Adding upstream version 1.0.2.upstream/1.0.2upstream

Signed-off-by: Daniel Baumann <daniel.baumann@progress-linux.org>

281 files changed, 28261 insertions, 0 deletions

diff --git a/library/Icingadb/Authentication/ObjectAuthorization.php b/library/Icingadb/Authentication/ObjectAuthorization.php
new file mode 100644
index 0000000..0792988
--- /dev/null
+++ b/library/Icingadb/Authentication/ObjectAuthorization.php
@@ -0,0 +1,259 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Authentication;
+
+use Icinga\Module\Icingadb\Common\Auth;
+use Icinga\Module\Icingadb\Common\Database;
+use Icinga\Module\Icingadb\Model\Host;
+use Icinga\Module\Icingadb\Model\Service;
+use InvalidArgumentException;
+use ipl\Orm\Compat\FilterProcessor;
+use ipl\Orm\Model;
+use ipl\Sql\Expression;
+use ipl\Sql\Select;
+use ipl\Stdlib\Filter;
+
+class ObjectAuthorization
+{
+    use Auth;
+    use Database;
+
+    /** @var array */
+    protected static $knownGrants = [];
+
+    /**
+     * Caches already applied filters to an object
+     *
+     * @var array
+     */
+    protected static $matchedFilters = [];
+
+    /**
+     * Check whether the permission is granted on the object
+     *
+     * @param string $permission
+     * @param Model $for The object
+     *
+     * @return bool
+     */
+    public static function grantsOn(string $permission, Model $for): bool
+    {
+        $self = new static();
+
+        $tableName = $for->getTableName();
+        $uniqueId = $for->{$for->getKeyName()};
+        if (! isset($uniqueId)) {
+            return false;
+        }
+
+        if (! isset(self::$knownGrants[$tableName][$uniqueId])) {
+            $self->loadGrants(
+                get_class($for),
+                Filter::equal($for->getKeyName(), $uniqueId),
+                $uniqueId,
+                false
+            );
+        }
+
+        return $self->checkGrants($permission, self::$knownGrants[$tableName][$uniqueId]);
+    }
+
+    /**
+     * Check whether the permission is granted on objects matching the type and filter
+     *
+     * The check will be performed on every object matching the filter. Though the result
+     * only allows to determine whether the permission is granted on **any** or *none*
+     * of the objects in question. Any subsequent call to {@see ObjectAuthorization::grantsOn}
+     * will make use of the underlying results the check has determined in order to avoid
+     * unnecessary queries.
+     *
+     * @param string $permission
+     * @param string $type
+     * @param Filter\Rule $filter
+     * @param bool $cache Pass `false` to not perform the check on every object
+     *
+     * @return bool
+     */
+    public static function grantsOnType(string $permission, string $type, Filter\Rule $filter, bool $cache = true): bool
+    {
+        switch ($type) {
+            case 'host':
+                $for = Host::class;
+                break;
+            case 'service':
+                $for = Service::class;
+                break;
+            default:
+                throw new InvalidArgumentException(sprintf('Unknown type "%s"', $type));
+        }
+
+        $self = new static();
+
+        $uniqueId = spl_object_hash($filter);
+        if (! isset(self::$knownGrants[$type][$uniqueId])) {
+            $self->loadGrants($for, $filter, $uniqueId, $cache);
+        }
+
+        return $self->checkGrants($permission, self::$knownGrants[$type][$uniqueId]);
+    }
+
+    /**
+     * Check whether the given filter matches on the given object
+     *
+     * @param string $queryString
+     * @param Model  $object
+     *
+     * @return bool
+     */
+    public static function matchesOn(string $queryString, Model $object): bool
+    {
+        $self = new static();
+
+        $uniqueId = $object->{$object->getKeyName()};
+        if (! isset(self::$matchedFilters[$queryString][$uniqueId])) {
+            $restriction = 'icingadb/filter/services';
+            if ($object instanceof Host) {
+                $restriction = 'icingadb/filter/hosts';
+            }
+
+            $filter = $self->parseRestriction($queryString, $restriction);
+
+            $query = $object::on($self->getDb());
+            $query
+                ->filter($filter)
+                ->filter(Filter::equal($object->getKeyName(), $uniqueId))
+                ->columns([new Expression('1')]);
+
+            $result = $query->execute()->hasResult();
+            self::$matchedFilters[$queryString][$uniqueId] = $result;
+
+            return $result;
+        }
+
+        return self::$matchedFilters[$queryString][$uniqueId];
+    }
+
+    /**
+     * Load all the user's roles that grant access to at least one object matching the filter
+     *
+     * @param string $model The class path to the object model
+     * @param Filter\Rule $filter
+     * @param string $cacheKey
+     * @param bool $cache Pass `false` to not populate the cache with the matching objects
+     *
+     * @return void
+     */
+    protected function loadGrants(string $model, Filter\Rule $filter, string $cacheKey, bool $cache = true)
+    {
+        /** @var Model $model */
+        $query = $model::on($this->getDb());
+        $tableName = $query->getModel()->getTableName();
+
+        $inspectedRoles = [];
+        $roleExpressions = [];
+        $rolesWithoutRestrictions = [];
+
+        foreach ($this->getAuth()->getUser()->getRoles() as $role) {
+            $roleFilter = Filter::all();
+            if (($restriction = $role->getRestrictions('icingadb/filter/objects'))) {
+                $roleFilter->add($this->parseRestriction($restriction, 'icingadb/filter/objects'));
+            }
+
+            if ($tableName === 'host' || $tableName === 'service') {
+                if (($restriction = $role->getRestrictions('icingadb/filter/hosts'))) {
+                    $roleFilter->add($this->parseRestriction($restriction, 'icingadb/filter/hosts'));
+                }
+            }
+
+            if ($tableName === 'service' && ($restriction = $role->getRestrictions('icingadb/filter/services'))) {
+                $roleFilter->add($this->parseRestriction($restriction, 'icingadb/filter/services'));
+            }
+
+            if ($roleFilter->isEmpty()) {
+                $rolesWithoutRestrictions[] = $role->getName();
+                continue;
+            }
+
+            $inspectedRoles[] = $role->getName();
+            $roleName = $this->getDb()->quoteIdentifier($role->getName());
+
+            if ($cache) {
+                FilterProcessor::apply($roleFilter, $query);
+                $where = $query->getSelectBase()->getWhere();
+                $query->getSelectBase()->resetWhere();
+
+                $values = [];
+                $rendered = $this->getDb()->getQueryBuilder()->buildCondition($where, $values);
+                $roleExpressions[$roleName] = new Expression($rendered, null, ...$values);
+            } else {
+                $subQuery = clone $query;
+                $roleExpressions[$roleName] = $subQuery
+                    ->columns([new Expression('1')])
+                    ->filter($roleFilter)
+                    ->filter($filter)
+                    ->limit(1)
+                    ->assembleSelect()
+                    ->resetOrderBy();
+            }
+        }
+
+        $rolesWithRestrictions = [];
+        if (! empty($roleExpressions)) {
+            if ($cache) {
+                $query->columns('id')->withColumns($roleExpressions);
+                $query->filter($filter);
+            } else {
+                $query = [$this->getDb()->fetchOne((new Select())->columns($roleExpressions))];
+            }
+
+            foreach ($query as $row) {
+                $roles = $rolesWithoutRestrictions;
+                foreach ($inspectedRoles as $alias) {
+                    if ($row->$alias) {
+                        $rolesWithRestrictions[$alias] = true;
+                        $roles[] = $alias;
+                    }
+                }
+
+                if ($cache) {
+                    self::$knownGrants[$tableName][$row->id] = $roles;
+                }
+            }
+        }
+
+        self::$knownGrants[$tableName][$cacheKey] = array_merge(
+            $rolesWithoutRestrictions,
+            array_keys($rolesWithRestrictions)
+        );
+    }
+
+    /**
+     * Check if any of the given roles grants the permission
+     *
+     * @param string $permission
+     * @param array $roles
+     *
+     * @return bool
+     */
+    protected function checkGrants(string $permission, array $roles): bool
+    {
+        if (empty($roles)) {
+            return false;
+        }
+
+        $granted = false;
+        foreach ($this->getAuth()->getUser()->getRoles() as $role) {
+            if ($role->denies($permission)) {
+                return false;
+            } elseif ($granted || ! $role->grants($permission)) {
+                continue;
+            }
+
+            $granted = in_array($role->getName(), $roles, true);
+        }
+
+        return $granted;
+    }
+}
diff --git a/library/Icingadb/Command/IcingaApiCommand.php b/library/Icingadb/Command/IcingaApiCommand.php
new file mode 100644
index 0000000..f3f0c33
--- /dev/null
+++ b/library/Icingadb/Command/IcingaApiCommand.php
@@ -0,0 +1,128 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command;
+
+class IcingaApiCommand
+{
+    /**
+     * Command data
+     *
+     * @var array
+     */
+    protected $data;
+
+    /**
+     * Name of the endpoint
+     *
+     * @var string
+     */
+    protected $endpoint;
+
+    /**
+     * HTTP method to use
+     *
+     * @var string
+     */
+    protected $method = 'POST';
+
+    /**
+     * Create a new Icinga 2 API command
+     *
+     * @param   string  $endpoint
+     * @param   array   $data
+     *
+     * @return  static
+     */
+    public static function create(string $endpoint, array $data): self
+    {
+        return (new static())
+            ->setEndpoint($endpoint)
+            ->setData($data);
+    }
+
+    /**
+     * Get the command data
+     *
+     * @return array
+     */
+    public function getData(): array
+    {
+        if ($this->data === null) {
+            throw new \LogicException(
+                'You are accessing an unset property. Please make sure to set it beforehand.'
+            );
+        }
+
+        return $this->data;
+    }
+
+    /**
+     * Set the command data
+     *
+     * @param   array   $data
+     *
+     * @return  $this
+     */
+    public function setData(array $data): self
+    {
+        $this->data = $data;
+
+        return $this;
+    }
+
+    /**
+     * Get the name of the endpoint
+     *
+     * @return string
+     */
+    public function getEndpoint(): string
+    {
+        if ($this->endpoint === null) {
+            throw new \LogicException(
+                'You are accessing an unset property. Please make sure to set it beforehand.'
+            );
+        }
+
+        return $this->endpoint;
+    }
+
+    /**
+     * Set the name of the endpoint
+     *
+     * @param   string  $endpoint
+     *
+     * @return  $this
+     */
+    public function setEndpoint(string $endpoint): self
+    {
+        $this->endpoint = $endpoint;
+
+        return $this;
+    }
+
+    /**
+     * Get the HTTP method to use
+     *
+     * @return string
+     */
+    public function getMethod(): string
+    {
+        return $this->method;
+    }
+
+    /**
+     * Set the HTTP method to use
+     *
+     * @param string $method All uppercase HTTP method name. Case-sensitive.
+     *
+     * @return $this
+     */
+    public function setMethod(string $method): self
+    {
+        $this->method = $method;
+
+        return $this;
+    }
+}
diff --git a/library/Icingadb/Command/IcingaCommand.php b/library/Icingadb/Command/IcingaCommand.php
new file mode 100644
index 0000000..7b5c5cf
--- /dev/null
+++ b/library/Icingadb/Command/IcingaCommand.php
@@ -0,0 +1,22 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command;
+
+/**
+ * Base class for commands sent to an Icinga instance
+ */
+abstract class IcingaCommand
+{
+    /**
+     * Get the name of the command
+     *
+     * @return string
+     */
+    public function getName(): string
+    {
+        $nsParts = explode('\\', get_called_class());
+        return substr_replace(end($nsParts), '', -7);  // Remove 'Command' Suffix
+    }
+}
diff --git a/library/Icingadb/Command/Instance/ToggleInstanceFeatureCommand.php b/library/Icingadb/Command/Instance/ToggleInstanceFeatureCommand.php
new file mode 100644
index 0000000..d275d9b
--- /dev/null
+++ b/library/Icingadb/Command/Instance/ToggleInstanceFeatureCommand.php
@@ -0,0 +1,109 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Instance;
+
+use Icinga\Module\Icingadb\Command\IcingaCommand;
+
+/**
+ * Enable or disable a feature of an Icinga instance
+ */
+class ToggleInstanceFeatureCommand extends IcingaCommand
+{
+    /**
+     * Feature for enabling or disabling active host checks on an Icinga instance
+     */
+    const FEATURE_ACTIVE_HOST_CHECKS = 'active_host_checks_enabled';
+
+    /**
+     * Feature for enabling or disabling active service checks on an Icinga instance
+     */
+    const FEATURE_ACTIVE_SERVICE_CHECKS = 'active_service_checks_enabled';
+
+    /**
+     * Feature for enabling or disabling host and service event handlers on an Icinga instance
+     */
+    const FEATURE_EVENT_HANDLERS = 'event_handlers_enabled';
+
+    /**
+     * Feature for enabling or disabling host and service flap detection on an Icinga instance
+     */
+    const FEATURE_FLAP_DETECTION = 'flap_detection_enabled';
+
+    /**
+     * Feature for enabling or disabling host and service notifications on an Icinga instance
+     */
+    const FEATURE_NOTIFICATIONS = 'notifications_enabled';
+
+    /**
+     * Feature for enabling or disabling the processing of host and service performance data on an Icinga instance
+     */
+    const FEATURE_PERFORMANCE_DATA = 'process_performance_data';
+
+    /**
+     * Feature that is to be enabled or disabled
+     *
+     * @var string
+     */
+    protected $feature;
+
+    /**
+     * Whether the feature should be enabled or disabled
+     *
+     * @var bool
+     */
+    protected $enabled;
+
+    /**
+     * Set the feature that is to be enabled or disabled
+     *
+     * @param   string $feature
+     *
+     * @return  $this
+     */
+    public function setFeature(string $feature): self
+    {
+        $this->feature = $feature;
+
+        return $this;
+    }
+
+    /**
+     * Get the feature that is to be enabled or disabled
+     *
+     * @return string
+     */
+    public function getFeature(): string
+    {
+        if ($this->feature === null) {
+            throw new \LogicException('You have to set the feature first before getting it.');
+        }
+
+        return $this->feature;
+    }
+
+    /**
+     * Set whether the feature should be enabled or disabled
+     *
+     * @param   bool $enabled
+     *
+     * @return  $this
+     */
+    public function setEnabled(bool $enabled = true): self
+    {
+        $this->enabled = $enabled;
+
+        return $this;
+    }
+
+    /**
+     * Get whether the feature should be enabled or disabled
+     *
+     * @return ?bool
+     */
+    public function getEnabled()
+    {
+        return $this->enabled;
+    }
+}
diff --git a/library/Icingadb/Command/Object/AcknowledgeProblemCommand.php b/library/Icingadb/Command/Object/AcknowledgeProblemCommand.php
new file mode 100644
index 0000000..baae24c
--- /dev/null
+++ b/library/Icingadb/Command/Object/AcknowledgeProblemCommand.php
@@ -0,0 +1,140 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Object;
+
+/**
+ * Acknowledge a host or service problem
+ */
+class AcknowledgeProblemCommand extends WithCommentCommand
+{
+    /**
+     * Whether the acknowledgement is sticky
+     *
+     * Sticky acknowledgements remain until the host or service recovers. Non-sticky acknowledgements will be
+     * automatically removed when the host or service state changes.
+     *
+     * @var bool
+     */
+    protected $sticky = false;
+
+    /**
+     * Whether to send a notification about the acknowledgement
+
+     * @var bool
+     */
+    protected $notify = false;
+
+    /**
+     * Whether the comment associated with the acknowledgement is persistent
+     *
+     * Persistent comments are not lost the next time the monitoring host restarts.
+     *
+     * @var bool
+     */
+    protected $persistent = false;
+
+    /**
+     * Optional time when the acknowledgement should expire
+     *
+     * @var int
+     */
+    protected $expireTime;
+
+    /**
+     * Set whether the acknowledgement is sticky
+     *
+     * @param   bool $sticky
+     *
+     * @return  $this
+     */
+    public function setSticky(bool $sticky = true): self
+    {
+        $this->sticky = $sticky;
+
+        return $this;
+    }
+
+    /**
+     * Is the acknowledgement sticky?
+     *
+     * @return bool
+     */
+    public function getSticky(): bool
+    {
+        return $this->sticky;
+    }
+
+    /**
+     * Set whether to send a notification about the acknowledgement
+     *
+     * @param   bool $notify
+     *
+     * @return  $this
+     */
+    public function setNotify(bool $notify = true): self
+    {
+        $this->notify = $notify;
+
+        return $this;
+    }
+
+    /**
+     * Get whether to send a notification about the acknowledgement
+     *
+     * @return bool
+     */
+    public function getNotify(): bool
+    {
+        return $this->notify;
+    }
+
+    /**
+     * Set whether the comment associated with the acknowledgement is persistent
+     *
+     * @param   bool $persistent
+     *
+     * @return  $this
+     */
+    public function setPersistent(bool $persistent = true): self
+    {
+        $this->persistent = $persistent;
+
+        return $this;
+    }
+
+    /**
+     * Is the comment associated with the acknowledgement is persistent?
+     *
+     * @return bool
+     */
+    public function getPersistent(): bool
+    {
+        return $this->persistent;
+    }
+
+    /**
+     * Set the time when the acknowledgement should expire
+     *
+     * @param   int $expireTime
+     *
+     * @return  $this
+     */
+    public function setExpireTime(int $expireTime): self
+    {
+        $this->expireTime = $expireTime;
+
+        return $this;
+    }
+
+    /**
+     * Get the time when the acknowledgement should expire
+     *
+     * @return ?int
+     */
+    public function getExpireTime()
+    {
+        return $this->expireTime;
+    }
+}
diff --git a/library/Icingadb/Command/Object/AddCommentCommand.php b/library/Icingadb/Command/Object/AddCommentCommand.php
new file mode 100644
index 0000000..c853b25
--- /dev/null
+++ b/library/Icingadb/Command/Object/AddCommentCommand.php
@@ -0,0 +1,42 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Object;
+
+/**
+ * Add a comment to a host or service
+ */
+class AddCommentCommand extends WithCommentCommand
+{
+    /**
+     * Optional time when the acknowledgement should expire
+     *
+     * @var int
+     */
+    protected $expireTime;
+
+    /**
+     * Set the time when the acknowledgement should expire
+     *
+     * @param   int $expireTime
+     *
+     * @return  $this
+     */
+    public function setExpireTime(int $expireTime): self
+    {
+        $this->expireTime = $expireTime;
+
+        return $this;
+    }
+
+    /**
+     * Get the time when the acknowledgement should expire
+     *
+     * @return ?int
+     */
+    public function getExpireTime()
+    {
+        return $this->expireTime;
+    }
+}
diff --git a/library/Icingadb/Command/Object/CommandAuthor.php b/library/Icingadb/Command/Object/CommandAuthor.php
new file mode 100644
index 0000000..f323b63
--- /dev/null
+++ b/library/Icingadb/Command/Object/CommandAuthor.php
@@ -0,0 +1,45 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Object;
+
+trait CommandAuthor
+{
+    /**
+     * Author of the command
+     *
+     * @var string
+     */
+    protected $author;
+
+    /**
+     * Set the author
+     *
+     * @param   string $author
+     *
+     * @return  $this
+     */
+    public function setAuthor(string $author): self
+    {
+        $this->author = $author;
+
+        return $this;
+    }
+
+    /**
+     * Get the author
+     *
+     * @return string
+     */
+    public function getAuthor(): string
+    {
+        if ($this->author === null) {
+            throw new \LogicException(
+                'You are accessing an unset property. Please make sure to set it beforehand.'
+            );
+        }
+
+        return $this->author;
+    }
+}
diff --git a/library/Icingadb/Command/Object/DeleteCommentCommand.php b/library/Icingadb/Command/Object/DeleteCommentCommand.php
new file mode 100644
index 0000000..8bfc2a3
--- /dev/null
+++ b/library/Icingadb/Command/Object/DeleteCommentCommand.php
@@ -0,0 +1,52 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Object;
+
+use Icinga\Module\Icingadb\Command\IcingaCommand;
+
+/**
+ * Delete a host or service comment
+ */
+class DeleteCommentCommand extends IcingaCommand
+{
+    use CommandAuthor;
+
+    /**
+     * Name of the comment
+     *
+     * @var string
+     */
+    protected $commentName;
+
+    /**
+     * Get the name of the comment
+     *
+     * @return string
+     */
+    public function getCommentName(): string
+    {
+        if ($this->commentName === null) {
+            throw new \LogicException(
+                'You are accessing an unset property. Please make sure to set it beforehand.'
+            );
+        }
+
+        return $this->commentName;
+    }
+
+    /**
+     * Set the name of the comment
+     *
+     * @param   string  $commentName
+     *
+     * @return  $this
+     */
+    public function setCommentName(string $commentName): self
+    {
+        $this->commentName = $commentName;
+
+        return $this;
+    }
+}
diff --git a/library/Icingadb/Command/Object/DeleteDowntimeCommand.php b/library/Icingadb/Command/Object/DeleteDowntimeCommand.php
new file mode 100644
index 0000000..a0867fa
--- /dev/null
+++ b/library/Icingadb/Command/Object/DeleteDowntimeCommand.php
@@ -0,0 +1,58 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Object;
+
+use Icinga\Module\Icingadb\Command\IcingaCommand;
+
+/**
+ * Delete a host or service downtime
+ */
+class DeleteDowntimeCommand extends IcingaCommand
+{
+    use CommandAuthor;
+
+    /**
+     * Name of the downtime (Icinga 2.4+)
+     *
+     * Required for removing the downtime via Icinga 2's API.
+     *
+     * @var string
+     */
+    protected $downtimeName;
+
+    /**
+     * Get the name of the downtime (Icinga 2.4+)
+     *
+     * Required for removing the downtime via Icinga 2's API.
+     *
+     * @return string
+     */
+    public function getDowntimeName(): string
+    {
+        if ($this->downtimeName === null) {
+            throw new \LogicException(
+                'You are accessing an unset property. Please make sure to set it beforehand.'
+            );
+        }
+
+        return $this->downtimeName;
+    }
+
+    /**
+     * Set the name of the downtime (Icinga 2.4+)
+     *
+     * Required for removing the downtime via Icinga 2's API.
+     *
+     * @param   string  $downtimeName
+     *
+     * @return  $this
+     */
+    public function setDowntimeName(string $downtimeName): self
+    {
+        $this->downtimeName = $downtimeName;
+
+        return $this;
+    }
+}
diff --git a/library/Icingadb/Command/Object/GetObjectCommand.php b/library/Icingadb/Command/Object/GetObjectCommand.php
new file mode 100644
index 0000000..372a555
--- /dev/null
+++ b/library/Icingadb/Command/Object/GetObjectCommand.php
@@ -0,0 +1,71 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Object;
+
+use Icinga\Module\Icingadb\Model\Host;
+use Icinga\Module\Icingadb\Model\Service;
+use LogicException;
+
+class GetObjectCommand extends ObjectCommand
+{
+    /** @var array */
+    protected $attributes;
+
+    /**
+     * Get the object name used in the Icinga 2 API
+     *
+     * @return string
+     */
+    public function getObjectName(): string
+    {
+        switch (true) {
+            case $this->object instanceof Service:
+                return $this->object->host->name . '!' . $this->object->name;
+            default:
+                return $this->object->name;
+        }
+    }
+
+    /**
+     * Get the sub-route of the endpoint for this object
+     *
+     * @return string
+     */
+    public function getObjectPluralType(): string
+    {
+        switch (true) {
+            case $this->object instanceof Host:
+                return 'hosts';
+            case $this->object instanceof Service:
+                return 'services';
+            default:
+                throw new LogicException(sprintf('Invalid object type %s provided', get_class($this->object)));
+        }
+    }
+
+    /**
+     * Get the attributes to query
+     *
+     * @return ?array
+     */
+    public function getAttributes()
+    {
+        return $this->attributes;
+    }
+
+    /**
+     * Set the attributes to query
+     *
+     * @param array $attributes
+     *
+     * @return $this
+     */
+    public function setAttributes(array $attributes): self
+    {
+        $this->attributes = $attributes;
+
+        return $this;
+    }
+}
diff --git a/library/Icingadb/Command/Object/ObjectCommand.php b/library/Icingadb/Command/Object/ObjectCommand.php
new file mode 100644
index 0000000..7dae799
--- /dev/null
+++ b/library/Icingadb/Command/Object/ObjectCommand.php
@@ -0,0 +1,51 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Object;
+
+use Icinga\Module\Icingadb\Command\IcingaCommand;
+use ipl\Orm\Model;
+
+/**
+ * Base class for commands that involve a monitored object, i.e. a host or service
+ */
+abstract class ObjectCommand extends IcingaCommand
+{
+    /**
+     * Involved object
+     *
+     * @var Model
+     */
+    protected $object;
+
+    /**
+     * Set the involved object
+     *
+     * @param   Model $object
+     *
+     * @return  $this
+     */
+    public function setObject(Model $object): self
+    {
+        $this->object = $object;
+
+        return $this;
+    }
+
+    /**
+     * Get the involved object
+     *
+     * @return Model
+     */
+    public function getObject(): Model
+    {
+        if ($this->object === null) {
+            throw new \LogicException(
+                'You are accessing an unset property. Please make sure to set it beforehand.'
+            );
+        }
+
+        return $this->object;
+    }
+}
diff --git a/library/Icingadb/Command/Object/ProcessCheckResultCommand.php b/library/Icingadb/Command/Object/ProcessCheckResultCommand.php
new file mode 100644
index 0000000..3d7e956
--- /dev/null
+++ b/library/Icingadb/Command/Object/ProcessCheckResultCommand.php
@@ -0,0 +1,140 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Object;
+
+/**
+ * Submit a passive check result for a host or service
+ */
+class ProcessCheckResultCommand extends ObjectCommand
+{
+    /**
+     * Host up
+     */
+    const HOST_UP = 0;
+
+    /**
+     * Host down
+     */
+    const HOST_DOWN = 1;
+
+    /**
+     * Service ok
+     */
+    const SERVICE_OK = 0;
+
+    /**
+     * Service warning
+     */
+    const SERVICE_WARNING = 1;
+
+    /**
+     * Service critical
+     */
+    const SERVICE_CRITICAL = 2;
+
+    /**
+     * Service unknown
+     */
+    const SERVICE_UNKNOWN = 3;
+
+    /**
+     * Status code of the host or service check result
+     *
+     * @var int
+     */
+    protected $status;
+
+    /**
+     * Text output of the host or service check result
+     *
+     * @var string
+     */
+    protected $output;
+
+    /**
+     * Optional performance data of the host or service check result
+     *
+     * @var string
+     */
+    protected $performanceData;
+
+    /**
+     * Set the status code of the host or service check result
+     *
+     * @param   int $status
+     *
+     * @return  $this
+     */
+    public function setStatus(int $status): self
+    {
+        $this->status = $status;
+
+        return $this;
+    }
+
+    /**
+     * Get the status code of the host or service check result
+     *
+     * @return int
+     */
+    public function getStatus(): int
+    {
+        if ($this->status === null) {
+            throw new \LogicException(
+                'You are accessing an unset property. Please make sure to set it beforehand.'
+            );
+        }
+
+        return $this->status;
+    }
+
+    /**
+     * Set the text output of the host or service check result
+     *
+     * @param   string $output
+     *
+     * @return  $this
+     */
+    public function setOutput(string $output): self
+    {
+        $this->output = $output;
+
+        return $this;
+    }
+
+    /**
+     * Get the text output of the host or service check result
+     *
+     * @return ?string
+     */
+    public function getOutput()
+    {
+        return $this->output;
+    }
+
+    /**
+     * Set the performance data of the host or service check result
+     *
+     * @param   string|null $performanceData
+     *
+     * @return  $this
+     */
+    public function setPerformanceData(string $performanceData = null): self
+    {
+        $this->performanceData = $performanceData;
+
+        return $this;
+    }
+
+    /**
+     * Get the performance data of the host or service check result
+     *
+     * @return ?string
+     */
+    public function getPerformanceData()
+    {
+        return $this->performanceData;
+    }
+}
diff --git a/library/Icingadb/Command/Object/PropagateHostDowntimeCommand.php b/library/Icingadb/Command/Object/PropagateHostDowntimeCommand.php
new file mode 100644
index 0000000..88964fb
--- /dev/null
+++ b/library/Icingadb/Command/Object/PropagateHostDowntimeCommand.php
@@ -0,0 +1,42 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Object;
+
+/**
+ * Schedule and propagate host downtime
+ */
+class PropagateHostDowntimeCommand extends ScheduleHostDowntimeCommand
+{
+    /**
+     * Whether the downtime for child hosts are all set to be triggered by this' host downtime
+     *
+     * @var bool
+     */
+    protected $triggered = false;
+
+    /**
+     * Set whether the downtime for child hosts are all set to be triggered by this' host downtime
+     *
+     * @param   bool $triggered
+     *
+     * @return  $this
+     */
+    public function setTriggered(bool $triggered = true): self
+    {
+        $this->triggered = $triggered;
+
+        return $this;
+    }
+
+    /**
+     * Get whether the downtime for child hosts are all set to be triggered by this' host downtime
+     *
+     * @return bool
+     */
+    public function getTriggered(): bool
+    {
+        return $this->triggered;
+    }
+}
diff --git a/library/Icingadb/Command/Object/RemoveAcknowledgementCommand.php b/library/Icingadb/Command/Object/RemoveAcknowledgementCommand.php
new file mode 100644
index 0000000..49a22a3
--- /dev/null
+++ b/library/Icingadb/Command/Object/RemoveAcknowledgementCommand.php
@@ -0,0 +1,13 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Object;
+
+/**
+ * Remove a problem acknowledgement from a host or service
+ */
+class RemoveAcknowledgementCommand extends ObjectCommand
+{
+    use CommandAuthor;
+}
diff --git a/library/Icingadb/Command/Object/ScheduleCheckCommand.php b/library/Icingadb/Command/Object/ScheduleCheckCommand.php
new file mode 100644
index 0000000..c3f2097
--- /dev/null
+++ b/library/Icingadb/Command/Object/ScheduleCheckCommand.php
@@ -0,0 +1,86 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Object;
+
+/**
+ * Schedule a check
+ */
+class ScheduleCheckCommand extends ObjectCommand
+{
+    /**
+     * Time when the next check of a host or service is to be scheduled
+     *
+     * If active checks are disabled on a host- or service-specific or program-wide basis or the host or service is
+     * already scheduled to be checked at an earlier time, etc. The check may not actually be scheduled at the time
+     * specified. This behaviour can be overridden by setting `ScheduledCheck::$forced' to true.
+     *
+     * @var int Unix timestamp
+     */
+    protected $checkTime;
+
+    /**
+     * Whether the check is forced
+     *
+     * Forced checks are performed regardless of what time it is (e.g. time period restrictions are ignored) and whether
+     * or not active checks are enabled on a host- or service-specific or program-wide basis.
+     *
+     * @var bool
+     */
+    protected $forced = false;
+
+    /**
+     * Set the time when the next check of a host or service is to be scheduled
+     *
+     * @param   int $checkTime Unix timestamp
+     *
+     * @return  $this
+     */
+    public function setCheckTime(int $checkTime): self
+    {
+        $this->checkTime = $checkTime;
+
+        return $this;
+    }
+
+    /**
+     * Get the time when the next check of a host or service is to be scheduled
+     *
+     * @return int Unix timestamp
+     */
+    public function getCheckTime(): int
+    {
+        if ($this->checkTime === null) {
+            throw new \LogicException(
+                'You are accessing an unset property. Please make sure to set it beforehand.'
+            );
+        }
+
+        return $this->checkTime;
+    }
+
+    /**
+     * Set whether the check is forced
+     *
+     * @param   bool $forced
+     *
+     * @return  $this
+     */
+    public function setForced(bool $forced = true): self
+    {
+        $this->forced = $forced;
+
+        return $this;
+    }
+
+    /**
+     * Get whether the check is forced
+     *
+     * @return bool
+     */
+    public function getForced(): bool
+    {
+        return $this->forced;
+    }
+}
diff --git a/library/Icingadb/Command/Object/ScheduleHostDowntimeCommand.php b/library/Icingadb/Command/Object/ScheduleHostDowntimeCommand.php
new file mode 100644
index 0000000..0e4d84f
--- /dev/null
+++ b/library/Icingadb/Command/Object/ScheduleHostDowntimeCommand.php
@@ -0,0 +1,42 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Object;
+
+/**
+ * Schedule a host downtime
+ */
+class ScheduleHostDowntimeCommand extends ScheduleServiceDowntimeCommand
+{
+    /**
+     * Whether to schedule a downtime for all services associated with a particular host
+     *
+     * @var bool
+     */
+    protected $forAllServices = false;
+
+    /**
+     * Set whether to schedule a downtime for all services associated with a particular host
+     *
+     * @param   bool $forAllServices
+     *
+     * @return  $this
+     */
+    public function setForAllServices(bool $forAllServices = true): self
+    {
+        $this->forAllServices = $forAllServices;
+
+        return $this;
+    }
+
+    /**
+     * Get whether to schedule a downtime for all services associated with a particular host
+     *
+     * @return bool
+     */
+    public function getForAllServices(): bool
+    {
+        return $this->forAllServices;
+    }
+}
diff --git a/library/Icingadb/Command/Object/ScheduleServiceDowntimeCommand.php b/library/Icingadb/Command/Object/ScheduleServiceDowntimeCommand.php
new file mode 100644
index 0000000..3bad28e
--- /dev/null
+++ b/library/Icingadb/Command/Object/ScheduleServiceDowntimeCommand.php
@@ -0,0 +1,196 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Object;
+
+/**
+ * Schedule a service downtime
+ */
+class ScheduleServiceDowntimeCommand extends AddCommentCommand
+{
+    /**
+     * Downtime starts at the exact time specified
+     *
+     * If `Downtime::$fixed' is set to false, the time between `Downtime::$start' and `Downtime::$end' at which a
+     * host or service transitions to a problem state determines the time at which the downtime actually starts.
+     * The downtime will then last for `Downtime::$duration' seconds.
+     *
+     * @var int Unix timestamp
+     */
+    protected $start;
+
+    /**
+     * Downtime ends at the exact time specified
+     *
+     * If `Downtime::$fixed' is set to false, the time between `Downtime::$start' and `Downtime::$end' at which a
+     * host or service transitions to a problem state determines the time at which the downtime actually starts.
+     * The downtime will then last for `Downtime::$duration' seconds.
+     *
+     * @var int Unix timestamp
+     */
+    protected $end;
+
+    /**
+     * Whether it's a fixed or flexible downtime
+     *
+     * @var bool
+     */
+    protected $fixed = true;
+
+    /**
+     * ID of the downtime which triggers this downtime
+     *
+     * The start of this downtime is triggered by the start of the other scheduled host or service downtime.
+     *
+     * @var int|null
+     */
+    protected $triggerId;
+
+    /**
+     * The duration in seconds the downtime must last if it's a flexible downtime
+     *
+     * If `Downtime::$fixed' is set to false, the downtime will last for the duration in seconds specified, even
+     * if the host or service recovers before the downtime expires.
+     *
+     * @var int|null
+     */
+    protected $duration;
+
+    /**
+     * Set the time when the downtime should start
+     *
+     * @param   int $start Unix timestamp
+     *
+     * @return  $this
+     */
+    public function setStart(int $start): self
+    {
+        $this->start = $start;
+
+        return $this;
+    }
+
+    /**
+     * Get the time when the downtime should start
+     *
+     * @return int Unix timestamp
+     */
+    public function getStart(): int
+    {
+        if ($this->start === null) {
+            throw new \LogicException(
+                'You are accessing an unset property. Please make sure to set it beforehand.'
+            );
+        }
+
+        return $this->start;
+    }
+
+    /**
+     * Set the time when the downtime should end
+     *
+     * @param   int $end Unix timestamp
+     *
+     * @return  $this
+     */
+    public function setEnd(int $end): self
+    {
+        $this->end = $end;
+
+        return $this;
+    }
+
+    /**
+     * Get the time when the downtime should end
+     *
+     * @return int Unix timestamp
+     */
+    public function getEnd(): int
+    {
+        if ($this->start === null) {
+            throw new \LogicException(
+                'You are accessing an unset property. Please make sure to set it beforehand.'
+            );
+        }
+
+        return $this->end;
+    }
+
+    /**
+     * Set whether it's a fixed or flexible downtime
+     *
+     * @param   boolean $fixed
+     *
+     * @return  $this
+     */
+    public function setFixed(bool $fixed = true): self
+    {
+        $this->fixed = $fixed;
+
+        return $this;
+    }
+
+    /**
+     * Is the downtime fixed?
+     *
+     * @return boolean
+     */
+    public function getFixed(): bool
+    {
+        return $this->fixed;
+    }
+
+    /**
+     * Set the ID of the downtime which triggers this downtime
+     *
+     * @param   int $triggerId
+     *
+     * @return  $this
+     */
+    public function setTriggerId(int $triggerId): self
+    {
+        $this->triggerId = $triggerId;
+
+        return $this;
+    }
+
+    /**
+     * Get the ID of the downtime which triggers this downtime
+     *
+     * @return int|null
+     */
+    public function getTriggerId()
+    {
+        return $this->triggerId;
+    }
+
+    /**
+     * Set the duration in seconds the downtime must last if it's a flexible downtime
+     *
+     * @param   int $duration
+     *
+     * @return  $this
+     */
+    public function setDuration(int $duration): self
+    {
+        $this->duration = $duration;
+
+        return $this;
+    }
+
+    /**
+     * Get the duration in seconds the downtime must last if it's a flexible downtime
+     *
+     * @return int|null
+     */
+    public function getDuration()
+    {
+        return $this->duration;
+    }
+
+    public function getName(): string
+    {
+        return 'ScheduleDowntime';
+    }
+}
diff --git a/library/Icingadb/Command/Object/SendCustomNotificationCommand.php b/library/Icingadb/Command/Object/SendCustomNotificationCommand.php
new file mode 100644
index 0000000..de90620
--- /dev/null
+++ b/library/Icingadb/Command/Object/SendCustomNotificationCommand.php
@@ -0,0 +1,44 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Object;
+
+/**
+ * Send custom notifications for a host or service
+ */
+class SendCustomNotificationCommand extends WithCommentCommand
+{
+    /**
+     * Whether the notification is forced
+     *
+     * Forced notifications are sent out regardless of time restrictions and whether or not notifications are enabled.
+     *
+     * @var bool
+     */
+    protected $forced;
+
+    /**
+     * Get whether to force the notification
+     *
+     * @return ?bool
+     */
+    public function getForced()
+    {
+        return $this->forced;
+    }
+
+    /**
+     * Set whether to force the notification
+     *
+     * @param   bool $forced
+     *
+     * @return  $this
+     */
+    public function setForced(bool $forced = true): self
+    {
+        $this->forced = $forced;
+
+        return $this;
+    }
+}
diff --git a/library/Icingadb/Command/Object/ToggleObjectFeatureCommand.php b/library/Icingadb/Command/Object/ToggleObjectFeatureCommand.php
new file mode 100644
index 0000000..699a113
--- /dev/null
+++ b/library/Icingadb/Command/Object/ToggleObjectFeatureCommand.php
@@ -0,0 +1,108 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Object;
+
+/**
+ * Enable or disable a feature of an Icinga object, i.e. host or service
+ */
+class ToggleObjectFeatureCommand extends ObjectCommand
+{
+    /**
+     * Feature for enabling or disabling active checks of a host or service
+     */
+    const FEATURE_ACTIVE_CHECKS = 'active_checks_enabled';
+
+    /**
+     * Feature for enabling or disabling passive checks of a host or service
+     */
+    const FEATURE_PASSIVE_CHECKS = 'passive_checks_enabled';
+
+    /**
+     * Feature for enabling or disabling notifications for a host or service
+     *
+     * Notifications will be sent out only if notifications are enabled on a program-wide basis as well.
+     */
+    const FEATURE_NOTIFICATIONS = 'notifications_enabled';
+
+    /**
+     * Feature for enabling or disabling event handler for a host or service
+     */
+    const FEATURE_EVENT_HANDLER = 'event_handler_enabled';
+
+    /**
+     * Feature for enabling or disabling flap detection for a host or service.
+     *
+     * In order to enable flap detection flap detection must be enabled on a program-wide basis as well.
+     */
+    const FEATURE_FLAP_DETECTION = 'flapping_enabled';
+
+    /**
+     * Feature that is to be enabled or disabled
+     *
+     * @var string
+     */
+    protected $feature;
+
+    /**
+     * Whether the feature should be enabled or disabled
+     *
+     * @var bool
+     */
+    protected $enabled;
+
+    /**
+     * Set the feature that is to be enabled or disabled
+     *
+     * @param   string $feature
+     *
+     * @return  $this
+     */
+    public function setFeature(string $feature): self
+    {
+        $this->feature = $feature;
+
+        return $this;
+    }
+
+    /**
+     * Get the feature that is to be enabled or disabled
+     *
+     * @return string
+     */
+    public function getFeature(): string
+    {
+        if ($this->feature === null) {
+            throw new \LogicException(
+                'You are accessing an unset property. Please make sure to set it beforehand.'
+            );
+        }
+
+        return $this->feature;
+    }
+
+    /**
+     * Set whether the feature should be enabled or disabled
+     *
+     * @param   bool $enabled
+     *
+     * @return  $this
+     */
+    public function setEnabled(bool $enabled = true): self
+    {
+        $this->enabled = $enabled;
+
+        return $this;
+    }
+
+    /**
+     * Get whether the feature should be enabled or disabled
+     *
+     * @return ?bool
+     */
+    public function getEnabled()
+    {
+        return $this->enabled;
+    }
+}
diff --git a/library/Icingadb/Command/Object/WithCommentCommand.php b/library/Icingadb/Command/Object/WithCommentCommand.php
new file mode 100644
index 0000000..299c998
--- /dev/null
+++ b/library/Icingadb/Command/Object/WithCommentCommand.php
@@ -0,0 +1,50 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Object;
+
+/**
+ * Base class for commands adding comments
+ */
+abstract class WithCommentCommand extends ObjectCommand
+{
+    use CommandAuthor;
+
+    /**
+     * Comment
+     *
+     * @var string
+     */
+    protected $comment;
+
+    /**
+     * Set the comment
+     *
+     * @param   string $comment
+     *
+     * @return  $this
+     */
+    public function setComment(string $comment): self
+    {
+        $this->comment = $comment;
+
+        return $this;
+    }
+
+    /**
+     * Get the comment
+     *
+     * @return string
+     */
+    public function getComment(): string
+    {
+        if ($this->comment === null) {
+            throw new \LogicException(
+                'You are accessing an unset property. Please make sure to set it beforehand.'
+            );
+        }
+
+        return $this->comment;
+    }
+}
diff --git a/library/Icingadb/Command/Renderer/IcingaApiCommandRenderer.php b/library/Icingadb/Command/Renderer/IcingaApiCommandRenderer.php
new file mode 100644
index 0000000..aa1cdbe
--- /dev/null
+++ b/library/Icingadb/Command/Renderer/IcingaApiCommandRenderer.php
@@ -0,0 +1,322 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Renderer;
+
+use Icinga\Module\Icingadb\Command\IcingaApiCommand;
+use Icinga\Module\Icingadb\Command\Object\GetObjectCommand;
+use Icinga\Module\Icingadb\Model\Host;
+use Icinga\Module\Icingadb\Model\Service;
+use Icinga\Module\Icingadb\Command\Instance\ToggleInstanceFeatureCommand;
+use Icinga\Module\Icingadb\Command\Object\AcknowledgeProblemCommand;
+use Icinga\Module\Icingadb\Command\Object\AddCommentCommand;
+use Icinga\Module\Icingadb\Command\Object\DeleteCommentCommand;
+use Icinga\Module\Icingadb\Command\Object\DeleteDowntimeCommand;
+use Icinga\Module\Icingadb\Command\Object\ProcessCheckResultCommand;
+use Icinga\Module\Icingadb\Command\Object\PropagateHostDowntimeCommand;
+use Icinga\Module\Icingadb\Command\Object\RemoveAcknowledgementCommand;
+use Icinga\Module\Icingadb\Command\Object\ScheduleHostDowntimeCommand;
+use Icinga\Module\Icingadb\Command\Object\ScheduleCheckCommand;
+use Icinga\Module\Icingadb\Command\Object\ScheduleServiceDowntimeCommand;
+use Icinga\Module\Icingadb\Command\Object\SendCustomNotificationCommand;
+use Icinga\Module\Icingadb\Command\Object\ToggleObjectFeatureCommand;
+use Icinga\Module\Icingadb\Command\IcingaCommand;
+use InvalidArgumentException;
+use ipl\Orm\Model;
+
+/**
+ * Icinga command renderer for the Icinga command file
+ */
+class IcingaApiCommandRenderer implements IcingaCommandRendererInterface
+{
+    /**
+     * Name of the Icinga application object
+     *
+     * @var string
+     */
+    protected $app = 'app';
+
+    /**
+     * Get the name of the Icinga application object
+     *
+     * @return string
+     */
+    public function getApp(): string
+    {
+        return $this->app;
+    }
+
+    /**
+     * Set the name of the Icinga application object
+     *
+     * @param   string  $app
+     *
+     * @return  $this
+     */
+    public function setApp(string $app): self
+    {
+        $this->app = $app;
+
+        return $this;
+    }
+
+    /**
+     * Apply filter to query data
+     *
+     * @param   array   $data
+     * @param   Model   $object
+     *
+     * @return  void
+     */
+    protected function applyFilter(array &$data, Model $object)
+    {
+        if ($object instanceof Host) {
+            $data['host'] = $object->name;
+        } else {
+            /** @var Service $object */
+            $data['service'] = sprintf('%s!%s', $object->host->name, $object->name);
+        }
+    }
+
+    /**
+     * Render a command
+     *
+     * @param   IcingaCommand   $command
+     *
+     * @return  IcingaApiCommand
+     */
+    public function render(IcingaCommand $command): IcingaApiCommand
+    {
+        $renderMethod = 'render' . $command->getName();
+        if (! method_exists($this, $renderMethod)) {
+            throw new InvalidArgumentException(
+                sprintf('Can\'t render command. Method %s not found', $renderMethod)
+            );
+        }
+
+        return $this->$renderMethod($command);
+    }
+
+    public function renderGetObject(GetObjectCommand $command): IcingaApiCommand
+    {
+        $endpoint = sprintf(
+            'objects/%s/%s',
+            $command->getObjectPluralType(),
+            rawurlencode($command->getObjectName())
+        );
+
+        $data = [
+            'all_joins' => 1,
+            'attrs'     => $command->getAttributes() ?: []
+        ];
+
+        return IcingaApiCommand::create($endpoint, $data)->setMethod('GET');
+    }
+
+    public function renderAddComment(AddCommentCommand $command): IcingaApiCommand
+    {
+        $endpoint = 'actions/add-comment';
+        $data = [
+            'author'    => $command->getAuthor(),
+            'comment'   => $command->getComment()
+        ];
+
+        if ($command->getExpireTime() !== null) {
+            $data['expiry'] = $command->getExpireTime();
+        }
+
+        $this->applyFilter($data, $command->getObject());
+        return IcingaApiCommand::create($endpoint, $data);
+    }
+
+    public function renderSendCustomNotification(SendCustomNotificationCommand $command): IcingaApiCommand
+    {
+        $endpoint = 'actions/send-custom-notification';
+        $data = [
+            'author'    => $command->getAuthor(),
+            'comment'   => $command->getComment(),
+            'force'     => $command->getForced()
+        ];
+
+        $this->applyFilter($data, $command->getObject());
+        return IcingaApiCommand::create($endpoint, $data);
+    }
+
+    public function renderProcessCheckResult(ProcessCheckResultCommand $command): IcingaApiCommand
+    {
+        $endpoint = 'actions/process-check-result';
+        $data = [
+            'exit_status'       => $command->getStatus(),
+            'plugin_output'     => $command->getOutput(),
+            'performance_data'  => $command->getPerformanceData()
+        ];
+
+        $this->applyFilter($data, $command->getObject());
+        return IcingaApiCommand::create($endpoint, $data);
+    }
+
+    public function renderScheduleCheck(ScheduleCheckCommand $command): IcingaApiCommand
+    {
+        $endpoint = 'actions/reschedule-check';
+        $data = [
+            'next_check'    => $command->getCheckTime(),
+            'force'         => $command->getForced()
+        ];
+
+        $this->applyFilter($data, $command->getObject());
+        return IcingaApiCommand::create($endpoint, $data);
+    }
+
+    public function renderScheduleDowntime(ScheduleServiceDowntimeCommand $command): IcingaApiCommand
+    {
+        $endpoint = 'actions/schedule-downtime';
+        $data = [
+            'author'        => $command->getAuthor(),
+            'comment'       => $command->getComment(),
+            'start_time'    => $command->getStart(),
+            'end_time'      => $command->getEnd(),
+            'duration'      => $command->getDuration(),
+            'fixed'         => $command->getFixed(),
+            'trigger_name'  => $command->getTriggerId()
+        ];
+
+        if ($command instanceof PropagateHostDowntimeCommand) {
+            $data['child_options'] = $command->getTriggered() ? 1 : 2;
+        }
+
+        if ($command instanceof ScheduleHostDowntimeCommand && $command->getForAllServices()) {
+            $data['all_services'] = true;
+        }
+
+        $this->applyFilter($data, $command->getObject());
+        return IcingaApiCommand::create($endpoint, $data);
+    }
+
+    public function renderAcknowledgeProblem(AcknowledgeProblemCommand $command): IcingaApiCommand
+    {
+        $endpoint = 'actions/acknowledge-problem';
+        $data = [
+            'author'        => $command->getAuthor(),
+            'comment'       => $command->getComment(),
+            'sticky'        => $command->getSticky(),
+            'notify'        => $command->getNotify(),
+            'persistent'    => $command->getPersistent()
+        ];
+
+        if ($command->getExpireTime() !== null) {
+            $data['expiry'] = $command->getExpireTime();
+        }
+
+        $this->applyFilter($data, $command->getObject());
+        return IcingaApiCommand::create($endpoint, $data);
+    }
+
+    public function renderToggleObjectFeature(ToggleObjectFeatureCommand $command): IcingaApiCommand
+    {
+        switch ($command->getFeature()) {
+            case ToggleObjectFeatureCommand::FEATURE_ACTIVE_CHECKS:
+                $attr = 'enable_active_checks';
+                break;
+            case ToggleObjectFeatureCommand::FEATURE_PASSIVE_CHECKS:
+                $attr = 'enable_passive_checks';
+                break;
+            case ToggleObjectFeatureCommand::FEATURE_NOTIFICATIONS:
+                $attr = 'enable_notifications';
+                break;
+            case ToggleObjectFeatureCommand::FEATURE_EVENT_HANDLER:
+                $attr = 'enable_event_handler';
+                break;
+            case ToggleObjectFeatureCommand::FEATURE_FLAP_DETECTION:
+                $attr = 'enable_flapping';
+                break;
+            default:
+                throw new InvalidArgumentException($command->getFeature());
+        }
+
+        $endpoint = 'objects/';
+        $object = $command->getObject();
+        if ($object instanceof Host) {
+            $endpoint .= 'hosts';
+        } else {
+            /** @var Service $object */
+            $endpoint .= 'services';
+        }
+
+        $data = [
+            'attrs' => [
+                $attr => $command->getEnabled()
+            ]
+        ];
+
+        $this->applyFilter($data, $object);
+        return IcingaApiCommand::create($endpoint, $data);
+    }
+
+    public function renderDeleteComment(DeleteCommentCommand $command): IcingaApiCommand
+    {
+        $endpoint = 'actions/remove-comment';
+        $data = [
+            'author'    => $command->getAuthor(),
+            'comment'   => $command->getCommentName()
+        ];
+
+        return IcingaApiCommand::create($endpoint, $data);
+    }
+
+    public function renderDeleteDowntime(DeleteDowntimeCommand $command): IcingaApiCommand
+    {
+        $endpoint = 'actions/remove-downtime';
+        $data = [
+            'author'    => $command->getAuthor(),
+            'downtime'  => $command->getDowntimeName()
+        ];
+
+        return IcingaApiCommand::create($endpoint, $data);
+    }
+
+    public function renderRemoveAcknowledgement(RemoveAcknowledgementCommand $command): IcingaApiCommand
+    {
+        $endpoint = 'actions/remove-acknowledgement';
+        $data = ['author' => $command->getAuthor()];
+
+        $this->applyFilter($data, $command->getObject());
+        return IcingaApiCommand::create($endpoint, $data);
+    }
+
+    public function renderToggleInstanceFeature(ToggleInstanceFeatureCommand $command): IcingaApiCommand
+    {
+        $endpoint = 'objects/icingaapplications/' . $this->getApp();
+
+        switch ($command->getFeature()) {
+            case ToggleInstanceFeatureCommand::FEATURE_ACTIVE_HOST_CHECKS:
+                $attr = 'enable_host_checks';
+                break;
+            case ToggleInstanceFeatureCommand::FEATURE_ACTIVE_SERVICE_CHECKS:
+                $attr = 'enable_service_checks';
+                break;
+            case ToggleInstanceFeatureCommand::FEATURE_EVENT_HANDLERS:
+                $attr = 'enable_event_handlers';
+                break;
+            case ToggleInstanceFeatureCommand::FEATURE_FLAP_DETECTION:
+                $attr = 'enable_flapping';
+                break;
+            case ToggleInstanceFeatureCommand::FEATURE_NOTIFICATIONS:
+                $attr = 'enable_notifications';
+                break;
+            case ToggleInstanceFeatureCommand::FEATURE_PERFORMANCE_DATA:
+                $attr = 'enable_perfdata';
+                break;
+            default:
+                throw new InvalidArgumentException($command->getFeature());
+        }
+
+        $data = [
+            'attrs' => [
+                $attr => $command->getEnabled()
+            ]
+        ];
+
+        return IcingaApiCommand::create($endpoint, $data);
+    }
+}
diff --git a/library/Icingadb/Command/Renderer/IcingaCommandRendererInterface.php b/library/Icingadb/Command/Renderer/IcingaCommandRendererInterface.php
new file mode 100644
index 0000000..50dd90c
--- /dev/null
+++ b/library/Icingadb/Command/Renderer/IcingaCommandRendererInterface.php
@@ -0,0 +1,12 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Renderer;
+
+/**
+ * Interface for Icinga command renderer
+ */
+interface IcingaCommandRendererInterface
+{
+}
diff --git a/library/Icingadb/Command/Transport/ApiCommandException.php b/library/Icingadb/Command/Transport/ApiCommandException.php
new file mode 100644
index 0000000..5449a7d
--- /dev/null
+++ b/library/Icingadb/Command/Transport/ApiCommandException.php
@@ -0,0 +1,14 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Transport;
+
+use Icinga\Exception\IcingaException;
+
+/**
+ * Exception thrown if a command was not successful
+ */
+class ApiCommandException extends IcingaException
+{
+}
diff --git a/library/Icingadb/Command/Transport/ApiCommandTransport.php b/library/Icingadb/Command/Transport/ApiCommandTransport.php
new file mode 100644
index 0000000..370d705
--- /dev/null
+++ b/library/Icingadb/Command/Transport/ApiCommandTransport.php
@@ -0,0 +1,353 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Transport;
+
+use GuzzleHttp\Client;
+use GuzzleHttp\Exception\GuzzleException;
+use Icinga\Application\Hook\AuditHook;
+use Icinga\Application\Logger;
+use Icinga\Exception\Json\JsonDecodeException;
+use Icinga\Module\Icingadb\Command\IcingaApiCommand;
+use Icinga\Module\Icingadb\Command\IcingaCommand;
+use Icinga\Module\Icingadb\Command\Renderer\IcingaApiCommandRenderer;
+use Icinga\Util\Json;
+
+/**
+ * Command transport over Icinga 2's REST API
+ */
+class ApiCommandTransport implements CommandTransportInterface
+{
+    /**
+     * Transport identifier
+     */
+    const TRANSPORT = 'api';
+
+    /**
+     * API host
+     *
+     * @var string
+     */
+    protected $host;
+
+    /**
+     * API password
+     *
+     * @var string
+     */
+    protected $password;
+
+    /**
+     * API port
+     *
+     * @var int
+     */
+    protected $port = 5665;
+
+    /**
+     * Command renderer
+     *
+     * @var IcingaApiCommandRenderer
+     */
+    protected $renderer;
+
+    /**
+     * API username
+     *
+     * @var string
+     */
+    protected $username;
+
+    /**
+     * Create a new API command transport
+     */
+    public function __construct()
+    {
+        $this->renderer = new IcingaApiCommandRenderer();
+    }
+
+    /**
+     * Set the name of the Icinga application object
+     *
+     * @param   string  $app
+     *
+     * @return  $this
+     */
+    public function setApp(string $app): self
+    {
+        $this->renderer->setApp($app);
+
+        return $this;
+    }
+
+    /**
+     * Get the API host
+     *
+     * @return string
+     */
+    public function getHost(): string
+    {
+        if ($this->host === null) {
+            throw new \LogicException(
+                'You are accessing an unset property. Please make sure to set it beforehand.'
+            );
+        }
+
+        return $this->host;
+    }
+
+    /**
+     * Set the API host
+     *
+     * @param   string  $host
+     *
+     * @return  $this
+     */
+    public function setHost(string $host): self
+    {
+        $this->host = $host;
+
+        return $this;
+    }
+
+    /**
+     * Get the API password
+     *
+     * @return string
+     */
+    public function getPassword(): string
+    {
+        if ($this->password === null) {
+            throw new \LogicException(
+                'You are accessing an unset property. Please make sure to set it beforehand.'
+            );
+        }
+
+        return $this->password;
+    }
+
+    /**
+     * Set the API password
+     *
+     * @param   string  $password
+     *
+     * @return  $this
+     */
+    public function setPassword(string $password): self
+    {
+        $this->password = $password;
+
+        return $this;
+    }
+
+    /**
+     * Get the API port
+     *
+     * @return int
+     */
+    public function getPort(): int
+    {
+        return $this->port;
+    }
+
+    /**
+     * Set the API port
+     *
+     * @param   int $port
+     *
+     * @return  $this
+     */
+    public function setPort(int $port): self
+    {
+        $this->port = $port;
+
+        return $this;
+    }
+
+    /**
+     * Get the API username
+     *
+     * @return string
+     */
+    public function getUsername(): string
+    {
+        if ($this->username === null) {
+            throw new \LogicException(
+                'You are accessing an unset property. Please make sure to set it beforehand.'
+            );
+        }
+
+        return $this->username;
+    }
+
+    /**
+     * Set the API username
+     *
+     * @param   string  $username
+     *
+     * @return  $this
+     */
+    public function setUsername(string $username): self
+    {
+        $this->username = $username;
+
+        return $this;
+    }
+
+    /**
+     * Get URI for endpoint
+     *
+     * @param   string  $endpoint
+     *
+     * @return  string
+     */
+    protected function getUriFor(string $endpoint): string
+    {
+        return sprintf('https://%s:%u/v1/%s', $this->getHost(), $this->getPort(), $endpoint);
+    }
+
+    /**
+     * Send the given command to the icinga2's REST API
+     *
+     * @param IcingaApiCommand $command
+     *
+     * @return mixed
+     */
+    protected function sendCommand(IcingaApiCommand $command)
+    {
+        Logger::debug(
+            'Sending Icinga command "%s" to the API "%s:%u"',
+            $command->getEndpoint(),
+            $this->getHost(),
+            $this->getPort()
+        );
+
+        $data = $command->getData();
+        $payload = Json::encode($data);
+        AuditHook::logActivity(
+            'monitoring/command',
+            "Issued command {$command->getEndpoint()} with the following payload: $payload",
+            $data
+        );
+
+        $headers = ['Accept' => 'application/json'];
+        if ($command->getMethod() !== 'POST') {
+            $headers['X-HTTP-Method-Override'] = $command->getMethod();
+        }
+
+        try {
+            $response = (new Client())
+                ->post($this->getUriFor($command->getEndpoint()), [
+                    'auth'          => [$this->getUsername(), $this->getPassword()],
+                    'headers'       => $headers,
+                    'json'          => $command->getData(),
+                    'http_errors'   => false,
+                    'verify'        => false
+                ]);
+        } catch (GuzzleException $e) {
+            throw new CommandTransportException(
+                'Can\'t connect to the Icinga 2 API: %u %s',
+                $e->getCode(),
+                $e->getMessage()
+            );
+        }
+
+        try {
+            $responseData = Json::decode((string) $response->getBody(), true);
+        } catch (JsonDecodeException $e) {
+            throw new CommandTransportException(
+                'Got invalid JSON response from the Icinga 2 API: %s',
+                $e->getMessage()
+            );
+        }
+
+        if (! isset($responseData['results']) || empty($responseData['results'])) {
+            if (isset($responseData['error'])) {
+                throw new ApiCommandException(
+                    'Can\'t send external Icinga command: %u %s',
+                    $responseData['error'],
+                    $responseData['status']
+                );
+            }
+
+            return;
+        }
+
+        $errorResult = $responseData['results'][0];
+        if (isset($errorResult['code']) && ($errorResult['code'] < 200 || $errorResult['code'] >= 300)) {
+            throw new ApiCommandException(
+                'Can\'t send external Icinga command: %u %s',
+                $errorResult['code'],
+                $errorResult['status']
+            );
+        }
+
+        return $responseData['results'];
+    }
+
+    /**
+     * Send the Icinga command over the Icinga 2 API
+     *
+     * @param   IcingaCommand   $command
+     * @param   int|null        $now
+     *
+     * @throws  CommandTransportException
+     *
+     * @return  mixed
+     */
+    public function send(IcingaCommand $command, int $now = null)
+    {
+        return $this->sendCommand($this->renderer->render($command));
+    }
+
+    /**
+     * Try to connect to the API
+     *
+     * @return void
+     *
+     * @throws  CommandTransportException In case the connection was not successful
+     */
+    public function probe()
+    {
+        try {
+            $response = (new Client(['timeout' => 15]))
+                ->get($this->getUriFor(''), [
+                    'auth'          => [$this->getUsername(), $this->getPassword()],
+                    'headers'       => ['Accept' => 'application/json'],
+                    'http_errors'   => false,
+                    'verify'        => false
+                ]);
+        } catch (GuzzleException $e) {
+            throw new CommandTransportException(
+                'Can\'t connect to the Icinga 2 API: %u %s',
+                $e->getCode(),
+                $e->getMessage()
+            );
+        }
+
+        try {
+            $responseData = Json::decode((string) $response->getBody(), true);
+        } catch (JsonDecodeException $e) {
+            throw new CommandTransportException(
+                'Got invalid JSON response from the Icinga 2 API: %s',
+                $e->getMessage()
+            );
+        }
+
+        if (! isset($responseData['results']) || empty($responseData['results'])) {
+            throw new CommandTransportException(
+                'Got invalid response from the Icinga 2 API: %s',
+                JSON::encode($responseData)
+            );
+        }
+
+        $result = array_pop($responseData['results']);
+        if (! isset($result['user']) || $result['user'] !== $this->getUsername()) {
+            throw new CommandTransportException(
+                'Got invalid response from the Icinga 2 API: %s',
+                JSON::encode($responseData)
+            );
+        }
+    }
+}
diff --git a/library/Icingadb/Command/Transport/CommandTransport.php b/library/Icingadb/Command/Transport/CommandTransport.php
new file mode 100644
index 0000000..ea125bc
--- /dev/null
+++ b/library/Icingadb/Command/Transport/CommandTransport.php
@@ -0,0 +1,130 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Transport;
+
+use Exception;
+use Icinga\Application\Config;
+use Icinga\Application\Logger;
+use Icinga\Data\ConfigObject;
+use Icinga\Exception\ConfigurationError;
+use Icinga\Module\Icingadb\Command\IcingaCommand;
+
+/**
+ * Command transport
+ */
+class CommandTransport implements CommandTransportInterface
+{
+    /**
+     * Transport configuration
+     *
+     * @var Config
+     */
+    protected static $config;
+
+    /**
+     * Get transport configuration
+     *
+     * @return  Config
+     *
+     * @throws  ConfigurationError
+     */
+    public static function getConfig(): Config
+    {
+        if (static::$config === null) {
+            $config = Config::module('icingadb', 'commandtransports');
+            if ($config->isEmpty()) {
+                throw new ConfigurationError(
+                    t('No command transports have been configured in "%s".'),
+                    $config->getConfigFile()
+                );
+            }
+
+            static::$config = $config;
+        }
+
+        return static::$config;
+    }
+
+    /**
+     * Create a transport from config
+     *
+     * @param   ConfigObject  $config
+     *
+     * @return  ApiCommandTransport
+     *
+     * @throws  ConfigurationError
+     */
+    public static function createTransport(ConfigObject $config): ApiCommandTransport
+    {
+        $config = clone $config;
+        switch (strtolower($config->transport)) {
+            case ApiCommandTransport::TRANSPORT:
+                $transport = new ApiCommandTransport();
+                break;
+            default:
+                throw new ConfigurationError(
+                    t('Cannot create command transport "%s". Invalid transport defined in "%s". Use one of: %s.'),
+                    $config->transport,
+                    static::getConfig()->getConfigFile(),
+                    join(', ', [ApiCommandTransport::TRANSPORT])
+                );
+        }
+
+        unset($config->transport);
+        foreach ($config as $key => $value) {
+            $method = 'set' . ucfirst($key);
+            if (! method_exists($transport, $method)) {
+                // Ignore settings from config that don't have a setter on the transport instead of throwing an
+                // exception here because the transport should throw an exception if it's not fully set up
+                // when being about to send a command
+                continue;
+            }
+
+            $transport->$method($value);
+        }
+
+        return $transport;
+    }
+
+    /**
+     * Send the given command over an appropriate Icinga command transport
+     *
+     * This will try one configured transport after another until the command has been successfully sent.
+     *
+     * @param   IcingaCommand   $command    The command to send
+     * @param   int|null        $now        Timestamp of the command or null for now
+     *
+     * @throws  CommandTransportException   If sending the Icinga command failed
+     *
+     * @return  mixed
+     */
+    public function send(IcingaCommand $command, int $now = null)
+    {
+        $errors = [];
+
+        foreach (static::getConfig() as $name => $transportConfig) {
+            $transport = static::createTransport($transportConfig);
+
+            try {
+                $result = $transport->send($command, $now);
+            } catch (CommandTransportException $e) {
+                Logger::error($e);
+                $errors[] = sprintf('%s: %s.', $name, rtrim($e->getMessage(), '.'));
+                continue; // Try the next transport
+            }
+
+            return $result; // The command was successfully sent
+        }
+
+        if (! empty($errors)) {
+            throw new CommandTransportException(implode("\n", $errors));
+        }
+
+        throw new CommandTransportException(t(
+            'Failed to send external Icinga command. No transport has been configured'
+            . ' for this instance. Please contact your Icinga Web administrator.'
+        ));
+    }
+}
diff --git a/library/Icingadb/Command/Transport/CommandTransportConfig.php b/library/Icingadb/Command/Transport/CommandTransportConfig.php
new file mode 100644
index 0000000..e17fa04
--- /dev/null
+++ b/library/Icingadb/Command/Transport/CommandTransportConfig.php
@@ -0,0 +1,31 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Transport;
+
+use Icinga\Repository\IniRepository;
+
+class CommandTransportConfig extends IniRepository
+{
+    protected $configs = [
+        'transport' => [
+            'name'      => 'commandtransports',
+            'module'    => 'icingadb',
+            'keyColumn' => 'name'
+        ]
+    ];
+
+    protected $queryColumns = [
+        'transport' => [
+            'name',
+            'transport',
+
+            // API options
+            'host',
+            'port',
+            'username',
+            'password'
+        ]
+    ];
+}
diff --git a/library/Icingadb/Command/Transport/CommandTransportException.php b/library/Icingadb/Command/Transport/CommandTransportException.php
new file mode 100644
index 0000000..2ca89d9
--- /dev/null
+++ b/library/Icingadb/Command/Transport/CommandTransportException.php
@@ -0,0 +1,14 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Transport;
+
+use Icinga\Exception\IcingaException;
+
+/**
+ * Exception thrown if a command was not sent
+ */
+class CommandTransportException extends IcingaException
+{
+}
diff --git a/library/Icingadb/Command/Transport/CommandTransportInterface.php b/library/Icingadb/Command/Transport/CommandTransportInterface.php
new file mode 100644
index 0000000..ad07cb9
--- /dev/null
+++ b/library/Icingadb/Command/Transport/CommandTransportInterface.php
@@ -0,0 +1,23 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Command\Transport;
+
+use Icinga\Module\Icingadb\Command\IcingaCommand;
+
+/**
+ * Interface for Icinga command transports
+ */
+interface CommandTransportInterface
+{
+    /**
+     * Send an Icinga command over the Icinga command transport
+     *
+     * @param   IcingaCommand   $command    The command to send
+     * @param   int|null        $now        Timestamp of the command or null for now
+     *
+     * @throws  CommandTransportException If sending the Icinga command failed
+     */
+    public function send(IcingaCommand $command, int $now = null);
+}
diff --git a/library/Icingadb/Common/Auth.php b/library/Icingadb/Common/Auth.php
new file mode 100644
index 0000000..c415d62
--- /dev/null
+++ b/library/Icingadb/Common/Auth.php
@@ -0,0 +1,358 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use Icinga\Authentication\Auth as IcingaAuth;
+use Icinga\Exception\ConfigurationError;
+use Icinga\Module\Icingadb\Authentication\ObjectAuthorization;
+use Icinga\Util\StringHelper;
+use ipl\Orm\Compat\FilterProcessor;
+use ipl\Orm\Model;
+use ipl\Orm\Query;
+use ipl\Orm\UnionQuery;
+use ipl\Sql\Expression;
+use ipl\Stdlib\Filter;
+use ipl\Web\Filter\QueryString;
+
+trait Auth
+{
+    public function getAuth(): IcingaAuth
+    {
+        return IcingaAuth::getInstance();
+    }
+
+    /**
+     * Check whether access to the given route is permitted
+     *
+     * @param string $name
+     *
+     * @return bool
+     */
+    public function isPermittedRoute(string $name): bool
+    {
+        if ($this->getAuth()->getUser()->isUnrestricted()) {
+            return true;
+        }
+
+        // The empty array is for PHP pre 7.4, older versions require at least a single param for array_merge
+        $routeDenylist = array_flip(array_merge([], ...array_map(function ($restriction) {
+            return StringHelper::trimSplit($restriction);
+        }, $this->getAuth()->getRestrictions('icingadb/denylist/routes'))));
+
+        return ! array_key_exists($name, $routeDenylist);
+    }
+
+    /**
+     * Check whether the permission is granted on the object
+     *
+     * @param string $permission
+     * @param Model $object
+     *
+     * @return bool
+     */
+    public function isGrantedOn(string $permission, Model $object): bool
+    {
+        if ($this->getAuth()->getUser()->isUnrestricted()) {
+            return $this->getAuth()->hasPermission($permission);
+        }
+
+        return ObjectAuthorization::grantsOn($permission, $object);
+    }
+
+    /**
+     * Check whether the permission is granted on objects matching the type and filter
+     *
+     * The check will be performed on every object matching the filter. Though the result
+     * only allows to determine whether the permission is granted on **any** or *none*
+     * of the objects in question. Any subsequent call to {@see Auth::isGrantedOn} will
+     * make use of the underlying results the check has determined in order to avoid
+     * unnecessary queries.
+     *
+     * @param string $permission
+     * @param string $type
+     * @param Filter\Rule $filter
+     * @param bool $cache Pass `false` to not perform the check on every object
+     *
+     * @return bool
+     */
+    public function isGrantedOnType(string $permission, string $type, Filter\Rule $filter, bool $cache = true): bool
+    {
+        if ($this->getAuth()->getUser()->isUnrestricted()) {
+            return $this->getAuth()->hasPermission($permission);
+        }
+
+        return ObjectAuthorization::grantsOnType($permission, $type, $filter, $cache);
+    }
+
+    /**
+     * Check whether the filter matches the given object
+     *
+     * @param string $queryString
+     * @param Model  $object
+     *
+     * @return bool
+     */
+    public function isMatchedOn(string $queryString, Model $object): bool
+    {
+        return ObjectAuthorization::matchesOn($queryString, $object);
+    }
+
+    /**
+     * Apply Icinga DB Web's restrictions depending on what is queried
+     *
+     * This will apply `icingadb/filter/objects` in any case. `icingadb/filter/services` is only
+     * applied to queries fetching services and `icingadb/filter/hosts` is applied to queries
+     * fetching either hosts or services. It also applies custom variable restrictions and
+     * obfuscations. (`icingadb/denylist/variables` and `icingadb/protect/variables`)
+     *
+     * @param Query $query
+     *
+     * @return void
+     */
+    public function applyRestrictions(Query $query)
+    {
+        if ($this->getAuth()->getUser()->isUnrestricted()) {
+            return;
+        }
+
+        if ($query instanceof UnionQuery) {
+            $queries = $query->getUnions();
+        } else {
+            $queries = [$query];
+        }
+
+        $orgQuery = $query;
+        foreach ($queries as $query) {
+            $relations = [$query->getModel()->getTableName()];
+            foreach ($query->getWith() as $relationPath => $relation) {
+                $relations[$relationPath] = $relation->getTarget()->getTableName();
+            }
+
+            $customVarRelationName = array_search('customvar_flat', $relations, true);
+            $applyServiceRestriction = in_array('service', $relations, true);
+            $applyHostRestriction = in_array('host', $relations, true)
+                // Hosts and services have a special relation as a service can't exist without its host.
+                // Hence why the hosts restriction is also applied if only services are queried.
+                || $applyServiceRestriction;
+
+            $resolver = $query->getResolver();
+
+            $queryFilter = Filter::any();
+            $obfuscationRules = Filter::any();
+            foreach ($this->getAuth()->getUser()->getRoles() as $role) {
+                $roleFilter = Filter::all();
+
+                if ($customVarRelationName !== false) {
+                    if (($restriction = $role->getRestrictions('icingadb/denylist/variables'))) {
+                        $roleFilter->add($this->parseDenylist(
+                            $restriction,
+                            $customVarRelationName
+                                ? $resolver->qualifyColumn('flatname', $customVarRelationName)
+                                : 'flatname'
+                        ));
+                    }
+
+                    if (($restriction = $role->getRestrictions('icingadb/protect/variables'))) {
+                        $obfuscationRules->add($this->parseDenylist(
+                            $restriction,
+                            $customVarRelationName
+                                ? $resolver->qualifyColumn('flatname', $customVarRelationName)
+                                : 'flatname'
+                        ));
+                    }
+                }
+
+                if ($customVarRelationName === false || count($relations) > 1) {
+                    if (($restriction = $role->getRestrictions('icingadb/filter/objects'))) {
+                        $roleFilter->add($this->parseRestriction($restriction, 'icingadb/filter/objects'));
+                    }
+
+                    if ($applyHostRestriction && ($restriction = $role->getRestrictions('icingadb/filter/hosts'))) {
+                        $hostFilter = $this->parseRestriction($restriction, 'icingadb/filter/hosts');
+                        if ($orgQuery instanceof UnionQuery) {
+                            $this->forceQueryOptimization($hostFilter, 'hostgroup.name');
+                        }
+
+                        $roleFilter->add($hostFilter);
+                    }
+
+                    if (
+                        $applyServiceRestriction
+                        && ($restriction = $role->getRestrictions('icingadb/filter/services'))
+                    ) {
+                        $serviceFilter = $this->parseRestriction($restriction, 'icingadb/filter/services');
+                        if ($orgQuery instanceof UnionQuery) {
+                            $this->forceQueryOptimization($serviceFilter, 'servicegroup.name');
+                        }
+
+                        $roleFilter->add(Filter::any(Filter::unlike('service.id', '*'), $serviceFilter));
+                    }
+                }
+
+                if (! $roleFilter->isEmpty()) {
+                    $queryFilter->add($roleFilter);
+                }
+            }
+
+            if (! $obfuscationRules->isEmpty()) {
+                $flatvaluePath = $customVarRelationName
+                    ? $resolver->qualifyColumn('flatvalue', $customVarRelationName)
+                    : 'flatvalue';
+
+                $columns = $query->getColumns();
+                if (empty($columns)) {
+                    $columns = [
+                        $customVarRelationName
+                            ? $resolver->qualifyColumn('flatname', $customVarRelationName)
+                            : 'flatname',
+                        $flatvaluePath
+                    ];
+                }
+
+                $flatvalue = null;
+                if (isset($columns[$flatvaluePath])) {
+                    $flatvalue = $columns[$flatvaluePath];
+                } else {
+                    $flatvaluePathAt = array_search($flatvaluePath, $columns, true);
+                    if ($flatvaluePathAt !== false) {
+                        $flatvalue = $columns[$flatvaluePathAt];
+                        if (is_int($flatvaluePathAt)) {
+                            unset($columns[$flatvaluePathAt]);
+                        } else {
+                            $flatvaluePath = $flatvaluePathAt;
+                        }
+                    }
+                }
+
+                if ($flatvalue !== null) {
+                    // TODO: The four lines below are needed because there is still no way to postpone filter column
+                    //       qualification. (i.e. Just like the expression, filter rules need to be handled the same
+                    //       so that their columns are qualified lazily when assembling the query)
+                    $queryClone = clone $query;
+                    $queryClone->getSelectBase()->resetWhere();
+                    FilterProcessor::apply($obfuscationRules, $queryClone);
+                    $where = $queryClone->getSelectBase()->getWhere();
+
+                    $values = [];
+                    $rendered = $query->getDb()->getQueryBuilder()->buildCondition($where, $values);
+                    $columns[$flatvaluePath] = new Expression(
+                        "CASE WHEN (" . $rendered . ") THEN (%s) ELSE '***' END",
+                        [$flatvalue],
+                        ...$values
+                    );
+
+                    $query->columns($columns);
+                }
+            }
+
+            $query->filter($queryFilter);
+        }
+    }
+
+    /**
+     * Parse the given restriction
+     *
+     * @param string $queryString
+     * @param string $restriction The name of the restriction
+     *
+     * @return Filter\Rule
+     */
+    protected function parseRestriction(string $queryString, string $restriction): Filter\Rule
+    {
+        $allowedColumns = [
+            'host.name',
+            'hostgroup.name',
+            'host.user.name',
+            'host.usergroup.name',
+            'service.name',
+            'servicegroup.name',
+            'service.user.name',
+            'service.usergroup.name',
+            '(host|service).vars.<customvar-name>' => function ($c) {
+                return preg_match('/^(?:host|service)\.vars\./i', $c);
+            }
+        ];
+
+        return QueryString::fromString($queryString)
+            ->on(
+                QueryString::ON_CONDITION,
+                function (Filter\Condition $condition) use (
+                    $restriction,
+                    $queryString,
+                    $allowedColumns
+                ) {
+                    foreach ($allowedColumns as $column) {
+                        if (is_callable($column)) {
+                            if ($column($condition->getColumn())) {
+                                return;
+                            }
+                        } elseif ($column === $condition->getColumn()) {
+                            return;
+                        }
+                    }
+
+                    throw new ConfigurationError(
+                        t(
+                            'Cannot apply restriction %s using the filter %s.'
+                            . ' You can only use the following columns: %s'
+                        ),
+                        $restriction,
+                        $queryString,
+                        join(
+                            ', ',
+                            array_map(
+                                function ($k, $v) {
+                                    return is_string($k) ? $k : $v;
+                                },
+                                array_keys($allowedColumns),
+                                $allowedColumns
+                            )
+                        )
+                    );
+                }
+            )->parse();
+    }
+
+    /**
+     * Parse the given denylist
+     *
+     * @param string $denylist Comma separated list of column names
+     * @param string $column The column which should not equal any of the denylisted names
+     *
+     * @return Filter\None
+     */
+    protected function parseDenylist(string $denylist, string $column): Filter\None
+    {
+        $filter = Filter::none();
+        foreach (explode(',', $denylist) as $value) {
+            $filter->add(Filter::like($column, trim($value)));
+        }
+
+        return $filter;
+    }
+
+    /**
+     * Force query optimization on the given service/host filter rule
+     *
+     * Applies forceOptimization, when the given filter rule contains the given filter column
+     *
+     * @param Filter\Rule $filterRule
+     * @param string $filterColumn
+     *
+     * @return void
+     */
+    protected function forceQueryOptimization(Filter\Rule $filterRule, string $filterColumn)
+    {
+        // TODO: This is really a very poor solution is therefore only a quick fix.
+        //  We need to somehow manage to make this more enjoyable and creative!
+        if ($filterRule instanceof Filter\Chain) {
+            foreach ($filterRule as $rule) {
+                $this->forceQueryOptimization($rule, $filterColumn);
+            }
+        } elseif ($filterRule->getColumn() === $filterColumn) {
+            $filterRule->metaData()->set('forceOptimization', true);
+        }
+    }
+}
diff --git a/library/Icingadb/Common/BaseFilter.php b/library/Icingadb/Common/BaseFilter.php
new file mode 100644
index 0000000..10ddafe
--- /dev/null
+++ b/library/Icingadb/Common/BaseFilter.php
@@ -0,0 +1,50 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use ipl\Stdlib\Filter\Rule;
+
+/**
+ * @deprecated Use {@see \ipl\Stdlib\BaseFilter} instead. This will be removed with version 1.1
+ */
+trait BaseFilter
+{
+    /** @var Rule Base filter */
+    private $baseFilter;
+
+    /**
+     * Get whether a base filter has been set
+     *
+     * @return bool
+     */
+    public function hasBaseFilter(): bool
+    {
+        return $this->baseFilter !== null;
+    }
+
+    /**
+     * Get the base filter
+     *
+     * @return ?Rule
+     */
+    public function getBaseFilter()
+    {
+        return $this->baseFilter;
+    }
+
+    /**
+     * Set the base filter
+     *
+     * @param Rule $baseFilter
+     *
+     * @return $this
+     */
+    public function setBaseFilter(Rule $baseFilter = null): self
+    {
+        $this->baseFilter = $baseFilter;
+
+        return $this;
+    }
+}
diff --git a/library/Icingadb/Common/BaseItemList.php b/library/Icingadb/Common/BaseItemList.php
new file mode 100644
index 0000000..7eacb28
--- /dev/null
+++ b/library/Icingadb/Common/BaseItemList.php
@@ -0,0 +1,99 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use Icinga\Module\Icingadb\Widget\EmptyState;
+use InvalidArgumentException;
+use ipl\Html\BaseHtmlElement;
+
+/**
+ * Base class for item lists
+ */
+abstract class BaseItemList extends BaseHtmlElement
+{
+    use BaseFilter;
+    use DetailActions;
+
+    protected $baseAttributes = [
+        'class' => 'item-list',
+        'data-base-target' => '_next',
+        'data-pdfexport-page-breaks-at' => '.list-item'
+    ];
+
+    /** @var iterable */
+    protected $data;
+
+    /** @var bool Whether the list contains at least one item with an icon_image */
+    protected $hasIconImages = false;
+
+    protected $tag = 'ul';
+
+    /**
+     * Create a new item  list
+     *
+     * @param iterable $data Data source of the list
+     */
+    public function __construct($data)
+    {
+        if (! is_iterable($data)) {
+            throw new InvalidArgumentException('Data must be an array or an instance of Traversable');
+        }
+
+        $this->data = $data;
+
+        $this->addAttributes($this->baseAttributes);
+
+        $this->initializeDetailActions();
+        $this->init();
+    }
+
+    abstract protected function getItemClass(): string;
+
+    /**
+     * Get whether the list contains at least one item with an icon_image
+     *
+     * @return bool
+     */
+    public function hasIconImages(): bool
+    {
+        return $this->hasIconImages;
+    }
+
+    /**
+     * Set whether the list contains at least one item with an icon_image
+     *
+     * @param bool $hasIconImages
+     */
+    public function setHasIconImages(bool $hasIconImages)
+    {
+        $this->hasIconImages = $hasIconImages;
+    }
+
+    /**
+     * Initialize the item list
+     *
+     * If you want to adjust the item list after construction, override this method.
+     */
+    protected function init()
+    {
+    }
+
+    protected function assemble()
+    {
+        $itemClass = $this->getItemClass();
+
+        foreach ($this->data as $data) {
+            /** @var BaseListItem|BaseTableRowItem $item */
+            $item = new $itemClass($data, $this);
+
+            $this->add($item);
+        }
+
+        if ($this->isEmpty()) {
+            $this->setTag('div');
+            $this->add(new EmptyState(t('No items found.')));
+        }
+    }
+}
diff --git a/library/Icingadb/Common/BaseListItem.php b/library/Icingadb/Common/BaseListItem.php
new file mode 100644
index 0000000..c552bb6
--- /dev/null
+++ b/library/Icingadb/Common/BaseListItem.php
@@ -0,0 +1,165 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use Icinga\Module\Icingadb\Common\BaseItemList;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\Html;
+use ipl\Html\HtmlElement;
+use ipl\Stdlib\Filter\Rule;
+use ipl\Web\Filter\QueryString;
+
+/**
+ * Base class for list items
+ */
+abstract class BaseListItem extends BaseHtmlElement
+{
+    protected $baseAttributes = ['class' => 'list-item'];
+
+    /** @var object The associated list item */
+    protected $item;
+
+    /** @var BaseItemList The list where the item is part of */
+    protected $list;
+
+    protected $tag = 'li';
+
+    /**
+     * Create a new list item
+     *
+     * @param object       $item
+     * @param BaseItemList $list
+     */
+    public function __construct($item, BaseItemList $list)
+    {
+        $this->item = $item;
+        $this->list = $list;
+
+        $this->addAttributes($this->baseAttributes);
+
+        $this->init();
+    }
+
+    abstract protected function assembleHeader(BaseHtmlElement $header);
+
+    abstract protected function assembleMain(BaseHtmlElement $main);
+
+    protected function assembleFooter(BaseHtmlElement $footer)
+    {
+    }
+
+    protected function assembleCaption(BaseHtmlElement $caption)
+    {
+    }
+
+    protected function assembleIconImage(BaseHtmlElement $iconImage)
+    {
+    }
+
+    protected function assembleTitle(BaseHtmlElement $title)
+    {
+    }
+
+    protected function assembleVisual(BaseHtmlElement $visual)
+    {
+    }
+
+    protected function createCaption(): BaseHtmlElement
+    {
+        $caption = Html::tag('section', ['class' => 'caption']);
+
+        $this->assembleCaption($caption);
+
+        return $caption;
+    }
+
+    protected function createHeader(): BaseHtmlElement
+    {
+        $header = Html::tag('header');
+
+        $this->assembleHeader($header);
+
+        return $header;
+    }
+
+    protected function createMain(): BaseHtmlElement
+    {
+        $main = Html::tag('div', ['class' => 'main']);
+
+        $this->assembleMain($main);
+
+        return $main;
+    }
+
+    protected function createFooter(): BaseHtmlElement
+    {
+        $footer = new HtmlElement('footer');
+
+        $this->assembleFooter($footer);
+
+        return $footer;
+    }
+
+    /**
+     * @return ?BaseHtmlElement
+     */
+    protected function createIconImage()
+    {
+        if (! $this->list->hasIconImages()) {
+            return null;
+        }
+
+        $iconImage = HtmlElement::create('div', [
+            'class' => 'icon-image',
+        ]);
+
+        $this->assembleIconImage($iconImage);
+
+        return $iconImage;
+    }
+
+    protected function createTimestamp()
+    {
+    }
+
+    protected function createTitle(): BaseHtmlElement
+    {
+        $title = HTML::tag('div', ['class' => 'title']);
+
+        $this->assembleTitle($title);
+
+        return $title;
+    }
+
+    /**
+     * @return ?BaseHtmlElement
+     */
+    protected function createVisual()
+    {
+        $visual = Html::tag('div', ['class' => 'visual']);
+
+        $this->assembleVisual($visual);
+
+        return $visual;
+    }
+
+    /**
+     * Initialize the list item
+     *
+     * If you want to adjust the list item after construction, override this method.
+     */
+    protected function init()
+    {
+    }
+
+    protected function assemble()
+    {
+        $this->add([
+            $this->createVisual(),
+            $this->createIconImage(),
+            $this->createMain()
+        ]);
+    }
+}
diff --git a/library/Icingadb/Common/BaseOrderedItemList.php b/library/Icingadb/Common/BaseOrderedItemList.php
new file mode 100644
index 0000000..23ae7e9
--- /dev/null
+++ b/library/Icingadb/Common/BaseOrderedItemList.php
@@ -0,0 +1,34 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use Icinga\Module\Icingadb\Common\BaseItemList;
+use Icinga\Module\Icingadb\Widget\EmptyState;
+
+/**
+ * @method BaseOrderedListItem getItemClass()
+ */
+abstract class BaseOrderedItemList extends BaseItemList
+{
+    protected $tag = 'ol';
+
+    protected function assemble()
+    {
+        $itemClass = $this->getItemClass();
+
+        $i = 0;
+        foreach ($this->data as $data) {
+            $item = new $itemClass($data, $this);
+            $item->setOrder($i++);
+
+            $this->add($item);
+        }
+
+        if ($this->isEmpty()) {
+            $this->setTag('div');
+            $this->add(new EmptyState(t('No items found.')));
+        }
+    }
+}
diff --git a/library/Icingadb/Common/BaseOrderedListItem.php b/library/Icingadb/Common/BaseOrderedListItem.php
new file mode 100644
index 0000000..bf0f2b2
--- /dev/null
+++ b/library/Icingadb/Common/BaseOrderedListItem.php
@@ -0,0 +1,41 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+abstract class BaseOrderedListItem extends BaseListItem
+{
+    /** @var int This element's position */
+    protected $order;
+
+    /**
+     * Set this element's position
+     *
+     * @param int $order
+     *
+     * @return $this
+     */
+    public function setOrder(int $order): self
+    {
+        $this->order = $order;
+
+        return $this;
+    }
+
+    /**
+     * Get this element's position
+     *
+     * @return int
+     */
+    public function getOrder()
+    {
+        if ($this->order === null) {
+            throw new \LogicException(
+                'You are accessing an unset property. Please make sure to set it beforehand.'
+            );
+        }
+
+        return $this->order;
+    }
+}
diff --git a/library/Icingadb/Common/BaseStatusBar.php b/library/Icingadb/Common/BaseStatusBar.php
new file mode 100644
index 0000000..7339eb2
--- /dev/null
+++ b/library/Icingadb/Common/BaseStatusBar.php
@@ -0,0 +1,45 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\Html;
+
+abstract class BaseStatusBar extends BaseHtmlElement
+{
+    use BaseFilter;
+
+    protected $summary;
+
+    protected $tag = 'div';
+
+    protected $defaultAttributes = ['class' => 'status-bar'];
+
+    public function __construct($summary)
+    {
+        $this->summary = $summary;
+    }
+
+    abstract protected function assembleTotal(BaseHtmlElement $total);
+
+    abstract protected function createStateBadges(): BaseHtmlElement;
+
+    protected function createCount(): BaseHtmlElement
+    {
+        $total = Html::tag('span', ['class' => 'item-count']);
+
+        $this->assembleTotal($total);
+
+        return $total;
+    }
+
+    protected function assemble()
+    {
+        $this->add([
+            $this->createCount(),
+            $this->createStateBadges()
+        ]);
+    }
+}
diff --git a/library/Icingadb/Common/BaseTableRowItem.php b/library/Icingadb/Common/BaseTableRowItem.php
new file mode 100644
index 0000000..d3e0036
--- /dev/null
+++ b/library/Icingadb/Common/BaseTableRowItem.php
@@ -0,0 +1,102 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use Icinga\Module\Icingadb\Common\BaseItemList;
+use ipl\Html\Attributes;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\Html;
+use ipl\Html\HtmlDocument;
+use ipl\Html\HtmlElement;
+
+abstract class BaseTableRowItem extends BaseHtmlElement
+{
+    protected $baseAttributes = ['class' => 'list-item'];
+
+    /** @var object The associated list item */
+    protected $item;
+
+    /** @var BaseItemList The list where the item is part of */
+    protected $list;
+
+    protected $tag = 'li';
+
+    /**
+     * Create a new table row item
+     *
+     * @param object       $item
+     * @param BaseItemList $list
+     */
+    public function __construct($item, BaseItemList $list)
+    {
+        $this->item = $item;
+        $this->list = $list;
+
+        $this->addAttributes($this->baseAttributes);
+
+        $this->init();
+    }
+
+    abstract protected function assembleColumns(HtmlDocument $columns);
+
+    abstract protected function assembleTitle(BaseHtmlElement $title);
+
+    protected function assembleVisual(BaseHtmlElement $visual)
+    {
+    }
+
+    protected function createColumn($content = null): BaseHtmlElement
+    {
+        return Html::tag('div', ['class' => 'col'], $content);
+    }
+
+    protected function createColumns(): HtmlDocument
+    {
+        $columns = new HtmlDocument();
+
+        $this->assembleColumns($columns);
+
+        return $columns;
+    }
+
+    protected function createTitle(): BaseHtmlElement
+    {
+        $title = $this->createColumn()->addAttributes(['class' => 'title']);
+
+        $this->assembleTitle($title);
+
+        return $title;
+    }
+
+    /**
+     * @return ?BaseHtmlElement
+     */
+    protected function createVisual()
+    {
+        $visual = new HtmlElement('div', Attributes::create(['class' => 'visual']));
+
+        $this->assembleVisual($visual);
+
+        return $visual->isEmpty() ? null : $visual;
+    }
+
+    /**
+     * Initialize the list item
+     *
+     * If you want to adjust the list item after construction, override this method.
+     */
+    protected function init()
+    {
+    }
+
+    protected function assemble()
+    {
+        $this->add([
+            $this->createVisual(),
+            $this->createTitle(),
+            $this->createColumns()
+        ]);
+    }
+}
diff --git a/library/Icingadb/Common/CaptionDisabled.php b/library/Icingadb/Common/CaptionDisabled.php
new file mode 100644
index 0000000..26344c5
--- /dev/null
+++ b/library/Icingadb/Common/CaptionDisabled.php
@@ -0,0 +1,30 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+trait CaptionDisabled
+{
+    protected $captionDisabled = false;
+
+    /**
+     * @return bool
+     */
+    public function isCaptionDisabled(): bool
+    {
+        return $this->captionDisabled;
+    }
+
+    /**
+     * @param bool $captionDisabled
+     *
+     * @return $this
+     */
+    public function setCaptionDisabled(bool $captionDisabled = true): self
+    {
+        $this->captionDisabled = $captionDisabled;
+
+        return $this;
+    }
+}
diff --git a/library/Icingadb/Common/CommandActions.php b/library/Icingadb/Common/CommandActions.php
new file mode 100644
index 0000000..3283964
--- /dev/null
+++ b/library/Icingadb/Common/CommandActions.php
@@ -0,0 +1,254 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use GuzzleHttp\Psr7\ServerRequest;
+use Icinga\Module\Icingadb\Forms\Command\CommandForm;
+use Icinga\Module\Icingadb\Forms\Command\Object\AcknowledgeProblemForm;
+use Icinga\Module\Icingadb\Forms\Command\Object\AddCommentForm;
+use Icinga\Module\Icingadb\Forms\Command\Object\CheckNowForm;
+use Icinga\Module\Icingadb\Forms\Command\Object\ProcessCheckResultForm;
+use Icinga\Module\Icingadb\Forms\Command\Object\RemoveAcknowledgementForm;
+use Icinga\Module\Icingadb\Forms\Command\Object\ScheduleCheckForm;
+use Icinga\Module\Icingadb\Forms\Command\Object\ScheduleHostDowntimeForm;
+use Icinga\Module\Icingadb\Forms\Command\Object\ScheduleServiceDowntimeForm;
+use Icinga\Module\Icingadb\Forms\Command\Object\SendCustomNotificationForm;
+use Icinga\Module\Icingadb\Forms\Command\Object\ToggleObjectFeaturesForm;
+use Icinga\Security\SecurityException;
+use ipl\Orm\Model;
+use ipl\Orm\Query;
+use ipl\Web\Url;
+
+/**
+ * Trait CommandActions
+ */
+trait CommandActions
+{
+    /** @var Query $commandTargets */
+    protected $commandTargets;
+
+    /** @var Model $commandTargetModel */
+    protected $commandTargetModel;
+
+    /**
+     * Get url to view command targets, used as redirection target
+     *
+     * @return Url
+     */
+    abstract protected function getCommandTargetsUrl(): Url;
+
+    /**
+     * Get status of toggleable features
+     *
+     * @return object
+     */
+    protected function getFeatureStatus()
+    {
+    }
+
+    /**
+     * Fetch command targets
+     *
+     * @return Query|Model[]
+     */
+    abstract protected function fetchCommandTargets();
+
+    /**
+     * Get command targets
+     *
+     * @return Query|Model[]
+     */
+    protected function getCommandTargets()
+    {
+        if (! isset($this->commandTargets)) {
+            $this->commandTargets = $this->fetchCommandTargets();
+        }
+
+        return $this->commandTargets;
+    }
+
+    /**
+     * Get the model of the command targets
+     *
+     * @return Model
+     */
+    protected function getCommandTargetModel(): Model
+    {
+        if (! isset($this->commandTargetModel)) {
+            $commandTargets = $this->getCommandTargets();
+            if (is_array($commandTargets) && !empty($commandTargets)) {
+                $this->commandTargetModel = $commandTargets[0];
+            } else {
+                $this->commandTargetModel = $commandTargets->getModel();
+            }
+        }
+
+        return $this->commandTargetModel;
+    }
+
+    /**
+     * Check whether the permission is granted on any of the command targets
+     *
+     * @param string $permission
+     *
+     * @return bool
+     */
+    protected function isGrantedOnCommandTargets(string $permission): bool
+    {
+        $commandTargets = $this->getCommandTargets();
+        if (is_array($commandTargets)) {
+            foreach ($commandTargets as $commandTarget) {
+                if ($this->isGrantedOn($permission, $commandTarget)) {
+                    return true;
+                }
+            }
+
+            return false;
+        }
+
+        return $this->isGrantedOnType(
+            $permission,
+            $this->getCommandTargetModel()->getTableName(),
+            $commandTargets->getFilter()
+        );
+    }
+
+    /**
+     * Assert that the permission is granted on any of the command targets
+     *
+     * @param string $permission
+     *
+     * @throws SecurityException
+     */
+    protected function assertIsGrantedOnCommandTargets(string $permission)
+    {
+        if (! $this->isGrantedOnCommandTargets($permission)) {
+            throw new SecurityException('No permission for %s', $permission);
+        }
+    }
+
+    /**
+     * Handle and register the given command form
+     *
+     * @param string|CommandForm $form
+     *
+     * @return void
+     */
+    protected function handleCommandForm($form)
+    {
+        if (is_string($form)) {
+            /** @var \Icinga\Module\Icingadb\Forms\Command\CommandForm $form */
+            $form = new $form();
+        }
+
+        $actionUrl = $this->getRequest()->getUrl();
+        if ($this->view->compact) {
+            $actionUrl = clone $actionUrl;
+            // TODO: This solves https://github.com/Icinga/icingadb-web/issues/124 but I'd like to omit this
+            // entirely. I think it should be solved like https://github.com/Icinga/icingaweb2/pull/4300 so
+            // that a request's url object still has params like showCompact and _dev
+            $actionUrl->getParams()->add('showCompact', true);
+        }
+
+        $form->setAction($actionUrl->getAbsoluteUrl());
+        $form->setObjects($this->getCommandTargets());
+        $form->on($form::ON_SUCCESS, function () {
+            // This forces the column to reload nearly instantly after the redirect
+            // and ensures the effect of the command is visible to the user asap
+            $this->getResponse()->setAutoRefreshInterval(1);
+
+            $this->redirectNow($this->getCommandTargetsUrl());
+        });
+
+        $form->handleRequest(ServerRequest::fromGlobals());
+
+        $this->addContent($form);
+    }
+
+    public function acknowledgeAction()
+    {
+        $this->assertIsGrantedOnCommandTargets('icingadb/command/acknowledge-problem');
+        $this->setTitle(t('Acknowledge Problem'));
+        $this->handleCommandForm(AcknowledgeProblemForm::class);
+    }
+
+    public function addCommentAction()
+    {
+        $this->assertIsGrantedOnCommandTargets('icingadb/command/comment/add');
+        $this->setTitle(t('Add Comment'));
+        $this->handleCommandForm(AddCommentForm::class);
+    }
+
+    public function checkNowAction()
+    {
+        if (! $this->isGrantedOnCommandTargets('icingadb/command/schedule-check/active-only')) {
+            $this->assertIsGrantedOnCommandTargets('icingadb/command/schedule-check');
+        }
+
+        $this->handleCommandForm(CheckNowForm::class);
+    }
+
+    public function processCheckresultAction()
+    {
+        $this->assertIsGrantedOnCommandTargets('icingadb/command/process-check-result');
+        $this->setTitle(t('Submit Passive Check Result'));
+        $this->handleCommandForm(ProcessCheckResultForm::class);
+    }
+
+    public function removeAcknowledgementAction()
+    {
+        $this->assertIsGrantedOnCommandTargets('icingadb/command/remove-acknowledgement');
+        $this->handleCommandForm(RemoveAcknowledgementForm::class);
+    }
+
+    public function scheduleCheckAction()
+    {
+        if (! $this->isGrantedOnCommandTargets('icingadb/command/schedule-check/active-only')) {
+            $this->assertIsGrantedOnCommandTargets('icingadb/command/schedule-check');
+        }
+
+        $this->setTitle(t('Reschedule Check'));
+        $this->handleCommandForm(ScheduleCheckForm::class);
+    }
+
+    public function scheduleDowntimeAction()
+    {
+        $this->assertIsGrantedOnCommandTargets('icingadb/command/downtime/schedule');
+
+        switch ($this->getCommandTargetModel()->getTableName()) {
+            case 'host':
+                $this->setTitle(t('Schedule Host Downtime'));
+                $this->handleCommandForm(ScheduleHostDowntimeForm::class);
+                break;
+            case 'service':
+                $this->setTitle(t('Schedule Service Downtime'));
+                $this->handleCommandForm(ScheduleServiceDowntimeForm::class);
+                break;
+        }
+    }
+
+    public function sendCustomNotificationAction()
+    {
+        $this->assertIsGrantedOnCommandTargets('icingadb/command/send-custom-notification');
+        $this->setTitle(t('Send Custom Notification'));
+        $this->handleCommandForm(SendCustomNotificationForm::class);
+    }
+
+    public function toggleFeaturesAction()
+    {
+        $commandObjects = $this->getCommandTargets();
+        if (count($commandObjects) > 1) {
+            $this->isGrantedOnCommandTargets('i/am-only-used/to-establish/the-object-auth-cache');
+            $form = new ToggleObjectFeaturesForm($this->getFeatureStatus());
+        } else {
+            foreach ($commandObjects as $object) {
+                // There's only a single result, a foreach is the most compatible way to retrieve the object
+                $form = new ToggleObjectFeaturesForm($object);
+            }
+        }
+
+        $this->handleCommandForm($form);
+    }
+}
diff --git a/library/Icingadb/Common/Database.php b/library/Icingadb/Common/Database.php
new file mode 100644
index 0000000..8fa87cc
--- /dev/null
+++ b/library/Icingadb/Common/Database.php
@@ -0,0 +1,102 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use Icinga\Application\Config as AppConfig;
+use Icinga\Data\ResourceFactory;
+use Icinga\Exception\ConfigurationError;
+use ipl\Sql\Adapter\Pgsql;
+use ipl\Sql\Config as SqlConfig;
+use ipl\Sql\Connection;
+use ipl\Sql\Expression;
+use ipl\Sql\QueryBuilder;
+use ipl\Sql\Select;
+use PDO;
+
+trait Database
+{
+    /** @var Connection Connection to the Icinga database */
+    private $db;
+
+    /**
+     * Get the connection to the Icinga database
+     *
+     * @return Connection
+     *
+     * @throws ConfigurationError If the related resource configuration does not exist
+     */
+    public function getDb(): Connection
+    {
+        if ($this->db === null) {
+            $config = new SqlConfig(ResourceFactory::getResourceConfig(
+                AppConfig::module('icingadb')->get('icingadb', 'resource')
+            ));
+
+            $config->options = [PDO::ATTR_DEFAULT_FETCH_MODE => PDO::FETCH_OBJ];
+            if ($config->db === 'mysql') {
+                $config->options[PDO::MYSQL_ATTR_INIT_COMMAND] = "SET SESSION SQL_MODE='STRICT_TRANS_TABLES"
+                    . ",NO_ZERO_IN_DATE,NO_ZERO_DATE,ERROR_FOR_DIVISION_BY_ZERO,NO_ENGINE_SUBSTITUTION'";
+            }
+
+            $this->db = new Connection($config);
+
+            $adapter = $this->db->getAdapter();
+            if ($adapter instanceof Pgsql) {
+                $quoted = $adapter->quoteIdentifier('user');
+                $this->db->getQueryBuilder()
+                    ->on(QueryBuilder::ON_SELECT_ASSEMBLED, function (&$sql) use ($quoted) {
+                        // user is a reserved key word in PostgreSQL, so we need to quote it.
+                        // TODO(lippserd): This is pretty hacky,
+                        // reconsider how to properly implement identifier quoting.
+                        $sql = str_replace(' user ', sprintf(' %s ', $quoted), $sql);
+                        $sql = str_replace(' user.', sprintf(' %s.', $quoted), $sql);
+                        $sql = str_replace('(user.', sprintf('(%s.', $quoted), $sql);
+                    })
+                    ->on(QueryBuilder::ON_ASSEMBLE_SELECT, function (Select $select) {
+                        // For SELECT DISTINCT, all ORDER BY columns must appear in SELECT list.
+                        if (! $select->getDistinct() || ! $select->hasOrderBy()) {
+                            return;
+                        }
+
+                        $candidates = [];
+                        foreach ($select->getOrderBy() as list($columnOrAlias, $_)) {
+                            if ($columnOrAlias instanceof Expression) {
+                                // Expressions can be and include anything,
+                                // also columns that aren't already part of the SELECT list,
+                                // so we're not trying to guess anything here.
+                                // Such expressions must be in the SELECT list if necessary and
+                                // referenced manually with an alias in ORDER BY.
+                                continue;
+                            }
+
+                            $candidates[$columnOrAlias] = true;
+                        }
+
+                        foreach ($select->getColumns() as $alias => $column) {
+                            if (is_int($alias)) {
+                                if ($column instanceof Expression) {
+                                    // This is the complement to the above consideration.
+                                    // If it is an unaliased expression, ignore it.
+                                    continue;
+                                }
+                            } else {
+                                unset($candidates[$alias]);
+                            }
+
+                            if (! $column instanceof Expression) {
+                                unset($candidates[$column]);
+                            }
+                        }
+
+                        if (! empty($candidates)) {
+                            $select->columns(array_keys($candidates));
+                        }
+                    });
+            }
+        }
+
+        return $this->db;
+    }
+}
diff --git a/library/Icingadb/Common/DetailActions.php b/library/Icingadb/Common/DetailActions.php
new file mode 100644
index 0000000..3b8e0e6
--- /dev/null
+++ b/library/Icingadb/Common/DetailActions.php
@@ -0,0 +1,140 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use ipl\Html\BaseHtmlElement;
+use ipl\Stdlib\Filter;
+use ipl\Web\Filter\QueryString;
+use ipl\Web\Url;
+
+trait DetailActions
+{
+    /** @var bool */
+    protected $detailActionsDisabled = false;
+
+    /**
+     * Set whether this list should be an action-list
+     *
+     * @param bool $state
+     *
+     * @return $this
+     */
+    public function setDetailActionsDisabled(bool $state = true): self
+    {
+        $this->detailActionsDisabled = $state;
+
+        return $this;
+    }
+
+    /**
+     * Get whether this list should be an action-list
+     *
+     * @return bool
+     */
+    public function getDetailActionsDisabled(): bool
+    {
+        return $this->detailActionsDisabled;
+    }
+
+    /**
+     * Prepare this list as action-list
+     *
+     * @return $this
+     */
+    public function initializeDetailActions(): self
+    {
+        $this->getAttributes()
+            ->registerAttributeCallback('class', function () {
+                return $this->getDetailActionsDisabled() ? null : 'action-list';
+            })
+            ->registerAttributeCallback('data-icinga-multiselect-count-label', function () {
+                return $this->getDetailActionsDisabled() ? null : t('%d Item(s) selected');
+            });
+
+        return $this;
+    }
+
+    /**
+     * Set the url to use for multiple selected list items
+     *
+     * @param Url $url
+     *
+     * @return $this
+     */
+    protected function setMultiselectUrl(Url $url): self
+    {
+        /** @var BaseHtmlElement $this */
+        $this->getAttributes()
+            ->registerAttributeCallback('data-icinga-multiselect-url', function () use ($url) {
+                return $this->getDetailActionsDisabled() ? null : (string) $url;
+            });
+
+        return $this;
+    }
+
+    /**
+     * Set the url to use for a single selected list item
+     *
+     * @param Url $url
+     *
+     * @return $this
+     */
+    protected function setDetailUrl(Url $url): self
+    {
+        /** @var BaseHtmlElement $this */
+        $this->getAttributes()
+            ->registerAttributeCallback('data-icinga-detail-url', function () use ($url) {
+                return $this->getDetailActionsDisabled() ? null : (string) $url;
+            });
+
+        return $this;
+    }
+
+    /**
+     * Associate the given element with the given multi-selection filter
+     *
+     * @param BaseHtmlElement $element
+     * @param Filter\Rule $filter
+     *
+     * @return $this
+     */
+    public function addMultiselectFilterAttribute(BaseHtmlElement $element, Filter\Rule $filter): self
+    {
+        $element->getAttributes()
+            ->registerAttributeCallback('data-icinga-multiselect-filter', function () use ($filter) {
+                if ($this->getDetailActionsDisabled()) {
+                    return null;
+                }
+
+                $queryString = QueryString::render($filter);
+                if ($filter instanceof Filter\Chain) {
+                    $queryString = '(' . $queryString . ')';
+                }
+
+                return $queryString;
+            });
+
+        return $this;
+    }
+
+    /**
+     * Associate the given element with the given single-selection filter
+     *
+     * @param BaseHtmlElement $element
+     * @param Filter\Rule $filter
+     *
+     * @return $this
+     */
+    public function addDetailFilterAttribute(BaseHtmlElement $element, Filter\Rule $filter): self
+    {
+        $element->getAttributes()
+            ->set('data-action-item', true)
+            ->registerAttributeCallback('data-icinga-detail-filter', function () use ($filter) {
+                return $this->getDetailActionsDisabled() ? null : QueryString::render($filter);
+            });
+
+        return $this;
+    }
+}
diff --git a/library/Icingadb/Common/HostLink.php b/library/Icingadb/Common/HostLink.php
new file mode 100644
index 0000000..3387220
--- /dev/null
+++ b/library/Icingadb/Common/HostLink.php
@@ -0,0 +1,27 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use Icinga\Module\Icingadb\Model\Host;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\Html;
+use ipl\Web\Widget\StateBall;
+
+trait HostLink
+{
+    protected function createHostLink(Host $host, bool $withStateBall = false): BaseHtmlElement
+    {
+        $content = [];
+
+        if ($withStateBall) {
+            $content[] = new StateBall($host->state->getStateText(), StateBall::SIZE_MEDIUM);
+            $content[] = ' ';
+        }
+
+        $content[] = $host->display_name;
+
+        return Html::tag('a', ['href' => Links::host($host), 'class' => 'subject'], $content);
+    }
+}
diff --git a/library/Icingadb/Common/HostLinks.php b/library/Icingadb/Common/HostLinks.php
new file mode 100644
index 0000000..e8f2880
--- /dev/null
+++ b/library/Icingadb/Common/HostLinks.php
@@ -0,0 +1,76 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use Icinga\Module\Icingadb\Model\Host;
+use ipl\Web\Url;
+
+abstract class HostLinks
+{
+    public static function acknowledge(Host $host): Url
+    {
+        return Url::fromPath('icingadb/host/acknowledge', ['name' => $host->name]);
+    }
+
+    public static function addComment(Host $host): Url
+    {
+        return Url::fromPath('icingadb/host/add-comment', ['name' => $host->name]);
+    }
+
+    public static function checkNow(Host $host): Url
+    {
+        return Url::fromPath('icingadb/host/check-now', ['name' => $host->name]);
+    }
+
+    public static function scheduleCheck(Host $host): Url
+    {
+        return Url::fromPath('icingadb/host/schedule-check', ['name' => $host->name]);
+    }
+
+    public static function comments(Host $host): Url
+    {
+        return Url::fromPath('icingadb/comments', ['host.name' => $host->name]);
+    }
+
+    public static function downtimes(Host $host): Url
+    {
+        return Url::fromPath('icingadb/downtimes', ['host.name' => $host->name]);
+    }
+
+    public static function history(Host $host): Url
+    {
+        return Url::fromPath('icingadb/host/history', ['name' => $host->name]);
+    }
+
+    public static function removeAcknowledgement(Host $host): Url
+    {
+        return Url::fromPath('icingadb/host/remove-acknowledgement', ['name' => $host->name]);
+    }
+
+    public static function scheduleDowntime(Host $host): Url
+    {
+        return Url::fromPath('icingadb/host/schedule-downtime', ['name' => $host->name]);
+    }
+
+    public static function sendCustomNotification(Host $host): Url
+    {
+        return Url::fromPath('icingadb/host/send-custom-notification', ['name' => $host->name]);
+    }
+
+    public static function processCheckresult(Host $host): Url
+    {
+        return Url::fromPath('icingadb/host/process-checkresult', ['name' => $host->name]);
+    }
+
+    public static function toggleFeatures(Host $host): Url
+    {
+        return Url::fromPath('icingadb/host/toggle-features', ['name' => $host->name]);
+    }
+
+    public static function services(Host $host): Url
+    {
+        return Url::fromPath('icingadb/host/services', ['name' => $host->name]);
+    }
+}
diff --git a/library/Icingadb/Common/HostStates.php b/library/Icingadb/Common/HostStates.php
new file mode 100644
index 0000000..b3a9473
--- /dev/null
+++ b/library/Icingadb/Common/HostStates.php
@@ -0,0 +1,118 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+/**
+ * Collection of possible host states.
+ */
+class HostStates
+{
+    const UP = 0;
+
+    const DOWN = 1;
+
+    const UNREACHABLE = 2;
+
+    const PENDING = 99;
+
+    /**
+     * Get the integer value of the given textual host state
+     *
+     * @param string $state
+     *
+     * @return int
+     *
+     * @throws \InvalidArgumentException If the given host state is invalid, i.e. not known
+     */
+    public static function int(string $state): int
+    {
+        switch (strtolower($state)) {
+            case 'up':
+                $int = self::UP;
+                break;
+            case 'down':
+                $int = self::DOWN;
+                break;
+            case 'unreachable':
+                $int = self::UNREACHABLE;
+                break;
+            case 'pending':
+                $int = self::PENDING;
+                break;
+            default:
+                throw new \InvalidArgumentException(sprintf('Invalid host state %d', $state));
+        }
+
+        return $int;
+    }
+
+    /**
+     * Get the textual representation of the passed host state
+     *
+     * @param int|null $state
+     *
+     * @return string
+     *
+     * @throws \InvalidArgumentException If the given host state is invalid, i.e. not known
+     */
+    public static function text(int $state = null): string
+    {
+        switch (true) {
+            case $state === self::UP:
+                $text = 'up';
+                break;
+            case $state === self::DOWN:
+                $text = 'down';
+                break;
+            case $state === self::UNREACHABLE:
+                $text = 'unreachable';
+                break;
+            case $state === self::PENDING:
+                $text = 'pending';
+                break;
+            case $state === null:
+                $text = 'not-available';
+                break;
+            default:
+                throw new \InvalidArgumentException(sprintf('Invalid host state %d', $state));
+        }
+
+        return $text;
+    }
+
+    /**
+     * Get the translated textual representation of the passed host state
+     *
+     * @param int|null $state
+     *
+     * @return string
+     *
+     * @throws \InvalidArgumentException If the given host state is invalid, i.e. not known
+     */
+    public static function translated(int $state = null): string
+    {
+        switch (true) {
+            case $state === self::UP:
+                $text = t('up');
+                break;
+            case $state === self::DOWN:
+                $text = t('down');
+                break;
+            case $state === self::UNREACHABLE:
+                $text = t('unreachable');
+                break;
+            case $state === self::PENDING:
+                $text = t('pending');
+                break;
+            case $state === null:
+                $text = t('not available');
+                break;
+            default:
+                throw new \InvalidArgumentException(sprintf('Invalid host state %d', $state));
+        }
+
+        return $text;
+    }
+}
diff --git a/library/Icingadb/Common/IcingaRedis.php b/library/Icingadb/Common/IcingaRedis.php
new file mode 100644
index 0000000..9473b8c
--- /dev/null
+++ b/library/Icingadb/Common/IcingaRedis.php
@@ -0,0 +1,236 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use Exception;
+use Icinga\Application\Config;
+use Icinga\Application\Logger;
+use Predis\Client as Redis;
+
+class IcingaRedis
+{
+    /** @var static The singleton */
+    protected static $instance;
+
+    /** @var Redis Connection to the Icinga Redis */
+    private $redis;
+
+    /** @var bool true if no connection attempt was successful */
+    private $redisUnavailable = false;
+
+    /**
+     * Get the singleton
+     *
+     * @return static
+     */
+    public static function instance(): self
+    {
+        if (self::$instance === null) {
+            self::$instance = new static();
+        }
+
+        return self::$instance;
+    }
+
+    /**
+     * Get the connection to the Icinga Redis
+     *
+     * @return Redis
+     *
+     * @throws Exception
+     */
+    public function getConnection(): Redis
+    {
+        if ($this->redisUnavailable) {
+            throw new Exception('Redis is still not available');
+        } elseif ($this->redis === null) {
+            try {
+                $primaryRedis = $this->getPrimaryRedis();
+            } catch (Exception $e) {
+                try {
+                    $secondaryRedis = $this->getSecondaryRedis();
+                } catch (Exception $ee) {
+                    $this->redisUnavailable = true;
+                    Logger::error($ee);
+
+                    throw $e;
+                }
+
+                if ($secondaryRedis === null) {
+                    $this->redisUnavailable = true;
+
+                    throw $e;
+                }
+
+                $this->redis = $secondaryRedis;
+
+                return $this->redis;
+            }
+
+            $primaryTimestamp = $this->getLastIcingaHeartbeat($primaryRedis);
+
+            if ($primaryTimestamp <= time() - 60) {
+                $secondaryRedis = $this->getSecondaryRedis();
+
+                if ($secondaryRedis === null) {
+                    $this->redis = $primaryRedis;
+
+                    return $this->redis;
+                }
+
+                $secondaryTimestamp = $this->getLastIcingaHeartbeat($secondaryRedis);
+
+                if ($secondaryTimestamp > $primaryTimestamp) {
+                    $this->redis = $secondaryRedis;
+                } else {
+                    $this->redis = $primaryRedis;
+                }
+            } else {
+                $this->redis = $primaryRedis;
+            }
+        }
+
+        return $this->redis;
+    }
+
+    /**
+     * Get the last icinga heartbeat from redis
+     *
+     * @param Redis|null $redis
+     *
+     * @return ?float|int
+     */
+    public static function getLastIcingaHeartbeat(Redis $redis = null)
+    {
+        if ($redis === null) {
+            $redis = self::instance()->getConnection();
+        }
+
+        // Predis doesn't support streams (yet).
+        // https://github.com/predis/predis/issues/607#event-3640855190
+        $rs = $redis->executeRaw(['XREAD', 'COUNT', '1', 'STREAMS', 'icinga:stats', '0']);
+
+        if (! is_array($rs)) {
+            return null;
+        }
+
+        $key = null;
+
+        foreach ($rs[0][1][0][1] as $kv) {
+            if ($key === null) {
+                $key = $kv;
+            } else {
+                if ($key === 'timestamp') {
+                    return $kv / 1000;
+                }
+
+                $key = null;
+            }
+        }
+
+        return null;
+    }
+
+    /**
+     * Get the primary redis instance
+     *
+     * @param Config|null $moduleConfig
+     * @param Config|null $redisConfig
+     *
+     * @return Redis
+     */
+    public static function getPrimaryRedis(Config $moduleConfig = null, Config $redisConfig = null): Redis
+    {
+        if ($moduleConfig === null) {
+            $moduleConfig = Config::module('icingadb');
+        }
+
+        if ($redisConfig === null) {
+            $redisConfig = Config::module('icingadb', 'redis');
+        }
+
+        $section = $redisConfig->getSection('redis1');
+
+        $redis = new Redis([
+            'host'      => $section->get('host', 'localhost'),
+            'port'      => $section->get('port', 6380),
+            'password'  => $section->get('password', ''),
+            'timeout'   => 0.5
+        ] + static::getTlsParams($moduleConfig));
+
+        $redis->ping();
+
+        return $redis;
+    }
+
+    /**
+     * Get the secondary redis instance if exists
+     *
+     * @param Config|null $moduleConfig
+     * @param Config|null $redisConfig
+     *
+     * @return ?Redis
+     */
+    public static function getSecondaryRedis(Config $moduleConfig = null, Config $redisConfig = null)
+    {
+        if ($moduleConfig === null) {
+            $moduleConfig = Config::module('redis');
+        }
+
+        if ($redisConfig === null) {
+            $redisConfig = Config::module('icingadb', 'redis');
+        }
+
+        $section = $redisConfig->getSection('redis2');
+        $host = $section->host;
+
+        if (empty($host)) {
+            return null;
+        }
+
+        $redis = new Redis([
+            'host'      => $host,
+            'port'      => $section->get('port', 6380),
+            'password'  => $section->get('password', ''),
+            'timeout'   => 0.5
+        ] + static::getTlsParams($moduleConfig));
+
+        $redis->ping();
+
+        return $redis;
+    }
+
+    private static function getTlsParams(Config $config): array
+    {
+        $config = $config->getSection('redis');
+
+        if (! $config->get('tls', false)) {
+            return [];
+        }
+
+        $ssl = [];
+
+        if ($config->get('insecure')) {
+            $ssl['verify_peer'] = false;
+            $ssl['verify_peer_name'] = false;
+        } else {
+            $ca = $config->get('ca');
+
+            if ($ca !== null) {
+                $ssl['cafile'] = $ca;
+            }
+        }
+
+        $cert = $config->get('cert');
+        $key = $config->get('key');
+
+        if ($cert !== null && $key !== null) {
+            $ssl['local_cert'] = $cert;
+            $ssl['local_pk'] = $key;
+        }
+
+        return ['scheme' => 'tls', 'ssl' => $ssl];
+    }
+}
diff --git a/library/Icingadb/Common/Icons.php b/library/Icingadb/Common/Icons.php
new file mode 100644
index 0000000..cac9f32
--- /dev/null
+++ b/library/Icingadb/Common/Icons.php
@@ -0,0 +1,30 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+class Icons
+{
+    const COMMENT = 'comment';
+
+    const HOST_DOWN = 'sitemap';
+
+    const IN_DOWNTIME = 'plug';
+
+    const IS_ACKNOWLEDGED = 'check';
+
+    const IS_FLAPPING = 'bolt';
+
+    const IS_PERSISTENT = 'thumbtack';
+
+    const NOTIFICATION = 'bell';
+
+    const REMOVE = 'trash';
+
+    const USER = 'user';
+
+    const USERGROUP = 'users';
+
+    const WARNING = 'exclamation-triangle';
+}
diff --git a/library/Icingadb/Common/Links.php b/library/Icingadb/Common/Links.php
new file mode 100644
index 0000000..5968e5f
--- /dev/null
+++ b/library/Icingadb/Common/Links.php
@@ -0,0 +1,143 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use Icinga\Module\Icingadb\Model\Comment;
+use Icinga\Module\Icingadb\Model\Downtime;
+use Icinga\Module\Icingadb\Model\History;
+use Icinga\Module\Icingadb\Model\Host;
+use Icinga\Module\Icingadb\Model\NotificationHistory;
+use Icinga\Module\Icingadb\Model\Service;
+use Icinga\Module\Icingadb\Model\User;
+use Icinga\Module\Icingadb\Model\Usergroup;
+use ipl\Web\Url;
+
+abstract class Links
+{
+    public static function comment(Comment $comment): Url
+    {
+        return Url::fromPath('icingadb/comment', ['name' => $comment->name]);
+    }
+
+    public static function comments(): Url
+    {
+        return Url::fromPath('icingadb/comments');
+    }
+
+    public static function commentsDelete(): Url
+    {
+        return Url::fromPath('icingadb/comments/delete');
+    }
+
+    public static function commentsDetails(): Url
+    {
+        return Url::fromPath('icingadb/comments/details');
+    }
+
+    public static function downtime(Downtime $downtime): Url
+    {
+        return Url::fromPath('icingadb/downtime', ['name' => $downtime->name]);
+    }
+
+    public static function downtimes(): Url
+    {
+        return Url::fromPath('icingadb/downtimes');
+    }
+
+    public static function downtimesDelete(): Url
+    {
+        return Url::fromPath('icingadb/downtimes/delete');
+    }
+
+    public static function downtimesDetails(): Url
+    {
+        return Url::fromPath('icingadb/downtimes/details');
+    }
+
+    public static function host(Host $host): Url
+    {
+        return Url::fromPath('icingadb/host', ['name' => $host->name]);
+    }
+
+    public static function hostSource(Host $host): Url
+    {
+        return Url::fromPath('icingadb/host/source', ['name' => $host->name]);
+    }
+
+    public static function hostsDetails(): Url
+    {
+        return Url::fromPath('icingadb/hosts/details');
+    }
+
+    public static function hostgroup($hostgroup): Url
+    {
+        return Url::fromPath('icingadb/hostgroup', ['name' => $hostgroup->name]);
+    }
+
+    public static function hosts(): Url
+    {
+        return Url::fromPath('icingadb/hosts');
+    }
+
+    public static function service(Service $service, Host $host): Url
+    {
+        return Url::fromPath('icingadb/service', ['name' => $service->name, 'host.name' => $host->name]);
+    }
+
+    public static function serviceSource(Service $service, Host $host): Url
+    {
+        return Url::fromPath('icingadb/service/source', ['name' => $service->name, 'host.name' => $host->name]);
+    }
+
+    public static function servicesDetails(): Url
+    {
+        return Url::fromPath('icingadb/services/details');
+    }
+
+    public static function servicegroup($servicegroup): Url
+    {
+        return Url::fromPath('icingadb/servicegroup', ['name' => $servicegroup->name]);
+    }
+
+    public static function services(): Url
+    {
+        return Url::fromPath('icingadb/services');
+    }
+
+    public static function toggleHostsFeatures(): Url
+    {
+        return Url::fromPath('icingadb/hosts/toggle-features');
+    }
+
+    public static function toggleServicesFeatures(): Url
+    {
+        return Url::fromPath('icingadb/services/toggle-features');
+    }
+
+    public static function user(User $user): Url
+    {
+        return Url::fromPath('icingadb/user', ['name' => $user->name]);
+    }
+
+    public static function usergroup(Usergroup $usergroup): Url
+    {
+        return Url::fromPath('icingadb/usergroup', ['name' => $usergroup->name]);
+    }
+
+    public static function users(): Url
+    {
+        return Url::fromPath('icingadb/users');
+    }
+
+    public static function usergroups(): Url
+    {
+        return Url::fromPath('icingadb/usergroups');
+    }
+
+    public static function event(History $event): Url
+    {
+        return Url::fromPath('icingadb/event', ['id' => bin2hex($event->id)]);
+    }
+}
diff --git a/library/Icingadb/Common/ListItemCommonLayout.php b/library/Icingadb/Common/ListItemCommonLayout.php
new file mode 100644
index 0000000..4777c7c
--- /dev/null
+++ b/library/Icingadb/Common/ListItemCommonLayout.php
@@ -0,0 +1,26 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use ipl\Html\BaseHtmlElement;
+
+trait ListItemCommonLayout
+{
+    use CaptionDisabled;
+
+    protected function assembleHeader(BaseHtmlElement $header)
+    {
+        $header->add($this->createTitle());
+        $header->add($this->createTimestamp());
+    }
+
+    protected function assembleMain(BaseHtmlElement $main)
+    {
+        $main->add($this->createHeader());
+        if (! $this->isCaptionDisabled()) {
+            $main->add($this->createCaption());
+        }
+    }
+}
diff --git a/library/Icingadb/Common/ListItemDetailedLayout.php b/library/Icingadb/Common/ListItemDetailedLayout.php
new file mode 100644
index 0000000..3db91a3
--- /dev/null
+++ b/library/Icingadb/Common/ListItemDetailedLayout.php
@@ -0,0 +1,23 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use ipl\Html\BaseHtmlElement;
+
+trait ListItemDetailedLayout
+{
+    protected function assembleHeader(BaseHtmlElement $header)
+    {
+        $header->add($this->createTitle());
+        $header->add($this->createTimestamp());
+    }
+
+    protected function assembleMain(BaseHtmlElement $main)
+    {
+        $main->add($this->createHeader());
+        $main->add($this->createCaption());
+        $main->add($this->createFooter());
+    }
+}
diff --git a/library/Icingadb/Common/ListItemMinimalLayout.php b/library/Icingadb/Common/ListItemMinimalLayout.php
new file mode 100644
index 0000000..9b0dc5b
--- /dev/null
+++ b/library/Icingadb/Common/ListItemMinimalLayout.php
@@ -0,0 +1,26 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use ipl\Html\BaseHtmlElement;
+
+trait ListItemMinimalLayout
+{
+    use CaptionDisabled;
+
+    protected function assembleHeader(BaseHtmlElement $header)
+    {
+        $header->add($this->createTitle());
+        if (! $this->isCaptionDisabled()) {
+            $header->add($this->createCaption());
+        }
+        $header->add($this->createTimestamp());
+    }
+
+    protected function assembleMain(BaseHtmlElement $main)
+    {
+        $main->add($this->createHeader());
+    }
+}
diff --git a/library/Icingadb/Common/LoadMore.php b/library/Icingadb/Common/LoadMore.php
new file mode 100644
index 0000000..c9ef0a2
--- /dev/null
+++ b/library/Icingadb/Common/LoadMore.php
@@ -0,0 +1,108 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use Generator;
+use Icinga\Module\Icingadb\Widget\ItemList\PageSeparatorItem;
+use Icinga\Module\Icingadb\Widget\ShowMore;
+use ipl\Orm\ResultSet;
+use ipl\Web\Url;
+
+trait LoadMore
+{
+    /** @var int */
+    protected $pageSize;
+
+    /** @var int */
+    protected $pageNumber;
+
+    /** @var Url */
+    protected $loadMoreUrl;
+
+    /**
+     * Set the page size
+     *
+     * @param int $size
+     *
+     * @return $this
+     */
+    public function setPageSize(int $size): self
+    {
+        $this->pageSize = $size;
+
+        return $this;
+    }
+
+    /**
+     * Set the page number
+     *
+     * @param int $number
+     *
+     * @return $this
+     */
+    public function setPageNumber(int $number): self
+    {
+        $this->pageNumber = $number;
+
+        return $this;
+    }
+
+    /**
+     * Set the url to fetch more items
+     *
+     * @param Url $url
+     *
+     * @return $this
+     */
+    public function setLoadMoreUrl(Url $url): self
+    {
+        $this->loadMoreUrl = $url;
+
+        return $this;
+    }
+
+    /**
+     * Iterate over the given data
+     *
+     * Add the page separator and the "LoadMore" button at the desired position
+     *
+     * @param ResultSet $result
+     *
+     * @return Generator
+     */
+    protected function getIterator(ResultSet $result): Generator
+    {
+        $count = 0;
+        $pageNumber = $this->pageNumber ?: 1;
+
+        if ($pageNumber > 1) {
+            $this->add(new PageSeparatorItem($pageNumber));
+        }
+
+        foreach ($result as $data) {
+            $count++;
+
+            if ($count % $this->pageSize === 0) {
+                $pageNumber++;
+            } elseif ($count > $this->pageSize && $count % $this->pageSize === 1) {
+                $this->add(new PageSeparatorItem($pageNumber));
+            }
+
+            yield $data;
+        }
+
+        if ($count > 0 && $this->loadMoreUrl !== null) {
+            $showMore = (new ShowMore(
+                $result,
+                $this->loadMoreUrl->setParam('page', $pageNumber)
+                    ->setAnchor('page-' . ($pageNumber))
+            ))
+                ->setLabel(t('Load More'))
+                ->setAttribute('data-no-icinga-ajax', true);
+
+            $this->add($showMore->setTag('li')->addAttributes(['class' => 'list-item']));
+        }
+    }
+}
diff --git a/library/Icingadb/Common/Macros.php b/library/Icingadb/Common/Macros.php
new file mode 100644
index 0000000..733c116
--- /dev/null
+++ b/library/Icingadb/Common/Macros.php
@@ -0,0 +1,118 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use Icinga\Application\Logger;
+use Icinga\Module\Icingadb\Model\Host;
+use ipl\Orm\Model;
+use ipl\Orm\Query;
+use ipl\Orm\ResultSet;
+
+use function ipl\Stdlib\get_php_type;
+
+trait Macros
+{
+    /**
+     * Get the given string with macros being resolved
+     *
+     * @param string $input  The string in which to look for macros
+     * @param Model  $object The host or service used to resolve the macros
+     *
+     * @return string
+     */
+    public function expandMacros(string $input, Model $object): string
+    {
+        if (preg_match_all('@\$([^\$\s]+)\$@', $input, $matches)) {
+            foreach ($matches[1] as $key => $value) {
+                $newValue = $this->resolveMacro($value, $object);
+                if ($newValue !== $value) {
+                    $input = str_replace($matches[0][$key], $newValue, $input);
+                }
+            }
+        }
+
+        return $input;
+    }
+
+    /**
+     * Resolve a macro based on the given object
+     *
+     * @param string $macro  The macro to resolve
+     * @param Model  $object The host or service used to resolve the macros
+     *
+     * @return string
+     */
+    public function resolveMacro(string $macro, Model $object): string
+    {
+        if ($object instanceof Host) {
+            $objectType = 'host';
+        } else {
+            $objectType = 'service';
+        }
+
+        $path = null;
+        $macroType = $objectType;
+        $isCustomVar = false;
+        if (preg_match('/^((host|service)\.)?vars\.(.+)/', $macro, $matches)) {
+            if (! empty($matches[2])) {
+                $macroType = $matches[2];
+            }
+
+            $path = $matches[3];
+            $isCustomVar = true;
+        } elseif (preg_match('/^(\w+)\.(.+)/', $macro, $matches)) {
+            $macroType = $matches[1];
+            $path = $matches[2];
+        }
+
+        try {
+            if ($path !== null) {
+                if ($macroType !== $objectType) {
+                    $value = $object->$macroType;
+                } else {
+                    $value = $object;
+                }
+
+                $properties = explode('.', $path);
+
+                do {
+                    $column = array_shift($properties);
+                    if ($value instanceof Query || $value instanceof ResultSet || is_array($value)) {
+                        Logger::debug(
+                            'Failed to resolve property "%s" on a "%s" type.',
+                            $isCustomVar ? 'vars' : $column,
+                            get_php_type($value)
+                        );
+                        $value = null;
+                        break;
+                    }
+
+                    if ($isCustomVar) {
+                        $value = $value->vars[$path];
+                        break;
+                    }
+
+                    $value = $value->$column;
+                } while (! empty($properties) && $value !== null);
+            } else {
+                $value = $object->$macro;
+            }
+        } catch (\Exception $e) {
+            $value = null;
+            Logger::debug('Unable to resolve macro "%s". An error occurred: %s', $macro, $e);
+        }
+
+        if ($value instanceof Query || $value instanceof ResultSet || is_array($value)) {
+            Logger::debug(
+                'It is not allowed to use "%s" as a macro which produces a "%s" type as a result.',
+                $macro,
+                get_php_type($value)
+            );
+            $value = null;
+        }
+
+        return $value !== null ? $value : $macro;
+    }
+}
diff --git a/library/Icingadb/Common/NoSubjectLink.php b/library/Icingadb/Common/NoSubjectLink.php
new file mode 100644
index 0000000..76c9a84
--- /dev/null
+++ b/library/Icingadb/Common/NoSubjectLink.php
@@ -0,0 +1,35 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+trait NoSubjectLink
+{
+    /** @var bool */
+    protected $noSubjectLink = false;
+
+    /**
+     * Set whether a list item's subject should be a link
+     *
+     * @param bool $state
+     *
+     * @return $this
+     */
+    public function setNoSubjectLink(bool $state = true): self
+    {
+        $this->noSubjectLink = $state;
+
+        return $this;
+    }
+
+    /**
+     * Get whether a list item's subject should be a link
+     *
+     * @return bool
+     */
+    public function getNoSubjectLink(): bool
+    {
+        return $this->noSubjectLink;
+    }
+}
diff --git a/library/Icingadb/Common/ObjectInspectionDetail.php b/library/Icingadb/Common/ObjectInspectionDetail.php
new file mode 100644
index 0000000..87c9b52
--- /dev/null
+++ b/library/Icingadb/Common/ObjectInspectionDetail.php
@@ -0,0 +1,330 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use DateTime;
+use DateTimeZone;
+use Exception;
+use Icinga\Exception\IcingaException;
+use Icinga\Exception\Json\JsonDecodeException;
+use Icinga\Module\Icingadb\Model\Host;
+use Icinga\Module\Icingadb\Model\Service;
+use Icinga\Module\Icingadb\Widget\Detail\CustomVarTable;
+use Icinga\Module\Icingadb\Widget\EmptyState;
+use Icinga\Util\Format;
+use Icinga\Util\Json;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\FormattedString;
+use ipl\Html\HtmlElement;
+use ipl\Html\Table;
+use ipl\Html\Text;
+use ipl\Orm\Model;
+
+abstract class ObjectInspectionDetail extends BaseHtmlElement
+{
+    protected $tag = 'div';
+
+    protected $defaultAttributes = ['class' => ['object-detail', 'inspection-detail']];
+
+    /** @var Model */
+    protected $object;
+
+    /** @var array */
+    protected $attrs;
+
+    /** @var array */
+    protected $joins;
+
+    public function __construct(Model $object, array $apiResult)
+    {
+        $this->object = $object;
+        $this->attrs = $apiResult['attrs'];
+        $this->joins = $apiResult['joins'];
+    }
+
+    /**
+     * Render the object source location
+     *
+     * @return ?array
+     */
+    protected function createSourceLocation()
+    {
+        if (! isset($this->attrs['source_location'])) {
+            return;
+        }
+
+        return [
+            new HtmlElement('h2', null, Text::create(t('Source Location'))),
+            FormattedString::create(
+                t('You can find this object in %s on line %s.'),
+                new HtmlElement('strong', null, Text::create($this->attrs['source_location']['path'])),
+                new HtmlElement('strong', null, Text::create($this->attrs['source_location']['first_line']))
+            )
+        ];
+    }
+
+    /**
+     * Render object's last check result
+     *
+     * @return ?array
+     */
+    protected function createLastCheckResult()
+    {
+        if (! isset($this->attrs['last_check_result'])) {
+            return;
+        }
+
+        $command = $this->attrs['last_check_result']['command'];
+        if (is_array($command)) {
+            $command = join(' ', array_map('escapeshellarg', $command));
+        }
+
+        $denylist = [
+            'command',
+            'output',
+            'type',
+            'active'
+        ];
+
+        return [
+            new HtmlElement('h2', null, Text::create(t('Executed Command'))),
+            new HtmlElement('pre', null, Text::create($command)),
+            new HtmlElement('h2', null, Text::create(t('Execution Details'))),
+            $this->createNameValueTable(
+                array_diff_key($this->attrs['last_check_result'], array_flip($denylist)),
+                [
+                    'execution_end'     => [$this, 'formatTimestamp'],
+                    'execution_start'   => [$this, 'formatTimestamp'],
+                    'schedule_end'      => [$this, 'formatTimestamp'],
+                    'schedule_start'    => [$this, 'formatTimestamp'],
+                    'ttl'               => [$this, 'formatSeconds'],
+                    'state'             => [$this, 'formatState']
+                ]
+            )
+        ];
+    }
+
+    protected function createRedisInfo(): array
+    {
+        $title = new HtmlElement('h2', null, Text::create(t('Volatile State Details')));
+
+        try {
+            $json = IcingaRedis::instance()->getConnection()
+                ->hGet("icinga:{$this->object->getTableName()}:state", bin2hex($this->object->id));
+        } catch (Exception $e) {
+            return [$title, sprintf('Failed to load redis data: %s', $e->getMessage())];
+        }
+
+        if (! $json) {
+            return [$title, new EmptyState(t('No data available in redis'))];
+        }
+
+        try {
+            $data = Json::decode($json, true);
+        } catch (JsonDecodeException $e) {
+            return [$title, sprintf('Failed to decode redis data: %s', $e->getMessage())];
+        }
+
+        $denylist = [
+            'commandline',
+            'environment_id',
+            'id'
+        ];
+
+        return [$title, $this->createNameValueTable(
+            array_diff_key($data, array_flip($denylist)),
+            [
+                'last_state_change'     => [$this, 'formatMillisecondTimestamp'],
+                'last_update'           => [$this, 'formatMillisecondTimestamp'],
+                'next_check'            => [$this, 'formatMillisecondTimestamp'],
+                'next_update'           => [$this, 'formatMillisecondTimestamp'],
+                'check_timeout'         => [$this, 'formatMilliseconds'],
+                'execution_time'        => [$this, 'formatMilliseconds'],
+                'latency'               => [$this, 'formatMilliseconds'],
+                'hard_state'            => [$this, 'formatState'],
+                'previous_soft_state'   => [$this, 'formatState'],
+                'previous_hard_state'   => [$this, 'formatState'],
+                'state'                 => [$this, 'formatState']
+            ]
+        )];
+    }
+
+    protected function createAttributes(): array
+    {
+        $denylist = [
+            'name',
+            '__name',
+            'host_name',
+            'display_name',
+            'last_check_result',
+            'source_location',
+            'templates',
+            'package',
+            'version',
+            'type',
+            'active',
+            'paused',
+            'ha_mode'
+        ];
+
+        return [
+            new HtmlElement('h2', null, Text::create(t('Object Attributes'))),
+            $this->createNameValueTable(
+                array_diff_key($this->attrs, array_flip($denylist)),
+                [
+                    'acknowledgement_expiry'        => [$this, 'formatTimestamp'],
+                    'acknowledgement_last_change'   => [$this, 'formatTimestamp'],
+                    'check_timeout'                 => [$this, 'formatSeconds'],
+                    'flapping_last_change'          => [$this, 'formatTimestamp'],
+                    'last_check'                    => [$this, 'formatTimestamp'],
+                    'last_hard_state_change'        => [$this, 'formatTimestamp'],
+                    'last_state_change'             => [$this, 'formatTimestamp'],
+                    'last_state_ok'                 => [$this, 'formatTimestamp'],
+                    'last_state_up'                 => [$this, 'formatTimestamp'],
+                    'last_state_warning'            => [$this, 'formatTimestamp'],
+                    'last_state_critical'           => [$this, 'formatTimestamp'],
+                    'last_state_down'               => [$this, 'formatTimestamp'],
+                    'last_state_unknown'            => [$this, 'formatTimestamp'],
+                    'last_state_unreachable'        => [$this, 'formatTimestamp'],
+                    'next_check'                    => [$this, 'formatTimestamp'],
+                    'next_update'                   => [$this, 'formatTimestamp'],
+                    'previous_state_change'         => [$this, 'formatTimestamp'],
+                    'check_interval'                => [$this, 'formatSeconds'],
+                    'retry_interval'                => [$this, 'formatSeconds'],
+                    'last_hard_state'               => [$this, 'formatState'],
+                    'last_state'                    => [$this, 'formatState'],
+                    'state'                         => [$this, 'formatState']
+                ]
+            )
+        ];
+    }
+
+    protected function createCustomVariables()
+    {
+        $query = $this->object->customvar
+            ->columns(['name', 'value']);
+
+        $result = [];
+        foreach ($query as $row) {
+            $result[$row->name] = json_decode($row->value, true) ?? $row->value;
+        }
+
+        if (! empty($result)) {
+            $vars = new CustomVarTable($result);
+        } else {
+            $vars = new EmptyState(t('No custom variables configured.'));
+        }
+
+        return [
+            new HtmlElement('h2', null, Text::create(t('Custom Variables'))),
+            $vars
+        ];
+    }
+
+    /**
+     * Format the given value as a json
+     *
+     * @param  mixed $json
+     *
+     * @return BaseHtmlElement|string
+     */
+    private function formatJson($json)
+    {
+        if (is_scalar($json)) {
+            return Json::encode($json, JSON_UNESCAPED_SLASHES);
+        }
+
+        return new HtmlElement(
+            'pre',
+            null,
+            Text::create(Json::encode($json, JSON_PRETTY_PRINT | JSON_UNESCAPED_SLASHES))
+        );
+    }
+
+    /**
+     * Format the given timestamp
+     *
+     * @param int|float|null $ts
+     *
+     * @return EmptyState|string
+     */
+    private function formatTimestamp($ts)
+    {
+        if (empty($ts)) {
+            return new EmptyState(t('n. a.'));
+        }
+
+        if (is_float($ts)) {
+            $dt = DateTime::createFromFormat('U.u', sprintf('%F', $ts));
+        } else {
+            $dt = (new DateTime())->setTimestamp($ts);
+        }
+
+        return $dt->setTimezone(new DateTimeZone('UTC'))
+            ->format('Y-m-d\TH:i:s.vP');
+    }
+
+    /**
+     * Format the given timestamp (in milliseconds)
+     *
+     * @param int|float|null $ms
+     *
+     * @return EmptyState|string
+     */
+    private function formatMillisecondTimestamp($ms)
+    {
+        return $this->formatTimestamp($ms / 1000.0);
+    }
+
+    private function formatSeconds($s): string
+    {
+        return Format::seconds($s);
+    }
+
+    private function formatMilliseconds($ms): string
+    {
+        return Format::seconds($ms / 1000.0);
+    }
+
+    private function formatState(int $state)
+    {
+        switch (true) {
+            case $this->object instanceof Host:
+                return HostStates::text($state);
+            case $this->object instanceof Service:
+                return ServiceStates::text($state);
+            default:
+                return $state;
+        }
+    }
+
+    private function createNameValueTable(array $data, array $formatters): Table
+    {
+        $table = new Table();
+        $table->addAttributes(['class' => 'name-value-table']);
+        foreach ($data as $name => $value) {
+            if (empty($value) && ($value === null || is_string($value) || is_array($value))) {
+                $value = new EmptyState(t('n. a.'));
+            } else {
+                try {
+                    if (isset($formatters[$name])) {
+                        $value = call_user_func($formatters[$name], $value);
+                    } else {
+                        $value = $this->formatJson($value);
+                    }
+                } catch (Exception $e) {
+                    $value = new EmptyState(IcingaException::describe($e));
+                }
+            }
+
+            $table->addHtml(Table::tr([
+                Table::th($name),
+                Table::td($value)
+            ]));
+        }
+
+        return $table;
+    }
+}
diff --git a/library/Icingadb/Common/ObjectLinkDisabled.php b/library/Icingadb/Common/ObjectLinkDisabled.php
new file mode 100644
index 0000000..ca8283f
--- /dev/null
+++ b/library/Icingadb/Common/ObjectLinkDisabled.php
@@ -0,0 +1,35 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+trait ObjectLinkDisabled
+{
+    /** @var bool */
+    protected $objectLinkDisabled = false;
+
+    /**
+     * Set whether list items should render host and service links
+     *
+     * @param bool $state
+     *
+     * @return $this
+     */
+    public function setObjectLinkDisabled(bool $state = true): self
+    {
+        $this->objectLinkDisabled = $state;
+
+        return $this;
+    }
+
+    /**
+     * Get whether list items should render host and service links
+     *
+     * @return bool
+     */
+    public function getObjectLinkDisabled(): bool
+    {
+        return $this->objectLinkDisabled;
+    }
+}
diff --git a/library/Icingadb/Common/SearchControls.php b/library/Icingadb/Common/SearchControls.php
new file mode 100644
index 0000000..7927da0
--- /dev/null
+++ b/library/Icingadb/Common/SearchControls.php
@@ -0,0 +1,69 @@
+<?php
+
+/* Icinga DB Web | (c) 2022 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use Icinga\Module\Icingadb\Web\Control\SearchBar\ObjectSuggestions;
+use ipl\Html\Html;
+use ipl\Orm\Query;
+use ipl\Web\Control\SearchBar;
+use ipl\Web\Url;
+use ipl\Web\Widget\ContinueWith;
+
+trait SearchControls
+{
+    use \ipl\Web\Compat\SearchControls {
+        \ipl\Web\Compat\SearchControls::createSearchBar as private webCreateSearchBar;
+    }
+
+    public function fetchFilterColumns(Query $query): array
+    {
+        return iterator_to_array(ObjectSuggestions::collectFilterColumns($query->getModel(), $query->getResolver()));
+    }
+
+    /**
+     * Create and return the SearchBar
+     *
+     * @param Query $query The query being filtered
+     * @param Url $redirectUrl Url to redirect to upon success
+     * @param array $preserveParams Query params to preserve when redirecting
+     *
+     * @return SearchBar
+     */
+    public function createSearchBar(Query $query, ...$params): SearchBar
+    {
+        $searchBar = $this->webCreateSearchBar($query, ...$params);
+
+        if (($wrapper = $searchBar->getWrapper()) && ! $wrapper->getWrapper()) {
+            // TODO: Remove this once ipl-web v0.7.0 is required
+            $searchBar->addWrapper(Html::tag('div', ['class' => 'search-controls']));
+        }
+
+        return $searchBar;
+    }
+
+    /**
+     * Create and return a ContinueWith
+     *
+     * This will automatically be appended to the SearchBar's wrapper. It's not necessary
+     * to add it separately as control or content!
+     *
+     * @param Url $detailsUrl
+     * @param SearchBar $searchBar
+     *
+     * @return ContinueWith
+     */
+    public function createContinueWith(Url $detailsUrl, SearchBar $searchBar): ContinueWith
+    {
+        $continueWith = new ContinueWith($detailsUrl, [$searchBar, 'getFilter']);
+        $continueWith->setTitle(t('Show bulk processing actions for all filtered results'));
+        $continueWith->setBaseTarget('_next');
+        $continueWith->getAttributes()
+            ->set('id', $this->getRequest()->protectId('continue-with'));
+
+        $searchBar->getWrapper()->add($continueWith);
+
+        return $continueWith;
+    }
+}
diff --git a/library/Icingadb/Common/ServiceLink.php b/library/Icingadb/Common/ServiceLink.php
new file mode 100644
index 0000000..75ac6c6
--- /dev/null
+++ b/library/Icingadb/Common/ServiceLink.php
@@ -0,0 +1,40 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use Icinga\Module\Icingadb\Model\Host;
+use Icinga\Module\Icingadb\Model\Service;
+use ipl\Html\FormattedString;
+use ipl\Html\Html;
+use ipl\Web\Widget\StateBall;
+
+trait ServiceLink
+{
+    protected function createServiceLink(Service $service, Host $host, bool $withStateBall = false): FormattedString
+    {
+        $content = [];
+
+        if ($withStateBall) {
+            $content[] = new StateBall($service->state->getStateText(), StateBall::SIZE_MEDIUM);
+            $content[] = ' ';
+        }
+
+        $content[] = $service->display_name;
+
+        return Html::sprintf(
+            t('%s on %s', '<service> on <host>'),
+            Html::tag('a', ['href' => Links::service($service, $host), 'class' => 'subject'], $content),
+            Html::tag(
+                'a',
+                ['href' => Links::host($host), 'class' => 'subject'],
+                [
+                    new StateBall($host->state->getStateText(), StateBall::SIZE_MEDIUM),
+                    ' ',
+                    $host->display_name
+                ]
+            )
+        );
+    }
+}
diff --git a/library/Icingadb/Common/ServiceLinks.php b/library/Icingadb/Common/ServiceLinks.php
new file mode 100644
index 0000000..368be48
--- /dev/null
+++ b/library/Icingadb/Common/ServiceLinks.php
@@ -0,0 +1,108 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use Icinga\Module\Icingadb\Model\Host;
+use Icinga\Module\Icingadb\Model\Service;
+use ipl\Web\Url;
+
+abstract class ServiceLinks
+{
+    public static function acknowledge(Service $service, Host $host): Url
+    {
+        return Url::fromPath(
+            'icingadb/service/acknowledge',
+            ['name' => $service->name, 'host.name' => $host->name]
+        );
+    }
+
+    public static function addComment(Service $service, Host $host): Url
+    {
+        return Url::fromPath(
+            'icingadb/service/add-comment',
+            ['name' => $service->name, 'host.name' => $host->name]
+        );
+    }
+
+    public static function checkNow(Service $service, Host $host): Url
+    {
+        return Url::fromPath(
+            'icingadb/service/check-now',
+            ['name' => $service->name, 'host.name' => $host->name]
+        );
+    }
+
+    public static function scheduleCheck(Service $service, Host $host): Url
+    {
+        return Url::fromPath(
+            'icingadb/service/schedule-check',
+            ['name' => $service->name, 'host.name' => $host->name]
+        );
+    }
+
+    public static function comments(Service $service, Host $host): Url
+    {
+        return Url::fromPath(
+            'icingadb/comments',
+            ['service.name' => $service->name, 'host.name' => $host->name]
+        );
+    }
+
+    public static function downtimes(Service $service, Host $host): Url
+    {
+        return Url::fromPath(
+            'icingadb/downtimes',
+            ['service.name' => $service->name, 'host.name' => $host->name]
+        );
+    }
+
+    public static function history(Service $service, Host $host): Url
+    {
+        return Url::fromPath(
+            'icingadb/service/history',
+            ['name' => $service->name, 'host.name' => $host->name]
+        );
+    }
+
+    public static function removeAcknowledgement(Service $service, Host $host): Url
+    {
+        return Url::fromPath(
+            'icingadb/service/remove-acknowledgement',
+            ['name' => $service->name, 'host.name' => $host->name]
+        );
+    }
+
+    public static function scheduleDowntime(Service $service, Host $host): Url
+    {
+        return Url::fromPath(
+            'icingadb/service/schedule-downtime',
+            ['name' => $service->name, 'host.name' => $host->name]
+        );
+    }
+
+    public static function sendCustomNotification(Service $service, Host $host): Url
+    {
+        return Url::fromPath(
+            'icingadb/service/send-custom-notification',
+            ['name' => $service->name, 'host.name' => $host->name]
+        );
+    }
+
+    public static function processCheckresult(Service $service, Host $host): Url
+    {
+        return Url::fromPath(
+            'icingadb/service/process-checkresult',
+            ['name' => $service->name, 'host.name' => $host->name]
+        );
+    }
+
+    public static function toggleFeatures(Service $service, Host $host): Url
+    {
+        return Url::fromPath(
+            'icingadb/service/toggle-features',
+            ['name' => $service->name, 'host.name' => $host->name]
+        );
+    }
+}
diff --git a/library/Icingadb/Common/ServiceStates.php b/library/Icingadb/Common/ServiceStates.php
new file mode 100644
index 0000000..526f95e
--- /dev/null
+++ b/library/Icingadb/Common/ServiceStates.php
@@ -0,0 +1,129 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+/**
+ * Collection of possible service states.
+ */
+class ServiceStates
+{
+    const OK = 0;
+
+    const WARNING = 1;
+
+    const CRITICAL = 2;
+
+    const UNKNOWN = 3;
+
+    const PENDING = 99;
+
+    /**
+     * Get the integer value of the given textual service state
+     *
+     * @param string $state
+     *
+     * @return int
+     *
+     * @throws \InvalidArgumentException If the given service state is invalid, i.e. not known
+     */
+    public static function int(string $state): int
+    {
+        switch (strtolower($state)) {
+            case 'ok':
+                $int = self::OK;
+                break;
+            case 'warning':
+                $int = self::WARNING;
+                break;
+            case 'critical':
+                $int = self::CRITICAL;
+                break;
+            case 'unknown':
+                $int = self::UNKNOWN;
+                break;
+            case 'pending':
+                $int = self::PENDING;
+                break;
+            default:
+                throw new \InvalidArgumentException(sprintf('Invalid service state %d', $state));
+        }
+
+        return $int;
+    }
+
+    /**
+     * Get the textual representation of the passed service state
+     *
+     * @param int|null $state
+     *
+     * @return string
+     *
+     * @throws \InvalidArgumentException If the given service state is invalid, i.e. not known
+     */
+    public static function text(int $state = null): string
+    {
+        switch (true) {
+            case $state === self::OK:
+                $text = 'ok';
+                break;
+            case $state === self::WARNING:
+                $text = 'warning';
+                break;
+            case $state === self::CRITICAL:
+                $text = 'critical';
+                break;
+            case $state === self::UNKNOWN:
+                $text = 'unknown';
+                break;
+            case $state === self::PENDING:
+                $text = 'pending';
+                break;
+            case $state === null:
+                $text = 'not-available';
+                break;
+            default:
+                throw new \InvalidArgumentException(sprintf('Invalid service state %d', $state));
+        }
+
+        return $text;
+    }
+
+    /**
+     * Get the translated textual representation of the passed service state
+     *
+     * @param int|null $state
+     *
+     * @return string
+     *
+     * @throws \InvalidArgumentException If the given service state is invalid, i.e. not known
+     */
+    public static function translated(int $state = null): string
+    {
+        switch (true) {
+            case $state === self::OK:
+                $text = t('ok');
+                break;
+            case $state === self::WARNING:
+                $text = t('warning');
+                break;
+            case $state === self::CRITICAL:
+                $text = t('critical');
+                break;
+            case $state === self::UNKNOWN:
+                $text = t('unknown');
+                break;
+            case $state === self::PENDING:
+                $text = t('pending');
+                break;
+            case $state === null:
+                $text = t('not available');
+                break;
+            default:
+                throw new \InvalidArgumentException(sprintf('Invalid service state %d', $state));
+        }
+
+        return $text;
+    }
+}
diff --git a/library/Icingadb/Common/StateBadges.php b/library/Icingadb/Common/StateBadges.php
new file mode 100644
index 0000000..2cb5cc8
--- /dev/null
+++ b/library/Icingadb/Common/StateBadges.php
@@ -0,0 +1,185 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use Icinga\Data\Filter\Filter;
+use Icinga\Module\Icingadb\Widget\StateBadge;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\Html;
+use ipl\Web\Filter\QueryString;
+use ipl\Web\Url;
+use ipl\Web\Widget\Link;
+
+abstract class StateBadges extends BaseHtmlElement
+{
+    use BaseFilter;
+
+    /** @var object $item */
+    protected $item;
+
+    /** @var string */
+    protected $type;
+
+    /** @var string Prefix */
+    protected $prefix;
+
+    /** @var Url Badge link */
+    protected $url;
+
+    protected $tag = 'ul';
+
+    protected $defaultAttributes = ['class' => 'state-badges'];
+
+    /**
+     * Create a new widget for state badges
+     *
+     * @param object $item
+     */
+    public function __construct($item)
+    {
+        $this->item = $item;
+        $this->type = $this->getType();
+        $this->prefix = $this->getPrefix();
+        $this->url = $this->getBaseUrl();
+    }
+
+    /**
+     * Get the badge base URL
+     *
+     * @return Url
+     */
+    abstract protected function getBaseUrl(): Url;
+
+    /**
+     * Get the type of the items
+     *
+     * @return string
+     */
+    abstract protected function getType(): string;
+
+    /**
+     * Get the prefix for accessing state information
+     *
+     * @return string
+     */
+    abstract protected function getPrefix(): string;
+
+    /**
+     * Get the integer of the given state text
+     *
+     * @param string $state
+     *
+     * @return int
+     */
+    abstract protected function getStateInt(string $state): int;
+
+    /**
+     * Get the badge URL
+     *
+     * @return Url
+     */
+    public function getUrl(): Url
+    {
+        return $this->url;
+    }
+
+    /**
+     * Set the badge URL
+     *
+     * @param Url $url
+     *
+     * @return $this
+     */
+    public function setUrl(Url $url): self
+    {
+        $this->url = $url;
+
+        return $this;
+    }
+
+    /**
+     * Create a badge link
+     *
+     * @param       $content
+     * @param array $params
+     *
+     * @return Link
+     */
+    public function createLink($content, array $params = null): Link
+    {
+        $url = clone $this->getUrl();
+
+        if (! empty($params)) {
+            $url->getParams()->mergeValues($params);
+        }
+
+        if ($this->hasBaseFilter()) {
+            $url->addFilter(Filter::fromQueryString(QueryString::render($this->getBaseFilter())));
+        }
+
+        return new Link($content, $url);
+    }
+
+    /**
+     * Create a state bade
+     *
+     * @param string $state
+     *
+     * @return ?BaseHtmlElement
+     */
+    protected function createBadge(string $state)
+    {
+        $key = $this->prefix . "_{$state}";
+
+        if (isset($this->item->$key) && $this->item->$key) {
+            return Html::tag('li', $this->createLink(
+                new StateBadge($this->item->$key, $state),
+                [$this->type . '.state.soft_state' => $this->getStateInt($state)]
+            ));
+        }
+
+        return null;
+    }
+
+    /**
+     * Create a state group
+     *
+     * @param string $state
+     *
+     * @return ?BaseHtmlElement
+     */
+    protected function createGroup(string $state)
+    {
+        $content = [];
+        $handledKey = $this->prefix . "_{$state}_handled";
+        $unhandledKey = $this->prefix . "_{$state}_unhandled";
+
+        if (isset($this->item->$unhandledKey) && $this->item->$unhandledKey) {
+            $content[] = Html::tag('li', $this->createLink(
+                new StateBadge($this->item->$unhandledKey, $state),
+                [
+                    $this->type . '.state.soft_state' => $this->getStateInt($state),
+                    $this->type . '.state.is_handled' => 'n'
+                ]
+            ));
+        }
+
+        if (isset($this->item->$handledKey) && $this->item->$handledKey) {
+            $content[] = Html::tag('li', $this->createLink(
+                new StateBadge($this->item->$handledKey, $state, true),
+                [
+                    $this->type . '.state.soft_state' => $this->getStateInt($state),
+                    $this->type . '.state.is_handled' => 'y'
+                ]
+            ));
+        }
+
+        if (empty($content)) {
+            return null;
+        }
+
+        return Html::tag('li', Html::tag('ul', $content));
+    }
+}
diff --git a/library/Icingadb/Common/TicketLinks.php b/library/Icingadb/Common/TicketLinks.php
new file mode 100644
index 0000000..6cf7e76
--- /dev/null
+++ b/library/Icingadb/Common/TicketLinks.php
@@ -0,0 +1,56 @@
+<?php
+
+/* Icinga DB Web | (c) 2022 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+use Icinga\Application\Hook;
+
+trait TicketLinks
+{
+    /** @var bool */
+    protected $ticketLinkEnabled = false;
+
+    /**
+     * Set whether list items should render host and service links
+     *
+     * @param bool $state
+     *
+     * @return $this
+     */
+    public function setTicketLinkEnabled(bool $state = true): self
+    {
+        $this->ticketLinkEnabled = $state;
+
+        return $this;
+    }
+
+    /**
+     * Get whether list items should render host and service links
+     *
+     * @return bool
+     */
+    public function getTicketLinkEnabled(): bool
+    {
+        return $this->ticketLinkEnabled;
+    }
+
+    /**
+     * Get whether list items should render host and service links
+     *
+     * @return string
+     */
+    public function createTicketLinks($text): string
+    {
+        if (Hook::has('ticket')) {
+            $tickets = Hook::first('ticket');
+        }
+
+        if ($this->getTicketLinkEnabled() && isset($tickets)) {
+            /** @var \Icinga\Application\Hook\TicketHook $tickets */
+            return $tickets->createLinks($text);
+        }
+
+        return $text;
+    }
+}
diff --git a/library/Icingadb/Common/ViewMode.php b/library/Icingadb/Common/ViewMode.php
new file mode 100644
index 0000000..841f28b
--- /dev/null
+++ b/library/Icingadb/Common/ViewMode.php
@@ -0,0 +1,35 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Common;
+
+trait ViewMode
+{
+    /** @var string */
+    protected $viewMode;
+
+    /**
+     * Get the view mode
+     *
+     * @return ?string
+     */
+    public function getViewMode()
+    {
+        return $this->viewMode;
+    }
+
+    /**
+     * Set the view mode
+     *
+     * @param string $viewMode
+     *
+     * @return $this
+     */
+    public function setViewMode(string $viewMode): self
+    {
+        $this->viewMode = $viewMode;
+
+        return $this;
+    }
+}
diff --git a/library/Icingadb/Compat/CompatHost.php b/library/Icingadb/Compat/CompatHost.php
new file mode 100644
index 0000000..0494573
--- /dev/null
+++ b/library/Icingadb/Compat/CompatHost.php
@@ -0,0 +1,106 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Compat;
+
+use Icinga\Module\Monitoring\Object\Host;
+
+class CompatHost extends Host
+{
+    use CompatObject;
+
+    private $legacyColumns = [
+        'host_action_url'                       => ['path' => ['action_url', 'action_url']],
+        'action_url'                            => ['path' => ['action_url', 'action_url']],
+        'host_address'                          => ['path' => ['address']],
+        'host_address6'                         => ['path' => ['address6']],
+        'host_alias'                            => ['path' => ['display_name']],
+        'host_check_interval'                   => ['path' => ['check_interval']],
+        'host_display_name'                     => ['path' => ['display_name']],
+        'host_icon_image'                       => ['path' => ['icon_image', 'icon_image']],
+        'host_icon_image_alt'                   => ['path' => ['icon_image_alt']],
+        'host_name'                             => ['path' => ['name']],
+        'host_notes'                            => ['path' => ['notes']],
+        'host_notes_url'                        => ['path' => ['notes_url', 'notes_url']],
+        'host_acknowledged'                     => [
+            'path' => ['state', 'is_acknowledged'],
+            'type' => 'bool'
+        ],
+        'host_acknowledgement_type'             => [
+            'path' => ['state', 'is_acknowledged'],
+            'type' => 'bool'
+        ],
+        'host_active_checks_enabled'            => [
+            'path' => ['active_checks_enabled'],
+            'type' => 'bool'
+        ],
+        'host_active_checks_enabled_changed'    => null,
+        'host_attempt'                          => null,
+        'host_check_command'                    => ['path' => ['checkcommand_name']],
+        'host_check_execution_time'             => ['path' => ['state', 'execution_time']],
+        'host_check_latency'                    => ['path' => ['state', 'latency']],
+        'host_check_source'                     => ['path' => ['state', 'check_source']],
+        'host_check_timeperiod'                 => ['path' => ['check_timeperiod_name']],
+        'host_current_check_attempt'            => ['path' => ['state', 'check_attempt']],
+        'host_current_notification_number'      => null,
+        'host_event_handler_enabled'            => [
+            'path' => ['event_handler_enabled'],
+            'type' => 'bool'
+        ],
+        'host_event_handler_enabled_changed'    => null,
+        'host_flap_detection_enabled'           => [
+            'path' => ['flapping_enabled'],
+            'type' => 'bool'
+        ],
+        'host_flap_detection_enabled_changed'   => null,
+        'host_handled'                          => [
+            'path' => ['state', 'is_handled'],
+            'type' => 'bool'
+        ],
+        'host_in_downtime'                      => [
+            'path' => ['state', 'in_downtime'],
+            'type' => 'bool'
+        ],
+        'host_is_flapping'                      => [
+            'path' => ['state', 'is_flapping'],
+            'type' => 'bool'
+        ],
+        'host_is_reachable'                     => [
+            'path' => ['state', 'is_reachable'],
+            'type' => 'bool'
+        ],
+        'host_last_check'                       => ['path' => ['state', 'last_update']],
+        'host_last_notification'                => null,
+        'host_last_state_change'                => ['path' => ['state', 'last_state_change']],
+        'host_long_output'                      => ['path' => ['state', 'long_output']],
+        'host_max_check_attempts'               => ['path' => ['max_check_attempts']],
+        'host_next_check'                       => ['path' => ['state', 'next_check']],
+        'host_next_update'                      => ['path' => ['state', 'next_update']],
+        'host_notifications_enabled'            => [
+            'path' => ['notifications_enabled'],
+            'type' => 'bool'
+        ],
+        'host_notifications_enabled_changed'    => null,
+        'host_obsessing'                        => null,
+        'host_obsessing_changed'                => null,
+        'host_output'                           => ['path' => ['state', 'output']],
+        'host_passive_checks_enabled'           => [
+            'path' => ['passive_checks_enabled'],
+            'type' => 'bool'
+        ],
+        'host_passive_checks_enabled_changed'   => null,
+        'host_percent_state_change'             => null,
+        'host_perfdata'                         => [
+            'path' => ['state', 'performance_data'],
+            'type' => 'bool'
+        ],
+        'host_process_perfdata'                 => [
+            'path' => ['perfdata_enabled'],
+            'type' => 'bool'
+        ],
+        'host_state'                            => ['path' => ['state', 'soft_state']],
+        'host_state_type'                       => ['path' => ['state', 'state_type']],
+        'instance_name'                         => null
+    ];
+}
diff --git a/library/Icingadb/Compat/CompatObject.php b/library/Icingadb/Compat/CompatObject.php
new file mode 100644
index 0000000..d9d72a3
--- /dev/null
+++ b/library/Icingadb/Compat/CompatObject.php
@@ -0,0 +1,373 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Compat;
+
+use Icinga\Exception\NotImplementedError;
+use Icinga\Module\Icingadb\Common\Auth;
+use Icinga\Module\Icingadb\Common\Database;
+use Icinga\Module\Icingadb\Model\CustomvarFlat;
+use Icinga\Module\Icingadb\Model\Host;
+use Icinga\Module\Icingadb\Model\Service;
+use Icinga\Module\Icingadb\Model\Servicegroup;
+use Icinga\Module\Icingadb\Model\ServicestateSummary;
+use InvalidArgumentException;
+use ipl\Orm\Model;
+use ipl\Orm\Query;
+use ipl\Stdlib\Filter;
+use LogicException;
+
+use function ipl\Stdlib\get_php_type;
+
+trait CompatObject
+{
+    use Auth;
+    use Database;
+
+    /** @var array Non-obscured custom variables */
+    protected $rawCustomvars;
+
+    /** @var array Non-obscured host custom variables */
+    protected $rawHostCustomvars;
+
+    /** @var Model $object */
+    private $object;
+
+    public function __construct(Model $object)
+    {
+        $this->object = $object;
+    }
+
+    public static function fromModel(Model $object)
+    {
+        switch (true) {
+            case $object instanceof Host:
+                return new CompatHost($object);
+            case $object instanceof Service:
+                return new CompatService($object);
+            default:
+                throw new InvalidArgumentException(sprintf(
+                    'Host or Service Model instance expected, got "%s" instead.',
+                    get_php_type($object)
+                ));
+        }
+    }
+
+    /**
+     * Get this object's name
+     *
+     * @return string
+     */
+    public function getName(): string
+    {
+        return $this->object->name;
+    }
+
+    public function fetch(): bool
+    {
+        return true;
+    }
+
+    protected function fetchRawCustomvars(): self
+    {
+        if ($this->rawCustomvars !== null) {
+            return $this;
+        }
+
+        $vars = $this->object->customvar->execute();
+
+        $customVars = [];
+        foreach ($vars as $row) {
+            $customVars[$row->name] = $row->value;
+        }
+
+        $this->rawCustomvars = $customVars;
+
+        return $this;
+    }
+
+    protected function fetchRawHostCustomvars(): self
+    {
+        if ($this->rawHostCustomvars !== null) {
+            return $this;
+        }
+
+        $vars = $this->object->host->customvar->execute();
+
+        $customVars = [];
+        foreach ($vars as $row) {
+            $customVars[$row->name] = $row->value;
+        }
+
+        $this->rawHostCustomvars = $customVars;
+
+        return $this;
+    }
+
+    public function fetchComments()
+    {
+        $this->comments = [];
+
+        return $this;
+    }
+
+    public function fetchContactgroups()
+    {
+        $this->contactgroups = [];
+
+        return $this;
+    }
+
+    public function fetchContacts()
+    {
+        $this->contacts = [];
+
+        return $this;
+    }
+
+    public function fetchCustomvars(): self
+    {
+        if ($this->customvars !== null) {
+            return $this;
+        }
+
+        $this->customvars = (new CustomvarFlat())->unflattenVars($this->object->customvar_flat);
+
+        return $this;
+    }
+
+    public function fetchHostVariables()
+    {
+        if (isset($this->hostVariables)) {
+            return $this;
+        }
+
+        $this->hostVariables = [];
+        foreach ($this->object->customvar as $customvar) {
+            $this->hostVariables[strtolower($customvar->name)] = json_decode($customvar->value);
+        }
+
+        return $this;
+    }
+
+    public function fetchServiceVariables()
+    {
+        if (isset($this->serviceVariables)) {
+            return $this;
+        }
+
+        $this->serviceVariables = [];
+        foreach ($this->object->customvar as $customvar) {
+            $this->serviceVariables[strtolower($customvar->name)] = json_decode($customvar->value);
+        }
+
+        return $this;
+    }
+
+    public function fetchDowntimes()
+    {
+        $this->downtimes = [];
+
+        return $this;
+    }
+
+    public function fetchEventhistory()
+    {
+        $this->eventhistory = [];
+
+        return $this;
+    }
+
+    public function fetchHostgroups()
+    {
+        if ($this->type === self::TYPE_HOST) {
+            $hostname = $this->object->name;
+            $hostgroupQuery = clone $this->object->hostgroup;
+        } else {
+            $hostname = $this->object->host->name;
+            $hostgroupQuery = clone $this->object->host->hostgroup;
+        }
+
+        $hostgroupQuery
+            ->columns(['name', 'display_name'])
+            ->filter(Filter::equal('host.name', $hostname));
+
+        /** @var Query $hostgroupQuery */
+        $this->hostgroups = [];
+        foreach ($hostgroupQuery as $hostgroup) {
+            $this->hostgroups[$hostgroup->name] = $hostgroup->display_name;
+        }
+
+        return $this;
+    }
+
+    public function fetchServicegroups()
+    {
+        if ($this->type === self::TYPE_HOST) {
+            $hostname = $this->object->name;
+            $query = Servicegroup::on($this->getDb());
+        } else {
+            $hostname = $this->object->host->name;
+            $query = (clone $this->object->servicegroup);
+        }
+
+        $query
+            ->columns(['name', 'display_name'])
+            ->filter(Filter::equal('host.name', $hostname));
+
+        if ($this->type === self::TYPE_SERVICE) {
+            $query->filter(Filter::equal('service.name', $this->object->name));
+        }
+
+        $this->servicegroups = [];
+        foreach ($query as $serviceGroup) {
+            $this->servicegroups[$serviceGroup->name] = $serviceGroup->display_name;
+        }
+
+        return $this;
+    }
+
+    public function fetchStats()
+    {
+        $query = ServicestateSummary::on($this->getDb());
+
+        if ($this->type === self::TYPE_HOST) {
+            $query->filter(Filter::equal('host.name', $this->object->name));
+        } else {
+            $query->filter(Filter::all(
+                Filter::equal('host.name', $this->object->host->name),
+                Filter::equal('service.name', $this->object->name)
+            ));
+        }
+
+        $result = $query->first();
+
+        $this->stats = (object) [
+            'services_total' => $result->services_total,
+            'services_ok' => $result->services_ok,
+            'services_critical' => $result->services_critical_handled + $result->services_critical_unhandled,
+            'services_critical_unhandled' => $result->services_critical_unhandled,
+            'services_critical_handled' => $result->services_critical_handled,
+            'services_warning' => $result->services_warning_handled + $result->services_warning_unhandled,
+            'services_warning_unhandled' => $result->services_warning_unhandled,
+            'services_warning_handled' => $result->services_warning_handled,
+            'services_unknown' => $result->services_unknown_handled + $result->services_unknown_unhandled,
+            'services_unknown_unhandled' => $result->services_unknown_unhandled,
+            'services_unknown_handled' => $result->services_unknown_handled,
+            'services_pending' => $result->services_pending
+        ];
+
+        return $this;
+    }
+
+    public function __get($name)
+    {
+        if (property_exists($this, $name)) {
+            if ($this->$name === null) {
+                $fetchMethod = 'fetch' . ucfirst($name);
+                $this->$fetchMethod();
+            }
+
+            return $this->$name;
+        }
+
+        if (preg_match('/^_(host|service)_(.+)/i', $name, $matches)) {
+            switch (strtolower($matches[1])) {
+                case $this->type:
+                    $customvars = $this->fetchRawCustomvars()->rawCustomvars;
+                    break;
+                case self::TYPE_HOST:
+                    $customvars = $this->fetchRawHostCustomvars()->rawHostCustomvars;
+                    break;
+                case self::TYPE_SERVICE:
+                    throw new LogicException('Cannot fetch service custom variables for non-service objects');
+            }
+
+            $variableName = strtolower($matches[2]);
+            if (isset($customvars[$variableName])) {
+                return $customvars[$variableName];
+            }
+
+            return null; // Unknown custom variables MUST NOT throw an error
+        }
+
+        if (! array_key_exists($name, $this->legacyColumns) && ! $this->object->hasProperty($name)) {
+            if (isset($this->customvars[$name])) {
+                return $this->customvars[$name];
+            }
+
+            if (substr($name, 0, strlen($this->prefix)) !== $this->prefix) {
+                $name = $this->prefix . $name;
+            }
+        }
+
+        if (array_key_exists($name, $this->legacyColumns)) {
+            $opts = $this->legacyColumns[$name];
+            if ($opts === null) {
+                return null;
+            }
+
+            $path = $opts['path'];
+            $value = null;
+
+            if (! empty($path)) {
+                $value = $this->object;
+
+                do {
+                    $col = array_shift($path);
+                    $value = $value->$col;
+                } while (! empty($path) && $value !== null);
+            }
+
+            if (isset($opts['type'])) {
+                $method = 'get' . ucfirst($opts['type']) . 'Type';
+                $value = $this->$method($value);
+            }
+
+            return $value;
+        }
+
+        return $this->object->$name;
+    }
+
+    public function __isset($name)
+    {
+        if (property_exists($this, $name)) {
+            return isset($this->$name);
+        }
+
+        if (isset($this->legacyColumns[$name]) || isset($this->object->$name)) {
+            return true;
+        }
+
+        return false;
+    }
+
+    /**
+     * @throws NotImplementedError Don't use!
+     */
+    protected function getDataView()
+    {
+        throw new NotImplementedError('getDataView() is not supported');
+    }
+
+    /**
+     * Get the bool type of the given value as an int
+     *
+     * @param bool|string $value
+     *
+     * @return ?int
+     */
+    private function getBoolType($value)
+    {
+        switch ($value) {
+            case false:
+                return 0;
+            case true:
+                return 1;
+            case 'sticky':
+                return 2;
+        }
+    }
+}
diff --git a/library/Icingadb/Compat/CompatService.php b/library/Icingadb/Compat/CompatService.php
new file mode 100644
index 0000000..8d95950
--- /dev/null
+++ b/library/Icingadb/Compat/CompatService.php
@@ -0,0 +1,159 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Compat;
+
+use Icinga\Module\Monitoring\Object\Service;
+
+class CompatService extends Service
+{
+    use CompatObject;
+
+    private $legacyColumns = [
+        'instance_name'                             => null,
+        'host_attempt'                              => null,
+        'host_icon_image'                           => ['path' => ['host', 'icon_image', 'icon_image']],
+        'host_icon_image_alt'                       => ['path' => ['host', 'icon_image_alt']],
+        'host_acknowledged'                         => [
+            'path' => ['host', 'state', 'is_acknowledged'],
+            'type' => 'bool'
+        ],
+        'host_active_checks_enabled'                => [
+            'path' => ['host', 'active_checks_enabled'],
+            'type' => 'bool'
+        ],
+        'host_address'                              => ['path' => ['host', 'address']],
+        'host_address6'                             => ['path' => ['host', 'address6']],
+        'host_alias'                                => ['path' => ['host', 'display_name']],
+        'host_display_name'                         => ['path' => ['host', 'display_name']],
+        'host_handled'                              => [
+            'path' => ['host', 'state', 'is_handled'],
+            'type' => 'bool'
+        ],
+        'host_in_downtime'                          => [
+            'path' => ['host', 'state', 'in_downtime'],
+            'type' => 'bool'
+        ],
+        'host_is_flapping'                          => [
+            'path' => ['host', 'state', 'is_flapping'],
+            'type' => 'bool'
+        ],
+        'host_last_state_change'                    => ['path' => ['host', 'state', 'last_state_change']],
+        'host_name'                                 => ['path' => ['host', 'name']],
+        'host_notifications_enabled'                => [
+            'path' => ['host', 'notifications_enabled'],
+            'type' => 'bool'
+        ],
+        'host_passive_checks_enabled'               => [
+            'path' => ['host', 'passive_checks_enabled'],
+            'type' => 'bool'
+        ],
+        'host_state'                                => ['path' => ['host', 'state', 'soft_state']],
+        'host_state_type'                           => ['path' => ['host', 'state', 'state_type']],
+        'service_icon_image'                        => ['path' => ['icon_image', 'icon_image']],
+        'service_icon_image_alt'                    => ['path' => ['icon_image_alt']],
+        'service_acknowledged'                      => [
+            'path' => ['state', 'is_acknowledged'],
+            'type' => 'bool'
+        ],
+        'service_acknowledgement_type'              => [
+            'path' => ['state', 'is_acknowledged'],
+            'type' => 'bool'
+        ],
+        'service_action_url'                        => ['path' => ['action_url', 'action_url']],
+        'action_url'                                => ['path' => ['action_url', 'action_url']],
+        'service_active_checks_enabled'             => [
+            'path' => ['active_checks_enabled'],
+            'type' => 'bool'
+        ],
+        'service_active_checks_enabled_changed'     => null,
+        'service_attempt'                           => null,
+        'service_check_command'                     => ['path' => ['checkcommand_name']],
+        'service_check_execution_time'              => ['path' => ['state', 'execution_time']],
+        'service_check_interval'                    => ['path' => ['check_interval']],
+        'service_check_latency'                     => ['path' => ['state', 'latency']],
+        'service_check_source'                      => ['path' => ['state', 'check_source']],
+        'service_check_timeperiod'                  => ['path' => ['check_timeperiod_name']],
+        'service_current_notification_number'       => null,
+        'service_description'                       => ['path' => ['name']],
+        'service_display_name'                      => ['path' => ['display_name']],
+        'service_event_handler_enabled'             => [
+            'path' => ['event_handler_enabled'],
+            'type' => 'bool'
+        ],
+        'service_event_handler_enabled_changed'     => null,
+        'service_flap_detection_enabled'            => [
+            'path' => ['flapping_enabled'],
+            'type' => 'bool'
+        ],
+        'service_flap_detection_enabled_changed'    => null,
+        'service_handled'                           => [
+            'path' => ['state', 'is_handled'],
+            'type' => 'bool'
+        ],
+        'service_in_downtime'                       => [
+            'path' => ['state', 'in_downtime'],
+            'type' => 'bool'
+        ],
+        'service_is_flapping'                       => [
+            'path' => ['state', 'is_flapping'],
+            'type' => 'bool'
+        ],
+        'service_is_reachable'                      => [
+            'path' => ['state', 'is_reachable'],
+            'type' => 'bool'
+        ],
+        'service_last_check'                        => ['path' => ['state', 'last_update']],
+        'service_last_notification'                 => null,
+        'service_last_state_change'                 => ['path' => ['state', 'last_state_change']],
+        'service_long_output'                       => ['path' => ['state', 'long_output']],
+        'service_next_check'                        => ['path' => ['state', 'next_check']],
+        'service_next_update'                       => ['path' => ['state', 'next_update']],
+        'service_notes'                             => ['path' => ['notes']],
+        'service_notes_url'                         => ['path' => ['notes_url', 'notes_url']],
+        'service_notifications_enabled'             => [
+            'path' => ['notifications_enabled'],
+            'type' => 'bool'
+        ],
+        'service_notifications_enabled_changed'     => null,
+        'service_obsessing'                         => null,
+        'service_obsessing_changed'                 => null,
+        'service_output'                            => ['path' => ['state', 'output']],
+        'service_passive_checks_enabled'            => [
+            'path' => ['passive_checks_enabled'],
+            'type' => 'bool'
+        ],
+        'service_passive_checks_enabled_changed'    => null,
+        'service_percent_state_change'              => null,
+        'service_perfdata'                          => [
+            'path' => ['state', 'performance_data'],
+            'type' => 'bool'
+        ],
+        'service_process_perfdata'                  => [
+            'path' => ['perfdata_enabled'],
+            'type' => 'bool'
+        ],
+        'service_state'                             => ['path' => ['state', 'soft_state']],
+        'service_state_type'                        => ['path' => ['state', 'state_type']]
+    ];
+
+    /**
+     * Get this service's host
+     *
+     * @return CompatHost
+     */
+    public function getHost(): CompatHost
+    {
+        if ($this->host === null) {
+            $this->host = new CompatHost($this->object->host);
+        }
+
+        return $this->host;
+    }
+
+    protected function fetchHost()
+    {
+        $this->getHost();
+    }
+}
diff --git a/library/Icingadb/Compat/UrlMigrator.php b/library/Icingadb/Compat/UrlMigrator.php
new file mode 100644
index 0000000..6eef3ca
--- /dev/null
+++ b/library/Icingadb/Compat/UrlMigrator.php
@@ -0,0 +1,1254 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Compat;
+
+use InvalidArgumentException;
+use ipl\Stdlib\Filter;
+use ipl\Web\Filter\QueryString;
+use ipl\Web\Url;
+
+class UrlMigrator
+{
+    const NO_YES = ['n', 'y'];
+    const USE_EXPR = 'use-expr';
+    const SORT_ONLY = 'sort-only';
+    const LOWER_EXPR = 'lower-expr';
+    const DROP = 'drop';
+
+    const SUPPORTED_PATHS = [
+        'monitoring/list/hosts' => ['hosts', 'icingadb/hosts'],
+        'monitoring/hosts/show' => ['multipleHosts', 'icingadb/hosts/details'],
+        'monitoring/host/show'  => ['host', 'icingadb/host'],
+        'monitoring/host/services' => ['host', 'icingadb/host/services'],
+        'monitoring/host/history' => ['host', 'icingadb/host/history'],
+        'monitoring/list/services' => ['services', 'icingadb/services'],
+        'monitoring/list/servicegrid' => ['servicegrid', 'icingadb/services/grid'],
+        'monitoring/services/show' => ['multipleServices', 'icingadb/services/details'],
+        'monitoring/service/show' => ['service', 'icingadb/service'],
+        'monitoring/service/history' => ['service', 'icingadb/service/history'],
+        'monitoring/list/hostgroups' => ['hostgroups', 'icingadb/hostgroups'],
+        'monitoring/list/servicegroups' => ['servicegroups', 'icingadb/servicegroups'],
+        'monitoring/list/contactgroups' => ['contactgroups', 'icingadb/usergroups'],
+        'monitoring/list/contacts' => ['contacts', 'icingadb/users'],
+        'monitoring/list/comments' => ['comments', 'icingadb/comments'],
+        'monitoring/list/downtimes' => ['downtimes', 'icingadb/downtimes'],
+        'monitoring/list/eventhistory' => ['history', 'icingadb/history'],
+        'monitoring/list/notifications' => ['notificationHistory', 'icingadb/notifications'],
+        'monitoring/health/info' => [null, 'icingadb/health'],
+        'monitoring/health/stats' => [null, 'icingadb/health'],
+        'monitoring/tactical' => ['services', 'icingadb/tactical']
+    ];
+
+    public static function isSupportedUrl(Url $url): bool
+    {
+        $supportedPaths = self::SUPPORTED_PATHS;
+        return isset($supportedPaths[$url->getPath()]);
+    }
+
+    public static function hasQueryTransformer(string $name): bool
+    {
+        return method_exists(new self(), $name . 'Columns');
+    }
+
+    public static function transformUrl(Url $url): Url
+    {
+        if (! self::isSupportedUrl($url)) {
+            throw new InvalidArgumentException(sprintf('Url path "%s" is not supported', $url->getPath()));
+        }
+
+        list($queryTransformer, $dbRoute) = self::SUPPORTED_PATHS[$url->getPath()];
+
+        $url = clone $url;
+        $url->setPath($dbRoute);
+
+        if (! $url->getParams()->isEmpty()) {
+            $filter = QueryString::parse((string) $url->getParams());
+            $filter = self::transformFilter($filter, $queryTransformer);
+            if ($filter) {
+                $url->setQueryString(QueryString::render($filter));
+            }
+        }
+
+        return $url;
+    }
+
+    /**
+     * Transform the given legacy filter
+     *
+     * @param Filter\Rule $filter
+     * @param string|null $queryTransformer
+     *
+     * @return Filter\Rule|false
+     */
+    public static function transformFilter(Filter\Rule $filter, string $queryTransformer = null)
+    {
+        $transformer = new self();
+
+        $columns = $transformer::commonColumns();
+        if ($queryTransformer !== null) {
+            if (! self::hasQueryTransformer($queryTransformer)) {
+                throw new InvalidArgumentException(sprintf('Transformer "%s" is not supported', $queryTransformer));
+            }
+
+            $columns = array_merge($columns, $transformer->{$queryTransformer . 'Columns'}());
+        }
+
+        $rewritten = $transformer->rewrite($filter, $columns);
+        return $rewritten === false ? false : ($rewritten instanceof Filter\Rule ? $rewritten : $filter);
+    }
+
+    /**
+     * Rewrite the given filter and legacy columns
+     *
+     * @param Filter\Rule $filter
+     * @param array $legacyColumns
+     * @param Filter\Chain|null $parent
+     *
+     * @return ?mixed
+     */
+    protected function rewrite(Filter\Rule $filter, array $legacyColumns, Filter\Chain $parent = null)
+    {
+        $rewritten = null;
+        if ($filter instanceof Filter\Condition) {
+            $column = $filter->getColumn();
+
+            if (isset($legacyColumns[$column])) {
+                if ($legacyColumns[$column] === self::DROP) {
+                    return false;
+                } elseif (is_callable($legacyColumns[$column])) {
+                    return $legacyColumns[$column]($filter);
+                } elseif (! is_array($legacyColumns[$column])) {
+                    return null;
+                }
+
+                foreach ($legacyColumns[$column] as $modelPath => $exprRule) {
+                    break;
+                }
+
+                $rewritten = $filter->setColumn($modelPath);
+
+                switch (true) {
+                    case $exprRule === self::USE_EXPR:
+                        break;
+                    case $exprRule === self::LOWER_EXPR:
+                        $filter->setValue(strtolower($filter->getValue()));
+                        break;
+                    case is_array($exprRule) && isset($exprRule[$filter->getValue()]):
+                        $filter->setValue($exprRule[$filter->getValue()]);
+                        break;
+                    default:
+                        $filter->setValue($exprRule);
+                }
+            } elseif ($column === 'sort') {
+                $column = $filter->getValue();
+                if (isset($legacyColumns[$column])) {
+                    if ($legacyColumns[$column] === self::DROP) {
+                        return false;
+                    } elseif (! is_array($legacyColumns[$column])) {
+                        return $rewritten;
+                    }
+
+                    $column = key($legacyColumns[$column]);
+
+                    $rewritten = $filter->setValue($column);
+                }
+
+                if ($parent !== null) {
+                    foreach ($parent as $child) {
+                        if ($child instanceof Filter\Condition && $child->getColumn() === 'dir') {
+                            $dir = $child->getValue();
+
+                            $rewritten = $filter->setValue("{$column} {$dir}");
+
+                            $parent->remove($child);
+                        }
+                    }
+                }
+            } elseif ($column === 'dir') {
+                if ($parent !== null) {
+                    foreach ($parent as $child) {
+                        if ($child instanceof Filter\Condition && $child->getColumn() === 'sort') {
+                            return null;
+                        }
+                    }
+                }
+
+                return false;
+            } elseif (preg_match('/^_(host|service)_([\w.]+)/i', $column, $groups)) {
+                $rewritten = $filter->setColumn($groups[1] . '.vars.' . $groups[2]);
+            }
+        } else {
+            /** @var Filter\Chain $filter */
+            foreach ($filter as $child) {
+                $retVal = $this->rewrite(
+                    $child instanceof Filter\Condition ? clone $child : $child,
+                    $legacyColumns,
+                    $filter
+                );
+                if ($retVal === false) {
+                    $filter->remove($child);
+                } elseif ($retVal instanceof Filter\Rule) {
+                    $filter->replace($child, $retVal);
+                }
+            }
+        }
+
+        return $rewritten;
+    }
+
+    protected static function commonColumns(): array
+    {
+        return [
+
+            // Filter columns
+            'host' => [
+                'host.name_ci' => self::USE_EXPR
+            ],
+            'host_display_name' => [
+                'host.display_name' => self::USE_EXPR
+            ],
+            'host_alias' => self::DROP,
+            'hostgroup' => [
+                'hostgroup.name_ci' => self::USE_EXPR
+            ],
+            'hostgroup_alias' => [
+                'hostgroup.display_name' => self::USE_EXPR
+            ],
+            'service' => [
+                'service.name_ci' => self::USE_EXPR
+            ],
+            'service_display_name' => [
+                'service.display_name' => self::USE_EXPR
+            ],
+            'servicegroup' => [
+                'servicegroup.name_ci' => self::USE_EXPR
+            ],
+            'servicegroup_alias' => [
+                'servicegroup.display_name' => self::USE_EXPR
+            ],
+
+            // Restriction columns
+            'instance_name' => self::DROP,
+            'host_name' => [
+                'host.name' => self::USE_EXPR
+            ],
+            'hostgroup_name' => [
+                'hostgroup.name' => self::USE_EXPR
+            ],
+            'service_description' => [
+                'service.name' => self::USE_EXPR
+            ],
+            'servicegroup_name' => [
+                'servicegroup.name' => self::USE_EXPR
+            ]
+        ];
+    }
+
+    protected static function hostsColumns(): array
+    {
+        return [
+
+            // Extraordinary columns
+            'addColumns' => function ($filter) {
+                /** @var Filter\Condition $filter */
+                $legacyColumns = array_filter(array_map('trim', explode(',', $filter->getValue())));
+
+                $columns = [
+                    'host.state.soft_state',
+                    'host.state.last_state_change',
+                    'host.icon_image.icon_image',
+                    'host.display_name',
+                    'host.state.output',
+                    'host.state.performance_data',
+                    'host.state.is_problem'
+                ];
+                foreach ($legacyColumns as $column) {
+                    if (($c = self::transformFilter(Filter::equal($column, 'bogus'), 'hosts')) !== false) {
+                        if ($c instanceof Filter\Condition) {
+                            $columns[] = $c->getColumn();
+                        }
+                    }
+                }
+
+                if (empty($columns)) {
+                    return false;
+                }
+
+                return Filter::equal('columns', implode(',', $columns));
+            },
+
+            // Query columns
+            'host_acknowledged' => [
+                'host.state.is_acknowledged' => self::NO_YES
+            ],
+            'host_acknowledgement_type' => [
+                'host.state.is_acknowledged' => array_merge(self::NO_YES, ['sticky'])
+            ],
+            'host_action_url' => [
+                'host.action_url.action_url' => self::USE_EXPR
+            ],
+            'host_active_checks_enabled' => [
+                'host.active_checks_enabled' => self::NO_YES
+            ],
+            'host_active_checks_enabled_changed' => self::DROP,
+            'host_address' => [
+                'host.address' => self::USE_EXPR
+            ],
+            'host_address6' => [
+                'host.address6' => self::USE_EXPR
+            ],
+            'host_alias' => self::DROP,
+            'host_check_command' => [
+                'host.checkcommand_name' => self::USE_EXPR
+            ],
+            'host_check_execution_time' => [
+                'host.state.execution_time' => self::USE_EXPR
+            ],
+            'host_check_latency' => [
+                'host.state.latency' => self::USE_EXPR
+            ],
+            'host_check_source' => [
+                'host.state.check_source' => self::USE_EXPR
+            ],
+            'host_check_timeperiod' => [
+                'host.check_timeperiod_name' => self::USE_EXPR
+            ],
+            'host_current_check_attempt' => [
+                'host.state.check_attempt' => self::USE_EXPR
+            ],
+            'host_current_notification_number' => self::DROP,
+            'host_display_name' => [
+                'host.display_name' => self::USE_EXPR
+            ],
+            'host_event_handler_enabled' => [
+                'host.event_handler_enabled' => self::NO_YES
+            ],
+            'host_event_handler_enabled_changed' => self::DROP,
+            'host_flap_detection_enabled' => [
+                'host.flapping_enabled' => self::NO_YES
+            ],
+            'host_flap_detection_enabled_changed' => self::DROP,
+            'host_handled' => [
+                'host.state.is_handled' => self::NO_YES
+            ],
+            'host_hard_state' => [
+                'host.state.hard_state' => self::USE_EXPR
+            ],
+            'host_in_downtime' => [
+                'host.state.in_downtime' => self::NO_YES
+            ],
+            'host_ipv4' => [
+                'host.address_bin' => self::USE_EXPR
+            ],
+            'host_is_flapping' => [
+                'host.state.is_flapping' => self::NO_YES
+            ],
+            'host_is_reachable' => [
+                'host.state.is_reachable' => self::NO_YES
+            ],
+            'host_last_check' => [
+                'host.state.last_update' => self::USE_EXPR
+            ],
+            'host_last_notification' => self::DROP,
+            'host_last_state_change' => [
+                'host.state.last_state_change' => self::USE_EXPR
+            ],
+            'host_last_state_change_ts' => [
+                'host.state.last_state_change' => self::USE_EXPR
+            ],
+            'host_long_output' => [
+                'host.state.long_output' => self::USE_EXPR
+            ],
+            'host_max_check_attempts' => [
+                'host.max_check_attempts' => self::USE_EXPR
+            ],
+            'host_modified_host_attributes' => self::DROP,
+            'host_name' => [
+                'host.name' => self::USE_EXPR
+            ],
+            'host_next_check' => [
+                'host.state.next_check' => self::USE_EXPR
+            ],
+            'host_notes_url' => [
+                'host.notes_url.notes_url' => self::USE_EXPR
+            ],
+            'host_notifications_enabled' => [
+                'host.notifications_enabled' => self::NO_YES
+            ],
+            'host_notifications_enabled_changed' => self::DROP,
+            'host_obsessing' => self::DROP,
+            'host_obsessing_changed' => self::DROP,
+            'host_output' => [
+                'host.state.output' => self::USE_EXPR
+            ],
+            'host_passive_checks_enabled' => [
+                'host.passive_checks_enabled' => self::NO_YES
+            ],
+            'host_passive_checks_enabled_changed' => self::DROP,
+            'host_percent_state_change' => self::DROP,
+            'host_perfdata' => [
+                'host.state.performance_data' => self::USE_EXPR
+            ],
+            'host_problem' => [
+                'host.state.is_problem' => self::NO_YES
+            ],
+            'host_severity' => [
+                'host.state.severity' => self::USE_EXPR
+            ],
+            'host_state' => [
+                'host.state.soft_state' => self::USE_EXPR
+            ],
+            'host_state_type' => [
+                'host.state.state_type' => ['soft', 'hard']
+            ],
+            'host_unhandled' => [
+                'host.state.is_handled' => array_reverse(self::NO_YES)
+            ],
+
+            // Filter columns
+            'host_contact' => [
+                'host.user.name' => self::USE_EXPR
+            ],
+            'host_contactgroup' => [
+                'host.usergroup.name' => self::USE_EXPR
+            ],
+
+            // Query columns the dataview doesn't include, added here because it's possible to filter for them anyway
+            'host_check_interval' => self::DROP,
+            'host_icon_image' => self::DROP,
+            'host_icon_image_alt' => self::DROP,
+            'host_notes' => self::DROP,
+            'object_type' => self::DROP,
+            'object_id' => self::DROP,
+            'host_attempt' => self::DROP,
+            'host_check_type' => self::DROP,
+            'host_event_handler' => self::DROP,
+            'host_failure_prediction_enabled' => self::DROP,
+            'host_is_passive_checked' => self::DROP,
+            'host_last_hard_state' => self::DROP,
+            'host_last_hard_state_change' => self::DROP,
+            'host_last_time_down' => self::DROP,
+            'host_last_time_unreachable' => self::DROP,
+            'host_last_time_up' => self::DROP,
+            'host_next_notification' => self::DROP,
+            'host_next_update' => function ($filter) {
+                /** @var Filter\Condition $filter */
+                if ($filter->getValue() !== 'now') {
+                    return false;
+                }
+
+                // Doesn't get dropped because there's a default dashlet using it..
+                // Though since this dashlet uses it to check for overdue hosts we'll
+                // replace it as next_update is volatile (only in redis up2date)
+                return Filter::equal('host.state.is_overdue', $filter instanceof Filter\LessThan ? 'y' : 'n');
+            },
+            'host_no_more_notifications' => self::DROP,
+            'host_normal_check_interval' => self::DROP,
+            'host_problem_has_been_acknowledged' => self::DROP,
+            'host_process_performance_data' => self::DROP,
+            'host_retry_check_interval' => self::DROP,
+            'host_scheduled_downtime_depth' => self::DROP,
+            'host_status_update_time' => self::DROP,
+            'problems' => self::DROP
+        ];
+    }
+
+    protected static function multipleHostsColumns(): array
+    {
+        return array_merge(
+            static::hostsColumns(),
+            [
+                'host'  => [
+                    'host.name' => self::USE_EXPR
+                ]
+            ]
+        );
+    }
+
+    protected static function hostColumns(): array
+    {
+        return [
+            'host' => [
+                'name' => self::USE_EXPR
+            ]
+        ];
+    }
+
+    protected static function servicesColumns(): array
+    {
+        return [
+
+            // Extraordinary columns
+            'addColumns' => function ($filter) {
+                /** @var Filter\Condition $filter */
+                $legacyColumns = array_filter(array_map('trim', explode(',', $filter->getValue())));
+
+                $columns = [
+                    'service.state.soft_state',
+                    'service.state.last_state_change',
+                    'service.icon_image.icon_image',
+                    'service.display_name',
+                    'service.host.display_name',
+                    'service.state.output',
+                    'service.state.performance_data',
+                    'service.state.is_problem'
+                ];
+                foreach ($legacyColumns as $column) {
+                    if (($c = self::transformFilter(Filter::equal($column, 'bogus'), 'services')) !== false) {
+                        if ($c instanceof Filter\Condition) {
+                            $columns[] = $c->getColumn();
+                        }
+                    }
+                }
+
+                if (empty($columns)) {
+                    return false;
+                }
+
+                return Filter::equal('columns', implode(',', $columns));
+            },
+
+            // Query columns
+            'host_acknowledged' => [
+                'host.state.is_acknowledged' => self::NO_YES
+            ],
+            'host_action_url' => [
+                'host.action_url.action_url' => self::USE_EXPR
+            ],
+            'host_active_checks_enabled' => [
+                'host.active_checks_enabled' => self::NO_YES
+            ],
+            'host_address' => [
+                'host.address' => self::USE_EXPR
+            ],
+            'host_address6' => [
+                'host.address6' => self::USE_EXPR
+            ],
+            'host_alias' => self::DROP,
+            'host_check_source' => [
+                'host.state.check_source' => self::USE_EXPR
+            ],
+            'host_display_name' => [
+                'host.display_name' => self::USE_EXPR
+            ],
+            'host_handled' => [
+                'host.state.is_handled' => self::NO_YES
+            ],
+            'host_hard_state' => [
+                'host.state.hard_state' => self::USE_EXPR
+            ],
+            'host_in_downtime' => [
+                'host.state.in_downtime' => self::NO_YES
+            ],
+            'host_ipv4' => [
+                'host.address_bin' => self::USE_EXPR
+            ],
+            'host_is_flapping' => [
+                'host.state.is_flapping' => self::NO_YES
+            ],
+            'host_last_check' => [
+                'host.state.last_update' => self::USE_EXPR
+            ],
+            'host_last_hard_state' => [
+                'host.state.previous_hard_state' => self::USE_EXPR
+            ],
+            'host_last_hard_state_change' => self::DROP,
+            'host_last_state_change' => [
+                'host.state.last_state_change' => self::USE_EXPR
+            ],
+            'host_last_time_down' => self::DROP,
+            'host_last_time_unreachable' => self::DROP,
+            'host_last_time_up' => self::DROP,
+            'host_long_output' => [
+                'host.state.long_output' => self::USE_EXPR
+            ],
+            'host_modified_host_attributes' => self::DROP,
+            'host_notes_url' => [
+                'host.notes_url.notes_url' => self::USE_EXPR
+            ],
+            'host_notifications_enabled' => [
+                'host.notifications_enabled' => self::NO_YES
+            ],
+            'host_output' => [
+                'host.state.output' => self::USE_EXPR
+            ],
+            'host_passive_checks_enabled' => [
+                'host.passive_checks_enabled' => self::NO_YES
+            ],
+            'host_perfdata' => [
+                'host.state.performance_data' => self::USE_EXPR
+            ],
+            'host_problem' => [
+                'host.state.is_problem' => self::NO_YES
+            ],
+            'host_severity' => [
+                'host.state.severity' => self::USE_EXPR
+            ],
+            'host_state' => [
+                'host.state.soft_state' => self::USE_EXPR
+            ],
+            'host_state_type' => [
+                'host.state.state_type' => ['soft', 'hard']
+            ],
+            'service_acknowledged' => [
+                'service.state.is_acknowledged' => self::NO_YES
+            ],
+            'service_acknowledgement_type' => [
+                'service.state.is_acknowledged' => array_merge(self::NO_YES, ['sticky'])
+            ],
+            'service_action_url' => [
+                'service.action_url.action_url' => self::USE_EXPR
+            ],
+            'service_active_checks_enabled' => [
+                'service.active_checks_enabled' => self::NO_YES
+            ],
+            'service_active_checks_enabled_changed' => self::DROP,
+            'service_attempt' => [
+                'service.state.check_attempt' => self::USE_EXPR
+            ],
+            'service_check_command' => [
+                'service.checkcommand_name' => self::USE_EXPR
+            ],
+            'service_check_source' => [
+                'service.state.check_source' => self::USE_EXPR
+            ],
+            'service_check_timeperiod' => [
+                'service.check_timeperiod_name' => self::USE_EXPR
+            ],
+            'service_current_check_attempt' => [
+                'service.state.check_attempt' => self::USE_EXPR
+            ],
+            'service_current_notification_number' => self::DROP,
+            'service_display_name' => [
+                'service.display_name' => self::USE_EXPR
+            ],
+            'service_event_handler_enabled' => [
+                'service.event_handler_enabled' => self::NO_YES
+            ],
+            'service_event_handler_enabled_changed' => self::DROP,
+            'service_flap_detection_enabled' => [
+                'service.flapping_enabled' => self::NO_YES
+            ],
+            'service_flap_detection_enabled_changed' => self::DROP,
+            'service_handled' => [
+                'service.state.is_handled' => self::NO_YES
+            ],
+            'service_hard_state' => [
+                'service.state.hard_state' => self::USE_EXPR
+            ],
+            'service_host_name' => [
+                'host.name' => self::USE_EXPR
+            ],
+            'service_in_downtime' => [
+                'service.state.in_downtime' => self::NO_YES
+            ],
+            'service_is_flapping' => [
+                'service.state.is_flapping' => self::NO_YES
+            ],
+            'service_is_reachable' => [
+                'service.state.is_reachable' => self::NO_YES
+            ],
+            'service_last_check' => [
+                'service.state.last_update' => self::USE_EXPR
+            ],
+            'service_last_hard_state' => [
+                'service.state.previous_hard_state' => self::USE_EXPR
+            ],
+            'service_last_hard_state_change' => self::DROP,
+            'service_last_notification' => self::DROP,
+            'service_last_state_change' => [
+                'service.state.last_state_change' => self::USE_EXPR
+            ],
+            'service_last_state_change_ts' => [
+                'service.state.last_state_change' => self::USE_EXPR
+            ],
+            'service_last_time_critical' => self::DROP,
+            'service_last_time_ok' => self::DROP,
+            'service_last_time_unknown' => self::DROP,
+            'service_last_time_warning' => self::DROP,
+            'service_long_output' => [
+                'service.state.long_output' => self::USE_EXPR
+            ],
+            'service_max_check_attempts' => [
+                'service.max_check_attempts' => self::USE_EXPR
+            ],
+            'service_modified_service_attributes' => self::DROP,
+            'service_next_check' => [
+                'service.state.next_check' => self::USE_EXPR
+            ],
+            'service_notes' => [
+                'service.notes' => self::USE_EXPR
+            ],
+            'service_notes_url' => [
+                'service.notes_url.notes_url' => self::USE_EXPR
+            ],
+            'service_notifications_enabled' => [
+                'service.notifications_enabled' => self::NO_YES
+            ],
+            'service_notifications_enabled_changed' => self::DROP,
+            'service_obsessing' => self::DROP,
+            'service_obsessing_changed' => self::DROP,
+            'service_output' => [
+                'service.state.output' => self::USE_EXPR
+            ],
+            'service_passive_checks_enabled' => [
+                'service.passive_checks_enabled' => self::USE_EXPR
+            ],
+            'service_passive_checks_enabled_changed' => self::DROP,
+            'service_perfdata' => [
+                'service.state.performance_data' => self::USE_EXPR
+            ],
+            'service_problem' => [
+                'service.state.is_problem' => self::NO_YES
+            ],
+            'service_severity' => [
+                'service.state.severity' => self::USE_EXPR
+            ],
+            'service_state' => [
+                'service.state.soft_state' => self::USE_EXPR
+            ],
+            'service_state_type' => [
+                'service.state.state_type' => ['soft', 'hard']
+            ],
+            'service_unhandled' => [
+                'service.state.is_handled' => array_reverse(self::NO_YES)
+            ],
+
+            // Filter columns
+            'host_contact' => [
+                'host.user.name' => self::USE_EXPR
+            ],
+            'host_contactgroup' => [
+                'host.usergroup.name' => self::USE_EXPR
+            ],
+            'service_contact' => [
+                'service.user.name' => self::USE_EXPR
+            ],
+            'service_contactgroup' => [
+                'service.usergroup.name' => self::USE_EXPR
+            ],
+            'service_host' => [
+                'host.name_ci' => self::USE_EXPR
+            ],
+
+            // Query columns the dataview doesn't include, added here because it's possible to filter for them anyway
+            'host_icon_image' => self::DROP,
+            'host_icon_image_alt' => self::DROP,
+            'host_notes' => self::DROP,
+            'host_acknowledgement_type' => self::DROP,
+            'host_active_checks_enabled_changed' => self::DROP,
+            'host_attempt' => self::DROP,
+            'host_check_command' => self::DROP,
+            'host_check_execution_time' => self::DROP,
+            'host_check_latency' => self::DROP,
+            'host_check_timeperiod_object_id' => self::DROP,
+            'host_check_type' => self::DROP,
+            'host_current_check_attempt' => self::DROP,
+            'host_current_notification_number' => self::DROP,
+            'host_event_handler' => self::DROP,
+            'host_event_handler_enabled' => self::DROP,
+            'host_event_handler_enabled_changed' => self::DROP,
+            'host_failure_prediction_enabled' => self::DROP,
+            'host_flap_detection_enabled' => self::DROP,
+            'host_flap_detection_enabled_changed' => self::DROP,
+            'host_is_reachable' => self::DROP,
+            'host_last_notification' => self::DROP,
+            'host_max_check_attempts' => self::DROP,
+            'host_next_check' => self::DROP,
+            'host_next_notification' => self::DROP,
+            'host_no_more_notifications' => self::DROP,
+            'host_normal_check_interval' => self::DROP,
+            'host_notifications_enabled_changed' => self::DROP,
+            'host_obsessing' => self::DROP,
+            'host_obsessing_changed' => self::DROP,
+            'host_passive_checks_enabled_changed' => self::DROP,
+            'host_percent_state_change' => self::DROP,
+            'host_problem_has_been_acknowledged' => self::DROP,
+            'host_process_performance_data' => self::DROP,
+            'host_retry_check_interval' => self::DROP,
+            'host_scheduled_downtime_depth' => self::DROP,
+            'host_status_update_time' => self::DROP,
+            'host_unhandled' => self::DROP,
+            'object_type' => self::DROP,
+            'service_check_interval' => self::DROP,
+            'service_icon_image' => self::DROP,
+            'service_icon_image_alt' => self::DROP,
+            'service_check_execution_time' => self::DROP,
+            'service_check_latency' => self::DROP,
+            'service_check_timeperiod_object_id' => self::DROP,
+            'service_check_type' => self::DROP,
+            'service_event_handler' => self::DROP,
+            'service_failure_prediction_enabled' => self::DROP,
+            'service_is_passive_checked' => self::DROP,
+            'service_next_notification' => self::DROP,
+            'service_next_update' => function ($filter) {
+                /** @var Filter\Condition $filter */
+                if ($filter->getValue() !== 'now') {
+                    return false;
+                }
+
+                // Doesn't get dropped because there's a default dashlet using it..
+                // Though since this dashlet uses it to check for overdue services we'll
+                // replace it as next_update is volatile (only in redis up2date)
+                return Filter::equal('service.state.is_overdue', $filter instanceof Filter\LessThan ? 'y' : 'n');
+            },
+            'service_no_more_notifications' => self::DROP,
+            'service_normal_check_interval' => self::DROP,
+            'service_percent_state_change' => self::DROP,
+            'service_problem_has_been_acknowledged' => self::DROP,
+            'service_process_performance_data' => self::DROP,
+            'service_retry_check_interval' => self::DROP,
+            'service_scheduled_downtime_depth' => self::DROP,
+            'service_status_update_time' => self::DROP,
+            'problems' => self::DROP,
+        ];
+    }
+
+    protected static function servicegridColumns(): array
+    {
+        return array_merge(
+            static::servicesColumns(),
+            [
+                'problems' => [
+                    'problems' => self::USE_EXPR
+                ]
+            ]
+        );
+    }
+
+    protected static function multipleServicesColumns(): array
+    {
+        return array_merge(
+            static::servicesColumns(),
+            [
+                'host' => [
+                    'host.name' => self::USE_EXPR
+                ],
+                'service' => [
+                    'service.name' => self::USE_EXPR
+                ]
+            ]
+        );
+    }
+
+    protected static function serviceColumns(): array
+    {
+        return [
+            'host' => [
+                'host.name' => self::USE_EXPR
+            ],
+            'service' => [
+                'name' => self::USE_EXPR
+            ]
+        ];
+    }
+
+    protected static function hostgroupsColumns(): array
+    {
+        return [
+
+            // Query columns
+            'hostgroup_alias' => [
+                'hostgroup.display_name' => self::USE_EXPR
+            ],
+            'hosts_severity' => self::SORT_ONLY,
+            'hosts_total' => self::SORT_ONLY,
+            'services_total' => self::SORT_ONLY,
+
+            // Filter columns
+            'host_contact' => [
+                'host.user.name' => self::USE_EXPR
+            ],
+            'host_contactgroup' => [
+                'host.usergroup.name' => self::USE_EXPR
+            ]
+        ];
+    }
+
+    protected static function servicegroupsColumns(): array
+    {
+        return [
+
+            // Query columns
+            'services_severity' => self::SORT_ONLY,
+            'services_total' => self::SORT_ONLY,
+            'servicegroup_alias' => [
+                'servicegroup.display_name' => self::USE_EXPR
+            ],
+
+            // Filter columns
+            'host_contact' => [
+                'host.user.name' => self::USE_EXPR
+            ],
+            'host_contactgroup' => [
+                'host.usergroup.name' => self::USE_EXPR
+            ],
+            'service_contact' => [
+                'service.user.name' => self::USE_EXPR
+            ],
+            'service_contactgroup' => [
+                'service.usergroup.name' => self::USE_EXPR
+            ]
+        ];
+    }
+
+    protected static function contactgroupsColumns(): array
+    {
+        return [
+
+            // Query columns
+            'contactgroup_name' => [
+                'usergroup.name' => self::USE_EXPR
+            ],
+            'contactgroup_alias' => [
+                'usergroup.display_name' => self::USE_EXPR
+            ],
+            'contact_count' => self::DROP,
+
+            // Filter columns
+            'contactgroup' => [
+                'usergroup.name_ci' => self::USE_EXPR
+            ]
+        ];
+    }
+
+    protected static function contactsColumns(): array
+    {
+        $receivesStateNotifications = function ($state, $type = null) {
+            return function ($filter) use ($state, $type) {
+                /** @var Filter\Condition $filter */
+                $negate = $filter instanceof Filter\Unequal || $filter instanceof Filter\Unlike;
+                switch ($filter->getValue()) {
+                    case '0':
+                        $filter = Filter::any(
+                            Filter::equal('user.notifications_enabled', 'n'),
+                            Filter::unequal('user.states', $state)
+                        );
+                        if ($type !== null) {
+                            $filter->add(Filter::unequal('user.types', $type));
+                        }
+
+                        break;
+                    case '1':
+                        $filter = Filter::all(
+                            Filter::equal('user.notifications_enabled', 'y'),
+                            Filter::equal('user.states', $state)
+                        );
+                        if ($type !== null) {
+                            $filter->add(Filter::equal('user.types', $type));
+                        }
+
+                        break;
+                    default:
+                        return null;
+                }
+
+                if ($negate) {
+                    $filter = Filter::none($filter);
+                }
+
+                return $filter;
+            };
+        };
+
+        return [
+
+            // Query columns
+            'contact_object_id' => self::DROP,
+            'contact_id' => [
+                'user.id' => self::USE_EXPR
+            ],
+            'contact_name' => [
+                'user.name' => self::USE_EXPR
+            ],
+            'contact_alias' => [
+                'user.display_name' => self::USE_EXPR
+            ],
+            'contact_email' => [
+                'user.email' => self::USE_EXPR
+            ],
+            'contact_pager' => [
+                'user.pager' => self::USE_EXPR
+            ],
+            'contact_has_host_notfications' => $receivesStateNotifications(['up', 'down']),
+            'contact_has_service_notfications' => $receivesStateNotifications(['ok', 'warning', 'critical', 'unknown']),
+            'contact_can_submit_commands' => self::DROP,
+            'contact_notify_service_recovery' => $receivesStateNotifications(
+                ['ok', 'warning', 'critical', 'unknown'],
+                'recovery'
+            ),
+            'contact_notify_service_warning' => $receivesStateNotifications('warning'),
+            'contact_notify_service_critical' => $receivesStateNotifications('critical'),
+            'contact_notify_service_unknown' => $receivesStateNotifications('unknown'),
+            'contact_notify_service_flapping' => $receivesStateNotifications(
+                ['ok', 'warning', 'critical', 'unknown'],
+                ['flapping_start', 'flapping_end']
+            ),
+            'contact_notify_service_downtime' => $receivesStateNotifications(
+                ['ok', 'warning', 'critical', 'unknown'],
+                ['downtime_start', 'downtime_end', 'downtime_removed']
+            ),
+            'contact_notify_host_recovery' => $receivesStateNotifications(['up', 'down'], 'recovery'),
+            'contact_notify_host_down' => $receivesStateNotifications('down'),
+            'contact_notify_host_unreachable' => self::DROP,
+            'contact_notify_host_flapping' => $receivesStateNotifications(
+                ['up', 'down'],
+                ['flapping_start', 'flapping_end']
+            ),
+            'contact_notify_host_downtime' => $receivesStateNotifications(
+                ['up', 'down'],
+                ['downtime_start', 'downtime_end', 'downtime_removed']
+            ),
+            'contact_notify_host_timeperiod' => function ($filter) {
+                /** @var Filter\Condition $filter */
+                $filter->setColumn('user.timeperiod.name_ci');
+                return Filter::all(
+                    $filter,
+                    Filter::equal('user.states', ['up', 'down'])
+                );
+            },
+            'contact_notify_service_timeperiod' => function ($filter) {
+                /** @var Filter\Condition $filter */
+                $filter->setColumn('user.timeperiod.name_ci');
+                return Filter::all(
+                    $filter,
+                    Filter::equal('user.states', ['ok', 'warning', 'critical', 'unknown'])
+                );
+            },
+
+            // Filter columns
+            'contact' => [
+                'user.name_ci' => self::USE_EXPR
+            ],
+            'contactgroup' => [
+                'usergroup.name_ci' => self::USE_EXPR
+            ],
+            'contactgroup_name' => [
+                'usergroup.name' => self::USE_EXPR
+            ],
+            'contactgroup_alias' => [
+                'usergroup.display_name' => self::USE_EXPR
+            ]
+        ];
+    }
+
+    protected static function commentsColumns(): array
+    {
+        return [
+
+            // Query columns
+            'comment_author_name' => [
+                'comment.author' => self::USE_EXPR
+            ],
+            'comment_data' => [
+                'comment.text' => self::USE_EXPR
+            ],
+            'comment_expiration' => [
+                'comment.expire_time' => self::USE_EXPR
+            ],
+            'comment_internal_id' => self::DROP,
+            'comment_is_persistent' => [
+                'comment.is_persistent' => self::NO_YES
+            ],
+            'comment_name' => [
+                'comment.name' => self::USE_EXPR
+            ],
+            'comment_timestamp' => [
+                'comment.entry_time' => self::USE_EXPR
+            ],
+            'comment_type' => [
+                'comment.entry_type' => self::LOWER_EXPR
+            ],
+            'host_display_name' => [
+                'host.display_name' => self::USE_EXPR
+            ],
+            'object_type' => [
+                'comment.object_type' => self::LOWER_EXPR
+            ],
+            'service_display_name' => [
+                'service.display_name' => self::USE_EXPR
+            ],
+            'service_host_name' => [
+                'host.name' => self::USE_EXPR
+            ],
+
+            // Filter columns
+            'comment_author' => [
+                'comment.author' => self::USE_EXPR
+            ]
+        ];
+    }
+
+    protected static function downtimesColumns(): array
+    {
+        return [
+
+            // Query columns
+            'downtime_author_name' => [
+                'downtime.author' => self::USE_EXPR
+            ],
+            'downtime_comment' => [
+                'downtime.comment' => self::USE_EXPR
+            ],
+            'downtime_duration' => [
+                'downtime.flexible_duration' => self::USE_EXPR
+            ],
+            'downtime_end' => [
+                'downtime.end_time' => self::USE_EXPR
+            ],
+            'downtime_entry_time' => [
+                'downtime.entry_time' => self::USE_EXPR
+            ],
+            'downtime_internal_id' => self::DROP,
+            'downtime_is_fixed' => [
+                'downtime.is_flexible' => array_reverse(self::NO_YES)
+            ],
+            'downtime_is_flexible' => [
+                'downtime.is_flexible' => self::NO_YES
+            ],
+            'downtime_is_in_effect' => [
+                'downtime.is_in_effect' => self::NO_YES
+            ],
+            'downtime_name' => [
+                'downtime.name' => self::USE_EXPR
+            ],
+            'downtime_scheduled_end' => [
+                'downtime.scheduled_end_time' => self::USE_EXPR
+            ],
+            'downtime_scheduled_start' => [
+                'downtime.scheduled_start_time' => self::USE_EXPR
+            ],
+            'downtime_start' => [
+                'downtime.start_time' => self::USE_EXPR
+            ],
+            'host_display_name' => [
+                'host.display_name' => self::USE_EXPR
+            ],
+            'host_state' => [
+                'host.state.soft_state' => self::USE_EXPR
+            ],
+            'object_type' => [
+                'downtime.object_type' => self::LOWER_EXPR
+            ],
+            'service_display_name' => [
+                'service.display_name' => self::USE_EXPR
+            ],
+            'service_host_name' => [
+                'host.name' => self::USE_EXPR
+            ],
+            'service_state' => [
+                'service.state.soft_state' => self::USE_EXPR
+            ],
+
+            // Filter columns
+            'downtime_author' => [
+                'downtime.author' => self::USE_EXPR
+            ]
+        ];
+    }
+
+    protected static function historyColumns(): array
+    {
+        return [
+
+            // Query columns
+            'id' => self::DROP,
+            'object_type' => [
+                'history.object_type' => self::LOWER_EXPR
+            ],
+            'timestamp' => [
+                'history.event_time' => self::USE_EXPR
+            ],
+            'state' => [
+                'history.state.soft_state' => self::USE_EXPR
+            ],
+            'output' => [
+                'history.state.output' => self::USE_EXPR
+            ],
+            'type' => function ($filter) {
+                /** @var Filter\Condition $filter */
+                $expr = strtolower($filter->getValue());
+
+                switch (true) {
+                    // NotificationhistoryQuery
+                    case substr($expr, 0, 13) === 'notification_':
+                        $filter->setColumn('history.notification.type');
+                        $filter->setValue([
+                            'notification_ack' => 'acknowledgement',
+                            'notification_flapping' => 'flapping_start',
+                            'notification_flapping_end' => 'flapping_end',
+                            'notification_dt_start' => 'downtime_start',
+                            'notification_dt_end' => 'downtime_end',
+                            'notification_custom' => 'custom',
+                            'notification_state' => ['problem', 'recovery']
+                        ][$expr]);
+                        return Filter::all($filter, Filter::equal('history.event_type', 'notification'));
+                    // StatehistoryQuery
+                    case in_array($expr, ['soft_state', 'hard_state'], true):
+                        $filter->setColumn('history.state.state_type');
+                        $filter->setValue(substr($expr, 0, 4));
+                        return Filter::all($filter, Filter::equal('history.event_type', 'state_change'));
+                     // DowntimestarthistoryQuery and DowntimeendhistoryQuery
+                    case in_array($expr, ['dt_start', 'dt_end'], true):
+                        $filter->setColumn('history.event_type');
+                        $filter->setValue('downtime_' . substr($expr, 3));
+                        return $filter;
+                    // CommenthistoryQuery
+                    case in_array($expr, ['comment', 'ack'], true):
+                        $filter->setColumn('history.comment.entry_type');
+                        $filter->setValue($expr);
+                        return Filter::all($filter, Filter::equal('history.event_type', 'comment_add'));
+                    // CommentdeletionhistoryQuery
+                    case in_array($expr, ['comment_deleted', 'ack_deleted'], true):
+                        $filter->setColumn('history.comment.entry_type');
+                        $filter->setValue($expr);
+                        return Filter::all($filter, Filter::equal('history.event_type', 'comment_remove'));
+                    // FlappingstarthistoryQuery and CommenthistoryQuery
+                    case in_array($expr, ['flapping', 'flapping_deleted'], true):
+                        $filter->setColumn('history.event_type');
+                        return $filter->setValue($expr === 'flapping' ? 'flapping_start' : 'flapping_end');
+                }
+            }
+        ];
+    }
+
+    protected static function notificationHistoryColumns(): array
+    {
+        return [
+
+            // Query columns
+            'notification_contact_name' => [
+                'notification_history.user.name' => self::USE_EXPR
+            ],
+            'notification_output' => [
+                'notification_history.text' => self::USE_EXPR
+            ],
+            'notification_reason' => [
+                'notification_history.type' => [
+                    0 => ['problem', 'recovery'],
+                    1 => 'acknowledgement',
+                    2 => 'flapping_start',
+                    3 => 'flapping_end',
+                    5 => 'downtime_start',
+                    6 => 'downtime_end',
+                    7 => 'downtime_removed',
+                    8 => 'custom' // ido schema doc says it's `99`, icinga2 though uses `8`
+                ]
+            ],
+            'notification_state' => [
+                'notification_history.state' => self::USE_EXPR
+            ],
+            'notification_timestamp' => [
+                'notification_history.send_time' => self::USE_EXPR
+            ],
+            'object_type' => [
+                'notification_history.object_type' => self::LOWER_EXPR
+            ],
+            'service_host_name' => [
+                'host.name' => self::USE_EXPR
+            ]
+        ];
+    }
+}
diff --git a/library/Icingadb/Data/CsvResultSet.php b/library/Icingadb/Data/CsvResultSet.php
new file mode 100644
index 0000000..24e34a6
--- /dev/null
+++ b/library/Icingadb/Data/CsvResultSet.php
@@ -0,0 +1,77 @@
+<?php
+
+/* Icinga DB Web | (c) 2022 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Data;
+
+use ipl\Orm\Model;
+use ipl\Orm\Query;
+use ipl\Orm\ResultSet;
+
+class CsvResultSet extends ResultSet
+{
+    protected $isCacheDisabled = true;
+
+    public function current()
+    {
+        return $this->extractKeysAndValues(parent::current());
+    }
+
+    protected function formatValue(string $key, ?string $value): ?string
+    {
+        if (
+            $value
+            && (
+                $key === 'id'
+                || substr($key, -3) === '_id'
+                || substr($key, -3) === '.id'
+                || substr($key, -9) === '_checksum'
+                || substr($key, -4) === '_bin'
+            )
+        ) {
+            $value = bin2hex($value);
+        }
+
+        if (is_bool($value)) {
+            return $value ? 'true' : 'false';
+        } elseif (is_string($value)) {
+            return '"' . str_replace('"', '""', $value) . '"';
+        } elseif (is_array($value)) {
+            return '"' . implode(',', $value) . '"';
+        } else {
+            return $value;
+        }
+    }
+
+    protected function extractKeysAndValues(Model $model, string $path = ''): array
+    {
+        $keysAndValues = [];
+        foreach ($model as $key => $value) {
+            $keyPath = ($path ? $path . '.' : '') . $key;
+            if ($value instanceof Model) {
+                $keysAndValues += $this->extractKeysAndValues($value, $keyPath);
+            } else {
+                $keysAndValues[$keyPath] = $this->formatValue($key, $value);
+            }
+        }
+
+        return $keysAndValues;
+    }
+
+    public static function stream(Query $query): void
+    {
+        $query->setResultSetClass(__CLASS__);
+
+        foreach ($query as $i => $keysAndValues) {
+            if ($i === 0) {
+                echo implode(',', array_keys($keysAndValues));
+            }
+
+            echo "\r\n";
+
+            echo implode(',', array_values($keysAndValues));
+        }
+
+        exit;
+    }
+}
diff --git a/library/Icingadb/Data/JsonResultSet.php b/library/Icingadb/Data/JsonResultSet.php
new file mode 100644
index 0000000..e0eb623
--- /dev/null
+++ b/library/Icingadb/Data/JsonResultSet.php
@@ -0,0 +1,70 @@
+<?php
+
+/* Icinga DB Web | (c) 2022 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Data;
+
+use Icinga\Util\Json;
+use ipl\Orm\Model;
+use ipl\Orm\Query;
+use ipl\Orm\ResultSet;
+
+class JsonResultSet extends ResultSet
+{
+    protected $isCacheDisabled = true;
+
+    public function current()
+    {
+        return $this->createObject(parent::current());
+    }
+
+    protected function formatValue(string $key, ?string $value): ?string
+    {
+        if (
+            $value
+            && (
+                $key === 'id'
+                || substr($key, -3) === '_id'
+                || substr($key, -3) === '.id'
+                || substr($key, -9) === '_checksum'
+                || substr($key, -4) === '_bin'
+            )
+        ) {
+            $value = bin2hex($value);
+        }
+
+        return $value;
+    }
+
+    protected function createObject(Model $model): array
+    {
+        $keysAndValues = [];
+        foreach ($model as $key => $value) {
+            if ($value instanceof Model) {
+                $keysAndValues[$key] = $this->createObject($value);
+            } else {
+                $keysAndValues[$key] = $this->formatValue($key, $value);
+            }
+        }
+
+        return $keysAndValues;
+    }
+
+    public static function stream(Query $query): void
+    {
+        $query->setResultSetClass(__CLASS__);
+
+        echo '[';
+        foreach ($query as $i => $object) {
+            if ($i > 0) {
+                echo ",\n";
+            }
+
+            echo Json::sanitize($object);
+        }
+
+        echo ']';
+
+        exit;
+    }
+}
diff --git a/library/Icingadb/Data/PivotTable.php b/library/Icingadb/Data/PivotTable.php
new file mode 100644
index 0000000..2819e11
--- /dev/null
+++ b/library/Icingadb/Data/PivotTable.php
@@ -0,0 +1,436 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Data;
+
+use Icinga\Application\Icinga;
+use ipl\Orm\Query;
+use ipl\Stdlib\Contract\Paginatable;
+use ipl\Stdlib\Filter;
+
+class PivotTable
+{
+    const SORT_ASC = 'asc';
+
+    /**
+     * The query to fetch as pivot table
+     *
+     * @var Query
+     */
+    protected $baseQuery;
+
+    /**
+     * X-axis pivot column
+     *
+     * @var string
+     */
+    protected $xAxisColumn;
+
+    /**
+     * Y-axis pivot column
+     *
+     * @var string
+     */
+    protected $yAxisColumn;
+
+    /**
+     * The filter being applied on the query for the x-axis
+     *
+     * @var Filter\Rule
+     */
+    protected $xAxisFilter;
+
+    /**
+     * The filter being applied on the query for the y-axis
+     *
+     * @var Filter\Rule
+     */
+    protected $yAxisFilter;
+
+    /**
+     * The query to fetch the leading x-axis rows and their headers
+     *
+     * @var Query
+     */
+    protected $xAxisQuery;
+
+    /**
+     * The query to fetch the leading y-axis rows and their headers
+     *
+     * @var Query
+     */
+    protected $yAxisQuery;
+
+    /**
+     * X-axis header column
+     *
+     * @var string|null
+     */
+    protected $xAxisHeader;
+
+    /**
+     * Y-axis header column
+     *
+     * @var string|null
+     */
+    protected $yAxisHeader;
+
+    /**
+     * Order by column and direction
+     *
+     * @var array
+     */
+    protected $order = [];
+
+    /**
+     * Grid columns as [Alias => Column name] pairs
+     *
+     * @var array
+     */
+    protected $gridcols = [];
+
+    /**
+     * Create a new pivot table
+     *
+     * @param   Query       $query          The query to fetch as pivot table
+     * @param   string      $xAxisColumn    X-axis pivot column
+     * @param   string      $yAxisColumn    Y-axis pivot column
+     * @param   array      $gridcols        Grid columns
+     */
+    public function __construct(Query $query, string $xAxisColumn, string $yAxisColumn, array $gridcols)
+    {
+        foreach ($query->getOrderBy() as $sort) {
+            $this->order[$sort[0]] = $sort[1];
+        }
+
+        $this->baseQuery = $query->columns($gridcols)->resetOrderBy();
+        $this->xAxisColumn = $xAxisColumn;
+        $this->yAxisColumn = $yAxisColumn;
+        $this->gridcols = $gridcols;
+    }
+
+    /**
+     * Set the filter to apply on the query for the x-axis
+     *
+     * @param   Filter\Rule  $filter
+     *
+     * @return  $this
+     */
+    public function setXAxisFilter(Filter\Rule $filter = null): self
+    {
+        $this->xAxisFilter = $filter;
+        return  $this;
+    }
+
+    /**
+     * Set the filter to apply on the query for the y-axis
+     *
+     * @param   Filter\Rule  $filter
+     *
+     * @return  $this
+     */
+    public function setYAxisFilter(Filter\Rule $filter = null): self
+    {
+        $this->yAxisFilter = $filter;
+        return  $this;
+    }
+
+    /**
+     * Get the x-axis header
+     *
+     * Defaults to {@link $xAxisColumn} in case no x-axis header has been set using {@link setXAxisHeader()}
+     *
+     * @return string
+     */
+    public function getXAxisHeader(): string
+    {
+        if ($this->xAxisHeader === null && $this->xAxisColumn === null) {
+            throw new \LogicException(
+                'You are accessing an unset property. Please make sure to set it beforehand.'
+            );
+        }
+
+        return $this->xAxisHeader !== null ? $this->xAxisHeader : $this->xAxisColumn;
+    }
+
+    /**
+     * Set the x-axis header
+     *
+     * @param   string $xAxisHeader
+     *
+     * @return  $this
+     */
+    public function setXAxisHeader(string $xAxisHeader): self
+    {
+        $this->xAxisHeader = $xAxisHeader;
+        return $this;
+    }
+
+    /**
+     * Get the y-axis header
+     *
+     * Defaults to {@link $yAxisColumn} in case no x-axis header has been set using {@link setYAxisHeader()}
+     *
+     * @return string
+     */
+    public function getYAxisHeader(): string
+    {
+        if ($this->yAxisHeader === null && $this->yAxisColumn === null) {
+            throw new \LogicException(
+                'You are accessing an unset property. Please make sure to set it beforehand.'
+            );
+        }
+
+        return $this->yAxisHeader !== null ? $this->yAxisHeader : $this->yAxisColumn;
+    }
+
+    /**
+     * Set the y-axis header
+     *
+     * @param   string $yAxisHeader
+     *
+     * @return  $this
+     */
+    public function setYAxisHeader(string $yAxisHeader): self
+    {
+        $this->yAxisHeader = $yAxisHeader;
+        return $this;
+    }
+
+    /**
+     * Return the value for the given request parameter
+     *
+     * @param   string  $axis       The axis for which to return the parameter ('x' or 'y')
+     * @param   string  $param      The parameter name to return
+     * @param   int     $default    The default value to return
+     *
+     * @return  int
+     */
+    protected function getPaginationParameter(string $axis, string $param, int $default = null): int
+    {
+        $request = Icinga::app()->getRequest();
+
+        $value = $request->getParam($param, '');
+        if (strpos($value, ',') > 0) {
+            $parts = explode(',', $value, 2);
+            return intval($parts[$axis === 'x' ? 0 : 1]);
+        }
+
+        return $default !== null ? $default : 0;
+    }
+
+    /**
+     * Query horizontal (x) axis
+     *
+     * @return Query
+     */
+    protected function queryXAxis(): Query
+    {
+        if ($this->xAxisQuery === null) {
+            $this->xAxisQuery = clone $this->baseQuery;
+            $xAxisHeader = $this->getXAxisHeader();
+            $table = $this->xAxisQuery->getModel()->getTableName();
+            $xCol = explode('.', $this->gridcols[$this->xAxisColumn]);
+            $columns = [
+                $this->xAxisColumn => $this->gridcols[$this->xAxisColumn],
+                $xAxisHeader => $this->gridcols[$xAxisHeader]
+            ];
+
+            // TODO: This shouldn't be required. Refactor this once ipl\Orm\Query has support for group by rules!
+            if ($xCol[0] !== $table) {
+                $groupCols = array_unique([
+                    $this->xAxisColumn => $table . '_' . $this->gridcols[$this->xAxisColumn],
+                    $xAxisHeader => $table . '_' . $this->gridcols[$xAxisHeader]
+                ]);
+            } else {
+                $groupCols = $columns;
+            }
+
+            $this->xAxisQuery->getSelectBase()->groupBy($groupCols);
+
+            if (count($columns) !== 2) {
+                $columns[] = $this->gridcols[$xAxisHeader];
+            }
+
+            $this->xAxisQuery->columns($columns);
+
+            if ($this->xAxisFilter !== null) {
+                $this->xAxisQuery->filter($this->xAxisFilter);
+            }
+
+            $this->xAxisQuery->orderBy(
+                $this->gridcols[$xAxisHeader],
+                isset($this->order[$this->gridcols[$xAxisHeader]]) ?
+                    $this->order[$this->gridcols[$xAxisHeader]] : self::SORT_ASC
+            );
+        }
+
+        return $this->xAxisQuery;
+    }
+
+    /**
+     * Query vertical (y) axis
+     *
+     * @return Query
+     */
+    protected function queryYAxis(): Query
+    {
+        if ($this->yAxisQuery === null) {
+            $this->yAxisQuery = clone $this->baseQuery;
+            $yAxisHeader = $this->getYAxisHeader();
+            $table = $this->yAxisQuery->getModel()->getTableName();
+            $columns = [
+                $this->yAxisColumn => $this->gridcols[$this->yAxisColumn],
+                $yAxisHeader => $this->gridcols[$yAxisHeader]
+            ];
+            $yCol = explode('.', $this->gridcols[$this->yAxisColumn]);
+
+            // TODO: This shouldn't be required. Refactor this once ipl\Orm\Query has support for group by rules!
+            if ($yCol[0] !== $table) {
+                $groupCols = array_unique([
+                    $this->yAxisColumn => $table . '_' . $this->gridcols[$this->yAxisColumn],
+                    $yAxisHeader => $table . '_' . $this->gridcols[$yAxisHeader]
+                ]);
+            } else {
+                $groupCols = $columns;
+            }
+
+            $this->yAxisQuery->getSelectBase()->groupBy($groupCols);
+
+            if (count($columns) !== 2) {
+                $columns[] = $this->gridcols[$yAxisHeader];
+            }
+
+            $this->yAxisQuery->columns($columns);
+
+            if ($this->yAxisFilter !== null) {
+                $this->yAxisQuery->filter($this->yAxisFilter);
+            }
+
+            $this->yAxisQuery->orderBy(
+                $this->gridcols[$yAxisHeader],
+                isset($this->order[$this->gridcols[$yAxisHeader]]) ?
+                    $this->order[$this->gridcols[$yAxisHeader]] : self::SORT_ASC
+            );
+        }
+
+        return $this->yAxisQuery;
+    }
+
+    /**
+     * Return a pagination adapter for the x-axis query
+     *
+     * $limit and $page are taken from the current request if not given.
+     *
+     * @param   int     $limit  The maximum amount of entries to fetch
+     * @param   int     $page   The page to set as current one
+     *
+     * @return  Paginatable
+     */
+    public function paginateXAxis(int $limit = null, int $page = null): Paginatable
+    {
+        if ($limit === null || $page === null) {
+            if ($limit === null) {
+                $limit = $this->getPaginationParameter('x', 'limit', 20);
+            }
+
+            if ($page === null) {
+                $page = $this->getPaginationParameter('x', 'page', 1);
+            }
+        }
+
+        $query = $this->queryXAxis();
+
+        $query->limit($limit);
+
+        $query->offset($page > 0 ? ($page - 1) * $limit : 0);
+
+        return $query;
+    }
+
+    /**
+     * Return a Paginatable for the y-axis query
+     *
+     * $limit and $page are taken from the current request if not given.
+     *
+     * @param int $limit The maximum amount of entries to fetch
+     * @param int $page The page to set as current one
+     *
+     * @return  Paginatable
+     */
+    public function paginateYAxis(int $limit = null, int $page = null): Paginatable
+    {
+        if ($limit === null || $page === null) {
+            if ($limit === null) {
+                $limit = $this->getPaginationParameter('y', 'limit', 20);
+            }
+
+            if ($page === null) {
+                $page = $this->getPaginationParameter('y', 'page', 1);
+            }
+        }
+
+        $query = $this->queryYAxis();
+        $query->limit($limit);
+        $query->offset($page > 0 ? ($page - 1) * $limit : 0);
+
+        return $query;
+    }
+
+    /**
+     * Return the pivot table as an array of pivot data and pivot header
+     *
+     * @return array
+     */
+    public function toArray(): array
+    {
+        if (
+            ($this->xAxisFilter === null && $this->yAxisFilter === null)
+            || ($this->xAxisFilter !== null && $this->yAxisFilter !== null)
+        ) {
+            $xAxis = $this->queryXAxis()->getDb()->fetchPairs($this->queryXAxis()->assembleSelect());
+            $xAxisKeys = array_keys($xAxis);
+            $yAxis = $this->queryYAxis()->getDb()->fetchPairs($this->queryYAxis()->assembleSelect());
+            $yAxisKeys = array_keys($yAxis);
+        } else {
+            if ($this->xAxisFilter !== null) {
+                $xAxis = $this->queryXAxis()->getDb()->fetchPairs($this->queryXAxis()->assembleSelect());
+                $xAxisKeys = array_keys($xAxis);
+                $yQuery = $this->queryYAxis();
+                $yQuery->filter(Filter::equal($this->gridcols[$this->xAxisColumn], $xAxisKeys));
+                $yAxis = $this->queryYAxis()->getDb()->fetchPairs($this->queryYAxis()->assembleSelect());
+                $yAxisKeys = array_keys($yAxis);
+            } else { // $this->yAxisFilter !== null
+                $yAxis = $this->queryYAxis()->getDb()->fetchPairs($this->queryYAxis()->assembleSelect());
+                $yAxisKeys = array_keys($yAxis);
+                $xQuery = $this->queryXAxis();
+                $xQuery->filter(Filter::equal($this->gridcols[$this->yAxisColumn], $yAxisKeys));
+                $xAxis = $this->queryXAxis()->getDb()->fetchPairs($this->queryXAxis()->assembleSelect());
+                $xAxisKeys = array_keys($yAxis);
+            }
+        }
+
+        $pivotData = [];
+        $pivotHeader = [
+            'cols'  => $xAxis,
+            'rows'  => $yAxis
+        ];
+
+        if (! empty($xAxis) && ! empty($yAxis)) {
+            $this->baseQuery->filter(Filter::equal($this->gridcols[$this->xAxisColumn], $xAxisKeys));
+            $this->baseQuery->filter(Filter::equal($this->gridcols[$this->yAxisColumn], $yAxisKeys));
+            foreach ($yAxisKeys as $yAxisKey) {
+                foreach ($xAxisKeys as $xAxisKey) {
+                    $pivotData[$yAxisKey][$xAxisKey] = null;
+                }
+            }
+
+            foreach ($this->baseQuery as $row) {
+                $pivotData[$row->{$this->yAxisColumn}][$row->{$this->xAxisColumn}] = $row;
+            }
+        }
+
+        return [$pivotData, $pivotHeader];
+    }
+}
diff --git a/library/Icingadb/Hook/ActionsHook/ObjectActionsHook.php b/library/Icingadb/Hook/ActionsHook/ObjectActionsHook.php
new file mode 100644
index 0000000..2f8df33
--- /dev/null
+++ b/library/Icingadb/Hook/ActionsHook/ObjectActionsHook.php
@@ -0,0 +1,83 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Hook\ActionsHook;
+
+use Exception;
+use Icinga\Application\Hook;
+use Icinga\Application\Logger;
+use Icinga\Exception\IcingaException;
+use Icinga\Module\Icingadb\Hook\Common\HookUtils;
+use Icinga\Module\Icingadb\Hook\HostActionsHook;
+use Icinga\Module\Icingadb\Hook\ServiceActionsHook;
+use Icinga\Module\Icingadb\Model\Host;
+use Icinga\Module\Icingadb\Model\Service;
+use InvalidArgumentException;
+use ipl\Html\Attributes;
+use ipl\Html\HtmlElement;
+use ipl\Html\HtmlString;
+use ipl\Html\Text;
+use ipl\Orm\Model;
+use ipl\Web\Widget\Link;
+
+use function ipl\Stdlib\get_php_type;
+
+abstract class ObjectActionsHook
+{
+    use HookUtils;
+
+    /**
+     * Load all actions for the given object
+     *
+     * @param Host|Service $object
+     *
+     * @return HtmlElement
+     *
+     * @throws InvalidArgumentException If the given model is not supported
+     */
+    final public static function loadActions(Model $object): HtmlElement
+    {
+        switch (true) {
+            case $object instanceof Host:
+                /** @var HostActionsHook $hook */
+                $hookName = 'Icingadb\\HostActions';
+                break;
+            case $object instanceof Service:
+                /** @var ServiceActionsHook $hook */
+                $hookName = 'Icingadb\\ServiceActions';
+                break;
+            default:
+                throw new InvalidArgumentException(
+                    sprintf('%s is not a supported object type', get_php_type($object))
+                );
+        }
+
+        $list = new HtmlElement('ul', Attributes::create(['class' => 'object-detail-actions']));
+        foreach (Hook::all($hookName) as $hook) {
+            try {
+                foreach ($hook->getActionsForObject($object) as $link) {
+                    if (! $link instanceof Link) {
+                        continue;
+                    }
+
+                    // It may be ValidHtml, but modules shouldn't be able to break our views.
+                    // That's why it needs to be rendered instantly, as any error will then
+                    // be caught here.
+                    $renderedLink = (string) $link;
+                    $moduleName = $hook->getModule()->getName();
+
+                    $list->addHtml(new HtmlElement('li', Attributes::create([
+                        'class' => 'icinga-module module-' . $moduleName,
+                        'data-icinga-module' => $moduleName
+                    ]), HtmlString::create($renderedLink)));
+                }
+            } catch (Exception $e) {
+                Logger::error("Failed to load object actions: %s\n%s", $e, $e->getTraceAsString());
+                $list->addHtml(new HtmlElement('li', null, Text::create(IcingaException::describe($e))));
+            }
+        }
+
+        return $list;
+    }
+}
diff --git a/library/Icingadb/Hook/Common/HookUtils.php b/library/Icingadb/Hook/Common/HookUtils.php
new file mode 100644
index 0000000..8778849
--- /dev/null
+++ b/library/Icingadb/Hook/Common/HookUtils.php
@@ -0,0 +1,39 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Hook\Common;
+
+use Icinga\Application\ClassLoader;
+use Icinga\Application\Icinga;
+use Icinga\Application\Modules\Module;
+
+trait HookUtils
+{
+    final public function __construct()
+    {
+        $this->init();
+    }
+
+    /**
+     * Initialize this hook
+     *
+     * Override this in your concrete implementation for any initialization at construction time.
+     */
+    protected function init()
+    {
+    }
+
+    /**
+     * Get the module this hook belongs to
+     *
+     * @return Module
+     */
+    final public function getModule(): Module
+    {
+        $moduleName = ClassLoader::extractModuleName(static::class);
+
+        return Icinga::app()->getModuleManager()
+            ->getModule($moduleName);
+    }
+}
diff --git a/library/Icingadb/Hook/CustomVarRendererHook.php b/library/Icingadb/Hook/CustomVarRendererHook.php
new file mode 100644
index 0000000..be3325b
--- /dev/null
+++ b/library/Icingadb/Hook/CustomVarRendererHook.php
@@ -0,0 +1,102 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Hook;
+
+use Closure;
+use Exception;
+use Icinga\Application\Hook;
+use Icinga\Application\Logger;
+use Icinga\Module\Icingadb\Hook\Common\HookUtils;
+use ipl\Orm\Model;
+
+abstract class CustomVarRendererHook
+{
+    use HookUtils;
+
+    /**
+     * Prefetch the data the hook needs to render custom variables
+     *
+     * @param Model $object The object for which they'll be rendered
+     *
+     * @return bool Return true if the hook can render variables for the given object, false otherwise
+     */
+    abstract public function prefetchForObject(Model $object): bool;
+
+    /**
+     * Render the given variable name
+     *
+     * @param string $key
+     *
+     * @return ?mixed
+     */
+    abstract public function renderCustomVarKey(string $key);
+
+    /**
+     * Render the given variable value
+     *
+     * @param string $key
+     * @param mixed $value
+     *
+     * @return ?mixed
+     */
+    abstract public function renderCustomVarValue(string $key, $value);
+
+    /**
+     * Return a group name for the given variable name
+     *
+     * @param string $key
+     *
+     * @return ?string
+     */
+    abstract public function identifyCustomVarGroup(string $key): ?string;
+
+    /**
+     * Prepare available hooks to render custom variables of the given object
+     *
+     * @param Model $object
+     *
+     * @return Closure A callback ($key, $value) which returns an array [$newKey, $newValue, $group]
+     */
+    final public static function prepareForObject(Model $object): Closure
+    {
+        $hooks = [];
+        foreach (Hook::all('Icingadb/CustomVarRenderer') as $hook) {
+            /** @var self $hook */
+            try {
+                if ($hook->prefetchForObject($object)) {
+                    $hooks[] = $hook;
+                }
+            } catch (Exception $e) {
+                Logger::error('Failed to load hook %s:', get_class($hook), $e);
+            }
+        }
+
+        return function (string $key, $value) use ($hooks, $object) {
+            $newKey = $key;
+            $newValue = $value;
+            $group = null;
+            foreach ($hooks as $hook) {
+                /** @var self $hook */
+
+                try {
+                    $renderedKey = $hook->renderCustomVarKey($key);
+                    $renderedValue = $hook->renderCustomVarValue($key, $value);
+                    $group = $hook->identifyCustomVarGroup($key);
+                } catch (Exception $e) {
+                    Logger::error('Failed to use hook %s:', get_class($hook), $e);
+                    continue;
+                }
+
+                if ($renderedKey !== null || $renderedValue !== null) {
+                    $newKey = $renderedKey ?? $key;
+                    $newValue = $renderedValue ?? $value;
+                    break;
+                }
+            }
+
+            return [$newKey, $newValue, $group];
+        };
+    }
+}
diff --git a/library/Icingadb/Hook/EventDetailExtensionHook.php b/library/Icingadb/Hook/EventDetailExtensionHook.php
new file mode 100644
index 0000000..c348a0c
--- /dev/null
+++ b/library/Icingadb/Hook/EventDetailExtensionHook.php
@@ -0,0 +1,21 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Hook;
+
+use Icinga\Module\Icingadb\Hook\ExtensionHook\ObjectDetailExtensionHook;
+use Icinga\Module\Icingadb\Model\History;
+use ipl\Html\ValidHtml;
+
+abstract class EventDetailExtensionHook extends ObjectDetailExtensionHook
+{
+    /**
+     * Assemble and return an HTML representation of the given event
+     *
+     * @param History $event
+     *
+     * @return ValidHtml
+     */
+    abstract public function getHtmlForObject(History $event): ValidHtml;
+}
diff --git a/library/Icingadb/Hook/ExtensionHook/BaseExtensionHook.php b/library/Icingadb/Hook/ExtensionHook/BaseExtensionHook.php
new file mode 100644
index 0000000..dfefdcd
--- /dev/null
+++ b/library/Icingadb/Hook/ExtensionHook/BaseExtensionHook.php
@@ -0,0 +1,146 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Hook\ExtensionHook;
+
+use Icinga\Module\Icingadb\Hook\Common\HookUtils;
+
+abstract class BaseExtensionHook
+{
+    use HookUtils;
+
+    /** @var int Used as default return value for {@see BaseExtensionHook::getLocation()} */
+    const IDENTIFY_LOCATION_BY_SECTION = -1;
+
+    /** @var string Output section, right at the top */
+    const OUTPUT_SECTION = 'output';
+
+    /** @var string Graph section, below output */
+    const GRAPH_SECTION = 'graph';
+
+    /** @var string Detail section, below graphs */
+    const DETAIL_SECTION = 'detail';
+
+    /** @var string Action section, below action and note urls */
+    const ACTION_SECTION = 'action';
+
+    /** @var string Problem section, below comments and downtimes */
+    const PROBLEM_SECTION = 'problem';
+
+    /** @var string Related section, below groups and notification recipients */
+    const RELATED_SECTION = 'related';
+
+    /** @var string State section, below check statistics and performance data */
+    const STATE_SECTION = 'state';
+
+    /** @var string Config section, below custom variables and feature toggles */
+    const CONFIG_SECTION = 'config';
+
+    /**
+     * Base locations for all known sections
+     *
+     * @var array<string, int>
+     */
+    const BASE_LOCATIONS = [
+        self::OUTPUT_SECTION    => 1000,
+        self::GRAPH_SECTION     => 1100,
+        self::DETAIL_SECTION    => 1200,
+        self::ACTION_SECTION    => 1300,
+        self::PROBLEM_SECTION   => 1400,
+        self::RELATED_SECTION   => 1500,
+        self::STATE_SECTION     => 1600,
+        self::CONFIG_SECTION    => 1700
+    ];
+
+    /** @var int This hook's location */
+    private $location = self::IDENTIFY_LOCATION_BY_SECTION;
+
+    /** @var string This hook's section */
+    private $section = self::DETAIL_SECTION;
+
+    /**
+     * Set this hook's location
+     *
+     * Note that setting the location explicitly may override other widgets using the same location. But beware that
+     * this applies to this hook's widget as well.
+     *
+     * Also, while the sections are guaranteed to always refer to the same general location, this guarantee is lost
+     * when setting a location explicitly. The core and base locations may change at any time and any explicitly set
+     * location will **not** adjust accordingly.
+     *
+     * @param int $location
+     *
+     * @return void
+     */
+    final public function setLocation(int $location)
+    {
+        $this->location = $location;
+    }
+
+    /**
+     * Get this hook's location
+     *
+     * @return int
+     */
+    final public function getLocation(): int
+    {
+        return $this->location;
+    }
+
+    /**
+     * Set this hook's section
+     *
+     * Sections are used to place widgets loosely in a general location. Using e.g. the `state` section this hook's
+     * widget will always appear after the check statistics and performance data widgets.
+     *
+     * @param string $section
+     *
+     * @return void
+     */
+    final public function setSection(string $section)
+    {
+        $this->section = $section;
+    }
+
+    /**
+     * Get this hook's section
+     *
+     * @return string
+     */
+    final public function getSection(): string
+    {
+        return $this->section;
+    }
+
+    /**
+     * Union both arrays and sort the result by key
+     *
+     * @param array $coreElements
+     * @param array $extensions
+     *
+     * @return array
+     */
+    final public static function injectExtensions(array $coreElements, array $extensions): array
+    {
+        $extensions += $coreElements;
+
+        uksort($extensions, function ($a, $b) {
+            if ($a < 1000 && $b >= 1000) {
+                $b -= 1000;
+                if (abs($a - $b) < 10 && abs($a % 100 - $b % 100) < 10) {
+                    return -1;
+                }
+            } elseif ($b < 1000 && $a >= 1000) {
+                $a -= 1000;
+                if (abs($a - $b) < 10 && abs($a % 100 - $b % 100) < 10) {
+                    return 1;
+                }
+            }
+
+            return $a < $b ? -1 : ($a > $b ? 1 : 0);
+        });
+
+        return $extensions;
+    }
+}
diff --git a/library/Icingadb/Hook/ExtensionHook/ObjectDetailExtensionHook.php b/library/Icingadb/Hook/ExtensionHook/ObjectDetailExtensionHook.php
new file mode 100644
index 0000000..4f0881d
--- /dev/null
+++ b/library/Icingadb/Hook/ExtensionHook/ObjectDetailExtensionHook.php
@@ -0,0 +1,118 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Hook\ExtensionHook;
+
+use Exception;
+use Icinga\Application\Hook;
+use Icinga\Application\Logger;
+use Icinga\Exception\IcingaException;
+use Icinga\Module\Icingadb\Hook\EventDetailExtensionHook;
+use Icinga\Module\Icingadb\Hook\HostDetailExtensionHook;
+use Icinga\Module\Icingadb\Hook\ServiceDetailExtensionHook;
+use Icinga\Module\Icingadb\Hook\UserDetailExtensionHook;
+use Icinga\Module\Icingadb\Hook\UsergroupDetailExtensionHook;
+use Icinga\Module\Icingadb\Model\History;
+use Icinga\Module\Icingadb\Model\Host;
+use Icinga\Module\Icingadb\Model\Service;
+use Icinga\Module\Icingadb\Model\User;
+use Icinga\Module\Icingadb\Model\Usergroup;
+use InvalidArgumentException;
+use ipl\Html\Attributes;
+use ipl\Html\HtmlElement;
+use ipl\Html\HtmlString;
+use ipl\Html\Text;
+use ipl\Html\ValidHtml;
+use ipl\Orm\Model;
+
+use function ipl\Stdlib\get_php_type;
+
+abstract class ObjectDetailExtensionHook extends BaseExtensionHook
+{
+    /**
+     * Load all extensions for the given object
+     *
+     * @param Host|Service|User|Usergroup|History $object
+     *
+     * @return array<int, ValidHtml>
+     *
+     * @throws InvalidArgumentException If the given model is not supported
+     */
+    final public static function loadExtensions(Model $object): array
+    {
+        switch (true) {
+            case $object instanceof Host:
+                /** @var HostDetailExtensionHook $hook */
+                $hookName = 'Icingadb\\HostDetailExtension';
+                break;
+            case $object instanceof Service:
+                /** @var ServiceDetailExtensionHook $hook */
+                $hookName = 'Icingadb\\ServiceDetailExtension';
+                break;
+            case $object instanceof User:
+                /** @var UserDetailExtensionHook $hook */
+                $hookName = 'Icingadb\\UserDetailExtension';
+                break;
+            case $object instanceof Usergroup:
+                /** @var UsergroupDetailExtensionHook $hook */
+                $hookName = 'Icingadb\\UsergroupDetailExtension';
+                break;
+            case $object instanceof History:
+                /** @var EventDetailExtensionHook $hook */
+                $hookName = 'Icingadb\\EventDetailExtension';
+                break;
+            default:
+                throw new InvalidArgumentException(
+                    sprintf('%s is not a supported object type', get_php_type($object))
+                );
+        }
+
+        $extensions = [];
+        $lastUsedLocations = [];
+        foreach (Hook::all($hookName) as $hook) {
+            $location = $hook->getLocation();
+            if ($location < 0) {
+                $location = null;
+            }
+
+            if ($location === null) {
+                $section = $hook->getSection();
+                if (! isset(self::BASE_LOCATIONS[$section])) {
+                    Logger::error('Detail extension %s is using an invalid section: %s', get_class($hook), $section);
+                    $section = self::DETAIL_SECTION;
+                }
+
+                if (isset($lastUsedLocations[$section])) {
+                    $location = ++$lastUsedLocations[$section];
+                } else {
+                    $location = self::BASE_LOCATIONS[$section];
+                    $lastUsedLocations[$section] = $location;
+                }
+            }
+
+            try {
+                // It may be ValidHtml, but modules shouldn't be able to break our views.
+                // That's why it needs to be rendered instantly, as any error will then
+                // be caught here.
+                $extension = (string) $hook->getHtmlForObject(clone $object);
+
+                $moduleName = $hook->getModule()->getName();
+
+                $extensions[$location] = new HtmlElement(
+                    'div',
+                    Attributes::create([
+                        'class' => 'icinga-module module-' . $moduleName,
+                        'data-icinga-module' => $moduleName
+                    ]),
+                    HtmlString::create($extension)
+                );
+            } catch (Exception $e) {
+                Logger::error("Failed to load detail extension: %s\n%s", $e, $e->getTraceAsString());
+                $extensions[$location] = Text::create(IcingaException::describe($e));
+            }
+        }
+
+        return $extensions;
+    }
+}
diff --git a/library/Icingadb/Hook/ExtensionHook/ObjectsDetailExtensionHook.php b/library/Icingadb/Hook/ExtensionHook/ObjectsDetailExtensionHook.php
new file mode 100644
index 0000000..5fe7c6c
--- /dev/null
+++ b/library/Icingadb/Hook/ExtensionHook/ObjectsDetailExtensionHook.php
@@ -0,0 +1,102 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Hook\ExtensionHook;
+
+use Exception;
+use Icinga\Application\Hook;
+use Icinga\Application\Logger;
+use Icinga\Exception\IcingaException;
+use Icinga\Module\Icingadb\Common\BaseFilter;
+use Icinga\Module\Icingadb\Hook\HostsDetailExtensionHook;
+use Icinga\Module\Icingadb\Hook\ServicesDetailExtensionHook;
+use InvalidArgumentException;
+use ipl\Html\Attributes;
+use ipl\Html\HtmlElement;
+use ipl\Html\HtmlString;
+use ipl\Html\Text;
+use ipl\Html\ValidHtml;
+use ipl\Orm\Query;
+use ipl\Stdlib\Filter;
+
+abstract class ObjectsDetailExtensionHook extends BaseExtensionHook
+{
+    use BaseFilter;
+
+    /**
+     * Load all extensions for the given objects
+     *
+     * @param string $objectType
+     * @param Query $query
+     * @param Filter\Rule $baseFilter
+     *
+     * @return array<int, ValidHtml>
+     *
+     * @throws InvalidArgumentException If the given object type is not supported
+     */
+    final public static function loadExtensions(string $objectType, Query $query, Filter\Rule $baseFilter): array
+    {
+        switch ($objectType) {
+            case 'host':
+                /** @var HostsDetailExtensionHook $hook */
+                $hookName = 'Icingadb\\HostsDetailExtension';
+                break;
+            case 'service':
+                /** @var ServicesDetailExtensionHook $hook */
+                $hookName = 'Icingadb\\ServicesDetailExtension';
+                break;
+            default:
+                throw new InvalidArgumentException(
+                    sprintf('%s is not a supported object type', $objectType)
+                );
+        }
+
+        $extensions = [];
+        $lastUsedLocations = [];
+        foreach (Hook::all($hookName) as $hook) {
+            $location = $hook->getLocation();
+            if ($location < 0) {
+                $location = null;
+            }
+
+            if ($location === null) {
+                $section = $hook->getSection();
+                if (! isset(self::BASE_LOCATIONS[$section])) {
+                    Logger::error('Detail extension %s is using an invalid section: %s', get_class($hook), $section);
+                    $section = self::DETAIL_SECTION;
+                }
+
+                if (isset($lastUsedLocations[$section])) {
+                    $location = ++$lastUsedLocations[$section];
+                } else {
+                    $location = self::BASE_LOCATIONS[$section];
+                    $lastUsedLocations[$section] = $location;
+                }
+            }
+
+            try {
+                // It may be ValidHtml, but modules shouldn't be able to break our views.
+                // That's why it needs to be rendered instantly, as any error will then
+                // be caught here.
+                $extension = (string) $hook->setBaseFilter($baseFilter)->getHtmlForObjects(clone $query);
+
+                $moduleName = $hook->getModule()->getName();
+
+                $extensions[$location] = new HtmlElement(
+                    'div',
+                    Attributes::create([
+                        'class' => 'icinga-module module-' . $moduleName,
+                        'data-icinga-module' => $moduleName
+                    ]),
+                    HtmlString::create($extension)
+                );
+            } catch (Exception $e) {
+                Logger::error("Failed to load details extension: %s\n%s", $e, $e->getTraceAsString());
+                $extensions[$location] = Text::create(IcingaException::describe($e));
+            }
+        }
+
+        return $extensions;
+    }
+}
diff --git a/library/Icingadb/Hook/HostActionsHook.php b/library/Icingadb/Hook/HostActionsHook.php
new file mode 100644
index 0000000..73c58f4
--- /dev/null
+++ b/library/Icingadb/Hook/HostActionsHook.php
@@ -0,0 +1,21 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Hook;
+
+use Icinga\Module\Icingadb\Hook\ActionsHook\ObjectActionsHook;
+use Icinga\Module\Icingadb\Model\Host;
+use ipl\Web\Widget\Link;
+
+abstract class HostActionsHook extends ObjectActionsHook
+{
+    /**
+     * Assemble and return a list of HTML anchors for the given host
+     *
+     * @param Host $host
+     *
+     * @return Link[]
+     */
+    abstract public function getActionsForObject(Host $host): array;
+}
diff --git a/library/Icingadb/Hook/HostDetailExtensionHook.php b/library/Icingadb/Hook/HostDetailExtensionHook.php
new file mode 100644
index 0000000..a6e9ab0
--- /dev/null
+++ b/library/Icingadb/Hook/HostDetailExtensionHook.php
@@ -0,0 +1,21 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Hook;
+
+use Icinga\Module\Icingadb\Hook\ExtensionHook\ObjectDetailExtensionHook;
+use Icinga\Module\Icingadb\Model\Host;
+use ipl\Html\ValidHtml;
+
+abstract class HostDetailExtensionHook extends ObjectDetailExtensionHook
+{
+    /**
+     * Assemble and return an HTML representation of the given host
+     *
+     * @param Host $host
+     *
+     * @return ValidHtml
+     */
+    abstract public function getHtmlForObject(Host $host): ValidHtml;
+}
diff --git a/library/Icingadb/Hook/HostsDetailExtensionHook.php b/library/Icingadb/Hook/HostsDetailExtensionHook.php
new file mode 100644
index 0000000..79c091e
--- /dev/null
+++ b/library/Icingadb/Hook/HostsDetailExtensionHook.php
@@ -0,0 +1,28 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Hook;
+
+use Icinga\Module\Icingadb\Hook\ExtensionHook\ObjectsDetailExtensionHook;
+use Icinga\Module\Icingadb\Model\Host;
+use ipl\Html\ValidHtml;
+use ipl\Orm\Query;
+
+abstract class HostsDetailExtensionHook extends ObjectsDetailExtensionHook
+{
+    /**
+     * Assemble and return an HTML representation of the given hosts
+     *
+     * The given query is already pre-filtered with the user's custom filter and restrictions. The base filter does
+     * only contain the user's custom filter, use this for e.g. subsidiary links.
+     *
+     * The query is also limited by default, use `$hosts->limit(null)` to clear that. But beware that this may yield
+     * a huge result set in case of a bulk selection.
+     *
+     * @param Query<Host> $hosts
+     *
+     * @return ValidHtml
+     */
+    abstract public function getHtmlForObjects(Query $hosts): ValidHtml;
+}
diff --git a/library/Icingadb/Hook/IcingadbSupportHook.php b/library/Icingadb/Hook/IcingadbSupportHook.php
new file mode 100644
index 0000000..cd43a5a
--- /dev/null
+++ b/library/Icingadb/Hook/IcingadbSupportHook.php
@@ -0,0 +1,50 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Hook;
+
+use Icinga\Application\Icinga;
+use Icinga\Module\Icingadb\Hook\Common\HookUtils;
+use Icinga\Web\Session;
+
+abstract class IcingadbSupportHook
+{
+    use HookUtils;
+
+    /** @var string key name of preference */
+    const PREFERENCE_NAME = 'icingadb.as_backend';
+
+    /**
+     * Return whether your module supports IcingaDB or not
+     *
+     * @return bool
+     */
+    public function supportsIcingaDb(): bool
+    {
+        return true;
+    }
+
+    /**
+     * Whether icingadb is set as the preferred backend in preferences
+     *
+     * @return bool Return true if icingadb is set as backend, false otherwise
+     */
+    final public static function isIcingaDbSetAsPreferredBackend(): bool
+    {
+        return (bool) Session::getSession()
+            ->getNamespace('icingadb')
+            ->get(self::PREFERENCE_NAME, false);
+    }
+
+    /**
+     * Whether to use icingadb as the backend
+     *
+     * @return bool Returns true if monitoring module is disabled or icingadb is selected as backend, false otherwise.
+     */
+    final public static function useIcingaDbAsBackend(): bool
+    {
+        return ! Icinga::app()->getModuleManager()->hasEnabled('monitoring')
+            || self::isIcingaDbSetAsPreferredBackend();
+    }
+}
diff --git a/library/Icingadb/Hook/PluginOutputHook.php b/library/Icingadb/Hook/PluginOutputHook.php
new file mode 100644
index 0000000..7c744ee
--- /dev/null
+++ b/library/Icingadb/Hook/PluginOutputHook.php
@@ -0,0 +1,63 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Hook;
+
+use Exception;
+use Icinga\Application\Hook;
+use Icinga\Application\Logger;
+use Icinga\Module\Icingadb\Hook\Common\HookUtils;
+
+abstract class PluginOutputHook
+{
+    use HookUtils;
+
+    /**
+     * Return whether the given command is supported or not
+     *
+     * @param string $commandName
+     *
+     * @return bool
+     */
+    abstract public function isSupportedCommand(string $commandName): bool;
+
+    /**
+     * Process the given plugin output based on the specified check command
+     *
+     * Try to process the output as efficient and fast as possible.
+     * Especially list view performance may suffer otherwise.
+     *
+     * @param string $output A host's or service's output
+     * @param string $commandName The name of the checkcommand that produced the output
+     * @param bool $enrichOutput Whether macros or other markup should be processed
+     *
+     * @return string
+     */
+    abstract public function render(string $output, string $commandName, bool $enrichOutput): string;
+
+    /**
+     * Let all hooks process the given plugin output based on the specified check command
+     *
+     * @param string $output
+     * @param string $commandName
+     * @param bool $enrichOutput
+     *
+     * @return string
+     */
+    final public static function processOutput(string $output, string $commandName, bool $enrichOutput): string
+    {
+        foreach (Hook::all('Icingadb\\PluginOutput') as $hook) {
+            /** @var self $hook */
+            try {
+                if ($hook->isSupportedCommand($commandName)) {
+                    $output = $hook->render($output, $commandName, $enrichOutput);
+                }
+            } catch (Exception $e) {
+                Logger::error("Unable to process plugin output: %s\n%s", $e, $e->getTraceAsString());
+            }
+        }
+
+        return $output;
+    }
+}
diff --git a/library/Icingadb/Hook/ServiceActionsHook.php b/library/Icingadb/Hook/ServiceActionsHook.php
new file mode 100644
index 0000000..988cdb6
--- /dev/null
+++ b/library/Icingadb/Hook/ServiceActionsHook.php
@@ -0,0 +1,21 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Hook;
+
+use Icinga\Module\Icingadb\Hook\ActionsHook\ObjectActionsHook;
+use Icinga\Module\Icingadb\Model\Service;
+use ipl\Web\Widget\Link;
+
+abstract class ServiceActionsHook extends ObjectActionsHook
+{
+    /**
+     * Assemble and return a list of HTML anchors for the given service
+     *
+     * @param Service $service
+     *
+     * @return Link[]
+     */
+    abstract public function getActionsForObject(Service $service): array;
+}
diff --git a/library/Icingadb/Hook/ServiceDetailExtensionHook.php b/library/Icingadb/Hook/ServiceDetailExtensionHook.php
new file mode 100644
index 0000000..5344620
--- /dev/null
+++ b/library/Icingadb/Hook/ServiceDetailExtensionHook.php
@@ -0,0 +1,21 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Hook;
+
+use Icinga\Module\Icingadb\Hook\ExtensionHook\ObjectDetailExtensionHook;
+use Icinga\Module\Icingadb\Model\Service;
+use ipl\Html\ValidHtml;
+
+abstract class ServiceDetailExtensionHook extends ObjectDetailExtensionHook
+{
+    /**
+     * Assemble and return an HTML representation of the given service
+     *
+     * @param Service $service
+     *
+     * @return ValidHtml
+     */
+    abstract public function getHtmlForObject(Service $service): ValidHtml;
+}
diff --git a/library/Icingadb/Hook/ServicesDetailExtensionHook.php b/library/Icingadb/Hook/ServicesDetailExtensionHook.php
new file mode 100644
index 0000000..35ba8d3
--- /dev/null
+++ b/library/Icingadb/Hook/ServicesDetailExtensionHook.php
@@ -0,0 +1,28 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Hook;
+
+use Icinga\Module\Icingadb\Hook\ExtensionHook\ObjectsDetailExtensionHook;
+use Icinga\Module\Icingadb\Model\Service;
+use ipl\Html\ValidHtml;
+use ipl\Orm\Query;
+
+abstract class ServicesDetailExtensionHook extends ObjectsDetailExtensionHook
+{
+    /**
+     * Assemble and return an HTML representation of the given services
+     *
+     * The given query is already pre-filtered with the user's custom filter and restrictions. The base filter does
+     * only contain the user's custom filter, use this for e.g. subsidiary links.
+     *
+     * The query is also limited by default, use `$hosts->limit(null)` to clear that. But beware that this may yield
+     * a huge result set in case of a bulk selection.
+     *
+     * @param Query<Service> $services
+     *
+     * @return ValidHtml
+     */
+    abstract public function getHtmlForObjects(Query $services): ValidHtml;
+}
diff --git a/library/Icingadb/Hook/TabHook.php b/library/Icingadb/Hook/TabHook.php
new file mode 100644
index 0000000..0c5b676
--- /dev/null
+++ b/library/Icingadb/Hook/TabHook.php
@@ -0,0 +1,82 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Hook;
+
+use Icinga\Module\Icingadb\Common\Auth;
+use Icinga\Module\Icingadb\Common\Database;
+use Icinga\Module\Icingadb\Hook\Common\HookUtils;
+use ipl\Html\ValidHtml;
+use ipl\Orm\Model;
+
+abstract class TabHook
+{
+    use Auth;
+    use Database;
+    use HookUtils;
+
+    /**
+     * Get the tab's name
+     *
+     * The name is used to identify this hook later on. It must be unique.
+     * Multiple words in the name should be separated by dashes. (-)
+     *
+     * @return string
+     */
+    abstract public function getName(): string;
+
+    /**
+     * Get the tab's label
+     *
+     * The label is shown on the tab and in the browser's title.
+     *
+     * @return string
+     */
+    abstract public function getLabel(): string;
+
+    /**
+     * Get tab content for the given object
+     *
+     * @param Model $object
+     *
+     * @return ValidHtml[]
+     */
+    abstract public function getContent(Model $object): array;
+
+    /**
+     * Get tab controls for the given object
+     *
+     * @param Model $object
+     *
+     * @return ValidHtml[]
+     */
+    public function getControls(Model $object): array
+    {
+        return [];
+    }
+
+    /**
+     * Get tab footer for the given object
+     *
+     * @param Model $object
+     *
+     * @return ValidHtml[]
+     */
+    public function getFooter(Model $object): array
+    {
+        return [];
+    }
+
+    /**
+     * Get whether this tab should be shown
+     *
+     * @param Model $object
+     *
+     * @return bool
+     */
+    public function shouldBeShown(Model $object): bool
+    {
+        return true;
+    }
+}
diff --git a/library/Icingadb/Hook/TabHook/HookActions.php b/library/Icingadb/Hook/TabHook/HookActions.php
new file mode 100644
index 0000000..d2801a5
--- /dev/null
+++ b/library/Icingadb/Hook/TabHook/HookActions.php
@@ -0,0 +1,148 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Hook\TabHook;
+
+use Exception;
+use Generator;
+use Icinga\Application\Hook;
+use Icinga\Application\Logger;
+use Icinga\Module\Icingadb\Hook\TabHook;
+use ipl\Html\ValidHtml;
+use ipl\Orm\Model;
+use ipl\Stdlib\Str;
+
+/**
+ * Trait HookActions
+ */
+trait HookActions
+{
+    /** @var Model The object to load tabs for */
+    protected $objectToLoadTabsFor;
+
+    /** @var TabHook[] Loaded tab hooks */
+    protected $tabHooks;
+
+    /**
+     * Get default control elements
+     *
+     * @return ValidHtml[]
+     */
+    abstract protected function getDefaultTabControls(): array;
+
+    public function __call($methodName, $args)
+    {
+        if (substr($methodName, -6) === 'Action') {
+            $hookName = substr($methodName, 0, -6);
+
+            $hooks = $this->loadTabHooks();
+            if (isset($hooks[$hookName])) {
+                $this->showTabHook($hooks[$hookName]);
+                return;
+            }
+        }
+
+        parent::__call($methodName, $args);
+    }
+
+    /**
+     * Register the object for which to load additional tabs
+     *
+     * @param Model $object
+     *
+     * @return void
+     */
+    protected function loadTabsForObject(Model $object)
+    {
+        $this->objectToLoadTabsFor = $object;
+    }
+
+    /**
+     * Load tab hooks
+     *
+     * @return array<string, TabHook>
+     */
+    protected function loadTabHooks(): array
+    {
+        if ($this->objectToLoadTabsFor === null) {
+            return [];
+        } elseif ($this->tabHooks !== null) {
+            return $this->tabHooks;
+        }
+
+        $this->tabHooks = [];
+        foreach (Hook::all('Icingadb\\Tab') as $hook) {
+            /** @var TabHook $hook */
+            try {
+                if ($hook->shouldBeShown($this->objectToLoadTabsFor)) {
+                    $this->tabHooks[Str::camel($hook->getName())] = $hook;
+                }
+            } catch (Exception $e) {
+                Logger::error("Failed to load tab hook: %s\n%s", $e, $e->getTraceAsString());
+            }
+        }
+
+        return $this->tabHooks;
+    }
+
+    /**
+     * Load additional tabs
+     *
+     * @return Generator<string, array{label: string, url: string}>
+     */
+    protected function loadAdditionalTabs(): Generator
+    {
+        foreach ($this->loadTabHooks() as $hook) {
+            yield $hook->getName() => [
+                'label' => $hook->getLabel(),
+                'url'   => 'icingadb/' . $this->getRequest()->getControllerName() . '/' . $hook->getName()
+            ];
+        }
+    }
+
+    /**
+     * Render the given tab hook
+     *
+     * @param TabHook $hook
+     *
+     * @return void
+     */
+    protected function showTabHook(TabHook $hook)
+    {
+        $moduleName = $hook->getModule()->getName();
+
+        foreach ($hook->getControls($this->objectToLoadTabsFor) as $control) {
+            $this->addControl($control);
+        }
+
+        if (! empty($this->controls->getContent())) {
+            $this->controls->addAttributes([
+                'class'                 => ['icinga-module', 'module-' . $moduleName],
+                'data-icinga-module'    => $moduleName
+            ]);
+        } else {
+            foreach ($this->getDefaultTabControls() as $control) {
+                $this->addControl($control);
+            }
+        }
+
+        foreach ($hook->getContent($this->objectToLoadTabsFor) as $content) {
+            $this->addContent($content);
+        }
+
+        $this->content->addAttributes([
+            'class'                 => ['icinga-module', 'module-' . $moduleName],
+            'data-icinga-module'    => $moduleName
+        ]);
+
+        foreach ($hook->getFooter($this->objectToLoadTabsFor) as $footer) {
+            $this->addFooter($footer);
+        }
+
+        $this->footer->addAttributes([
+            'class'                 => ['icinga-module', 'module-' . $moduleName],
+            'data-icinga-module'    => $moduleName
+        ]);
+    }
+}
diff --git a/library/Icingadb/Hook/UserDetailExtensionHook.php b/library/Icingadb/Hook/UserDetailExtensionHook.php
new file mode 100644
index 0000000..bb1bf7e
--- /dev/null
+++ b/library/Icingadb/Hook/UserDetailExtensionHook.php
@@ -0,0 +1,21 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Hook;
+
+use Icinga\Module\Icingadb\Hook\ExtensionHook\ObjectDetailExtensionHook;
+use Icinga\Module\Icingadb\Model\User;
+use ipl\Html\ValidHtml;
+
+abstract class UserDetailExtensionHook extends ObjectDetailExtensionHook
+{
+    /**
+     * Assemble and return an HTML representation of the given user
+     *
+     * @param User $user
+     *
+     * @return ValidHtml
+     */
+    abstract public function getHtmlForObject(User $user): ValidHtml;
+}
diff --git a/library/Icingadb/Hook/UsergroupDetailExtensionHook.php b/library/Icingadb/Hook/UsergroupDetailExtensionHook.php
new file mode 100644
index 0000000..da2264d
--- /dev/null
+++ b/library/Icingadb/Hook/UsergroupDetailExtensionHook.php
@@ -0,0 +1,21 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Hook;
+
+use Icinga\Module\Icingadb\Hook\ExtensionHook\ObjectDetailExtensionHook;
+use Icinga\Module\Icingadb\Model\Usergroup;
+use ipl\Html\ValidHtml;
+
+abstract class UsergroupDetailExtensionHook extends ObjectDetailExtensionHook
+{
+    /**
+     * Assemble and return an HTML representation of the given usergroup
+     *
+     * @param Usergroup $usergroup
+     *
+     * @return ValidHtml
+     */
+    abstract public function getHtmlForObject(Usergroup $usergroup): ValidHtml;
+}
diff --git a/library/Icingadb/Model/AcknowledgementHistory.php b/library/Icingadb/Model/AcknowledgementHistory.php
new file mode 100644
index 0000000..409e4b0
--- /dev/null
+++ b/library/Icingadb/Model/AcknowledgementHistory.php
@@ -0,0 +1,102 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Model\Behavior\BoolCast;
+use Icinga\Module\Icingadb\Model\Behavior\Timestamp;
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+/**
+ * Model for table `acknowledgement_history`
+ *
+ * Please note that using this model will fetch history entries for decommissioned services. To avoid this, the query
+ * needs a `acknowledgement_history.service_id IS NULL OR acknowledgement_history_service.id IS NOT NULL` where.
+ */
+class AcknowledgementHistory extends Model
+{
+    public function getTableName()
+    {
+        return 'acknowledgement_history';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'environment_id',
+            'endpoint_id',
+            'object_type',
+            'host_id',
+            'service_id',
+            'set_time',
+            'clear_time',
+            'author',
+            'cleared_by',
+            'comment',
+            'expire_time',
+            'is_sticky',
+            'is_persistent'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'environment_id'    => t('Environment Id'),
+            'endpoint_id'       => t('Endpoint Id'),
+            'object_type'       => t('Object Type'),
+            'host_id'           => t('Host Id'),
+            'service_id'        => t('Service Id'),
+            'set_time'          => t('Acknowledgement Set Time'),
+            'clear_time'        => t('Acknowledgement Clear Time'),
+            'author'            => t('Acknowledgement Author'),
+            'cleared_by'        => t('Acknowledgement Cleared By'),
+            'comment'           => t('Acknowledgement Comment'),
+            'expire_time'       => t('Acknowledgement Expire Time'),
+            'is_sticky'         => t('Acknowledgement Is Sticky'),
+            'is_persistent'     => t('Acknowledgement Is Persistent')
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new BoolCast([
+            'is_sticky',
+            'is_persistent'
+        ]));
+
+        $behaviors->add(new Timestamp([
+            'set_time',
+            'clear_time',
+            'expire_time'
+        ]));
+
+        $behaviors->add(new Binary([
+            'id',
+            'environment_id',
+            'endpoint_id',
+            'host_id',
+            'service_id',
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('endpoint', Endpoint::class);
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('history', History::class)
+            ->setCandidateKey('id')
+            ->setForeignKey('acknowledgement_history_id');
+        $relations->belongsTo('host', Host::class);
+        $relations->belongsTo('service', Service::class)->setJoinType('LEFT');
+    }
+}
diff --git a/library/Icingadb/Model/ActionUrl.php b/library/Icingadb/Model/ActionUrl.php
new file mode 100644
index 0000000..e0b092e
--- /dev/null
+++ b/library/Icingadb/Model/ActionUrl.php
@@ -0,0 +1,62 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Model\Behavior\ActionAndNoteUrl;
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class ActionUrl extends Model
+{
+    public function getTableName()
+    {
+        return 'action_url';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'action_url',
+            'environment_id'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'action_url'        => t('Action Url'),
+            'environment_id'    => t('Environment Id')
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new ActionAndNoteUrl(['action_url']));
+
+        $behaviors->add(new Binary([
+            'id',
+            'environment_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+
+        $relations->hasMany('host', Host::class)
+            ->setCandidateKey('id')
+            ->setForeignKey('action_url_id');
+        $relations->hasMany('service', Service::class)
+            ->setCandidateKey('id')
+            ->setForeignKey('action_url_id');
+    }
+}
diff --git a/library/Icingadb/Model/Behavior/ActionAndNoteUrl.php b/library/Icingadb/Model/Behavior/ActionAndNoteUrl.php
new file mode 100644
index 0000000..e8f6799
--- /dev/null
+++ b/library/Icingadb/Model/Behavior/ActionAndNoteUrl.php
@@ -0,0 +1,52 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model\Behavior;
+
+use ipl\Orm\Contract\PropertyBehavior;
+
+class ActionAndNoteUrl extends PropertyBehavior
+{
+    public function fromDb($value, $key, $_)
+    {
+        if (empty($value)) {
+            return [];
+        }
+
+        $links = [];
+        if (strpos($value, "' ") === false) {
+            $links[] = $value;
+        } else {
+            foreach (explode("' ", $value) as $url) {
+                $url = strpos($url, "'") === 0 ? substr($url, 1) : $url;
+                $url = strpos($url, "'") === strlen($url) - 1 ? substr($url, 0, strlen($url) - 1) : $url;
+                $links[] = $url;
+            }
+        }
+
+        return $links;
+    }
+
+    public function toDb($value, $key, $_)
+    {
+        if (empty($value) || ! is_array($value)) {
+            return $value;
+        }
+
+        if (count($value) === 1) {
+            return $value[0];
+        }
+
+        $links = '';
+        foreach ($value as $url) {
+            if (! empty($links)) {
+                $links .= ' ';
+            }
+
+            $links .= "'$url'";
+        }
+
+        return $links;
+    }
+}
diff --git a/library/Icingadb/Model/Behavior/Bitmask.php b/library/Icingadb/Model/Behavior/Bitmask.php
new file mode 100644
index 0000000..f8d91f6
--- /dev/null
+++ b/library/Icingadb/Model/Behavior/Bitmask.php
@@ -0,0 +1,83 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model\Behavior;
+
+use ipl\Orm\Contract\PropertyBehavior;
+use ipl\Orm\Contract\RewriteFilterBehavior;
+use ipl\Stdlib\Filter\Condition;
+
+/**
+ * Class Bitmask
+ *
+ * @method void __construct(array $properties) Pass property names as keys and their bitmap ([value => bit]) as value
+ */
+class Bitmask extends PropertyBehavior implements RewriteFilterBehavior
+{
+    public function fromDb($bits, $key, $context)
+    {
+        $values = [];
+        foreach ($context as $value => $bit) {
+            if ($bits & $bit) {
+                $values[] = $value;
+            }
+        }
+
+        return $values;
+    }
+
+    public function toDb($value, $key, $context)
+    {
+        if (! is_array($value)) {
+            if (is_int($value) || ctype_digit($value)) {
+                return $value;
+            }
+
+            return isset($context[$value]) ? $context[$value] : -1;
+        }
+
+        $bits = [];
+        $allBits = 0;
+        foreach ($value as $v) {
+            if (isset($context[$v])) {
+                $bits[] = $context[$v];
+                $allBits |= $context[$v];
+            } elseif (is_int($v) || ctype_digit($v)) {
+                $bits[] = $v;
+                $allBits |= $v;
+            }
+        }
+
+        $bits[] = $allBits;
+        return $bits;
+    }
+
+    public function rewriteCondition(Condition $condition, $relation = null)
+    {
+        $column = $condition->metaData()->get('columnName');
+        if (! isset($this->properties[$column])) {
+            return;
+        }
+
+        $values = $condition->getValue();
+        if (! is_array($values)) {
+            if (is_int($values) || ctype_digit($values)) {
+                return;
+            }
+
+            $values = [$values];
+        }
+
+        $bits = 0;
+        foreach ($values as $value) {
+            if (isset($this->properties[$column][$value])) {
+                $bits |= $this->properties[$column][$value];
+            } elseif (is_int($value) || ctype_digit($value)) {
+                $bits |= $value;
+            }
+        }
+
+        $condition->setColumn(sprintf('%s & %s', $condition->getColumn(), $bits));
+    }
+}
diff --git a/library/Icingadb/Model/Behavior/BoolCast.php b/library/Icingadb/Model/Behavior/BoolCast.php
new file mode 100644
index 0000000..8ab01ae
--- /dev/null
+++ b/library/Icingadb/Model/Behavior/BoolCast.php
@@ -0,0 +1,31 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model\Behavior;
+
+use ipl\Orm\Contract\PropertyBehavior;
+
+class BoolCast extends PropertyBehavior
+{
+    public function fromDb($value, $key, $_)
+    {
+        switch ((string) $value) {
+            case 'y':
+                return true;
+            case 'n':
+                return false;
+            default:
+                return $value;
+        }
+    }
+
+    public function toDb($value, $key, $_)
+    {
+        if (is_string($value)) {
+            return $value;
+        }
+
+        return $value ? 'y' : 'n';
+    }
+}
diff --git a/library/Icingadb/Model/Behavior/FlattenedObjectVars.php b/library/Icingadb/Model/Behavior/FlattenedObjectVars.php
new file mode 100644
index 0000000..b1c308a
--- /dev/null
+++ b/library/Icingadb/Model/Behavior/FlattenedObjectVars.php
@@ -0,0 +1,77 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model\Behavior;
+
+use Icinga\Module\Icingadb\Common\Auth;
+use Icinga\Module\Icingadb\Model\CustomvarFlat;
+use ipl\Orm\AliasedExpression;
+use ipl\Orm\ColumnDefinition;
+use ipl\Orm\Contract\QueryAwareBehavior;
+use ipl\Orm\Contract\RewriteColumnBehavior;
+use ipl\Orm\Query;
+use ipl\Stdlib\Filter;
+
+class FlattenedObjectVars implements RewriteColumnBehavior, QueryAwareBehavior
+{
+    use Auth;
+
+    /** @var Query */
+    protected $query;
+
+    public function setQuery(Query $query)
+    {
+        $this->query = $query;
+
+        return $this;
+    }
+
+    public function rewriteCondition(Filter\Condition $condition, $relation = null)
+    {
+        $column = $condition->metaData()->get('columnName');
+        if ($column !== null) {
+            $relation = substr($relation, 0, -5) . 'customvar_flat.';
+            $nameFilter = Filter::like($relation . 'flatname', $column);
+            $class = get_class($condition);
+            $valueFilter = new $class($relation . 'flatvalue', $condition->getValue());
+
+            return Filter::all($nameFilter, $valueFilter);
+        }
+    }
+
+    public function rewriteColumn($column, $relation = null)
+    {
+        $subQuery = $this->query->createSubQuery(new CustomvarFlat(), $relation)
+            ->limit(1)
+            ->columns('flatvalue')
+            ->filter(Filter::equal('flatname', $column));
+
+        $this->applyRestrictions($subQuery);
+
+        $alias = $this->query->getDb()->quoteIdentifier([str_replace('.', '_', $relation) . "_$column"]);
+
+        list($select, $values) = $this->query->getDb()->getQueryBuilder()->assembleSelect($subQuery->assembleSelect());
+        return new AliasedExpression($alias, "($select)", null, ...$values);
+    }
+
+    public function rewriteColumnDefinition(ColumnDefinition $def, string $relation): void
+    {
+        $parts = explode('.', substr($relation, 0, -5));
+        $objectType = array_pop($parts);
+
+        $name = $def->getName();
+        if (substr($name, -3) === '[*]') {
+            // The suggestions also hide this from the label, so should this
+            $name = substr($name, 0, -3);
+        }
+
+        // Programmatically translated since the full definition is available in class ObjectSuggestions
+        $def->setLabel(sprintf(t(ucfirst($objectType) . ' %s', '..<customvar-name>'), $name));
+    }
+
+    public function isSelectableColumn(string $name): bool
+    {
+        return true;
+    }
+}
diff --git a/library/Icingadb/Model/Behavior/ReRoute.php b/library/Icingadb/Model/Behavior/ReRoute.php
new file mode 100644
index 0000000..d054f00
--- /dev/null
+++ b/library/Icingadb/Model/Behavior/ReRoute.php
@@ -0,0 +1,83 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model\Behavior;
+
+use ipl\Orm\Contract\RewriteFilterBehavior;
+use ipl\Orm\Contract\RewritePathBehavior;
+use ipl\Stdlib\Filter;
+
+class ReRoute implements RewriteFilterBehavior, RewritePathBehavior
+{
+    protected $routes;
+
+    /**
+     * Tables with mixed object type entries for which servicegroup filters need to be resolved in multiple steps
+     *
+     * @var string[]
+     */
+    const MIXED_TYPE_RELATIONS = ['downtime', 'comment', 'history', 'notification_history'];
+
+    public function __construct(array $routes)
+    {
+        $this->routes = $routes;
+    }
+
+    public function getRoutes(): array
+    {
+        return $this->routes;
+    }
+
+    public function rewriteCondition(Filter\Condition $condition, $relation = null)
+    {
+        $remainingPath = $condition->metaData()->get('columnName', '');
+        if (strpos($remainingPath, '.') === false) {
+            return;
+        }
+
+        if (($path = $this->rewritePath($remainingPath, $relation)) !== null) {
+            $class = get_class($condition);
+            $filter = new $class($relation . $path, $condition->getValue());
+            if ($condition->metaData()->has('forceOptimization')) {
+                $filter->metaData()->set(
+                    'forceOptimization',
+                    $condition->metaData()->get('forceOptimization')
+                );
+            }
+
+            if (
+                in_array(substr($relation, 0, -1), self::MIXED_TYPE_RELATIONS)
+                && substr($remainingPath, 0, 13) === 'servicegroup.'
+            ) {
+                $applyAll = Filter::all();
+                $applyAll->add(Filter::equal($relation . 'object_type', 'host'));
+
+                $orgFilter = clone $filter;
+                $orgFilter->setColumn($relation . 'host.' . $path);
+
+                $applyAll->add($orgFilter);
+
+                $filter = Filter::any($filter, $applyAll);
+            }
+
+            return $filter;
+        }
+    }
+
+    public function rewritePath(string $path, ?string $relation = null): ?string
+    {
+        $dot = strpos($path, '.');
+        if ($dot !== false) {
+            $routeName = substr($path, 0, $dot);
+        } else {
+            $routeName = $path;
+        }
+
+        if (isset($this->routes[$routeName])) {
+            return $this->routes[$routeName] . ($dot !== false ? substr($path, $dot) : '');
+        }
+
+        return null;
+    }
+}
diff --git a/library/Icingadb/Model/Behavior/Timestamp.php b/library/Icingadb/Model/Behavior/Timestamp.php
new file mode 100644
index 0000000..b365491
--- /dev/null
+++ b/library/Icingadb/Model/Behavior/Timestamp.php
@@ -0,0 +1,37 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model\Behavior;
+
+use ipl\Orm\Contract\PropertyBehavior;
+
+class Timestamp extends PropertyBehavior
+{
+    public function fromDb($value, $key, $_)
+    {
+        if ($value === null) {
+            return $value;
+        }
+
+        return $value / 1000.0;
+    }
+
+    public function toDb($value, $key, $_)
+    {
+        if ($value === null) {
+            return $value;
+        }
+
+        if (is_string($value) && ! ctype_digit($value)) {
+            $timestamp = strtotime($value);
+            if ($timestamp === false) {
+                return $value;
+            } else {
+                $value = $timestamp;
+            }
+        }
+
+        return $value * 1000.0;
+    }
+}
diff --git a/library/Icingadb/Model/Checkcommand.php b/library/Icingadb/Model/Checkcommand.php
new file mode 100644
index 0000000..400a24b
--- /dev/null
+++ b/library/Icingadb/Model/Checkcommand.php
@@ -0,0 +1,86 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Model\Behavior\ReRoute;
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class Checkcommand extends Model
+{
+    public function getTableName()
+    {
+        return 'checkcommand';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'zone_id',
+            'environment_id',
+            'name_checksum',
+            'properties_checksum',
+            'name',
+            'name_ci',
+            'command',
+            'timeout'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'zone_id'               => t('Zone Id'),
+            'environment_id'        => t('Environment Id'),
+            'name_checksum'         => t('Checkcommand Name Checksum'),
+            'properties_checksum'   => t('Checkcommand Properties Checksum'),
+            'name'                  => t('Checkcommand Name'),
+            'name_ci'               => t('Checkcommand Name (CI)'),
+            'command'               => t('Checkcommand'),
+            'timeout'               => t('Checkcommand Timeout')
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new ReRoute([
+            'hostgroup'     => 'host.hostgroup',
+            'servicegroup'  => 'service.servicegroup'
+        ]));
+
+        $behaviors->add(new Binary([
+            'id',
+            'zone_id',
+            'environment_id',
+            'name_checksum',
+            'properties_checksum'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('zone', Zone::class);
+
+        $relations->belongsToMany('customvar', Customvar::class)
+            ->through(CheckcommandCustomvar::class);
+        $relations->belongsToMany('customvar_flat', CustomvarFlat::class)
+            ->through(CheckcommandCustomvar::class);
+        $relations->belongsToMany('vars', Vars::class)
+            ->through(CheckcommandCustomvar::class);
+
+        $relations->hasMany('argument', CheckcommandArgument::class);
+        $relations->hasMany('envvar', CheckcommandEnvvar::class);
+        $relations->hasMany('host', Host::class);
+        $relations->hasMany('service', Service::class);
+    }
+}
diff --git a/library/Icingadb/Model/CheckcommandArgument.php b/library/Icingadb/Model/CheckcommandArgument.php
new file mode 100644
index 0000000..d59d4e3
--- /dev/null
+++ b/library/Icingadb/Model/CheckcommandArgument.php
@@ -0,0 +1,75 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class CheckcommandArgument extends Model
+{
+    public function getTableName()
+    {
+        return 'checkcommand_argument';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'checkcommand_id',
+            'argument_key',
+            'environment_id',
+            'properties_checksum',
+            'argument_value',
+            'argument_order',
+            'description',
+            'argument_key_override',
+            'repeat_key',
+            'required',
+            'set_if',
+            'skip_key'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'checkcommand_id'       => t('Checkcommand Id'),
+            'argument_key'          => t('Checkcommand Argument Name'),
+            'environment_id'        => t('Environment Id'),
+            'properties_checksum'   => t('Checkcommand Argument Properties Checksum'),
+            'argument_value'        => t('Checkcommand Argument Value'),
+            'argument_order'        => t('Checkcommand Argument Position'),
+            'description'           => t('Checkcommand Argument Description'),
+            'argument_key_override' => t('Checkcommand Argument Actual Name'),
+            'repeat_key'            => t('Checkcommand Argument Repeated'),
+            'required'              => t('Checkcommand Argument Required'),
+            'set_if'                => t('Checkcommand Argument Condition'),
+            'skip_key'              => t('Checkcommand Argument Without Name')
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'checkcommand_id',
+            'environment_id',
+            'properties_checksum'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('checkcommand', CheckCommand::class);
+    }
+}
diff --git a/library/Icingadb/Model/CheckcommandCustomvar.php b/library/Icingadb/Model/CheckcommandCustomvar.php
new file mode 100644
index 0000000..d55506e
--- /dev/null
+++ b/library/Icingadb/Model/CheckcommandCustomvar.php
@@ -0,0 +1,52 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class CheckcommandCustomvar extends Model
+{
+    public function getTableName()
+    {
+        return 'checkcommand_customvar';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'checkcommand_id',
+            'customvar_id',
+            'environment_id'
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'checkcommand_id',
+            'customvar_id',
+            'environment_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('checkcommand', CheckCommand::class);
+        $relations->belongsTo('customvar', Customvar::class);
+        $relations->belongsTo('customvar_flat', CustomvarFlat::class)
+            ->setCandidateKey('customvar_id')
+            ->setForeignKey('customvar_id');
+    }
+}
diff --git a/library/Icingadb/Model/CheckcommandEnvvar.php b/library/Icingadb/Model/CheckcommandEnvvar.php
new file mode 100644
index 0000000..cbcb926
--- /dev/null
+++ b/library/Icingadb/Model/CheckcommandEnvvar.php
@@ -0,0 +1,61 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class CheckcommandEnvvar extends Model
+{
+    public function getTableName()
+    {
+        return 'checkcommand_envvar';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'checkcommand_id',
+            'envvar_key',
+            'environment_id',
+            'properties_checksum',
+            'envvar_value'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'checkcommand_id'       => t('Checkcommand Id'),
+            'envvar_key'            => t('Checkcommand Envvar Name'),
+            'environment_id'        => t('Environment Id'),
+            'properties_checksum'   => t('Checkcommand Properties Checksum'),
+            'envvar_value'          => t('Checkcommand Envvar Value')
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'checkcommand_id',
+            'environment_id',
+            'properties_checksum'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('checkcommand', CheckCommand::class);
+    }
+}
diff --git a/library/Icingadb/Model/Comment.php b/library/Icingadb/Model/Comment.php
new file mode 100644
index 0000000..9cea1ce
--- /dev/null
+++ b/library/Icingadb/Model/Comment.php
@@ -0,0 +1,120 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Model\Behavior\BoolCast;
+use Icinga\Module\Icingadb\Model\Behavior\ReRoute;
+use Icinga\Module\Icingadb\Model\Behavior\Timestamp;
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class Comment extends Model
+{
+    public function getTableName()
+    {
+        return 'comment';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'environment_id',
+            'object_type',
+            'host_id',
+            'service_id',
+            'name_checksum',
+            'properties_checksum',
+            'name',
+            'author',
+            'text',
+            'entry_type',
+            'entry_time',
+            'is_persistent',
+            'is_sticky',
+            'expire_time',
+            'zone_id'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'environment_id'        => t('Environment Id'),
+            'object_type'           => t('Object Type'),
+            'host_id'               => t('Host Id'),
+            'service_id'            => t('Service Id'),
+            'name_checksum'         => t('Comment Name Checksum'),
+            'properties_checksum'   => t('Comment Properties Checksum'),
+            'name'                  => t('Comment Name'),
+            'author'                => t('Comment Author'),
+            'text'                  => t('Comment Text'),
+            'entry_type'            => t('Comment Type'),
+            'entry_time'            => t('Comment Entry Time'),
+            'is_persistent'         => t('Comment Is Persistent'),
+            'is_sticky'             => t('Comment Is Sticky'),
+            'expire_time'           => t('Comment Expire Time'),
+            'zone_id'               => t('Zone Id')
+        ];
+    }
+
+    public function getSearchColumns()
+    {
+        return ['text'];
+    }
+
+    public function getDefaultSort()
+    {
+        return 'comment.entry_time desc';
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new BoolCast([
+            'is_persistent',
+            'is_sticky'
+        ]));
+
+        $behaviors->add(new Timestamp([
+            'entry_time',
+            'expire_time'
+        ]));
+
+        $behaviors->add(new Binary([
+            'id',
+            'environment_id',
+            'host_id',
+            'service_id',
+            'name_checksum',
+            'properties_checksum',
+            'zone_id'
+        ]));
+
+        $behaviors->add(new ReRoute([
+            'hostgroup'     => 'host.hostgroup',
+            'servicegroup'  => 'service.servicegroup'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('host', Host::class)->setJoinType('LEFT');
+        $relations->belongsTo('host_state', HostState::class)
+            ->setForeignKey('last_comment_id')
+            ->setCandidateKey('id');
+        $relations->belongsTo('service', Service::class)->setJoinType('LEFT');
+        $relations->belongsTo('service_state', ServiceState::class)
+            ->setForeignKey('last_comment_id')
+            ->setCandidateKey('id');
+        $relations->belongsTo('zone', Zone::class);
+    }
+}
diff --git a/library/Icingadb/Model/CommentHistory.php b/library/Icingadb/Model/CommentHistory.php
new file mode 100644
index 0000000..8428a15
--- /dev/null
+++ b/library/Icingadb/Model/CommentHistory.php
@@ -0,0 +1,107 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Model\Behavior\BoolCast;
+use Icinga\Module\Icingadb\Model\Behavior\Timestamp;
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+/**
+ * Model for table `comment_history`
+ *
+ * Please note that using this model will fetch history entries for decommissioned services. To avoid this,
+ * the query needs a `comment_history.service_id IS NULL OR comment_history_service.id IS NOT NULL` where.
+ */
+class CommentHistory extends Model
+{
+    public function getTableName()
+    {
+        return 'comment_history';
+    }
+
+    public function getKeyName()
+    {
+        return 'comment_id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'environment_id',
+            'endpoint_id',
+            'object_type',
+            'host_id',
+            'service_id',
+            'entry_time',
+            'author',
+            'removed_by',
+            'comment',
+            'entry_type',
+            'is_persistent',
+            'is_sticky',
+            'expire_time',
+            'remove_time',
+            'has_been_removed'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'environment_id'    => t('Environment Id'),
+            'endpoint_id'       => t('Endpoint Id'),
+            'object_type'       => t('Object Type'),
+            'host_id'           => t('Host Id'),
+            'service_id'        => t('Service Id'),
+            'entry_time'        => t('Comment Entry Time'),
+            'author'            => t('Comment Author'),
+            'removed_by'        => t('Comment Removed By'),
+            'comment'           => t('Comment Text'),
+            'entry_type'        => t('Comment Entry Type'),
+            'is_persistent'     => t('Comment Is Persistent'),
+            'is_sticky'         => t('Comment Is Sticky'),
+            'expire_time'       => t('Comment Expire Time'),
+            'remove_time'       => t('Comment Remove Time'),
+            'has_been_removed'  => t('Comment Has Been Removed')
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new BoolCast([
+            'is_persistent',
+            'is_sticky',
+            'has_been_removed'
+        ]));
+
+        $behaviors->add(new Timestamp([
+            'entry_time',
+            'expire_time',
+            'remove_time'
+        ]));
+
+        $behaviors->add(new Binary([
+            'comment_id',
+            'environment_id',
+            'endpoint_id',
+            'host_id',
+            'service_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('endpoint', Endpoint::class);
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('history', History::class)
+            ->setCandidateKey('comment_id')
+            ->setForeignKey('comment_history_id');
+        $relations->belongsTo('host', Host::class);
+        $relations->belongsTo('service', Service::class)->setJoinType('LEFT');
+    }
+}
diff --git a/library/Icingadb/Model/Customvar.php b/library/Icingadb/Model/Customvar.php
new file mode 100644
index 0000000..e043229
--- /dev/null
+++ b/library/Icingadb/Model/Customvar.php
@@ -0,0 +1,72 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class Customvar extends Model
+{
+    public function getTableName()
+    {
+        return 'customvar';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'environment_id',
+            'name_checksum',
+            'name',
+            'value'
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'environment_id',
+            'name_checksum'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+
+        $relations->belongsToMany('checkcommand', Checkcommand::class)
+            ->through(CheckcommandCustomvar::class);
+        $relations->belongsToMany('eventcommand', Eventcommand::class)
+            ->through(EventcommandCustomvar::class);
+        $relations->belongsToMany('host', Host::class)
+            ->through(HostCustomvar::class);
+        $relations->belongsToMany('hostgroup', Hostgroup::class)
+            ->through(HostgroupCustomvar::class);
+        $relations->belongsToMany('notification', Notification::class)
+            ->through(NotificationCustomvar::class);
+        $relations->belongsToMany('notificationcommand', Notificationcommand::class)
+            ->through(NotificationcommandCustomvar::class);
+        $relations->belongsToMany('service', Service::class)
+            ->through(ServiceCustomvar::class);
+        $relations->belongsToMany('servicegroup', Servicegroup::class)
+            ->through(ServicegroupCustomvar::class);
+        $relations->belongsToMany('timeperiod', Timeperiod::class)
+            ->through(TimeperiodCustomvar::class);
+        $relations->belongsToMany('user', User::class)
+            ->through(UserCustomvar::class);
+        $relations->belongsToMany('usergroup', Usergroup::class)
+            ->through(UsergroupCustomvar::class);
+
+        $relations->hasMany('customvar_flat', CustomvarFlat::class);
+    }
+}
diff --git a/library/Icingadb/Model/CustomvarFlat.php b/library/Icingadb/Model/CustomvarFlat.php
new file mode 100644
index 0000000..64e3a79
--- /dev/null
+++ b/library/Icingadb/Model/CustomvarFlat.php
@@ -0,0 +1,122 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+use Traversable;
+
+class CustomvarFlat extends Model
+{
+    public function getTableName()
+    {
+        return 'customvar_flat';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'environment_id',
+            'customvar_id',
+            'flatname_checksum',
+            'flatname',
+            'flatvalue'
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'environment_id',
+            'customvar_id',
+            'flatname_checksum'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('customvar', Customvar::class);
+
+        $relations->belongsToMany('checkcommand', Checkcommand::class)
+            ->through(CheckcommandCustomvar::class)
+            ->setCandidateKey('customvar_id');
+        $relations->belongsToMany('eventcommand', Eventcommand::class)
+            ->through(EventcommandCustomvar::class)
+            ->setCandidateKey('customvar_id');
+        $relations->belongsToMany('host', Host::class)
+            ->through(HostCustomvar::class)
+            ->setCandidateKey('customvar_id');
+        $relations->belongsToMany('hostgroup', Hostgroup::class)
+            ->through(HostgroupCustomvar::class)
+            ->setCandidateKey('customvar_id');
+        $relations->belongsToMany('notification', Notification::class)
+            ->through(NotificationCustomvar::class)
+            ->setCandidateKey('customvar_id');
+        $relations->belongsToMany('notificationcommand', Notificationcommand::class)
+            ->through(NotificationcommandCustomvar::class)
+            ->setCandidateKey('customvar_id');
+        $relations->belongsToMany('service', Service::class)
+            ->through(ServiceCustomvar::class)
+            ->setCandidateKey('customvar_id');
+        $relations->belongsToMany('servicegroup', Servicegroup::class)
+            ->through(ServicegroupCustomvar::class)
+            ->setCandidateKey('customvar_id');
+        $relations->belongsToMany('timeperiod', Timeperiod::class)
+            ->through(TimeperiodCustomvar::class)
+            ->setCandidateKey('customvar_id');
+        $relations->belongsToMany('user', User::class)
+            ->through(UserCustomvar::class)
+            ->setCandidateKey('customvar_id');
+        $relations->belongsToMany('usergroup', Usergroup::class)
+            ->through(UsergroupCustomvar::class)
+            ->setCandidateKey('customvar_id');
+    }
+
+    /**
+     * Restore flattened custom variables to their previous structure
+     *
+     * @param Traversable $flattenedVars
+     *
+     * @return array
+     */
+    public function unFlattenVars(Traversable $flattenedVars): array
+    {
+        $registerValue = function (&$data, $path, $value) use (&$registerValue) {
+            $step = array_shift($path);
+            $pos = null;
+            if (preg_match('/\[(\d+)]$/', $step, $m)) {
+                $step = substr($step, 0, -strlen($m[0]));
+                array_unshift($path, $m[1]);
+            }
+
+            if (! empty($path)) {
+                if (! isset($data[$step])) {
+                    $data[$step] = [];
+                }
+
+                $registerValue($data[$step], $path, $value);
+            } else {
+                $data[$step] = $value;
+            }
+        };
+
+        $vars = [];
+        foreach ($flattenedVars as $var) {
+            $path = explode('.', $var->flatname);
+            $registerValue($vars, $path, $var->flatvalue);
+        }
+
+        return $vars;
+    }
+}
diff --git a/library/Icingadb/Model/Downtime.php b/library/Icingadb/Model/Downtime.php
new file mode 100644
index 0000000..07112c5
--- /dev/null
+++ b/library/Icingadb/Model/Downtime.php
@@ -0,0 +1,147 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Model\Behavior\BoolCast;
+use Icinga\Module\Icingadb\Model\Behavior\ReRoute;
+use Icinga\Module\Icingadb\Model\Behavior\Timestamp;
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class Downtime extends Model
+{
+    public function getTableName()
+    {
+        return 'downtime';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'environment_id',
+            'triggered_by_id',
+            'parent_id',
+            'object_type',
+            'host_id',
+            'service_id',
+            'name_checksum',
+            'properties_checksum',
+            'name',
+            'author',
+            'comment',
+            'entry_time',
+            'scheduled_start_time',
+            'scheduled_end_time',
+            'scheduled_duration',
+            'is_flexible',
+            'flexible_duration',
+            'is_in_effect',
+            'start_time',
+            'end_time',
+            'duration',
+            'scheduled_by',
+            'zone_id'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'environment_id'       => t('Environment Id'),
+            'triggered_by_id'      => t('Triggered By Downtime Id'),
+            'parent_id'            => t('Parent Downtime Id'),
+            'object_type'          => t('Object Type'),
+            'host_id'              => t('Host Id'),
+            'service_id'           => t('Service Id'),
+            'name_checksum'        => t('Downtime Name Checksum'),
+            'properties_checksum'  => t('Downtime Properties Checksum'),
+            'name'                 => t('Downtime Name'),
+            'author'               => t('Downtime Author'),
+            'comment'              => t('Downtime Comment'),
+            'entry_time'           => t('Downtime Entry Time'),
+            'scheduled_start_time' => t('Downtime Scheduled Start'),
+            'scheduled_end_time'   => t('Downtime Scheduled End'),
+            'scheduled_duration'   => t('Downtime Scheduled Duration'),
+            'is_flexible'          => t('Downtime Is Flexible'),
+            'flexible_duration'    => t('Downtime Flexible Duration'),
+            'is_in_effect'         => t('Downtime Is In Effect'),
+            'start_time'           => t('Downtime Actual Start'),
+            'end_time'             => t('Downtime Actual End'),
+            'duration'             => t('Downtime Duration'),
+            'scheduled_by'         => t('Scheduled By Downtime'),
+            'zone_id'              => t('Zone Id')
+        ];
+    }
+
+    public function getSearchColumns()
+    {
+        return ['comment'];
+    }
+
+    public function getDefaultSort()
+    {
+        return ['downtime.is_in_effect desc', 'downtime.start_time desc'];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new BoolCast([
+            'is_flexible',
+            'is_in_effect'
+        ]));
+
+        $behaviors->add(new Timestamp([
+            'entry_time',
+            'scheduled_start_time',
+            'scheduled_end_time',
+            'scheduled_duration',
+            'flexible_duration',
+            'start_time',
+            'end_time',
+            'duration'
+        ]));
+
+        $behaviors->add(new Binary([
+            'id',
+            'environment_id',
+            'triggered_by_id',
+            'parent_id',
+            'host_id',
+            'service_id',
+            'name_checksum',
+            'properties_checksum',
+            'zone_id'
+        ]));
+
+        // As long as the rewriteCondition() expects only Filter\Condition as a first argument
+        // We have to add this reroute behavior after the binary because the filter condition might
+        // be transformed into a filter chain!
+        $behaviors->add(new ReRoute([
+            'hostgroup'    => 'host.hostgroup',
+            'servicegroup' => 'service.servicegroup'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('triggered_by', self::class)
+            ->setCandidateKey('triggered_by_id')
+            ->setJoinType('LEFT');
+        $relations->belongsTo('parent', self::class)
+            ->setCandidateKey('parent_id')
+            ->setJoinType('LEFT');
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('host', Host::class)->setJoinType('LEFT');
+        $relations->belongsTo('service', Service::class)->setJoinType('LEFT');
+        $relations->belongsTo('zone', Zone::class);
+    }
+}
diff --git a/library/Icingadb/Model/DowntimeHistory.php b/library/Icingadb/Model/DowntimeHistory.php
new file mode 100644
index 0000000..ee4f973
--- /dev/null
+++ b/library/Icingadb/Model/DowntimeHistory.php
@@ -0,0 +1,129 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Model\Behavior\BoolCast;
+use Icinga\Module\Icingadb\Model\Behavior\Timestamp;
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+/**
+ * Model for table `downtime_history`
+ *
+ * Please note that using this model will fetch history entries for decommissioned services. To avoid this,
+ * the query needs a `downtime_history.service_id IS NULL OR downtime_history_service.id IS NOT NULL` where.
+ */
+class DowntimeHistory extends Model
+{
+    public function getTableName()
+    {
+        return 'downtime_history';
+    }
+
+    public function getKeyName()
+    {
+        return 'downtime_id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'environment_id',
+            'endpoint_id',
+            'triggered_by_id',
+            'parent_id',
+            'object_type',
+            'host_id',
+            'service_id',
+            'entry_time',
+            'author',
+            'cancelled_by',
+            'comment',
+            'is_flexible',
+            'flexible_duration',
+            'scheduled_start_time',
+            'scheduled_end_time',
+            'start_time',
+            'end_time',
+            'has_been_cancelled',
+            'trigger_time',
+            'cancel_time'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'environment_id'        => t('Environment Id'),
+            'endpoint_id'           => t('Endpoint Id'),
+            'triggered_by_id'       => t('Triggered By Downtime Id'),
+            'parent_id'             => t('Parent Downtime Id'),
+            'object_type'           => t('Object Type'),
+            'host_id'               => t('Host Id'),
+            'service_id'            => t('Service Id'),
+            'entry_time'            => t('Downtime Entry Time'),
+            'author'                => t('Downtime Author'),
+            'cancelled_by'          => t('Downtime Cancelled By'),
+            'comment'               => t('Downtime Comment'),
+            'is_flexible'           => t('Downtime Is Flexible'),
+            'flexible_duration'     => t('Downtime Flexible Duration'),
+            'scheduled_start_time'  => t('Downtime Scheduled Start'),
+            'scheduled_end_time'    => t('Downtime Scheduled End'),
+            'start_time'            => t('Downtime Actual Start'),
+            'end_time'              => t('Downtime Actual End'),
+            'has_been_cancelled'    => t('Downtime Has Been Cancelled'),
+            'trigger_time'          => t('Downtime Trigger Time'),
+            'cancel_time'           => t('Downtime Cancel Time')
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new BoolCast([
+            'is_flexible',
+            'has_been_cancelled'
+        ]));
+
+        $behaviors->add(new Timestamp([
+            'entry_time',
+            'scheduled_start_time',
+            'scheduled_end_time',
+            'flexible_duration',
+            'start_time',
+            'end_time',
+            'trigger_time',
+            'cancel_time'
+        ]));
+
+        $behaviors->add(new Binary([
+            'downtime_id',
+            'environment_id',
+            'endpoint_id',
+            'triggered_by_id',
+            'parent_id',
+            'host_id',
+            'service_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('triggered_by', self::class)
+            ->setCandidateKey('triggered_by_id')
+            ->setJoinType('LEFT');
+        $relations->belongsTo('parent', self::class)
+            ->setCandidateKey('parent_id')
+            ->setJoinType('LEFT');
+        $relations->belongsTo('endpoint', Endpoint::class);
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('history', History::class)
+            ->setCandidateKey('downtime_id')
+            ->setForeignKey('downtime_history_id');
+        $relations->belongsTo('host', Host::class)->setJoinType('LEFT');
+        $relations->belongsTo('service', Service::class)->setJoinType('LEFT');
+    }
+}
diff --git a/library/Icingadb/Model/Endpoint.php b/library/Icingadb/Model/Endpoint.php
new file mode 100644
index 0000000..257001b
--- /dev/null
+++ b/library/Icingadb/Model/Endpoint.php
@@ -0,0 +1,69 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class Endpoint extends Model
+{
+    public function getTableName()
+    {
+        return 'endpoint';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'environment_id',
+            'name_checksum',
+            'properties_checksum',
+            'name',
+            'name_ci',
+            'zone_id'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'environment_id'        => t('Environment Id'),
+            'name_checksum'         => t('Endpoint Name Checksum'),
+            'properties_checksum'   => t('Endpoint Properties Checksum'),
+            'name'                  => t('Endpoint Name'),
+            'name_ci'               => t('Endpoint Name (CI)'),
+            'zone_id'               => t('Zone Id')
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'environment_id',
+            'name_checksum',
+            'properties_checksum',
+            'zone_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('zone', Zone::class);
+
+        $relations->hasMany('host', Host::class)
+            ->setForeignKey('command_endpoint_id');
+        $relations->hasMany('service', Service::class)
+            ->setForeignKey('command_endpoint_id');
+    }
+}
diff --git a/library/Icingadb/Model/Environment.php b/library/Icingadb/Model/Environment.php
new file mode 100644
index 0000000..919ca1c
--- /dev/null
+++ b/library/Icingadb/Model/Environment.php
@@ -0,0 +1,105 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class Environment extends Model
+{
+    public function getTableName()
+    {
+        return 'environment';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'name'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'name' => t('Environment Name')
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->hasMany('acknowledgement_history', AcknowledgementHistory::class);
+        $relations->hasMany('action_url', ActionUrl::class);
+        $relations->hasMany('checkcommand', Checkcommand::class);
+        $relations->hasMany('checkcommand_argument', CheckcommandArgument::class);
+        $relations->hasMany('checkcommand_customvar', CheckcommandCustomvar::class);
+        $relations->hasMany('checkcommand_envvar', CheckcommandEnvvar::class);
+        $relations->hasMany('comment', Comment::class);
+        $relations->hasMany('comment_history', CommentHistory::class);
+        $relations->hasMany('customvar', Customvar::class);
+        $relations->hasMany('customvar_flat', CustomvarFlat::class);
+        $relations->hasMany('downtime', Downtime::class);
+        $relations->hasMany('downtime_history', DowntimeHistory::class);
+        $relations->hasMany('endpoint', Endpoint::class);
+        $relations->hasMany('eventcommand', Eventcommand::class);
+        $relations->hasMany('eventcommand_argument', EventcommandArgument::class);
+        $relations->hasMany('eventcommand_customvar', EventcommandCustomvar::class);
+        $relations->hasMany('eventcommand_envvar', EventcommandEnvvar::class);
+        $relations->hasMany('flapping_history', FlappingHistory::class);
+        $relations->hasMany('history', History::class);
+        $relations->hasMany('host', Host::class);
+        $relations->hasMany('host_customvar', HostCustomvar::class);
+        $relations->hasMany('host_state', HostState::class);
+        $relations->hasMany('hostgroup', Hostgroup::class);
+        $relations->hasMany('hostgroup_customvar', HostgroupCustomvar::class);
+        $relations->hasMany('hostgroup_member', HostgroupMember::class);
+        $relations->hasMany('instance', Instance::class);
+        $relations->hasMany('icon_image', IconImage::class);
+        $relations->hasMany('notes_url', NotesUrl::class);
+        $relations->hasMany('notification', Notification::class);
+        $relations->hasMany('notification_customvar', NotificationCustomvar::class);
+        $relations->hasMany('notification_history', NotificationHistory::class);
+        //$relations->hasMany('notification_recipient', NotificationRecipient::class);
+        $relations->hasMany('notification_user', NotificationUser::class);
+        $relations->hasMany('notification_usergroup', NotificationUsergroup::class);
+        $relations->hasMany('notificationcommand', Notificationcommand::class);
+        $relations->hasMany('notificationcommand_argument', NotificationcommandArgument::class);
+        $relations->hasMany('notificationcommand_customvar', NotificationcommandCustomvar::class);
+        $relations->hasMany('notificationcommand_envvar', NotificationcommandEnvvar::class);
+        $relations->hasMany('service', Service::class);
+        $relations->hasMany('service_customvar', ServiceCustomvar::class);
+        $relations->hasMany('service_state', ServiceState::class);
+        $relations->hasMany('servicegroup', Servicegroup::class);
+        $relations->hasMany('servicegroup_customvar', ServicegroupCustomvar::class);
+        $relations->hasMany('servicegroup_member', ServicegroupMember::class);
+        $relations->hasMany('state_history', StateHistory::class);
+        $relations->hasMany('timeperiod', Timeperiod::class);
+        $relations->hasMany('timeperiod_customvar', TimeperiodCustomvar::class);
+        $relations->hasMany('timeperiod_override_exclude', TimeperiodOverrideExclude::class);
+        $relations->hasMany('timeperiod_override_include', TimeperiodOverrideInclude::class);
+        $relations->hasMany('timeperiod_range', TimeperiodRange::class);
+        $relations->hasMany('user', User::class);
+        $relations->hasMany('user_customvar', UserCustomvar::class);
+        //$relations->hasMany('user_notification_history', UserNotificationHistory::class);
+        $relations->hasMany('usergroup', Usergroup::class);
+        $relations->hasMany('usergroup_customvar', UsergroupCustomvar::class);
+        $relations->hasMany('usergroup_member', UsergroupMember::class);
+        $relations->hasMany('zone', Zone::class);
+    }
+}
diff --git a/library/Icingadb/Model/Eventcommand.php b/library/Icingadb/Model/Eventcommand.php
new file mode 100644
index 0000000..ad18e22
--- /dev/null
+++ b/library/Icingadb/Model/Eventcommand.php
@@ -0,0 +1,86 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Model\Behavior\ReRoute;
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class Eventcommand extends Model
+{
+    public function getTableName()
+    {
+        return 'eventcommand';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'zone_id',
+            'environment_id',
+            'name_checksum',
+            'properties_checksum',
+            'name',
+            'name_ci',
+            'command',
+            'timeout'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'zone_id'               => t('Zone Id'),
+            'environment_id'        => t('Environment Id'),
+            'name_checksum'         => t('Eventcommand Name Checksum'),
+            'properties_checksum'   => t('Eventcommand Properties Checksum'),
+            'name'                  => t('Eventcommand Name'),
+            'name_ci'               => t('Eventcommand Name (CI)'),
+            'command'               => t('Eventcommand'),
+            'timeout'               => t('Eventcommand Timeout')
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new ReRoute([
+            'hostgroup'     => 'host.hostgroup',
+            'servicegroup'  => 'service.servicegroup'
+        ]));
+
+        $behaviors->add(new Binary([
+            'id',
+            'zone_id',
+            'environment_id',
+            'name_checksum',
+            'properties_checksum'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('zone', Zone::class);
+
+        $relations->belongsToMany('customvar', Customvar::class)
+            ->through(EventcommandCustomvar::class);
+        $relations->belongsToMany('customvar_flat', CustomvarFlat::class)
+            ->through(EventcommandCustomvar::class);
+        $relations->belongsToMany('vars', Vars::class)
+            ->through(EventcommandCustomvar::class);
+
+        $relations->hasMany('argument', EventcommandArgument::class);
+        $relations->hasMany('envvar', EventcommandEnvvar::class);
+        $relations->hasMany('host', Host::class);
+        $relations->hasMany('service', Service::class);
+    }
+}
diff --git a/library/Icingadb/Model/EventcommandArgument.php b/library/Icingadb/Model/EventcommandArgument.php
new file mode 100644
index 0000000..485e5d3
--- /dev/null
+++ b/library/Icingadb/Model/EventcommandArgument.php
@@ -0,0 +1,75 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class EventcommandArgument extends Model
+{
+    public function getTableName()
+    {
+        return 'eventcommand_argument';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'eventcommand_id',
+            'argument_key',
+            'environment_id',
+            'properties_checksum',
+            'argument_value',
+            'argument_order',
+            'description',
+            'argument_key_override',
+            'repeat_key',
+            'required',
+            'set_if',
+            'skip_key'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'eventcommand_id'       => t('Eventcommand Id'),
+            'argument_key'          => t('Eventcommand Argument Name'),
+            'environment_id'        => t('Environment Id'),
+            'properties_checksum'   => t('Eventcommand Argument Properties Checksum'),
+            'argument_value'        => t('Eventcommand Argument Value'),
+            'argument_order'        => t('Eventcommand Argument Position'),
+            'description'           => t('Eventcommand Argument Description'),
+            'argument_key_override' => t('Eventcommand Argument Actual Name'),
+            'repeat_key'            => t('Eventcommand Argument Repeated'),
+            'required'              => t('Eventcommand Argument Required'),
+            'set_if'                => t('Eventcommand Argument Condition'),
+            'skip_key'              => t('Eventcommand Argument Without Name')
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'eventcommand_id',
+            'environment_id',
+            'properties_checksum'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('eventcommand', Eventcommand::class);
+    }
+}
diff --git a/library/Icingadb/Model/EventcommandCustomvar.php b/library/Icingadb/Model/EventcommandCustomvar.php
new file mode 100644
index 0000000..3d1fa48
--- /dev/null
+++ b/library/Icingadb/Model/EventcommandCustomvar.php
@@ -0,0 +1,52 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class EventcommandCustomvar extends Model
+{
+    public function getTableName()
+    {
+        return 'eventcommand_customvar';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'eventcommand_id',
+            'customvar_id',
+            'environment_id'
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'eventcommand_id',
+            'customvar_id',
+            'environment_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('eventcommand', Eventcommand::class);
+        $relations->belongsTo('customvar', Customvar::class);
+        $relations->belongsTo('customvar_flat', CustomvarFlat::class)
+            ->setCandidateKey('customvar_id')
+            ->setForeignKey('customvar_id');
+    }
+}
diff --git a/library/Icingadb/Model/EventcommandEnvvar.php b/library/Icingadb/Model/EventcommandEnvvar.php
new file mode 100644
index 0000000..3883bef
--- /dev/null
+++ b/library/Icingadb/Model/EventcommandEnvvar.php
@@ -0,0 +1,61 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class EventcommandEnvvar extends Model
+{
+    public function getTableName()
+    {
+        return 'eventcommand_envvar';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'eventcommand_id',
+            'envvar_key',
+            'environment_id',
+            'properties_checksum',
+            'envvar_value'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'eventcommand_id'       => t('Eventcommand Id'),
+            'envvar_key'            => t('Eventcommand Envvar Name'),
+            'environment_id'        => t('Environment Id'),
+            'properties_checksum'   => t('Eventcommand Envvar Properties Checksum'),
+            'envvar_value'          => t('Eventcommand Envvar Value')
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'eventcommand_id',
+            'environment_id',
+            'properties_checksum'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('eventcommand', Eventcommand::class);
+    }
+}
diff --git a/library/Icingadb/Model/FlappingHistory.php b/library/Icingadb/Model/FlappingHistory.php
new file mode 100644
index 0000000..377d2ca
--- /dev/null
+++ b/library/Icingadb/Model/FlappingHistory.php
@@ -0,0 +1,91 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Model\Behavior\Timestamp;
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+/**
+ * Model for table `flapping_history`
+ *
+ * Please note that using this model will fetch history entries for decommissioned services. To avoid this,
+ * the query needs a `flapping_history.service_id IS NULL OR flapping_history_service.id IS NOT NULL` where.
+ */
+class FlappingHistory extends Model
+{
+    public function getTableName()
+    {
+        return 'flapping_history';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'environment_id',
+            'endpoint_id',
+            'object_type',
+            'host_id',
+            'service_id',
+            'start_time',
+            'end_time',
+            'percent_state_change_start',
+            'percent_state_change_end',
+            'flapping_threshold_low',
+            'flapping_threshold_high'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'environment_id'                => t('Environment Id'),
+            'endpoint_id'                   => t('Endpoint Id'),
+            'object_type'                   => t('Object Type'),
+            'host_id'                       => t('Host Id'),
+            'service_id'                    => t('Service Id'),
+            'start_time'                    => t('Flapping Start Time'),
+            'end_time'                      => t('Flapping End Time'),
+            'percent_state_change_start'    => t('Flapping Percent State Change Start'),
+            'percent_state_change_end'      => t('Flapping Percent State Change End'),
+            'flapping_threshold_low'        => t('Flapping Threshold Low'),
+            'flapping_threshold_high'       => t('Flapping Threshold High')
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Timestamp([
+            'start_time',
+            'end_time'
+        ]));
+
+        $behaviors->add(new Binary([
+            'id',
+            'environment_id',
+            'endpoint_id',
+            'host_id',
+            'service_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('endpoint', Endpoint::class);
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('history', History::class)
+            ->setCandidateKey('id')
+            ->setForeignKey('flapping_history_id');
+        $relations->belongsTo('host', Host::class);
+        $relations->belongsTo('service', Service::class)->setJoinType('LEFT');
+    }
+}
diff --git a/library/Icingadb/Model/History.php b/library/Icingadb/Model/History.php
new file mode 100644
index 0000000..74288d3
--- /dev/null
+++ b/library/Icingadb/Model/History.php
@@ -0,0 +1,127 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Model\Behavior\ReRoute;
+use Icinga\Module\Icingadb\Model\Behavior\Timestamp;
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+/**
+ * Model for table `history`
+ *
+ * Please note that using this model will fetch history entries for decommissioned services. To avoid
+ * this, the query needs a `history.service_id IS NULL OR history_service.id IS NOT NULL` where.
+ */
+class History extends Model
+{
+    public function getTableName()
+    {
+        return 'history';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'environment_id',
+            'endpoint_id',
+            'object_type',
+            'host_id',
+            'service_id',
+            'comment_history_id',
+            'downtime_history_id',
+            'flapping_history_id',
+            'notification_history_id',
+            'acknowledgement_history_id',
+            'state_history_id',
+            'event_type',
+            'event_time'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'environment_id'    => t('Environment Id'),
+            'endpoint_id'       => t('Endpoint Id'),
+            'object_type'       => t('Object Type'),
+            'host_id'           => t('Host Id'),
+            'service_id'        => t('Service Id'),
+            'event_type'        => t('Event Type'),
+            'event_time'        => t('Event Time')
+        ];
+    }
+
+    public function getDefaultSort()
+    {
+        return 'history.event_time desc';
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Timestamp([
+            'event_time'
+        ]));
+
+        $behaviors->add(new Binary([
+            'id',
+            'environment_id',
+            'endpoint_id',
+            'host_id',
+            'service_id',
+            'comment_history_id',
+            'downtime_history_id',
+            'flapping_history_id',
+            'notification_history_id',
+            'acknowledgement_history_id',
+            'state_history_id'
+        ]));
+
+        $behaviors->add(new ReRoute([
+            'hostgroup'     => 'host.hostgroup',
+            'servicegroup'  => 'service.servicegroup'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('endpoint', Endpoint::class);
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('host', Host::class);
+        $relations->belongsTo('service', Service::class)->setJoinType('LEFT');
+
+        $relations->hasOne('comment', CommentHistory::class)
+            ->setCandidateKey('comment_history_id')
+            ->setForeignKey('comment_id')
+            ->setJoinType('LEFT');
+        $relations->hasOne('downtime', DowntimeHistory::class)
+            ->setCandidateKey('downtime_history_id')
+            ->setForeignKey('downtime_id')
+            ->setJoinType('LEFT');
+        $relations->hasOne('flapping', FlappingHistory::class)
+            ->setCandidateKey('flapping_history_id')
+            ->setForeignKey('id')
+            ->setJoinType('LEFT');
+        $relations->hasOne('notification', NotificationHistory::class)
+            ->setCandidateKey('notification_history_id')
+            ->setForeignKey('id')
+            ->setJoinType('LEFT');
+        $relations->hasOne('acknowledgement', AcknowledgementHistory::class)
+            ->setCandidateKey('acknowledgement_history_id')
+            ->setForeignKey('id')
+            ->setJoinType('LEFT');
+        $relations->hasOne('state', StateHistory::class)
+            ->setCandidateKey('state_history_id')
+            ->setForeignKey('id')
+            ->setJoinType('LEFT');
+    }
+}
diff --git a/library/Icingadb/Model/Host.php b/library/Icingadb/Model/Host.php
new file mode 100644
index 0000000..a76cb36
--- /dev/null
+++ b/library/Icingadb/Model/Host.php
@@ -0,0 +1,233 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Common\Auth;
+use Icinga\Module\Icingadb\Model\Behavior\BoolCast;
+use Icinga\Module\Icingadb\Model\Behavior\ReRoute;
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Defaults;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+use ipl\Orm\ResultSet;
+
+/**
+ * Host model.
+ */
+class Host extends Model
+{
+    use Auth;
+
+    public function getTableName()
+    {
+        return 'host';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'environment_id',
+            'name_checksum',
+            'properties_checksum',
+            'name',
+            'name_ci',
+            'display_name',
+            'address',
+            'address6',
+            'address_bin',
+            'address6_bin',
+            'checkcommand_name',
+            'checkcommand_id',
+            'max_check_attempts',
+            'check_timeperiod_name',
+            'check_timeperiod_id',
+            'check_timeout',
+            'check_interval',
+            'check_retry_interval',
+            'active_checks_enabled',
+            'passive_checks_enabled',
+            'event_handler_enabled',
+            'notifications_enabled',
+            'flapping_enabled',
+            'flapping_threshold_low',
+            'flapping_threshold_high',
+            'perfdata_enabled',
+            'eventcommand_name',
+            'eventcommand_id',
+            'is_volatile',
+            'action_url_id',
+            'notes_url_id',
+            'notes',
+            'icon_image_id',
+            'icon_image_alt',
+            'zone_name',
+            'zone_id',
+            'command_endpoint_name',
+            'command_endpoint_id'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'environment_id'            => t('Environment Id'),
+            'name_checksum'             => t('Host Name Checksum'),
+            'properties_checksum'       => t('Host Properties Checksum'),
+            'name'                      => t('Host Name'),
+            'name_ci'                   => t('Host Name (CI)'),
+            'display_name'              => t('Host Display Name'),
+            'address'                   => t('Host Address (IPv4)'),
+            'address6'                  => t('Host Address (IPv6)'),
+            'address_bin'               => t('Host Address (IPv4, Binary)'),
+            'address6_bin'              => t('Host Address (IPv6, Binary)'),
+            'checkcommand_name'         => t('Checkcommand Name'),
+            'checkcommand_id'           => t('Checkcommand Id'),
+            'max_check_attempts'        => t('Host Max Check Attempts'),
+            'check_timeperiod_name'     => t('Check Timeperiod Name'),
+            'check_timeperiod_id'       => t('Check Timeperiod Id'),
+            'check_timeout'             => t('Host Check Timeout'),
+            'check_interval'            => t('Host Check Interval'),
+            'check_retry_interval'      => t('Host Check Retry Inverval'),
+            'active_checks_enabled'     => t('Host Active Checks Enabled'),
+            'passive_checks_enabled'    => t('Host Passive Checks Enabled'),
+            'event_handler_enabled'     => t('Host Event Handler Enabled'),
+            'notifications_enabled'     => t('Host Notifications Enabled'),
+            'flapping_enabled'          => t('Host Flapping Enabled'),
+            'flapping_threshold_low'    => t('Host Flapping Threshold Low'),
+            'flapping_threshold_high'   => t('Host Flapping Threshold High'),
+            'perfdata_enabled'          => t('Host Performance Data Enabled'),
+            'eventcommand_name'         => t('Eventcommand Name'),
+            'eventcommand_id'           => t('Eventcommand Id'),
+            'is_volatile'               => t('Host Is Volatile'),
+            'action_url_id'             => t('Action Url Id'),
+            'notes_url_id'              => t('Notes Url Id'),
+            'notes'                     => t('Host Notes'),
+            'icon_image_id'             => t('Icon Image Id'),
+            'icon_image_alt'            => t('Icon Image Alt'),
+            'zone_name'                 => t('Zone Name'),
+            'zone_id'                   => t('Zone Id'),
+            'command_endpoint_name'     => t('Endpoint Name'),
+            'command_endpoint_id'       => t('Endpoint Id')
+        ];
+    }
+
+    public function getSearchColumns()
+    {
+        return ['name_ci'];
+    }
+
+    public function getDefaultSort()
+    {
+        return 'host.display_name';
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new BoolCast([
+            'active_checks_enabled',
+            'passive_checks_enabled',
+            'event_handler_enabled',
+            'notifications_enabled',
+            'flapping_enabled',
+            'is_volatile'
+        ]));
+
+        $behaviors->add(new ReRoute([
+            'servicegroup'  => 'service.servicegroup',
+            'user'          => 'notification.user',
+            'usergroup'     => 'notification.usergroup'
+        ]));
+
+        $behaviors->add(new Binary([
+            'id',
+            'environment_id',
+            'name_checksum',
+            'properties_checksum',
+            'address_bin',
+            'address6_bin',
+            'checkcommand_id',
+            'check_timeperiod_id',
+            'eventcommand_id',
+            'action_url_id',
+            'notes_url_id',
+            'icon_image_id',
+            'zone_id',
+            'command_endpoint_id'
+        ]));
+    }
+
+    public function createDefaults(Defaults $defaults)
+    {
+        $defaults->add('vars', function (self $subject) {
+            if (! $subject->customvar_flat instanceof ResultSet) {
+                $this->applyRestrictions($subject->customvar_flat);
+            }
+
+            $vars = [];
+            foreach ($subject->customvar_flat as $customVar) {
+                $vars[$customVar->flatname] = $customVar->flatvalue;
+            }
+
+            return $vars;
+        });
+
+        $defaults->add('customvars', function (self $subject) {
+            if (! $subject->customvar instanceof ResultSet) {
+                $this->applyRestrictions($subject->customvar);
+            }
+
+            $vars = [];
+            foreach ($subject->customvar as $customVar) {
+                $vars[$customVar->name] = json_decode($customVar->value, true);
+            }
+
+            return $vars;
+        });
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('eventcommand', Eventcommand::class);
+        $relations->belongsTo('checkcommand', Checkcommand::class);
+        $relations->belongsTo('timeperiod', Timeperiod::class)
+            ->setCandidateKey('check_timeperiod_id');
+        $relations->belongsTo('action_url', ActionUrl::class)
+            ->setCandidateKey('action_url_id')
+            ->setForeignKey('id');
+        $relations->belongsTo('notes_url', NotesUrl::class)
+            ->setCandidateKey('notes_url_id')
+            ->setForeignKey('id');
+        $relations->belongsTo('icon_image', IconImage::class)
+            ->setCandidateKey('icon_image_id')
+            ->setJoinType('LEFT');
+        $relations->belongsTo('zone', Zone::class);
+        $relations->belongsTo('endpoint', Endpoint::class)
+            ->setCandidateKey('command_endpoint_id');
+
+        $relations->belongsToMany('customvar', Customvar::class)
+            ->through(HostCustomvar::class);
+        $relations->belongsToMany('customvar_flat', CustomvarFlat::class)
+            ->through(HostCustomvar::class);
+        $relations->belongsToMany('vars', Vars::class)
+            ->through(HostCustomvar::class);
+        $relations->belongsToMany('hostgroup', Hostgroup::class)
+            ->through(HostgroupMember::class);
+
+        $relations->hasOne('state', HostState::class)->setJoinType('LEFT');
+        $relations->hasMany('comment', Comment::class)->setJoinType('LEFT');
+        $relations->hasMany('downtime', Downtime::class)->setJoinType('LEFT');
+        $relations->hasMany('history', History::class);
+        $relations->hasMany('notification', Notification::class)->setJoinType('LEFT');
+        $relations->hasMany('notification_history', NotificationHistory::class);
+        $relations->hasMany('service', Service::class)->setJoinType('LEFT');
+    }
+}
diff --git a/library/Icingadb/Model/HostCustomvar.php b/library/Icingadb/Model/HostCustomvar.php
new file mode 100644
index 0000000..9f7df26
--- /dev/null
+++ b/library/Icingadb/Model/HostCustomvar.php
@@ -0,0 +1,52 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class HostCustomvar extends Model
+{
+    public function getTableName()
+    {
+        return 'host_customvar';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'host_id',
+            'customvar_id',
+            'environment_id'
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'host_id',
+            'customvar_id',
+            'environment_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('host', Host::class);
+        $relations->belongsTo('customvar', Customvar::class);
+        $relations->belongsTo('customvar_flat', CustomvarFlat::class)
+            ->setForeignKey('customvar_id')
+            ->setCandidateKey('customvar_id');
+    }
+}
diff --git a/library/Icingadb/Model/HostState.php b/library/Icingadb/Model/HostState.php
new file mode 100644
index 0000000..0c83417
--- /dev/null
+++ b/library/Icingadb/Model/HostState.php
@@ -0,0 +1,89 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Common\HostStates;
+use ipl\Orm\Relations;
+
+/**
+ * Host state model.
+ */
+class HostState extends State
+{
+    public function getTableName()
+    {
+        return 'host_state';
+    }
+
+    public function getKeyName()
+    {
+        return 'host_id';
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'environment_id'                => t('Environment Id'),
+            'state_type'                    => t('Host State Type'),
+            'soft_state'                    => t('Host Soft State'),
+            'hard_state'                    => t('Host Hard State'),
+            'previous_soft_state'           => t('Host Previous Soft State'),
+            'previous_hard_state'           => t('Host Previous Hard State'),
+            'check_attempt'                 => t('Host Check Attempt No.'),
+            'severity'                      => t('Host State Severity'),
+            'output'                        => t('Host Output'),
+            'long_output'                   => t('Host Long Output'),
+            'performance_data'              => t('Host Performance Data'),
+            'normalized_performance_data'   => t('Host Normalized Performance Data'),
+            'check_commandline'             => t('Host Check Commandline'),
+            'is_problem'                    => t('Host Has Problem'),
+            'is_handled'                    => t('Host Is Handled'),
+            'is_reachable'                  => t('Host Is Reachable'),
+            'is_flapping'                   => t('Host Is Flapping'),
+            'is_overdue'                    => t('Host Check Is Overdue'),
+            'is_acknowledged'               => t('Host Is Acknowledged'),
+            'acknowledgement_comment_id'    => t('Acknowledgement Comment Id'),
+            'in_downtime'                   => t('Host In Downtime'),
+            'execution_time'                => t('Host Check Execution Time'),
+            'latency'                       => t('Host Check Latency'),
+            'check_timeout'                 => t('Host Check Timeout'),
+            'check_source'                  => t('Host Check Source'),
+            'last_update'                   => t('Host Last Update'),
+            'last_state_change'             => t('Host Last State Change'),
+            'next_check'                    => t('Host Next Check'),
+            'next_update'                   => t('Host Next Update')
+        ];
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('host', Host::class);
+        $relations->hasOne('last_comment', Comment::class)
+            ->setCandidateKey('last_comment_id')
+            ->setForeignKey('id')
+            ->setJoinType('LEFT');
+    }
+
+    /**
+     * Get the host state as the textual representation
+     *
+     * @return string
+     */
+    public function getStateText(): string
+    {
+        return HostStates::text($this->soft_state);
+    }
+
+    /**
+     * Get the host state as the translated textual representation
+     *
+     * @return string
+     */
+    public function getStateTextTranslated(): string
+    {
+        return HostStates::text($this->soft_state);
+    }
+}
diff --git a/library/Icingadb/Model/Hostgroup.php b/library/Icingadb/Model/Hostgroup.php
new file mode 100644
index 0000000..1dfae31
--- /dev/null
+++ b/library/Icingadb/Model/Hostgroup.php
@@ -0,0 +1,92 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Model\Behavior\ReRoute;
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class Hostgroup extends Model
+{
+    public function getTableName()
+    {
+        return 'hostgroup';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'environment_id',
+            'name_checksum',
+            'properties_checksum',
+            'name',
+            'name_ci',
+            'display_name',
+            'zone_id'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'environment_id'        => t('Environment Id'),
+            'name_checksum'         => t('Hostgroup Name Checksum'),
+            'properties_checksum'   => t('Hostgroup Properties Checksum'),
+            'name'                  => t('Hostgroup Name'),
+            'name_ci'               => t('Hostgroup Name (CI)'),
+            'display_name'          => t('Hostgroup Display Name'),
+            'zone_id'               => t('Zone Id')
+        ];
+    }
+
+    public function getSearchColumns()
+    {
+        return ['name_ci'];
+    }
+
+    public function getDefaultSort()
+    {
+        return 'display_name';
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new ReRoute([
+            'servicegroup'  => 'service.servicegroup'
+        ]));
+
+        $behaviors->add(new Binary([
+            'id',
+            'environment_id',
+            'name_checksum',
+            'properties_checksum',
+            'zone_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('zone', Zone::class);
+
+        $relations->belongsToMany('customvar', Customvar::class)
+            ->through(HostgroupCustomvar::class);
+        $relations->belongsToMany('customvar_flat', CustomvarFlat::class)
+            ->through(HostgroupCustomvar::class);
+        $relations->belongsToMany('vars', Vars::class)
+            ->through(HostgroupCustomvar::class);
+        $relations->belongsToMany('host', Host::class)
+            ->through(HostgroupMember::class);
+        $relations->belongsToMany('service', Service::class)
+            ->through(HostgroupMember::class);
+    }
+}
diff --git a/library/Icingadb/Model/HostgroupCustomvar.php b/library/Icingadb/Model/HostgroupCustomvar.php
new file mode 100644
index 0000000..41272d1
--- /dev/null
+++ b/library/Icingadb/Model/HostgroupCustomvar.php
@@ -0,0 +1,52 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class HostgroupCustomvar extends Model
+{
+    public function getTableName()
+    {
+        return 'hostgroup_customvar';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'hostgroup_id',
+            'customvar_id',
+            'environment_id'
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'hostgroup_id',
+            'customvar_id',
+            'environment_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('hostgroup', Hostgroup::class);
+        $relations->belongsTo('customvar', Customvar::class);
+        $relations->belongsTo('customvar_flat', CustomvarFlat::class)
+            ->setCandidateKey('customvar_id')
+            ->setForeignKey('customvar_id');
+    }
+}
diff --git a/library/Icingadb/Model/HostgroupMember.php b/library/Icingadb/Model/HostgroupMember.php
new file mode 100644
index 0000000..3660e71
--- /dev/null
+++ b/library/Icingadb/Model/HostgroupMember.php
@@ -0,0 +1,53 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class HostgroupMember extends Model
+{
+    public function getTableName()
+    {
+        return 'hostgroup_member';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'host_id',
+            'hostgroup_id',
+            'environment_id'
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'host_id',
+            'hostgroup_id',
+            'environment_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('hostgroup', Hostgroup::class);
+        $relations->belongsTo('host', Host::class);
+
+        $relations->hasMany('service', Service::class)
+            ->setForeignKey('host_id')
+            ->setCandidateKey('host_id');
+    }
+}
diff --git a/library/Icingadb/Model/Hostgroupsummary.php b/library/Icingadb/Model/Hostgroupsummary.php
new file mode 100644
index 0000000..6e93df5
--- /dev/null
+++ b/library/Icingadb/Model/Hostgroupsummary.php
@@ -0,0 +1,208 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Relations;
+use ipl\Orm\UnionModel;
+use ipl\Sql\Adapter\Pgsql;
+use ipl\Sql\Connection;
+use ipl\Sql\Expression;
+use ipl\Sql\Select;
+
+class Hostgroupsummary extends UnionModel
+{
+    public static function on(Connection $db)
+    {
+        $q = parent::on($db);
+
+        $q->on($q::ON_SELECT_ASSEMBLED, function (Select $select) use ($q) {
+            $model = $q->getModel();
+
+            $groupBy = $q->getResolver()->qualifyColumnsAndAliases((array) $model->getKeyName(), $model, false);
+
+            // For PostgreSQL, ALL non-aggregate SELECT columns must appear in the GROUP BY clause:
+            if ($q->getDb()->getAdapter() instanceof Pgsql) {
+                /**
+                 * Ignore Expressions, i.e. aggregate functions {@see getColumns()},
+                 * which do not need to be added to the GROUP BY.
+                 */
+                $candidates = array_filter($select->getColumns(), 'is_string');
+                // Remove already considered columns for the GROUP BY, i.e. the primary key.
+                $candidates = array_diff_assoc($candidates, $groupBy);
+                $groupBy = array_merge($groupBy, $candidates);
+            }
+
+            $select->groupBy($groupBy);
+        });
+
+        return $q;
+    }
+
+    public function getTableName()
+    {
+        return 'hostgroup';
+    }
+
+    public function getKeyName()
+    {
+        return ['id' => 'hostgroup_id'];
+    }
+
+    public function getColumns()
+    {
+        return [
+            'display_name'                => 'hostgroup_display_name',
+            'hosts_down_handled'          => new Expression(
+                'SUM(CASE WHEN host_state = 1 AND host_handled = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'hosts_down_unhandled'        => new Expression(
+                'SUM(CASE WHEN host_state = 1 AND host_handled = \'n\' THEN 1 ELSE 0 END)'
+            ),
+            'hosts_pending'               => new Expression(
+                'SUM(CASE WHEN host_state = 99 THEN 1 ELSE 0 END)'
+            ),
+            'hosts_total'                 => new Expression(
+                'SUM(CASE WHEN host_id IS NOT NULL THEN 1 ELSE 0 END)'
+            ),
+            'hosts_unreachable'           => new Expression(
+                'SUM(CASE WHEN host_state = 2 THEN 1 ELSE 0 END)'
+            ),
+            'hosts_unreachable_handled'   => new Expression(
+                'SUM(CASE WHEN host_state = 2 AND host_handled = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'hosts_unreachable_unhandled' => new Expression(
+                'SUM(CASE WHEN host_state = 2 AND host_handled = \'n\' THEN 1 ELSE 0 END)'
+            ),
+            'hosts_up'                    => new Expression(
+                'SUM(CASE WHEN host_state = 0 THEN 1 ELSE 0 END)'
+            ),
+            'hosts_severity'              => new Expression('MAX(host_severity)'),
+            'name'                        => 'hostgroup_name',
+            'services_critical_handled'   => new Expression(
+                'SUM(CASE WHEN service_state = 2 AND service_handled = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'services_critical_unhandled' => new Expression(
+                'SUM(CASE WHEN service_state = 2 AND service_handled = \'n\' THEN 1 ELSE 0 END)'
+            ),
+            'services_ok'                 => new Expression(
+                'SUM(CASE WHEN service_state = 0 THEN 1 ELSE 0 END)'
+            ),
+            'services_pending'            => new Expression(
+                'SUM(CASE WHEN service_state = 99 THEN 1 ELSE 0 END)'
+            ),
+            'services_total'              => new Expression(
+                'SUM(CASE WHEN service_id IS NOT NULL THEN 1 ELSE 0 END)'
+            ),
+            'services_unknown_handled'    => new Expression(
+                'SUM(CASE WHEN service_state = 3 AND service_handled = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'services_unknown_unhandled'  => new Expression(
+                'SUM(CASE WHEN service_state = 3 AND service_handled = \'n\' THEN 1 ELSE 0 END)'
+            ),
+            'services_warning_handled'    => new Expression(
+                'SUM(CASE WHEN service_state = 1 AND service_handled = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'services_warning_unhandled'  => new Expression(
+                'SUM(CASE WHEN service_state = 1 AND service_handled = \'n\' THEN 1 ELSE 0 END)'
+            )
+        ];
+    }
+
+    public function getSearchColumns()
+    {
+        return ['display_name'];
+    }
+
+    public function getDefaultSort()
+    {
+        return 'display_name';
+    }
+
+    public function getUnions()
+    {
+        $unions = [
+            [
+                Host::class,
+                [
+                    'hostgroup',
+                    'state'
+                ],
+                [
+                    'hostgroup_id'           => 'hostgroup.id',
+                    'hostgroup_name'         => 'hostgroup.name',
+                    'hostgroup_display_name' => 'hostgroup.display_name',
+                    'host_id'                => 'host.id',
+                    'host_state'             => 'state.soft_state',
+                    'host_handled'           => 'state.is_handled',
+                    'host_severity'          => 'state.severity',
+                    'service_id'             => new Expression('NULL'),
+                    'service_state'          => new Expression('NULL'),
+                    'service_handled'        => new Expression('NULL')
+                ]
+            ],
+            [
+                Service::class,
+                [
+                    'hostgroup',
+                    'state'
+                ],
+                [
+                    'hostgroup_id'           => 'hostgroup.id',
+                    'hostgroup_name'         => 'hostgroup.name',
+                    'hostgroup_display_name' => 'hostgroup.display_name',
+                    'host_id'                => new Expression('NULL'),
+                    'host_state'             => new Expression('NULL'),
+                    'host_handled'           => new Expression('NULL'),
+                    'host_severity'          => new Expression('0'),
+                    'service_id'             => 'service.id',
+                    'service_state'          => 'state.soft_state',
+                    'service_handled'        => 'state.is_handled'
+                ]
+            ],
+            [
+                Hostgroup::class,
+                [],
+                [
+                    'hostgroup_id'           => 'hostgroup.id',
+                    'hostgroup_name'         => 'hostgroup.name',
+                    'hostgroup_display_name' => 'hostgroup.display_name',
+                    'host_id'                => new Expression('NULL'),
+                    'host_state'             => new Expression('NULL'),
+                    'host_handled'           => new Expression('NULL'),
+                    'host_severity'          => new Expression('0'),
+                    'service_id'             => new Expression('NULL'),
+                    'service_state'          => new Expression('NULL'),
+                    'service_handled'        => new Expression('NULL')
+                ]
+            ]
+        ];
+
+        return $unions;
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id'
+        ]));
+
+        // This is because there is no better way
+        (new Hostgroup())->createBehaviors($behaviors);
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        // This is because there is no better way
+        (new Hostgroup())->createRelations($relations);
+    }
+
+    public function getColumnDefinitions()
+    {
+        // This is because there is no better way
+        return (new Hostgroup())->getColumnDefinitions();
+    }
+}
diff --git a/library/Icingadb/Model/HoststateSummary.php b/library/Icingadb/Model/HoststateSummary.php
new file mode 100644
index 0000000..e437c19
--- /dev/null
+++ b/library/Icingadb/Model/HoststateSummary.php
@@ -0,0 +1,89 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Sql\Connection;
+use ipl\Sql\Expression;
+
+class HoststateSummary extends Host
+{
+    public function getSummaryColumns()
+    {
+        return [
+            'hosts_acknowledged' => new Expression(
+                'SUM(CASE WHEN host_state.is_acknowledged = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'hosts_active_checks_enabled' => new Expression(
+                'SUM(CASE WHEN host.active_checks_enabled = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'hosts_passive_checks_enabled' => new Expression(
+                'SUM(CASE WHEN host.passive_checks_enabled = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'hosts_down_handled' => new Expression(
+                'SUM(CASE WHEN host_state.soft_state = 1'
+                . ' AND host_state.is_handled = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'hosts_down_unhandled' => new Expression(
+                'SUM(CASE WHEN host_state.soft_state = 1'
+                . ' AND host_state.is_handled = \'n\' THEN 1 ELSE 0 END)'
+            ),
+            'hosts_event_handler_enabled' => new Expression(
+                'SUM(CASE WHEN host.event_handler_enabled = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'hosts_flapping_enabled' => new Expression(
+                'SUM(CASE WHEN host.flapping_enabled = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'hosts_notifications_enabled' => new Expression(
+                'SUM(CASE WHEN host.notifications_enabled = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'hosts_pending' => new Expression(
+                'SUM(CASE WHEN host_state.soft_state = 99 THEN 1 ELSE 0 END)'
+            ),
+            'hosts_problems_unacknowledged' => new Expression(
+                'SUM(CASE WHEN host_state.is_problem = \'y\''
+                . ' AND host_state.is_acknowledged = \'n\' THEN 1 ELSE 0 END)'
+            ),
+            'hosts_total' => new Expression(
+                'SUM(CASE WHEN host.id IS NOT NULL THEN 1 ELSE 0 END)'
+            ),
+            'hosts_unreachable' => new Expression(
+                'SUM(CASE WHEN host_state.soft_state = 2 THEN 1 ELSE 0 END)'
+            ),
+            'hosts_unreachable_handled' => new Expression(
+                'SUM(CASE WHEN host_state.soft_state = 2'
+                . ' AND host_state.is_handled = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'hosts_unreachable_unhandled' => new Expression(
+                'SUM(CASE WHEN host_state.soft_state = 2'
+                . ' AND host_state.is_handled = \'n\' THEN 1 ELSE 0 END)'
+            ),
+            'hosts_up' => new Expression(
+                'SUM(CASE WHEN host_state.soft_state = 0 THEN 1 ELSE 0 END)'
+            )
+        ];
+    }
+
+    public static function on(Connection $db)
+    {
+        $q = parent::on($db);
+        $q->utilize('state');
+
+        /** @var static $m */
+        $m = $q->getModel();
+        $q->columns($m->getSummaryColumns());
+
+        return $q;
+    }
+
+    public function getColumns()
+    {
+        return array_merge(parent::getColumns(), $this->getSummaryColumns());
+    }
+
+    public function getDefaultSort()
+    {
+        return null;
+    }
+}
diff --git a/library/Icingadb/Model/IconImage.php b/library/Icingadb/Model/IconImage.php
new file mode 100644
index 0000000..212234a
--- /dev/null
+++ b/library/Icingadb/Model/IconImage.php
@@ -0,0 +1,55 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class IconImage extends Model
+{
+    public function getTableName()
+    {
+        return 'icon_image';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'icon_image',
+            'environment_id'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'icon_image'        => t('Icon Image'),
+            'environment_id'    => t('Environment Id')
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'environment_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+
+        $relations->hasMany('host', Host::class);
+        $relations->hasMany('service', Service::class);
+    }
+}
diff --git a/library/Icingadb/Model/Instance.php b/library/Icingadb/Model/Instance.php
new file mode 100644
index 0000000..23826d0
--- /dev/null
+++ b/library/Icingadb/Model/Instance.php
@@ -0,0 +1,78 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Model\Behavior\BoolCast;
+use Icinga\Module\Icingadb\Model\Behavior\Timestamp;
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class Instance extends Model
+{
+    public function getTableName()
+    {
+        return 'icingadb_instance';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'environment_id',
+            'endpoint_id',
+            'heartbeat',
+            'responsible',
+            'icinga2_active_host_checks_enabled',
+            'icinga2_active_service_checks_enabled',
+            'icinga2_event_handlers_enabled',
+            'icinga2_flap_detection_enabled',
+            'icinga2_notifications_enabled',
+            'icinga2_performance_data_enabled',
+            'icinga2_start_time',
+            'icinga2_version'
+        ];
+    }
+
+    public function getDefaultSort()
+    {
+        return ['responsible desc', 'heartbeat desc'];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Timestamp([
+            'heartbeat',
+            'icinga2_start_time'
+        ]));
+
+        $behaviors->add(new BoolCast([
+            'responsible',
+            'icinga2_active_host_checks_enabled',
+            'icinga2_active_service_checks_enabled',
+            'icinga2_event_handlers_enabled',
+            'icinga2_flap_detection_enabled',
+            'icinga2_notifications_enabled',
+            'icinga2_performance_data_enabled'
+        ]));
+
+        $behaviors->add(new Binary([
+            'id',
+            'environment_id',
+            'endpoint_id',
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('endpoint', Endpoint::class)->setJoinType('LEFT');
+    }
+}
diff --git a/library/Icingadb/Model/NotesUrl.php b/library/Icingadb/Model/NotesUrl.php
new file mode 100644
index 0000000..5865c52
--- /dev/null
+++ b/library/Icingadb/Model/NotesUrl.php
@@ -0,0 +1,62 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Model\Behavior\ActionAndNoteUrl;
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class NotesUrl extends Model
+{
+    public function getTableName()
+    {
+        return 'notes_url';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'notes_url',
+            'environment_id'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'notes_url'         => t('Notes Url'),
+            'environment_id'    => t('Environment Id')
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new ActionAndNoteUrl(['notes_url']));
+
+        $behaviors->add(new Binary([
+            'id',
+            'environment_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+
+        $relations->hasMany('host', Host::class)
+            ->setCandidateKey('id')
+            ->setForeignKey('notes_url_id');
+        $relations->hasMany('service', Service::class)
+            ->setCandidateKey('id')
+            ->setForeignKey('notes_url_id');
+    }
+}
diff --git a/library/Icingadb/Model/Notification.php b/library/Icingadb/Model/Notification.php
new file mode 100644
index 0000000..8d42301
--- /dev/null
+++ b/library/Icingadb/Model/Notification.php
@@ -0,0 +1,130 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Model\Behavior\Bitmask;
+use Icinga\Module\Icingadb\Model\Behavior\ReRoute;
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class Notification extends Model
+{
+    public function getTableName()
+    {
+        return 'notification';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'environment_id',
+            'name_checksum',
+            'properties_checksum',
+            'name',
+            'name_ci',
+            'host_id',
+            'service_id',
+            'notificationcommand_id',
+            'times_begin',
+            'times_end',
+            'notification_interval',
+            'timeperiod_id',
+            'states',
+            'types',
+            'zone_id'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'environment_id'         => t('Environment Id'),
+            'name_checksum'          => t('Notification Name Checksum'),
+            'properties_checksum'    => t('Notification Properties Checksum'),
+            'name'                   => t('Notification Name'),
+            'name_ci'                => t('Notification Name (CI)'),
+            'host_id'                => t('Host Id'),
+            'service_id'             => t('Service Id'),
+            'notificationcommand_id' => t('Notificationcommand Id'),
+            'times_begin'            => t('Notification Escalate After'),
+            'times_end'              => t('Notification Escalate Until'),
+            'notification_interval'  => t('Notification Interval'),
+            'timeperiod_id'          => t('Timeperiod Id'),
+            'states'                 => t('Notification State Filter'),
+            'types'                  => t('Notification Type Filter'),
+            'zone_id'                => t('Zone Id')
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new ReRoute([
+            'hostgroup'     => 'host.hostgroup',
+            'servicegroup'  => 'service.servicegroup'
+        ]));
+
+        $behaviors->add(new Bitmask([
+            'states' => [
+                'ok'        => 1,
+                'warning'   => 2,
+                'critical'  => 4,
+                'unknown'   => 8,
+                'up'        => 16,
+                'down'      => 32
+            ],
+            'types' => [
+                'downtime_start'    => 1,
+                'downtime_end'      => 2,
+                'downtime_removed'  => 4,
+                'custom'            => 8,
+                'ack'               => 16,
+                'problem'           => 32,
+                'recovery'          => 64,
+                'flapping_start'    => 128,
+                'flapping_end'      => 256
+            ]
+        ]));
+
+        $behaviors->add(new Binary([
+            'id',
+            'environment_id',
+            'name_checksum',
+            'properties_checksum',
+            'host_id',
+            'service_id',
+            'notificationcommand_id',
+            'timeperiod_id',
+            'zone_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('host', Host::class);
+        $relations->belongsTo('service', Service::class);
+        $relations->belongsTo('notificationcommand', Notificationcommand::class);
+        $relations->belongsTo('timeperiod', Timeperiod::class);
+        $relations->belongsTo('zone', Zone::class);
+
+        $relations->belongsToMany('customvar', Customvar::class)
+            ->through(NotificationCustomvar::class);
+        $relations->belongsToMany('customvar_flat', CustomvarFlat::class)
+            ->through(NotificationCustomvar::class);
+        $relations->belongsToMany('vars', Vars::class)
+            ->through(NotificationCustomvar::class);
+        $relations->belongsToMany('user', User::class)
+            ->through('notification_recipient');
+        $relations->belongsToMany('usergroup', Usergroup::class)
+            ->through('notification_recipient');
+    }
+}
diff --git a/library/Icingadb/Model/NotificationCustomvar.php b/library/Icingadb/Model/NotificationCustomvar.php
new file mode 100644
index 0000000..620ae5c
--- /dev/null
+++ b/library/Icingadb/Model/NotificationCustomvar.php
@@ -0,0 +1,52 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class NotificationCustomvar extends Model
+{
+    public function getTableName()
+    {
+        return 'notification_customvar';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'notification_id',
+            'customvar_id',
+            'environment_id'
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'notification_id',
+            'customvar_id',
+            'environment_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('notification', Notification::class);
+        $relations->belongsTo('customvar', Customvar::class);
+        $relations->belongsTo('customvar_flat', CustomvarFlat::class)
+            ->setCandidateKey('customvar_id')
+            ->setForeignKey('customvar_id');
+    }
+}
diff --git a/library/Icingadb/Model/NotificationHistory.php b/library/Icingadb/Model/NotificationHistory.php
new file mode 100644
index 0000000..de7b493
--- /dev/null
+++ b/library/Icingadb/Model/NotificationHistory.php
@@ -0,0 +1,114 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Model\Behavior\ReRoute;
+use Icinga\Module\Icingadb\Model\Behavior\Timestamp;
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+/**
+ * Model for table `notification_history`
+ *
+ * Please note that using this model will fetch history entries for decommissioned services. To avoid this, the
+ * query needs a `notification_history.service_id IS NULL OR notification_history_service.id IS NOT NULL` where.
+ */
+class NotificationHistory extends Model
+{
+    public function getTableName()
+    {
+        return 'notification_history';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'environment_id',
+            'endpoint_id',
+            'object_type',
+            'host_id',
+            'service_id',
+            'notification_id',
+            'type',
+            'send_time',
+            'state',
+            'previous_hard_state',
+            'author',
+            'text',
+            'users_notified'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'id'                    => t('History Id'),
+            'environment_id'        => t('Environment Id'),
+            'endpoint_id'           => t('Endpoint Id'),
+            'object_type'           => t('Object Type'),
+            'host_id'               => t('Host Id'),
+            'service_id'            => t('Service Id'),
+            'notification_id'       => t('Notification Id'),
+            'type'                  => t('Notification Type'),
+            'send_time'             => t('Notification Sent On'),
+            'state'                 => t('Hard State'),
+            'previous_hard_state'   => t('Previous Hard State'),
+            'author'                => t('Notification Author'),
+            'text'                  => t('Notification Text'),
+            'users_notified'        => t('Users Notified')
+        ];
+    }
+
+    public function getSearchColumns()
+    {
+        return ['text'];
+    }
+
+    public function getDefaultSort()
+    {
+        return 'notification_history.send_time desc';
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Timestamp([
+            'send_time'
+        ]));
+
+        $behaviors->add(new Binary([
+            'id',
+            'environment_id',
+            'endpoint_id',
+            'host_id',
+            'service_id',
+            'notification_id'
+        ]));
+
+        $behaviors->add(new ReRoute([
+            'hostgroup'     => 'host.hostgroup',
+            'servicegroup'  => 'service.servicegroup'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('history', History::class)
+            ->setCandidateKey('id')
+            ->setForeignKey('notification_history_id');
+        $relations->belongsTo('host', Host::class);
+        $relations->belongsTo('service', Service::class)->setJoinType('LEFT');
+
+        $relations->belongsToMany('user', User::class)
+            ->through('user_notification_history');
+    }
+}
diff --git a/library/Icingadb/Model/NotificationUser.php b/library/Icingadb/Model/NotificationUser.php
new file mode 100644
index 0000000..ab23ad4
--- /dev/null
+++ b/library/Icingadb/Model/NotificationUser.php
@@ -0,0 +1,49 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class NotificationUser extends Model
+{
+    public function getTableName()
+    {
+        return 'notification_user';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'notification_id',
+            'user_id',
+            'environment_id'
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'notification_id',
+            'user_id',
+            'environment_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('notification', Notification::class);
+        $relations->belongsTo('user', User::class);
+    }
+}
diff --git a/library/Icingadb/Model/NotificationUsergroup.php b/library/Icingadb/Model/NotificationUsergroup.php
new file mode 100644
index 0000000..bd60fae
--- /dev/null
+++ b/library/Icingadb/Model/NotificationUsergroup.php
@@ -0,0 +1,49 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class NotificationUsergroup extends Model
+{
+    public function getTableName()
+    {
+        return 'notification_usergroup';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'notification_id',
+            'usergroup_id',
+            'environment_id'
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'notification_id',
+            'usergroup_id',
+            'environment_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('notification', Notification::class);
+        $relations->belongsTo('usergroup', Usergroup::class);
+    }
+}
diff --git a/library/Icingadb/Model/Notificationcommand.php b/library/Icingadb/Model/Notificationcommand.php
new file mode 100644
index 0000000..6ee2a21
--- /dev/null
+++ b/library/Icingadb/Model/Notificationcommand.php
@@ -0,0 +1,87 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Model\Behavior\ReRoute;
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class Notificationcommand extends Model
+{
+    public function getTableName()
+    {
+        return 'notificationcommand';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'zone_id',
+            'environment_id',
+            'name_checksum',
+            'properties_checksum',
+            'name',
+            'name_ci',
+            'command',
+            'timeout'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'zone_id'               => t('Zone Id'),
+            'environment_id'        => t('Environment Id'),
+            'name_checksum'         => t('Notificationcommand Name Checksum'),
+            'properties_checksum'   => t('Notificationcommand Properties Checksum'),
+            'name'                  => t('Notificationcommand Name'),
+            'name_ci'               => t('Notificationcommand Name (CI)'),
+            'command'               => t('Notificationcommand'),
+            'timeout'               => t('Notificationcommand Timeout')
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new ReRoute([
+            'host'          => 'notification.host',
+            'hostgroup'     => 'notification.host.hostgroup',
+            'service'       => 'notification.service',
+            'servicegroup'  => 'notification.service.servicegroup'
+        ]));
+
+        $behaviors->add(new Binary([
+            'id',
+            'zone_id',
+            'environment_id',
+            'name_checksum',
+            'properties_checksum'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('zone', Zone::class);
+
+        $relations->belongsToMany('customvar', Customvar::class)
+            ->through(NotificationcommandCustomvar::class);
+        $relations->belongsToMany('customvar_flat', CustomvarFlat::class)
+            ->through(NotificationcommandCustomvar::class);
+        $relations->belongsToMany('vars', Vars::class)
+            ->through(NotificationcommandCustomvar::class);
+
+        $relations->hasMany('notification', Notification::class);
+        $relations->hasMany('argument', NotificationcommandArgument::class);
+        $relations->hasMany('envvar', NotificationcommandEnvvar::class);
+    }
+}
diff --git a/library/Icingadb/Model/NotificationcommandArgument.php b/library/Icingadb/Model/NotificationcommandArgument.php
new file mode 100644
index 0000000..e855022
--- /dev/null
+++ b/library/Icingadb/Model/NotificationcommandArgument.php
@@ -0,0 +1,75 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class NotificationcommandArgument extends Model
+{
+    public function getTableName()
+    {
+        return 'notificationcommand_argument';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'notificationcommand_id',
+            'argument_key',
+            'environment_id',
+            'properties_checksum',
+            'argument_value',
+            'argument_order',
+            'description',
+            'argument_key_override',
+            'repeat_key',
+            'required',
+            'set_if',
+            'skip_key'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'notificationcommand_id' => t('Notificationcommand Id'),
+            'argument_key'           => t('Notificationcommand Argument Name'),
+            'environment_id'         => t('Environment Id'),
+            'properties_checksum'    => t('Notificationcommand Argument Properties Checksum'),
+            'argument_value'         => t('Notificationcommand Argument Value'),
+            'argument_order'         => t('Notificationcommand Argument Position'),
+            'description'            => t('Notificationcommand Argument Description'),
+            'argument_key_override'  => t('Notificationcommand Argument Actual Name'),
+            'repeat_key'             => t('Notificationcommand Argument Repeated'),
+            'required'               => t('Notificationcommand Argument Required'),
+            'set_if'                 => t('Notificationcommand Argument Condition'),
+            'skip_key'               => t('Notificationcommand Argument Without Name')
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'notificationcommand_id',
+            'environment_id',
+            'properties_checksum'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('notificationcommand', Notificationcommand::class);
+    }
+}
diff --git a/library/Icingadb/Model/NotificationcommandCustomvar.php b/library/Icingadb/Model/NotificationcommandCustomvar.php
new file mode 100644
index 0000000..bd103f7
--- /dev/null
+++ b/library/Icingadb/Model/NotificationcommandCustomvar.php
@@ -0,0 +1,52 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class NotificationcommandCustomvar extends Model
+{
+    public function getTableName()
+    {
+        return 'notificationcommand_customvar';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'notificationcommand_id',
+            'customvar_id',
+            'environment_id'
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'notificationcommand_id',
+            'customvar_id',
+            'environment_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('notificationcommand', Notificationcommand::class);
+        $relations->belongsTo('customvar', Customvar::class);
+        $relations->belongsTo('customvar_flat', CustomvarFlat::class)
+            ->setCandidateKey('customvar_id')
+            ->setForeignKey('customvar_id');
+    }
+}
diff --git a/library/Icingadb/Model/NotificationcommandEnvvar.php b/library/Icingadb/Model/NotificationcommandEnvvar.php
new file mode 100644
index 0000000..09f77b0
--- /dev/null
+++ b/library/Icingadb/Model/NotificationcommandEnvvar.php
@@ -0,0 +1,61 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class NotificationcommandEnvvar extends Model
+{
+    public function getTableName()
+    {
+        return 'notificationcommand_envvar';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'notificationcommand_id',
+            'envvar_key',
+            'environment_id',
+            'properties_checksum',
+            'envvar_value'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'notificationcommand_id' => t('Notificationcommand Id'),
+            'envvar_key'             => t('Notificationcommand Envvar Key'),
+            'environment_id'         => t('Environment Id'),
+            'properties_checksum'    => t('Notificationcommand Envvar Properties Checksum'),
+            'envvar_value'           => t('Notificationcommand Envvar Value')
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'notificationcommand_id',
+            'environment_id',
+            'properties_checksum',
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('notificationcommand', Notificationcommand::class);
+    }
+}
diff --git a/library/Icingadb/Model/Service.php b/library/Icingadb/Model/Service.php
new file mode 100644
index 0000000..74eda0e
--- /dev/null
+++ b/library/Icingadb/Model/Service.php
@@ -0,0 +1,224 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Common\Auth;
+use Icinga\Module\Icingadb\Model\Behavior\BoolCast;
+use Icinga\Module\Icingadb\Model\Behavior\ReRoute;
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Defaults;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+use ipl\Orm\ResultSet;
+
+class Service extends Model
+{
+    use Auth;
+
+    public function getTableName()
+    {
+        return 'service';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'environment_id',
+            'name_checksum',
+            'properties_checksum',
+            'host_id',
+            'name',
+            'name_ci',
+            'display_name',
+            'checkcommand_name',
+            'checkcommand_id',
+            'max_check_attempts',
+            'check_timeperiod_name',
+            'check_timeperiod_id',
+            'check_timeout',
+            'check_interval',
+            'check_retry_interval',
+            'active_checks_enabled',
+            'passive_checks_enabled',
+            'event_handler_enabled',
+            'notifications_enabled',
+            'flapping_enabled',
+            'flapping_threshold_low',
+            'flapping_threshold_high',
+            'perfdata_enabled',
+            'eventcommand_name',
+            'eventcommand_id',
+            'is_volatile',
+            'action_url_id',
+            'notes_url_id',
+            'notes',
+            'icon_image_id',
+            'icon_image_alt',
+            'zone_name',
+            'zone_id',
+            'command_endpoint_name',
+            'command_endpoint_id'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'environment_id'            => t('Environment Id'),
+            'name_checksum'             => t('Service Name Checksum'),
+            'properties_checksum'       => t('Service Properties Checksum'),
+            'host_id'                   => t('Host Id'),
+            'name'                      => t('Service Name'),
+            'name_ci'                   => t('Service Name (CI)'),
+            'display_name'              => t('Service Display Name'),
+            'checkcommand_name'         => t('Checkcommand Name'),
+            'checkcommand_id'           => t('Checkcommand Id'),
+            'max_check_attempts'        => t('Service Max Check Attempts'),
+            'check_timeperiod_name'     => t('Check Timeperiod Name'),
+            'check_timeperiod_id'       => t('Check Timeperiod Id'),
+            'check_timeout'             => t('Service Check Timeout'),
+            'check_interval'            => t('Service Check Interval'),
+            'check_retry_interval'      => t('Service Check Retry Inverval'),
+            'active_checks_enabled'     => t('Service Active Checks Enabled'),
+            'passive_checks_enabled'    => t('Service Passive Checks Enabled'),
+            'event_handler_enabled'     => t('Service Event Handler Enabled'),
+            'notifications_enabled'     => t('Service Notifications Enabled'),
+            'flapping_enabled'          => t('Service Flapping Enabled'),
+            'flapping_threshold_low'    => t('Service Flapping Threshold Low'),
+            'flapping_threshold_high'   => t('Service Flapping Threshold High'),
+            'perfdata_enabled'          => t('Service Performance Data Enabled'),
+            'eventcommand_name'         => t('Eventcommand Name'),
+            'eventcommand_id'           => t('Eventcommand Id'),
+            'is_volatile'               => t('Service Is Volatile'),
+            'action_url_id'             => t('Action Url Id'),
+            'notes_url_id'              => t('Notes Url Id'),
+            'notes'                     => t('Service Notes'),
+            'icon_image_id'             => t('Icon Image Id'),
+            'icon_image_alt'            => t('Icon Image Alt'),
+            'zone_name'                 => t('Zone Name'),
+            'zone_id'                   => t('Zone Id'),
+            'command_endpoint_name'     => t('Endpoint Name'),
+            'command_endpoint_id'       => t('Endpoint Id')
+        ];
+    }
+
+    public function getSearchColumns()
+    {
+        return ['name_ci'];
+    }
+
+    public function getDefaultSort()
+    {
+        return 'service.display_name';
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new BoolCast([
+            'active_checks_enabled',
+            'passive_checks_enabled',
+            'event_handler_enabled',
+            'notifications_enabled',
+            'flapping_enabled',
+            'is_volatile'
+        ]));
+
+        $behaviors->add(new ReRoute([
+            'user'          => 'notification.user',
+            'usergroup'     => 'notification.usergroup'
+        ]));
+
+        $behaviors->add(new Binary([
+            'id',
+            'environment_id',
+            'name_checksum',
+            'properties_checksum',
+            'host_id',
+            'checkcommand_id',
+            'check_timeperiod_id',
+            'eventcommand_id',
+            'action_url_id',
+            'notes_url_id',
+            'icon_image_id',
+            'zone_id',
+            'command_endpoint_id'
+        ]));
+    }
+
+    public function createDefaults(Defaults $defaults)
+    {
+        $defaults->add('vars', function (self $subject) {
+            if (! $subject->customvar_flat instanceof ResultSet) {
+                $this->applyRestrictions($subject->customvar_flat);
+            }
+
+            $vars = [];
+            foreach ($subject->customvar_flat as $customVar) {
+                $vars[$customVar->flatname] = $customVar->flatvalue;
+            }
+
+            return $vars;
+        });
+
+        $defaults->add('customvars', function (self $subject) {
+            if (! $subject->customvar instanceof ResultSet) {
+                $this->applyRestrictions($subject->customvar);
+            }
+
+            $vars = [];
+            foreach ($subject->customvar as $customVar) {
+                $vars[$customVar->name] = json_decode($customVar->value, true);
+            }
+
+            return $vars;
+        });
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('host', Host::class)->setJoinType('LEFT');
+        $relations->belongsTo('checkcommand', Checkcommand::class);
+        $relations->belongsTo('timeperiod', Timeperiod::class)
+            ->setCandidateKey('check_timeperiod_id');
+        $relations->belongsTo('eventcommand', Eventcommand::class);
+        $relations->belongsTo('action_url', ActionUrl::class)
+            ->setCandidateKey('action_url_id')
+            ->setForeignKey('id');
+        $relations->belongsTo('notes_url', NotesUrl::class)
+            ->setCandidateKey('notes_url_id')
+            ->setForeignKey('id');
+        $relations->belongsTo('icon_image', IconImage::class)
+            ->setCandidateKey('icon_image_id')
+            ->setJoinType('LEFT');
+        $relations->belongsTo('zone', Zone::class);
+        $relations->belongsTo('endpoint', Endpoint::class)
+            ->setCandidateKey('command_endpoint_id');
+
+        $relations->belongsToMany('customvar', Customvar::class)
+            ->through(ServiceCustomvar::class);
+        $relations->belongsToMany('customvar_flat', CustomvarFlat::class)
+            ->through(ServiceCustomvar::class);
+        $relations->belongsToMany('vars', Vars::class)
+            ->through(ServiceCustomvar::class);
+        $relations->belongsToMany('servicegroup', Servicegroup::class)
+            ->through(ServicegroupMember::class);
+        $relations->belongsToMany('hostgroup', Hostgroup::class)
+            ->through(HostgroupMember::class);
+
+        $relations->hasOne('state', ServiceState::class)->setJoinType('LEFT');
+        $relations->hasMany('comment', Comment::class)->setJoinType('LEFT');
+        $relations->hasMany('downtime', Downtime::class)->setJoinType('LEFT');
+        $relations->hasMany('history', History::class);
+        $relations->hasMany('notification', Notification::class)->setJoinType('LEFT');
+        $relations->hasMany('notification_history', NotificationHistory::class);
+    }
+}
diff --git a/library/Icingadb/Model/ServiceCustomvar.php b/library/Icingadb/Model/ServiceCustomvar.php
new file mode 100644
index 0000000..07ee84c
--- /dev/null
+++ b/library/Icingadb/Model/ServiceCustomvar.php
@@ -0,0 +1,52 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class ServiceCustomvar extends Model
+{
+    public function getTableName()
+    {
+        return 'service_customvar';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'service_id',
+            'customvar_id',
+            'environment_id'
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'service_id',
+            'customvar_id',
+            'environment_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('service', Service::class);
+        $relations->belongsTo('customvar', Customvar::class);
+        $relations->belongsTo('customvar_flat', CustomvarFlat::class)
+            ->setForeignKey('customvar_id')
+            ->setCandidateKey('customvar_id');
+    }
+}
diff --git a/library/Icingadb/Model/ServiceState.php b/library/Icingadb/Model/ServiceState.php
new file mode 100644
index 0000000..9de2a21
--- /dev/null
+++ b/library/Icingadb/Model/ServiceState.php
@@ -0,0 +1,86 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Common\ServiceStates;
+use ipl\Orm\Relations;
+
+class ServiceState extends State
+{
+    public function getTableName()
+    {
+        return 'service_state';
+    }
+
+    public function getKeyName()
+    {
+        return 'service_id';
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'environment_id'                => t('Environment Id'),
+            'state_type'                    => t('Service State Type'),
+            'soft_state'                    => t('Service Soft State'),
+            'hard_state'                    => t('Service Hard State'),
+            'previous_soft_state'           => t('Service Previous Soft State'),
+            'previous_hard_state'           => t('Service Previous Hard State'),
+            'check_attempt'                 => t('Service Check Attempt No.'),
+            'severity'                      => t('Service State Severity'),
+            'output'                        => t('Service Output'),
+            'long_output'                   => t('Service Long Output'),
+            'performance_data'              => t('Service Performance Data'),
+            'normalized_performance_data'   => t('Service Normalized Performance Data'),
+            'check_commandline'             => t('Service Check Commandline'),
+            'is_problem'                    => t('Service Has Problem'),
+            'is_handled'                    => t('Service Is Handled'),
+            'is_reachable'                  => t('Service Is Reachable'),
+            'is_flapping'                   => t('Service Is Flapping'),
+            'is_overdue'                    => t('Service Check Is Overdue'),
+            'is_acknowledged'               => t('Service Is Acknowledged'),
+            'acknowledgement_comment_id'    => t('Acknowledgement Comment Id'),
+            'in_downtime'                   => t('Service In Downtime'),
+            'execution_time'                => t('Service Check Execution Time'),
+            'latency'                       => t('Service Check Latency'),
+            'check_timeout'                 => t('Service Check Timeout'),
+            'check_source'                  => t('Service Check Source'),
+            'last_update'                   => t('Service Last Update'),
+            'last_state_change'             => t('Service Last State Change'),
+            'next_check'                    => t('Service Next Check'),
+            'next_update'                   => t('Service Next Update')
+        ];
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('service', Service::class);
+        $relations->hasOne('last_comment', Comment::class)
+            ->setCandidateKey('last_comment_id')
+            ->setForeignKey('id')
+            ->setJoinType('LEFT');
+    }
+
+    /**
+     * Get the host state as the textual representation
+     *
+     * @return string
+     */
+    public function getStateText(): string
+    {
+        return ServiceStates::text($this->soft_state);
+    }
+
+    /**
+     * Get the host state as the translated textual representation
+     *
+     * @return string
+     */
+    public function getStateTextTranslated(): string
+    {
+        return ServiceStates::text($this->soft_state);
+    }
+}
diff --git a/library/Icingadb/Model/Servicegroup.php b/library/Icingadb/Model/Servicegroup.php
new file mode 100644
index 0000000..34f67bd
--- /dev/null
+++ b/library/Icingadb/Model/Servicegroup.php
@@ -0,0 +1,91 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Model\Behavior\ReRoute;
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class Servicegroup extends Model
+{
+    public function getTableName()
+    {
+        return 'servicegroup';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'environment_id',
+            'name_checksum',
+            'properties_checksum',
+            'name',
+            'name_ci',
+            'display_name',
+            'zone_id'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'environment_id'        => t('Environment Id'),
+            'name_checksum'         => t('Servicegroup Name Checksum'),
+            'properties_checksum'   => t('Servicegroup Properties Checksum'),
+            'name'                  => t('Servicegroup Name'),
+            'name_ci'               => t('Servicegroup Name (CI)'),
+            'display_name'          => t('Servicegroup Display Name'),
+            'zone_id'               => t('Zone Id')
+        ];
+    }
+
+    public function getSearchColumns()
+    {
+        return ['name_ci'];
+    }
+
+    public function getDefaultSort()
+    {
+        return 'display_name';
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new ReRoute([
+            'host'      => 'service.host',
+            'hostgroup' => 'service.hostgroup'
+        ]));
+
+        $behaviors->add(new Binary([
+            'id',
+            'environment_id',
+            'name_checksum',
+            'properties_checksum',
+            'zone_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('zone', Zone::class);
+
+        $relations->belongsToMany('customvar', Customvar::class)
+            ->through(ServicegroupCustomvar::class);
+        $relations->belongsToMany('customvar_flat', CustomvarFlat::class)
+            ->through(ServicegroupCustomvar::class);
+        $relations->belongsToMany('vars', Vars::class)
+            ->through(ServicegroupCustomvar::class);
+        $relations->belongsToMany('service', Service::class)
+            ->through(ServicegroupMember::class);
+    }
+}
diff --git a/library/Icingadb/Model/ServicegroupCustomvar.php b/library/Icingadb/Model/ServicegroupCustomvar.php
new file mode 100644
index 0000000..23e536b
--- /dev/null
+++ b/library/Icingadb/Model/ServicegroupCustomvar.php
@@ -0,0 +1,52 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class ServicegroupCustomvar extends Model
+{
+    public function getTableName()
+    {
+        return 'servicegroup_customvar';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'servicegroup_id',
+            'customvar_id',
+            'environment_id'
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'servicegroup_id',
+            'customvar_id',
+            'environment_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('servicegroup', Servicegroup::class);
+        $relations->belongsTo('customvar', Customvar::class);
+        $relations->belongsTo('customvar_flat', CustomvarFlat::class)
+            ->setCandidateKey('customvar_id')
+            ->setForeignKey('customvar_id');
+    }
+}
diff --git a/library/Icingadb/Model/ServicegroupMember.php b/library/Icingadb/Model/ServicegroupMember.php
new file mode 100644
index 0000000..5da537a
--- /dev/null
+++ b/library/Icingadb/Model/ServicegroupMember.php
@@ -0,0 +1,49 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class ServicegroupMember extends Model
+{
+    public function getTableName()
+    {
+        return 'servicegroup_member';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'service_id',
+            'servicegroup_id',
+            'environment_id'
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'service_id',
+            'servicegroup_id',
+            'environment_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('servicegroup', Servicegroup::class);
+        $relations->belongsTo('service', Service::class);
+    }
+}
diff --git a/library/Icingadb/Model/ServicegroupSummary.php b/library/Icingadb/Model/ServicegroupSummary.php
new file mode 100644
index 0000000..b43de09
--- /dev/null
+++ b/library/Icingadb/Model/ServicegroupSummary.php
@@ -0,0 +1,159 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Relations;
+use ipl\Orm\UnionModel;
+use ipl\Sql\Adapter\Pgsql;
+use ipl\Sql\Connection;
+use ipl\Sql\Expression;
+use ipl\Sql\Select;
+
+class ServicegroupSummary extends UnionModel
+{
+    public static function on(Connection $db)
+    {
+        $q = parent::on($db);
+
+        $q->on($q::ON_SELECT_ASSEMBLED, function (Select $select) use ($q) {
+            $model = $q->getModel();
+
+            $groupBy = $q->getResolver()->qualifyColumnsAndAliases((array) $model->getKeyName(), $model, false);
+
+            // For PostgreSQL, ALL non-aggregate SELECT columns must appear in the GROUP BY clause:
+            if ($q->getDb()->getAdapter() instanceof Pgsql) {
+                /**
+                 * Ignore Expressions, i.e. aggregate functions {@see getColumns()},
+                 * which do not need to be added to the GROUP BY.
+                 */
+                $candidates = array_filter($select->getColumns(), 'is_string');
+                // Remove already considered columns for the GROUP BY, i.e. the primary key.
+                $candidates = array_diff_assoc($candidates, $groupBy);
+                $groupBy = array_merge($groupBy, $candidates);
+            }
+
+            $select->groupBy($groupBy);
+        });
+
+        return $q;
+    }
+
+    public function getTableName()
+    {
+        return 'servicegroup';
+    }
+
+    public function getKeyName()
+    {
+        return ['id' => 'servicegroup_id'];
+    }
+
+    public function getColumns()
+    {
+        return [
+            'display_name'                => 'servicegroup_display_name',
+            'name'                        => 'servicegroup_name',
+            'services_critical_handled'   => new Expression(
+                'SUM(CASE WHEN service_state = 2 AND service_handled = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'services_critical_unhandled' => new Expression(
+                'SUM(CASE WHEN service_state = 2 AND service_handled = \'n\' THEN 1 ELSE 0 END)'
+            ),
+            'services_ok'                 => new Expression(
+                'SUM(CASE WHEN service_state = 0 THEN 1 ELSE 0 END)'
+            ),
+            'services_pending'            => new Expression(
+                'SUM(CASE WHEN service_state = 99 THEN 1 ELSE 0 END)'
+            ),
+            'services_total'              => new Expression(
+                'SUM(CASE WHEN service_id IS NOT NULL THEN 1 ELSE 0 END)'
+            ),
+            'services_unknown_handled'    => new Expression(
+                'SUM(CASE WHEN service_state = 3 AND service_handled = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'services_unknown_unhandled'  => new Expression(
+                'SUM(CASE WHEN service_state = 3 AND service_handled = \'n\' THEN 1 ELSE 0 END)'
+            ),
+            'services_warning_handled'    => new Expression(
+                'SUM(CASE WHEN service_state = 1 AND service_handled = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'services_warning_unhandled'  => new Expression(
+                'SUM(CASE WHEN service_state = 1 AND service_handled = \'n\' THEN 1 ELSE 0 END)'
+            ),
+            'services_severity'           => new Expression('MAX(service_severity)')
+        ];
+    }
+
+    public function getSearchColumns()
+    {
+        return ['display_name'];
+    }
+
+    public function getDefaultSort()
+    {
+        return 'display_name';
+    }
+
+    public function getUnions()
+    {
+        $unions = [
+            [
+                Service::class,
+                [
+                    'servicegroup',
+                    'state'
+                ],
+                [
+                    'servicegroup_id'           => 'servicegroup.id',
+                    'servicegroup_name'         => 'servicegroup.name',
+                    'servicegroup_display_name' => 'servicegroup.display_name',
+                    'service_id'                => 'service.id',
+                    'service_state'             => 'state.soft_state',
+                    'service_handled'           => 'state.is_handled',
+                    'service_severity'          => 'state.severity'
+                ]
+            ],
+            [
+                Servicegroup::class,
+                [],
+                [
+                    'servicegroup_id'           => 'servicegroup.id',
+                    'servicegroup_name'         => 'servicegroup.name',
+                    'servicegroup_display_name' => 'servicegroup.display_name',
+                    'service_id'                => new Expression('NULL'),
+                    'service_state'             => new Expression('NULL'),
+                    'service_handled'           => new Expression('NULL'),
+                    'service_severity'          => new Expression('0')
+                ]
+            ]
+        ];
+
+        return $unions;
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id'
+        ]));
+
+        // This is because there is no better way
+        (new Servicegroup())->createBehaviors($behaviors);
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        // This is because there is no better way
+        (new Servicegroup())->createRelations($relations);
+    }
+
+    public function getColumnDefinitions()
+    {
+        // This is because there is no better way
+        return (new Servicegroup())->getColumnDefinitions();
+    }
+}
diff --git a/library/Icingadb/Model/ServicestateSummary.php b/library/Icingadb/Model/ServicestateSummary.php
new file mode 100644
index 0000000..03a012c
--- /dev/null
+++ b/library/Icingadb/Model/ServicestateSummary.php
@@ -0,0 +1,99 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Sql\Connection;
+use ipl\Sql\Expression;
+
+class ServicestateSummary extends Service
+{
+    public function getSummaryColumns()
+    {
+        return [
+            'services_acknowledged' => new Expression(
+                'SUM(CASE WHEN service_state.is_acknowledged = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'services_active_checks_enabled' => new Expression(
+                'SUM(CASE WHEN service.active_checks_enabled = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'services_passive_checks_enabled' => new Expression(
+                'SUM(CASE WHEN service.passive_checks_enabled = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'services_critical_handled' => new Expression(
+                'SUM(CASE WHEN service_state.soft_state = 2'
+                . ' AND service_state.is_handled = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'services_critical_unhandled' => new Expression(
+                'SUM(CASE WHEN service_state.soft_state = 2'
+                . ' AND service_state.is_handled = \'n\' THEN 1 ELSE 0 END)'
+            ),
+            'services_event_handler_enabled' => new Expression(
+                'SUM(CASE WHEN service.event_handler_enabled = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'services_flapping_enabled' => new Expression(
+                'SUM(CASE WHEN service.flapping_enabled = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'services_notifications_enabled' => new Expression(
+                'SUM(CASE WHEN service.notifications_enabled = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'services_ok' => new Expression(
+                'SUM(CASE WHEN service_state.soft_state = 0 THEN 1 ELSE 0 END)'
+            ),
+            'services_pending' => new Expression(
+                'SUM(CASE WHEN service_state.soft_state = 99 THEN 1 ELSE 0 END)'
+            ),
+            'services_problems_unacknowledged' => new Expression(
+                'SUM(CASE WHEN service_state.is_problem = \'y\''
+                . ' AND service_state.is_acknowledged = \'n\' THEN 1 ELSE 0 END)'
+            ),
+            'services_total' => new Expression(
+                'SUM(CASE WHEN service.id IS NOT NULL THEN 1 ELSE 0 END)'
+            ),
+            'services_unknown_handled' => new Expression(
+                'SUM(CASE WHEN service_state.soft_state = 3'
+                . ' AND service_state.is_handled = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'services_unknown_unhandled' => new Expression(
+                'SUM(CASE WHEN service_state.soft_state = 3'
+                . ' AND service_state.is_handled = \'n\' THEN 1 ELSE 0 END)'
+            ),
+            'services_warning_handled' => new Expression(
+                'SUM(CASE WHEN service_state.soft_state = 1'
+                . ' AND service_state.is_handled = \'y\' THEN 1 ELSE 0 END)'
+            ),
+            'services_warning_unhandled' => new Expression(
+                'SUM(CASE WHEN service_state.soft_state = 1'
+                . ' AND service_state.is_handled = \'n\' THEN 1 ELSE 0 END)'
+            )
+        ];
+    }
+
+    public static function on(Connection $db)
+    {
+        $q = parent::on($db);
+        $q->utilize('state');
+
+        /** @var static $m */
+        $m = $q->getModel();
+        $q->columns($m->getSummaryColumns());
+
+        return $q;
+    }
+
+    public function getColumns()
+    {
+        return array_merge(parent::getColumns(), $this->getSummaryColumns());
+    }
+
+    public function getDefaultSort()
+    {
+        return null;
+    }
+
+    public function getSearchColumns()
+    {
+        return ['name_ci', 'host.name_ci'];
+    }
+}
diff --git a/library/Icingadb/Model/State.php b/library/Icingadb/Model/State.php
new file mode 100644
index 0000000..acd3769
--- /dev/null
+++ b/library/Icingadb/Model/State.php
@@ -0,0 +1,83 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Model\Behavior\BoolCast;
+use Icinga\Module\Icingadb\Model\Behavior\Timestamp;
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+
+/**
+ * Base class for the {@link HostState} and {@link ServiceState} models providing common columns.
+ */
+abstract class State extends Model
+{
+    public function getColumns()
+    {
+        return [
+            'environment_id',
+            'state_type',
+            'soft_state',
+            'hard_state',
+            'previous_soft_state',
+            'previous_hard_state',
+            'check_attempt',
+            'severity',
+            'output',
+            'long_output',
+            'performance_data',
+            'normalized_performance_data',
+            'check_commandline',
+            'is_problem',
+            'is_handled',
+            'is_reachable',
+            'is_flapping',
+            'is_overdue',
+            'is_acknowledged',
+            'acknowledgement_comment_id',
+            'last_comment_id',
+            'in_downtime',
+            'execution_time',
+            'latency',
+            'check_timeout',
+            'check_source',
+            'scheduling_source',
+            'last_update',
+            'last_state_change',
+            'next_check',
+            'next_update'
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new BoolCast([
+            'is_problem',
+            'is_handled',
+            'is_reachable',
+            'is_flapping',
+            'is_overdue',
+            'is_acknowledged',
+            'in_downtime'
+        ]));
+
+        $behaviors->add(new Timestamp([
+            'execution_time',
+            'latency',
+            'last_update',
+            'last_state_change',
+            'next_check',
+            'next_update'
+        ]));
+
+        $behaviors->add(new Binary([
+            $this->getKeyName(),
+            'environment_id',
+            'acknowledgement_comment_id',
+            'last_comment_id'
+        ]));
+    }
+}
diff --git a/library/Icingadb/Model/StateHistory.php b/library/Icingadb/Model/StateHistory.php
new file mode 100644
index 0000000..a4ae3d3
--- /dev/null
+++ b/library/Icingadb/Model/StateHistory.php
@@ -0,0 +1,101 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Model\Behavior\Timestamp;
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+/**
+ * Model for table `state_history`
+ *
+ * Please note that using this model will fetch history entries for decommissioned services. To avoid this,
+ * the query needs a `state_history.service_id IS NULL OR state_history_service.id IS NOT NULL` where.
+ */
+class StateHistory extends Model
+{
+    public function getTableName()
+    {
+        return 'state_history';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'environment_id',
+            'endpoint_id',
+            'object_type',
+            'host_id',
+            'service_id',
+            'event_time',
+            'state_type',
+            'soft_state',
+            'hard_state',
+            'check_attempt',
+            'previous_soft_state',
+            'previous_hard_state',
+            'output',
+            'long_output',
+            'max_check_attempts',
+            'check_source',
+            'scheduling_source'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'environment_id'        => t('Environment Id'),
+            'endpoint_id'           => t('Endpoint Id'),
+            'object_type'           => t('Object Type'),
+            'host_id'               => t('Host Id'),
+            'service_id'            => t('Service Id'),
+            'event_time'            => t('Event Time'),
+            'state_type'            => t('Event State Type'),
+            'soft_state'            => t('Event Soft State'),
+            'hard_state'            => t('Event Hard State'),
+            'check_attempt'         => t('Event Check Attempt No.'),
+            'previous_soft_state'   => t('Event Previous Soft State'),
+            'previous_hard_state'   => t('Event Previous Hard State'),
+            'output'                => t('Event Output'),
+            'long_output'           => t('Event Long Output'),
+            'max_check_attempts'    => t('Event Max Check Attempts'),
+            'check_source'          => t('Event Check Source')
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Timestamp([
+            'event_time'
+        ]));
+
+        $behaviors->add(new Binary([
+            'id',
+            'environment_id',
+            'endpoint_id',
+            'host_id',
+            'service_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('endpoint', Endpoint::class);
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('history', History::class)
+            ->setCandidateKey('id')
+            ->setForeignKey('state_history_id');
+        $relations->belongsTo('host', Host::class);
+        $relations->belongsTo('service', Service::class)->setJoinType('LEFT');
+    }
+}
diff --git a/library/Icingadb/Model/Timeperiod.php b/library/Icingadb/Model/Timeperiod.php
new file mode 100644
index 0000000..26dd722
--- /dev/null
+++ b/library/Icingadb/Model/Timeperiod.php
@@ -0,0 +1,91 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Model\Behavior\ReRoute;
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class Timeperiod extends Model
+{
+    public function getTableName()
+    {
+        return 'timeperiod';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'environment_id',
+            'name_checksum',
+            'properties_checksum',
+            'name',
+            'name_ci',
+            'display_name',
+            'prefer_includes',
+            'zone_id'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'environment_id'        => t('Environment Id'),
+            'name_checksum'         => t('Timeperiod Name Checksum'),
+            'properties_checksum'   => t('Timeperiod Properties Checksum'),
+            'name'                  => t('Timeperiod Name'),
+            'name_ci'               => t('Timeperiod Name (CI)'),
+            'display_name'          => t('Timeperiod Display Name'),
+            'prefer_includes'       => t('Timeperiod Prefer Includes'),
+            'zone_id'               => t('Zone Id')
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new ReRoute([
+            'hostgroup'     => 'host.hostgroup',
+            'servicegroup'  => 'service.servicegroup'
+        ]));
+
+        $behaviors->add(new Binary([
+            'id',
+            'environment_id',
+            'name_checksum',
+            'properties_checksum',
+            'zone_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('zone', Zone::class);
+
+        $relations->belongsToMany('customvar', Customvar::class)
+            ->through(TimeperiodCustomvar::class);
+        $relations->belongsToMany('customvar_flat', CustomvarFlat::class)
+            ->through(TimeperiodCustomvar::class);
+        $relations->belongsToMany('vars', Vars::class)
+            ->through(TimeperiodCustomvar::class);
+
+        // TODO: Decide how to establish the override relations
+
+        $relations->hasMany('range', TimeperiodRange::class);
+        $relations->hasMany('host', Host::class)
+            ->setForeignKey('check_timeperiod_id');
+        $relations->hasMany('Notification', Notification::class);
+        $relations->hasMany('service', Service::class)
+            ->setForeignKey('check_timeperiod_id');
+        $relations->hasMany('user', User::class);
+    }
+}
diff --git a/library/Icingadb/Model/TimeperiodCustomvar.php b/library/Icingadb/Model/TimeperiodCustomvar.php
new file mode 100644
index 0000000..614a312
--- /dev/null
+++ b/library/Icingadb/Model/TimeperiodCustomvar.php
@@ -0,0 +1,52 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class TimeperiodCustomvar extends Model
+{
+    public function getTableName()
+    {
+        return 'timeperiod_customvar';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'timeperiod_id',
+            'customvar_id',
+            'environment_id'
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'timeperiod_id',
+            'customvar_id',
+            'environment_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('timeperiod', Timeperiod::class);
+        $relations->belongsTo('customvar', Customvar::class);
+        $relations->belongsTo('customvar_flat', CustomvarFlat::class)
+            ->setCandidateKey('customvar_id')
+            ->setForeignKey('customvar_id');
+    }
+}
diff --git a/library/Icingadb/Model/TimeperiodOverrideExclude.php b/library/Icingadb/Model/TimeperiodOverrideExclude.php
new file mode 100644
index 0000000..c33df77
--- /dev/null
+++ b/library/Icingadb/Model/TimeperiodOverrideExclude.php
@@ -0,0 +1,51 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class TimeperiodOverrideExclude extends Model
+{
+    public function getTableName()
+    {
+        return 'timeperiod_override_exclude';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'timeperiod_id',
+            'override_id',
+            'environment_id'
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'timeperiod_id',
+            'override_id',
+            'environment_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('timeperiod', Timeperiod::class);
+        // TODO: `timeperiod` cannot be used again, find a better name
+        $relations->belongsTo('timeperiod', Timeperiod::class)
+            ->setCandidateKey('override_id');
+    }
+}
diff --git a/library/Icingadb/Model/TimeperiodOverrideInclude.php b/library/Icingadb/Model/TimeperiodOverrideInclude.php
new file mode 100644
index 0000000..5418596
--- /dev/null
+++ b/library/Icingadb/Model/TimeperiodOverrideInclude.php
@@ -0,0 +1,51 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class TimeperiodOverrideInclude extends Model
+{
+    public function getTableName()
+    {
+        return 'timeperiod_override_include';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'timeperiod_id',
+            'override_id',
+            'environment_id'
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'timeperiod_id',
+            'override_id',
+            'environment_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('timeperiod', Timeperiod::class);
+        // TODO: `timeperiod` cannot be used again, find a better name
+        $relations->belongsTo('timeperiod', Timeperiod::class)
+            ->setCandidateKey('override_id');
+    }
+}
diff --git a/library/Icingadb/Model/TimeperiodRange.php b/library/Icingadb/Model/TimeperiodRange.php
new file mode 100644
index 0000000..62e87f8
--- /dev/null
+++ b/library/Icingadb/Model/TimeperiodRange.php
@@ -0,0 +1,58 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class TimeperiodRange extends Model
+{
+    public function getTableName()
+    {
+        return 'timeperiod_range';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'timeperiod_id',
+            'range_key',
+            'environment_id',
+            'range_value'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'timeperiod_id'     => t('Timeperiod Id'),
+            'range_key'         => t('Timeperiod Range Date(s)/Day'),
+            'environment_id'    => t('Environment Id'),
+            'range_value'       => t('Timeperiod Range Time')
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'timeperiod_id',
+            'environment_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('timeperiod', Timeperiod::class);
+    }
+}
diff --git a/library/Icingadb/Model/User.php b/library/Icingadb/Model/User.php
new file mode 100644
index 0000000..e894e0f
--- /dev/null
+++ b/library/Icingadb/Model/User.php
@@ -0,0 +1,134 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Model\Behavior\Bitmask;
+use Icinga\Module\Icingadb\Model\Behavior\ReRoute;
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class User extends Model
+{
+    public function getTableName()
+    {
+        return 'user';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'environment_id',
+            'name_checksum',
+            'properties_checksum',
+            'name',
+            'name_ci',
+            'display_name',
+            'email',
+            'pager',
+            'notifications_enabled',
+            'timeperiod_id',
+            'states',
+            'types',
+            'zone_id'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'environment_id'        => t('Environment Id'),
+            'name_checksum'         => t('User Name Checksum'),
+            'properties_checksum'   => t('User Properties Checksum'),
+            'name'                  => t('User Name'),
+            'name_ci'               => t('User Name (CI)'),
+            'display_name'          => t('User Display Name'),
+            'email'                 => t('User Email'),
+            'pager'                 => t('User Pager'),
+            'notifications_enabled' => t('User Receives Notifications'),
+            'timeperiod_id'         => t('Timeperiod Id'),
+            'states'                => t('Notification State Filter'),
+            'types'                 => t('Notification Type Filter'),
+            'zone_id'               => t('Zone Id')
+        ];
+    }
+
+    public function getSearchColumns()
+    {
+        return ['name_ci'];
+    }
+
+    public function getDefaultSort()
+    {
+        return 'user.display_name';
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new ReRoute([
+            'host'          => 'notification.host',
+            'service'       => 'notification.service',
+            'hostgroup'     => 'notification.host.hostgroup',
+            'servicegroup'  => 'notification.service.servicegroup'
+        ]));
+
+        $behaviors->add(new Bitmask([
+            'states' => [
+                'ok'        => 1,
+                'warning'   => 2,
+                'critical'  => 4,
+                'unknown'   => 8,
+                'up'        => 16,
+                'down'      => 32
+            ],
+            'types' => [
+                'downtime_start'    => 1,
+                'downtime_end'      => 2,
+                'downtime_removed'  => 4,
+                'custom'            => 8,
+                'ack'               => 16,
+                'problem'           => 32,
+                'recovery'          => 64,
+                'flapping_start'    => 128,
+                'flapping_end'      => 256
+            ]
+        ]));
+
+        $behaviors->add(new Binary([
+            'id',
+            'environment_id',
+            'name_checksum',
+            'properties_checksum',
+            'timeperiod_id',
+            'zone_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('timeperiod', Timeperiod::class);
+        $relations->belongsTo('zone', Zone::class);
+
+        $relations->belongsToMany('customvar', Customvar::class)
+            ->through(UserCustomvar::class);
+        $relations->belongsToMany('customvar_flat', CustomvarFlat::class)
+            ->through(UserCustomvar::class);
+        $relations->belongsToMany('vars', Vars::class)
+            ->through(UserCustomvar::class);
+        $relations->belongsToMany('notification', Notification::class)
+            ->through('notification_recipient');
+        $relations->belongsToMany('notification_history', NotificationHistory::class)
+            ->through('user_notification_history');
+        $relations->belongsToMany('usergroup', Usergroup::class)
+            ->through(UsergroupMember::class);
+    }
+}
diff --git a/library/Icingadb/Model/UserCustomvar.php b/library/Icingadb/Model/UserCustomvar.php
new file mode 100644
index 0000000..a702b68
--- /dev/null
+++ b/library/Icingadb/Model/UserCustomvar.php
@@ -0,0 +1,52 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class UserCustomvar extends Model
+{
+    public function getTableName()
+    {
+        return 'user_customvar';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'user_id',
+            'customvar_id',
+            'environment_id'
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'user_id',
+            'customvar_id',
+            'environment_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('user', User::class);
+        $relations->belongsTo('customvar', Customvar::class);
+        $relations->belongsTo('customvar_flat', CustomvarFlat::class)
+            ->setCandidateKey('customvar_id')
+            ->setForeignKey('customvar_id');
+    }
+}
diff --git a/library/Icingadb/Model/Usergroup.php b/library/Icingadb/Model/Usergroup.php
new file mode 100644
index 0000000..7034770
--- /dev/null
+++ b/library/Icingadb/Model/Usergroup.php
@@ -0,0 +1,95 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Model\Behavior\ReRoute;
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class Usergroup extends Model
+{
+    public function getTableName()
+    {
+        return 'usergroup';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'environment_id',
+            'name_checksum',
+            'properties_checksum',
+            'name',
+            'name_ci',
+            'display_name',
+            'zone_id'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'environment_id'        => t('Environment Id'),
+            'name_checksum'         => t('Usergroup Name Checksum'),
+            'properties_checksum'   => t('Usergroup Properties Checksum'),
+            'name'                  => t('Usergroup Name'),
+            'name_ci'               => t('Usergroup Name (CI)'),
+            'display_name'          => t('Usergroup Display Name'),
+            'zone_id'               => t('Zone Id')
+        ];
+    }
+
+    public function getSearchColumns()
+    {
+        return ['name_ci'];
+    }
+
+    public function getDefaultSort()
+    {
+        return 'usergroup.display_name';
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new ReRoute([
+            'host'          => 'notification.host',
+            'service'       => 'notification.service',
+            'hostgroup'     => 'notification.host.hostgroup',
+            'servicegroup'  => 'notification.service.servicegroup'
+        ]));
+
+        $behaviors->add(new Binary([
+            'id',
+            'environment_id',
+            'name_checksum',
+            'properties_checksum',
+            'zone_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('zone', Zone::class);
+
+        $relations->belongsToMany('customvar', Customvar::class)
+            ->through(UsergroupCustomvar::class);
+        $relations->belongsToMany('customvar_flat', CustomvarFlat::class)
+            ->through(UsergroupCustomvar::class);
+        $relations->belongsToMany('vars', Vars::class)
+            ->through(UsergroupCustomvar::class);
+        $relations->belongsToMany('user', User::class)
+            ->through(UsergroupMember::class);
+        $relations->belongsToMany('notification', Notification::class)
+            ->through('notification_recipient');
+    }
+}
diff --git a/library/Icingadb/Model/UsergroupCustomvar.php b/library/Icingadb/Model/UsergroupCustomvar.php
new file mode 100644
index 0000000..ab97273
--- /dev/null
+++ b/library/Icingadb/Model/UsergroupCustomvar.php
@@ -0,0 +1,52 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class UsergroupCustomvar extends Model
+{
+    public function getTableName()
+    {
+        return 'usergroup_customvar';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'usergroup_id',
+            'customvar_id',
+            'environment_id'
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'usergroup_id',
+            'customvar_id',
+            'environment_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('usergroup', Usergroup::class);
+        $relations->belongsTo('customvar', Customvar::class);
+        $relations->belongsTo('customvar_flat', CustomvarFlat::class)
+            ->setCandidateKey('customvar_id')
+            ->setForeignKey('customvar_id');
+    }
+}
diff --git a/library/Icingadb/Model/UsergroupMember.php b/library/Icingadb/Model/UsergroupMember.php
new file mode 100644
index 0000000..7c61d67
--- /dev/null
+++ b/library/Icingadb/Model/UsergroupMember.php
@@ -0,0 +1,49 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class UsergroupMember extends Model
+{
+    public function getTableName()
+    {
+        return 'usergroup_member';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'user_id',
+            'usergroup_id',
+            'environment_id'
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'user_id',
+            'usergroup_id',
+            'environment_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+        $relations->belongsTo('usergroup', Usergroup::class);
+        $relations->belongsTo('user', User::class);
+    }
+}
diff --git a/library/Icingadb/Model/Vars.php b/library/Icingadb/Model/Vars.php
new file mode 100644
index 0000000..304d526
--- /dev/null
+++ b/library/Icingadb/Model/Vars.php
@@ -0,0 +1,28 @@
+<?php
+
+/* Icinga DB Web | (c) 2022 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use Icinga\Module\Icingadb\Model\Behavior\FlattenedObjectVars;
+use ipl\Orm\Behaviors;
+use ipl\Sql\Connection;
+
+class Vars extends CustomvarFlat
+{
+    /**
+     * @internal Don't use. This model acts only as relation target and is not supposed to be directly used as query
+     *           target. Use {@see CustomvarFlat} instead.
+     */
+    public static function on(Connection $_)
+    {
+        throw new \LogicException('Documentation says: DO NOT USE. Can\'t you read?');
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        parent::createBehaviors($behaviors);
+
+        $behaviors->add(new FlattenedObjectVars());
+    }
+}
diff --git a/library/Icingadb/Model/Zone.php b/library/Icingadb/Model/Zone.php
new file mode 100644
index 0000000..aaf3bbf
--- /dev/null
+++ b/library/Icingadb/Model/Zone.php
@@ -0,0 +1,82 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Model;
+
+use ipl\Orm\Behavior\Binary;
+use ipl\Orm\Behaviors;
+use ipl\Orm\Model;
+use ipl\Orm\Relations;
+
+class Zone extends Model
+{
+    public function getTableName()
+    {
+        return 'zone';
+    }
+
+    public function getKeyName()
+    {
+        return 'id';
+    }
+
+    public function getColumns()
+    {
+        return [
+            'environment_id',
+            'name_checksum',
+            'properties_checksum',
+            'name',
+            'name_ci',
+            'is_global',
+            'parent_id',
+            'depth'
+        ];
+    }
+
+    public function getColumnDefinitions()
+    {
+        return [
+            'environment_id'        => t('Environment Id'),
+            'name_checksum'         => t('Zone Name Checksum'),
+            'properties_checksum'   => t('Zone Properties Checksum'),
+            'name'                  => t('Zone Name'),
+            'name_ci'               => t('Zone Name (CI)'),
+            'is_global'             => t('Zone Is Global'),
+            'parent_id'             => t('Parent Zone Id'),
+            'depth'                 => t('Zone Depth')
+        ];
+    }
+
+    public function createBehaviors(Behaviors $behaviors)
+    {
+        $behaviors->add(new Binary([
+            'id',
+            'environment_id',
+            'name_checksum',
+            'properties_checksum',
+            'parent_id'
+        ]));
+    }
+
+    public function createRelations(Relations $relations)
+    {
+        $relations->belongsTo('environment', Environment::class);
+
+        $relations->hasMany('comment', Comment::class);
+        $relations->hasMany('downtime', Downtime::class);
+        $relations->hasMany('endpoint', Endpoint::class);
+        $relations->hasMany('eventcommand', Eventcommand::class);
+        $relations->hasMany('host', Host::class);
+        $relations->hasMany('hostgroup', Hostgroup::class);
+        $relations->hasMany('notification', Notification::class);
+        $relations->hasMany('service', Service::class);
+        $relations->hasMany('servicegroup', Servicegroup::class);
+        $relations->hasMany('timeperiod', Timeperiod::class);
+        $relations->hasMany('user', User::class);
+        $relations->hasMany('usergroup', Usergroup::class);
+
+        // TODO: Decide how to establish recursive relations
+    }
+}
diff --git a/library/Icingadb/ProvidedHook/ApplicationState.php b/library/Icingadb/ProvidedHook/ApplicationState.php
new file mode 100644
index 0000000..1b6f8c1
--- /dev/null
+++ b/library/Icingadb/ProvidedHook/ApplicationState.php
@@ -0,0 +1,111 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\ProvidedHook;
+
+use Exception;
+use Icinga\Application\Hook\ApplicationStateHook;
+use Icinga\Module\Icingadb\Common\Database;
+use Icinga\Module\Icingadb\Common\IcingaRedis;
+use Icinga\Module\Icingadb\Model\Instance;
+use Icinga\Web\Session;
+use ipl\Stdlib\Filter;
+
+class ApplicationState extends ApplicationStateHook
+{
+    use Database;
+
+    public function collectMessages()
+    {
+        try {
+            $lastIcingaHeartbeat = IcingaRedis::getLastIcingaHeartbeat();
+        } catch (Exception $e) {
+            $downSince = Session::getSession()->getNamespace('icingadb')->get('redis.down-since');
+
+            if ($downSince === null) {
+                $downSince = time();
+                Session::getSession()->getNamespace('icingadb')->set('redis.down-since', $downSince);
+            }
+
+            $this->addError(
+                'icingadb/redis-down',
+                $downSince,
+                sprintf(t("Can't connect to Icinga Redis: %s"), $e->getMessage())
+            );
+
+            return;
+        }
+
+        $instance = Instance::on($this->getDb())
+            ->with(['endpoint'])
+            ->filter(Filter::equal('responsible', true))
+            ->orderBy('heartbeat', 'desc')
+            ->first();
+
+        if ($instance === null) {
+            $noInstanceSince = Session::getSession()
+                ->getNamespace('icingadb')->get('icingadb.no-instance-since');
+
+            if ($noInstanceSince === null) {
+                $noInstanceSince = time();
+                Session::getSession()
+                    ->getNamespace('icingadb')->set('icingadb.no-instance-since', $noInstanceSince);
+            }
+
+            $this->addError(
+                'icingadb/no-instance',
+                $noInstanceSince,
+                t(
+                    'It seems that Icinga DB is not running.'
+                    . ' Make sure Icinga DB is running and writing into the database.'
+                )
+            );
+
+            return;
+        } else {
+            Session::getSession()->getNamespace('icingadb')->delete('db.no-instance-since');
+        }
+
+        $outdatedDbHeartbeat = $instance->heartbeat < time() - 60;
+
+        if ($lastIcingaHeartbeat === null) {
+            $missingSince = Session::getSession()
+                ->getNamespace('icingadb')->get('redis.heartbeat-missing-since');
+
+            if ($missingSince === null) {
+                $missingSince = time();
+                Session::getSession()
+                    ->getNamespace('icingadb')->set('redis.heartbeat-missing-since', $missingSince);
+            }
+
+            $lastIcingaHeartbeat = $missingSince;
+        } else {
+            Session::getSession()->getNamespace('icingadb')->delete('redis.heartbeat-missing-since');
+        }
+
+        switch (true) {
+            case $outdatedDbHeartbeat && $instance->heartbeat > $lastIcingaHeartbeat:
+                $this->addError(
+                    'icingadb/redis-outdated',
+                    $lastIcingaHeartbeat,
+                    t('Icinga Redis is outdated. Make sure Icinga 2 is running and connected to Redis.')
+                );
+
+                break;
+            case $outdatedDbHeartbeat:
+                $this->addError(
+                    'icingadb/icingadb-down',
+                    $instance->heartbeat,
+                    t(
+                        'It seems that Icinga DB is not running.'
+                        . ' Make sure Icinga DB is running and writing into the database.'
+                    )
+                );
+
+                break;
+        }
+
+        Session::getSession()->getNamespace('icingadb')->delete('redis.down-since');
+    }
+}
diff --git a/library/Icingadb/ProvidedHook/IcingaHealth.php b/library/Icingadb/ProvidedHook/IcingaHealth.php
new file mode 100644
index 0000000..863c207
--- /dev/null
+++ b/library/Icingadb/ProvidedHook/IcingaHealth.php
@@ -0,0 +1,115 @@
+<?php
+
+// Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2
+
+namespace Icinga\Module\Icingadb\ProvidedHook;
+
+use Icinga\Application\Hook\HealthHook;
+use Icinga\Module\Icingadb\Common\Database;
+use Icinga\Module\Icingadb\Model\Instance;
+use ipl\Web\Url;
+
+class IcingaHealth extends HealthHook
+{
+    use Database;
+
+    /** @var Instance */
+    protected $instance;
+
+    public function getName(): string
+    {
+        return 'Icinga DB';
+    }
+
+    public function getUrl(): Url
+    {
+        return Url::fromPath('icingadb/health');
+    }
+
+    public function checkHealth()
+    {
+        $instance = $this->getInstance();
+
+        if ($instance === null) {
+            $this->setState(self::STATE_UNKNOWN);
+            $this->setMessage(t(
+                'Icinga DB is not running or not writing into the database'
+                . ' (make sure the icinga feature "icingadb" is enabled)'
+            ));
+        } elseif ($instance->heartbeat < time() - 60) {
+            $this->setState(self::STATE_CRITICAL);
+            $this->setMessage(t(
+                'Icinga DB is not running or not writing into the database'
+                . ' (make sure the icinga feature "icingadb" is enabled)'
+            ));
+        } else {
+            $this->setState(self::STATE_OK);
+            $this->setMessage(t('Icinga DB is running and writing into the database'));
+            $warningMessages = [];
+
+            if (! $instance->icinga2_active_host_checks_enabled) {
+                $this->setState(self::STATE_WARNING);
+                $warningMessages[] = t('Active host checks are disabled');
+            }
+
+            if (! $instance->icinga2_active_service_checks_enabled) {
+                $this->setState(self::STATE_WARNING);
+                $warningMessages[] = t('Active service checks are disabled');
+            }
+
+            if (! $instance->icinga2_notifications_enabled) {
+                $this->setState(self::STATE_WARNING);
+                $warningMessages[] = t('Notifications are disabled');
+            }
+
+            if ($this->getState() === self::STATE_WARNING) {
+                $this->setMessage(implode("; ", $warningMessages));
+            }
+        }
+
+        if ($instance !== null) {
+            $this->setMetrics([
+                'heartbeat' => $instance->heartbeat,
+                'responsible' => $instance->responsible,
+                'icinga2_active_host_checks_enabled' => $instance->icinga2_active_host_checks_enabled,
+                'icinga2_active_service_checks_enabled' => $instance->icinga2_active_service_checks_enabled,
+                'icinga2_event_handlers_enabled' => $instance->icinga2_event_handlers_enabled,
+                'icinga2_flap_detection_enabled' => $instance->icinga2_flap_detection_enabled,
+                'icinga2_notifications_enabled' => $instance->icinga2_notifications_enabled,
+                'icinga2_performance_data_enabled' => $instance->icinga2_performance_data_enabled,
+                'icinga2_start_time' => $instance->icinga2_start_time,
+                'icinga2_version' => $instance->icinga2_version,
+                'endpoint' => ['name' => $instance->endpoint->name]
+            ]);
+        }
+    }
+
+    /**
+     * Get an Icinga DB instance
+     *
+     * @return ?Instance
+     */
+    protected function getInstance()
+    {
+        if ($this->instance === null) {
+            $this->instance = Instance::on($this->getDb())
+                ->with('endpoint')
+                ->columns([
+                    'heartbeat',
+                    'responsible',
+                    'icinga2_active_host_checks_enabled',
+                    'icinga2_active_service_checks_enabled',
+                    'icinga2_event_handlers_enabled',
+                    'icinga2_flap_detection_enabled',
+                    'icinga2_notifications_enabled',
+                    'icinga2_performance_data_enabled',
+                    'icinga2_start_time',
+                    'icinga2_version',
+                    'endpoint.name'
+                ])
+                ->first();
+        }
+
+        return $this->instance;
+    }
+}
diff --git a/library/Icingadb/ProvidedHook/RedisHealth.php b/library/Icingadb/ProvidedHook/RedisHealth.php
new file mode 100644
index 0000000..9e71154
--- /dev/null
+++ b/library/Icingadb/ProvidedHook/RedisHealth.php
@@ -0,0 +1,55 @@
+<?php
+
+// Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2
+
+namespace Icinga\Module\Icingadb\ProvidedHook;
+
+use Exception;
+use Icinga\Application\Hook\HealthHook;
+use Icinga\Module\Icingadb\Common\Database;
+use Icinga\Module\Icingadb\Common\IcingaRedis;
+use Icinga\Module\Icingadb\Model\Instance;
+
+class RedisHealth extends HealthHook
+{
+    use Database;
+
+    public function getName(): string
+    {
+        return 'Icinga Redis';
+    }
+
+    public function checkHealth()
+    {
+        try {
+            $lastIcingaHeartbeat = IcingaRedis::getLastIcingaHeartbeat();
+            if ($lastIcingaHeartbeat === null) {
+                $lastIcingaHeartbeat = time();
+            }
+
+            $instance = Instance::on($this->getDb())->columns('heartbeat')->first();
+
+            if ($instance === null) {
+                $this->setState(self::STATE_UNKNOWN);
+                $this->setMessage(t(
+                    'Can\'t check Icinga Redis: Icinga DB is not running or not writing into the database'
+                    . ' (make sure the icinga feature "icingadb" is enabled)'
+                ));
+
+                return;
+            }
+
+            $outdatedDbHeartbeat = $instance->heartbeat < time() - 60;
+            if (! $outdatedDbHeartbeat || $instance->heartbeat <= $lastIcingaHeartbeat) {
+                $this->setState(self::STATE_OK);
+                $this->setMessage(t('Icinga Redis available and up to date.'));
+            } elseif ($instance->heartbeat > $lastIcingaHeartbeat) {
+                $this->setState(self::STATE_CRITICAL);
+                $this->setMessage(t('Icinga Redis outdated. Make sure Icinga 2 is running and connected to Redis.'));
+            }
+        } catch (Exception $e) {
+            $this->setState(self::STATE_CRITICAL);
+            $this->setMessage(sprintf(t("Can't connect to Icinga Redis: %s"), $e->getMessage()));
+        }
+    }
+}
diff --git a/library/Icingadb/ProvidedHook/Reporting/HostSlaReport.php b/library/Icingadb/ProvidedHook/Reporting/HostSlaReport.php
new file mode 100644
index 0000000..d9c4f4f
--- /dev/null
+++ b/library/Icingadb/ProvidedHook/Reporting/HostSlaReport.php
@@ -0,0 +1,68 @@
+<?php
+
+/* Icinga DB Web | (c) 2022 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\ProvidedHook\Reporting;
+
+use Icinga\Application\Icinga;
+use Icinga\Module\Icingadb\Model\Host;
+use Icinga\Module\Reporting\ReportData;
+use Icinga\Module\Reporting\ReportRow;
+use Icinga\Module\Reporting\Timerange;
+use ipl\Sql\Expression;
+use ipl\Stdlib\Filter\Rule;
+
+use function ipl\I18n\t;
+
+class HostSlaReport extends SlaReport
+{
+    public function getName()
+    {
+        $name = t('Host SLA');
+        if (Icinga::app()->getModuleManager()->hasEnabled('idoreports')) {
+            $name .= ' (Icinga DB)';
+        }
+
+        return $name;
+    }
+
+    protected function createReportData()
+    {
+        return (new ReportData())
+            ->setDimensions([t('Hostname')])
+            ->setValues([t('SLA in %')]);
+    }
+
+    protected function createReportRow($row)
+    {
+        if ($row->sla === null) {
+            return null;
+        }
+
+        return (new ReportRow())
+            ->setDimensions([$row->display_name])
+            ->setValues([(float) $row->sla]);
+    }
+
+    protected function fetchSla(Timerange $timerange, Rule $filter = null)
+    {
+        $sla = Host::on($this->getDb())
+            ->columns([
+                'display_name',
+                'sla' => new Expression(sprintf(
+                    "get_sla_ok_percent(%s, NULL, '%s', '%s')",
+                    'host.id',
+                    $timerange->getStart()->format('Uv'),
+                    $timerange->getEnd()->format('Uv')
+                ))
+            ]);
+
+        $this->applyRestrictions($sla);
+
+        if ($filter !== null) {
+            $sla->filter($filter);
+        }
+
+        return $sla;
+    }
+}
diff --git a/library/Icingadb/ProvidedHook/Reporting/ServiceSlaReport.php b/library/Icingadb/ProvidedHook/Reporting/ServiceSlaReport.php
new file mode 100644
index 0000000..46a0684
--- /dev/null
+++ b/library/Icingadb/ProvidedHook/Reporting/ServiceSlaReport.php
@@ -0,0 +1,72 @@
+<?php
+
+/* Icinga DB Web | (c) 2022 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\ProvidedHook\Reporting;
+
+use Icinga\Application\Icinga;
+use Icinga\Module\Icingadb\Model\Service;
+use Icinga\Module\Reporting\ReportData;
+use Icinga\Module\Reporting\ReportRow;
+use Icinga\Module\Reporting\Timerange;
+use ipl\Sql\Expression;
+use ipl\Stdlib\Filter\Rule;
+
+use function ipl\I18n\t;
+
+class ServiceSlaReport extends SlaReport
+{
+    public function getName()
+    {
+        $name = t('Service SLA');
+        if (Icinga::app()->getModuleManager()->hasEnabled('idoreports')) {
+            $name .= ' (Icinga DB)';
+        }
+
+        return $name;
+    }
+
+    protected function createReportData()
+    {
+        return (new ReportData())
+            ->setDimensions([t('Hostname'), t('Service Name')])
+            ->setValues([t('SLA in %')]);
+    }
+
+    protected function createReportRow($row)
+    {
+        if ($row->sla === null) {
+            return null;
+        }
+
+        return (new ReportRow())
+            ->setDimensions([$row->host->display_name, $row->display_name])
+            ->setValues([(float) $row->sla]);
+    }
+
+    protected function fetchSla(Timerange $timerange, Rule $filter = null)
+    {
+        $sla = Service::on($this->getDb())
+            ->columns([
+                'host.display_name',
+                'display_name',
+                'sla' => new Expression(sprintf(
+                    "get_sla_ok_percent(%s, %s, '%s', '%s')",
+                    'service.host_id',
+                    'service.id',
+                    $timerange->getStart()->format('Uv'),
+                    $timerange->getEnd()->format('Uv')
+                ))
+            ]);
+
+        $sla->resetOrderBy()->orderBy('host.display_name')->orderBy('display_name');
+
+        $this->applyRestrictions($sla);
+
+        if ($filter !== null) {
+            $sla->filter($filter);
+        }
+
+        return $sla;
+    }
+}
diff --git a/library/Icingadb/ProvidedHook/Reporting/SlaReport.php b/library/Icingadb/ProvidedHook/Reporting/SlaReport.php
new file mode 100644
index 0000000..b5898fd
--- /dev/null
+++ b/library/Icingadb/ProvidedHook/Reporting/SlaReport.php
@@ -0,0 +1,279 @@
+<?php
+
+/* Icinga DB Web | (c) 2022 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\ProvidedHook\Reporting;
+
+use DateInterval;
+use DatePeriod;
+use Icinga\Module\Icingadb\Common\Auth;
+use Icinga\Module\Icingadb\Common\Database;
+use Icinga\Module\Icingadb\Widget\EmptyState;
+use Icinga\Module\Reporting\Hook\ReportHook;
+use Icinga\Module\Reporting\ReportData;
+use Icinga\Module\Reporting\ReportRow;
+use Icinga\Module\Reporting\Timerange;
+use ipl\Html\Form;
+use ipl\Html\Html;
+use ipl\Stdlib\Filter\Rule;
+use ipl\Web\Filter\QueryString;
+
+use function ipl\I18n\t;
+
+/**
+ * Base class for host and service SLA reports
+ */
+abstract class SlaReport extends ReportHook
+{
+    use Auth;
+    use Database;
+
+    /** @var float If an SLA value is lower than the threshold, it is considered not ok */
+    const DEFAULT_THRESHOLD = 99.5;
+
+    /** @var int The amount of decimal places for the report result */
+    const DEFAULT_REPORT_PRECISION = 2;
+
+    /**
+     * Create and return a {@link ReportData} container
+     *
+     * @return ReportData Container initialized with the expected dimensions and value labels for the specific report
+     */
+    abstract protected function createReportData();
+
+    /**
+     * Create and return a {@link ReportRow}
+     *
+     * @param mixed $row Data for the row
+     *
+     * @return ReportRow|null Row with the dimensions and values for the specific report set according to the data
+     *                        expected in {@link createRepportData()} or null for no data
+     */
+    abstract protected function createReportRow($row);
+
+    /**
+     * Fetch SLA according to specified time range and filter
+     *
+     * @param Timerange $timerange
+     * @param Rule|null $filter
+     *
+     * @return iterable
+     */
+    abstract protected function fetchSla(Timerange $timerange, Rule $filter = null);
+
+    protected function fetchReportData(Timerange $timerange, array $config = null)
+    {
+        $rd = $this->createReportData();
+        $rows = [];
+
+        $filter = trim((string) $config['filter']) ?: '*';
+        $filter = $filter !== '*' ? QueryString::parse($filter) : null;
+
+        if (isset($config['breakdown']) && $config['breakdown'] !== 'none') {
+            switch ($config['breakdown']) {
+                case 'day':
+                    $interval = new DateInterval('P1D');
+                    $format = 'Y-m-d';
+                    $boundary = 'tomorrow midnight';
+
+                    break;
+                case 'week':
+                    $interval = new DateInterval('P1W');
+                    $format = 'Y-\WW';
+                    $boundary = 'monday next week midnight';
+
+                    break;
+                case 'month':
+                    $interval = new DateInterval('P1M');
+                    $format = 'Y-m';
+                    $boundary = 'first day of next month midnight';
+
+                    break;
+            }
+
+            $dimensions = $rd->getDimensions();
+            $dimensions[] = ucfirst($config['breakdown']);
+            $rd->setDimensions($dimensions);
+
+            foreach ($this->yieldTimerange($timerange, $interval, $boundary) as list($start, $end)) {
+                foreach ($this->fetchSla(new Timerange($start, $end), $filter) as $row) {
+                    $row = $this->createReportRow($row);
+
+                    if ($row === null) {
+                        continue;
+                    }
+
+                    $dimensions = $row->getDimensions();
+                    $dimensions[] = $start->format($format);
+                    $row->setDimensions($dimensions);
+
+                    $rows[] = $row;
+                }
+            }
+        } else {
+            foreach ($this->fetchSla($timerange, $filter) as $row) {
+                $rows[] = $this->createReportRow($row);
+            }
+        }
+
+        $rd->setRows($rows);
+
+        return $rd;
+    }
+
+    /**
+     * Yield start and end times that recur at the specified interval over the given time range
+     *
+     * @param Timerange    $timerange
+     * @param DateInterval $interval
+     * @param string|null  $boundary English text datetime description for calculating bounds to get
+     *                               calendar days, weeks or months instead of relative times according to interval
+     *
+     * @return \Generator
+     */
+    protected function yieldTimerange(Timerange $timerange, DateInterval $interval, $boundary = null)
+    {
+        $start = clone $timerange->getStart();
+        $end = clone $timerange->getEnd();
+        $oneSecond = new DateInterval('PT1S');
+
+        if ($boundary !== null) {
+            $intermediate = (clone $start)->modify($boundary);
+            if ($intermediate < $end) {
+                yield [clone $start, $intermediate->sub($oneSecond)];
+
+                $start->modify($boundary);
+            }
+        }
+
+        $period = new DatePeriod($start, $interval, $end, DatePeriod::EXCLUDE_START_DATE);
+
+        foreach ($period as $date) {
+            /** @var \DateTime $date */
+            yield [$start, (clone $date)->sub($oneSecond)];
+
+            $start = $date;
+        }
+
+        yield [$start, $end];
+    }
+
+    public function initConfigForm(Form $form)
+    {
+        $form->addElement('text', 'filter', [
+            'label' => t('Filter')
+        ]);
+
+        $form->addElement('select', 'breakdown', [
+            'label'   => t('Breakdown'),
+            'options' => [
+                'none'  => t('None', 'SLA Report Breakdown'),
+                'day'   => t('Day'),
+                'week'  => t('Week'),
+                'month' => t('Month')
+            ]
+        ]);
+
+        $form->addElement('number', 'threshold', [
+            'label'       => t('Threshold'),
+            'placeholder' => static::DEFAULT_THRESHOLD,
+            'step'        => '0.01',
+            'min'         => '1',
+            'max'         => '100'
+        ]);
+
+        $form->addElement('number', 'sla_precision', [
+            'label'       => t('Amount Decimal Places'),
+            'placeholder' => static::DEFAULT_REPORT_PRECISION,
+            'min'         => '1',
+            'max'         => '12'
+        ]);
+    }
+
+    public function getData(Timerange $timerange, array $config = null)
+    {
+        return $this->fetchReportData($timerange, $config);
+    }
+
+    public function getHtml(Timerange $timerange, array $config = null)
+    {
+        $data = $this->getData($timerange, $config);
+
+        if (! count($data)) {
+            return new EmptyState(t('No data found.'));
+        }
+
+        $threshold = isset($config['threshold']) ? (float) $config['threshold'] : static::DEFAULT_THRESHOLD;
+
+        $tableHeaderCells = [];
+
+        foreach ($data->getDimensions() as $dimension) {
+            $tableHeaderCells[] = Html::tag('th', null, $dimension);
+        }
+
+        foreach ($data->getValues() as $value) {
+            $tableHeaderCells[] = Html::tag('th', null, $value);
+        }
+
+        $tableRows = [];
+        $precision = $config['sla_precision'] ?? static::DEFAULT_REPORT_PRECISION;
+
+        foreach ($data->getRows() as $row) {
+            $cells = [];
+
+            foreach ($row->getDimensions() as $dimension) {
+                $cells[] = Html::tag('td', null, $dimension);
+            }
+
+            // We only have one metric
+            $sla = $row->getValues()[0];
+
+            if ($sla < $threshold) {
+                $slaClass = 'nok';
+            } else {
+                $slaClass = 'ok';
+            }
+
+            $cells[] = Html::tag('td', ['class' => "sla-column $slaClass"], round($sla, $precision));
+
+            $tableRows[] = Html::tag('tr', null, $cells);
+        }
+
+        // We only have one average
+        $average = $data->getAverages()[0];
+
+        if ($average < $threshold) {
+            $slaClass = 'nok';
+        } else {
+            $slaClass = 'ok';
+        }
+
+        $total = $this instanceof HostSlaReport
+            ? sprintf(t('Total (%d Hosts)'), $data->count())
+            : sprintf(t('Total (%d Services)'), $data->count());
+
+        $tableRows[] = Html::tag('tr', null, [
+            Html::tag('td', ['colspan' => count($data->getDimensions())], $total),
+            Html::tag('td', ['class' => "sla-column $slaClass"], round($average, $precision))
+        ]);
+
+        $table = Html::tag(
+            'table',
+            ['class' => 'common-table sla-table'],
+            [
+                Html::tag(
+                    'thead',
+                    null,
+                    Html::tag(
+                        'tr',
+                        null,
+                        $tableHeaderCells
+                    )
+                ),
+                Html::tag('tbody', null, $tableRows)
+            ]
+        );
+
+        return $table;
+    }
+}
diff --git a/library/Icingadb/ProvidedHook/X509/Sni.php b/library/Icingadb/ProvidedHook/X509/Sni.php
new file mode 100644
index 0000000..d6e1415
--- /dev/null
+++ b/library/Icingadb/ProvidedHook/X509/Sni.php
@@ -0,0 +1,57 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\ProvidedHook\X509;
+
+use Generator;
+use Icinga\Data\Filter\Filter;
+use Icinga\Module\Icingadb\Common\Auth;
+use Icinga\Module\Icingadb\Common\Database;
+use Icinga\Module\Icingadb\Model\Host;
+use Icinga\Module\X509\Hook\SniHook;
+use ipl\Web\Filter\QueryString;
+
+class Sni extends SniHook
+{
+    use Auth;
+    use Database;
+
+    /**
+     * @inheritDoc
+     */
+    public function getHosts(Filter $filter = null): Generator
+    {
+        $queryHost = Host::on($this->getDb());
+
+        $queryHost->getSelectBase();
+
+        $hostStatusCols = [
+            'host_name'      => 'name',
+            'host_address'   => 'address',
+            'host_address6'  => 'address6'
+        ];
+
+        $queryHost = $queryHost->columns($hostStatusCols);
+
+        $this->applyRestrictions($queryHost);
+
+        if ($filter !== null) {
+            $queryString = $filter->toQueryString();
+            $filterCondition = QueryString::parse($queryString);
+            $queryHost->filter($filterCondition);
+        }
+
+        $hosts = $this->getdb()->select($queryHost->assembleSelect());
+
+        foreach ($hosts as $host) {
+            if (! empty($host->host_address)) {
+                yield $host->host_address => $host->host_name;
+            }
+
+            if (! empty($host->host_address6)) {
+                yield $host->host_address6 => $host->host_name;
+            }
+        }
+    }
+}
diff --git a/library/Icingadb/Redis/VolatileStateResults.php b/library/Icingadb/Redis/VolatileStateResults.php
new file mode 100644
index 0000000..186022a
--- /dev/null
+++ b/library/Icingadb/Redis/VolatileStateResults.php
@@ -0,0 +1,164 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Redis;
+
+use Exception;
+use Generator;
+use Icinga\Application\Benchmark;
+use Icinga\Module\Icingadb\Common\IcingaRedis;
+use Icinga\Module\Icingadb\Model\Host;
+use Icinga\Module\Icingadb\Model\Service;
+use ipl\Orm\Query;
+use ipl\Orm\Resolver;
+use ipl\Orm\ResultSet;
+use Predis\Client;
+use RuntimeException;
+
+class VolatileStateResults extends ResultSet
+{
+    /** @var Resolver */
+    private $resolver;
+
+    /** @var Client */
+    private $redis;
+
+    /** @var bool Whether Redis updates were applied */
+    private $updatesApplied = false;
+
+    public static function fromQuery(Query $query)
+    {
+        $self = parent::fromQuery($query);
+        $self->resolver = $query->getResolver();
+
+        try {
+            $self->redis = IcingaRedis::instance()->getConnection();
+        } catch (Exception $e) {
+            // The error has already been logged
+        }
+
+        return $self;
+    }
+
+    /**
+     * Get whether Redis is unavailable
+     *
+     * @return bool
+     */
+    public function isRedisUnavailable(): bool
+    {
+        return $this->redis === null;
+    }
+
+    public function current()
+    {
+        if ($this->redis && ! $this->updatesApplied && ! $this->isCacheDisabled) {
+            $this->rewind();
+        }
+
+        return parent::current();
+    }
+
+    public function key(): int
+    {
+        if ($this->redis && ! $this->updatesApplied && ! $this->isCacheDisabled) {
+            $this->rewind();
+        }
+
+        return parent::key();
+    }
+
+    public function rewind(): void
+    {
+        if ($this->redis && ! $this->updatesApplied && ! $this->isCacheDisabled) {
+            $this->updatesApplied = true;
+            $this->advance();
+
+            Benchmark::measure('Applying Redis updates');
+            $this->applyRedisUpdates();
+            Benchmark::measure('Redis updates applied');
+        }
+
+        parent::rewind();
+    }
+
+    protected function applyRedisUpdates()
+    {
+        $type = null;
+        $behaviors = null;
+
+        $keys = [];
+        $hostStateKeys = [];
+
+        $states = [];
+        $hostStates = [];
+        foreach ($this as $row) {
+            if ($type === null) {
+                $behaviors = $this->resolver->getBehaviors($row->state);
+
+                switch (true) {
+                    case $row instanceof Host:
+                        $type = 'host';
+                        break;
+                    case $row instanceof Service:
+                        $type = 'service';
+                        break;
+                    default:
+                        throw new RuntimeException('Volatile states can only be fetched for hosts and services');
+                }
+            }
+
+            $states[bin2hex($row->id)] = $row->state;
+            if (empty($keys)) {
+                $keys = $row->state->getColumns();
+            }
+
+            if ($type === 'service' && $row->host instanceof Host) {
+                $hostStates[bin2hex($row->host->id)] = $row->host->state;
+                if (empty($hostStateKeys)) {
+                    $hostStateKeys = $row->host->state->getColumns();
+                }
+            }
+        }
+
+        if (empty($states)) {
+            return;
+        }
+
+        foreach ($this->fetchStates("icinga:{$type}:state", array_keys($states), $keys) as $id => $data) {
+            foreach ($data as $key => $value) {
+                $data[$key] = $behaviors->retrieveProperty($value, $key);
+            }
+
+            $states[$id]->setProperties($data);
+        }
+
+        if ($type === 'service' && ! empty($hostStates)) {
+            foreach ($this->fetchStates('icinga:host:state', array_keys($hostStates), $hostStateKeys) as $id => $data) {
+                foreach ($data as $key => $value) {
+                    $data[$key] = $behaviors->retrieveProperty($value, $key);
+                }
+
+                $hostStates[$id]->setProperties($data);
+            }
+        }
+    }
+
+    protected function fetchStates(string $key, array $ids, array $keys): Generator
+    {
+        $results = $this->redis->hmget($key, $ids);
+        foreach ($results as $i => $json) {
+            if ($json !== null) {
+                $data = json_decode($json, true);
+                $keyMap = array_fill_keys($keys, null);
+                unset($keyMap['is_overdue']); // Is calculated by Icinga DB, not Icinga 2, hence it's never in redis
+
+                // TODO: Remove once https://github.com/Icinga/icinga2/issues/9427 is fixed
+                $data['state_type'] = $data['state_type'] === 0 ? 'soft' : 'hard';
+
+                yield $ids[$i] => array_intersect_key(array_merge($keyMap, $data), $keyMap);
+            }
+        }
+    }
+}
diff --git a/library/Icingadb/Setup/ApiTransportPage.php b/library/Icingadb/Setup/ApiTransportPage.php
new file mode 100644
index 0000000..310933a
--- /dev/null
+++ b/library/Icingadb/Setup/ApiTransportPage.php
@@ -0,0 +1,127 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Setup;
+
+use Icinga\Data\ConfigObject;
+use Icinga\Module\Icingadb\Command\Transport\CommandTransport;
+use Icinga\Module\Icingadb\Command\Transport\CommandTransportException;
+use Icinga\Web\Form;
+
+class ApiTransportPage extends Form
+{
+    public function init()
+    {
+        $this->setName('setup_icingadb_api_transport');
+        $this->setTitle(t('Icinga 2 API'));
+        $this->addDescription(t(
+            'Please fill out the connection details to the Icinga 2 API.'
+        ));
+        $this->setValidatePartial(true);
+    }
+
+    public function createElements(array $formData)
+    {
+        if (isset($formData['skip_validation']) && $formData['skip_validation']) {
+            // In case another error occured and the checkbox was displayed before
+            $this->addSkipValidationCheckbox();
+        } else {
+            $this->addElement('hidden', 'skip_validation', ['value' => 0]);
+        }
+
+        $this->addElement('hidden', 'transport', [
+            'required'  => true,
+            'disabled'  => true,
+            'value'     => 'api'
+        ]);
+        $this->addElement('hidden', 'name', [
+            'required'  => true,
+            'disabled'  => true,
+            'value'     => 'icinga2'
+        ]);
+        $this->addElement('text', 'host', [
+            'required'      => true,
+            'label'         => t('Host'),
+            'description'   => t('Hostname or address of the Icinga master')
+        ]);
+        $this->addElement('number', 'port', [
+            'required'          => true,
+            'label'             => t('Port'),
+            'value'             => 5665,
+            'min'               => 1,
+            'max'               => 65536
+        ]);
+        $this->addElement('text', 'username', [
+            'required'      => true,
+            'label'         => t('API Username'),
+            'description'   => t('User to authenticate with using HTTP Basic Auth')
+        ]);
+        $this->addElement('password', 'password', [
+            'required'          => true,
+            'renderPassword'    => true,
+            'label'             => t('API Password')
+        ]);
+    }
+
+    public function isValid($formData)
+    {
+        if (! parent::isValid($formData)) {
+            return false;
+        }
+
+        if (! isset($formData['skip_validation']) || !$formData['skip_validation']) {
+            if (! $this->validateConfiguration()) {
+                $this->addSkipValidationCheckbox();
+                return false;
+            }
+        }
+
+        return true;
+    }
+
+    public function isValidPartial(array $formData)
+    {
+        if (isset($formData['backend_validation']) && parent::isValid($formData)) {
+            if (! $this->validateConfiguration()) {
+                return false;
+            }
+
+            $this->info(t('The configuration has been successfully validated.'));
+        } elseif (! isset($formData['backend_validation'])) {
+            // This is usually done by isValid(Partial), but as we're not calling any of these...
+            $this->populate($formData);
+        }
+
+        return true;
+    }
+
+    protected function validateConfiguration(): bool
+    {
+        try {
+            CommandTransport::createTransport(new ConfigObject($this->getValues()))->probe();
+        } catch (CommandTransportException $e) {
+            $this->error(sprintf(
+                t('Failed to successfully validate the configuration: %s'),
+                $e->getMessage()
+            ));
+
+            return false;
+        }
+
+        return true;
+    }
+
+    protected function addSkipValidationCheckbox()
+    {
+        $this->addElement(
+            'checkbox',
+            'skip_validation',
+            [
+                'ignore'        => true,
+                'label'         => t('Skip Validation'),
+                'description'   => t('Check this to not to validate the configuration')
+            ]
+        );
+    }
+}
diff --git a/library/Icingadb/Setup/ApiTransportStep.php b/library/Icingadb/Setup/ApiTransportStep.php
new file mode 100644
index 0000000..1e2e905
--- /dev/null
+++ b/library/Icingadb/Setup/ApiTransportStep.php
@@ -0,0 +1,102 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Setup;
+
+use Exception;
+use Icinga\Application\Config;
+use Icinga\Exception\IcingaException;
+use Icinga\Module\Setup\Step;
+use ipl\Html\Attributes;
+use ipl\Html\HtmlDocument;
+use ipl\Html\HtmlElement;
+use ipl\Html\Table;
+use ipl\Html\Text;
+
+class ApiTransportStep extends Step
+{
+    /** @var array */
+    protected $data;
+
+    /** @var Exception */
+    protected $error;
+
+    public function __construct(array $data)
+    {
+        $this->data = $data;
+    }
+
+    public function apply()
+    {
+        $transportConfig = $this->data;
+        $transportName = $transportConfig['name'];
+        unset($transportConfig['name']);
+
+        try {
+            $config = Config::module('icingadb', 'commandtransports', true);
+            $config->setSection($transportName, $transportConfig);
+            $config->saveIni();
+        } catch (Exception $e) {
+            $this->error = $e;
+            return false;
+        }
+
+        return true;
+    }
+
+    public function getSummary()
+    {
+        $description = new HtmlElement('p', null, Text::create(mt(
+            'icingadb',
+            'The Icinga 2 API will be accessed using the following connection details:'
+        )));
+
+        $apiOptions = new Table();
+        $apiOptions->addHtml(Table::row([
+            new HtmlElement('strong', null, Text::create(t('Host'))),
+            $this->data['host']
+        ]));
+        $apiOptions->addHtml(Table::row([
+            new HtmlElement('strong', null, Text::create(t('Port'))),
+            $this->data['port']
+        ]));
+        $apiOptions->addHtml(Table::row([
+            new HtmlElement('strong', null, Text::create(t('Username'))),
+            $this->data['username']
+        ]));
+        $apiOptions->addHtml(Table::row([
+            new HtmlElement('strong', null, Text::create(t('Password'))),
+            str_repeat('*', strlen($this->data['password']))
+        ]));
+
+        $topic = new HtmlElement('div', Attributes::create(['class' => 'topic']));
+        $topic->addHtml($description, $apiOptions);
+
+        $summary = new HtmlDocument();
+        $summary->addHtml(
+            new HtmlElement('h2', null, Text::create(mt('icingadb', 'Icinga 2 API'))),
+            $topic
+        );
+
+        return $summary->render();
+    }
+
+    public function getReport()
+    {
+        if ($this->error === null) {
+            return [sprintf(
+                mt('icingadb', 'Commandtransport configuration update successful: %s'),
+                Config::module('icingadb', 'commandtransports')->getConfigFile()
+            )];
+        } else {
+            return [
+                sprintf(
+                    mt('icingadb', 'Commandtransport configuration update failed: %s'),
+                    Config::module('icingadb', 'commandtransports')->getConfigFile()
+                ),
+                sprintf(mt('setup', 'ERROR: %s'), IcingaException::describe($this->error))
+            ];
+        }
+    }
+}
diff --git a/library/Icingadb/Setup/DbResourcePage.php b/library/Icingadb/Setup/DbResourcePage.php
new file mode 100644
index 0000000..cc99dcc
--- /dev/null
+++ b/library/Icingadb/Setup/DbResourcePage.php
@@ -0,0 +1,145 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Setup;
+
+use Icinga\Forms\Config\ResourceConfigForm;
+use Icinga\Forms\Config\Resource\DbResourceForm;
+use Icinga\Web\Form;
+
+class DbResourcePage extends Form
+{
+    public function init()
+    {
+        $this->setName('setup_icingadb_resource');
+        $this->setTitle(t('Icinga DB Resource'));
+        $this->addDescription(t(
+            'Please fill out the connection details below to access Icinga DB.'
+        ));
+        $this->setValidatePartial(true);
+    }
+
+    public function createElements(array $formData)
+    {
+        $this->addElement(
+            'hidden',
+            'type',
+            [
+                'required'  => true,
+                'disabled'  => true,
+                'value'     => 'db'
+            ]
+        );
+
+        if (isset($formData['skip_validation']) && $formData['skip_validation']) {
+            // In case another error occured and the checkbox was displayed before
+            $this->addSkipValidationCheckbox();
+        } else {
+            $this->addElement('hidden', 'skip_validation', ['value' => 0]);
+        }
+
+        $dbResourceForm = new DbResourceForm();
+        $this->addElements($dbResourceForm->createElements($formData)->getElements());
+        $this->getElement('name')->setValue('icingadb');
+        $this->getElement('db')->setMultiOptions([
+            'mysql' => 'MySQL',
+            'pgsql' => 'PostgreSQL'
+        ]);
+
+        $this->removeElement('name');
+        $this->addElement(
+            'hidden',
+            'name',
+            [
+                'required'  => true,
+                'disabled'  => true,
+                'value'     => 'icingadb'
+            ]
+        );
+
+        if (! isset($formData['db']) || $formData['db'] === 'mysql') {
+            $this->getElement('charset')->setValue('utf8mb4');
+        }
+    }
+
+    public function isValid($formData)
+    {
+        if (! parent::isValid($formData)) {
+            return false;
+        }
+
+        if (! isset($formData['skip_validation']) || !$formData['skip_validation']) {
+            if (! $this->validateConfiguration()) {
+                $this->addSkipValidationCheckbox();
+                return false;
+            }
+        }
+
+        return true;
+    }
+
+    public function isValidPartial(array $formData)
+    {
+        if (isset($formData['backend_validation']) && parent::isValid($formData)) {
+            if (! $this->validateConfiguration(true)) {
+                return false;
+            }
+
+            $this->info(t('The configuration has been successfully validated.'));
+        } elseif (! isset($formData['backend_validation'])) {
+            // This is usually done by isValid(Partial), but as we're not calling any of these...
+            $this->populate($formData);
+        }
+
+        return true;
+    }
+
+    protected function validateConfiguration(bool $showLog = false): bool
+    {
+        $inspection = ResourceConfigForm::inspectResource($this);
+        if ($inspection !== null) {
+            if ($showLog) {
+                $join = function ($e) use (&$join) {
+                    return is_string($e) ? $e : join("\n", array_map($join, $e));
+                };
+                $this->addElement(
+                    'note',
+                    'inspection_output',
+                    [
+                        'order'         => 0,
+                        'value'         => '<strong>' . t('Validation Log') . "</strong>\n\n"
+                            . join("\n", array_map($join, $inspection->toArray())),
+                        'decorators'    => [
+                            'ViewHelper',
+                            ['HtmlTag', ['tag' => 'pre', 'class' => 'log-output']],
+                        ]
+                    ]
+                );
+            }
+
+            if ($inspection->hasError()) {
+                $this->error(sprintf(
+                    t('Failed to successfully validate the configuration: %s'),
+                    $inspection->getError()
+                ));
+                return false;
+            }
+        }
+
+        return true;
+    }
+
+    protected function addSkipValidationCheckbox()
+    {
+        $this->addElement(
+            'checkbox',
+            'skip_validation',
+            [
+                'ignore'        => true,
+                'label'         => t('Skip Validation'),
+                'description'   => t('Check this to not to validate the configuration')
+            ]
+        );
+    }
+}
diff --git a/library/Icingadb/Setup/DbResourceStep.php b/library/Icingadb/Setup/DbResourceStep.php
new file mode 100644
index 0000000..970d367
--- /dev/null
+++ b/library/Icingadb/Setup/DbResourceStep.php
@@ -0,0 +1,148 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Setup;
+
+use Exception;
+use Icinga\Application\Config;
+use Icinga\Exception\IcingaException;
+use Icinga\Module\Setup\Step;
+use ipl\Html\Attributes;
+use ipl\Html\HtmlDocument;
+use ipl\Html\HtmlElement;
+use ipl\Html\Table;
+use ipl\Html\Text;
+
+class DbResourceStep extends Step
+{
+    /** @var array */
+    protected $data;
+
+    /** @var Exception */
+    protected $error;
+
+    public function __construct(array $data)
+    {
+        $this->data = $data;
+    }
+
+    public function apply()
+    {
+        $resourceConfig = $this->data;
+        $resourceName = $resourceConfig['name'];
+        unset($resourceConfig['name']);
+
+        try {
+            $config = Config::app('resources', true);
+            $config->setSection($resourceName, $resourceConfig);
+            $config->saveIni();
+        } catch (Exception $e) {
+            $this->error = $e;
+            return false;
+        }
+
+        try {
+            $config = Config::module('icingadb', 'config', true);
+            $config->setSection('icingadb', ['resource' => $resourceName]);
+            $config->saveIni();
+        } catch (Exception $e) {
+            $this->error = $e;
+            return false;
+        }
+
+        return true;
+    }
+
+    public function getSummary()
+    {
+        $description = new HtmlElement('p', null, Text::create(mt(
+            'icingadb',
+            'Icinga DB will be accessed using the following connection details:'
+        )));
+
+        $resourceOptions = new Table();
+        $resourceOptions->addHtml(Table::row([
+            new HtmlElement('strong', null, Text::create(t('Host'))),
+            $this->data['host']
+        ]));
+        $resourceOptions->addHtml(Table::row([
+            new HtmlElement('strong', null, Text::create(t('Port'))),
+            $this->data['port'] ?: ($this->data['db'] === 'mysql' ? 3306 : 5432)
+        ]));
+        $resourceOptions->addHtml(Table::row([
+            new HtmlElement('strong', null, Text::create(t('Database'))),
+            $this->data['dbname']
+        ]));
+        $resourceOptions->addHtml(Table::row([
+            new HtmlElement('strong', null, Text::create(t('Username'))),
+            $this->data['username']
+        ]));
+        $resourceOptions->addHtml(Table::row([
+            new HtmlElement('strong', null, Text::create(t('Password'))),
+            str_repeat('*', strlen($this->data['password']))
+        ]));
+        $resourceOptions->addHtml(Table::row([
+            new HtmlElement('strong', null, Text::create(t('Charset'))),
+            $this->data['charset']
+        ]));
+
+        if (isset($this->data['use_ssl']) && $this->data['use_ssl']) {
+            $resourceOptions->addHtml(Table::row([
+                new HtmlElement('strong', null, Text::create(t('SSL Do Not Verify Server Certificate'))),
+                isset($this->data['ssl_do_not_verify_server_cert']) && $this->data['ssl_do_not_verify_server_cert']
+                    ? t('Yes')
+                    : t('No')
+            ]));
+            $resourceOptions->addHtml(Table::row([
+                new HtmlElement('strong', null, Text::create(t('SSL Key'))),
+                $this->data['ssl_key'] ?: mt('icingadb', 'None', 'non-existence of a value')
+            ]));
+            $resourceOptions->addHtml(Table::row([
+                new HtmlElement('strong', null, Text::create(t('SSL Certificate'))),
+                $this->data['ssl_cert'] ?: mt('icingadb', 'None', 'non-existence of a value')
+            ]));
+            $resourceOptions->addHtml(Table::row([
+                new HtmlElement('strong', null, Text::create(t('SSL CA'))),
+                $this->data['ssl_ca'] ?: mt('icingadb', 'None', 'non-existence of a value')
+            ]));
+            $resourceOptions->addHtml(Table::row([
+                new HtmlElement('strong', null, Text::create(t('The CA certificate file path'))),
+                $this->data['ssl_capath'] ?: mt('icingadb', 'None', 'non-existence of a value')
+            ]));
+            $resourceOptions->addHtml(Table::row([
+                new HtmlElement('strong', null, Text::create(t('SSL CA Path'))),
+                $this->data['ssl_cipher'] ?: mt('icingadb', 'None', 'non-existence of a value')
+            ]));
+        }
+
+        $topic = new HtmlElement('div', Attributes::create(['class' => 'topic']));
+        $topic->addHtml($description, $resourceOptions);
+
+        $summary = new HtmlDocument();
+        $summary->addHtml(
+            new HtmlElement('h2', null, Text::create(mt('icingadb', 'Icinga DB Resource'))),
+            $topic
+        );
+
+        return $summary->render();
+    }
+
+    public function getReport()
+    {
+        if ($this->error === null) {
+            return [sprintf(
+                mt('icingadb', 'Resource configuration update successful: %s'),
+                Config::resolvePath('resources.ini')
+            )];
+        } else {
+            return [
+                sprintf(
+                    mt('icingadb', 'Resource configuration update failed: %s'),
+                    Config::resolvePath('resources.ini')
+                ),
+                sprintf(mt('setup', 'ERROR: %s'), IcingaException::describe($this->error))
+            ];
+        }
+    }
+}
diff --git a/library/Icingadb/Setup/IcingaDbWizard.php b/library/Icingadb/Setup/IcingaDbWizard.php
new file mode 100644
index 0000000..2ad514a
--- /dev/null
+++ b/library/Icingadb/Setup/IcingaDbWizard.php
@@ -0,0 +1,86 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Setup;
+
+use Icinga\Module\Setup\Forms\SummaryPage;
+use Icinga\Module\Setup\Requirement\PhpModuleRequirement;
+use Icinga\Module\Setup\Requirement\PhpVersionRequirement;
+use Icinga\Module\Setup\Requirement\WebLibraryRequirement;
+use Icinga\Module\Setup\RequirementSet;
+use Icinga\Module\Setup\Setup;
+use Icinga\Module\Setup\SetupWizard;
+use Icinga\Web\Form;
+use Icinga\Web\Request;
+use Icinga\Web\Wizard;
+
+class IcingaDbWizard extends Wizard implements SetupWizard
+{
+    protected function init()
+    {
+        $this->addPage(new WelcomePage());
+        $this->addPage(new DbResourcePage());
+        $this->addPage(new RedisPage());
+        $this->addPage(new ApiTransportPage());
+        $this->addPage(new SummaryPage(['name' => 'setup_icingadb_summary']));
+    }
+
+    public function setupPage(Form $page, Request $request)
+    {
+        if ($page->getName() === 'setup_icingadb_summary') {
+            $page->setSummary($this->getSetup()->getSummary());
+            $page->setSubjectTitle('Icinga DB Web');
+        }
+    }
+
+    public function getSetup()
+    {
+        $pageData = $this->getPageData();
+        $setup = new Setup();
+
+        $setup->addStep(new DbResourceStep($pageData['setup_icingadb_resource']));
+        $setup->addStep(new RedisStep($pageData['setup_icingadb_redis']));
+        $setup->addStep(new ApiTransportStep($pageData['setup_icingadb_api_transport']));
+
+        return $setup;
+    }
+
+    public function getRequirements()
+    {
+        $set = new RequirementSet();
+
+        $set->add(new PhpVersionRequirement([
+            'condition'     => ['>=', '7.2'],
+            'description'   => sprintf(t('Icinga DB Web requires PHP version %s.'), '7.2')
+        ]));
+
+        $set->add(new WebLibraryRequirement([
+            'condition'     => ['icinga-php-library', '>=', '0.9.0'],
+            'alias'         => 'Icinga PHP library',
+            'description'   => t('The Icinga PHP library (IPL) is required for Icinga DB Web')
+        ]));
+
+        $set->add(new WebLibraryRequirement([
+            'condition'     => ['icinga-php-thirdparty', '>=', '0.11.0'],
+            'alias'         => 'Icinga PHP Thirdparty',
+            'description'   => t('The Icinga PHP Thirdparty library is required for Icinga DB Web')
+        ]));
+
+        $set->add(new PhpModuleRequirement([
+            'condition'     => 'libxml',
+            'alias'         => 'libxml',
+            'description'   => t('For check plugins that output HTML the libxml extension is required')
+        ]));
+
+        $set->add(new PhpModuleRequirement([
+            'condition'     => 'curl',
+            'alias'         => 'cURL',
+            'description'   => t(
+                'To send external commands over Icinga 2\'s API, the cURL module for PHP is required.'
+            )
+        ]));
+
+        return $set;
+    }
+}
diff --git a/library/Icingadb/Setup/RedisPage.php b/library/Icingadb/Setup/RedisPage.php
new file mode 100644
index 0000000..3c0a741
--- /dev/null
+++ b/library/Icingadb/Setup/RedisPage.php
@@ -0,0 +1,68 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Setup;
+
+use Icinga\Module\Icingadb\Forms\RedisConfigForm;
+use Icinga\Web\Form;
+
+class RedisPage extends Form
+{
+    public function init()
+    {
+        $this->setName('setup_icingadb_redis');
+        $this->setTitle(t('Icinga DB Redis'));
+        $this->addDescription(t(
+            'Please fill out the connection details to access the Icinga DB Redis.'
+        ));
+        $this->setValidatePartial(true);
+    }
+
+    public function createElements(array $formData)
+    {
+        $redisConfigForm = new RedisConfigForm();
+        $redisConfigForm->createElements($formData);
+        if (isset($formData['redis_tls']) && $formData['redis_tls']) {
+            $redisConfigForm->getElement('redis_ca_pem')->setIgnore(false);
+            $redisConfigForm->getElement('redis_cert_pem')->setIgnore(false);
+            $redisConfigForm->getElement('redis_key_pem')->setIgnore(false);
+        }
+
+        $this->addElements($redisConfigForm->getElements());
+        $this->addDisplayGroups($redisConfigForm->getDisplayGroups());
+    }
+
+    public function isValid($formData)
+    {
+        if (! parent::isValid($formData)) {
+            return false;
+        }
+
+        if (($el = $this->getElement('skip_validation')) === null || ! $el->isChecked()) {
+            if (! RedisConfigForm::checkRedis($this)) {
+                if ($el === null) {
+                    RedisConfigForm::addSkipValidationCheckbox($this);
+                    RedisConfigForm::addInsecureCheckboxIfTls($this);
+                }
+
+                return false;
+            }
+        }
+
+        return true;
+    }
+
+    public function isValidPartial(array $formData)
+    {
+        if (! parent::isValidPartial($formData)) {
+            return false;
+        }
+
+        if (isset($formData['backend_validation'])) {
+            return RedisConfigForm::checkRedis($this);
+        }
+
+        return true;
+    }
+}
diff --git a/library/Icingadb/Setup/RedisStep.php b/library/Icingadb/Setup/RedisStep.php
new file mode 100644
index 0000000..97e50e0
--- /dev/null
+++ b/library/Icingadb/Setup/RedisStep.php
@@ -0,0 +1,205 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Setup;
+
+use Exception;
+use Icinga\Application\Config;
+use Icinga\Application\Icinga;
+use Icinga\Exception\IcingaException;
+use Icinga\Exception\NotWritableError;
+use Icinga\File\Storage\LocalFileStorage;
+use Icinga\Module\Setup\Step;
+use ipl\Html\Attributes;
+use ipl\Html\HtmlDocument;
+use ipl\Html\HtmlElement;
+use ipl\Html\Table;
+use ipl\Html\Text;
+
+class RedisStep extends Step
+{
+    /** @var array */
+    protected $data;
+
+    /** @var Exception */
+    protected $error;
+
+    public function __construct(array $data)
+    {
+        $this->data = $data;
+    }
+
+    public function apply()
+    {
+        $moduleConfig = [
+            'redis'  => [
+                'tls' => 0
+            ]
+        ];
+        $redisConfig = [
+            'redis1' => [
+                'host'      => $this->data['redis1_host'],
+                'port'      => $this->data['redis1_port'] ?: null,
+                'password'  => $this->data['redis1_password'] ?: null
+            ]
+        ];
+        if (isset($this->data['redis2_host']) && $this->data['redis2_host']) {
+            $redisConfig['redis2'] = [
+                'host'      => $this->data['redis2_host'],
+                'port'      => $this->data['redis2_port'] ?: null,
+                'password'  => $this->data['redis2_password'] ?: null
+            ];
+        }
+
+        if (isset($this->data['redis_tls']) && $this->data['redis_tls']) {
+            $moduleConfig['redis']['tls'] = 1;
+            if (isset($this->data['redis_insecure']) && $this->data['redis_insecure']) {
+                $moduleConfig['redis']['insecure'] = 1;
+            }
+
+            $storage = new LocalFileStorage(Icinga::app()->getStorageDir(
+                join(DIRECTORY_SEPARATOR, ['modules', 'icingadb', 'redis'])
+            ));
+            foreach (['ca', 'cert', 'key'] as $name) {
+                $textareaName = 'redis_' . $name . '_pem';
+                if (isset($this->data[$textareaName]) && $this->data[$textareaName]) {
+                    $pem = $this->data[$textareaName];
+                    $pemFile = md5($pem) . '-' . $name . '.pem';
+                    if (! $storage->has($pemFile)) {
+                        try {
+                            $storage->create($pemFile, $pem);
+                        } catch (NotWritableError $e) {
+                            $this->error = $e;
+                            return false;
+                        }
+                    }
+
+                    $moduleConfig['redis'][$name] = $storage->resolvePath($pemFile);
+                }
+            }
+        }
+
+        try {
+            $config = Config::module('icingadb', 'config', true);
+            foreach ($moduleConfig as $section => $options) {
+                $config->setSection($section, $options);
+            }
+
+            $config->saveIni();
+
+            $config = Config::module('icingadb', 'redis', true);
+            foreach ($redisConfig as $section => $options) {
+                $config->setSection($section, $options);
+            }
+
+            $config->saveIni();
+        } catch (Exception $e) {
+            $this->error = $e;
+            return false;
+        }
+
+        return true;
+    }
+
+    public function getSummary()
+    {
+        $topic = new HtmlElement('div', Attributes::create(['class' => 'topic']));
+        $topic->addHtml(new HtmlElement('p', null, Text::create(mt(
+            'icingadb',
+            'The Icinga DB Redis will be accessed using the following connection details:'
+        ))));
+
+        $primaryOptions = new Table();
+        $primaryOptions->addHtml(Table::row([
+            new HtmlElement('strong', null, Text::create(t('Host'))),
+            $this->data['redis1_host']
+        ]));
+        $primaryOptions->addHtml(Table::row([
+            new HtmlElement('strong', null, Text::create(t('Port'))),
+            $this->data['redis1_port'] ?: 6380
+        ]));
+        $primaryOptions->addHtml(Table::row([
+            new HtmlElement('strong', null, Text::create(t('Password'))),
+            $this->data['redis1_password'] ?: mt('icingadb', 'None', 'non-existence of a value')
+        ]));
+
+        if (isset($this->data['redis2_host']) && $this->data['redis2_host']) {
+            $topic->addHtml(
+                new HtmlElement('h3', null, Text::create(mt('icingadb', 'Primary'))),
+                $primaryOptions
+            );
+
+            $secondaryOptions = new Table();
+            $secondaryOptions->addHtml(Table::row([
+                new HtmlElement('strong', null, Text::create(t('Host'))),
+                $this->data['redis2_host']
+            ]));
+            $secondaryOptions->addHtml(Table::row([
+                new HtmlElement('strong', null, Text::create(t('Port'))),
+                $this->data['redis2_port'] ?: 6380
+            ]));
+            $secondaryOptions->addHtml(Table::row([
+                new HtmlElement('strong', null, Text::create(t('Password'))),
+                $this->data['redis2_password'] ?: mt('icingadb', 'None', 'non-existence of a value')
+            ]));
+
+            $topic->addHtml(
+                new HtmlElement('h3', null, Text::create(mt('icingadb', 'Secondary'))),
+                $secondaryOptions
+            );
+        } else {
+            $topic->addHtml($primaryOptions);
+        }
+
+        $tlsOptions = new Table();
+        $topic->addHtml($tlsOptions);
+        if (isset($this->data['redis_tls']) && $this->data['redis_tls']) {
+            if (isset($this->data['redis_cert_pem']) && $this->data['redis_cert_pem']) {
+                $tlsOptions->addHtml(Table::row([
+                    new HtmlElement('strong', null, Text::create('TLS')),
+                    Text::create(
+                        t('Icinga DB Web will authenticate against Redis with a client'
+                          . ' certificate and private key over a secured connection')
+                    )
+                ]));
+            } else {
+                $tlsOptions->addHtml(Table::row([
+                    new HtmlElement('strong', null, Text::create('TLS')),
+                    Text::create(t('Icinga DB Web will use secured Redis connections'))
+                ]));
+            }
+        } else {
+            $tlsOptions->addHtml(Table::row([
+                new HtmlElement('strong', null, Text::create('TLS')),
+                Text::create(t('No'))
+            ]));
+        }
+
+        $summary = new HtmlDocument();
+        $summary->addHtml(
+            new HtmlElement('h2', null, Text::create(mt('icingadb', 'Icinga DB Redis'))),
+            $topic
+        );
+
+        return $summary->render();
+    }
+
+    public function getReport()
+    {
+        if ($this->error === null) {
+            return [sprintf(
+                mt('icingadb', 'Module configuration update successful: %s'),
+                Config::module('icingab')->getConfigFile()
+            )];
+        } else {
+            return [
+                sprintf(
+                    mt('icingadb', 'Module configuration update failed: %s'),
+                    Config::module('icingab')->getConfigFile()
+                ),
+                sprintf(mt('setup', 'ERROR: %s'), IcingaException::describe($this->error))
+            ];
+        }
+    }
+}
diff --git a/library/Icingadb/Setup/WelcomePage.php b/library/Icingadb/Setup/WelcomePage.php
new file mode 100644
index 0000000..9f97c7d
--- /dev/null
+++ b/library/Icingadb/Setup/WelcomePage.php
@@ -0,0 +1,56 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Setup;
+
+use Icinga\Web\Form;
+
+class WelcomePage extends Form
+{
+    public function init()
+    {
+        $this->setName('setup_icingadb_welcome');
+    }
+
+    public function createElements(array $formData)
+    {
+        $this->addElement(
+            'note',
+            'welcome',
+            array(
+                'value'         => t(
+                    'Welcome to the configuration of Icinga DB Web!'
+                ),
+                'decorators'    => array(
+                    'ViewHelper',
+                    array('HtmlTag', array('tag' => 'h2'))
+                )
+            )
+        );
+
+        $this->addElement(
+            'note',
+            'description_1',
+            array(
+                'value'         => '<p>' . t(
+                    'Icinga DB Web is the UI for Icinga DB and provides'
+                    . ' a graphical interface to your monitoring environment.'
+                ) . '</p>',
+                'decorators'    => array('ViewHelper')
+            )
+        );
+
+        $this->addElement(
+            'note',
+            'description_2',
+            array(
+                'value'         => '<p>' . t(
+                    'The wizard will guide you through the configuration to'
+                    . ' establish a connection with Icinga DB and Icinga 2.'
+                ) . '</p>',
+                'decorators'    => array('ViewHelper')
+            )
+        );
+    }
+}
diff --git a/library/Icingadb/Util/FeatureStatus.php b/library/Icingadb/Util/FeatureStatus.php
new file mode 100644
index 0000000..94bf6d4
--- /dev/null
+++ b/library/Icingadb/Util/FeatureStatus.php
@@ -0,0 +1,50 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Util;
+
+use ArrayObject;
+use Icinga\Module\Icingadb\Command\Object\ToggleObjectFeatureCommand;
+
+class FeatureStatus extends ArrayObject
+{
+    public function __construct(string $type, $summary)
+    {
+        $prefix = "{$type}s";
+
+        $featureStatus = [
+            ToggleObjectFeatureCommand::FEATURE_ACTIVE_CHECKS =>
+                $this->getFeatureStatus('active_checks_enabled', $prefix, $summary),
+            ToggleObjectFeatureCommand::FEATURE_PASSIVE_CHECKS =>
+                $this->getFeatureStatus('passive_checks_enabled', $prefix, $summary),
+            ToggleObjectFeatureCommand::FEATURE_NOTIFICATIONS =>
+                $this->getFeatureStatus('notifications_enabled', $prefix, $summary),
+            ToggleObjectFeatureCommand::FEATURE_EVENT_HANDLER =>
+                $this->getFeatureStatus('event_handler_enabled', $prefix, $summary),
+            ToggleObjectFeatureCommand::FEATURE_FLAP_DETECTION =>
+                $this->getFeatureStatus('flapping_enabled', $prefix, $summary)
+        ];
+
+        parent::__construct($featureStatus, ArrayObject::ARRAY_AS_PROPS);
+    }
+
+    protected function getFeatureStatus(string $feature, string $prefix, $summary): int
+    {
+        $key = "{$prefix}_{$feature}";
+        $value = (int) $summary->$key;
+
+        if ($value === 0) {
+            return 0;
+        }
+
+        $totalKey = "{$prefix}_total";
+        $total = (int) $summary->$totalKey;
+
+        if ($value === $total) {
+            return 1;
+        }
+
+        return 2;
+    }
+}
diff --git a/library/Icingadb/Util/ObjectSuggestionsCursor.php b/library/Icingadb/Util/ObjectSuggestionsCursor.php
new file mode 100644
index 0000000..0013b35
--- /dev/null
+++ b/library/Icingadb/Util/ObjectSuggestionsCursor.php
@@ -0,0 +1,25 @@
+<?php
+
+/* Icinga DB Web | (c) 2022 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Util;
+
+use ipl\Sql\Cursor;
+use Iterator;
+
+class ObjectSuggestionsCursor extends Cursor
+{
+    public function getIterator(): \Traversable
+    {
+        foreach (parent::getIterator() as $key => $value) {
+            // TODO(lippserd): This is a quick and dirty fix for PostgreSQL binary datatypes for which PDO returns
+            // PHP resources that would cause exceptions since resources are not a valid type for attribute values.
+            // We need to do it this way as the suggestion implementation bypasses ORM behaviors here and there.
+            if (is_resource($value)) {
+                $value = stream_get_contents($value);
+            }
+
+            yield $key => $value;
+        }
+    }
+}
diff --git a/library/Icingadb/Util/PerfData.php b/library/Icingadb/Util/PerfData.php
new file mode 100644
index 0000000..2d83c54
--- /dev/null
+++ b/library/Icingadb/Util/PerfData.php
@@ -0,0 +1,642 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Util;
+
+use Icinga\Module\Icingadb\Common\ServiceStates;
+use Icinga\Web\Widget\Chart\InlinePie;
+use InvalidArgumentException;
+use LogicException;
+
+class PerfData
+{
+    const PERFDATA_OK = 'ok';
+    const PERFDATA_WARNING = 'warning';
+    const PERFDATA_CRITICAL = 'critical';
+
+    /**
+     * The performance data value being parsed
+     *
+     * @var string
+     */
+    protected $perfdataValue;
+
+    /**
+     * Unit of measurement (UOM)
+     *
+     * @var string
+     */
+    protected $unit;
+
+    /**
+     * The label
+     *
+     * @var string
+     */
+    protected $label;
+
+    /**
+     * The value
+     *
+     * @var float
+     */
+    protected $value;
+
+    /**
+     * The minimum value
+     *
+     * @var float
+     */
+    protected $minValue;
+
+    /**
+     * The maximum value
+     *
+     * @var float
+     */
+    protected $maxValue;
+
+    /**
+     * The WARNING threshold
+     *
+     * @var ThresholdRange
+     */
+    protected $warningThreshold;
+
+    /**
+     * The CRITICAL threshold
+     *
+     * @var ThresholdRange
+     */
+    protected $criticalThreshold;
+
+    /**
+     * Create a new PerfData object based on the given performance data label and value
+     *
+     * @param   string      $label      The perfdata label
+     * @param   string      $value      The perfdata value
+     */
+    public function __construct(string $label, string $value)
+    {
+        $this->perfdataValue = $value;
+        $this->label = $label;
+        $this->parse();
+
+        if ($this->unit === '%') {
+            if ($this->minValue === null) {
+                $this->minValue = 0.0;
+            }
+            if ($this->maxValue === null) {
+                $this->maxValue = 100.0;
+            }
+        }
+
+        $warn = $this->warningThreshold->getMax();
+        if ($warn !== null) {
+            $crit = $this->criticalThreshold->getMax();
+            if ($crit !== null && $warn > $crit) {
+                $this->warningThreshold->setInverted();
+                $this->criticalThreshold->setInverted();
+            }
+        }
+    }
+
+    /**
+     * Return a new PerfData object based on the given performance data key=value pair
+     *
+     * @param   string      $perfdata       The key=value pair to parse
+     *
+     * @return  PerfData
+     *
+     * @throws  InvalidArgumentException    In case the given performance data has no content or a invalid format
+     */
+    public static function fromString(string $perfdata): self
+    {
+        if (empty($perfdata)) {
+            throw new InvalidArgumentException('PerfData::fromString expects a string with content');
+        } elseif (strpos($perfdata, '=') === false) {
+            throw new InvalidArgumentException(
+                'PerfData::fromString expects a key=value formatted string. Got "' . $perfdata . '" instead'
+            );
+        }
+
+        list($label, $value) = explode('=', $perfdata, 2);
+        return new static(trim($label), trim($value));
+    }
+
+    /**
+     * Return whether this performance data's value is a number
+     *
+     * @return  bool    True in case it's a number, otherwise False
+     */
+    public function isNumber(): bool
+    {
+        return $this->unit === null;
+    }
+
+    /**
+     * Return whether this performance data's value are seconds
+     *
+     * @return  bool    True in case it's seconds, otherwise False
+     */
+    public function isSeconds(): bool
+    {
+        return $this->unit === 's';
+    }
+
+    /**
+     * Return whether this performance data's value is a temperature
+     *
+     * @return  bool    True in case it's temperature, otherwise False
+     */
+    public function isTemperature(): bool
+    {
+        return in_array($this->unit, array('C', 'F', 'K'));
+    }
+
+    /**
+     * Return whether this performance data's value is in percentage
+     *
+     * @return  bool    True in case it's in percentage, otherwise False
+     */
+    public function isPercentage(): bool
+    {
+        return $this->unit === '%';
+    }
+
+    /**
+     * Get whether this perf data's value is in packets
+     *
+     * @return bool   True in case it's in packets
+     */
+    public function isPackets(): bool
+    {
+        return $this->unit === 'packets';
+    }
+
+    /**
+     * Get whether this perf data's value is in lumen
+     *
+     * @return bool
+     */
+    public function isLumens(): bool
+    {
+        return $this->unit === 'lm';
+    }
+
+    /**
+     * Get whether this perf data's value is in decibel-milliwatts
+     *
+     * @return bool
+     */
+    public function isDecibelMilliWatts(): bool
+    {
+        return $this->unit === 'dBm';
+    }
+
+    /**
+     * Get whether this data's value is in bits
+     *
+     * @return bool
+     */
+    public function isBits(): bool
+    {
+        return $this->unit === 'b';
+    }
+
+    /**
+     * Return whether this performance data's value is in bytes
+     *
+     * @return  bool    True in case it's in bytes, otherwise False
+     */
+    public function isBytes(): bool
+    {
+        return $this->unit === 'B';
+    }
+
+    /**
+     * Get whether this data's value is in watt hours
+     *
+     * @return bool
+     */
+    public function isWattHours(): bool
+    {
+        return $this->unit === 'Wh';
+    }
+
+    /**
+     * Get whether this data's value is in watt
+     *
+     * @return bool
+     */
+    public function isWatts(): bool
+    {
+        return $this->unit === 'W';
+    }
+
+    /**
+     * Get whether this data's value is in ampere
+     *
+     * @return bool
+     */
+    public function isAmperes(): bool
+    {
+        return $this->unit === 'A';
+    }
+
+    /**
+     * Get whether this data's value is in ampere seconds
+     *
+     * @return bool
+     */
+    public function isAmpSeconds(): bool
+    {
+        return $this->unit === 'As';
+    }
+
+    /**
+     * Get whether this data's value is in volts
+     *
+     * @return bool
+     */
+    public function isVolts(): bool
+    {
+        return $this->unit === 'V';
+    }
+
+    /**
+     * Get whether this data's value is in ohm
+     *
+     * @return bool
+     */
+    public function isOhms(): bool
+    {
+        return $this->unit === 'O';
+    }
+
+    /**
+     * Get whether this data's value is in grams
+     *
+     * @return bool
+     */
+    public function isGrams(): bool
+    {
+        return $this->unit === 'g';
+    }
+
+    /**
+     * Get whether this data's value is in Litters
+     *
+     * @return bool
+     */
+    public function isLiters(): bool
+    {
+        return $this->unit === 'l';
+    }
+
+    /**
+     * Return whether this performance data's value is a counter
+     *
+     * @return  bool    True in case it's a counter, otherwise False
+     */
+    public function isCounter(): bool
+    {
+        return $this->unit === 'c';
+    }
+
+    /**
+     * Returns whether it is possible to display a visual representation
+     *
+     * @return  bool    True when the perfdata is visualizable
+     */
+    public function isVisualizable(): bool
+    {
+        return isset($this->minValue) && isset($this->maxValue) && isset($this->value);
+    }
+
+    /**
+     * Return this perfomance data's label
+     */
+    public function getLabel(): string
+    {
+        return $this->label;
+    }
+
+    /**
+     * Return the value or null if it is unknown (U)
+     *
+     * @return  null|float
+     */
+    public function getValue()
+    {
+        return $this->value;
+    }
+
+    /**
+     * Return the unit as a string
+     *
+     * @return ?string
+     */
+    public function getUnit()
+    {
+        return $this->unit;
+    }
+
+    /**
+     * Return the value as percentage (0-100)
+     *
+     * @return  null|float
+     */
+    public function getPercentage()
+    {
+        if ($this->isPercentage()) {
+            return $this->value;
+        }
+
+        if ($this->maxValue !== null) {
+            $minValue = $this->minValue !== null ? $this->minValue : 0.0;
+            if ($this->maxValue == $minValue) {
+                return null;
+            }
+
+            if ($this->value > $minValue) {
+                return (($this->value - $minValue) / ($this->maxValue - $minValue)) * 100;
+            }
+        }
+    }
+
+    /**
+     * Return this performance data's warning treshold
+     *
+     * @return  ThresholdRange
+     */
+    public function getWarningThreshold(): ThresholdRange
+    {
+        return $this->warningThreshold;
+    }
+
+    /**
+     * Return this performance data's critical treshold
+     *
+     * @return  ThresholdRange
+     */
+    public function getCriticalThreshold(): ThresholdRange
+    {
+        return $this->criticalThreshold;
+    }
+
+    /**
+     * Return the minimum value or null if it is not available
+     *
+     * @return ?float
+     */
+    public function getMinimumValue()
+    {
+        return $this->minValue;
+    }
+
+    /**
+     * Return the maximum value or null if it is not available
+     *
+     * @return  null|float
+     */
+    public function getMaximumValue()
+    {
+        return $this->maxValue;
+    }
+
+    /**
+     * Return this performance data as string
+     *
+     * @return  string
+     */
+    public function __toString()
+    {
+        return $this->formatLabel();
+    }
+
+    /**
+     * Parse the current performance data value
+     *
+     * @todo    Handle optional min/max if UOM == %
+     */
+    protected function parse()
+    {
+        $parts = explode(';', $this->perfdataValue);
+
+        $matches = array();
+        if (preg_match('@^(-?(?:\d+)?(?:\.\d+)?)([a-zA-Z%°]{1,3})$@u', $parts[0], $matches)) {
+            $this->unit = $matches[2];
+            $this->value = $matches[1];
+        } else {
+            $this->value = $parts[0];
+        }
+
+        switch (count($parts)) {
+            /* @noinspection PhpMissingBreakStatementInspection */
+            case 5:
+                if ($parts[4] !== '') {
+                    $this->maxValue = $parts[4];
+                }
+            /* @noinspection PhpMissingBreakStatementInspection */
+            case 4:
+                if ($parts[3] !== '') {
+                    $this->minValue = $parts[3];
+                }
+            /* @noinspection PhpMissingBreakStatementInspection */
+            case 3:
+                $this->criticalThreshold = ThresholdRange::fromString(trim($parts[2]));
+            // Fallthrough
+            case 2:
+                $this->warningThreshold = ThresholdRange::fromString(trim($parts[1]));
+        }
+
+        if ($this->warningThreshold === null) {
+            $this->warningThreshold = new ThresholdRange();
+        }
+        if ($this->criticalThreshold === null) {
+            $this->criticalThreshold = new ThresholdRange();
+        }
+    }
+
+    protected function calculatePieChartData(): array
+    {
+        $rawValue = $this->getValue();
+        $minValue = $this->getMinimumValue() !== null ? $this->getMinimumValue() : 0;
+        $usedValue = ($rawValue - $minValue);
+
+        $green = $orange = $red = 0;
+
+        if ($this->criticalThreshold->contains($rawValue)) {
+            if ($this->warningThreshold->contains($rawValue)) {
+                $green = $usedValue;
+            } else {
+                $orange = $usedValue;
+            }
+        } else {
+            $red = $usedValue;
+        }
+
+        return array($green, $orange, $red, ($this->getMaximumValue() - $minValue) - $usedValue);
+    }
+
+
+    public function asInlinePie(): InlinePie
+    {
+        if (! $this->isVisualizable()) {
+            throw new LogicException('Cannot calculate piechart data for unvisualizable perfdata entry.');
+        }
+
+        $data = $this->calculatePieChartData();
+        $pieChart = new InlinePie($data, $this);
+        $pieChart->setColors(array('#44bb77', '#ffaa44', '#ff5566', '#ddccdd'));
+
+        return $pieChart;
+    }
+
+    /**
+     * Format the given value depending on the currently used unit
+     */
+    protected function format($value)
+    {
+        if ($value === null) {
+            return null;
+        }
+
+        if ($value instanceof ThresholdRange) {
+            if ($value->getMin()) {
+                return (string) $value;
+            }
+
+            $max = $value->getMax();
+            return $max === null ? '' : $this->format($max);
+        }
+
+        switch (true) {
+            case $this->isPercentage():
+                return (string) $value . '%';
+            case $this->isPackets():
+                return (string) $value . 'packets';
+            case $this->isLumens():
+                return (string) $value . 'lm';
+            case $this->isDecibelMilliWatts():
+                return (string) $value . 'dBm';
+            case $this->isCounter():
+                return (string) $value . 'c';
+            case $this->isTemperature():
+                return (string) $value . $this->unit;
+            case $this->isBits():
+                return PerfDataFormat::bits($value);
+            case $this->isBytes():
+                return PerfDataFormat::bytes($value);
+            case $this->isSeconds():
+                return PerfDataFormat::seconds($value);
+            case $this->isWatts():
+                return PerfDataFormat::watts($value);
+            case $this->isWattHours():
+                return PerfDataFormat::wattHours($value);
+            case $this->isAmperes():
+                return PerfDataFormat::amperes($value);
+            case $this->isAmpSeconds():
+                return PerfDataFormat::ampereSeconds($value);
+            case $this->isVolts():
+                return PerfDataFormat::volts($value);
+            case $this->isOhms():
+                return PerfDataFormat::ohms($value);
+            case $this->isGrams():
+                return PerfDataFormat::grams($value);
+            case $this->isLiters():
+                return PerfDataFormat::liters($value);
+            case ! is_numeric($value):
+                return $value;
+            default:
+                return number_format($value, 2) . ($this->unit !== null ? ' ' . $this->unit : '');
+        }
+    }
+
+    /**
+     * Format the title string that represents this perfdata set
+     *
+     * @param bool $html
+     *
+     * @return string
+     */
+    public function formatLabel(bool $html = false): string
+    {
+        return sprintf(
+            $html ? '<b>%s %s</b> (%s%%)' : '%s %s (%s%%)',
+            htmlspecialchars($this->getLabel()),
+            $this->format($this->value),
+            number_format($this->getPercentage() ?? 0, 2)
+        );
+    }
+
+    public function toArray(): array
+    {
+        return array(
+            'label' => $this->getLabel(),
+            'value' => $this->format($this->getvalue()),
+            'min' => isset($this->minValue) && !$this->isPercentage()
+                ? $this->format($this->minValue)
+                : '',
+            'max' => isset($this->maxValue) && !$this->isPercentage()
+                ? $this->format($this->maxValue)
+                : '',
+            'warn' => $this->format($this->warningThreshold),
+            'crit' => $this->format($this->criticalThreshold)
+        );
+    }
+
+    /**
+     * Return the state indicated by this perfdata
+     *
+     * @return int
+     */
+    public function getState(): int
+    {
+        if (! is_numeric($this->value)) {
+            return ServiceStates::UNKNOWN;
+        }
+
+        if (! $this->criticalThreshold->contains($this->value)) {
+            return ServiceStates::CRITICAL;
+        }
+
+        if (! $this->warningThreshold->contains($this->value)) {
+            return ServiceStates::WARNING;
+        }
+
+        return ServiceStates::OK;
+    }
+
+    /**
+     * Return whether the state indicated by this perfdata is worse than
+     * the state indicated by the other perfdata
+     * CRITICAL > UNKNOWN > WARNING > OK
+     *
+     * @param PerfData $rhs     the other perfdata
+     *
+     * @return bool
+     */
+    public function worseThan(PerfData $rhs): bool
+    {
+        if (($state = $this->getState()) === ($rhsState = $rhs->getState())) {
+            return $this->getPercentage() > $rhs->getPercentage();
+        }
+
+        if ($state === ServiceStates::CRITICAL) {
+            return true;
+        }
+
+        if ($state === ServiceStates::UNKNOWN) {
+            return $rhsState !== ServiceStates::CRITICAL;
+        }
+
+        if ($state === ServiceStates::WARNING) {
+            return $rhsState === ServiceStates::OK;
+        }
+
+        return false;
+    }
+}
diff --git a/library/Icingadb/Util/PerfDataFormat.php b/library/Icingadb/Util/PerfDataFormat.php
new file mode 100644
index 0000000..8c33ae5
--- /dev/null
+++ b/library/Icingadb/Util/PerfDataFormat.php
@@ -0,0 +1,172 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Util;
+
+class PerfDataFormat
+{
+    protected static $instance;
+
+    protected static $generalBase = 1000;
+
+    protected static $bitPrefix = ['b', 'kb', 'mb', 'gb', 'tb', 'pb', 'eb', 'zb', 'yb'];
+
+    protected static $bytePrefix = ['B', 'kB', 'MB', 'GB', 'TB', 'PB', 'EB', 'ZB', 'YB'];
+
+    protected static $wattHourPrefix = ['Wh', 'kWh', 'MWh', 'GWh', 'TWh', 'PWh', 'EWh', 'ZWh', 'YWh'];
+
+    protected static $wattPrefix = [-1 => 'mW', 'W', 'kW', 'MW', 'GW'];
+
+    protected static $amperePrefix = [-3 => 'nA', -2 => 'µA', -1 => 'mA', 'A', 'kA', 'MA', 'GA'];
+
+    protected static $ampSecondPrefix = [-2 => 'µAs', -1 => 'mAs', 'As', 'kAs', 'MAs', 'GAs'];
+
+    protected static $voltPrefix = [-2 => 'µV', -1 => 'mV', 'V', 'kV', 'MV', 'GV'];
+
+    protected static $ohmPrefix = ['Ω'];
+
+    protected static $gramPrefix = [
+        -5 => 'fg',
+        -4 => 'pg',
+        -3 => 'ng',
+        -2 => 'µg',
+        -1 => 'mg',
+        'g',
+        'kg',
+        't',
+        'ktǂ',
+        'Mt',
+        'Gt'
+    ];
+
+    protected static $literPrefix = [
+        -5 => 'fl',
+        -4 => 'pl',
+        -3 => 'nl',
+        -2 => 'µl',
+        -1 => 'ml',
+        'l',
+        'kl',
+        'Ml',
+        'Gl',
+        'Tl',
+        'Pl'
+    ];
+
+    protected static $secondPrefix = [-3 => 'ns', -2 => 'µs', -1 => 'ms', 's'];
+
+    public static function getInstance(): self
+    {
+        if (self::$instance === null) {
+            self::$instance = new PerfDataFormat();
+        }
+
+        return self::$instance;
+    }
+
+    public static function bits($value): string
+    {
+        return self::formatForUnits($value, self::$bitPrefix, self::$generalBase);
+    }
+
+    public static function bytes($value): string
+    {
+        return self::formatForUnits($value, self::$bytePrefix, self::$generalBase);
+    }
+
+    public static function wattHours($value): string
+    {
+        return self::formatForUnits($value, self::$wattHourPrefix, self::$generalBase);
+    }
+
+    public static function watts($value): string
+    {
+        return self::formatForUnits($value, self::$wattPrefix, self::$generalBase);
+    }
+
+    public static function amperes($value): string
+    {
+        return self::formatForUnits($value, self::$amperePrefix, self::$generalBase);
+    }
+
+    public static function ampereSeconds($value): string
+    {
+        return self::formatForUnits($value, self::$ampSecondPrefix, self::$generalBase);
+    }
+
+    public static function volts($value): string
+    {
+        return self::formatForUnits($value, self::$voltPrefix, self::$generalBase);
+    }
+
+    public static function ohms($value): string
+    {
+        return self::formatForUnits($value, self::$ohmPrefix, self::$generalBase);
+    }
+
+    public static function grams($value): string
+    {
+        return self::formatForUnits($value, self::$gramPrefix, self::$generalBase);
+    }
+
+    public static function liters($value): string
+    {
+        return self::formatForUnits($value, self::$literPrefix, self::$generalBase);
+    }
+
+    public static function seconds($value): string
+    {
+        $value = (float) $value;
+        $absValue = abs($value);
+
+        if ($absValue < 60) {
+            return self::formatForUnits($value, self::$secondPrefix, self::$generalBase);
+        } elseif ($absValue < 3600) {
+            return sprintf('%0.2f m', $value / 60);
+        } elseif ($absValue < 86400) {
+            return sprintf('%0.2f h', $value / 3600);
+        }
+
+        return sprintf('%0.2f d', $value / 86400);
+    }
+
+    protected static function formatForUnits($value, array &$units, int $base): string
+    {
+        $sign = '';
+        $value = (float) $value;
+        if ($value < 0) {
+            $value = abs($value);
+            $sign = '-';
+        }
+
+        if ($value == 0) {
+            $pow = $result = 0;
+        } else {
+            $pow = floor(log($value, $base));
+
+            // Identify nearest unit if unknown
+            while (! isset($units[$pow])) {
+                if ($pow < 0) {
+                    $pow++;
+                } else {
+                    $pow--;
+                }
+            }
+
+            $result = $value / pow($base, $pow);
+        }
+
+        // 1034.23 looks better than 1.03, but 2.03 is fine:
+        if ($pow > 0 && $result < 2) {
+            $result = $value / pow($base, --$pow);
+        }
+
+        return sprintf(
+            '%s%0.2f %s',
+            $sign,
+            $result,
+            $units[$pow]
+        );
+    }
+}
diff --git a/library/Icingadb/Util/PerfDataSet.php b/library/Icingadb/Util/PerfDataSet.php
new file mode 100644
index 0000000..6a18d99
--- /dev/null
+++ b/library/Icingadb/Util/PerfDataSet.php
@@ -0,0 +1,159 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Util;
+
+use ArrayIterator;
+use IteratorAggregate;
+
+class PerfDataSet implements IteratorAggregate
+{
+    /**
+     * The performance data being parsed
+     *
+     * @var string
+     */
+    protected $perfdataStr;
+
+    /**
+     * The current parsing position
+     *
+     * @var int
+     */
+    protected $parserPos = 0;
+
+    /**
+     * A list of PerfData objects
+     *
+     * @var array
+     */
+    protected $perfdata = array();
+
+    /**
+     * Create a new set of performance data
+     *
+     * @param   string      $perfdataStr    A space separated list of label/value pairs
+     */
+    protected function __construct(string $perfdataStr)
+    {
+        if (($perfdataStr = trim($perfdataStr)) !== '') {
+            $this->perfdataStr = $perfdataStr;
+            $this->parse();
+        }
+    }
+
+    /**
+     * Return a iterator for this set of performance data
+     *
+     * @return  ArrayIterator
+     */
+    public function getIterator(): ArrayIterator
+    {
+        return new ArrayIterator($this->asArray());
+    }
+
+    /**
+     * Return a new set of performance data
+     *
+     * @param   string      $perfdataStr    A space separated list of label/value pairs
+     *
+     * @return  PerfDataSet
+     */
+    public static function fromString(string $perfdataStr): self
+    {
+        return new static($perfdataStr);
+    }
+
+    /**
+     * Return this set of performance data as array
+     *
+     * @return  array
+     */
+    public function asArray(): array
+    {
+        return $this->perfdata;
+    }
+
+    /**
+     * Parse the current performance data
+     */
+    protected function parse()
+    {
+        while ($this->parserPos < strlen($this->perfdataStr)) {
+            $label = trim($this->readLabel());
+            $value = trim($this->readUntil(' '));
+
+            if ($label) {
+                $this->perfdata[] = new PerfData($label, $value);
+            }
+        }
+
+        uasort(
+            $this->perfdata,
+            function ($a, $b) {
+                if ($a->isVisualizable() && ! $b->isVisualizable()) {
+                    return -1;
+                } elseif (! $a->isVisualizable() && $b->isVisualizable()) {
+                    return 1;
+                } elseif (! $a->isVisualizable() && ! $b->isVisualizable()) {
+                    return 0;
+                }
+
+                return $a->worseThan($b) ? -1 : ($b->worseThan($a) ? 1 : 0);
+            }
+        );
+    }
+
+    /**
+     * Return the next label found in the performance data
+     *
+     * @return  string      The label found
+     */
+    protected function readLabel(): string
+    {
+        $this->skipSpaces();
+        if (in_array($this->perfdataStr[$this->parserPos], array('"', "'"))) {
+            $quoteChar = $this->perfdataStr[$this->parserPos++];
+            $label = $this->readUntil($quoteChar);
+            $this->parserPos++;
+
+            if ($this->perfdataStr[$this->parserPos] === '=') {
+                $this->parserPos++;
+            }
+        } else {
+            $label = $this->readUntil('=');
+            $this->parserPos++;
+        }
+
+        $this->skipSpaces();
+        return $label;
+    }
+
+    /**
+     * Return all characters between the current parser position and the given character
+     *
+     * @param   string  $stopChar   The character on which to stop
+     *
+     * @return  string
+     */
+    protected function readUntil(string $stopChar): string
+    {
+        $start = $this->parserPos;
+        while ($this->parserPos < strlen($this->perfdataStr) && $this->perfdataStr[$this->parserPos] !== $stopChar) {
+            $this->parserPos++;
+        }
+
+        return substr($this->perfdataStr, $start, $this->parserPos - $start);
+    }
+
+    /**
+     * Advance the parser position to the next non-whitespace character
+     */
+    protected function skipSpaces()
+    {
+        while ($this->parserPos < strlen($this->perfdataStr) && $this->perfdataStr[$this->parserPos] === ' ') {
+            $this->parserPos++;
+        }
+    }
+}
diff --git a/library/Icingadb/Util/PluginOutput.php b/library/Icingadb/Util/PluginOutput.php
new file mode 100644
index 0000000..71d08b1
--- /dev/null
+++ b/library/Icingadb/Util/PluginOutput.php
@@ -0,0 +1,260 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Util;
+
+use DOMDocument;
+use DOMNode;
+use DOMText;
+use Icinga\Module\Icingadb\Hook\PluginOutputHook;
+use Icinga\Module\Icingadb\Model\Host;
+use Icinga\Module\Icingadb\Model\Service;
+use Icinga\Web\Dom\DomNodeIterator;
+use Icinga\Web\Helper\HtmlPurifier;
+use InvalidArgumentException;
+use ipl\Html\HtmlString;
+use ipl\Orm\Model;
+use LogicException;
+use RecursiveIteratorIterator;
+
+class PluginOutput extends HtmlString
+{
+    /** @var string[] Patterns to be replaced in plain text plugin output */
+    const TEXT_PATTERNS = [
+        '~\\\t~',
+        '~\\\n~',
+        '~(\[|\()OK(\]|\))~',
+        '~(\[|\()WARNING(\]|\))~',
+        '~(\[|\()CRITICAL(\]|\))~',
+        '~(\[|\()UNKNOWN(\]|\))~',
+        '~(\[|\()UP(\]|\))~',
+        '~(\[|\()DOWN(\]|\))~',
+        '~\@{6,}~'
+    ];
+
+    /** @var string[] Replacements for {@see PluginOutput::TEXT_PATTERNS} */
+    const TEXT_REPLACEMENTS = [
+        "\t",
+        "\n",
+        '<span class="state-ball ball-size-m state-ok"></span>',
+        '<span class="state-ball ball-size-m state-warning"></span>',
+        '<span class="state-ball ball-size-m state-critical"></span>',
+        '<span class="state-ball ball-size-m state-unknown"></span>',
+        '<span class="state-ball ball-size-m state-up"></span>',
+        '<span class="state-ball ball-size-m state-down"></span>',
+        '@@@@@@'
+    ];
+
+    /** @var string[] Patterns to be replaced in html plugin output */
+    const HTML_PATTERNS = [
+        '~\\\t~',
+        '~\\\n~'
+    ];
+
+    /** @var string[] Replacements for {@see PluginOutput::HTML_PATTERNS} */
+    const HTML_REPLACEMENTS = [
+        "\t",
+        "\n"
+    ];
+
+    /** @var string Already rendered output */
+    protected $renderedOutput;
+
+    /** @var bool Whether the output contains HTML */
+    protected $isHtml;
+
+    /** @var bool Whether output will be enriched */
+    protected $enrichOutput = true;
+
+    /** @var string The name of the command that produced the output */
+    protected $commandName;
+
+    /**
+     * Get whether the output contains HTML
+     *
+     * Requires the output being already rendered.
+     *
+     * @return bool
+     *
+     * @throws LogicException In case the output hasn't been rendered yet
+     */
+    public function isHtml(): bool
+    {
+        if ($this->isHtml === null) {
+            if (empty($this->getContent())) {
+                // "Nothing" can't be HTML
+                return false;
+            }
+
+            throw new LogicException('Output not rendered yet');
+        }
+
+        return $this->isHtml;
+    }
+
+    /**
+     * Set whether the output should be enriched
+     *
+     * @param bool $state
+     *
+     * @return $this
+     */
+    public function setEnrichOutput(bool $state = true): self
+    {
+        $this->enrichOutput = $state;
+
+        return $this;
+    }
+
+    /**
+     * Set name of the command that produced the output
+     *
+     * @param string $name
+     *
+     * @return $this
+     */
+    public function setCommandName(string $name): self
+    {
+        $this->commandName = $name;
+
+        return $this;
+    }
+
+    /**
+     * Render plugin output of the given object
+     *
+     * @param Host|Service $object
+     *
+     * @return static
+     *
+     * @throws InvalidArgumentException If $object is neither a host nor a service
+     */
+    public static function fromObject(Model $object): self
+    {
+        if (! $object instanceof Host && ! $object instanceof Service) {
+            throw new InvalidArgumentException(
+                sprintf('Object is not a host or service, got %s instead', get_class($object))
+            );
+        }
+
+        return (new static($object->state->output . "\n" . $object->state->long_output))
+            ->setCommandName($object->checkcommand_name);
+    }
+
+    public function render()
+    {
+        if ($this->renderedOutput !== null) {
+            return $this->renderedOutput;
+        }
+
+        $output = parent::render();
+        if (empty($output)) {
+            return '';
+        }
+
+        if ($this->commandName !== null) {
+            $output = PluginOutputHook::processOutput($output, $this->commandName, $this->enrichOutput);
+        }
+
+        if (preg_match('~<\w+(?>\s\w+=[^>]*)?>~', $output)) {
+            // HTML
+            $output = HtmlPurifier::process(preg_replace(
+                self::HTML_PATTERNS,
+                self::HTML_REPLACEMENTS,
+                $output
+            ));
+            $this->isHtml = true;
+        } else {
+            // Plaintext
+            $output = preg_replace(
+                self::TEXT_PATTERNS,
+                self::TEXT_REPLACEMENTS,
+                htmlspecialchars($output, ENT_COMPAT | ENT_SUBSTITUTE | ENT_HTML5, null, false)
+            );
+            $this->isHtml = false;
+        }
+
+        $output = trim($output);
+
+        // Add zero-width space after commas which are not followed by a whitespace character
+        // in oder to help browsers to break words in plugin output
+        $output = preg_replace('/,(?=[^\s])/', ',&#8203;', $output);
+
+        if ($this->enrichOutput && $this->isHtml) {
+            $output = $this->processHtml($output);
+        }
+
+        $this->renderedOutput = $output;
+
+        return $output;
+    }
+
+    /**
+     * Replace color state information, if any
+     *
+     * @param   string  $html
+     *
+     * @todo Do we really need to create a DOM here? Or is a preg_replace like we do it for text also feasible?
+     * @return  string
+     */
+    protected function processHtml(string $html): string
+    {
+        $pattern = '/[([](OK|WARNING|CRITICAL|UNKNOWN|UP|DOWN)[)\]]/';
+        $doc = new DOMDocument();
+        $doc->loadXML('<div>' . $html . '</div>', LIBXML_NOERROR | LIBXML_NOWARNING);
+        $dom = new RecursiveIteratorIterator(new DomNodeIterator($doc), RecursiveIteratorIterator::SELF_FIRST);
+
+        $nodesToRemove = [];
+        foreach ($dom as $node) {
+            /** @var DOMNode $node */
+            if ($node->nodeType !== XML_TEXT_NODE) {
+                continue;
+            }
+
+            $start = 0;
+            while (preg_match($pattern, $node->nodeValue, $match, PREG_OFFSET_CAPTURE, $start)) {
+                $offsetLeft = $match[0][1];
+                $matchLength = strlen($match[0][0]);
+                $leftLength = $offsetLeft - $start;
+
+                // if there is text before the match
+                if ($leftLength) {
+                    // create node for leading text
+                    $text = new DOMText(substr($node->nodeValue, $start, $leftLength));
+                    $node->parentNode->insertBefore($text, $node);
+                }
+
+                // create the state ball for the match
+                $span = $doc->createElement('span');
+                $span->setAttribute(
+                    'class',
+                    'state-ball ball-size-m state-' . strtolower($match[1][0])
+                );
+                $node->parentNode->insertBefore($span, $node);
+
+                // start for next match
+                $start = $offsetLeft + $matchLength;
+            }
+
+            if ($start) {
+                // is there text left?
+                if (strlen($node->nodeValue) > $start) {
+                    // create node for trailing text
+                    $text = new DOMText(substr($node->nodeValue, $start));
+                    $node->parentNode->insertBefore($text, $node);
+                }
+
+                // delete the old node later
+                $nodesToRemove[] = $node;
+            }
+        }
+
+        foreach ($nodesToRemove as $node) {
+            /** @var DOMNode $node */
+            $node->parentNode->removeChild($node);
+        }
+
+        return substr($doc->saveHTML(), 5, -7);
+    }
+}
diff --git a/library/Icingadb/Util/ThresholdRange.php b/library/Icingadb/Util/ThresholdRange.php
new file mode 100644
index 0000000..c92842d
--- /dev/null
+++ b/library/Icingadb/Util/ThresholdRange.php
@@ -0,0 +1,180 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Util;
+
+/**
+ * The warning/critical threshold of a measured value
+ */
+class ThresholdRange
+{
+    /**
+     * The smallest value inside the range (null stands for -∞)
+     *
+     * @var float|null
+     */
+    protected $min;
+
+    /**
+     * The biggest value inside the range (null stands for ∞)
+     *
+     * @var float|null
+     */
+    protected $max;
+
+    /**
+     * Whether to invert the result of contains()
+     *
+     * @var bool
+     */
+    protected $inverted = false;
+
+    /**
+     * The unmodified range as passed to fromString()
+     *
+     * @var string
+     */
+    protected $raw;
+
+    /**
+     * Create a new instance based on a threshold range conforming to <https://nagios-plugins.org/doc/guidelines.html>
+     *
+     * @param   string  $rawRange
+     *
+     * @return  ThresholdRange
+     */
+    public static function fromString(string $rawRange): self
+    {
+        $range = new static();
+        $range->raw = $rawRange;
+
+        if ($rawRange == '') {
+            return $range;
+        }
+
+        $rawRange = ltrim($rawRange);
+        if (substr($rawRange, 0, 1) === '@') {
+            $range->setInverted();
+            $rawRange = substr($rawRange, 1);
+        }
+
+        if (strpos($rawRange, ':') === false) {
+            $min = 0.0;
+            $max = floatval(trim($rawRange));
+        } else {
+            list($min, $max) = explode(':', $rawRange, 2);
+            $min = trim($min);
+            $max = trim($max);
+
+            switch ($min) {
+                case '':
+                    $min = 0.0;
+                    break;
+                case '~':
+                    $min = null;
+                    break;
+                default:
+                    $min = floatval($min);
+            }
+
+            $max = empty($max) ? null : floatval($max);
+        }
+
+        return $range->setMin($min)
+            ->setMax($max);
+    }
+
+    /**
+     * Set the smallest value inside the range (null stands for -∞)
+     *
+     * @param   float|null  $min
+     *
+     * @return  $this
+     */
+    public function setMin(float $min): self
+    {
+        $this->min = $min;
+        return $this;
+    }
+
+    /**
+     * Get the smallest value inside the range (null stands for -∞)
+     *
+     * @return  float|null
+     */
+    public function getMin()
+    {
+        return $this->min;
+    }
+
+    /**
+     * Set the biggest value inside the range (null stands for ∞)
+     *
+     * @param   float|null  $max
+     *
+     * @return  $this
+     */
+    public function setMax(float $max): self
+    {
+        $this->max = $max;
+        return $this;
+    }
+
+    /**
+     * Get the biggest value inside the range (null stands for ∞)
+     *
+     * @return  float|null
+     */
+    public function getMax()
+    {
+        return $this->max;
+    }
+
+    /**
+     * Set whether to invert the result of contains()
+     *
+     * @param   bool    $inverted
+     *
+     * @return  $this
+     */
+    public function setInverted(bool $inverted = true): self
+    {
+        $this->inverted = $inverted;
+        return $this;
+    }
+
+    /**
+     * Get whether to invert the result of contains()
+     *
+     * @return  bool
+     */
+    public function isInverted(): bool
+    {
+        return $this->inverted;
+    }
+
+    /**
+     * Return whether $value is inside $this
+     *
+     * @param   float   $value
+     *
+     * @return  bool
+     */
+    public function contains(float $value): bool
+    {
+        return (bool) ($this->inverted ^ (
+            ($this->min === null || $this->min <= $value) && ($this->max === null || $this->max >= $value)
+        ));
+    }
+
+    /**
+     * Return the textual representation of $this, suitable for fromString()
+     *
+     * @return  string
+     */
+    public function __toString()
+    {
+        return (string) $this->raw;
+    }
+}
diff --git a/library/Icingadb/Web/Control/ProblemToggle.php b/library/Icingadb/Web/Control/ProblemToggle.php
new file mode 100644
index 0000000..c5aed82
--- /dev/null
+++ b/library/Icingadb/Web/Control/ProblemToggle.php
@@ -0,0 +1,74 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Web\Control;
+
+use ipl\Web\Common\FormUid;
+use ipl\Web\Compat\CompatForm;
+
+class ProblemToggle extends CompatForm
+{
+    use FormUid;
+
+    protected $filter;
+
+    protected $protector;
+
+    protected $defaultAttributes = [
+        'name'    => 'problem-toggle',
+        'class'   => 'icinga-form icinga-controls inline'
+    ];
+
+    public function __construct($filter)
+    {
+        $this->filter = $filter;
+    }
+
+    /**
+     * Set callback to protect ids with
+     *
+     * @param   callable $protector
+     *
+     * @return  $this
+     */
+    public function setIdProtector(callable $protector): self
+    {
+        $this->protector = $protector;
+
+        return $this;
+    }
+
+    /**
+     * Get whether the toggle is checked
+     *
+     * @return bool
+     */
+    public function isChecked(): bool
+    {
+        $this->ensureAssembled();
+
+        return $this->getElement('problems')->isChecked();
+    }
+
+    protected function assemble()
+    {
+        $this->addElement('checkbox', 'problems', [
+            'class'     => 'autosubmit',
+            'id'        => $this->protectId('problems'),
+            'label'     => t('Problems Only'),
+            'value'     => $this->filter !== null
+        ]);
+
+        $this->add($this->createUidElement());
+    }
+
+    private function protectId($id)
+    {
+        if (is_callable($this->protector)) {
+            return call_user_func($this->protector, $id);
+        }
+
+        return $id;
+    }
+}
diff --git a/library/Icingadb/Web/Control/SearchBar/ObjectSuggestions.php b/library/Icingadb/Web/Control/SearchBar/ObjectSuggestions.php
new file mode 100644
index 0000000..c4bdb6d
--- /dev/null
+++ b/library/Icingadb/Web/Control/SearchBar/ObjectSuggestions.php
@@ -0,0 +1,400 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Web\Control\SearchBar;
+
+use Generator;
+use Icinga\Module\Icingadb\Common\Auth;
+use Icinga\Module\Icingadb\Common\Database;
+use Icinga\Module\Icingadb\Model\Behavior\ReRoute;
+use Icinga\Module\Icingadb\Model\CustomvarFlat;
+use Icinga\Module\Icingadb\Model\Host;
+use Icinga\Module\Icingadb\Model\Service;
+use Icinga\Module\Icingadb\Util\ObjectSuggestionsCursor;
+use ipl\Html\HtmlElement;
+use ipl\Orm\Exception\InvalidColumnException;
+use ipl\Orm\Exception\InvalidRelationException;
+use ipl\Orm\Model;
+use ipl\Orm\Relation;
+use ipl\Orm\Relation\BelongsToMany;
+use ipl\Orm\Relation\HasOne;
+use ipl\Orm\Resolver;
+use ipl\Orm\UnionModel;
+use ipl\Sql\Expression;
+use ipl\Sql\Select;
+use ipl\Stdlib\Filter;
+use ipl\Stdlib\Seq;
+use ipl\Web\Control\SearchBar\SearchException;
+use ipl\Web\Control\SearchBar\Suggestions;
+use PDO;
+
+class ObjectSuggestions extends Suggestions
+{
+    use Auth;
+    use Database;
+
+    /** @var Model */
+    protected $model;
+
+    /** @var array */
+    protected $customVarSources;
+
+    public function __construct()
+    {
+        $this->customVarSources = [
+            'checkcommand'          => t('Checkcommand %s', '..<customvar-name>'),
+            'eventcommand'          => t('Eventcommand %s', '..<customvar-name>'),
+            'host'                  => t('Host %s', '..<customvar-name>'),
+            'hostgroup'             => t('Hostgroup %s', '..<customvar-name>'),
+            'notification'          => t('Notification %s', '..<customvar-name>'),
+            'notificationcommand'   => t('Notificationcommand %s', '..<customvar-name>'),
+            'service'               => t('Service %s', '..<customvar-name>'),
+            'servicegroup'          => t('Servicegroup %s', '..<customvar-name>'),
+            'timeperiod'            => t('Timeperiod %s', '..<customvar-name>'),
+            'user'                  => t('User %s', '..<customvar-name>'),
+            'usergroup'             => t('Usergroup %s', '..<customvar-name>')
+        ];
+    }
+
+    /**
+     * Set the model to show suggestions for
+     *
+     * @param string|Model $model
+     *
+     * @return $this
+     */
+    public function setModel($model): self
+    {
+        if (is_string($model)) {
+            $model = new $model();
+        }
+
+        $this->model = $model;
+
+        return $this;
+    }
+
+    /**
+     * Get the model to show suggestions for
+     *
+     * @return Model
+     */
+    public function getModel(): Model
+    {
+        if ($this->model === null) {
+            throw new \LogicException(
+                'You are accessing an unset property. Please make sure to set it beforehand.'
+            );
+        }
+
+        return $this->model;
+    }
+
+    protected function shouldShowRelationFor(string $column): bool
+    {
+        if (strpos($column, '.vars.') !== false) {
+            return false;
+        }
+
+        $tableName = $this->getModel()->getTableName();
+        $columnPath = explode('.', $column);
+
+        switch (count($columnPath)) {
+            case 3:
+                if ($columnPath[1] !== 'state' || ! in_array($tableName, ['host', 'service'])) {
+                    return true;
+                }
+
+                // For host/service state relation columns apply the same rules
+            case 2:
+                return $columnPath[0] !== $tableName;
+            default:
+                return true;
+        }
+    }
+
+    protected function createQuickSearchFilter($searchTerm)
+    {
+        $model = $this->getModel();
+        $resolver = $model::on($this->getDb())->getResolver();
+
+        $quickFilter = Filter::any();
+        foreach ($model->getSearchColumns() as $column) {
+            $where = Filter::like($resolver->qualifyColumn($column, $model->getTableName()), $searchTerm);
+            $where->metaData()->set('columnLabel', $resolver->getColumnDefinition($where->getColumn())->getLabel());
+            $quickFilter->add($where);
+        }
+
+        return $quickFilter;
+    }
+
+    protected function fetchValueSuggestions($column, $searchTerm, Filter\Chain $searchFilter)
+    {
+        $model = $this->getModel();
+        $query = $model::on($this->getDb());
+        $query->limit(static::DEFAULT_LIMIT);
+
+        if (strpos($column, ' ') !== false) {
+            // $column may be a label
+            list($path, $_) = Seq::find(
+                self::collectFilterColumns($query->getModel(), $query->getResolver()),
+                $column,
+                false
+            );
+            if ($path !== null) {
+                $column = $path;
+            }
+        }
+
+        $columnPath = $query->getResolver()->qualifyPath($column, $model->getTableName());
+        list($targetPath, $columnName) = preg_split('/(?<=vars)\.|\.(?=[^.]+$)/', $columnPath);
+
+        $isCustomVar = false;
+        if (substr($targetPath, -5) === '.vars') {
+            $isCustomVar = true;
+            $targetPath = substr($targetPath, 0, -4) . 'customvar_flat';
+        }
+
+        if (strpos($targetPath, '.') !== false) {
+            try {
+                $query->with($targetPath); // TODO: Remove this, once ipl/orm does it as early
+            } catch (InvalidRelationException $e) {
+                throw new SearchException(sprintf(t('"%s" is not a valid relation'), $e->getRelation()));
+            }
+        }
+
+        if ($isCustomVar) {
+            $columnPath = $targetPath . '.flatvalue';
+            $query->filter(Filter::like($targetPath . '.flatname', $columnName));
+        }
+
+        $inputFilter = Filter::like($columnPath, $searchTerm);
+        $query->columns($columnPath);
+        $query->orderBy($columnPath);
+
+        // This had so many iterations, if it still doesn't work, consider removing it entirely :(
+        if ($searchFilter instanceof Filter\None) {
+            $query->filter($inputFilter);
+        } elseif ($searchFilter instanceof Filter\All) {
+            $searchFilter->add($inputFilter);
+
+            // There may be columns part of $searchFilter which target the base table. These must be
+            // optimized, otherwise they influence what we'll suggest to the user. (i.e. less)
+            // The $inputFilter on the other hand must not be optimized, which it wouldn't, but since
+            // we force optimization on its parent chain, we have to negate that.
+            $searchFilter->metaData()->set('forceOptimization', true);
+            $inputFilter->metaData()->set('forceOptimization', false);
+        } else {
+            $searchFilter = $inputFilter;
+        }
+
+        $query->filter($searchFilter);
+        $this->applyRestrictions($query);
+
+        try {
+            return (new ObjectSuggestionsCursor($query->getDb(), $query->assembleSelect()->distinct()))
+                ->setFetchMode(PDO::FETCH_COLUMN);
+        } catch (InvalidColumnException $e) {
+            throw new SearchException(sprintf(t('"%s" is not a valid column'), $e->getColumn()));
+        }
+    }
+
+    protected function fetchColumnSuggestions($searchTerm)
+    {
+        $model = $this->getModel();
+        $query = $model::on($this->getDb());
+
+        // Ordinary columns first
+        foreach (self::collectFilterColumns($model, $query->getResolver()) as $columnName => $columnMeta) {
+            yield $columnName => $columnMeta;
+        }
+
+        // Custom variables only after the columns are exhausted and there's actually a chance the user sees them
+        $titleAdded = false;
+        foreach ($this->getDb()->select($this->queryCustomvarConfig($searchTerm)) as $customVar) {
+            $search = $name = $customVar->flatname;
+            if (preg_match('/\w+\[(\d+)]$/', $search, $matches)) {
+                // array vars need to be specifically handled
+                if ($matches[1] !== '0') {
+                    continue;
+                }
+
+                $name = substr($search, 0, -3);
+                $search = $name . '[*]';
+            }
+
+            foreach ($this->customVarSources as $relation => $label) {
+                if (isset($customVar->$relation)) {
+                    if (! $titleAdded) {
+                        $titleAdded = true;
+                        $this->addHtml(HtmlElement::create(
+                            'li',
+                            ['class' => static::SUGGESTION_TITLE_CLASS],
+                            t('Custom Variables')
+                        ));
+                    }
+
+                    yield $relation . '.vars.' . $search => sprintf($label, $name);
+                }
+            }
+        }
+    }
+
+    protected function matchSuggestion($path, $label, $searchTerm)
+    {
+        if (preg_match('/[_.](id|bin|checksum)$/', $path)) {
+            // Only suggest exotic columns if the user knows about them
+            $trimmedSearch = trim($searchTerm, ' *');
+            return substr($path, -strlen($trimmedSearch)) === $trimmedSearch;
+        }
+
+        return parent::matchSuggestion($path, $label, $searchTerm);
+    }
+
+    /**
+     * Create a query to fetch all available custom variables matching the given term
+     *
+     * @param string $searchTerm
+     *
+     * @return Select
+     */
+    protected function queryCustomvarConfig(string $searchTerm): Select
+    {
+        $customVars = CustomvarFlat::on($this->getDb());
+        $tableName = $customVars->getModel()->getTableName();
+        $resolver = $customVars->getResolver();
+
+        $scalarQueries = [];
+        $aggregates = ['flatname'];
+        foreach ($resolver->getRelations($customVars->getModel()) as $name => $relation) {
+            if (isset($this->customVarSources[$name]) && $relation instanceof BelongsToMany) {
+                $query = $customVars->createSubQuery(
+                    $relation->getTarget(),
+                    $resolver->qualifyPath($name, $tableName)
+                );
+
+                $this->applyRestrictions($query);
+
+                $aggregates[$name] = new Expression("MAX($name)");
+                $scalarQueries[$name] = $query->assembleSelect()
+                    ->resetColumns()->columns(new Expression('1'))
+                    ->limit(1);
+            }
+        }
+
+        $customVars->columns('flatname');
+        $this->applyRestrictions($customVars);
+        $customVars->filter(Filter::like('flatname', $searchTerm));
+        $idColumn = $resolver->qualifyColumn('id', $resolver->getAlias($customVars->getModel()));
+        $customVars = $customVars->assembleSelect();
+
+        $customVars->columns($scalarQueries);
+        $customVars->groupBy($idColumn);
+        $customVars->limit(static::DEFAULT_LIMIT);
+
+        // This outer query exists only because there's no way to combine aggregates and sub queries (yet)
+        return (new Select())->columns($aggregates)->from(['results' => $customVars])->groupBy('flatname');
+    }
+
+    /**
+     * Collect all columns of this model and its relations that can be used for filtering
+     *
+     * @param Model $model
+     * @param Resolver $resolver
+     *
+     * @return Generator
+     */
+    public static function collectFilterColumns(Model $model, Resolver $resolver): Generator
+    {
+        if ($model instanceof UnionModel) {
+            $models = [];
+            foreach ($model->getUnions() as $union) {
+                /** @var Model $unionModel */
+                $unionModel = new $union[0]();
+                $models[$unionModel->getTableName()] = $unionModel;
+                self::collectRelations($resolver, $unionModel, $models, []);
+            }
+        } else {
+            $models = [$model->getTableName() => $model];
+            self::collectRelations($resolver, $model, $models, []);
+        }
+
+        foreach ($models as $path => $targetModel) {
+            /** @var Model $targetModel */
+            foreach ($resolver->getColumnDefinitions($targetModel) as $columnName => $definition) {
+                yield $path . '.' . $columnName => $definition->getLabel();
+            }
+        }
+
+        foreach ($resolver->getBehaviors($model) as $behavior) {
+            if ($behavior instanceof ReRoute) {
+                foreach ($behavior->getRoutes() as $name => $route) {
+                    $relation = $resolver->resolveRelation(
+                        $resolver->qualifyPath($route, $model->getTableName()),
+                        $model
+                    );
+                    foreach ($resolver->getColumnDefinitions($relation->getTarget()) as $columnName => $definition) {
+                        yield $name . '.' . $columnName => $definition->getLabel();
+                    }
+                }
+            }
+        }
+
+        if ($model instanceof UnionModel) {
+            $queries = $model->getUnions();
+            $baseModelClass = end($queries)[0];
+            $model = new $baseModelClass();
+        }
+
+        $foreignMetaDataSources = [];
+        if (! $model instanceof Host) {
+            $foreignMetaDataSources[] = 'host.user';
+            $foreignMetaDataSources[] = 'host.usergroup';
+        }
+
+        if (! $model instanceof Service) {
+            $foreignMetaDataSources[] = 'service.user';
+            $foreignMetaDataSources[] = 'service.usergroup';
+        }
+
+        foreach ($foreignMetaDataSources as $path) {
+            $foreignColumnDefinitions = $resolver->getColumnDefinitions($resolver->resolveRelation(
+                $resolver->qualifyPath($path, $model->getTableName()),
+                $model
+            )->getTarget());
+            foreach ($foreignColumnDefinitions as $columnName => $columnDefinition) {
+                yield "$path.$columnName" => $columnDefinition->getLabel();
+            }
+        }
+    }
+
+    /**
+     * Collect all direct relations of the given model
+     *
+     * A direct relation is either a direct descendant of the model
+     * or a descendant of such related in a to-one cardinality.
+     *
+     * @param Resolver $resolver
+     * @param Model $subject
+     * @param array $models
+     * @param array $path
+     */
+    protected static function collectRelations(Resolver $resolver, Model $subject, array &$models, array $path)
+    {
+        foreach ($resolver->getRelations($subject) as $name => $relation) {
+            /** @var Relation $relation */
+            $isHasOne = $relation instanceof HasOne;
+            if (empty($path) || $name === 'state' || $name === 'last_comment') {
+                $relationPath = [$name];
+                if ($isHasOne && empty($path)) {
+                    array_unshift($relationPath, $subject->getTableName());
+                }
+
+                $relationPath = array_merge($path, $relationPath);
+                $models[join('.', $relationPath)] = $relation->getTarget();
+                self::collectRelations($resolver, $relation->getTarget(), $models, $relationPath);
+            }
+        }
+    }
+}
diff --git a/library/Icingadb/Web/Control/ViewModeSwitcher.php b/library/Icingadb/Web/Control/ViewModeSwitcher.php
new file mode 100644
index 0000000..669bc32
--- /dev/null
+++ b/library/Icingadb/Web/Control/ViewModeSwitcher.php
@@ -0,0 +1,203 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Web\Control;
+
+use ipl\Html\Attributes;
+use ipl\Html\Form;
+use ipl\Html\FormElement\HiddenElement;
+use ipl\Html\FormElement\InputElement;
+use ipl\Html\HtmlElement;
+use ipl\Web\Common\FormUid;
+use ipl\Web\Widget\IcingaIcon;
+
+class ViewModeSwitcher extends Form
+{
+    use FormUid;
+
+    protected $defaultAttributes = [
+        'class' => 'view-mode-switcher',
+        'name'  => 'view-mode-switcher'
+    ];
+
+    /** @var string Default view mode */
+    const DEFAULT_VIEW_MODE = 'common';
+
+    /** @var string Default view mode param */
+    const DEFAULT_VIEW_MODE_PARAM = 'view';
+
+    /** @var array View mode-icon pairs */
+    public static $viewModes = [
+        'minimal'  => 'minimal',
+        'common'   => 'default',
+        'detailed' => 'detailed',
+        'tabular'  => 'tabular'
+    ];
+
+    /** @var string */
+    protected $defaultViewMode;
+
+    /** @var string */
+    protected $method = 'POST';
+
+    /** @var callable */
+    protected $protector;
+
+    /** @var string */
+    protected $viewModeParam = self::DEFAULT_VIEW_MODE_PARAM;
+
+    /**
+     * Get the default mode
+     *
+     * @return string
+     */
+    public function getDefaultViewMode(): string
+    {
+        return $this->defaultViewMode ?: static::DEFAULT_VIEW_MODE;
+    }
+
+    /**
+     * Set the default view mode
+     *
+     * @param string $defaultViewMode
+     *
+     * @return $this
+     */
+    public function setDefaultViewMode(string $defaultViewMode): self
+    {
+        $this->defaultViewMode = $defaultViewMode;
+
+        return $this;
+    }
+
+    /**
+     * Get the view mode URL parameter
+     *
+     * @return string
+     */
+    public function getViewModeParam(): string
+    {
+        return $this->viewModeParam;
+    }
+
+    /**
+     * Set the view mode URL parameter
+     *
+     * @param string $viewModeParam
+     *
+     * @return $this
+     */
+    public function setViewModeParam(string $viewModeParam): self
+    {
+        $this->viewModeParam = $viewModeParam;
+
+        return $this;
+    }
+
+    /**
+     * Get the view mode
+     *
+     * @return string
+     */
+    public function getViewMode(): string
+    {
+        $viewMode = $this->getPopulatedValue($this->getViewModeParam(), $this->getDefaultViewMode());
+
+        if (array_key_exists($viewMode, static::$viewModes)) {
+            return $viewMode;
+        }
+
+        return $this->getDefaultViewMode();
+    }
+
+    /**
+     * Set the view mode
+     *
+     * @param string $name
+     *
+     * @return $this
+     */
+    public function setViewMode(string $name)
+    {
+        $this->populate([$this->getViewModeParam() => $name]);
+
+        return $this;
+    }
+
+    /**
+     * Set callback to protect ids with
+     *
+     * @param   callable $protector
+     *
+     * @return  $this
+     */
+    public function setIdProtector(callable $protector): self
+    {
+        $this->protector = $protector;
+
+        return $this;
+    }
+
+    private function protectId($id)
+    {
+        if (is_callable($this->protector)) {
+            return call_user_func($this->protector, $id);
+        }
+
+        return $id;
+    }
+
+    protected function assemble()
+    {
+        $viewModeParam = $this->getViewModeParam();
+
+        $this->addElement($this->createUidElement());
+        $this->addElement(new HiddenElement($viewModeParam));
+
+        foreach (static::$viewModes as $viewMode => $icon) {
+            if ($viewMode === 'tabular') {
+                continue;
+            }
+
+            $protectedId = $this->protectId('view-mode-switcher-' . $icon);
+            $input = new InputElement($viewModeParam, [
+                'class' => 'autosubmit',
+                'id'    => $protectedId,
+                'name'  => $viewModeParam,
+                'type'  => 'radio',
+                'value' => $viewMode
+            ]);
+            $input->getAttributes()->registerAttributeCallback('checked', function () use ($viewMode) {
+                return $viewMode === $this->getViewMode();
+            });
+
+            $label = new HtmlElement(
+                'label',
+                Attributes::create([
+                    'for' => $protectedId
+                ]),
+                new IcingaIcon($icon)
+            );
+            $label->getAttributes()->registerAttributeCallback('title', function () use ($viewMode) {
+                switch ($viewMode) {
+                    case 'minimal':
+                        $active = t('Minimal view active');
+                        $inactive = t('Switch to minimal view');
+                        break;
+                    case 'common':
+                        $active = t('Common view active');
+                        $inactive = t('Switch to common view');
+                        break;
+                    case 'detailed':
+                        $active = t('Detailed view active');
+                        $inactive = t('Switch to detailed view');
+                }
+
+                return $viewMode === $this->getViewMode() ? $active : $inactive;
+            });
+
+            $this->addHtml($input, $label);
+        }
+    }
+}
diff --git a/library/Icingadb/Web/Controller.php b/library/Icingadb/Web/Controller.php
new file mode 100644
index 0000000..08d69c9
--- /dev/null
+++ b/library/Icingadb/Web/Controller.php
@@ -0,0 +1,566 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Web;
+
+use Exception;
+use Generator;
+use GuzzleHttp\Psr7\ServerRequest;
+use Icinga\Application\Config;
+use Icinga\Application\Icinga;
+use Icinga\Application\Logger;
+use Icinga\Application\Version;
+use Icinga\Data\ConfigObject;
+use Icinga\Date\DateFormatter;
+use Icinga\Exception\ConfigurationError;
+use Icinga\Exception\Json\JsonDecodeException;
+use Icinga\Module\Icingadb\Common\Auth;
+use Icinga\Module\Icingadb\Common\Database;
+use Icinga\Module\Icingadb\Common\BaseItemList;
+use Icinga\Module\Icingadb\Common\SearchControls;
+use Icinga\Module\Icingadb\Data\CsvResultSet;
+use Icinga\Module\Icingadb\Data\JsonResultSet;
+use Icinga\Module\Icingadb\Web\Control\ViewModeSwitcher;
+use Icinga\Module\Icingadb\Widget\ItemTable\BaseItemTable;
+use Icinga\Module\Pdfexport\PrintableHtmlDocument;
+use Icinga\Module\Pdfexport\ProvidedHook\Pdfexport;
+use Icinga\Security\SecurityException;
+use Icinga\User\Preferences;
+use Icinga\User\Preferences\PreferencesStore;
+use Icinga\Util\Environment;
+use Icinga\Util\Json;
+use ipl\Html\Html;
+use ipl\Html\ValidHtml;
+use ipl\Orm\Query;
+use ipl\Orm\UnionQuery;
+use ipl\Stdlib\Contract\Paginatable;
+use ipl\Stdlib\Filter;
+use ipl\Web\Compat\CompatController;
+use ipl\Web\Control\LimitControl;
+use ipl\Web\Control\PaginationControl;
+use ipl\Web\Control\SortControl;
+use ipl\Web\Filter\QueryString;
+use ipl\Web\Url;
+
+class Controller extends CompatController
+{
+    use Auth;
+    use Database;
+    use SearchControls;
+
+    /** @var Filter\Rule Filter from query string parameters */
+    private $filter;
+
+    /** @var string|null */
+    private $format;
+
+    /** @var bool */
+    private $formatProcessed = false;
+
+    /**
+     * Get the filter created from query string parameters
+     *
+     * @return Filter\Rule
+     */
+    public function getFilter(): Filter\Rule
+    {
+        if ($this->filter === null) {
+            $this->filter = QueryString::parse((string) $this->params);
+        }
+
+        return $this->filter;
+    }
+
+    public function createColumnControl(Query $query, ViewModeSwitcher $viewModeSwitcher)
+    {
+        // All of that is essentially what `ColumnControl::apply()` should do
+        $columnsDef = $this->params->shift('columns');
+        if (! $columnsDef) {
+            return null;
+        }
+
+        $columns = [];
+        foreach (explode(',', $columnsDef) as $column) {
+            if ($column = trim($column)) {
+                $columns[] = $column;
+            }
+        }
+
+        $query->withColumns($columns);
+
+        if (! $this->getRequest()->getUrl()->hasParam($viewModeSwitcher->getViewModeParam())) {
+            $viewModeSwitcher->setViewMode('tabular');
+        }
+
+        // For now this also returns the columns, but they should be accessible
+        // by calling `ColumnControl::getColumns()` in the future
+        return $columns;
+    }
+
+    /**
+     * Create and return the LimitControl
+     *
+     * This automatically shifts the limit URL parameter from {@link $params}.
+     *
+     * @return LimitControl
+     */
+    public function createLimitControl(): LimitControl
+    {
+        $limitControl = new LimitControl(Url::fromRequest());
+        $limitControl->setDefaultLimit($this->getPageSize(null));
+
+        $this->params->shift($limitControl->getLimitParam());
+
+        return $limitControl;
+    }
+
+    /**
+     * Create and return the PaginationControl
+     *
+     * This automatically shifts the pagination URL parameters from {@link $params}.
+     *
+     * @return PaginationControl
+     */
+    public function createPaginationControl(Paginatable $paginatable): PaginationControl
+    {
+        $paginationControl = new PaginationControl($paginatable, Url::fromRequest());
+        $paginationControl->setDefaultPageSize($this->getPageSize(null));
+        $paginationControl->setAttribute('id', $this->getRequest()->protectId('pagination-control'));
+
+        $this->params->shift($paginationControl->getPageParam());
+        $this->params->shift($paginationControl->getPageSizeParam());
+
+        return $paginationControl->apply();
+    }
+
+    /**
+     * Create and return the SortControl
+     *
+     * This automatically shifts the sort URL parameter from {@link $params}.
+     *
+     * @param Query $query
+     * @param array $columns Possible sort columns as sort string-label pairs
+     *
+     * @return SortControl
+     */
+    public function createSortControl(Query $query, array $columns): SortControl
+    {
+        $sortControl = SortControl::create($columns);
+
+        $this->params->shift($sortControl->getSortParam());
+
+        return $sortControl->apply($query);
+    }
+
+    /**
+     * Create and return the ViewModeSwitcher
+     *
+     * This automatically shifts the view mode URL parameter from {@link $params}.
+     *
+     * @param PaginationControl $paginationControl
+     * @param LimitControl      $limitControl
+     * @param bool              $verticalPagination
+     *
+     * @return ViewModeSwitcher
+     */
+    public function createViewModeSwitcher(
+        PaginationControl $paginationControl,
+        LimitControl $limitControl,
+        bool $verticalPagination = false
+    ): ViewModeSwitcher {
+        $viewModeSwitcher = new ViewModeSwitcher();
+        $viewModeSwitcher->setIdProtector([$this->getRequest(), 'protectId']);
+
+        $user = $this->Auth()->getUser();
+        if (($preferredModes = $user->getAdditional('icingadb.view_modes')) === null) {
+            try {
+                $preferredModes = Json::decode(
+                    $user->getPreferences()->getValue('icingadb', 'view_modes', '[]'),
+                    true
+                );
+            } catch (JsonDecodeException $e) {
+                Logger::error('Failed to load preferred view modes for user "%s": %s', $user->getUsername(), $e);
+                $preferredModes = [];
+            }
+
+            $user->setAdditional('icingadb.view_modes', $preferredModes);
+        }
+
+        $requestRoute = $this->getRequest()->getUrl()->getPath();
+        if (isset($preferredModes[$requestRoute])) {
+            $viewModeSwitcher->setDefaultViewMode($preferredModes[$requestRoute]);
+        }
+
+        $viewModeSwitcher->populate([
+            $viewModeSwitcher->getViewModeParam() => $this->params->shift($viewModeSwitcher->getViewModeParam())
+        ]);
+
+        $session = $this->Window()->getSessionNamespace(
+            'icingadb-viewmode-' . $this->Window()->getContainerId()
+        );
+
+        $viewModeSwitcher->on(
+            ViewModeSwitcher::ON_SUCCESS,
+            function (ViewModeSwitcher $viewModeSwitcher) use (
+                $user,
+                $preferredModes,
+                $paginationControl,
+                $verticalPagination,
+                &$session
+            ) {
+                $viewMode = $viewModeSwitcher->getValue($viewModeSwitcher->getViewModeParam());
+                $requestUrl = Url::fromRequest();
+
+                $preferredModes[$requestUrl->getPath()] = $viewMode;
+                $user->setAdditional('icingadb.view_modes', $preferredModes);
+
+                try {
+                    $preferencesStore = PreferencesStore::create(new ConfigObject([
+                        //TODO: Don't set store key as it will no longer be needed once we drop support for
+                        // lower version of icingaweb2 then v2.11.
+                        //https://github.com/Icinga/icingaweb2/pull/4765
+                        'store'     => Config::app()->get('global', 'config_backend', 'db'),
+                        'resource'  => Config::app()->get('global', 'config_resource')
+                    ]), $user);
+                    $preferencesStore->load();
+                    $preferencesStore->save(
+                        new Preferences(['icingadb' => ['view_modes' => Json::encode($preferredModes)]])
+                    );
+                } catch (Exception $e) {
+                    Logger::error('Failed to save preferred view mode for user "%s": %s', $user->getUsername(), $e);
+                }
+
+                $pageParam = $paginationControl->getPageParam();
+                $limitParam = LimitControl::DEFAULT_LIMIT_PARAM;
+                $currentPage = $paginationControl->getCurrentPageNumber();
+
+                $requestUrl->setParam($viewModeSwitcher->getViewModeParam(), $viewMode);
+                if (! $requestUrl->hasParam($limitParam)) {
+                    if ($viewMode === 'minimal') {
+                        $session->set('previous_page', $currentPage);
+                        $session->set('request_path', $requestUrl->getPath());
+
+                        $limit = $paginationControl->getLimit();
+                        if (! $verticalPagination) {
+                            // We are computing it based on the first element being rendered on this current page
+                            $currentPage = (int) (floor((($currentPage * $limit) - $limit) / ($limit * 2)) + 1);
+                        } else {
+                            $currentPage = (int) (round($currentPage * $limit / ($limit * 2)));
+                        }
+
+                        $session->set('current_page', $currentPage);
+                    } elseif ($viewModeSwitcher->getDefaultViewMode() === 'minimal') {
+                        $limit = $paginationControl->getLimit();
+                        if ($currentPage === $session->get('current_page')) {
+                            // No other page numbers have been selected, i.e the user only
+                            // switches back and forth without changing the page numbers
+                            $currentPage =  $session->get('previous_page');
+                        } elseif (! $verticalPagination) {
+                            $currentPage = (int) (floor((($currentPage * $limit) - $limit) / ($limit / 2)) + 1);
+                        } else {
+                            $currentPage = (int) (floor($currentPage * $limit / ($limit / 2)));
+                        }
+
+                        $session->clear();
+                    }
+
+                    if (($requestUrl->hasParam($pageParam) && $currentPage > 1) || $currentPage > 1) {
+                        $requestUrl->setParam($pageParam, $currentPage);
+                    } else {
+                        $requestUrl->remove($pageParam);
+                    }
+                }
+
+                $this->redirectNow($requestUrl);
+            }
+        )->handleRequest(ServerRequest::fromGlobals());
+
+        if ($viewModeSwitcher->getViewMode() === 'minimal') {
+            $hasLimitParam = Url::fromRequest()->hasParam($limitControl->getLimitParam());
+
+            if ($paginationControl->getDefaultPageSize() <= LimitControl::DEFAULT_LIMIT && ! $hasLimitParam) {
+                $paginationControl->setDefaultPageSize($paginationControl->getDefaultPageSize() * 2);
+                $limitControl->setDefaultLimit($limitControl->getDefaultLimit() * 2);
+
+                $paginationControl->apply();
+            }
+        }
+
+        $requestPath =  $session->get('request_path');
+        if ($requestPath && $requestPath !== $requestRoute) {
+            $session->clear();
+        }
+
+        return $viewModeSwitcher;
+    }
+
+    /**
+     * Process a search request
+     *
+     * @param Query $query
+     *
+     * @return void
+     */
+    public function handleSearchRequest(Query $query)
+    {
+        $q = trim($this->params->shift('q', ''), ' *');
+        if (! $q) {
+            return;
+        }
+
+        $filter = Filter::any();
+        $this->prepareSearchFilter($query, $q, $filter);
+
+        $redirectUrl = Url::fromRequest();
+        $redirectUrl->setQueryString(QueryString::render($filter));
+        foreach ($this->params->toArray(false) as $name => $value) {
+            $redirectUrl->getParams()->addEncoded($name, $value);
+        }
+
+        $this->getResponse()->redirectAndExit($redirectUrl);
+    }
+
+    /**
+     * Prepare the given search filter
+     *
+     * @param Query $query
+     * @param string $search
+     * @param Filter\Any $filter
+     *
+     * @return void
+     */
+    protected function prepareSearchFilter(Query $query, string $search, Filter\Any $filter)
+    {
+        foreach ($query->getModel()->getSearchColumns() as $column) {
+            $filter->add(Filter::like(
+                $query->getResolver()->qualifyColumn($column, $query->getModel()->getTableName()),
+                "*$search*"
+            ));
+        }
+    }
+
+    /**
+     * Require permission to access the given route
+     *
+     * @param string $name If NULL, the current controller name is used
+     *
+     * @throws SecurityException
+     */
+    public function assertRouteAccess(string $name = null)
+    {
+        if (! $name) {
+            $name = $this->getRequest()->getControllerName();
+        }
+
+        if (! $this->isPermittedRoute($name)) {
+            throw new SecurityException('No permission to access this route');
+        }
+    }
+
+    public function export(Query ...$queries)
+    {
+        if ($this->format === 'sql') {
+            foreach ($queries as $query) {
+                list($sql, $values) = $query->getDb()->getQueryBuilder()->assembleSelect($query->assembleSelect());
+
+                $unused = [];
+                foreach ($values as $value) {
+                    $pos = strpos($sql, '?');
+                    if ($pos !== false) {
+                        if (is_string($value)) {
+                            $value = "'" . $value . "'";
+                        }
+
+                        $sql = substr_replace($sql, $value, $pos, 1);
+                    } else {
+                        $unused[] = $value;
+                    }
+                }
+
+                if (!empty($unused)) {
+                    $sql .= ' /* Unused values: "' . join('", "', $unused) . '" */';
+                }
+
+                $this->content->add(Html::tag('pre', $sql));
+            }
+
+            return true;
+        }
+
+        // It only makes sense to export a single result to CSV or JSON
+        $query = $queries[0];
+
+        // No matter the format, a limit should only apply if set
+        if ($this->format !== null) {
+            $query->limit(Url::fromRequest()->getParam('limit'));
+        }
+
+        if ($this->format === 'json' || $this->format === 'csv') {
+            $response = $this->getResponse();
+            $fileName = $this->view->title;
+
+            ob_end_clean();
+            Environment::raiseExecutionTime();
+
+            if ($this->format === 'json') {
+                $response
+                    ->setHeader('Content-Type', 'application/json')
+                    ->setHeader('Cache-Control', 'no-store')
+                    ->setHeader(
+                        'Content-Disposition',
+                        'attachment; filename=' . $fileName . '.json'
+                    )
+                    ->sendResponse();
+
+                JsonResultSet::stream($query);
+            } else {
+                $response
+                    ->setHeader('Content-Type', 'text/csv')
+                    ->setHeader('Cache-Control', 'no-store')
+                    ->setHeader(
+                        'Content-Disposition',
+                        'attachment; filename=' . $fileName . '.csv'
+                    )
+                    ->sendResponse();
+
+                CsvResultSet::stream($query);
+            }
+        }
+
+        $this->getTabs()->enableDataExports();
+    }
+
+    /**
+     * @todo Remove once support for Icinga Web 2 v2.9.x is dropped
+     */
+    protected function sendAsPdf()
+    {
+        if (! Icinga::app()->getModuleManager()->has('pdfexport')) {
+            throw new ConfigurationError('The pdfexport module is required for exports to PDF');
+        }
+
+        if (version_compare(Version::VERSION, '2.10.0', '>=')) {
+            parent::sendAsPdf();
+            return;
+        }
+
+        putenv('ICINGAWEB_EXPORT_FORMAT=pdf');
+        Environment::raiseMemoryLimit('512M');
+        Environment::raiseExecutionTime(300);
+
+        $time = DateFormatter::formatDateTime(time());
+
+        $doc = (new PrintableHtmlDocument())
+            ->setTitle($this->view->title)
+            ->setHeader(Html::wantHtml([
+                Html::tag('span', ['class' => 'title']),
+                Html::tag('time', null, $time)
+            ]))
+            ->setFooter(Html::wantHtml([
+                Html::tag('span', null, [
+                    t('Page') . ' ',
+                    Html::tag('span', ['class' => 'pageNumber']),
+                    ' / ',
+                    Html::tag('span', ['class' => 'totalPages'])
+                ]),
+                Html::tag('p', null, Url::fromRequest()->setParams($this->params))
+            ]))
+            ->addHtml($this->content);
+        $doc->getAttributes()->add('class', 'icinga-module module-icingadb');
+
+        Pdfexport::first()->streamPdfFromHtml($doc, sprintf(
+            '%s-%s',
+            $this->view->title ?: $this->getRequest()->getActionName(),
+            $time
+        ));
+    }
+
+    public function dispatch($action)
+    {
+        // Notify helpers of action preDispatch state
+        $this->_helper->notifyPreDispatch();
+
+        $this->preDispatch();
+
+        if ($this->getRequest()->isDispatched()) {
+            // If pre-dispatch hooks introduced a redirect then stop dispatch
+            // @see ZF-7496
+            if (! $this->getResponse()->isRedirect()) {
+                $interceptable = $this->$action();
+                if ($interceptable instanceof Generator) {
+                    foreach ($interceptable as $stopSignal) {
+                        if ($stopSignal === true) {
+                            $this->formatProcessed = true;
+                            break;
+                        }
+                    }
+                }
+            }
+            $this->postDispatch();
+        }
+
+        // whats actually important here is that this action controller is
+        // shutting down, regardless of dispatching; notify the helpers of this
+        // state
+        $this->_helper->notifyPostDispatch();
+    }
+
+    protected function addContent(ValidHtml $content)
+    {
+        if ($content instanceof BaseItemList) {
+            $this->content->getAttributes()->add('class', 'full-width');
+        } elseif ($content instanceof BaseItemTable) {
+            $this->content->getAttributes()->add('class', 'full-height');
+        }
+
+        return parent::addContent($content);
+    }
+
+    public function filter(Query $query, Filter\Rule $filter = null): self
+    {
+        if ($this->format !== 'sql' || $this->hasPermission('config/authentication/roles/show')) {
+            $this->applyRestrictions($query);
+        }
+
+        if ($query instanceof UnionQuery) {
+            foreach ($query->getUnions() as $query) {
+                $query->filter($filter ?: $this->getFilter());
+            }
+        } else {
+            $query->filter($filter ?: $this->getFilter());
+        }
+
+        return $this;
+    }
+
+    public function preDispatch()
+    {
+        parent::preDispatch();
+
+        $this->format = $this->params->shift('format');
+    }
+
+    public function postDispatch()
+    {
+        if (! $this->formatProcessed && $this->format !== null && $this->format !== 'pdf') {
+            // The purpose of this is not only to show that a requested format isn't supported.
+            // It's main purpose is to not allow to bypass restrictions with `?format=sql` as
+            // it may be possible that an action applies restrictions, but doesn't support any
+            // output formats. Since the restrictions are bypassed in method `$this->filter()`
+            // for the SQL output format and the actual format processing is part of a different
+            // method (`$this->export()`) which needs to be called explicitly by an action,
+            // it's otherwise possible for bad individuals to access unrestricted data.
+            $this->httpBadRequest(t('This route does not support the requested output format'));
+        }
+
+        parent::postDispatch();
+    }
+
+    protected function moduleInit()
+    {
+        Icinga::app()->getFrontController()
+            ->getPlugin('Zend_Controller_Plugin_ErrorHandler')
+            ->setErrorHandlerModule('icingadb');
+    }
+}
diff --git a/library/Icingadb/Web/Navigation/Action.php b/library/Icingadb/Web/Navigation/Action.php
new file mode 100644
index 0000000..d02f933
--- /dev/null
+++ b/library/Icingadb/Web/Navigation/Action.php
@@ -0,0 +1,134 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Web\Navigation;
+
+use Icinga\Module\Icingadb\Common\Auth;
+use Icinga\Module\Icingadb\Common\Macros;
+use Icinga\Module\Icingadb\Model\Host;
+use Icinga\Module\Icingadb\Model\Service;
+use Icinga\Web\Navigation\NavigationItem;
+use ipl\Web\Url;
+
+class Action extends NavigationItem
+{
+    use Auth;
+    use Macros;
+
+    /**
+     * Whether this action's macros were already resolved
+     *
+     * @var bool
+     */
+    protected $resolved = false;
+
+    /**
+     * This action's object
+     *
+     * @var Host|Service
+     */
+    protected $object;
+
+    /**
+     * The filter to use when being asked whether to render this action
+     *
+     * @var string
+     */
+    protected $filter;
+
+    /**
+     * This action's raw url attribute
+     *
+     * @var string
+     */
+    protected $rawUrl;
+
+    /**
+     * Set this action's object
+     *
+     * @param  Host|Service $object
+     *
+     * @return $this
+     */
+    public function setObject($object): self
+    {
+        $this->object = $object;
+
+        return $this;
+    }
+
+    /**
+     * Get this action's object
+     *
+     * @return Host|Service
+     */
+    protected function getObject()
+    {
+        return $this->object;
+    }
+
+    /**
+     * Set the filter to use when being asked whether to render this action
+     *
+     * @param   string  $filter
+     *
+     * @return  $this
+     */
+    public function setFilter(string $filter): self
+    {
+        $this->filter = $filter;
+
+        return $this;
+    }
+
+    /**
+     * Get the filter to use when being asked whether to render this action
+     *
+     * @return  ?string
+     */
+    public function getFilter(): ?string
+    {
+        return $this->filter;
+    }
+
+    /**
+     * Set this item's url
+     *
+     * @param \Icinga\Web\Url|string $url
+     *
+     * @return $this
+     */
+    public function setUrl($url): self
+    {
+        if (is_string($url)) {
+            $this->rawUrl = $url;
+        } else {
+            parent::setUrl($url);
+        }
+
+        return $this;
+    }
+
+    public function getUrl(): ?\Icinga\Web\Url
+    {
+        $url = parent::getUrl();
+        if (! $this->resolved && $url === null && $this->rawUrl !== null) {
+            $this->setUrl(Url::fromPath($this->expandMacros($this->rawUrl, $this->getObject())));
+            $this->resolved = true;
+            return parent::getUrl();
+        } else {
+            return $url;
+        }
+    }
+
+    public function getRender(): bool
+    {
+        if ($this->render === null) {
+            $filter = $this->getFilter();
+            $this->render = ! $filter || $this->isMatchedOn($filter, $this->getObject());
+        }
+
+        return $this->render;
+    }
+}
diff --git a/library/Icingadb/Web/Navigation/IcingadbHostAction.php b/library/Icingadb/Web/Navigation/IcingadbHostAction.php
new file mode 100644
index 0000000..a5fc256
--- /dev/null
+++ b/library/Icingadb/Web/Navigation/IcingadbHostAction.php
@@ -0,0 +1,9 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Web\Navigation;
+
+class IcingadbHostAction extends Action
+{
+}
diff --git a/library/Icingadb/Web/Navigation/IcingadbServiceAction.php b/library/Icingadb/Web/Navigation/IcingadbServiceAction.php
new file mode 100644
index 0000000..d623951
--- /dev/null
+++ b/library/Icingadb/Web/Navigation/IcingadbServiceAction.php
@@ -0,0 +1,9 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Web\Navigation;
+
+class IcingadbServiceAction extends Action
+{
+}
diff --git a/library/Icingadb/Web/Navigation/Renderer/HostProblemsBadge.php b/library/Icingadb/Web/Navigation/Renderer/HostProblemsBadge.php
new file mode 100644
index 0000000..fc64c7d
--- /dev/null
+++ b/library/Icingadb/Web/Navigation/Renderer/HostProblemsBadge.php
@@ -0,0 +1,35 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Web\Navigation\Renderer;
+
+use Icinga\Module\Icingadb\Common\Auth;
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Model\HoststateSummary;
+use ipl\Web\Url;
+
+class HostProblemsBadge extends ProblemsBadge
+{
+    use Auth;
+
+    protected function fetchProblemsCount()
+    {
+        $summary = HoststateSummary::on($this->getDb());
+        $this->applyRestrictions($summary);
+        $count = (int) $summary->first()->hosts_down_unhandled;
+        if ($count) {
+            $this->setTitle(sprintf(
+                tp('One unhandled host down', '%d unhandled hosts down', $count),
+                $count
+            ));
+        }
+
+        return $count;
+    }
+
+    protected function getUrl(): Url
+    {
+        return Links::hosts()->setParams(['host.state.is_problem' => 'y', 'sort' => 'host.state.severity desc']);
+    }
+}
diff --git a/library/Icingadb/Web/Navigation/Renderer/ProblemsBadge.php b/library/Icingadb/Web/Navigation/Renderer/ProblemsBadge.php
new file mode 100644
index 0000000..bebc6be
--- /dev/null
+++ b/library/Icingadb/Web/Navigation/Renderer/ProblemsBadge.php
@@ -0,0 +1,173 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Web\Navigation\Renderer;
+
+use Exception;
+use Icinga\Application\Logger;
+use Icinga\Module\Icingadb\Common\Database;
+use Icinga\Module\Icingadb\Widget\StateBadge;
+use Icinga\Web\Navigation\NavigationItem;
+use Icinga\Web\Navigation\Renderer\NavigationItemRenderer;
+use ipl\Html\HtmlDocument;
+use ipl\Html\HtmlString;
+use ipl\Web\Widget\Link;
+
+abstract class ProblemsBadge extends NavigationItemRenderer
+{
+    use Database;
+
+    const STATE_CRITICAL = 'critical';
+    const STATE_UNKNOWN = 'unknown';
+
+    /** @var int Count cache */
+    protected $count;
+
+    /** @var string State text */
+    protected $state;
+
+    /** @var string Title */
+    protected $title;
+
+    protected $linkDisabled;
+
+    abstract protected function fetchProblemsCount();
+
+    abstract protected function getUrl();
+
+    public function getProblemsCount()
+    {
+        if ($this->count === null) {
+            try {
+                $count = $this->fetchProblemsCount();
+            } catch (Exception $e) {
+                Logger::debug($e);
+
+                $this->count = 1;
+
+                $this->setState(static::STATE_UNKNOWN);
+                $this->setTitle($e->getMessage());
+
+                return $this->count;
+            }
+
+            $this->count = $this->round($count);
+
+            $this->setState(static::STATE_CRITICAL);
+        }
+
+        return $this->count;
+    }
+
+    /**
+     * Set the state text
+     *
+     * @param string $state
+     *
+     * @return $this
+     */
+    public function setState(string $state): self
+    {
+        $this->state = $state;
+
+        return $this;
+    }
+
+    /**
+     * Get the state text
+     *
+     * @return string
+     */
+    public function getState(): string
+    {
+        if ($this->state === null) {
+            throw new \LogicException(
+                'You are accessing an unset property. Please make sure to set it beforehand.'
+            );
+        }
+
+        return $this->state;
+    }
+
+    /**
+     * Set the title
+     *
+     * @param string $title
+     *
+     * @return $this
+     */
+    public function setTitle(string $title): self
+    {
+        $this->title = $title;
+
+        return $this;
+    }
+
+    /**
+     * Get the title
+     *
+     * @return ?string
+     */
+    public function getTitle()
+    {
+        return $this->title;
+    }
+
+    public function render(NavigationItem $item = null): string
+    {
+        if ($item === null) {
+            $item = $this->getItem();
+        }
+
+        $item->setCssClass('badge-nav-item icinga-module module-icingadb');
+
+        $html = new HtmlDocument();
+
+        $badge = $this->createBadge();
+        if ($badge !== null) {
+            if ($this->linkDisabled) {
+                $badge->addAttributes(['class' => 'disabled']);
+                $this->setEscapeLabel(false);
+                $label = $this->view()->escape($item->getLabel());
+                $item->setLabel($badge . $label);
+            } else {
+                $html->add(new Link($badge, $this->getUrl(), ['title' => $this->getTitle()]));
+            }
+        }
+
+        return $html
+            ->prepend(new HtmlString(parent::render($item)))
+            ->render();
+    }
+
+    protected function createBadge()
+    {
+        $count = $this->getProblemsCount();
+
+        if ($count) {
+            return (new StateBadge($count, $this->getState()))
+                    ->addAttributes(['class' => 'badge', 'title' => $this->getTitle()]);
+        }
+
+        return null;
+    }
+
+    protected function round($count)
+    {
+        if ($count > 1000000) {
+            $count = round($count, -6) / 1000000 . 'M';
+        } elseif ($count > 1000) {
+            $count = round($count, -3) / 1000 . 'k';
+        }
+
+        return $count;
+    }
+
+    public function disableLink()
+    {
+        $this->linkDisabled = true;
+
+        return $this;
+    }
+}
diff --git a/library/Icingadb/Web/Navigation/Renderer/ServiceProblemsBadge.php b/library/Icingadb/Web/Navigation/Renderer/ServiceProblemsBadge.php
new file mode 100644
index 0000000..b2f2cae
--- /dev/null
+++ b/library/Icingadb/Web/Navigation/Renderer/ServiceProblemsBadge.php
@@ -0,0 +1,36 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Web\Navigation\Renderer;
+
+use Icinga\Module\Icingadb\Common\Auth;
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Model\ServicestateSummary;
+use ipl\Web\Url;
+
+class ServiceProblemsBadge extends ProblemsBadge
+{
+    use Auth;
+
+    protected function fetchProblemsCount()
+    {
+        $summary = ServicestateSummary::on($this->getDb());
+        $this->applyRestrictions($summary);
+        $count = (int) $summary->first()->services_critical_unhandled;
+        if ($count) {
+            $this->setTitle(sprintf(
+                tp('One unhandled service critical', '%d unhandled services critical', $count),
+                $count
+            ));
+        }
+
+        return $count;
+    }
+
+    protected function getUrl(): Url
+    {
+        return Links::services()
+            ->setParams(['service.state.is_problem' => 'y', 'sort' => 'service.state.severity desc']);
+    }
+}
diff --git a/library/Icingadb/Web/Navigation/Renderer/TotalProblemsBadge.php b/library/Icingadb/Web/Navigation/Renderer/TotalProblemsBadge.php
new file mode 100644
index 0000000..703db65
--- /dev/null
+++ b/library/Icingadb/Web/Navigation/Renderer/TotalProblemsBadge.php
@@ -0,0 +1,66 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Web\Navigation\Renderer;
+
+use Icinga\Web\Navigation\Renderer\BadgeNavigationItemRenderer;
+
+class TotalProblemsBadge extends BadgeNavigationItemRenderer
+{
+    /**
+     * Cached count
+     *
+     * @var int
+     */
+    protected $count;
+
+    /**
+     * State to severity map
+     *
+     * @var array
+     */
+    protected static $stateSeverityMap = [
+        self::STATE_OK          => 0,
+        self::STATE_PENDING     => 1,
+        self::STATE_UNKNOWN     => 2,
+        self::STATE_WARNING     => 3,
+        self::STATE_CRITICAL    => 4,
+    ];
+
+    /**
+     * Severity to state map
+     *
+     * @var array
+     */
+    protected static $severityStateMap = [
+        self::STATE_OK,
+        self::STATE_PENDING,
+        self::STATE_UNKNOWN,
+        self::STATE_WARNING,
+        self::STATE_CRITICAL
+    ];
+
+    public function getCount()
+    {
+        if ($this->count === null) {
+            $countMap = array_fill(0, 5, 0);
+            $maxSeverity = 0;
+            foreach ($this->getItem()->getChildren() as $child) {
+                $renderer = $child->getRenderer();
+                if ($renderer instanceof ProblemsBadge) {
+                    $count = $renderer->getProblemsCount();
+                    if ($count) {
+                        $severity = static::$stateSeverityMap[$renderer->getState()];
+                        $countMap[$severity] += $count;
+                        $maxSeverity = max($maxSeverity, $severity);
+                    }
+                }
+            }
+            $this->count = $countMap[$maxSeverity];
+            $this->state = static::$severityStateMap[$maxSeverity];
+        }
+
+        return $this->count;
+    }
+}
diff --git a/library/Icingadb/Widget/AttemptBall.php b/library/Icingadb/Widget/AttemptBall.php
new file mode 100644
index 0000000..e57c59c
--- /dev/null
+++ b/library/Icingadb/Widget/AttemptBall.php
@@ -0,0 +1,31 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget;
+
+use ipl\Html\BaseHtmlElement;
+
+/**
+ * Visually represents one single check attempt.
+ */
+class AttemptBall extends BaseHtmlElement
+{
+    protected $tag = 'div';
+
+    protected $defaultAttributes = ['class' => 'ball'];
+
+    /**
+     * Create a new attempt ball
+     *
+     * @param bool $taken Whether the attempt was taken
+     */
+    public function __construct(bool $taken = false)
+    {
+        if ($taken) {
+            $this->addAttributes(['class' => 'ball-size-s taken']);
+        } else {
+            $this->addAttributes(['class' => 'ball-size-xs']);
+        }
+    }
+}
diff --git a/library/Icingadb/Widget/CheckAttempt.php b/library/Icingadb/Widget/CheckAttempt.php
new file mode 100644
index 0000000..cf12de3
--- /dev/null
+++ b/library/Icingadb/Widget/CheckAttempt.php
@@ -0,0 +1,54 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget;
+
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\FormattedString;
+
+/**
+ * Visually represents the check attempts taken out of max check attempts.
+ */
+class CheckAttempt extends BaseHtmlElement
+{
+    protected $tag = 'div';
+
+    protected $defaultAttributes = ['class' => 'check-attempt'];
+
+    /** @var int Current attempt */
+    protected $attempt;
+
+    /** @var int Max check attempts */
+    protected $maxAttempts;
+
+    /**
+     * Create a new check attempt widget
+     *
+     * @param int $attempt     Current check attempt
+     * @param int $maxAttempts Max check attempts
+     */
+    public function __construct(int $attempt, int $maxAttempts)
+    {
+        $this->attempt = $attempt;
+        $this->maxAttempts = $maxAttempts;
+    }
+
+    protected function assemble()
+    {
+        if ($this->attempt == $this->maxAttempts) {
+            return;
+        }
+
+        if ($this->maxAttempts > 5) {
+            $this->add(FormattedString::create('%d/%d', $this->attempt, $this->maxAttempts));
+        } else {
+            for ($i = 0; $i < $this->attempt; ++$i) {
+                $this->add(new AttemptBall(true));
+            }
+            for ($i = $this->attempt; $i < $this->maxAttempts; ++$i) {
+                $this->add(new AttemptBall());
+            }
+        }
+    }
+}
diff --git a/library/Icingadb/Widget/Detail/CheckStatistics.php b/library/Icingadb/Widget/Detail/CheckStatistics.php
new file mode 100644
index 0000000..51bcb63
--- /dev/null
+++ b/library/Icingadb/Widget/Detail/CheckStatistics.php
@@ -0,0 +1,204 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\Detail;
+
+use Icinga\Date\DateFormatter;
+use Icinga\Module\Icingadb\Widget\CheckAttempt;
+use Icinga\Module\Icingadb\Widget\EmptyState;
+use Icinga\Util\Format;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\Html;
+use ipl\Web\Common\Card;
+use ipl\Web\Widget\HorizontalKeyValue;
+use ipl\Web\Widget\StateBall;
+use ipl\Web\Widget\TimeAgo;
+use ipl\Web\Widget\TimeSince;
+use ipl\Web\Widget\TimeUntil;
+use ipl\Web\Widget\VerticalKeyValue;
+
+class CheckStatistics extends Card
+{
+    protected $object;
+
+    protected $tag = 'div';
+
+    protected $defaultAttributes = ['class' => 'progress-bar check-statistics'];
+
+    public function __construct($object)
+    {
+        $this->object = $object;
+    }
+
+    protected function assembleBody(BaseHtmlElement $body)
+    {
+        $hPadding = 10;
+        $durationScale = 80;
+
+        $timeline = Html::tag('div', ['class' => 'check-timeline timeline']);
+
+        $overdueBar = null;
+        $nextCheckTime = $this->object->state->next_check;
+        if ($this->object->state->is_overdue) {
+            $nextCheckTime = $this->object->state->next_update;
+            $leftNow = $durationScale + $hPadding / 2;
+
+            $overdueScale = ($durationScale / 2) * (time() - $nextCheckTime) / (10 * $this->object->check_interval);
+            if ($overdueScale > $durationScale / 2) {
+                $overdueScale = $durationScale / 2;
+            }
+
+            $durationScale -= $overdueScale;
+            $overdueBar = Html::tag('div', [
+                'class' => 'timeline-overlay check-overdue',
+                'style' => sprintf(
+                    'left: %F%%; width: %F%%;',
+                    $hPadding + $durationScale,
+                    $overdueScale + $hPadding / 2
+                )
+            ]);
+        } else {
+            $leftNow = $durationScale * (1 - ($nextCheckTime - time()) / $this->object->check_interval);
+            if ($leftNow > $durationScale) {
+                $leftNow = $durationScale;
+            } elseif ($leftNow < 0) {
+                $leftNow = 0;
+            }
+        }
+
+        $above = Html::tag('ul', ['class' => 'above']);
+        $now = Html::tag(
+            'li',
+            [
+                'class' => 'now positioned',
+                'style' => sprintf('left: %F%%', $hPadding + $leftNow)
+            ],
+            Html::tag(
+                'div',
+                ['class' => 'bubble'],
+                Html::tag(
+                    'strong',
+                    t('Now')
+                )
+            )
+        );
+        $above->add($now);
+
+        $markerLast = Html::tag('div', [
+            'class' => 'marker start',
+            'style' => 'left: ' . $hPadding . '%',
+            'title' => $this->object->state->last_update !== null
+                ? DateFormatter::formatDateTime($this->object->state->last_update)
+                : null
+        ]);
+        $markerNext = Html::tag('div', [
+            'class' => 'marker end',
+            'style' => sprintf('left: %F%%', $hPadding + $durationScale),
+            'title' => $nextCheckTime !== null ? DateFormatter::formatDateTime($nextCheckTime) : null
+        ]);
+        $markerNow = Html::tag('div', [
+            'class' => 'marker now',
+            'style' => sprintf('left: %F%%', $hPadding + $leftNow),
+        ]);
+
+        $timeline->add([
+            $markerLast,
+            $markerNow,
+            $markerNext,
+            $overdueBar
+        ]);
+
+        $lastUpdate = Html::tag(
+            'li',
+            ['class' => 'start'],
+            Html::tag(
+                'div',
+                ['class' => 'bubble upwards'],
+                new VerticalKeyValue(t('Last update'), $this->object->state->last_update !== null
+                    ? new TimeAgo($this->object->state->last_update)
+                    : t('PENDING'))
+            )
+        );
+        $interval = Html::tag(
+            'li',
+            ['class' => 'interval'],
+            new VerticalKeyValue(
+                t('Interval'),
+                $this->object->check_interval
+                    ? Format::seconds($this->object->check_interval)
+                    : (new EmptyState(t('n. a.')))->setTag('span')
+            )
+        );
+        $nextCheck = Html::tag(
+            'li',
+            ['class' => 'end'],
+            Html::tag(
+                'div',
+                ['class' => 'bubble upwards'],
+                $this->object->state->is_overdue
+                    ? new VerticalKeyValue(t('Overdue'), new TimeSince($nextCheckTime))
+                    : new VerticalKeyValue(
+                        t('Next Check'),
+                        $nextCheckTime !== null ? new TimeUntil($nextCheckTime) : t('PENDING')
+                    )
+            )
+        );
+
+        $below = Html::tag(
+            'ul',
+            [
+                'class' => 'below',
+                'style' => sprintf('width: %F%%;', $durationScale)
+            ]
+        );
+        $below->add([
+            $lastUpdate,
+            $interval,
+            $nextCheck
+        ]);
+
+        $body->add([$above, $timeline, $below]);
+    }
+
+    protected function assembleFooter(BaseHtmlElement $footer)
+    {
+        $footer->add(new HorizontalKeyValue(
+            t('Scheduling Source') . ':',
+            $this->object->state->scheduling_source ?? (new EmptyState(t('n. a.')))->setTag('span')
+        ));
+    }
+
+    protected function assembleHeader(BaseHtmlElement $header)
+    {
+        $checkSource = (new EmptyState(t('n. a.')))->setTag('span');
+        if ($this->object->state->check_source) {
+            $checkSource = [
+                new StateBall($this->object->state->is_reachable ? 'up' : 'down', StateBall::SIZE_MEDIUM),
+                ' ',
+                $this->object->state->check_source
+            ];
+        }
+
+        $header->add([
+            new VerticalKeyValue(t('Command'), $this->object->checkcommand_name),
+            new VerticalKeyValue(
+                t('Attempts'),
+                new CheckAttempt((int) $this->object->state->check_attempt, (int) $this->object->max_check_attempts)
+            ),
+            new VerticalKeyValue(t('Check Source'), $checkSource),
+            new VerticalKeyValue(
+                t('Execution time'),
+                $this->object->state->execution_time
+                    ? Format::seconds($this->object->state->execution_time)
+                    : (new EmptyState(t('n. a.')))->setTag('span')
+            ),
+            new VerticalKeyValue(
+                t('Latency'),
+                $this->object->state->latency
+                    ? Format::seconds($this->object->state->latency)
+                    : (new EmptyState(t('n. a.')))->setTag('span')
+            )
+        ]);
+    }
+}
diff --git a/library/Icingadb/Widget/Detail/CommentDetail.php b/library/Icingadb/Widget/Detail/CommentDetail.php
new file mode 100644
index 0000000..eb13523
--- /dev/null
+++ b/library/Icingadb/Widget/Detail/CommentDetail.php
@@ -0,0 +1,140 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\Detail;
+
+use Icinga\Date\DateFormatter;
+use Icinga\Module\Icingadb\Common\Auth;
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Common\TicketLinks;
+use Icinga\Module\Icingadb\Model\Comment;
+use Icinga\Module\Icingadb\Widget\MarkdownText;
+use Icinga\Module\Icingadb\Forms\Command\Object\DeleteCommentForm;
+use ipl\Stdlib\Filter;
+use ipl\Web\Filter\QueryString;
+use ipl\Web\Widget\HorizontalKeyValue;
+use ipl\Web\Widget\StateBall;
+use ipl\Web\Widget\TimeUntil;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\Html;
+
+class CommentDetail extends BaseHtmlElement
+{
+    use Auth;
+    use TicketLinks;
+
+    protected $comment;
+
+    protected $defaultAttributes = ['class' => ['object-detail', 'comment-detail']];
+
+    protected $tag = 'div';
+
+    public function __construct(Comment $comment)
+    {
+        $this->comment = $comment;
+    }
+
+    protected function createComment(): array
+    {
+        return [
+            Html::tag('h2', t('Comment')),
+            new MarkdownText($this->createTicketLinks($this->comment->text))
+        ];
+    }
+
+    protected function createDetails(): array
+    {
+        $details = [];
+
+        if (getenv('ICINGAWEB_EXPORT_FORMAT') === 'pdf') {
+            if ($this->comment->object_type === 'host') {
+                $details[] = new HorizontalKeyValue(t('Host'), [
+                    $this->comment->host->name,
+                    ' ',
+                    new StateBall($this->comment->host->state->getStateText())
+                ]);
+            } else {
+                $details[] = new HorizontalKeyValue(t('Service'), Html::sprintf(
+                    t('%s on %s', '<service> on <host>'),
+                    [$this->comment->service->name, ' ', new StateBall($this->comment->service->state->getStateText())],
+                    $this->comment->host->name
+                ));
+            }
+
+            $details[] = new HorizontalKeyValue(t('Author'), $this->comment->author);
+            $details[] = new HorizontalKeyValue(
+                t('Acknowledgement'),
+                $this->comment->entry_type === 'ack' ? t('Yes') : t('No')
+            );
+            $details[] = new HorizontalKeyValue(
+                t('Persistent'),
+                $this->comment->is_persistent ? t('Yes') : t('No')
+            );
+            $details[] = new HorizontalKeyValue(
+                t('Created'),
+                DateFormatter::formatDateTime($this->comment->entry_time)
+            );
+            $details[] = new HorizontalKeyValue(t('Expires'), $this->comment->expire_time != 0
+                ? DateFormatter::formatDateTime($this->comment->expire_time)
+                : t('Never'));
+        } else {
+            if ($this->comment->expire_time != 0) {
+                $details[] = Html::tag(
+                    'p',
+                    Html::sprintf(
+                        $this->comment->entry_type === 'ack'
+                            ? t('This acknowledgement expires %s.', '..<time-until>')
+                            : t('This comment expires %s.', '..<time-until>'),
+                        new TimeUntil($this->comment->expire_time)
+                    )
+                );
+            }
+
+            if ($this->comment->is_sticky) {
+                $details[] = Html::tag('p', t('This acknowledgement is sticky.'));
+            }
+        }
+
+        if (! empty($details)) {
+            array_unshift($details, Html::tag('h2', t('Details')));
+        }
+
+        return $details;
+    }
+
+    protected function createRemoveCommentForm()
+    {
+        if (getenv('ICINGAWEB_EXPORT_FORMAT') === 'pdf') {
+            return null;
+        }
+
+        $action = Links::commentsDelete();
+        $action->setQueryString(QueryString::render(Filter::equal('name', $this->comment->name)));
+
+        return (new DeleteCommentForm())
+            ->setObjects([$this->comment])
+            ->populate(['redirect' => '__BACK__'])
+            ->setAction($action->getAbsoluteUrl());
+    }
+
+    protected function assemble()
+    {
+        $this->add($this->createComment());
+
+        $details = $this->createDetails();
+
+        if (! empty($details)) {
+            $this->add($details);
+        }
+
+        if (
+            $this->isGrantedOn(
+                'icingadb/command/comment/delete',
+                $this->comment->{$this->comment->object_type}
+            )
+        ) {
+            $this->add($this->createRemoveCommentForm());
+        }
+    }
+}
diff --git a/library/Icingadb/Widget/Detail/CustomVarTable.php b/library/Icingadb/Widget/Detail/CustomVarTable.php
new file mode 100644
index 0000000..9d3e06b
--- /dev/null
+++ b/library/Icingadb/Widget/Detail/CustomVarTable.php
@@ -0,0 +1,267 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\Detail;
+
+use Icinga\Module\Icingadb\Hook\CustomVarRendererHook;
+use Icinga\Module\Icingadb\Widget\EmptyState;
+use ipl\Html\Attributes;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\Html;
+use ipl\Html\HtmlDocument;
+use ipl\Html\HtmlElement;
+use ipl\Html\Text;
+use ipl\Orm\Model;
+use ipl\Web\Widget\Icon;
+
+class CustomVarTable extends BaseHtmlElement
+{
+    /** @var array The variables */
+    protected $data;
+
+    /** @var ?Model The object the variables are bound to */
+    protected $object;
+
+    /** @var Closure Callback to apply hooks */
+    protected $hookApplier;
+
+    /** @var array The groups as identified by hooks */
+    protected $groups = [];
+
+    /** @var string Header title */
+    protected $headerTitle;
+
+    /** @var int The nesting level */
+    protected $level = 0;
+
+    protected $tag = 'table';
+
+    /** @var HtmlElement The table body */
+    protected $body;
+
+    protected $defaultAttributes = [
+        'class' => ['custom-var-table', 'name-value-table']
+    ];
+
+    /**
+     * Create a new CustomVarTable
+     *
+     * @param iterable $data
+     * @param ?Model $object
+     */
+    public function __construct($data, Model $object = null)
+    {
+        $this->data = $data;
+        $this->object = $object;
+        $this->body = new HtmlElement('tbody');
+    }
+
+    /**
+     * Set the header to show
+     *
+     * @param string $title
+     *
+     * @return $this
+     */
+    protected function setHeader(string $title): self
+    {
+        $this->headerTitle = $title;
+
+        return $this;
+    }
+
+    /**
+     * Add a new row to the body
+     *
+     * @param mixed $name
+     * @param mixed $value
+     *
+     * @return void
+     */
+    protected function addRow($name, $value)
+    {
+        $this->body->addHtml(new HtmlElement(
+            'tr',
+            Attributes::create(['class' => "level-{$this->level}"]),
+            new HtmlElement('th', null, Html::wantHtml($name)),
+            new HtmlElement('td', null, Html::wantHtml($value))
+        ));
+    }
+
+    /**
+     * Render a variable
+     *
+     * @param mixed $name
+     * @param mixed $value
+     *
+     * @return void
+     */
+    protected function renderVar($name, $value)
+    {
+        if ($this->object !== null && $this->level === 0) {
+            list($name, $value, $group) = call_user_func($this->hookApplier, $name, $value);
+            if ($group !== null) {
+                $this->groups[$group][] = [$name, $value];
+                return;
+            }
+        }
+
+        $isArray = is_array($value);
+        switch (true) {
+            case $isArray && is_int(key($value)):
+                $this->renderArray($name, $value);
+                break;
+            case $isArray:
+                $this->renderObject($name, $value);
+                break;
+            default:
+                $this->renderScalar($name, $value);
+        }
+    }
+
+    /**
+     * Render an array
+     *
+     * @param string $name
+     * @param array $array
+     *
+     * @return void
+     */
+    protected function renderArray($name, array $array)
+    {
+        $numItems = count($array);
+        $name = (new HtmlDocument())->addHtml(
+            Html::wantHtml($name),
+            Text::create(' (Array)')
+        );
+
+        $this->addRow($name, sprintf(tp('%d item', '%d items', $numItems), $numItems));
+
+        ++$this->level;
+
+        ksort($array);
+        foreach ($array as $key => $value) {
+            $this->renderVar("[$key]", $value);
+        }
+
+        --$this->level;
+    }
+
+    /**
+     * Render an object (associative array)
+     *
+     * @param mixed $name
+     * @param array $object
+     *
+     * @return void
+     */
+    protected function renderObject($name, array $object)
+    {
+        $numItems = count($object);
+        $this->addRow($name, sprintf(tp('%d item', '%d items', $numItems), $numItems));
+
+        ++$this->level;
+
+        ksort($object);
+        foreach ($object as $key => $value) {
+            $this->renderVar($key, $value);
+        }
+
+        --$this->level;
+    }
+
+    /**
+     * Render a scalar
+     *
+     * @param mixed $name
+     * @param mixed $value
+     *
+     * @return void
+     */
+    protected function renderScalar($name, $value)
+    {
+        if ($value === '') {
+            $value = new EmptyState(t('empty string'));
+        }
+
+        $this->addRow($name, $value);
+    }
+
+    /**
+     * Render a group
+     *
+     * @param string $name
+     * @param iterable $entries
+     *
+     * @return void
+     */
+    protected function renderGroup(string $name, $entries)
+    {
+        $table = new self($entries);
+
+        $wrapper = $this->getWrapper();
+        if ($wrapper === null) {
+            $wrapper = new HtmlDocument();
+            $wrapper->addHtml($this);
+            $this->prependWrapper($wrapper);
+        }
+
+        $wrapper->addHtml($table->setHeader($name));
+    }
+
+    protected function assemble()
+    {
+        if ($this->object !== null) {
+            $this->hookApplier = CustomVarRendererHook::prepareForObject($this->object);
+        }
+
+        if ($this->headerTitle !== null) {
+            $this->getAttributes()
+                ->add('class', 'collapsible')
+                ->add('data-visible-height', 100)
+                ->add('data-toggle-element', 'thead')
+                ->add(
+                    'id',
+                    preg_replace('/\s+/', '-', strtolower($this->headerTitle)) . '-customvars'
+                );
+
+            $this->addHtml(new HtmlElement('thead', null, new HtmlElement(
+                'tr',
+                null,
+                new HtmlElement(
+                    'th',
+                    Attributes::create(['colspan' => 2]),
+                    new HtmlElement(
+                        'span',
+                        null,
+                        new Icon('angle-right'),
+                        new Icon('angle-down')
+                    ),
+                    Text::create($this->headerTitle)
+                )
+            )));
+        }
+
+        if (is_array($this->data)) {
+            ksort($this->data);
+        }
+
+        foreach ($this->data as $name => $value) {
+            $this->renderVar($name, $value);
+        }
+
+        $this->addHtml($this->body);
+
+        // Hooks can return objects as replacement for keys, hence a generator is needed for group entries
+        $genGenerator = function ($entries) {
+            foreach ($entries as list($key, $value)) {
+                yield $key => $value;
+            }
+        };
+
+        foreach ($this->groups as $group => $entries) {
+            $this->renderGroup($group, $genGenerator($entries));
+        }
+    }
+}
diff --git a/library/Icingadb/Widget/Detail/DowntimeCard.php b/library/Icingadb/Widget/Detail/DowntimeCard.php
new file mode 100644
index 0000000..68cc922
--- /dev/null
+++ b/library/Icingadb/Widget/Detail/DowntimeCard.php
@@ -0,0 +1,336 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\Detail;
+
+use Icinga\Module\Icingadb\Model\Downtime;
+use ipl\Web\Widget\TimeAgo;
+use ipl\Web\Widget\TimeUntil;
+use ipl\Web\Widget\VerticalKeyValue;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\Html;
+
+class DowntimeCard extends BaseHtmlElement
+{
+    protected $downtime;
+
+    protected $duration;
+
+    protected $defaultAttributes = ['class' => 'progress-bar downtime-progress'];
+
+    protected $tag = 'div';
+
+    public function __construct(Downtime $downtime)
+    {
+        $this->downtime = $downtime;
+
+        $this->start = $this->downtime->scheduled_start_time;
+        $this->end = $this->downtime->scheduled_end_time;
+
+        if ($this->downtime->end_time > $this->downtime->scheduled_end_time) {
+            $this->duration = $this->downtime->end_time - $this->downtime->scheduled_start_time;
+        } else {
+            $this->duration = $this->downtime->scheduled_end_time - $this->downtime->scheduled_start_time;
+        }
+    }
+
+    protected function assemble()
+    {
+        $timeline = Html::tag('div', ['class' => 'downtime-timeline timeline']);
+        $hPadding = 10;
+
+        $above = Html::tag('ul', ['class' => 'above']);
+        $below = Html::tag('ul', ['class' => 'below']);
+
+        $flexProgress = null;
+        $markerFlexStart = null;
+        $markerFlexEnd = null;
+
+        if ($this->downtime->scheduled_end_time < time()) {
+            $endTime = new TimeAgo($this->downtime->scheduled_end_time);
+        } else {
+            $endTime = new TimeUntil($this->downtime->scheduled_end_time);
+        }
+
+        if ($this->downtime->is_flexible && $this->downtime->is_in_effect) {
+            $this->addAttributes(['class' => 'flexible in-effect']);
+
+            $flexStartLeft = $hPadding + $this->calcRelativeLeft($this->downtime->start_time);
+            $flexEndLeft = $hPadding + $this->calcRelativeLeft($this->downtime->end_time);
+
+            $evade = false;
+            if ($flexEndLeft - $flexStartLeft < 2) {
+                $flexStartLeft -= 1;
+                $flexEndLeft += 1;
+
+                if ($flexEndLeft > $hPadding + $this->calcRelativeLeft($this->downtime->scheduled_end_time)) {
+                    $flexEndLeft = $hPadding + $this->calcRelativeLeft($this->downtime->scheduled_end_time) - .5;
+                    $flexStartLeft = $flexEndLeft - 2;
+                }
+
+                if ($flexStartLeft < $hPadding + $this->calcRelativeLeft($this->downtime->scheduled_start_time)) {
+                    $flexStartLeft = $hPadding + $this->calcRelativeLeft($this->downtime->scheduled_start_time) + .5;
+                    $flexEndLeft = $flexStartLeft + 2;
+                }
+
+                $evade = true;
+            }
+
+            $markerFlexStart = Html::tag('div', [
+                'class' => 'marker flex-start',
+                'style' => sprintf('left: %F%%', $flexStartLeft)
+            ]);
+
+            $markerFlexEnd = Html::tag('div', [
+                'class' => 'marker flex-end',
+                'style' => sprintf('left: %F%%', $flexEndLeft)
+            ]);
+
+            if (time() > $this->downtime->scheduled_end_time) {
+                $timelineProgress = Html::tag('div', [
+                    'class' => 'timeline-overlay downtime-elapsed',
+                    'style' => sprintf(
+                        'left: %F%%; width: %F%%;',
+                        $hPadding + $this->calcRelativeLeft($this->downtime->start_time),
+                        $this->calcRelativeLeft($this->downtime->scheduled_end_time, $this->downtime->start_time)
+                    )
+                ]);
+                $flexProgress = Html::tag('div', [
+                    'class' => 'timeline-overlay downtime-overrun',
+                    'style' => sprintf(
+                        'left: %F%%; width: %F%%;',
+                        $hPadding + $this->calcRelativeLeft($this->downtime->scheduled_end_time),
+                        $this->calcRelativeLeft(time(), $this->downtime->scheduled_end_time)
+                    )
+                ]);
+            } else {
+                $timelineProgress = Html::tag('div', [
+                    'class' => 'timeline-overlay downtime-elapsed',
+                    'style' => sprintf(
+                        'left: %F%%; width: %F%%;',
+                        $flexStartLeft,
+                        $hPadding + $this->calcRelativeLeft(time()) - $flexStartLeft
+                    )
+                ]);
+            }
+
+            $above->add([
+                Html::tag(
+                    'li',
+                    ['class' => 'start positioned'],
+                    Html::tag(
+                        'div',
+                        ['class' => 'bubble'],
+                        new VerticalKeyValue(t('Scheduled Start'), new TimeAgo($this->downtime->scheduled_start_time))
+                    )
+                ),
+                Html::tag(
+                    'li',
+                    [
+                        'class' => 'end positioned',
+                        'style' => sprintf(
+                            'left: %F%%',
+                            $hPadding + $this->calcRelativeLeft($this->downtime->scheduled_end_time)
+                        )
+                    ],
+                    Html::tag('div', ['class' => 'bubble'], new VerticalKeyValue(t('Scheduled End'), $endTime))
+                )
+            ]);
+
+            $below->add([
+                Html::tag(
+                    'li',
+                    [
+                        'class' => 'start positioned',
+                        'style' => sprintf('left: %F%%', $flexStartLeft)
+                    ],
+                    Html::tag(
+                        'div',
+                        ['class' => 'bubble upwards' . ($evade ? ' left' : '')],
+                        new VerticalKeyValue(t('Start'), new TimeAgo($this->downtime->start_time))
+                    )
+                ),
+                Html::tag(
+                    'li',
+                    [
+                        'class' => 'end positioned',
+                        'style' => sprintf('left: %F%%', $flexEndLeft)
+                    ],
+                    Html::tag(
+                        'div',
+                        ['class' => 'bubble upwards' . ($evade ? ' right' : '')],
+                        new VerticalKeyValue(t('End'), new TimeUntil($this->downtime->end_time))
+                    )
+                )
+            ]);
+        } elseif ($this->downtime->is_flexible) {
+            $this->addAttributes(['class' => 'flexible']);
+
+            $timelineProgress = Html::tag('div', [
+                'class' => 'timeline-overlay downtime-elapsed',
+                'style' => sprintf(
+                    'left: %F%%; width: %F%%;',
+                    $hPadding + $this->calcRelativeLeft($this->downtime->scheduled_start_time),
+                    $this->calcRelativeLeft(time())
+                )
+            ]);
+
+            $above->add([
+                Html::tag(
+                    'li',
+                    ['class' => 'start positioned'],
+                    Html::tag(
+                        'div',
+                        ['class' => 'bubble'],
+                        new VerticalKeyValue(
+                            t('Scheduled Start'),
+                            time() > $this->downtime->scheduled_start_time
+                                ? new TimeAgo($this->downtime->scheduled_start_time)
+                                : new TimeUntil($this->downtime->scheduled_start_time)
+                        )
+                    )
+                ),
+                Html::tag(
+                    'li',
+                    [
+                        'class' => 'end positioned',
+                        'style' => sprintf(
+                            'left: %F%%',
+                            $hPadding + $this->calcRelativeLeft($this->downtime->scheduled_end_time)
+                        )
+                    ],
+                    Html::tag(
+                        'div',
+                        ['class' => 'bubble'],
+                        new VerticalKeyValue(t('Scheduled End'), $endTime)
+                    )
+                )
+            ]);
+
+            $below = null;
+        } else {
+            $timelineProgress = Html::tag('div', [
+                'class' => 'timeline-overlay downtime-elapsed',
+                'style' => sprintf(
+                    'left: %F%%; width: %F%%;',
+                    $hPadding + $this->calcRelativeLeft($this->downtime->scheduled_start_time),
+                    $this->calcRelativeLeft(time())
+                )
+            ]);
+
+            $below->add([
+                Html::tag(
+                    'li',
+                    [
+                        'class' => 'start positioned',
+                        'style' => sprintf(
+                            'left: %F%%',
+                            $hPadding + $this->calcRelativeLeft($this->downtime->scheduled_start_time)
+                        )
+                    ],
+                    Html::tag(
+                        'div',
+                        ['class' => 'bubble upwards'],
+                        new VerticalKeyValue(t('Start'), new TimeAgo($this->downtime->scheduled_start_time))
+                    )
+                ),
+                Html::tag(
+                    'li',
+                    [
+                        'class' => 'end positioned',
+                        'style' => sprintf(
+                            'left: %F%%',
+                            $hPadding + $this->calcRelativeLeft($this->downtime->scheduled_end_time)
+                        )
+                    ],
+                    Html::tag(
+                        'div',
+                        ['class' => 'bubble upwards'],
+                        new VerticalKeyValue(t('End'), new TimeUntil($this->downtime->scheduled_end_time))
+                    )
+                )
+            ]);
+        }
+
+        $now = Html::tag(
+            'li',
+            [
+                'class' => 'now positioned',
+                'style' => sprintf(
+                    'left: %F%%',
+                    $hPadding + $this->calcRelativeLeft(time(), null, null, -$hPadding + 3)
+                )
+            ],
+            Html::tag(
+                'div',
+                ['class' => 'bubble'],
+                Html::tag('strong', t('Now'))
+            )
+        );
+        $above->add($now);
+
+        $markerStart = Html::tag('div', [
+            'class' => 'marker start',
+            'style' => sprintf(
+                'left: %F%%',
+                $hPadding + $this->calcRelativeLeft($this->downtime->scheduled_start_time)
+            )
+        ]);
+
+        $markerNow = Html::tag('div', [
+            'class' => 'marker now',
+            'style' => sprintf(
+                'left: %F%%',
+                $hPadding + $this->calcRelativeLeft(time(), null, null, -$hPadding + 3)
+            )
+        ]);
+
+        $markerEnd = Html::tag('div', [
+            'class' => 'marker end',
+            'style' => sprintf(
+                'left: %F%%',
+                $hPadding + $this->calcRelativeLeft($this->downtime->scheduled_end_time)
+            )
+        ]);
+
+        $timeline->add([
+            $timelineProgress,
+            $flexProgress,
+            $markerStart,
+            $markerEnd,
+            $markerFlexStart,
+            $markerFlexEnd,
+            $markerNow,
+        ]);
+
+        $this->add([
+            $above,
+            $timeline,
+            $below
+        ]);
+    }
+
+    protected function calcRelativeLeft($value, $relativeStart = null, $relativeWidth = null, $min = null, $max = null)
+    {
+        if ($relativeStart === null) {
+            $relativeStart = $this->downtime->scheduled_start_time;
+        }
+
+        if ($relativeWidth === null) {
+            $relativeWidth = $this->duration;
+        }
+
+        $left = round(($value - $relativeStart) / $relativeWidth * 80, 2);
+
+        if ($min !== null && $left < $min) {
+            $left = $min;
+        }
+
+        if ($max !== null && $left > $max) {
+            $left = $max;
+        }
+
+        return $left;
+    }
+}
diff --git a/library/Icingadb/Widget/Detail/DowntimeDetail.php b/library/Icingadb/Widget/Detail/DowntimeDetail.php
new file mode 100644
index 0000000..fbeb069
--- /dev/null
+++ b/library/Icingadb/Widget/Detail/DowntimeDetail.php
@@ -0,0 +1,206 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\Detail;
+
+use Icinga\Date\DateFormatter;
+use Icinga\Date\DateFormatter as WebDateFormatter;
+use Icinga\Module\Icingadb\Common\Auth;
+use Icinga\Module\Icingadb\Common\Database;
+use Icinga\Module\Icingadb\Common\HostLink;
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Widget\EmptyState;
+use Icinga\Module\Icingadb\Widget\MarkdownText;
+use Icinga\Module\Icingadb\Common\ServiceLink;
+use Icinga\Module\Icingadb\Forms\Command\Object\DeleteDowntimeForm;
+use Icinga\Module\Icingadb\Model\Downtime;
+use Icinga\Module\Icingadb\Widget\ItemList\DowntimeList;
+use ipl\Web\Widget\HorizontalKeyValue;
+use Icinga\Module\Icingadb\Widget\ShowMore;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\Html;
+use ipl\Html\HtmlElement;
+use ipl\Html\TemplateString;
+use ipl\Html\Text;
+use ipl\Stdlib\Filter;
+use ipl\Web\Filter\QueryString;
+use ipl\Web\Widget\Icon;
+use ipl\Web\Widget\Link;
+use ipl\Web\Widget\StateBall;
+
+class DowntimeDetail extends BaseHtmlElement
+{
+    use Auth;
+    use Database;
+    use HostLink;
+    use ServiceLink;
+
+    /** @var BaseHtmlElement */
+    protected $control;
+
+    /** @var Downtime */
+    protected $downtime;
+
+    protected $defaultAttributes = ['class' => ['object-detail', 'downtime-detail']];
+
+    protected $tag = 'div';
+
+    public function __construct(Downtime $downtime)
+    {
+        $this->downtime = $downtime;
+    }
+
+    protected function createCancelDowntimeForm()
+    {
+        $action = Links::downtimesDelete();
+        $action->setQueryString(QueryString::render(Filter::equal('name', $this->downtime->name)));
+
+        return (new DeleteDowntimeForm())
+            ->setObjects([$this->downtime])
+            ->populate(['redirect' => '__BACK__'])
+            ->setAction($action->getAbsoluteUrl());
+    }
+
+    protected function createTimeline(): DowntimeCard
+    {
+        return new DowntimeCard($this->downtime);
+    }
+
+    protected function assemble()
+    {
+        $this->add(Html::tag('h2', t('Comment')));
+        $this->add(Html::tag('div', [
+            new Icon('user'),
+            Html::sprintf(
+                t('%s commented: %s', '<username> ..: <comment>'),
+                $this->downtime->author,
+                new MarkdownText($this->downtime->comment)
+            )
+        ]));
+
+        $this->add(Html::tag('h2', t('Details')));
+
+        if (getenv('ICINGAWEB_EXPORT_FORMAT') === 'pdf') {
+            $this->addHtml(new HorizontalKeyValue(
+                t('Type'),
+                $this->downtime->is_flexible ? t('Flexible') : t('Fixed')
+            ));
+            if ($this->downtime->object_type === 'host') {
+                $this->addHtml(new HorizontalKeyValue(t('Host'), [
+                    $this->downtime->host->name,
+                    ' ',
+                    new StateBall($this->downtime->host->state->getStateText())
+                ]));
+            } else {
+                $this->addHtml(new HorizontalKeyValue(t('Service'), Html::sprintf(
+                    t('%s on %s', '<service> on <host>'),
+                    [
+                        $this->downtime->service->name,
+                        ' ',
+                        new StateBall($this->downtime->service->state->getStateText())
+                    ],
+                    $this->downtime->host->name
+                )));
+            }
+        }
+
+        if ($this->downtime->triggered_by_id !== null || $this->downtime->parent_id !== null) {
+            if ($this->downtime->triggered_by_id !== null) {
+                $label = t('Triggered By');
+                $relatedDowntime = $this->downtime->triggered_by;
+            } else {
+                $label = t('Parent');
+                $relatedDowntime = $this->downtime->parent;
+            }
+
+            $this->addHtml(new HorizontalKeyValue(
+                $label,
+                HtmlElement::create('span', ['class' => 'accompanying-text'], TemplateString::create(
+                    $relatedDowntime->is_flexible
+                        ? t('{{#link}}Flexible Downtime{{/link}} for %s')
+                        : t('{{#link}}Fixed Downtime{{/link}} for %s'),
+                    ['link' => new Link(null, Links::downtime($relatedDowntime), ['class' => 'subject'])],
+                    ($relatedDowntime->object_type === 'host'
+                        ? $this->createHostLink($relatedDowntime->host, true)
+                        : $this->createServiceLink($relatedDowntime->service, $relatedDowntime->host, true))
+                ))
+            ));
+        }
+
+        $this->add(new HorizontalKeyValue(
+            t('Created'),
+            WebDateFormatter::formatDateTime($this->downtime->entry_time)
+        ));
+        $this->add(new HorizontalKeyValue(
+            t('Start time'),
+            $this->downtime->start_time
+                ? WebDateFormatter::formatDateTime($this->downtime->start_time)
+                : new EmptyState(t('Not started yet'))
+        ));
+        $this->add(new HorizontalKeyValue(
+            t('End time'),
+            $this->downtime->end_time
+                ? WebDateFormatter::formatDateTime($this->downtime->end_time)
+                : new EmptyState(t('Not started yet'))
+        ));
+        $this->add(new HorizontalKeyValue(
+            t('Scheduled Start'),
+            WebDateFormatter::formatDateTime($this->downtime->scheduled_start_time)
+        ));
+        $this->add(new HorizontalKeyValue(
+            t('Scheduled End'),
+            WebDateFormatter::formatDateTime($this->downtime->scheduled_end_time)
+        ));
+        $this->add(new HorizontalKeyValue(
+            t('Scheduled Duration'),
+            DateFormatter::formatDuration($this->downtime->scheduled_duration)
+        ));
+        if ($this->downtime->is_flexible) {
+            $this->add(new HorizontalKeyValue(
+                t('Flexible Duration'),
+                DateFormatter::formatDuration($this->downtime->flexible_duration)
+            ));
+        }
+
+        $query = Downtime::on($this->getDb())->with([
+            'host',
+            'host.state',
+            'service',
+            'service.host',
+            'service.host.state',
+            'service.state'
+        ])
+            ->limit(3)
+            ->filter(Filter::equal('parent_id', $this->downtime->id))
+            ->orFilter(Filter::equal('triggered_by_id', $this->downtime->id));
+        $this->applyRestrictions($query);
+
+        $children = $query->peekAhead()->execute();
+        if ($children->hasResult()) {
+            $this->addHtml(
+                new HtmlElement('h2', null, Text::create(t('Children'))),
+                new DowntimeList($children),
+                (new ShowMore($children, Links::downtimes()->setQueryString(
+                    QueryString::render(Filter::any(
+                        Filter::equal('downtime.parent.name', $this->downtime->name),
+                        Filter::equal('downtime.triggered_by.name', $this->downtime->name)
+                    ))
+                )))->setBaseTarget('_next')
+            );
+        }
+
+        $this->add(Html::tag('h2', t('Progress')));
+        $this->add($this->createTimeline());
+
+        if (
+            getenv('ICINGAWEB_EXPORT_FORMAT') !== 'pdf'
+            && $this->isGrantedOn(
+                'icingadb/command/downtime/delete',
+                $this->downtime->{$this->downtime->object_type}
+            )
+        ) {
+            $this->add($this->createCancelDowntimeForm());
+        }
+    }
+}
diff --git a/library/Icingadb/Widget/Detail/EventDetail.php b/library/Icingadb/Widget/Detail/EventDetail.php
new file mode 100644
index 0000000..d29a8a1
--- /dev/null
+++ b/library/Icingadb/Widget/Detail/EventDetail.php
@@ -0,0 +1,612 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\Detail;
+
+use DateTime;
+use DateTimeZone;
+use Icinga\Date\DateFormatter;
+use Icinga\Module\Icingadb\Common\Auth;
+use Icinga\Module\Icingadb\Common\Database;
+use Icinga\Module\Icingadb\Common\HostLink;
+use Icinga\Module\Icingadb\Common\HostStates;
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Common\TicketLinks;
+use Icinga\Module\Icingadb\Hook\ExtensionHook\ObjectDetailExtensionHook;
+use Icinga\Module\Icingadb\Widget\MarkdownText;
+use Icinga\Module\Icingadb\Common\ServiceLink;
+use Icinga\Module\Icingadb\Common\ServiceStates;
+use Icinga\Module\Icingadb\Model\AcknowledgementHistory;
+use Icinga\Module\Icingadb\Model\CommentHistory;
+use Icinga\Module\Icingadb\Model\DowntimeHistory;
+use Icinga\Module\Icingadb\Model\FlappingHistory;
+use Icinga\Module\Icingadb\Model\History;
+use Icinga\Module\Icingadb\Model\NotificationHistory;
+use Icinga\Module\Icingadb\Model\StateHistory;
+use Icinga\Module\Icingadb\Util\PluginOutput;
+use Icinga\Module\Icingadb\Widget\EmptyState;
+use ipl\Web\Widget\HorizontalKeyValue;
+use Icinga\Module\Icingadb\Widget\ItemList\UserList;
+use Icinga\Module\Icingadb\Widget\PluginOutputContainer;
+use Icinga\Module\Icingadb\Widget\ShowMore;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\FormattedString;
+use ipl\Html\HtmlElement;
+use ipl\Html\TemplateString;
+use ipl\Html\Text;
+use ipl\Orm\ResultSet;
+use ipl\Stdlib\Filter;
+use ipl\Stdlib\Str;
+use ipl\Web\Widget\Icon;
+use ipl\Web\Widget\Link;
+use ipl\Web\Widget\StateBall;
+
+class EventDetail extends BaseHtmlElement
+{
+    use Auth;
+    use Database;
+    use HostLink;
+    use ServiceLink;
+    use TicketLinks;
+
+    protected $tag = 'div';
+
+    protected $defaultAttributes = ['class' => 'object-detail'];
+
+    /** @var History */
+    protected $event;
+
+    public function __construct(History $event)
+    {
+        $this->event = $event;
+    }
+
+    protected function assembleNotificationEvent(NotificationHistory $notification)
+    {
+        $pluginOutput = [];
+
+        $commandName = $notification->object_type === 'host'
+            ? $this->event->host->checkcommand_name
+            : $this->event->service->checkcommand_name;
+        if (isset($commandName)) {
+            if (empty($notification->text)) {
+                $notificationText = new EmptyState(t('Output unavailable.'));
+            } else {
+                $notificationText = new PluginOutputContainer(
+                    (new PluginOutput($notification->text))
+                        ->setCommandName($notification->object_type === 'host'
+                            ? $this->event->host->checkcommand_name
+                            : $this->event->service->checkcommand_name)
+                );
+            }
+
+            $pluginOutput = [
+                HtmlElement::create('h2', null, $notification->author ? t('Comment') : t('Plugin Output')),
+                HtmlElement::create('div', [
+                    'id'    => 'check-output-' . $commandName,
+                    'class' => 'collapsible',
+                    'data-visible-height' => 100
+                ], $notificationText)
+            ];
+        } else {
+            $pluginOutput[] = new EmptyState(t('Waiting for Icinga DB to synchronize the config.'));
+        }
+
+        if ($notification->object_type === 'host') {
+            $objectKey = t('Host');
+            $objectInfo = HtmlElement::create('span', ['class' => 'accompanying-text'], [
+                HtmlElement::create('span', ['class' => 'state-change'], [
+                    new StateBall(HostStates::text($notification->previous_hard_state), StateBall::SIZE_MEDIUM),
+                    new StateBall(HostStates::text($notification->state), StateBall::SIZE_MEDIUM)
+                ]),
+                ' ',
+                HtmlElement::create('span', ['class' => 'subject'], $this->event->host->display_name)
+            ]);
+        } else {
+            $objectKey = t('Service');
+            $objectInfo = HtmlElement::create('span', ['class' => 'accompanying-text'], [
+                HtmlElement::create('span', ['class' => 'state-change'], [
+                    new StateBall(ServiceStates::text($notification->previous_hard_state), StateBall::SIZE_MEDIUM),
+                    new StateBall(ServiceStates::text($notification->state), StateBall::SIZE_MEDIUM)
+                ]),
+                ' ',
+                FormattedString::create(
+                    t('%s on %s', '<service> on <host>'),
+                    HtmlElement::create('span', ['class' => 'subject'], $this->event->service->display_name),
+                    HtmlElement::create('span', ['class' => 'subject'], $this->event->host->display_name)
+                )
+            ]);
+        }
+
+        $eventInfo = [
+            new HtmlElement('h2', null, Text::create(t('Event Info'))),
+            new HorizontalKeyValue(t('Sent On'), DateFormatter::formatDateTime($notification->send_time))
+        ];
+
+        if ($notification->author) {
+            $eventInfo[] = (new HorizontalKeyValue(t('Sent by'), [
+                new Icon('user'),
+                $notification->author
+            ]));
+        }
+
+        $eventInfo[] = new HorizontalKeyValue(t('Type'), ucfirst(Str::camel($notification->type)));
+        $eventInfo[] = new HorizontalKeyValue(t('State'), $notification->object_type === 'host'
+                ? ucfirst(HostStates::text($notification->state))
+                : ucfirst(ServiceStates::text($notification->state)));
+        $eventInfo[] = new HorizontalKeyValue($objectKey, $objectInfo);
+
+
+        $notifiedUsers = [new HtmlElement('h2', null, Text::create(t('Notified Users')))];
+
+        if ($notification->users_notified === 0) {
+            $notifiedUsers[] = new EmptyState(t('None', 'notified users: none'));
+        } elseif (! $this->isPermittedRoute('users')) {
+            $notifiedUsers[] = Text::create(sprintf(tp(
+                'This notification was sent to a single user',
+                'This notification was sent to %d users',
+                $notification->users_notified
+            ), $notification->users_notified));
+        } elseif ($notification->users_notified > 0) {
+            $users = $notification->user
+                ->limit(5)
+                ->peekAhead();
+
+            $users = $users->execute();
+            /** @var ResultSet $users */
+
+            $notifiedUsers[] = new UserList($users);
+            $notifiedUsers[] = (new ShowMore(
+                $users,
+                Links::users()->addParams(['notification_history.id' => bin2hex($notification->id)]),
+                sprintf(t('Show all %d recipients'), $notification->users_notified)
+            ))->setBaseTarget('_next');
+        }
+
+        $this->add(ObjectDetailExtensionHook::injectExtensions([
+            0   => $pluginOutput,
+            200 => $eventInfo,
+            500 => $notifiedUsers
+        ], $this->createExtensions()));
+    }
+
+    protected function assembleStateChangeEvent(StateHistory $stateChange)
+    {
+        $pluginOutput = [];
+
+        $commandName = $stateChange->object_type === 'host'
+            ? $this->event->host->checkcommand_name
+            : $this->event->service->checkcommand_name;
+        if (isset($commandName)) {
+            if (empty($stateChange->output) && empty($stateChange->long_output)) {
+                $commandOutput = new EmptyState(t('Output unavailable.'));
+            } else {
+                $commandOutput = new PluginOutputContainer(
+                    (new PluginOutput($stateChange->output . "\n" . $stateChange->long_output))
+                        ->setCommandName($commandName)
+                );
+            }
+
+            $pluginOutput = [
+                new HtmlElement('h2', null, Text::create(t('Plugin Output'))),
+                HtmlElement::create('div', [
+                    'id'    => 'check-output-' . $commandName,
+                    'class' => 'collapsible',
+                    'data-visible-height' => 100
+                ], $commandOutput)
+            ];
+        } else {
+            $pluginOutput[] = new EmptyState(t('Waiting for Icinga DB to synchronize the config.'));
+        }
+
+        if ($stateChange->object_type === 'host') {
+            $objectKey = t('Host');
+            $objectState = $stateChange->state_type === 'hard' ? $stateChange->hard_state : $stateChange->soft_state;
+            $objectInfo = HtmlElement::create('span', ['class' => 'accompanying-text'], [
+                HtmlElement::create('span', ['class' => 'state-change'], [
+                    new StateBall(HostStates::text($stateChange->previous_soft_state), StateBall::SIZE_MEDIUM),
+                    new StateBall(HostStates::text($objectState), StateBall::SIZE_MEDIUM)
+                ]),
+                ' ',
+                HtmlElement::create('span', ['class' => 'subject'], $this->event->host->display_name)
+            ]);
+        } else {
+            $objectKey = t('Service');
+            $objectState = $stateChange->state_type === 'hard' ? $stateChange->hard_state : $stateChange->soft_state;
+            $objectInfo = HtmlElement::create('span', ['class' => 'accompanying-text'], [
+                HtmlElement::create('span', ['class' => 'state-change'], [
+                    new StateBall(ServiceStates::text($stateChange->previous_soft_state), StateBall::SIZE_MEDIUM),
+                    new StateBall(ServiceStates::text($objectState), StateBall::SIZE_MEDIUM)
+                ]),
+                ' ',
+                FormattedString::create(
+                    t('%s on %s', '<service> on <host>'),
+                    HtmlElement::create('span', ['class' => 'subject'], $this->event->service->display_name),
+                    HtmlElement::create('span', ['class' => 'subject'], $this->event->host->display_name)
+                )
+            ]);
+        }
+
+        $eventInfo = [
+            new HtmlElement('h2', null, Text::create(t('Event Info'))),
+            new HorizontalKeyValue(t('Occurred On'), DateFormatter::formatDateTime($stateChange->event_time)),
+            new HorizontalKeyValue(t('Scheduling Source'), $stateChange->scheduling_source),
+            new HorizontalKeyValue(t('Check Source'), $stateChange->check_source)
+        ];
+
+        if ($stateChange->state_type === 'soft') {
+            $eventInfo[] = new HorizontalKeyValue(t('Check Attempt'), sprintf(
+                t('%d of %d'),
+                $stateChange->check_attempt,
+                $stateChange->max_check_attempts
+            ));
+        }
+
+        $eventInfo[] = new HorizontalKeyValue(
+            t('State'),
+            $stateChange->object_type === 'host'
+                ? ucfirst(HostStates::text($objectState))
+                : ucfirst(ServiceStates::text($objectState))
+        );
+
+        $eventInfo[] = new HorizontalKeyValue(
+            t('State Type'),
+            $stateChange->state_type === 'hard' ? t('Hard', 'state') : t('Soft', 'state')
+        );
+
+        $eventInfo[] = new HorizontalKeyValue($objectKey, $objectInfo);
+
+        $this->add(ObjectDetailExtensionHook::injectExtensions([
+            0   => $pluginOutput,
+            200 => $eventInfo
+        ], $this->createExtensions()));
+    }
+
+    protected function assembleDowntimeEvent(DowntimeHistory $downtime)
+    {
+        $commentInfo = [
+            new HtmlElement('h2', null, Text::create(t('Comment'))),
+            new MarkdownText($this->createTicketLinks($downtime->comment))
+        ];
+
+        $eventInfo = [new HtmlElement('h2', null, Text::create(t('Event Info')))];
+
+        if ($downtime->triggered_by_id !== null || $downtime->parent_id !== null) {
+            if ($downtime->triggered_by_id !== null) {
+                $label = t('Triggered By');
+                $relatedDowntime = $downtime->triggered_by;
+            } else {
+                $label = t('Parent');
+                $relatedDowntime = $downtime->parent;
+            }
+
+            $query = History::on($this->getDb())
+                ->columns('id')
+                ->filter(Filter::equal('event_type', 'downtime_start'))
+                ->filter(Filter::equal('history.downtime_history_id', $relatedDowntime->downtime_id));
+            $this->applyRestrictions($query);
+            if (($relatedEvent = $query->first()) !== null) {
+                /** @var History $relatedEvent */
+                $eventInfo[] = new HorizontalKeyValue(
+                    $label,
+                    HtmlElement::create('span', ['class' => 'accompanying-text'], TemplateString::create(
+                        $relatedDowntime->is_flexible
+                            ? t('{{#link}}Flexible Downtime{{/link}} for %s')
+                            : t('{{#link}}Fixed Downtime{{/link}} for %s'),
+                        ['link' => new Link(null, Links::event($relatedEvent), ['class' => 'subject'])],
+                        ($relatedDowntime->object_type === 'host'
+                            ? $this->createHostLink($relatedDowntime->host, true)
+                            : $this->createServiceLink($relatedDowntime->service, $relatedDowntime->host, true))
+                            ->addAttributes(['class' => 'subject'])
+                    ))
+                );
+            }
+        }
+
+        $eventInfo[] = $downtime->object_type === 'host'
+            ? new HorizontalKeyValue(t('Host'), HtmlElement::create(
+                'span',
+                ['class' => 'accompanying-text'],
+                HtmlElement::create('span', ['class' => 'subject'], $this->event->host->display_name)
+            ))
+            : new HorizontalKeyValue(t('Service'), HtmlElement::create(
+                'span',
+                ['class' => 'accompanying-text'],
+                FormattedString::create(
+                    t('%s on %s', '<service> on <host>'),
+                    HtmlElement::create('span', ['class' => 'subject'], $this->event->service->display_name),
+                    HtmlElement::create('span', ['class' => 'subject'], $this->event->host->display_name)
+                )
+            ));
+        $eventInfo[] = new HorizontalKeyValue(t('Entered On'), DateFormatter::formatDateTime($downtime->entry_time));
+        $eventInfo[] = new HorizontalKeyValue(t('Author'), [new Icon('user'), $downtime->author]);
+            // TODO: The following should be presented in a specific widget (maybe just like the downtime card)
+        $eventInfo[] = new HorizontalKeyValue(
+            t('Triggered On'),
+            DateFormatter::formatDateTime($downtime->trigger_time)
+        );
+        $eventInfo[] = new HorizontalKeyValue(
+            t('Scheduled Start'),
+            DateFormatter::formatDateTime($downtime->scheduled_start_time)
+        );
+        $eventInfo[] = new HorizontalKeyValue(t('Actual Start'), DateFormatter::formatDateTime($downtime->start_time));
+        $eventInfo[] = new HorizontalKeyValue(
+            t('Scheduled End'),
+            DateFormatter::formatDateTime($downtime->scheduled_end_time)
+        );
+        $eventInfo[] = new HorizontalKeyValue(t('Actual End'), DateFormatter::formatDateTime($downtime->end_time));
+
+        if ($downtime->is_flexible) {
+            $eventInfo[] = new HorizontalKeyValue(t('Flexible'), t('Yes'));
+            $eventInfo[] = new HorizontalKeyValue(
+                t('Duration'),
+                DateFormatter::formatDuration($downtime->flexible_duration)
+            );
+        }
+
+        $cancelInfo = [];
+        if ($downtime->has_been_cancelled) {
+            $cancelInfo = [
+                new HtmlElement('h2', null, Text::create(t('This downtime has been cancelled'))),
+                new HorizontalKeyValue(t('Cancelled On'), DateFormatter::formatDateTime($downtime->cancel_time)),
+                new HorizontalKeyValue(t('Cancelled by'), [new Icon('user'), $downtime->cancelled_by])
+            ];
+        }
+
+
+        $this->add(ObjectDetailExtensionHook::injectExtensions([
+            200 => $commentInfo,
+            201 => $eventInfo,
+            600 => $cancelInfo
+        ], $this->createExtensions()));
+    }
+
+    protected function assembleCommentEvent(CommentHistory $comment)
+    {
+        $commentInfo = [
+            new HtmlElement('h2', null, Text::create(t('Comment'))),
+            new MarkdownText($this->createTicketLinks($comment->comment))
+        ];
+
+        $eventInfo = [new HtmlElement('h2', null, Text::create(t('Event Info')))];
+        $eventInfo[] = $comment->object_type === 'host'
+            ? new HorizontalKeyValue(t('Host'), HtmlElement::create(
+                'span',
+                ['class' => 'accompanying-text'],
+                HtmlElement::create('span', ['class' => 'subject'], $this->event->host->display_name)
+            ))
+            : new HorizontalKeyValue(t('Service'), HtmlElement::create(
+                'span',
+                ['class' => 'accompanying-text'],
+                FormattedString::create(
+                    t('%s on %s', '<service> on <host>'),
+                    HtmlElement::create('span', ['class' => 'subject'], $this->event->service->display_name),
+                    HtmlElement::create('span', ['class' => 'subject'], $this->event->host->display_name)
+                )
+            ));
+        $eventInfo[] = new HorizontalKeyValue(t('Entered On'), DateFormatter::formatDateTime($comment->entry_time));
+        $eventInfo[] = new HorizontalKeyValue(t('Author'), [new Icon('user'), $comment->author]);
+        $eventInfo[] = new HorizontalKeyValue(
+            t('Expires On'),
+            $comment->expire_time
+                ? DateFormatter::formatDateTime($comment->expire_time)
+                : new EmptyState(t('Never'))
+        );
+
+        $tiedToAckInfo = [];
+        if ($comment->entry_type === 'ack') {
+            $tiedToAckInfo = [
+                new HtmlElement('h2', null, Text::create(t('This comment is tied to an acknowledgement'))),
+                new HorizontalKeyValue(t('Sticky'), $comment->is_sticky ? t('Yes') : t('No')),
+                new HorizontalKeyValue(t('Persistent'), $comment->is_persistent ? t('Yes') : t('No'))
+            ];
+        }
+
+        $removedInfo = [];
+        if ($comment->has_been_removed) {
+            $removedInfo[] = new HtmlElement('h2', null, Text::create(t('This comment has been removed')));
+            if ($comment->removed_by) {
+                $removedInfo[] = new HorizontalKeyValue(
+                    t('Removed On'),
+                    DateFormatter::formatDateTime($comment->remove_time)
+                );
+                $removedInfo[] = new HorizontalKeyValue(
+                    t('Removed by'),
+                    [new Icon('user'), $comment->removed_by]
+                );
+            } else {
+                $removedInfo[] = new HorizontalKeyValue(
+                    t('Expired On'),
+                    DateFormatter::formatDateTime($comment->remove_time)
+                );
+            }
+        }
+
+        $this->add(ObjectDetailExtensionHook::injectExtensions([
+            200 => $commentInfo,
+            201 => $eventInfo,
+            500 => $tiedToAckInfo,
+            600 => $removedInfo
+        ], $this->createExtensions()));
+    }
+
+    protected function assembleFlappingEvent(FlappingHistory $flapping)
+    {
+        $eventInfo = [
+            new HtmlElement('h2', null, Text::create(t('Event Info'))),
+            $flapping->object_type === 'host'
+                ? new HorizontalKeyValue(t('Host'), HtmlElement::create(
+                    'span',
+                    ['class' => 'accompanying-text'],
+                    HtmlElement::create('span', ['class' => 'subject'], $this->event->host->display_name)
+                ))
+                : new HorizontalKeyValue(t('Service'), HtmlElement::create(
+                    'span',
+                    ['class' => 'accompanying-text'],
+                    FormattedString::create(
+                        t('%s on %s', '<service> on <host>'),
+                        HtmlElement::create('span', ['class' => 'subject'], $this->event->service->display_name),
+                        HtmlElement::create('span', ['class' => 'subject'], $this->event->host->display_name)
+                    )
+                )),
+            new HorizontalKeyValue(t('Started on'), DateFormatter::formatDateTime($flapping->start_time))
+        ];
+        if ($this->event->event_type === 'flapping_start') {
+            $eventInfo[] = new HorizontalKeyValue(t('Reason'), sprintf(
+                t('State change rate of %.2f%% exceeded the threshold (%.2f%%)'),
+                $flapping->percent_state_change_start,
+                $flapping->flapping_threshold_high
+            ));
+        } else {
+            $eventInfo[] = new HorizontalKeyValue(t('Ended on'), DateFormatter::formatDateTime($flapping->end_time));
+            $eventInfo[] = new HorizontalKeyValue(t('Reason'), sprintf(
+                t('State change rate of %.2f%% undercut the threshold (%.2f%%)'),
+                $flapping->percent_state_change_end,
+                $flapping->flapping_threshold_low
+            ));
+        }
+
+        $this->add(ObjectDetailExtensionHook::injectExtensions([
+            200 => $eventInfo
+        ], $this->createExtensions()));
+    }
+
+    protected function assembleAcknowledgeEvent(AcknowledgementHistory $acknowledgement)
+    {
+        $commentInfo = [];
+        if ($acknowledgement->comment) {
+            $commentInfo = [
+                new HtmlElement('h2', null, Text::create(t('Comment'))),
+                new MarkdownText($this->createTicketLinks($acknowledgement->comment))
+            ];
+        } elseif (! isset($acknowledgement->author)) {
+            $commentInfo[] = new EmptyState(t('This acknowledgement was set before Icinga DB history recording'));
+        }
+
+        $eventInfo = [
+            new HtmlElement('h2', null, Text::create(t('Event Info'))),
+            new HorizontalKeyValue(t('Set on'), DateFormatter::formatDateTime($acknowledgement->set_time)),
+            new HorizontalKeyValue(t('Author'), $acknowledgement->author
+                ? [new Icon('user'), $acknowledgement->author]
+                : new EmptyState(t('n. a.'))),
+            $acknowledgement->object_type === 'host'
+                ? new HorizontalKeyValue(t('Host'), HtmlElement::create(
+                    'span',
+                    ['class' => 'accompanying-text'],
+                    HtmlElement::create('span', ['class' => 'subject'], $this->event->host->display_name)
+                ))
+                : new HorizontalKeyValue(t('Service'), HtmlElement::create(
+                    'span',
+                    ['class' => 'accompanying-text'],
+                    FormattedString::create(
+                        t('%s on %s', '<service> on <host>'),
+                        HtmlElement::create('span', ['class' => 'subject'], $this->event->service->display_name),
+                        HtmlElement::create('span', ['class' => 'subject'], $this->event->host->display_name)
+                    )
+                ))
+        ];
+
+        if ($this->event->event_type === 'ack_set') {
+            $eventInfo[] = new HorizontalKeyValue(
+                t('Expires On'),
+                $acknowledgement->expire_time
+                ? DateFormatter::formatDateTime($acknowledgement->expire_time)
+                : new EmptyState(t('Never'))
+            );
+            $eventInfo[] = new HorizontalKeyValue(t('Sticky'), isset($acknowledgement->is_sticky)
+                ? ($acknowledgement->is_sticky ? t('Yes') : t('No'))
+                : new EmptyState(t('n. a.')));
+            $eventInfo[] = new HorizontalKeyValue(t('Persistent'), isset($acknowledgement->is_persistent)
+                ? ($acknowledgement->is_persistent ? t('Yes') : t('No'))
+                : new EmptyState(t('n. a.')));
+        } else {
+            $eventInfo[] = new HorizontalKeyValue(
+                t('Cleared on'),
+                DateFormatter::formatDateTime($acknowledgement->clear_time ?: $this->event->event_time)
+            );
+            if ($acknowledgement->cleared_by) {
+                $eventInfo[] = new HorizontalKeyValue(
+                    t('Cleared by'),
+                    [new Icon('user', $acknowledgement->cleared_by)]
+                );
+            } else {
+                $expired = false;
+                if ($acknowledgement->expire_time) {
+                    $now = (new DateTime())->setTimezone(new DateTimeZone('UTC'));
+                    $expiresOn = clone $now;
+                    $expiresOn->setTimestamp($acknowledgement->expire_time);
+                    if ($now <= $expiresOn) {
+                        $expired = true;
+                        $eventInfo[] = new HorizontalKeyValue(t('Removal Reason'), t(
+                            'The acknowledgement expired on %s',
+                            DateFormatter::formatDateTime($acknowledgement->expire_time)
+                        ));
+                    }
+                }
+
+                if (! $expired) {
+                    if ($acknowledgement->is_sticky) {
+                        $eventInfo[] = new HorizontalKeyValue(
+                            t('Reason'),
+                            $acknowledgement->object_type === 'host'
+                                ? t('Host recovered')
+                                : t('Service recovered')
+                        );
+                    } else {
+                        $eventInfo[] = new HorizontalKeyValue(
+                            t('Reason'),
+                            $acknowledgement->object_type === 'host'
+                                ? t('Host recovered') // Hosts have no other state between UP and DOWN
+                                : t('Service changed its state')
+                        );
+                    }
+                }
+            }
+        }
+
+        $this->add(ObjectDetailExtensionHook::injectExtensions([
+            200 => $commentInfo,
+            201 => $eventInfo
+        ], $this->createExtensions()));
+    }
+
+    protected function createExtensions(): array
+    {
+        return ObjectDetailExtensionHook::loadExtensions($this->event);
+    }
+
+    protected function assemble()
+    {
+        switch ($this->event->event_type) {
+            case 'notification':
+                $this->assembleNotificationEvent($this->event->notification);
+
+                break;
+            case 'state_change':
+                $this->assembleStateChangeEvent($this->event->state);
+
+                break;
+            case 'downtime_start':
+            case 'downtime_end':
+                $this->assembleDowntimeEvent($this->event->downtime);
+
+                break;
+            case 'comment_add':
+            case 'comment_remove':
+                $this->assembleCommentEvent($this->event->comment);
+
+                break;
+            case 'flapping_start':
+            case 'flapping_end':
+                $this->assembleFlappingEvent($this->event->flapping);
+
+                break;
+            case 'ack_set':
+            case 'ack_clear':
+                $this->assembleAcknowledgeEvent($this->event->acknowledgement);
+
+                break;
+        }
+    }
+}
diff --git a/library/Icingadb/Widget/Detail/HostDetail.php b/library/Icingadb/Widget/Detail/HostDetail.php
new file mode 100644
index 0000000..8757436
--- /dev/null
+++ b/library/Icingadb/Widget/Detail/HostDetail.php
@@ -0,0 +1,58 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\Detail;
+
+use Icinga\Module\Icingadb\Hook\ExtensionHook\ObjectDetailExtensionHook;
+use Icinga\Module\Icingadb\Model\Host;
+use Icinga\Module\Icingadb\Model\ServicestateSummary;
+use Icinga\Module\Icingadb\Widget\EmptyState;
+use ipl\Html\Html;
+use ipl\Stdlib\Filter;
+
+class HostDetail extends ObjectDetail
+{
+    protected $serviceSummary;
+
+    public function __construct(Host $object, ServicestateSummary $serviceSummary)
+    {
+        parent::__construct($object);
+
+        $this->serviceSummary = $serviceSummary;
+    }
+
+    protected function createServiceStatistics(): array
+    {
+        if ($this->serviceSummary->services_total > 0) {
+            $services = new ServiceStatistics($this->serviceSummary);
+            $services->setBaseFilter(Filter::equal('host.name', $this->object->name));
+        } else {
+            $services = new EmptyState(t('This host has no services'));
+        }
+
+        return [Html::tag('h2', t('Services')), $services];
+    }
+
+    protected function assemble()
+    {
+        if (getenv('ICINGAWEB_EXPORT_FORMAT') === 'pdf') {
+            $this->add($this->createPrintHeader());
+        }
+
+        $this->add(ObjectDetailExtensionHook::injectExtensions([
+            0   => $this->createPluginOutput(),
+            190 => $this->createServiceStatistics(),
+            300 => $this->createActions(),
+            301 => $this->createNotes(),
+            400 => $this->createComments(),
+            401 => $this->createDowntimes(),
+            500 => $this->createGroups(),
+            501 => $this->createNotifications(),
+            600 => $this->createCheckStatistics(),
+            601 => $this->createPerformanceData(),
+            700 => $this->createCustomVars(),
+            701 => $this->createFeatureToggles()
+        ], $this->createExtensions()));
+    }
+}
diff --git a/library/Icingadb/Widget/Detail/HostInspectionDetail.php b/library/Icingadb/Widget/Detail/HostInspectionDetail.php
new file mode 100644
index 0000000..93b35b8
--- /dev/null
+++ b/library/Icingadb/Widget/Detail/HostInspectionDetail.php
@@ -0,0 +1,21 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\Detail;
+
+use Icinga\Module\Icingadb\Common\ObjectInspectionDetail;
+
+class HostInspectionDetail extends ObjectInspectionDetail
+{
+    protected function assemble()
+    {
+        $this->add([
+            $this->createSourceLocation(),
+            $this->createLastCheckResult(),
+            $this->createAttributes(),
+            $this->createCustomVariables(),
+            $this->createRedisInfo()
+        ]);
+    }
+}
diff --git a/library/Icingadb/Widget/Detail/HostMetaInfo.php b/library/Icingadb/Widget/Detail/HostMetaInfo.php
new file mode 100644
index 0000000..15e7da6
--- /dev/null
+++ b/library/Icingadb/Widget/Detail/HostMetaInfo.php
@@ -0,0 +1,75 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\Detail;
+
+use Icinga\Date\DateFormatter;
+use Icinga\Module\Icingadb\Model\Host;
+use Icinga\Module\Icingadb\Widget\EmptyState;
+use ipl\Web\Widget\HorizontalKeyValue;
+use ipl\Web\Widget\VerticalKeyValue;
+use ipl\Html\Attributes;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\HtmlDocument;
+use ipl\Html\HtmlElement;
+use ipl\Web\Widget\Icon;
+
+class HostMetaInfo extends BaseHtmlElement
+{
+    protected $tag = 'div';
+
+    protected $defaultAttributes = ['class' => 'object-meta-info'];
+
+    /** @var Host */
+    protected $host;
+
+    public function __construct(Host $host)
+    {
+        $this->host = $host;
+    }
+
+    protected function assemble()
+    {
+        $this->addHtml(
+            new VerticalKeyValue('host.name', $this->host->name),
+            new HtmlElement(
+                'div',
+                null,
+                new HorizontalKeyValue(
+                    'host.address',
+                    $this->host->address ?: new EmptyState(t('None', 'address'))
+                ),
+                new HorizontalKeyValue(
+                    'host.address6',
+                    $this->host->address6 ?: new EmptyState(t('None', 'address'))
+                )
+            ),
+            new VerticalKeyValue(
+                'last_state_change',
+                DateFormatter::formatDateTime($this->host->state->last_state_change)
+            )
+        );
+
+        $collapsible = new HtmlElement('div', Attributes::create([
+            'class' => 'collapsible',
+            'id'    => 'object-meta-info',
+            'data-toggle-element' => '.object-meta-info-control',
+            'data-visible-height' => 0
+        ]));
+
+        $renderHelper = new HtmlDocument();
+        $renderHelper->addHtml(
+            $this,
+            new HtmlElement(
+                'button',
+                Attributes::create(['class' => 'object-meta-info-control']),
+                new Icon('angle-double-up', ['class' => 'collapse-icon']),
+                new Icon('angle-double-down', ['class' => 'expand-icon'])
+            )
+        );
+
+        $this->addWrapper($collapsible);
+        $this->addWrapper($renderHelper);
+    }
+}
diff --git a/library/Icingadb/Widget/Detail/HostStatistics.php b/library/Icingadb/Widget/Detail/HostStatistics.php
new file mode 100644
index 0000000..53423be
--- /dev/null
+++ b/library/Icingadb/Widget/Detail/HostStatistics.php
@@ -0,0 +1,62 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\Detail;
+
+use Icinga\Chart\Donut;
+use Icinga\Data\Filter\Filter;
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Widget\HostStateBadges;
+use ipl\Html\ValidHtml;
+use ipl\Web\Widget\VerticalKeyValue;
+use ipl\Html\HtmlString;
+use ipl\Web\Filter\QueryString;
+use ipl\Web\Widget\Link;
+
+class HostStatistics extends ObjectStatistics
+{
+    protected $summary;
+
+    public function __construct($summary)
+    {
+        $this->summary = $summary;
+    }
+
+    protected function createDonut(): ValidHtml
+    {
+        $donut = (new Donut())
+            ->addSlice($this->summary->hosts_up, ['class' => 'slice-state-ok'])
+            ->addSlice($this->summary->hosts_down_handled, ['class' => 'slice-state-critical-handled'])
+            ->addSlice($this->summary->hosts_down_unhandled, ['class' => 'slice-state-critical'])
+            ->addSlice($this->summary->hosts_pending, ['class' => 'slice-state-pending']);
+
+        return HtmlString::create($donut->render());
+    }
+
+    protected function createTotal(): ValidHtml
+    {
+        $url = Links::hosts();
+        if ($this->hasBaseFilter()) {
+            $url->addFilter(Filter::fromQueryString(QueryString::render($this->getBaseFilter())));
+        }
+
+        return new Link(
+            new VerticalKeyValue(
+                tp('Host', 'Hosts', $this->summary->hosts_total),
+                $this->summary->hosts_total
+            ),
+            $url
+        );
+    }
+
+    protected function createBadges(): ValidHtml
+    {
+        $badges = new HostStateBadges($this->summary);
+        if ($this->hasBaseFilter()) {
+            $badges->setBaseFilter($this->getBaseFilter());
+        }
+
+        return $badges;
+    }
+}
diff --git a/library/Icingadb/Widget/Detail/MultiselectQuickActions.php b/library/Icingadb/Widget/Detail/MultiselectQuickActions.php
new file mode 100644
index 0000000..b945cc0
--- /dev/null
+++ b/library/Icingadb/Widget/Detail/MultiselectQuickActions.php
@@ -0,0 +1,194 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\Detail;
+
+use Icinga\Module\Icingadb\Common\Auth;
+use Icinga\Module\Icingadb\Common\BaseFilter;
+use Icinga\Module\Icingadb\Forms\Command\Object\CheckNowForm;
+use Icinga\Module\Icingadb\Forms\Command\Object\RemoveAcknowledgementForm;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\Html;
+use ipl\Web\Filter\QueryString;
+use ipl\Web\Url;
+use ipl\Web\Widget\Icon;
+
+class MultiselectQuickActions extends BaseHtmlElement
+{
+    use BaseFilter;
+    use Auth;
+
+    protected $summary;
+
+    protected $type;
+
+    protected $tag = 'ul';
+
+    protected $defaultAttributes = ['class' => 'quick-actions'];
+
+    public function __construct($type, $summary)
+    {
+        $this->summary = $summary;
+        $this->type = $type;
+    }
+
+    protected function assemble()
+    {
+        $unacknowledged = "{$this->type}s_problems_unacknowledged";
+        $acks = "{$this->type}s_acknowledged";
+        $activeChecks = "{$this->type}s_active_checks_enabled";
+
+        if (
+            $this->summary->$unacknowledged > $this->summary->$acks
+            && $this->isGrantedOnType(
+                'icingadb/command/acknowledge-problem',
+                $this->type,
+                $this->getBaseFilter(),
+                false
+            )
+        ) {
+            $this->assembleAction(
+                'acknowledge',
+                t('Acknowledge'),
+                'check-circle',
+                t('Acknowledge this problem, suppress all future notifications for it and tag it as being handled')
+            );
+        }
+
+        if (
+            $this->summary->$acks > 0
+            && $this->isGrantedOnType(
+                'icingadb/command/remove-acknowledgement',
+                $this->type,
+                $this->getBaseFilter(),
+                false
+            )
+        ) {
+            $removeAckForm = (new RemoveAcknowledgementForm())
+                ->setAction($this->getLink('removeAcknowledgement'))
+                ->setObjects(array_fill(0, $this->summary->$acks, null));
+
+            $this->add(Html::tag('li', $removeAckForm));
+        }
+
+        if (
+            $this->isGrantedOnType('icingadb/command/schedule-check', $this->type, $this->getBaseFilter(), false)
+            || (
+                $this->summary->$activeChecks > 0
+                && $this->isGrantedOnType(
+                    'icingadb/command/schedule-check/active-only',
+                    $this->type,
+                    $this->getBaseFilter(),
+                    false
+                )
+            )
+        ) {
+            $this->add(Html::tag('li', (new CheckNowForm())->setAction($this->getLink('checkNow'))));
+        }
+
+        if ($this->isGrantedOnType('icingadb/command/comment/add', $this->type, $this->getBaseFilter(), false)) {
+            $this->assembleAction(
+                'addComment',
+                t('Comment'),
+                'comment',
+                t('Add a new comment')
+            );
+        }
+
+        if (
+            $this->isGrantedOnType(
+                'icingadb/command/send-custom-notification',
+                $this->type,
+                $this->getBaseFilter(),
+                false
+            )
+        ) {
+            $this->assembleAction(
+                'sendCustomNotification',
+                t('Notification'),
+                'bell',
+                t('Send a custom notification')
+            );
+        }
+
+        if (
+            $this->isGrantedOnType(
+                'icingadb/command/downtime/schedule',
+                $this->type,
+                $this->getBaseFilter(),
+                false
+            )
+        ) {
+            $this->assembleAction(
+                'scheduleDowntime',
+                t('Downtime'),
+                'plug',
+                t('Schedule a downtime to suppress all problem notifications within a specific period of time')
+            );
+        }
+
+        if (
+            $this->isGrantedOnType('icingadb/command/schedule-check', $this->type, $this->getBaseFilter(), false)
+            || (
+                $this->summary->$activeChecks > 0
+                && $this->isGrantedOnType(
+                    'icingadb/command/schedule-check/active-only',
+                    $this->type,
+                    $this->getBaseFilter(),
+                    false
+                )
+            )
+        ) {
+            $this->assembleAction(
+                'scheduleCheck',
+                t('Reschedule'),
+                'calendar',
+                t('Schedule the next active check at a different time than the current one')
+            );
+        }
+
+        if (
+            $this->isGrantedOnType(
+                'icingadb/command/process-check-result',
+                $this->type,
+                $this->getBaseFilter(),
+                false
+            )
+        ) {
+            $this->assembleAction(
+                'processCheckresult',
+                t('Process check result'),
+                'edit',
+                t('Submit passive check result')
+            );
+        }
+    }
+
+    protected function assembleAction(string $action, string $label, string $icon, string $title)
+    {
+        $link = Html::tag(
+            'a',
+            [
+                'href'                => $this->getLink($action),
+                'class'               => 'action-link',
+                'title'               => $title,
+                'data-icinga-modal'   => true,
+                'data-no-icinga-ajax' => true
+            ],
+            [
+                new Icon($icon),
+                $label
+            ]
+        );
+
+        $this->add(Html::tag('li', $link));
+    }
+
+    protected function getLink(string $action): string
+    {
+        return Url::fromPath("icingadb/{$this->type}s/$action")
+            ->setQueryString(QueryString::render($this->getBaseFilter()))
+            ->getAbsoluteUrl();
+    }
+}
diff --git a/library/Icingadb/Widget/Detail/ObjectDetail.php b/library/Icingadb/Widget/Detail/ObjectDetail.php
new file mode 100644
index 0000000..b8760ee
--- /dev/null
+++ b/library/Icingadb/Widget/Detail/ObjectDetail.php
@@ -0,0 +1,585 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\Detail;
+
+use Exception;
+use Icinga\Application\ClassLoader;
+use Icinga\Application\Hook;
+use Icinga\Application\Hook\GrapherHook;
+use Icinga\Application\Icinga;
+use Icinga\Application\Logger;
+use Icinga\Date\DateFormatter;
+use Icinga\Exception\IcingaException;
+use Icinga\Module\Icingadb\Common\Auth;
+use Icinga\Module\Icingadb\Common\Database;
+use Icinga\Module\Icingadb\Common\HostLinks;
+use Icinga\Module\Icingadb\Common\Icons;
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Common\Macros;
+use Icinga\Module\Icingadb\Compat\CompatHost;
+use Icinga\Module\Icingadb\Model\CustomvarFlat;
+use Icinga\Module\Icingadb\Web\Navigation\Action;
+use Icinga\Module\Icingadb\Widget\MarkdownText;
+use Icinga\Module\Icingadb\Common\ServiceLinks;
+use Icinga\Module\Icingadb\Forms\Command\Object\ToggleObjectFeaturesForm;
+use Icinga\Module\Icingadb\Hook\ActionsHook\ObjectActionsHook;
+use Icinga\Module\Icingadb\Hook\ExtensionHook\ObjectDetailExtensionHook;
+use Icinga\Module\Icingadb\Model\Host;
+use Icinga\Module\Icingadb\Model\User;
+use Icinga\Module\Icingadb\Model\Usergroup;
+use Icinga\Module\Icingadb\Util\PluginOutput;
+use Icinga\Module\Icingadb\Widget\ItemList\DowntimeList;
+use Icinga\Module\Icingadb\Widget\EmptyState;
+use Icinga\Module\Icingadb\Widget\StateChange;
+use ipl\Web\Widget\HorizontalKeyValue;
+use Icinga\Module\Icingadb\Widget\ItemList\CommentList;
+use Icinga\Module\Icingadb\Widget\PluginOutputContainer;
+use Icinga\Module\Icingadb\Widget\ShowMore;
+use Icinga\Module\Icingadb\Widget\TagList;
+use Icinga\Module\Monitoring\Hook\DetailviewExtensionHook;
+use Icinga\Web\Navigation\Navigation;
+use ipl\Html\Attributes;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\Html;
+use ipl\Html\HtmlElement;
+use ipl\Html\HtmlString;
+use ipl\Html\Text;
+use ipl\Orm\ResultSet;
+use ipl\Stdlib\Filter;
+use ipl\Web\Widget\Icon;
+use ipl\Web\Widget\StateBall;
+
+class ObjectDetail extends BaseHtmlElement
+{
+    use Auth;
+    use Database;
+    use Macros;
+
+    protected $object;
+
+    protected $compatObject;
+
+    protected $objectType;
+
+    protected $defaultAttributes = [
+        // Class host-detail is kept as the grafana module's iframe.js depends on it
+        'class' => ['object-detail', 'host-detail'],
+        'data-pdfexport-page-breaks-at' => 'h2'
+    ];
+
+    protected $tag = 'div';
+
+    public function __construct($object)
+    {
+        $this->object = $object;
+        $this->objectType = $object instanceof Host ? 'host' : 'service';
+    }
+
+    protected function compatObject()
+    {
+        if ($this->compatObject === null) {
+            $this->compatObject = CompatHost::fromModel($this->object);
+        }
+
+        return $this->compatObject;
+    }
+
+    protected function createPrintHeader()
+    {
+        $info = [new HorizontalKeyValue(t('Name'), $this->object->name)];
+
+        if ($this->objectType === 'host') {
+            $info[] = new HorizontalKeyValue(
+                t('IPv4 Address'),
+                $this->object->address ?: new EmptyState(t('None', 'address'))
+            );
+            $info[] = new HorizontalKeyValue(
+                t('IPv6 Address'),
+                $this->object->address6 ?: new EmptyState(t('None', 'address'))
+            );
+        }
+
+        $info[] = new HorizontalKeyValue(t('State'), [
+            $this->object->state->getStateTextTranslated(),
+            ' ',
+            new StateBall($this->object->state->getStateText())
+        ]);
+
+        $info[] = new HorizontalKeyValue(
+            t('Last State Change'),
+            DateFormatter::formatDateTime($this->object->state->last_state_change)
+        );
+
+        return [
+            new HtmlElement('h2', null, Text::create(
+                $this->objectType === 'host' ? t('Host') : t('Service')
+            )),
+            $info
+        ];
+    }
+
+    protected function createActions()
+    {
+        $this->fetchCustomVars();
+
+        $navigation = new Navigation();
+        $navigation->load('icingadb-' . $this->objectType . '-action');
+        /** @var Action $item */
+        foreach ($navigation as $item) {
+            $item->setObject($this->object);
+        }
+
+        foreach ($this->object->action_url->first()->action_url ?? [] as $url) {
+            $url = $this->expandMacros($url, $this->object);
+            $navigation->addItem(
+                Html::wantHtml([
+                    // Add warning to links that open in new tabs, as recommended by WCAG20 G201
+                    new Icon('external-link-alt', ['title' => t('Link opens in a new window')]),
+                    $url
+                ])->render(),
+                [
+                    'target'   => '_blank',
+                    'url'      => $url,
+                    'renderer' => [
+                        'NavigationItemRenderer',
+                        'escape_label' => false
+                    ]
+                ]
+            );
+        }
+
+        $moduleActions = ObjectActionsHook::loadActions($this->object);
+
+        $nativeExtensionProviders = [];
+        foreach ($moduleActions->getContent() as $item) {
+            if ($item->getAttributes()->has('data-icinga-module')) {
+                $nativeExtensionProviders[$item->getAttributes()->get('data-icinga-module')->getValue()] = true;
+            }
+        }
+
+        if (Icinga::app()->getModuleManager()->hasInstalled('monitoring')) {
+            foreach (Hook::all('Monitoring\\' . ucfirst($this->objectType) . 'Actions') as $hook) {
+                $moduleName = ClassLoader::extractModuleName(get_class($hook));
+                if (! isset($nativeExtensionProviders[$moduleName])) {
+                    try {
+                        $navigation->merge($hook->getNavigation($this->compatObject()));
+                    } catch (Exception $e) {
+                        Logger::error("Failed to load legacy action hook: %s\n%s", $e, $e->getTraceAsString());
+                        $navigation->addItem($moduleName, ['label' => IcingaException::describe($e), 'url' => '#']);
+                    }
+                }
+            }
+        }
+
+        if ($moduleActions->isEmpty() && ($navigation->isEmpty() || ! $navigation->hasRenderableItems())) {
+            return null;
+        }
+
+        return [
+            Html::tag('h2', t('Actions')),
+            new HtmlString($navigation->getRenderer()->setCssClass('object-detail-actions')->render()),
+            $moduleActions->isEmpty() ? null : $moduleActions
+        ];
+    }
+
+    protected function createCheckStatistics(): array
+    {
+        return [
+            Html::tag('h2', t('Check Statistics')),
+            new CheckStatistics($this->object)
+        ];
+    }
+
+    protected function createComments(): array
+    {
+        if ($this->objectType === 'host') {
+            $link = HostLinks::comments($this->object);
+            $relations = ['host', 'host.state'];
+        } else {
+            $link = ServiceLinks::comments($this->object, $this->object->host);
+            $relations = ['service', 'service.state', 'service.host', 'service.host.state'];
+        }
+
+        $comments = $this->object->comment
+            ->with($relations)
+            ->limit(3)
+            ->peekAhead();
+        // TODO: This should be automatically done by the model/resolver and added as ON condition
+        $comments->filter(Filter::equal('object_type', $this->objectType));
+
+        $comments = $comments->execute();
+        /** @var ResultSet $comments */
+
+        $content = [Html::tag('h2', t('Comments'))];
+
+        if ($comments->hasResult()) {
+            $content[] = (new CommentList($comments))->setObjectLinkDisabled()->setTicketLinkEnabled();
+            $content[] = (new ShowMore($comments, $link))->setBaseTarget('_next');
+        } else {
+            $content[] = new EmptyState(t('No comments created.'));
+        }
+
+        return $content;
+    }
+
+    protected function createCustomVars(): array
+    {
+        $content = [Html::tag('h2', t('Custom Variables'))];
+
+        $this->fetchCustomVars();
+        $vars = (new CustomvarFlat())->unFlattenVars($this->object->customvar_flat);
+        if (! empty($vars)) {
+            $content[] = new HtmlElement('div', Attributes::create([
+                'id' => $this->objectType . '-customvars',
+                'class' => 'collapsible',
+                'data-visible-height' => 200
+            ]), new CustomVarTable($vars, $this->object));
+        } else {
+            $content[] = new EmptyState(t('No custom variables configured.'));
+        }
+
+        return $content;
+    }
+
+    protected function createDowntimes(): array
+    {
+        if ($this->objectType === 'host') {
+            $link = HostLinks::downtimes($this->object);
+            $relations = ['host', 'host.state'];
+        } else {
+            $link = ServiceLinks::downtimes($this->object, $this->object->host);
+            $relations = ['service', 'service.state', 'service.host', 'service.host.state'];
+        }
+
+        $downtimes = $this->object->downtime
+            ->with($relations)
+            ->limit(3)
+            ->peekAhead();
+        // TODO: This should be automatically done by the model/resolver and added as ON condition
+        $downtimes->filter(Filter::equal('object_type', $this->objectType));
+
+        $downtimes = $downtimes->execute();
+        /** @var ResultSet $downtimes */
+
+        $content = [Html::tag('h2', t('Downtimes'))];
+
+        if ($downtimes->hasResult()) {
+            $content[] = (new DowntimeList($downtimes))->setObjectLinkDisabled()->setTicketLinkEnabled();
+            $content[] = (new ShowMore($downtimes, $link))->setBaseTarget('_next');
+        } else {
+            $content[] = new EmptyState(t('No downtimes scheduled.'));
+        }
+
+        return $content;
+    }
+
+    protected function createGroups(): array
+    {
+        $groups = [Html::tag('h2', t('Groups'))];
+
+        if ($this->objectType === 'host') {
+            $hostgroups = [];
+            if ($this->isPermittedRoute('hostgroups')) {
+                $hostgroups = $this->object->hostgroup;
+                $this->applyRestrictions($hostgroups);
+            }
+
+            $hostgroupList = new TagList();
+            foreach ($hostgroups as $hostgroup) {
+                $hostgroupList->addLink($hostgroup->display_name, Links::hostgroup($hostgroup));
+            }
+
+            $groups[] = $hostgroupList->hasContent()
+                ? $hostgroupList
+                : new EmptyState(t('Not a member of any host group.'));
+        } else {
+            $servicegroups = [];
+            if ($this->isPermittedRoute('servicegroups')) {
+                $servicegroups = $this->object->servicegroup;
+                $this->applyRestrictions($servicegroups);
+            }
+
+            $servicegroupList = new TagList();
+            foreach ($servicegroups as $servicegroup) {
+                $servicegroupList->addLink($servicegroup->display_name, Links::servicegroup($servicegroup));
+            }
+
+            $groups[] = $servicegroupList->hasContent()
+                ? $servicegroupList
+                : new EmptyState(t('Not a member of any service group.'));
+        }
+
+        return $groups;
+    }
+
+    protected function createNotes()
+    {
+        $navigation = new Navigation();
+        $notes = trim($this->object->notes);
+
+        foreach ($this->object->notes_url->first()->notes_url ?? [] as $url) {
+            $url = $this->expandMacros($url, $this->object);
+            $navigation->addItem(
+                Html::wantHtml([
+                    // Add warning to links that open in new tabs, as recommended by WCAG20 G201
+                    new Icon('external-link-alt', ['title' => t('Link opens in a new window')]),
+                    $url
+                ])->render(),
+                [
+                    'target'   => '_blank',
+                    'url'      => $url,
+                    'renderer'  => [
+                        'NavigationItemRenderer',
+                        'escape_label' => false
+                    ]
+                ]
+            );
+        }
+
+        $content = [];
+
+        if (! $navigation->isEmpty() && $navigation->hasRenderableItems()) {
+            $content[] = new HtmlString($navigation->getRenderer()->setCssClass('object-detail-actions')->render());
+        }
+
+        if ($notes !== '') {
+            $content[] = (new MarkdownText($notes))
+                ->addAttributes([
+                    'class'               => 'collapsible',
+                    'data-visible-height' => 200,
+                    'id'                  => $this->objectType . '-notes'
+                ]);
+        }
+
+        if (empty($content)) {
+            return null;
+        }
+
+        array_unshift($content, Html::tag('h2', t('Notes')));
+
+        return $content;
+    }
+
+    protected function createNotifications(): array
+    {
+        list($users, $usergroups) = $this->getUsersAndUsergroups();
+
+        $userList = new TagList();
+        $usergroupList = new TagList();
+
+        foreach ($users as $user) {
+            $userList->addLink([new Icon(Icons::USER), $user->display_name], Links::user($user));
+        }
+
+        foreach ($usergroups as $usergroup) {
+            $usergroupList->addLink(
+                [new Icon(Icons::USERGROUP), $usergroup->display_name],
+                Links::usergroup($usergroup)
+            );
+        }
+
+        return [
+            Html::tag('h2', t('Notifications')),
+            new HorizontalKeyValue(
+                t('Users'),
+                $userList->hasContent() ? $userList : new EmptyState(t('No users configured.'))
+            ),
+            new HorizontalKeyValue(
+                t('User Groups'),
+                $usergroupList->hasContent()
+                    ? $usergroupList
+                    : new EmptyState(t('No user groups configured.'))
+            )
+        ];
+    }
+
+    protected function createPerformanceData(): array
+    {
+        $content[] = Html::tag('h2', t('Performance Data'));
+
+        if (empty($this->object->state->performance_data)) {
+            $content[] = new EmptyState(t('No performance data available.'));
+        } else {
+            $content[] = new HtmlElement(
+                'div',
+                Attributes::create(['id' => 'check-perfdata-' . $this->object->checkcommand_name]),
+                new PerfDataTable($this->object->state->normalized_performance_data)
+            );
+        }
+
+        return $content;
+    }
+
+    protected function createPluginOutput(): array
+    {
+        if (empty($this->object->state->output) && empty($this->object->state->long_output)) {
+            $pluginOutput = new EmptyState(t('Output unavailable.'));
+        } else {
+            $pluginOutput = new PluginOutputContainer(PluginOutput::fromObject($this->object));
+        }
+
+        return [
+            Html::tag('h2', t('Plugin Output')),
+            Html::tag(
+                'div',
+                [
+                    'id'    => 'check-output-' . $this->object->checkcommand_name,
+                    'class' => 'collapsible',
+                    'data-visible-height' => 100
+                ],
+                $pluginOutput
+            )
+        ];
+    }
+
+    protected function createExtensions(): array
+    {
+        $extensions = ObjectDetailExtensionHook::loadExtensions($this->object);
+
+        $nativeExtensionProviders = [];
+        foreach ($extensions as $extension) {
+            if ($extension instanceof BaseHtmlElement && $extension->getAttributes()->has('data-icinga-module')) {
+                $nativeExtensionProviders[$extension->getAttributes()->get('data-icinga-module')->getValue()] = true;
+            }
+        }
+
+        if (! Icinga::app()->getModuleManager()->hasInstalled('monitoring')) {
+            return $extensions;
+        }
+
+        foreach (Hook::all('Grapher') as $grapher) {
+            /** @var GrapherHook $grapher */
+            $moduleName = ClassLoader::extractModuleName(get_class($grapher));
+
+            if (isset($nativeExtensionProviders[$moduleName])) {
+                continue;
+            }
+
+            try {
+                $graph = HtmlString::create($grapher->getPreviewHtml($this->compatObject()));
+            } catch (Exception $e) {
+                Logger::error("Failed to load legacy grapher: %s\n%s", $e, $e->getTraceAsString());
+                $graph = Text::create(IcingaException::describe($e));
+            }
+
+            $location = ObjectDetailExtensionHook::BASE_LOCATIONS[ObjectDetailExtensionHook::GRAPH_SECTION];
+            while (isset($extensions[$location])) {
+                $location++;
+            }
+
+            $extensions[$location] = $graph;
+        }
+
+        foreach (Hook::all('Monitoring\DetailviewExtension') as $extension) {
+            /** @var DetailviewExtensionHook $extension */
+            $moduleName = $extension->getModule()->getName();
+
+            if (isset($nativeExtensionProviders[$moduleName])) {
+                continue;
+            }
+
+            try {
+                $renderedExtension = $extension
+                    ->setView(Icinga::app()->getViewRenderer()->view)
+                    ->getHtmlForObject($this->compatObject());
+
+                $extensionHtml = new HtmlElement(
+                    'div',
+                    Attributes::create([
+                        'class' => 'icinga-module module-' . $moduleName,
+                        'data-icinga-module' => $moduleName
+                    ]),
+                    HtmlString::create($renderedExtension)
+                );
+            } catch (Exception $e) {
+                Logger::error("Failed to load legacy detail extension: %s\n%s", $e, $e->getTraceAsString());
+                $extensionHtml = Text::create(IcingaException::describe($e));
+            }
+
+            $location = ObjectDetailExtensionHook::BASE_LOCATIONS[ObjectDetailExtensionHook::DETAIL_SECTION];
+            while (isset($extensions[$location])) {
+                $location++;
+            }
+
+            $extensions[$location] = $extensionHtml;
+        }
+
+        return $extensions;
+    }
+
+    protected function createFeatureToggles(): array
+    {
+        $form = new ToggleObjectFeaturesForm($this->object);
+
+        if ($this->objectType === 'host') {
+            $form->setAction(HostLinks::toggleFeatures($this->object)->getAbsoluteUrl());
+        } else {
+            $form->setAction(ServiceLinks::toggleFeatures($this->object, $this->object->host)->getAbsoluteUrl());
+        }
+
+        return [
+            Html::tag('h2', t('Feature Commands')),
+            $form
+        ];
+    }
+
+    protected function getUsersAndUsergroups(): array
+    {
+        $users = [];
+        $usergroups = [];
+        $groupBy = false;
+
+        if ($this->objectType === 'host') {
+            $objectFilter = Filter::all(
+                Filter::equal('notification.host_id', $this->object->id),
+                Filter::unlike('notification.service_id', '*')
+            );
+            $objectFilter->metaData()->set('forceOptimization', false);
+            $groupBy = true;
+        } else {
+            $objectFilter = Filter::equal(
+                'notification.service_id',
+                $this->object->id
+            );
+        }
+
+        if ($this->isPermittedRoute('users')) {
+            $userQuery = User::on($this->getDb());
+            $userQuery->filter($objectFilter);
+            $this->applyRestrictions($userQuery);
+            if ($groupBy) {
+                $userQuery->getSelectBase()->groupBy(['user.id']);
+            }
+
+            foreach ($userQuery as $user) {
+                $users[$user->name] = $user;
+            }
+        }
+
+        if ($this->isPermittedRoute('usergroups')) {
+            $usergroupQuery = Usergroup::on($this->getDb());
+            $usergroupQuery->filter($objectFilter);
+            $this->applyRestrictions($usergroupQuery);
+            if ($groupBy) {
+                $userQuery->getSelectBase()->groupBy(['usergroup.id']);
+            }
+
+            foreach ($usergroupQuery as $usergroup) {
+                $usergroups[$usergroup->name] = $usergroup;
+            }
+        }
+
+        return [$users, $usergroups];
+    }
+
+    protected function fetchCustomVars()
+    {
+        $customvarFlat = $this->object->customvar_flat;
+        if (! $customvarFlat instanceof ResultSet) {
+            $this->applyRestrictions($customvarFlat);
+            $this->object->customvar_flat = $customvarFlat->execute();
+        }
+    }
+}
diff --git a/library/Icingadb/Widget/Detail/ObjectStatistics.php b/library/Icingadb/Widget/Detail/ObjectStatistics.php
new file mode 100644
index 0000000..2142c8b
--- /dev/null
+++ b/library/Icingadb/Widget/Detail/ObjectStatistics.php
@@ -0,0 +1,34 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\Detail;
+
+use Icinga\Module\Icingadb\Common\BaseFilter;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\Html;
+use ipl\Html\ValidHtml;
+
+abstract class ObjectStatistics extends BaseHtmlElement
+{
+    use BaseFilter;
+
+    protected $tag = 'ul';
+
+    protected $defaultAttributes = ['class' => 'object-statistics'];
+
+    abstract protected function createDonut(): ValidHtml;
+
+    abstract protected function createTotal(): ValidHtml;
+
+    abstract protected function createBadges(): ValidHtml;
+
+    protected function assemble()
+    {
+        $this->add([
+            Html::tag('li', ['class' => 'object-statistics-graph'], $this->createDonut()),
+            Html::tag('li', ['class' => ['object-statistics-total', 'text-center']], $this->createTotal()),
+            Html::tag('li', $this->createBadges())
+        ]);
+    }
+}
diff --git a/library/Icingadb/Widget/Detail/ObjectsDetail.php b/library/Icingadb/Widget/Detail/ObjectsDetail.php
new file mode 100644
index 0000000..f30823a
--- /dev/null
+++ b/library/Icingadb/Widget/Detail/ObjectsDetail.php
@@ -0,0 +1,192 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\Detail;
+
+use Icinga\Chart\Donut;
+use Icinga\Module\Icingadb\Common\BaseFilter;
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Forms\Command\Object\ToggleObjectFeaturesForm;
+use Icinga\Module\Icingadb\Hook\ExtensionHook\ObjectsDetailExtensionHook;
+use Icinga\Module\Icingadb\Model\HoststateSummary;
+use Icinga\Module\Icingadb\Model\ServicestateSummary;
+use Icinga\Module\Icingadb\Util\FeatureStatus;
+use Icinga\Module\Icingadb\Widget\EmptyState;
+use Icinga\Module\Icingadb\Widget\HostStateBadges;
+use Icinga\Module\Icingadb\Widget\ServiceStateBadges;
+use ipl\Html\HtmlElement;
+use ipl\Orm\Query;
+use ipl\Web\Widget\VerticalKeyValue;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\Html;
+use ipl\Html\HtmlString;
+use ipl\Web\Filter\QueryString;
+use ipl\Web\Widget\ActionLink;
+
+class ObjectsDetail extends BaseHtmlElement
+{
+    use BaseFilter;
+
+    protected $summary;
+
+    protected $query;
+
+    protected $type;
+
+    protected $defaultAttributes = ['class' => 'objects-detail'];
+
+    protected $tag = 'div';
+
+    /**
+     * Construct an object detail summary widget
+     *
+     * @param string $type
+     * @param HoststateSummary|ServicestateSummary $summary
+     * @param Query $query
+     */
+    public function __construct(string $type, $summary, Query $query)
+    {
+        $this->summary = $summary;
+        $this->query = $query;
+        $this->type = $type;
+    }
+
+    protected function createChart(): BaseHtmlElement
+    {
+        $content = Html::tag('div', ['class' => 'multiselect-summary']);
+
+        if ($this->type === 'host') {
+            $hostsChart = (new Donut())
+                ->addSlice($this->summary->hosts_up, ['class' => 'slice-state-ok'])
+                ->addSlice($this->summary->hosts_down_handled, ['class' => 'slice-state-critical-handled'])
+                ->addSlice($this->summary->hosts_down_unhandled, ['class' => 'slice-state-critical'])
+                ->addSlice($this->summary->hosts_pending, ['class' => 'slice-state-pending']);
+
+            $badges = (new HostStateBadges($this->summary))
+                ->setBaseFilter($this->getBaseFilter());
+
+            $content->add([
+                HtmlString::create($hostsChart->render()),
+                new VerticalKeyValue(
+                    tp('Host', 'Hosts', $this->summary->hosts_total),
+                    $this->summary->hosts_total
+                ),
+                $badges
+            ]);
+        } else {
+            $servicesChart = (new Donut())
+                ->addSlice($this->summary->services_ok, ['class' => 'slice-state-ok'])
+                ->addSlice($this->summary->services_warning_handled, ['class' => 'slice-state-warning-handled'])
+                ->addSlice($this->summary->services_warning_unhandled, ['class' => 'slice-state-warning'])
+                ->addSlice($this->summary->services_critical_handled, ['class' => 'slice-state-critical-handled'])
+                ->addSlice($this->summary->services_critical_unhandled, ['class' => 'slice-state-critical'])
+                ->addSlice($this->summary->services_unknown_handled, ['class' => 'slice-state-unknown-handled'])
+                ->addSlice($this->summary->services_unknown_unhandled, ['class' => 'slice-state-unknown'])
+                ->addSlice($this->summary->services_pending, ['class' => 'slice-state-pending']);
+
+            $badges = (new ServiceStateBadges($this->summary))
+                ->setBaseFilter($this->getBaseFilter());
+
+            $content->add([
+                HtmlString::create($servicesChart->render()),
+                new VerticalKeyValue(
+                    tp('Service', 'Services', $this->summary->services_total),
+                    $this->summary->services_total
+                ),
+                $badges
+            ]);
+        }
+
+        return $content;
+    }
+
+    protected function createComments(): array
+    {
+        $content = [Html::tag('h2', t('Comments'))];
+
+        if ($this->summary->comments_total > 0) {
+            $content[] = new ActionLink(
+                sprintf(
+                    tp('Show %d comment', 'Show %d comments', $this->summary->comments_total),
+                    $this->summary->comments_total
+                ),
+                Links::comments()->setQueryString(QueryString::render($this->getBaseFilter()))
+            );
+        } else {
+            $content[] = new EmptyState(t('No comments created.'));
+        }
+
+        return $content;
+    }
+
+    protected function createDowntimes(): array
+    {
+        $content = [Html::tag('h2', t('Downtimes'))];
+
+        if ($this->summary->downtimes_total > 0) {
+            $content[] = new ActionLink(
+                sprintf(
+                    tp('Show %d downtime', 'Show %d downtimes', $this->summary->downtimes_total),
+                    $this->summary->downtimes_total
+                ),
+                Links::downtimes()->setQueryString(QueryString::render($this->getBaseFilter()))
+            );
+        } else {
+            $content[] = new EmptyState(t('No downtimes scheduled.'));
+        }
+
+        return $content;
+    }
+
+    protected function createFeatureToggles(): array
+    {
+        $form = new ToggleObjectFeaturesForm(new FeatureStatus($this->type, $this->summary));
+
+        if ($this->type === 'host') {
+            $form->setAction(
+                Links::toggleHostsFeatures()
+                    ->setQueryString(QueryString::render($this->getBaseFilter()))
+                    ->getAbsoluteUrl()
+            );
+        } else {
+            $form->setAction(
+                Links::toggleServicesFeatures()
+                    ->setQueryString(QueryString::render($this->getBaseFilter()))
+                    ->getAbsoluteUrl()
+            );
+        }
+
+        return [
+            Html::tag('h2', t('Feature Commands')),
+            $form
+        ];
+    }
+
+    protected function createExtensions(): array
+    {
+        return ObjectsDetailExtensionHook::loadExtensions(
+            $this->type,
+            $this->query,
+            $this->getBaseFilter()
+        );
+    }
+
+    protected function createSummary(): array
+    {
+        return [
+            Html::tag('h2', t('Summary')),
+            $this->createChart()
+        ];
+    }
+
+    protected function assemble()
+    {
+        $this->add(ObjectsDetailExtensionHook::injectExtensions([
+            190 => $this->createSummary(),
+            400 => $this->createComments(),
+            401 => $this->createDowntimes(),
+            701 => $this->createFeatureToggles()
+        ], $this->createExtensions()));
+    }
+}
diff --git a/library/Icingadb/Widget/Detail/PerfDataTable.php b/library/Icingadb/Widget/Detail/PerfDataTable.php
new file mode 100644
index 0000000..4e03089
--- /dev/null
+++ b/library/Icingadb/Widget/Detail/PerfDataTable.php
@@ -0,0 +1,133 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\Detail;
+
+use Icinga\Module\Icingadb\Util\PerfData;
+use Icinga\Module\Icingadb\Util\PerfDataSet;
+use Icinga\Module\Icingadb\Widget\EmptyState;
+use ipl\Html\Attributes;
+use ipl\Html\HtmlElement;
+use ipl\Html\HtmlString;
+use ipl\Html\Table;
+use ipl\Html\Text;
+
+class PerfDataTable extends Table
+{
+    /** @var bool Whether the table contains a sparkline column */
+    protected $containsSparkline = false;
+
+    protected $defaultAttributes = [
+        'class' => 'performance-data-table collapsible',
+        'data-visible-rows' => 6
+    ];
+
+    /** @var string The perfdata string  */
+    protected $perfdataStr;
+
+    /** @var int Max labels to show; 0 for no limit */
+    protected $limit;
+
+    /** @var string The color indicating the perfdata state */
+    protected $color;
+
+    /**
+     * Display the given perfdata string to the user
+     *
+     * @param   string  $perfdataStr    The perfdata string
+     * @param   int       $limit              Max labels to show; 0 for no limit
+     * @param   string  $color             The color indicating the perfdata state
+     */
+    public function __construct(string $perfdataStr, int $limit = 0, string $color = PerfData::PERFDATA_OK)
+    {
+        $this->perfdataStr = $perfdataStr;
+        $this->limit = $limit;
+        $this->color = $color;
+    }
+
+    public function assemble()
+    {
+        $pieChartData = PerfDataSet::fromString($this->perfdataStr)->asArray();
+        $keys = ['', 'label', 'value', 'min', 'max', 'warn', 'crit'];
+        $columns = [];
+        $labels = array_combine(
+            $keys,
+            [
+                '',
+                t('Label'),
+                t('Value'),
+                t('Min'),
+                t('Max'),
+                t('Warning'),
+                t('Critical')
+            ]
+        );
+        foreach ($pieChartData as $perfdata) {
+            if ($perfdata->isVisualizable()) {
+                $columns[''] = '';
+                $this->containsSparkline = true;
+            }
+
+            foreach ($perfdata->toArray() as $column => $value) {
+                if (
+                    empty($value) ||
+                    $column === 'min' && floatval($value) === 0.0 ||
+                    $column === 'max' && $perfdata->isPercentage() && floatval($value) === 100
+                ) {
+                    continue;
+                }
+
+                $columns[$column] = $labels[$column];
+            }
+        }
+
+        $headerRow = new HtmlElement('tr');
+        foreach ($keys as $key => $col) {
+            if ((! $this->containsSparkline) && $col == '') {
+                unset($keys[$key]);
+                continue;
+            }
+            if (isset($col)) {
+                $headerRow->addHtml(new HtmlElement('th', Attributes::create([
+                    'class' => ($col == 'label' ? 'title' : null)
+                ]), Text::create($labels[$col])));
+            }
+        }
+
+        $this->getHeader()->addHtml($headerRow);
+
+        foreach ($pieChartData as $count => $perfdata) {
+            if ($this->limit != 0 && $count > $this->limit) {
+                break;
+            } else {
+                $cols = [];
+                if ($this->containsSparkline) {
+                    if ($perfdata->isVisualizable()) {
+                        $cols[] = Table::td(
+                            HtmlString::create($perfdata->asInlinePie($this->color)->render()),
+                            [ 'class' => 'sparkline-col']
+                        );
+                    } else {
+                        $cols[] = Table::td('');
+                    }
+                }
+
+                foreach ($perfdata->toArray() as $column => $value) {
+                    $cols[] = Table::td(
+                        new HtmlElement(
+                            'span',
+                            Attributes::create([
+                                'class' => ($value ? '' : 'no-value')
+                            ]),
+                            $value ? Text::create($value) : new EmptyState(t('None', 'value'))
+                        ),
+                        [ 'class' => ($column === 'label' ? 'title' : null) ]
+                    );
+                }
+
+                $this->addHtml(Table::tr([$cols]));
+            }
+        }
+    }
+}
diff --git a/library/Icingadb/Widget/Detail/QuickActions.php b/library/Icingadb/Widget/Detail/QuickActions.php
new file mode 100644
index 0000000..2ea26c2
--- /dev/null
+++ b/library/Icingadb/Widget/Detail/QuickActions.php
@@ -0,0 +1,148 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\Detail;
+
+use Icinga\Module\Icingadb\Common\Auth;
+use Icinga\Module\Icingadb\Common\HostLinks;
+use Icinga\Module\Icingadb\Common\ServiceLinks;
+use Icinga\Module\Icingadb\Forms\Command\Object\CheckNowForm;
+use Icinga\Module\Icingadb\Forms\Command\Object\RemoveAcknowledgementForm;
+use Icinga\Module\Icingadb\Model\Host;
+use Icinga\Module\Icingadb\Model\Service;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\Html;
+use ipl\Web\Widget\Icon;
+
+class QuickActions extends BaseHtmlElement
+{
+    use Auth;
+
+    /** @var Host|Service */
+    protected $object;
+
+    protected $tag = 'ul';
+
+    protected $defaultAttributes = ['class' => 'quick-actions'];
+
+    public function __construct($object)
+    {
+        $this->object = $object;
+    }
+
+    protected function assemble()
+    {
+        if ($this->object->state->is_problem) {
+            if ($this->object->state->is_acknowledged) {
+                if ($this->isGrantedOn('icingadb/command/remove-acknowledgement', $this->object)) {
+                    $removeAckForm = (new RemoveAcknowledgementForm())
+                        ->setAction($this->getLink('removeAcknowledgement'))
+                        ->setObjects([$this->object]);
+
+                    $this->add(Html::tag('li', $removeAckForm));
+                }
+            } elseif ($this->isGrantedOn('icingadb/command/acknowledge-problem', $this->object)) {
+                $this->assembleAction(
+                    'acknowledge',
+                    t('Acknowledge'),
+                    'check-circle',
+                    t('Acknowledge this problem, suppress all future notifications for it and tag it as being handled')
+                );
+            }
+        }
+
+        if (
+            $this->isGrantedOn('icingadb/command/schedule-check', $this->object)
+            || (
+                $this->object->active_checks_enabled
+                && $this->isGrantedOn('icingadb/command/schedule-check/active-only', $this->object)
+            )
+        ) {
+            $this->add(Html::tag('li', (new CheckNowForm())->setAction($this->getLink('checkNow'))));
+        }
+
+        if ($this->isGrantedOn('icingadb/command/comment/add', $this->object)) {
+            $this->assembleAction(
+                'addComment',
+                t('Comment', 'verb'),
+                'comment',
+                t('Add a new comment')
+            );
+        }
+
+        if ($this->isGrantedOn('icingadb/command/send-custom-notification', $this->object)) {
+            $this->assembleAction(
+                'sendCustomNotification',
+                t('Notification'),
+                'bell',
+                t('Send a custom notification')
+            );
+        }
+
+        if ($this->isGrantedOn('icingadb/command/downtime/schedule', $this->object)) {
+            $this->assembleAction(
+                'scheduleDowntime',
+                t('Downtime'),
+                'plug',
+                t('Schedule a downtime to suppress all problem notifications within a specific period of time')
+            );
+        }
+
+        if (
+            $this->isGrantedOn('icingadb/command/schedule-check', $this->object)
+            || (
+                $this->object->active_checks_enabled
+                && $this->isGrantedOn('icingadb/command/schedule-check/active-only', $this->object)
+            )
+        ) {
+            $this->assembleAction(
+                'scheduleCheck',
+                t('Reschedule'),
+                'calendar',
+                t('Schedule the next active check at a different time than the current one')
+            );
+        }
+
+        if ($this->isGrantedOn('icingadb/command/process-check-result', $this->object)) {
+            $this->assembleAction(
+                'processCheckresult',
+                t('Process check result'),
+                'edit',
+                sprintf(
+                    t('Submit a one time or so called passive result for the %s check'),
+                    $this->object->checkcommand_name
+                )
+            );
+        }
+    }
+
+    protected function assembleAction(string $action, string $label, string $icon, string $title)
+    {
+        $link = Html::tag(
+            'a',
+            [
+                'href'                => $this->getLink($action),
+                'class'               => 'action-link',
+                'title'               => $title,
+                'data-icinga-modal'   => true,
+                'data-no-icinga-ajax' => true
+            ],
+            [
+                new Icon($icon),
+                $label
+            ]
+        );
+
+        $this->add(Html::tag('li', $link));
+    }
+
+    protected function getLink($action)
+    {
+        if ($this->object instanceof Host) {
+            return HostLinks::$action($this->object)->getAbsoluteUrl();
+        } else {
+            return ServiceLinks::$action($this->object, $this->object->host)->getAbsoluteUrl();
+        }
+    }
+}
diff --git a/library/Icingadb/Widget/Detail/ServiceDetail.php b/library/Icingadb/Widget/Detail/ServiceDetail.php
new file mode 100644
index 0000000..8421e31
--- /dev/null
+++ b/library/Icingadb/Widget/Detail/ServiceDetail.php
@@ -0,0 +1,37 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\Detail;
+
+use Icinga\Module\Icingadb\Hook\ExtensionHook\ObjectDetailExtensionHook;
+use Icinga\Module\Icingadb\Model\Service;
+
+class ServiceDetail extends ObjectDetail
+{
+    public function __construct(Service $object)
+    {
+        parent::__construct($object);
+    }
+
+    protected function assemble()
+    {
+        if (getenv('ICINGAWEB_EXPORT_FORMAT') === 'pdf') {
+            $this->add($this->createPrintHeader());
+        }
+
+        $this->add(ObjectDetailExtensionHook::injectExtensions([
+            0   => $this->createPluginOutput(),
+            300 => $this->createActions(),
+            301 => $this->createNotes(),
+            400 => $this->createComments(),
+            401 => $this->createDowntimes(),
+            500 => $this->createGroups(),
+            501 => $this->createNotifications(),
+            600 => $this->createCheckStatistics(),
+            601 => $this->createPerformanceData(),
+            700 => $this->createCustomVars(),
+            701 => $this->createFeatureToggles()
+        ], $this->createExtensions()));
+    }
+}
diff --git a/library/Icingadb/Widget/Detail/ServiceInspectionDetail.php b/library/Icingadb/Widget/Detail/ServiceInspectionDetail.php
new file mode 100644
index 0000000..f29ee9b
--- /dev/null
+++ b/library/Icingadb/Widget/Detail/ServiceInspectionDetail.php
@@ -0,0 +1,21 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\Detail;
+
+use Icinga\Module\Icingadb\Common\ObjectInspectionDetail;
+
+class ServiceInspectionDetail extends ObjectInspectionDetail
+{
+    protected function assemble()
+    {
+        $this->add([
+            $this->createSourceLocation(),
+            $this->createLastCheckResult(),
+            $this->createAttributes(),
+            $this->createCustomVariables(),
+            $this->createRedisInfo()
+        ]);
+    }
+}
diff --git a/library/Icingadb/Widget/Detail/ServiceMetaInfo.php b/library/Icingadb/Widget/Detail/ServiceMetaInfo.php
new file mode 100644
index 0000000..448252f
--- /dev/null
+++ b/library/Icingadb/Widget/Detail/ServiceMetaInfo.php
@@ -0,0 +1,61 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\Detail;
+
+use Icinga\Date\DateFormatter;
+use Icinga\Module\Icingadb\Model\Service;
+use ipl\Web\Widget\VerticalKeyValue;
+use ipl\Html\Attributes;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\HtmlDocument;
+use ipl\Html\HtmlElement;
+use ipl\Web\Widget\Icon;
+
+class ServiceMetaInfo extends BaseHtmlElement
+{
+    protected $tag = 'div';
+
+    protected $defaultAttributes = ['class' => 'object-meta-info'];
+
+    /** @var Service */
+    protected $service;
+
+    public function __construct(Service $service)
+    {
+        $this->service = $service;
+    }
+
+    protected function assemble()
+    {
+        $this->addHtml(
+            new VerticalKeyValue('service.name', $this->service->name),
+            new VerticalKeyValue(
+                'last_state_change',
+                DateFormatter::formatDateTime($this->service->state->last_state_change)
+            )
+        );
+
+        $collapsible = new HtmlElement('div', Attributes::create([
+            'class'                 => 'collapsible',
+            'id'                    => 'object-meta-info',
+            'data-toggle-element'   => '.object-meta-info-control',
+            'data-visible-height'   => 0
+        ]));
+
+        $renderHelper = new HtmlDocument();
+        $renderHelper->addHtml(
+            $this,
+            new HtmlElement(
+                'button',
+                Attributes::create(['class' => 'object-meta-info-control']),
+                new Icon('angle-double-up', ['class' => 'collapse-icon']),
+                new Icon('angle-double-down', ['class' => 'expand-icon'])
+            )
+        );
+
+        $this->addWrapper($collapsible);
+        $this->addWrapper($renderHelper);
+    }
+}
diff --git a/library/Icingadb/Widget/Detail/ServiceStatistics.php b/library/Icingadb/Widget/Detail/ServiceStatistics.php
new file mode 100644
index 0000000..0f570b4
--- /dev/null
+++ b/library/Icingadb/Widget/Detail/ServiceStatistics.php
@@ -0,0 +1,66 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\Detail;
+
+use Icinga\Chart\Donut;
+use Icinga\Data\Filter\Filter;
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Widget\ServiceStateBadges;
+use ipl\Html\ValidHtml;
+use ipl\Web\Widget\VerticalKeyValue;
+use ipl\Html\HtmlString;
+use ipl\Web\Filter\QueryString;
+use ipl\Web\Widget\Link;
+
+class ServiceStatistics extends ObjectStatistics
+{
+    protected $summary;
+
+    public function __construct($summary)
+    {
+        $this->summary = $summary;
+    }
+
+    protected function createDonut(): ValidHtml
+    {
+        $donut = (new Donut())
+            ->addSlice($this->summary->services_ok, ['class' => 'slice-state-ok'])
+            ->addSlice($this->summary->services_warning_handled, ['class' => 'slice-state-warning-handled'])
+            ->addSlice($this->summary->services_warning_unhandled, ['class' => 'slice-state-warning'])
+            ->addSlice($this->summary->services_critical_handled, ['class' => 'slice-state-critical-handled'])
+            ->addSlice($this->summary->services_critical_unhandled, ['class' => 'slice-state-critical'])
+            ->addSlice($this->summary->services_unknown_handled, ['class' => 'slice-state-unknown-handled'])
+            ->addSlice($this->summary->services_unknown_unhandled, ['class' => 'slice-state-unknown'])
+            ->addSlice($this->summary->services_pending, ['class' => 'slice-state-pending']);
+
+        return HtmlString::create($donut->render());
+    }
+
+    protected function createTotal(): ValidHtml
+    {
+        $url = Links::services();
+        if ($this->hasBaseFilter()) {
+            $url->addFilter(Filter::fromQueryString(QueryString::render($this->getBaseFilter())));
+        }
+
+        return new Link(
+            new VerticalKeyValue(
+                tp('Service', 'Services', $this->summary->services_total),
+                $this->summary->services_total
+            ),
+            $url
+        );
+    }
+
+    protected function createBadges(): ValidHtml
+    {
+        $badges = new ServiceStateBadges($this->summary);
+        if ($this->hasBaseFilter()) {
+            $badges->setBaseFilter($this->getBaseFilter());
+        }
+
+        return $badges;
+    }
+}
diff --git a/library/Icingadb/Widget/Detail/UserDetail.php b/library/Icingadb/Widget/Detail/UserDetail.php
new file mode 100644
index 0000000..bfdfa46
--- /dev/null
+++ b/library/Icingadb/Widget/Detail/UserDetail.php
@@ -0,0 +1,188 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\Detail;
+
+use Icinga\Module\Icingadb\Common\Auth;
+use Icinga\Module\Icingadb\Common\Database;
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Hook\ExtensionHook\ObjectDetailExtensionHook;
+use Icinga\Module\Icingadb\Model\User;
+use Icinga\Module\Icingadb\Widget\EmptyState;
+use ipl\Html\Attributes;
+use ipl\Web\Widget\HorizontalKeyValue;
+use Icinga\Module\Icingadb\Widget\ItemList\UsergroupList;
+use Icinga\Module\Icingadb\Widget\ShowMore;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\HtmlElement;
+use ipl\Html\Text;
+
+class UserDetail extends BaseHtmlElement
+{
+    use Auth;
+    use Database;
+
+    /** @var User The given user */
+    protected $user;
+
+    protected $defaultAttributes = ['class' => 'object-detail'];
+
+    protected $tag = 'div';
+
+    public function __construct(User $user)
+    {
+        $this->user = $user;
+    }
+
+    protected function createCustomVars(): array
+    {
+        $content = [new HtmlElement('h2', null, Text::create(t('Custom Variables')))];
+        $flattenedVars = $this->user->customvar_flat;
+        $this->applyRestrictions($flattenedVars);
+
+        $vars = $this->user->customvar_flat->getModel()->unflattenVars($flattenedVars);
+        if (! empty($vars)) {
+            $content[] = new HtmlElement('div', Attributes::create([
+                'id' => 'user-customvars',
+                'class' => 'collapsible',
+                'data-visible-height' => 200
+            ]), new CustomVarTable($vars, $this->user));
+        } else {
+            $content[] = new EmptyState(t('No custom variables configured.'));
+        }
+
+        return $content;
+    }
+
+    protected function createUserDetail(): array
+    {
+        list($hostStates, $serviceStates) = $this->separateStates($this->user->states);
+        $hostStates = implode(', ', $this->localizeStates($hostStates));
+        $serviceStates = implode(', ', $this->localizeStates($serviceStates));
+        $types = implode(', ', $this->localizeTypes($this->user->types));
+
+        return [
+            new HtmlElement('h2', null, Text::create(t('Details'))),
+            new HorizontalKeyValue(t('Name'), $this->user->name),
+            new HorizontalKeyValue(t('E-Mail'), $this->user->email ?: new EmptyState(t('None', 'address'))),
+            new HorizontalKeyValue(t('Pager'), $this->user->pager ?: new EmptyState(t('None', 'phone-number'))),
+            new HorizontalKeyValue(t('Host States'), $hostStates ?: t('All')),
+            new HorizontalKeyValue(t('Service States'), $serviceStates ?: t('All')),
+            new HorizontalKeyValue(t('Types'), $types ?: t('All'))
+        ];
+    }
+
+    protected function createUsergroupList(): array
+    {
+        $userGroups = $this->user->usergroup->limit(6)->peekAhead()->execute();
+
+        $showMoreLink = (new ShowMore(
+            $userGroups,
+            Links::usergroups()->addParams(['user.name' => $this->user->name])
+        ))->setBaseTarget('_next');
+
+        return [
+            new HtmlElement('h2', null, Text::create(t('Groups'))),
+            new UsergroupList($userGroups),
+            $showMoreLink
+        ];
+    }
+
+    protected function createExtensions(): array
+    {
+        return ObjectDetailExtensionHook::loadExtensions($this->user);
+    }
+
+    protected function assemble()
+    {
+        $this->add(ObjectDetailExtensionHook::injectExtensions([
+            200 => $this->createUserDetail(),
+            500 => $this->createUsergroupList(),
+            700 => $this->createCustomVars()
+        ], $this->createExtensions()));
+    }
+
+    private function localizeTypes(array $types): array
+    {
+        $localizedTypes = [];
+        foreach ($types as $type) {
+            switch ($type) {
+                case 'problem':
+                    $localizedTypes[] = t('Problem');
+                    break;
+                case 'ack':
+                    $localizedTypes[] = t('Acknowledgement');
+                    break;
+                case 'recovery':
+                    $localizedTypes[] = t('Recovery');
+                    break;
+                case 'downtime_start':
+                    $localizedTypes[] = t('Downtime Start');
+                    break;
+                case 'downtime_end':
+                    $localizedTypes[] = t('Downtime End');
+                    break;
+                case 'downtime_removed':
+                    $localizedTypes[] = t('Downtime Removed');
+                    break;
+                case 'flapping_start':
+                    $localizedTypes[] = t('Flapping Start');
+                    break;
+                case 'flapping_end':
+                    $localizedTypes[] = t('Flapping End');
+                    break;
+                case 'custom':
+                    $localizedTypes[] = t('Custom');
+                    break;
+            }
+        }
+
+        return $localizedTypes;
+    }
+
+    private function localizeStates(array $states): array
+    {
+        $localizedState = [];
+        foreach ($states as $state) {
+            switch ($state) {
+                case 'up':
+                    $localizedState[] = t('Up');
+                    break;
+                case 'down':
+                    $localizedState[] = t('Down');
+                    break;
+                case 'ok':
+                    $localizedState[] = t('Ok');
+                    break;
+                case 'warning':
+                    $localizedState[] = t('Warning');
+                    break;
+                case 'critical':
+                    $localizedState[] = t('Critical');
+                    break;
+                case 'unknown':
+                    $localizedState[] = t('Unknown');
+                    break;
+            }
+        }
+
+        return $localizedState;
+    }
+
+    private function separateStates(array $states): array
+    {
+        $hostStates = [];
+        $serviceStates = [];
+
+        foreach ($states as $state) {
+            if ($state === 'Up' || $state === 'Down') {
+                $hostStates[] = $state;
+            } else {
+                $serviceStates[] = $state;
+            }
+        }
+
+        return [$hostStates, $serviceStates];
+    }
+}
diff --git a/library/Icingadb/Widget/Detail/UsergroupDetail.php b/library/Icingadb/Widget/Detail/UsergroupDetail.php
new file mode 100644
index 0000000..f2cdebe
--- /dev/null
+++ b/library/Icingadb/Widget/Detail/UsergroupDetail.php
@@ -0,0 +1,98 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\Detail;
+
+use Icinga\Module\Icingadb\Common\Auth;
+use Icinga\Module\Icingadb\Common\Database;
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Hook\ExtensionHook\ObjectDetailExtensionHook;
+use Icinga\Module\Icingadb\Model\Usergroup;
+use Icinga\Module\Icingadb\Widget\EmptyState;
+use Icinga\Module\Icingadb\Widget\ItemList\UserList;
+use Icinga\Module\Icingadb\Widget\ShowMore;
+use ipl\Html\Attributes;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\HtmlElement;
+use ipl\Html\Text;
+use ipl\Web\Widget\HorizontalKeyValue;
+
+class UsergroupDetail extends BaseHtmlElement
+{
+    use Auth;
+    use Database;
+
+    /** @var Usergroup The given user group */
+    protected $usergroup;
+
+    protected $defaultAttributes = ['class' => 'object-detail'];
+
+    protected $tag = 'div';
+
+    public function __construct(Usergroup $usergroup)
+    {
+        $this->usergroup = $usergroup;
+    }
+
+    protected function createPrintHeader()
+    {
+        return [
+            new HtmlElement('h2', null, Text::create(t('Details'))),
+            new HorizontalKeyValue(t('Name'), $this->usergroup->name)
+        ];
+    }
+
+    protected function createCustomVars(): array
+    {
+        $content = [new HtmlElement('h2', null, Text::create(t('Custom Variables')))];
+        $flattenedVars = $this->usergroup->customvar_flat;
+        $this->applyRestrictions($flattenedVars);
+
+        $vars = $this->usergroup->customvar_flat->getModel()->unflattenVars($flattenedVars);
+        if (! empty($vars)) {
+            $content[] = new HtmlElement('div', Attributes::create([
+                'id' => 'usergroup-customvars',
+                'class' => 'collapsible',
+                'data-visible-height' => 200
+            ]), new CustomVarTable($vars, $this->usergroup));
+        } else {
+            $content[] = new EmptyState(t('No custom variables configured.'));
+        }
+
+        return $content;
+    }
+
+    protected function createUserList(): array
+    {
+        $users = $this->usergroup->user->limit(6)->peekAhead()->execute();
+
+        $showMoreLink = (new ShowMore(
+            $users,
+            Links::users()->addParams(['usergroup.name' => $this->usergroup->name])
+        ))->setBaseTarget('_next');
+
+        return [
+            new HtmlElement('h2', null, Text::create(t('Users'))),
+            new UserList($users),
+            $showMoreLink
+        ];
+    }
+
+    protected function createExtensions(): array
+    {
+        return ObjectDetailExtensionHook::loadExtensions($this->usergroup);
+    }
+
+    protected function assemble()
+    {
+        if (getenv('ICINGAWEB_EXPORT_FORMAT') === 'pdf') {
+            $this->add($this->createPrintHeader());
+        }
+
+        $this->add(ObjectDetailExtensionHook::injectExtensions([
+            500 => $this->createUserList(),
+            700 => $this->createCustomVars()
+        ], $this->createExtensions()));
+    }
+}
diff --git a/library/Icingadb/Widget/EmptyState.php b/library/Icingadb/Widget/EmptyState.php
new file mode 100644
index 0000000..4800244
--- /dev/null
+++ b/library/Icingadb/Widget/EmptyState.php
@@ -0,0 +1,27 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget;
+
+use ipl\Html\BaseHtmlElement;
+
+class EmptyState extends BaseHtmlElement
+{
+    /** @var mixed Content */
+    protected $content;
+
+    protected $tag = 'div';
+
+    protected $defaultAttributes = ['class' => 'empty-state'];
+
+    public function __construct($content)
+    {
+        $this->content = $content;
+    }
+
+    protected function assemble()
+    {
+        $this->add($this->content);
+    }
+}
diff --git a/library/Icingadb/Widget/Health.php b/library/Icingadb/Widget/Health.php
new file mode 100644
index 0000000..17cf014
--- /dev/null
+++ b/library/Icingadb/Widget/Health.php
@@ -0,0 +1,66 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget;
+
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\Html;
+use ipl\Web\Widget\TimeAgo;
+use ipl\Web\Widget\TimeSince;
+use ipl\Web\Widget\VerticalKeyValue;
+
+class Health extends BaseHtmlElement
+{
+    protected $data;
+
+    protected $tag = 'section';
+
+    public function __construct($data)
+    {
+        $this->data = $data;
+    }
+
+    protected function assemble()
+    {
+        if ($this->data->heartbeat > time() - 60) {
+            $this->add(Html::tag('div', ['class' => 'icinga-health up'], [
+                Html::sprintf(
+                    t('Icinga 2 is up and running %s', '...since <timespan>'),
+                    new TimeSince($this->data->icinga2_start_time)
+                )
+            ]));
+        } else {
+            $this->add(Html::tag('div', ['class' => 'icinga-health down'], [
+                Html::sprintf(
+                    t('Icinga 2 or Icinga DB is not running %s', '...since <timespan>'),
+                    new TimeSince($this->data->heartbeat)
+                )
+            ]));
+        }
+
+        $icingaInfo = Html::tag('div', ['class' => 'icinga-info'], [
+            new VerticalKeyValue(
+                t('Icinga 2 Version'),
+                $this->data->icinga2_version
+            ),
+            new VerticalKeyValue(
+                t('Icinga 2 Start Time'),
+                new TimeAgo($this->data->icinga2_start_time)
+            ),
+            new VerticalKeyValue(
+                t('Last Heartbeat'),
+                new TimeAgo($this->data->heartbeat)
+            ),
+            new VerticalKeyValue(
+                t('Active Icinga 2 Endpoint'),
+                $this->data->endpoint->name ?: t('N/A')
+            ),
+            new VerticalKeyValue(
+                t('Active Icinga Web Endpoint'),
+                gethostname() ?: t('N/A')
+            )
+        ]);
+        $this->add($icingaInfo);
+    }
+}
diff --git a/library/Icingadb/Widget/HostStateBadges.php b/library/Icingadb/Widget/HostStateBadges.php
new file mode 100644
index 0000000..8141e82
--- /dev/null
+++ b/library/Icingadb/Widget/HostStateBadges.php
@@ -0,0 +1,45 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget;
+
+use Icinga\Module\Icingadb\Common\HostStates;
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Common\StateBadges;
+use ipl\Web\Url;
+
+class HostStateBadges extends StateBadges
+{
+    protected function getBaseUrl(): Url
+    {
+        return Links::hosts();
+    }
+
+    protected function getType(): string
+    {
+        return 'host';
+    }
+
+    protected function getPrefix(): string
+    {
+        return 'hosts';
+    }
+
+    protected function getStateInt(string $state): int
+    {
+        return HostStates::int($state);
+    }
+
+    protected function assemble()
+    {
+        $this->addAttributes(['class' => 'host-state-badges']);
+
+        $this->add(array_filter([
+            $this->createGroup('down'),
+            $this->createBadge('unknown'),
+            $this->createBadge('up'),
+            $this->createBadge('pending')
+        ]));
+    }
+}
diff --git a/library/Icingadb/Widget/HostStatusBar.php b/library/Icingadb/Widget/HostStatusBar.php
new file mode 100644
index 0000000..0014b5e
--- /dev/null
+++ b/library/Icingadb/Widget/HostStatusBar.php
@@ -0,0 +1,21 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget;
+
+use Icinga\Module\Icingadb\Common\BaseStatusBar;
+use ipl\Html\BaseHtmlElement;
+
+class HostStatusBar extends BaseStatusBar
+{
+    protected function assembleTotal(BaseHtmlElement $total)
+    {
+        $total->add(sprintf(tp('%d Host', '%d Hosts', $this->summary->hosts_total), $this->summary->hosts_total));
+    }
+
+    protected function createStateBadges(): BaseHtmlElement
+    {
+        return new HostStateBadges($this->summary);
+    }
+}
diff --git a/library/Icingadb/Widget/HostSummaryDonut.php b/library/Icingadb/Widget/HostSummaryDonut.php
new file mode 100644
index 0000000..19f7984
--- /dev/null
+++ b/library/Icingadb/Widget/HostSummaryDonut.php
@@ -0,0 +1,76 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget;
+
+use Icinga\Chart\Donut;
+use Icinga\Data\Filter\Filter;
+use Icinga\Module\Icingadb\Common\BaseFilter;
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Model\HoststateSummary;
+use ipl\Html\Attributes;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\HtmlElement;
+use ipl\Html\HtmlString;
+use ipl\Html\TemplateString;
+use ipl\Html\Text;
+use ipl\Web\Common\Card;
+use ipl\Web\Filter\QueryString;
+
+class HostSummaryDonut extends Card
+{
+    use BaseFilter;
+
+    protected $defaultAttributes = ['class' => 'donut-container', 'data-base-target' => '_next'];
+
+    /** @var HoststateSummary */
+    protected $summary;
+
+    public function __construct(HoststateSummary $summary)
+    {
+        $this->summary = $summary;
+    }
+
+    protected function assembleBody(BaseHtmlElement $body)
+    {
+        $donut = (new Donut())
+            ->addSlice($this->summary->hosts_up, ['class' => 'slice-state-ok'])
+            ->addSlice($this->summary->hosts_down_handled, ['class' => 'slice-state-critical-handled'])
+            ->addSlice($this->summary->hosts_down_unhandled, ['class' => 'slice-state-critical'])
+            ->addSlice($this->summary->hosts_unreachable_handled, ['class' => 'slice-state-unreachable-handled'])
+            ->addSlice($this->summary->hosts_unreachable_unhandled, ['class' => 'slice-state-unreachable'])
+            ->addSlice($this->summary->hosts_pending, ['class' => 'slice-state-pending'])
+            ->setLabelBig($this->summary->hosts_down_unhandled)
+            ->setLabelBigUrl(Links::hosts()->addFilter(
+                Filter::fromQueryString(QueryString::render($this->getBaseFilter()))
+            )->addParams([
+                'host.state.soft_state' => 1,
+                'host.state.is_handled' => 'n',
+                'sort' => 'host.state.last_state_change'
+            ]))
+            ->setLabelBigEyeCatching($this->summary->hosts_down_unhandled > 0)
+            ->setLabelSmall(t('Down'));
+
+        $body->addHtml(
+            new HtmlElement('div', Attributes::create(['class' => 'donut']), new HtmlString($donut->render()))
+        );
+    }
+
+    protected function assembleFooter(BaseHtmlElement $footer)
+    {
+        $footer->addHtml((new HostStateBadges($this->summary))->setBaseFilter($this->getBaseFilter()));
+    }
+
+    protected function assembleHeader(BaseHtmlElement $header)
+    {
+        $header->addHtml(
+            new HtmlElement('h2', null, Text::create(t('Hosts'))),
+            new HtmlElement('span', Attributes::create(['class' => 'meta']), TemplateString::create(
+                t('{{#total}}Total{{/total}} %d'),
+                ['total' => new HtmlElement('span')],
+                (int) $this->summary->hosts_total
+            ))
+        );
+    }
+}
diff --git a/library/Icingadb/Widget/IconImage.php b/library/Icingadb/Widget/IconImage.php
new file mode 100644
index 0000000..fcf25c8
--- /dev/null
+++ b/library/Icingadb/Widget/IconImage.php
@@ -0,0 +1,74 @@
+<?php
+
+/* Icinga DB Web | (c) 2022 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget;
+
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\HtmlDocument;
+use ipl\Web\Url;
+use ipl\Web\Widget\Icon;
+
+class IconImage extends BaseHtmlElement
+{
+    /** @var string */
+    protected $source;
+
+    /** @var ?string */
+    protected $alt;
+
+    protected $tag = 'img';
+
+    /**
+     * Create a new icon image
+     *
+     * @param string $source
+     * @param ?string $alt The alternative text
+     */
+    public function __construct(string $source, ?string $alt)
+    {
+        $this->source = $source;
+        $this->alt = $alt;
+    }
+
+    public function renderUnwrapped()
+    {
+        if (! $this->getAttributes()->has('src')) {
+            // If it's an icon we don't need the <img> tag
+            return '';
+        }
+
+        return parent::renderUnwrapped();
+    }
+
+    protected function assemble()
+    {
+        $src = $this->source;
+
+        if (strpos($src, '.') === false) {
+            $this->setWrapper((new HtmlDocument())->addHtml(new Icon($src)));
+            return;
+        }
+
+        if (strpos($src, '/') === false) {
+            $src = 'img/icons/' . $src;
+        }
+
+        if (getenv('ICINGAWEB_EXPORT_FORMAT') === 'pdf') {
+            $srcUrl = Url::fromPath($src);
+            $srcPath = $srcUrl->getRelativeUrl();
+            if (! $srcUrl->isExternal() && file_exists($srcPath) && is_file($srcPath)) {
+                $mimeType = @mime_content_type($srcPath);
+                $content = @file_get_contents($srcPath);
+                if ($mimeType !== false && $content !== false) {
+                    $src = "data:$mimeType;base64," . base64_encode($content);
+                }
+            }
+        }
+
+        $this->addAttributes([
+            'src' => $src,
+            'alt' => $this->alt
+        ]);
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/BaseCommentListItem.php b/library/Icingadb/Widget/ItemList/BaseCommentListItem.php
new file mode 100644
index 0000000..5fbd033
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/BaseCommentListItem.php
@@ -0,0 +1,131 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\TicketLinks;
+use ipl\Html\Html;
+use Icinga\Module\Icingadb\Common\HostLink;
+use Icinga\Module\Icingadb\Common\Icons;
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Widget\MarkdownLine;
+use Icinga\Module\Icingadb\Common\NoSubjectLink;
+use Icinga\Module\Icingadb\Common\ObjectLinkDisabled;
+use Icinga\Module\Icingadb\Common\ServiceLink;
+use Icinga\Module\Icingadb\Model\Comment;
+use Icinga\Module\Icingadb\Common\BaseListItem;
+use ipl\Html\FormattedString;
+use ipl\Web\Widget\TimeAgo;
+use ipl\Html\Attributes;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\HtmlElement;
+use ipl\Html\Text;
+use ipl\Stdlib\Filter;
+use ipl\Web\Widget\Icon;
+use ipl\Web\Widget\Link;
+use ipl\Web\Widget\TimeUntil;
+
+/**
+ * Comment item of a comment list. Represents one database row.
+ *
+ * @property Comment $item
+ * @property CommentList $list
+ */
+abstract class BaseCommentListItem extends BaseListItem
+{
+    use HostLink;
+    use ServiceLink;
+    use NoSubjectLink;
+    use ObjectLinkDisabled;
+    use TicketLinks;
+
+    protected function assembleCaption(BaseHtmlElement $caption)
+    {
+        $markdownLine = new MarkdownLine($this->createTicketLinks($this->item->text));
+
+        $caption->getAttributes()->add($markdownLine->getAttributes());
+        $caption->addFrom($markdownLine);
+    }
+
+    protected function assembleTitle(BaseHtmlElement $title)
+    {
+        $isAck = $this->item->entry_type === 'ack';
+        $expires = $this->item->expire_time;
+
+        $subjectText = sprintf(
+            $isAck ? t('%s acknowledged', '<username>..') : t('%s commented', '<username>..'),
+            $this->item->author
+        );
+
+        $headerParts = [
+            new Icon(Icons::USER),
+            $this->getNoSubjectLink()
+                ? new HtmlElement('span', Attributes::create(['class' => 'subject']), Text::create($subjectText))
+                : new Link($subjectText, Links::comment($this->item), ['class' => 'subject'])
+        ];
+
+        if ($isAck) {
+            $label = [Text::create('ack')];
+
+            if ($this->item->is_persistent) {
+                array_unshift($label, new Icon(Icons::IS_PERSISTENT));
+            }
+
+            $headerParts[] = Text::create(' ');
+            $headerParts[] = new HtmlElement('span', Attributes::create(['class' => 'ack-badge badge']), ...$label);
+        }
+
+        if ($expires != 0) {
+            $headerParts[] = Text::create(' ');
+            $headerParts[] = new HtmlElement(
+                'span',
+                Attributes::create(['class' => 'ack-badge badge']),
+                Text::create(t('EXPIRES'))
+            );
+        }
+
+        if ($this->getObjectLinkDisabled()) {
+            // pass
+        } elseif ($this->item->object_type === 'host') {
+            $headerParts[] = $this->createHostLink($this->item->host, true);
+        } else {
+            $headerParts[] = $this->createServiceLink($this->item->service, $this->item->service->host, true);
+        }
+
+        $title->addHtml(...$headerParts);
+    }
+
+    protected function assembleVisual(BaseHtmlElement $visual)
+    {
+        $visual->addHtml(new HtmlElement(
+            'div',
+            Attributes::create(['class' => 'user-ball']),
+            Text::create($this->item->author[0])
+        ));
+    }
+
+    protected function createTimestamp()
+    {
+        if ($this->item->expire_time) {
+            return Html::tag(
+                'span',
+                FormattedString::create(t("expires %s"), new TimeUntil($this->item->expire_time))
+            );
+        }
+
+        return Html::tag(
+            'span',
+            FormattedString::create(t("created %s"), new TimeAgo($this->item->entry_time))
+        );
+    }
+
+    protected function init()
+    {
+        $this->setTicketLinkEnabled($this->list->getTicketLinkEnabled());
+        $this->list->addDetailFilterAttribute($this, Filter::equal('name', $this->item->name));
+        $this->list->addMultiselectFilterAttribute($this, Filter::equal('name', $this->item->name));
+        $this->setObjectLinkDisabled($this->list->getObjectLinkDisabled());
+        $this->setNoSubjectLink($this->list->getNoSubjectLink());
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/BaseDowntimeListItem.php b/library/Icingadb/Widget/ItemList/BaseDowntimeListItem.php
new file mode 100644
index 0000000..04e8e1b
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/BaseDowntimeListItem.php
@@ -0,0 +1,217 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Date\DateFormatter;
+use Icinga\Module\Icingadb\Common\BaseListItem;
+use Icinga\Module\Icingadb\Common\HostLink;
+use Icinga\Module\Icingadb\Common\Icons;
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Common\NoSubjectLink;
+use Icinga\Module\Icingadb\Common\ObjectLinkDisabled;
+use Icinga\Module\Icingadb\Common\ServiceLink;
+use Icinga\Module\Icingadb\Common\TicketLinks;
+use Icinga\Module\Icingadb\Model\Downtime;
+use Icinga\Module\Icingadb\Widget\MarkdownLine;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\Html;
+use ipl\Html\HtmlElement;
+use ipl\Html\TemplateString;
+use ipl\Html\Text;
+use ipl\Stdlib\Filter;
+use ipl\Web\Widget\Icon;
+use ipl\Web\Widget\Link;
+
+/**
+ * Downtime item of a downtime list. Represents one database row.
+ *
+ * @property Downtime $item
+ * @property DowntimeList $list
+ */
+abstract class BaseDowntimeListItem extends BaseListItem
+{
+    use HostLink;
+    use ServiceLink;
+    use NoSubjectLink;
+    use ObjectLinkDisabled;
+    use TicketLinks;
+
+    /** @var int Current Time */
+    protected $currentTime;
+
+    /** @var int Duration */
+    protected $duration;
+
+    /** @var int Downtime end time */
+    protected $endTime;
+
+    /** @var bool Whether the downtime is active */
+    protected $isActive;
+
+    /** @var int Downtime start time */
+    protected $startTime;
+
+    protected function init()
+    {
+        if ($this->item->is_flexible && $this->item->is_in_effect) {
+            $this->startTime = $this->item->start_time;
+            $this->endTime = $this->item->end_time;
+        } else {
+            $this->startTime = $this->item->scheduled_start_time;
+            $this->endTime = $this->item->scheduled_end_time;
+        }
+
+        $this->currentTime = time();
+
+        $this->isActive = $this->item->is_in_effect
+            || $this->item->is_flexible && $this->item->scheduled_start_time <= $this->currentTime;
+
+        $until = ($this->isActive ? $this->endTime : $this->startTime) - $this->currentTime;
+        $this->duration = explode(' ', DateFormatter::formatDuration(
+            $until <= 3600 ? $until : $until + (3600 - ((int) $until % 3600))
+        ), 2)[0];
+
+        $this->list->addDetailFilterAttribute($this, Filter::equal('name', $this->item->name));
+        $this->list->addMultiselectFilterAttribute($this, Filter::equal('name', $this->item->name));
+        $this->setObjectLinkDisabled($this->list->getObjectLinkDisabled());
+        $this->setNoSubjectLink($this->list->getNoSubjectLink());
+        $this->setTicketLinkEnabled($this->list->getTicketLinkEnabled());
+
+        if ($this->item->is_in_effect) {
+            $this->getAttributes()->add('class', 'in-effect');
+        }
+    }
+
+    protected function createProgress(): BaseHtmlElement
+    {
+        $ref = floor(
+            (float) ($this->currentTime - $this->startTime)
+            / (float) ($this->endTime - $this->startTime)
+            * 100
+        );
+
+        $progress = Html::tag(
+            'div',
+            ['class' => 'progress'],
+            Html::tag(
+                'div',
+                [
+                    'class' => 'progress-bar',
+                    'style' => sprintf('width: %F%%', $ref)
+                ]
+            )
+        );
+
+        return $progress;
+    }
+
+    protected function assembleCaption(BaseHtmlElement $caption)
+    {
+        $markdownLine = new MarkdownLine($this->createTicketLinks($this->item->comment));
+        $caption->getAttributes()->add($markdownLine->getAttributes());
+        $caption->addHtml(
+            new HtmlElement(
+                'span',
+                null,
+                new Icon(Icons::USER),
+                Text::create($this->item->author)
+            ),
+            Text::create(': ')
+        )->addFrom($markdownLine);
+    }
+
+    protected function assembleTitle(BaseHtmlElement $title)
+    {
+        if ($this->getObjectLinkDisabled()) {
+            $link = null;
+        } elseif ($this->item->object_type === 'host') {
+            $link = $this->createHostLink($this->item->host, true);
+        } else {
+            $link = $this->createServiceLink($this->item->service, $this->item->service->host, true);
+        }
+
+        if ($this->item->is_flexible) {
+            if ($link !== null) {
+                $template = t('{{#link}}Flexible Downtime{{/link}} for %s');
+            } else {
+                $template = t('Flexible Downtime');
+            }
+        } else {
+            if ($link !== null) {
+                $template = t('{{#link}}Fixed Downtime{{/link}} for %s');
+            } else {
+                $template = t('Fixed Downtime');
+            }
+        }
+
+        if ($this->getNoSubjectLink()) {
+            if ($link === null) {
+                $title->addHtml(HtmlElement::create('span', [ 'class' => 'subject'], $template));
+            } else {
+                $title->addHtml(TemplateString::create(
+                    $template,
+                    ['link' => HtmlElement::create('span', [ 'class' => 'subject'])],
+                    $link
+                ));
+            }
+        } else {
+            if ($link === null) {
+                $title->addHtml(new Link($template, Links::downtime($this->item)));
+            } else {
+                $title->addHtml(TemplateString::create(
+                    $template,
+                    ['link' => new Link('', Links::downtime($this->item))],
+                    $link
+                ));
+            }
+        }
+    }
+
+    protected function assembleVisual(BaseHtmlElement $visual)
+    {
+        $dateTime = DateFormatter::formatDateTime($this->endTime);
+
+        if ($this->isActive) {
+            $visual->addHtml(Html::sprintf(
+                t('%s left', '<timespan>..'),
+                Html::tag(
+                    'strong',
+                    Html::tag(
+                        'time',
+                        [
+                            'datetime' => $dateTime,
+                            'title'    => $dateTime
+                        ],
+                        $this->duration
+                    )
+                )
+            ));
+        } else {
+            $visual->addHtml(Html::sprintf(
+                t('in %s', '..<timespan>'),
+                Html::tag('strong', $this->duration)
+            ));
+        }
+    }
+
+    protected function createTimestamp()
+    {
+        $dateTime = DateFormatter::formatDateTime($this->endTime);
+
+        return Html::tag(
+            'time',
+            [
+                'datetime' => $dateTime,
+                'title'    => $dateTime
+            ],
+            sprintf(
+                $this->isActive
+                   ? t('expires in %s', '..<timespan>')
+                   : t('starts in %s', '..<timespan>'),
+                $this->duration
+            )
+        );
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/BaseHistoryListItem.php b/library/Icingadb/Widget/ItemList/BaseHistoryListItem.php
new file mode 100644
index 0000000..f7408d7
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/BaseHistoryListItem.php
@@ -0,0 +1,404 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Date\DateFormatter;
+use Icinga\Module\Icingadb\Common\HostLink;
+use Icinga\Module\Icingadb\Common\HostStates;
+use Icinga\Module\Icingadb\Common\Icons;
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Common\TicketLinks;
+use Icinga\Module\Icingadb\Widget\EmptyState;
+use Icinga\Module\Icingadb\Widget\MarkdownLine;
+use Icinga\Module\Icingadb\Common\NoSubjectLink;
+use Icinga\Module\Icingadb\Common\ServiceLink;
+use Icinga\Module\Icingadb\Common\ServiceStates;
+use Icinga\Module\Icingadb\Model\History;
+use Icinga\Module\Icingadb\Util\PluginOutput;
+use Icinga\Module\Icingadb\Common\BaseListItem;
+use Icinga\Module\Icingadb\Widget\CheckAttempt;
+use Icinga\Module\Icingadb\Widget\PluginOutputContainer;
+use Icinga\Module\Icingadb\Widget\StateChange;
+use ipl\Stdlib\Filter;
+use ipl\Web\Widget\StateBall;
+use ipl\Web\Widget\TimeAgo;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\HtmlElement;
+use ipl\Html\Text;
+use ipl\Web\Widget\Icon;
+use ipl\Web\Widget\Link;
+
+abstract class BaseHistoryListItem extends BaseListItem
+{
+    use HostLink;
+    use NoSubjectLink;
+    use ServiceLink;
+    use TicketLinks;
+
+    /** @var History */
+    protected $item;
+
+    /** @var HistoryList */
+    protected $list;
+
+    protected function init()
+    {
+        $this->setNoSubjectLink($this->list->getNoSubjectLink());
+        $this->setTicketLinkEnabled($this->list->getTicketLinkEnabled());
+        $this->list->addDetailFilterAttribute($this, Filter::equal('id', bin2hex($this->item->id)));
+    }
+
+    abstract protected function getStateBallSize(): string;
+
+    protected function assembleCaption(BaseHtmlElement $caption)
+    {
+        switch ($this->item->event_type) {
+            case 'comment_add':
+            case 'comment_remove':
+                $markdownLine = new MarkdownLine($this->createTicketLinks($this->item->comment->comment));
+                $caption->getAttributes()->add($markdownLine->getAttributes());
+                $caption->add([
+                    new Icon(Icons::USER),
+                    $this->item->comment->author,
+                    ': '
+                ])->addFrom($markdownLine);
+
+                break;
+            case 'downtime_end':
+            case 'downtime_start':
+                $markdownLine = new MarkdownLine($this->createTicketLinks($this->item->downtime->comment));
+                $caption->getAttributes()->add($markdownLine->getAttributes());
+                $caption->add([
+                    new Icon(Icons::USER),
+                    $this->item->downtime->author,
+                    ': '
+                ])->addFrom($markdownLine);
+
+                break;
+            case 'flapping_start':
+                $caption
+                    ->add(sprintf(
+                        t('State Change Rate: %.2f%%; Start Threshold: %.2f%%'),
+                        $this->item->flapping->percent_state_change_start,
+                        $this->item->flapping->flapping_threshold_high
+                    ))
+                    ->getAttributes()
+                    ->add('class', 'plugin-output');
+
+                break;
+            case 'flapping_end':
+                $caption
+                    ->add(sprintf(
+                        t('State Change Rate: %.2f%%; End Threshold: %.2f%%; Flapping for %s'),
+                        $this->item->flapping->percent_state_change_end,
+                        $this->item->flapping->flapping_threshold_low,
+                        DateFormatter::formatDuration(
+                            $this->item->flapping->end_time - $this->item->flapping->start_time
+                        )
+                    ))
+                    ->getAttributes()
+                    ->add('class', 'plugin-output');
+
+                break;
+            case 'ack_clear':
+            case 'ack_set':
+                if (! isset($this->item->acknowledgement->comment) && ! isset($this->item->acknowledgement->author)) {
+                    $caption->addHtml(new EmptyState(
+                        t('This acknowledgement was set before Icinga DB history recording')
+                    ));
+                } else {
+                    $markdownLine = new MarkdownLine($this->createTicketLinks($this->item->acknowledgement->comment));
+                    $caption->getAttributes()->add($markdownLine->getAttributes());
+                    $caption->add([
+                        new Icon(Icons::USER),
+                        $this->item->acknowledgement->author,
+                        ': '
+                    ])->addFrom($markdownLine);
+                }
+
+                break;
+            case 'notification':
+                if (! empty($this->item->notification->author)) {
+                    $caption->add([
+                        new Icon(Icons::USER),
+                        $this->item->notification->author,
+                        ': ',
+                        $this->item->notification->text
+                    ]);
+                } else {
+                    $commandName = $this->item->object_type === 'host'
+                        ? $this->item->host->checkcommand_name
+                        : $this->item->service->checkcommand_name;
+                    if (isset($commandName)) {
+                        if (empty($this->item->notification->text)) {
+                            $caption->addHtml(new EmptyState(t('Output unavailable.')));
+                        } else {
+                            $caption->addHtml(new PluginOutputContainer(
+                                (new PluginOutput($this->item->notification->text))
+                                    ->setCommandName($commandName)
+                            ));
+                        }
+                    } else {
+                        $caption->addHtml(new EmptyState(t('Waiting for Icinga DB to synchronize the config.')));
+                    }
+                }
+
+                break;
+            case 'state_change':
+                $commandName = $this->item->object_type === 'host'
+                    ? $this->item->host->checkcommand_name
+                    : $this->item->service->checkcommand_name;
+                if (isset($commandName)) {
+                    if (empty($this->item->state->output)) {
+                        $caption->addHtml(new EmptyState(t('Output unavailable.')));
+                    } else {
+                        $caption->addHtml(new PluginOutputContainer(
+                            (new PluginOutput($this->item->state->output))
+                                ->setCommandName($commandName)
+                        ));
+                    }
+                } else {
+                    $caption->addHtml(new EmptyState(t('Waiting for Icinga DB to synchronize the config.')));
+                }
+
+                break;
+        }
+    }
+
+    protected function assembleVisual(BaseHtmlElement $visual)
+    {
+        switch ($this->item->event_type) {
+            case 'comment_add':
+                $visual->addHtml(HtmlElement::create(
+                    'div',
+                    ['class' => ['icon-ball', 'ball-size-' . $this->getStateBallSize()]],
+                    new Icon(Icons::COMMENT)
+                ));
+
+                break;
+            case 'comment_remove':
+            case 'downtime_end':
+            case 'ack_clear':
+                $visual->addHtml(HtmlElement::create(
+                    'div',
+                    ['class' => ['icon-ball', 'ball-size-' . $this->getStateBallSize()]],
+                    new Icon(Icons::REMOVE)
+                ));
+
+                break;
+            case 'downtime_start':
+                $visual->addHtml(HtmlElement::create(
+                    'div',
+                    ['class' => ['icon-ball', 'ball-size-' . $this->getStateBallSize()]],
+                    new Icon(Icons::IN_DOWNTIME)
+                ));
+
+                break;
+            case 'ack_set':
+                $visual->addHtml(HtmlElement::create(
+                    'div',
+                    ['class' => ['icon-ball', 'ball-size-' . $this->getStateBallSize()]],
+                    new Icon(Icons::IS_ACKNOWLEDGED)
+                ));
+
+                break;
+            case 'flapping_end':
+            case 'flapping_start':
+                $visual->addHtml(HtmlElement::create(
+                    'div',
+                    ['class' => ['icon-ball', 'ball-size-' . $this->getStateBallSize()]],
+                    new Icon(Icons::IS_FLAPPING)
+                ));
+
+                break;
+            case 'notification':
+                $visual->addHtml(HtmlElement::create(
+                    'div',
+                    ['class' => ['icon-ball', 'ball-size-' . $this->getStateBallSize()]],
+                    new Icon(Icons::NOTIFICATION)
+                ));
+
+                break;
+            case 'state_change':
+                if ($this->item->state->state_type === 'soft') {
+                    $stateType = 'soft_state';
+                    $previousStateType = 'previous_soft_state';
+
+                    if ($this->item->state->previous_soft_state === 0) {
+                        $previousStateType = 'hard_state';
+                    }
+
+                    $visual->addHtml(new CheckAttempt(
+                        (int) $this->item->state->check_attempt,
+                        (int) $this->item->state->max_check_attempts
+                    ));
+                } else {
+                    $stateType = 'hard_state';
+                    $previousStateType = 'previous_hard_state';
+
+                    if ($this->item->state->hard_state === $this->item->state->previous_hard_state) {
+                        $previousStateType = 'previous_soft_state';
+                    }
+                }
+
+                if ($this->item->object_type === 'host') {
+                    $state = HostStates::text($this->item->state->$stateType);
+                    $previousState = HostStates::text($this->item->state->$previousStateType);
+                } else {
+                    $state = ServiceStates::text($this->item->state->$stateType);
+                    $previousState = ServiceStates::text($this->item->state->$previousStateType);
+                }
+
+                $stateChange = new StateChange($state, $previousState);
+                if ($stateType === 'soft_state') {
+                    $stateChange->setCurrentStateBallSize(StateBall::SIZE_MEDIUM_LARGE);
+                }
+
+                if ($previousStateType === 'previous_soft_state') {
+                    $stateChange->setPreviousStateBallSize(StateBall::SIZE_MEDIUM_LARGE);
+                    if ($stateType === 'soft_state') {
+                        $visual->getAttributes()->add('class', 'small-state-change');
+                    }
+                }
+
+                $visual->prependHtml($stateChange);
+
+                break;
+        }
+    }
+
+    protected function assembleTitle(BaseHtmlElement $title)
+    {
+        switch ($this->item->event_type) {
+            case 'comment_add':
+                $subjectLabel = t('Comment added');
+
+                break;
+            case 'comment_remove':
+                if (! empty($this->item->comment->removed_by)) {
+                    if ($this->item->comment->removed_by !== $this->item->comment->author) {
+                        $subjectLabel = sprintf(
+                            t('Comment removed by %s', '..<username>'),
+                            $this->item->comment->removed_by
+                        );
+                    } else {
+                        $subjectLabel = t('Comment removed by author');
+                    }
+                } elseif (isset($this->item->comment->expire_time)) {
+                    $subjectLabel = t('Comment expired');
+                } else {
+                    $subjectLabel = t('Comment removed');
+                }
+
+                break;
+            case 'downtime_end':
+                if (! empty($this->item->downtime->cancelled_by)) {
+                    if ($this->item->downtime->cancelled_by !== $this->item->downtime->author) {
+                        $subjectLabel = sprintf(
+                            t('Downtime cancelled by %s', '..<username>'),
+                            $this->item->downtime->cancelled_by
+                        );
+                    } else {
+                        $subjectLabel = t('Downtime cancelled by author');
+                    }
+                } elseif (isset($this->item->downtime->cancel_time)) {
+                    $subjectLabel = t('Downtime cancelled');
+                } else {
+                    $subjectLabel = t('Downtime ended');
+                }
+
+                break;
+            case 'downtime_start':
+                $subjectLabel = t('Downtime started');
+
+                break;
+            case 'flapping_start':
+                $subjectLabel = t('Flapping started');
+
+                break;
+            case 'flapping_end':
+                $subjectLabel = t('Flapping stopped');
+
+                break;
+            case 'ack_set':
+                $subjectLabel = t('Acknowledgement set');
+
+                break;
+            case 'ack_clear':
+                if (! empty($this->item->acknowledgement->cleared_by)) {
+                    if ($this->item->acknowledgement->cleared_by !== $this->item->acknowledgement->author) {
+                        $subjectLabel = sprintf(
+                            t('Acknowledgement cleared by %s', '..<username>'),
+                            $this->item->acknowledgement->cleared_by
+                        );
+                    } else {
+                        $subjectLabel = t('Acknowledgement cleared by author');
+                    }
+                } elseif (isset($this->item->acknowledgement->expire_time)) {
+                    $subjectLabel = t('Acknowledgement expired');
+                } else {
+                    $subjectLabel = t('Acknowledgement cleared');
+                }
+
+                break;
+            case 'notification':
+                $subjectLabel = sprintf(
+                    NotificationListItem::phraseForType($this->item->notification->type),
+                    ucfirst($this->item->object_type)
+                );
+
+                break;
+            case 'state_change':
+                $state = $this->item->state === 'hard'
+                    ? $this->item->state->hard_state
+                    : $this->item->state->soft_state;
+                if ($state === 0) {
+                    if ($this->item->object_type === 'service') {
+                        $subjectLabel = t('Service recovered');
+                    } else {
+                        $subjectLabel = t('Host recovered');
+                    }
+                } else {
+                    if ($this->item->state->state_type === 'hard') {
+                        $subjectLabel = t('Hard state changed');
+                    } else {
+                        $subjectLabel = t('Soft state changed');
+                    }
+                }
+
+                break;
+            default:
+                $subjectLabel = $this->item->event_type;
+
+                break;
+        }
+
+        if ($this->getNoSubjectLink()) {
+            $title->addHtml(HtmlElement::create('span', ['class' => 'subject'], $subjectLabel));
+        } else {
+            $title->addHtml(new Link($subjectLabel, Links::event($this->item), ['class' => 'subject']));
+        }
+
+        if ($this->item->object_type === 'host') {
+            if (isset($this->item->host->id)) {
+                $link = $this->createHostLink($this->item->host, true);
+            }
+        } else {
+            if (isset($this->item->host->id, $this->item->service->id)) {
+                $link = $this->createServiceLink($this->item->service, $this->item->host, true);
+            }
+        }
+
+        $title->addHtml(Text::create(' '));
+        if (isset($link)) {
+            $title->addHtml($link);
+        }
+    }
+
+    protected function createTimestamp()
+    {
+        return new TimeAgo($this->item->event_time);
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/BaseHostListItem.php b/library/Icingadb/Widget/ItemList/BaseHostListItem.php
new file mode 100644
index 0000000..99a8c63
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/BaseHostListItem.php
@@ -0,0 +1,56 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Common\NoSubjectLink;
+use Icinga\Module\Icingadb\Model\Host;
+use ipl\Html\Attributes;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\HtmlElement;
+use ipl\Html\Text;
+use ipl\Stdlib\Filter;
+use ipl\Web\Widget\Link;
+
+/**
+ * Host item of a host list. Represents one database row.
+ *
+ * @property Host $item
+ * @property HostList $list
+ */
+abstract class BaseHostListItem extends StateListItem
+{
+    use NoSubjectLink;
+
+    /**
+     * Create new subject link
+     *
+     * @return BaseHtmlElement
+     */
+    protected function createSubject()
+    {
+        if ($this->getNoSubjectLink()) {
+            return new HtmlElement(
+                'span',
+                Attributes::create(['class' => 'subject']),
+                Text::create($this->item->display_name)
+            );
+        } else {
+            return new Link($this->item->display_name, Links::host($this->item), ['class' => 'subject']);
+        }
+    }
+
+    protected function init()
+    {
+        parent::init();
+
+        if ($this->list->getNoSubjectLink()) {
+            $this->setNoSubjectLink();
+        }
+
+        $this->list->addDetailFilterAttribute($this, Filter::equal('name', $this->item->name))
+            ->addMultiselectFilterAttribute($this, Filter::equal('host.name', $this->item->name));
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/BaseNotificationListItem.php b/library/Icingadb/Widget/ItemList/BaseNotificationListItem.php
new file mode 100644
index 0000000..962fe3e
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/BaseNotificationListItem.php
@@ -0,0 +1,189 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\HostLink;
+use Icinga\Module\Icingadb\Common\HostStates;
+use Icinga\Module\Icingadb\Common\Icons;
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Common\NoSubjectLink;
+use Icinga\Module\Icingadb\Common\ServiceLink;
+use Icinga\Module\Icingadb\Common\ServiceStates;
+use Icinga\Module\Icingadb\Util\PluginOutput;
+use Icinga\Module\Icingadb\Common\BaseListItem;
+use Icinga\Module\Icingadb\Widget\EmptyState;
+use Icinga\Module\Icingadb\Widget\PluginOutputContainer;
+use Icinga\Module\Icingadb\Widget\StateChange;
+use ipl\Stdlib\Filter;
+use ipl\Web\Widget\TimeAgo;
+use InvalidArgumentException;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\HtmlElement;
+use ipl\Html\Text;
+use ipl\Web\Widget\Icon;
+use ipl\Web\Widget\Link;
+
+abstract class BaseNotificationListItem extends BaseListItem
+{
+    use HostLink;
+    use NoSubjectLink;
+    use ServiceLink;
+
+    /** @var NotificationList */
+    protected $list;
+
+    protected function init()
+    {
+        $this->setNoSubjectLink($this->list->getNoSubjectLink());
+        $this->list->addDetailFilterAttribute($this, Filter::equal('id', bin2hex($this->item->history->id)));
+    }
+
+    /**
+     * Get a localized phrase for the given notification type
+     *
+     * @param string $type
+     *
+     * @return string
+     */
+    public static function phraseForType(string $type): string
+    {
+        switch ($type) {
+            case 'acknowledgement':
+                return t('Problem acknowledged');
+            case 'custom':
+                return t('Custom Notification triggered');
+            case 'downtime_end':
+                return t('Downtime ended');
+            case 'downtime_removed':
+                return t('Downtime removed');
+            case 'downtime_start':
+                return t('Downtime started');
+            case 'flapping_end':
+                return t('Flapping stopped');
+            case 'flapping_start':
+                return t('Flapping started');
+            case 'problem':
+                return t('%s ran into a problem');
+            case 'recovery':
+                return t('%s recovered');
+            default:
+                throw new InvalidArgumentException(sprintf('Type %s is not a valid notification type', $type));
+        }
+    }
+
+    abstract protected function getStateBallSize();
+
+    protected function assembleCaption(BaseHtmlElement $caption)
+    {
+        if (in_array($this->item->type, ['flapping_end', 'flapping_start', 'problem', 'recovery'])) {
+            $commandName = $this->item->object_type === 'host'
+                ? $this->item->host->checkcommand_name
+                : $this->item->service->checkcommand_name;
+            if (isset($commandName)) {
+                if (empty($this->item->text)) {
+                    $caption->addHtml(new EmptyState(t('Output unavailable.')));
+                } else {
+                    $caption->addHtml(new PluginOutputContainer(
+                        (new PluginOutput($this->item->text))
+                            ->setCommandName($commandName)
+                    ));
+                }
+            } else {
+                $caption->addHtml(new EmptyState(t('Waiting for Icinga DB to synchronize the config.')));
+            }
+        } else {
+            $caption->add([
+                new Icon(Icons::USER),
+                $this->item->author,
+                ': ',
+                $this->item->text
+            ]);
+        }
+    }
+
+    protected function assembleVisual(BaseHtmlElement $visual)
+    {
+        switch ($this->item->type) {
+            case 'acknowledgement':
+                $visual->addHtml(HtmlElement::create(
+                    'div',
+                    ['class' => ['icon-ball', 'ball-size-' . $this->getStateBallSize()]],
+                    new Icon(Icons::IS_ACKNOWLEDGED)
+                ));
+
+                break;
+            case 'custom':
+                $visual->addHtml(HtmlElement::create(
+                    'div',
+                    ['class' => ['icon-ball', 'ball-size-' . $this->getStateBallSize()]],
+                    new Icon(Icons::NOTIFICATION)
+                ));
+
+                break;
+            case 'downtime_end':
+            case 'downtime_removed':
+            case 'downtime_start':
+                $visual->addHtml(HtmlElement::create(
+                    'div',
+                    ['class' => ['icon-ball', 'ball-size-' . $this->getStateBallSize()]],
+                    new Icon(Icons::IN_DOWNTIME)
+                ));
+
+                break;
+            case 'flapping_end':
+            case 'flapping_start':
+                $visual->addHtml(HtmlElement::create(
+                    'div',
+                    ['class' => ['icon-ball', 'ball-size-' . $this->getStateBallSize()]],
+                    new Icon(Icons::IS_FLAPPING)
+                ));
+
+                break;
+            case 'problem':
+            case 'recovery':
+                if ($this->item->object_type === 'host') {
+                    $state = HostStates::text($this->item->state);
+                    $previousHardState = HostStates::text($this->item->previous_hard_state);
+                } else {
+                    $state = ServiceStates::text($this->item->state);
+                    $previousHardState = ServiceStates::text($this->item->previous_hard_state);
+                }
+
+                $visual->addHtml(new StateChange($state, $previousHardState));
+
+                break;
+        }
+    }
+
+    protected function assembleTitle(BaseHtmlElement $title)
+    {
+        if ($this->getNoSubjectLink()) {
+            $title->addHtml(HtmlElement::create(
+                'span',
+                ['class' => 'subject'],
+                sprintf(self::phraseForType($this->item->type), ucfirst($this->item->object_type))
+            ));
+        } else {
+            $title->addHtml(new Link(
+                sprintf(self::phraseForType($this->item->type), ucfirst($this->item->object_type)),
+                Links::event($this->item->history),
+                ['class' => 'subject']
+            ));
+        }
+
+        if ($this->item->object_type === 'host') {
+            $link = $this->createHostLink($this->item->host, true);
+        } else {
+            $link = $this->createServiceLink($this->item->service, $this->item->host, true);
+        }
+
+        $title->addHtml(Text::create(' '), $link);
+    }
+
+    protected function createTimestamp()
+    {
+        return new TimeAgo($this->item->send_time);
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/BaseServiceListItem.php b/library/Icingadb/Widget/ItemList/BaseServiceListItem.php
new file mode 100644
index 0000000..208e496
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/BaseServiceListItem.php
@@ -0,0 +1,70 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Common\NoSubjectLink;
+use Icinga\Module\Icingadb\Model\Service;
+use ipl\Html\Attributes;
+use ipl\Html\Html;
+use ipl\Html\HtmlElement;
+use ipl\Html\Text;
+use ipl\Stdlib\Filter;
+use ipl\Web\Widget\Link;
+use ipl\Web\Widget\StateBall;
+
+/**
+ * Service item of a service list. Represents one database row.
+ *
+ * @property Service $item
+ * @property ServiceList $list
+ */
+abstract class BaseServiceListItem extends StateListItem
+{
+    use NoSubjectLink;
+
+    protected function createSubject()
+    {
+        $service = $this->item->display_name;
+        $host = [
+            new StateBall($this->item->host->state->getStateText(), StateBall::SIZE_MEDIUM),
+            ' ',
+            $this->item->host->display_name
+        ];
+
+        $host = new Link($host, Links::host($this->item->host), ['class' => 'subject']);
+        if ($this->getNoSubjectLink()) {
+            $service = new HtmlElement('span', Attributes::create(['class' => 'subject']), Text::create($service));
+        } else {
+            $service = new Link($service, Links::service($this->item, $this->item->host), ['class' => 'subject']);
+        }
+
+        return [Html::sprintf(t('%s on %s', '<service> on <host>'), $service, $host)];
+    }
+
+    protected function init()
+    {
+        parent::init();
+
+        if ($this->list->getNoSubjectLink()) {
+            $this->setNoSubjectLink();
+        }
+
+        $this->list->addMultiselectFilterAttribute(
+            $this,
+            Filter::all(
+                Filter::equal('service.name', $this->item->name),
+                Filter::equal('host.name', $this->item->host->name)
+            )
+        );
+        $this->list->addDetailFilterAttribute(
+            $this,
+            Filter::all(
+                Filter::equal('name', $this->item->name),
+                Filter::equal('host.name', $this->item->host->name)
+            )
+        );
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/CommandTransportList.php b/library/Icingadb/Widget/ItemList/CommandTransportList.php
new file mode 100644
index 0000000..50ae06d
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/CommandTransportList.php
@@ -0,0 +1,22 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\BaseOrderedItemList;
+use ipl\Web\Url;
+
+class CommandTransportList extends BaseOrderedItemList
+{
+    protected function init()
+    {
+        $this->getAttributes()->add('class', 'command-transport-list');
+        $this->setDetailUrl(Url::fromPath('icingadb/command-transport/show'));
+    }
+
+    protected function getItemClass(): string
+    {
+        return CommandTransportListItem::class;
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/CommandTransportListItem.php b/library/Icingadb/Widget/ItemList/CommandTransportListItem.php
new file mode 100644
index 0000000..c15e1bc
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/CommandTransportListItem.php
@@ -0,0 +1,70 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\BaseOrderedListItem;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\HtmlElement;
+use ipl\Html\Text;
+use ipl\Stdlib\Filter;
+use ipl\Web\Url;
+use ipl\Web\Widget\Icon;
+use ipl\Web\Widget\Link;
+
+class CommandTransportListItem extends BaseOrderedListItem
+{
+    protected function init()
+    {
+        $this->list->addDetailFilterAttribute($this, Filter::equal('name', $this->item->name));
+    }
+
+    protected function assembleHeader(BaseHtmlElement $header)
+    {
+    }
+
+    protected function assembleMain(BaseHtmlElement $main)
+    {
+        $main->addHtml(new Link(
+            new HtmlElement('strong', null, Text::create($this->item->name)),
+            Url::fromPath('icingadb/command-transport/show', ['name' => $this->item->name])
+        ));
+
+        $main->addHtml(new Link(
+            new Icon('trash', ['title' => sprintf(t('Remove command transport "%s"'), $this->item->name)]),
+            Url::fromPath('icingadb/command-transport/remove', ['name' => $this->item->name]),
+            [
+                'class' => 'pull-right action-link',
+                'data-icinga-modal' => true,
+                'data-no-icinga-ajax' => true
+            ]
+        ));
+
+        if ($this->getOrder() + 1 < $this->list->count()) {
+            $main->addHtml((new Link(
+                new Icon('arrow-down'),
+                Url::fromPath('icingadb/command-transport/sort', [
+                    'name'  => $this->item->name,
+                    'pos'   => $this->getOrder() + 1
+                ]),
+                ['class' => 'pull-right action-link']
+            ))->setBaseTarget('_self'));
+        }
+
+        if ($this->getOrder() > 0) {
+            $main->addHtml((new Link(
+                new Icon('arrow-up'),
+                Url::fromPath('icingadb/command-transport/sort', [
+                    'name'  => $this->item->name,
+                    'pos'   => $this->getOrder() - 1
+                ]),
+                ['class' => 'pull-right action-link']
+            ))->setBaseTarget('_self'));
+        }
+    }
+
+    protected function createVisual()
+    {
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/CommentList.php b/library/Icingadb/Widget/ItemList/CommentList.php
new file mode 100644
index 0000000..db164ff
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/CommentList.php
@@ -0,0 +1,44 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\CaptionDisabled;
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Common\NoSubjectLink;
+use Icinga\Module\Icingadb\Common\ObjectLinkDisabled;
+use Icinga\Module\Icingadb\Common\TicketLinks;
+use Icinga\Module\Icingadb\Common\ViewMode;
+use Icinga\Module\Icingadb\Common\BaseItemList;
+use ipl\Web\Url;
+
+class CommentList extends BaseItemList
+{
+    use CaptionDisabled;
+    use NoSubjectLink;
+    use ObjectLinkDisabled;
+    use ViewMode;
+    use TicketLinks;
+
+    protected $defaultAttributes = ['class' => 'comment-list'];
+
+    protected function getItemClass(): string
+    {
+        $viewMode = $this->getViewMode();
+
+        $this->addAttributes(['class' => $viewMode]);
+
+        if ($viewMode === 'minimal') {
+            return CommentListItemMinimal::class;
+        }
+
+        return CommentListItem::class;
+    }
+
+    protected function init()
+    {
+        $this->setMultiselectUrl(Links::commentsDetails());
+        $this->setDetailUrl(Url::fromPath('icingadb/comment'));
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/CommentListItem.php b/library/Icingadb/Widget/ItemList/CommentListItem.php
new file mode 100644
index 0000000..3bbd0c2
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/CommentListItem.php
@@ -0,0 +1,12 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\ListItemCommonLayout;
+
+class CommentListItem extends BaseCommentListItem
+{
+    use ListItemCommonLayout;
+}
diff --git a/library/Icingadb/Widget/ItemList/CommentListItemMinimal.php b/library/Icingadb/Widget/ItemList/CommentListItemMinimal.php
new file mode 100644
index 0000000..fc204b3
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/CommentListItemMinimal.php
@@ -0,0 +1,21 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\ListItemMinimalLayout;
+
+class CommentListItemMinimal extends BaseCommentListItem
+{
+    use ListItemMinimalLayout;
+
+    protected function init()
+    {
+        parent::init();
+
+        if ($this->list->isCaptionDisabled()) {
+            $this->setCaptionDisabled();
+        }
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/DowntimeList.php b/library/Icingadb/Widget/ItemList/DowntimeList.php
new file mode 100644
index 0000000..964fd20
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/DowntimeList.php
@@ -0,0 +1,44 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\BaseItemList;
+use Icinga\Module\Icingadb\Common\CaptionDisabled;
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Common\NoSubjectLink;
+use Icinga\Module\Icingadb\Common\ObjectLinkDisabled;
+use Icinga\Module\Icingadb\Common\TicketLinks;
+use Icinga\Module\Icingadb\Common\ViewMode;
+use ipl\Web\Url;
+
+class DowntimeList extends BaseItemList
+{
+    use CaptionDisabled;
+    use NoSubjectLink;
+    use ObjectLinkDisabled;
+    use ViewMode;
+    use TicketLinks;
+
+    protected $defaultAttributes = ['class' => 'downtime-list'];
+
+    protected function getItemClass(): string
+    {
+        $viewMode = $this->getViewMode();
+
+        $this->addAttributes(['class' => $viewMode]);
+
+        if ($viewMode === 'minimal') {
+            return DowntimeListItemMinimal::class;
+        }
+
+        return DowntimeListItem::class;
+    }
+
+    protected function init()
+    {
+        $this->setMultiselectUrl(Links::downtimesDetails());
+        $this->setDetailUrl(Url::fromPath('icingadb/downtime'));
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/DowntimeListItem.php b/library/Icingadb/Widget/ItemList/DowntimeListItem.php
new file mode 100644
index 0000000..0a00986
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/DowntimeListItem.php
@@ -0,0 +1,23 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\ListItemCommonLayout;
+use ipl\Html\BaseHtmlElement;
+
+class DowntimeListItem extends BaseDowntimeListItem
+{
+    use ListItemCommonLayout;
+
+    protected function assembleMain(BaseHtmlElement $main)
+    {
+        if ($this->item->is_in_effect) {
+            $main->add($this->createProgress());
+        }
+
+        $main->add($this->createHeader());
+        $main->add($this->createCaption());
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/DowntimeListItemMinimal.php b/library/Icingadb/Widget/ItemList/DowntimeListItemMinimal.php
new file mode 100644
index 0000000..58ef3d8
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/DowntimeListItemMinimal.php
@@ -0,0 +1,21 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\ListItemMinimalLayout;
+
+class DowntimeListItemMinimal extends BaseDowntimeListItem
+{
+    use ListItemMinimalLayout;
+
+    protected function init()
+    {
+        parent::init();
+
+        if ($this->list->isCaptionDisabled()) {
+            $this->setCaptionDisabled();
+        }
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/HistoryList.php b/library/Icingadb/Widget/ItemList/HistoryList.php
new file mode 100644
index 0000000..dbb7cea
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/HistoryList.php
@@ -0,0 +1,58 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\CaptionDisabled;
+use Icinga\Module\Icingadb\Common\LoadMore;
+use Icinga\Module\Icingadb\Common\NoSubjectLink;
+use Icinga\Module\Icingadb\Common\TicketLinks;
+use Icinga\Module\Icingadb\Common\ViewMode;
+use Icinga\Module\Icingadb\Common\BaseItemList;
+use ipl\Orm\ResultSet;
+use ipl\Web\Url;
+
+class HistoryList extends BaseItemList
+{
+    use CaptionDisabled;
+    use NoSubjectLink;
+    use ViewMode;
+    use LoadMore;
+    use TicketLinks;
+
+    protected $defaultAttributes = ['class' => 'history-list'];
+
+    /** @var ResultSet */
+    protected $data;
+
+    public function __construct(ResultSet $data)
+    {
+        parent::__construct($data);
+    }
+
+    protected function init()
+    {
+        $this->data = $this->getIterator($this->data);
+        $this->setDetailUrl(Url::fromPath('icingadb/event'));
+    }
+
+    protected function getItemClass(): string
+    {
+        switch ($this->getViewMode()) {
+            case 'minimal':
+                return HistoryListItemMinimal::class;
+            case 'detailed':
+                return HistoryListItemDetailed::class;
+            default:
+                return HistoryListItem::class;
+        }
+    }
+
+    protected function assemble()
+    {
+        $this->addAttributes(['class' => $this->getViewMode()]);
+
+        parent::assemble();
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/HistoryListItem.php b/library/Icingadb/Widget/ItemList/HistoryListItem.php
new file mode 100644
index 0000000..c44a807
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/HistoryListItem.php
@@ -0,0 +1,18 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\ListItemCommonLayout;
+use ipl\Web\Widget\StateBall;
+
+class HistoryListItem extends BaseHistoryListItem
+{
+    use ListItemCommonLayout;
+
+    protected function getStateBallSize(): string
+    {
+        return StateBall::SIZE_LARGE;
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/HistoryListItemDetailed.php b/library/Icingadb/Widget/ItemList/HistoryListItemDetailed.php
new file mode 100644
index 0000000..7129d2d
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/HistoryListItemDetailed.php
@@ -0,0 +1,18 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\ListItemDetailedLayout;
+use ipl\Web\Widget\StateBall;
+
+class HistoryListItemDetailed extends BaseHistoryListItem
+{
+    use ListItemDetailedLayout;
+
+    protected function getStateBallSize(): string
+    {
+        return StateBall::SIZE_LARGE;
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/HistoryListItemMinimal.php b/library/Icingadb/Widget/ItemList/HistoryListItemMinimal.php
new file mode 100644
index 0000000..b516a4e
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/HistoryListItemMinimal.php
@@ -0,0 +1,27 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\ListItemMinimalLayout;
+use ipl\Web\Widget\StateBall;
+
+class HistoryListItemMinimal extends BaseHistoryListItem
+{
+    use ListItemMinimalLayout;
+
+    protected function init()
+    {
+        parent::init();
+
+        if ($this->list->isCaptionDisabled()) {
+            $this->setCaptionDisabled();
+        }
+    }
+
+    protected function getStateBallSize(): string
+    {
+        return StateBall::SIZE_BIG;
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/HostDetailHeader.php b/library/Icingadb/Widget/ItemList/HostDetailHeader.php
new file mode 100644
index 0000000..0c90fea
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/HostDetailHeader.php
@@ -0,0 +1,72 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\HostStates;
+use Icinga\Module\Icingadb\Widget\CheckAttempt;
+use Icinga\Module\Icingadb\Widget\StateChange;
+use ipl\Html\BaseHtmlElement;
+use ipl\Web\Widget\Icon;
+use ipl\Web\Widget\StateBall;
+
+class HostDetailHeader extends HostListItemMinimal
+{
+    protected function getStateBallSize(): string
+    {
+        return '';
+    }
+
+    protected function assembleVisual(BaseHtmlElement $visual)
+    {
+        if ($this->state->state_type === 'soft') {
+            $stateType = 'soft_state';
+            $previousStateType = 'previous_soft_state';
+
+            if ($this->state->previous_soft_state === 0) {
+                $previousStateType = 'hard_state';
+            }
+        } else {
+            $stateType = 'hard_state';
+            $previousStateType = 'previous_hard_state';
+
+            if ($this->state->hard_state === $this->state->previous_hard_state) {
+                $previousStateType = 'previous_soft_state';
+            }
+        }
+
+        $state = HostStates::text($this->state->$stateType);
+        $previousState = HostStates::text($this->state->$previousStateType);
+
+        $stateChange = new StateChange($state, $previousState);
+        if ($stateType === 'soft_state') {
+            $stateChange->setCurrentStateBallSize(StateBall::SIZE_MEDIUM_LARGE);
+        }
+
+        if ($previousStateType === 'previous_soft_state') {
+            $stateChange->setPreviousStateBallSize(StateBall::SIZE_MEDIUM_LARGE);
+            if ($stateType === 'soft_state') {
+                $visual->getAttributes()->add('class', 'small-state-change');
+            }
+        }
+
+        if ($this->state->is_handled) {
+            $currentStateBall = $stateChange->ensureAssembled()->getContent()[1];
+            $currentStateBall->addHtml(new Icon($this->getHandledIcon()));
+            $currentStateBall->getAttributes()->add('class', 'handled');
+        }
+
+        $visual->addHtml($stateChange);
+    }
+
+    protected function assemble()
+    {
+        $attributes = $this->list->getAttributes();
+        if (! in_array('minimal', $attributes->get('class')->getValue())) {
+            $attributes->add('class', 'minimal');
+        }
+
+        parent::assemble();
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/HostList.php b/library/Icingadb/Widget/ItemList/HostList.php
new file mode 100644
index 0000000..51d218e
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/HostList.php
@@ -0,0 +1,36 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\Links;
+use ipl\Web\Url;
+
+/**
+ * Host list
+ */
+class HostList extends StateList
+{
+    protected $defaultAttributes = ['class' => 'host-list'];
+
+    protected function getItemClass(): string
+    {
+        switch ($this->getViewMode()) {
+            case 'minimal':
+                return HostListItemMinimal::class;
+            case 'detailed':
+                return HostListItemDetailed::class;
+            case 'objectHeader':
+                return HostDetailHeader::class;
+            default:
+                return HostListItem::class;
+        }
+    }
+
+    protected function init()
+    {
+        $this->setMultiselectUrl(Links::hostsDetails());
+        $this->setDetailUrl(Url::fromPath('icingadb/host'));
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/HostListItem.php b/library/Icingadb/Widget/ItemList/HostListItem.php
new file mode 100644
index 0000000..2eae660
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/HostListItem.php
@@ -0,0 +1,18 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\ListItemCommonLayout;
+use ipl\Web\Widget\StateBall;
+
+class HostListItem extends BaseHostListItem
+{
+    use ListItemCommonLayout;
+
+    protected function getStateBallSize(): string
+    {
+        return StateBall::SIZE_LARGE;
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/HostListItemDetailed.php b/library/Icingadb/Widget/ItemList/HostListItemDetailed.php
new file mode 100644
index 0000000..a2f1909
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/HostListItemDetailed.php
@@ -0,0 +1,103 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\ListItemDetailedLayout;
+use Icinga\Module\Icingadb\Util\PerfDataSet;
+use Icinga\Module\Icingadb\Widget\ItemList\CommentList;
+use ipl\Html\Attributes;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\HtmlElement;
+use ipl\Html\HtmlString;
+use ipl\Html\Text;
+use ipl\Web\Widget\Icon;
+use ipl\Web\Widget\StateBall;
+
+class HostListItemDetailed extends BaseHostListItem
+{
+    use ListItemDetailedLayout;
+
+    /** @var int Max pie charts to be shown */
+    const PIE_CHART_LIMIT = 5;
+
+    protected function getStateBallSize(): string
+    {
+        return StateBall::SIZE_LARGE;
+    }
+
+    protected function assembleFooter(BaseHtmlElement $footer)
+    {
+        $statusIcons = new HtmlElement('div', Attributes::create(['class' => 'status-icons']));
+
+        if ($this->item->state->last_comment->host_id === $this->item->id) {
+            $comment = $this->item->state->last_comment;
+            $comment->host = $this->item;
+            $comment = (new CommentList([$comment]))
+                ->setNoSubjectLink()
+                ->setObjectLinkDisabled()
+                ->setDetailActionsDisabled();
+
+            $statusIcons->addHtml(
+                new HtmlElement(
+                    'div',
+                    Attributes::create(['class' => 'comment-wrapper']),
+                    new HtmlElement('div', Attributes::create(['class' => 'comment-popup']), $comment),
+                    (new Icon('comments', ['class' => 'comment-icon']))
+                )
+            );
+        }
+
+        if ($this->item->state->is_flapping) {
+            $statusIcons->addHtml(new Icon(
+                'random',
+                [
+                    'title' => sprintf(t('Host "%s" is in flapping state'), $this->item->display_name),
+                ]
+            ));
+        }
+
+        if (! $this->item->notifications_enabled) {
+            $statusIcons->addHtml(new Icon('bell-slash', ['title' => t('Notifications disabled')]));
+        }
+
+        if (! $this->item->active_checks_enabled) {
+            $statusIcons->addHtml(new Icon('eye-slash', ['title' => t('Active checks disabled')]));
+        }
+
+        $performanceData = new HtmlElement('div', Attributes::create(['class' => 'performance-data']));
+        if ($this->item->state->performance_data) {
+            $pieChartData = PerfDataSet::fromString($this->item->state->normalized_performance_data)->asArray();
+
+            $pies = [];
+            foreach ($pieChartData as $i => $perfdata) {
+                if ($perfdata->isVisualizable()) {
+                    $pies[] = $perfdata->asInlinePie()->render();
+                }
+
+                // Check if number of visualizable pie charts is larger than PIE_CHART_LIMIT
+                if (count($pies) > HostListItemDetailed::PIE_CHART_LIMIT) {
+                    break;
+                }
+            }
+
+            $maxVisiblePies = HostListItemDetailed::PIE_CHART_LIMIT - 2;
+            $numOfPies = count($pies);
+            foreach ($pies as $i => $pie) {
+                if (
+                    // Show max. 5 elements: if there are more than 5, show 4 + `…`
+                    $i > $maxVisiblePies && $numOfPies > HostListItemDetailed::PIE_CHART_LIMIT
+                ) {
+                    $performanceData->addHtml(new HtmlElement('span', null, Text::create('…')));
+                    break;
+                }
+
+                $performanceData->addHtml(HtmlString::create($pie));
+            }
+        }
+
+        $footer->addHtml($statusIcons);
+        $footer->addHtml($performanceData);
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/HostListItemMinimal.php b/library/Icingadb/Widget/ItemList/HostListItemMinimal.php
new file mode 100644
index 0000000..f04b991
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/HostListItemMinimal.php
@@ -0,0 +1,18 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\ListItemMinimalLayout;
+use ipl\Web\Widget\StateBall;
+
+class HostListItemMinimal extends BaseHostListItem
+{
+    use ListItemMinimalLayout;
+
+    protected function getStateBallSize(): string
+    {
+        return StateBall::SIZE_BIG;
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/HostgroupList.php b/library/Icingadb/Widget/ItemList/HostgroupList.php
new file mode 100644
index 0000000..e6c8279
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/HostgroupList.php
@@ -0,0 +1,33 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\NoSubjectLink;
+use Icinga\Module\Icingadb\Common\ViewMode;
+use Icinga\Module\Icingadb\Common\BaseItemList;
+use ipl\Web\Url;
+
+class HostgroupList extends BaseItemList
+{
+    use NoSubjectLink;
+    use ViewMode;
+
+    protected $defaultAttributes = ['class' => 'hostgroup-list item-table'];
+
+    protected function init()
+    {
+        parent::init();
+
+        $this->getAttributes()->get('class')->removeValue('item-list');
+        $this->setDetailUrl(Url::fromPath('icingadb/hostgroup'));
+    }
+
+    protected function getItemClass(): string
+    {
+        $this->addAttributes(['class' => $this->getViewMode()]);
+
+        return HostgroupListItem::class;
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/HostgroupListItem.php b/library/Icingadb/Widget/ItemList/HostgroupListItem.php
new file mode 100644
index 0000000..5df0432
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/HostgroupListItem.php
@@ -0,0 +1,84 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\BaseTableRowItem;
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Common\NoSubjectLink;
+use Icinga\Module\Icingadb\Model\Hostgroup;
+use Icinga\Module\Icingadb\Widget\Detail\HostStatistics;
+use Icinga\Module\Icingadb\Widget\Detail\ServiceStatistics;
+use ipl\Html\Attributes;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\HtmlDocument;
+use ipl\Html\HtmlElement;
+use ipl\Html\Text;
+use ipl\Stdlib\Filter;
+use ipl\Web\Widget\Link;
+
+/**
+ * Hostgroup item of a hostgroup list. Represents one database row.
+ *
+ * @property Hostgroup $item
+ * @property HostgroupList $list
+ */
+class HostgroupListItem extends BaseTableRowItem
+{
+    use NoSubjectLink;
+
+    protected function init()
+    {
+        $this->setNoSubjectLink($this->list->getNoSubjectLink());
+        $this->list->addDetailFilterAttribute($this, Filter::equal('name', $this->item->name));
+    }
+
+    protected function assembleColumns(HtmlDocument $columns)
+    {
+        $hostStats = new HostStatistics($this->item);
+
+        $hostStats->setBaseFilter(Filter::equal('hostgroup.name', $this->item->name));
+        if ($this->list->hasBaseFilter()) {
+            $hostStats->setBaseFilter(
+                Filter::all($hostStats->getBaseFilter(), $this->list->getBaseFilter())
+            );
+        }
+
+        $columns->addFrom($hostStats, function (BaseHtmlElement $item) {
+            $item->getAttributes()->add(['class' => 'col']);
+            $item->setTag('div');
+            return $item;
+        });
+
+        $serviceStats = new ServiceStatistics($this->item);
+
+        $serviceStats->setBaseFilter(Filter::equal('hostgroup.name', $this->item->name));
+        if ($this->list->hasBaseFilter()) {
+            $serviceStats->setBaseFilter(
+                Filter::all($serviceStats->getBaseFilter(), $this->list->getBaseFilter())
+            );
+        }
+
+        $columns->addFrom($serviceStats, function (BaseHtmlElement $item) {
+            $item->getAttributes()->add(['class' => 'col']);
+            $item->setTag('div');
+            return $item;
+        });
+    }
+
+    protected function assembleTitle(BaseHtmlElement $title)
+    {
+        $title->addHtml(
+            $this->getNoSubjectLink()
+                ? new HtmlElement(
+                    'span',
+                    Attributes::create(['class' => 'subject']),
+                    Text::create($this->item->display_name)
+                )
+                : new Link($this->item->display_name, Links::hostgroup($this->item), ['class' => 'subject']),
+            new HtmlElement('br'),
+            Text::create($this->item->name)
+        );
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/NotificationList.php b/library/Icingadb/Widget/ItemList/NotificationList.php
new file mode 100644
index 0000000..8c95d26
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/NotificationList.php
@@ -0,0 +1,56 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\CaptionDisabled;
+use Icinga\Module\Icingadb\Common\LoadMore;
+use Icinga\Module\Icingadb\Common\NoSubjectLink;
+use Icinga\Module\Icingadb\Common\ViewMode;
+use Icinga\Module\Icingadb\Common\BaseItemList;
+use ipl\Orm\ResultSet;
+use ipl\Web\Url;
+
+class NotificationList extends BaseItemList
+{
+    use CaptionDisabled;
+    use NoSubjectLink;
+    use ViewMode;
+    use LoadMore;
+
+    protected $defaultAttributes = ['class' => 'notification-list'];
+
+    /** @var ResultSet */
+    protected $data;
+
+    public function __construct(ResultSet $data)
+    {
+        parent::__construct($data);
+    }
+
+    protected function init()
+    {
+        $this->data = $this->getIterator($this->data);
+        $this->setDetailUrl(Url::fromPath('icingadb/event'));
+    }
+
+    protected function getItemClass(): string
+    {
+        switch ($this->getViewMode()) {
+            case 'minimal':
+                return NotificationListItemMinimal::class;
+            case 'detailed':
+                return NotificationListItemDetailed::class;
+            default:
+                return NotificationListItem::class;
+        }
+    }
+
+    protected function assemble()
+    {
+        $this->addAttributes(['class' => $this->getViewMode()]);
+
+        parent::assemble();
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/NotificationListItem.php b/library/Icingadb/Widget/ItemList/NotificationListItem.php
new file mode 100644
index 0000000..683762f
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/NotificationListItem.php
@@ -0,0 +1,18 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\ListItemCommonLayout;
+use ipl\Web\Widget\StateBall;
+
+class NotificationListItem extends BaseNotificationListItem
+{
+    use ListItemCommonLayout;
+
+    protected function getStateBallSize(): string
+    {
+        return StateBall::SIZE_LARGE;
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/NotificationListItemDetailed.php b/library/Icingadb/Widget/ItemList/NotificationListItemDetailed.php
new file mode 100644
index 0000000..0a7449e
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/NotificationListItemDetailed.php
@@ -0,0 +1,18 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\ListItemDetailedLayout;
+use ipl\Web\Widget\StateBall;
+
+class NotificationListItemDetailed extends BaseNotificationListItem
+{
+    use ListItemDetailedLayout;
+
+    protected function getStateBallSize(): string
+    {
+        return StateBall::SIZE_LARGE;
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/NotificationListItemMinimal.php b/library/Icingadb/Widget/ItemList/NotificationListItemMinimal.php
new file mode 100644
index 0000000..dcda5fd
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/NotificationListItemMinimal.php
@@ -0,0 +1,27 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\ListItemMinimalLayout;
+use ipl\Web\Widget\StateBall;
+
+class NotificationListItemMinimal extends BaseNotificationListItem
+{
+    use ListItemMinimalLayout;
+
+    protected function init()
+    {
+        parent::init();
+
+        if ($this->list->isCaptionDisabled()) {
+            $this->setCaptionDisabled();
+        }
+    }
+
+    protected function getStateBallSize(): string
+    {
+        return StateBall::SIZE_BIG;
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/PageSeparatorItem.php b/library/Icingadb/Widget/ItemList/PageSeparatorItem.php
new file mode 100644
index 0000000..3e252eb
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/PageSeparatorItem.php
@@ -0,0 +1,36 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\Html;
+
+class PageSeparatorItem extends BaseHtmlElement
+{
+    protected $defaultAttributes = ['class' => 'list-item page-separator'];
+
+    /** @var int */
+    protected $pageNumber;
+
+    /** @var string */
+    protected $tag = 'li';
+
+    public function __construct(int $pageNumber)
+    {
+        $this->pageNumber = $pageNumber;
+    }
+
+    protected function assemble()
+    {
+        $this->add(Html::tag(
+            'a',
+            [
+                'id' => 'page-' . $this->pageNumber,
+                'data-icinga-no-scroll-on-focus' => true
+            ],
+            $this->pageNumber
+        ));
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/ServiceDetailHeader.php b/library/Icingadb/Widget/ItemList/ServiceDetailHeader.php
new file mode 100644
index 0000000..6036929
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/ServiceDetailHeader.php
@@ -0,0 +1,72 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\ServiceStates;
+use Icinga\Module\Icingadb\Widget\CheckAttempt;
+use Icinga\Module\Icingadb\Widget\StateChange;
+use ipl\Html\BaseHtmlElement;
+use ipl\Web\Widget\Icon;
+use ipl\Web\Widget\StateBall;
+
+class ServiceDetailHeader extends ServiceListItemMinimal
+{
+    protected function getStateBallSize(): string
+    {
+        return '';
+    }
+
+    protected function assembleVisual(BaseHtmlElement $visual)
+    {
+        if ($this->state->state_type === 'soft') {
+            $stateType = 'soft_state';
+            $previousStateType = 'previous_soft_state';
+
+            if ($this->state->previous_soft_state === 0) {
+                $previousStateType = 'hard_state';
+            }
+        } else {
+            $stateType = 'hard_state';
+            $previousStateType = 'previous_hard_state';
+
+            if ($this->state->hard_state === $this->state->previous_hard_state) {
+                $previousStateType = 'previous_soft_state';
+            }
+        }
+
+        $state = ServiceStates::text($this->state->$stateType);
+        $previousState = ServiceStates::text($this->state->$previousStateType);
+
+        $stateChange = new StateChange($state, $previousState);
+        if ($stateType === 'soft_state') {
+            $stateChange->setCurrentStateBallSize(StateBall::SIZE_MEDIUM_LARGE);
+        }
+
+        if ($previousStateType === 'previous_soft_state') {
+            $stateChange->setPreviousStateBallSize(StateBall::SIZE_MEDIUM_LARGE);
+            if ($stateType === 'soft_state') {
+                $visual->getAttributes()->add('class', 'small-state-change');
+            }
+        }
+
+        if ($this->state->is_handled) {
+            $currentStateBall = $stateChange->ensureAssembled()->getContent()[1];
+            $currentStateBall->addHtml(new Icon($this->getHandledIcon()));
+            $currentStateBall->getAttributes()->add('class', 'handled');
+        }
+
+        $visual->addHtml($stateChange);
+    }
+
+    protected function assemble()
+    {
+        $attributes = $this->list->getAttributes();
+        if (! in_array('minimal', $attributes->get('class')->getValue())) {
+            $attributes->add('class', 'minimal');
+        }
+
+        parent::assemble();
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/ServiceList.php b/library/Icingadb/Widget/ItemList/ServiceList.php
new file mode 100644
index 0000000..11febb0
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/ServiceList.php
@@ -0,0 +1,33 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\Links;
+use ipl\Web\Url;
+
+class ServiceList extends StateList
+{
+    protected $defaultAttributes = ['class' => 'service-list'];
+
+    protected function getItemClass(): string
+    {
+        switch ($this->getViewMode()) {
+            case 'minimal':
+                return ServiceListItemMinimal::class;
+            case 'detailed':
+                return ServiceListItemDetailed::class;
+            case 'objectHeader':
+                return ServiceDetailHeader::class;
+            default:
+                return ServiceListItem::class;
+        }
+    }
+
+    protected function init()
+    {
+        $this->setMultiselectUrl(Links::servicesDetails());
+        $this->setDetailUrl(Url::fromPath('icingadb/service'));
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/ServiceListItem.php b/library/Icingadb/Widget/ItemList/ServiceListItem.php
new file mode 100644
index 0000000..a974581
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/ServiceListItem.php
@@ -0,0 +1,18 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\ListItemCommonLayout;
+use ipl\Web\Widget\StateBall;
+
+class ServiceListItem extends BaseServiceListItem
+{
+    use ListItemCommonLayout;
+
+    protected function getStateBallSize(): string
+    {
+        return StateBall::SIZE_LARGE;
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/ServiceListItemDetailed.php b/library/Icingadb/Widget/ItemList/ServiceListItemDetailed.php
new file mode 100644
index 0000000..a068beb
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/ServiceListItemDetailed.php
@@ -0,0 +1,107 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\ListItemDetailedLayout;
+use Icinga\Module\Icingadb\Util\PerfDataSet;
+use Icinga\Module\Icingadb\Widget\ItemList\CommentList;
+use ipl\Html\Attributes;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\HtmlElement;
+use ipl\Html\HtmlString;
+use ipl\Html\Text;
+use ipl\Web\Widget\Icon;
+use ipl\Web\Widget\StateBall;
+
+class ServiceListItemDetailed extends BaseServiceListItem
+{
+    use ListItemDetailedLayout;
+
+    /** @var int Max pie charts to be shown */
+    const PIE_CHART_LIMIT = 5;
+
+    protected function getStateBallSize(): string
+    {
+        return StateBall::SIZE_LARGE;
+    }
+
+    protected function assembleFooter(BaseHtmlElement $footer)
+    {
+        $statusIcons = new HtmlElement('div', Attributes::create(['class' => 'status-icons']));
+
+        if ($this->item->state->last_comment->service_id === $this->item->id) {
+            $comment = $this->item->state->last_comment;
+            $comment->service = $this->item;
+            $comment = (new CommentList([$comment]))
+                ->setNoSubjectLink()
+                ->setObjectLinkDisabled()
+                ->setDetailActionsDisabled();
+
+            $statusIcons->addHtml(
+                new HtmlElement(
+                    'div',
+                    Attributes::create(['class' => 'comment-wrapper']),
+                    new HtmlElement('div', Attributes::create(['class' => 'comment-popup']), $comment),
+                    (new Icon('comments', ['class' => 'comment-icon']))
+                )
+            );
+        }
+
+        if ($this->item->state->is_flapping) {
+            $statusIcons->addHtml(new Icon(
+                'random',
+                [
+                    'title' => sprintf(
+                        t('Service "%s" on "%s" is in flapping state'),
+                        $this->item->display_name,
+                        $this->item->host->display_name
+                    ),
+                ]
+            ));
+        }
+
+        if (! $this->item->notifications_enabled) {
+            $statusIcons->addHtml(new Icon('bell-slash', ['title' => t('Notifications disabled')]));
+        }
+
+        if (! $this->item->active_checks_enabled) {
+            $statusIcons->addHtml(new Icon('eye-slash', ['title' => t('Active checks disabled')]));
+        }
+
+        $performanceData = new HtmlElement('div', Attributes::create(['class' => 'performance-data']));
+        if ($this->item->state->performance_data) {
+            $pieChartData = PerfDataSet::fromString($this->item->state->normalized_performance_data)->asArray();
+
+            $pies = [];
+            foreach ($pieChartData as $i => $perfdata) {
+                if ($perfdata->isVisualizable()) {
+                    $pies[] = $perfdata->asInlinePie()->render();
+                }
+
+                // Check if number of visualizable pie charts is larger than PIE_CHART_LIMIT
+                if (count($pies) > ServiceListItemDetailed::PIE_CHART_LIMIT) {
+                    break;
+                }
+            }
+
+            $maxVisiblePies = ServiceListItemDetailed::PIE_CHART_LIMIT - 2;
+            $numOfPies = count($pies);
+            foreach ($pies as $i => $pie) {
+                if (
+                    // Show max. 5 elements: if there are more than 5, show 4 + `…`
+                    $i > $maxVisiblePies && $numOfPies > ServiceListItemDetailed::PIE_CHART_LIMIT
+                ) {
+                    $performanceData->addHtml(new HtmlElement('span', null, Text::create('…')));
+                    break;
+                }
+
+                $performanceData->addHtml(HtmlString::create($pie));
+            }
+        }
+
+        $footer->addHtml($statusIcons);
+        $footer->addHtml($performanceData);
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/ServiceListItemMinimal.php b/library/Icingadb/Widget/ItemList/ServiceListItemMinimal.php
new file mode 100644
index 0000000..e7a1bc6
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/ServiceListItemMinimal.php
@@ -0,0 +1,18 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\ListItemMinimalLayout;
+use ipl\Web\Widget\StateBall;
+
+class ServiceListItemMinimal extends BaseServiceListItem
+{
+    use ListItemMinimalLayout;
+
+    protected function getStateBallSize(): string
+    {
+        return StateBall::SIZE_BIG;
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/ServicegroupList.php b/library/Icingadb/Widget/ItemList/ServicegroupList.php
new file mode 100644
index 0000000..fa612f1
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/ServicegroupList.php
@@ -0,0 +1,33 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\NoSubjectLink;
+use Icinga\Module\Icingadb\Common\ViewMode;
+use Icinga\Module\Icingadb\Common\BaseItemList;
+use ipl\Web\Url;
+
+class ServicegroupList extends BaseItemList
+{
+    use NoSubjectLink;
+    use ViewMode;
+
+    protected $defaultAttributes = ['class' => 'servicegroup-list item-table'];
+
+    protected function init()
+    {
+        parent::init();
+
+        $this->getAttributes()->get('class')->removeValue('item-list');
+        $this->setDetailUrl(Url::fromPath('icingadb/servicegroup'));
+    }
+
+    protected function getItemClass(): string
+    {
+        $this->addAttributes(['class' => $this->getViewMode()]);
+
+        return ServicegroupListItem::class;
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/ServicegroupListItem.php b/library/Icingadb/Widget/ItemList/ServicegroupListItem.php
new file mode 100644
index 0000000..6a8320c
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/ServicegroupListItem.php
@@ -0,0 +1,68 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\BaseTableRowItem;
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Common\NoSubjectLink;
+use Icinga\Module\Icingadb\Model\Servicegroup;
+use Icinga\Module\Icingadb\Widget\Detail\ServiceStatistics;
+use ipl\Html\Attributes;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\HtmlDocument;
+use ipl\Html\HtmlElement;
+use ipl\Html\Text;
+use ipl\Stdlib\Filter;
+use ipl\Web\Widget\Link;
+
+/**
+ * Servicegroup item of a servicegroup list. Represents one database row.
+ *
+ * @property Servicegroup $item
+ * @property ServicegroupList $list
+ */
+class ServicegroupListItem extends BaseTableRowItem
+{
+    use NoSubjectLink;
+
+    protected function init()
+    {
+        $this->setNoSubjectLink($this->list->getNoSubjectLink());
+        $this->list->addDetailFilterAttribute($this, Filter::equal('name', $this->item->name));
+    }
+
+    protected function assembleColumns(HtmlDocument $columns)
+    {
+        $serviceStats = new ServiceStatistics($this->item);
+
+        $serviceStats->setBaseFilter(Filter::equal('servicegroup.name', $this->item->name));
+        if ($this->list->hasBaseFilter()) {
+            $serviceStats->setBaseFilter(
+                Filter::all($serviceStats->getBaseFilter(), $this->list->getBaseFilter())
+            );
+        }
+
+        $columns->addFrom($serviceStats, function (BaseHtmlElement $item) {
+            $item->getAttributes()->add(['class' => 'col']);
+            $item->setTag('div');
+            return $item;
+        });
+    }
+
+    protected function assembleTitle(BaseHtmlElement $title)
+    {
+        $title->addHtml(
+            $this->getNoSubjectLink()
+                ? new HtmlElement(
+                    'span',
+                    Attributes::create(['class' => 'subject']),
+                    Text::create($this->item->display_name)
+                )
+                : new Link($this->item->display_name, Links::servicegroup($this->item), ['class' => 'subject']),
+            new HtmlElement('br'),
+            Text::create($this->item->name)
+        );
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/StateList.php b/library/Icingadb/Widget/ItemList/StateList.php
new file mode 100644
index 0000000..cf6ec0b
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/StateList.php
@@ -0,0 +1,31 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\BaseItemList;
+use Icinga\Module\Icingadb\Common\NoSubjectLink;
+use Icinga\Module\Icingadb\Common\ViewMode;
+use Icinga\Module\Icingadb\Redis\VolatileStateResults;
+use Icinga\Module\Icingadb\Widget\Notice;
+use ipl\Html\HtmlDocument;
+
+abstract class StateList extends BaseItemList
+{
+    use ViewMode;
+    use NoSubjectLink;
+
+    protected function assemble()
+    {
+        $this->addAttributes(['class' => $this->getViewMode()]);
+
+        parent::assemble();
+
+        if ($this->data instanceof VolatileStateResults && $this->data->isRedisUnavailable()) {
+            $this->prependWrapper((new HtmlDocument())->addHtml(new Notice(
+                t('Icinga Redis is currently unavailable. The shown information might be outdated.')
+            )));
+        }
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/StateListItem.php b/library/Icingadb/Widget/ItemList/StateListItem.php
new file mode 100644
index 0000000..d5eb4fd
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/StateListItem.php
@@ -0,0 +1,129 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\BaseListItem;
+use Icinga\Module\Icingadb\Common\Icons;
+use Icinga\Module\Icingadb\Model\State;
+use Icinga\Module\Icingadb\Util\PluginOutput;
+use Icinga\Module\Icingadb\Widget\CheckAttempt;
+use Icinga\Module\Icingadb\Widget\EmptyState;
+use Icinga\Module\Icingadb\Widget\IconImage;
+use Icinga\Module\Icingadb\Widget\PluginOutputContainer;
+use ipl\Web\Widget\TimeSince;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\Html;
+use ipl\Html\Text;
+use ipl\Web\Widget\Icon;
+use ipl\Web\Widget\StateBall;
+
+/**
+ * Host or service item of a host or service list. Represents one database row.
+ */
+abstract class StateListItem extends BaseListItem
+{
+    /** @var State The state of the item */
+    protected $state;
+
+    protected function init()
+    {
+        $this->state = $this->item->state;
+
+        if (isset($this->item->icon_image->icon_image)) {
+            $this->list->setHasIconImages(true);
+        }
+    }
+
+    abstract protected function createSubject();
+
+    abstract protected function getStateBallSize(): string;
+
+    protected function assembleCaption(BaseHtmlElement $caption)
+    {
+        if ($this->state->soft_state === null && $this->state->output === null) {
+            $caption->addHtml(Text::create(t('Waiting for Icinga DB to synchronize the state.')));
+        } else {
+            if (empty($this->state->output)) {
+                $pluginOutput = new EmptyState(t('Output unavailable.'));
+            } else {
+                $pluginOutput = new PluginOutputContainer(PluginOutput::fromObject($this->item));
+            }
+
+            $caption->addHtml($pluginOutput);
+        }
+    }
+
+    protected function assembleIconImage(BaseHtmlElement $iconImage)
+    {
+        if (isset($this->item->icon_image->icon_image)) {
+            $iconImage->addHtml(new IconImage($this->item->icon_image->icon_image, $this->item->icon_image_alt));
+        } else {
+            $iconImage->addAttributes(['class' => 'placeholder']);
+        }
+    }
+
+    protected function assembleTitle(BaseHtmlElement $title)
+    {
+        $title->addHtml(Html::sprintf(
+            t('%s is %s', '<hostname> is <state-text>'),
+            $this->createSubject(),
+            Html::tag('span', ['class' => 'state-text'], $this->state->getStateTextTranslated())
+        ));
+    }
+
+    protected function assembleVisual(BaseHtmlElement $visual)
+    {
+        $stateBall = new StateBall($this->state->getStateText(), $this->getStateBallSize());
+
+        if ($this->state->is_handled) {
+            $stateBall->addHtml(new Icon($this->getHandledIcon()));
+            $stateBall->getAttributes()->add('class', 'handled');
+        } elseif ($this->state->getStateText() === 'pending' && $this->state->in_downtime) {
+            $stateBall->addHtml(new Icon($this->getHandledIcon()));
+        }
+
+        $visual->addHtml($stateBall);
+        if ($this->state->state_type === 'soft') {
+            $visual->addHtml(
+                new CheckAttempt((int) $this->state->check_attempt, (int) $this->item->max_check_attempts)
+            );
+        }
+    }
+
+    protected function createTimestamp()
+    {
+        if ($this->state->is_overdue) {
+            $since = new TimeSince($this->state->next_update);
+            $since->prepend(t('Overdue') . ' ');
+            $since->prependHtml(new Icon(Icons::WARNING));
+            return $since;
+        } elseif ($this->state->last_state_change > 0) {
+            return new TimeSince($this->state->last_state_change);
+        }
+    }
+
+    protected function getHandledIcon(): string
+    {
+        switch (true) {
+            case $this->state->is_acknowledged:
+                return Icons::IS_ACKNOWLEDGED;
+            case $this->state->in_downtime:
+                return Icons::IN_DOWNTIME;
+            case $this->state->is_flapping:
+                return Icons::IS_FLAPPING;
+            default:
+                return Icons::HOST_DOWN;
+        }
+    }
+
+    protected function assemble()
+    {
+        if ($this->state->is_overdue) {
+            $this->addAttributes(['class' => 'overdue']);
+        }
+
+        parent::assemble();
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/UserList.php b/library/Icingadb/Widget/ItemList/UserList.php
new file mode 100644
index 0000000..826a467
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/UserList.php
@@ -0,0 +1,29 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\NoSubjectLink;
+use Icinga\Module\Icingadb\Common\BaseItemList;
+use ipl\Web\Url;
+
+class UserList extends BaseItemList
+{
+    use NoSubjectLink;
+
+    protected $defaultAttributes = ['class' => 'user-list item-table'];
+
+    protected function init()
+    {
+        parent::init();
+
+        $this->getAttributes()->get('class')->removeValue('item-list');
+        $this->setDetailUrl(Url::fromPath('icingadb/user'));
+    }
+
+    protected function getItemClass(): string
+    {
+        return UserListItem::class;
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/UserListItem.php b/library/Icingadb/Widget/ItemList/UserListItem.php
new file mode 100644
index 0000000..e43692f
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/UserListItem.php
@@ -0,0 +1,62 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\BaseTableRowItem;
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Common\NoSubjectLink;
+use Icinga\Module\Icingadb\Model\User;
+use ipl\Html\Attributes;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\HtmlDocument;
+use ipl\Html\HtmlElement;
+use ipl\Html\Text;
+use ipl\Stdlib\Filter;
+use ipl\Web\Widget\Link;
+
+/**
+ * User item of a user list. Represents one database row.
+ *
+ * @property User $item
+ * @property UserList $list
+ */
+class UserListItem extends BaseTableRowItem
+{
+    use NoSubjectLink;
+
+    protected function init()
+    {
+        $this->setNoSubjectLink($this->list->getNoSubjectLink());
+        $this->list->addDetailFilterAttribute($this, Filter::equal('name', $this->item->name));
+    }
+
+    protected function assembleVisual(BaseHtmlElement $visual)
+    {
+        $visual->addHtml(new HtmlElement(
+            'div',
+            Attributes::create(['class' => 'user-ball']),
+            Text::create($this->item->display_name[0])
+        ));
+    }
+
+    protected function assembleTitle(BaseHtmlElement $title)
+    {
+        $title->addHtml(
+            $this->getNoSubjectLink()
+                ? new HtmlElement(
+                    'span',
+                    Attributes::create(['class' => 'subject']),
+                    Text::create($this->item->display_name)
+                )
+                : new Link($this->item->display_name, Links::user($this->item), ['class' => 'subject']),
+            new HtmlElement('br'),
+            Text::create($this->item->name)
+        );
+    }
+
+    protected function assembleColumns(HtmlDocument $columns)
+    {
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/UsergroupList.php b/library/Icingadb/Widget/ItemList/UsergroupList.php
new file mode 100644
index 0000000..2e95368
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/UsergroupList.php
@@ -0,0 +1,29 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\NoSubjectLink;
+use Icinga\Module\Icingadb\Common\BaseItemList;
+use ipl\Web\Url;
+
+class UsergroupList extends BaseItemList
+{
+    use NoSubjectLink;
+
+    protected $defaultAttributes = ['class' => 'usergroup-list item-table'];
+
+    protected function init()
+    {
+        parent::init();
+
+        $this->getAttributes()->get('class')->removeValue('item-list');
+        $this->setDetailUrl(Url::fromPath('icingadb/usergroup'));
+    }
+
+    protected function getItemClass(): string
+    {
+        return UsergroupListItem::class;
+    }
+}
diff --git a/library/Icingadb/Widget/ItemList/UsergroupListItem.php b/library/Icingadb/Widget/ItemList/UsergroupListItem.php
new file mode 100644
index 0000000..f8c800d
--- /dev/null
+++ b/library/Icingadb/Widget/ItemList/UsergroupListItem.php
@@ -0,0 +1,62 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemList;
+
+use Icinga\Module\Icingadb\Common\BaseTableRowItem;
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Common\NoSubjectLink;
+use Icinga\Module\Icingadb\Model\Usergroup;
+use ipl\Html\Attributes;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\HtmlDocument;
+use ipl\Html\HtmlElement;
+use ipl\Html\Text;
+use ipl\Stdlib\Filter;
+use ipl\Web\Widget\Link;
+
+/**
+ * Usergroup item of a usergroup list. Represents one database row.
+ *
+ * @property Usergroup $item
+ * @property UsergroupList $list
+ */
+class UsergroupListItem extends BaseTableRowItem
+{
+    use NoSubjectLink;
+
+    protected function init()
+    {
+        $this->setNoSubjectLink($this->list->getNoSubjectLink());
+        $this->list->addDetailFilterAttribute($this, Filter::equal('name', $this->item->name));
+    }
+
+    protected function assembleVisual(BaseHtmlElement $visual)
+    {
+        $visual->addHtml(new HtmlElement(
+            'div',
+            Attributes::create(['class' => 'usergroup-ball']),
+            Text::create($this->item->display_name[0])
+        ));
+    }
+
+    protected function assembleTitle(BaseHtmlElement $title)
+    {
+        $title->addHtml(
+            $this->getNoSubjectLink()
+                ? new HtmlElement(
+                    'span',
+                    Attributes::create(['class' => 'subject']),
+                    Text::create($this->item->display_name)
+                )
+                : new Link($this->item->display_name, Links::usergroup($this->item), ['class' => 'subject']),
+            new HtmlElement('br'),
+            Text::create($this->item->name)
+        );
+    }
+
+    protected function assembleColumns(HtmlDocument $columns)
+    {
+    }
+}
diff --git a/library/Icingadb/Widget/ItemTable/BaseItemTable.php b/library/Icingadb/Widget/ItemTable/BaseItemTable.php
new file mode 100644
index 0000000..d8fd85b
--- /dev/null
+++ b/library/Icingadb/Widget/ItemTable/BaseItemTable.php
@@ -0,0 +1,198 @@
+<?php
+
+/* Icinga DB Web | (c) 2022 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemTable;
+
+use Icinga\Module\Icingadb\Widget\EmptyState;
+use ipl\Html\Attributes;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\Form;
+use ipl\Html\Html;
+use ipl\Html\HtmlElement;
+use ipl\Html\HtmlString;
+use ipl\Orm\Common\SortUtil;
+use ipl\Orm\Query;
+use ipl\Web\Control\SortControl;
+use ipl\Web\Widget\Icon;
+
+abstract class BaseItemTable extends BaseHtmlElement
+{
+    protected $baseAttributes = [
+        'class' => 'item-table'
+    ];
+
+    /** @var array<string, string> The columns to render */
+    protected $columns;
+
+    /** @var iterable The datasource */
+    protected $data;
+
+    /** @var string The sort rules */
+    protected $sort;
+
+    protected $tag = 'table';
+
+    /**
+     * Create a new item table
+     *
+     * @param iterable $data Datasource of the table
+     * @param array<string, string> $columns The columns to render, keys are labels
+     */
+    public function __construct(iterable $data, array $columns)
+    {
+        $this->data = $data;
+        $this->columns = array_flip($columns);
+
+        $this->addAttributes($this->baseAttributes);
+
+        $this->init();
+    }
+
+    /**
+     * Initialize the item table
+     *
+     * If you want to adjust the item table after construction, override this method.
+     */
+    protected function init()
+    {
+    }
+
+    /**
+     * Get the columns being rendered
+     *
+     * @return array<string, string>
+     */
+    public function getColumns(): array
+    {
+        return $this->columns;
+    }
+
+    /**
+     * Set sort rules (as returned by {@see SortControl::getSort()})
+     *
+     * @param ?string $sort
+     *
+     * @return $this
+     */
+    public function setSort(?string $sort): self
+    {
+        $this->sort = $sort;
+
+        return $this;
+    }
+
+    abstract protected function getItemClass(): string;
+
+    abstract protected function getVisualColumn(): string;
+
+    abstract protected function getVisualLabel();
+
+    protected function assembleColumnHeader(BaseHtmlElement $header, string $name, $label): void
+    {
+        $sortRules = [];
+        if ($this->sort !== null) {
+            $sortRules = SortUtil::createOrderBy($this->sort);
+        }
+
+        $active = false;
+        $sortDirection = null;
+        foreach ($sortRules as $rule) {
+            if ($rule[0] === $name) {
+                $sortDirection = $rule[1];
+                $active = true;
+                break;
+            }
+        }
+
+        if ($sortDirection === 'desc') {
+            $value = "$name asc";
+        } else {
+            $value = "$name desc";
+        }
+
+        $icon = 'sort';
+        if ($active) {
+            $icon = $sortDirection === 'desc' ? 'sort-up' : 'sort-down';
+        }
+
+        $form = new Form();
+        $form->setAttribute('method', 'GET');
+
+        $button = $form->createElement('button', 'sort', [
+            'value' => $value,
+            'type'  => 'submit',
+            'title' => is_string($label) ? $label : null,
+            'class' => $active ? 'active' : null
+        ]);
+        $button->addHtml(
+            Html::tag(
+                'span',
+                null,
+                // With &nbsp; to have the height sized the same as the others
+                $label ?? HtmlString::create('&nbsp;')
+            ),
+            new Icon($icon)
+        );
+        $form->addElement($button);
+
+        $header->add($form);
+    }
+
+    protected function assemble()
+    {
+        $itemClass = $this->getItemClass();
+
+        $headerRow = new HtmlElement('tr');
+
+        $visualCell = new HtmlElement('th', Attributes::create(['class' => 'has-visual']));
+        $this->assembleColumnHeader($visualCell, $this->getVisualColumn(), $this->getVisualLabel());
+        $headerRow->addHtml($visualCell);
+
+        foreach ($this->columns as $name => $label) {
+            $headerCell = new HtmlElement('th');
+            $this->assembleColumnHeader($headerCell, $name, is_int($label) ? $name : $label);
+            $headerRow->addHtml($headerCell);
+        }
+
+        $this->addHtml(new HtmlElement('thead', null, $headerRow));
+
+        $body = new HtmlElement('tbody', Attributes::create(['data-base-target' => '_next']));
+        foreach ($this->data as $item) {
+            $body->addHtml(new $itemClass($item, $this));
+        }
+
+        if ($body->isEmpty()) {
+            $body->addHtml(new HtmlElement(
+                'tr',
+                null,
+                new HtmlElement(
+                    'td',
+                    Attributes::create(['colspan' => count($this->columns)]),
+                    new EmptyState(t('No items found.'))
+                )
+            ));
+        }
+
+        $this->addHtml($body);
+    }
+
+    /**
+     * Enrich the given list of column names with appropriate labels
+     *
+     * @param Query $query
+     * @param array $columns
+     *
+     * @return array
+     */
+    public static function applyColumnMetaData(Query $query, array $columns): array
+    {
+        $newColumns = [];
+        foreach ($columns as $columnPath) {
+            $label = $query->getResolver()->getColumnDefinition($columnPath)->getLabel();
+            $newColumns[$label ?? $columnPath] = $columnPath;
+        }
+
+        return $newColumns;
+    }
+}
diff --git a/library/Icingadb/Widget/ItemTable/BaseRowItem.php b/library/Icingadb/Widget/ItemTable/BaseRowItem.php
new file mode 100644
index 0000000..0189619
--- /dev/null
+++ b/library/Icingadb/Widget/ItemTable/BaseRowItem.php
@@ -0,0 +1,106 @@
+<?php
+
+/* Icinga DB Web | (c) 2022 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemTable;
+
+use ipl\Html\Attributes;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\HtmlElement;
+use ipl\Orm\Model;
+
+abstract class BaseRowItem extends BaseHtmlElement
+{
+    protected $defaultAttributes = ['class' => 'row-item'];
+
+    /** @var Model */
+    protected $item;
+
+    /** @var BaseItemTable */
+    protected $list;
+
+    protected $tag = 'tr';
+
+    /**
+     * Create a new row item
+     *
+     * @param Model $item
+     * @param BaseItemTable $list
+     */
+    public function __construct(Model $item, BaseItemTable $list)
+    {
+        $this->item = $item;
+        $this->list = $list;
+
+        $this->init();
+    }
+
+    /**
+     * Initialize the row item
+     *
+     * If you want to adjust the row item after construction, override this method.
+     */
+    protected function init()
+    {
+    }
+
+    abstract protected function assembleVisual(BaseHtmlElement $visual);
+
+    abstract protected function assembleCell(BaseHtmlElement $cell, string $path, $value);
+
+    protected function createVisual(): BaseHtmlElement
+    {
+        $visual = new HtmlElement('td', Attributes::create(['class' => 'visual']));
+
+        $this->assembleVisual($visual);
+
+        return $visual;
+    }
+
+    protected function assemble()
+    {
+        $this->addHtml($this->createVisual());
+
+        foreach ($this->list->getColumns() as $columnPath => $_) {
+            $steps = explode('.', $columnPath);
+            if ($steps[0] === $this->item->getTableName()) {
+                array_shift($steps);
+                $columnPath = implode('.', $steps);
+            }
+
+            $column = null;
+            $subject = $this->item;
+            foreach ($steps as $i => $step) {
+                if (isset($subject->$step)) {
+                    if ($subject->$step instanceof Model) {
+                        $subject = $subject->$step;
+                    } else {
+                        $column = $step;
+                    }
+                } else {
+                    $columnCandidate = implode('.', array_slice($steps, $i));
+                    if (isset($subject->$columnCandidate)) {
+                        $column = $columnCandidate;
+                    } else {
+                        break;
+                    }
+                }
+            }
+
+            $value = null;
+            if ($column !== null) {
+                $value = $subject->$column;
+                if (is_array($value)) {
+                    $value = empty($value) ? null : implode(',', $value);
+                }
+            }
+
+            $cell = new HtmlElement('td');
+            if ($value !== null) {
+                $this->assembleCell($cell, $columnPath, $value);
+            }
+
+            $this->addHtml($cell);
+        }
+    }
+}
diff --git a/library/Icingadb/Widget/ItemTable/HostItemTable.php b/library/Icingadb/Widget/ItemTable/HostItemTable.php
new file mode 100644
index 0000000..e303746
--- /dev/null
+++ b/library/Icingadb/Widget/ItemTable/HostItemTable.php
@@ -0,0 +1,31 @@
+<?php
+
+/* Icinga DB Web | (c) 2022 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemTable;
+
+use Icinga\Module\Icingadb\Common\DetailActions;
+use Icinga\Module\Icingadb\Common\Links;
+use ipl\Web\Url;
+
+class HostItemTable extends StateItemTable
+{
+    use DetailActions;
+
+    protected function init()
+    {
+        $this->initializeDetailActions();
+        $this->setMultiselectUrl(Links::hostsDetails());
+        $this->setDetailUrl(Url::fromPath('icingadb/host'));
+    }
+
+    protected function getItemClass(): string
+    {
+        return HostRowItem::class;
+    }
+
+    protected function getVisualColumn(): string
+    {
+        return 'host.state.severity';
+    }
+}
diff --git a/library/Icingadb/Widget/ItemTable/HostRowItem.php b/library/Icingadb/Widget/ItemTable/HostRowItem.php
new file mode 100644
index 0000000..cff70dd
--- /dev/null
+++ b/library/Icingadb/Widget/ItemTable/HostRowItem.php
@@ -0,0 +1,51 @@
+<?php
+
+/* Icinga DB Web | (c) 2022 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemTable;
+
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Model\Host;
+use ipl\Html\BaseHtmlElement;
+use ipl\Stdlib\Filter;
+use ipl\Web\Widget\Link;
+
+class HostRowItem extends StateRowItem
+{
+    /** @var HostItemTable */
+    protected $list;
+
+    /** @var Host */
+    protected $item;
+
+    protected function init()
+    {
+        parent::init();
+
+        $this->list->addDetailFilterAttribute($this, Filter::equal('name', $this->item->name))
+            ->addMultiselectFilterAttribute($this, Filter::equal('host.name', $this->item->name));
+    }
+
+    protected function assembleCell(BaseHtmlElement $cell, string $path, $value)
+    {
+        switch ($path) {
+            case 'name':
+            case 'display_name':
+                $cell->addHtml(new Link($this->item->$path, Links::host($this->item), [
+                    'class' => 'subject',
+                    'title' => $this->item->$path
+                ]));
+                break;
+            case 'service.name':
+            case 'service.display_name':
+                $column = substr($path, 8);
+                $cell->addHtml(new Link(
+                    $this->item->service->$column,
+                    Links::service($this->item->service, $this->item)
+                ));
+                break;
+            default:
+                parent::assembleCell($cell, $path, $value);
+        }
+    }
+}
diff --git a/library/Icingadb/Widget/ItemTable/ServiceItemTable.php b/library/Icingadb/Widget/ItemTable/ServiceItemTable.php
new file mode 100644
index 0000000..60872d8
--- /dev/null
+++ b/library/Icingadb/Widget/ItemTable/ServiceItemTable.php
@@ -0,0 +1,31 @@
+<?php
+
+/* Icinga DB Web | (c) 2022 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemTable;
+
+use Icinga\Module\Icingadb\Common\DetailActions;
+use Icinga\Module\Icingadb\Common\Links;
+use ipl\Web\Url;
+
+class ServiceItemTable extends StateItemTable
+{
+    use DetailActions;
+
+    protected function init()
+    {
+        $this->initializeDetailActions();
+        $this->setMultiselectUrl(Links::servicesDetails());
+        $this->setDetailUrl(Url::fromPath('icingadb/service'));
+    }
+
+    protected function getItemClass(): string
+    {
+        return ServiceRowItem::class;
+    }
+
+    protected function getVisualColumn(): string
+    {
+        return 'service.state.severity';
+    }
+}
diff --git a/library/Icingadb/Widget/ItemTable/ServiceRowItem.php b/library/Icingadb/Widget/ItemTable/ServiceRowItem.php
new file mode 100644
index 0000000..0fb95d0
--- /dev/null
+++ b/library/Icingadb/Widget/ItemTable/ServiceRowItem.php
@@ -0,0 +1,64 @@
+<?php
+
+/* Icinga DB Web | (c) 2022 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemTable;
+
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Model\Service;
+use ipl\Html\BaseHtmlElement;
+use ipl\Stdlib\Filter;
+use ipl\Web\Widget\Link;
+
+class ServiceRowItem extends StateRowItem
+{
+    /** @var ServiceItemTable */
+    protected $list;
+
+    /** @var Service */
+    protected $item;
+
+    protected function init()
+    {
+        parent::init();
+
+        $this->list->addMultiselectFilterAttribute(
+            $this,
+            Filter::all(
+                Filter::equal('service.name', $this->item->name),
+                Filter::equal('host.name', $this->item->host->name)
+            )
+        );
+        $this->list->addDetailFilterAttribute(
+            $this,
+            Filter::all(
+                Filter::equal('name', $this->item->name),
+                Filter::equal('host.name', $this->item->host->name)
+            )
+        );
+    }
+
+    protected function assembleCell(BaseHtmlElement $cell, string $path, $value)
+    {
+        switch ($path) {
+            case 'name':
+            case 'display_name':
+                $cell->addHtml(new Link(
+                    $this->item->$path,
+                    Links::service($this->item, $this->item->host),
+                    [
+                        'class' => 'subject',
+                        'title' => $this->item->$path
+                    ]
+                ));
+                break;
+            case 'host.name':
+            case 'host.display_name':
+                $column = substr($path, 5);
+                $cell->addHtml(new Link($this->item->host->$column, Links::host($this->item->host)));
+                break;
+            default:
+                parent::assembleCell($cell, $path, $value);
+        }
+    }
+}
diff --git a/library/Icingadb/Widget/ItemTable/StateItemTable.php b/library/Icingadb/Widget/ItemTable/StateItemTable.php
new file mode 100644
index 0000000..5f9b38a
--- /dev/null
+++ b/library/Icingadb/Widget/ItemTable/StateItemTable.php
@@ -0,0 +1,35 @@
+<?php
+
+/* Icinga DB Web | (c) 2022 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemTable;
+
+use ipl\Html\BaseHtmlElement;
+use ipl\Web\Widget\Icon;
+
+abstract class StateItemTable extends BaseItemTable
+{
+    protected function getVisualLabel()
+    {
+        return new Icon('heartbeat', ['title' => t('Severity')]);
+    }
+
+    protected function assembleColumnHeader(BaseHtmlElement $header, string $name, $label): void
+    {
+        parent::assembleColumnHeader($header, $name, $label);
+
+        switch (true) {
+            case substr($name, -7) === '.output':
+            case substr($name, -12) === '.long_output':
+                $header->getAttributes()->add('class', 'has-plugin-output');
+                break;
+            case substr($name, -22) === '.icon_image.icon_image':
+                $header->getAttributes()->add('class', 'has-icon-images');
+                break;
+            case substr($name, -17) === '.performance_data':
+            case substr($name, -28) === '.normalized_performance_data':
+                $header->getAttributes()->add('class', 'has-performance-data');
+                break;
+        }
+    }
+}
diff --git a/library/Icingadb/Widget/ItemTable/StateRowItem.php b/library/Icingadb/Widget/ItemTable/StateRowItem.php
new file mode 100644
index 0000000..6e2cb5c
--- /dev/null
+++ b/library/Icingadb/Widget/ItemTable/StateRowItem.php
@@ -0,0 +1,139 @@
+<?php
+
+/* Icinga DB Web | (c) 2022 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget\ItemTable;
+
+use Icinga\Module\Icingadb\Common\HostStates;
+use Icinga\Module\Icingadb\Common\Icons;
+use Icinga\Module\Icingadb\Common\ServiceStates;
+use Icinga\Module\Icingadb\Model\Host;
+use Icinga\Module\Icingadb\Util\PerfDataSet;
+use Icinga\Module\Icingadb\Util\PluginOutput;
+use Icinga\Module\Icingadb\Widget\CheckAttempt;
+use Icinga\Module\Icingadb\Widget\EmptyState;
+use Icinga\Module\Icingadb\Widget\IconImage;
+use Icinga\Module\Icingadb\Widget\PluginOutputContainer;
+use ipl\Html\Attributes;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\HtmlElement;
+use ipl\Html\HtmlString;
+use ipl\Html\Text;
+use ipl\Web\Widget\Icon;
+use ipl\Web\Widget\StateBall;
+use ipl\Web\Widget\TimeSince;
+use ipl\Web\Widget\TimeUntil;
+
+abstract class StateRowItem extends BaseRowItem
+{
+    /** @var StateItemTable */
+    protected $list;
+
+    protected function getHandledIcon(): string
+    {
+        switch (true) {
+            case $this->item->state->in_downtime:
+                return Icons::IN_DOWNTIME;
+            case $this->item->state->is_acknowledged:
+                return Icons::IS_ACKNOWLEDGED;
+            case $this->item->state->is_flapping:
+                return Icons::IS_FLAPPING;
+            default:
+                return Icons::HOST_DOWN;
+        }
+    }
+
+    protected function assembleVisual(BaseHtmlElement $visual)
+    {
+        $stateBall = new StateBall($this->item->state->getStateText(), StateBall::SIZE_LARGE);
+
+        if ($this->item->state->is_handled) {
+            $stateBall->addHtml(new Icon($this->getHandledIcon()));
+            $stateBall->getAttributes()->add('class', 'handled');
+        }
+
+        $visual->addHtml($stateBall);
+        if ($this->item->state->state_type === 'soft') {
+            $visual->addHtml(new CheckAttempt(
+                (int) $this->item->state->check_attempt,
+                (int) $this->item->max_check_attempts
+            ));
+        }
+    }
+
+    protected function assembleCell(BaseHtmlElement $cell, string $path, $value)
+    {
+        switch (true) {
+            case $path === 'state.output':
+            case $path === 'state.long_output':
+                if (empty($value)) {
+                    $pluginOutput = new EmptyState(t('Output unavailable.'));
+                } else {
+                    $pluginOutput = new PluginOutputContainer(PluginOutput::fromObject($this->item));
+                }
+
+                $cell->addHtml($pluginOutput)
+                    ->getAttributes()
+                    ->add('class', 'has-plugin-output');
+                break;
+            case $path === 'state.soft_state':
+            case $path === 'state.hard_state':
+            case $path === 'state.previous_soft_state':
+            case $path === 'state.previous_hard_state':
+                $stateType = substr($path, 6);
+                if ($this->item instanceof Host) {
+                    $stateName = HostStates::translated($this->item->state->$stateType);
+                } else {
+                    $stateName = ServiceStates::translated($this->item->state->$stateType);
+                }
+
+                $cell->addHtml(Text::create($stateName));
+                break;
+            case $path === 'state.last_update':
+            case $path === 'state.last_state_change':
+                $column = substr($path, 6);
+                $cell->addHtml(new TimeSince($this->item->state->$column));
+                break;
+            case $path === 'state.next_check':
+            case $path === 'state.next_update':
+                $column = substr($path, 6);
+                $cell->addHtml(new TimeUntil($this->item->state->$column));
+                break;
+            case $path === 'state.performance_data':
+            case $path === 'state.normalized_performance_data':
+                $perfdataContainer = new HtmlElement('div', Attributes::create(['class' => 'performance-data']));
+
+                $pieChartData = PerfDataSet::fromString($this->item->state->normalized_performance_data)->asArray();
+                foreach ($pieChartData as $perfdata) {
+                    if ($perfdata->isVisualizable()) {
+                        $perfdataContainer->addHtml(new HtmlString($perfdata->asInlinePie()->render()));
+                    }
+                }
+
+                $cell->addHtml($perfdataContainer)
+                    ->getAttributes()
+                    ->add('class', 'has-performance-data');
+                break;
+            case $path === 'is_volatile':
+            case $path === 'host.is_volatile':
+            case substr($path, -8) == '_enabled':
+            case (bool) preg_match('/state\.(is_|in_)/', $path):
+                if ($value) {
+                    $cell->addHtml(new Icon('check'));
+                }
+
+                break;
+            case $path === 'icon_image.icon_image':
+                $cell->addHtml(new IconImage($value, $this->item->icon_image_alt))
+                    ->getAttributes()
+                    ->add('class', 'has-icon-images');
+                break;
+            default:
+                if (preg_match('/(^id|_id|.id|_checksum|_bin)$/', $path)) {
+                    $value = bin2hex($value);
+                }
+
+                $cell->addHtml(Text::create($value));
+        }
+    }
+}
diff --git a/library/Icingadb/Widget/MarkdownLine.php b/library/Icingadb/Widget/MarkdownLine.php
new file mode 100644
index 0000000..74c413d
--- /dev/null
+++ b/library/Icingadb/Widget/MarkdownLine.php
@@ -0,0 +1,28 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget;
+
+use Icinga\Web\Helper\Markdown;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\DeferredText;
+
+class MarkdownLine extends BaseHtmlElement
+{
+    protected $tag = 'section';
+
+    protected $defaultAttributes = ['class' => ['markdown', 'inline']];
+
+    /**
+     * MarkdownLine constructor.
+     *
+     * @param string $line
+     */
+    public function __construct(string $line)
+    {
+        $this->add((new DeferredText(function () use ($line) {
+            return Markdown::line($line);
+        }))->setEscaped(true));
+    }
+}
diff --git a/library/Icingadb/Widget/MarkdownText.php b/library/Icingadb/Widget/MarkdownText.php
new file mode 100644
index 0000000..43db03e
--- /dev/null
+++ b/library/Icingadb/Widget/MarkdownText.php
@@ -0,0 +1,28 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget;
+
+use Icinga\Web\Helper\Markdown;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\DeferredText;
+
+class MarkdownText extends BaseHtmlElement
+{
+    protected $tag = 'section';
+
+    protected $defaultAttributes = ['class' => 'markdown'];
+
+    /**
+     * MarkdownText constructor.
+     *
+     * @param string $text
+     */
+    public function __construct(string $text)
+    {
+        $this->add((new DeferredText(function () use ($text) {
+            return Markdown::text($text);
+        }))->setEscaped(true));
+    }
+}
diff --git a/library/Icingadb/Widget/Notice.php b/library/Icingadb/Widget/Notice.php
new file mode 100644
index 0000000..998ad30
--- /dev/null
+++ b/library/Icingadb/Widget/Notice.php
@@ -0,0 +1,31 @@
+<?php
+
+/* Icinga DB Web | (c) 2022 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget;
+
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\HtmlElement;
+use ipl\Web\Widget\Icon;
+
+class Notice extends BaseHtmlElement
+{
+    /** @var mixed */
+    protected $content;
+
+    protected $tag = 'p';
+
+    protected $defaultAttributes = ['class' => 'notice'];
+
+    public function __construct($content)
+    {
+        $this->content = $content;
+    }
+
+    protected function assemble()
+    {
+        $this->addHtml(new Icon('triangle-exclamation'));
+        $this->addHtml((new HtmlElement('span'))->add($this->content));
+        $this->addHtml(new Icon('triangle-exclamation'));
+    }
+}
diff --git a/library/Icingadb/Widget/PluginOutputContainer.php b/library/Icingadb/Widget/PluginOutputContainer.php
new file mode 100644
index 0000000..a8ff578
--- /dev/null
+++ b/library/Icingadb/Widget/PluginOutputContainer.php
@@ -0,0 +1,22 @@
+<?php
+
+/* Icinga DB Web | (c) 2021 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget;
+
+use Icinga\Module\Icingadb\Util\PluginOutput;
+use ipl\Html\BaseHtmlElement;
+
+class PluginOutputContainer extends BaseHtmlElement
+{
+    protected $tag = 'div';
+
+    public function __construct(PluginOutput $output)
+    {
+        $this->setHtmlContent($output);
+
+        $this->getAttributes()->registerAttributeCallback('class', function () use ($output) {
+            return $output->isHtml() ? 'plugin-output' : 'plugin-output preformatted';
+        });
+    }
+}
diff --git a/library/Icingadb/Widget/ServiceStateBadges.php b/library/Icingadb/Widget/ServiceStateBadges.php
new file mode 100644
index 0000000..fee2586
--- /dev/null
+++ b/library/Icingadb/Widget/ServiceStateBadges.php
@@ -0,0 +1,46 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget;
+
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Common\ServiceStates;
+use Icinga\Module\Icingadb\Common\StateBadges;
+use ipl\Web\Url;
+
+class ServiceStateBadges extends StateBadges
+{
+    protected function getBaseUrl(): Url
+    {
+        return Links::services();
+    }
+
+    protected function getType(): string
+    {
+        return 'service';
+    }
+
+    protected function getPrefix(): string
+    {
+        return 'services';
+    }
+
+    protected function getStateInt(string $state): int
+    {
+        return ServiceStates::int($state);
+    }
+
+    protected function assemble()
+    {
+        $this->addAttributes(['class' => 'service-state-badges']);
+
+        $this->add(array_filter([
+            $this->createGroup('critical'),
+            $this->createGroup('warning'),
+            $this->createGroup('unknown'),
+            $this->createBadge('ok'),
+            $this->createBadge('pending')
+        ]));
+    }
+}
diff --git a/library/Icingadb/Widget/ServiceStatusBar.php b/library/Icingadb/Widget/ServiceStatusBar.php
new file mode 100644
index 0000000..fd80835
--- /dev/null
+++ b/library/Icingadb/Widget/ServiceStatusBar.php
@@ -0,0 +1,24 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget;
+
+use Icinga\Module\Icingadb\Common\BaseStatusBar;
+use ipl\Html\BaseHtmlElement;
+
+class ServiceStatusBar extends BaseStatusBar
+{
+    protected function assembleTotal(BaseHtmlElement $total)
+    {
+        $total->add(sprintf(
+            tp('%d Service', '%d Services', $this->summary->services_total),
+            $this->summary->services_total
+        ));
+    }
+
+    protected function createStateBadges(): BaseHtmlElement
+    {
+        return new ServiceStateBadges($this->summary);
+    }
+}
diff --git a/library/Icingadb/Widget/ServiceSummaryDonut.php b/library/Icingadb/Widget/ServiceSummaryDonut.php
new file mode 100644
index 0000000..8141f86
--- /dev/null
+++ b/library/Icingadb/Widget/ServiceSummaryDonut.php
@@ -0,0 +1,78 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget;
+
+use Icinga\Chart\Donut;
+use Icinga\Data\Filter\Filter;
+use Icinga\Module\Icingadb\Common\BaseFilter;
+use Icinga\Module\Icingadb\Common\Links;
+use Icinga\Module\Icingadb\Model\ServicestateSummary;
+use ipl\Html\Attributes;
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\HtmlElement;
+use ipl\Html\HtmlString;
+use ipl\Html\TemplateString;
+use ipl\Html\Text;
+use ipl\Web\Common\Card;
+use ipl\Web\Filter\QueryString;
+
+class ServiceSummaryDonut extends Card
+{
+    use BaseFilter;
+
+    protected $defaultAttributes = ['class' => 'donut-container', 'data-base-target' => '_next'];
+
+    /** @var ServicestateSummary */
+    protected $summary;
+
+    public function __construct(ServicestateSummary $summary)
+    {
+        $this->summary = $summary;
+    }
+
+    protected function assembleBody(BaseHtmlElement $body)
+    {
+        $donut = (new Donut())
+            ->addSlice($this->summary->services_ok, ['class' => 'slice-state-ok'])
+            ->addSlice($this->summary->services_warning_handled, ['class' => 'slice-state-warning-handled'])
+            ->addSlice($this->summary->services_warning_unhandled, ['class' => 'slice-state-warning'])
+            ->addSlice($this->summary->services_critical_handled, ['class' => 'slice-state-critical-handled'])
+            ->addSlice($this->summary->services_critical_unhandled, ['class' => 'slice-state-critical'])
+            ->addSlice($this->summary->services_unknown_handled, ['class' => 'slice-state-unknown-handled'])
+            ->addSlice($this->summary->services_unknown_unhandled, ['class' => 'slice-state-unknown'])
+            ->addSlice($this->summary->services_pending, ['class' => 'slice-state-pending'])
+            ->setLabelBig($this->summary->services_critical_unhandled)
+            ->setLabelBigUrl(Links::services()->addFilter(
+                Filter::fromQueryString(QueryString::render($this->getBaseFilter()))
+            )->addParams([
+                'service.state.soft_state' => 2,
+                'service.state.is_handled' => 'n',
+                'sort' => 'service.state.last_state_change'
+            ]))
+            ->setLabelBigEyeCatching($this->summary->services_critical_unhandled > 0)
+            ->setLabelSmall(t('Critical'));
+
+        $body->addHtml(
+            new HtmlElement('div', Attributes::create(['class' => 'donut']), new HtmlString($donut->render()))
+        );
+    }
+
+    protected function assembleFooter(BaseHtmlElement $footer)
+    {
+        $footer->addHtml((new ServiceStateBadges($this->summary))->setBaseFilter($this->getBaseFilter()));
+    }
+
+    protected function assembleHeader(BaseHtmlElement $header)
+    {
+        $header->addHtml(
+            new HtmlElement('h2', null, Text::create(t('Services'))),
+            new HtmlElement('span', Attributes::create(['class' => 'meta']), TemplateString::create(
+                t('{{#total}}Total{{/total}} %d'),
+                ['total' => new HtmlElement('span')],
+                (int) $this->summary->services_total
+            ))
+        );
+    }
+}
diff --git a/library/Icingadb/Widget/ShowMore.php b/library/Icingadb/Widget/ShowMore.php
new file mode 100644
index 0000000..40f2a4d
--- /dev/null
+++ b/library/Icingadb/Widget/ShowMore.php
@@ -0,0 +1,61 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget;
+
+use ipl\Html\BaseHtmlElement;
+use ipl\Orm\ResultSet;
+use ipl\Web\Common\BaseTarget;
+use ipl\Web\Url;
+use ipl\Web\Widget\ActionLink;
+
+class ShowMore extends BaseHtmlElement
+{
+    use BaseTarget;
+
+    protected $defaultAttributes = ['class' => 'show-more'];
+
+    protected $tag = 'div';
+
+    protected $resultSet;
+
+    protected $url;
+
+    protected $label;
+
+    public function __construct(ResultSet $resultSet, Url $url, string $label = null)
+    {
+        $this->label = $label;
+        $this->resultSet = $resultSet;
+        $this->url = $url;
+    }
+
+    public function setLabel(string $label): self
+    {
+        $this->label = $label;
+
+        return $this;
+    }
+
+    public function getLabel(): string
+    {
+        return $this->label ?: t('Show More');
+    }
+
+    public function renderUnwrapped(): string
+    {
+        if ($this->resultSet->hasMore()) {
+            return parent::renderUnwrapped();
+        }
+
+        return '';
+    }
+
+    protected function assemble()
+    {
+        if ($this->resultSet->hasMore()) {
+            $this->add(new ActionLink($this->getLabel(), $this->url));
+        }
+    }
+}
diff --git a/library/Icingadb/Widget/StateBadge.php b/library/Icingadb/Widget/StateBadge.php
new file mode 100644
index 0000000..7cc81a9
--- /dev/null
+++ b/library/Icingadb/Widget/StateBadge.php
@@ -0,0 +1,49 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget;
+
+use ipl\Html\BaseHtmlElement;
+
+class StateBadge extends BaseHtmlElement
+{
+    protected $defaultAttributes = ['class' => 'state-badge'];
+
+    /** @var mixed Badge content */
+    protected $content;
+
+    /** @var bool Whether the state is handled */
+    protected $isHandled;
+
+    /** @var string Textual representation of a state */
+    protected $state;
+
+    /**
+     * Create a new state badge
+     *
+     * @param mixed  $content   Content of the badge
+     * @param string $state     Textual representation of a state
+     * @param bool   $isHandled True if state is handled
+     */
+    public function __construct($content, string $state, bool $isHandled = false)
+    {
+        $this->content = $content;
+        $this->isHandled = $isHandled;
+        $this->state = $state;
+    }
+
+    protected function assemble()
+    {
+        $this->setTag('span');
+
+        $class = "state-{$this->state}";
+        if ($this->isHandled) {
+            $class .= ' handled';
+        }
+
+        $this->addAttributes(['class' => $class]);
+
+        $this->add($this->content);
+    }
+}
diff --git a/library/Icingadb/Widget/StateChange.php b/library/Icingadb/Widget/StateChange.php
new file mode 100644
index 0000000..0bf4fa3
--- /dev/null
+++ b/library/Icingadb/Widget/StateChange.php
@@ -0,0 +1,98 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget;
+
+use ipl\Html\BaseHtmlElement;
+use ipl\Web\Widget\StateBall;
+
+class StateChange extends BaseHtmlElement
+{
+    protected $previousState;
+
+    protected $state;
+
+    protected $previousStateBallSize = StateBall::SIZE_BIG;
+
+    protected $currentStateBallSize = StateBall::SIZE_BIG;
+
+    protected $defaultAttributes = ['class' => 'state-change'];
+
+    protected $tag = 'div';
+
+    public function __construct(string $state, string $previousState)
+    {
+        $this->previousState = $previousState;
+        $this->state = $state;
+    }
+
+    /**
+     * Set the state ball size for the previous state
+     *
+     * @param string $size
+     *
+     * @return $this
+     */
+    public function setPreviousStateBallSize(string $size): self
+    {
+        $this->previousStateBallSize = $size;
+
+        return $this;
+    }
+
+    /**
+     * Set the state ball size for the current state
+     *
+     * @param string $size
+     *
+     * @return $this
+     */
+    public function setCurrentStateBallSize(string $size): self
+    {
+        $this->currentStateBallSize = $size;
+
+        return $this;
+    }
+
+    protected function assemble()
+    {
+        if ($this->isRightBiggerThanLeft()) {
+            $this->getAttributes()->add('class', 'reversed-state-balls');
+
+            $this->addHtml(
+                new StateBall($this->state, $this->currentStateBallSize),
+                new StateBall($this->previousState, $this->previousStateBallSize)
+            );
+        } else {
+            $this->addHtml(
+                new StateBall($this->previousState, $this->previousStateBallSize),
+                new StateBall($this->state, $this->currentStateBallSize)
+            );
+        }
+    }
+
+    protected function isRightBiggerThanLeft(): bool
+    {
+        $left = $this->previousStateBallSize;
+        $right = $this->currentStateBallSize;
+
+        if ($left === $right) {
+            return false;
+        } elseif ($left === StateBall::SIZE_LARGE) {
+            return false;
+        }
+
+        $map = [
+            StateBall::SIZE_BIG => [false, [StateBall::SIZE_LARGE]],
+            StateBall::SIZE_MEDIUM_LARGE => [false, [StateBall::SIZE_BIG, StateBall::SIZE_LARGE]],
+            StateBall::SIZE_MEDIUM => [true, [StateBall::SIZE_TINY, StateBall::SIZE_SMALL]],
+            StateBall::SIZE_SMALL => [true, [StateBall::SIZE_TINY]]
+        ];
+
+        list($negate, $sizes) = $map[$left];
+        $found = in_array($right, $sizes, true);
+
+        return ($negate && ! $found) || (! $negate && $found);
+    }
+}
diff --git a/library/Icingadb/Widget/TagList.php b/library/Icingadb/Widget/TagList.php
new file mode 100644
index 0000000..6a28a9c
--- /dev/null
+++ b/library/Icingadb/Widget/TagList.php
@@ -0,0 +1,35 @@
+<?php
+
+/* Icinga DB Web | (c) 2020 Icinga GmbH | GPLv2 */
+
+namespace Icinga\Module\Icingadb\Widget;
+
+use ipl\Html\BaseHtmlElement;
+use ipl\Html\Html;
+use ipl\Web\Widget\Link;
+
+class TagList extends BaseHtmlElement
+{
+    protected $content = [];
+
+    protected $defaultAttributes = ['class' => 'tag-list'];
+
+    protected $tag = 'div';
+
+    public function addLink($content, $url): self
+    {
+        $this->content[] = new Link($content, $url);
+
+        return $this;
+    }
+
+    public function hasContent(): bool
+    {
+        return ! empty($this->content);
+    }
+
+    protected function assemble()
+    {
+        $this->add(Html::wrapEach($this->content, 'li'));
+    }
+}