack"] + + def __init__(self, default_style: "Style") -> None: + self._stack: List[Style] = [default_style] + + def __repr__(self) -> str: + return f"<stylestack {self._stack!r}>" + + @property + def current(self) -> Style: + """Get the Style at the top of the stack.""" + return self._stack[-1] + + def push(self, style: Style) -> None: + """Push a new style on to the stack. + + Args: + style (Style): New style to combine with current style. + """ + self._stack.append(self._stack[-1] + style) + + def pop(self) -> Style: + """Pop last style and discard. + + Returns: + Style: New current style (also available as stack.current) + """ + self._stack.pop() + return self._stack[-1] diff --git a/rich/styled.py b/rich/styled.py new file mode 100644 index 0000000..f163122 --- /dev/null +++ b/rich/styled.py @@ -0,0 +1,40 @@ +from typing import TYPE_CHECKING + +from .measure import Measurement +from .segment import Segment +from .style import StyleType + +if TYPE_CHECKING: + from .console import Console, ConsoleOptions, RenderResult, RenderableType + + +class Styled: + """Apply a style to a renderable. + + Args: + renderable (RenderableType): Any renderable. + style (StyleType): A style to apply across the entire renderable. + """ + + def __init__(self, renderable: "RenderableType", style: "StyleType") -> None: + self.renderable = renderable + self.style = style + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + style = console.get_style(self.style) + rendered_segments = console.render(self.renderable, options) + segments = Segment.apply_style(rendered_segments, style) + return segments + + def __rich_measure__(self, console: "Console", max_width: int) -> Measurement: + return Measurement.get(console, self.renderable, max_width) + + +if __name__ == "__main__": # pragma: no cover + from rich import print + from rich.panel import Panel + + panel = Styled(Panel("hello"), "on blue") + print(panel) diff --git a/rich/syntax.py b/rich/syntax.py new file mode 100644 index 0000000..7bb749f --- /dev/null +++ b/rich/syntax.py @@ -0,0 +1,669 @@ +import os.path +import platform +import textwrap +from abc import ABC, abstractmethod +from typing import Any, Dict, Iterable, Optional, Set, Tuple, Type, Union + +from pygments.lexers import get_lexer_by_name, guess_lexer_for_filename +from pygments.style import Style as PygmentsStyle +from pygments.styles import get_style_by_name +from pygments.token import ( + Comment, + Error, + Generic, + Keyword, + Name, + Number, + Operator, + String, + Token, + Whitespace, +) +from pygments.util import ClassNotFound + +from ._loop import loop_first +from .color import Color, blend_rgb +from .console import Console, ConsoleOptions, JustifyMethod, RenderResult, Segment +from .jupyter import JupyterMixin +from .measure import Measurement +from .style import Style +from .text import Text + +TokenType = Tuple[str, ...] + +WINDOWS = platform.system() == "Windows" +DEFAULT_THEME = "monokai" + +# The following styles are based on https://github.com/pygments/pygments/blob/master/pygments/formatters/terminal.py +# A few modifications were made + +ANSI_LIGHT: Dict[TokenType, Style] = { + Token: Style(), + Whitespace: Style(color="white"), + Comment: Style(dim=True), + Comment.Preproc: Style(color="cyan"), + Keyword: Style(color="blue"), + Keyword.Type: Style(color="cyan"), + Operator.Word: Style(color="magenta"), + Name.Builtin: Style(color="cyan"), + Name.Function: Style(color="green"), + Name.Namespace: Style(color="cyan", underline=True), + Name.Class: Style(color="green", underline=True), + Name.Exception: Style(color="cyan"), + Name.Decorator: Style(color="magenta", bold=True), + Name.Variable: Style(color="red"), + Name.Constant: Style(color="red"), + Name.Attribute: Style(color="cyan"), + Name.Tag: Style(color="bright_blue"), + String: Style(color="yellow"), + Number: Style(color="blue"), + Generic.Deleted: Style(color="bright_red"), + Generic.Inserted: Style(color="green"), + Generic.Heading: Style(bold=True), + Generic.Subheading: Style(color="magenta", bold=True), + Generic.Prompt: Style(bold=True), + Generic.Error: Style(color="bright_red"), + Error: Style(color="red", underline=True), +} + +ANSI_DARK: Dict[TokenType, Style] = { + Token: Style(), + Whitespace: Style(color="bright_black"), + Comment: Style(dim=True), + Comment.Preproc: Style(color="bright_cyan"), + Keyword: Style(color="bright_blue"), + Keyword.Type: Style(color="bright_cyan"), + Operator.Word: Style(color="bright_magenta"), + Name.Builtin: Style(color="bright_cyan"), + Name.Function: Style(color="bright_green"), + Name.Namespace: Style(color="bright_cyan", underline=True), + Name.Class: Style(color="bright_green", underline=True), + Name.Exception: Style(color="bright_cyan"), + Name.Decorator: Style(color="bright_magenta", bold=True), + Name.Variable: Style(color="bright_red"), + Name.Constant: Style(color="bright_red"), + Name.Attribute: Style(color="bright_cyan"), + Name.Tag: Style(color="bright_blue"), + String: Style(color="yellow"), + Number: Style(color="bright_blue"), + Generic.Deleted: Style(color="bright_red"), + Generic.Inserted: Style(color="bright_green"), + Generic.Heading: Style(bold=True), + Generic.Subheading: Style(color="bright_magenta", bold=True), + Generic.Prompt: Style(bold=True), + Generic.Error: Style(color="bright_red"), + Error: Style(color="red", underline=True), +} + +RICH_SYNTAX_THEMES = {"ansi_light": ANSI_LIGHT, "ansi_dark": ANSI_DARK} + + +class SyntaxTheme(ABC): + """Base class for a syntax theme.""" + + @abstractmethod + def get_style_for_token(self, token_type: TokenType) -> Style: + """Get a style for a given Pygments token.""" + raise NotImplementedError # pragma: no cover + + @abstractmethod + def get_background_style(self) -> Style: + """Get the background color.""" + raise NotImplementedError # pragma: no cover + + +class PygmentsSyntaxTheme(SyntaxTheme): + """Syntax theme that delagates to Pygments theme.""" + + def __init__(self, theme: Union[str, Type[PygmentsStyle]]) -> None: + self._style_cache: Dict[TokenType, Style] = {} + if isinstance(theme, str): + try: + self._pygments_style_class = get_style_by_name(theme) + except ClassNotFound: + self._pygments_style_class = get_style_by_name("default") + else: + self._pygments_style_class = theme + + self._background_color = self._pygments_style_class.background_color + self._background_style = Style(bgcolor=self._background_color) + + def get_style_for_token(self, token_type: TokenType) -> Style: + """Get a style from a Pygments class.""" + try: + return self._style_cache[token_type] + except KeyError: + try: + pygments_style = self._pygments_style_class.style_for_token(token_type) + except KeyError: + style = Style.null() + else: + color = pygments_style["color"] + bgcolor = pygments_style["bgcolor"] + style = Style( + color="#" + color if color else "#000000", + bgcolor="#" + bgcolor if bgcolor else self._background_color, + bold=pygments_style["bold"], + italic=pygments_style["italic"], + underline=pygments_style["underline"], + ) + self._style_cache[token_type] = style + return style + + def get_background_style(self) -> Style: + return self._background_style + + +class ANSISyntaxTheme(SyntaxTheme): + """Syntax theme to use standard colors.""" + + def __init__(self, style_map: Dict[TokenType, Style]) -> None: + self.style_map = style_map + self._missing_style = Style.null() + self._background_style = Style.null() + self._style_cache: Dict[TokenType, Style] = {} + + def get_style_for_token(self, token_type: TokenType) -> Style: + """Look up style in the style map.""" + try: + return self._style_cache[token_type] + except KeyError: + # Styles form a hierarchy + # We need to go from most to least specific + # e.g. ("foo", "bar", "baz") to ("foo", "bar") to ("foo",) + get_style = self.style_map.get + token = tuple(token_type) + style = self._missing_style + while token: + _style = get_style(token) + if _style is not None: + style = _style + break + token = token[:-1] + self._style_cache[token_type] = style + return style + + def get_background_style(self) -> Style: + return self._background_style + + +class Syntax(JupyterMixin): + """Construct a Syntax object to render syntax highlighted code. + + Args: + code (str): Code to highlight. + lexer_name (str): Lexer to use (see https://pygments.org/docs/lexers/) + theme (str, optional): Color theme, aka Pygments style (see https://pygments.org/docs/styles/#getting-a-list-of-available-styles). Defaults to "monokai". + dedent (bool, optional): Enable stripping of initial whitespace. Defaults to False. + line_numbers (bool, optional): Enable rendering of line numbers. Defaults to False. + start_line (int, optional): Starting number for line numbers. Defaults to 1. + line_range (Tuple[int, int], optional): If given should be a tuple of the start and end line to render. + highlight_lines (Set[int]): A set of line numbers to highlight. + code_width: Width of code to render (not including line numbers), or ``None`` to use all available width. + tab_size (int, optional): Size of tabs. Defaults to 4. + word_wrap (bool, optional): Enable word wrapping. + background_color (str, optional): Optional background color, or None to use theme color. Defaults to None. + indent_guides (bool, optional): Show indent guides. Defaults to False. + """ + + _pygments_style_class: Type[PygmentsStyle] + _theme: SyntaxTheme + + @classmethod + def get_theme(cls, name: Union[str, SyntaxTheme]) -> SyntaxTheme: + """Get a syntax theme instance.""" + if isinstance(name, SyntaxTheme): + return name + theme: SyntaxTheme + if name in RICH_SYNTAX_THEMES: + theme = ANSISyntaxTheme(RICH_SYNTAX_THEMES[name]) + else: + theme = PygmentsSyntaxTheme(name) + return theme + + def __init__( + self, + code: str, + lexer_name: str, + *, + theme: Union[str, SyntaxTheme] = DEFAULT_THEME, + dedent: bool = False, + line_numbers: bool = False, + start_line: int = 1, + line_range: Tuple[int, int] = None, + highlight_lines: Set[int] = None, + code_width: Optional[int] = None, + tab_size: int = 4, + word_wrap: bool = False, + background_color: str = None, + indent_guides: bool = False, + ) -> None: + self.code = code + self.lexer_name = lexer_name + self.dedent = dedent + self.line_numbers = line_numbers + self.start_line = start_line + self.line_range = line_range + self.highlight_lines = highlight_lines or set() + self.code_width = code_width + self.tab_size = tab_size + self.word_wrap = word_wrap + self.background_color = background_color + self.indent_guides = indent_guides + + self._theme = self.get_theme(theme) + + @classmethod + def from_path( + cls, + path: str, + encoding: str = "utf-8", + theme: Union[str, SyntaxTheme] = DEFAULT_THEME, + dedent: bool = False, + line_numbers: bool = False, + line_range: Tuple[int, int] = None, + start_line: int = 1, + highlight_lines: Set[int] = None, + code_width: Optional[int] = None, + tab_size: int = 4, + word_wrap: bool = False, + background_color: str = None, + indent_guides: bool = False, + ) -> "Syntax": + """Construct a Syntax object from a file. + + Args: + path (str): Path to file to highlight. + encoding (str): Encoding of file. + theme (str, optional): Color theme, aka Pygments style (see https://pygments.org/docs/styles/#getting-a-list-of-available-styles). Defaults to "emacs". + dedent (bool, optional): Enable stripping of initial whitespace. Defaults to True. + line_numbers (bool, optional): Enable rendering of line numbers. Defaults to False. + start_line (int, optional): Starting number for line numbers. Defaults to 1. + line_range (Tuple[int, int], optional): If given should be a tuple of the start and end line to render. + highlight_lines (Set[int]): A set of line numbers to highlight. + code_width: Width of code to render (not including line numbers), or ``None`` to use all available width. + tab_size (int, optional): Size of tabs. Defaults to 4. + word_wrap (bool, optional): Enable word wrapping of code. + background_color (str, optional): Optional background color, or None to use theme color. Defaults to None. + indent_guides (bool, optional): Show indent guides. Defaults to False. + + Returns: + [Syntax]: A Syntax object that may be printed to the console + """ + with open(path, "rt", encoding=encoding) as code_file: + code = code_file.read() + + lexer = None + lexer_name = "default" + try: + _, ext = os.path.splitext(path) + if ext: + extension = ext.lstrip(".").lower() + lexer = get_lexer_by_name(extension) + lexer_name = lexer.name + except ClassNotFound: + pass + + if lexer is None: + try: + lexer_name = guess_lexer_for_filename(path, code).name + except ClassNotFound: + pass + + return cls( + code, + lexer_name, + theme=theme, + dedent=dedent, + line_numbers=line_numbers, + line_range=line_range, + start_line=start_line, + highlight_lines=highlight_lines, + code_width=code_width, + tab_size=tab_size, + word_wrap=word_wrap, + background_color=background_color, + indent_guides=indent_guides, + ) + + def _get_base_style(self) -> Style: + """Get the base style.""" + default_style = ( + Style(bgcolor=self.background_color) + if self.background_color is not None + else self._theme.get_background_style() + ) + return default_style + + def _get_token_color(self, token_type: TokenType) -> Optional[Color]: + """Get a color (if any) for the given token. + + Args: + token_type (TokenType): A token type tuple from Pygments. + + Returns: + Optional[Color]: Color from theme, or None for no color. + """ + style = self._theme.get_style_for_token(token_type) + return style.color + + def highlight(self, code: str, line_range: Tuple[int, int] = None) -> Text: + """Highlight code and return a Text instance. + + Args: + code (str): Code to highlight. + line_range(Tuple[int, int], optional): Optional line range to highlight. + + Returns: + Text: A text instance containing highlighted syntax. + """ + + base_style = self._get_base_style() + justify: JustifyMethod = ( + "default" if base_style.transparent_background else "left" + ) + + text = Text( + justify=justify, + style=base_style, + tab_size=self.tab_size, + no_wrap=not self.word_wrap, + ) + _get_theme_style = self._theme.get_style_for_token + try: + lexer = get_lexer_by_name(self.lexer_name) + except ClassNotFound: + text.append(code) + else: + if line_range: + # More complicated path to only stylize a portion of the code + # This speeds up further operations as there are less spans to process + line_start, line_end = line_range + + def line_tokenize() -> Iterable[Tuple[Any, str]]: + """Split tokens to one per line.""" + for token_type, token in lexer.get_tokens(code): + while token: + line_token, new_line, token = token.partition("\n") + yield token_type, line_token + new_line + + def tokens_to_spans() -> Iterable[Tuple[str, Optional[Style]]]: + """Convert tokens to spans.""" + tokens = iter(line_tokenize()) + line_no = 0 + _line_start = line_start - 1 + + # Skip over tokens until line start + while line_no < _line_start: + _token_type, token = next(tokens) + yield (token, None) + if token.endswith("\n"): + line_no += 1 + # Generate spans until line end + for token_type, token in tokens: + yield (token, _get_theme_style(token_type)) + if token.endswith("\n"): + line_no += 1 + if line_no >= line_end: + break + + text.append_tokens(tokens_to_spans()) + + else: + text.append_tokens( + (token, _get_theme_style(token_type)) + for token_type, token in lexer.get_tokens(code) + ) + if self.background_color is not None: + text.stylize(f"on {self.background_color}") + return text + + def _get_line_numbers_color(self, blend: float = 0.3) -> Color: + background_color = self._theme.get_background_style().bgcolor + if background_color is None or background_color.is_system_defined: + return background_color or Color.default() + foreground_color = self._get_token_color(Token.Text) + if foreground_color is None or foreground_color.is_system_defined: + return foreground_color or Color.default() + new_color = blend_rgb( + background_color.get_truecolor(), + foreground_color.get_truecolor(), + cross_fade=blend, + ) + return Color.from_triplet(new_color) + + @property + def _numbers_column_width(self) -> int: + """Get the number of characters used to render the numbers column.""" + column_width = 0 + if self.line_numbers: + column_width = len(str(self.start_line + self.code.count("\n"))) + 2 + return column_width + + def _get_number_styles(self, console: Console) -> Tuple[Style, Style, Style]: + """Get background, number, and highlight styles for line numbers.""" + background_style = self._get_base_style() + if background_style.transparent_background: + return Style.null(), Style(dim=True), Style.null() + if console.color_system in ("256", "truecolor"): + number_style = Style.chain( + background_style, + self._theme.get_style_for_token(Token.Text), + Style(color=self._get_line_numbers_color()), + ) + highlight_number_style = Style.chain( + background_style, + self._theme.get_style_for_token(Token.Text), + Style(bold=True, color=self._get_line_numbers_color(0.9)), + ) + else: + number_style = background_style + Style(dim=True) + highlight_number_style = background_style + Style(dim=False) + return background_style, number_style, highlight_number_style + + def __rich_measure__(self, console: "Console", max_width: int) -> "Measurement": + if self.code_width is not None: + width = self.code_width + self._numbers_column_width + return Measurement(self._numbers_column_width, width) + return Measurement(self._numbers_column_width, max_width) + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + + transparent_background = self._get_base_style().transparent_background + code_width = ( + (options.max_width - self._numbers_column_width - 1) + if self.code_width is None + else self.code_width + ) + + line_offset = 0 + if self.line_range: + start_line, end_line = self.line_range + line_offset = max(0, start_line - 1) + + code = textwrap.dedent(self.code) if self.dedent else self.code + code = code.expandtabs(self.tab_size) + text = self.highlight(code, self.line_range) + text.remove_suffix("\n") + + ( + background_style, + number_style, + highlight_number_style, + ) = self._get_number_styles(console) + + if not self.line_numbers: + # Simple case of just rendering text + yield from console.render(text, options=options.update(width=code_width)) + return + + lines = text.split("\n") + if self.line_range: + lines = lines[line_offset:end_line] + + if self.indent_guides and not options.ascii_only: + style = ( + self._get_base_style() + + self._theme.get_style_for_token(Comment) + + Style(dim=True) + ) + lines = ( + Text("\n") + .join(lines) + .with_indent_guides(self.tab_size, style=style) + .split("\n") + ) + + numbers_column_width = self._numbers_column_width + render_options = options.update(width=code_width) + + highlight_line = self.highlight_lines.__contains__ + _Segment = Segment + padding = _Segment(" " * numbers_column_width + " ", background_style) + new_line = _Segment("\n") + + line_pointer = "> " if options.legacy_windows else "❱ " + + for line_no, line in enumerate(lines, self.start_line + line_offset): + if self.word_wrap: + wrapped_lines = console.render_lines( + line, + render_options, + style=background_style, + pad=not transparent_background, + ) + else: + segments = list(line.render(console, end="")) + if options.no_wrap: + wrapped_lines = [segments] + else: + wrapped_lines = [ + _Segment.adjust_line_length( + segments, + render_options.max_width, + style=background_style, + pad=not transparent_background, + ) + ] + for first, wrapped_line in loop_first(wrapped_lines): + if first: + line_column = str(line_no).rjust(numbers_column_width - 2) + " " + if highlight_line(line_no): + yield _Segment(line_pointer, Style(color="red")) + yield _Segment(line_column, highlight_number_style) + else: + yield _Segment(" ", highlight_number_style) + yield _Segment(line_column, number_style) + else: + yield padding + yield from wrapped_line + yield new_line + + +if __name__ == "__main__": # pragma: no cover + + import argparse + import sys + + parser = argparse.ArgumentParser( + description="Render syntax to the console with Rich" + ) + parser.add_argument( + "path", + metavar="PATH", + nargs="?", + help="path to file", + ) + parser.add_argument( + "-c", + "--force-color", + dest="force_color", + action="store_true", + default=None, + help="force color for non-terminals", + ) + parser.add_argument( + "-i", + "--indent-guides", + dest="indent_guides", + action="store_true", + default=False, + help="display indent guides", + ) + parser.add_argument( + "-l", + "--line-numbers", + dest="line_numbers", + action="store_true", + help="render line numbers", + ) + parser.add_argument( + "-w", + "--width", + type=int, + dest="width", + default=None, + help="width of output (default will auto-detect)", + ) + parser.add_argument( + "-r", + "--wrap", + dest="word_wrap", + action="store_true", + default=False, + help="word wrap long lines", + ) + parser.add_argument( + "-s", + "--soft-wrap", + action="store_true", + dest="soft_wrap", + default=False, + help="enable soft wrapping mode", + ) + parser.add_argument( + "-t", "--theme", dest="theme", default="monokai", help="pygments theme" + ) + parser.add_argument( + "-b", + "--background-color", + dest="background_color", + default=None, + help="Overide background color", + ) + parser.add_argument( + "-x", + "--lexer", + default="default", + dest="lexer_name", + help="Lexer name", + ) + args = parser.parse_args() + + from rich.console import Console + + console = Console(force_terminal=args.force_color, width=args.width) + + if not args.path or args.path == "-": + code = sys.stdin.read() + syntax = Syntax( + code=code, + lexer_name=args.lexer_name, + line_numbers=args.line_numbers, + word_wrap=args.word_wrap, + theme=args.theme, + background_color=args.background_color, + indent_guides=args.indent_guides, + ) + else: + syntax = Syntax.from_path( + args.path, + line_numbers=args.line_numbers, + word_wrap=args.word_wrap, + theme=args.theme, + background_color=args.background_color, + indent_guides=args.indent_guides, + ) + console.print(syntax, soft_wrap=args.soft_wrap) diff --git a/rich/table.py b/rich/table.py new file mode 100644 index 0000000..41d0116 --- /dev/null +++ b/rich/table.py @@ -0,0 +1,881 @@ +from dataclasses import dataclass, field, replace +from typing import TYPE_CHECKING, Iterable, List, NamedTuple, Optional, Tuple, Union + +from . import box, errors +from ._loop import loop_first_last, loop_last +from ._pick import pick_bool +from ._ratio import ratio_distribute, ratio_reduce +from .jupyter import JupyterMixin +from .measure import Measurement +from .padding import Padding, PaddingDimensions +from .protocol import is_renderable +from .segment import Segment +from .style import Style, StyleType +from .text import Text, TextType + +if TYPE_CHECKING: + from .console import ( + Console, + ConsoleOptions, + JustifyMethod, + OverflowMethod, + RenderableType, + RenderResult, + ) + + +@dataclass +class Column: + """Defines a column in a table.""" + + header: "RenderableType" = "" + """RenderableType: Renderable for the header (typically a string)""" + + footer: "RenderableType" = "" + """RenderableType: Renderable for the footer (typically a string)""" + + header_style: StyleType = "" + """StyleType: The style of the header.""" + + footer_style: StyleType = "" + """StyleType: The style of the footer.""" + + style: StyleType = "" + """StyleType: The style of the column.""" + + justify: "JustifyMethod" = "left" + """str: How to justify text within the column ("left", "center", "right", or "full")""" + + overflow: "OverflowMethod" = "ellipsis" + """str: Overflow method.""" + + width: Optional[int] = None + """Optional[int]: Width of the column, or ``None`` (default) to auto calculate width.""" + + min_width: Optional[int] = None + """Optional[int]: Minimum width of column, or ``None`` for no minimum. Defaults to None.""" + + max_width: Optional[int] = None + """Optional[int]: Maximum width of column, or ``None`` for no maximum. Defaults to None.""" + + ratio: Optional[int] = None + """Optional[int]: Ratio to use when calculating column width, or ``None`` (default) to adapt to column contents.""" + + no_wrap: bool = False + """bool: Prevent wrapping of text within the column. Defaults to ``False``.""" + + _index: int = 0 + """Index of column.""" + + _cells: List["RenderableType"] = field(default_factory=list) + + def copy(self) -> "Column": + """Return a copy of this Column.""" + return replace(self, _cells=[]) + + @property + def cells(self) -> Iterable["RenderableType"]: + """Get all cells in the column, not including header.""" + yield from self._cells + + @property + def flexible(self) -> bool: + """Check if this column is flexible.""" + return self.ratio is not None + + +@dataclass +class Row: + """Information regarding a row.""" + + style: Optional[StyleType] = None + """Style to apply to row.""" + + end_section: bool = False + """Indicated end of section, which will force a line beneath the row.""" + + +class _Cell(NamedTuple): + """A single cell in a table.""" + + style: StyleType + """Style to apply to cell.""" + renderable: "RenderableType" + """Cell renderable.""" + + +class Table(JupyterMixin): + """A console renderable to draw a table. + + Args: + *headers (Union[Column, str]): Column headers, either as a string, or :class:`~rich.table.Column` instance. + title (Union[str, Text], optional): The title of the table rendered at the top. Defaults to None. + caption (Union[str, Text], optional): The table caption rendered below. Defaults to None. + width (int, optional): The width in characters of the table, or ``None`` to automatically fit. Defaults to None. + min_width (Optional[int], optional): The minimum width of the table, or ``None`` for no minimum. Defaults to None. + box (box.Box, optional): One of the constants in box.py used to draw the edges (see :ref:`appendix_box`). Defaults to box.HEAVY_HEAD. + safe_box (Optional[bool], optional): Disable box characters that don't display on windows legacy terminal with *raster* fonts. Defaults to True. + padding (PaddingDimensions, optional): Padding for cells (top, right, bottom, left). Defaults to (0, 1). + collapse_padding (bool, optional): Enable collapsing of padding around cells. Defaults to False. + pad_edge (bool, optional): Enable padding of edge cells. Defaults to True. + expand (bool, optional): Expand the table to fit the available space if ``True``, otherwise the table width will be auto-calculated. Defaults to False. + show_header (bool, optional): Show a header row. Defaults to True. + show_footer (bool, optional): Show a footer row. Defaults to False. + show_edge (bool, optional): Draw a box around the outside of the table. Defaults to True. + show_lines (bool, optional): Draw lines between every row. Defaults to False. + leading (bool, optional): Number of blank lines between rows (precludes ``show_lines``). Defaults to 0. + style (Union[str, Style], optional): Default style for the table. Defaults to "none". + row_styles (List[Union, str], optional): Optional list of row styles, if more that one style is give then the styles will alternate. Defaults to None. + header_style (Union[str, Style], optional): Style of the header. Defaults to "table.header". + footer_style (Union[str, Style], optional): Style of the footer. Defaults to "table.footer". + border_style (Union[str, Style], optional): Style of the border. Defaults to None. + title_style (Union[str, Style], optional): Style of the title. Defaults to None. + caption_style (Union[str, Style], optional): Style of the caption. Defaults to None. + title_justify (str, optional): Justify method for title. Defaults to "center". + caption_justify (str, optional): Justify method for caption. Defaults to "center". + highlight (bool, optional): Highlight cell contents (if str). Defaults to False. + """ + + columns: List[Column] + rows: List[Row] + + def __init__( + self, + *headers: Union[Column, str], + title: TextType = None, + caption: TextType = None, + width: int = None, + min_width: int = None, + box: Optional[box.Box] = box.HEAVY_HEAD, + safe_box: Optional[bool] = None, + padding: PaddingDimensions = (0, 1), + collapse_padding: bool = False, + pad_edge: bool = True, + expand: bool = False, + show_header: bool = True, + show_footer: bool = False, + show_edge: bool = True, + show_lines: bool = False, + leading: int = 0, + style: StyleType = "none", + row_styles: Iterable[StyleType] = None, + header_style: Optional[StyleType] = "table.header", + footer_style: Optional[StyleType] = "table.footer", + border_style: StyleType = None, + title_style: StyleType = None, + caption_style: StyleType = None, + title_justify: "JustifyMethod" = "center", + caption_justify: "JustifyMethod" = "center", + highlight: bool = False, + ) -> None: + + self.columns: List[Column] = [] + self.rows: List[Row] = [] + self.title = title + self.caption = caption + self.width = width + self.min_width = min_width + self.box = box + self.safe_box = safe_box + self._padding = Padding.unpack(padding) + self.pad_edge = pad_edge + self._expand = expand + self.show_header = show_header + self.show_footer = show_footer + self.show_edge = show_edge + self.show_lines = show_lines + self.leading = leading + self.collapse_padding = collapse_padding + self.style = style + self.header_style = header_style or "" + self.footer_style = footer_style or "" + self.border_style = border_style + self.title_style = title_style + self.caption_style = caption_style + self.title_justify = title_justify + self.caption_justify = caption_justify + self.highlight = highlight + self.row_styles = list(row_styles or []) + append_column = self.columns.append + for header in headers: + if isinstance(header, str): + self.add_column(header=header) + else: + header._index = len(self.columns) + append_column(header) + + @classmethod + def grid( + cls, + *headers: Union[Column, str], + padding: PaddingDimensions = 0, + collapse_padding: bool = True, + pad_edge: bool = False, + expand: bool = False, + ) -> "Table": + """Get a table with no lines, headers, or footer. + + Args: + *headers (Union[Column, str]): Column headers, either as a string, or :class:`~rich.table.Column` instance. + padding (PaddingDimensions, optional): Get padding around cells. Defaults to 0. + collapse_padding (bool, optional): Enable collapsing of padding around cells. Defaults to True. + pad_edge (bool, optional): Enable padding around edges of table. Defaults to False. + expand (bool, optional): Expand the table to fit the available space if ``True``, otherwise the table width will be auto-calculated. Defaults to False. + + Returns: + Table: A table instance. + """ + return cls( + *headers, + box=None, + padding=padding, + collapse_padding=collapse_padding, + show_header=False, + show_footer=False, + show_edge=False, + pad_edge=pad_edge, + expand=expand, + ) + + @property + def expand(self) -> int: + """Setting a non-None self.width implies expand.""" + return self._expand or self.width is not None + + @expand.setter + def expand(self, expand: bool) -> None: + """Set expand.""" + self._expand = expand + + @property + def _extra_width(self) -> int: + """Get extra width to add to cell content.""" + width = 0 + if self.box and self.show_edge: + width += 2 + if self.box: + width += len(self.columns) - 1 + return width + + @property + def row_count(self) -> int: + """Get the current number of rows.""" + return len(self.rows) + + def get_row_style(self, console: "Console", index: int) -> StyleType: + """Get the current row style.""" + style = Style.null() + if self.row_styles: + style += console.get_style(self.row_styles[index % len(self.row_styles)]) + row_style = self.rows[index].style + if row_style is not None: + style += console.get_style(row_style) + return style + + def __rich_measure__(self, console: "Console", max_width: int) -> Measurement: + if self.width is not None: + max_width = self.width + if max_width < 0: + return Measurement(0, 0) + + extra_width = self._extra_width + max_width = sum(self._calculate_column_widths(console, max_width - extra_width)) + _measure_column = self._measure_column + + measurements = [ + _measure_column(console, column, max_width) for column in self.columns + ] + minimum_width = ( + sum(measurement.minimum for measurement in measurements) + extra_width + ) + maximum_width = ( + sum(measurement.maximum for measurement in measurements) + extra_width + if (self.width is None) + else self.width + ) + measurement = Measurement(minimum_width, maximum_width) + measurement = measurement.clamp(self.min_width) + return measurement + + @property + def padding(self) -> Tuple[int, int, int, int]: + """Get cell padding.""" + return self._padding + + @padding.setter + def padding(self, padding: PaddingDimensions) -> "Table": + """Set cell padding.""" + self._padding = Padding.unpack(padding) + return self + + def add_column( + self, + header: "RenderableType" = "", + footer: "RenderableType" = "", + *, + header_style: StyleType = None, + footer_style: StyleType = None, + style: StyleType = None, + justify: "JustifyMethod" = "left", + overflow: "OverflowMethod" = "ellipsis", + width: int = None, + min_width: int = None, + max_width: int = None, + ratio: int = None, + no_wrap: bool = False, + ) -> None: + """Add a column to the table. + + Args: + header (RenderableType, optional): Text or renderable for the header. + Defaults to "". + footer (RenderableType, optional): Text or renderable for the footer. + Defaults to "". + header_style (Union[str, Style], optional): Style for the header, or None for default. Defaults to None. + footer_style (Union[str, Style], optional): Style for the footer, or None for default. Defaults to None. + style (Union[str, Style], optional): Style for the column cells, or None for default. Defaults to None. + justify (JustifyMethod, optional): Alignment for cells. Defaults to "left". + width (int, optional): Desired width of column in characters, or None to fit to contents. Defaults to None. + min_width (Optional[int], optional): Minimum width of column, or ``None`` for no minimum. Defaults to None. + max_width (Optional[int], optional): Maximum width of column, or ``None`` for no maximum. Defaults to None. + ratio (int, optional): Flexible ratio for the column (requires ``Table.expand`` or ``Table.width``). Defaults to None. + no_wrap (bool, optional): Set to ``True`` to disable wrapping of this column. + """ + + column = Column( + _index=len(self.columns), + header=header, + footer=footer, + header_style=header_style or "", + footer_style=footer_style or "", + style=style or "", + justify=justify, + overflow=overflow, + width=width, + min_width=min_width, + max_width=max_width, + ratio=ratio, + no_wrap=no_wrap, + ) + self.columns.append(column) + + def add_row( + self, + *renderables: Optional["RenderableType"], + style: StyleType = None, + end_section: bool = False, + ) -> None: + """Add a row of renderables. + + Args: + *renderables (None or renderable): Each cell in a row must be a renderable object (including str), + or ``None`` for a blank cell. + style (StyleType, optional): An optional style to apply to the entire row. Defaults to None. + end_section (bool, optional): End a section and draw a line. Defaults to False. + + Raises: + errors.NotRenderableError: If you add something that can't be rendered. + """ + + def add_cell(column: Column, renderable: "RenderableType") -> None: + column._cells.append(renderable) + + cell_renderables: List[Optional["RenderableType"]] = list(renderables) + + columns = self.columns + if len(cell_renderables) < len(columns): + cell_renderables = [ + *cell_renderables, + *[None] * (len(columns) - len(cell_renderables)), + ] + for index, renderable in enumerate(cell_renderables): + if index == len(columns): + column = Column(_index=index) + for _ in self.rows: + add_cell(column, Text("")) + self.columns.append(column) + else: + column = columns[index] + if renderable is None: + add_cell(column, "") + elif is_renderable(renderable): + add_cell(column, renderable) + else: + raise errors.NotRenderableError( + f"unable to render {type(renderable).__name__}; a string or other renderable object is required" + ) + self.rows.append(Row(style=style, end_section=end_section)) + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + + max_width = options.max_width + if self.width is not None: + max_width = self.width + + extra_width = self._extra_width + widths = self._calculate_column_widths(console, max_width - extra_width) + table_width = sum(widths) + extra_width + + render_options = options.update( + width=table_width, highlight=self.highlight, height=None + ) + + def render_annotation( + text: TextType, style: StyleType, justify: "JustifyMethod" = "center" + ) -> "RenderResult": + render_text = ( + console.render_str(text, style=style, highlight=False) + if isinstance(text, str) + else text + ) + return console.render( + render_text, options=render_options.update(justify=justify) + ) + + if self.title: + yield from render_annotation( + self.title, + style=Style.pick_first(self.title_style, "table.title"), + justify=self.title_justify, + ) + yield from self._render(console, render_options, widths) + if self.caption: + yield from render_annotation( + self.caption, + style=Style.pick_first(self.caption_style, "table.caption"), + justify=self.caption_justify, + ) + + def _calculate_column_widths(self, console: "Console", max_width: int) -> List[int]: + """Calculate the widths of each column, including padding, not including borders.""" + columns = self.columns + width_ranges = [ + self._measure_column(console, column, max_width) for column in columns + ] + widths = [_range.maximum or 1 for _range in width_ranges] + get_padding_width = self._get_padding_width + extra_width = self._extra_width + + if self.expand: + ratios = [col.ratio or 0 for col in columns if col.flexible] + if any(ratios): + fixed_widths = [ + 0 if column.flexible else _range.maximum + for _range, column in zip(width_ranges, columns) + ] + flex_minimum = [ + (column.width or 1) + get_padding_width(column._index) + for column in columns + if column.flexible + ] + flexible_width = max_width - sum(fixed_widths) + flex_widths = ratio_distribute(flexible_width, ratios, flex_minimum) + iter_flex_widths = iter(flex_widths) + for index, column in enumerate(columns): + if column.flexible: + widths[index] = fixed_widths[index] + next(iter_flex_widths) + table_width = sum(widths) + + if table_width > max_width: + widths = self._collapse_widths( + widths, + [(column.width is None and not column.no_wrap) for column in columns], + max_width, + ) + table_width = sum(widths) + + # last resort, reduce columns evenly + if table_width > max_width: + excess_width = table_width - max_width + widths = ratio_reduce(excess_width, [1] * len(widths), widths, widths) + table_width = sum(widths) + + width_ranges = [ + self._measure_column(console, column, width) + for width, column in zip(widths, columns) + ] + widths = [_range.maximum or 1 for _range in width_ranges] + + if (table_width < max_width and self.expand) or ( + self.min_width is not None and table_width < (self.min_width - extra_width) + ): + _max_width = ( + max_width + if self.min_width is None + else min(self.min_width - extra_width, max_width) + ) + pad_widths = ratio_distribute(_max_width - table_width, widths) + widths = [_width + pad for _width, pad in zip(widths, pad_widths)] + + return widths + + @classmethod + def _collapse_widths( + cls, widths: List[int], wrapable: List[bool], max_width: int + ) -> List[int]: + """Reduce widths so that the total is under max_width. + + Args: + widths (List[int]): List of widths. + wrapable (List[bool]): List of booleans that indicate if a column may shrink. + max_width (int): Maximum width to reduce to. + + Returns: + List[int]: A new list of widths. + """ + total_width = sum(widths) + excess_width = total_width - max_width + if any(wrapable): + while total_width and excess_width > 0: + max_column = max( + width for width, allow_wrap in zip(widths, wrapable) if allow_wrap + ) + second_max_column = max( + width if allow_wrap and width != max_column else 0 + for width, allow_wrap in zip(widths, wrapable) + ) + column_difference = max_column - second_max_column + ratios = [ + (1 if (width == max_column and allow_wrap) else 0) + for width, allow_wrap in zip(widths, wrapable) + ] + if not any(ratios) or not column_difference: + break + max_reduce = [min(excess_width, column_difference)] * len(widths) + widths = ratio_reduce(excess_width, ratios, max_reduce, widths) + + total_width = sum(widths) + excess_width = total_width - max_width + return widths + + def _get_cells( + self, console: "Console", column_index: int, column: Column + ) -> Iterable[_Cell]: + """Get all the cells with padding and optional header.""" + + collapse_padding = self.collapse_padding + pad_edge = self.pad_edge + padding = self.padding + any_padding = any(padding) + + first_column = column_index == 0 + last_column = column_index == len(self.columns) - 1 + + def add_padding( + renderable: "RenderableType", first_row: bool, last_row: bool + ) -> "RenderableType": + if not any_padding: + return renderable + top, right, bottom, left = padding + + if collapse_padding: + if not first_column: + left = max(0, left - right) + if not last_row: + bottom = max(0, top - bottom) + + if not pad_edge: + if first_column: + left = 0 + if last_column: + right = 0 + if first_row: + top = 0 + if last_row: + bottom = 0 + _padding = Padding(renderable, (top, right, bottom, left)) + return _padding + + raw_cells: List[Tuple[StyleType, "RenderableType"]] = [] + _append = raw_cells.append + get_style = console.get_style + if self.show_header: + header_style = get_style(self.header_style or "") + get_style( + column.header_style + ) + _append((header_style, column.header)) + cell_style = get_style(self.style or "") + get_style(column.style) + for cell in column.cells: + _append((cell_style, cell)) + if self.show_footer: + footer_style = get_style(self.footer_style or "") + get_style( + column.footer_style + ) + _append((footer_style, column.footer)) + for first, last, (style, renderable) in loop_first_last(raw_cells): + yield _Cell(style, add_padding(renderable, first, last)) + + def _get_padding_width(self, column_index: int) -> int: + """Get extra width from padding.""" + _, pad_right, _, pad_left = self.padding + if self.collapse_padding: + if column_index > 0: + pad_left = max(0, pad_left - pad_right) + return pad_left + pad_right + + def _measure_column( + self, console: "Console", column: Column, max_width: int + ) -> Measurement: + """Get the minimum and maximum width of the column.""" + + if max_width < 1: + return Measurement(0, 0) + + padding_width = self._get_padding_width(column._index) + + if column.width is not None: + # Fixed width column + return Measurement( + column.width + padding_width, column.width + padding_width + ).with_maximum(max_width) + # Flexible column, we need to measure contents + min_widths: List[int] = [] + max_widths: List[int] = [] + append_min = min_widths.append + append_max = max_widths.append + get_render_width = Measurement.get + for cell in self._get_cells(console, column._index, column): + _min, _max = get_render_width(console, cell.renderable, max_width) + append_min(_min) + append_max(_max) + + measurement = Measurement( + max(min_widths) if min_widths else 1, + max(max_widths) if max_widths else max_width, + ).with_maximum(max_width) + measurement = measurement.clamp( + None if column.min_width is None else column.min_width + padding_width, + None if column.max_width is None else column.max_width + padding_width, + ) + return measurement + + def _render( + self, console: "Console", options: "ConsoleOptions", widths: List[int] + ) -> "RenderResult": + table_style = console.get_style(self.style or "") + + border_style = table_style + console.get_style(self.border_style or "") + _column_cells = ( + self._get_cells(console, column_index, column) + for column_index, column in enumerate(self.columns) + ) + row_cells: List[Tuple[_Cell, ...]] = list(zip(*_column_cells)) + _box = ( + self.box.substitute( + options, safe=pick_bool(self.safe_box, console.safe_box) + ) + if self.box + else None + ) + + # _box = self.box + new_line = Segment.line() + + columns = self.columns + show_header = self.show_header + show_footer = self.show_footer + show_edge = self.show_edge + show_lines = self.show_lines + leading = self.leading + + _Segment = Segment + if _box: + box_segments = [ + ( + _Segment(_box.head_left, border_style), + _Segment(_box.head_right, border_style), + _Segment(_box.head_vertical, border_style), + ), + ( + _Segment(_box.foot_left, border_style), + _Segment(_box.foot_right, border_style), + _Segment(_box.foot_vertical, border_style), + ), + ( + _Segment(_box.mid_left, border_style), + _Segment(_box.mid_right, border_style), + _Segment(_box.mid_vertical, border_style), + ), + ] + if show_edge: + yield _Segment(_box.get_top(widths), border_style) + yield new_line + else: + box_segments = [] + + get_row_style = self.get_row_style + get_style = console.get_style + + for index, (first, last, row_cell) in enumerate(loop_first_last(row_cells)): + header_row = first and show_header + footer_row = last and show_footer + row = ( + self.rows[index - show_header] + if (not header_row and not footer_row) + else None + ) + max_height = 1 + cells: List[List[List[Segment]]] = [] + if header_row or footer_row: + row_style = Style.null() + else: + row_style = get_style( + get_row_style(console, index - 1 if show_header else index) + ) + for width, cell, column in zip(widths, row_cell, columns): + render_options = options.update( + width=width, + justify=column.justify, + no_wrap=column.no_wrap, + overflow=column.overflow, + height=None, + ) + cell_style = table_style + row_style + get_style(cell.style) + lines = console.render_lines( + cell.renderable, render_options, style=cell_style + ) + max_height = max(max_height, len(lines)) + cells.append(lines) + + cells[:] = [ + _Segment.set_shape( + _cell, width, max_height, style=table_style + row_style + ) + for width, _cell in zip(widths, cells) + ] + + if _box: + if last and show_footer: + yield _Segment( + _box.get_row(widths, "foot", edge=show_edge), border_style + ) + yield new_line + left, right, _divider = box_segments[0 if first else (2 if last else 1)] + + # If the column divider is whitespace also style it with the row background + divider = ( + _divider + if _divider.text.strip() + else _Segment( + _divider.text, row_style.background_style + _divider.style + ) + ) + for line_no in range(max_height): + if show_edge: + yield left + for last_cell, rendered_cell in loop_last(cells): + yield from rendered_cell[line_no] + if not last_cell: + yield divider + if show_edge: + yield right + yield new_line + else: + for line_no in range(max_height): + for rendered_cell in cells: + yield from rendered_cell[line_no] + yield new_line + if _box and first and show_header: + yield _Segment( + _box.get_row(widths, "head", edge=show_edge), border_style + ) + yield new_line + end_section = row and row.end_section + if _box and (show_lines or leading or end_section): + if ( + not last + and not (show_footer and index >= len(row_cells) - 2) + and not (show_header and header_row) + ): + if leading: + yield _Segment( + _box.get_row(widths, "mid", edge=show_edge) * leading, + border_style, + ) + else: + yield _Segment( + _box.get_row(widths, "row", edge=show_edge), border_style + ) + yield new_line + + if _box and show_edge: + yield _Segment(_box.get_bottom(widths), border_style) + yield new_line + + +if __name__ == "__main__": # pragma: no cover + from rich.console import Console + from rich.highlighter import ReprHighlighter + from rich.table import Table + + table = Table( + title="Star Wars Movies", + caption="Rich example table", + caption_justify="right", + ) + + table.add_column("Released", header_style="bright_cyan", style="cyan", no_wrap=True) + table.add_column("Title", style="magenta") + table.add_column("Box Office", justify="right", style="green") + + table.add_row( + "Dec 20, 2019", + "Star Wars: The Rise of Skywalker", + "$952,110,690", + ) + table.add_row("May 25, 2018", "Solo: A Star Wars Story", "$393,151,347") + table.add_row( + "Dec 15, 2017", + "Star Wars Ep. V111: The Last Jedi", + "$1,332,539,889", + style="on black", + end_section=True, + ) + table.add_row( + "Dec 16, 2016", + "Rogue One: A Star Wars Story", + "$1,332,439,889", + ) + + def header(text: str) -> None: + console.print() + console.rule(highlight(text)) + console.print() + + console = Console() + highlight = ReprHighlighter() + header("Example Table") + console.print(table, justify="center") + + table.expand = True + header("expand=True") + console.print(table, justify="center") + + table.width = 50 + header("width=50") + + console.print(table, justify="center") + + table.width = None + table.expand = False + table.row_styles = ["dim", "none"] + header("row_styles=['dim', 'none']") + + console.print(table, justify="center") + + table.width = None + table.expand = False + table.row_styles = ["dim", "none"] + table.leading = 1 + header("leading=1, row_styles=['dim', 'none']") + console.print(table, justify="center") + + table.width = None + table.expand = False + table.row_styles = ["dim", "none"] + table.show_lines = True + table.leading = 0 + header("show_lines=True, row_styles=['dim', 'none']") + console.print(table, justify="center") diff --git a/rich/tabulate.py b/rich/tabulate.py new file mode 100644 index 0000000..2966948 --- /dev/null +++ b/rich/tabulate.py @@ -0,0 +1,75 @@ +from collections.abc import Mapping +from typing import Optional + +from rich.console import JustifyMethod + +from . import box +from .highlighter import ReprHighlighter +from .pretty import Pretty +from .table import Table + + +def tabulate_mapping( + mapping: Mapping, + title: str = None, + caption: str = None, + title_justify: Optional[JustifyMethod] = None, + caption_justify: Optional[JustifyMethod] = None, +) -> Table: + """Generate a simple table from a mapping. + + Args: + mapping (Mapping): A mapping object (e.g. a dict); + title (str, optional): Optional title to be displayed over the table. + caption (str, optional): Optional caption to be displayed below the table. + title_justify (str, optional): Justify method for title. Defaults to None. + caption_justify (str, optional): Justify method for caption. Defaults to None. + + Returns: + Table: A table instance which may be rendered by the Console. + """ + table = Table( + show_header=False, + title=title, + caption=caption, + box=box.ROUNDED, + border_style="blue", + ) + table.title = title + table.caption = caption + if title_justify is not None: + table.title_justify = title_justify + if caption_justify is not None: + table.caption_justify = caption_justify + highlighter = ReprHighlighter() + for key, value in mapping.items(): + table.add_row( + Pretty(key, highlighter=highlighter), Pretty(value, highlighter=highlighter) + ) + return table + + +if __name__ == "__main__": # pragma: no cover + from rich import print + + def test(foo, bar, tjustify=None, cjustify=None): + list_of_things = [1, 2, 3, None, 4, True, False, "Hello World"] + dict_of_things = { + "version": "1.1", + "method": "confirmFruitPurchase", + "params": [["apple", "orange", "mangoes", "pomelo"], 1.123], + "id": "194521489", + } + print( + tabulate_mapping( + locals(), + title="locals()", + title_justify=tjustify, + caption="__main__.test", + caption_justify=cjustify, + ) + ) + + print() + test(20.3423, 3.1427, cjustify="right") + print() diff --git a/rich/terminal_theme.py b/rich/terminal_theme.py new file mode 100644 index 0000000..a5ca1c0 --- /dev/null +++ b/rich/terminal_theme.py @@ -0,0 +1,55 @@ +from typing import List, Tuple + +from .color_triplet import ColorTriplet +from .palette import Palette + +_ColorTuple = Tuple[int, int, int] + + +class TerminalTheme: + """A color theme used when exporting console content. + + Args: + background (Tuple[int, int, int]): The background color. + foreground (Tuple[int, int, int]): The foreground (text) color. + normal (List[Tuple[int, int, int]]): A list of 8 normal intensity colors. + bright (List[Tuple[int, int, int]], optional): A list of 8 bright colors, or None + to repeat normal intensity. Defaults to None. + """ + + def __init__( + self, + background: _ColorTuple, + foreground: _ColorTuple, + normal: List[_ColorTuple], + bright: List[_ColorTuple] = None, + ) -> None: + self.background_color = ColorTriplet(*background) + self.foreground_color = ColorTriplet(*foreground) + self.ansi_colors = Palette(normal + (bright or normal)) + + +DEFAULT_TERMINAL_THEME = TerminalTheme( + (255, 255, 255), + (0, 0, 0), + [ + (0, 0, 0), + (128, 0, 0), + (0, 128, 0), + (128, 128, 0), + (0, 0, 128), + (128, 0, 128), + (0, 128, 128), + (192, 192, 192), + ], + [ + (128, 128, 128), + (255, 0, 0), + (0, 255, 0), + (255, 255, 0), + (0, 0, 255), + (255, 0, 255), + (0, 255, 255), + (255, 255, 255), + ], +) diff --git a/rich/text.py b/rich/text.py new file mode 100644 index 0000000..6a4a332 --- /dev/null +++ b/rich/text.py @@ -0,0 +1,1133 @@ +import re +from functools import partial, reduce +from math import gcd +from operator import attrgetter, itemgetter +from typing import ( + TYPE_CHECKING, + Any, + Callable, + Dict, + Iterable, + List, + NamedTuple, + Optional, + Tuple, + Union, + cast, +) + +from ._loop import loop_last +from ._pick import pick_bool +from ._wrap import divide_line +from .align import AlignMethod +from .cells import cell_len, set_cell_size +from .containers import Lines +from .control import strip_control_codes +from .jupyter import JupyterMixin +from .measure import Measurement +from .segment import Segment +from .style import Style, StyleType + +if TYPE_CHECKING: # pragma: no cover + from .console import Console, ConsoleOptions, JustifyMethod, OverflowMethod + +DEFAULT_JUSTIFY: "JustifyMethod" = "default" +DEFAULT_OVERFLOW: "OverflowMethod" = "fold" + + +_re_whitespace = re.compile(r"\s+$") + +TextType = Union[str, "Text"] + +GetStyleCallable = Callable[[str], Optional[StyleType]] + + +class Span(NamedTuple): + """A marked up region in some text.""" + + start: int + """Span start index.""" + end: int + """Span end index.""" + style: Union[str, Style] + """Style associated with the span.""" + + def __repr__(self) -> str: + return f"Span({self.start}, {self.end}, {str(self.style)!r})" + + def __bool__(self) -> bool: + return self.end > self.start + + def split(self, offset: int) -> Tuple["Span", Optional["Span"]]: + """Split a span in to 2 from a given offset.""" + + if offset < self.start: + return self, None + if offset >= self.end: + return self, None + + start, end, style = self + span1 = Span(start, min(end, offset), style) + span2 = Span(span1.end, end, style) + return span1, span2 + + def move(self, offset: int) -> "Span": + """Move start and end by a given offset. + + Args: + offset (int): Number of characters to add to start and end. + + Returns: + TextSpan: A new TextSpan with adjusted position. + """ + start, end, style = self + return Span(start + offset, end + offset, style) + + def right_crop(self, offset: int) -> "Span": + """Crop the span at the given offset. + + Args: + offset (int): A value between start and end. + + Returns: + Span: A new (possibly smaller) span. + """ + start, end, style = self + if offset >= end: + return self + return Span(start, min(offset, end), style) + + +class Text(JupyterMixin): + """Text with color / style. + + Args: + text (str, optional): Default unstyled text. Defaults to "". + style (Union[str, Style], optional): Base style for text. Defaults to "". + justify (str, optional): Justify method: "left", "center", "full", "right". Defaults to None. + overflow (str, optional): Overflow method: "crop", "fold", "ellipsis". Defaults to None. + no_wrap (bool, optional): Disable text wrapping, or None for default. Defaults to None. + end (str, optional): Character to end text with. Defaults to "\\\\n". + tab_size (int): Number of spaces per tab, or ``None`` to use ``console.tab_size``. Defaults to 8. + spans (List[Span], optional). A list of predefined style spans. Defaults to None. + """ + + __slots__ = [ + "_text", + "style", + "justify", + "overflow", + "no_wrap", + "end", + "tab_size", + "_spans", + "_length", + ] + + def __init__( + self, + text: str = "", + style: Union[str, Style] = "", + *, + justify: "JustifyMethod" = None, + overflow: "OverflowMethod" = None, + no_wrap: bool = None, + end: str = "\n", + tab_size: Optional[int] = 8, + spans: List[Span] = None, + ) -> None: + self._text = [strip_control_codes(text)] + self.style = style + self.justify = justify + self.overflow = overflow + self.no_wrap = no_wrap + self.end = end + self.tab_size = tab_size + self._spans: List[Span] = spans or [] + self._length: int = len(text) + + def __len__(self) -> int: + return self._length + + def __bool__(self) -> bool: + return bool(self._length) + + def __str__(self) -> str: + return self.plain + + def __repr__(self) -> str: + return f"<text {self.plain!r} {self._spans!r}>" + + def __add__(self, other: Any) -> "Text": + if isinstance(other, (str, Text)): + result = self.copy() + result.append(other) + return result + return NotImplemented + + def __eq__(self, other: object) -> bool: + if not isinstance(other, Text): + return NotImplemented + return self.plain == other.plain and self._spans == other._spans + + def __contains__(self, other: object) -> bool: + if isinstance(other, str): + return other in self.plain + elif isinstance(other, Text): + return other.plain in self.plain + return False + + def __getitem__(self, slice: Union[int, slice]) -> "Text": + def get_text_at(offset) -> "Text": + _Span = Span + text = Text( + self.plain[offset], + spans=[ + _Span(0, 1, style) + for start, end, style in self._spans + if end > offset >= start + ], + end="", + ) + return text + + if isinstance(slice, int): + return get_text_at(slice) + else: + start, stop, step = slice.indices(len(self.plain)) + if step == 1: + lines = self.divide([start, stop]) + return lines[1] + else: + # This would be a bit of work to implement efficiently + # For now, its not required + raise TypeError("slices with step!=1 are not supported") + + @property + def cell_len(self) -> int: + """Get the number of cells required to render this text.""" + return cell_len(self.plain) + + @classmethod + def from_markup( + cls, + text: str, + *, + style: Union[str, Style] = "", + emoji: bool = True, + justify: "JustifyMethod" = None, + overflow: "OverflowMethod" = None, + ) -> "Text": + """Create Text instance from markup. + + Args: + text (str): A string containing console markup. + emoji (bool, optional): Also render emoji code. Defaults to True. + justify (str, optional): Justify method: "left", "center", "full", "right". Defaults to None. + overflow (str, optional): Overflow method: "crop", "fold", "ellipsis". Defaults to None. + + Returns: + Text: A Text instance with markup rendered. + """ + from .markup import render + + rendered_text = render(text, style, emoji=emoji) + rendered_text.justify = justify + rendered_text.overflow = overflow + return rendered_text + + @classmethod + def styled( + cls, + text: str, + style: StyleType = "", + *, + justify: "JustifyMethod" = None, + overflow: "OverflowMethod" = None, + ) -> "Text": + """Construct a Text instance with a pre-applied styled. A style applied in this way won't be used + to pad the text when it is justified. + + Args: + text (str): A string containing console markup. + style (Union[str, Style]): Style to apply to the text. Defaults to "". + justify (str, optional): Justify method: "left", "center", "full", "right". Defaults to None. + overflow (str, optional): Overflow method: "crop", "fold", "ellipsis". Defaults to None. + + Returns: + Text: A text instance with a style applied to the entire string. + """ + styled_text = cls(text, justify=justify, overflow=overflow) + styled_text.stylize(style) + return styled_text + + @classmethod + def assemble( + cls, + *parts: Union[str, "Text", Tuple[str, StyleType]], + style: Union[str, Style] = "", + justify: "JustifyMethod" = None, + overflow: "OverflowMethod" = None, + no_wrap: bool = None, + end: str = "\n", + tab_size: int = 8, + ) -> "Text": + """Construct a text instance by combining a sequence of strings with optional styles. + The positional arguments should be either strings, or a tuple of string + style. + + Args: + style (Union[str, Style], optional): Base style for text. Defaults to "". + justify (str, optional): Justify method: "left", "center", "full", "right". Defaults to None. + overflow (str, optional): Overflow method: "crop", "fold", "ellipsis". Defaults to None. + end (str, optional): Character to end text with. Defaults to "\\\\n". + tab_size (int): Number of spaces per tab, or ``None`` to use ``console.tab_size``. Defaults to 8. + + Returns: + Text: A new text instance. + """ + text = cls( + style=style, + justify=justify, + overflow=overflow, + no_wrap=no_wrap, + end=end, + tab_size=tab_size, + ) + append = text.append + _Text = Text + for part in parts: + if isinstance(part, (_Text, str)): + append(part) + else: + append(*part) + return text + + @property + def plain(self) -> str: + """Get the text as a single string.""" + if len(self._text) != 1: + self._text[:] = ["".join(self._text)] + return self._text[0] + + @plain.setter + def plain(self, new_text: str) -> None: + """Set the text to a new value.""" + if new_text != self.plain: + self._text[:] = [new_text] + old_length = self._length + self._length = len(new_text) + if old_length > self._length: + self._trim_spans() + + @property + def spans(self) -> List[Span]: + """Get a reference to the internal list of spans.""" + return self._spans + + @spans.setter + def spans(self, spans: List[Span]) -> None: + """Set spans.""" + self._spans = spans[:] + + def blank_copy(self) -> "Text": + """Return a new Text instance with copied meta data (but not the string or spans).""" + copy_self = Text( + style=self.style, + justify=self.justify, + overflow=self.overflow, + no_wrap=self.no_wrap, + end=self.end, + tab_size=self.tab_size, + ) + return copy_self + + def copy(self) -> "Text": + """Return a copy of this instance.""" + copy_self = Text( + self.plain, + style=self.style, + justify=self.justify, + overflow=self.overflow, + no_wrap=self.no_wrap, + end=self.end, + tab_size=self.tab_size, + ) + copy_self._spans[:] = self._spans + return copy_self + + def stylize( + self, style: Union[str, Style], start: int = 0, end: Optional[int] = None + ) -> None: + """Apply a style to the text, or a portion of the text. + + Args: + style (Union[str, Style]): Style instance or style definition to apply. + start (int): Start offset (negative indexing is supported). Defaults to 0. + end (Optional[int], optional): End offset (negative indexing is supported), or None for end of text. Defaults to None. + + """ + length = len(self) + if start < 0: + start = length + start + if end is None: + end = length + if end < 0: + end = length + end + if start >= length or end <= start: + # Span not in text or not valid + return + self._spans.append(Span(start, min(length, end), style)) + + def remove_suffix(self, suffix: str) -> None: + """Remove a suffix if it exists. + + Args: + suffix (str): Suffix to remove. + """ + if self.plain.endswith(suffix): + self.right_crop(len(suffix)) + + def get_style_at_offset(self, console: "Console", offset: int) -> Style: + """Get the style of a character at give offset. + + Args: + console (~Console): Console where text will be rendered. + offset (int): Offset in to text (negative indexing supported) + + Returns: + Style: A Style instance. + """ + # TODO: This is a little inefficient, it is only used by full justify + if offset < 0: + offset = len(self) + offset + get_style = console.get_style + style = get_style(self.style).copy() + for start, end, span_style in self._spans: + if end > offset >= start: + style += get_style(span_style, default="") + return style + + def highlight_regex( + self, + re_highlight: str, + style: Union[GetStyleCallable, StyleType] = None, + *, + style_prefix: str = "", + ) -> int: + """Highlight text with a regular expression, where group names are + translated to styles. + + Args: + re_highlight (str): A regular expression. + style (Union[GetStyleCallable, StyleType]): Optional style to apply to whole match, or a callable + which accepts the matched text and returns a style. Defaults to None. + style_prefix (str, optional): Optional prefix to add to style group names. + + Returns: + int: Number of regex matches + """ + count = 0 + append_span = self._spans.append + _Span = Span + plain = self.plain + for match in re.finditer(re_highlight, plain): + get_span = match.span + if style: + start, end = get_span() + match_style = style(plain[start:end]) if callable(style) else style + if match_style is not None and end > start: + append_span(_Span(start, end, match_style)) + + count += 1 + for name in match.groupdict().keys(): + start, end = get_span(name) + if start != -1 and end > start: + append_span(_Span(start, end, f"{style_prefix}{name}")) + return count + + def highlight_words( + self, + words: Iterable[str], + style: Union[str, Style], + *, + case_sensitive: bool = True, + ) -> int: + """Highlight words with a style. + + Args: + words (Iterable[str]): Worlds to highlight. + style (Union[str, Style]): Style to apply. + case_sensitive (bool, optional): Enable case sensitive matchings. Defaults to True. + + Returns: + int: Number of words highlighted. + """ + re_words = "|".join(re.escape(word) for word in words) + add_span = self._spans.append + count = 0 + _Span = Span + for match in re.finditer( + re_words, self.plain, flags=0 if case_sensitive else re.IGNORECASE + ): + start, end = match.span(0) + add_span(_Span(start, end, style)) + count += 1 + return count + + def rstrip(self) -> None: + """Strip whitespace from end of text.""" + self.plain = self.plain.rstrip() + + def rstrip_end(self, size: int) -> None: + """Remove whitespace beyond a certain width at the end of the text. + + Args: + size (int): The desired size of the text. + """ + text_length = len(self) + if text_length > size: + excess = text_length - size + whitespace_match = _re_whitespace.search(self.plain) + if whitespace_match is not None: + whitespace_count = len(whitespace_match.group(0)) + self.right_crop(min(whitespace_count, excess)) + + def set_length(self, new_length: int) -> None: + """Set new length of the text, clipping or padding is required.""" + length = len(self) + if length != new_length: + if length < new_length: + self.pad_right(new_length - length) + else: + self.right_crop(length - new_length) + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> Iterable[Segment]: + tab_size: int = console.tab_size or self.tab_size or 8 # type: ignore + justify = cast( + "JustifyMethod", self.justify or options.justify or DEFAULT_OVERFLOW + ) + overflow = cast( + "OverflowMethod", self.overflow or options.overflow or DEFAULT_OVERFLOW + ) + + lines = self.wrap( + console, + options.max_width, + justify=justify, + overflow=overflow, + tab_size=tab_size or 8, + no_wrap=pick_bool(self.no_wrap, options.no_wrap, False), + ) + all_lines = Text("\n").join(lines) + yield from all_lines.render(console, end=self.end) + + def __rich_measure__(self, console: "Console", max_width: int) -> Measurement: + text = self.plain + if not text.strip(): + return Measurement(cell_len(text), cell_len(text)) + max_text_width = max(cell_len(line) for line in text.splitlines()) + min_text_width = max(cell_len(word) for word in text.split()) + return Measurement(min_text_width, max_text_width) + + def render(self, console: "Console", end: str = "") -> Iterable["Segment"]: + """Render the text as Segments. + + Args: + console (Console): Console instance. + end (Optional[str], optional): Optional end character. + + Returns: + Iterable[Segment]: Result of render that may be written to the console. + """ + + _Segment = Segment + text = self.plain + enumerated_spans = list(enumerate(self._spans, 1)) + get_style = partial(console.get_style, default=Style.null()) + style_map = {index: get_style(span.style) for index, span in enumerated_spans} + style_map[0] = get_style(self.style) + + spans = [ + (0, False, 0), + *((span.start, False, index) for index, span in enumerated_spans), + *((span.end, True, index) for index, span in enumerated_spans), + (len(text), True, 0), + ] + spans.sort(key=itemgetter(0, 1)) + + stack: List[int] = [] + stack_append = stack.append + stack_pop = stack.remove + + style_cache: Dict[Tuple[Style, ...], Style] = {} + style_cache_get = style_cache.get + combine = Style.combine + + def get_current_style() -> Style: + """Construct current style from stack.""" + styles = tuple(style_map[_style_id] for _style_id in sorted(stack)) + cached_style = style_cache_get(styles) + if cached_style is not None: + return cached_style + current_style = combine(styles) + style_cache[styles] = current_style + return current_style + + for (offset, leaving, style_id), (next_offset, _, _) in zip(spans, spans[1:]): + if leaving: + stack_pop(style_id) + else: + stack_append(style_id) + if next_offset > offset: + yield _Segment(text[offset:next_offset], get_current_style()) + if end: + yield _Segment(end) + + def join(self, lines: Iterable["Text"]) -> "Text": + """Join text together with this instance as the separator. + + Args: + lines (Iterable[Text]): An iterable of Text instances to join. + + Returns: + Text: A new text instance containing join text. + """ + + new_text = self.blank_copy() + + def iter_text() -> Iterable["Text"]: + if self.plain: + for last, line in loop_last(lines): + yield line + if not last: + yield self + else: + yield from lines + + extend_text = new_text._text.extend + append_span = new_text._spans.append + extend_spans = new_text._spans.extend + offset = 0 + _Span = Span + + for text in iter_text(): + extend_text(text._text) + if text.style is not None: + append_span(_Span(offset, offset + len(text), text.style)) + extend_spans( + _Span(offset + start, offset + end, style) + for start, end, style in text._spans + ) + offset += len(text) + new_text._length = offset + return new_text + + def expand_tabs(self, tab_size: int = None) -> None: + """Converts tabs to spaces. + + Args: + tab_size (int, optional): Size of tabs. Defaults to 8. + + """ + if "\t" not in self.plain: + return + pos = 0 + if tab_size is None: + tab_size = self.tab_size + assert tab_size is not None + result = self.blank_copy() + append = result.append + + _style = self.style + for line in self.split("\n", include_separator=True): + parts = line.split("\t", include_separator=True) + for part in parts: + if part.plain.endswith("\t"): + part._text = [part.plain[:-1] + " "] + append(part) + pos += len(part) + spaces = tab_size - ((pos - 1) % tab_size) - 1 + if spaces: + append(" " * spaces, _style) + pos += spaces + else: + append(part) + self._text = [result.plain] + self._length = len(self.plain) + self._spans[:] = result._spans + + def truncate( + self, + max_width: int, + *, + overflow: Optional["OverflowMethod"] = None, + pad: bool = False, + ) -> None: + """Truncate text if it is longer that a given width. + + Args: + max_width (int): Maximum number of characters in text. + overflow (str, optional): Overflow method: "crop", "fold", or "ellipsis". Defaults to None, to use self.overflow. + pad (bool, optional): Pad with spaces if the length is less than max_width. Defaults to False. + """ + _overflow = overflow or self.overflow or DEFAULT_OVERFLOW + if _overflow != "ignore": + length = cell_len(self.plain) + if length > max_width: + if _overflow == "ellipsis": + self.plain = set_cell_size(self.plain, max_width - 1) + "…" + else: + self.plain = set_cell_size(self.plain, max_width) + if pad and length < max_width: + spaces = max_width - length + self._text = [f"{self.plain}{' ' * spaces}"] + self._length = len(self.plain) + + def _trim_spans(self) -> None: + """Remove or modify any spans that are over the end of the text.""" + max_offset = len(self.plain) + _Span = Span + self._spans[:] = [ + ( + span + if span.end < max_offset + else _Span(span.start, min(max_offset, span.end), span.style) + ) + for span in self._spans + if span.start < max_offset + ] + + def pad(self, count: int, character: str = " ") -> None: + """Pad left and right with a given number of characters. + + Args: + count (int): Width of padding. + """ + assert len(character) == 1, "Character must be a string of length 1" + if count: + pad_characters = character * count + self.plain = f"{pad_characters}{self.plain}{pad_characters}" + _Span = Span + self._spans[:] = [ + _Span(start + count, end + count, style) + for start, end, style in self._spans + ] + + def pad_left(self, count: int, character: str = " ") -> None: + """Pad the left with a given character. + + Args: + count (int): Number of characters to pad. + character (str, optional): Character to pad with. Defaults to " ". + """ + assert len(character) == 1, "Character must be a string of length 1" + if count: + self.plain = f"{character * count}{self.plain}" + _Span = Span + self._spans[:] = [ + _Span(start + count, end + count, style) + for start, end, style in self._spans + ] + + def pad_right(self, count: int, character: str = " ") -> None: + """Pad the right with a given character. + + Args: + count (int): Number of characters to pad. + character (str, optional): Character to pad with. Defaults to " ". + """ + assert len(character) == 1, "Character must be a string of length 1" + if count: + self.plain = f"{self.plain}{character * count}" + + def align(self, align: AlignMethod, width: int, character: str = " ") -> None: + """Align text to a given width. + + Args: + align (AlignMethod): One of "left", "center", or "right". + width (int): Desired width. + character (str, optional): Character to pad with. Defaults to " ". + """ + self.truncate(width) + excess_space = width - cell_len(self.plain) + if excess_space: + if align == "left": + self.pad_right(excess_space, character) + elif align == "center": + left = excess_space // 2 + self.pad_left(left, character) + self.pad_right(excess_space - left, character) + else: + self.pad_left(excess_space, character) + + def append( + self, text: Union["Text", str], style: Union[str, "Style"] = None + ) -> "Text": + """Add text with an optional style. + + Args: + text (Union[Text, str]): A str or Text to append. + style (str, optional): A style name. Defaults to None. + + Returns: + Text: Returns self for chaining. + """ + + if not isinstance(text, (str, Text)): + raise TypeError("Only str or Text can be appended to Text") + + if len(text): + if isinstance(text, str): + text = strip_control_codes(text) + self._text.append(text) + offset = len(self) + text_length = len(text) + if style is not None: + self._spans.append(Span(offset, offset + text_length, style)) + self._length += text_length + elif isinstance(text, Text): + _Span = Span + if style is not None: + raise ValueError( + "style must not be set when appending Text instance" + ) + text_length = self._length + if text.style is not None: + self._spans.append( + _Span(text_length, text_length + len(text), text.style) + ) + self._text.append(text.plain) + self._spans.extend( + _Span(start + text_length, end + text_length, style) + for start, end, style in text._spans + ) + self._length += len(text) + return self + + def append_text(self, text: "Text") -> "Text": + """Append another Text instance. This method is more performant that Text.append, but + only works for Text. + + Returns: + Text: Returns self for chaining. + """ + _Span = Span + text_length = self._length + if text.style is not None: + self._spans.append(_Span(text_length, text_length + len(text), text.style)) + self._text.append(text.plain) + self._spans.extend( + _Span(start + text_length, end + text_length, style) + for start, end, style in text._spans + ) + self._length += len(text) + return self + + def append_tokens(self, tokens: Iterable[Tuple[str, Optional[StyleType]]]): + """Append iterable of str and style. Style may be a Style instance or a str style definition. + + Args: + pairs (Iterable[Tuple[str, Optional[StyleType]]]): An iterable of tuples containing str content and style. + + Returns: + Text: Returns self for chaining. + """ + append_text = self._text.append + append_span = self._spans.append + _Span = Span + offset = len(self) + for content, style in tokens: + append_text(content) + if style is not None: + append_span(_Span(offset, offset + len(content), style)) + offset += len(content) + self._length = offset + return self + + def copy_styles(self, text: "Text") -> None: + """Copy styles from another Text instance. + + Args: + text (Text): A Text instance to copy styles from, must be the same length. + """ + self._spans.extend(text._spans) + + def split( + self, + separator="\n", + *, + include_separator: bool = False, + allow_blank: bool = False, + ) -> Lines: + """Split rich text in to lines, preserving styles. + + Args: + separator (str, optional): String to split on. Defaults to "\\\\n". + include_separator (bool, optional): Include the separator in the lines. Defaults to False. + allow_blank (bool, optional): Return a blank line if the text ends with a separator. Defaults to False. + + Returns: + List[RichText]: A list of rich text, one per line of the original. + """ + assert separator, "separator must not be empty" + + text = self.plain + if separator not in text: + return Lines([self.copy()]) + + if include_separator: + lines = self.divide( + match.end() for match in re.finditer(re.escape(separator), text) + ) + else: + + def flatten_spans() -> Iterable[int]: + for match in re.finditer(re.escape(separator), text): + start, end = match.span() + yield start + yield end + + lines = Lines( + line for line in self.divide(flatten_spans()) if line.plain != separator + ) + + if not allow_blank and text.endswith(separator): + lines.pop() + + return lines + + def divide(self, offsets: Iterable[int]) -> Lines: + """Divide text in to a number of lines at given offsets. + + Args: + offsets (Iterable[int]): Offsets used to divide text. + + Returns: + Lines: New RichText instances between offsets. + """ + _offsets = list(offsets) + if not _offsets: + return Lines([self.copy()]) + + text = self.plain + text_length = len(text) + divide_offsets = [0, *_offsets, text_length] + line_ranges = list(zip(divide_offsets, divide_offsets[1:])) + + style = self.style + justify = self.justify + overflow = self.overflow + _Text = Text + new_lines = Lines( + _Text( + text[start:end], + style=style, + justify=justify, + overflow=overflow, + ) + for start, end in line_ranges + ) + if not self._spans: + return new_lines + order = {span: span_index for span_index, span in enumerate(self._spans)} + span_stack = sorted(self._spans, key=attrgetter("start"), reverse=True) + + pop = span_stack.pop + push = span_stack.append + _Span = Span + get_order = order.__getitem__ + + for line, (start, end) in zip(new_lines, line_ranges): + if not span_stack: + break + append_span = line._spans.append + position = len(span_stack) - 1 + while span_stack[position].start < end: + span = pop(position) + add_span, remaining_span = span.split(end) + if remaining_span: + push(remaining_span) + order[remaining_span] = order[span] + span_start, span_end, span_style = add_span + line_span = _Span(span_start - start, span_end - start, span_style) + order[line_span] = order[span] + append_span(line_span) + position -= 1 + if position < 0 or not span_stack: + break # pragma: no cover + line._spans.sort(key=get_order) + + return new_lines + + def right_crop(self, amount: int = 1) -> None: + """Remove a number of characters from the end of the text.""" + max_offset = len(self.plain) - amount + _Span = Span + self._spans[:] = [ + ( + span + if span.end < max_offset + else _Span(span.start, min(max_offset, span.end), span.style) + ) + for span in self._spans + if span.start < max_offset + ] + self._text = [self.plain[:-amount]] + self._length -= amount + + def wrap( + self, + console: "Console", + width: int, + *, + justify: "JustifyMethod" = None, + overflow: "OverflowMethod" = None, + tab_size: int = 8, + no_wrap: bool = None, + ) -> Lines: + """Word wrap the text. + + Args: + console (Console): Console instance. + width (int): Number of characters per line. + emoji (bool, optional): Also render emoji code. Defaults to True. + justify (str, optional): Justify method: "default", "left", "center", "full", "right". Defaults to "default". + overflow (str, optional): Overflow method: "crop", "fold", or "ellipsis". Defaults to None. + tab_size (int, optional): Default tab size. Defaults to 8. + no_wrap (bool, optional): Disable wrapping, Defaults to False. + + Returns: + Lines: Number of lines. + """ + wrap_justify = cast("JustifyMethod", justify or self.justify or DEFAULT_JUSTIFY) + wrap_overflow = cast( + "OverflowMethod", overflow or self.overflow or DEFAULT_OVERFLOW + ) + no_wrap = pick_bool(no_wrap, self.no_wrap, False) or overflow == "ignore" + + lines = Lines() + for line in self.split(allow_blank=True): + if "\t" in line: + line.expand_tabs(tab_size) + if no_wrap: + new_lines = Lines([line]) + else: + offsets = divide_line(str(line), width, fold=wrap_overflow == "fold") + new_lines = line.divide(offsets) + for line in new_lines: + line.rstrip_end(width) + if wrap_justify: + new_lines.justify( + console, width, justify=wrap_justify, overflow=wrap_overflow + ) + for line in new_lines: + line.truncate(width, overflow=wrap_overflow) + lines.extend(new_lines) + return lines + + def fit(self, width: int) -> Lines: + """Fit the text in to given width by chopping in to lines. + + Args: + width (int): Maximum characters in a line. + + Returns: + Lines: List of lines. + """ + lines: Lines = Lines() + append = lines.append + for line in self.split(): + line.set_length(width) + append(line) + return lines + + def detect_indentation(self) -> int: + """Auto-detect indentation of code. + + Returns: + int: Number of spaces used to indent code. + """ + + _indentations = { + len(match.group(1)) + for match in re.finditer(r"^( *)(.*)$", self.plain, flags=re.MULTILINE) + } + + try: + indentation = ( + reduce(gcd, [indent for indent in _indentations if not indent % 2]) or 1 + ) + except TypeError: + indentation = 1 + + return indentation + + def with_indent_guides( + self, + indent_size: int = None, + *, + character: str = "│", + style: StyleType = "dim green", + ) -> "Text": + """Adds indent guide lines to text. + + Args: + indent_size (Optional[int]): Size of indentation, or None to auto detect. Defaults to None. + character (str, optional): Character to use for indentation. Defaults to "│". + style (Union[Style, str], optional): Style of indent guides. + + Returns: + Text: New text with indentation guides. + """ + + _indent_size = self.detect_indentation() if indent_size is None else indent_size + + text = self.copy() + text.expand_tabs() + indent_line = f"{character}{' ' * (_indent_size - 1)}" + + re_indent = re.compile(r"^( *)(.*)$") + new_lines: List[Text] = [] + add_line = new_lines.append + blank_lines = 0 + for line in text.split(): + match = re_indent.match(line.plain) + if not match or not match.group(2): + blank_lines += 1 + continue + indent = match.group(1) + full_indents, remaining_space = divmod(len(indent), _indent_size) + new_indent = f"{indent_line * full_indents}{' ' * remaining_space}" + line.plain = new_indent + line.plain[len(new_indent) :] + line.stylize(style, 0, len(new_indent)) + if blank_lines: + new_lines.extend([Text(new_indent, style=style)] * blank_lines) + blank_lines = 0 + add_line(line) + if blank_lines: + new_lines.extend([Text("", style=style)] * blank_lines) + + new_text = Text("\n").join(new_lines) + return new_text + + +if __name__ == "__main__": # pragma: no cover + from rich import print + + text = Text("<span>\n\tHello\n</span>") + text.expand_tabs(4) + print(text) + + code = """ +def __add__(self, other: Any) -> "Text": + if isinstance(other, (str, Text)): + result = self.copy() + result.append(other) + return result + return NotImplemented +""" + text = Text(code) + text = text.with_indent_guides() + print(text) diff --git a/rich/theme.py b/rich/theme.py new file mode 100644 index 0000000..7f161d9 --- /dev/null +++ b/rich/theme.py @@ -0,0 +1,110 @@ +import configparser +from typing import Dict, List, IO, Mapping, Optional + +from .default_styles import DEFAULT_STYLES +from .style import Style, StyleType + + +class Theme: + """A container for style information, used by :class:`~rich.console.Console`. + + Args: + styles (Dict[str, Style], optional): A mapping of style names on to styles. Defaults to None for a theme with no styles. + inherit (bool, optional): Inherit default styles. Defaults to True. + """ + + styles: Dict[str, Style] + + def __init__(self, styles: Mapping[str, StyleType] = None, inherit: bool = True): + self.styles = DEFAULT_STYLES.copy() if inherit else {} + if styles is not None: + self.styles.update( + { + name: style if isinstance(style, Style) else Style.parse(style) + for name, style in styles.items() + } + ) + + @property + def config(self) -> str: + """Get contents of a config file for this theme.""" + config = "[styles]\n" + "\n".join( + f"{name} = {style}" for name, style in sorted(self.styles.items()) + ) + return config + + @classmethod + def from_file( + cls, config_file: IO[str], source: str = None, inherit: bool = True + ) -> "Theme": + """Load a theme from a text mode file. + + Args: + config_file (IO[str]): An open conf file. + source (str, optional): The filename of the open file. Defaults to None. + inherit (bool, optional): Inherit default styles. Defaults to True. + + Returns: + Theme: A New theme instance. + """ + config = configparser.ConfigParser() + config.read_file(config_file, source=source) + styles = {name: Style.parse(value) for name, value in config.items("styles")} + theme = Theme(styles, inherit=inherit) + return theme + + @classmethod + def read(cls, path: str, inherit: bool = True) -> "Theme": + """Read a theme from a path. + + Args: + path (str): Path to a config file readable by Python configparser module. + inherit (bool, optional): Inherit default styles. Defaults to True. + + Returns: + Theme: A new theme instance. + """ + with open(path, "rt") as config_file: + return cls.from_file(config_file, source=path, inherit=inherit) + + +class ThemeStackError(Exception): + """Base exception for errors related to the theme stack.""" + + +class ThemeStack: + """A stack of themes. + + Args: + theme (Theme): A theme instance + """ + + def __init__(self, theme: Theme) -> None: + self._entries: List[Dict[str, Style]] = [theme.styles] + self.get = self._entries[-1].get + + def push_theme(self, theme: Theme, inherit: bool = True) -> None: + """Push a theme on the top of the stack. + + Args: + theme (Theme): A Theme instance. + inherit (boolean, optional): Inherit styles from current top of stack. + """ + styles: Dict[str, Style] + styles = ( + {**self._entries[-1], **theme.styles} if inherit else theme.styles.copy() + ) + self._entries.append(styles) + self.get = self._entries[-1].get + + def pop_theme(self) -> None: + """Pop (and discard) the top-most theme.""" + if len(self._entries) == 1: + raise ThemeStackError("Unable to pop base theme") + self._entries.pop() + self.get = self._entries[-1].get + + +if __name__ == "__main__": # pragma: no cover + theme = Theme() + print(theme.config) diff --git a/rich/themes.py b/rich/themes.py new file mode 100644 index 0000000..bf6db10 --- /dev/null +++ b/rich/themes.py @@ -0,0 +1,5 @@ +from .default_styles import DEFAULT_STYLES +from .theme import Theme + + +DEFAULT = Theme(DEFAULT_STYLES) diff --git a/rich/traceback.py b/rich/traceback.py new file mode 100644 index 0000000..e97cc52 --- /dev/null +++ b/rich/traceback.py @@ -0,0 +1,621 @@ +from __future__ import absolute_import + +import os +import platform +import sys +from dataclasses import dataclass, field +from traceback import walk_tb +from types import TracebackType +from typing import Any, Callable, Dict, Iterable, List, Optional, Type + +from pygments.lexers import guess_lexer_for_filename +from pygments.token import Comment, Keyword, Name, Number, Operator, String +from pygments.token import Text as TextToken +from pygments.token import Token + +from . import pretty +from ._loop import loop_first, loop_last +from .columns import Columns +from .console import ( + Console, + ConsoleOptions, + ConsoleRenderable, + RenderResult, + render_group, +) +from .constrain import Constrain +from .highlighter import RegexHighlighter, ReprHighlighter +from .panel import Panel +from .scope import render_scope +from .style import Style +from .syntax import Syntax +from .text import Text +from .theme import Theme + +WINDOWS = platform.system() == "Windows" + +LOCALS_MAX_LENGTH = 10 +LOCALS_MAX_STRING = 80 + + +def install( + *, + console: Console = None, + width: Optional[int] = 100, + extra_lines: int = 3, + theme: Optional[str] = None, + word_wrap: bool = False, + show_locals: bool = False, + indent_guides: bool = True, +) -> Callable: + """Install a rich traceback handler. + + Once installed, any tracebacks will be printed with syntax highlighting and rich formatting. + + + Args: + console (Optional[Console], optional): Console to write exception to. Default uses internal Console instance. + width (Optional[int], optional): Width (in characters) of traceback. Defaults to 100. + extra_lines (int, optional): Extra lines of code. Defaults to 3. + theme (Optional[str], optional): Pygments theme to use in traceback. Defaults to ``None`` which will pick + a theme appropriate for the platform. + word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False. + show_locals (bool, optional): Enable display of local variables. Defaults to False. + indent_guides (bool, optional): Enable indent guides in code and locals. Defaults to True. + + Returns: + Callable: The previous exception handler that was replaced. + + """ + traceback_console = Console(file=sys.stderr) if console is None else console + + def excepthook( + type_: Type[BaseException], + value: BaseException, + traceback: Optional[TracebackType], + ) -> None: + traceback_console.print( + Traceback.from_exception( + type_, + value, + traceback, + width=width, + extra_lines=extra_lines, + theme=theme, + word_wrap=word_wrap, + show_locals=show_locals, + indent_guides=indent_guides, + ) + ) + + def ipy_excepthook_closure(ip) -> None: # pragma: no cover + tb_data = {} # store information about showtraceback call + default_showtraceback = ip.showtraceback # keep reference of default traceback + + def ipy_show_traceback(*args, **kwargs) -> None: + """wrap the default ip.showtraceback to store info for ip._showtraceback""" + nonlocal tb_data + tb_data = kwargs + default_showtraceback(*args, **kwargs) + + def ipy_display_traceback(*args, is_syntax: bool = False, **kwargs) -> None: + """Internally called traceback from ip._showtraceback""" + nonlocal tb_data + exc_tuple = ip._get_exc_info() + + # do not display trace on syntax error + tb: Optional[TracebackType] = None if is_syntax else exc_tuple[2] + + # determine correct tb_offset + compiled = tb_data.get("running_compiled_code", False) + tb_offset = tb_data.get("tb_offset", 1 if compiled else 0) + # remove ipython internal frames from trace with tb_offset + for _ in range(tb_offset): + if tb is None: + break + tb = tb.tb_next + + excepthook(exc_tuple[0], exc_tuple[1], tb) + tb_data = {} # clear data upon usage + + # replace _showtraceback instead of showtraceback to allow ipython features such as debugging to work + # this is also what the ipython docs recommends to modify when subclassing InteractiveShell + ip._showtraceback = ipy_display_traceback + # add wrapper to capture tb_data + ip.showtraceback = ipy_show_traceback + ip.showsyntaxerror = lambda *args, **kwargs: ipy_display_traceback( + *args, is_syntax=True, **kwargs + ) + + try: # pragma: no cover + # if wihin ipython, use customized traceback + ip = get_ipython() # type: ignore + ipy_excepthook_closure(ip) + return sys.excepthook + except Exception: + # otherwise use default system hook + old_excepthook = sys.excepthook + sys.excepthook = excepthook + return old_excepthook + + +@dataclass +class Frame: + filename: str + lineno: int + name: str + line: str = "" + locals: Optional[Dict[str, pretty.Node]] = None + + +@dataclass +class _SyntaxError: + offset: int + filename: str + line: str + lineno: int + msg: str + + +@dataclass +class Stack: + exc_type: str + exc_value: str + syntax_error: Optional[_SyntaxError] = None + is_cause: bool = False + frames: List[Frame] = field(default_factory=list) + + +@dataclass +class Trace: + stacks: List[Stack] + + +class PathHighlighter(RegexHighlighter): + highlights = [r"(?P<dim>.*/)(?P<bold>.+)"] + + +class Traceback: + """A Console renderable that renders a traceback. + + Args: + trace (Trace, optional): A `Trace` object produced from `extract`. Defaults to None, which uses + the last exception. + width (Optional[int], optional): Number of characters used to traceback. Defaults to 100. + extra_lines (int, optional): Additional lines of code to render. Defaults to 3. + theme (str, optional): Override pygments theme used in traceback. + word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False. + show_locals (bool, optional): Enable display of local variables. Defaults to False. + indent_guides (bool, optional): Enable indent guides in code and locals. Defaults to True. + locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. + Defaults to 10. + locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80. + """ + + LEXERS = { + "": "text", + ".py": "python", + ".pxd": "cython", + ".pyx": "cython", + ".pxi": "pyrex", + } + + def __init__( + self, + trace: Trace = None, + width: Optional[int] = 100, + extra_lines: int = 3, + theme: Optional[str] = None, + word_wrap: bool = False, + show_locals: bool = False, + indent_guides: bool = True, + locals_max_length: int = LOCALS_MAX_LENGTH, + locals_max_string: int = LOCALS_MAX_STRING, + ): + if trace is None: + exc_type, exc_value, traceback = sys.exc_info() + if exc_type is None or exc_value is None or traceback is None: + raise ValueError( + "Value for 'trace' required if not called in except: block" + ) + trace = self.extract( + exc_type, exc_value, traceback, show_locals=show_locals + ) + self.trace = trace + self.width = width + self.extra_lines = extra_lines + self.theme = Syntax.get_theme(theme or "ansi_dark") + self.word_wrap = word_wrap + self.show_locals = show_locals + self.indent_guides = indent_guides + self.locals_max_length = locals_max_length + self.locals_max_string = locals_max_string + + @classmethod + def from_exception( + cls, + exc_type: Type, + exc_value: BaseException, + traceback: Optional[TracebackType], + width: Optional[int] = 100, + extra_lines: int = 3, + theme: Optional[str] = None, + word_wrap: bool = False, + show_locals: bool = False, + indent_guides: bool = True, + locals_max_length: int = LOCALS_MAX_LENGTH, + locals_max_string: int = LOCALS_MAX_STRING, + ) -> "Traceback": + """Create a traceback from exception info + + Args: + exc_type (Type[BaseException]): Exception type. + exc_value (BaseException): Exception value. + traceback (TracebackType): Python Traceback object. + width (Optional[int], optional): Number of characters used to traceback. Defaults to 100. + extra_lines (int, optional): Additional lines of code to render. Defaults to 3. + theme (str, optional): Override pygments theme used in traceback. + word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False. + show_locals (bool, optional): Enable display of local variables. Defaults to False. + indent_guides (bool, optional): Enable indent guides in code and locals. Defaults to True. + locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. + Defaults to 10. + locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80. + + Returns: + Traceback: A Traceback instance that may be printed. + """ + rich_traceback = cls.extract( + exc_type, exc_value, traceback, show_locals=show_locals + ) + return cls( + rich_traceback, + width=width, + extra_lines=extra_lines, + theme=theme, + word_wrap=word_wrap, + show_locals=show_locals, + indent_guides=indent_guides, + locals_max_length=locals_max_length, + locals_max_string=locals_max_string, + ) + + @classmethod + def extract( + cls, + exc_type: Type[BaseException], + exc_value: BaseException, + traceback: Optional[TracebackType], + show_locals: bool = False, + locals_max_length: int = LOCALS_MAX_LENGTH, + locals_max_string: int = LOCALS_MAX_STRING, + ) -> Trace: + """Extract traceback information. + + Args: + exc_type (Type[BaseException]): Exception type. + exc_value (BaseException): Exception value. + traceback (TracebackType): Python Traceback object. + show_locals (bool, optional): Enable display of local variables. Defaults to False. + locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. + Defaults to 10. + locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80. + + Returns: + Trace: A Trace instance which you can use to construct a `Traceback`. + """ + + stacks: List[Stack] = [] + is_cause = False + + from rich import _IMPORT_CWD + + def safe_str(_object: Any) -> str: + """Don't allow exceptions from __str__ to propegate.""" + try: + return str(_object) + except Exception: + return "<exception str() failed>" + + while True: + stack = Stack( + exc_type=safe_str(exc_type.__name__), + exc_value=safe_str(exc_value), + is_cause=is_cause, + ) + + if isinstance(exc_value, SyntaxError): + stack.syntax_error = _SyntaxError( + offset=exc_value.offset or 0, + filename=exc_value.filename or "?", + lineno=exc_value.lineno or 0, + line=exc_value.text or "", + msg=exc_value.msg, + ) + + stacks.append(stack) + append = stack.frames.append + + for frame_summary, line_no in walk_tb(traceback): + filename = frame_summary.f_code.co_filename + if filename and not filename.startswith("<"): + if not os.path.isabs(filename): + filename = os.path.join(_IMPORT_CWD, filename) + frame = Frame( + filename=filename or "?", + lineno=line_no, + name=frame_summary.f_code.co_name, + locals={ + key: pretty.traverse( + value, + max_length=locals_max_length, + max_string=locals_max_string, + ) + for key, value in frame_summary.f_locals.items() + } + if show_locals + else None, + ) + append(frame) + + cause = getattr(exc_value, "__cause__", None) + if cause and cause.__traceback__: + exc_type = cause.__class__ + exc_value = cause + traceback = cause.__traceback__ + if traceback: + is_cause = True + continue + + cause = exc_value.__context__ + if ( + cause + and cause.__traceback__ + and not getattr(exc_value, "__suppress_context__", False) + ): + exc_type = cause.__class__ + exc_value = cause + traceback = cause.__traceback__ + if traceback: + is_cause = False + continue + # No cover, code is reached but coverage doesn't recognize it. + break # pragma: no cover + + trace = Trace(stacks=stacks) + return trace + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + theme = self.theme + background_style = theme.get_background_style() + token_style = theme.get_style_for_token + + traceback_theme = Theme( + { + "pretty": token_style(TextToken), + "pygments.text": token_style(Token), + "pygments.string": token_style(String), + "pygments.function": token_style(Name.Function), + "pygments.number": token_style(Number), + "repr.indent": token_style(Comment) + Style(dim=True), + "repr.str": token_style(String), + "repr.brace": token_style(TextToken) + Style(bold=True), + "repr.number": token_style(Number), + "repr.bool_true": token_style(Keyword.Constant), + "repr.bool_false": token_style(Keyword.Constant), + "repr.none": token_style(Keyword.Constant), + "scope.border": token_style(String.Delimiter), + "scope.equals": token_style(Operator), + "scope.key": token_style(Name), + "scope.key.special": token_style(Name.Constant) + Style(dim=True), + } + ) + + highlighter = ReprHighlighter() + for last, stack in loop_last(reversed(self.trace.stacks)): + if stack.frames: + stack_renderable: ConsoleRenderable = Panel( + self._render_stack(stack), + title="[traceback.title]Traceback [dim](most recent call last)", + style=background_style, + border_style="traceback.border.syntax_error", + expand=True, + padding=(0, 1), + ) + stack_renderable = Constrain(stack_renderable, self.width) + with console.use_theme(traceback_theme): + yield stack_renderable + if stack.syntax_error is not None: + with console.use_theme(traceback_theme): + yield Constrain( + Panel( + self._render_syntax_error(stack.syntax_error), + style=background_style, + border_style="traceback.border", + expand=True, + padding=(0, 1), + width=self.width, + ), + self.width, + ) + yield Text.assemble( + (f"{stack.exc_type}: ", "traceback.exc_type"), + highlighter(stack.syntax_error.msg), + ) + else: + yield Text.assemble( + (f"{stack.exc_type}: ", "traceback.exc_type"), + highlighter(stack.exc_value), + ) + + if not last: + if stack.is_cause: + yield Text.from_markup( + "\n[i]The above exception was the direct cause of the following exception:\n", + ) + else: + yield Text.from_markup( + "\n[i]During handling of the above exception, another exception occurred:\n", + ) + + @render_group() + def _render_syntax_error(self, syntax_error: _SyntaxError) -> RenderResult: + highlighter = ReprHighlighter() + path_highlighter = PathHighlighter() + if syntax_error.filename != "<stdin>": + text = Text.assemble( + (f" {syntax_error.filename}", "pygments.string"), + (":", "pygments.text"), + (str(syntax_error.lineno), "pygments.number"), + style="pygments.text", + ) + yield path_highlighter(text) + syntax_error_text = highlighter(syntax_error.line.rstrip()) + syntax_error_text.no_wrap = True + offset = min(syntax_error.offset - 1, len(syntax_error_text)) + syntax_error_text.stylize("bold underline", offset, offset + 1) + syntax_error_text += Text.from_markup( + "\n" + " " * offset + "[traceback.offset]▲[/]", + style="pygments.text", + ) + yield syntax_error_text + + @classmethod + def _guess_lexer(cls, filename: str, code: str) -> str: + ext = os.path.splitext(filename)[-1] + if not ext: + # No extension, look at first line to see if it is a hashbang + # Note, this is an educated guess and not a guarantee + # If it fails, the only downside is that the code is highlighted strangely + new_line_index = code.index("\n") + first_line = code[:new_line_index] if new_line_index != -1 else code + if first_line.startswith("#!") and "python" in first_line.lower(): + return "python" + lexer_name = ( + cls.LEXERS.get(ext) or guess_lexer_for_filename(filename, code).name + ) + return lexer_name + + @render_group() + def _render_stack(self, stack: Stack) -> RenderResult: + path_highlighter = PathHighlighter() + theme = self.theme + code_cache: Dict[str, str] = {} + + def read_code(filename: str) -> str: + """Read files, and cache results on filename. + + Args: + filename (str): Filename to read + + Returns: + str: Contents of file + """ + code = code_cache.get(filename) + if code is None: + with open( + filename, "rt", encoding="utf-8", errors="replace" + ) as code_file: + code = code_file.read() + code_cache[filename] = code + return code + + def render_locals(frame: Frame) -> Iterable[ConsoleRenderable]: + if frame.locals: + yield render_scope( + frame.locals, + title="locals", + indent_guides=self.indent_guides, + max_length=self.locals_max_length, + max_string=self.locals_max_string, + ) + + for first, frame in loop_first(stack.frames): + text = Text.assemble( + path_highlighter(Text(frame.filename, style="pygments.string")), + (":", "pygments.text"), + (str(frame.lineno), "pygments.number"), + " in ", + (frame.name, "pygments.function"), + style="pygments.text", + ) + if not frame.filename.startswith("<") and not first: + yield "" + yield text + if frame.filename.startswith("<"): + yield from render_locals(frame) + continue + try: + code = read_code(frame.filename) + lexer_name = self._guess_lexer(frame.filename, code) + syntax = Syntax( + code, + lexer_name, + theme=theme, + line_numbers=True, + line_range=( + frame.lineno - self.extra_lines, + frame.lineno + self.extra_lines, + ), + highlight_lines={frame.lineno}, + word_wrap=self.word_wrap, + code_width=88, + indent_guides=self.indent_guides, + dedent=False, + ) + yield "" + except Exception as error: + yield Text.assemble( + (f"\n{error}", "traceback.error"), + ) + else: + yield ( + Columns( + [ + syntax, + *render_locals(frame), + ], + padding=1, + ) + if frame.locals + else syntax + ) + + +if __name__ == "__main__": # pragma: no cover + + from .console import Console + + console = Console() + import sys + + def bar(a): # 这是对亚洲语言支持的测试。面对模棱两可的想法，拒绝猜测的诱惑 + one = 1 + print(one / a) + + def foo(a): + + zed = { + "characters": { + "Paul Atriedies", + "Vladimir Harkonnen", + "Thufir Haway", + "Duncan Idaho", + }, + "atomic_types": (None, False, True), + } + bar(a) + + def error(): + + try: + try: + foo(0) + except: + slfkjsldkfj # type: ignore + except: + console.print_exception(show_locals=True) + + error() diff --git a/rich/tree.py b/rich/tree.py new file mode 100644 index 0000000..15a3a93 --- /dev/null +++ b/rich/tree.py @@ -0,0 +1,240 @@ +from typing import Iterator, List, Tuple + +from ._loop import loop_first, loop_last +from .console import Console, ConsoleOptions, RenderableType, RenderResult +from .jupyter import JupyterMixin +from .measure import Measurement +from .segment import Segment +from .style import Style, StyleStack, StyleType +from .styled import Styled + + +class Tree(JupyterMixin): + """A renderable for a tree structure. + + Args: + label (RenderableType): The renderable or str for the tree label. + style (StyleType, optional): Style of this tree. Defaults to "tree". + guide_style (StyleType, optional): Style of the guide lines. Defaults to "tree.line". + expanded (bool, optional): Also display children. Defaults to True. + highlight (bool, optional): Highlight renderable (if str). Defaults to False. + """ + + def __init__( + self, + label: RenderableType, + *, + style: StyleType = "tree", + guide_style: StyleType = "tree.line", + expanded=True, + highlight=False, + ) -> None: + self.label = label + self.style = style + self.guide_style = guide_style + self.children: List[Tree] = [] + self.expanded = expanded + self.highlight = highlight + + def add( + self, + label: RenderableType, + *, + style: StyleType = None, + guide_style: StyleType = None, + expanded=True, + highlight=False, + ) -> "Tree": + """Add a child tree. + + Args: + label (RenderableType): The renderable or str for the tree label. + style (StyleType, optional): Style of this tree. Defaults to "tree". + guide_style (StyleType, optional): Style of the guide lines. Defaults to "tree.line". + expanded (bool, optional): Also display children. Defaults to True. + highlight (Optional[bool], optional): Highlight renderable (if str). Defaults to False. + + Returns: + Tree: A new child Tree, which may be further modified. + """ + node = Tree( + label, + style=self.style if style is None else style, + guide_style=self.guide_style if guide_style is None else guide_style, + expanded=expanded, + highlight=self.highlight if highlight is None else highlight, + ) + self.children.append(node) + return node + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + + stack: List[Iterator[Tuple[bool, Tree]]] = [] + pop = stack.pop + push = stack.append + new_line = Segment.line() + + get_style = console.get_style + null_style = Style.null() + guide_style = get_style(self.guide_style) or null_style + SPACE, CONTINUE, FORK, END = range(4) + + ASCII_GUIDES = (" ", "| ", "+-- ", "`-- ") + TREE_GUIDES = [ + (" ", "│ ", "├── ", "└── "), + (" ", "┃ ", "┣━━ ", "┗━━ "), + (" ", "║ ", "╠══ ", "╚══ "), + ] + _Segment = Segment + + def make_guide(index: int, style: Style) -> Segment: + """Make a Segment for a level of the guide lines.""" + if options.ascii_only: + line = ASCII_GUIDES[index] + else: + guide = 1 if style.bold else (2 if style.underline2 else 0) + line = TREE_GUIDES[0 if options.legacy_windows else guide][index] + return _Segment(line, style) + + levels: List[Segment] = [make_guide(CONTINUE, guide_style)] + push(iter(loop_last([self]))) + + guide_style_stack = StyleStack(get_style(self.guide_style)) + style_stack = StyleStack(get_style(self.style)) + remove_guide_styles = Style(bold=False, underline2=False) + + while stack: + stack_node = pop() + try: + last, node = next(stack_node) + except StopIteration: + levels.pop() + if levels: + guide_style = levels[-1].style or null_style + levels[-1] = make_guide(FORK, guide_style) + guide_style_stack.pop() + style_stack.pop() + continue + push(stack_node) + if last: + levels[-1] = make_guide(END, levels[-1].style or null_style) + + guide_style = guide_style_stack.current + get_style(node.guide_style) + style = style_stack.current + get_style(node.style) + prefix = levels[1:] + renderable_lines = console.render_lines( + Styled(node.label, style), + options.update( + width=options.max_width + - sum(level.cell_length for level in prefix), + highlight=self.highlight, + height=None, + ), + ) + for first, line in loop_first(renderable_lines): + if prefix: + yield from _Segment.apply_style( + prefix, + style.background_style, + post_style=remove_guide_styles, + ) + yield from line + yield new_line + if first and prefix: + prefix[-1] = make_guide( + SPACE if last else CONTINUE, prefix[-1].style or null_style + ) + + if node.expanded and node.children: + levels[-1] = make_guide( + SPACE if last else CONTINUE, levels[-1].style or null_style + ) + levels.append( + make_guide(END if len(node.children) == 1 else FORK, guide_style) + ) + style_stack.push(get_style(node.style)) + guide_style_stack.push(get_style(node.guide_style)) + push(iter(loop_last(node.children))) + + def __rich_measure__(self, console: "Console", max_width: int) -> "Measurement": + stack: List[Iterator[Tree]] = [iter([self])] + pop = stack.pop + push = stack.append + minimum = 0 + maximum = 0 + measure = Measurement.get + level = 0 + while stack: + iter_tree = pop() + try: + tree = next(iter_tree) + except StopIteration: + level -= 1 + continue + push(iter_tree) + min_measure, max_measure = measure(console, tree.label, max_width) + indent = level * 4 + minimum = max(min_measure + indent, minimum) + maximum = max(max_measure + indent, maximum) + if tree.expanded and tree.children: + push(iter(tree.children)) + level += 1 + return Measurement(minimum, maximum) + + +if __name__ == "__main__": # pragma: no cover + + from rich.console import RenderGroup + from rich.markdown import Markdown + from rich.panel import Panel + from rich.syntax import Syntax + from rich.table import Table + + table = Table(row_styles=["", "dim"]) + + table.add_column("Released", style="cyan", no_wrap=True) + table.add_column("Title", style="magenta") + table.add_column("Box Office", justify="right", style="green") + + table.add_row("Dec 20, 2019", "Star Wars: The Rise of Skywalker", "$952,110,690") + table.add_row("May 25, 2018", "Solo: A Star Wars Story", "$393,151,347") + table.add_row("Dec 15, 2017", "Star Wars Ep. V111: The Last Jedi", "$1,332,539,889") + table.add_row("Dec 16, 2016", "Rogue One: A Star Wars Story", "$1,332,439,889") + + code = """\ +class Segment(NamedTuple): + text: str = "" + style: Optional[Style] = None + is_control: bool = False +""" + syntax = Syntax(code, "python", theme="monokai", line_numbers=True) + + markdown = Markdown( + """\ +### example.md +> Hello, World! +> +> Markdown _all_ the things +""" + ) + + root = Tree("🌲 [b green]Rich Tree", highlight=True) + + node = root.add(":file_folder: Renderables", guide_style="red") + simple_node = node.add(":file_folder: [bold yellow]Atomic", guide_style="uu green") + simple_node.add(RenderGroup("📄 Syntax", syntax)) + simple_node.add(RenderGroup("📄 Markdown", Panel(markdown, border_style="green"))) + + containers_node = node.add( + ":file_folder: [bold magenta]Containers", guide_style="bold magenta" + ) + containers_node.expanded = True + panel = Panel.fit("Just a panel", border_style="red") + containers_node.add(RenderGroup("📄 Panels", panel)) + + containers_node.add(RenderGroup("📄 [b magenta]Table", table)) + + console = Console() + console.print(root) |