From 2aa4a82499d4becd2284cdb482213d541b8804dd Mon Sep 17 00:00:00 2001 From: Daniel Baumann Date: Sun, 28 Apr 2024 16:29:10 +0200 Subject: Adding upstream version 86.0.1. Signed-off-by: Daniel Baumann --- dom/serviceworkers/FetchEventOpChild.cpp | 495 +++ dom/serviceworkers/FetchEventOpChild.h | 83 + dom/serviceworkers/FetchEventOpParent.cpp | 30 + dom/serviceworkers/FetchEventOpParent.h | 36 + dom/serviceworkers/FetchEventOpProxyChild.cpp | 160 + dom/serviceworkers/FetchEventOpProxyChild.h | 54 + dom/serviceworkers/FetchEventOpProxyParent.cpp | 190 ++ dom/serviceworkers/FetchEventOpProxyParent.h | 68 + .../IPCServiceWorkerDescriptor.ipdlh | 30 + .../IPCServiceWorkerRegistrationDescriptor.ipdlh | 58 + dom/serviceworkers/PFetchEventOp.ipdl | 26 + dom/serviceworkers/PFetchEventOpProxy.ipdl | 26 + dom/serviceworkers/PServiceWorker.ipdl | 27 + dom/serviceworkers/PServiceWorkerContainer.ipdl | 40 + dom/serviceworkers/PServiceWorkerManager.ipdl | 50 + dom/serviceworkers/PServiceWorkerRegistration.ipdl | 33 + dom/serviceworkers/PServiceWorkerUpdater.ipdl | 25 + .../RemoteServiceWorkerContainerImpl.cpp | 238 ++ .../RemoteServiceWorkerContainerImpl.h | 63 + dom/serviceworkers/RemoteServiceWorkerImpl.cpp | 118 + dom/serviceworkers/RemoteServiceWorkerImpl.h | 49 + .../RemoteServiceWorkerRegistrationImpl.cpp | 170 + .../RemoteServiceWorkerRegistrationImpl.h | 55 + dom/serviceworkers/ServiceWorker.cpp | 274 ++ dom/serviceworkers/ServiceWorker.h | 123 + dom/serviceworkers/ServiceWorkerActors.cpp | 39 + dom/serviceworkers/ServiceWorkerActors.h | 39 + dom/serviceworkers/ServiceWorkerChild.cpp | 71 + dom/serviceworkers/ServiceWorkerChild.h | 46 + dom/serviceworkers/ServiceWorkerCloneData.cpp | 126 + dom/serviceworkers/ServiceWorkerCloneData.h | 82 + dom/serviceworkers/ServiceWorkerContainer.cpp | 835 +++++ dom/serviceworkers/ServiceWorkerContainer.h | 172 + dom/serviceworkers/ServiceWorkerContainerChild.cpp | 74 + dom/serviceworkers/ServiceWorkerContainerChild.h | 49 + dom/serviceworkers/ServiceWorkerContainerImpl.cpp | 189 ++ dom/serviceworkers/ServiceWorkerContainerImpl.h | 54 + .../ServiceWorkerContainerParent.cpp | 131 + dom/serviceworkers/ServiceWorkerContainerParent.h | 57 + dom/serviceworkers/ServiceWorkerContainerProxy.cpp | 154 + dom/serviceworkers/ServiceWorkerContainerProxy.h | 48 + dom/serviceworkers/ServiceWorkerDescriptor.cpp | 143 + dom/serviceworkers/ServiceWorkerDescriptor.h | 100 + dom/serviceworkers/ServiceWorkerEvents.cpp | 1285 ++++++++ dom/serviceworkers/ServiceWorkerEvents.h | 308 ++ dom/serviceworkers/ServiceWorkerIPCUtils.h | 35 + dom/serviceworkers/ServiceWorkerImpl.cpp | 78 + dom/serviceworkers/ServiceWorkerImpl.h | 47 + dom/serviceworkers/ServiceWorkerInfo.cpp | 262 ++ dom/serviceworkers/ServiceWorkerInfo.h | 172 + .../ServiceWorkerInterceptController.cpp | 120 + .../ServiceWorkerInterceptController.h | 27 + dom/serviceworkers/ServiceWorkerJob.cpp | 222 ++ dom/serviceworkers/ServiceWorkerJob.h | 126 + dom/serviceworkers/ServiceWorkerJobQueue.cpp | 122 + dom/serviceworkers/ServiceWorkerJobQueue.h | 42 + dom/serviceworkers/ServiceWorkerManager.cpp | 3411 ++++++++++++++++++++ dom/serviceworkers/ServiceWorkerManager.h | 425 +++ dom/serviceworkers/ServiceWorkerManagerChild.cpp | 110 + dom/serviceworkers/ServiceWorkerManagerChild.h | 60 + dom/serviceworkers/ServiceWorkerManagerParent.cpp | 343 ++ dom/serviceworkers/ServiceWorkerManagerParent.h | 77 + dom/serviceworkers/ServiceWorkerManagerService.cpp | 259 ++ dom/serviceworkers/ServiceWorkerManagerService.h | 78 + dom/serviceworkers/ServiceWorkerOp.cpp | 1729 ++++++++++ dom/serviceworkers/ServiceWorkerOp.h | 180 ++ dom/serviceworkers/ServiceWorkerOpArgs.ipdlh | 132 + dom/serviceworkers/ServiceWorkerOpPromise.h | 40 + dom/serviceworkers/ServiceWorkerParent.cpp | 64 + dom/serviceworkers/ServiceWorkerParent.h | 46 + dom/serviceworkers/ServiceWorkerPrivate.cpp | 2139 ++++++++++++ dom/serviceworkers/ServiceWorkerPrivate.h | 305 ++ dom/serviceworkers/ServiceWorkerPrivateImpl.cpp | 1085 +++++++ dom/serviceworkers/ServiceWorkerPrivateImpl.h | 233 ++ dom/serviceworkers/ServiceWorkerProxy.cpp | 124 + dom/serviceworkers/ServiceWorkerProxy.h | 63 + dom/serviceworkers/ServiceWorkerRegisterJob.cpp | 59 + dom/serviceworkers/ServiceWorkerRegisterJob.h | 35 + dom/serviceworkers/ServiceWorkerRegistrar.cpp | 1280 ++++++++ dom/serviceworkers/ServiceWorkerRegistrar.h | 115 + .../ServiceWorkerRegistrarTypes.ipdlh | 30 + dom/serviceworkers/ServiceWorkerRegistration.cpp | 548 ++++ dom/serviceworkers/ServiceWorkerRegistration.h | 159 + .../ServiceWorkerRegistrationChild.cpp | 92 + .../ServiceWorkerRegistrationChild.h | 54 + .../ServiceWorkerRegistrationDescriptor.cpp | 276 ++ .../ServiceWorkerRegistrationDescriptor.h | 103 + .../ServiceWorkerRegistrationImpl.cpp | 982 ++++++ dom/serviceworkers/ServiceWorkerRegistrationImpl.h | 133 + .../ServiceWorkerRegistrationInfo.cpp | 838 +++++ dom/serviceworkers/ServiceWorkerRegistrationInfo.h | 259 ++ .../ServiceWorkerRegistrationListener.h | 37 + .../ServiceWorkerRegistrationParent.cpp | 105 + .../ServiceWorkerRegistrationParent.h | 49 + .../ServiceWorkerRegistrationProxy.cpp | 388 +++ .../ServiceWorkerRegistrationProxy.h | 88 + dom/serviceworkers/ServiceWorkerScriptCache.cpp | 1509 +++++++++ dom/serviceworkers/ServiceWorkerScriptCache.h | 56 + .../ServiceWorkerShutdownBlocker.cpp | 286 ++ dom/serviceworkers/ServiceWorkerShutdownBlocker.h | 157 + dom/serviceworkers/ServiceWorkerShutdownState.cpp | 168 + dom/serviceworkers/ServiceWorkerShutdownState.h | 63 + .../ServiceWorkerUnregisterCallback.cpp | 37 + .../ServiceWorkerUnregisterCallback.h | 43 + dom/serviceworkers/ServiceWorkerUnregisterJob.cpp | 139 + dom/serviceworkers/ServiceWorkerUnregisterJob.h | 38 + dom/serviceworkers/ServiceWorkerUpdateJob.cpp | 543 ++++ dom/serviceworkers/ServiceWorkerUpdateJob.h | 99 + dom/serviceworkers/ServiceWorkerUpdaterChild.cpp | 67 + dom/serviceworkers/ServiceWorkerUpdaterChild.h | 37 + dom/serviceworkers/ServiceWorkerUpdaterParent.cpp | 30 + dom/serviceworkers/ServiceWorkerUpdaterParent.h | 31 + dom/serviceworkers/ServiceWorkerUtils.cpp | 150 + dom/serviceworkers/ServiceWorkerUtils.h | 57 + dom/serviceworkers/moz.build | 132 + dom/serviceworkers/test/.eslintrc.js | 9 + dom/serviceworkers/test/ForceRefreshChild.jsm | 14 + dom/serviceworkers/test/ForceRefreshParent.jsm | 79 + .../test/abrupt_completion_worker.js | 18 + .../test/activate_event_error_worker.js | 4 + dom/serviceworkers/test/async_waituntil_worker.js | 53 + .../test/blocking_install_event_worker.js | 22 + dom/serviceworkers/test/browser.ini | 43 + dom/serviceworkers/test/browser_antitracking.js | 104 + .../test/browser_antitracking_subiframes.js | 105 + .../test/browser_base_force_refresh.html | 27 + .../test/browser_cached_force_refresh.html | 59 + .../browser_devtools_serviceworker_interception.js | 297 ++ dom/serviceworkers/test/browser_download.js | 96 + .../test/browser_download_canceled.js | 155 + dom/serviceworkers/test/browser_force_refresh.js | 85 + .../browser_intercepted_channel_process_swap.js | 110 + .../test/browser_remote_type_process_swap.js | 138 + .../test/browser_storage_permission.js | 297 ++ .../test/browser_storage_recovery.js | 155 + .../test/browser_unregister_with_containers.js | 153 + .../test/browser_userContextId_openWindow.js | 166 + dom/serviceworkers/test/bug1151916_driver.html | 53 + dom/serviceworkers/test/bug1151916_worker.js | 15 + dom/serviceworkers/test/bug1240436_worker.js | 2 + dom/serviceworkers/test/chrome.ini | 21 + dom/serviceworkers/test/chrome_helpers.js | 71 + dom/serviceworkers/test/claim_clients/client.html | 43 + dom/serviceworkers/test/claim_oninstall_worker.js | 7 + dom/serviceworkers/test/claim_worker_1.js | 32 + dom/serviceworkers/test/claim_worker_2.js | 34 + dom/serviceworkers/test/close_test.js | 22 + dom/serviceworkers/test/console_monitor.js | 44 + dom/serviceworkers/test/controller/index.html | 72 + .../test/create_another_sharedWorker.html | 6 + dom/serviceworkers/test/download/window.html | 46 + dom/serviceworkers/test/download/worker.js | 34 + .../download_canceled/page_download_canceled.html | 58 + .../download_canceled/server-stream-download.sjs | 121 + .../test/download_canceled/sw_download_canceled.js | 150 + dom/serviceworkers/test/empty.html | 0 dom/serviceworkers/test/empty.js | 0 dom/serviceworkers/test/empty_with_utils.html | 13 + dom/serviceworkers/test/error_reporting_helpers.js | 73 + dom/serviceworkers/test/eval_worker.js | 1 + .../test/eventsource/eventsource.resource | 22 + .../test/eventsource/eventsource.resource^headers^ | 3 + .../eventsource/eventsource_cors_response.html | 75 + .../eventsource_cors_response_intercept_worker.js | 30 + .../eventsource_mixed_content_cors_response.html | 75 + ...mixed_content_cors_response_intercept_worker.js | 29 + .../eventsource/eventsource_opaque_response.html | 75 + ...eventsource_opaque_response_intercept_worker.js | 30 + .../eventsource/eventsource_register_worker.html | 27 + .../eventsource_synthetic_response.html | 75 + ...ntsource_synthetic_response_intercept_worker.js | 27 + .../test/eventsource/eventsource_worker_helper.js | 17 + dom/serviceworkers/test/fetch.js | 33 + .../test/fetch/cookie/cookie_test.js | 11 + dom/serviceworkers/test/fetch/cookie/register.html | 19 + .../test/fetch/cookie/unregister.html | 12 + dom/serviceworkers/test/fetch/deliver-gzip.sjs | 17 + dom/serviceworkers/test/fetch/fetch_tests.js | 716 ++++ .../test/fetch/fetch_worker_script.js | 28 + dom/serviceworkers/test/fetch/hsts/embedder.html | 7 + dom/serviceworkers/test/fetch/hsts/hsts_test.js | 11 + dom/serviceworkers/test/fetch/hsts/image-20px.png | Bin 0 -> 87 bytes dom/serviceworkers/test/fetch/hsts/image-40px.png | Bin 0 -> 123 bytes dom/serviceworkers/test/fetch/hsts/image.html | 13 + dom/serviceworkers/test/fetch/hsts/realindex.html | 8 + dom/serviceworkers/test/fetch/hsts/register.html | 14 + .../test/fetch/hsts/register.html^headers^ | 2 + dom/serviceworkers/test/fetch/hsts/unregister.html | 12 + .../test/fetch/https/clonedresponse/https_test.js | 19 + .../test/fetch/https/clonedresponse/index.html | 4 + .../test/fetch/https/clonedresponse/register.html | 14 + .../fetch/https/clonedresponse/unregister.html | 12 + dom/serviceworkers/test/fetch/https/https_test.js | 31 + dom/serviceworkers/test/fetch/https/index.html | 4 + dom/serviceworkers/test/fetch/https/register.html | 20 + .../test/fetch/https/unregister.html | 12 + .../test/fetch/imagecache-maxage/image-20px.png | Bin 0 -> 87 bytes .../test/fetch/imagecache-maxage/image-40px.png | Bin 0 -> 123 bytes .../test/fetch/imagecache-maxage/index.html | 29 + .../test/fetch/imagecache-maxage/maxage_test.js | 45 + .../test/fetch/imagecache-maxage/register.html | 14 + .../test/fetch/imagecache-maxage/unregister.html | 12 + .../test/fetch/imagecache/image-20px.png | Bin 0 -> 87 bytes .../test/fetch/imagecache/image-40px.png | Bin 0 -> 123 bytes .../test/fetch/imagecache/imagecache_test.js | 15 + .../test/fetch/imagecache/index.html | 20 + .../test/fetch/imagecache/postmortem.html | 9 + .../test/fetch/imagecache/register.html | 16 + .../test/fetch/imagecache/unregister.html | 12 + .../fetch/importscript-mixedcontent/https_test.js | 31 + .../fetch/importscript-mixedcontent/register.html | 14 + .../importscript-mixedcontent/unregister.html | 12 + dom/serviceworkers/test/fetch/index.html | 191 ++ dom/serviceworkers/test/fetch/interrupt.sjs | 20 + .../test/fetch/origin/https/index-https.sjs | 4 + .../test/fetch/origin/https/origin_test.js | 29 + .../test/fetch/origin/https/realindex.html | 6 + .../fetch/origin/https/realindex.html^headers^ | 1 + .../test/fetch/origin/https/register.html | 14 + .../test/fetch/origin/https/unregister.html | 12 + .../test/fetch/origin/index-to-https.sjs | 4 + dom/serviceworkers/test/fetch/origin/index.sjs | 4 + .../test/fetch/origin/origin_test.js | 38 + .../test/fetch/origin/realindex.html | 6 + .../test/fetch/origin/realindex.html^headers^ | 1 + dom/serviceworkers/test/fetch/origin/register.html | 14 + .../test/fetch/origin/unregister.html | 12 + dom/serviceworkers/test/fetch/plugin/plugins.html | 43 + dom/serviceworkers/test/fetch/plugin/worker.js | 15 + dom/serviceworkers/test/fetch/real-file.txt | 1 + dom/serviceworkers/test/fetch/redirect.sjs | 4 + .../test/fetch/requesturl/index.html | 7 + .../test/fetch/requesturl/redirect.sjs | 4 + .../test/fetch/requesturl/redirector.html | 2 + .../test/fetch/requesturl/register.html | 14 + .../test/fetch/requesturl/requesturl_test.js | 21 + .../test/fetch/requesturl/secret.html | 5 + .../test/fetch/requesturl/unregister.html | 12 + dom/serviceworkers/test/fetch/sandbox/index.html | 5 + .../test/fetch/sandbox/intercepted_index.html | 5 + .../test/fetch/sandbox/register.html | 14 + .../test/fetch/sandbox/sandbox_test.js | 5 + .../test/fetch/sandbox/unregister.html | 12 + .../test/fetch/upgrade-insecure/embedder.html | 10 + .../fetch/upgrade-insecure/embedder.html^headers^ | 1 + .../test/fetch/upgrade-insecure/image-20px.png | Bin 0 -> 87 bytes .../test/fetch/upgrade-insecure/image-40px.png | Bin 0 -> 123 bytes .../test/fetch/upgrade-insecure/image.html | 13 + .../test/fetch/upgrade-insecure/realindex.html | 4 + .../test/fetch/upgrade-insecure/register.html | 14 + .../test/fetch/upgrade-insecure/unregister.html | 12 + .../upgrade-insecure/upgrade-insecure_test.js | 11 + dom/serviceworkers/test/fetch_event_worker.js | 364 +++ .../test/file_blob_response_worker.js | 39 + dom/serviceworkers/test/file_js_cache.html | 10 + dom/serviceworkers/test/file_js_cache.js | 5 + dom/serviceworkers/test/file_js_cache_cleanup.js | 16 + .../test/file_js_cache_save_after_load.html | 10 + .../test/file_js_cache_save_after_load.js | 15 + .../test/file_js_cache_syntax_error.html | 10 + .../test/file_js_cache_syntax_error.js | 1 + .../test/file_js_cache_with_sri.html | 12 + .../test/file_notification_openWindow.html | 26 + .../test/file_userContextId_openWindow.js | 3 + .../test/force_refresh_browser_worker.js | 42 + dom/serviceworkers/test/force_refresh_worker.js | 43 + dom/serviceworkers/test/gtest/TestReadWrite.cpp | 939 ++++++ dom/serviceworkers/test/gtest/moz.build | 13 + dom/serviceworkers/test/gzip_redirect_worker.js | 15 + dom/serviceworkers/test/header_checker.sjs | 9 + dom/serviceworkers/test/hello.html | 9 + dom/serviceworkers/test/importscript.sjs | 11 + dom/serviceworkers/test/importscript_worker.js | 46 + .../test/install_event_error_worker.js | 9 + dom/serviceworkers/test/install_event_worker.js | 3 + .../intercepted_channel_process_swap_worker.js | 7 + dom/serviceworkers/test/isolated/README.md | 19 + .../test/isolated/multi-e10s-update/browser.ini | 8 + .../multi-e10s-update/browser_multie10s_update.js | 143 + .../multi-e10s-update/file_multie10s_update.html | 40 + .../multi-e10s-update/server_multie10s_update.sjs | 97 + dom/serviceworkers/test/lazy_worker.js | 8 + dom/serviceworkers/test/lorem_script.js | 8 + .../test/match_all_advanced_worker.js | 5 + .../test/match_all_client/match_all_client_id.html | 31 + .../test/match_all_client_id_worker.js | 28 + .../match_all_clients/match_all_controlled.html | 83 + .../test/match_all_properties_worker.js | 28 + dom/serviceworkers/test/match_all_worker.js | 10 + dom/serviceworkers/test/message_posting_worker.js | 8 + dom/serviceworkers/test/message_receiver.html | 6 + dom/serviceworkers/test/mochitest.ini | 348 ++ dom/serviceworkers/test/nofetch_handler_worker.js | 14 + dom/serviceworkers/test/notification/listener.html | 27 + dom/serviceworkers/test/notification/register.html | 11 + .../test/notification/unregister.html | 12 + .../test/notification_alt/register.html | 11 + .../test/notification_alt/unregister.html | 12 + .../test/notification_constructor_error.js | 1 + dom/serviceworkers/test/notification_get_sw.js | 55 + .../test/notification_openWindow_worker.js | 25 + .../test/notificationclick-otherwindow.html | 30 + dom/serviceworkers/test/notificationclick.html | 27 + dom/serviceworkers/test/notificationclick.js | 23 + .../test/notificationclick_focus.html | 28 + dom/serviceworkers/test/notificationclick_focus.js | 49 + dom/serviceworkers/test/notificationclose.html | 37 + dom/serviceworkers/test/notificationclose.js | 31 + dom/serviceworkers/test/notify_loaded.js | 1 + dom/serviceworkers/test/onmessageerror_worker.js | 54 + dom/serviceworkers/test/opaque_intercept_worker.js | 40 + dom/serviceworkers/test/openWindow_worker.js | 178 + dom/serviceworkers/test/open_window/client.sjs | 69 + dom/serviceworkers/test/page_post_controlled.html | 27 + dom/serviceworkers/test/parse_error_worker.js | 2 + dom/serviceworkers/test/redirect.sjs | 5 + dom/serviceworkers/test/redirect_post.sjs | 35 + dom/serviceworkers/test/redirect_serviceworker.sjs | 4 + dom/serviceworkers/test/register_https.html | 15 + .../sanitize/example_check_and_unregister.html | 22 + dom/serviceworkers/test/sanitize/frame.html | 11 + dom/serviceworkers/test/sanitize/register.html | 9 + dom/serviceworkers/test/sanitize_worker.js | 5 + dom/serviceworkers/test/scope/scope_worker.js | 2 + dom/serviceworkers/test/script_file_upload.js | 13 + dom/serviceworkers/test/self_update_worker.sjs | 43 + dom/serviceworkers/test/server_file_upload.sjs | 17 + dom/serviceworkers/test/service_worker.js | 9 + dom/serviceworkers/test/service_worker_client.html | 28 + dom/serviceworkers/test/serviceworker.html | 12 + .../test/serviceworker_not_sharedworker.js | 20 + dom/serviceworkers/test/serviceworker_wrapper.js | 92 + .../test/serviceworkerinfo_iframe.html | 27 + .../test/serviceworkermanager_iframe.html | 34 + .../test/serviceworkerregistrationinfo_iframe.html | 30 + dom/serviceworkers/test/sharedWorker_fetch.js | 30 + dom/serviceworkers/test/simpleregister/index.html | 51 + dom/serviceworkers/test/simpleregister/ready.html | 14 + .../test/skip_waiting_installed_worker.js | 6 + .../test/skip_waiting_scope/index.html | 33 + .../test/source_message_posting_worker.js | 16 + .../test/storage_recovery_worker.sjs | 23 + dom/serviceworkers/test/streamfilter_server.sjs | 9 + dom/serviceworkers/test/streamfilter_worker.js | 9 + dom/serviceworkers/test/strict_mode_warning.js | 4 + dom/serviceworkers/test/sw_bad_mime_type.js | 1 + .../test/sw_bad_mime_type.js^headers^ | 1 + .../test/sw_clients/file_blob_upload_frame.html | 76 + dom/serviceworkers/test/sw_clients/navigator.html | 34 + dom/serviceworkers/test/sw_clients/refresher.html | 38 + .../test/sw_clients/refresher_cached.html | 37 + .../sw_clients/refresher_cached_compressed.html | Bin 0 -> 560 bytes .../refresher_cached_compressed.html^headers^ | 2 + .../test/sw_clients/refresher_compressed.html | Bin 0 -> 609 bytes .../sw_clients/refresher_compressed.html^headers^ | 2 + .../test/sw_clients/service_worker_controlled.html | 38 + dom/serviceworkers/test/sw_clients/simple.html | 29 + dom/serviceworkers/test/sw_file_upload.js | 16 + dom/serviceworkers/test/sw_storage_not_allow.js | 33 + .../test/swa/worker_scope_different.js | 0 .../test/swa/worker_scope_different.js^headers^ | 1 + .../test/swa/worker_scope_different2.js | 0 .../test/swa/worker_scope_different2.js^headers^ | 1 + .../test/swa/worker_scope_precise.js | 0 .../test/swa/worker_scope_precise.js^headers^ | 1 + .../test/swa/worker_scope_too_deep.js | 0 .../test/swa/worker_scope_too_deep.js^headers^ | 1 + .../test/swa/worker_scope_too_narrow.js | 0 .../test/swa/worker_scope_too_narrow.js^headers^ | 1 + .../test/test_abrupt_completion.html | 146 + dom/serviceworkers/test/test_async_waituntil.html | 91 + dom/serviceworkers/test/test_bad_script_cache.html | 96 + dom/serviceworkers/test/test_bug1151916.html | 104 + dom/serviceworkers/test/test_bug1240436.html | 34 + dom/serviceworkers/test/test_bug1408734.html | 52 + dom/serviceworkers/test/test_claim.html | 171 + dom/serviceworkers/test/test_claim_oninstall.html | 77 + dom/serviceworkers/test/test_client_focus.html | 99 + dom/serviceworkers/test/test_controller.html | 83 + dom/serviceworkers/test/test_cookie_fetch.html | 61 + .../test/test_cross_origin_url_after_redirect.html | 50 + .../test/test_csp_upgrade-insecure_intercept.html | 55 + .../test/test_devtools_bypass_serviceworker.html | 107 + .../test_devtools_track_serviceworker_time.html | 230 ++ .../test/test_empty_serviceworker.html | 46 + dom/serviceworkers/test/test_error_reporting.html | 247 ++ dom/serviceworkers/test/test_escapedSlashes.html | 102 + dom/serviceworkers/test/test_eval_allowed.html | 51 + .../test/test_eval_allowed.html^headers^ | 1 + .../test/test_event_listener_leaks.html | 63 + .../test/test_eventsource_intercept.html | 103 + dom/serviceworkers/test/test_fetch_event.html | 76 + .../test/test_fetch_event_with_thirdpartypref.html | 91 + dom/serviceworkers/test/test_fetch_integrity.html | 228 ++ .../test/test_file_blob_response.html | 78 + dom/serviceworkers/test/test_file_blob_upload.html | 146 + dom/serviceworkers/test/test_file_upload.html | 68 + dom/serviceworkers/test/test_force_refresh.html | 105 + dom/serviceworkers/test/test_gzip_redirect.html | 88 + .../test/test_hsts_upgrade_intercept.html | 66 + dom/serviceworkers/test/test_https_fetch.html | 62 + .../test/test_https_fetch_cloned_response.html | 56 + .../test/test_https_origin_after_redirect.html | 57 + .../test_https_origin_after_redirect_cached.html | 57 + .../test_https_synth_fetch_from_cached_sw.html | 69 + dom/serviceworkers/test/test_imagecache.html | 55 + .../test/test_imagecache_max_age.html | 71 + dom/serviceworkers/test/test_importscript.html | 74 + .../test/test_importscript_mixedcontent.html | 53 + dom/serviceworkers/test/test_install_event.html | 143 + dom/serviceworkers/test/test_install_event_gc.html | 121 + .../test/test_installation_simple.html | 208 ++ dom/serviceworkers/test/test_match_all.html | 83 + .../test/test_match_all_advanced.html | 102 + .../test/test_match_all_client_id.html | 95 + .../test/test_match_all_client_properties.html | 101 + dom/serviceworkers/test/test_navigator.html | 40 + dom/serviceworkers/test/test_nofetch_handler.html | 57 + .../test/test_not_intercept_plugin.html | 75 + .../test/test_notification_constructor_error.html | 51 + dom/serviceworkers/test/test_notification_get.html | 213 ++ .../test/test_notification_openWindow.html | 90 + .../test/test_notificationclick-otherwindow.html | 65 + .../test/test_notificationclick.html | 66 + .../test/test_notificationclick_focus.html | 66 + .../test/test_notificationclose.html | 67 + dom/serviceworkers/test/test_onmessageerror.html | 128 + dom/serviceworkers/test/test_opaque_intercept.html | 93 + dom/serviceworkers/test/test_openWindow.html | 112 + .../test/test_origin_after_redirect.html | 57 + .../test/test_origin_after_redirect_cached.html | 57 + .../test/test_origin_after_redirect_to_https.html | 57 + ...test_origin_after_redirect_to_https_cached.html | 57 + dom/serviceworkers/test/test_post_message.html | 80 + .../test/test_post_message_advanced.html | 109 + .../test/test_post_message_source.html | 66 + dom/serviceworkers/test/test_privateBrowsing.html | 103 + dom/serviceworkers/test/test_register_base.html | 34 + .../test/test_register_https_in_http.html | 45 + .../test/test_sandbox_intercept.html | 56 + dom/serviceworkers/test/test_sanitize.html | 86 + dom/serviceworkers/test/test_sanitize_domain.html | 89 + dom/serviceworkers/test/test_scopes.html | 149 + .../test_script_loader_intercepted_js_cache.html | 224 ++ .../test/test_self_update_worker.html | 136 + .../test/test_service_worker_allowed.html | 74 + dom/serviceworkers/test/test_serviceworker.html | 79 + .../test/test_serviceworker_header.html | 41 + .../test/test_serviceworker_interfaces.html | 114 + .../test/test_serviceworker_interfaces.js | 361 +++ .../test/test_serviceworker_not_sharedworker.html | 66 + .../test/test_serviceworkerinfo.xhtml | 114 + .../test/test_serviceworkermanager.xhtml | 79 + .../test/test_serviceworkerregistrationinfo.xhtml | 155 + dom/serviceworkers/test/test_skip_waiting.html | 86 + dom/serviceworkers/test/test_streamfilter.html | 206 ++ .../test/test_strict_mode_warning.html | 42 + .../test/test_third_party_iframes.html | 288 ++ dom/serviceworkers/test/test_unregister.html | 137 + .../test/test_unresolved_fetch_interception.html | 95 + dom/serviceworkers/test/test_workerUnregister.html | 81 + dom/serviceworkers/test/test_workerUpdate.html | 63 + .../test/test_worker_reference_gc_timeout.html | 76 + .../test/test_workerupdatefoundevent.html | 91 + dom/serviceworkers/test/test_xslt.html | 117 + dom/serviceworkers/test/thirdparty/iframe1.html | 42 + dom/serviceworkers/test/thirdparty/iframe2.html | 14 + dom/serviceworkers/test/thirdparty/register.html | 29 + dom/serviceworkers/test/thirdparty/sw.js | 33 + dom/serviceworkers/test/thirdparty/unregister.html | 19 + dom/serviceworkers/test/thirdparty/worker.js | 1 + dom/serviceworkers/test/unregister/index.html | 26 + dom/serviceworkers/test/unregister/unregister.html | 21 + dom/serviceworkers/test/unresolved_fetch_worker.js | 18 + dom/serviceworkers/test/update_worker.sjs | 13 + dom/serviceworkers/test/updatefoundevent.html | 13 + dom/serviceworkers/test/utils.js | 85 + dom/serviceworkers/test/window_party_iframes.html | 18 + dom/serviceworkers/test/worker.js | 1 + dom/serviceworkers/test/worker2.js | 1 + dom/serviceworkers/test/worker3.js | 1 + dom/serviceworkers/test/workerUpdate/update.html | 23 + dom/serviceworkers/test/worker_unregister.js | 22 + dom/serviceworkers/test/worker_update.js | 25 + dom/serviceworkers/test/worker_updatefoundevent.js | 20 + .../test/worker_updatefoundevent2.js | 1 + dom/serviceworkers/test/xslt/test.xml | 6 + dom/serviceworkers/test/xslt/xslt.sjs | 12 + dom/serviceworkers/test/xslt_worker.js | 58 + 489 files changed, 47429 insertions(+) create mode 100644 dom/serviceworkers/FetchEventOpChild.cpp create mode 100644 dom/serviceworkers/FetchEventOpChild.h create mode 100644 dom/serviceworkers/FetchEventOpParent.cpp create mode 100644 dom/serviceworkers/FetchEventOpParent.h create mode 100644 dom/serviceworkers/FetchEventOpProxyChild.cpp create mode 100644 dom/serviceworkers/FetchEventOpProxyChild.h create mode 100644 dom/serviceworkers/FetchEventOpProxyParent.cpp create mode 100644 dom/serviceworkers/FetchEventOpProxyParent.h create mode 100644 dom/serviceworkers/IPCServiceWorkerDescriptor.ipdlh create mode 100644 dom/serviceworkers/IPCServiceWorkerRegistrationDescriptor.ipdlh create mode 100644 dom/serviceworkers/PFetchEventOp.ipdl create mode 100644 dom/serviceworkers/PFetchEventOpProxy.ipdl create mode 100644 dom/serviceworkers/PServiceWorker.ipdl create mode 100644 dom/serviceworkers/PServiceWorkerContainer.ipdl create mode 100644 dom/serviceworkers/PServiceWorkerManager.ipdl create mode 100644 dom/serviceworkers/PServiceWorkerRegistration.ipdl create mode 100644 dom/serviceworkers/PServiceWorkerUpdater.ipdl create mode 100644 dom/serviceworkers/RemoteServiceWorkerContainerImpl.cpp create mode 100644 dom/serviceworkers/RemoteServiceWorkerContainerImpl.h create mode 100644 dom/serviceworkers/RemoteServiceWorkerImpl.cpp create mode 100644 dom/serviceworkers/RemoteServiceWorkerImpl.h create mode 100644 dom/serviceworkers/RemoteServiceWorkerRegistrationImpl.cpp create mode 100644 dom/serviceworkers/RemoteServiceWorkerRegistrationImpl.h create mode 100644 dom/serviceworkers/ServiceWorker.cpp create mode 100644 dom/serviceworkers/ServiceWorker.h create mode 100644 dom/serviceworkers/ServiceWorkerActors.cpp create mode 100644 dom/serviceworkers/ServiceWorkerActors.h create mode 100644 dom/serviceworkers/ServiceWorkerChild.cpp create mode 100644 dom/serviceworkers/ServiceWorkerChild.h create mode 100644 dom/serviceworkers/ServiceWorkerCloneData.cpp create mode 100644 dom/serviceworkers/ServiceWorkerCloneData.h create mode 100644 dom/serviceworkers/ServiceWorkerContainer.cpp create mode 100644 dom/serviceworkers/ServiceWorkerContainer.h create mode 100644 dom/serviceworkers/ServiceWorkerContainerChild.cpp create mode 100644 dom/serviceworkers/ServiceWorkerContainerChild.h create mode 100644 dom/serviceworkers/ServiceWorkerContainerImpl.cpp create mode 100644 dom/serviceworkers/ServiceWorkerContainerImpl.h create mode 100644 dom/serviceworkers/ServiceWorkerContainerParent.cpp create mode 100644 dom/serviceworkers/ServiceWorkerContainerParent.h create mode 100644 dom/serviceworkers/ServiceWorkerContainerProxy.cpp create mode 100644 dom/serviceworkers/ServiceWorkerContainerProxy.h create mode 100644 dom/serviceworkers/ServiceWorkerDescriptor.cpp create mode 100644 dom/serviceworkers/ServiceWorkerDescriptor.h create mode 100644 dom/serviceworkers/ServiceWorkerEvents.cpp create mode 100644 dom/serviceworkers/ServiceWorkerEvents.h create mode 100644 dom/serviceworkers/ServiceWorkerIPCUtils.h create mode 100644 dom/serviceworkers/ServiceWorkerImpl.cpp create mode 100644 dom/serviceworkers/ServiceWorkerImpl.h create mode 100644 dom/serviceworkers/ServiceWorkerInfo.cpp create mode 100644 dom/serviceworkers/ServiceWorkerInfo.h create mode 100644 dom/serviceworkers/ServiceWorkerInterceptController.cpp create mode 100644 dom/serviceworkers/ServiceWorkerInterceptController.h create mode 100644 dom/serviceworkers/ServiceWorkerJob.cpp create mode 100644 dom/serviceworkers/ServiceWorkerJob.h create mode 100644 dom/serviceworkers/ServiceWorkerJobQueue.cpp create mode 100644 dom/serviceworkers/ServiceWorkerJobQueue.h create mode 100644 dom/serviceworkers/ServiceWorkerManager.cpp create mode 100644 dom/serviceworkers/ServiceWorkerManager.h create mode 100644 dom/serviceworkers/ServiceWorkerManagerChild.cpp create mode 100644 dom/serviceworkers/ServiceWorkerManagerChild.h create mode 100644 dom/serviceworkers/ServiceWorkerManagerParent.cpp create mode 100644 dom/serviceworkers/ServiceWorkerManagerParent.h create mode 100644 dom/serviceworkers/ServiceWorkerManagerService.cpp create mode 100644 dom/serviceworkers/ServiceWorkerManagerService.h create mode 100644 dom/serviceworkers/ServiceWorkerOp.cpp create mode 100644 dom/serviceworkers/ServiceWorkerOp.h create mode 100644 dom/serviceworkers/ServiceWorkerOpArgs.ipdlh create mode 100644 dom/serviceworkers/ServiceWorkerOpPromise.h create mode 100644 dom/serviceworkers/ServiceWorkerParent.cpp create mode 100644 dom/serviceworkers/ServiceWorkerParent.h create mode 100644 dom/serviceworkers/ServiceWorkerPrivate.cpp create mode 100644 dom/serviceworkers/ServiceWorkerPrivate.h create mode 100644 dom/serviceworkers/ServiceWorkerPrivateImpl.cpp create mode 100644 dom/serviceworkers/ServiceWorkerPrivateImpl.h create mode 100644 dom/serviceworkers/ServiceWorkerProxy.cpp create mode 100644 dom/serviceworkers/ServiceWorkerProxy.h create mode 100644 dom/serviceworkers/ServiceWorkerRegisterJob.cpp create mode 100644 dom/serviceworkers/ServiceWorkerRegisterJob.h create mode 100644 dom/serviceworkers/ServiceWorkerRegistrar.cpp create mode 100644 dom/serviceworkers/ServiceWorkerRegistrar.h create mode 100644 dom/serviceworkers/ServiceWorkerRegistrarTypes.ipdlh create mode 100644 dom/serviceworkers/ServiceWorkerRegistration.cpp create mode 100644 dom/serviceworkers/ServiceWorkerRegistration.h create mode 100644 dom/serviceworkers/ServiceWorkerRegistrationChild.cpp create mode 100644 dom/serviceworkers/ServiceWorkerRegistrationChild.h create mode 100644 dom/serviceworkers/ServiceWorkerRegistrationDescriptor.cpp create mode 100644 dom/serviceworkers/ServiceWorkerRegistrationDescriptor.h create mode 100644 dom/serviceworkers/ServiceWorkerRegistrationImpl.cpp create mode 100644 dom/serviceworkers/ServiceWorkerRegistrationImpl.h create mode 100644 dom/serviceworkers/ServiceWorkerRegistrationInfo.cpp create mode 100644 dom/serviceworkers/ServiceWorkerRegistrationInfo.h create mode 100644 dom/serviceworkers/ServiceWorkerRegistrationListener.h create mode 100644 dom/serviceworkers/ServiceWorkerRegistrationParent.cpp create mode 100644 dom/serviceworkers/ServiceWorkerRegistrationParent.h create mode 100644 dom/serviceworkers/ServiceWorkerRegistrationProxy.cpp create mode 100644 dom/serviceworkers/ServiceWorkerRegistrationProxy.h create mode 100644 dom/serviceworkers/ServiceWorkerScriptCache.cpp create mode 100644 dom/serviceworkers/ServiceWorkerScriptCache.h create mode 100644 dom/serviceworkers/ServiceWorkerShutdownBlocker.cpp create mode 100644 dom/serviceworkers/ServiceWorkerShutdownBlocker.h create mode 100644 dom/serviceworkers/ServiceWorkerShutdownState.cpp create mode 100644 dom/serviceworkers/ServiceWorkerShutdownState.h create mode 100644 dom/serviceworkers/ServiceWorkerUnregisterCallback.cpp create mode 100644 dom/serviceworkers/ServiceWorkerUnregisterCallback.h create mode 100644 dom/serviceworkers/ServiceWorkerUnregisterJob.cpp create mode 100644 dom/serviceworkers/ServiceWorkerUnregisterJob.h create mode 100644 dom/serviceworkers/ServiceWorkerUpdateJob.cpp create mode 100644 dom/serviceworkers/ServiceWorkerUpdateJob.h create mode 100644 dom/serviceworkers/ServiceWorkerUpdaterChild.cpp create mode 100644 dom/serviceworkers/ServiceWorkerUpdaterChild.h create mode 100644 dom/serviceworkers/ServiceWorkerUpdaterParent.cpp create mode 100644 dom/serviceworkers/ServiceWorkerUpdaterParent.h create mode 100644 dom/serviceworkers/ServiceWorkerUtils.cpp create mode 100644 dom/serviceworkers/ServiceWorkerUtils.h create mode 100644 dom/serviceworkers/moz.build create mode 100644 dom/serviceworkers/test/.eslintrc.js create mode 100644 dom/serviceworkers/test/ForceRefreshChild.jsm create mode 100644 dom/serviceworkers/test/ForceRefreshParent.jsm create mode 100644 dom/serviceworkers/test/abrupt_completion_worker.js create mode 100644 dom/serviceworkers/test/activate_event_error_worker.js create mode 100644 dom/serviceworkers/test/async_waituntil_worker.js create mode 100644 dom/serviceworkers/test/blocking_install_event_worker.js create mode 100644 dom/serviceworkers/test/browser.ini create mode 100644 dom/serviceworkers/test/browser_antitracking.js create mode 100644 dom/serviceworkers/test/browser_antitracking_subiframes.js create mode 100644 dom/serviceworkers/test/browser_base_force_refresh.html create mode 100644 dom/serviceworkers/test/browser_cached_force_refresh.html create mode 100644 dom/serviceworkers/test/browser_devtools_serviceworker_interception.js create mode 100644 dom/serviceworkers/test/browser_download.js create mode 100644 dom/serviceworkers/test/browser_download_canceled.js create mode 100644 dom/serviceworkers/test/browser_force_refresh.js create mode 100644 dom/serviceworkers/test/browser_intercepted_channel_process_swap.js create mode 100644 dom/serviceworkers/test/browser_remote_type_process_swap.js create mode 100644 dom/serviceworkers/test/browser_storage_permission.js create mode 100644 dom/serviceworkers/test/browser_storage_recovery.js create mode 100644 dom/serviceworkers/test/browser_unregister_with_containers.js create mode 100644 dom/serviceworkers/test/browser_userContextId_openWindow.js create mode 100644 dom/serviceworkers/test/bug1151916_driver.html create mode 100644 dom/serviceworkers/test/bug1151916_worker.js create mode 100644 dom/serviceworkers/test/bug1240436_worker.js create mode 100644 dom/serviceworkers/test/chrome.ini create mode 100644 dom/serviceworkers/test/chrome_helpers.js create mode 100644 dom/serviceworkers/test/claim_clients/client.html create mode 100644 dom/serviceworkers/test/claim_oninstall_worker.js create mode 100644 dom/serviceworkers/test/claim_worker_1.js create mode 100644 dom/serviceworkers/test/claim_worker_2.js create mode 100644 dom/serviceworkers/test/close_test.js create mode 100644 dom/serviceworkers/test/console_monitor.js create mode 100644 dom/serviceworkers/test/controller/index.html create mode 100644 dom/serviceworkers/test/create_another_sharedWorker.html create mode 100644 dom/serviceworkers/test/download/window.html create mode 100644 dom/serviceworkers/test/download/worker.js create mode 100644 dom/serviceworkers/test/download_canceled/page_download_canceled.html create mode 100644 dom/serviceworkers/test/download_canceled/server-stream-download.sjs create mode 100644 dom/serviceworkers/test/download_canceled/sw_download_canceled.js create mode 100644 dom/serviceworkers/test/empty.html create mode 100644 dom/serviceworkers/test/empty.js create mode 100644 dom/serviceworkers/test/empty_with_utils.html create mode 100644 dom/serviceworkers/test/error_reporting_helpers.js create mode 100644 dom/serviceworkers/test/eval_worker.js create mode 100644 dom/serviceworkers/test/eventsource/eventsource.resource create mode 100644 dom/serviceworkers/test/eventsource/eventsource.resource^headers^ create mode 100644 dom/serviceworkers/test/eventsource/eventsource_cors_response.html create mode 100644 dom/serviceworkers/test/eventsource/eventsource_cors_response_intercept_worker.js create mode 100644 dom/serviceworkers/test/eventsource/eventsource_mixed_content_cors_response.html create mode 100644 dom/serviceworkers/test/eventsource/eventsource_mixed_content_cors_response_intercept_worker.js create mode 100644 dom/serviceworkers/test/eventsource/eventsource_opaque_response.html create mode 100644 dom/serviceworkers/test/eventsource/eventsource_opaque_response_intercept_worker.js create mode 100644 dom/serviceworkers/test/eventsource/eventsource_register_worker.html create mode 100644 dom/serviceworkers/test/eventsource/eventsource_synthetic_response.html create mode 100644 dom/serviceworkers/test/eventsource/eventsource_synthetic_response_intercept_worker.js create mode 100644 dom/serviceworkers/test/eventsource/eventsource_worker_helper.js create mode 100644 dom/serviceworkers/test/fetch.js create mode 100644 dom/serviceworkers/test/fetch/cookie/cookie_test.js create mode 100644 dom/serviceworkers/test/fetch/cookie/register.html create mode 100644 dom/serviceworkers/test/fetch/cookie/unregister.html create mode 100644 dom/serviceworkers/test/fetch/deliver-gzip.sjs create mode 100644 dom/serviceworkers/test/fetch/fetch_tests.js create mode 100644 dom/serviceworkers/test/fetch/fetch_worker_script.js create mode 100644 dom/serviceworkers/test/fetch/hsts/embedder.html create mode 100644 dom/serviceworkers/test/fetch/hsts/hsts_test.js create mode 100644 dom/serviceworkers/test/fetch/hsts/image-20px.png create mode 100644 dom/serviceworkers/test/fetch/hsts/image-40px.png create mode 100644 dom/serviceworkers/test/fetch/hsts/image.html create mode 100644 dom/serviceworkers/test/fetch/hsts/realindex.html create mode 100644 dom/serviceworkers/test/fetch/hsts/register.html create mode 100644 dom/serviceworkers/test/fetch/hsts/register.html^headers^ create mode 100644 dom/serviceworkers/test/fetch/hsts/unregister.html create mode 100644 dom/serviceworkers/test/fetch/https/clonedresponse/https_test.js create mode 100644 dom/serviceworkers/test/fetch/https/clonedresponse/index.html create mode 100644 dom/serviceworkers/test/fetch/https/clonedresponse/register.html create mode 100644 dom/serviceworkers/test/fetch/https/clonedresponse/unregister.html create mode 100644 dom/serviceworkers/test/fetch/https/https_test.js create mode 100644 dom/serviceworkers/test/fetch/https/index.html create mode 100644 dom/serviceworkers/test/fetch/https/register.html create mode 100644 dom/serviceworkers/test/fetch/https/unregister.html create mode 100644 dom/serviceworkers/test/fetch/imagecache-maxage/image-20px.png create mode 100644 dom/serviceworkers/test/fetch/imagecache-maxage/image-40px.png create mode 100644 dom/serviceworkers/test/fetch/imagecache-maxage/index.html create mode 100644 dom/serviceworkers/test/fetch/imagecache-maxage/maxage_test.js create mode 100644 dom/serviceworkers/test/fetch/imagecache-maxage/register.html create mode 100644 dom/serviceworkers/test/fetch/imagecache-maxage/unregister.html create mode 100644 dom/serviceworkers/test/fetch/imagecache/image-20px.png create mode 100644 dom/serviceworkers/test/fetch/imagecache/image-40px.png create mode 100644 dom/serviceworkers/test/fetch/imagecache/imagecache_test.js create mode 100644 dom/serviceworkers/test/fetch/imagecache/index.html create mode 100644 dom/serviceworkers/test/fetch/imagecache/postmortem.html create mode 100644 dom/serviceworkers/test/fetch/imagecache/register.html create mode 100644 dom/serviceworkers/test/fetch/imagecache/unregister.html create mode 100644 dom/serviceworkers/test/fetch/importscript-mixedcontent/https_test.js create mode 100644 dom/serviceworkers/test/fetch/importscript-mixedcontent/register.html create mode 100644 dom/serviceworkers/test/fetch/importscript-mixedcontent/unregister.html create mode 100644 dom/serviceworkers/test/fetch/index.html create mode 100644 dom/serviceworkers/test/fetch/interrupt.sjs create mode 100644 dom/serviceworkers/test/fetch/origin/https/index-https.sjs create mode 100644 dom/serviceworkers/test/fetch/origin/https/origin_test.js create mode 100644 dom/serviceworkers/test/fetch/origin/https/realindex.html create mode 100644 dom/serviceworkers/test/fetch/origin/https/realindex.html^headers^ create mode 100644 dom/serviceworkers/test/fetch/origin/https/register.html create mode 100644 dom/serviceworkers/test/fetch/origin/https/unregister.html create mode 100644 dom/serviceworkers/test/fetch/origin/index-to-https.sjs create mode 100644 dom/serviceworkers/test/fetch/origin/index.sjs create mode 100644 dom/serviceworkers/test/fetch/origin/origin_test.js create mode 100644 dom/serviceworkers/test/fetch/origin/realindex.html create mode 100644 dom/serviceworkers/test/fetch/origin/realindex.html^headers^ create mode 100644 dom/serviceworkers/test/fetch/origin/register.html create mode 100644 dom/serviceworkers/test/fetch/origin/unregister.html create mode 100644 dom/serviceworkers/test/fetch/plugin/plugins.html create mode 100644 dom/serviceworkers/test/fetch/plugin/worker.js create mode 100644 dom/serviceworkers/test/fetch/real-file.txt create mode 100644 dom/serviceworkers/test/fetch/redirect.sjs create mode 100644 dom/serviceworkers/test/fetch/requesturl/index.html create mode 100644 dom/serviceworkers/test/fetch/requesturl/redirect.sjs create mode 100644 dom/serviceworkers/test/fetch/requesturl/redirector.html create mode 100644 dom/serviceworkers/test/fetch/requesturl/register.html create mode 100644 dom/serviceworkers/test/fetch/requesturl/requesturl_test.js create mode 100644 dom/serviceworkers/test/fetch/requesturl/secret.html create mode 100644 dom/serviceworkers/test/fetch/requesturl/unregister.html create mode 100644 dom/serviceworkers/test/fetch/sandbox/index.html create mode 100644 dom/serviceworkers/test/fetch/sandbox/intercepted_index.html create mode 100644 dom/serviceworkers/test/fetch/sandbox/register.html create mode 100644 dom/serviceworkers/test/fetch/sandbox/sandbox_test.js create mode 100644 dom/serviceworkers/test/fetch/sandbox/unregister.html create mode 100644 dom/serviceworkers/test/fetch/upgrade-insecure/embedder.html create mode 100644 dom/serviceworkers/test/fetch/upgrade-insecure/embedder.html^headers^ create mode 100644 dom/serviceworkers/test/fetch/upgrade-insecure/image-20px.png create mode 100644 dom/serviceworkers/test/fetch/upgrade-insecure/image-40px.png create mode 100644 dom/serviceworkers/test/fetch/upgrade-insecure/image.html create mode 100644 dom/serviceworkers/test/fetch/upgrade-insecure/realindex.html create mode 100644 dom/serviceworkers/test/fetch/upgrade-insecure/register.html create mode 100644 dom/serviceworkers/test/fetch/upgrade-insecure/unregister.html create mode 100644 dom/serviceworkers/test/fetch/upgrade-insecure/upgrade-insecure_test.js create mode 100644 dom/serviceworkers/test/fetch_event_worker.js create mode 100644 dom/serviceworkers/test/file_blob_response_worker.js create mode 100644 dom/serviceworkers/test/file_js_cache.html create mode 100644 dom/serviceworkers/test/file_js_cache.js create mode 100644 dom/serviceworkers/test/file_js_cache_cleanup.js create mode 100644 dom/serviceworkers/test/file_js_cache_save_after_load.html create mode 100644 dom/serviceworkers/test/file_js_cache_save_after_load.js create mode 100644 dom/serviceworkers/test/file_js_cache_syntax_error.html create mode 100644 dom/serviceworkers/test/file_js_cache_syntax_error.js create mode 100644 dom/serviceworkers/test/file_js_cache_with_sri.html create mode 100644 dom/serviceworkers/test/file_notification_openWindow.html create mode 100644 dom/serviceworkers/test/file_userContextId_openWindow.js create mode 100644 dom/serviceworkers/test/force_refresh_browser_worker.js create mode 100644 dom/serviceworkers/test/force_refresh_worker.js create mode 100644 dom/serviceworkers/test/gtest/TestReadWrite.cpp create mode 100644 dom/serviceworkers/test/gtest/moz.build create mode 100644 dom/serviceworkers/test/gzip_redirect_worker.js create mode 100644 dom/serviceworkers/test/header_checker.sjs create mode 100644 dom/serviceworkers/test/hello.html create mode 100644 dom/serviceworkers/test/importscript.sjs create mode 100644 dom/serviceworkers/test/importscript_worker.js create mode 100644 dom/serviceworkers/test/install_event_error_worker.js create mode 100644 dom/serviceworkers/test/install_event_worker.js create mode 100644 dom/serviceworkers/test/intercepted_channel_process_swap_worker.js create mode 100644 dom/serviceworkers/test/isolated/README.md create mode 100644 dom/serviceworkers/test/isolated/multi-e10s-update/browser.ini create mode 100644 dom/serviceworkers/test/isolated/multi-e10s-update/browser_multie10s_update.js create mode 100644 dom/serviceworkers/test/isolated/multi-e10s-update/file_multie10s_update.html create mode 100644 dom/serviceworkers/test/isolated/multi-e10s-update/server_multie10s_update.sjs create mode 100644 dom/serviceworkers/test/lazy_worker.js create mode 100644 dom/serviceworkers/test/lorem_script.js create mode 100644 dom/serviceworkers/test/match_all_advanced_worker.js create mode 100644 dom/serviceworkers/test/match_all_client/match_all_client_id.html create mode 100644 dom/serviceworkers/test/match_all_client_id_worker.js create mode 100644 dom/serviceworkers/test/match_all_clients/match_all_controlled.html create mode 100644 dom/serviceworkers/test/match_all_properties_worker.js create mode 100644 dom/serviceworkers/test/match_all_worker.js create mode 100644 dom/serviceworkers/test/message_posting_worker.js create mode 100644 dom/serviceworkers/test/message_receiver.html create mode 100644 dom/serviceworkers/test/mochitest.ini create mode 100644 dom/serviceworkers/test/nofetch_handler_worker.js create mode 100644 dom/serviceworkers/test/notification/listener.html create mode 100644 dom/serviceworkers/test/notification/register.html create mode 100644 dom/serviceworkers/test/notification/unregister.html create mode 100644 dom/serviceworkers/test/notification_alt/register.html create mode 100644 dom/serviceworkers/test/notification_alt/unregister.html create mode 100644 dom/serviceworkers/test/notification_constructor_error.js create mode 100644 dom/serviceworkers/test/notification_get_sw.js create mode 100644 dom/serviceworkers/test/notification_openWindow_worker.js create mode 100644 dom/serviceworkers/test/notificationclick-otherwindow.html create mode 100644 dom/serviceworkers/test/notificationclick.html create mode 100644 dom/serviceworkers/test/notificationclick.js create mode 100644 dom/serviceworkers/test/notificationclick_focus.html create mode 100644 dom/serviceworkers/test/notificationclick_focus.js create mode 100644 dom/serviceworkers/test/notificationclose.html create mode 100644 dom/serviceworkers/test/notificationclose.js create mode 100644 dom/serviceworkers/test/notify_loaded.js create mode 100644 dom/serviceworkers/test/onmessageerror_worker.js create mode 100644 dom/serviceworkers/test/opaque_intercept_worker.js create mode 100644 dom/serviceworkers/test/openWindow_worker.js create mode 100644 dom/serviceworkers/test/open_window/client.sjs create mode 100644 dom/serviceworkers/test/page_post_controlled.html create mode 100644 dom/serviceworkers/test/parse_error_worker.js create mode 100644 dom/serviceworkers/test/redirect.sjs create mode 100644 dom/serviceworkers/test/redirect_post.sjs create mode 100644 dom/serviceworkers/test/redirect_serviceworker.sjs create mode 100644 dom/serviceworkers/test/register_https.html create mode 100644 dom/serviceworkers/test/sanitize/example_check_and_unregister.html create mode 100644 dom/serviceworkers/test/sanitize/frame.html create mode 100644 dom/serviceworkers/test/sanitize/register.html create mode 100644 dom/serviceworkers/test/sanitize_worker.js create mode 100644 dom/serviceworkers/test/scope/scope_worker.js create mode 100644 dom/serviceworkers/test/script_file_upload.js create mode 100644 dom/serviceworkers/test/self_update_worker.sjs create mode 100644 dom/serviceworkers/test/server_file_upload.sjs create mode 100644 dom/serviceworkers/test/service_worker.js create mode 100644 dom/serviceworkers/test/service_worker_client.html create mode 100644 dom/serviceworkers/test/serviceworker.html create mode 100644 dom/serviceworkers/test/serviceworker_not_sharedworker.js create mode 100644 dom/serviceworkers/test/serviceworker_wrapper.js create mode 100644 dom/serviceworkers/test/serviceworkerinfo_iframe.html create mode 100644 dom/serviceworkers/test/serviceworkermanager_iframe.html create mode 100644 dom/serviceworkers/test/serviceworkerregistrationinfo_iframe.html create mode 100644 dom/serviceworkers/test/sharedWorker_fetch.js create mode 100644 dom/serviceworkers/test/simpleregister/index.html create mode 100644 dom/serviceworkers/test/simpleregister/ready.html create mode 100644 dom/serviceworkers/test/skip_waiting_installed_worker.js create mode 100644 dom/serviceworkers/test/skip_waiting_scope/index.html create mode 100644 dom/serviceworkers/test/source_message_posting_worker.js create mode 100644 dom/serviceworkers/test/storage_recovery_worker.sjs create mode 100644 dom/serviceworkers/test/streamfilter_server.sjs create mode 100644 dom/serviceworkers/test/streamfilter_worker.js create mode 100644 dom/serviceworkers/test/strict_mode_warning.js create mode 100644 dom/serviceworkers/test/sw_bad_mime_type.js create mode 100644 dom/serviceworkers/test/sw_bad_mime_type.js^headers^ create mode 100644 dom/serviceworkers/test/sw_clients/file_blob_upload_frame.html create mode 100644 dom/serviceworkers/test/sw_clients/navigator.html create mode 100644 dom/serviceworkers/test/sw_clients/refresher.html create mode 100644 dom/serviceworkers/test/sw_clients/refresher_cached.html create mode 100644 dom/serviceworkers/test/sw_clients/refresher_cached_compressed.html create mode 100644 dom/serviceworkers/test/sw_clients/refresher_cached_compressed.html^headers^ create mode 100644 dom/serviceworkers/test/sw_clients/refresher_compressed.html create mode 100644 dom/serviceworkers/test/sw_clients/refresher_compressed.html^headers^ create mode 100644 dom/serviceworkers/test/sw_clients/service_worker_controlled.html create mode 100644 dom/serviceworkers/test/sw_clients/simple.html create mode 100644 dom/serviceworkers/test/sw_file_upload.js create mode 100644 dom/serviceworkers/test/sw_storage_not_allow.js create mode 100644 dom/serviceworkers/test/swa/worker_scope_different.js create mode 100644 dom/serviceworkers/test/swa/worker_scope_different.js^headers^ create mode 100644 dom/serviceworkers/test/swa/worker_scope_different2.js create mode 100644 dom/serviceworkers/test/swa/worker_scope_different2.js^headers^ create mode 100644 dom/serviceworkers/test/swa/worker_scope_precise.js create mode 100644 dom/serviceworkers/test/swa/worker_scope_precise.js^headers^ create mode 100644 dom/serviceworkers/test/swa/worker_scope_too_deep.js create mode 100644 dom/serviceworkers/test/swa/worker_scope_too_deep.js^headers^ create mode 100644 dom/serviceworkers/test/swa/worker_scope_too_narrow.js create mode 100644 dom/serviceworkers/test/swa/worker_scope_too_narrow.js^headers^ create mode 100644 dom/serviceworkers/test/test_abrupt_completion.html create mode 100644 dom/serviceworkers/test/test_async_waituntil.html create mode 100644 dom/serviceworkers/test/test_bad_script_cache.html create mode 100644 dom/serviceworkers/test/test_bug1151916.html create mode 100644 dom/serviceworkers/test/test_bug1240436.html create mode 100644 dom/serviceworkers/test/test_bug1408734.html create mode 100644 dom/serviceworkers/test/test_claim.html create mode 100644 dom/serviceworkers/test/test_claim_oninstall.html create mode 100644 dom/serviceworkers/test/test_client_focus.html create mode 100644 dom/serviceworkers/test/test_controller.html create mode 100644 dom/serviceworkers/test/test_cookie_fetch.html create mode 100644 dom/serviceworkers/test/test_cross_origin_url_after_redirect.html create mode 100644 dom/serviceworkers/test/test_csp_upgrade-insecure_intercept.html create mode 100644 dom/serviceworkers/test/test_devtools_bypass_serviceworker.html create mode 100644 dom/serviceworkers/test/test_devtools_track_serviceworker_time.html create mode 100644 dom/serviceworkers/test/test_empty_serviceworker.html create mode 100644 dom/serviceworkers/test/test_error_reporting.html create mode 100644 dom/serviceworkers/test/test_escapedSlashes.html create mode 100644 dom/serviceworkers/test/test_eval_allowed.html create mode 100644 dom/serviceworkers/test/test_eval_allowed.html^headers^ create mode 100644 dom/serviceworkers/test/test_event_listener_leaks.html create mode 100644 dom/serviceworkers/test/test_eventsource_intercept.html create mode 100644 dom/serviceworkers/test/test_fetch_event.html create mode 100644 dom/serviceworkers/test/test_fetch_event_with_thirdpartypref.html create mode 100644 dom/serviceworkers/test/test_fetch_integrity.html create mode 100644 dom/serviceworkers/test/test_file_blob_response.html create mode 100644 dom/serviceworkers/test/test_file_blob_upload.html create mode 100644 dom/serviceworkers/test/test_file_upload.html create mode 100644 dom/serviceworkers/test/test_force_refresh.html create mode 100644 dom/serviceworkers/test/test_gzip_redirect.html create mode 100644 dom/serviceworkers/test/test_hsts_upgrade_intercept.html create mode 100644 dom/serviceworkers/test/test_https_fetch.html create mode 100644 dom/serviceworkers/test/test_https_fetch_cloned_response.html create mode 100644 dom/serviceworkers/test/test_https_origin_after_redirect.html create mode 100644 dom/serviceworkers/test/test_https_origin_after_redirect_cached.html create mode 100644 dom/serviceworkers/test/test_https_synth_fetch_from_cached_sw.html create mode 100644 dom/serviceworkers/test/test_imagecache.html create mode 100644 dom/serviceworkers/test/test_imagecache_max_age.html create mode 100644 dom/serviceworkers/test/test_importscript.html create mode 100644 dom/serviceworkers/test/test_importscript_mixedcontent.html create mode 100644 dom/serviceworkers/test/test_install_event.html create mode 100644 dom/serviceworkers/test/test_install_event_gc.html create mode 100644 dom/serviceworkers/test/test_installation_simple.html create mode 100644 dom/serviceworkers/test/test_match_all.html create mode 100644 dom/serviceworkers/test/test_match_all_advanced.html create mode 100644 dom/serviceworkers/test/test_match_all_client_id.html create mode 100644 dom/serviceworkers/test/test_match_all_client_properties.html create mode 100644 dom/serviceworkers/test/test_navigator.html create mode 100644 dom/serviceworkers/test/test_nofetch_handler.html create mode 100644 dom/serviceworkers/test/test_not_intercept_plugin.html create mode 100644 dom/serviceworkers/test/test_notification_constructor_error.html create mode 100644 dom/serviceworkers/test/test_notification_get.html create mode 100644 dom/serviceworkers/test/test_notification_openWindow.html create mode 100644 dom/serviceworkers/test/test_notificationclick-otherwindow.html create mode 100644 dom/serviceworkers/test/test_notificationclick.html create mode 100644 dom/serviceworkers/test/test_notificationclick_focus.html create mode 100644 dom/serviceworkers/test/test_notificationclose.html create mode 100644 dom/serviceworkers/test/test_onmessageerror.html create mode 100644 dom/serviceworkers/test/test_opaque_intercept.html create mode 100644 dom/serviceworkers/test/test_openWindow.html create mode 100644 dom/serviceworkers/test/test_origin_after_redirect.html create mode 100644 dom/serviceworkers/test/test_origin_after_redirect_cached.html create mode 100644 dom/serviceworkers/test/test_origin_after_redirect_to_https.html create mode 100644 dom/serviceworkers/test/test_origin_after_redirect_to_https_cached.html create mode 100644 dom/serviceworkers/test/test_post_message.html create mode 100644 dom/serviceworkers/test/test_post_message_advanced.html create mode 100644 dom/serviceworkers/test/test_post_message_source.html create mode 100644 dom/serviceworkers/test/test_privateBrowsing.html create mode 100644 dom/serviceworkers/test/test_register_base.html create mode 100644 dom/serviceworkers/test/test_register_https_in_http.html create mode 100644 dom/serviceworkers/test/test_sandbox_intercept.html create mode 100644 dom/serviceworkers/test/test_sanitize.html create mode 100644 dom/serviceworkers/test/test_sanitize_domain.html create mode 100644 dom/serviceworkers/test/test_scopes.html create mode 100644 dom/serviceworkers/test/test_script_loader_intercepted_js_cache.html create mode 100644 dom/serviceworkers/test/test_self_update_worker.html create mode 100644 dom/serviceworkers/test/test_service_worker_allowed.html create mode 100644 dom/serviceworkers/test/test_serviceworker.html create mode 100644 dom/serviceworkers/test/test_serviceworker_header.html create mode 100644 dom/serviceworkers/test/test_serviceworker_interfaces.html create mode 100644 dom/serviceworkers/test/test_serviceworker_interfaces.js create mode 100644 dom/serviceworkers/test/test_serviceworker_not_sharedworker.html create mode 100644 dom/serviceworkers/test/test_serviceworkerinfo.xhtml create mode 100644 dom/serviceworkers/test/test_serviceworkermanager.xhtml create mode 100644 dom/serviceworkers/test/test_serviceworkerregistrationinfo.xhtml create mode 100644 dom/serviceworkers/test/test_skip_waiting.html create mode 100644 dom/serviceworkers/test/test_streamfilter.html create mode 100644 dom/serviceworkers/test/test_strict_mode_warning.html create mode 100644 dom/serviceworkers/test/test_third_party_iframes.html create mode 100644 dom/serviceworkers/test/test_unregister.html create mode 100644 dom/serviceworkers/test/test_unresolved_fetch_interception.html create mode 100644 dom/serviceworkers/test/test_workerUnregister.html create mode 100644 dom/serviceworkers/test/test_workerUpdate.html create mode 100644 dom/serviceworkers/test/test_worker_reference_gc_timeout.html create mode 100644 dom/serviceworkers/test/test_workerupdatefoundevent.html create mode 100644 dom/serviceworkers/test/test_xslt.html create mode 100644 dom/serviceworkers/test/thirdparty/iframe1.html create mode 100644 dom/serviceworkers/test/thirdparty/iframe2.html create mode 100644 dom/serviceworkers/test/thirdparty/register.html create mode 100644 dom/serviceworkers/test/thirdparty/sw.js create mode 100644 dom/serviceworkers/test/thirdparty/unregister.html create mode 100644 dom/serviceworkers/test/thirdparty/worker.js create mode 100644 dom/serviceworkers/test/unregister/index.html create mode 100644 dom/serviceworkers/test/unregister/unregister.html create mode 100644 dom/serviceworkers/test/unresolved_fetch_worker.js create mode 100644 dom/serviceworkers/test/update_worker.sjs create mode 100644 dom/serviceworkers/test/updatefoundevent.html create mode 100644 dom/serviceworkers/test/utils.js create mode 100644 dom/serviceworkers/test/window_party_iframes.html create mode 100644 dom/serviceworkers/test/worker.js create mode 100644 dom/serviceworkers/test/worker2.js create mode 100644 dom/serviceworkers/test/worker3.js create mode 100644 dom/serviceworkers/test/workerUpdate/update.html create mode 100644 dom/serviceworkers/test/worker_unregister.js create mode 100644 dom/serviceworkers/test/worker_update.js create mode 100644 dom/serviceworkers/test/worker_updatefoundevent.js create mode 100644 dom/serviceworkers/test/worker_updatefoundevent2.js create mode 100644 dom/serviceworkers/test/xslt/test.xml create mode 100644 dom/serviceworkers/test/xslt/xslt.sjs create mode 100644 dom/serviceworkers/test/xslt_worker.js (limited to 'dom/serviceworkers') diff --git a/dom/serviceworkers/FetchEventOpChild.cpp b/dom/serviceworkers/FetchEventOpChild.cpp new file mode 100644 index 0000000000..5b0e90bf25 --- /dev/null +++ b/dom/serviceworkers/FetchEventOpChild.cpp @@ -0,0 +1,495 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "FetchEventOpChild.h" + +#include + +#include "MainThreadUtils.h" +#include "nsContentPolicyUtils.h" +#include "nsContentUtils.h" +#include "nsDebug.h" +#include "nsError.h" +#include "nsIChannel.h" +#include "nsIConsoleReportCollector.h" +#include "nsIContentPolicy.h" +#include "nsIInputStream.h" +#include "nsILoadInfo.h" +#include "nsINetworkInterceptController.h" +#include "nsIObserverService.h" +#include "nsIScriptError.h" +#include "nsISupportsImpl.h" +#include "nsIURI.h" +#include "nsNetUtil.h" +#include "nsProxyRelease.h" +#include "nsTArray.h" +#include "nsThreadUtils.h" + +#include "ServiceWorkerPrivate.h" +#include "mozilla/Assertions.h" +#include "mozilla/LoadInfo.h" +#include "mozilla/Services.h" +#include "mozilla/Telemetry.h" +#include "mozilla/UniquePtr.h" +#include "mozilla/Unused.h" +#include "mozilla/ipc/BackgroundChild.h" +#include "mozilla/dom/InternalHeaders.h" +#include "mozilla/dom/InternalResponse.h" +#include "mozilla/dom/PRemoteWorkerControllerChild.h" +#include "mozilla/dom/ServiceWorkerRegistrationInfo.h" +#include "mozilla/net/NeckoChannelParams.h" + +namespace mozilla { + +using ipc::AutoIPCStream; +using ipc::BackgroundChild; +using ipc::PBackgroundChild; + +namespace dom { + +namespace { + +bool CSPPermitsResponse(nsILoadInfo* aLoadInfo, InternalResponse* aResponse, + const nsACString& aWorkerScriptSpec) { + AssertIsOnMainThread(); + MOZ_ASSERT(aLoadInfo); + + nsCString url = aResponse->GetUnfilteredURL(); + if (url.IsEmpty()) { + // Synthetic response. + url = aWorkerScriptSpec; + } + + nsCOMPtr uri; + nsresult rv = NS_NewURI(getter_AddRefs(uri), url, nullptr, nullptr); + if (NS_WARN_IF(NS_FAILED(rv))) { + return false; + } + + int16_t decision = nsIContentPolicy::ACCEPT; + rv = NS_CheckContentLoadPolicy(uri, aLoadInfo, ""_ns, &decision); + if (NS_WARN_IF(NS_FAILED(rv))) { + return false; + } + + return decision == nsIContentPolicy::ACCEPT; +} + +void AsyncLog(nsIInterceptedChannel* aChannel, const nsACString& aScriptSpec, + uint32_t aLineNumber, uint32_t aColumnNumber, + const nsACString& aMessageName, nsTArray&& aParams) { + AssertIsOnMainThread(); + MOZ_ASSERT(aChannel); + + nsCOMPtr reporter = + aChannel->GetConsoleReportCollector(); + + if (reporter) { + // NOTE: is appears that `const nsTArray&` is required for + // nsIConsoleReportCollector::AddConsoleReport to resolve to the correct + // overload. + const nsTArray params = std::move(aParams); + + reporter->AddConsoleReport( + nsIScriptError::errorFlag, "Service Worker Interception"_ns, + nsContentUtils::eDOM_PROPERTIES, aScriptSpec, aLineNumber, + aColumnNumber, aMessageName, params); + } +} + +class SynthesizeResponseWatcher final : public nsIInterceptedBodyCallback { + public: + NS_DECL_THREADSAFE_ISUPPORTS + + SynthesizeResponseWatcher( + const nsMainThreadPtrHandle& aInterceptedChannel, + const nsMainThreadPtrHandle& aRegistration, + const bool aIsNonSubresourceRequest, + FetchEventRespondWithClosure&& aClosure, nsAString&& aRequestURL) + : mInterceptedChannel(aInterceptedChannel), + mRegistration(aRegistration), + mIsNonSubresourceRequest(aIsNonSubresourceRequest), + mClosure(std::move(aClosure)), + mRequestURL(std::move(aRequestURL)) { + AssertIsOnMainThread(); + MOZ_ASSERT(mInterceptedChannel); + MOZ_ASSERT(mRegistration); + } + + NS_IMETHOD + BodyComplete(nsresult aRv) override { + AssertIsOnMainThread(); + MOZ_ASSERT(mInterceptedChannel); + + if (NS_WARN_IF(NS_FAILED(aRv))) { + AsyncLog(mInterceptedChannel, mClosure.respondWithScriptSpec(), + mClosure.respondWithLineNumber(), + mClosure.respondWithColumnNumber(), + "InterceptionFailedWithURL"_ns, {mRequestURL}); + + CancelInterception(NS_ERROR_INTERCEPTION_FAILED); + + return NS_OK; + } + + nsresult rv = mInterceptedChannel->FinishSynthesizedResponse(); + + if (NS_WARN_IF(NS_FAILED(rv))) { + CancelInterception(rv); + } + + mInterceptedChannel = nullptr; + + return NS_OK; + } + + // See FetchEventOpChild::MaybeScheduleRegistrationUpdate() for comments. + void CancelInterception(nsresult aStatus) { + AssertIsOnMainThread(); + MOZ_ASSERT(mInterceptedChannel); + MOZ_ASSERT(mRegistration); + + mInterceptedChannel->CancelInterception(aStatus); + + if (mIsNonSubresourceRequest) { + mRegistration->MaybeScheduleUpdate(); + } else { + mRegistration->MaybeScheduleTimeCheckAndUpdate(); + } + + mInterceptedChannel = nullptr; + mRegistration = nullptr; + } + + private: + ~SynthesizeResponseWatcher() { + if (NS_WARN_IF(mInterceptedChannel)) { + CancelInterception(NS_ERROR_DOM_ABORT_ERR); + } + } + + nsMainThreadPtrHandle mInterceptedChannel; + nsMainThreadPtrHandle mRegistration; + const bool mIsNonSubresourceRequest; + const FetchEventRespondWithClosure mClosure; + const nsString mRequestURL; +}; + +NS_IMPL_ISUPPORTS(SynthesizeResponseWatcher, nsIInterceptedBodyCallback) + +} // anonymous namespace + +/* static */ RefPtr FetchEventOpChild::SendFetchEvent( + PRemoteWorkerControllerChild* aManager, + ServiceWorkerFetchEventOpArgs&& aArgs, + nsCOMPtr aInterceptedChannel, + RefPtr aRegistration, + RefPtr&& aKeepAliveToken) { + AssertIsOnMainThread(); + MOZ_ASSERT(aManager); + MOZ_ASSERT(aInterceptedChannel); + MOZ_ASSERT(aKeepAliveToken); + + FetchEventOpChild* actor = new FetchEventOpChild( + std::move(aArgs), std::move(aInterceptedChannel), + std::move(aRegistration), std::move(aKeepAliveToken)); + + Unused << aManager->SendPFetchEventOpConstructor(actor, actor->mArgs); + + return actor->mPromiseHolder.Ensure(__func__); +} + +FetchEventOpChild::~FetchEventOpChild() { + AssertIsOnMainThread(); + MOZ_ASSERT(mInterceptedChannelHandled); + MOZ_DIAGNOSTIC_ASSERT(mPromiseHolder.IsEmpty()); +} + +FetchEventOpChild::FetchEventOpChild( + ServiceWorkerFetchEventOpArgs&& aArgs, + nsCOMPtr&& aInterceptedChannel, + RefPtr&& aRegistration, + RefPtr&& aKeepAliveToken) + : mArgs(std::move(aArgs)), + mInterceptedChannel(std::move(aInterceptedChannel)), + mRegistration(std::move(aRegistration)), + mKeepAliveToken(std::move(aKeepAliveToken)) {} + +mozilla::ipc::IPCResult FetchEventOpChild::RecvAsyncLog( + const nsCString& aScriptSpec, const uint32_t& aLineNumber, + const uint32_t& aColumnNumber, const nsCString& aMessageName, + nsTArray&& aParams) { + AssertIsOnMainThread(); + MOZ_ASSERT(mInterceptedChannel); + + AsyncLog(mInterceptedChannel, aScriptSpec, aLineNumber, aColumnNumber, + aMessageName, std::move(aParams)); + + return IPC_OK(); +} + +mozilla::ipc::IPCResult FetchEventOpChild::RecvRespondWith( + IPCFetchEventRespondWithResult&& aResult) { + AssertIsOnMainThread(); + + switch (aResult.type()) { + case IPCFetchEventRespondWithResult::TIPCSynthesizeResponseArgs: + SynthesizeResponse(std::move(aResult.get_IPCSynthesizeResponseArgs())); + break; + case IPCFetchEventRespondWithResult::TResetInterceptionArgs: + ResetInterception(); + break; + case IPCFetchEventRespondWithResult::TCancelInterceptionArgs: + CancelInterception(aResult.get_CancelInterceptionArgs().status()); + break; + default: + MOZ_CRASH("Unknown IPCFetchEventRespondWithResult type!"); + break; + } + + return IPC_OK(); +} + +mozilla::ipc::IPCResult FetchEventOpChild::Recv__delete__( + const ServiceWorkerFetchEventOpResult& aResult) { + AssertIsOnMainThread(); + MOZ_ASSERT(mRegistration); + + if (NS_WARN_IF(!mInterceptedChannelHandled)) { + MOZ_ASSERT(NS_FAILED(aResult.rv())); + NS_WARNING( + "Failed to handle intercepted network request; canceling " + "interception!"); + + CancelInterception(aResult.rv()); + } + + mPromiseHolder.ResolveIfExists(true, __func__); + + /** + * This corresponds to the "Fire Functional Event" algorithm's step 9: + * + * "If the time difference in seconds calculated by the current time minus + * registration's last update check time is greater than 84600, invoke Soft + * Update algorithm with registration." + * + * TODO: this is probably being called later than it should be; it should be + * called ASAP after dispatching the FetchEvent. + */ + mRegistration->MaybeScheduleTimeCheckAndUpdate(); + + return IPC_OK(); +} + +void FetchEventOpChild::ActorDestroy(ActorDestroyReason) { + AssertIsOnMainThread(); + + // If `Recv__delete__` was called, it would have resolved the promise already. + mPromiseHolder.RejectIfExists(NS_ERROR_DOM_ABORT_ERR, __func__); + + if (NS_WARN_IF(!mInterceptedChannelHandled)) { + Unused << Recv__delete__(NS_ERROR_DOM_ABORT_ERR); + } +} + +nsresult FetchEventOpChild::StartSynthesizedResponse( + IPCSynthesizeResponseArgs&& aArgs) { + AssertIsOnMainThread(); + MOZ_ASSERT(mInterceptedChannel); + MOZ_ASSERT(!mInterceptedChannelHandled); + MOZ_ASSERT(mRegistration); + + /** + * TODO: moving the IPCInternalResponse won't do anything right now because + * there isn't a prefect-forwarding or rvalue-ref-parameter overload of + * `InternalResponse::FromIPC().` + */ + RefPtr response = + InternalResponse::FromIPC(aArgs.internalResponse()); + if (NS_WARN_IF(!response)) { + return NS_ERROR_FAILURE; + } + + nsCOMPtr underlyingChannel; + nsresult rv = + mInterceptedChannel->GetChannel(getter_AddRefs(underlyingChannel)); + if (NS_WARN_IF(NS_FAILED(rv)) || NS_WARN_IF(!underlyingChannel)) { + return NS_FAILED(rv) ? rv : NS_ERROR_FAILURE; + } + + nsCOMPtr loadInfo = underlyingChannel->LoadInfo(); + if (!CSPPermitsResponse(loadInfo, response, mArgs.workerScriptSpec())) { + return NS_ERROR_CONTENT_BLOCKED; + } + + MOZ_ASSERT(response->GetChannelInfo().IsInitialized()); + ChannelInfo channelInfo = response->GetChannelInfo(); + rv = mInterceptedChannel->SetChannelInfo(&channelInfo); + if (NS_WARN_IF(NS_FAILED(rv))) { + return NS_ERROR_INTERCEPTION_FAILED; + } + + rv = mInterceptedChannel->SynthesizeStatus( + response->GetUnfilteredStatus(), response->GetUnfilteredStatusText()); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + AutoTArray entries; + response->UnfilteredHeaders()->GetEntries(entries); + for (auto& entry : entries) { + mInterceptedChannel->SynthesizeHeader(entry.mName, entry.mValue); + } + + auto castLoadInfo = static_cast(loadInfo.get()); + castLoadInfo->SynthesizeServiceWorkerTainting(response->GetTainting()); + + // Get the preferred alternative data type of the outer channel + nsAutoCString preferredAltDataType(""_ns); + nsCOMPtr outerChannel = + do_QueryInterface(underlyingChannel); + if (outerChannel && + !outerChannel->PreferredAlternativeDataTypes().IsEmpty()) { + preferredAltDataType.Assign( + outerChannel->PreferredAlternativeDataTypes()[0].type()); + } + + nsCOMPtr body; + if (preferredAltDataType.Equals(response->GetAlternativeDataType())) { + body = response->TakeAlternativeBody(); + } + if (!body) { + response->GetUnfilteredBody(getter_AddRefs(body)); + } else { + Telemetry::ScalarAdd(Telemetry::ScalarID::SW_ALTERNATIVE_BODY_USED_COUNT, + 1); + } + + // Propagate the URL to the content if the request mode is not "navigate". + // Note that, we only reflect the final URL if the response.redirected is + // false. We propagate all the URLs if the response.redirected is true. + const IPCInternalRequest& request = mArgs.internalRequest(); + nsAutoCString responseURL; + if (request.requestMode() != RequestMode::Navigate) { + responseURL = response->GetUnfilteredURL(); + + // Similar to how we apply the request fragment to redirects automatically + // we also want to apply it automatically when propagating the response + // URL from a service worker interception. Currently response.url strips + // the fragment, so this will never conflict with an existing fragment + // on the response. In the future we will have to check for a response + // fragment and avoid overriding in that case. + if (!request.fragment().IsEmpty() && !responseURL.IsEmpty()) { + MOZ_ASSERT(!responseURL.Contains('#')); + responseURL.AppendLiteral("#"); + responseURL.Append(request.fragment()); + } + } + + nsMainThreadPtrHandle interceptedChannel( + new nsMainThreadPtrHolder( + "nsIInterceptedChannel", mInterceptedChannel, false)); + + nsMainThreadPtrHandle registration( + new nsMainThreadPtrHolder( + "ServiceWorkerRegistrationInfo", mRegistration, false)); + + nsCString requestURL = request.urlList().LastElement(); + if (!request.fragment().IsEmpty()) { + requestURL.AppendLiteral("#"); + requestURL.Append(request.fragment()); + } + + RefPtr watcher = new SynthesizeResponseWatcher( + interceptedChannel, registration, mArgs.isNonSubresourceRequest(), + std::move(aArgs.closure()), NS_ConvertUTF8toUTF16(responseURL)); + + rv = mInterceptedChannel->StartSynthesizedResponse( + body, watcher, nullptr /* TODO */, responseURL, response->IsRedirected()); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + nsCOMPtr obsService = services::GetObserverService(); + if (obsService) { + obsService->NotifyObservers(underlyingChannel, + "service-worker-synthesized-response", nullptr); + } + + return rv; +} + +void FetchEventOpChild::SynthesizeResponse(IPCSynthesizeResponseArgs&& aArgs) { + AssertIsOnMainThread(); + MOZ_ASSERT(mInterceptedChannel); + MOZ_ASSERT(!mInterceptedChannelHandled); + + nsresult rv = StartSynthesizedResponse(std::move(aArgs)); + + if (NS_WARN_IF(NS_FAILED(rv))) { + NS_WARNING("Failed to synthesize response!"); + + mInterceptedChannel->CancelInterception(rv); + } + + mInterceptedChannelHandled = true; + + MaybeScheduleRegistrationUpdate(); +} + +void FetchEventOpChild::ResetInterception() { + AssertIsOnMainThread(); + MOZ_ASSERT(mInterceptedChannel); + MOZ_ASSERT(!mInterceptedChannelHandled); + + nsresult rv = mInterceptedChannel->ResetInterception(); + + if (NS_WARN_IF(NS_FAILED(rv))) { + NS_WARNING("Failed to resume intercepted network request!"); + + mInterceptedChannel->CancelInterception(rv); + } + + mInterceptedChannelHandled = true; + + MaybeScheduleRegistrationUpdate(); +} + +void FetchEventOpChild::CancelInterception(nsresult aStatus) { + AssertIsOnMainThread(); + MOZ_ASSERT(mInterceptedChannel); + MOZ_ASSERT(!mInterceptedChannelHandled); + MOZ_ASSERT(NS_FAILED(aStatus)); + + mInterceptedChannel->CancelInterception(aStatus); + mInterceptedChannelHandled = true; + + MaybeScheduleRegistrationUpdate(); +} + +/** + * This corresponds to the "Handle Fetch" algorithm's steps 20.3, 21.2, and + * 22.2: + * + * "If request is a non-subresource request, or request is a subresource + * request and the time difference in seconds calculated by the current time + * minus registration's last update check time is greater than 86400, invoke + * Soft Update algorithm with registration." + */ +void FetchEventOpChild::MaybeScheduleRegistrationUpdate() const { + AssertIsOnMainThread(); + MOZ_ASSERT(mRegistration); + MOZ_ASSERT(mInterceptedChannelHandled); + + if (mArgs.isNonSubresourceRequest()) { + mRegistration->MaybeScheduleUpdate(); + } else { + mRegistration->MaybeScheduleTimeCheckAndUpdate(); + } +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/FetchEventOpChild.h b/dom/serviceworkers/FetchEventOpChild.h new file mode 100644 index 0000000000..805a8355f1 --- /dev/null +++ b/dom/serviceworkers/FetchEventOpChild.h @@ -0,0 +1,83 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_fetcheventopchild_h__ +#define mozilla_dom_fetcheventopchild_h__ + +#include "nsCOMPtr.h" + +#include "mozilla/MozPromise.h" +#include "mozilla/RefPtr.h" +#include "mozilla/dom/PFetchEventOpChild.h" +#include "mozilla/dom/ServiceWorkerOpArgs.h" + +class nsIInterceptedChannel; + +namespace mozilla { +namespace dom { + +class KeepAliveToken; +class PRemoteWorkerControllerChild; +class ServiceWorkerRegistrationInfo; + +/** + * FetchEventOpChild represents an in-flight FetchEvent operation. + */ +class FetchEventOpChild final : public PFetchEventOpChild { + friend class PFetchEventOpChild; + + public: + static RefPtr SendFetchEvent( + PRemoteWorkerControllerChild* aManager, + ServiceWorkerFetchEventOpArgs&& aArgs, + nsCOMPtr aInterceptedChannel, + RefPtr aRegistrationInfo, + RefPtr&& aKeepAliveToken); + + ~FetchEventOpChild(); + + private: + FetchEventOpChild(ServiceWorkerFetchEventOpArgs&& aArgs, + nsCOMPtr&& aInterceptedChannel, + RefPtr&& aRegistrationInfo, + RefPtr&& aKeepAliveToken); + + mozilla::ipc::IPCResult RecvAsyncLog(const nsCString& aScriptSpec, + const uint32_t& aLineNumber, + const uint32_t& aColumnNumber, + const nsCString& aMessageName, + nsTArray&& aParams); + + mozilla::ipc::IPCResult RecvRespondWith( + IPCFetchEventRespondWithResult&& aResult); + + mozilla::ipc::IPCResult Recv__delete__( + const ServiceWorkerFetchEventOpResult& aResult); + + void ActorDestroy(ActorDestroyReason) override; + + nsresult StartSynthesizedResponse(IPCSynthesizeResponseArgs&& aArgs); + + void SynthesizeResponse(IPCSynthesizeResponseArgs&& aArgs); + + void ResetInterception(); + + void CancelInterception(nsresult aStatus); + + void MaybeScheduleRegistrationUpdate() const; + + const ServiceWorkerFetchEventOpArgs mArgs; + nsCOMPtr mInterceptedChannel; + RefPtr mRegistration; + RefPtr mKeepAliveToken; + bool mInterceptedChannelHandled = false; + MozPromiseHolder mPromiseHolder; +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_fetcheventopchild_h__ diff --git a/dom/serviceworkers/FetchEventOpParent.cpp b/dom/serviceworkers/FetchEventOpParent.cpp new file mode 100644 index 0000000000..2443fb2760 --- /dev/null +++ b/dom/serviceworkers/FetchEventOpParent.cpp @@ -0,0 +1,30 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "FetchEventOpParent.h" + +#include "nsDebug.h" + +#include "mozilla/Assertions.h" +#include "mozilla/RefPtr.h" +#include "mozilla/Unused.h" +#include "mozilla/dom/FetchEventOpProxyParent.h" +#include "mozilla/dom/RemoteWorkerControllerParent.h" +#include "mozilla/dom/RemoteWorkerParent.h" +#include "mozilla/ipc/BackgroundParent.h" + +namespace mozilla { + +using namespace ipc; + +namespace dom { + +void FetchEventOpParent::ActorDestroy(ActorDestroyReason) { + AssertIsOnBackgroundThread(); +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/FetchEventOpParent.h b/dom/serviceworkers/FetchEventOpParent.h new file mode 100644 index 0000000000..03d9427c67 --- /dev/null +++ b/dom/serviceworkers/FetchEventOpParent.h @@ -0,0 +1,36 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_fetcheventopparent_h__ +#define mozilla_dom_fetcheventopparent_h__ + +#include "nsISupports.h" + +#include "mozilla/dom/PFetchEventOpParent.h" + +namespace mozilla { +namespace dom { + +class ServiceWorkerFetchEventOpArgs; + +class FetchEventOpParent final : public PFetchEventOpParent { + friend class PFetchEventOpParent; + + public: + NS_INLINE_DECL_REFCOUNTING(FetchEventOpParent) + + FetchEventOpParent() = default; + + private: + ~FetchEventOpParent() = default; + + void ActorDestroy(ActorDestroyReason) override; +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_fetcheventopparent_h__ diff --git a/dom/serviceworkers/FetchEventOpProxyChild.cpp b/dom/serviceworkers/FetchEventOpProxyChild.cpp new file mode 100644 index 0000000000..7de39022ff --- /dev/null +++ b/dom/serviceworkers/FetchEventOpProxyChild.cpp @@ -0,0 +1,160 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "FetchEventOpProxyChild.h" + +#include + +#include "nsCOMPtr.h" +#include "nsDebug.h" +#include "nsThreadUtils.h" + +#include "mozilla/Assertions.h" +#include "mozilla/RefPtr.h" +#include "mozilla/UniquePtr.h" +#include "mozilla/Unused.h" +#include "mozilla/dom/RemoteWorkerChild.h" +#include "mozilla/dom/RemoteWorkerService.h" +#include "mozilla/dom/ServiceWorkerOp.h" +#include "mozilla/dom/WorkerCommon.h" +#include "mozilla/ipc/BackgroundChild.h" +#include "mozilla/ipc/IPCStreamUtils.h" + +namespace mozilla { + +using namespace ipc; + +namespace dom { + +namespace { + +nsresult GetIPCSynthesizeResponseArgs( + IPCSynthesizeResponseArgs* aIPCArgs, SynthesizeResponseArgs&& aArgs, + UniquePtr& aAutoBodyStream, + UniquePtr& aAutoAlternativeBodyStream) { + MOZ_ASSERT(RemoteWorkerService::Thread()->IsOnCurrentThread()); + + PBackgroundChild* bgChild = BackgroundChild::GetOrCreateForCurrentThread(); + + if (NS_WARN_IF(!bgChild)) { + return NS_ERROR_DOM_INVALID_STATE_ERR; + } + + aArgs.first->ToIPC(&aIPCArgs->internalResponse(), bgChild, aAutoBodyStream, + aAutoAlternativeBodyStream); + aIPCArgs->closure() = std::move(aArgs.second); + + return NS_OK; +} + +} // anonymous namespace + +void FetchEventOpProxyChild::Initialize( + const ServiceWorkerFetchEventOpArgs& aArgs) { + MOZ_ASSERT(RemoteWorkerService::Thread()->IsOnCurrentThread()); + MOZ_ASSERT(!mOp); + + mInternalRequest = MakeSafeRefPtr(aArgs.internalRequest()); + + RemoteWorkerChild* manager = static_cast(Manager()); + MOZ_ASSERT(manager); + + RefPtr self = this; + + auto callback = [self](const ServiceWorkerOpResult& aResult) { + if (!self->CanSend()) { + return; + } + + if (NS_WARN_IF(aResult.type() == ServiceWorkerOpResult::Tnsresult)) { + Unused << self->Send__delete__(self, aResult.get_nsresult()); + return; + } + + MOZ_ASSERT(aResult.type() == + ServiceWorkerOpResult::TServiceWorkerFetchEventOpResult); + + Unused << self->Send__delete__(self, aResult); + }; + + RefPtr op = ServiceWorkerOp::Create(aArgs, std::move(callback)) + .template downcast(); + + MOZ_ASSERT(op); + + op->SetActor(this); + mOp = op; + + op->GetRespondWithPromise() + ->Then(GetCurrentSerialEventTarget(), __func__, + [self = std::move(self)]( + FetchEventRespondWithPromise::ResolveOrRejectValue&& aResult) { + self->mRespondWithPromiseRequestHolder.Complete(); + + if (NS_WARN_IF(aResult.IsReject())) { + MOZ_ASSERT(NS_FAILED(aResult.RejectValue())); + + Unused << self->SendRespondWith( + CancelInterceptionArgs(aResult.RejectValue())); + return; + } + + auto& result = aResult.ResolveValue(); + + if (result.is()) { + IPCSynthesizeResponseArgs ipcArgs; + UniquePtr autoBodyStream = + MakeUnique(); + UniquePtr autoAlternativeBodyStream = + MakeUnique(); + nsresult rv = GetIPCSynthesizeResponseArgs( + &ipcArgs, result.extract(), + autoBodyStream, autoAlternativeBodyStream); + + if (NS_WARN_IF(NS_FAILED(rv))) { + Unused << self->SendRespondWith(CancelInterceptionArgs(rv)); + return; + } + + Unused << self->SendRespondWith(ipcArgs); + + if (ipcArgs.internalResponse().body()) { + autoBodyStream->TakeValue(); + } + + if (ipcArgs.internalResponse().alternativeBody()) { + autoAlternativeBodyStream->TakeValue(); + } + } else if (result.is()) { + Unused << self->SendRespondWith( + result.extract()); + } else { + Unused << self->SendRespondWith( + result.extract()); + } + }) + ->Track(mRespondWithPromiseRequestHolder); + + manager->MaybeStartOp(std::move(op)); +} + +SafeRefPtr FetchEventOpProxyChild::ExtractInternalRequest() { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + MOZ_ASSERT(mInternalRequest); + + return std::move(mInternalRequest); +} + +void FetchEventOpProxyChild::ActorDestroy(ActorDestroyReason) { + Unused << NS_WARN_IF(mRespondWithPromiseRequestHolder.Exists()); + mRespondWithPromiseRequestHolder.DisconnectIfExists(); + + mOp->RevokeActor(this); + mOp = nullptr; +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/FetchEventOpProxyChild.h b/dom/serviceworkers/FetchEventOpProxyChild.h new file mode 100644 index 0000000000..45abd6c994 --- /dev/null +++ b/dom/serviceworkers/FetchEventOpProxyChild.h @@ -0,0 +1,54 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_fetcheventopproxychild_h__ +#define mozilla_dom_fetcheventopproxychild_h__ + +#include "nsISupportsImpl.h" + +#include "ServiceWorkerOp.h" +#include "ServiceWorkerOpPromise.h" +#include "mozilla/RefPtr.h" +#include "mozilla/dom/InternalRequest.h" +#include "mozilla/dom/PFetchEventOpProxyChild.h" + +namespace mozilla { +namespace dom { + +class InternalRequest; +class ServiceWorkerFetchEventOpArgs; + +class FetchEventOpProxyChild final : public PFetchEventOpProxyChild { + friend class PFetchEventOpProxyChild; + + public: + NS_INLINE_DECL_THREADSAFE_REFCOUNTING(FetchEventOpProxyChild) + + FetchEventOpProxyChild() = default; + + void Initialize(const ServiceWorkerFetchEventOpArgs& aArgs); + + // Must only be called once and on a worker thread. + SafeRefPtr ExtractInternalRequest(); + + private: + ~FetchEventOpProxyChild() = default; + + void ActorDestroy(ActorDestroyReason) override; + + MozPromiseRequestHolder + mRespondWithPromiseRequestHolder; + + RefPtr mOp; + + // Initialized on RemoteWorkerService::Thread, read on a worker thread. + SafeRefPtr mInternalRequest; +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_fetcheventopproxychild_h__ diff --git a/dom/serviceworkers/FetchEventOpProxyParent.cpp b/dom/serviceworkers/FetchEventOpProxyParent.cpp new file mode 100644 index 0000000000..90569bf97d --- /dev/null +++ b/dom/serviceworkers/FetchEventOpProxyParent.cpp @@ -0,0 +1,190 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "FetchEventOpProxyParent.h" + +#include + +#include "nsCOMPtr.h" +#include "nsContentUtils.h" +#include "nsIInputStream.h" + +#include "mozilla/Assertions.h" +#include "mozilla/DebugOnly.h" +#include "mozilla/Result.h" +#include "mozilla/ResultExtensions.h" +#include "mozilla/UniquePtr.h" +#include "mozilla/Unused.h" +#include "mozilla/dom/InternalResponse.h" +#include "mozilla/dom/PRemoteWorkerParent.h" +#include "mozilla/dom/PRemoteWorkerControllerParent.h" +#include "mozilla/dom/FetchEventOpParent.h" +#include "mozilla/ipc/BackgroundParent.h" +#include "mozilla/ipc/IPCStreamUtils.h" +#include "mozilla/RemoteLazyInputStreamUtils.h" +#include "mozilla/RemoteLazyInputStreamStorage.h" + +namespace mozilla { + +using namespace ipc; + +namespace dom { + +namespace { + +nsresult MaybeDeserializeAndWrapForMainThread( + const Maybe& aSource, int64_t aBodyStreamSize, + Maybe& aSink, PBackgroundParent* aManager) { + if (aSource.isNothing()) { + return NS_OK; + } + + nsCOMPtr deserialized = + DeserializeIPCStream(aSource->get_ChildToParentStream().stream()); + + aSink = Some(ParentToParentStream()); + auto& uuid = aSink->get_ParentToParentStream().uuid(); + + MOZ_TRY(nsContentUtils::GenerateUUIDInPlace(uuid)); + + auto storageOrErr = RemoteLazyInputStreamStorage::Get(); + + if (NS_WARN_IF(storageOrErr.isErr())) { + return storageOrErr.unwrapErr(); + } + + auto storage = storageOrErr.unwrap(); + storage->AddStream(deserialized, uuid, aBodyStreamSize, 0); + return NS_OK; +} + +} // anonymous namespace + +/* static */ void FetchEventOpProxyParent::Create( + PRemoteWorkerParent* aManager, + RefPtr&& aPromise, + const ServiceWorkerFetchEventOpArgs& aArgs, + RefPtr aReal, nsCOMPtr aBodyStream) { + AssertIsInMainProcess(); + AssertIsOnBackgroundThread(); + MOZ_ASSERT(aManager); + MOZ_ASSERT(aReal); + + FetchEventOpProxyParent* actor = + new FetchEventOpProxyParent(std::move(aReal), std::move(aPromise)); + + ServiceWorkerFetchEventOpArgs copyArgs = aArgs; + IPCInternalRequest& copyRequest = copyArgs.internalRequest(); + + if (aBodyStream) { + PBackgroundParent* bgParent = aManager->Manager(); + MOZ_ASSERT(bgParent); + + copyRequest.body() = Some(ParentToChildStream()); + + RemoteLazyStream ipdlStream; + MOZ_ALWAYS_SUCCEEDS(RemoteLazyInputStreamUtils::SerializeInputStream( + aBodyStream, copyRequest.bodySize(), ipdlStream, bgParent)); + + copyRequest.body().ref().get_ParentToChildStream().actorParent() = + ipdlStream; + } + + Unused << aManager->SendPFetchEventOpProxyConstructor(actor, copyArgs); +} + +FetchEventOpProxyParent::~FetchEventOpProxyParent() { + AssertIsOnBackgroundThread(); +} + +FetchEventOpProxyParent::FetchEventOpProxyParent( + RefPtr&& aReal, + RefPtr&& aPromise) + : mReal(std::move(aReal)), mLifetimePromise(std::move(aPromise)) {} + +mozilla::ipc::IPCResult FetchEventOpProxyParent::RecvAsyncLog( + const nsCString& aScriptSpec, const uint32_t& aLineNumber, + const uint32_t& aColumnNumber, const nsCString& aMessageName, + nsTArray&& aParams) { + AssertIsOnBackgroundThread(); + MOZ_ASSERT(mReal); + + Unused << mReal->SendAsyncLog(aScriptSpec, aLineNumber, aColumnNumber, + aMessageName, aParams); + + return IPC_OK(); +} + +mozilla::ipc::IPCResult FetchEventOpProxyParent::RecvRespondWith( + const IPCFetchEventRespondWithResult& aResult) { + AssertIsOnBackgroundThread(); + MOZ_ASSERT(mReal); + + // IPCSynthesizeResponseArgs possibly contains an IPCStream. If so, + // deserialize it and reserialize it before forwarding it to the main thread. + if (aResult.type() == + IPCFetchEventRespondWithResult::TIPCSynthesizeResponseArgs) { + const IPCSynthesizeResponseArgs& originalArgs = + aResult.get_IPCSynthesizeResponseArgs(); + const IPCInternalResponse& originalResponse = + originalArgs.internalResponse(); + + // Do nothing if neither the body nor the alt. body can be deserialized. + if (!originalResponse.body() && !originalResponse.alternativeBody()) { + Unused << mReal->SendRespondWith(aResult); + return IPC_OK(); + } + + IPCSynthesizeResponseArgs copyArgs = originalArgs; + IPCInternalResponse& copyResponse = copyArgs.internalResponse(); + + PRemoteWorkerControllerParent* manager = mReal->Manager(); + MOZ_ASSERT(manager); + + PBackgroundParent* bgParent = manager->Manager(); + MOZ_ASSERT(bgParent); + + MOZ_ALWAYS_SUCCEEDS(MaybeDeserializeAndWrapForMainThread( + originalResponse.body(), copyResponse.bodySize(), copyResponse.body(), + bgParent)); + MOZ_ALWAYS_SUCCEEDS(MaybeDeserializeAndWrapForMainThread( + originalResponse.alternativeBody(), InternalResponse::UNKNOWN_BODY_SIZE, + copyResponse.alternativeBody(), bgParent)); + + Unused << mReal->SendRespondWith(copyArgs); + } else { + Unused << mReal->SendRespondWith(aResult); + } + + return IPC_OK(); +} + +mozilla::ipc::IPCResult FetchEventOpProxyParent::Recv__delete__( + const ServiceWorkerFetchEventOpResult& aResult) { + AssertIsOnBackgroundThread(); + MOZ_ASSERT(mLifetimePromise); + MOZ_ASSERT(mReal); + + if (mLifetimePromise) { + mLifetimePromise->Resolve(aResult, __func__); + mLifetimePromise = nullptr; + mReal = nullptr; + } + + return IPC_OK(); +} + +void FetchEventOpProxyParent::ActorDestroy(ActorDestroyReason) { + AssertIsOnBackgroundThread(); + if (mLifetimePromise) { + mLifetimePromise->Reject(NS_ERROR_DOM_ABORT_ERR, __func__); + mLifetimePromise = nullptr; + mReal = nullptr; + } +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/FetchEventOpProxyParent.h b/dom/serviceworkers/FetchEventOpProxyParent.h new file mode 100644 index 0000000000..bfd4332032 --- /dev/null +++ b/dom/serviceworkers/FetchEventOpProxyParent.h @@ -0,0 +1,68 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_fetcheventopproxyparent_h__ +#define mozilla_dom_fetcheventopproxyparent_h__ + +#include "mozilla/RefPtr.h" +#include "mozilla/dom/PFetchEventOpProxyParent.h" +#include "mozilla/dom/ServiceWorkerOpPromise.h" + +namespace mozilla { +namespace dom { + +class FetchEventOpParent; +class PRemoteWorkerParent; +class ServiceWorkerFetchEventOpArgs; + +/** + * FetchEventOpProxyParent owns a FetchEventOpParent in order to propagate + * the respondWith() value by directly calling SendRespondWith on the + * FetchEventOpParent, but the call to Send__delete__ is handled via MozPromise. + * This is done because this actor may only be created after its managing + * PRemoteWorker is created, which is asynchronous and may fail. We take on + * responsibility for the promise once we are created, but we may not be created + * if the RemoteWorker is never successfully launched. + */ +class FetchEventOpProxyParent final : public PFetchEventOpProxyParent { + friend class PFetchEventOpProxyParent; + + public: + static void Create( + PRemoteWorkerParent* aManager, + RefPtr&& aPromise, + const ServiceWorkerFetchEventOpArgs& aArgs, + RefPtr aReal, nsCOMPtr aBodyStream); + + ~FetchEventOpProxyParent(); + + private: + FetchEventOpProxyParent( + RefPtr&& aReal, + RefPtr&& aPromise); + + mozilla::ipc::IPCResult RecvAsyncLog(const nsCString& aScriptSpec, + const uint32_t& aLineNumber, + const uint32_t& aColumnNumber, + const nsCString& aMessageName, + nsTArray&& aParams); + + mozilla::ipc::IPCResult RecvRespondWith( + const IPCFetchEventRespondWithResult& aResult); + + mozilla::ipc::IPCResult Recv__delete__( + const ServiceWorkerFetchEventOpResult& aResult); + + void ActorDestroy(ActorDestroyReason) override; + + RefPtr mReal; + RefPtr mLifetimePromise; +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_fetcheventopproxyparent_h__ diff --git a/dom/serviceworkers/IPCServiceWorkerDescriptor.ipdlh b/dom/serviceworkers/IPCServiceWorkerDescriptor.ipdlh new file mode 100644 index 0000000000..0bb246b5a7 --- /dev/null +++ b/dom/serviceworkers/IPCServiceWorkerDescriptor.ipdlh @@ -0,0 +1,30 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +include PBackgroundSharedTypes; + +include "mozilla/dom/ServiceWorkerIPCUtils.h"; + +using ServiceWorkerState from "mozilla/dom/ServiceWorkerBinding.h"; + +namespace mozilla { +namespace dom { + +// IPC type with enough information to create a ServiceWorker DOM object +// in a child process. Note that the state may be slightly out-of-sync +// with the parent and should be updated dynamically if necessary. +comparable struct IPCServiceWorkerDescriptor +{ + uint64_t id; + uint64_t registrationId; + uint64_t registrationVersion; + PrincipalInfo principalInfo; + nsCString scope; + nsCString scriptURL; + ServiceWorkerState state; + bool handlesFetch; +}; + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/IPCServiceWorkerRegistrationDescriptor.ipdlh b/dom/serviceworkers/IPCServiceWorkerRegistrationDescriptor.ipdlh new file mode 100644 index 0000000000..f4efd54087 --- /dev/null +++ b/dom/serviceworkers/IPCServiceWorkerRegistrationDescriptor.ipdlh @@ -0,0 +1,58 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +include PBackgroundSharedTypes; +include IPCServiceWorkerDescriptor; + +include "ipc/ErrorIPCUtils.h"; +include "mozilla/dom/ServiceWorkerIPCUtils.h"; + +using ServiceWorkerUpdateViaCache from "mozilla/dom/ServiceWorkerRegistrationBinding.h"; +using mozilla::CopyableErrorResult from "mozilla/ErrorResult.h"; + +namespace mozilla { +namespace dom { + +// IPC type with enough information to create a ServiceWorker DOM object +// in a child process. Note that the state may be slightly out-of-sync +// with the parent and should be updated dynamically if necessary. +comparable struct IPCServiceWorkerRegistrationDescriptor +{ + uint64_t id; + uint64_t version; + + // These values should match the principal and scope in each + // associated worker. It may be possible to optimize in the future, + // but for now we duplicate the information here to ensure correctness. + // Its possible we may need to reference a registration before the + // worker is installed yet, etc. + PrincipalInfo principalInfo; + nsCString scope; + + ServiceWorkerUpdateViaCache updateViaCache; + + IPCServiceWorkerDescriptor? installing; + IPCServiceWorkerDescriptor? waiting; + IPCServiceWorkerDescriptor? active; +}; + +union IPCServiceWorkerRegistrationDescriptorOrCopyableErrorResult +{ + IPCServiceWorkerRegistrationDescriptor; + CopyableErrorResult; +}; + +struct IPCServiceWorkerRegistrationDescriptorList +{ + IPCServiceWorkerRegistrationDescriptor[] values; +}; + +union IPCServiceWorkerRegistrationDescriptorListOrCopyableErrorResult +{ + IPCServiceWorkerRegistrationDescriptorList; + CopyableErrorResult; +}; + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/PFetchEventOp.ipdl b/dom/serviceworkers/PFetchEventOp.ipdl new file mode 100644 index 0000000000..07d376c05f --- /dev/null +++ b/dom/serviceworkers/PFetchEventOp.ipdl @@ -0,0 +1,26 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +include protocol PRemoteWorkerController; + +include ServiceWorkerOpArgs; + +namespace mozilla { +namespace dom { + +protocol PFetchEventOp { + manager PRemoteWorkerController; + + child: + async AsyncLog(nsCString aScriptSpec, uint32_t aLineNumber, + uint32_t aColumnNumber, nsCString aMessageName, + nsString[] aParams); + + async RespondWith(IPCFetchEventRespondWithResult aResult); + + async __delete__(ServiceWorkerFetchEventOpResult aResult); +}; + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/PFetchEventOpProxy.ipdl b/dom/serviceworkers/PFetchEventOpProxy.ipdl new file mode 100644 index 0000000000..7182eef03e --- /dev/null +++ b/dom/serviceworkers/PFetchEventOpProxy.ipdl @@ -0,0 +1,26 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +include protocol PRemoteWorker; + +include ServiceWorkerOpArgs; + +namespace mozilla { +namespace dom { + +protocol PFetchEventOpProxy { + manager PRemoteWorker; + + parent: + async AsyncLog(nsCString aScriptSpec, uint32_t aLineNumber, + uint32_t aColumnNumber, nsCString aMessageName, + nsString[] aParams); + + async RespondWith(IPCFetchEventRespondWithResult aResult); + + async __delete__(ServiceWorkerFetchEventOpResult aResult); +}; + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/PServiceWorker.ipdl b/dom/serviceworkers/PServiceWorker.ipdl new file mode 100644 index 0000000000..2dd9458af6 --- /dev/null +++ b/dom/serviceworkers/PServiceWorker.ipdl @@ -0,0 +1,27 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +include protocol PBackground; + +include ClientIPCTypes; +include DOMTypes; + +namespace mozilla { +namespace dom { + +refcounted protocol PServiceWorker +{ + manager PBackground; + +parent: + async Teardown(); + + async PostMessage(ClonedOrErrorMessageData aClonedData, ClientInfoAndState aSource); + +child: + async __delete__(); +}; + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/PServiceWorkerContainer.ipdl b/dom/serviceworkers/PServiceWorkerContainer.ipdl new file mode 100644 index 0000000000..a614ee92b6 --- /dev/null +++ b/dom/serviceworkers/PServiceWorkerContainer.ipdl @@ -0,0 +1,40 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +include protocol PBackground; + +include ClientIPCTypes; +include IPCServiceWorkerRegistrationDescriptor; + +include "mozilla/dom/ServiceWorkerIPCUtils.h"; + +namespace mozilla { +namespace dom { + +refcounted protocol PServiceWorkerContainer +{ + manager PBackground; + +parent: + async Teardown(); + + async Register(IPCClientInfo aClientInfo, nsCString aScopeURL, nsCString aScriptURL, + ServiceWorkerUpdateViaCache aUpdateViaCache) + returns (IPCServiceWorkerRegistrationDescriptorOrCopyableErrorResult aResult); + + async GetRegistration(IPCClientInfo aClientInfo, nsCString aURL) + returns (IPCServiceWorkerRegistrationDescriptorOrCopyableErrorResult aResult); + + async GetRegistrations(IPCClientInfo aClientInfo) + returns (IPCServiceWorkerRegistrationDescriptorListOrCopyableErrorResult aResult); + + async GetReady(IPCClientInfo aClientInfo) + returns (IPCServiceWorkerRegistrationDescriptorOrCopyableErrorResult aResult); + +child: + async __delete__(); +}; + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/PServiceWorkerManager.ipdl b/dom/serviceworkers/PServiceWorkerManager.ipdl new file mode 100644 index 0000000000..0515d48630 --- /dev/null +++ b/dom/serviceworkers/PServiceWorkerManager.ipdl @@ -0,0 +1,50 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +include protocol PBackground; +include protocol PServiceWorkerUpdater; + +include PBackgroundSharedTypes; +include ServiceWorkerRegistrarTypes; + +using mozilla::OriginAttributes from "mozilla/ipc/BackgroundUtils.h"; + +namespace mozilla { +namespace dom { + +protocol PServiceWorkerManager +{ + manager PBackground; + manages PServiceWorkerUpdater; + +parent: + async Register(ServiceWorkerRegistrationData data); + + async Unregister(PrincipalInfo principalInfo, nsString scope); + + async PropagateSoftUpdate(OriginAttributes originAttributes, + nsString scope); + async PropagateUnregister(PrincipalInfo principalInfo, nsString scope); + + async PropagateRemove(nsCString host); + + async PropagateRemoveAll(); + + async Shutdown(); + + async PServiceWorkerUpdater(OriginAttributes originAttributes, + nsCString scope); + +child: + async NotifyRegister(ServiceWorkerRegistrationData data); + async NotifySoftUpdate(OriginAttributes originAttributes, nsString scope); + async NotifyUnregister(PrincipalInfo principalInfo, nsString scope); + async NotifyRemove(nsCString host); + async NotifyRemoveAll(); + + async __delete__(); +}; + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/PServiceWorkerRegistration.ipdl b/dom/serviceworkers/PServiceWorkerRegistration.ipdl new file mode 100644 index 0000000000..fd610a8911 --- /dev/null +++ b/dom/serviceworkers/PServiceWorkerRegistration.ipdl @@ -0,0 +1,33 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +include protocol PBackground; + +include IPCServiceWorkerRegistrationDescriptor; + +include "ipc/ErrorIPCUtils.h"; + +namespace mozilla { +namespace dom { + +refcounted protocol PServiceWorkerRegistration +{ + manager PBackground; + +parent: + async Teardown(); + + async Unregister() returns (bool aSuccess, CopyableErrorResult aRv); + async Update(nsCString aNewestWorkerScriptUrl) returns ( + IPCServiceWorkerRegistrationDescriptorOrCopyableErrorResult aResult); + +child: + async __delete__(); + + async UpdateState(IPCServiceWorkerRegistrationDescriptor aDescriptor); + async FireUpdateFound(); +}; + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/PServiceWorkerUpdater.ipdl b/dom/serviceworkers/PServiceWorkerUpdater.ipdl new file mode 100644 index 0000000000..2036d2d4ca --- /dev/null +++ b/dom/serviceworkers/PServiceWorkerUpdater.ipdl @@ -0,0 +1,25 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +include protocol PServiceWorkerManager; + +namespace mozilla { +namespace dom { + +protocol PServiceWorkerUpdater +{ + manager PServiceWorkerManager; + +parent: + // This __delete__ is safe because it's called when Proceed() is received and + // no other IPC messages are received nor sent. + async __delete__(); + +child: + async Proceed(bool allowed); +}; + +} // namespace dom +} // namespace mozilla + diff --git a/dom/serviceworkers/RemoteServiceWorkerContainerImpl.cpp b/dom/serviceworkers/RemoteServiceWorkerContainerImpl.cpp new file mode 100644 index 0000000000..21a6f012c7 --- /dev/null +++ b/dom/serviceworkers/RemoteServiceWorkerContainerImpl.cpp @@ -0,0 +1,238 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "RemoteServiceWorkerContainerImpl.h" + +#include + +#include "mozilla/ipc/BackgroundChild.h" +#include "mozilla/ipc/PBackgroundChild.h" +#include "ServiceWorkerContainerChild.h" + +namespace mozilla { +namespace dom { + +using mozilla::ipc::BackgroundChild; +using mozilla::ipc::PBackgroundChild; +using mozilla::ipc::ResponseRejectReason; + +RemoteServiceWorkerContainerImpl::~RemoteServiceWorkerContainerImpl() { + Shutdown(); + MOZ_DIAGNOSTIC_ASSERT(!mOuter); +} + +void RemoteServiceWorkerContainerImpl::Shutdown() { + if (mShutdown) { + return; + } + mShutdown = true; + + if (mActor) { + mActor->RevokeOwner(this); + mActor->MaybeStartTeardown(); + mActor = nullptr; + } +} + +void RemoteServiceWorkerContainerImpl::AddContainer( + ServiceWorkerContainer* aOuter) { + MOZ_DIAGNOSTIC_ASSERT(aOuter); + MOZ_DIAGNOSTIC_ASSERT(!mOuter); + mOuter = aOuter; +} + +void RemoteServiceWorkerContainerImpl::RemoveContainer( + ServiceWorkerContainer* aOuter) { + MOZ_DIAGNOSTIC_ASSERT(aOuter); + MOZ_DIAGNOSTIC_ASSERT(mOuter == aOuter); + mOuter = nullptr; +} + +void RemoteServiceWorkerContainerImpl::Register( + const ClientInfo& aClientInfo, const nsACString& aScopeURL, + const nsACString& aScriptURL, ServiceWorkerUpdateViaCache aUpdateViaCache, + ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) const { + if (!mActor) { + CopyableErrorResult rv; + rv.ThrowInvalidStateError("Can't register service worker"); + aFailureCB(std::move(rv)); + return; + } + + mActor->SendRegister( + aClientInfo.ToIPC(), nsCString(aScopeURL), nsCString(aScriptURL), + aUpdateViaCache, + [successCB = std::move(aSuccessCB), aFailureCB]( + const IPCServiceWorkerRegistrationDescriptorOrCopyableErrorResult& + aResult) { + if (aResult.type() == + IPCServiceWorkerRegistrationDescriptorOrCopyableErrorResult:: + TCopyableErrorResult) { + // application layer error + auto& rv = aResult.get_CopyableErrorResult(); + MOZ_DIAGNOSTIC_ASSERT(rv.Failed()); + aFailureCB(CopyableErrorResult(rv)); + return; + } + // success + auto& ipcDesc = aResult.get_IPCServiceWorkerRegistrationDescriptor(); + successCB(ServiceWorkerRegistrationDescriptor(ipcDesc)); + }, + [aFailureCB](ResponseRejectReason&& aReason) { + // IPC layer error + CopyableErrorResult rv; + rv.ThrowInvalidStateError("Failed to register service worker"); + aFailureCB(std::move(rv)); + }); +} + +void RemoteServiceWorkerContainerImpl::GetRegistration( + const ClientInfo& aClientInfo, const nsACString& aURL, + ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) const { + if (!mActor) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + mActor->SendGetRegistration( + aClientInfo.ToIPC(), nsCString(aURL), + [successCB = std::move(aSuccessCB), aFailureCB]( + const IPCServiceWorkerRegistrationDescriptorOrCopyableErrorResult& + aResult) { + if (aResult.type() == + IPCServiceWorkerRegistrationDescriptorOrCopyableErrorResult:: + TCopyableErrorResult) { + auto& rv = aResult.get_CopyableErrorResult(); + // If rv is a failure then this is an application layer error. Note, + // though, we also reject with NS_OK to indicate that we just didn't + // find a registration. + aFailureCB(CopyableErrorResult(rv)); + return; + } + // success + auto& ipcDesc = aResult.get_IPCServiceWorkerRegistrationDescriptor(); + successCB(ServiceWorkerRegistrationDescriptor(ipcDesc)); + }, + [aFailureCB](ResponseRejectReason&& aReason) { + // IPC layer error + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + }); +} + +void RemoteServiceWorkerContainerImpl::GetRegistrations( + const ClientInfo& aClientInfo, + ServiceWorkerRegistrationListCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) const { + if (!mActor) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + mActor->SendGetRegistrations( + aClientInfo.ToIPC(), + [successCB = std::move(aSuccessCB), aFailureCB]( + const IPCServiceWorkerRegistrationDescriptorListOrCopyableErrorResult& + aResult) { + if (aResult.type() == + IPCServiceWorkerRegistrationDescriptorListOrCopyableErrorResult:: + TCopyableErrorResult) { + // application layer error + auto& rv = aResult.get_CopyableErrorResult(); + MOZ_DIAGNOSTIC_ASSERT(rv.Failed()); + aFailureCB(CopyableErrorResult(rv)); + return; + } + // success + auto& ipcList = + aResult.get_IPCServiceWorkerRegistrationDescriptorList(); + nsTArray list( + ipcList.values().Length()); + for (auto& ipcDesc : ipcList.values()) { + list.AppendElement(ServiceWorkerRegistrationDescriptor(ipcDesc)); + } + successCB(std::move(list)); + }, + [aFailureCB](ResponseRejectReason&& aReason) { + // IPC layer error + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + }); +} + +void RemoteServiceWorkerContainerImpl::GetReady( + const ClientInfo& aClientInfo, + ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) const { + if (!mActor) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + mActor->SendGetReady( + aClientInfo.ToIPC(), + [successCB = std::move(aSuccessCB), aFailureCB]( + const IPCServiceWorkerRegistrationDescriptorOrCopyableErrorResult& + aResult) { + if (aResult.type() == + IPCServiceWorkerRegistrationDescriptorOrCopyableErrorResult:: + TCopyableErrorResult) { + // application layer error + auto& rv = aResult.get_CopyableErrorResult(); + MOZ_DIAGNOSTIC_ASSERT(rv.Failed()); + aFailureCB(CopyableErrorResult(rv)); + return; + } + // success + auto& ipcDesc = aResult.get_IPCServiceWorkerRegistrationDescriptor(); + successCB(ServiceWorkerRegistrationDescriptor(ipcDesc)); + }, + [aFailureCB](ResponseRejectReason&& aReason) { + // IPC layer error + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + }); +} + +RemoteServiceWorkerContainerImpl::RemoteServiceWorkerContainerImpl() + : mOuter(nullptr), mShutdown(false) { + PBackgroundChild* parentActor = + BackgroundChild::GetOrCreateForCurrentThread(); + if (NS_WARN_IF(!parentActor)) { + Shutdown(); + return; + } + + RefPtr actor = + ServiceWorkerContainerChild::Create(); + if (NS_WARN_IF(!actor)) { + Shutdown(); + return; + } + + PServiceWorkerContainerChild* sentActor = + parentActor->SendPServiceWorkerContainerConstructor(actor); + if (NS_WARN_IF(!sentActor)) { + Shutdown(); + return; + } + MOZ_DIAGNOSTIC_ASSERT(sentActor == actor); + + mActor = std::move(actor); + mActor->SetOwner(this); +} + +void RemoteServiceWorkerContainerImpl::RevokeActor( + ServiceWorkerContainerChild* aActor) { + MOZ_DIAGNOSTIC_ASSERT(mActor); + MOZ_DIAGNOSTIC_ASSERT(mActor == aActor); + mActor->RevokeOwner(this); + mActor = nullptr; + + mShutdown = true; +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/RemoteServiceWorkerContainerImpl.h b/dom/serviceworkers/RemoteServiceWorkerContainerImpl.h new file mode 100644 index 0000000000..fffe7002d1 --- /dev/null +++ b/dom/serviceworkers/RemoteServiceWorkerContainerImpl.h @@ -0,0 +1,63 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_remoteserviceworkercontainerimpl_h__ +#define mozilla_dom_remoteserviceworkercontainerimpl_h__ + +#include "ServiceWorkerContainer.h" + +namespace mozilla { +namespace dom { + +class ServiceWorkerContainerChild; + +class RemoteServiceWorkerContainerImpl final + : public ServiceWorkerContainer::Inner { + RefPtr mActor; + ServiceWorkerContainer* mOuter; + bool mShutdown; + + ~RemoteServiceWorkerContainerImpl(); + + void Shutdown(); + + // ServiceWorkerContainer::Inner implementation + void AddContainer(ServiceWorkerContainer* aOuter) override; + + void RemoveContainer(ServiceWorkerContainer* aOuter) override; + + void Register(const ClientInfo& aClientInfo, const nsACString& aScopeURL, + const nsACString& aScriptURL, + ServiceWorkerUpdateViaCache aUpdateViaCache, + ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) const override; + + void GetRegistration( + const ClientInfo& aClientInfo, const nsACString& aURL, + ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) const override; + + void GetRegistrations( + const ClientInfo& aClientInfo, + ServiceWorkerRegistrationListCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) const override; + + void GetReady(const ClientInfo& aClientInfo, + ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) const override; + + public: + RemoteServiceWorkerContainerImpl(); + + void RevokeActor(ServiceWorkerContainerChild* aActor); + + NS_INLINE_DECL_REFCOUNTING(RemoteServiceWorkerContainerImpl, override) +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_remoteserviceworkercontainerimpl_h__ diff --git a/dom/serviceworkers/RemoteServiceWorkerImpl.cpp b/dom/serviceworkers/RemoteServiceWorkerImpl.cpp new file mode 100644 index 0000000000..9fa898cb55 --- /dev/null +++ b/dom/serviceworkers/RemoteServiceWorkerImpl.cpp @@ -0,0 +1,118 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "RemoteServiceWorkerImpl.h" + +#include + +#include "mozilla/dom/ClientInfo.h" +#include "mozilla/dom/ClientState.h" +#include "mozilla/ipc/BackgroundChild.h" +#include "mozilla/ipc/PBackgroundChild.h" +#include "ServiceWorkerChild.h" +#include "ServiceWorkerCloneData.h" + +namespace mozilla { +namespace dom { + +using mozilla::ipc::BackgroundChild; +using mozilla::ipc::PBackgroundChild; + +RemoteServiceWorkerImpl::~RemoteServiceWorkerImpl() { + MOZ_DIAGNOSTIC_ASSERT(!mWorker); + Shutdown(); +} + +void RemoteServiceWorkerImpl::Shutdown() { + if (mShutdown) { + return; + } + mShutdown = true; + + if (mActor) { + mActor->RevokeOwner(this); + mActor->MaybeStartTeardown(); + mActor = nullptr; + } +} + +void RemoteServiceWorkerImpl::AddServiceWorker(ServiceWorker* aWorker) { + NS_ASSERT_OWNINGTHREAD(RemoteServiceWorkerImpl); + MOZ_DIAGNOSTIC_ASSERT(!mWorker); + MOZ_DIAGNOSTIC_ASSERT(aWorker); + mWorker = aWorker; +} + +void RemoteServiceWorkerImpl::RemoveServiceWorker(ServiceWorker* aWorker) { + NS_ASSERT_OWNINGTHREAD(RemoteServiceWorkerImpl); + MOZ_DIAGNOSTIC_ASSERT(mWorker); + MOZ_DIAGNOSTIC_ASSERT(aWorker == mWorker); + mWorker = nullptr; +} + +void RemoteServiceWorkerImpl::GetRegistration( + ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) { + // TODO +} + +void RemoteServiceWorkerImpl::PostMessage( + RefPtr&& aData, const ClientInfo& aClientInfo, + const ClientState& aClientState) { + NS_ASSERT_OWNINGTHREAD(RemoteServiceWorkerImpl); + if (!mActor) { + return; + } + + ClonedOrErrorMessageData data; + if (!aData->BuildClonedMessageDataForBackgroundChild(mActor->Manager(), + data)) { + return; + } + + mActor->SendPostMessage( + data, ClientInfoAndState(aClientInfo.ToIPC(), aClientState.ToIPC())); +} + +RemoteServiceWorkerImpl::RemoteServiceWorkerImpl( + const ServiceWorkerDescriptor& aDescriptor) + : mWorker(nullptr), mShutdown(false) { + PBackgroundChild* parentActor = + BackgroundChild::GetOrCreateForCurrentThread(); + if (NS_WARN_IF(!parentActor)) { + Shutdown(); + return; + } + + RefPtr actor = ServiceWorkerChild::Create(); + if (NS_WARN_IF(!actor)) { + Shutdown(); + return; + } + + PServiceWorkerChild* sentActor = + parentActor->SendPServiceWorkerConstructor(actor, aDescriptor.ToIPC()); + if (NS_WARN_IF(!sentActor)) { + Shutdown(); + return; + } + MOZ_DIAGNOSTIC_ASSERT(sentActor == actor); + + mActor = std::move(actor); + mActor->SetOwner(this); +} + +void RemoteServiceWorkerImpl::RevokeActor(ServiceWorkerChild* aActor) { + MOZ_DIAGNOSTIC_ASSERT(mActor); + MOZ_DIAGNOSTIC_ASSERT(mActor == aActor); + mActor->RevokeOwner(this); + mActor = nullptr; + + mShutdown = true; +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/RemoteServiceWorkerImpl.h b/dom/serviceworkers/RemoteServiceWorkerImpl.h new file mode 100644 index 0000000000..df86552195 --- /dev/null +++ b/dom/serviceworkers/RemoteServiceWorkerImpl.h @@ -0,0 +1,49 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_remoteserviceworkerimpl_h__ +#define mozilla_dom_remoteserviceworkerimpl_h__ + +#include "ServiceWorker.h" + +namespace mozilla { +namespace dom { + +class ServiceWorkerChild; + +class RemoteServiceWorkerImpl final : public ServiceWorker::Inner { + RefPtr mActor; + ServiceWorker* mWorker; + bool mShutdown; + + ~RemoteServiceWorkerImpl(); + + void Shutdown(); + + // ServiceWorker::Inner implementation + void AddServiceWorker(ServiceWorker* aWorker) override; + + void RemoveServiceWorker(ServiceWorker* aWorker) override; + + void GetRegistration(ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) override; + + void PostMessage(RefPtr&& aData, + const ClientInfo& aClientInfo, + const ClientState& aClientState) override; + + public: + explicit RemoteServiceWorkerImpl(const ServiceWorkerDescriptor& aDescriptor); + + void RevokeActor(ServiceWorkerChild* aActor); + + NS_INLINE_DECL_REFCOUNTING(RemoteServiceWorkerImpl, override) +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_remoteserviceworkerimpl_h__ diff --git a/dom/serviceworkers/RemoteServiceWorkerRegistrationImpl.cpp b/dom/serviceworkers/RemoteServiceWorkerRegistrationImpl.cpp new file mode 100644 index 0000000000..399ca87519 --- /dev/null +++ b/dom/serviceworkers/RemoteServiceWorkerRegistrationImpl.cpp @@ -0,0 +1,170 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "RemoteServiceWorkerRegistrationImpl.h" + +#include "ServiceWorkerRegistrationChild.h" +#include "mozilla/ipc/PBackgroundChild.h" +#include "mozilla/ipc/BackgroundChild.h" + +namespace mozilla { +namespace dom { + +using mozilla::ipc::IPCResult; +using mozilla::ipc::ResponseRejectReason; + +RemoteServiceWorkerRegistrationImpl::~RemoteServiceWorkerRegistrationImpl() { + MOZ_DIAGNOSTIC_ASSERT(!mOuter); + Shutdown(); +} + +void RemoteServiceWorkerRegistrationImpl::Shutdown() { + if (mShutdown) { + return; + } + mShutdown = true; + + if (mActor) { + mActor->RevokeOwner(this); + mActor->MaybeStartTeardown(); + mActor = nullptr; + } +} + +void RemoteServiceWorkerRegistrationImpl::SetServiceWorkerRegistration( + ServiceWorkerRegistration* aReg) { + NS_ASSERT_OWNINGTHREAD(RemoteServiceWorkerRegistrationImpl); + MOZ_DIAGNOSTIC_ASSERT(!mOuter); + MOZ_DIAGNOSTIC_ASSERT(aReg); + mOuter = aReg; +} + +void RemoteServiceWorkerRegistrationImpl::ClearServiceWorkerRegistration( + ServiceWorkerRegistration* aReg) { + NS_ASSERT_OWNINGTHREAD(RemoteServiceWorkerRegistrationImpl); + MOZ_DIAGNOSTIC_ASSERT(mOuter); + MOZ_DIAGNOSTIC_ASSERT(aReg == mOuter); + mOuter = nullptr; +} + +void RemoteServiceWorkerRegistrationImpl::Update( + const nsCString& aNewestWorkerScriptUrl, + ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) { + if (!mActor) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + mActor->SendUpdate( + aNewestWorkerScriptUrl, + [successCB = std::move(aSuccessCB), aFailureCB]( + const IPCServiceWorkerRegistrationDescriptorOrCopyableErrorResult& + aResult) { + if (aResult.type() == + IPCServiceWorkerRegistrationDescriptorOrCopyableErrorResult:: + TCopyableErrorResult) { + // application layer error + auto& rv = aResult.get_CopyableErrorResult(); + MOZ_DIAGNOSTIC_ASSERT(rv.Failed()); + aFailureCB(CopyableErrorResult(rv)); + return; + } + // success + auto& ipcDesc = aResult.get_IPCServiceWorkerRegistrationDescriptor(); + successCB(ServiceWorkerRegistrationDescriptor(ipcDesc)); + }, + [aFailureCB](ResponseRejectReason&& aReason) { + // IPC layer error + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + }); +} + +void RemoteServiceWorkerRegistrationImpl::Unregister( + ServiceWorkerBoolCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) { + if (!mActor) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + mActor->SendUnregister( + [successCB = std::move(aSuccessCB), + aFailureCB](Tuple&& aResult) { + if (Get<1>(aResult).Failed()) { + // application layer error + aFailureCB(std::move(Get<1>(aResult))); + return; + } + // success + successCB(Get<0>(aResult)); + }, + [aFailureCB](ResponseRejectReason&& aReason) { + // IPC layer error + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + }); +} + +RemoteServiceWorkerRegistrationImpl::RemoteServiceWorkerRegistrationImpl( + const ServiceWorkerRegistrationDescriptor& aDescriptor) + : mOuter(nullptr), mShutdown(false) { + ::mozilla::ipc::PBackgroundChild* parentActor = + ::mozilla::ipc::BackgroundChild::GetOrCreateForCurrentThread(); + if (NS_WARN_IF(!parentActor)) { + Shutdown(); + return; + } + + auto actor = ServiceWorkerRegistrationChild::Create(); + if (NS_WARN_IF(!actor)) { + Shutdown(); + return; + } + + PServiceWorkerRegistrationChild* sentActor = + parentActor->SendPServiceWorkerRegistrationConstructor( + actor, aDescriptor.ToIPC()); + if (NS_WARN_IF(!sentActor)) { + Shutdown(); + return; + } + MOZ_DIAGNOSTIC_ASSERT(sentActor == actor); + + mActor = std::move(actor); + mActor->SetOwner(this); +} + +void RemoteServiceWorkerRegistrationImpl::RevokeActor( + ServiceWorkerRegistrationChild* aActor) { + MOZ_DIAGNOSTIC_ASSERT(mActor); + MOZ_DIAGNOSTIC_ASSERT(mActor == aActor); + mActor->RevokeOwner(this); + mActor = nullptr; + + mShutdown = true; + + if (mOuter) { + RefPtr outer = mOuter; + outer->RegistrationCleared(); + } +} + +void RemoteServiceWorkerRegistrationImpl::UpdateState( + const ServiceWorkerRegistrationDescriptor& aDescriptor) { + if (mOuter) { + RefPtr outer = mOuter; + outer->UpdateState(aDescriptor); + } +} + +void RemoteServiceWorkerRegistrationImpl::FireUpdateFound() { + if (mOuter) { + mOuter->MaybeDispatchUpdateFoundRunnable(); + } +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/RemoteServiceWorkerRegistrationImpl.h b/dom/serviceworkers/RemoteServiceWorkerRegistrationImpl.h new file mode 100644 index 0000000000..69d08cc75b --- /dev/null +++ b/dom/serviceworkers/RemoteServiceWorkerRegistrationImpl.h @@ -0,0 +1,55 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_remoteserviceworkerregistrationimpl_h__ +#define mozilla_dom_remoteserviceworkerregistrationimpl_h__ + +#include "ServiceWorkerRegistration.h" + +namespace mozilla { +namespace dom { + +class ServiceWorkerRegistrationChild; + +class RemoteServiceWorkerRegistrationImpl final + : public ServiceWorkerRegistration::Inner { + RefPtr mActor; + ServiceWorkerRegistration* mOuter; + bool mShutdown; + + ~RemoteServiceWorkerRegistrationImpl(); + + void Shutdown(); + + // ServiceWorkerRegistration::Inner implementation + void SetServiceWorkerRegistration(ServiceWorkerRegistration* aReg) override; + + void ClearServiceWorkerRegistration(ServiceWorkerRegistration* aReg) override; + + void Update(const nsCString& aNewestWorkerScriptUrl, + ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) override; + + void Unregister(ServiceWorkerBoolCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) override; + + public: + explicit RemoteServiceWorkerRegistrationImpl( + const ServiceWorkerRegistrationDescriptor& aDescriptor); + + void RevokeActor(ServiceWorkerRegistrationChild* aActor); + + void UpdateState(const ServiceWorkerRegistrationDescriptor& aDescriptor); + + void FireUpdateFound(); + + NS_INLINE_DECL_REFCOUNTING(RemoteServiceWorkerRegistrationImpl, override) +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_remoteserviceworkerregistrationimpl_h__ diff --git a/dom/serviceworkers/ServiceWorker.cpp b/dom/serviceworkers/ServiceWorker.cpp new file mode 100644 index 0000000000..47c4e6ff44 --- /dev/null +++ b/dom/serviceworkers/ServiceWorker.cpp @@ -0,0 +1,274 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this file, + * You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorker.h" + +#include "mozilla/dom/Document.h" +#include "nsGlobalWindowInner.h" +#include "nsPIDOMWindow.h" +#include "RemoteServiceWorkerImpl.h" +#include "ServiceWorkerCloneData.h" +#include "ServiceWorkerImpl.h" +#include "ServiceWorkerManager.h" +#include "ServiceWorkerPrivate.h" +#include "ServiceWorkerRegistration.h" +#include "ServiceWorkerUtils.h" + +#include "mozilla/dom/ClientIPCTypes.h" +#include "mozilla/dom/ClientState.h" +#include "mozilla/dom/MessagePortBinding.h" +#include "mozilla/dom/Promise.h" +#include "mozilla/dom/ServiceWorkerGlobalScopeBinding.h" +#include "mozilla/dom/WorkerPrivate.h" +#include "mozilla/StaticPrefs_dom.h" +#include "mozilla/StorageAccess.h" +#include "nsGlobalWindowInner.h" + +#ifdef XP_WIN +# undef PostMessage +#endif + +using mozilla::ErrorResult; +using namespace mozilla::dom; + +namespace mozilla { +namespace dom { + +bool ServiceWorkerVisible(JSContext* aCx, JSObject* aObj) { + if (NS_IsMainThread()) { + return StaticPrefs::dom_serviceWorkers_enabled(); + } + + return IS_INSTANCE_OF(ServiceWorkerGlobalScope, aObj); +} + +// static +already_AddRefed ServiceWorker::Create( + nsIGlobalObject* aOwner, const ServiceWorkerDescriptor& aDescriptor) { + RefPtr ref; + RefPtr inner; + + if (ServiceWorkerParentInterceptEnabled()) { + inner = new RemoteServiceWorkerImpl(aDescriptor); + } else { + RefPtr swm = ServiceWorkerManager::GetInstance(); + NS_ENSURE_TRUE(swm, nullptr); + + RefPtr reg = + swm->GetRegistration(aDescriptor.PrincipalInfo(), aDescriptor.Scope()); + NS_ENSURE_TRUE(reg, nullptr); + + RefPtr info = reg->GetByDescriptor(aDescriptor); + NS_ENSURE_TRUE(info, nullptr); + + inner = new ServiceWorkerImpl(info, reg); + } + + NS_ENSURE_TRUE(inner, nullptr); + + ref = new ServiceWorker(aOwner, aDescriptor, inner); + return ref.forget(); +} + +ServiceWorker::ServiceWorker(nsIGlobalObject* aGlobal, + const ServiceWorkerDescriptor& aDescriptor, + ServiceWorker::Inner* aInner) + : DOMEventTargetHelper(aGlobal), + mDescriptor(aDescriptor), + mInner(aInner), + mLastNotifiedState(ServiceWorkerState::Installing) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_DIAGNOSTIC_ASSERT(aGlobal); + MOZ_DIAGNOSTIC_ASSERT(mInner); + + KeepAliveIfHasListenersFor(u"statechange"_ns); + + // The error event handler is required by the spec currently, but is not used + // anywhere. Don't keep the object alive in that case. + + // This will update our state too. + mInner->AddServiceWorker(this); + + // Attempt to get an existing binding object for the registration + // associated with this ServiceWorker. + RefPtr reg = + aGlobal->GetServiceWorkerRegistration(ServiceWorkerRegistrationDescriptor( + mDescriptor.RegistrationId(), mDescriptor.RegistrationVersion(), + mDescriptor.PrincipalInfo(), mDescriptor.Scope(), + ServiceWorkerUpdateViaCache::Imports)); + if (reg) { + MaybeAttachToRegistration(reg); + } else { + RefPtr self = this; + + mInner->GetRegistration( + [self = std::move(self)]( + const ServiceWorkerRegistrationDescriptor& aDescriptor) { + nsIGlobalObject* global = self->GetParentObject(); + NS_ENSURE_TRUE_VOID(global); + RefPtr reg = + global->GetOrCreateServiceWorkerRegistration(aDescriptor); + self->MaybeAttachToRegistration(reg); + }, + [](ErrorResult&& aRv) { + // do nothing + aRv.SuppressException(); + }); + } +} + +ServiceWorker::~ServiceWorker() { + MOZ_ASSERT(NS_IsMainThread()); + mInner->RemoveServiceWorker(this); +} + +NS_IMPL_CYCLE_COLLECTION_INHERITED(ServiceWorker, DOMEventTargetHelper, + mRegistration); + +NS_IMPL_ADDREF_INHERITED(ServiceWorker, DOMEventTargetHelper) +NS_IMPL_RELEASE_INHERITED(ServiceWorker, DOMEventTargetHelper) + +NS_INTERFACE_MAP_BEGIN_CYCLE_COLLECTION(ServiceWorker) + NS_INTERFACE_MAP_ENTRY(ServiceWorker) +NS_INTERFACE_MAP_END_INHERITING(DOMEventTargetHelper) + +JSObject* ServiceWorker::WrapObject(JSContext* aCx, + JS::Handle aGivenProto) { + MOZ_ASSERT(NS_IsMainThread()); + + return ServiceWorker_Binding::Wrap(aCx, this, aGivenProto); +} + +ServiceWorkerState ServiceWorker::State() const { return mDescriptor.State(); } + +void ServiceWorker::SetState(ServiceWorkerState aState) { + NS_ENSURE_TRUE_VOID(aState >= mDescriptor.State()); + mDescriptor.SetState(aState); +} + +void ServiceWorker::MaybeDispatchStateChangeEvent() { + if (mDescriptor.State() <= mLastNotifiedState || !GetParentObject()) { + return; + } + mLastNotifiedState = mDescriptor.State(); + + DOMEventTargetHelper::DispatchTrustedEvent(u"statechange"_ns); + + // Once we have transitioned to the redundant state then no + // more statechange events will occur. We can allow the DOM + // object to GC if script is not holding it alive. + if (mLastNotifiedState == ServiceWorkerState::Redundant) { + IgnoreKeepAliveIfHasListenersFor(u"statechange"_ns); + } +} + +void ServiceWorker::GetScriptURL(nsString& aURL) const { + CopyUTF8toUTF16(mDescriptor.ScriptURL(), aURL); +} + +void ServiceWorker::PostMessage(JSContext* aCx, JS::Handle aMessage, + const Sequence& aTransferable, + ErrorResult& aRv) { + if (State() == ServiceWorkerState::Redundant) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return; + } + + nsPIDOMWindowInner* window = GetOwner(); + if (NS_WARN_IF(!window || !window->GetExtantDoc())) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return; + } + + auto storageAllowed = StorageAllowedForWindow(window); + if (storageAllowed != StorageAccess::eAllow) { + ServiceWorkerManager::LocalizeAndReportToAllClients( + mDescriptor.Scope(), "ServiceWorkerPostMessageStorageError", + nsTArray{NS_ConvertUTF8toUTF16(mDescriptor.Scope())}); + aRv.Throw(NS_ERROR_DOM_SECURITY_ERR); + return; + } + + Maybe clientInfo = window->GetClientInfo(); + Maybe clientState = window->GetClientState(); + if (NS_WARN_IF(clientInfo.isNothing() || clientState.isNothing())) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return; + } + + JS::Rooted transferable(aCx, JS::UndefinedValue()); + aRv = nsContentUtils::CreateJSValueFromSequenceOfObject(aCx, aTransferable, + &transferable); + if (aRv.Failed()) { + return; + } + + // Window-to-SW messages do not allow memory sharing since they are not in the + // same agent cluster group, but we do not want to throw an error during the + // serialization. Because of this, ServiceWorkerCloneData will propagate an + // error message data if the SameProcess serialization is required. So that + // the receiver (service worker) knows that it needs to throw while + // deserialization and sharing memory objects are not propagated to the other + // process. + JS::CloneDataPolicy clonePolicy; + if (nsGlobalWindowInner::Cast(window)->IsSharedMemoryAllowed()) { + clonePolicy.allowSharedMemoryObjects(); + } + + RefPtr data = new ServiceWorkerCloneData(); + data->Write(aCx, aMessage, transferable, clonePolicy, aRv); + if (aRv.Failed()) { + return; + } + + // The value of CloneScope() is set while StructuredCloneData::Write(). If the + // aValue contiains a shared memory object, then the scope will be restricted + // and thus return SameProcess. If not, it will return DifferentProcess. + // + // When we postMessage a shared memory object from a window to a service + // worker, the object must be sent from a cross-origin isolated process to + // another one. So, we mark mark this data as an error message data if the + // scope is limited to same process. + if (data->CloneScope() == + StructuredCloneHolder::StructuredCloneScope::SameProcess) { + data->SetAsErrorMessageData(); + } + + mInner->PostMessage(std::move(data), clientInfo.ref(), clientState.ref()); +} + +void ServiceWorker::PostMessage(JSContext* aCx, JS::Handle aMessage, + const PostMessageOptions& aOptions, + ErrorResult& aRv) { + PostMessage(aCx, aMessage, aOptions.mTransfer, aRv); +} + +const ServiceWorkerDescriptor& ServiceWorker::Descriptor() const { + return mDescriptor; +} + +void ServiceWorker::DisconnectFromOwner() { + DOMEventTargetHelper::DisconnectFromOwner(); +} + +void ServiceWorker::MaybeAttachToRegistration( + ServiceWorkerRegistration* aRegistration) { + MOZ_DIAGNOSTIC_ASSERT(aRegistration); + MOZ_DIAGNOSTIC_ASSERT(!mRegistration); + + // If the registration no longer actually references this ServiceWorker + // then we must be in the redundant state. + if (!aRegistration->Descriptor().HasWorker(mDescriptor)) { + SetState(ServiceWorkerState::Redundant); + MaybeDispatchStateChangeEvent(); + return; + } + + mRegistration = aRegistration; +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorker.h b/dom/serviceworkers/ServiceWorker.h new file mode 100644 index 0000000000..b407865753 --- /dev/null +++ b/dom/serviceworkers/ServiceWorker.h @@ -0,0 +1,123 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworker_h__ +#define mozilla_dom_serviceworker_h__ + +#include "mozilla/DOMEventTargetHelper.h" +#include "mozilla/dom/BindingDeclarations.h" +#include "mozilla/dom/ServiceWorkerDescriptor.h" +#include "mozilla/dom/ServiceWorkerUtils.h" + +#ifdef XP_WIN +# undef PostMessage +#endif + +class nsIGlobalObject; + +namespace mozilla { +namespace dom { + +struct PostMessageOptions; +class ServiceWorkerCloneData; + +#define NS_DOM_SERVICEWORKER_IID \ + { \ + 0xd42e0611, 0x3647, 0x4319, { \ + 0xae, 0x05, 0x19, 0x89, 0x59, 0xba, 0x99, 0x5e \ + } \ + } + +bool ServiceWorkerVisible(JSContext* aCx, JSObject* aObj); + +class ServiceWorker final : public DOMEventTargetHelper { + public: + // Abstract interface for the internal representation of the + // ServiceWorker object. + class Inner { + public: + // This will be called when a DOM ServiceWorker object is + // created and takes a strong ref to the Inner object. + // RemoveServiceWorker() is guaranteed to be called on the + // current thread before the ServiceWorker is destroyed. + // + // In addition, the Inner object should check to see if + // the ServiceWorker's state is correct. If not, it should + // be updated automatically by calling SetState(). This is + // necessary to handle race conditions where the DOM + // ServiceWorker object is created while the state is being + // updated in another process. + virtual void AddServiceWorker(ServiceWorker* aWorker) = 0; + + // This is called when the DOM ServiceWorker object is + // destroyed and drops its ref to the Inner object. + virtual void RemoveServiceWorker(ServiceWorker* aWorker) = 0; + + // Get the associated registration for this ServiceWorker. The success + // callback should always be called asynchronously. + virtual void GetRegistration(ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) = 0; + + virtual void PostMessage(RefPtr&& aData, + const ClientInfo& aClientInfo, + const ClientState& aClientState) = 0; + + NS_INLINE_DECL_PURE_VIRTUAL_REFCOUNTING + }; + + NS_DECLARE_STATIC_IID_ACCESSOR(NS_DOM_SERVICEWORKER_IID) + NS_DECL_ISUPPORTS_INHERITED + NS_DECL_CYCLE_COLLECTION_CLASS_INHERITED(ServiceWorker, DOMEventTargetHelper) + + IMPL_EVENT_HANDLER(statechange) + IMPL_EVENT_HANDLER(error) + + static already_AddRefed Create( + nsIGlobalObject* aOwner, const ServiceWorkerDescriptor& aDescriptor); + + virtual JSObject* WrapObject(JSContext* aCx, + JS::Handle aGivenProto) override; + + ServiceWorkerState State() const; + + void SetState(ServiceWorkerState aState); + + void MaybeDispatchStateChangeEvent(); + + void GetScriptURL(nsString& aURL) const; + + void PostMessage(JSContext* aCx, JS::Handle aMessage, + const Sequence& aTransferable, ErrorResult& aRv); + + void PostMessage(JSContext* aCx, JS::Handle aMessage, + const PostMessageOptions& aOptions, ErrorResult& aRv); + + const ServiceWorkerDescriptor& Descriptor() const; + + void DisconnectFromOwner() override; + + private: + ServiceWorker(nsIGlobalObject* aWindow, + const ServiceWorkerDescriptor& aDescriptor, Inner* aInner); + + // This class is reference-counted and will be destroyed from Release(). + ~ServiceWorker(); + + void MaybeAttachToRegistration(ServiceWorkerRegistration* aRegistration); + + ServiceWorkerDescriptor mDescriptor; + + RefPtr mInner; + RefPtr mRegistration; + ServiceWorkerState mLastNotifiedState; +}; + +NS_DEFINE_STATIC_IID_ACCESSOR(ServiceWorker, NS_DOM_SERVICEWORKER_IID) + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_serviceworker_h__ diff --git a/dom/serviceworkers/ServiceWorkerActors.cpp b/dom/serviceworkers/ServiceWorkerActors.cpp new file mode 100644 index 0000000000..c9625fcbe2 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerActors.cpp @@ -0,0 +1,39 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerActors.h" + +#include "ServiceWorkerChild.h" +#include "ServiceWorkerContainerChild.h" +#include "ServiceWorkerContainerParent.h" +#include "ServiceWorkerParent.h" +#include "ServiceWorkerRegistrationChild.h" +#include "ServiceWorkerRegistrationParent.h" +#include "mozilla/dom/WorkerRef.h" + +namespace mozilla { +namespace dom { + +void InitServiceWorkerParent(PServiceWorkerParent* aActor, + const IPCServiceWorkerDescriptor& aDescriptor) { + auto actor = static_cast(aActor); + actor->Init(aDescriptor); +} + +void InitServiceWorkerContainerParent(PServiceWorkerContainerParent* aActor) { + auto actor = static_cast(aActor); + actor->Init(); +} + +void InitServiceWorkerRegistrationParent( + PServiceWorkerRegistrationParent* aActor, + const IPCServiceWorkerRegistrationDescriptor& aDescriptor) { + auto actor = static_cast(aActor); + actor->Init(aDescriptor); +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerActors.h b/dom/serviceworkers/ServiceWorkerActors.h new file mode 100644 index 0000000000..ee3c58c97b --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerActors.h @@ -0,0 +1,39 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworkeractors_h__ +#define mozilla_dom_serviceworkeractors_h__ + +namespace mozilla { +namespace dom { + +// PServiceWorker + +class IPCServiceWorkerDescriptor; +class PServiceWorkerParent; + +void InitServiceWorkerParent(PServiceWorkerParent* aActor, + const IPCServiceWorkerDescriptor& aDescriptor); + +// PServiceWorkerContainer + +class PServiceWorkerContainerParent; + +void InitServiceWorkerContainerParent(PServiceWorkerContainerParent* aActor); + +// PServiceWorkerRegistration + +class IPCServiceWorkerRegistrationDescriptor; +class PServiceWorkerRegistrationParent; + +void InitServiceWorkerRegistrationParent( + PServiceWorkerRegistrationParent* aActor, + const IPCServiceWorkerRegistrationDescriptor& aDescriptor); + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_serviceworkeractors_h__ diff --git a/dom/serviceworkers/ServiceWorkerChild.cpp b/dom/serviceworkers/ServiceWorkerChild.cpp new file mode 100644 index 0000000000..feedca71db --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerChild.cpp @@ -0,0 +1,71 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerChild.h" +#include "RemoteServiceWorkerImpl.h" +#include "mozilla/dom/WorkerCommon.h" +#include "mozilla/dom/WorkerRef.h" + +namespace mozilla { +namespace dom { + +void ServiceWorkerChild::ActorDestroy(ActorDestroyReason aReason) { + mIPCWorkerRef = nullptr; + + if (mOwner) { + mOwner->RevokeActor(this); + MOZ_DIAGNOSTIC_ASSERT(!mOwner); + } +} + +// static +RefPtr ServiceWorkerChild::Create() { + RefPtr actor = new ServiceWorkerChild(); + + if (!NS_IsMainThread()) { + WorkerPrivate* workerPrivate = GetCurrentThreadWorkerPrivate(); + MOZ_DIAGNOSTIC_ASSERT(workerPrivate); + + RefPtr> helper = + new IPCWorkerRefHelper(actor); + + actor->mIPCWorkerRef = IPCWorkerRef::Create( + workerPrivate, "ServiceWorkerChild", + [helper] { helper->Actor()->MaybeStartTeardown(); }); + + if (NS_WARN_IF(!actor->mIPCWorkerRef)) { + return nullptr; + } + } + + return actor; +} + +ServiceWorkerChild::ServiceWorkerChild() + : mOwner(nullptr), mTeardownStarted(false) {} + +void ServiceWorkerChild::SetOwner(RemoteServiceWorkerImpl* aOwner) { + MOZ_DIAGNOSTIC_ASSERT(!mOwner); + MOZ_DIAGNOSTIC_ASSERT(aOwner); + mOwner = aOwner; +} + +void ServiceWorkerChild::RevokeOwner(RemoteServiceWorkerImpl* aOwner) { + MOZ_DIAGNOSTIC_ASSERT(mOwner); + MOZ_DIAGNOSTIC_ASSERT(aOwner == mOwner); + mOwner = nullptr; +} + +void ServiceWorkerChild::MaybeStartTeardown() { + if (mTeardownStarted) { + return; + } + mTeardownStarted = true; + Unused << SendTeardown(); +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerChild.h b/dom/serviceworkers/ServiceWorkerChild.h new file mode 100644 index 0000000000..289a1e4131 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerChild.h @@ -0,0 +1,46 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworkerchild_h__ +#define mozilla_dom_serviceworkerchild_h__ + +#include "mozilla/dom/PServiceWorkerChild.h" +#include "mozilla/dom/WorkerRef.h" + +namespace mozilla { +namespace dom { + +class IPCWorkerRef; +class RemoteServiceWorkerImpl; + +class ServiceWorkerChild final : public PServiceWorkerChild { + RefPtr mIPCWorkerRef; + RemoteServiceWorkerImpl* mOwner; + bool mTeardownStarted; + + ServiceWorkerChild(); + + ~ServiceWorkerChild() = default; + + // PServiceWorkerChild + void ActorDestroy(ActorDestroyReason aReason) override; + + public: + NS_INLINE_DECL_REFCOUNTING(ServiceWorkerChild, override); + + static RefPtr Create(); + + void SetOwner(RemoteServiceWorkerImpl* aOwner); + + void RevokeOwner(RemoteServiceWorkerImpl* aOwner); + + void MaybeStartTeardown(); +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_serviceworkerchild_h__ diff --git a/dom/serviceworkers/ServiceWorkerCloneData.cpp b/dom/serviceworkers/ServiceWorkerCloneData.cpp new file mode 100644 index 0000000000..babc07f324 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerCloneData.cpp @@ -0,0 +1,126 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerCloneData.h" + +#include +#include "mozilla/RefPtr.h" +#include "mozilla/dom/DOMTypes.h" +#include "mozilla/dom/StructuredCloneHolder.h" +#include "nsISerialEventTarget.h" +#include "nsProxyRelease.h" +#include "nsThreadUtils.h" + +namespace mozilla { +namespace dom { + +ServiceWorkerCloneData::~ServiceWorkerCloneData() { + RefPtr sharedData = TakeSharedData(); + if (sharedData) { + NS_ProxyRelease(__func__, mEventTarget, sharedData.forget()); + } +} + +ServiceWorkerCloneData::ServiceWorkerCloneData() + : ipc::StructuredCloneData( + StructuredCloneHolder::StructuredCloneScope::UnknownDestination, + StructuredCloneHolder::TransferringSupported), + mEventTarget(GetCurrentSerialEventTarget()), + mIsErrorMessageData(false) { + MOZ_DIAGNOSTIC_ASSERT(mEventTarget); +} + +bool ServiceWorkerCloneData:: + StealFromAndBuildClonedMessageDataForBackgroundParent( + ClonedOrErrorMessageData& aFromClonedData, + mozilla::ipc::PBackgroundParent* aParent, + ClonedOrErrorMessageData& aToClonedData) { + if (aFromClonedData.type() == ClonedOrErrorMessageData::TErrorMessageData) { + mIsErrorMessageData = true; + aToClonedData = ErrorMessageData(); + return true; + } + + MOZ_DIAGNOSTIC_ASSERT(aFromClonedData.type() == + ClonedOrErrorMessageData::TClonedMessageData); + + StructuredCloneData::StealFromClonedMessageDataForBackgroundParent( + aFromClonedData); + + ClonedMessageData messageData; + if (!StructuredCloneData::BuildClonedMessageDataForBackgroundParent( + aParent, messageData)) { + return false; + } + + aToClonedData = std::move(messageData); + + return true; +} + +bool ServiceWorkerCloneData::BuildClonedMessageDataForBackgroundChild( + mozilla::ipc::PBackgroundChild* aChild, + ClonedOrErrorMessageData& aClonedData) { + if (IsErrorMessageData()) { + aClonedData = ErrorMessageData(); + return true; + } + + MOZ_DIAGNOSTIC_ASSERT( + CloneScope() == + StructuredCloneHolder::StructuredCloneScope::DifferentProcess); + + ClonedMessageData messageData; + if (!StructuredCloneData::BuildClonedMessageDataForBackgroundChild( + aChild, messageData)) { + return false; + } + + aClonedData = std::move(messageData); + + return true; +} + +void ServiceWorkerCloneData::CopyFromClonedMessageDataForBackgroundParent( + const ClonedOrErrorMessageData& aClonedData) { + if (aClonedData.type() == ClonedOrErrorMessageData::TErrorMessageData) { + mIsErrorMessageData = true; + return; + } + + MOZ_DIAGNOSTIC_ASSERT(aClonedData.type() == + ClonedOrErrorMessageData::TClonedMessageData); + + StructuredCloneData::CopyFromClonedMessageDataForBackgroundParent( + aClonedData); +} + +void ServiceWorkerCloneData::CopyFromClonedMessageDataForBackgroundChild( + const ClonedOrErrorMessageData& aClonedData) { + if (aClonedData.type() == ClonedOrErrorMessageData::TErrorMessageData) { + mIsErrorMessageData = true; + return; + } + + MOZ_DIAGNOSTIC_ASSERT(aClonedData.type() == + ClonedOrErrorMessageData::TClonedMessageData); + + StructuredCloneData::CopyFromClonedMessageDataForBackgroundChild(aClonedData); +} + +void ServiceWorkerCloneData::SetAsErrorMessageData() { + MOZ_ASSERT(CloneScope() == + StructuredCloneHolder::StructuredCloneScope::SameProcess); + + mIsErrorMessageData = true; +} + +bool ServiceWorkerCloneData::IsErrorMessageData() const { + return mIsErrorMessageData; +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerCloneData.h b/dom/serviceworkers/ServiceWorkerCloneData.h new file mode 100644 index 0000000000..f2f0ae4d57 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerCloneData.h @@ -0,0 +1,82 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_ServiceWorkerCloneData_h__ +#define mozilla_dom_ServiceWorkerCloneData_h__ + +#include "mozilla/Assertions.h" +#include "mozilla/dom/DOMTypes.h" +#include "mozilla/dom/ipc/StructuredCloneData.h" +#include "nsCOMPtr.h" +#include "nsISupports.h" + +class nsISerialEventTarget; + +namespace mozilla { +namespace ipc { +class PBackgroundChild; +class PBackgroundParent; +} // namespace ipc + +namespace dom { + +class ClonedOrErrorMessageData; + +// Helper class used to pack structured clone data so that it can be +// passed across thread and process boundaries. Currently the raw +// StructuredCloneData and StructureCloneHolder APIs both make it +// difficult to meet this needs directly. This helper class improves +// the situation by: +// +// 1. Provides a ref-counted version of StructuredCloneData. We need +// StructuredCloneData so we can serialize/deserialize across IPC. +// The move constructor problems in StructuredCloneData (bug 1462676), +// though, makes it hard to pass it around. Passing a ref-counted +// pointer addresses this problem. +// 2. Normally StructuredCloneData runs into problems if you try to move +// it across thread boundaries because it releases its SharedJSAllocatedData +// on the wrong thread. This helper will correctly proxy release the +// shared data on the correct thread. +// +// This helper class should really just be used to serialize on one thread +// and then move the reference across thread/process boundries to the +// target worker thread. This class is not intended to support simultaneous +// read/write operations from different threads at the same time. +class ServiceWorkerCloneData final : public ipc::StructuredCloneData { + nsCOMPtr mEventTarget; + bool mIsErrorMessageData; + + ~ServiceWorkerCloneData(); + + public: + ServiceWorkerCloneData(); + + bool StealFromAndBuildClonedMessageDataForBackgroundParent( + ClonedOrErrorMessageData& aFromClonedData, + mozilla::ipc::PBackgroundParent* aParent, + ClonedOrErrorMessageData& aToClonedData); + + bool BuildClonedMessageDataForBackgroundChild( + mozilla::ipc::PBackgroundChild* aChild, + ClonedOrErrorMessageData& aClonedData); + + void CopyFromClonedMessageDataForBackgroundParent( + const ClonedOrErrorMessageData& aClonedData); + + void CopyFromClonedMessageDataForBackgroundChild( + const ClonedOrErrorMessageData& aClonedData); + + void SetAsErrorMessageData(); + + bool IsErrorMessageData() const; + + NS_INLINE_DECL_THREADSAFE_REFCOUNTING(ServiceWorkerCloneData) +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_ServiceWorkerCloneData_h__ diff --git a/dom/serviceworkers/ServiceWorkerContainer.cpp b/dom/serviceworkers/ServiceWorkerContainer.cpp new file mode 100644 index 0000000000..7816b18243 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerContainer.cpp @@ -0,0 +1,835 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerContainer.h" + +#include "nsContentPolicyUtils.h" +#include "nsContentSecurityManager.h" +#include "nsContentUtils.h" +#include "mozilla/dom/Document.h" +#include "nsIServiceWorkerManager.h" +#include "nsIScriptError.h" +#include "nsThreadUtils.h" +#include "nsNetUtil.h" +#include "nsPIDOMWindow.h" +#include "mozilla/Services.h" +#include "mozilla/StaticPrefs_dom.h" + +#include "nsCycleCollectionParticipant.h" +#include "nsServiceManagerUtils.h" +#include "mozilla/BasePrincipal.h" +#include "mozilla/LoadInfo.h" +#include "mozilla/SchedulerGroup.h" +#include "mozilla/StaticPrefs_extensions.h" +#include "mozilla/StorageAccess.h" +#include "mozilla/dom/ClientIPCTypes.h" +#include "mozilla/dom/DOMMozPromiseRequestHolder.h" +#include "mozilla/dom/MessageEvent.h" +#include "mozilla/dom/MessageEventBinding.h" +#include "mozilla/dom/Navigator.h" +#include "mozilla/dom/Promise.h" +#include "mozilla/dom/ServiceWorker.h" +#include "mozilla/dom/ServiceWorkerContainerBinding.h" +#include "mozilla/dom/ServiceWorkerManager.h" +#include "mozilla/dom/ipc/StructuredCloneData.h" + +#include "RemoteServiceWorkerContainerImpl.h" +#include "ServiceWorker.h" +#include "ServiceWorkerContainerImpl.h" +#include "ServiceWorkerRegistration.h" +#include "ServiceWorkerUtils.h" + +// This is defined to something else on Windows +#ifdef DispatchMessage +# undef DispatchMessage +#endif + +namespace mozilla { +namespace dom { + +NS_INTERFACE_MAP_BEGIN_CYCLE_COLLECTION(ServiceWorkerContainer) +NS_INTERFACE_MAP_END_INHERITING(DOMEventTargetHelper) + +NS_IMPL_ADDREF_INHERITED(ServiceWorkerContainer, DOMEventTargetHelper) +NS_IMPL_RELEASE_INHERITED(ServiceWorkerContainer, DOMEventTargetHelper) + +NS_IMPL_CYCLE_COLLECTION_INHERITED(ServiceWorkerContainer, DOMEventTargetHelper, + mControllerWorker, mReadyPromise) + +namespace { + +bool IsInPrivateBrowsing(JSContext* const aCx) { + if (const nsCOMPtr global = xpc::CurrentNativeGlobal(aCx)) { + if (const nsCOMPtr principal = global->PrincipalOrNull()) { + return principal->GetPrivateBrowsingId() > 0; + } + } + return false; +} + +bool IsServiceWorkersTestingEnabledInWindow(JSObject* const aGlobal) { + if (const nsCOMPtr innerWindow = + Navigator::GetWindowFromGlobal(aGlobal)) { + if (const nsCOMPtr outerWindow = + innerWindow->GetOuterWindow()) { + return outerWindow->GetServiceWorkersTestingEnabled(); + } + } + return false; +} + +} // namespace + +/* static */ +bool ServiceWorkerContainer::IsEnabled(JSContext* aCx, JSObject* aGlobal) { + MOZ_ASSERT(NS_IsMainThread()); + + JS::Rooted global(aCx, aGlobal); + + if (!StaticPrefs::dom_serviceWorkers_enabled()) { + return false; + } + + if (IsInPrivateBrowsing(aCx)) { + return false; + } + + if (IsSecureContextOrObjectIsFromSecureContext(aCx, global)) { + return true; + } + + const bool isTestingEnabledInWindow = + IsServiceWorkersTestingEnabledInWindow(global); + const bool isTestingEnabledByPref = + StaticPrefs::dom_serviceWorkers_testing_enabled(); + const bool isTestingEnabled = + isTestingEnabledByPref || isTestingEnabledInWindow; + + return isTestingEnabled; +} + +// static +already_AddRefed ServiceWorkerContainer::Create( + nsIGlobalObject* aGlobal) { + RefPtr inner; + if (ServiceWorkerParentInterceptEnabled()) { + inner = new RemoteServiceWorkerContainerImpl(); + } else { + inner = new ServiceWorkerContainerImpl(); + } + NS_ENSURE_TRUE(inner, nullptr); + + RefPtr ref = + new ServiceWorkerContainer(aGlobal, inner.forget()); + return ref.forget(); +} + +ServiceWorkerContainer::ServiceWorkerContainer( + nsIGlobalObject* aGlobal, + already_AddRefed aInner) + : DOMEventTargetHelper(aGlobal), mInner(aInner) { + mInner->AddContainer(this); + Maybe controller = aGlobal->GetController(); + if (controller.isSome()) { + mControllerWorker = aGlobal->GetOrCreateServiceWorker(controller.ref()); + } +} + +ServiceWorkerContainer::~ServiceWorkerContainer() { + mInner->RemoveContainer(this); +} + +void ServiceWorkerContainer::DisconnectFromOwner() { + mControllerWorker = nullptr; + mReadyPromise = nullptr; + DOMEventTargetHelper::DisconnectFromOwner(); +} + +void ServiceWorkerContainer::ControllerChanged(ErrorResult& aRv) { + nsCOMPtr go = GetParentObject(); + if (!go) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return; + } + mControllerWorker = go->GetOrCreateServiceWorker(go->GetController().ref()); + aRv = DispatchTrustedEvent(u"controllerchange"_ns); +} + +using mozilla::dom::ipc::StructuredCloneData; + +// A ReceivedMessage represents a message sent via +// Client.postMessage(). It is used as used both for queuing of +// incoming messages and as an interface to DispatchMessage(). +struct MOZ_HEAP_CLASS ServiceWorkerContainer::ReceivedMessage { + explicit ReceivedMessage(const ClientPostMessageArgs& aArgs) + : mServiceWorker(aArgs.serviceWorker()) { + mClonedData.CopyFromClonedMessageDataForBackgroundChild(aArgs.clonedData()); + } + + ServiceWorkerDescriptor mServiceWorker; + StructuredCloneData mClonedData; + + NS_INLINE_DECL_REFCOUNTING(ReceivedMessage) + + private: + ~ReceivedMessage() = default; +}; + +void ServiceWorkerContainer::ReceiveMessage( + const ClientPostMessageArgs& aArgs) { + RefPtr message = new ReceivedMessage(aArgs); + if (mMessagesStarted) { + EnqueueReceivedMessageDispatch(std::move(message)); + } else { + mPendingMessages.AppendElement(message.forget()); + } +} + +JSObject* ServiceWorkerContainer::WrapObject( + JSContext* aCx, JS::Handle aGivenProto) { + return ServiceWorkerContainer_Binding::Wrap(aCx, this, aGivenProto); +} + +namespace { + +already_AddRefed GetBaseURIFromGlobal(nsIGlobalObject* aGlobal, + ErrorResult& aRv) { + // It would be nice not to require a window here, but right + // now we don't have a great way to get the base URL just + // from the nsIGlobalObject. + nsCOMPtr window = do_QueryInterface(aGlobal); + if (!window) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return nullptr; + } + + Document* doc = window->GetExtantDoc(); + if (!doc) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return nullptr; + } + + nsCOMPtr baseURI = doc->GetDocBaseURI(); + if (!baseURI) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return nullptr; + } + + return baseURI.forget(); +} + +} // anonymous namespace + +already_AddRefed ServiceWorkerContainer::Register( + const nsAString& aScriptURL, const RegistrationOptions& aOptions, + const CallerType aCallerType, ErrorResult& aRv) { + // Note, we can't use GetGlobalIfValid() from the start here. If we + // hit a storage failure we want to log a message with the final + // scope string we put together below. + nsIGlobalObject* global = GetParentObject(); + if (!global) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return nullptr; + } + + Maybe clientInfo = global->GetClientInfo(); + if (clientInfo.isNothing()) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return nullptr; + } + + nsCOMPtr baseURI = GetBaseURIFromGlobal(global, aRv); + if (aRv.Failed()) { + return nullptr; + } + + // Don't use NS_ConvertUTF16toUTF8 because that doesn't let us handle OOM. + nsAutoCString scriptURL; + if (!AppendUTF16toUTF8(aScriptURL, scriptURL, fallible)) { + aRv.Throw(NS_ERROR_OUT_OF_MEMORY); + return nullptr; + } + + nsCOMPtr scriptURI; + nsresult rv = + NS_NewURI(getter_AddRefs(scriptURI), scriptURL, nullptr, baseURI); + if (NS_WARN_IF(NS_FAILED(rv))) { + aRv.ThrowTypeError(scriptURL); + return nullptr; + } + + // Never allow script URL with moz-extension scheme if support is fully + // disabled by the 'extensions.background_service_worker.enabled' pref. + if (scriptURI->SchemeIs("moz-extension") && + !StaticPrefs::extensions_backgroundServiceWorker_enabled_AtStartup()) { + aRv.Throw(NS_ERROR_DOM_SECURITY_ERR); + return nullptr; + } + + // Allow a webextension principal to register a service worker script with + // a moz-extension url only if 'extensions.service_worker_register.allowed' + // is true. + if (scriptURI->SchemeIs("moz-extension") && + aCallerType == CallerType::NonSystem && + (!baseURI->SchemeIs("moz-extension") || + !StaticPrefs::extensions_serviceWorkerRegister_allowed())) { + aRv.Throw(NS_ERROR_DOM_SECURITY_ERR); + return nullptr; + } + + // In ServiceWorkerContainer.register() the scope argument is parsed against + // different base URLs depending on whether it was passed or not. + nsCOMPtr scopeURI; + + // Step 4. If none passed, parse against script's URL + if (!aOptions.mScope.WasPassed()) { + constexpr auto defaultScope = "./"_ns; + rv = NS_NewURI(getter_AddRefs(scopeURI), defaultScope, nullptr, scriptURI); + if (NS_WARN_IF(NS_FAILED(rv))) { + nsAutoCString spec; + scriptURI->GetSpec(spec); + aRv.ThrowTypeError(defaultScope, spec); + return nullptr; + } + } else { + // Step 5. Parse against entry settings object's base URL. + rv = NS_NewURI(getter_AddRefs(scopeURI), aOptions.mScope.Value(), nullptr, + baseURI); + if (NS_WARN_IF(NS_FAILED(rv))) { + nsIURI* uri = baseURI ? baseURI : scriptURI; + nsAutoCString spec; + uri->GetSpec(spec); + aRv.ThrowTypeError( + NS_ConvertUTF16toUTF8(aOptions.mScope.Value()), spec); + return nullptr; + } + } + + // Strip the any ref from both the script and scope URLs. + nsCOMPtr cloneWithoutRef; + aRv = NS_GetURIWithoutRef(scriptURI, getter_AddRefs(cloneWithoutRef)); + if (aRv.Failed()) { + return nullptr; + } + scriptURI = std::move(cloneWithoutRef); + + aRv = NS_GetURIWithoutRef(scopeURI, getter_AddRefs(cloneWithoutRef)); + if (aRv.Failed()) { + return nullptr; + } + scopeURI = std::move(cloneWithoutRef); + + ServiceWorkerScopeAndScriptAreValid(clientInfo.ref(), scopeURI, scriptURI, + aRv); + if (aRv.Failed()) { + return nullptr; + } + + nsCOMPtr window = do_QueryInterface(global); + if (!window) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return nullptr; + } + + Document* doc = window->GetExtantDoc(); + if (!doc) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return nullptr; + } + + // The next section of code executes an NS_CheckContentLoadPolicy() + // check. This is necessary to enforce the CSP of the calling client. + // Currently this requires an Document. Once bug 965637 lands we + // should try to move this into ServiceWorkerScopeAndScriptAreValid() + // using the ClientInfo instead of doing a window-specific check here. + // See bug 1455077 for further investigation. + nsCOMPtr secCheckLoadInfo = new mozilla::net::LoadInfo( + doc->NodePrincipal(), // loading principal + doc->NodePrincipal(), // triggering principal + doc, // loading node + nsILoadInfo::SEC_ONLY_FOR_EXPLICIT_CONTENTSEC_CHECK, + nsIContentPolicy::TYPE_INTERNAL_SERVICE_WORKER); + + // Check content policy. + int16_t decision = nsIContentPolicy::ACCEPT; + rv = NS_CheckContentLoadPolicy(scriptURI, secCheckLoadInfo, + "application/javascript"_ns, &decision); + if (NS_FAILED(rv)) { + aRv.Throw(NS_ERROR_DOM_SECURITY_ERR); + return nullptr; + } + if (NS_WARN_IF(decision != nsIContentPolicy::ACCEPT)) { + aRv.Throw(NS_ERROR_CONTENT_BLOCKED); + return nullptr; + } + + // Get the string representation for both the script and scope since + // we sanitized them above. + nsCString cleanedScopeURL; + aRv = scopeURI->GetSpec(cleanedScopeURL); + if (aRv.Failed()) { + return nullptr; + } + + nsCString cleanedScriptURL; + aRv = scriptURI->GetSpec(cleanedScriptURL); + if (aRv.Failed()) { + return nullptr; + } + + // Verify that the global is valid and has permission to store + // data. We perform this late so that we can report the final + // scope URL in any error message. + Unused << GetGlobalIfValid(aRv, [&](Document* aDoc) { + AutoTArray param; + CopyUTF8toUTF16(cleanedScopeURL, *param.AppendElement()); + nsContentUtils::ReportToConsole(nsIScriptError::errorFlag, + "Service Workers"_ns, aDoc, + nsContentUtils::eDOM_PROPERTIES, + "ServiceWorkerRegisterStorageError", param); + }); + + window->NoteCalledRegisterForServiceWorkerScope(cleanedScopeURL); + + RefPtr outer = + Promise::Create(global, aRv, Promise::ePropagateUserInteraction); + if (aRv.Failed()) { + return nullptr; + } + + RefPtr self = this; + + mInner->Register( + clientInfo.ref(), cleanedScopeURL, cleanedScriptURL, + aOptions.mUpdateViaCache, + [self, outer](const ServiceWorkerRegistrationDescriptor& aDesc) { + ErrorResult rv; + nsIGlobalObject* global = self->GetGlobalIfValid(rv); + if (rv.Failed()) { + outer->MaybeReject(std::move(rv)); + return; + } + RefPtr reg = + global->GetOrCreateServiceWorkerRegistration(aDesc); + outer->MaybeResolve(reg); + }, + [outer](ErrorResult&& aRv) { outer->MaybeReject(std::move(aRv)); }); + + return outer.forget(); +} + +already_AddRefed ServiceWorkerContainer::GetController() { + RefPtr ref = mControllerWorker; + return ref.forget(); +} + +already_AddRefed ServiceWorkerContainer::GetRegistrations( + ErrorResult& aRv) { + nsIGlobalObject* global = GetGlobalIfValid(aRv, [](Document* aDoc) { + nsContentUtils::ReportToConsole(nsIScriptError::errorFlag, + "Service Workers"_ns, aDoc, + nsContentUtils::eDOM_PROPERTIES, + "ServiceWorkerGetRegistrationStorageError"); + }); + if (aRv.Failed()) { + return nullptr; + } + + Maybe clientInfo = global->GetClientInfo(); + if (clientInfo.isNothing()) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return nullptr; + } + + RefPtr outer = + Promise::Create(global, aRv, Promise::ePropagateUserInteraction); + if (aRv.Failed()) { + return nullptr; + } + + RefPtr self = this; + + mInner->GetRegistrations( + clientInfo.ref(), + [self, + outer](const nsTArray& aDescList) { + ErrorResult rv; + nsIGlobalObject* global = self->GetGlobalIfValid(rv); + if (rv.Failed()) { + outer->MaybeReject(std::move(rv)); + return; + } + nsTArray> regList; + for (auto& desc : aDescList) { + RefPtr reg = + global->GetOrCreateServiceWorkerRegistration(desc); + if (reg) { + regList.AppendElement(std::move(reg)); + } + } + outer->MaybeResolve(regList); + }, + [self, outer](ErrorResult&& aRv) { outer->MaybeReject(std::move(aRv)); }); + + return outer.forget(); +} + +void ServiceWorkerContainer::StartMessages() { + while (!mPendingMessages.IsEmpty()) { + EnqueueReceivedMessageDispatch(mPendingMessages.ElementAt(0)); + mPendingMessages.RemoveElementAt(0); + } + mMessagesStarted = true; +} + +already_AddRefed ServiceWorkerContainer::GetRegistration( + const nsAString& aURL, ErrorResult& aRv) { + nsIGlobalObject* global = GetGlobalIfValid(aRv, [](Document* aDoc) { + nsContentUtils::ReportToConsole(nsIScriptError::errorFlag, + "Service Workers"_ns, aDoc, + nsContentUtils::eDOM_PROPERTIES, + "ServiceWorkerGetRegistrationStorageError"); + }); + if (aRv.Failed()) { + return nullptr; + } + + Maybe clientInfo = global->GetClientInfo(); + if (clientInfo.isNothing()) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return nullptr; + } + + nsCOMPtr baseURI = GetBaseURIFromGlobal(global, aRv); + if (aRv.Failed()) { + return nullptr; + } + + nsCOMPtr uri; + aRv = NS_NewURI(getter_AddRefs(uri), aURL, nullptr, baseURI); + if (aRv.Failed()) { + return nullptr; + } + + nsCString spec; + aRv = uri->GetSpec(spec); + if (aRv.Failed()) { + return nullptr; + } + + RefPtr outer = + Promise::Create(global, aRv, Promise::ePropagateUserInteraction); + if (aRv.Failed()) { + return nullptr; + } + + RefPtr self = this; + + mInner->GetRegistration( + clientInfo.ref(), spec, + [self, outer](const ServiceWorkerRegistrationDescriptor& aDescriptor) { + ErrorResult rv; + nsIGlobalObject* global = self->GetGlobalIfValid(rv); + if (rv.Failed()) { + outer->MaybeReject(std::move(rv)); + return; + } + RefPtr reg = + global->GetOrCreateServiceWorkerRegistration(aDescriptor); + outer->MaybeResolve(reg); + }, + [self, outer](ErrorResult&& aRv) { + if (!aRv.Failed()) { + Unused << self->GetGlobalIfValid(aRv); + if (!aRv.Failed()) { + outer->MaybeResolveWithUndefined(); + return; + } + } + outer->MaybeReject(std::move(aRv)); + }); + + return outer.forget(); +} + +Promise* ServiceWorkerContainer::GetReady(ErrorResult& aRv) { + if (mReadyPromise) { + return mReadyPromise; + } + + nsIGlobalObject* global = GetGlobalIfValid(aRv); + if (aRv.Failed()) { + return nullptr; + } + MOZ_DIAGNOSTIC_ASSERT(global); + + Maybe clientInfo(global->GetClientInfo()); + if (clientInfo.isNothing()) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return nullptr; + } + + mReadyPromise = + Promise::Create(global, aRv, Promise::ePropagateUserInteraction); + if (aRv.Failed()) { + return nullptr; + } + + RefPtr self = this; + RefPtr outer = mReadyPromise; + + mInner->GetReady( + clientInfo.ref(), + [self, outer](const ServiceWorkerRegistrationDescriptor& aDescriptor) { + ErrorResult rv; + nsIGlobalObject* global = self->GetGlobalIfValid(rv); + if (rv.Failed()) { + outer->MaybeReject(std::move(rv)); + return; + } + RefPtr reg = + global->GetOrCreateServiceWorkerRegistration(aDescriptor); + NS_ENSURE_TRUE_VOID(reg); + + // Don't resolve the ready promise until the registration has + // reached the right version. This ensures that the active + // worker property is set correctly on the registration. + reg->WhenVersionReached( + aDescriptor.Version(), + [outer, reg](bool aResult) { outer->MaybeResolve(reg); }); + }, + [self, outer](ErrorResult&& aRv) { outer->MaybeReject(std::move(aRv)); }); + + return mReadyPromise; +} + +// Testing only. +void ServiceWorkerContainer::GetScopeForUrl(const nsAString& aUrl, + nsString& aScope, + ErrorResult& aRv) { + nsCOMPtr swm = + mozilla::services::GetServiceWorkerManager(); + if (!swm) { + aRv.Throw(NS_ERROR_FAILURE); + return; + } + + nsCOMPtr window = GetOwner(); + if (NS_WARN_IF(!window)) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return; + } + + nsCOMPtr doc = window->GetExtantDoc(); + if (NS_WARN_IF(!doc)) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return; + } + + aRv = swm->GetScopeForUrl(doc->NodePrincipal(), aUrl, aScope); +} + +nsIGlobalObject* ServiceWorkerContainer::GetGlobalIfValid( + ErrorResult& aRv, + const std::function&& aStorageFailureCB) const { + // For now we require a window since ServiceWorkerContainer is + // not exposed on worker globals yet. The main thing we need + // to fix here to support that is the storage access check via + // the nsIGlobalObject. + nsPIDOMWindowInner* window = GetOwner(); + if (NS_WARN_IF(!window)) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return nullptr; + } + + nsCOMPtr doc = window->GetExtantDoc(); + if (NS_WARN_IF(!doc)) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return nullptr; + } + + // Don't allow a service worker to access service worker registrations + // from a window with storage disabled. If these windows can access + // the registration it increases the chance they can bypass the storage + // block via postMessage(), etc. + auto storageAllowed = StorageAllowedForWindow(window); + if (NS_WARN_IF(storageAllowed != StorageAccess::eAllow)) { + if (aStorageFailureCB) { + aStorageFailureCB(doc); + } + aRv.Throw(NS_ERROR_DOM_SECURITY_ERR); + return nullptr; + } + + // Don't allow service workers when the document is chrome. + if (NS_WARN_IF(doc->NodePrincipal()->IsSystemPrincipal())) { + aRv.Throw(NS_ERROR_DOM_SECURITY_ERR); + return nullptr; + } + + return window->AsGlobal(); +} + +void ServiceWorkerContainer::EnqueueReceivedMessageDispatch( + RefPtr aMessage) { + if (nsPIDOMWindowInner* const window = GetOwner()) { + if (auto* const target = window->EventTargetFor(TaskCategory::Other)) { + target->Dispatch(NewRunnableMethod>( + "ServiceWorkerContainer::DispatchMessage", this, + &ServiceWorkerContainer::DispatchMessage, std::move(aMessage))); + } + } +} + +template +void ServiceWorkerContainer::RunWithJSContext(F&& aCallable) { + nsCOMPtr globalObject; + if (nsPIDOMWindowInner* const window = GetOwner()) { + globalObject = do_QueryInterface(window); + } + + // If AutoJSAPI::Init() fails then either global is nullptr or not + // in a usable state. + AutoJSAPI jsapi; + if (!jsapi.Init(globalObject)) { + return; + } + + aCallable(jsapi.cx(), globalObject); +} + +void ServiceWorkerContainer::DispatchMessage(RefPtr aMessage) { + MOZ_ASSERT(NS_IsMainThread()); + + // When dispatching a message, either DOMContentLoaded has already + // been fired, or someone called startMessages() or set onmessage. + // Either way, a global object is supposed to be present. If it's + // not, we'd fail to initialize the JS API and exit. + RunWithJSContext([this, message = std::move(aMessage)]( + JSContext* const aCx, nsIGlobalObject* const aGlobal) { + ErrorResult result; + bool deserializationFailed = false; + RootedDictionary init(aCx); + auto res = FillInMessageEventInit(aCx, aGlobal, *message, init, result); + if (res.isErr()) { + deserializationFailed = res.unwrapErr(); + MOZ_ASSERT_IF(deserializationFailed, init.mData.isNull()); + MOZ_ASSERT_IF(deserializationFailed, init.mPorts.IsEmpty()); + MOZ_ASSERT_IF(deserializationFailed, !init.mOrigin.IsEmpty()); + MOZ_ASSERT_IF(deserializationFailed, !init.mSource.IsNull()); + result.SuppressException(); + + if (!deserializationFailed && result.MaybeSetPendingException(aCx)) { + return; + } + } + + RefPtr event = MessageEvent::Constructor( + this, deserializationFailed ? u"messageerror"_ns : u"message"_ns, init); + event->SetTrusted(true); + + result = NS_OK; + DispatchEvent(*event, result); + if (result.Failed()) { + result.SuppressException(); + } + }); +} + +namespace { + +nsresult FillInOriginNoSuffix(const ServiceWorkerDescriptor& aServiceWorker, + nsString& aOrigin) { + using mozilla::ipc::PrincipalInfoToPrincipal; + + nsresult rv; + + auto principalOrErr = + PrincipalInfoToPrincipal(aServiceWorker.PrincipalInfo()); + if (NS_WARN_IF(principalOrErr.isErr())) { + return principalOrErr.unwrapErr(); + } + + nsAutoCString originUTF8; + rv = principalOrErr.unwrap()->GetOriginNoSuffix(originUTF8); + if (NS_FAILED(rv)) { + return rv; + } + + CopyUTF8toUTF16(originUTF8, aOrigin); + return NS_OK; +} + +already_AddRefed GetOrCreateServiceWorkerWithoutWarnings( + nsIGlobalObject* const aGlobal, + const ServiceWorkerDescriptor& aDescriptor) { + // In child-intercept mode we have to verify that the registration + // exists in the current process. This exact check is also performed + // (indirectly) in nsIGlobalObject::GetOrCreateServiceWorker, but it + // also emits a warning when the registration is not present. To + // to avoid having too many warnings, we do a precheck here. + if (!ServiceWorkerParentInterceptEnabled()) { + const RefPtr serviceWorkerManager = + ServiceWorkerManager::GetInstance(); + if (!serviceWorkerManager) { + return nullptr; + } + + const RefPtr registration = + serviceWorkerManager->GetRegistration(aDescriptor.PrincipalInfo(), + aDescriptor.Scope()); + if (!registration) { + return nullptr; + } + } + + return aGlobal->GetOrCreateServiceWorker(aDescriptor).forget(); +} + +} // namespace + +Result ServiceWorkerContainer::FillInMessageEventInit( + JSContext* const aCx, nsIGlobalObject* const aGlobal, + ReceivedMessage& aMessage, MessageEventInit& aInit, ErrorResult& aRv) { + // Determining the source and origin should preceed attempting deserialization + // because on a "messageerror" event (i.e. when deserialization fails), the + // dispatched message needs to contain such an origin and source, per spec: + // + // "If this throws an exception, catch it, fire an event named messageerror + // at destination, using MessageEvent, with the origin attribute initialized + // to origin and the source attribute initialized to source, and then abort + // these steps." - 6.4 of postMessage + // See: https://w3c.github.io/ServiceWorker/#service-worker-postmessage + const RefPtr serviceWorkerInstance = + GetOrCreateServiceWorkerWithoutWarnings(aGlobal, aMessage.mServiceWorker); + if (serviceWorkerInstance) { + aInit.mSource.SetValue().SetAsServiceWorker() = serviceWorkerInstance; + } + + const nsresult rv = + FillInOriginNoSuffix(aMessage.mServiceWorker, aInit.mOrigin); + if (NS_FAILED(rv)) { + return Err(false); + } + + JS::Rooted messageData(aCx); + aMessage.mClonedData.Read(aCx, &messageData, aRv); + if (aRv.Failed()) { + return Err(true); + } + + aInit.mData = messageData; + + if (!aMessage.mClonedData.TakeTransferredPortsAsSequence(aInit.mPorts)) { + xpc::Throw(aCx, NS_ERROR_OUT_OF_MEMORY); + return Err(false); + } + + return Ok(); +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerContainer.h b/dom/serviceworkers/ServiceWorkerContainer.h new file mode 100644 index 0000000000..d3ac715734 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerContainer.h @@ -0,0 +1,172 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworkercontainer_h__ +#define mozilla_dom_serviceworkercontainer_h__ + +#include "mozilla/DOMEventTargetHelper.h" +#include "mozilla/ErrorResult.h" +#include "mozilla/dom/ServiceWorkerUtils.h" + +class nsIGlobalWindow; + +namespace mozilla { +namespace dom { + +class ClientPostMessageArgs; +struct MessageEventInit; +class Promise; +struct RegistrationOptions; +class ServiceWorker; + +// Lightweight serviceWorker APIs collection. +class ServiceWorkerContainer final : public DOMEventTargetHelper { + public: + class Inner { + public: + virtual void AddContainer(ServiceWorkerContainer* aOuter) = 0; + + virtual void RemoveContainer(ServiceWorkerContainer* aOuter) = 0; + + virtual void Register(const ClientInfo& aClientInfo, + const nsACString& aScopeURL, + const nsACString& aScriptURL, + ServiceWorkerUpdateViaCache aUpdateViaCache, + ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) const = 0; + + virtual void GetRegistration( + const ClientInfo& aClientInfo, const nsACString& aURL, + ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) const = 0; + + virtual void GetRegistrations( + const ClientInfo& aClientInfo, + ServiceWorkerRegistrationListCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) const = 0; + + virtual void GetReady(const ClientInfo& aClientInfo, + ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) const = 0; + + NS_INLINE_DECL_PURE_VIRTUAL_REFCOUNTING + }; + + NS_DECL_ISUPPORTS_INHERITED + NS_DECL_CYCLE_COLLECTION_CLASS_INHERITED(ServiceWorkerContainer, + DOMEventTargetHelper) + + IMPL_EVENT_HANDLER(controllerchange) + IMPL_EVENT_HANDLER(error) + IMPL_EVENT_HANDLER(messageerror) + + // Almost a manual expansion of IMPL_EVENT_HANDLER(message), but + // with the additional StartMessages() when setting the handler, as + // required by the spec. + inline mozilla::dom::EventHandlerNonNull* GetOnmessage() { + return GetEventHandler(nsGkAtoms::onmessage); + } + inline void SetOnmessage(mozilla::dom::EventHandlerNonNull* aCallback) { + SetEventHandler(nsGkAtoms::onmessage, aCallback); + StartMessages(); + } + + static bool IsEnabled(JSContext* aCx, JSObject* aGlobal); + + static already_AddRefed Create( + nsIGlobalObject* aGlobal); + + virtual JSObject* WrapObject(JSContext* aCx, + JS::Handle aGivenProto) override; + + already_AddRefed Register(const nsAString& aScriptURL, + const RegistrationOptions& aOptions, + const CallerType aCallerType, + ErrorResult& aRv); + + already_AddRefed GetController(); + + already_AddRefed GetRegistration(const nsAString& aDocumentURL, + ErrorResult& aRv); + + already_AddRefed GetRegistrations(ErrorResult& aRv); + + void StartMessages(); + + Promise* GetReady(ErrorResult& aRv); + + // Testing only. + void GetScopeForUrl(const nsAString& aUrl, nsString& aScope, + ErrorResult& aRv); + + // DOMEventTargetHelper + void DisconnectFromOwner() override; + + // Invalidates |mControllerWorker| and dispatches a "controllerchange" + // event. + void ControllerChanged(ErrorResult& aRv); + + void ReceiveMessage(const ClientPostMessageArgs& aArgs); + + private: + ServiceWorkerContainer( + nsIGlobalObject* aGlobal, + already_AddRefed aInner); + + ~ServiceWorkerContainer(); + + // Utility method to get the global if its present and if certain + // additional validaty checks pass. One of these additional checks + // verifies the global can access storage. Since storage access can + // vary based on user settings we want to often provide some error + // message if the storage check fails. This method takes an optional + // callback that can be used to report the storage failure to the + // devtools console. + nsIGlobalObject* GetGlobalIfValid( + ErrorResult& aRv, + const std::function&& aStorageFailureCB = nullptr) const; + + struct ReceivedMessage; + + // Dispatch a Runnable that dispatches the given message on this + // object. When the owner of this object is a Window, the Runnable + // is dispatched on the corresponding TabGroup. + void EnqueueReceivedMessageDispatch(RefPtr aMessage); + + template + void RunWithJSContext(F&& aCallable); + + void DispatchMessage(RefPtr aMessage); + + // When it fails, returning boolean means whether it's because deserailization + // failed or not. + static Result FillInMessageEventInit(JSContext* aCx, + nsIGlobalObject* aGlobal, + ReceivedMessage& aMessage, + MessageEventInit& aInit, + ErrorResult& aRv); + + RefPtr mInner; + + // This only changes when a worker hijacks everything in its scope by calling + // claim. + RefPtr mControllerWorker; + + RefPtr mReadyPromise; + MozPromiseRequestHolder mReadyPromiseHolder; + + // Set after StartMessages() has been called. + bool mMessagesStarted = false; + + // Queue holding messages posted from service worker as long as + // StartMessages() hasn't been called. + nsTArray> mPendingMessages; +}; + +} // namespace dom +} // namespace mozilla + +#endif /* mozilla_dom_serviceworkercontainer_h__ */ diff --git a/dom/serviceworkers/ServiceWorkerContainerChild.cpp b/dom/serviceworkers/ServiceWorkerContainerChild.cpp new file mode 100644 index 0000000000..93e0c2f7eb --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerContainerChild.cpp @@ -0,0 +1,74 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "mozilla/dom/PServiceWorkerContainerChild.h" +#include "mozilla/dom/WorkerCommon.h" +#include "mozilla/dom/WorkerRef.h" + +#include "RemoteServiceWorkerContainerImpl.h" +#include "ServiceWorkerContainerChild.h" + +namespace mozilla { +namespace dom { + +void ServiceWorkerContainerChild::ActorDestroy(ActorDestroyReason aReason) { + mIPCWorkerRef = nullptr; + + if (mOwner) { + mOwner->RevokeActor(this); + MOZ_DIAGNOSTIC_ASSERT(!mOwner); + } +} + +// static +already_AddRefed +ServiceWorkerContainerChild::Create() { + RefPtr actor = new ServiceWorkerContainerChild; + + if (!NS_IsMainThread()) { + WorkerPrivate* workerPrivate = GetCurrentThreadWorkerPrivate(); + MOZ_DIAGNOSTIC_ASSERT(workerPrivate); + + RefPtr> helper = + new IPCWorkerRefHelper(actor); + + actor->mIPCWorkerRef = IPCWorkerRef::Create( + workerPrivate, "ServiceWorkerContainerChild", + [helper] { helper->Actor()->MaybeStartTeardown(); }); + if (NS_WARN_IF(!actor->mIPCWorkerRef)) { + return nullptr; + } + } + + return actor.forget(); +} + +ServiceWorkerContainerChild::ServiceWorkerContainerChild() + : mOwner(nullptr), mTeardownStarted(false) {} + +void ServiceWorkerContainerChild::SetOwner( + RemoteServiceWorkerContainerImpl* aOwner) { + MOZ_DIAGNOSTIC_ASSERT(!mOwner); + MOZ_DIAGNOSTIC_ASSERT(aOwner); + mOwner = aOwner; +} + +void ServiceWorkerContainerChild::RevokeOwner( + RemoteServiceWorkerContainerImpl* aOwner) { + MOZ_DIAGNOSTIC_ASSERT(mOwner); + MOZ_DIAGNOSTIC_ASSERT(aOwner == mOwner); + mOwner = nullptr; +} + +void ServiceWorkerContainerChild::MaybeStartTeardown() { + if (mTeardownStarted) { + return; + } + mTeardownStarted = true; +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerContainerChild.h b/dom/serviceworkers/ServiceWorkerContainerChild.h new file mode 100644 index 0000000000..9c7b748497 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerContainerChild.h @@ -0,0 +1,49 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworkercontainerchild_h__ +#define mozilla_dom_serviceworkercontainerchild_h__ + +#include "mozilla/dom/PServiceWorkerContainerChild.h" + +// XXX Avoid including this here by moving function bodies to the cpp file +#include "mozilla/dom/WorkerRef.h" + +namespace mozilla { +namespace dom { + +class RemoteServiceWorkerContainerImpl; + +class IPCWorkerRef; + +class ServiceWorkerContainerChild final : public PServiceWorkerContainerChild { + RefPtr mIPCWorkerRef; + RemoteServiceWorkerContainerImpl* mOwner; + bool mTeardownStarted; + + ServiceWorkerContainerChild(); + + ~ServiceWorkerContainerChild() = default; + + // PServiceWorkerContainerChild + void ActorDestroy(ActorDestroyReason aReason) override; + + public: + NS_INLINE_DECL_REFCOUNTING(ServiceWorkerContainerChild, override); + + static already_AddRefed Create(); + + void SetOwner(RemoteServiceWorkerContainerImpl* aOwner); + + void RevokeOwner(RemoteServiceWorkerContainerImpl* aOwner); + + void MaybeStartTeardown(); +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_serviceworkercontainerchild_h__ diff --git a/dom/serviceworkers/ServiceWorkerContainerImpl.cpp b/dom/serviceworkers/ServiceWorkerContainerImpl.cpp new file mode 100644 index 0000000000..160826b113 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerContainerImpl.cpp @@ -0,0 +1,189 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerContainerImpl.h" + +#include "ServiceWorkerManager.h" +#include "ServiceWorkerRegistration.h" + +#include "mozilla/dom/DOMMozPromiseRequestHolder.h" + +namespace mozilla { +namespace dom { + +ServiceWorkerContainerImpl::~ServiceWorkerContainerImpl() { + MOZ_DIAGNOSTIC_ASSERT(!mOuter); +} + +ServiceWorkerContainerImpl::ServiceWorkerContainerImpl() : mOuter(nullptr) {} + +void ServiceWorkerContainerImpl::AddContainer(ServiceWorkerContainer* aOuter) { + MOZ_DIAGNOSTIC_ASSERT(aOuter); + MOZ_DIAGNOSTIC_ASSERT(!mOuter); + mOuter = aOuter; +} + +void ServiceWorkerContainerImpl::RemoveContainer( + ServiceWorkerContainer* aOuter) { + MOZ_DIAGNOSTIC_ASSERT(aOuter); + MOZ_DIAGNOSTIC_ASSERT(mOuter == aOuter); + mOuter = nullptr; +} + +void ServiceWorkerContainerImpl::Register( + const ClientInfo& aClientInfo, const nsACString& aScopeURL, + const nsACString& aScriptURL, ServiceWorkerUpdateViaCache aUpdateViaCache, + ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) const { + MOZ_DIAGNOSTIC_ASSERT(mOuter); + + nsIGlobalObject* global = mOuter->GetParentObject(); + if (NS_WARN_IF(!global)) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (NS_WARN_IF(!swm)) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + auto holder = + MakeRefPtr>( + global); + + swm->Register(aClientInfo, aScopeURL, aScriptURL, aUpdateViaCache) + ->Then( + global->EventTargetFor(TaskCategory::Other), __func__, + [successCB = std::move(aSuccessCB), + holder](const ServiceWorkerRegistrationDescriptor& aDescriptor) { + holder->Complete(); + successCB(aDescriptor); + }, + [failureCB = std::move(aFailureCB), + holder](const CopyableErrorResult& aResult) { + holder->Complete(); + failureCB(CopyableErrorResult(aResult)); + }) + ->Track(*holder); +} + +void ServiceWorkerContainerImpl::GetRegistration( + const ClientInfo& aClientInfo, const nsACString& aURL, + ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) const { + MOZ_DIAGNOSTIC_ASSERT(mOuter); + + nsIGlobalObject* global = mOuter->GetParentObject(); + if (NS_WARN_IF(!global)) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (NS_WARN_IF(!swm)) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + auto holder = + MakeRefPtr>( + global); + + swm->GetRegistration(aClientInfo, aURL) + ->Then( + global->EventTargetFor(TaskCategory::Other), __func__, + [successCB = std::move(aSuccessCB), + holder](const ServiceWorkerRegistrationDescriptor& aDescriptor) { + holder->Complete(); + successCB(aDescriptor); + }, + [failureCB = std::move(aFailureCB), + holder](const CopyableErrorResult& aResult) { + holder->Complete(); + failureCB(CopyableErrorResult(aResult)); + }) + ->Track(*holder); +} + +void ServiceWorkerContainerImpl::GetRegistrations( + const ClientInfo& aClientInfo, + ServiceWorkerRegistrationListCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) const { + MOZ_DIAGNOSTIC_ASSERT(mOuter); + + nsIGlobalObject* global = mOuter->GetParentObject(); + if (NS_WARN_IF(!global)) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (NS_WARN_IF(!swm)) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + auto holder = MakeRefPtr< + DOMMozPromiseRequestHolder>(global); + + swm->GetRegistrations(aClientInfo) + ->Then( + global->EventTargetFor(TaskCategory::Other), __func__, + [successCB = std::move(aSuccessCB), + holder](const nsTArray& aList) { + holder->Complete(); + successCB(aList); + }, + [failureCB = std::move(aFailureCB), + holder](const CopyableErrorResult& aResult) { + holder->Complete(); + failureCB(CopyableErrorResult(aResult)); + }) + ->Track(*holder); +} + +void ServiceWorkerContainerImpl::GetReady( + const ClientInfo& aClientInfo, + ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) const { + MOZ_DIAGNOSTIC_ASSERT(mOuter); + + nsIGlobalObject* global = mOuter->GetParentObject(); + if (NS_WARN_IF(!global)) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (NS_WARN_IF(!swm)) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + auto holder = + MakeRefPtr>( + global); + + swm->WhenReady(aClientInfo) + ->Then( + global->EventTargetFor(TaskCategory::Other), __func__, + [successCB = std::move(aSuccessCB), + holder](const ServiceWorkerRegistrationDescriptor& aDescriptor) { + holder->Complete(); + successCB(aDescriptor); + }, + [failureCB = std::move(aFailureCB), + holder](const CopyableErrorResult& aResult) { + holder->Complete(); + failureCB(CopyableErrorResult(aResult)); + }) + ->Track(*holder); +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerContainerImpl.h b/dom/serviceworkers/ServiceWorkerContainerImpl.h new file mode 100644 index 0000000000..f8ff4a216e --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerContainerImpl.h @@ -0,0 +1,54 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworkercontainerimpl_h__ +#define mozilla_dom_serviceworkercontainerimpl_h__ + +#include "ServiceWorkerContainer.h" + +namespace mozilla { +namespace dom { + +// Lightweight serviceWorker APIs collection. +class ServiceWorkerContainerImpl final : public ServiceWorkerContainer::Inner { + ServiceWorkerContainer* mOuter; + + ~ServiceWorkerContainerImpl(); + + public: + ServiceWorkerContainerImpl(); + + void AddContainer(ServiceWorkerContainer* aOuter) override; + + void RemoveContainer(ServiceWorkerContainer* aOuter) override; + + void Register(const ClientInfo& aClientInfo, const nsACString& aScopeURL, + const nsACString& aScriptURL, + ServiceWorkerUpdateViaCache aUpdateViaCache, + ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) const override; + + void GetRegistration( + const ClientInfo& aClientInfo, const nsACString& aURL, + ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) const override; + + void GetRegistrations( + const ClientInfo& aClientInfo, + ServiceWorkerRegistrationListCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) const override; + + void GetReady(const ClientInfo& aClientInfo, + ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) const override; + + NS_INLINE_DECL_REFCOUNTING(ServiceWorkerContainerImpl, override) +}; + +} // namespace dom +} // namespace mozilla + +#endif /* mozilla_dom_serviceworkercontainerimpl_h__ */ diff --git a/dom/serviceworkers/ServiceWorkerContainerParent.cpp b/dom/serviceworkers/ServiceWorkerContainerParent.cpp new file mode 100644 index 0000000000..d00caf3f0a --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerContainerParent.cpp @@ -0,0 +1,131 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerContainerParent.h" + +#include "ServiceWorkerContainerProxy.h" +#include "mozilla/dom/ClientInfo.h" + +namespace mozilla { +namespace dom { + +using mozilla::ipc::IPCResult; + +void ServiceWorkerContainerParent::ActorDestroy(ActorDestroyReason aReason) { + if (mProxy) { + mProxy->RevokeActor(this); + mProxy = nullptr; + } +} + +IPCResult ServiceWorkerContainerParent::RecvTeardown() { + Unused << Send__delete__(this); + return IPC_OK(); +} + +IPCResult ServiceWorkerContainerParent::RecvRegister( + const IPCClientInfo& aClientInfo, const nsCString& aScopeURL, + const nsCString& aScriptURL, + const ServiceWorkerUpdateViaCache& aUpdateViaCache, + RegisterResolver&& aResolver) { + if (!mProxy) { + aResolver(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return IPC_OK(); + } + + mProxy + ->Register(ClientInfo(aClientInfo), aScopeURL, aScriptURL, + aUpdateViaCache) + ->Then( + GetCurrentSerialEventTarget(), __func__, + [aResolver](const ServiceWorkerRegistrationDescriptor& aDescriptor) { + aResolver(aDescriptor.ToIPC()); + }, + [aResolver](const CopyableErrorResult& aResult) { + aResolver(aResult); + }); + + return IPC_OK(); +} + +IPCResult ServiceWorkerContainerParent::RecvGetRegistration( + const IPCClientInfo& aClientInfo, const nsCString& aURL, + GetRegistrationResolver&& aResolver) { + if (!mProxy) { + aResolver(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return IPC_OK(); + } + + mProxy->GetRegistration(ClientInfo(aClientInfo), aURL) + ->Then( + GetCurrentSerialEventTarget(), __func__, + [aResolver](const ServiceWorkerRegistrationDescriptor& aDescriptor) { + aResolver(aDescriptor.ToIPC()); + }, + [aResolver](const CopyableErrorResult& aResult) { + aResolver(aResult); + }); + + return IPC_OK(); +} + +IPCResult ServiceWorkerContainerParent::RecvGetRegistrations( + const IPCClientInfo& aClientInfo, GetRegistrationsResolver&& aResolver) { + if (!mProxy) { + aResolver(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return IPC_OK(); + } + + mProxy->GetRegistrations(ClientInfo(aClientInfo)) + ->Then( + GetCurrentSerialEventTarget(), __func__, + [aResolver]( + const nsTArray& aList) { + IPCServiceWorkerRegistrationDescriptorList ipcList; + for (auto& desc : aList) { + ipcList.values().AppendElement(desc.ToIPC()); + } + aResolver(std::move(ipcList)); + }, + [aResolver](const CopyableErrorResult& aResult) { + aResolver(aResult); + }); + + return IPC_OK(); +} + +IPCResult ServiceWorkerContainerParent::RecvGetReady( + const IPCClientInfo& aClientInfo, GetReadyResolver&& aResolver) { + if (!mProxy) { + aResolver(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return IPC_OK(); + } + + mProxy->GetReady(ClientInfo(aClientInfo)) + ->Then( + GetCurrentSerialEventTarget(), __func__, + [aResolver](const ServiceWorkerRegistrationDescriptor& aDescriptor) { + aResolver(aDescriptor.ToIPC()); + }, + [aResolver](const CopyableErrorResult& aResult) { + aResolver(aResult); + }); + + return IPC_OK(); +} + +ServiceWorkerContainerParent::ServiceWorkerContainerParent() = default; + +ServiceWorkerContainerParent::~ServiceWorkerContainerParent() { + MOZ_DIAGNOSTIC_ASSERT(!mProxy); +} + +void ServiceWorkerContainerParent::Init() { + mProxy = new ServiceWorkerContainerProxy(this); +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerContainerParent.h b/dom/serviceworkers/ServiceWorkerContainerParent.h new file mode 100644 index 0000000000..ccfdced8f6 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerContainerParent.h @@ -0,0 +1,57 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworkercontainerparent_h__ +#define mozilla_dom_serviceworkercontainerparent_h__ + +#include "mozilla/dom/PServiceWorkerContainerParent.h" + +namespace mozilla { +namespace dom { + +class IPCServiceWorkerDescriptor; +class ServiceWorkerContainerProxy; + +class ServiceWorkerContainerParent final + : public PServiceWorkerContainerParent { + RefPtr mProxy; + + ~ServiceWorkerContainerParent(); + + // PServiceWorkerContainerParent + void ActorDestroy(ActorDestroyReason aReason) override; + + mozilla::ipc::IPCResult RecvTeardown() override; + + mozilla::ipc::IPCResult RecvRegister( + const IPCClientInfo& aClientInfo, const nsCString& aScopeURL, + const nsCString& aScriptURL, + const ServiceWorkerUpdateViaCache& aUpdateViaCache, + RegisterResolver&& aResolver) override; + + mozilla::ipc::IPCResult RecvGetRegistration( + const IPCClientInfo& aClientInfo, const nsCString& aURL, + GetRegistrationResolver&& aResolver) override; + + mozilla::ipc::IPCResult RecvGetRegistrations( + const IPCClientInfo& aClientInfo, + GetRegistrationsResolver&& aResolver) override; + + mozilla::ipc::IPCResult RecvGetReady(const IPCClientInfo& aClientInfo, + GetReadyResolver&& aResolver) override; + + public: + NS_INLINE_DECL_REFCOUNTING(ServiceWorkerContainerParent, override); + + ServiceWorkerContainerParent(); + + void Init(); +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_serviceworkercontainerparent_h__ diff --git a/dom/serviceworkers/ServiceWorkerContainerProxy.cpp b/dom/serviceworkers/ServiceWorkerContainerProxy.cpp new file mode 100644 index 0000000000..9574e062e3 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerContainerProxy.cpp @@ -0,0 +1,154 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerContainerProxy.h" + +#include "mozilla/dom/ServiceWorkerContainerParent.h" +#include "mozilla/dom/ServiceWorkerManager.h" +#include "mozilla/ipc/BackgroundParent.h" +#include "mozilla/SchedulerGroup.h" +#include "mozilla/ScopeExit.h" + +namespace mozilla { +namespace dom { + +using mozilla::ipc::AssertIsOnBackgroundThread; + +ServiceWorkerContainerProxy::~ServiceWorkerContainerProxy() { + // Any thread + MOZ_DIAGNOSTIC_ASSERT(!mActor); +} + +ServiceWorkerContainerProxy::ServiceWorkerContainerProxy( + ServiceWorkerContainerParent* aActor) + : mActor(aActor) { + AssertIsOnBackgroundThread(); + MOZ_DIAGNOSTIC_ASSERT(mActor); + + // The container does not directly listen for updates, so we don't need + // to immediately initialize. The controllerchange event comes via the + // ClientSource associated with the ServiceWorkerContainer's bound global. +} + +void ServiceWorkerContainerProxy::RevokeActor( + ServiceWorkerContainerParent* aActor) { + AssertIsOnBackgroundThread(); + MOZ_DIAGNOSTIC_ASSERT(mActor); + MOZ_DIAGNOSTIC_ASSERT(mActor == aActor); + mActor = nullptr; +} + +RefPtr ServiceWorkerContainerProxy::Register( + const ClientInfo& aClientInfo, const nsCString& aScopeURL, + const nsCString& aScriptURL, ServiceWorkerUpdateViaCache aUpdateViaCache) { + AssertIsOnBackgroundThread(); + + RefPtr promise = + new ServiceWorkerRegistrationPromise::Private(__func__); + + nsCOMPtr r = NS_NewRunnableFunction( + __func__, + [aClientInfo, aScopeURL, aScriptURL, aUpdateViaCache, promise]() mutable { + auto scopeExit = MakeScopeExit( + [&] { promise->Reject(NS_ERROR_DOM_INVALID_STATE_ERR, __func__); }); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + NS_ENSURE_TRUE_VOID(swm); + + swm->Register(aClientInfo, aScopeURL, aScriptURL, aUpdateViaCache) + ->ChainTo(promise.forget(), __func__); + + scopeExit.release(); + }); + + MOZ_ALWAYS_SUCCEEDS( + SchedulerGroup::Dispatch(TaskCategory::Other, r.forget())); + + return promise; +} + +RefPtr +ServiceWorkerContainerProxy::GetRegistration(const ClientInfo& aClientInfo, + const nsCString& aURL) { + AssertIsOnBackgroundThread(); + + RefPtr promise = + new ServiceWorkerRegistrationPromise::Private(__func__); + + nsCOMPtr r = + NS_NewRunnableFunction(__func__, [aClientInfo, aURL, promise]() mutable { + auto scopeExit = MakeScopeExit( + [&] { promise->Reject(NS_ERROR_DOM_INVALID_STATE_ERR, __func__); }); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + NS_ENSURE_TRUE_VOID(swm); + + swm->GetRegistration(aClientInfo, aURL) + ->ChainTo(promise.forget(), __func__); + + scopeExit.release(); + }); + + MOZ_ALWAYS_SUCCEEDS( + SchedulerGroup::Dispatch(TaskCategory::Other, r.forget())); + + return promise; +} + +RefPtr +ServiceWorkerContainerProxy::GetRegistrations(const ClientInfo& aClientInfo) { + AssertIsOnBackgroundThread(); + + RefPtr promise = + new ServiceWorkerRegistrationListPromise::Private(__func__); + + nsCOMPtr r = + NS_NewRunnableFunction(__func__, [aClientInfo, promise]() mutable { + auto scopeExit = MakeScopeExit( + [&] { promise->Reject(NS_ERROR_DOM_INVALID_STATE_ERR, __func__); }); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + NS_ENSURE_TRUE_VOID(swm); + + swm->GetRegistrations(aClientInfo)->ChainTo(promise.forget(), __func__); + + scopeExit.release(); + }); + + MOZ_ALWAYS_SUCCEEDS( + SchedulerGroup::Dispatch(TaskCategory::Other, r.forget())); + + return promise; +} + +RefPtr ServiceWorkerContainerProxy::GetReady( + const ClientInfo& aClientInfo) { + AssertIsOnBackgroundThread(); + + RefPtr promise = + new ServiceWorkerRegistrationPromise::Private(__func__); + + nsCOMPtr r = + NS_NewRunnableFunction(__func__, [aClientInfo, promise]() mutable { + auto scopeExit = MakeScopeExit( + [&] { promise->Reject(NS_ERROR_DOM_INVALID_STATE_ERR, __func__); }); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + NS_ENSURE_TRUE_VOID(swm); + + swm->WhenReady(aClientInfo)->ChainTo(promise.forget(), __func__); + + scopeExit.release(); + }); + + MOZ_ALWAYS_SUCCEEDS( + SchedulerGroup::Dispatch(TaskCategory::Other, r.forget())); + + return promise; +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerContainerProxy.h b/dom/serviceworkers/ServiceWorkerContainerProxy.h new file mode 100644 index 0000000000..7eaee6fbac --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerContainerProxy.h @@ -0,0 +1,48 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef moz_dom_ServiceWorkerContainerProxy_h +#define moz_dom_ServiceWorkerContainerProxy_h + +#include "mozilla/dom/ServiceWorkerUtils.h" +#include "mozilla/RefPtr.h" + +namespace mozilla { +namespace dom { + +class ServiceWorkerContainerParent; + +class ServiceWorkerContainerProxy final { + // Background thread only + RefPtr mActor; + + ~ServiceWorkerContainerProxy(); + + public: + explicit ServiceWorkerContainerProxy(ServiceWorkerContainerParent* aActor); + + void RevokeActor(ServiceWorkerContainerParent* aActor); + + RefPtr Register( + const ClientInfo& aClientInfo, const nsCString& aScopeURL, + const nsCString& aScriptURL, ServiceWorkerUpdateViaCache aUpdateViaCache); + + RefPtr GetRegistration( + const ClientInfo& aClientInfo, const nsCString& aURL); + + RefPtr GetRegistrations( + const ClientInfo& aClientInfo); + + RefPtr GetReady( + const ClientInfo& aClientInfo); + + NS_INLINE_DECL_THREADSAFE_REFCOUNTING(ServiceWorkerContainerProxy); +}; + +} // namespace dom +} // namespace mozilla + +#endif // moz_dom_ServiceWorkerContainerProxy_h diff --git a/dom/serviceworkers/ServiceWorkerDescriptor.cpp b/dom/serviceworkers/ServiceWorkerDescriptor.cpp new file mode 100644 index 0000000000..a418623f56 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerDescriptor.cpp @@ -0,0 +1,143 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerDescriptor.h" +#include "mozilla/dom/IPCServiceWorkerDescriptor.h" +#include "mozilla/dom/ServiceWorkerBinding.h" +#include "mozilla/ipc/PBackgroundSharedTypes.h" + +namespace mozilla { +namespace dom { + +using mozilla::ipc::PrincipalInfo; +using mozilla::ipc::PrincipalInfoToPrincipal; + +ServiceWorkerDescriptor::ServiceWorkerDescriptor( + uint64_t aId, uint64_t aRegistrationId, uint64_t aRegistrationVersion, + nsIPrincipal* aPrincipal, const nsACString& aScope, + const nsACString& aScriptURL, ServiceWorkerState aState) + : mData(MakeUnique()) { + MOZ_ALWAYS_SUCCEEDS( + PrincipalToPrincipalInfo(aPrincipal, &mData->principalInfo())); + + mData->id() = aId; + mData->registrationId() = aRegistrationId; + mData->registrationVersion() = aRegistrationVersion; + mData->scope() = aScope; + mData->scriptURL() = aScriptURL; + mData->state() = aState; + // Set HandlesFetch as true in default + mData->handlesFetch() = true; +} + +ServiceWorkerDescriptor::ServiceWorkerDescriptor( + uint64_t aId, uint64_t aRegistrationId, uint64_t aRegistrationVersion, + const mozilla::ipc::PrincipalInfo& aPrincipalInfo, const nsACString& aScope, + const nsACString& aScriptURL, ServiceWorkerState aState) + : mData(MakeUnique( + aId, aRegistrationId, aRegistrationVersion, aPrincipalInfo, + nsCString(aScriptURL), nsCString(aScope), aState, true)) {} + +ServiceWorkerDescriptor::ServiceWorkerDescriptor( + const IPCServiceWorkerDescriptor& aDescriptor) + : mData(MakeUnique(aDescriptor)) {} + +ServiceWorkerDescriptor::ServiceWorkerDescriptor( + const ServiceWorkerDescriptor& aRight) { + operator=(aRight); +} + +ServiceWorkerDescriptor& ServiceWorkerDescriptor::operator=( + const ServiceWorkerDescriptor& aRight) { + if (this == &aRight) { + return *this; + } + mData.reset(); + mData = MakeUnique(*aRight.mData); + return *this; +} + +ServiceWorkerDescriptor::ServiceWorkerDescriptor( + ServiceWorkerDescriptor&& aRight) + : mData(std::move(aRight.mData)) {} + +ServiceWorkerDescriptor& ServiceWorkerDescriptor::operator=( + ServiceWorkerDescriptor&& aRight) { + mData.reset(); + mData = std::move(aRight.mData); + return *this; +} + +ServiceWorkerDescriptor::~ServiceWorkerDescriptor() = default; + +bool ServiceWorkerDescriptor::operator==( + const ServiceWorkerDescriptor& aRight) const { + return *mData == *aRight.mData; +} + +uint64_t ServiceWorkerDescriptor::Id() const { return mData->id(); } + +uint64_t ServiceWorkerDescriptor::RegistrationId() const { + return mData->registrationId(); +} + +uint64_t ServiceWorkerDescriptor::RegistrationVersion() const { + return mData->registrationVersion(); +} + +const mozilla::ipc::PrincipalInfo& ServiceWorkerDescriptor::PrincipalInfo() + const { + return mData->principalInfo(); +} + +Result, nsresult> ServiceWorkerDescriptor::GetPrincipal() + const { + AssertIsOnMainThread(); + return PrincipalInfoToPrincipal(mData->principalInfo()); +} + +const nsCString& ServiceWorkerDescriptor::Scope() const { + return mData->scope(); +} + +const nsCString& ServiceWorkerDescriptor::ScriptURL() const { + return mData->scriptURL(); +} + +ServiceWorkerState ServiceWorkerDescriptor::State() const { + return mData->state(); +} + +void ServiceWorkerDescriptor::SetState(ServiceWorkerState aState) { + mData->state() = aState; +} + +void ServiceWorkerDescriptor::SetRegistrationVersion(uint64_t aVersion) { + MOZ_DIAGNOSTIC_ASSERT(aVersion > mData->registrationVersion()); + mData->registrationVersion() = aVersion; +} + +bool ServiceWorkerDescriptor::HandlesFetch() const { + return mData->handlesFetch(); +} + +void ServiceWorkerDescriptor::SetHandlesFetch(bool aHandlesFetch) { + mData->handlesFetch() = aHandlesFetch; +} + +bool ServiceWorkerDescriptor::Matches( + const ServiceWorkerDescriptor& aDescriptor) const { + return Id() == aDescriptor.Id() && Scope() == aDescriptor.Scope() && + ScriptURL() == aDescriptor.ScriptURL() && + PrincipalInfo() == aDescriptor.PrincipalInfo(); +} + +const IPCServiceWorkerDescriptor& ServiceWorkerDescriptor::ToIPC() const { + return *mData; +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerDescriptor.h b/dom/serviceworkers/ServiceWorkerDescriptor.h new file mode 100644 index 0000000000..b85890089b --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerDescriptor.h @@ -0,0 +1,100 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ +#ifndef _mozilla_dom_ServiceWorkerDescriptor_h +#define _mozilla_dom_ServiceWorkerDescriptor_h + +#include "mozilla/UniquePtr.h" +#include "nsCOMPtr.h" +#include "nsString.h" + +class nsIPrincipal; + +namespace mozilla { + +namespace ipc { +class PrincipalInfo; +} // namespace ipc + +namespace dom { + +class IPCServiceWorkerDescriptor; +enum class ServiceWorkerState : uint8_t; + +// This class represents a snapshot of a particular ServiceWorkerInfo object. +// It is threadsafe and can be transferred across processes. This is useful +// because most of its values are immutable and can be relied upon to be +// accurate. Currently the only variable field is the ServiceWorkerState. +class ServiceWorkerDescriptor final { + // This class is largely a wrapper around an IPDL generated struct. We + // need the wrapper class since IPDL generated code includes windows.h + // which is in turn incompatible with bindings code. + UniquePtr mData; + + public: + ServiceWorkerDescriptor(uint64_t aId, uint64_t aRegistrationId, + uint64_t aRegistrationVersion, + nsIPrincipal* aPrincipal, const nsACString& aScope, + const nsACString& aScriptURL, + ServiceWorkerState aState); + + ServiceWorkerDescriptor(uint64_t aId, uint64_t aRegistrationId, + uint64_t aRegistrationVersion, + const mozilla::ipc::PrincipalInfo& aPrincipalInfo, + const nsACString& aScope, + const nsACString& aScriptURL, + ServiceWorkerState aState); + + explicit ServiceWorkerDescriptor( + const IPCServiceWorkerDescriptor& aDescriptor); + + ServiceWorkerDescriptor(const ServiceWorkerDescriptor& aRight); + + ServiceWorkerDescriptor& operator=(const ServiceWorkerDescriptor& aRight); + + ServiceWorkerDescriptor(ServiceWorkerDescriptor&& aRight); + + ServiceWorkerDescriptor& operator=(ServiceWorkerDescriptor&& aRight); + + ~ServiceWorkerDescriptor(); + + bool operator==(const ServiceWorkerDescriptor& aRight) const; + + uint64_t Id() const; + + uint64_t RegistrationId() const; + + uint64_t RegistrationVersion() const; + + const mozilla::ipc::PrincipalInfo& PrincipalInfo() const; + + Result, nsresult> GetPrincipal() const; + + const nsCString& Scope() const; + + const nsCString& ScriptURL() const; + + ServiceWorkerState State() const; + + void SetState(ServiceWorkerState aState); + + void SetRegistrationVersion(uint64_t aVersion); + + bool HandlesFetch() const; + + void SetHandlesFetch(bool aHandlesFetch); + + // Try to determine if two workers match each other. This is less strict + // than an operator==() call since it ignores mutable values like State(). + bool Matches(const ServiceWorkerDescriptor& aDescriptor) const; + + // Expose the underlying IPC type so that it can be passed via IPC. + const IPCServiceWorkerDescriptor& ToIPC() const; +}; + +} // namespace dom +} // namespace mozilla + +#endif // _mozilla_dom_ServiceWorkerDescriptor_h diff --git a/dom/serviceworkers/ServiceWorkerEvents.cpp b/dom/serviceworkers/ServiceWorkerEvents.cpp new file mode 100644 index 0000000000..e5efe8db34 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerEvents.cpp @@ -0,0 +1,1285 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerEvents.h" + +#include + +#include "ServiceWorker.h" +#include "ServiceWorkerManager.h" +#include "js/Conversions.h" +#include "js/Exception.h" // JS::ExceptionStack, JS::StealPendingExceptionStack +#include "js/TypeDecls.h" +#include "mozilla/Encoding.h" +#include "mozilla/ErrorResult.h" +#include "mozilla/HoldDropJSObjects.h" +#include "mozilla/LoadInfo.h" +#include "mozilla/Preferences.h" +#include "mozilla/dom/BodyUtil.h" +#include "mozilla/dom/Client.h" +#include "mozilla/dom/EventBinding.h" +#include "mozilla/dom/FetchEventBinding.h" +#include "mozilla/dom/MessagePort.h" +#include "mozilla/dom/PromiseNativeHandler.h" +#include "mozilla/dom/PushEventBinding.h" +#include "mozilla/dom/PushMessageDataBinding.h" +#include "mozilla/dom/PushUtil.h" +#include "mozilla/dom/Request.h" +#include "mozilla/dom/Response.h" +#include "mozilla/dom/ServiceWorkerOp.h" +#include "mozilla/dom/TypedArray.h" +#include "mozilla/dom/WorkerPrivate.h" +#include "mozilla/dom/WorkerScope.h" +#include "mozilla/net/NeckoChannelParams.h" +#include "mozilla/Telemetry.h" +#include "nsComponentManagerUtils.h" +#include "nsContentPolicyUtils.h" +#include "nsContentUtils.h" +#include "nsIConsoleReportCollector.h" +#include "nsINetworkInterceptController.h" +#include "nsIScriptError.h" +#include "nsNetCID.h" +#include "nsNetUtil.h" +#include "nsQueryObject.h" +#include "nsSerializationHelper.h" +#include "nsServiceManagerUtils.h" +#include "nsStreamUtils.h" +#include "xpcpublic.h" + +using namespace mozilla; +using namespace mozilla::dom; + +namespace { + +void AsyncLog(nsIInterceptedChannel* aInterceptedChannel, + const nsACString& aRespondWithScriptSpec, + uint32_t aRespondWithLineNumber, + uint32_t aRespondWithColumnNumber, const nsACString& aMessageName, + const nsTArray& aParams) { + MOZ_ASSERT(aInterceptedChannel); + nsCOMPtr reporter = + aInterceptedChannel->GetConsoleReportCollector(); + if (reporter) { + reporter->AddConsoleReport(nsIScriptError::errorFlag, + "Service Worker Interception"_ns, + nsContentUtils::eDOM_PROPERTIES, + aRespondWithScriptSpec, aRespondWithLineNumber, + aRespondWithColumnNumber, aMessageName, aParams); + } +} + +template +void AsyncLog(nsIInterceptedChannel* aInterceptedChannel, + const nsACString& aRespondWithScriptSpec, + uint32_t aRespondWithLineNumber, + uint32_t aRespondWithColumnNumber, + // We have to list one explicit string so that calls with an + // nsTArray of params won't end up in here. + const nsACString& aMessageName, const nsAString& aFirstParam, + Params&&... aParams) { + nsTArray paramsList(sizeof...(Params) + 1); + StringArrayAppender::Append(paramsList, sizeof...(Params) + 1, aFirstParam, + std::forward(aParams)...); + AsyncLog(aInterceptedChannel, aRespondWithScriptSpec, aRespondWithLineNumber, + aRespondWithColumnNumber, aMessageName, paramsList); +} + +} // anonymous namespace + +namespace mozilla { +namespace dom { + +CancelChannelRunnable::CancelChannelRunnable( + nsMainThreadPtrHandle& aChannel, + nsMainThreadPtrHandle& aRegistration, + nsresult aStatus) + : Runnable("dom::CancelChannelRunnable"), + mChannel(aChannel), + mRegistration(aRegistration), + mStatus(aStatus) {} + +NS_IMETHODIMP +CancelChannelRunnable::Run() { + MOZ_ASSERT(NS_IsMainThread()); + + // TODO: When bug 1204254 is implemented, this time marker should be moved to + // the point where the body of the network request is complete. + mChannel->SetHandleFetchEventEnd(TimeStamp::Now()); + mChannel->SaveTimeStamps(); + + mChannel->CancelInterception(mStatus); + mRegistration->MaybeScheduleUpdate(); + return NS_OK; +} + +FetchEvent::FetchEvent(EventTarget* aOwner) + : ExtendableEvent(aOwner), + mPreventDefaultLineNumber(0), + mPreventDefaultColumnNumber(0), + mWaitToRespond(false) {} + +FetchEvent::~FetchEvent() = default; + +void FetchEvent::PostInit( + nsMainThreadPtrHandle& aChannel, + nsMainThreadPtrHandle& aRegistration, + const nsACString& aScriptSpec) { + mChannel = aChannel; + mRegistration = aRegistration; + mScriptSpec.Assign(aScriptSpec); +} + +void FetchEvent::PostInit(const nsACString& aScriptSpec, + RefPtr aRespondWithHandler) { + MOZ_ASSERT(aRespondWithHandler); + + mScriptSpec.Assign(aScriptSpec); + mRespondWithHandler = std::move(aRespondWithHandler); +} + +/*static*/ +already_AddRefed FetchEvent::Constructor( + const GlobalObject& aGlobal, const nsAString& aType, + const FetchEventInit& aOptions) { + RefPtr owner = do_QueryObject(aGlobal.GetAsSupports()); + MOZ_ASSERT(owner); + RefPtr e = new FetchEvent(owner); + bool trusted = e->Init(owner); + e->InitEvent(aType, aOptions.mBubbles, aOptions.mCancelable); + e->SetTrusted(trusted); + e->SetComposed(aOptions.mComposed); + e->mRequest = aOptions.mRequest; + e->mClientId = aOptions.mClientId; + e->mResultingClientId = aOptions.mResultingClientId; + RefPtr global = do_QueryObject(aGlobal.GetAsSupports()); + MOZ_ASSERT(global); + ErrorResult rv; + e->mHandled = Promise::Create(global, rv); + if (rv.Failed()) { + rv.SuppressException(); + return nullptr; + } + return e.forget(); +} + +namespace { + +struct RespondWithClosure { + nsMainThreadPtrHandle mInterceptedChannel; + nsMainThreadPtrHandle mRegistration; + const nsString mRequestURL; + const nsCString mRespondWithScriptSpec; + const uint32_t mRespondWithLineNumber; + const uint32_t mRespondWithColumnNumber; + + RespondWithClosure( + nsMainThreadPtrHandle& aChannel, + nsMainThreadPtrHandle& aRegistration, + const nsAString& aRequestURL, const nsACString& aRespondWithScriptSpec, + uint32_t aRespondWithLineNumber, uint32_t aRespondWithColumnNumber) + : mInterceptedChannel(aChannel), + mRegistration(aRegistration), + mRequestURL(aRequestURL), + mRespondWithScriptSpec(aRespondWithScriptSpec), + mRespondWithLineNumber(aRespondWithLineNumber), + mRespondWithColumnNumber(aRespondWithColumnNumber) {} +}; + +class FinishResponse final : public Runnable { + nsMainThreadPtrHandle mChannel; + + public: + explicit FinishResponse( + nsMainThreadPtrHandle& aChannel) + : Runnable("dom::FinishResponse"), mChannel(aChannel) {} + + NS_IMETHOD + Run() override { + MOZ_ASSERT(NS_IsMainThread()); + + nsresult rv = mChannel->FinishSynthesizedResponse(); + if (NS_WARN_IF(NS_FAILED(rv))) { + mChannel->CancelInterception(NS_ERROR_INTERCEPTION_FAILED); + return NS_OK; + } + + TimeStamp timeStamp = TimeStamp::Now(); + mChannel->SetHandleFetchEventEnd(timeStamp); + mChannel->SetFinishSynthesizedResponseEnd(timeStamp); + mChannel->SaveTimeStamps(); + + return rv; + } +}; + +class BodyCopyHandle final : public nsIInterceptedBodyCallback { + UniquePtr mClosure; + + ~BodyCopyHandle() = default; + + public: + NS_DECL_THREADSAFE_ISUPPORTS + + explicit BodyCopyHandle(UniquePtr&& aClosure) + : mClosure(std::move(aClosure)) {} + + NS_IMETHOD + BodyComplete(nsresult aRv) override { + MOZ_ASSERT(NS_IsMainThread()); + + nsCOMPtr event; + if (NS_WARN_IF(NS_FAILED(aRv))) { + AsyncLog(mClosure->mInterceptedChannel, mClosure->mRespondWithScriptSpec, + mClosure->mRespondWithLineNumber, + mClosure->mRespondWithColumnNumber, + "InterceptionFailedWithURL"_ns, mClosure->mRequestURL); + event = new CancelChannelRunnable(mClosure->mInterceptedChannel, + mClosure->mRegistration, + NS_ERROR_INTERCEPTION_FAILED); + } else { + event = new FinishResponse(mClosure->mInterceptedChannel); + } + + mClosure.reset(); + + event->Run(); + + return NS_OK; + } +}; + +NS_IMPL_ISUPPORTS(BodyCopyHandle, nsIInterceptedBodyCallback) + +class StartResponse final : public Runnable { + nsMainThreadPtrHandle mChannel; + RefPtr mInternalResponse; + ChannelInfo mWorkerChannelInfo; + const nsCString mScriptSpec; + const nsCString mResponseURLSpec; + UniquePtr mClosure; + + public: + StartResponse(nsMainThreadPtrHandle& aChannel, + InternalResponse* aInternalResponse, + const ChannelInfo& aWorkerChannelInfo, + const nsACString& aScriptSpec, + const nsACString& aResponseURLSpec, + UniquePtr&& aClosure) + : Runnable("dom::StartResponse"), + mChannel(aChannel), + mInternalResponse(aInternalResponse), + mWorkerChannelInfo(aWorkerChannelInfo), + mScriptSpec(aScriptSpec), + mResponseURLSpec(aResponseURLSpec), + mClosure(std::move(aClosure)) {} + + NS_IMETHOD + Run() override { + MOZ_ASSERT(NS_IsMainThread()); + + nsCOMPtr underlyingChannel; + nsresult rv = mChannel->GetChannel(getter_AddRefs(underlyingChannel)); + NS_ENSURE_SUCCESS(rv, rv); + NS_ENSURE_TRUE(underlyingChannel, NS_ERROR_UNEXPECTED); + nsCOMPtr loadInfo = underlyingChannel->LoadInfo(); + + if (!CSPPermitsResponse(loadInfo)) { + mChannel->CancelInterception(NS_ERROR_CONTENT_BLOCKED); + return NS_OK; + } + + ChannelInfo channelInfo; + if (mInternalResponse->GetChannelInfo().IsInitialized()) { + channelInfo = mInternalResponse->GetChannelInfo(); + } else { + // We are dealing with a synthesized response here, so fall back to the + // channel info for the worker script. + channelInfo = mWorkerChannelInfo; + } + rv = mChannel->SetChannelInfo(&channelInfo); + if (NS_WARN_IF(NS_FAILED(rv))) { + mChannel->CancelInterception(NS_ERROR_INTERCEPTION_FAILED); + return NS_OK; + } + + rv = mChannel->SynthesizeStatus( + mInternalResponse->GetUnfilteredStatus(), + mInternalResponse->GetUnfilteredStatusText()); + if (NS_WARN_IF(NS_FAILED(rv))) { + mChannel->CancelInterception(NS_ERROR_INTERCEPTION_FAILED); + return NS_OK; + } + + AutoTArray entries; + mInternalResponse->UnfilteredHeaders()->GetEntries(entries); + for (uint32_t i = 0; i < entries.Length(); ++i) { + mChannel->SynthesizeHeader(entries[i].mName, entries[i].mValue); + } + + auto castLoadInfo = static_cast(loadInfo.get()); + castLoadInfo->SynthesizeServiceWorkerTainting( + mInternalResponse->GetTainting()); + + // Get the preferred alternative data type of outter channel + nsAutoCString preferredAltDataType(""_ns); + nsCOMPtr outerChannel = + do_QueryInterface(underlyingChannel); + if (outerChannel && + !outerChannel->PreferredAlternativeDataTypes().IsEmpty()) { + // TODO: handle multiple types properly. + preferredAltDataType.Assign( + outerChannel->PreferredAlternativeDataTypes()[0].type()); + } + + // Get the alternative data type saved in the InternalResponse + nsAutoCString altDataType; + nsCOMPtr cacheInfoChannel = + mInternalResponse->TakeCacheInfoChannel().get(); + if (cacheInfoChannel) { + cacheInfoChannel->GetAlternativeDataType(altDataType); + } + + nsCOMPtr body; + if (preferredAltDataType.Equals(altDataType)) { + body = mInternalResponse->TakeAlternativeBody(); + } + if (!body) { + mInternalResponse->GetUnfilteredBody(getter_AddRefs(body)); + } else { + Telemetry::ScalarAdd(Telemetry::ScalarID::SW_ALTERNATIVE_BODY_USED_COUNT, + 1); + } + + RefPtr copyHandle; + copyHandle = new BodyCopyHandle(std::move(mClosure)); + + rv = mChannel->StartSynthesizedResponse(body, copyHandle, cacheInfoChannel, + mResponseURLSpec, + mInternalResponse->IsRedirected()); + if (NS_WARN_IF(NS_FAILED(rv))) { + mChannel->CancelInterception(NS_ERROR_INTERCEPTION_FAILED); + return NS_OK; + } + + nsCOMPtr obsService = services::GetObserverService(); + if (obsService) { + obsService->NotifyObservers( + underlyingChannel, "service-worker-synthesized-response", nullptr); + } + + return rv; + } + + bool CSPPermitsResponse(nsILoadInfo* aLoadInfo) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aLoadInfo); + nsresult rv; + nsCOMPtr uri; + nsCString url = mInternalResponse->GetUnfilteredURL(); + if (url.IsEmpty()) { + // Synthetic response. The buck stops at the worker script. + url = mScriptSpec; + } + rv = NS_NewURI(getter_AddRefs(uri), url); + NS_ENSURE_SUCCESS(rv, false); + int16_t decision = nsIContentPolicy::ACCEPT; + rv = NS_CheckContentLoadPolicy(uri, aLoadInfo, ""_ns, &decision); + NS_ENSURE_SUCCESS(rv, false); + return decision == nsIContentPolicy::ACCEPT; + } +}; + +class RespondWithHandler final : public PromiseNativeHandler { + nsMainThreadPtrHandle mInterceptedChannel; + nsMainThreadPtrHandle mRegistration; + const RequestMode mRequestMode; + const RequestRedirect mRequestRedirectMode; +#ifdef DEBUG + const bool mIsClientRequest; +#endif + const nsCString mScriptSpec; + const nsString mRequestURL; + const nsCString mRequestFragment; + const nsCString mRespondWithScriptSpec; + const uint32_t mRespondWithLineNumber; + const uint32_t mRespondWithColumnNumber; + bool mRequestWasHandled; + + public: + NS_DECL_ISUPPORTS + + RespondWithHandler( + nsMainThreadPtrHandle& aChannel, + nsMainThreadPtrHandle& aRegistration, + RequestMode aRequestMode, bool aIsClientRequest, + RequestRedirect aRedirectMode, const nsACString& aScriptSpec, + const nsAString& aRequestURL, const nsACString& aRequestFragment, + const nsACString& aRespondWithScriptSpec, uint32_t aRespondWithLineNumber, + uint32_t aRespondWithColumnNumber) + : mInterceptedChannel(aChannel), + mRegistration(aRegistration), + mRequestMode(aRequestMode), + mRequestRedirectMode(aRedirectMode) +#ifdef DEBUG + , + mIsClientRequest(aIsClientRequest) +#endif + , + mScriptSpec(aScriptSpec), + mRequestURL(aRequestURL), + mRequestFragment(aRequestFragment), + mRespondWithScriptSpec(aRespondWithScriptSpec), + mRespondWithLineNumber(aRespondWithLineNumber), + mRespondWithColumnNumber(aRespondWithColumnNumber), + mRequestWasHandled(false) { + } + + void ResolvedCallback(JSContext* aCx, JS::Handle aValue) override; + + void RejectedCallback(JSContext* aCx, JS::Handle aValue) override; + + void CancelRequest(nsresult aStatus); + + void AsyncLog(const nsACString& aMessageName, + const nsTArray& aParams) { + ::AsyncLog(mInterceptedChannel, mRespondWithScriptSpec, + mRespondWithLineNumber, mRespondWithColumnNumber, aMessageName, + aParams); + } + + void AsyncLog(const nsACString& aSourceSpec, uint32_t aLine, uint32_t aColumn, + const nsACString& aMessageName, + const nsTArray& aParams) { + ::AsyncLog(mInterceptedChannel, aSourceSpec, aLine, aColumn, aMessageName, + aParams); + } + + private: + ~RespondWithHandler() { + if (!mRequestWasHandled) { + ::AsyncLog(mInterceptedChannel, mRespondWithScriptSpec, + mRespondWithLineNumber, mRespondWithColumnNumber, + "InterceptionFailedWithURL"_ns, mRequestURL); + CancelRequest(NS_ERROR_INTERCEPTION_FAILED); + } + } +}; + +class MOZ_STACK_CLASS AutoCancel { + RefPtr mOwner; + nsCString mSourceSpec; + uint32_t mLine; + uint32_t mColumn; + nsCString mMessageName; + nsTArray mParams; + + public: + AutoCancel(RespondWithHandler* aOwner, const nsString& aRequestURL) + : mOwner(aOwner), + mLine(0), + mColumn(0), + mMessageName("InterceptionFailedWithURL"_ns) { + mParams.AppendElement(aRequestURL); + } + + ~AutoCancel() { + if (mOwner) { + if (mSourceSpec.IsEmpty()) { + mOwner->AsyncLog(mMessageName, mParams); + } else { + mOwner->AsyncLog(mSourceSpec, mLine, mColumn, mMessageName, mParams); + } + mOwner->CancelRequest(NS_ERROR_INTERCEPTION_FAILED); + } + } + + // This function steals the error message from a ErrorResult. + void SetCancelErrorResult(JSContext* aCx, ErrorResult& aRv) { + MOZ_DIAGNOSTIC_ASSERT(aRv.Failed()); + MOZ_DIAGNOSTIC_ASSERT(!JS_IsExceptionPending(aCx)); + + // Storing the error as exception in the JSContext. + if (!aRv.MaybeSetPendingException(aCx)) { + return; + } + + MOZ_ASSERT(!aRv.Failed()); + + // Let's take the pending exception. + JS::ExceptionStack exnStack(aCx); + if (!JS::StealPendingExceptionStack(aCx, &exnStack)) { + return; + } + + // Converting the exception in a JS::ErrorReportBuilder. + JS::ErrorReportBuilder report(aCx); + if (!report.init(aCx, exnStack, JS::ErrorReportBuilder::WithSideEffects)) { + JS_ClearPendingException(aCx); + return; + } + + MOZ_ASSERT(mOwner); + MOZ_ASSERT(mMessageName.EqualsLiteral("InterceptionFailedWithURL")); + MOZ_ASSERT(mParams.Length() == 1); + + // Let's store the error message here. + mMessageName.Assign(report.toStringResult().c_str()); + mParams.Clear(); + } + + template + void SetCancelMessage(const nsACString& aMessageName, Params&&... aParams) { + MOZ_ASSERT(mOwner); + MOZ_ASSERT(mMessageName.EqualsLiteral("InterceptionFailedWithURL")); + MOZ_ASSERT(mParams.Length() == 1); + mMessageName = aMessageName; + mParams.Clear(); + StringArrayAppender::Append(mParams, sizeof...(Params), + std::forward(aParams)...); + } + + template + void SetCancelMessageAndLocation(const nsACString& aSourceSpec, + uint32_t aLine, uint32_t aColumn, + const nsACString& aMessageName, + Params&&... aParams) { + MOZ_ASSERT(mOwner); + MOZ_ASSERT(mMessageName.EqualsLiteral("InterceptionFailedWithURL")); + MOZ_ASSERT(mParams.Length() == 1); + + mSourceSpec = aSourceSpec; + mLine = aLine; + mColumn = aColumn; + + mMessageName = aMessageName; + mParams.Clear(); + StringArrayAppender::Append(mParams, sizeof...(Params), + std::forward(aParams)...); + } + + void Reset() { mOwner = nullptr; } +}; + +NS_IMPL_ISUPPORTS0(RespondWithHandler) + +void RespondWithHandler::ResolvedCallback(JSContext* aCx, + JS::Handle aValue) { + AutoCancel autoCancel(this, mRequestURL); + mInterceptedChannel->SetFinishResponseStart(TimeStamp::Now()); + + if (!aValue.isObject()) { + NS_WARNING( + "FetchEvent::RespondWith was passed a promise resolved to a non-Object " + "value"); + + nsCString sourceSpec; + uint32_t line = 0; + uint32_t column = 0; + nsString valueString; + nsContentUtils::ExtractErrorValues(aCx, aValue, sourceSpec, &line, &column, + valueString); + + autoCancel.SetCancelMessageAndLocation(sourceSpec, line, column, + "InterceptedNonResponseWithURL"_ns, + mRequestURL, valueString); + return; + } + + RefPtr response; + nsresult rv = UNWRAP_OBJECT(Response, &aValue.toObject(), response); + if (NS_FAILED(rv)) { + nsCString sourceSpec; + uint32_t line = 0; + uint32_t column = 0; + nsString valueString; + nsContentUtils::ExtractErrorValues(aCx, aValue, sourceSpec, &line, &column, + valueString); + + autoCancel.SetCancelMessageAndLocation(sourceSpec, line, column, + "InterceptedNonResponseWithURL"_ns, + mRequestURL, valueString); + return; + } + + WorkerPrivate* worker = GetCurrentThreadWorkerPrivate(); + MOZ_ASSERT(worker); + worker->AssertIsOnWorkerThread(); + + // Section "HTTP Fetch", step 3.3: + // If one of the following conditions is true, return a network error: + // * response's type is "error". + // * request's mode is not "no-cors" and response's type is "opaque". + // * request's redirect mode is not "manual" and response's type is + // "opaqueredirect". + // * request's redirect mode is not "follow" and response's url list + // has more than one item. + + if (response->Type() == ResponseType::Error) { + autoCancel.SetCancelMessage("InterceptedErrorResponseWithURL"_ns, + mRequestURL); + return; + } + + MOZ_ASSERT_IF(mIsClientRequest, mRequestMode == RequestMode::Same_origin || + mRequestMode == RequestMode::Navigate); + + if (response->Type() == ResponseType::Opaque && + mRequestMode != RequestMode::No_cors) { + NS_ConvertASCIItoUTF16 modeString( + RequestModeValues::GetString(mRequestMode)); + + autoCancel.SetCancelMessage("BadOpaqueInterceptionRequestModeWithURL"_ns, + mRequestURL, modeString); + return; + } + + if (mRequestRedirectMode != RequestRedirect::Manual && + response->Type() == ResponseType::Opaqueredirect) { + autoCancel.SetCancelMessage("BadOpaqueRedirectInterceptionWithURL"_ns, + mRequestURL); + return; + } + + if (mRequestRedirectMode != RequestRedirect::Follow && + response->Redirected()) { + autoCancel.SetCancelMessage("BadRedirectModeInterceptionWithURL"_ns, + mRequestURL); + return; + } + + { + ErrorResult error; + bool bodyUsed = response->GetBodyUsed(error); + error.WouldReportJSException(); + if (NS_WARN_IF(error.Failed())) { + autoCancel.SetCancelErrorResult(aCx, error); + return; + } + if (NS_WARN_IF(bodyUsed)) { + autoCancel.SetCancelMessage("InterceptedUsedResponseWithURL"_ns, + mRequestURL); + return; + } + } + + RefPtr ir = response->GetInternalResponse(); + if (NS_WARN_IF(!ir)) { + return; + } + + // An extra safety check to make sure our invariant that opaque and cors + // responses always have a URL does not break. + if (NS_WARN_IF((response->Type() == ResponseType::Opaque || + response->Type() == ResponseType::Cors) && + ir->GetUnfilteredURL().IsEmpty())) { + MOZ_DIAGNOSTIC_ASSERT(false, "Cors or opaque Response without a URL"); + return; + } + + Telemetry::ScalarAdd(Telemetry::ScalarID::SW_SYNTHESIZED_RES_COUNT, 1); + + if (mRequestMode == RequestMode::Same_origin && + response->Type() == ResponseType::Cors) { + Telemetry::ScalarAdd(Telemetry::ScalarID::SW_CORS_RES_FOR_SO_REQ_COUNT, 1); + + // XXXtt: Will have a pref to enable the quirk response in bug 1419684. + // The variadic template provided by StringArrayAppender requires exactly + // an nsString. + NS_ConvertUTF8toUTF16 responseURL(ir->GetUnfilteredURL()); + autoCancel.SetCancelMessage("CorsResponseForSameOriginRequest"_ns, + mRequestURL, responseURL); + return; + } + + // Propagate the URL to the content if the request mode is not "navigate". + // Note that, we only reflect the final URL if the response.redirected is + // false. We propagate all the URLs if the response.redirected is true. + nsCString responseURL; + if (mRequestMode != RequestMode::Navigate) { + responseURL = ir->GetUnfilteredURL(); + + // Similar to how we apply the request fragment to redirects automatically + // we also want to apply it automatically when propagating the response + // URL from a service worker interception. Currently response.url strips + // the fragment, so this will never conflict with an existing fragment + // on the response. In the future we will have to check for a response + // fragment and avoid overriding in that case. + if (!mRequestFragment.IsEmpty() && !responseURL.IsEmpty()) { + MOZ_ASSERT(!responseURL.Contains('#')); + responseURL.Append("#"_ns); + responseURL.Append(mRequestFragment); + } + } + + UniquePtr closure(new RespondWithClosure( + mInterceptedChannel, mRegistration, mRequestURL, mRespondWithScriptSpec, + mRespondWithLineNumber, mRespondWithColumnNumber)); + + nsCOMPtr startRunnable = + new StartResponse(mInterceptedChannel, ir, worker->GetChannelInfo(), + mScriptSpec, responseURL, std::move(closure)); + + nsCOMPtr body; + ir->GetUnfilteredBody(getter_AddRefs(body)); + // Errors and redirects may not have a body. + if (body) { + ErrorResult error; + response->SetBodyUsed(aCx, error); + error.WouldReportJSException(); + if (NS_WARN_IF(error.Failed())) { + autoCancel.SetCancelErrorResult(aCx, error); + return; + } + } + + MOZ_ALWAYS_SUCCEEDS(worker->DispatchToMainThread(startRunnable.forget())); + + MOZ_ASSERT(!closure); + autoCancel.Reset(); + mRequestWasHandled = true; +} + +void RespondWithHandler::RejectedCallback(JSContext* aCx, + JS::Handle aValue) { + nsCString sourceSpec = mRespondWithScriptSpec; + uint32_t line = mRespondWithLineNumber; + uint32_t column = mRespondWithColumnNumber; + nsString valueString; + + mInterceptedChannel->SetFinishResponseStart(TimeStamp::Now()); + + nsContentUtils::ExtractErrorValues(aCx, aValue, sourceSpec, &line, &column, + valueString); + + ::AsyncLog(mInterceptedChannel, sourceSpec, line, column, + "InterceptionRejectedResponseWithURL"_ns, mRequestURL, + valueString); + + CancelRequest(NS_ERROR_INTERCEPTION_FAILED); +} + +void RespondWithHandler::CancelRequest(nsresult aStatus) { + nsCOMPtr runnable = + new CancelChannelRunnable(mInterceptedChannel, mRegistration, aStatus); + // Note, this may run off the worker thread during worker termination. + WorkerPrivate* worker = GetCurrentThreadWorkerPrivate(); + if (worker) { + MOZ_ALWAYS_SUCCEEDS(worker->DispatchToMainThread(runnable.forget())); + } else { + MOZ_ALWAYS_SUCCEEDS(NS_DispatchToMainThread(runnable.forget())); + } + mRequestWasHandled = true; +} + +} // namespace + +void FetchEvent::RespondWith(JSContext* aCx, Promise& aArg, ErrorResult& aRv) { + if (!GetDispatchFlag() || mWaitToRespond) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return; + } + + // Record where respondWith() was called in the script so we can include the + // information in any error reporting. We should be guaranteed not to get + // a file:// string here because service workers require http/https. + nsCString spec; + uint32_t line = 0; + uint32_t column = 0; + nsJSUtils::GetCallingLocation(aCx, spec, &line, &column); + + SafeRefPtr ir = mRequest->GetInternalRequest(); + + nsAutoCString requestURL; + ir->GetURL(requestURL); + + StopImmediatePropagation(); + mWaitToRespond = true; + + if (mChannel) { + RefPtr handler = new RespondWithHandler( + mChannel, mRegistration, mRequest->Mode(), ir->IsClientRequest(), + mRequest->Redirect(), mScriptSpec, NS_ConvertUTF8toUTF16(requestURL), + ir->GetFragment(), spec, line, column); + + aArg.AppendNativeHandler(handler); + } else { + MOZ_ASSERT(mRespondWithHandler); + + mRespondWithHandler->RespondWithCalledAt(spec, line, column); + aArg.AppendNativeHandler(mRespondWithHandler); + mRespondWithHandler = nullptr; + } + + if (!WaitOnPromise(aArg)) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + } +} + +void FetchEvent::PreventDefault(JSContext* aCx, CallerType aCallerType) { + MOZ_ASSERT(aCx); + MOZ_ASSERT(aCallerType != CallerType::System, + "Since when do we support system-principal service workers?"); + + if (mPreventDefaultScriptSpec.IsEmpty()) { + // Note when the FetchEvent might have been canceled by script, but don't + // actually log the location until we are sure it matters. This is + // determined in ServiceWorkerPrivate.cpp. We only remember the first + // call to preventDefault() as its the most likely to have actually canceled + // the event. + nsJSUtils::GetCallingLocation(aCx, mPreventDefaultScriptSpec, + &mPreventDefaultLineNumber, + &mPreventDefaultColumnNumber); + } + + Event::PreventDefault(aCx, aCallerType); +} + +void FetchEvent::ReportCanceled() { + MOZ_ASSERT(!mPreventDefaultScriptSpec.IsEmpty()); + + SafeRefPtr ir = mRequest->GetInternalRequest(); + nsAutoCString url; + ir->GetURL(url); + + // The variadic template provided by StringArrayAppender requires exactly + // an nsString. + NS_ConvertUTF8toUTF16 requestURL(url); + // nsString requestURL; + // CopyUTF8toUTF16(url, requestURL); + + if (mChannel) { + ::AsyncLog(mChannel.get(), mPreventDefaultScriptSpec, + mPreventDefaultLineNumber, mPreventDefaultColumnNumber, + "InterceptionCanceledWithURL"_ns, requestURL); + } else { + mRespondWithHandler->ReportCanceled(mPreventDefaultScriptSpec, + mPreventDefaultLineNumber, + mPreventDefaultColumnNumber); + mRespondWithHandler = nullptr; + } +} + +namespace { + +class WaitUntilHandler final : public PromiseNativeHandler { + WorkerPrivate* mWorkerPrivate; + const nsCString mScope; + nsString mSourceSpec; + uint32_t mLine; + uint32_t mColumn; + nsString mRejectValue; + + ~WaitUntilHandler() = default; + + public: + NS_DECL_THREADSAFE_ISUPPORTS + + WaitUntilHandler(WorkerPrivate* aWorkerPrivate, JSContext* aCx) + : mWorkerPrivate(aWorkerPrivate), + mScope(mWorkerPrivate->ServiceWorkerScope()), + mLine(0), + mColumn(0) { + mWorkerPrivate->AssertIsOnWorkerThread(); + + // Save the location of the waitUntil() call itself as a fallback + // in case the rejection value does not contain any location info. + nsJSUtils::GetCallingLocation(aCx, mSourceSpec, &mLine, &mColumn); + } + + void ResolvedCallback(JSContext* aCx, JS::Handle aValue) override { + // do nothing, we are only here to report errors + } + + void RejectedCallback(JSContext* aCx, JS::Handle aValue) override { + mWorkerPrivate->AssertIsOnWorkerThread(); + + nsString spec; + uint32_t line = 0; + uint32_t column = 0; + nsContentUtils::ExtractErrorValues(aCx, aValue, spec, &line, &column, + mRejectValue); + + // only use the extracted location if we found one + if (!spec.IsEmpty()) { + mSourceSpec = spec; + mLine = line; + mColumn = column; + } + + MOZ_ALWAYS_SUCCEEDS(mWorkerPrivate->DispatchToMainThread( + NewRunnableMethod("WaitUntilHandler::ReportOnMainThread", this, + &WaitUntilHandler::ReportOnMainThread))); + } + + void ReportOnMainThread() { + MOZ_ASSERT(NS_IsMainThread()); + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (!swm) { + // browser shutdown + return; + } + + // TODO: Make the error message a localized string. (bug 1222720) + nsString message; + message.AppendLiteral( + "Service worker event waitUntil() was passed a " + "promise that rejected with '"); + message.Append(mRejectValue); + message.AppendLiteral("'."); + + // Note, there is a corner case where this won't report to the window + // that triggered the error. Consider a navigation fetch event that + // rejects waitUntil() without holding respondWith() open. In this case + // there is no controlling document yet, the window did call .register() + // because there is no documeny yet, and the navigation is no longer + // being intercepted. + + swm->ReportToAllClients(mScope, message, mSourceSpec, u""_ns, mLine, + mColumn, nsIScriptError::errorFlag); + } +}; + +NS_IMPL_ISUPPORTS0(WaitUntilHandler) + +} // anonymous namespace + +ExtendableEvent::ExtensionsHandler::~ExtensionsHandler() { + MOZ_ASSERT(!mExtendableEvent); +} + +bool ExtendableEvent::ExtensionsHandler::GetDispatchFlag() const { + // mExtendableEvent should set itself as nullptr in its destructor, and we + // can't be dispatching an event that doesn't exist, so this should work for + // as long as it's not needed to determine whether the event is still alive, + // which seems unlikely. + if (!mExtendableEvent) { + return false; + } + + return mExtendableEvent->GetDispatchFlag(); +} + +void ExtendableEvent::ExtensionsHandler::SetExtendableEvent( + const ExtendableEvent* const aExtendableEvent) { + mExtendableEvent = aExtendableEvent; +} + +NS_IMPL_ADDREF_INHERITED(FetchEvent, ExtendableEvent) +NS_IMPL_RELEASE_INHERITED(FetchEvent, ExtendableEvent) + +NS_INTERFACE_MAP_BEGIN_CYCLE_COLLECTION(FetchEvent) +NS_INTERFACE_MAP_END_INHERITING(ExtendableEvent) + +NS_IMPL_CYCLE_COLLECTION_INHERITED(FetchEvent, ExtendableEvent, mRequest) + +ExtendableEvent::ExtendableEvent(EventTarget* aOwner) + : Event(aOwner, nullptr, nullptr) {} + +bool ExtendableEvent::WaitOnPromise(Promise& aPromise) { + if (!mExtensionsHandler) { + return false; + } + return mExtensionsHandler->WaitOnPromise(aPromise); +} + +void ExtendableEvent::SetKeepAliveHandler( + ExtensionsHandler* aExtensionsHandler) { + MOZ_ASSERT(!mExtensionsHandler); + WorkerPrivate* worker = GetCurrentThreadWorkerPrivate(); + MOZ_ASSERT(worker); + worker->AssertIsOnWorkerThread(); + mExtensionsHandler = aExtensionsHandler; + mExtensionsHandler->SetExtendableEvent(this); +} + +void ExtendableEvent::WaitUntil(JSContext* aCx, Promise& aPromise, + ErrorResult& aRv) { + MOZ_ASSERT(!NS_IsMainThread()); + + if (!WaitOnPromise(aPromise)) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return; + } + + // Append our handler to each waitUntil promise separately so we + // can record the location in script where waitUntil was called. + RefPtr handler = + new WaitUntilHandler(GetCurrentThreadWorkerPrivate(), aCx); + aPromise.AppendNativeHandler(handler); +} + +NS_IMPL_ADDREF_INHERITED(ExtendableEvent, Event) +NS_IMPL_RELEASE_INHERITED(ExtendableEvent, Event) + +NS_INTERFACE_MAP_BEGIN_CYCLE_COLLECTION(ExtendableEvent) +NS_INTERFACE_MAP_END_INHERITING(Event) + +namespace { +nsresult ExtractBytesFromUSVString(const nsAString& aStr, + nsTArray& aBytes) { + MOZ_ASSERT(aBytes.IsEmpty()); + auto encoder = UTF_8_ENCODING->NewEncoder(); + CheckedInt needed = + encoder->MaxBufferLengthFromUTF16WithoutReplacement(aStr.Length()); + if (NS_WARN_IF(!needed.isValid() || + !aBytes.SetLength(needed.value(), fallible))) { + return NS_ERROR_OUT_OF_MEMORY; + } + uint32_t result; + size_t read; + size_t written; + Tie(result, read, written) = + encoder->EncodeFromUTF16WithoutReplacement(aStr, aBytes, true); + MOZ_ASSERT(result == kInputEmpty); + MOZ_ASSERT(read == aStr.Length()); + aBytes.TruncateLength(written); + return NS_OK; +} + +nsresult ExtractBytesFromData( + const OwningArrayBufferViewOrArrayBufferOrUSVString& aDataInit, + nsTArray& aBytes) { + if (aDataInit.IsArrayBufferView()) { + const ArrayBufferView& view = aDataInit.GetAsArrayBufferView(); + if (NS_WARN_IF(!PushUtil::CopyArrayBufferViewToArray(view, aBytes))) { + return NS_ERROR_OUT_OF_MEMORY; + } + return NS_OK; + } + if (aDataInit.IsArrayBuffer()) { + const ArrayBuffer& buffer = aDataInit.GetAsArrayBuffer(); + if (NS_WARN_IF(!PushUtil::CopyArrayBufferToArray(buffer, aBytes))) { + return NS_ERROR_OUT_OF_MEMORY; + } + return NS_OK; + } + if (aDataInit.IsUSVString()) { + return ExtractBytesFromUSVString(aDataInit.GetAsUSVString(), aBytes); + } + MOZ_ASSERT_UNREACHABLE("Unexpected push message data"); + return NS_ERROR_FAILURE; +} +} // namespace + +PushMessageData::PushMessageData(nsIGlobalObject* aOwner, + nsTArray&& aBytes) + : mOwner(aOwner), mBytes(std::move(aBytes)) {} + +PushMessageData::~PushMessageData() = default; + +NS_IMPL_CYCLE_COLLECTION_WRAPPERCACHE(PushMessageData, mOwner) + +NS_IMPL_CYCLE_COLLECTING_ADDREF(PushMessageData) +NS_IMPL_CYCLE_COLLECTING_RELEASE(PushMessageData) + +NS_INTERFACE_MAP_BEGIN_CYCLE_COLLECTION(PushMessageData) + NS_WRAPPERCACHE_INTERFACE_MAP_ENTRY + NS_INTERFACE_MAP_ENTRY(nsISupports) +NS_INTERFACE_MAP_END + +JSObject* PushMessageData::WrapObject(JSContext* aCx, + JS::Handle aGivenProto) { + return mozilla::dom::PushMessageData_Binding::Wrap(aCx, this, aGivenProto); +} + +void PushMessageData::Json(JSContext* cx, JS::MutableHandle aRetval, + ErrorResult& aRv) { + if (NS_FAILED(EnsureDecodedText())) { + aRv.Throw(NS_ERROR_DOM_UNKNOWN_ERR); + return; + } + BodyUtil::ConsumeJson(cx, aRetval, mDecodedText, aRv); +} + +void PushMessageData::Text(nsAString& aData) { + if (NS_SUCCEEDED(EnsureDecodedText())) { + aData = mDecodedText; + } +} + +void PushMessageData::ArrayBuffer(JSContext* cx, + JS::MutableHandle aRetval, + ErrorResult& aRv) { + uint8_t* data = GetContentsCopy(); + if (data) { + BodyUtil::ConsumeArrayBuffer(cx, aRetval, mBytes.Length(), data, aRv); + } +} + +already_AddRefed PushMessageData::Blob(ErrorResult& aRv) { + uint8_t* data = GetContentsCopy(); + if (data) { + RefPtr blob = + BodyUtil::ConsumeBlob(mOwner, u""_ns, mBytes.Length(), data, aRv); + if (blob) { + return blob.forget(); + } + } + return nullptr; +} + +nsresult PushMessageData::EnsureDecodedText() { + if (mBytes.IsEmpty() || !mDecodedText.IsEmpty()) { + return NS_OK; + } + nsresult rv = BodyUtil::ConsumeText( + mBytes.Length(), reinterpret_cast(mBytes.Elements()), + mDecodedText); + if (NS_WARN_IF(NS_FAILED(rv))) { + mDecodedText.Truncate(); + return rv; + } + return NS_OK; +} + +uint8_t* PushMessageData::GetContentsCopy() { + uint32_t length = mBytes.Length(); + void* data = malloc(length); + if (!data) { + return nullptr; + } + memcpy(data, mBytes.Elements(), length); + return reinterpret_cast(data); +} + +PushEvent::PushEvent(EventTarget* aOwner) : ExtendableEvent(aOwner) {} + +already_AddRefed PushEvent::Constructor( + mozilla::dom::EventTarget* aOwner, const nsAString& aType, + const PushEventInit& aOptions, ErrorResult& aRv) { + RefPtr e = new PushEvent(aOwner); + bool trusted = e->Init(aOwner); + e->InitEvent(aType, aOptions.mBubbles, aOptions.mCancelable); + e->SetTrusted(trusted); + e->SetComposed(aOptions.mComposed); + if (aOptions.mData.WasPassed()) { + nsTArray bytes; + nsresult rv = ExtractBytesFromData(aOptions.mData.Value(), bytes); + if (NS_FAILED(rv)) { + aRv.Throw(rv); + return nullptr; + } + e->mData = new PushMessageData(aOwner->GetOwnerGlobal(), std::move(bytes)); + } + return e.forget(); +} + +NS_IMPL_ADDREF_INHERITED(PushEvent, ExtendableEvent) +NS_IMPL_RELEASE_INHERITED(PushEvent, ExtendableEvent) + +NS_INTERFACE_MAP_BEGIN_CYCLE_COLLECTION(PushEvent) +NS_INTERFACE_MAP_END_INHERITING(ExtendableEvent) + +NS_IMPL_CYCLE_COLLECTION_INHERITED(PushEvent, ExtendableEvent, mData) + +JSObject* PushEvent::WrapObjectInternal(JSContext* aCx, + JS::Handle aGivenProto) { + return mozilla::dom::PushEvent_Binding::Wrap(aCx, this, aGivenProto); +} + +ExtendableMessageEvent::ExtendableMessageEvent(EventTarget* aOwner) + : ExtendableEvent(aOwner), mData(JS::UndefinedValue()) { + mozilla::HoldJSObjects(this); +} + +ExtendableMessageEvent::~ExtendableMessageEvent() { + mData.setUndefined(); + DropJSObjects(this); +} + +void ExtendableMessageEvent::GetData(JSContext* aCx, + JS::MutableHandle aData, + ErrorResult& aRv) { + aData.set(mData); + if (!JS_WrapValue(aCx, aData)) { + aRv.Throw(NS_ERROR_FAILURE); + } +} + +void ExtendableMessageEvent::GetSource( + Nullable& aValue) const { + if (mClient) { + aValue.SetValue().SetAsClient() = mClient; + } else if (mServiceWorker) { + aValue.SetValue().SetAsServiceWorker() = mServiceWorker; + } else if (mMessagePort) { + aValue.SetValue().SetAsMessagePort() = mMessagePort; + } else { + // nullptr source is possible for manually constructed event + aValue.SetNull(); + } +} + +/* static */ +already_AddRefed ExtendableMessageEvent::Constructor( + const GlobalObject& aGlobal, const nsAString& aType, + const ExtendableMessageEventInit& aOptions) { + nsCOMPtr t = do_QueryInterface(aGlobal.GetAsSupports()); + return Constructor(t, aType, aOptions); +} + +/* static */ +already_AddRefed ExtendableMessageEvent::Constructor( + mozilla::dom::EventTarget* aEventTarget, const nsAString& aType, + const ExtendableMessageEventInit& aOptions) { + RefPtr event = + new ExtendableMessageEvent(aEventTarget); + + event->InitEvent(aType, aOptions.mBubbles, aOptions.mCancelable); + bool trusted = event->Init(aEventTarget); + event->SetTrusted(trusted); + + event->mData = aOptions.mData; + event->mOrigin = aOptions.mOrigin; + event->mLastEventId = aOptions.mLastEventId; + + if (!aOptions.mSource.IsNull()) { + if (aOptions.mSource.Value().IsClient()) { + event->mClient = aOptions.mSource.Value().GetAsClient(); + } else if (aOptions.mSource.Value().IsServiceWorker()) { + event->mServiceWorker = aOptions.mSource.Value().GetAsServiceWorker(); + } else if (aOptions.mSource.Value().IsMessagePort()) { + event->mMessagePort = aOptions.mSource.Value().GetAsMessagePort(); + } + } + + event->mPorts.AppendElements(aOptions.mPorts); + return event.forget(); +} + +void ExtendableMessageEvent::GetPorts(nsTArray>& aPorts) { + aPorts = mPorts.Clone(); +} + +NS_IMPL_CYCLE_COLLECTION_MULTI_ZONE_JSHOLDER_CLASS(ExtendableMessageEvent) + +NS_IMPL_CYCLE_COLLECTION_UNLINK_BEGIN_INHERITED(ExtendableMessageEvent, Event) + tmp->mData.setUndefined(); + NS_IMPL_CYCLE_COLLECTION_UNLINK(mClient) + NS_IMPL_CYCLE_COLLECTION_UNLINK(mServiceWorker) + NS_IMPL_CYCLE_COLLECTION_UNLINK(mMessagePort) + NS_IMPL_CYCLE_COLLECTION_UNLINK(mPorts) +NS_IMPL_CYCLE_COLLECTION_UNLINK_END + +NS_IMPL_CYCLE_COLLECTION_TRAVERSE_BEGIN_INHERITED(ExtendableMessageEvent, Event) + NS_IMPL_CYCLE_COLLECTION_TRAVERSE(mClient) + NS_IMPL_CYCLE_COLLECTION_TRAVERSE(mServiceWorker) + NS_IMPL_CYCLE_COLLECTION_TRAVERSE(mMessagePort) + NS_IMPL_CYCLE_COLLECTION_TRAVERSE(mPorts) +NS_IMPL_CYCLE_COLLECTION_TRAVERSE_END + +NS_IMPL_CYCLE_COLLECTION_TRACE_BEGIN_INHERITED(ExtendableMessageEvent, Event) + NS_IMPL_CYCLE_COLLECTION_TRACE_JS_MEMBER_CALLBACK(mData) +NS_IMPL_CYCLE_COLLECTION_TRACE_END + +NS_INTERFACE_MAP_BEGIN_CYCLE_COLLECTION(ExtendableMessageEvent) +NS_INTERFACE_MAP_END_INHERITING(Event) + +NS_IMPL_ADDREF_INHERITED(ExtendableMessageEvent, Event) +NS_IMPL_RELEASE_INHERITED(ExtendableMessageEvent, Event) + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerEvents.h b/dom/serviceworkers/ServiceWorkerEvents.h new file mode 100644 index 0000000000..3a0fbf5ef3 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerEvents.h @@ -0,0 +1,308 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworkerevents_h__ +#define mozilla_dom_serviceworkerevents_h__ + +#include "mozilla/Attributes.h" +#include "mozilla/dom/Event.h" +#include "mozilla/dom/ExtendableEventBinding.h" +#include "mozilla/dom/ExtendableMessageEventBinding.h" +#include "mozilla/dom/FetchEventBinding.h" +#include "mozilla/dom/File.h" +#include "mozilla/dom/Promise.h" +#include "mozilla/dom/Response.h" +#include "mozilla/dom/WorkerCommon.h" + +#include "nsProxyRelease.h" +#include "nsContentUtils.h" + +class nsIInterceptedChannel; + +namespace mozilla { +namespace dom { + +class Blob; +class Client; +class FetchEventOp; +class MessagePort; +struct PushEventInit; +class Request; +class ResponseOrPromise; +class ServiceWorker; +class ServiceWorkerRegistrationInfo; + +// Defined in ServiceWorker.cpp +bool ServiceWorkerVisible(JSContext* aCx, JSObject* aObj); + +class CancelChannelRunnable final : public Runnable { + nsMainThreadPtrHandle mChannel; + nsMainThreadPtrHandle mRegistration; + const nsresult mStatus; + + public: + CancelChannelRunnable( + nsMainThreadPtrHandle& aChannel, + nsMainThreadPtrHandle& aRegistration, + nsresult aStatus); + + NS_IMETHOD Run() override; +}; + +enum ExtendableEventResult { Rejected = 0, Resolved }; + +class ExtendableEventCallback { + public: + virtual void FinishedWithResult(ExtendableEventResult aResult) = 0; + + NS_INLINE_DECL_PURE_VIRTUAL_REFCOUNTING +}; + +class ExtendableEvent : public Event { + public: + class ExtensionsHandler { + friend class ExtendableEvent; + + public: + virtual bool WaitOnPromise(Promise& aPromise) = 0; + + NS_INLINE_DECL_PURE_VIRTUAL_REFCOUNTING + + protected: + virtual ~ExtensionsHandler(); + + // Also returns false if the owning ExtendableEvent is destroyed. + bool GetDispatchFlag() const; + + private: + // Only the owning ExtendableEvent is allowed to set this data. + void SetExtendableEvent(const ExtendableEvent* const aExtendableEvent); + + MOZ_NON_OWNING_REF const ExtendableEvent* mExtendableEvent = nullptr; + }; + + private: + RefPtr mExtensionsHandler; + + protected: + bool GetDispatchFlag() const { return mEvent->mFlags.mIsBeingDispatched; } + + bool WaitOnPromise(Promise& aPromise); + + explicit ExtendableEvent(mozilla::dom::EventTarget* aOwner); + + ~ExtendableEvent() { + if (mExtensionsHandler) { + mExtensionsHandler->SetExtendableEvent(nullptr); + } + }; + + public: + NS_DECL_ISUPPORTS_INHERITED + + void SetKeepAliveHandler(ExtensionsHandler* aExtensionsHandler); + + virtual JSObject* WrapObjectInternal( + JSContext* aCx, JS::Handle aGivenProto) override { + return mozilla::dom::ExtendableEvent_Binding::Wrap(aCx, this, aGivenProto); + } + + static already_AddRefed Constructor( + mozilla::dom::EventTarget* aOwner, const nsAString& aType, + const EventInit& aOptions) { + RefPtr e = new ExtendableEvent(aOwner); + bool trusted = e->Init(aOwner); + e->InitEvent(aType, aOptions.mBubbles, aOptions.mCancelable); + e->SetTrusted(trusted); + e->SetComposed(aOptions.mComposed); + return e.forget(); + } + + static already_AddRefed Constructor( + const GlobalObject& aGlobal, const nsAString& aType, + const EventInit& aOptions) { + nsCOMPtr target = do_QueryInterface(aGlobal.GetAsSupports()); + return Constructor(target, aType, aOptions); + } + + void WaitUntil(JSContext* aCx, Promise& aPromise, ErrorResult& aRv); + + virtual ExtendableEvent* AsExtendableEvent() override { return this; } +}; + +class FetchEvent final : public ExtendableEvent { + RefPtr mRespondWithHandler; + nsMainThreadPtrHandle mChannel; + nsMainThreadPtrHandle mRegistration; + RefPtr mRequest; + RefPtr mHandled; + nsCString mScriptSpec; + nsCString mPreventDefaultScriptSpec; + nsString mClientId; + nsString mResultingClientId; + uint32_t mPreventDefaultLineNumber; + uint32_t mPreventDefaultColumnNumber; + bool mWaitToRespond; + + protected: + explicit FetchEvent(EventTarget* aOwner); + ~FetchEvent(); + + public: + NS_DECL_ISUPPORTS_INHERITED + NS_DECL_CYCLE_COLLECTION_CLASS_INHERITED(FetchEvent, ExtendableEvent) + + virtual JSObject* WrapObjectInternal( + JSContext* aCx, JS::Handle aGivenProto) override { + return FetchEvent_Binding::Wrap(aCx, this, aGivenProto); + } + + void PostInit( + nsMainThreadPtrHandle& aChannel, + nsMainThreadPtrHandle& aRegistration, + const nsACString& aScriptSpec); + + void PostInit(const nsACString& aScriptSpec, + RefPtr aRespondWithHandler); + + static already_AddRefed Constructor( + const GlobalObject& aGlobal, const nsAString& aType, + const FetchEventInit& aOptions); + + bool WaitToRespond() const { return mWaitToRespond; } + + Request* Request_() const { + MOZ_ASSERT(mRequest); + return mRequest; + } + + void GetClientId(nsAString& aClientId) const { aClientId = mClientId; } + + void GetResultingClientId(nsAString& aResultingClientId) const { + aResultingClientId = mResultingClientId; + } + + Promise* Handled() const { return mHandled; } + + void RespondWith(JSContext* aCx, Promise& aArg, ErrorResult& aRv); + + // Pull in the Event version of PreventDefault so we don't get + // shadowing warnings. + using Event::PreventDefault; + void PreventDefault(JSContext* aCx, CallerType aCallerType) override; + + void ReportCanceled(); +}; + +class PushMessageData final : public nsISupports, public nsWrapperCache { + public: + NS_DECL_CYCLE_COLLECTING_ISUPPORTS + NS_DECL_CYCLE_COLLECTION_SCRIPT_HOLDER_CLASS(PushMessageData) + + virtual JSObject* WrapObject(JSContext* aCx, + JS::Handle aGivenProto) override; + + nsIGlobalObject* GetParentObject() const { return mOwner; } + + void Json(JSContext* cx, JS::MutableHandle aRetval, + ErrorResult& aRv); + void Text(nsAString& aData); + void ArrayBuffer(JSContext* cx, JS::MutableHandle aRetval, + ErrorResult& aRv); + already_AddRefed Blob(ErrorResult& aRv); + + PushMessageData(nsIGlobalObject* aOwner, nsTArray&& aBytes); + + private: + nsCOMPtr mOwner; + nsTArray mBytes; + nsString mDecodedText; + ~PushMessageData(); + + nsresult EnsureDecodedText(); + uint8_t* GetContentsCopy(); +}; + +class PushEvent final : public ExtendableEvent { + RefPtr mData; + + protected: + explicit PushEvent(mozilla::dom::EventTarget* aOwner); + ~PushEvent() = default; + + public: + NS_DECL_ISUPPORTS_INHERITED + NS_DECL_CYCLE_COLLECTION_CLASS_INHERITED(PushEvent, ExtendableEvent) + + virtual JSObject* WrapObjectInternal( + JSContext* aCx, JS::Handle aGivenProto) override; + + static already_AddRefed Constructor( + mozilla::dom::EventTarget* aOwner, const nsAString& aType, + const PushEventInit& aOptions, ErrorResult& aRv); + + static already_AddRefed Constructor(const GlobalObject& aGlobal, + const nsAString& aType, + const PushEventInit& aOptions, + ErrorResult& aRv) { + nsCOMPtr owner = do_QueryInterface(aGlobal.GetAsSupports()); + return Constructor(owner, aType, aOptions, aRv); + } + + PushMessageData* GetData() const { return mData; } +}; + +class ExtendableMessageEvent final : public ExtendableEvent { + JS::Heap mData; + nsString mOrigin; + nsString mLastEventId; + RefPtr mClient; + RefPtr mServiceWorker; + RefPtr mMessagePort; + nsTArray> mPorts; + + protected: + explicit ExtendableMessageEvent(EventTarget* aOwner); + ~ExtendableMessageEvent(); + + public: + NS_DECL_ISUPPORTS_INHERITED + NS_DECL_CYCLE_COLLECTION_SCRIPT_HOLDER_CLASS_INHERITED(ExtendableMessageEvent, + ExtendableEvent) + + virtual JSObject* WrapObjectInternal( + JSContext* aCx, JS::Handle aGivenProto) override { + return mozilla::dom::ExtendableMessageEvent_Binding::Wrap(aCx, this, + aGivenProto); + } + + static already_AddRefed Constructor( + mozilla::dom::EventTarget* aOwner, const nsAString& aType, + const ExtendableMessageEventInit& aOptions); + + static already_AddRefed Constructor( + const GlobalObject& aGlobal, const nsAString& aType, + const ExtendableMessageEventInit& aOptions); + + void GetData(JSContext* aCx, JS::MutableHandle aData, + ErrorResult& aRv); + + void GetSource( + Nullable& aValue) const; + + void GetOrigin(nsAString& aOrigin) const { aOrigin = mOrigin; } + + void GetLastEventId(nsAString& aLastEventId) const { + aLastEventId = mLastEventId; + } + + void GetPorts(nsTArray>& aPorts); +}; + +} // namespace dom +} // namespace mozilla + +#endif /* mozilla_dom_serviceworkerevents_h__ */ diff --git a/dom/serviceworkers/ServiceWorkerIPCUtils.h b/dom/serviceworkers/ServiceWorkerIPCUtils.h new file mode 100644 index 0000000000..bd867f877a --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerIPCUtils.h @@ -0,0 +1,35 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ +#ifndef _mozilla_dom_ServiceWorkerIPCUtils_h +#define _mozilla_dom_ServiceWorkerIPCUtils_h + +#include "ipc/EnumSerializer.h" + +// Undo X11/X.h's definition of None +#undef None + +#include "mozilla/dom/ServiceWorkerBinding.h" +#include "mozilla/dom/ServiceWorkerRegistrationBinding.h" + +namespace IPC { + +template <> +struct ParamTraits + : public ContiguousEnumSerializer< + mozilla::dom::ServiceWorkerState, + mozilla::dom::ServiceWorkerState::Parsed, + mozilla::dom::ServiceWorkerState::EndGuard_> {}; + +template <> +struct ParamTraits + : public ContiguousEnumSerializer< + mozilla::dom::ServiceWorkerUpdateViaCache, + mozilla::dom::ServiceWorkerUpdateViaCache::Imports, + mozilla::dom::ServiceWorkerUpdateViaCache::EndGuard_> {}; + +} // namespace IPC + +#endif // _mozilla_dom_ServiceWorkerIPCUtils_h diff --git a/dom/serviceworkers/ServiceWorkerImpl.cpp b/dom/serviceworkers/ServiceWorkerImpl.cpp new file mode 100644 index 0000000000..b01f3fba5c --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerImpl.cpp @@ -0,0 +1,78 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerImpl.h" + +#include "ServiceWorkerInfo.h" +#include "ServiceWorkerRegistrationInfo.h" + +namespace mozilla { +namespace dom { + +ServiceWorkerImpl::~ServiceWorkerImpl() { MOZ_DIAGNOSTIC_ASSERT(!mOuter); } + +void ServiceWorkerImpl::AddServiceWorker(ServiceWorker* aWorker) { + MOZ_DIAGNOSTIC_ASSERT(!mOuter); + MOZ_DIAGNOSTIC_ASSERT(aWorker); + mOuter = aWorker; +} + +void ServiceWorkerImpl::RemoveServiceWorker(ServiceWorker* aWorker) { + MOZ_DIAGNOSTIC_ASSERT(mOuter); + MOZ_DIAGNOSTIC_ASSERT(mOuter == aWorker); + mOuter = nullptr; +} + +void ServiceWorkerImpl::GetRegistration( + ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) { + // While we could immediate call success with our registration descriptor + // we instead queue a runnable to do this. This ensures that + // GetRegistration() is always async to match how the IPC implementation will + // work. It also ensure that if any events are triggered from providing the + // registration that they are fired from a runnable on the correct global's + // event target. + + if (!mOuter) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + nsIGlobalObject* global = mOuter->GetParentObject(); + if (!global) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + nsCOMPtr r = NS_NewRunnableFunction( + "ServiceWorkerImpl::GetRegistration", + [reg = mReg, successCB = std::move(aSuccessCB)]() mutable { + successCB(reg->Descriptor()); + }); + + nsresult rv = global->EventTargetFor(TaskCategory::Other) + ->Dispatch(r.forget(), NS_DISPATCH_NORMAL); + if (NS_FAILED(rv)) { + aFailureCB(CopyableErrorResult(rv)); + return; + } +} + +void ServiceWorkerImpl::PostMessage(RefPtr&& aData, + const ClientInfo& aClientInfo, + const ClientState& aClientState) { + mInfo->PostMessage(std::move(aData), aClientInfo, aClientState); +} + +ServiceWorkerImpl::ServiceWorkerImpl(ServiceWorkerInfo* aInfo, + ServiceWorkerRegistrationInfo* aReg) + : mInfo(aInfo), mReg(aReg), mOuter(nullptr) { + MOZ_DIAGNOSTIC_ASSERT(mInfo); + MOZ_DIAGNOSTIC_ASSERT(mReg); +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerImpl.h b/dom/serviceworkers/ServiceWorkerImpl.h new file mode 100644 index 0000000000..33458030fb --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerImpl.h @@ -0,0 +1,47 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_ServiceWorkerImpl_h +#define mozilla_dom_ServiceWorkerImpl_h + +#include "ServiceWorker.h" + +namespace mozilla { +namespace dom { + +class ServiceWorkerInfo; +class ServiceWorkerRegistrationInfo; + +class ServiceWorkerImpl final : public ServiceWorker::Inner { + RefPtr mInfo; + RefPtr mReg; + ServiceWorker* mOuter; + + ~ServiceWorkerImpl(); + + // ServiceWorker::Inner interface + void AddServiceWorker(ServiceWorker* aWorker) override; + + void RemoveServiceWorker(ServiceWorker* aWorker) override; + + void GetRegistration(ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) override; + + void PostMessage(RefPtr&& aData, + const ClientInfo& aClientInfo, + const ClientState& aClientState) override; + + public: + ServiceWorkerImpl(ServiceWorkerInfo* aInfo, + ServiceWorkerRegistrationInfo* aReg); + + NS_INLINE_DECL_REFCOUNTING(ServiceWorkerImpl, override); +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_ServiceWorkerImpl_h diff --git a/dom/serviceworkers/ServiceWorkerInfo.cpp b/dom/serviceworkers/ServiceWorkerInfo.cpp new file mode 100644 index 0000000000..4310ebdc4c --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerInfo.cpp @@ -0,0 +1,262 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerInfo.h" + +#include "ServiceWorkerUtils.h" +#include "ServiceWorkerPrivate.h" +#include "ServiceWorkerScriptCache.h" +#include "mozilla/dom/ClientIPCTypes.h" +#include "mozilla/dom/ClientState.h" +#include "mozilla/dom/RemoteWorkerTypes.h" +#include "mozilla/dom/WorkerPrivate.h" + +namespace mozilla { +namespace dom { + +using mozilla::ipc::PrincipalInfo; + +static_assert(nsIServiceWorkerInfo::STATE_PARSED == + static_cast(ServiceWorkerState::Parsed), + "ServiceWorkerState enumeration value should match state values " + "from nsIServiceWorkerInfo."); +static_assert(nsIServiceWorkerInfo::STATE_INSTALLING == + static_cast(ServiceWorkerState::Installing), + "ServiceWorkerState enumeration value should match state values " + "from nsIServiceWorkerInfo."); +static_assert(nsIServiceWorkerInfo::STATE_INSTALLED == + static_cast(ServiceWorkerState::Installed), + "ServiceWorkerState enumeration value should match state values " + "from nsIServiceWorkerInfo."); +static_assert(nsIServiceWorkerInfo::STATE_ACTIVATING == + static_cast(ServiceWorkerState::Activating), + "ServiceWorkerState enumeration value should match state values " + "from nsIServiceWorkerInfo."); +static_assert(nsIServiceWorkerInfo::STATE_ACTIVATED == + static_cast(ServiceWorkerState::Activated), + "ServiceWorkerState enumeration value should match state values " + "from nsIServiceWorkerInfo."); +static_assert(nsIServiceWorkerInfo::STATE_REDUNDANT == + static_cast(ServiceWorkerState::Redundant), + "ServiceWorkerState enumeration value should match state values " + "from nsIServiceWorkerInfo."); +static_assert(nsIServiceWorkerInfo::STATE_UNKNOWN == + ServiceWorkerStateValues::Count, + "ServiceWorkerState enumeration value should match state values " + "from nsIServiceWorkerInfo."); + +NS_IMPL_ISUPPORTS(ServiceWorkerInfo, nsIServiceWorkerInfo) + +NS_IMETHODIMP +ServiceWorkerInfo::GetId(nsAString& aId) { + MOZ_ASSERT(NS_IsMainThread()); + aId = mWorkerPrivateId; + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerInfo::GetScriptSpec(nsAString& aScriptSpec) { + MOZ_ASSERT(NS_IsMainThread()); + CopyUTF8toUTF16(mDescriptor.ScriptURL(), aScriptSpec); + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerInfo::GetCacheName(nsAString& aCacheName) { + MOZ_ASSERT(NS_IsMainThread()); + aCacheName = mCacheName; + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerInfo::GetState(uint16_t* aState) { + MOZ_ASSERT(aState); + MOZ_ASSERT(NS_IsMainThread()); + *aState = static_cast(State()); + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerInfo::GetDebugger(nsIWorkerDebugger** aResult) { + if (NS_WARN_IF(!aResult)) { + return NS_ERROR_FAILURE; + } + + return mServiceWorkerPrivate->GetDebugger(aResult); +} + +NS_IMETHODIMP +ServiceWorkerInfo::GetHandlesFetchEvents(bool* aValue) { + MOZ_ASSERT(aValue); + MOZ_ASSERT(NS_IsMainThread()); + + if (mHandlesFetch == Unknown) { + return NS_ERROR_FAILURE; + } + + *aValue = HandlesFetch(); + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerInfo::GetInstalledTime(PRTime* _retval) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(_retval); + *_retval = mInstalledTime; + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerInfo::GetActivatedTime(PRTime* _retval) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(_retval); + *_retval = mActivatedTime; + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerInfo::GetRedundantTime(PRTime* _retval) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(_retval); + *_retval = mRedundantTime; + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerInfo::AttachDebugger() { + return mServiceWorkerPrivate->AttachDebugger(); +} + +NS_IMETHODIMP +ServiceWorkerInfo::DetachDebugger() { + return mServiceWorkerPrivate->DetachDebugger(); +} + +void ServiceWorkerInfo::UpdateState(ServiceWorkerState aState) { + MOZ_ASSERT(NS_IsMainThread()); +#ifdef DEBUG + // Any state can directly transition to redundant, but everything else is + // ordered. + if (aState != ServiceWorkerState::Redundant) { + MOZ_ASSERT_IF(State() == ServiceWorkerState::EndGuard_, + aState == ServiceWorkerState::Installing); + MOZ_ASSERT_IF(State() == ServiceWorkerState::Installing, + aState == ServiceWorkerState::Installed); + MOZ_ASSERT_IF(State() == ServiceWorkerState::Installed, + aState == ServiceWorkerState::Activating); + MOZ_ASSERT_IF(State() == ServiceWorkerState::Activating, + aState == ServiceWorkerState::Activated); + } + // Activated can only go to redundant. + MOZ_ASSERT_IF(State() == ServiceWorkerState::Activated, + aState == ServiceWorkerState::Redundant); +#endif + // Flush any pending functional events to the worker when it transitions to + // the activated state. + // TODO: Do we care that these events will race with the propagation of the + // state change? + if (State() != aState) { + mServiceWorkerPrivate->UpdateState(aState); + } + mDescriptor.SetState(aState); + if (State() == ServiceWorkerState::Redundant) { + serviceWorkerScriptCache::PurgeCache(mPrincipal, mCacheName); + mServiceWorkerPrivate->NoteDeadServiceWorkerInfo(); + } +} + +ServiceWorkerInfo::ServiceWorkerInfo(nsIPrincipal* aPrincipal, + const nsACString& aScope, + uint64_t aRegistrationId, + uint64_t aRegistrationVersion, + const nsACString& aScriptSpec, + const nsAString& aCacheName, + nsLoadFlags aImportsLoadFlags) + : mPrincipal(aPrincipal), + mDescriptor(GetNextID(), aRegistrationId, aRegistrationVersion, + aPrincipal, aScope, aScriptSpec, ServiceWorkerState::Parsed), + mCacheName(aCacheName), + mWorkerPrivateId(ComputeWorkerPrivateId()), + mImportsLoadFlags(aImportsLoadFlags), + mCreationTime(PR_Now()), + mCreationTimeStamp(TimeStamp::Now()), + mInstalledTime(0), + mActivatedTime(0), + mRedundantTime(0), + mServiceWorkerPrivate(new ServiceWorkerPrivate(this)), + mSkipWaitingFlag(false), + mHandlesFetch(Unknown) { + MOZ_ASSERT_IF(ServiceWorkerParentInterceptEnabled(), + XRE_GetProcessType() == GeckoProcessType_Default); + MOZ_ASSERT(mPrincipal); + // cache origin attributes so we can use them off main thread + mOriginAttributes = mPrincipal->OriginAttributesRef(); + MOZ_ASSERT(!mDescriptor.ScriptURL().IsEmpty()); + MOZ_ASSERT(!mCacheName.IsEmpty()); + MOZ_ASSERT(!mWorkerPrivateId.IsEmpty()); + + // Scripts of a service worker should always be loaded bypass service workers. + // Otherwise, we might not be able to update a service worker correctly, if + // there is a service worker generating the script. + MOZ_DIAGNOSTIC_ASSERT(mImportsLoadFlags & + nsIChannel::LOAD_BYPASS_SERVICE_WORKER); +} + +ServiceWorkerInfo::~ServiceWorkerInfo() { + MOZ_ASSERT(mServiceWorkerPrivate); + mServiceWorkerPrivate->NoteDeadServiceWorkerInfo(); +} + +static uint64_t gServiceWorkerInfoCurrentID = 0; + +uint64_t ServiceWorkerInfo::GetNextID() const { + return ++gServiceWorkerInfoCurrentID; +} + +void ServiceWorkerInfo::PostMessage(RefPtr&& aData, + const ClientInfo& aClientInfo, + const ClientState& aClientState) { + mServiceWorkerPrivate->SendMessageEvent( + std::move(aData), + ClientInfoAndState(aClientInfo.ToIPC(), aClientState.ToIPC())); +} + +void ServiceWorkerInfo::UpdateInstalledTime() { + MOZ_ASSERT(State() == ServiceWorkerState::Installed); + MOZ_ASSERT(mInstalledTime == 0); + + mInstalledTime = + mCreationTime + + static_cast( + (TimeStamp::Now() - mCreationTimeStamp).ToMicroseconds()); +} + +void ServiceWorkerInfo::UpdateActivatedTime() { + MOZ_ASSERT(State() == ServiceWorkerState::Activated); + MOZ_ASSERT(mActivatedTime == 0); + + mActivatedTime = + mCreationTime + + static_cast( + (TimeStamp::Now() - mCreationTimeStamp).ToMicroseconds()); +} + +void ServiceWorkerInfo::UpdateRedundantTime() { + MOZ_ASSERT(State() == ServiceWorkerState::Redundant); + MOZ_ASSERT(mRedundantTime == 0); + + mRedundantTime = + mCreationTime + + static_cast( + (TimeStamp::Now() - mCreationTimeStamp).ToMicroseconds()); +} + +void ServiceWorkerInfo::SetRegistrationVersion(uint64_t aVersion) { + mDescriptor.SetRegistrationVersion(aVersion); +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerInfo.h b/dom/serviceworkers/ServiceWorkerInfo.h new file mode 100644 index 0000000000..9fbf5dc7a9 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerInfo.h @@ -0,0 +1,172 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworkerinfo_h +#define mozilla_dom_serviceworkerinfo_h + +#include "MainThreadUtils.h" +#include "mozilla/dom/ServiceWorkerBinding.h" // For ServiceWorkerState +#include "mozilla/dom/ServiceWorkerDescriptor.h" +#include "mozilla/dom/WorkerCommon.h" +#include "mozilla/OriginAttributes.h" +#include "mozilla/TimeStamp.h" +#include "nsIServiceWorkerManager.h" + +namespace mozilla { +namespace dom { + +class ClientInfoAndState; +class ClientState; +class ServiceWorkerCloneData; +class ServiceWorkerPrivate; + +/* + * Wherever the spec treats a worker instance and a description of said worker + * as the same thing; i.e. "Resolve foo with + * _GetNewestWorker(serviceWorkerRegistration)", we represent the description + * by this class and spawn a ServiceWorker in the right global when required. + */ +class ServiceWorkerInfo final : public nsIServiceWorkerInfo { + private: + nsCOMPtr mPrincipal; + ServiceWorkerDescriptor mDescriptor; + const nsString mCacheName; + OriginAttributes mOriginAttributes; + const nsString mWorkerPrivateId; + + // This LoadFlags is only applied to imported scripts, since the main script + // has already been downloaded when performing the bytecheck. This LoadFlag is + // composed of three parts: + // 1. nsIChannel::LOAD_BYPASS_SERVICE_WORKER + // 2. (Optional) nsIRequest::VALIDATE_ALWAYS + // depends on ServiceWorkerUpdateViaCache of its registration. + // 3. (optional) nsIRequest::LOAD_BYPASS_CACHE + // depends on whether the update timer is expired. + const nsLoadFlags mImportsLoadFlags; + + // Timestamp to track SW's state + PRTime mCreationTime; + TimeStamp mCreationTimeStamp; + + // The time of states are 0, if SW has not reached that state yet. Besides, we + // update each of them after UpdateState() is called in SWRegistrationInfo. + PRTime mInstalledTime; + PRTime mActivatedTime; + PRTime mRedundantTime; + + RefPtr mServiceWorkerPrivate; + bool mSkipWaitingFlag; + + enum { Unknown, Enabled, Disabled } mHandlesFetch; + + ~ServiceWorkerInfo(); + + // Generates a unique id for the service worker, with zero being treated as + // invalid. + uint64_t GetNextID() const; + + public: + NS_DECL_ISUPPORTS + NS_DECL_NSISERVICEWORKERINFO + + void PostMessage(RefPtr&& aData, + const ClientInfo& aClientInfo, + const ClientState& aClientState); + + class ServiceWorkerPrivate* WorkerPrivate() const { + MOZ_ASSERT(mServiceWorkerPrivate); + return mServiceWorkerPrivate; + } + + nsIPrincipal* Principal() const { return mPrincipal; } + + const nsCString& ScriptSpec() const { return mDescriptor.ScriptURL(); } + + const nsCString& Scope() const { return mDescriptor.Scope(); } + + bool SkipWaitingFlag() const { + MOZ_ASSERT(NS_IsMainThread()); + return mSkipWaitingFlag; + } + + void SetSkipWaitingFlag() { + MOZ_ASSERT(NS_IsMainThread()); + mSkipWaitingFlag = true; + } + + ServiceWorkerInfo(nsIPrincipal* aPrincipal, const nsACString& aScope, + uint64_t aRegistrationId, uint64_t aRegistrationVersion, + const nsACString& aScriptSpec, const nsAString& aCacheName, + nsLoadFlags aLoadFlags); + + ServiceWorkerState State() const { return mDescriptor.State(); } + + const OriginAttributes& GetOriginAttributes() const { + return mOriginAttributes; + } + + const nsString& CacheName() const { return mCacheName; } + + nsLoadFlags GetImportsLoadFlags() const { return mImportsLoadFlags; } + + uint64_t ID() const { return mDescriptor.Id(); } + + const ServiceWorkerDescriptor& Descriptor() const { return mDescriptor; } + + void UpdateState(ServiceWorkerState aState); + + // Only used to set initial state when loading from disk! + void SetActivateStateUncheckedWithoutEvent(ServiceWorkerState aState) { + MOZ_ASSERT(NS_IsMainThread()); + mDescriptor.SetState(aState); + } + + void SetHandlesFetch(bool aHandlesFetch) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_DIAGNOSTIC_ASSERT(mHandlesFetch == Unknown); + mHandlesFetch = aHandlesFetch ? Enabled : Disabled; + mDescriptor.SetHandlesFetch(aHandlesFetch); + } + + void SetRegistrationVersion(uint64_t aVersion); + + bool HandlesFetch() const { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_DIAGNOSTIC_ASSERT(mHandlesFetch != Unknown); + return mHandlesFetch != Disabled; + } + + void UpdateInstalledTime(); + + void UpdateActivatedTime(); + + void UpdateRedundantTime(); + + int64_t GetInstalledTime() const { return mInstalledTime; } + + void SetInstalledTime(const int64_t aTime) { + if (aTime == 0) { + return; + } + + mInstalledTime = aTime; + } + + int64_t GetActivatedTime() const { return mActivatedTime; } + + void SetActivatedTime(const int64_t aTime) { + if (aTime == 0) { + return; + } + + mActivatedTime = aTime; + } +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_serviceworkerinfo_h diff --git a/dom/serviceworkers/ServiceWorkerInterceptController.cpp b/dom/serviceworkers/ServiceWorkerInterceptController.cpp new file mode 100644 index 0000000000..d02bcea757 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerInterceptController.cpp @@ -0,0 +1,120 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerInterceptController.h" + +#include "mozilla/BasePrincipal.h" +#include "mozilla/StaticPrefs_dom.h" +#include "mozilla/StorageAccess.h" +#include "nsCOMPtr.h" +#include "nsContentUtils.h" +#include "nsIChannel.h" +#include "ServiceWorkerManager.h" +#include "nsIPrincipal.h" + +namespace mozilla { +namespace dom { + +NS_IMPL_ISUPPORTS(ServiceWorkerInterceptController, + nsINetworkInterceptController) + +NS_IMETHODIMP +ServiceWorkerInterceptController::ShouldPrepareForIntercept( + nsIURI* aURI, nsIChannel* aChannel, bool* aShouldIntercept) { + *aShouldIntercept = false; + + nsCOMPtr loadInfo = aChannel->LoadInfo(); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + + // For subresource requests we base our decision solely on the client's + // controller value. Any settings that would have blocked service worker + // access should have been set before the initial navigation created the + // window. + if (!nsContentUtils::IsNonSubresourceRequest(aChannel)) { + const Maybe& controller = + loadInfo->GetController(); + // For child intercept, only checking the loadInfo controller existence. + if (!ServiceWorkerParentInterceptEnabled()) { + *aShouldIntercept = controller.isSome(); + return NS_OK; + } + + // If the controller doesn't handle fetch events, return false + if (controller.isSome()) { + *aShouldIntercept = controller.ref().HandlesFetch(); + + // The service worker has no fetch event handler, try to schedule a + // soft-update through ServiceWorkerRegistrationInfo. + // Get ServiceWorkerRegistrationInfo by the ServiceWorkerInfo's principal + // and scope + if (!*aShouldIntercept && swm) { + nsCOMPtr principal = + controller.ref().GetPrincipal().unwrap(); + RefPtr registration = + swm->GetRegistration(principal, controller.ref().Scope()); + // Could not get ServiceWorkerRegistration here if unregister is + // executed before getting here. + if (NS_WARN_IF(!registration)) { + return NS_OK; + } + registration->MaybeScheduleTimeCheckAndUpdate(); + } + } else { + *aShouldIntercept = false; + } + return NS_OK; + } + + nsCOMPtr principal = BasePrincipal::CreateContentPrincipal( + aURI, loadInfo->GetOriginAttributes()); + + // First check with the ServiceWorkerManager for a matching service worker. + if (!swm || !swm->IsAvailable(principal, aURI, aChannel)) { + return NS_OK; + } + + // Check if we're in a secure context, unless service worker testing is + // enabled. + if (!nsContentUtils::ComputeIsSecureContext(aChannel) && + !StaticPrefs::dom_serviceWorkers_testing_enabled()) { + return NS_OK; + } + + // Then check to see if we are allowed to control the window. + // It is important to check for the availability of the service worker first + // to avoid showing warnings about the use of third-party cookies in the UI + // unnecessarily when no service worker is being accessed. + if (StorageAllowedForChannel(aChannel) != StorageAccess::eAllow) { + return NS_OK; + } + + *aShouldIntercept = true; + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerInterceptController::ChannelIntercepted( + nsIInterceptedChannel* aChannel) { + // Note, do not cancel the interception here. The caller will try to + // ResetInterception() on error. + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (!swm) { + return NS_ERROR_FAILURE; + } + + ErrorResult error; + swm->DispatchFetchEvent(aChannel, error); + if (NS_WARN_IF(error.Failed())) { + return error.StealNSResult(); + } + + return NS_OK; +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerInterceptController.h b/dom/serviceworkers/ServiceWorkerInterceptController.h new file mode 100644 index 0000000000..43f24dc776 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerInterceptController.h @@ -0,0 +1,27 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworkerinterceptcontroller_h +#define mozilla_dom_serviceworkerinterceptcontroller_h + +#include "nsINetworkInterceptController.h" + +namespace mozilla { +namespace dom { + +class ServiceWorkerInterceptController final + : public nsINetworkInterceptController { + ~ServiceWorkerInterceptController() = default; + + public: + NS_DECL_ISUPPORTS + NS_DECL_NSINETWORKINTERCEPTCONTROLLER +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_serviceworkerinterceptcontroller_h diff --git a/dom/serviceworkers/ServiceWorkerJob.cpp b/dom/serviceworkers/ServiceWorkerJob.cpp new file mode 100644 index 0000000000..7e73d7b7dd --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerJob.cpp @@ -0,0 +1,222 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerJob.h" + +#include "mozilla/dom/WorkerCommon.h" +#include "nsIPrincipal.h" +#include "nsProxyRelease.h" +#include "nsThreadUtils.h" +#include "ServiceWorkerManager.h" + +namespace mozilla { +namespace dom { + +ServiceWorkerJob::Type ServiceWorkerJob::GetType() const { return mType; } + +ServiceWorkerJob::State ServiceWorkerJob::GetState() const { return mState; } + +bool ServiceWorkerJob::Canceled() const { return mCanceled; } + +bool ServiceWorkerJob::ResultCallbacksInvoked() const { + return mResultCallbacksInvoked; +} + +bool ServiceWorkerJob::IsEquivalentTo(ServiceWorkerJob* aJob) const { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aJob); + return mType == aJob->mType && mScope.Equals(aJob->mScope) && + mScriptSpec.Equals(aJob->mScriptSpec) && + mPrincipal->Equals(aJob->mPrincipal); +} + +void ServiceWorkerJob::AppendResultCallback(Callback* aCallback) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_DIAGNOSTIC_ASSERT(mState != State::Finished); + MOZ_DIAGNOSTIC_ASSERT(aCallback); + MOZ_DIAGNOSTIC_ASSERT(mFinalCallback != aCallback); + MOZ_ASSERT(!mResultCallbackList.Contains(aCallback)); + MOZ_DIAGNOSTIC_ASSERT(!mResultCallbacksInvoked); + mResultCallbackList.AppendElement(aCallback); +} + +void ServiceWorkerJob::StealResultCallbacksFrom(ServiceWorkerJob* aJob) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aJob); + MOZ_ASSERT(aJob->mState == State::Initial); + + // Take the callbacks from the other job immediately to avoid the + // any possibility of them existing on both jobs at once. + nsTArray> callbackList = + std::move(aJob->mResultCallbackList); + + for (RefPtr& callback : callbackList) { + // Use AppendResultCallback() so that assertion checking is performed on + // each callback. + AppendResultCallback(callback); + } +} + +void ServiceWorkerJob::Start(Callback* aFinalCallback) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_DIAGNOSTIC_ASSERT(!mCanceled); + + MOZ_DIAGNOSTIC_ASSERT(aFinalCallback); + MOZ_DIAGNOSTIC_ASSERT(!mFinalCallback); + MOZ_ASSERT(!mResultCallbackList.Contains(aFinalCallback)); + mFinalCallback = aFinalCallback; + + MOZ_DIAGNOSTIC_ASSERT(mState == State::Initial); + mState = State::Started; + + nsCOMPtr runnable = NewRunnableMethod( + "ServiceWorkerJob::AsyncExecute", this, &ServiceWorkerJob::AsyncExecute); + + // We may have to wait for the PBackground actor to be initialized + // before proceeding. We should always be able to get a ServiceWorkerManager, + // however, since Start() should not be called during shutdown. + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (!swm) { + // browser shutdown + return; + } + + // Otherwise start asynchronously. We should never run a job synchronously. + MOZ_ALWAYS_TRUE(NS_SUCCEEDED(NS_DispatchToMainThread(runnable.forget()))); +} + +void ServiceWorkerJob::Cancel() { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(!mCanceled); + mCanceled = true; + + if (GetState() != State::Started) { + MOZ_ASSERT(GetState() == State::Initial); + + ErrorResult error(NS_ERROR_DOM_ABORT_ERR); + InvokeResultCallbacks(error); + + // The callbacks might not consume the error, which is fine. + error.SuppressException(); + } +} + +ServiceWorkerJob::ServiceWorkerJob(Type aType, nsIPrincipal* aPrincipal, + const nsACString& aScope, + nsCString aScriptSpec) + : mType(aType), + mPrincipal(aPrincipal), + mScope(aScope), + mScriptSpec(std::move(aScriptSpec)), + mState(State::Initial), + mCanceled(false), + mResultCallbacksInvoked(false) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(mPrincipal); + MOZ_ASSERT(!mScope.IsEmpty()); + + // Empty script URL if and only if this is an unregister job. + MOZ_ASSERT((mType == Type::Unregister) == mScriptSpec.IsEmpty()); +} + +ServiceWorkerJob::~ServiceWorkerJob() { + MOZ_ASSERT(NS_IsMainThread()); + // Jobs must finish or never be started. Destroying an actively running + // job is an error. + MOZ_ASSERT(mState != State::Started); + MOZ_ASSERT_IF(mState == State::Finished, mResultCallbacksInvoked); +} + +void ServiceWorkerJob::InvokeResultCallbacks(ErrorResult& aRv) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_DIAGNOSTIC_ASSERT(mState != State::Finished); + MOZ_DIAGNOSTIC_ASSERT_IF(mState == State::Initial, Canceled()); + + MOZ_DIAGNOSTIC_ASSERT(!mResultCallbacksInvoked); + mResultCallbacksInvoked = true; + + nsTArray> callbackList = std::move(mResultCallbackList); + + for (RefPtr& callback : callbackList) { + // The callback might consume an exception on the ErrorResult, so we need + // to clone in order to maintain the error for the next callback. + ErrorResult rv; + aRv.CloneTo(rv); + + if (GetState() == State::Started) { + callback->JobFinished(this, rv); + } else { + callback->JobDiscarded(rv); + } + + // The callback might not consume the error. + rv.SuppressException(); + } +} + +void ServiceWorkerJob::InvokeResultCallbacks(nsresult aRv) { + ErrorResult converted(aRv); + InvokeResultCallbacks(converted); +} + +void ServiceWorkerJob::Finish(ErrorResult& aRv) { + MOZ_ASSERT(NS_IsMainThread()); + + // Avoid double-completion because it can result on operating on cleaned + // up data. This should not happen, though, so also assert to try to + // narrow down the causes. + MOZ_DIAGNOSTIC_ASSERT(mState == State::Started); + if (mState != State::Started) { + return; + } + + // Ensure that we only surface SecurityErr, TypeErr or InvalidStateErr to + // script. + if (aRv.Failed() && !aRv.ErrorCodeIs(NS_ERROR_DOM_SECURITY_ERR) && + !aRv.ErrorCodeIs(NS_ERROR_INTERNAL_ERRORRESULT_TYPEERROR) && + !aRv.ErrorCodeIs(NS_ERROR_DOM_INVALID_STATE_ERR)) { + // Remove the old error code so we can replace it with a TypeError. + aRv.SuppressException(); + + // Throw the type error with a generic error message. We use a stack + // reference to bypass the normal static analysis for "return right after + // throwing", since it's not the right check here: this ErrorResult came in + // pre-thrown. + ErrorResult& rv = aRv; + rv.ThrowTypeError(mScriptSpec, mScope); + } + + // The final callback may drop the last ref to this object. + RefPtr kungFuDeathGrip = this; + + if (!mResultCallbacksInvoked) { + InvokeResultCallbacks(aRv); + } + + mState = State::Finished; + + MOZ_DIAGNOSTIC_ASSERT(mFinalCallback); + if (mFinalCallback) { + mFinalCallback->JobFinished(this, aRv); + mFinalCallback = nullptr; + } + + // The callback might not consume the error. + aRv.SuppressException(); + + // Async release this object to ensure that our caller methods complete + // as well. + NS_ReleaseOnMainThread("ServiceWorkerJobProxyRunnable", + kungFuDeathGrip.forget(), true /* always proxy */); +} + +void ServiceWorkerJob::Finish(nsresult aRv) { + ErrorResult converted(aRv); + Finish(converted); +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerJob.h b/dom/serviceworkers/ServiceWorkerJob.h new file mode 100644 index 0000000000..70eed04636 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerJob.h @@ -0,0 +1,126 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworkerjob_h +#define mozilla_dom_serviceworkerjob_h + +#include "nsCOMPtr.h" +#include "nsString.h" +#include "nsTArray.h" + +class nsIPrincipal; + +namespace mozilla { + +class ErrorResult; + +namespace dom { + +class ServiceWorkerJob { + public: + // Implement this interface to receive notification when a job completes or + // is discarded. + class Callback { + public: + // Called once when the job completes. If the job is started, then this + // will be called. If a job is never executed due to browser shutdown, + // then this method will never be called. This method is always called + // on the main thread asynchronously after Start() completes. + virtual void JobFinished(ServiceWorkerJob* aJob, ErrorResult& aStatus) = 0; + + // If the job has not started and will never start, then this will be + // called; either JobFinished or JobDiscarded will be called, but not both. + virtual void JobDiscarded(ErrorResult& aStatus) = 0; + + NS_INLINE_DECL_PURE_VIRTUAL_REFCOUNTING + }; + + enum class Type { Register, Update, Unregister }; + + enum class State { Initial, Started, Finished }; + + Type GetType() const; + + State GetState() const; + + // Determine if the job has been canceled. This does not change the + // current State, but indicates that the job should progress to Finished + // as soon as possible. + bool Canceled() const; + + // Determine if the result callbacks have already been called. This is + // equivalent to the spec checked to see if the job promise has settled. + bool ResultCallbacksInvoked() const; + + bool IsEquivalentTo(ServiceWorkerJob* aJob) const; + + // Add a callback that will be invoked when the job's result is available. + // Some job types will invoke this before the job is actually finished. + // If an early callback does not occur, then it will be called automatically + // when Finish() is called. These callbacks will be invoked while the job + // state is Started. + void AppendResultCallback(Callback* aCallback); + + // This takes ownership of any result callbacks associated with the given job + // and then appends them to this job's callback list. + void StealResultCallbacksFrom(ServiceWorkerJob* aJob); + + // Start the job. All work will be performed asynchronously on + // the main thread. The Finish() method must be called exactly + // once after this point. A final callback must be provided. It + // will be invoked after all other callbacks have been processed. + void Start(Callback* aFinalCallback); + + // Set an internal flag indicating that a started job should finish as + // soon as possible. + void Cancel(); + + protected: + ServiceWorkerJob(Type aType, nsIPrincipal* aPrincipal, + const nsACString& aScope, nsCString aScriptSpec); + + virtual ~ServiceWorkerJob(); + + // Invoke the result callbacks immediately. The job must be in the + // Started state or be canceled and in the Initial state. The callbacks are + // cleared after being invoked, so subsequent method calls have no effect. + void InvokeResultCallbacks(ErrorResult& aRv); + + // Convenience method that converts to ErrorResult and calls real method. + void InvokeResultCallbacks(nsresult aRv); + + // Indicate that the job has completed. The must be called exactly + // once after Start() has initiated job execution. It may not be + // called until Start() has returned. + void Finish(ErrorResult& aRv); + + // Convenience method that converts to ErrorResult and calls real method. + void Finish(nsresult aRv); + + // Specific job types should define AsyncExecute to begin their work. + // All errors and successes must result in Finish() being called. + virtual void AsyncExecute() = 0; + + const Type mType; + nsCOMPtr mPrincipal; + const nsCString mScope; + const nsCString mScriptSpec; + + private: + RefPtr mFinalCallback; + nsTArray> mResultCallbackList; + State mState; + bool mCanceled; + bool mResultCallbacksInvoked; + + public: + NS_INLINE_DECL_REFCOUNTING(ServiceWorkerJob) +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_serviceworkerjob_h diff --git a/dom/serviceworkers/ServiceWorkerJobQueue.cpp b/dom/serviceworkers/ServiceWorkerJobQueue.cpp new file mode 100644 index 0000000000..db7b2748a1 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerJobQueue.cpp @@ -0,0 +1,122 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerJobQueue.h" + +#include "nsThreadUtils.h" +#include "ServiceWorkerJob.h" +#include "mozilla/dom/WorkerCommon.h" + +namespace mozilla { +namespace dom { + +class ServiceWorkerJobQueue::Callback final + : public ServiceWorkerJob::Callback { + RefPtr mQueue; + + ~Callback() = default; + + public: + explicit Callback(ServiceWorkerJobQueue* aQueue) : mQueue(aQueue) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(mQueue); + } + + virtual void JobFinished(ServiceWorkerJob* aJob, + ErrorResult& aStatus) override { + MOZ_ASSERT(NS_IsMainThread()); + mQueue->JobFinished(aJob); + } + + virtual void JobDiscarded(ErrorResult&) override { + // no-op; nothing to do. + } + + NS_INLINE_DECL_REFCOUNTING(ServiceWorkerJobQueue::Callback, override) +}; + +ServiceWorkerJobQueue::~ServiceWorkerJobQueue() { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(mJobList.IsEmpty()); +} + +void ServiceWorkerJobQueue::JobFinished(ServiceWorkerJob* aJob) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aJob); + + // XXX There are some corner cases where jobs can double-complete. Until + // we track all these down we do a non-fatal assert in debug builds and + // a runtime check to verify the queue is in the correct state. + NS_ASSERTION(!mJobList.IsEmpty(), + "Job queue should contain the job that just completed."); + NS_ASSERTION(mJobList.SafeElementAt(0, nullptr) == aJob, + "Job queue should contain the job that just completed."); + if (NS_WARN_IF(mJobList.SafeElementAt(0, nullptr) != aJob)) { + return; + } + + mJobList.RemoveElementAt(0); + + if (mJobList.IsEmpty()) { + return; + } + + RunJob(); +} + +void ServiceWorkerJobQueue::RunJob() { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(!mJobList.IsEmpty()); + MOZ_ASSERT(mJobList[0]->GetState() == ServiceWorkerJob::State::Initial); + + RefPtr callback = new Callback(this); + mJobList[0]->Start(callback); +} + +ServiceWorkerJobQueue::ServiceWorkerJobQueue() { + MOZ_ASSERT(NS_IsMainThread()); +} + +void ServiceWorkerJobQueue::ScheduleJob(ServiceWorkerJob* aJob) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aJob); + MOZ_ASSERT(!mJobList.Contains(aJob)); + + if (mJobList.IsEmpty()) { + mJobList.AppendElement(aJob); + RunJob(); + return; + } + + MOZ_ASSERT(mJobList[0]->GetState() == ServiceWorkerJob::State::Started); + + RefPtr& tailJob = mJobList[mJobList.Length() - 1]; + if (!tailJob->ResultCallbacksInvoked() && aJob->IsEquivalentTo(tailJob)) { + tailJob->StealResultCallbacksFrom(aJob); + return; + } + + mJobList.AppendElement(aJob); +} + +void ServiceWorkerJobQueue::CancelAll() { + MOZ_ASSERT(NS_IsMainThread()); + + for (RefPtr& job : mJobList) { + job->Cancel(); + } + + // Remove jobs that are queued but not started since they should never + // run after being canceled. This means throwing away all jobs except + // for the job at the front of the list. + if (!mJobList.IsEmpty()) { + MOZ_ASSERT(mJobList[0]->GetState() == ServiceWorkerJob::State::Started); + mJobList.TruncateLength(1); + } +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerJobQueue.h b/dom/serviceworkers/ServiceWorkerJobQueue.h new file mode 100644 index 0000000000..09be22a091 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerJobQueue.h @@ -0,0 +1,42 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworkerjobqueue_h +#define mozilla_dom_serviceworkerjobqueue_h + +#include "mozilla/RefPtr.h" +#include "nsTArray.h" + +namespace mozilla { +namespace dom { + +class ServiceWorkerJob; + +class ServiceWorkerJobQueue final { + class Callback; + + nsTArray> mJobList; + + ~ServiceWorkerJobQueue(); + + void JobFinished(ServiceWorkerJob* aJob); + + void RunJob(); + + public: + ServiceWorkerJobQueue(); + + void ScheduleJob(ServiceWorkerJob* aJob); + + void CancelAll(); + + NS_INLINE_DECL_REFCOUNTING(ServiceWorkerJobQueue) +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_serviceworkerjobqueue_h diff --git a/dom/serviceworkers/ServiceWorkerManager.cpp b/dom/serviceworkers/ServiceWorkerManager.cpp new file mode 100644 index 0000000000..ab0c6aadc0 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerManager.cpp @@ -0,0 +1,3411 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerManager.h" + +#include + +#include "nsCOMPtr.h" +#include "nsIEffectiveTLDService.h" +#include "nsIHttpChannel.h" +#include "nsIHttpChannelInternal.h" +#include "nsINamed.h" +#include "nsINetworkInterceptController.h" +#include "nsIMutableArray.h" +#include "nsIPrincipal.h" +#include "nsITimer.h" +#include "nsIUploadChannel2.h" +#include "nsServiceManagerUtils.h" +#include "nsDebug.h" +#include "nsIPermissionManager.h" +#include "nsXULAppAPI.h" + +#include "jsapi.h" + +#include "mozilla/BasePrincipal.h" +#include "mozilla/ClearOnShutdown.h" +#include "mozilla/ErrorNames.h" +#include "mozilla/LoadContext.h" +#include "mozilla/Result.h" +#include "mozilla/ResultExtensions.h" +#include "mozilla/Telemetry.h" +#include "mozilla/dom/BindingUtils.h" +#include "mozilla/dom/ClientHandle.h" +#include "mozilla/dom/ClientManager.h" +#include "mozilla/dom/ClientSource.h" +#include "mozilla/dom/ConsoleUtils.h" +#include "mozilla/dom/ContentParent.h" +#include "mozilla/dom/ErrorEvent.h" +#include "mozilla/dom/Headers.h" +#include "mozilla/dom/InternalHeaders.h" +#include "mozilla/dom/Navigator.h" +#include "mozilla/dom/NotificationEvent.h" +#include "mozilla/dom/Promise.h" +#include "mozilla/dom/PromiseNativeHandler.h" +#include "mozilla/dom/Request.h" +#include "mozilla/dom/RootedDictionary.h" +#include "mozilla/dom/TypedArray.h" +#include "mozilla/dom/SharedWorker.h" +#include "mozilla/dom/WorkerPrivate.h" +#include "mozilla/dom/WorkerRunnable.h" +#include "mozilla/dom/WorkerScope.h" +#include "mozilla/extensions/WebExtensionPolicy.h" +#include "mozilla/ipc/BackgroundChild.h" +#include "mozilla/ipc/PBackgroundChild.h" +#include "mozilla/ipc/PBackgroundSharedTypes.h" +#include "mozilla/dom/ScriptLoader.h" +#include "mozilla/PermissionManager.h" +#include "mozilla/ScopeExit.h" +#include "mozilla/StaticPrefs_extensions.h" +#include "mozilla/Unused.h" +#include "mozilla/EnumSet.h" + +#include "nsComponentManagerUtils.h" +#include "nsContentUtils.h" +#include "nsNetUtil.h" +#include "nsProxyRelease.h" +#include "nsQueryObject.h" +#include "nsTArray.h" + +#include "ServiceWorker.h" +#include "ServiceWorkerContainer.h" +#include "ServiceWorkerInfo.h" +#include "ServiceWorkerJobQueue.h" +#include "ServiceWorkerManagerChild.h" +#include "ServiceWorkerPrivate.h" +#include "ServiceWorkerRegisterJob.h" +#include "ServiceWorkerRegistrar.h" +#include "ServiceWorkerRegistration.h" +#include "ServiceWorkerScriptCache.h" +#include "ServiceWorkerShutdownBlocker.h" +#include "ServiceWorkerEvents.h" +#include "ServiceWorkerUnregisterJob.h" +#include "ServiceWorkerUpdateJob.h" +#include "ServiceWorkerUpdaterChild.h" +#include "ServiceWorkerUtils.h" + +#ifdef PostMessage +# undef PostMessage +#endif + +using namespace mozilla; +using namespace mozilla::dom; +using namespace mozilla::ipc; + +namespace mozilla { +namespace dom { + +static_assert( + nsIHttpChannelInternal::CORS_MODE_SAME_ORIGIN == + static_cast(RequestMode::Same_origin), + "RequestMode enumeration value should match Necko CORS mode value."); +static_assert( + nsIHttpChannelInternal::CORS_MODE_NO_CORS == + static_cast(RequestMode::No_cors), + "RequestMode enumeration value should match Necko CORS mode value."); +static_assert( + nsIHttpChannelInternal::CORS_MODE_CORS == + static_cast(RequestMode::Cors), + "RequestMode enumeration value should match Necko CORS mode value."); +static_assert( + nsIHttpChannelInternal::CORS_MODE_NAVIGATE == + static_cast(RequestMode::Navigate), + "RequestMode enumeration value should match Necko CORS mode value."); + +static_assert( + nsIHttpChannelInternal::REDIRECT_MODE_FOLLOW == + static_cast(RequestRedirect::Follow), + "RequestRedirect enumeration value should make Necko Redirect mode value."); +static_assert( + nsIHttpChannelInternal::REDIRECT_MODE_ERROR == + static_cast(RequestRedirect::Error), + "RequestRedirect enumeration value should make Necko Redirect mode value."); +static_assert( + nsIHttpChannelInternal::REDIRECT_MODE_MANUAL == + static_cast(RequestRedirect::Manual), + "RequestRedirect enumeration value should make Necko Redirect mode value."); +static_assert( + 3 == RequestRedirectValues::Count, + "RequestRedirect enumeration value should make Necko Redirect mode value."); + +static_assert( + nsIHttpChannelInternal::FETCH_CACHE_MODE_DEFAULT == + static_cast(RequestCache::Default), + "RequestCache enumeration value should match Necko Cache mode value."); +static_assert( + nsIHttpChannelInternal::FETCH_CACHE_MODE_NO_STORE == + static_cast(RequestCache::No_store), + "RequestCache enumeration value should match Necko Cache mode value."); +static_assert( + nsIHttpChannelInternal::FETCH_CACHE_MODE_RELOAD == + static_cast(RequestCache::Reload), + "RequestCache enumeration value should match Necko Cache mode value."); +static_assert( + nsIHttpChannelInternal::FETCH_CACHE_MODE_NO_CACHE == + static_cast(RequestCache::No_cache), + "RequestCache enumeration value should match Necko Cache mode value."); +static_assert( + nsIHttpChannelInternal::FETCH_CACHE_MODE_FORCE_CACHE == + static_cast(RequestCache::Force_cache), + "RequestCache enumeration value should match Necko Cache mode value."); +static_assert( + nsIHttpChannelInternal::FETCH_CACHE_MODE_ONLY_IF_CACHED == + static_cast(RequestCache::Only_if_cached), + "RequestCache enumeration value should match Necko Cache mode value."); +static_assert( + 6 == RequestCacheValues::Count, + "RequestCache enumeration value should match Necko Cache mode value."); + +static_assert(static_cast(ServiceWorkerUpdateViaCache::Imports) == + nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS, + "nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_*" + " should match ServiceWorkerUpdateViaCache enumeration."); +static_assert(static_cast(ServiceWorkerUpdateViaCache::All) == + nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_ALL, + "nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_*" + " should match ServiceWorkerUpdateViaCache enumeration."); +static_assert(static_cast(ServiceWorkerUpdateViaCache::None) == + nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_NONE, + "nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_*" + " should match ServiceWorkerUpdateViaCache enumeration."); + +static StaticRefPtr gInstance; + +namespace { + +nsresult PopulateRegistrationData( + nsIPrincipal* aPrincipal, + const ServiceWorkerRegistrationInfo* aRegistration, + ServiceWorkerRegistrationData& aData) { + MOZ_ASSERT(aPrincipal); + MOZ_ASSERT(aRegistration); + + if (NS_WARN_IF(!BasePrincipal::Cast(aPrincipal)->IsContentPrincipal())) { + return NS_ERROR_FAILURE; + } + + nsresult rv = PrincipalToPrincipalInfo(aPrincipal, &aData.principal()); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + aData.scope() = aRegistration->Scope(); + + // TODO: When bug 1426401 is implemented we will need to handle more + // than just the active worker here. + RefPtr active = aRegistration->GetActive(); + MOZ_ASSERT(active); + if (NS_WARN_IF(!active)) { + return NS_ERROR_FAILURE; + } + + aData.currentWorkerURL() = active->ScriptSpec(); + aData.cacheName() = active->CacheName(); + aData.currentWorkerHandlesFetch() = active->HandlesFetch(); + + aData.currentWorkerInstalledTime() = active->GetInstalledTime(); + aData.currentWorkerActivatedTime() = active->GetActivatedTime(); + + aData.updateViaCache() = + static_cast(aRegistration->GetUpdateViaCache()); + + aData.lastUpdateTime() = aRegistration->GetLastUpdateTime(); + + MOZ_ASSERT(ServiceWorkerRegistrationDataIsValid(aData)); + + return NS_OK; +} + +class TeardownRunnable final : public Runnable { + public: + explicit TeardownRunnable(ServiceWorkerManagerChild* aActor) + : Runnable("dom::ServiceWorkerManager::TeardownRunnable"), + mActor(aActor) { + MOZ_ASSERT(mActor); + } + + NS_IMETHOD Run() override { + MOZ_ASSERT(mActor); + mActor->SendShutdown(); + return NS_OK; + } + + private: + ~TeardownRunnable() = default; + + RefPtr mActor; +}; + +constexpr char kFinishShutdownTopic[] = "profile-before-change-qm"; + +already_AddRefed GetAsyncShutdownBarrier() { + AssertIsOnMainThread(); + + nsCOMPtr svc = services::GetAsyncShutdownService(); + MOZ_ASSERT(svc); + + nsCOMPtr barrier; + DebugOnly rv = + svc->GetProfileChangeTeardown(getter_AddRefs(barrier)); + MOZ_ASSERT(NS_SUCCEEDED(rv)); + + return barrier.forget(); +} + +Result, nsresult> ScopeToPrincipal( + nsIURI* aScopeURI, const OriginAttributes& aOriginAttributes) { + MOZ_ASSERT(aScopeURI); + + nsCOMPtr principal = + BasePrincipal::CreateContentPrincipal(aScopeURI, aOriginAttributes); + if (NS_WARN_IF(!principal)) { + return Err(NS_ERROR_FAILURE); + } + + return principal; +} + +Result, nsresult> ScopeToPrincipal( + const nsACString& aScope, const OriginAttributes& aOriginAttributes) { + MOZ_ASSERT(nsContentUtils::IsAbsoluteURL(aScope)); + + nsCOMPtr scopeURI; + MOZ_TRY(NS_NewURI(getter_AddRefs(scopeURI), aScope)); + + return ScopeToPrincipal(scopeURI, aOriginAttributes); +} + +} // namespace + +struct ServiceWorkerManager::RegistrationDataPerPrincipal final { + // Implements a container of keys for the "scope to registration map": + // https://w3c.github.io/ServiceWorker/#dfn-scope-to-registration-map + // + // where each key is an absolute URL. + // + // The properties of this map that the spec uses are + // 1) insertion, + // 2) removal, + // 3) iteration of scopes in FIFO order (excluding removed scopes), + // 4) and finding, for a given path, the maximal length scope which is a + // prefix of the path. + // + // Additionally, because this is a container of keys for a map, there + // shouldn't be duplicate scopes. + // + // The current implementation uses a dynamic array as the underlying + // container, which is not optimal for unbounded container sizes (all + // supported operations are in linear time) but may be superior for small + // container sizes. + // + // If this is proven to be too slow, the underlying storage should be replaced + // with a linked list of scopes in combination with an ordered map that maps + // scopes to linked list elements/iterators. This would reduce all of the + // above operations besides iteration (necessarily linear) to logarithmic + // time. + class ScopeContainer final : private nsTArray { + using Base = nsTArray; + + public: + using Base::Contains; + using Base::IsEmpty; + using Base::Length; + + // No using-declaration to avoid importing the non-const overload. + decltype(auto) operator[](Base::index_type aIndex) const { + return Base::operator[](aIndex); + } + + void InsertScope(const nsACString& aScope) { + MOZ_DIAGNOSTIC_ASSERT(nsContentUtils::IsAbsoluteURL(aScope)); + + if (Contains(aScope)) { + return; + } + + AppendElement(aScope); + } + + void RemoveScope(const nsACString& aScope) { + MOZ_ALWAYS_TRUE(RemoveElement(aScope)); + } + + // Implements most of "Match Service Worker Registration": + // https://w3c.github.io/ServiceWorker/#scope-match-algorithm + Maybe MatchScope(const nsACString& aClientUrl) const { + Maybe match; + + for (const nsCString& scope : *this) { + if (StringBeginsWith(aClientUrl, scope)) { + if (!match || scope.Length() > match->Length()) { + match = Some(scope); + } + } + } + + // Step 7.2: + // "Assert: matchingScope’s origin and clientURL’s origin are same + // origin." + MOZ_DIAGNOSTIC_ASSERT_IF(match, IsSameOrigin(*match, aClientUrl)); + + return match; + } + + private: + bool IsSameOrigin(const nsACString& aMatchingScope, + const nsACString& aClientUrl) const { + auto parseResult = ScopeToPrincipal(aMatchingScope, OriginAttributes()); + + if (NS_WARN_IF(parseResult.isErr())) { + return false; + } + + auto scopePrincipal = parseResult.unwrap(); + + parseResult = ScopeToPrincipal(aClientUrl, OriginAttributes()); + + if (NS_WARN_IF(parseResult.isErr())) { + return false; + } + + auto clientPrincipal = parseResult.unwrap(); + + bool equals = false; + + if (NS_WARN_IF( + NS_FAILED(scopePrincipal->Equals(clientPrincipal, &equals)))) { + return false; + } + + return equals; + } + }; + + ScopeContainer mScopeContainer; + + // Scope to registration. + // The scope should be a fully qualified valid URL. + nsRefPtrHashtable mInfos; + + // Maps scopes to job queues. + nsRefPtrHashtable mJobQueues; + + // Map scopes to scheduled update timers. + nsInterfaceHashtable mUpdateTimers; +}; + +////////////////////////// +// ServiceWorkerManager // +////////////////////////// + +NS_IMPL_ADDREF(ServiceWorkerManager) +NS_IMPL_RELEASE(ServiceWorkerManager) + +NS_INTERFACE_MAP_BEGIN(ServiceWorkerManager) + NS_INTERFACE_MAP_ENTRY(nsIServiceWorkerManager) + NS_INTERFACE_MAP_ENTRY(nsIObserver) + NS_INTERFACE_MAP_ENTRY_AMBIGUOUS(nsISupports, nsIServiceWorkerManager) +NS_INTERFACE_MAP_END + +ServiceWorkerManager::ServiceWorkerManager() + : mActor(nullptr), mShuttingDown(false) {} + +ServiceWorkerManager::~ServiceWorkerManager() { + // The map will assert if it is not empty when destroyed. + mRegistrationInfos.Clear(); + + // This can happen if the browser is started up in ProfileManager mode, in + // which case XPCOM will startup and shutdown, but there won't be any + // profile-* topic notifications. The shutdown blocker expects to be in a + // NotAcceptingPromises state when it's destroyed, and this transition + // normally happens in the "profile-change-teardown" notification callback + // (which won't be called in ProfileManager mode). + if (!mShuttingDown && mShutdownBlocker) { + mShutdownBlocker->StopAcceptingPromises(); + } +} + +void ServiceWorkerManager::BlockShutdownOn(GenericNonExclusivePromise* aPromise, + uint32_t aShutdownStateId) { + AssertIsOnMainThread(); + + MOZ_ASSERT(mShutdownBlocker); + MOZ_ASSERT(aPromise); + + mShutdownBlocker->WaitOnPromise(aPromise, aShutdownStateId); +} + +void ServiceWorkerManager::Init(ServiceWorkerRegistrar* aRegistrar) { + // ServiceWorkers now only support parent intercept. In parent intercept + // mode, only the parent process ServiceWorkerManager has any state or does + // anything. + // + // It is our goal to completely eliminate support for content process + // ServiceWorkerManager instances and make getting a SWM instance trigger a + // fatal assertion. But until we've reached that point, we make + // initialization a no-op so that content process ServiceWorkerManager + // instances will simply have no state and no registrations. + if (!XRE_IsParentProcess()) { + return; + } + + nsCOMPtr shutdownBarrier = GetAsyncShutdownBarrier(); + + if (shutdownBarrier) { + mShutdownBlocker = ServiceWorkerShutdownBlocker::CreateAndRegisterOn( + *shutdownBarrier, *this); + MOZ_ASSERT(mShutdownBlocker); + } + + MOZ_DIAGNOSTIC_ASSERT(aRegistrar); + + nsTArray data; + aRegistrar->GetRegistrations(data); + LoadRegistrations(data); + + PBackgroundChild* actorChild = BackgroundChild::GetOrCreateForCurrentThread(); + if (NS_WARN_IF(!actorChild)) { + MaybeStartShutdown(); + return; + } + + PServiceWorkerManagerChild* actor = + actorChild->SendPServiceWorkerManagerConstructor(); + if (!actor) { + MaybeStartShutdown(); + return; + } + + mActor = static_cast(actor); +} + +RefPtr ServiceWorkerManager::StartControllingClient( + const ClientInfo& aClientInfo, + ServiceWorkerRegistrationInfo* aRegistrationInfo, + bool aControlClientHandle) { + MOZ_DIAGNOSTIC_ASSERT(aRegistrationInfo->GetActive()); + + RefPtr promise; + RefPtr self(this); + + const ServiceWorkerDescriptor& active = + aRegistrationInfo->GetActive()->Descriptor(); + + auto entry = mControlledClients.LookupForAdd(aClientInfo.Id()); + if (entry) { + RefPtr old = + std::move(entry.Data()->mRegistrationInfo); + + if (aControlClientHandle) { + promise = entry.Data()->mClientHandle->Control(active); + } else { + promise = GenericErrorResultPromise::CreateAndResolve(false, __func__); + } + + entry.Data()->mRegistrationInfo = aRegistrationInfo; + + if (old != aRegistrationInfo) { + StopControllingRegistration(old); + aRegistrationInfo->StartControllingClient(); + } + + Telemetry::Accumulate(Telemetry::SERVICE_WORKER_CONTROLLED_DOCUMENTS, 1); + + // Always check to see if we failed to actually control the client. In + // that case removed the client from our list of controlled clients. + return promise->Then( + GetMainThreadSerialEventTarget(), __func__, + [](bool) { + // do nothing on success + return GenericErrorResultPromise::CreateAndResolve(true, __func__); + }, + [self, aClientInfo](const CopyableErrorResult& aRv) { + // failed to control, forget about this client + self->StopControllingClient(aClientInfo); + return GenericErrorResultPromise::CreateAndReject(aRv, __func__); + }); + } + + RefPtr clientHandle = ClientManager::CreateHandle( + aClientInfo, GetMainThreadSerialEventTarget()); + + if (aControlClientHandle) { + promise = clientHandle->Control(active); + } else { + promise = GenericErrorResultPromise::CreateAndResolve(false, __func__); + } + + aRegistrationInfo->StartControllingClient(); + + entry.OrInsert([&] { + return new ControlledClientData(clientHandle, aRegistrationInfo); + }); + + clientHandle->OnDetach()->Then( + GetMainThreadSerialEventTarget(), __func__, + [self, aClientInfo] { self->StopControllingClient(aClientInfo); }); + + Telemetry::Accumulate(Telemetry::SERVICE_WORKER_CONTROLLED_DOCUMENTS, 1); + + // Always check to see if we failed to actually control the client. In + // that case removed the client from our list of controlled clients. + return promise->Then( + GetMainThreadSerialEventTarget(), __func__, + [](bool) { + // do nothing on success + return GenericErrorResultPromise::CreateAndResolve(true, __func__); + }, + [self, aClientInfo](const CopyableErrorResult& aRv) { + // failed to control, forget about this client + self->StopControllingClient(aClientInfo); + return GenericErrorResultPromise::CreateAndReject(aRv, __func__); + }); +} + +void ServiceWorkerManager::StopControllingClient( + const ClientInfo& aClientInfo) { + auto entry = mControlledClients.Lookup(aClientInfo.Id()); + if (!entry) { + return; + } + + RefPtr reg = + std::move(entry.Data()->mRegistrationInfo); + + entry.Remove(); + + StopControllingRegistration(reg); +} + +void ServiceWorkerManager::MaybeStartShutdown() { + MOZ_ASSERT(NS_IsMainThread()); + + if (mShuttingDown) { + return; + } + + mShuttingDown = true; + + for (auto& entry : mRegistrationInfos) { + auto& dataPtr = entry.GetData(); + + for (auto& timerEntry : dataPtr->mUpdateTimers) { + timerEntry.GetData()->Cancel(); + } + dataPtr->mUpdateTimers.Clear(); + + for (auto& queueEntry : dataPtr->mJobQueues) { + queueEntry.GetData()->CancelAll(); + } + dataPtr->mJobQueues.Clear(); + + for (auto& registrationEntry : dataPtr->mInfos) { + registrationEntry.GetData()->ShutdownWorkers(); + } + + // ServiceWorkerCleanup may try to unregister registrations, so don't clear + // mInfos. + } + + for (auto& entry : mControlledClients) { + entry.GetData()->mRegistrationInfo->ShutdownWorkers(); + } + + for (auto iter = mOrphanedRegistrations.iter(); !iter.done(); iter.next()) { + iter.get()->ShutdownWorkers(); + } + + if (mShutdownBlocker) { + mShutdownBlocker->StopAcceptingPromises(); + } + + nsCOMPtr obs = mozilla::services::GetObserverService(); + if (obs) { + obs->AddObserver(this, kFinishShutdownTopic, false); + return; + } + + MaybeFinishShutdown(); +} + +void ServiceWorkerManager::MaybeFinishShutdown() { + nsCOMPtr obs = mozilla::services::GetObserverService(); + if (obs) { + obs->RemoveObserver(this, kFinishShutdownTopic); + } + + if (!mActor) { + return; + } + + mActor->ManagerShuttingDown(); + + RefPtr runnable = new TeardownRunnable(mActor); + nsresult rv = NS_DispatchToMainThread(runnable); + Unused << NS_WARN_IF(NS_FAILED(rv)); + mActor = nullptr; +} + +class ServiceWorkerResolveWindowPromiseOnRegisterCallback final + : public ServiceWorkerJob::Callback { + public: + NS_INLINE_DECL_REFCOUNTING( + ServiceWorkerResolveWindowPromiseOnRegisterCallback, override) + + virtual void JobFinished(ServiceWorkerJob* aJob, + ErrorResult& aStatus) override { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aJob); + + if (aStatus.Failed()) { + mPromiseHolder.Reject(CopyableErrorResult(aStatus), __func__); + return; + } + + MOZ_ASSERT(aJob->GetType() == ServiceWorkerJob::Type::Register); + RefPtr registerJob = + static_cast(aJob); + RefPtr reg = registerJob->GetRegistration(); + + mPromiseHolder.Resolve(reg->Descriptor(), __func__); + } + + virtual void JobDiscarded(ErrorResult& aStatus) override { + MOZ_ASSERT(NS_IsMainThread()); + + mPromiseHolder.Reject(CopyableErrorResult(aStatus), __func__); + } + + RefPtr Promise() { + MOZ_ASSERT(NS_IsMainThread()); + return mPromiseHolder.Ensure(__func__); + } + + private: + ~ServiceWorkerResolveWindowPromiseOnRegisterCallback() = default; + + MozPromiseHolder mPromiseHolder; +}; + +namespace { + +class PromiseResolverCallback final : public ServiceWorkerUpdateFinishCallback { + public: + PromiseResolverCallback(ServiceWorkerUpdateFinishCallback* aCallback, + GenericPromise::Private* aPromise) + : mCallback(aCallback), mPromise(aPromise) { + MOZ_DIAGNOSTIC_ASSERT(mPromise); + } + + void UpdateSucceeded(ServiceWorkerRegistrationInfo* aInfo) override { + MOZ_DIAGNOSTIC_ASSERT(mPromise); + + if (mCallback) { + mCallback->UpdateSucceeded(aInfo); + } + + MaybeResolve(); + } + + void UpdateFailed(ErrorResult& aStatus) override { + MOZ_DIAGNOSTIC_ASSERT(mPromise); + + if (mCallback) { + mCallback->UpdateFailed(aStatus); + } + + MaybeResolve(); + } + + private: + ~PromiseResolverCallback() { MaybeResolve(); } + + void MaybeResolve() { + if (mPromise) { + mPromise->Resolve(true, __func__); + mPromise = nullptr; + } + } + + RefPtr mCallback; + RefPtr mPromise; +}; + +// This runnable is used for 2 different tasks: +// - to postpone the SoftUpdate() until the IPC SWM actor is created +// (aInternalMethod == false) +// - to call the 'real' SoftUpdate when the ServiceWorkerUpdaterChild is +// notified by the parent (aInternalMethod == true) +class SoftUpdateRunnable final : public CancelableRunnable { + public: + SoftUpdateRunnable(const OriginAttributes& aOriginAttributes, + const nsACString& aScope, bool aInternalMethod, + GenericPromise::Private* aPromise) + : CancelableRunnable("dom::ServiceWorkerManager::SoftUpdateRunnable"), + mAttrs(aOriginAttributes), + mScope(aScope), + mInternalMethod(aInternalMethod), + mPromise(aPromise) {} + + NS_IMETHOD Run() override { + MOZ_ASSERT(NS_IsMainThread()); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (!swm) { + return NS_ERROR_FAILURE; + } + + if (mInternalMethod) { + RefPtr callback = + new PromiseResolverCallback(nullptr, mPromise); + mPromise = nullptr; + + swm->SoftUpdateInternal(mAttrs, mScope, callback); + } else { + swm->SoftUpdate(mAttrs, mScope); + } + + return NS_OK; + } + + nsresult Cancel() override { + mPromise = nullptr; + return NS_OK; + } + + private: + ~SoftUpdateRunnable() { + if (mPromise) { + mPromise->Resolve(true, __func__); + } + } + + const OriginAttributes mAttrs; + const nsCString mScope; + bool mInternalMethod; + + RefPtr mPromise; +}; + +// This runnable is used for 2 different tasks: +// - to call the 'real' Update when the ServiceWorkerUpdaterChild is +// notified by the parent (aType == eSuccess) +// - an error must be propagated (aType == eFailure) +class UpdateRunnable final : public CancelableRunnable { + public: + enum Type { + eSuccess, + eFailure, + }; + + UpdateRunnable(nsIPrincipal* aPrincipal, const nsACString& aScope, + nsCString aNewestWorkerScriptUrl, + ServiceWorkerUpdateFinishCallback* aCallback, Type aType, + GenericPromise::Private* aPromise) + : CancelableRunnable("dom::ServiceWorkerManager::UpdateRunnable"), + mPrincipal(aPrincipal), + mScope(aScope), + mNewestWorkerScriptUrl(std::move(aNewestWorkerScriptUrl)), + mCallback(aCallback), + mType(aType), + mPromise(aPromise) { + MOZ_ASSERT_IF(mType == eSuccess, !mNewestWorkerScriptUrl.IsEmpty()); + } + + NS_IMETHOD Run() override { + MOZ_ASSERT(NS_IsMainThread()); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (!swm) { + return NS_ERROR_FAILURE; + } + + MOZ_ASSERT(mPromise); + + RefPtr callback = + new PromiseResolverCallback(mCallback, mPromise); + mPromise = nullptr; + + if (mType == eSuccess) { + swm->UpdateInternal(mPrincipal, mScope, std::move(mNewestWorkerScriptUrl), + callback); + return NS_OK; + } + + ErrorResult error(NS_ERROR_DOM_ABORT_ERR); + callback->UpdateFailed(error); + return NS_OK; + } + + nsresult Cancel() override { + mPromise = nullptr; + return NS_OK; + } + + private: + ~UpdateRunnable() { + if (mPromise) { + mPromise->Resolve(true, __func__); + } + } + + nsCOMPtr mPrincipal; + const nsCString mScope; + nsCString mNewestWorkerScriptUrl; + RefPtr mCallback; + Type mType; + + RefPtr mPromise; +}; + +class ResolvePromiseRunnable final : public CancelableRunnable { + public: + explicit ResolvePromiseRunnable(GenericPromise::Private* aPromise) + : CancelableRunnable("dom::ServiceWorkerManager::ResolvePromiseRunnable"), + mPromise(aPromise) {} + + NS_IMETHOD + Run() override { + MaybeResolve(); + return NS_OK; + } + + nsresult Cancel() override { + mPromise = nullptr; + return NS_OK; + } + + private: + ~ResolvePromiseRunnable() { MaybeResolve(); } + + void MaybeResolve() { + if (mPromise) { + mPromise->Resolve(true, __func__); + mPromise = nullptr; + } + } + + RefPtr mPromise; +}; + +} // namespace + +NS_IMETHODIMP +ServiceWorkerManager::RegisterForTest(nsIPrincipal* aPrincipal, + const nsAString& aScopeURL, + const nsAString& aScriptURL, + JSContext* aCx, + mozilla::dom::Promise** aPromise) { + nsIGlobalObject* global = xpc::CurrentNativeGlobal(aCx); + if (NS_WARN_IF(!global)) { + return NS_ERROR_FAILURE; + } + + ErrorResult erv; + RefPtr outer = Promise::Create(global, erv); + if (NS_WARN_IF(erv.Failed())) { + return erv.StealNSResult(); + } + + if (!StaticPrefs::dom_serviceWorkers_testing_enabled()) { + outer->MaybeRejectWithAbortError( + "registerForTest only allowed when dom.serviceWorkers.testing.enabled " + "is true"); + return NS_OK; + } + + if (aPrincipal == nullptr) { + outer->MaybeRejectWithAbortError("Missing principal"); + return NS_OK; + } + + if (aScriptURL.IsEmpty()) { + outer->MaybeRejectWithAbortError("Missing script url"); + return NS_OK; + } + + if (aScopeURL.IsEmpty()) { + outer->MaybeRejectWithAbortError("Missing scope url"); + return NS_OK; + } + + // The ClientType isn't really used here, but ClientType::Window + // is the least bad choice since this is happening on the main thread. + Maybe clientInfo = + dom::ClientManager::CreateInfo(ClientType::Window, aPrincipal); + + if (!clientInfo.isSome()) { + outer->MaybeRejectWithUnknownError("Error creating clientInfo"); + return NS_OK; + } + + auto scope = NS_ConvertUTF16toUTF8(aScopeURL); + auto scriptURL = NS_ConvertUTF16toUTF8(aScriptURL); + + auto regPromise = Register(clientInfo.ref(), scope, scriptURL, + dom::ServiceWorkerUpdateViaCache::Imports); + const RefPtr self(this); + const nsCOMPtr principal(aPrincipal); + regPromise->Then( + GetMainThreadSerialEventTarget(), __func__, + [self, outer, principal, + scope](const ServiceWorkerRegistrationDescriptor& regDesc) { + RefPtr registration = + self->GetRegistration(principal, NS_ConvertUTF16toUTF8(scope)); + if (registration) { + outer->MaybeResolve(registration); + } else { + outer->MaybeRejectWithUnknownError( + "Failed to retrieve ServiceWorkerRegistrationInfo"); + } + }, + [outer](const mozilla::CopyableErrorResult& err) { + CopyableErrorResult result(err); + outer->MaybeReject(std::move(result)); + }); + + outer.forget(aPromise); + + return NS_OK; +} + +RefPtr ServiceWorkerManager::Register( + const ClientInfo& aClientInfo, const nsACString& aScopeURL, + const nsACString& aScriptURL, ServiceWorkerUpdateViaCache aUpdateViaCache) { + nsCOMPtr scopeURI; + nsresult rv = NS_NewURI(getter_AddRefs(scopeURI), aScopeURL); + if (NS_FAILED(rv)) { + // Odd, since it was serialiazed from an nsIURI. + CopyableErrorResult err; + err.ThrowInvalidStateError("Scope URL cannot be parsed"); + return ServiceWorkerRegistrationPromise::CreateAndReject(err, __func__); + } + + nsCOMPtr scriptURI; + rv = NS_NewURI(getter_AddRefs(scriptURI), aScriptURL); + if (NS_FAILED(rv)) { + // Odd, since it was serialiazed from an nsIURI. + CopyableErrorResult err; + err.ThrowInvalidStateError("Script URL cannot be parsed"); + return ServiceWorkerRegistrationPromise::CreateAndReject(err, __func__); + } + + IgnoredErrorResult err; + ServiceWorkerScopeAndScriptAreValid(aClientInfo, scopeURI, scriptURI, err); + if (err.Failed()) { + return ServiceWorkerRegistrationPromise::CreateAndReject( + CopyableErrorResult(std::move(err)), __func__); + } + + // If the previous validation step passed then we must have a principal. + auto principalOrErr = aClientInfo.GetPrincipal(); + + if (NS_WARN_IF(principalOrErr.isErr())) { + return ServiceWorkerRegistrationPromise::CreateAndReject( + CopyableErrorResult(principalOrErr.unwrapErr()), __func__); + } + + nsCOMPtr principal = principalOrErr.unwrap(); + nsAutoCString scopeKey; + rv = PrincipalToScopeKey(principal, scopeKey); + if (NS_WARN_IF(NS_FAILED(rv))) { + return ServiceWorkerRegistrationPromise::CreateAndReject( + CopyableErrorResult(rv), __func__); + } + + RefPtr queue = + GetOrCreateJobQueue(scopeKey, aScopeURL); + + RefPtr cb = + new ServiceWorkerResolveWindowPromiseOnRegisterCallback(); + + RefPtr job = new ServiceWorkerRegisterJob( + principal, aScopeURL, aScriptURL, + static_cast(aUpdateViaCache)); + + job->AppendResultCallback(cb); + queue->ScheduleJob(job); + + MOZ_ASSERT(NS_IsMainThread()); + Telemetry::Accumulate(Telemetry::SERVICE_WORKER_REGISTRATIONS, 1); + + return cb->Promise(); +} + +/* + * Implements the async aspects of the getRegistrations algorithm. + */ +class GetRegistrationsRunnable final : public Runnable { + const ClientInfo mClientInfo; + RefPtr mPromise; + + public: + explicit GetRegistrationsRunnable(const ClientInfo& aClientInfo) + : Runnable("dom::ServiceWorkerManager::GetRegistrationsRunnable"), + mClientInfo(aClientInfo), + mPromise(new ServiceWorkerRegistrationListPromise::Private(__func__)) {} + + RefPtr Promise() const { + return mPromise; + } + + NS_IMETHOD + Run() override { + auto scopeExit = MakeScopeExit( + [&] { mPromise->Reject(NS_ERROR_DOM_INVALID_STATE_ERR, __func__); }); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (!swm) { + return NS_OK; + } + + auto principalOrErr = mClientInfo.GetPrincipal(); + if (NS_WARN_IF(principalOrErr.isErr())) { + return NS_OK; + } + + nsCOMPtr principal = principalOrErr.unwrap(); + + nsTArray array; + + if (NS_WARN_IF(!BasePrincipal::Cast(principal)->IsContentPrincipal())) { + return NS_OK; + } + + nsAutoCString scopeKey; + nsresult rv = swm->PrincipalToScopeKey(principal, scopeKey); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + ServiceWorkerManager::RegistrationDataPerPrincipal* data; + if (!swm->mRegistrationInfos.Get(scopeKey, &data)) { + scopeExit.release(); + mPromise->Resolve(array, __func__); + return NS_OK; + } + + for (uint32_t i = 0; i < data->mScopeContainer.Length(); ++i) { + RefPtr info = + data->mInfos.GetWeak(data->mScopeContainer[i]); + + NS_ConvertUTF8toUTF16 scope(data->mScopeContainer[i]); + + nsCOMPtr scopeURI; + nsresult rv = NS_NewURI(getter_AddRefs(scopeURI), scope); + if (NS_WARN_IF(NS_FAILED(rv))) { + break; + } + + // Unfortunately we don't seem to have an obvious window id here; in + // particular ClientInfo does not have one, and neither do service worker + // registrations, as far as I can tell. + rv = principal->CheckMayLoadWithReporting( + scopeURI, false /* allowIfInheritsPrincipal */, + 0 /* innerWindowID */); + if (NS_WARN_IF(NS_FAILED(rv))) { + continue; + } + + array.AppendElement(info->Descriptor()); + } + + scopeExit.release(); + mPromise->Resolve(array, __func__); + + return NS_OK; + } +}; + +RefPtr +ServiceWorkerManager::GetRegistrations(const ClientInfo& aClientInfo) const { + RefPtr runnable = + new GetRegistrationsRunnable(aClientInfo); + MOZ_ALWAYS_SUCCEEDS(NS_DispatchToCurrentThread(runnable)); + return runnable->Promise(); +} + +/* + * Implements the async aspects of the getRegistration algorithm. + */ +class GetRegistrationRunnable final : public Runnable { + const ClientInfo mClientInfo; + RefPtr mPromise; + nsCString mURL; + + public: + GetRegistrationRunnable(const ClientInfo& aClientInfo, const nsACString& aURL) + : Runnable("dom::ServiceWorkerManager::GetRegistrationRunnable"), + mClientInfo(aClientInfo), + mPromise(new ServiceWorkerRegistrationPromise::Private(__func__)), + mURL(aURL) {} + + RefPtr Promise() const { return mPromise; } + + NS_IMETHOD + Run() override { + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (!swm) { + mPromise->Reject(NS_ERROR_DOM_INVALID_STATE_ERR, __func__); + return NS_OK; + } + + auto principalOrErr = mClientInfo.GetPrincipal(); + if (NS_WARN_IF(principalOrErr.isErr())) { + mPromise->Reject(NS_ERROR_DOM_INVALID_STATE_ERR, __func__); + return NS_OK; + } + + nsCOMPtr principal = principalOrErr.unwrap(); + nsCOMPtr uri; + nsresult rv = NS_NewURI(getter_AddRefs(uri), mURL); + if (NS_WARN_IF(NS_FAILED(rv))) { + mPromise->Reject(rv, __func__); + return NS_OK; + } + + // Unfortunately we don't seem to have an obvious window id here; in + // particular ClientInfo does not have one, and neither do service worker + // registrations, as far as I can tell. + rv = principal->CheckMayLoadWithReporting( + uri, false /* allowIfInheritsPrincipal */, 0 /* innerWindowID */); + if (NS_FAILED(rv)) { + mPromise->Reject(NS_ERROR_DOM_SECURITY_ERR, __func__); + return NS_OK; + } + + RefPtr registration = + swm->GetServiceWorkerRegistrationInfo(principal, uri); + + if (!registration) { + // Reject with NS_OK means "not found". + mPromise->Reject(NS_OK, __func__); + return NS_OK; + } + + mPromise->Resolve(registration->Descriptor(), __func__); + + return NS_OK; + } +}; + +RefPtr ServiceWorkerManager::GetRegistration( + const ClientInfo& aClientInfo, const nsACString& aURL) const { + MOZ_ASSERT(NS_IsMainThread()); + + RefPtr runnable = + new GetRegistrationRunnable(aClientInfo, aURL); + MOZ_ALWAYS_SUCCEEDS(NS_DispatchToCurrentThread(runnable)); + + return runnable->Promise(); +} + +NS_IMETHODIMP +ServiceWorkerManager::SendPushEvent(const nsACString& aOriginAttributes, + const nsACString& aScope, + const nsTArray& aDataBytes, + uint8_t optional_argc) { + if (optional_argc == 1) { + // This does one copy here (while constructing the Maybe) and another when + // we end up copying into the SendPushEventRunnable. We could fix that to + // only do one copy by making things between here and there take + // Maybe>&&, but then we'd need to copy before we know + // whether we really need to in PushMessageDispatcher::NotifyWorkers. Since + // in practice this only affects JS callers that pass data, and we don't + // have any right now, let's not worry about it. + return SendPushEvent(aOriginAttributes, aScope, u""_ns, + Some(aDataBytes.Clone())); + } + MOZ_ASSERT(optional_argc == 0); + return SendPushEvent(aOriginAttributes, aScope, u""_ns, Nothing()); +} + +nsresult ServiceWorkerManager::SendPushEvent( + const nsACString& aOriginAttributes, const nsACString& aScope, + const nsAString& aMessageId, const Maybe>& aData) { + OriginAttributes attrs; + if (!attrs.PopulateFromSuffix(aOriginAttributes)) { + return NS_ERROR_INVALID_ARG; + } + + nsCOMPtr principal; + MOZ_TRY_VAR(principal, ScopeToPrincipal(aScope, attrs)); + + // The registration handling a push notification must have an exact scope + // match. This will try to find an exact match, unlike how fetch may find the + // registration with the longest scope that's a prefix of the fetched URL. + RefPtr registration = + GetRegistration(principal, aScope); + if (NS_WARN_IF(!registration)) { + return NS_ERROR_FAILURE; + } + + MOZ_DIAGNOSTIC_ASSERT(registration->Scope().Equals(aScope)); + + ServiceWorkerInfo* serviceWorker = registration->GetActive(); + if (NS_WARN_IF(!serviceWorker)) { + return NS_ERROR_FAILURE; + } + + return serviceWorker->WorkerPrivate()->SendPushEvent(aMessageId, aData, + registration); +} + +NS_IMETHODIMP +ServiceWorkerManager::SendPushSubscriptionChangeEvent( + const nsACString& aOriginAttributes, const nsACString& aScope) { + OriginAttributes attrs; + if (!attrs.PopulateFromSuffix(aOriginAttributes)) { + return NS_ERROR_INVALID_ARG; + } + + ServiceWorkerInfo* info = GetActiveWorkerInfoForScope(attrs, aScope); + if (!info) { + return NS_ERROR_FAILURE; + } + return info->WorkerPrivate()->SendPushSubscriptionChangeEvent(); +} + +nsresult ServiceWorkerManager::SendNotificationEvent( + const nsAString& aEventName, const nsACString& aOriginSuffix, + const nsACString& aScope, const nsAString& aID, const nsAString& aTitle, + const nsAString& aDir, const nsAString& aLang, const nsAString& aBody, + const nsAString& aTag, const nsAString& aIcon, const nsAString& aData, + const nsAString& aBehavior) { + OriginAttributes attrs; + if (!attrs.PopulateFromSuffix(aOriginSuffix)) { + return NS_ERROR_INVALID_ARG; + } + + ServiceWorkerInfo* info = GetActiveWorkerInfoForScope(attrs, aScope); + if (!info) { + return NS_ERROR_FAILURE; + } + + ServiceWorkerPrivate* workerPrivate = info->WorkerPrivate(); + return workerPrivate->SendNotificationEvent( + aEventName, aID, aTitle, aDir, aLang, aBody, aTag, aIcon, aData, + aBehavior, NS_ConvertUTF8toUTF16(aScope)); +} + +NS_IMETHODIMP +ServiceWorkerManager::SendNotificationClickEvent( + const nsACString& aOriginSuffix, const nsACString& aScope, + const nsAString& aID, const nsAString& aTitle, const nsAString& aDir, + const nsAString& aLang, const nsAString& aBody, const nsAString& aTag, + const nsAString& aIcon, const nsAString& aData, + const nsAString& aBehavior) { + return SendNotificationEvent(nsLiteralString(NOTIFICATION_CLICK_EVENT_NAME), + aOriginSuffix, aScope, aID, aTitle, aDir, aLang, + aBody, aTag, aIcon, aData, aBehavior); +} + +NS_IMETHODIMP +ServiceWorkerManager::SendNotificationCloseEvent( + const nsACString& aOriginSuffix, const nsACString& aScope, + const nsAString& aID, const nsAString& aTitle, const nsAString& aDir, + const nsAString& aLang, const nsAString& aBody, const nsAString& aTag, + const nsAString& aIcon, const nsAString& aData, + const nsAString& aBehavior) { + return SendNotificationEvent(nsLiteralString(NOTIFICATION_CLOSE_EVENT_NAME), + aOriginSuffix, aScope, aID, aTitle, aDir, aLang, + aBody, aTag, aIcon, aData, aBehavior); +} + +RefPtr ServiceWorkerManager::WhenReady( + const ClientInfo& aClientInfo) { + AssertIsOnMainThread(); + + for (auto& prd : mPendingReadyList) { + if (prd->mClientHandle->Info().Id() == aClientInfo.Id() && + prd->mClientHandle->Info().PrincipalInfo() == + aClientInfo.PrincipalInfo()) { + return prd->mPromise; + } + } + + RefPtr reg = + GetServiceWorkerRegistrationInfo(aClientInfo); + if (reg && reg->GetActive()) { + return ServiceWorkerRegistrationPromise::CreateAndResolve(reg->Descriptor(), + __func__); + } + + nsCOMPtr target = GetMainThreadSerialEventTarget(); + + RefPtr handle = + ClientManager::CreateHandle(aClientInfo, target); + mPendingReadyList.AppendElement(MakeUnique(handle)); + + RefPtr self(this); + handle->OnDetach()->Then(target, __func__, + [self = std::move(self), aClientInfo] { + self->RemovePendingReadyPromise(aClientInfo); + }); + + return mPendingReadyList.LastElement()->mPromise; +} + +void ServiceWorkerManager::CheckPendingReadyPromises() { + nsTArray> pendingReadyList = + std::move(mPendingReadyList); + for (uint32_t i = 0; i < pendingReadyList.Length(); ++i) { + UniquePtr prd(std::move(pendingReadyList[i])); + + RefPtr reg = + GetServiceWorkerRegistrationInfo(prd->mClientHandle->Info()); + + if (reg && reg->GetActive()) { + prd->mPromise->Resolve(reg->Descriptor(), __func__); + } else { + mPendingReadyList.AppendElement(std::move(prd)); + } + } +} + +void ServiceWorkerManager::RemovePendingReadyPromise( + const ClientInfo& aClientInfo) { + nsTArray> pendingReadyList = + std::move(mPendingReadyList); + for (uint32_t i = 0; i < pendingReadyList.Length(); ++i) { + UniquePtr prd(std::move(pendingReadyList[i])); + + if (prd->mClientHandle->Info().Id() == aClientInfo.Id() && + prd->mClientHandle->Info().PrincipalInfo() == + aClientInfo.PrincipalInfo()) { + prd->mPromise->Reject(NS_ERROR_DOM_ABORT_ERR, __func__); + } else { + mPendingReadyList.AppendElement(std::move(prd)); + } + } +} + +void ServiceWorkerManager::NoteInheritedController( + const ClientInfo& aClientInfo, const ServiceWorkerDescriptor& aController) { + MOZ_ASSERT(NS_IsMainThread()); + + auto principalOrErr = PrincipalInfoToPrincipal(aController.PrincipalInfo()); + + if (NS_WARN_IF(principalOrErr.isErr())) { + return; + } + + nsCOMPtr principal = principalOrErr.unwrap(); + nsCOMPtr scope; + nsresult rv = NS_NewURI(getter_AddRefs(scope), aController.Scope()); + NS_ENSURE_SUCCESS_VOID(rv); + + RefPtr registration = + GetServiceWorkerRegistrationInfo(principal, scope); + NS_ENSURE_TRUE_VOID(registration); + NS_ENSURE_TRUE_VOID(registration->GetActive()); + + StartControllingClient(aClientInfo, registration, + false /* aControlClientHandle */); +} + +ServiceWorkerInfo* ServiceWorkerManager::GetActiveWorkerInfoForScope( + const OriginAttributes& aOriginAttributes, const nsACString& aScope) { + MOZ_ASSERT(NS_IsMainThread()); + + nsCOMPtr scopeURI; + nsresult rv = NS_NewURI(getter_AddRefs(scopeURI), aScope); + if (NS_FAILED(rv)) { + return nullptr; + } + + auto result = ScopeToPrincipal(scopeURI, aOriginAttributes); + if (NS_WARN_IF(result.isErr())) { + return nullptr; + } + + auto principal = result.unwrap(); + + RefPtr registration = + GetServiceWorkerRegistrationInfo(principal, scopeURI); + if (!registration) { + return nullptr; + } + + return registration->GetActive(); +} + +namespace { + +class UnregisterJobCallback final : public ServiceWorkerJob::Callback { + nsCOMPtr mCallback; + + ~UnregisterJobCallback() { MOZ_ASSERT(!mCallback); } + + public: + explicit UnregisterJobCallback(nsIServiceWorkerUnregisterCallback* aCallback) + : mCallback(aCallback) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(mCallback); + } + + void JobFinished(ServiceWorkerJob* aJob, ErrorResult& aStatus) override { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aJob); + MOZ_ASSERT(mCallback); + + auto scopeExit = MakeScopeExit([&]() { mCallback = nullptr; }); + + if (aStatus.Failed()) { + mCallback->UnregisterFailed(); + return; + } + + MOZ_ASSERT(aJob->GetType() == ServiceWorkerJob::Type::Unregister); + RefPtr unregisterJob = + static_cast(aJob); + mCallback->UnregisterSucceeded(unregisterJob->GetResult()); + } + + void JobDiscarded(ErrorResult&) override { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(mCallback); + + mCallback->UnregisterFailed(); + mCallback = nullptr; + } + + NS_INLINE_DECL_REFCOUNTING(UnregisterJobCallback, override) +}; + +} // anonymous namespace + +NS_IMETHODIMP +ServiceWorkerManager::Unregister(nsIPrincipal* aPrincipal, + nsIServiceWorkerUnregisterCallback* aCallback, + const nsAString& aScope) { + MOZ_ASSERT(NS_IsMainThread()); + + if (!aPrincipal) { + return NS_ERROR_FAILURE; + } + + nsresult rv; + +// This is not accessible by content, and callers should always ensure scope is +// a correct URI, so this is wrapped in DEBUG +#ifdef DEBUG + nsCOMPtr scopeURI; + rv = NS_NewURI(getter_AddRefs(scopeURI), aScope); + if (NS_WARN_IF(NS_FAILED(rv))) { + return NS_ERROR_DOM_SECURITY_ERR; + } +#endif + + nsAutoCString scopeKey; + rv = PrincipalToScopeKey(aPrincipal, scopeKey); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + NS_ConvertUTF16toUTF8 scope(aScope); + RefPtr queue = GetOrCreateJobQueue(scopeKey, scope); + + RefPtr job = new ServiceWorkerUnregisterJob( + aPrincipal, scope, true /* send to parent */); + + if (aCallback) { + RefPtr cb = new UnregisterJobCallback(aCallback); + job->AppendResultCallback(cb); + } + + queue->ScheduleJob(job); + return NS_OK; +} + +nsresult ServiceWorkerManager::NotifyUnregister(nsIPrincipal* aPrincipal, + const nsAString& aScope) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aPrincipal); + + nsresult rv; + +// This is not accessible by content, and callers should always ensure scope is +// a correct URI, so this is wrapped in DEBUG +#ifdef DEBUG + nsCOMPtr scopeURI; + rv = NS_NewURI(getter_AddRefs(scopeURI), aScope); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } +#endif + + nsAutoCString scopeKey; + rv = PrincipalToScopeKey(aPrincipal, scopeKey); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + NS_ConvertUTF16toUTF8 scope(aScope); + RefPtr queue = GetOrCreateJobQueue(scopeKey, scope); + + RefPtr job = new ServiceWorkerUnregisterJob( + aPrincipal, scope, false /* send to parent */); + + queue->ScheduleJob(job); + return NS_OK; +} + +void ServiceWorkerManager::WorkerIsIdle(ServiceWorkerInfo* aWorker) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_DIAGNOSTIC_ASSERT(aWorker); + + RefPtr reg = + GetRegistration(aWorker->Principal(), aWorker->Scope()); + if (!reg) { + return; + } + + if (reg->GetActive() != aWorker) { + return; + } + + reg->TryToActivateAsync(); +} + +already_AddRefed +ServiceWorkerManager::GetOrCreateJobQueue(const nsACString& aKey, + const nsACString& aScope) { + MOZ_ASSERT(!aKey.IsEmpty()); + ServiceWorkerManager::RegistrationDataPerPrincipal* data; + // XXX we could use LookupForAdd here to avoid a hashtable lookup, except that + // leads to a false positive assertion, see bug 1370674 comment 7. + if (!mRegistrationInfos.Get(aKey, &data)) { + data = new RegistrationDataPerPrincipal(); + mRegistrationInfos.Put(aKey, data); + } + + RefPtr queue = + data->mJobQueues.LookupForAdd(aScope).OrInsert( + []() { return new ServiceWorkerJobQueue(); }); + + return queue.forget(); +} + +/* static */ +already_AddRefed ServiceWorkerManager::GetInstance() { + // Note: We don't simply check gInstance for null-ness here, since otherwise + // this can resurrect the ServiceWorkerManager pretty late during shutdown. + static bool firstTime = true; + if (firstTime) { + RefPtr swr; + + // Don't create the ServiceWorkerManager until the ServiceWorkerRegistrar is + // initialized. + if (XRE_IsParentProcess()) { + swr = ServiceWorkerRegistrar::Get(); + if (!swr) { + return nullptr; + } + } + + firstTime = false; + + MOZ_ASSERT(NS_IsMainThread()); + + gInstance = new ServiceWorkerManager(); + gInstance->Init(swr); + ClearOnShutdown(&gInstance); + } + RefPtr copy = gInstance.get(); + return copy.forget(); +} + +void ServiceWorkerManager::ReportToAllClients( + const nsCString& aScope, const nsString& aMessage, + const nsString& aFilename, const nsString& aLine, uint32_t aLineNumber, + uint32_t aColumnNumber, uint32_t aFlags) { + ConsoleUtils::ReportForServiceWorkerScope( + NS_ConvertUTF8toUTF16(aScope), aMessage, aFilename, aLineNumber, + aColumnNumber, ConsoleUtils::eError); +} + +/* static */ +void ServiceWorkerManager::LocalizeAndReportToAllClients( + const nsCString& aScope, const char* aStringKey, + const nsTArray& aParamArray, uint32_t aFlags, + const nsString& aFilename, const nsString& aLine, uint32_t aLineNumber, + uint32_t aColumnNumber) { + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (!swm) { + return; + } + + nsresult rv; + nsAutoString message; + rv = nsContentUtils::FormatLocalizedString(nsContentUtils::eDOM_PROPERTIES, + aStringKey, aParamArray, message); + if (NS_SUCCEEDED(rv)) { + swm->ReportToAllClients(aScope, message, aFilename, aLine, aLineNumber, + aColumnNumber, aFlags); + } else { + NS_WARNING("Failed to format and therefore report localized error."); + } +} + +void ServiceWorkerManager::HandleError( + JSContext* aCx, nsIPrincipal* aPrincipal, const nsCString& aScope, + const nsString& aWorkerURL, const nsString& aMessage, + const nsString& aFilename, const nsString& aLine, uint32_t aLineNumber, + uint32_t aColumnNumber, uint32_t aFlags, JSExnType aExnType) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aPrincipal); + + nsAutoCString scopeKey; + nsresult rv = PrincipalToScopeKey(aPrincipal, scopeKey); + if (NS_WARN_IF(NS_FAILED(rv))) { + return; + } + + ServiceWorkerManager::RegistrationDataPerPrincipal* data; + if (NS_WARN_IF(!mRegistrationInfos.Get(scopeKey, &data))) { + return; + } + + // Always report any uncaught exceptions or errors to the console of + // each client. + ReportToAllClients(aScope, aMessage, aFilename, aLine, aLineNumber, + aColumnNumber, aFlags); +} + +void ServiceWorkerManager::LoadRegistration( + const ServiceWorkerRegistrationData& aRegistration) { + MOZ_ASSERT(NS_IsMainThread()); + + auto principalOrErr = PrincipalInfoToPrincipal(aRegistration.principal()); + if (NS_WARN_IF(principalOrErr.isErr())) { + return; + } + nsCOMPtr principal = principalOrErr.unwrap(); + + // Purge extensions registrations if they are disabled by prefs. + if (!StaticPrefs::extensions_backgroundServiceWorker_enabled_AtStartup()) { + nsCOMPtr uri = principal->GetURI(); + + // We do check the URI scheme here because when this is going to run + // the extension may not have been loaded yet and the WebExtensionPolicy + // may not exist yet. + if (uri->SchemeIs("moz-extension")) { + const auto& cacheName = aRegistration.cacheName(); + serviceWorkerScriptCache::PurgeCache(principal, cacheName); + return; + } + } + + RefPtr registration = + GetRegistration(principal, aRegistration.scope()); + if (!registration) { + registration = + CreateNewRegistration(aRegistration.scope(), principal, + static_cast( + aRegistration.updateViaCache())); + } else { + // If active worker script matches our expectations for a "current worker", + // then we are done. Since scripts with the same URL might have different + // contents such as updated scripts or scripts with different LoadFlags, we + // use the CacheName to judje whether the two scripts are identical, where + // the CacheName is an UUID generated when a new script is found. + if (registration->GetActive() && + registration->GetActive()->CacheName() == aRegistration.cacheName()) { + // No needs for updates. + return; + } + } + + registration->SetLastUpdateTime(aRegistration.lastUpdateTime()); + + nsLoadFlags importsLoadFlags = nsIChannel::LOAD_BYPASS_SERVICE_WORKER; + if (aRegistration.updateViaCache() != + static_cast(ServiceWorkerUpdateViaCache::None)) { + importsLoadFlags |= nsIRequest::VALIDATE_ALWAYS; + } + + const nsCString& currentWorkerURL = aRegistration.currentWorkerURL(); + if (!currentWorkerURL.IsEmpty()) { + registration->SetActive(new ServiceWorkerInfo( + registration->Principal(), registration->Scope(), registration->Id(), + registration->Version(), currentWorkerURL, aRegistration.cacheName(), + importsLoadFlags)); + registration->GetActive()->SetHandlesFetch( + aRegistration.currentWorkerHandlesFetch()); + registration->GetActive()->SetInstalledTime( + aRegistration.currentWorkerInstalledTime()); + registration->GetActive()->SetActivatedTime( + aRegistration.currentWorkerActivatedTime()); + } +} + +void ServiceWorkerManager::LoadRegistrations( + const nsTArray& aRegistrations) { + MOZ_ASSERT(NS_IsMainThread()); + + for (uint32_t i = 0, len = aRegistrations.Length(); i < len; ++i) { + LoadRegistration(aRegistrations[i]); + } +} + +void ServiceWorkerManager::StoreRegistration( + nsIPrincipal* aPrincipal, ServiceWorkerRegistrationInfo* aRegistration) { + MOZ_ASSERT(aPrincipal); + MOZ_ASSERT(aRegistration); + + if (mShuttingDown) { + return; + } + + ServiceWorkerRegistrationData data; + nsresult rv = PopulateRegistrationData(aPrincipal, aRegistration, data); + if (NS_WARN_IF(NS_FAILED(rv))) { + return; + } + + PrincipalInfo principalInfo; + if (NS_WARN_IF( + NS_FAILED(PrincipalToPrincipalInfo(aPrincipal, &principalInfo)))) { + return; + } + + mActor->SendRegister(data); +} + +already_AddRefed +ServiceWorkerManager::GetServiceWorkerRegistrationInfo( + const ClientInfo& aClientInfo) const { + auto principalOrErr = aClientInfo.GetPrincipal(); + if (NS_WARN_IF(principalOrErr.isErr())) { + return nullptr; + } + + nsCOMPtr principal = principalOrErr.unwrap(); + nsCOMPtr uri; + nsresult rv = NS_NewURI(getter_AddRefs(uri), aClientInfo.URL()); + NS_ENSURE_SUCCESS(rv, nullptr); + + return GetServiceWorkerRegistrationInfo(principal, uri); +} + +already_AddRefed +ServiceWorkerManager::GetServiceWorkerRegistrationInfo(nsIPrincipal* aPrincipal, + nsIURI* aURI) const { + MOZ_ASSERT(aPrincipal); + MOZ_ASSERT(aURI); + + nsAutoCString scopeKey; + nsresult rv = PrincipalToScopeKey(aPrincipal, scopeKey); + if (NS_FAILED(rv)) { + return nullptr; + } + + return GetServiceWorkerRegistrationInfo(scopeKey, aURI); +} + +already_AddRefed +ServiceWorkerManager::GetServiceWorkerRegistrationInfo( + const nsACString& aScopeKey, nsIURI* aURI) const { + MOZ_ASSERT(aURI); + + nsAutoCString spec; + nsresult rv = aURI->GetSpec(spec); + if (NS_WARN_IF(NS_FAILED(rv))) { + return nullptr; + } + + nsAutoCString scope; + RegistrationDataPerPrincipal* data; + if (!FindScopeForPath(aScopeKey, spec, &data, scope)) { + return nullptr; + } + + MOZ_ASSERT(data); + + RefPtr registration; + data->mInfos.Get(scope, getter_AddRefs(registration)); + // ordered scopes and registrations better be in sync. + MOZ_ASSERT(registration); + +#ifdef DEBUG + nsAutoCString origin; + rv = registration->Principal()->GetOrigin(origin); + MOZ_ASSERT(NS_SUCCEEDED(rv)); + MOZ_ASSERT(origin.Equals(aScopeKey)); +#endif + + return registration.forget(); +} + +/* static */ +nsresult ServiceWorkerManager::PrincipalToScopeKey(nsIPrincipal* aPrincipal, + nsACString& aKey) { + MOZ_ASSERT(aPrincipal); + + if (!BasePrincipal::Cast(aPrincipal)->IsContentPrincipal()) { + return NS_ERROR_FAILURE; + } + + nsresult rv = aPrincipal->GetOrigin(aKey); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + return NS_OK; +} + +/* static */ +nsresult ServiceWorkerManager::PrincipalInfoToScopeKey( + const PrincipalInfo& aPrincipalInfo, nsACString& aKey) { + if (aPrincipalInfo.type() != PrincipalInfo::TContentPrincipalInfo) { + return NS_ERROR_FAILURE; + } + + auto content = aPrincipalInfo.get_ContentPrincipalInfo(); + + nsAutoCString suffix; + content.attrs().CreateSuffix(suffix); + + aKey = content.originNoSuffix(); + aKey.Append(suffix); + + return NS_OK; +} + +/* static */ +void ServiceWorkerManager::AddScopeAndRegistration( + const nsACString& aScope, ServiceWorkerRegistrationInfo* aInfo) { + MOZ_ASSERT(aInfo); + MOZ_ASSERT(aInfo->Principal()); + MOZ_ASSERT(!aInfo->IsUnregistered()); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (!swm) { + // browser shutdown + return; + } + + nsAutoCString scopeKey; + nsresult rv = swm->PrincipalToScopeKey(aInfo->Principal(), scopeKey); + if (NS_WARN_IF(NS_FAILED(rv))) { + return; + } + + MOZ_ASSERT(!scopeKey.IsEmpty()); + + const auto& data = swm->mRegistrationInfos.LookupForAdd(scopeKey).OrInsert( + []() { return new RegistrationDataPerPrincipal(); }); + + data->mScopeContainer.InsertScope(aScope); + data->mInfos.Put(aScope, RefPtr{aInfo}); + swm->NotifyListenersOnRegister(aInfo); +} + +/* static */ +bool ServiceWorkerManager::FindScopeForPath( + const nsACString& aScopeKey, const nsACString& aPath, + RegistrationDataPerPrincipal** aData, nsACString& aMatch) { + MOZ_ASSERT(aData); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + + if (!swm || !swm->mRegistrationInfos.Get(aScopeKey, aData)) { + return false; + } + + Maybe scope = (*aData)->mScopeContainer.MatchScope(aPath); + + if (scope) { + // scope.isSome() will still truen true after this; we are just moving the + // string inside the Maybe, so the Maybe will contain an empty string. + aMatch = std::move(*scope); + } + + return scope.isSome(); +} + +/* static */ +bool ServiceWorkerManager::HasScope(nsIPrincipal* aPrincipal, + const nsACString& aScope) { + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (!swm) { + return false; + } + + nsAutoCString scopeKey; + nsresult rv = PrincipalToScopeKey(aPrincipal, scopeKey); + if (NS_WARN_IF(NS_FAILED(rv))) { + return false; + } + + RegistrationDataPerPrincipal* data; + if (!swm->mRegistrationInfos.Get(scopeKey, &data)) { + return false; + } + + return data->mScopeContainer.Contains(aScope); +} + +/* static */ +void ServiceWorkerManager::RemoveScopeAndRegistration( + ServiceWorkerRegistrationInfo* aRegistration) { + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (!swm) { + return; + } + + nsAutoCString scopeKey; + nsresult rv = swm->PrincipalToScopeKey(aRegistration->Principal(), scopeKey); + if (NS_WARN_IF(NS_FAILED(rv))) { + return; + } + + RegistrationDataPerPrincipal* data; + if (!swm->mRegistrationInfos.Get(scopeKey, &data)) { + return; + } + + if (auto entry = data->mUpdateTimers.Lookup(aRegistration->Scope())) { + entry.Data()->Cancel(); + entry.Remove(); + } + + // Verify there are no controlled clients for the purged registration. + for (auto iter = swm->mControlledClients.Iter(); !iter.Done(); iter.Next()) { + auto& reg = iter.UserData()->mRegistrationInfo; + if (reg->Scope().Equals(aRegistration->Scope()) && + reg->Principal()->Equals(aRegistration->Principal()) && + reg->IsCorrupt()) { + iter.Remove(); + } + } + + RefPtr info; + data->mInfos.Remove(aRegistration->Scope(), getter_AddRefs(info)); + aRegistration->SetUnregistered(); + data->mScopeContainer.RemoveScope(aRegistration->Scope()); + swm->NotifyListenersOnUnregister(info); + + swm->MaybeRemoveRegistrationInfo(scopeKey); +} + +void ServiceWorkerManager::MaybeRemoveRegistrationInfo( + const nsACString& aScopeKey) { + if (auto entry = mRegistrationInfos.Lookup(aScopeKey)) { + if (entry.Data()->mScopeContainer.IsEmpty() && + entry.Data()->mJobQueues.Count() == 0) { + entry.Remove(); + } + } +} + +bool ServiceWorkerManager::StartControlling( + const ClientInfo& aClientInfo, + const ServiceWorkerDescriptor& aServiceWorker) { + MOZ_ASSERT(NS_IsMainThread()); + + auto principalOrErr = + PrincipalInfoToPrincipal(aServiceWorker.PrincipalInfo()); + + if (NS_WARN_IF(principalOrErr.isErr())) { + return false; + } + + nsCOMPtr principal = principalOrErr.unwrap(); + + nsCOMPtr scope; + nsresult rv = NS_NewURI(getter_AddRefs(scope), aServiceWorker.Scope()); + NS_ENSURE_SUCCESS(rv, false); + + RefPtr registration = + GetServiceWorkerRegistrationInfo(principal, scope); + NS_ENSURE_TRUE(registration, false); + NS_ENSURE_TRUE(registration->GetActive(), false); + + StartControllingClient(aClientInfo, registration); + + return true; +} + +void ServiceWorkerManager::MaybeCheckNavigationUpdate( + const ClientInfo& aClientInfo) { + MOZ_ASSERT(NS_IsMainThread()); + // We perform these success path navigation update steps when the + // document tells us its more or less done loading. This avoids + // slowing down page load and also lets pages consistently get + // updatefound events when they fire. + // + // 9.8.20 If respondWithEntered is false, then: + // 9.8.22 Else: (respondWith was entered and succeeded) + // If request is a non-subresource request, then: Invoke Soft Update + // algorithm. + ControlledClientData* data = mControlledClients.Get(aClientInfo.Id()); + if (data && data->mRegistrationInfo) { + data->mRegistrationInfo->MaybeScheduleUpdate(); + } +} + +void ServiceWorkerManager::StopControllingRegistration( + ServiceWorkerRegistrationInfo* aRegistration) { + aRegistration->StopControllingClient(); + if (aRegistration->IsControllingClients()) { + return; + } + + if (aRegistration->IsUnregistered()) { + if (aRegistration->IsIdle()) { + aRegistration->Clear(); + } else { + aRegistration->ClearWhenIdle(); + } + return; + } + + // We use to aggressively terminate the worker at this point, but it + // caused problems. There are more uses for a service worker than actively + // controlled documents. We need to let the worker naturally terminate + // in case its handling push events, message events, etc. + aRegistration->TryToActivateAsync(); +} + +NS_IMETHODIMP +ServiceWorkerManager::GetScopeForUrl(nsIPrincipal* aPrincipal, + const nsAString& aUrl, nsAString& aScope) { + MOZ_ASSERT(aPrincipal); + + nsCOMPtr uri; + nsresult rv = NS_NewURI(getter_AddRefs(uri), aUrl); + if (NS_WARN_IF(NS_FAILED(rv))) { + return NS_ERROR_FAILURE; + } + + RefPtr r = + GetServiceWorkerRegistrationInfo(aPrincipal, uri); + if (!r) { + return NS_ERROR_FAILURE; + } + + CopyUTF8toUTF16(r->Scope(), aScope); + return NS_OK; +} + +namespace { + +class ContinueDispatchFetchEventRunnable : public Runnable { + RefPtr mServiceWorkerPrivate; + nsCOMPtr mChannel; + nsCOMPtr mLoadGroup; + + public: + ContinueDispatchFetchEventRunnable( + ServiceWorkerPrivate* aServiceWorkerPrivate, + nsIInterceptedChannel* aChannel, nsILoadGroup* aLoadGroup) + : Runnable( + "dom::ServiceWorkerManager::ContinueDispatchFetchEventRunnable"), + mServiceWorkerPrivate(aServiceWorkerPrivate), + mChannel(aChannel), + mLoadGroup(aLoadGroup) { + MOZ_ASSERT(aServiceWorkerPrivate); + MOZ_ASSERT(aChannel); + } + + void HandleError() { + MOZ_ASSERT(NS_IsMainThread()); + NS_WARNING("Unexpected error while dispatching fetch event!"); + nsresult rv = mChannel->ResetInterception(); + if (NS_FAILED(rv)) { + NS_WARNING("Failed to resume intercepted network request"); + mChannel->CancelInterception(rv); + } + } + + NS_IMETHOD + Run() override { + MOZ_ASSERT(NS_IsMainThread()); + + nsCOMPtr channel; + nsresult rv = mChannel->GetChannel(getter_AddRefs(channel)); + if (NS_WARN_IF(NS_FAILED(rv))) { + HandleError(); + return NS_OK; + } + + // The channel might have encountered an unexpected error while ensuring + // the upload stream is cloneable. Check here and reset the interception + // if that happens. + nsresult status; + rv = channel->GetStatus(&status); + if (NS_WARN_IF(NS_FAILED(rv) || NS_FAILED(status))) { + HandleError(); + return NS_OK; + } + + nsString clientId; + nsString resultingClientId; + nsCOMPtr loadInfo = channel->LoadInfo(); + char buf[NSID_LENGTH]; + Maybe clientInfo = loadInfo->GetClientInfo(); + if (clientInfo.isSome()) { + clientInfo.ref().Id().ToProvidedString(buf); + NS_ConvertASCIItoUTF16 uuid(buf); + + // Remove {} and the null terminator + clientId.Assign(Substring(uuid, 1, NSID_LENGTH - 3)); + } + + // Having an initial or reserved client are mutually exclusive events: + // either an initial client is used upon navigating an about:blank + // iframe, or a new, reserved environment/client is created (e.g. + // upon a top-level navigation). See step 4 of + // https://html.spec.whatwg.org/#process-a-navigate-fetch as well as + // https://github.com/w3c/ServiceWorker/issues/1228#issuecomment-345132444 + Maybe resulting = loadInfo->GetInitialClientInfo(); + + if (resulting.isNothing()) { + resulting = loadInfo->GetReservedClientInfo(); + } else { + MOZ_ASSERT(loadInfo->GetReservedClientInfo().isNothing()); + } + + if (resulting.isSome()) { + resulting.ref().Id().ToProvidedString(buf); + NS_ConvertASCIItoUTF16 uuid(buf); + + resultingClientId.Assign(Substring(uuid, 1, NSID_LENGTH - 3)); + } + + rv = mServiceWorkerPrivate->SendFetchEvent(mChannel, mLoadGroup, clientId, + resultingClientId); + if (NS_WARN_IF(NS_FAILED(rv))) { + HandleError(); + } + + return NS_OK; + } +}; + +} // anonymous namespace + +void ServiceWorkerManager::DispatchFetchEvent(nsIInterceptedChannel* aChannel, + ErrorResult& aRv) { + MOZ_ASSERT(aChannel); + MOZ_ASSERT(NS_IsMainThread()); + + nsCOMPtr internalChannel; + aRv = aChannel->GetChannel(getter_AddRefs(internalChannel)); + if (NS_WARN_IF(aRv.Failed())) { + return; + } + + nsCOMPtr loadGroup; + aRv = internalChannel->GetLoadGroup(getter_AddRefs(loadGroup)); + if (NS_WARN_IF(aRv.Failed())) { + return; + } + + nsCOMPtr loadInfo = internalChannel->LoadInfo(); + RefPtr serviceWorker; + + if (!nsContentUtils::IsNonSubresourceRequest(internalChannel)) { + const Maybe& controller = + loadInfo->GetController(); + if (NS_WARN_IF(controller.isNothing())) { + aRv.Throw(NS_ERROR_FAILURE); + return; + } + + RefPtr registration; + nsresult rv = GetClientRegistration(loadInfo->GetClientInfo().ref(), + getter_AddRefs(registration)); + if (NS_WARN_IF(NS_FAILED(rv))) { + aRv.Throw(rv); + return; + } + + serviceWorker = registration->GetActive(); + if (NS_WARN_IF(!serviceWorker) || + NS_WARN_IF(serviceWorker->Descriptor().Id() != controller.ref().Id())) { + aRv.Throw(NS_ERROR_FAILURE); + return; + } + } else { + nsCOMPtr uri; + aRv = aChannel->GetSecureUpgradedChannelURI(getter_AddRefs(uri)); + if (NS_WARN_IF(aRv.Failed())) { + return; + } + + // non-subresource request means the URI contains the principal + nsCOMPtr principal = BasePrincipal::CreateContentPrincipal( + uri, loadInfo->GetOriginAttributes()); + + RefPtr registration = + GetServiceWorkerRegistrationInfo(principal, uri); + if (NS_WARN_IF(!registration)) { + aRv.Throw(NS_ERROR_FAILURE); + return; + } + + // While we only enter this method if IsAvailable() previously saw + // an active worker, it is possible for that worker to be removed + // before we get to this point. Therefore we must handle a nullptr + // active worker here. + serviceWorker = registration->GetActive(); + if (NS_WARN_IF(!serviceWorker)) { + aRv.Throw(NS_ERROR_FAILURE); + return; + } + + // If there is a reserved client it should be marked as controlled before + // the FetchEvent is dispatched. + Maybe clientInfo = loadInfo->GetReservedClientInfo(); + + // Also override the initial about:blank controller since the real + // network load may be intercepted by a different service worker. If + // the intial about:blank has a controller here its simply been + // inherited from its parent. + if (clientInfo.isNothing()) { + clientInfo = loadInfo->GetInitialClientInfo(); + + // TODO: We need to handle the case where the initial about:blank is + // controlled, but the final document load is not. Right now + // the spec does not really say what to do. There currently + // is no way for the controller to be cleared from a client in + // the spec or our implementation. We may want to force a + // new inner window to be created instead of reusing the + // initial about:blank global. See bug 1419620 and the spec + // issue here: https://github.com/w3c/ServiceWorker/issues/1232 + } + + if (clientInfo.isSome()) { + // ClientChannelHelper is not called for STS upgrades that get + // intercepted by a service worker when interception occurs in + // the content process. Therefore the reserved client is not + // properly cleared in that case leading to a situation where + // a ClientSource with an http:// principal is controlled by + // a ServiceWorker with an https:// principal. + // + // This does not occur when interception is handled by the + // simpler InterceptedHttpChannel approach in the parent. + // + // As a temporary work around check for this principal mismatch + // here and perform the ClientChannelHelper's replacement of + // reserved client automatically. + if (!XRE_IsParentProcess()) { + auto clientPrincipalOrErr = clientInfo.ref().GetPrincipal(); + + nsCOMPtr clientPrincipal; + if (clientPrincipalOrErr.isOk()) { + clientPrincipal = clientPrincipalOrErr.unwrap(); + } + + if (!clientPrincipal || !clientPrincipal->Equals(principal)) { + UniquePtr reservedClient = + loadInfo->TakeReservedClientSource(); + + nsCOMPtr target = + reservedClient ? reservedClient->EventTarget() + : GetMainThreadSerialEventTarget(); + + reservedClient.reset(); + reservedClient = ClientManager::CreateSource(ClientType::Window, + target, principal); + + loadInfo->GiveReservedClientSource(std::move(reservedClient)); + + clientInfo = loadInfo->GetReservedClientInfo(); + } + } + + // First, attempt to mark the reserved client controlled directly. This + // will update the controlled status in the ClientManagerService in the + // parent. It will also eventually propagate back to the ClientSource. + StartControllingClient(clientInfo.ref(), registration); + } + + uint32_t redirectMode = nsIHttpChannelInternal::REDIRECT_MODE_MANUAL; + nsCOMPtr http = do_QueryInterface(internalChannel); + MOZ_ALWAYS_SUCCEEDS(http->GetRedirectMode(&redirectMode)); + + // Synthetic redirects for non-subresource requests with a "follow" + // redirect mode may switch controllers. This is basically worker + // scripts right now. In this case we need to explicitly clear the + // controller to avoid assertions on the SetController() below. + if (redirectMode == nsIHttpChannelInternal::REDIRECT_MODE_FOLLOW) { + loadInfo->ClearController(); + } + + // But we also note the reserved state on the LoadInfo. This allows the + // ClientSource to be updated immediately after the nsIChannel starts. + // This is necessary to have the correct controller in place for immediate + // follow-on requests. + loadInfo->SetController(serviceWorker->Descriptor()); + } + + MOZ_DIAGNOSTIC_ASSERT(serviceWorker); + + RefPtr continueRunnable = + new ContinueDispatchFetchEventRunnable(serviceWorker->WorkerPrivate(), + aChannel, loadGroup); + + // When this service worker was registered, we also sent down the permissions + // for the runnable. They should have arrived by now, but we still need to + // wait for them if they have not. + nsCOMPtr permissionsRunnable = NS_NewRunnableFunction( + "dom::ServiceWorkerManager::DispatchFetchEvent", [=]() { + RefPtr permMgr = PermissionManager::GetInstance(); + if (permMgr) { + permMgr->WhenPermissionsAvailable(serviceWorker->Principal(), + continueRunnable); + } else { + continueRunnable->HandleError(); + } + }); + + nsCOMPtr uploadChannel = + do_QueryInterface(internalChannel); + + // If there is no upload stream, then continue immediately + if (!uploadChannel) { + MOZ_ALWAYS_SUCCEEDS(permissionsRunnable->Run()); + return; + } + // Otherwise, ensure the upload stream can be cloned directly. This may + // require some async copying, so provide a callback. + aRv = uploadChannel->EnsureUploadStreamIsCloneable(permissionsRunnable); +} + +bool ServiceWorkerManager::IsAvailable(nsIPrincipal* aPrincipal, nsIURI* aURI, + nsIChannel* aChannel) { + MOZ_ASSERT(aPrincipal); + MOZ_ASSERT(aURI); + MOZ_ASSERT(aChannel); + + RefPtr registration = + GetServiceWorkerRegistrationInfo(aPrincipal, aURI); + + // For child interception, just check the availability. + if (!ServiceWorkerParentInterceptEnabled()) { + return registration && registration->GetActive(); + } + + if (!registration || !registration->GetActive()) { + return false; + } + + // Checking if the matched service worker handles fetch events or not. + // If it does, directly return true and handle the client controlling logic + // in DispatchFetchEvent(). otherwise, do followings then return false. + // 1. Set the matched service worker as the controller of LoadInfo and + // correspoinding ClinetInfo + // 2. Maybe schedule a soft update + if (!registration->GetActive()->HandlesFetch()) { + // Checkin if the channel is not storage allowed first. + if (StorageAllowedForChannel(aChannel) != StorageAccess::eAllow) { + return false; + } + + // ServiceWorkerInterceptController::ShouldPrepareForIntercept() handles the + // subresource cases. Must be non-subresource case here. + MOZ_ASSERT(nsContentUtils::IsNonSubresourceRequest(aChannel)); + + nsCOMPtr loadInfo = aChannel->LoadInfo(); + + Maybe clientInfo = loadInfo->GetReservedClientInfo(); + if (clientInfo.isNothing()) { + clientInfo = loadInfo->GetInitialClientInfo(); + } + + if (clientInfo.isSome()) { + StartControllingClient(clientInfo.ref(), registration); + } + loadInfo->SetController(registration->GetActive()->Descriptor()); + + // https://w3c.github.io/ServiceWorker/#on-fetch-request-algorithm 17.1 + // try schedule a soft-update for non-subresource case. + registration->MaybeScheduleUpdate(); + return false; + } + // Found a matching service worker which handles fetch events, return true. + return true; +} + +nsresult ServiceWorkerManager::GetClientRegistration( + const ClientInfo& aClientInfo, + ServiceWorkerRegistrationInfo** aRegistrationInfo) { + ControlledClientData* data = mControlledClients.Get(aClientInfo.Id()); + if (!data || !data->mRegistrationInfo) { + return NS_ERROR_NOT_AVAILABLE; + } + + // If the document is controlled, the current worker MUST be non-null. + if (!data->mRegistrationInfo->GetActive()) { + return NS_ERROR_NOT_AVAILABLE; + } + + RefPtr ref = data->mRegistrationInfo; + ref.forget(aRegistrationInfo); + return NS_OK; +} + +void ServiceWorkerManager::SoftUpdate(const OriginAttributes& aOriginAttributes, + const nsACString& aScope) { + MOZ_ASSERT(NS_IsMainThread()); + + if (mShuttingDown) { + return; + } + + if (ServiceWorkerParentInterceptEnabled()) { + SoftUpdateInternal(aOriginAttributes, aScope, nullptr); + return; + } + + RefPtr promise = + new GenericPromise::Private(__func__); + + RefPtr successRunnable = + new SoftUpdateRunnable(aOriginAttributes, aScope, true, promise); + + RefPtr failureRunnable = + new ResolvePromiseRunnable(promise); + + ServiceWorkerUpdaterChild* actor = + new ServiceWorkerUpdaterChild(promise, successRunnable, failureRunnable); + + mActor->SendPServiceWorkerUpdaterConstructor(actor, aOriginAttributes, + nsCString(aScope)); +} + +namespace { + +class UpdateJobCallback final : public ServiceWorkerJob::Callback { + RefPtr mCallback; + + ~UpdateJobCallback() { MOZ_ASSERT(!mCallback); } + + public: + explicit UpdateJobCallback(ServiceWorkerUpdateFinishCallback* aCallback) + : mCallback(aCallback) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(mCallback); + } + + void JobFinished(ServiceWorkerJob* aJob, ErrorResult& aStatus) override { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aJob); + MOZ_ASSERT(mCallback); + + auto scopeExit = MakeScopeExit([&]() { mCallback = nullptr; }); + + if (aStatus.Failed()) { + mCallback->UpdateFailed(aStatus); + return; + } + + MOZ_DIAGNOSTIC_ASSERT(aJob->GetType() == ServiceWorkerJob::Type::Update); + RefPtr updateJob = + static_cast(aJob); + RefPtr reg = updateJob->GetRegistration(); + mCallback->UpdateSucceeded(reg); + } + + void JobDiscarded(ErrorResult& aStatus) override { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(mCallback); + + mCallback->UpdateFailed(aStatus); + mCallback = nullptr; + } + + NS_INLINE_DECL_REFCOUNTING(UpdateJobCallback, override) +}; + +} // anonymous namespace + +void ServiceWorkerManager::SoftUpdateInternal( + const OriginAttributes& aOriginAttributes, const nsACString& aScope, + ServiceWorkerUpdateFinishCallback* aCallback) { + MOZ_ASSERT(NS_IsMainThread()); + + if (mShuttingDown) { + return; + } + + auto result = ScopeToPrincipal(aScope, aOriginAttributes); + if (NS_WARN_IF(result.isErr())) { + return; + } + + auto principal = result.unwrap(); + + nsAutoCString scopeKey; + nsresult rv = PrincipalToScopeKey(principal, scopeKey); + if (NS_WARN_IF(NS_FAILED(rv))) { + return; + } + + RefPtr registration = + GetRegistration(scopeKey, aScope); + if (NS_WARN_IF(!registration)) { + return; + } + + // "If registration's installing worker is not null, abort these steps." + if (registration->GetInstalling()) { + return; + } + + // "Let newestWorker be the result of running Get Newest Worker algorithm + // passing registration as its argument. + // If newestWorker is null, abort these steps." + RefPtr newest = registration->Newest(); + if (!newest) { + return; + } + + // "If the registration queue for registration is empty, invoke Update + // algorithm, or its equivalent, with client, registration as its argument." + // TODO(catalinb): We don't implement the force bypass cache flag. + // See: https://github.com/slightlyoff/ServiceWorker/issues/759 + RefPtr queue = GetOrCreateJobQueue(scopeKey, aScope); + + RefPtr job = new ServiceWorkerUpdateJob( + principal, registration->Scope(), newest->ScriptSpec(), + registration->GetUpdateViaCache()); + + if (aCallback) { + RefPtr cb = new UpdateJobCallback(aCallback); + job->AppendResultCallback(cb); + } + + queue->ScheduleJob(job); +} + +void ServiceWorkerManager::Update( + nsIPrincipal* aPrincipal, const nsACString& aScope, + nsCString aNewestWorkerScriptUrl, + ServiceWorkerUpdateFinishCallback* aCallback) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(!aNewestWorkerScriptUrl.IsEmpty()); + + if (ServiceWorkerParentInterceptEnabled()) { + UpdateInternal(aPrincipal, aScope, std::move(aNewestWorkerScriptUrl), + aCallback); + return; + } + + RefPtr promise = + new GenericPromise::Private(__func__); + + RefPtr successRunnable = + new UpdateRunnable(aPrincipal, aScope, std::move(aNewestWorkerScriptUrl), + aCallback, UpdateRunnable::eSuccess, promise); + + RefPtr failureRunnable = new UpdateRunnable( + aPrincipal, aScope, ""_ns, aCallback, UpdateRunnable::eFailure, promise); + + ServiceWorkerUpdaterChild* actor = + new ServiceWorkerUpdaterChild(promise, successRunnable, failureRunnable); + + mActor->SendPServiceWorkerUpdaterConstructor( + actor, aPrincipal->OriginAttributesRef(), nsCString(aScope)); +} + +void ServiceWorkerManager::UpdateInternal( + nsIPrincipal* aPrincipal, const nsACString& aScope, + nsCString&& aNewestWorkerScriptUrl, + ServiceWorkerUpdateFinishCallback* aCallback) { + MOZ_ASSERT(aPrincipal); + MOZ_ASSERT(aCallback); + MOZ_ASSERT(!aNewestWorkerScriptUrl.IsEmpty()); + + nsAutoCString scopeKey; + nsresult rv = PrincipalToScopeKey(aPrincipal, scopeKey); + if (NS_WARN_IF(NS_FAILED(rv))) { + return; + } + + RefPtr registration = + GetRegistration(scopeKey, aScope); + if (NS_WARN_IF(!registration)) { + ErrorResult error; + error.ThrowTypeError(aScope, "uninstalled"); + aCallback->UpdateFailed(error); + + // In case the callback does not consume the exception + error.SuppressException(); + return; + } + + RefPtr queue = GetOrCreateJobQueue(scopeKey, aScope); + + // "Let job be the result of running Create Job with update, registration’s + // scope url, newestWorker’s script url, promise, and the context object’s + // relevant settings object." + RefPtr job = new ServiceWorkerUpdateJob( + aPrincipal, registration->Scope(), std::move(aNewestWorkerScriptUrl), + registration->GetUpdateViaCache()); + + RefPtr cb = new UpdateJobCallback(aCallback); + job->AppendResultCallback(cb); + + // "Invoke Schedule Job with job." + queue->ScheduleJob(job); +} + +RefPtr ServiceWorkerManager::MaybeClaimClient( + const ClientInfo& aClientInfo, + ServiceWorkerRegistrationInfo* aWorkerRegistration) { + MOZ_DIAGNOSTIC_ASSERT(aWorkerRegistration); + + if (!aWorkerRegistration->GetActive()) { + CopyableErrorResult rv; + rv.ThrowInvalidStateError("Worker is not active"); + return GenericErrorResultPromise::CreateAndReject(rv, __func__); + } + + // Same origin check + auto principalOrErr = aClientInfo.GetPrincipal(); + + if (NS_WARN_IF(principalOrErr.isErr())) { + CopyableErrorResult rv; + rv.ThrowSecurityError("Could not extract client's principal"); + return GenericErrorResultPromise::CreateAndReject(rv, __func__); + } + + nsCOMPtr principal = principalOrErr.unwrap(); + if (!aWorkerRegistration->Principal()->Equals(principal)) { + CopyableErrorResult rv; + rv.ThrowSecurityError("Worker is for a different origin"); + return GenericErrorResultPromise::CreateAndReject(rv, __func__); + } + + // The registration that should be controlling the client + RefPtr matchingRegistration = + GetServiceWorkerRegistrationInfo(aClientInfo); + + // The registration currently controlling the client + RefPtr controllingRegistration; + GetClientRegistration(aClientInfo, getter_AddRefs(controllingRegistration)); + + if (aWorkerRegistration != matchingRegistration || + aWorkerRegistration == controllingRegistration) { + return GenericErrorResultPromise::CreateAndResolve(true, __func__); + } + + return StartControllingClient(aClientInfo, aWorkerRegistration); +} + +RefPtr ServiceWorkerManager::MaybeClaimClient( + const ClientInfo& aClientInfo, + const ServiceWorkerDescriptor& aServiceWorker) { + auto principalOrErr = aServiceWorker.GetPrincipal(); + if (NS_WARN_IF(principalOrErr.isErr())) { + return GenericErrorResultPromise::CreateAndResolve(false, __func__); + } + + nsCOMPtr principal = principalOrErr.unwrap(); + + RefPtr registration = + GetRegistration(principal, aServiceWorker.Scope()); + + // While ServiceWorkerManager is distributed across child processes its + // possible for us to sometimes get a claim for a new worker that has + // not propagated to this process yet. For now, simply note that we + // are done. The fix for this is to move the SWM to the parent process + // so there are no consistency errors. + if (NS_WARN_IF(!registration) || NS_WARN_IF(!registration->GetActive())) { + return GenericErrorResultPromise::CreateAndResolve(false, __func__); + } + + return MaybeClaimClient(aClientInfo, registration); +} + +void ServiceWorkerManager::SetSkipWaitingFlag(nsIPrincipal* aPrincipal, + const nsCString& aScope, + uint64_t aServiceWorkerID) { + RefPtr registration = + GetRegistration(aPrincipal, aScope); + if (NS_WARN_IF(!registration)) { + return; + } + + RefPtr worker = + registration->GetServiceWorkerInfoById(aServiceWorkerID); + + if (NS_WARN_IF(!worker)) { + return; + } + + worker->SetSkipWaitingFlag(); + + if (worker->State() == ServiceWorkerState::Installed) { + registration->TryToActivateAsync(); + } +} + +void ServiceWorkerManager::UpdateClientControllers( + ServiceWorkerRegistrationInfo* aRegistration) { + MOZ_ASSERT(NS_IsMainThread()); + + RefPtr activeWorker = aRegistration->GetActive(); + MOZ_DIAGNOSTIC_ASSERT(activeWorker); + + AutoTArray, 16> handleList; + for (auto iter = mControlledClients.Iter(); !iter.Done(); iter.Next()) { + if (iter.UserData()->mRegistrationInfo != aRegistration) { + continue; + } + + handleList.AppendElement(iter.UserData()->mClientHandle); + } + + // Fire event after iterating mControlledClients is done to prevent + // modification by reentering from the event handlers during iteration. + for (auto& handle : handleList) { + RefPtr p = + handle->Control(activeWorker->Descriptor()); + + RefPtr self = this; + + // If we fail to control the client, then automatically remove it + // from our list of controlled clients. + p->Then( + GetMainThreadSerialEventTarget(), __func__, + [](bool) { + // do nothing on success + }, + [self, clientInfo = handle->Info()](const CopyableErrorResult& aRv) { + // failed to control, forget about this client + self->StopControllingClient(clientInfo); + }); + } +} + +already_AddRefed +ServiceWorkerManager::GetRegistration(nsIPrincipal* aPrincipal, + const nsACString& aScope) const { + MOZ_ASSERT(aPrincipal); + + nsAutoCString scopeKey; + nsresult rv = PrincipalToScopeKey(aPrincipal, scopeKey); + if (NS_WARN_IF(NS_FAILED(rv))) { + return nullptr; + } + + return GetRegistration(scopeKey, aScope); +} + +already_AddRefed +ServiceWorkerManager::GetRegistration(const PrincipalInfo& aPrincipalInfo, + const nsACString& aScope) const { + nsAutoCString scopeKey; + nsresult rv = PrincipalInfoToScopeKey(aPrincipalInfo, scopeKey); + if (NS_WARN_IF(NS_FAILED(rv))) { + return nullptr; + } + + return GetRegistration(scopeKey, aScope); +} + +NS_IMETHODIMP +ServiceWorkerManager::RegisterForAddonPrincipal(nsIPrincipal* aPrincipal, + JSContext* aCx, + dom::Promise** aPromise) { + nsIGlobalObject* global = xpc::CurrentNativeGlobal(aCx); + if (NS_WARN_IF(!global)) { + return NS_ERROR_FAILURE; + } + + ErrorResult erv; + RefPtr outer = Promise::Create(global, erv); + if (NS_WARN_IF(erv.Failed())) { + return erv.StealNSResult(); + } + + auto enabled = + StaticPrefs::extensions_backgroundServiceWorker_enabled_AtStartup(); + if (!enabled) { + outer->MaybeRejectWithNotAllowedError( + "Disabled. extensions.backgroundServiceWorker.enabled is false"); + return NS_OK; + } + + MOZ_ASSERT(aPrincipal); + auto* addonPolicy = BasePrincipal::Cast(aPrincipal)->AddonPolicy(); + if (!addonPolicy) { + outer->MaybeRejectWithNotAllowedError("Not an extension principal"); + return NS_OK; + } + + nsCString scope; + auto result = addonPolicy->GetURL(u""_ns); + if (result.isOk()) { + scope.Assign(NS_ConvertUTF16toUTF8(result.unwrap())); + } else { + outer->MaybeRejectWithUnknownError("Unable to resolve addon scope URL"); + return NS_OK; + } + + nsString scriptURL; + addonPolicy->GetBackgroundWorker(scriptURL); + + if (scriptURL.IsEmpty()) { + outer->MaybeRejectWithNotFoundError("Missing background worker script url"); + return NS_OK; + } + + Maybe clientInfo = + dom::ClientManager::CreateInfo(ClientType::All, aPrincipal); + + if (!clientInfo.isSome()) { + outer->MaybeRejectWithUnknownError("Error creating clientInfo"); + return NS_OK; + } + + auto regPromise = + Register(clientInfo.ref(), scope, NS_ConvertUTF16toUTF8(scriptURL), + dom::ServiceWorkerUpdateViaCache::Imports); + const RefPtr self(this); + const nsCOMPtr principal(aPrincipal); + regPromise->Then( + GetMainThreadSerialEventTarget(), __func__, + [self, outer, principal, + scope](const ServiceWorkerRegistrationDescriptor& regDesc) { + RefPtr registration = + self->GetRegistration(principal, scope); + if (registration) { + outer->MaybeResolve(registration); + } else { + outer->MaybeRejectWithUnknownError( + "Failed to retrieve ServiceWorkerRegistrationInfo"); + } + }, + [outer](const mozilla::CopyableErrorResult& err) { + CopyableErrorResult result(err); + outer->MaybeReject(std::move(result)); + }); + + outer.forget(aPromise); + + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerManager::GetRegistrationByPrincipal( + nsIPrincipal* aPrincipal, const nsAString& aScope, + nsIServiceWorkerRegistrationInfo** aInfo) { + MOZ_ASSERT(aPrincipal); + MOZ_ASSERT(aInfo); + + nsCOMPtr scopeURI; + nsresult rv = NS_NewURI(getter_AddRefs(scopeURI), aScope); + if (NS_FAILED(rv)) { + return NS_ERROR_FAILURE; + } + + RefPtr info = + GetServiceWorkerRegistrationInfo(aPrincipal, scopeURI); + if (!info) { + return NS_ERROR_FAILURE; + } + info.forget(aInfo); + + return NS_OK; +} + +already_AddRefed +ServiceWorkerManager::GetRegistration(const nsACString& aScopeKey, + const nsACString& aScope) const { + RefPtr reg; + + RegistrationDataPerPrincipal* data; + if (!mRegistrationInfos.Get(aScopeKey, &data)) { + return reg.forget(); + } + + data->mInfos.Get(aScope, getter_AddRefs(reg)); + return reg.forget(); +} + +already_AddRefed +ServiceWorkerManager::CreateNewRegistration( + const nsCString& aScope, nsIPrincipal* aPrincipal, + ServiceWorkerUpdateViaCache aUpdateViaCache) { +#ifdef DEBUG + MOZ_ASSERT(NS_IsMainThread()); + nsCOMPtr scopeURI; + nsresult rv = NS_NewURI(getter_AddRefs(scopeURI), aScope); + MOZ_ASSERT(NS_SUCCEEDED(rv)); + + RefPtr tmp = + GetRegistration(aPrincipal, aScope); + MOZ_ASSERT(!tmp); +#endif + + RefPtr registration = + new ServiceWorkerRegistrationInfo(aScope, aPrincipal, aUpdateViaCache); + + // From now on ownership of registration is with + // mServiceWorkerRegistrationInfos. + AddScopeAndRegistration(aScope, registration); + return registration.forget(); +} + +void ServiceWorkerManager::MaybeRemoveRegistration( + ServiceWorkerRegistrationInfo* aRegistration) { + MOZ_ASSERT(aRegistration); + RefPtr newest = aRegistration->Newest(); + if (!newest && HasScope(aRegistration->Principal(), aRegistration->Scope())) { + RemoveRegistration(aRegistration); + } +} + +void ServiceWorkerManager::RemoveRegistration( + ServiceWorkerRegistrationInfo* aRegistration) { + // Note, we do not need to call mActor->SendUnregister() here. There are a + // few ways we can get here: 1) Through a normal unregister which calls + // SendUnregister() in the + // unregister job Start() method. + // 2) Through origin storage being purged. These result in ForceUnregister() + // starting unregister jobs which in turn call SendUnregister(). + // 3) Through the failure to install a new service worker. Since we don't + // store the registration until install succeeds, we do not need to call + // SendUnregister here. + MOZ_ASSERT(HasScope(aRegistration->Principal(), aRegistration->Scope())); + + RemoveScopeAndRegistration(aRegistration); +} + +NS_IMETHODIMP +ServiceWorkerManager::GetAllRegistrations(nsIArray** aResult) { + MOZ_ASSERT(NS_IsMainThread()); + + nsCOMPtr array(do_CreateInstance(NS_ARRAY_CONTRACTID)); + if (!array) { + return NS_ERROR_OUT_OF_MEMORY; + } + + for (auto it1 = mRegistrationInfos.Iter(); !it1.Done(); it1.Next()) { + for (auto it2 = it1.UserData()->mInfos.Iter(); !it2.Done(); it2.Next()) { + ServiceWorkerRegistrationInfo* reg = it2.UserData(); + MOZ_ASSERT(reg); + + array->AppendElement(reg); + } + } + + array.forget(aResult); + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerManager::RemoveRegistrationsByOriginAttributes( + const nsAString& aPattern) { + MOZ_ASSERT(XRE_IsParentProcess()); + MOZ_ASSERT(NS_IsMainThread()); + + MOZ_ASSERT(!aPattern.IsEmpty()); + + OriginAttributesPattern pattern; + MOZ_ALWAYS_TRUE(pattern.Init(aPattern)); + + for (auto it1 = mRegistrationInfos.Iter(); !it1.Done(); it1.Next()) { + ServiceWorkerManager::RegistrationDataPerPrincipal* data = it1.UserData(); + + // We can use iteration because ForceUnregister (and Unregister) are + // async. Otherwise doing some R/W operations on an hashtable during + // iteration will crash. + for (auto it2 = data->mInfos.Iter(); !it2.Done(); it2.Next()) { + ServiceWorkerRegistrationInfo* reg = it2.UserData(); + + MOZ_ASSERT(reg); + MOZ_ASSERT(reg->Principal()); + + bool matches = pattern.Matches(reg->Principal()->OriginAttributesRef()); + if (!matches) { + continue; + } + + ForceUnregister(data, reg); + } + } + + return NS_OK; +} + +// MUST ONLY BE CALLED FROM Remove()! +void ServiceWorkerManager::ForceUnregister( + RegistrationDataPerPrincipal* aRegistrationData, + ServiceWorkerRegistrationInfo* aRegistration) { + MOZ_ASSERT(aRegistrationData); + MOZ_ASSERT(aRegistration); + + RefPtr queue; + aRegistrationData->mJobQueues.Get(aRegistration->Scope(), + getter_AddRefs(queue)); + if (queue) { + queue->CancelAll(); + } + + if (auto entry = + aRegistrationData->mUpdateTimers.Lookup(aRegistration->Scope())) { + entry.Data()->Cancel(); + entry.Remove(); + } + + // Since Unregister is async, it is ok to call it in an enumeration. + Unregister(aRegistration->Principal(), nullptr, + NS_ConvertUTF8toUTF16(aRegistration->Scope())); +} + +void ServiceWorkerManager::Remove(const nsACString& aHost) { + MOZ_ASSERT(NS_IsMainThread()); + + nsCOMPtr tldService = + do_GetService(NS_EFFECTIVETLDSERVICE_CONTRACTID); + if (NS_WARN_IF(!tldService)) { + return; + } + + for (auto it1 = mRegistrationInfos.Iter(); !it1.Done(); it1.Next()) { + ServiceWorkerManager::RegistrationDataPerPrincipal* data = it1.UserData(); + for (auto it2 = data->mInfos.Iter(); !it2.Done(); it2.Next()) { + ServiceWorkerRegistrationInfo* reg = it2.UserData(); + nsCOMPtr scopeURI; + nsresult rv = NS_NewURI(getter_AddRefs(scopeURI), it2.Key()); + if (NS_WARN_IF(NS_FAILED(rv))) { + continue; + } + + nsAutoCString host; + rv = scopeURI->GetHost(host); + if (NS_WARN_IF(NS_FAILED(rv))) { + continue; + } + + // This way subdomains are also cleared. + bool hasRootDomain = false; + rv = tldService->HasRootDomain(host, aHost, &hasRootDomain); + if (NS_WARN_IF(NS_FAILED(rv))) { + continue; + } + + if (hasRootDomain) { + ForceUnregister(data, reg); + } + } + } +} + +void ServiceWorkerManager::RemoveAll() { + MOZ_ASSERT(NS_IsMainThread()); + + for (auto it1 = mRegistrationInfos.Iter(); !it1.Done(); it1.Next()) { + ServiceWorkerManager::RegistrationDataPerPrincipal* data = it1.UserData(); + for (auto it2 = data->mInfos.Iter(); !it2.Done(); it2.Next()) { + ServiceWorkerRegistrationInfo* reg = it2.UserData(); + ForceUnregister(data, reg); + } + } +} + +NS_IMETHODIMP +ServiceWorkerManager::AddListener(nsIServiceWorkerManagerListener* aListener) { + MOZ_ASSERT(NS_IsMainThread()); + + if (!aListener || mListeners.Contains(aListener)) { + return NS_ERROR_INVALID_ARG; + } + + mListeners.AppendElement(aListener); + + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerManager::RemoveListener( + nsIServiceWorkerManagerListener* aListener) { + MOZ_ASSERT(NS_IsMainThread()); + + if (!aListener || !mListeners.Contains(aListener)) { + return NS_ERROR_INVALID_ARG; + } + + mListeners.RemoveElement(aListener); + + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerManager::Observe(nsISupports* aSubject, const char* aTopic, + const char16_t* aData) { + if (strcmp(aTopic, kFinishShutdownTopic) == 0) { + MaybeFinishShutdown(); + return NS_OK; + } + + MOZ_CRASH("Received message we aren't supposed to be registered for!"); + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerManager::PropagateSoftUpdate( + JS::Handle aOriginAttributes, const nsAString& aScope, + JSContext* aCx) { + MOZ_ASSERT(NS_IsMainThread()); + + OriginAttributes attrs; + if (!aOriginAttributes.isObject() || !attrs.Init(aCx, aOriginAttributes)) { + return NS_ERROR_INVALID_ARG; + } + + PropagateSoftUpdate(attrs, aScope); + return NS_OK; +} + +void ServiceWorkerManager::PropagateSoftUpdate( + const OriginAttributes& aOriginAttributes, const nsAString& aScope) { + MOZ_ASSERT(NS_IsMainThread()); + mActor->SendPropagateSoftUpdate(aOriginAttributes, nsString(aScope)); +} + +NS_IMETHODIMP +ServiceWorkerManager::PropagateUnregister( + nsIPrincipal* aPrincipal, nsIServiceWorkerUnregisterCallback* aCallback, + const nsAString& aScope) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aPrincipal); + + PrincipalInfo principalInfo; + if (NS_WARN_IF( + NS_FAILED(PrincipalToPrincipalInfo(aPrincipal, &principalInfo)))) { + return NS_ERROR_FAILURE; + } + + mActor->SendPropagateUnregister(principalInfo, nsString(aScope)); + + nsresult rv = Unregister(aPrincipal, aCallback, aScope); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + return NS_OK; +} + +void ServiceWorkerManager::NotifyListenersOnRegister( + nsIServiceWorkerRegistrationInfo* aInfo) { + nsTArray> listeners( + mListeners.Clone()); + for (size_t index = 0; index < listeners.Length(); ++index) { + listeners[index]->OnRegister(aInfo); + } +} + +void ServiceWorkerManager::NotifyListenersOnUnregister( + nsIServiceWorkerRegistrationInfo* aInfo) { + nsTArray> listeners( + mListeners.Clone()); + for (size_t index = 0; index < listeners.Length(); ++index) { + listeners[index]->OnUnregister(aInfo); + } +} + +class UpdateTimerCallback final : public nsITimerCallback, public nsINamed { + nsCOMPtr mPrincipal; + const nsCString mScope; + + ~UpdateTimerCallback() = default; + + public: + UpdateTimerCallback(nsIPrincipal* aPrincipal, const nsACString& aScope) + : mPrincipal(aPrincipal), mScope(aScope) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(mPrincipal); + MOZ_ASSERT(!mScope.IsEmpty()); + } + + NS_IMETHOD + Notify(nsITimer* aTimer) override { + MOZ_ASSERT(NS_IsMainThread()); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (!swm) { + // shutting down, do nothing + return NS_OK; + } + + swm->UpdateTimerFired(mPrincipal, mScope); + return NS_OK; + } + + NS_IMETHOD + GetName(nsACString& aName) override { + aName.AssignLiteral("UpdateTimerCallback"); + return NS_OK; + } + + NS_DECL_ISUPPORTS +}; + +NS_IMPL_ISUPPORTS(UpdateTimerCallback, nsITimerCallback, nsINamed) + +void ServiceWorkerManager::ScheduleUpdateTimer(nsIPrincipal* aPrincipal, + const nsACString& aScope) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aPrincipal); + MOZ_ASSERT(!aScope.IsEmpty()); + + if (mShuttingDown) { + return; + } + + nsAutoCString scopeKey; + nsresult rv = PrincipalToScopeKey(aPrincipal, scopeKey); + if (NS_WARN_IF(NS_FAILED(rv))) { + return; + } + + RegistrationDataPerPrincipal* data; + if (!mRegistrationInfos.Get(scopeKey, &data)) { + return; + } + + nsCOMPtr& timer = data->mUpdateTimers.GetOrInsert(aScope); + if (timer) { + // There is already a timer scheduled. In this case just use the original + // schedule time. We don't want to push it out to a later time since that + // could allow updates to be starved forever if events are continuously + // fired. + return; + } + + nsCOMPtr callback = + new UpdateTimerCallback(aPrincipal, aScope); + + const uint32_t UPDATE_DELAY_MS = 1000; + + rv = NS_NewTimerWithCallback(getter_AddRefs(timer), callback, UPDATE_DELAY_MS, + nsITimer::TYPE_ONE_SHOT); + + if (NS_WARN_IF(NS_FAILED(rv))) { + data->mUpdateTimers.Remove(aScope); // another lookup, but very rare + return; + } +} + +void ServiceWorkerManager::UpdateTimerFired(nsIPrincipal* aPrincipal, + const nsACString& aScope) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aPrincipal); + MOZ_ASSERT(!aScope.IsEmpty()); + + if (mShuttingDown) { + return; + } + + // First cleanup the timer. + nsAutoCString scopeKey; + nsresult rv = PrincipalToScopeKey(aPrincipal, scopeKey); + if (NS_WARN_IF(NS_FAILED(rv))) { + return; + } + + RegistrationDataPerPrincipal* data; + if (!mRegistrationInfos.Get(scopeKey, &data)) { + return; + } + + if (auto entry = data->mUpdateTimers.Lookup(aScope)) { + entry.Data()->Cancel(); + entry.Remove(); + } + + RefPtr registration; + data->mInfos.Get(aScope, getter_AddRefs(registration)); + if (!registration) { + return; + } + + if (!registration->CheckAndClearIfUpdateNeeded()) { + return; + } + + OriginAttributes attrs = aPrincipal->OriginAttributesRef(); + + SoftUpdate(attrs, aScope); +} + +void ServiceWorkerManager::MaybeSendUnregister(nsIPrincipal* aPrincipal, + const nsACString& aScope) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aPrincipal); + MOZ_ASSERT(!aScope.IsEmpty()); + + if (!mActor) { + return; + } + + PrincipalInfo principalInfo; + nsresult rv = PrincipalToPrincipalInfo(aPrincipal, &principalInfo); + if (NS_WARN_IF(NS_FAILED(rv))) { + return; + } + + Unused << mActor->SendUnregister(principalInfo, + NS_ConvertUTF8toUTF16(aScope)); +} + +NS_IMETHODIMP +ServiceWorkerManager::IsParentInterceptEnabled(bool* aIsEnabled) { + MOZ_ASSERT(NS_IsMainThread()); + *aIsEnabled = ServiceWorkerParentInterceptEnabled(); + return NS_OK; +} + +void ServiceWorkerManager::AddOrphanedRegistration( + ServiceWorkerRegistrationInfo* aRegistration) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aRegistration); + MOZ_ASSERT(aRegistration->IsUnregistered()); + MOZ_ASSERT(!aRegistration->IsControllingClients()); + MOZ_ASSERT(!aRegistration->IsIdle()); + MOZ_ASSERT(!mOrphanedRegistrations.has(aRegistration)); + + MOZ_ALWAYS_TRUE(mOrphanedRegistrations.putNew(aRegistration)); +} + +void ServiceWorkerManager::RemoveOrphanedRegistration( + ServiceWorkerRegistrationInfo* aRegistration) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aRegistration); + MOZ_ASSERT(aRegistration->IsUnregistered()); + MOZ_ASSERT(!aRegistration->IsControllingClients()); + MOZ_ASSERT(aRegistration->IsIdle()); + MOZ_ASSERT(mOrphanedRegistrations.has(aRegistration)); + + mOrphanedRegistrations.remove(aRegistration); +} + +uint32_t ServiceWorkerManager::MaybeInitServiceWorkerShutdownProgress() const { + if (!mShutdownBlocker) { + return ServiceWorkerShutdownBlocker::kInvalidShutdownStateId; + } + + return mShutdownBlocker->CreateShutdownState(); +} + +void ServiceWorkerManager::ReportServiceWorkerShutdownProgress( + uint32_t aShutdownStateId, + ServiceWorkerShutdownState::Progress aProgress) const { + MOZ_ASSERT(mShutdownBlocker); + mShutdownBlocker->ReportShutdownProgress(aShutdownStateId, aProgress); +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerManager.h b/dom/serviceworkers/ServiceWorkerManager.h new file mode 100644 index 0000000000..564000cc6a --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerManager.h @@ -0,0 +1,425 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_workers_serviceworkermanager_h +#define mozilla_dom_workers_serviceworkermanager_h + +#include +#include "ErrorList.h" +#include "ServiceWorkerShutdownState.h" +#include "js/ErrorReport.h" +#include "mozilla/AlreadyAddRefed.h" +#include "mozilla/Assertions.h" +#include "mozilla/HashTable.h" +#include "mozilla/MozPromise.h" +#include "mozilla/RefPtr.h" +#include "mozilla/UniquePtr.h" +#include "mozilla/dom/ClientHandle.h" +#include "mozilla/dom/ClientOpPromise.h" +#include "mozilla/dom/ServiceWorkerRegistrationBinding.h" +#include "mozilla/dom/ServiceWorkerRegistrationInfo.h" +#include "mozilla/dom/ServiceWorkerUtils.h" +#include "mozilla/mozalloc.h" +#include "nsClassHashtable.h" +#include "nsContentUtils.h" +#include "nsHashKeys.h" +#include "nsIObserver.h" +#include "nsIServiceWorkerManager.h" +#include "nsISupports.h" +#include "nsStringFwd.h" +#include "nsTArray.h" + +class nsIConsoleReportCollector; + +namespace mozilla { + +class OriginAttributes; + +namespace ipc { +class PrincipalInfo; +} // namespace ipc + +namespace dom { + +class ContentParent; +class ServiceWorkerInfo; +class ServiceWorkerJobQueue; +class ServiceWorkerManagerChild; +class ServiceWorkerPrivate; +class ServiceWorkerRegistrar; +class ServiceWorkerShutdownBlocker; + +class ServiceWorkerUpdateFinishCallback { + protected: + virtual ~ServiceWorkerUpdateFinishCallback() = default; + + public: + NS_INLINE_DECL_REFCOUNTING(ServiceWorkerUpdateFinishCallback) + + virtual void UpdateSucceeded(ServiceWorkerRegistrationInfo* aInfo) = 0; + + virtual void UpdateFailed(ErrorResult& aStatus) = 0; +}; + +#define NS_SERVICEWORKERMANAGER_IMPL_IID \ + { /* f4f8755a-69ca-46e8-a65d-775745535990 */ \ + 0xf4f8755a, 0x69ca, 0x46e8, { \ + 0xa6, 0x5d, 0x77, 0x57, 0x45, 0x53, 0x59, 0x90 \ + } \ + } + +/* + * The ServiceWorkerManager is a per-process global that deals with the + * installation, querying and event dispatch of ServiceWorkers for all the + * origins in the process. + * + * NOTE: the following documentation is a WIP and only applies with + * dom.serviceWorkers.parent_intercept=true: + * + * The ServiceWorkerManager (SWM) is a main-thread, parent-process singleton + * that encapsulates the browser-global state of service workers. This state + * includes, but is not limited to, all service worker registrations and all + * controlled service worker clients. The SWM also provides methods to read and + * mutate this state and to dispatch operations (e.g. DOM events such as a + * FetchEvent) to service workers. + * + * Example usage: + * + * MOZ_ASSERT(NS_IsMainThread(), "SWM is main-thread only"); + * + * RefPtr swm = ServiceWorkerManager::GetInstance(); + * + * // Nullness must be checked by code that possibly executes during browser + * // shutdown, which is when the SWM is destroyed. + * if (swm) { + * // Do something with the SWM. + * } + */ +class ServiceWorkerManager final : public nsIServiceWorkerManager, + public nsIObserver { + friend class GetRegistrationsRunnable; + friend class GetRegistrationRunnable; + friend class ServiceWorkerJob; + friend class ServiceWorkerRegistrationInfo; + friend class ServiceWorkerShutdownBlocker; + friend class ServiceWorkerUnregisterJob; + friend class ServiceWorkerUpdateJob; + friend class UpdateTimerCallback; + + public: + NS_DECL_ISUPPORTS + NS_DECL_NSISERVICEWORKERMANAGER + NS_DECL_NSIOBSERVER + + // Return true if the given principal and URI matches a registered service + // worker which handles fetch event. + // If there is a matched service worker but doesn't handle fetch events, this + // method will try to set the matched service worker as the controller of the + // passed in channel. Then also schedule a soft-update job for the service + // worker. + bool IsAvailable(nsIPrincipal* aPrincipal, nsIURI* aURI, + nsIChannel* aChannel); + + void DispatchFetchEvent(nsIInterceptedChannel* aChannel, ErrorResult& aRv); + + void Update(nsIPrincipal* aPrincipal, const nsACString& aScope, + nsCString aNewestWorkerScriptUrl, + ServiceWorkerUpdateFinishCallback* aCallback); + + void UpdateInternal(nsIPrincipal* aPrincipal, const nsACString& aScope, + nsCString&& aNewestWorkerScriptUrl, + ServiceWorkerUpdateFinishCallback* aCallback); + + void SoftUpdate(const OriginAttributes& aOriginAttributes, + const nsACString& aScope); + + void SoftUpdateInternal(const OriginAttributes& aOriginAttributes, + const nsACString& aScope, + ServiceWorkerUpdateFinishCallback* aCallback); + + void PropagateSoftUpdate(const OriginAttributes& aOriginAttributes, + const nsAString& aScope); + + void Remove(const nsACString& aHost); + + void RemoveAll(); + + RefPtr Register( + const ClientInfo& aClientInfo, const nsACString& aScopeURL, + const nsACString& aScriptURL, + ServiceWorkerUpdateViaCache aUpdateViaCache); + + RefPtr GetRegistration( + const ClientInfo& aClientInfo, const nsACString& aURL) const; + + RefPtr GetRegistrations( + const ClientInfo& aClientInfo) const; + + already_AddRefed GetRegistration( + nsIPrincipal* aPrincipal, const nsACString& aScope) const; + + already_AddRefed GetRegistration( + const mozilla::ipc::PrincipalInfo& aPrincipal, + const nsACString& aScope) const; + + already_AddRefed CreateNewRegistration( + const nsCString& aScope, nsIPrincipal* aPrincipal, + ServiceWorkerUpdateViaCache aUpdateViaCache); + + void RemoveRegistration(ServiceWorkerRegistrationInfo* aRegistration); + + void StoreRegistration(nsIPrincipal* aPrincipal, + ServiceWorkerRegistrationInfo* aRegistration); + + /** + * Report an error for the given scope to any window we think might be + * interested, failing over to the Browser Console if we couldn't find any. + * + * Error messages should be localized, so you probably want to call + * LocalizeAndReportToAllClients instead, which in turn calls us after + * localizing the error. + */ + void ReportToAllClients(const nsCString& aScope, const nsString& aMessage, + const nsString& aFilename, const nsString& aLine, + uint32_t aLineNumber, uint32_t aColumnNumber, + uint32_t aFlags); + + /** + * Report a localized error for the given scope to any window we think might + * be interested. + * + * Note that this method takes an nsTArray for the parameters, not + * bare chart16_t*[]. You can use a std::initializer_list constructor inline + * so that argument might look like: nsTArray { some_nsString, + * PromiseFlatString(some_nsSubString_aka_nsAString), + * NS_ConvertUTF8toUTF16(some_nsCString_or_nsCSubString), + * u"some literal"_ns }. If you have anything else, like a + * number, you can use an nsAutoString with AppendInt/friends. + * + * @param [aFlags] + * The nsIScriptError flag, one of errorFlag (0x0), warningFlag (0x1), + * infoFlag (0x8). We default to error if omitted because usually we're + * logging exceptional and/or obvious breakage. + */ + static void LocalizeAndReportToAllClients( + const nsCString& aScope, const char* aStringKey, + const nsTArray& aParamArray, uint32_t aFlags = 0x0, + const nsString& aFilename = u""_ns, const nsString& aLine = u""_ns, + uint32_t aLineNumber = 0, uint32_t aColumnNumber = 0); + + // Always consumes the error by reporting to consoles of all controlled + // documents. + void HandleError(JSContext* aCx, nsIPrincipal* aPrincipal, + const nsCString& aScope, const nsString& aWorkerURL, + const nsString& aMessage, const nsString& aFilename, + const nsString& aLine, uint32_t aLineNumber, + uint32_t aColumnNumber, uint32_t aFlags, JSExnType aExnType); + + [[nodiscard]] RefPtr MaybeClaimClient( + const ClientInfo& aClientInfo, + ServiceWorkerRegistrationInfo* aWorkerRegistration); + + [[nodiscard]] RefPtr MaybeClaimClient( + const ClientInfo& aClientInfo, + const ServiceWorkerDescriptor& aServiceWorker); + + void SetSkipWaitingFlag(nsIPrincipal* aPrincipal, const nsCString& aScope, + uint64_t aServiceWorkerID); + + static already_AddRefed GetInstance(); + + void LoadRegistration(const ServiceWorkerRegistrationData& aRegistration); + + void LoadRegistrations( + const nsTArray& aRegistrations); + + void MaybeCheckNavigationUpdate(const ClientInfo& aClientInfo); + + nsresult SendPushEvent(const nsACString& aOriginAttributes, + const nsACString& aScope, const nsAString& aMessageId, + const Maybe>& aData); + + nsresult NotifyUnregister(nsIPrincipal* aPrincipal, const nsAString& aScope); + + void WorkerIsIdle(ServiceWorkerInfo* aWorker); + + RefPtr WhenReady( + const ClientInfo& aClientInfo); + + void CheckPendingReadyPromises(); + + void RemovePendingReadyPromise(const ClientInfo& aClientInfo); + + void NoteInheritedController(const ClientInfo& aClientInfo, + const ServiceWorkerDescriptor& aController); + + void BlockShutdownOn(GenericNonExclusivePromise* aPromise, + uint32_t aShutdownStateId); + + nsresult GetClientRegistration( + const ClientInfo& aClientInfo, + ServiceWorkerRegistrationInfo** aRegistrationInfo); + + // Returns the shutdown state ID (may be an invalid ID if an + // nsIAsyncShutdownBlocker is not used). + uint32_t MaybeInitServiceWorkerShutdownProgress() const; + + void ReportServiceWorkerShutdownProgress( + uint32_t aShutdownStateId, + ServiceWorkerShutdownState::Progress aProgress) const; + + private: + struct RegistrationDataPerPrincipal; + + static bool FindScopeForPath(const nsACString& aScopeKey, + const nsACString& aPath, + RegistrationDataPerPrincipal** aData, + nsACString& aMatch); + + ServiceWorkerManager(); + ~ServiceWorkerManager(); + + void Init(ServiceWorkerRegistrar* aRegistrar); + + RefPtr StartControllingClient( + const ClientInfo& aClientInfo, + ServiceWorkerRegistrationInfo* aRegistrationInfo, + bool aControlClientHandle = true); + + void StopControllingClient(const ClientInfo& aClientInfo); + + void MaybeStartShutdown(); + + void MaybeFinishShutdown(); + + already_AddRefed GetOrCreateJobQueue( + const nsACString& aOriginSuffix, const nsACString& aScope); + + void MaybeRemoveRegistrationInfo(const nsACString& aScopeKey); + + already_AddRefed GetRegistration( + const nsACString& aScopeKey, const nsACString& aScope) const; + + void AbortCurrentUpdate(ServiceWorkerRegistrationInfo* aRegistration); + + nsresult Update(ServiceWorkerRegistrationInfo* aRegistration); + + ServiceWorkerInfo* GetActiveWorkerInfoForScope( + const OriginAttributes& aOriginAttributes, const nsACString& aScope); + + void StopControllingRegistration( + ServiceWorkerRegistrationInfo* aRegistration); + + already_AddRefed + GetServiceWorkerRegistrationInfo(const ClientInfo& aClientInfo) const; + + already_AddRefed + GetServiceWorkerRegistrationInfo(nsIPrincipal* aPrincipal, + nsIURI* aURI) const; + + already_AddRefed + GetServiceWorkerRegistrationInfo(const nsACString& aScopeKey, + nsIURI* aURI) const; + + // This method generates a key using isInElementBrowser from the principal. We + // don't use the origin because it can change during the loading. + static nsresult PrincipalToScopeKey(nsIPrincipal* aPrincipal, + nsACString& aKey); + + static nsresult PrincipalInfoToScopeKey( + const mozilla::ipc::PrincipalInfo& aPrincipalInfo, nsACString& aKey); + + static void AddScopeAndRegistration( + const nsACString& aScope, ServiceWorkerRegistrationInfo* aRegistation); + + static bool HasScope(nsIPrincipal* aPrincipal, const nsACString& aScope); + + static void RemoveScopeAndRegistration( + ServiceWorkerRegistrationInfo* aRegistration); + + void QueueFireEventOnServiceWorkerRegistrations( + ServiceWorkerRegistrationInfo* aRegistration, const nsAString& aName); + + void UpdateClientControllers(ServiceWorkerRegistrationInfo* aRegistration); + + void MaybeRemoveRegistration(ServiceWorkerRegistrationInfo* aRegistration); + + RefPtr mActor; + + bool mShuttingDown; + + nsTArray> mListeners; + + void NotifyListenersOnRegister( + nsIServiceWorkerRegistrationInfo* aRegistration); + + void NotifyListenersOnUnregister( + nsIServiceWorkerRegistrationInfo* aRegistration); + + void ScheduleUpdateTimer(nsIPrincipal* aPrincipal, const nsACString& aScope); + + void UpdateTimerFired(nsIPrincipal* aPrincipal, const nsACString& aScope); + + void MaybeSendUnregister(nsIPrincipal* aPrincipal, const nsACString& aScope); + + nsresult SendNotificationEvent(const nsAString& aEventName, + const nsACString& aOriginSuffix, + const nsACString& aScope, const nsAString& aID, + const nsAString& aTitle, const nsAString& aDir, + const nsAString& aLang, const nsAString& aBody, + const nsAString& aTag, const nsAString& aIcon, + const nsAString& aData, + const nsAString& aBehavior); + + // Used by remove() and removeAll() when clearing history. + // MUST ONLY BE CALLED FROM UnregisterIfMatchesHost! + void ForceUnregister(RegistrationDataPerPrincipal* aRegistrationData, + ServiceWorkerRegistrationInfo* aRegistration); + + // An "orphaned" registration is one that is unregistered and not controlling + // clients. The ServiceWorkerManager must know about all orphaned + // registrations to forcefully shutdown all Service Workers during browser + // shutdown. + void AddOrphanedRegistration(ServiceWorkerRegistrationInfo* aRegistration); + + void RemoveOrphanedRegistration(ServiceWorkerRegistrationInfo* aRegistration); + + HashSet, + PointerHasher> + mOrphanedRegistrations; + + RefPtr mShutdownBlocker; + + nsClassHashtable + mRegistrationInfos; + + struct ControlledClientData { + RefPtr mClientHandle; + RefPtr mRegistrationInfo; + + ControlledClientData(ClientHandle* aClientHandle, + ServiceWorkerRegistrationInfo* aRegistrationInfo) + : mClientHandle(aClientHandle), mRegistrationInfo(aRegistrationInfo) {} + }; + + nsClassHashtable mControlledClients; + + struct PendingReadyData { + RefPtr mClientHandle; + RefPtr mPromise; + + explicit PendingReadyData(ClientHandle* aClientHandle) + : mClientHandle(aClientHandle), + mPromise(new ServiceWorkerRegistrationPromise::Private(__func__)) {} + }; + + nsTArray> mPendingReadyList; +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_workers_serviceworkermanager_h diff --git a/dom/serviceworkers/ServiceWorkerManagerChild.cpp b/dom/serviceworkers/ServiceWorkerManagerChild.cpp new file mode 100644 index 0000000000..5d33f5c084 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerManagerChild.cpp @@ -0,0 +1,110 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerManagerChild.h" +#include "ServiceWorkerManager.h" +#include "ServiceWorkerUpdaterChild.h" +#include "mozilla/Unused.h" + +namespace mozilla { + +using namespace ipc; + +namespace dom { + +mozilla::ipc::IPCResult ServiceWorkerManagerChild::RecvNotifyRegister( + const ServiceWorkerRegistrationData& aData) { + if (mShuttingDown) { + return IPC_OK(); + } + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (swm) { + swm->LoadRegistration(aData); + } + + return IPC_OK(); +} + +mozilla::ipc::IPCResult ServiceWorkerManagerChild::RecvNotifySoftUpdate( + const OriginAttributes& aOriginAttributes, const nsString& aScope) { + if (mShuttingDown) { + return IPC_OK(); + } + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (swm) { + swm->SoftUpdate(aOriginAttributes, NS_ConvertUTF16toUTF8(aScope)); + } + + return IPC_OK(); +} + +mozilla::ipc::IPCResult ServiceWorkerManagerChild::RecvNotifyUnregister( + const PrincipalInfo& aPrincipalInfo, const nsString& aScope) { + if (mShuttingDown) { + return IPC_OK(); + } + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (!swm) { + // browser shutdown + return IPC_OK(); + } + + auto principalOrErr = PrincipalInfoToPrincipal(aPrincipalInfo); + if (NS_WARN_IF(principalOrErr.isErr())) { + return IPC_OK(); + } + + nsCOMPtr principal = principalOrErr.unwrap(); + + nsresult rv = swm->NotifyUnregister(principal, aScope); + Unused << NS_WARN_IF(NS_FAILED(rv)); + return IPC_OK(); +} + +mozilla::ipc::IPCResult ServiceWorkerManagerChild::RecvNotifyRemove( + const nsCString& aHost) { + if (mShuttingDown) { + return IPC_OK(); + } + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (swm) { + swm->Remove(aHost); + } + + return IPC_OK(); +} + +mozilla::ipc::IPCResult ServiceWorkerManagerChild::RecvNotifyRemoveAll() { + if (mShuttingDown) { + return IPC_OK(); + } + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (swm) { + swm->RemoveAll(); + } + + return IPC_OK(); +} + +PServiceWorkerUpdaterChild* +ServiceWorkerManagerChild::AllocPServiceWorkerUpdaterChild( + const OriginAttributes& aOriginAttributes, const nsCString& aScope) { + MOZ_CRASH("Do no use ServiceWorkerUpdaterChild IPC CTOR."); +} + +bool ServiceWorkerManagerChild::DeallocPServiceWorkerUpdaterChild( + PServiceWorkerUpdaterChild* aActor) { + delete aActor; + return true; +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerManagerChild.h b/dom/serviceworkers/ServiceWorkerManagerChild.h new file mode 100644 index 0000000000..93e4072879 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerManagerChild.h @@ -0,0 +1,60 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this file, + * You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_ServiceWorkerManagerChild_h +#define mozilla_dom_ServiceWorkerManagerChild_h + +#include "mozilla/dom/PServiceWorkerManagerChild.h" +#include "mozilla/ipc/BackgroundUtils.h" + +namespace mozilla { + +class OriginAttributes; + +namespace ipc { +class BackgroundChildImpl; +} // namespace ipc + +namespace dom { + +class ServiceWorkerManagerChild final : public PServiceWorkerManagerChild { + friend class mozilla::ipc::BackgroundChildImpl; + + public: + NS_INLINE_DECL_REFCOUNTING(ServiceWorkerManagerChild) + + void ManagerShuttingDown() { mShuttingDown = true; } + + mozilla::ipc::IPCResult RecvNotifyRegister( + const ServiceWorkerRegistrationData& aData); + + mozilla::ipc::IPCResult RecvNotifySoftUpdate( + const OriginAttributes& aOriginAttributes, const nsString& aScope); + + mozilla::ipc::IPCResult RecvNotifyUnregister( + const PrincipalInfo& aPrincipalInfo, const nsString& aScope); + + mozilla::ipc::IPCResult RecvNotifyRemove(const nsCString& aHost); + + mozilla::ipc::IPCResult RecvNotifyRemoveAll(); + + PServiceWorkerUpdaterChild* AllocPServiceWorkerUpdaterChild( + const OriginAttributes& originAttributes, const nsCString& scope); + + bool DeallocPServiceWorkerUpdaterChild(PServiceWorkerUpdaterChild* aActor); + + private: + ServiceWorkerManagerChild() : mShuttingDown(false) {} + + ~ServiceWorkerManagerChild() = default; + + bool mShuttingDown; +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_ServiceWorkerManagerChild_h diff --git a/dom/serviceworkers/ServiceWorkerManagerParent.cpp b/dom/serviceworkers/ServiceWorkerManagerParent.cpp new file mode 100644 index 0000000000..49b9a4511c --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerManagerParent.cpp @@ -0,0 +1,343 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerManagerParent.h" +#include "ServiceWorkerManagerService.h" +#include "ServiceWorkerUpdaterParent.h" +#include "ServiceWorkerUtils.h" +#include "mozilla/dom/ContentParent.h" +#include "mozilla/dom/ServiceWorkerRegistrar.h" +#include "mozilla/ipc/BackgroundParent.h" +#include "mozilla/ipc/BackgroundUtils.h" +#include "mozilla/Unused.h" +#include "nsThreadUtils.h" + +namespace mozilla { + +using namespace ipc; + +namespace dom { + +namespace { + +uint64_t sServiceWorkerManagerParentID = 0; + +class RegisterServiceWorkerCallback final : public Runnable { + public: + RegisterServiceWorkerCallback(const ServiceWorkerRegistrationData& aData, + uint64_t aParentID) + : Runnable("dom::RegisterServiceWorkerCallback"), + mData(aData), + mParentID(aParentID) { + AssertIsInMainProcess(); + AssertIsOnBackgroundThread(); + } + + NS_IMETHOD + Run() override { + AssertIsInMainProcess(); + AssertIsOnBackgroundThread(); + + RefPtr service = + dom::ServiceWorkerRegistrar::Get(); + + // Shutdown during the process of trying to update the registrar. Give + // up on this modification. + if (!service) { + return NS_OK; + } + + service->RegisterServiceWorker(mData); + + RefPtr managerService = + ServiceWorkerManagerService::Get(); + if (managerService) { + managerService->PropagateRegistration(mParentID, mData); + } + + return NS_OK; + } + + private: + ServiceWorkerRegistrationData mData; + const uint64_t mParentID; +}; + +class UnregisterServiceWorkerCallback final : public Runnable { + public: + UnregisterServiceWorkerCallback(const PrincipalInfo& aPrincipalInfo, + const nsString& aScope, uint64_t aParentID) + : Runnable("dom::UnregisterServiceWorkerCallback"), + mPrincipalInfo(aPrincipalInfo), + mScope(aScope), + mParentID(aParentID) { + AssertIsInMainProcess(); + AssertIsOnBackgroundThread(); + } + + NS_IMETHOD + Run() override { + AssertIsInMainProcess(); + AssertIsOnBackgroundThread(); + + RefPtr service = + dom::ServiceWorkerRegistrar::Get(); + + // Shutdown during the process of trying to update the registrar. Give + // up on this modification. + if (!service) { + return NS_OK; + } + + service->UnregisterServiceWorker(mPrincipalInfo, + NS_ConvertUTF16toUTF8(mScope)); + + // We do not propagate the unregister in parent-intercept mode because the + // only point of PropagateUnregister historically is: + // 1. Tell other ServiceWorkerManagers about the removal. There is only 1 + // ServiceWorkerManager in parent-intercept mode. + // 2. To remove the registration as an awkward API for privacy and devtools + // purposes. Although the unregister method is idempotent, it's + // preferable to only call the method once if possible. And we're now + // re-enabling the removal in PropagateUnregister due to a privacy + // regression in bug 1589708, so it makes sense to bail now. + if (ServiceWorkerParentInterceptEnabled()) { + return NS_OK; + } + + RefPtr managerService = + ServiceWorkerManagerService::Get(); + if (managerService) { + managerService->PropagateUnregister(mParentID, mPrincipalInfo, mScope); + } + + return NS_OK; + } + + private: + const PrincipalInfo mPrincipalInfo; + nsString mScope; + uint64_t mParentID; +}; + +class CheckPrincipalWithCallbackRunnable final : public Runnable { + public: + CheckPrincipalWithCallbackRunnable(already_AddRefed aParent, + const PrincipalInfo& aPrincipalInfo, + Runnable* aCallback) + : Runnable("dom::CheckPrincipalWithCallbackRunnable"), + mContentParent(aParent), + mPrincipalInfo(aPrincipalInfo), + mCallback(aCallback), + mBackgroundEventTarget(GetCurrentEventTarget()) { + AssertIsInMainProcess(); + AssertIsOnBackgroundThread(); + + MOZ_ASSERT(mContentParent); + MOZ_ASSERT(mCallback); + MOZ_ASSERT(mBackgroundEventTarget); + } + + NS_IMETHOD Run() override { + if (NS_IsMainThread()) { + mContentParent = nullptr; + + mBackgroundEventTarget->Dispatch(this, NS_DISPATCH_NORMAL); + return NS_OK; + } + + AssertIsOnBackgroundThread(); + mCallback->Run(); + mCallback = nullptr; + + return NS_OK; + } + + private: + RefPtr mContentParent; + PrincipalInfo mPrincipalInfo; + RefPtr mCallback; + nsCOMPtr mBackgroundEventTarget; +}; + +} // namespace + +ServiceWorkerManagerParent::ServiceWorkerManagerParent() + : mService(ServiceWorkerManagerService::GetOrCreate()), + mID(++sServiceWorkerManagerParentID) { + AssertIsOnBackgroundThread(); + mService->RegisterActor(this); +} + +ServiceWorkerManagerParent::~ServiceWorkerManagerParent() { + AssertIsOnBackgroundThread(); +} + +mozilla::ipc::IPCResult ServiceWorkerManagerParent::RecvRegister( + const ServiceWorkerRegistrationData& aData) { + AssertIsInMainProcess(); + AssertIsOnBackgroundThread(); + + // Basic validation. + if (aData.scope().IsEmpty() || + aData.principal().type() == PrincipalInfo::TNullPrincipalInfo || + aData.principal().type() == PrincipalInfo::TSystemPrincipalInfo) { + return IPC_FAIL_NO_REASON(this); + } + + RefPtr callback = + new RegisterServiceWorkerCallback(aData, mID); + + RefPtr parent = BackgroundParent::GetContentParent(Manager()); + + // If the ContentParent is null we are dealing with a same-process actor. + if (!parent) { + callback->Run(); + return IPC_OK(); + } + + RefPtr runnable = + new CheckPrincipalWithCallbackRunnable(parent.forget(), aData.principal(), + callback); + MOZ_ALWAYS_SUCCEEDS(NS_DispatchToMainThread(runnable)); + + return IPC_OK(); +} + +mozilla::ipc::IPCResult ServiceWorkerManagerParent::RecvUnregister( + const PrincipalInfo& aPrincipalInfo, const nsString& aScope) { + AssertIsInMainProcess(); + AssertIsOnBackgroundThread(); + + // Basic validation. + if (aScope.IsEmpty() || + aPrincipalInfo.type() == PrincipalInfo::TNullPrincipalInfo || + aPrincipalInfo.type() == PrincipalInfo::TSystemPrincipalInfo) { + return IPC_FAIL_NO_REASON(this); + } + + RefPtr callback = + new UnregisterServiceWorkerCallback(aPrincipalInfo, aScope, mID); + + RefPtr parent = BackgroundParent::GetContentParent(Manager()); + + // If the ContentParent is null we are dealing with a same-process actor. + if (!parent) { + callback->Run(); + return IPC_OK(); + } + + RefPtr runnable = + new CheckPrincipalWithCallbackRunnable(parent.forget(), aPrincipalInfo, + callback); + MOZ_ALWAYS_SUCCEEDS(NS_DispatchToMainThread(runnable)); + + return IPC_OK(); +} + +mozilla::ipc::IPCResult ServiceWorkerManagerParent::RecvPropagateSoftUpdate( + const OriginAttributes& aOriginAttributes, const nsString& aScope) { + AssertIsOnBackgroundThread(); + + if (NS_WARN_IF(!mService)) { + return IPC_FAIL_NO_REASON(this); + } + + mService->PropagateSoftUpdate(mID, aOriginAttributes, aScope); + return IPC_OK(); +} + +mozilla::ipc::IPCResult ServiceWorkerManagerParent::RecvPropagateUnregister( + const PrincipalInfo& aPrincipalInfo, const nsString& aScope) { + AssertIsOnBackgroundThread(); + + if (NS_WARN_IF(!mService)) { + return IPC_FAIL_NO_REASON(this); + } + + mService->PropagateUnregister(mID, aPrincipalInfo, aScope); + return IPC_OK(); +} + +mozilla::ipc::IPCResult ServiceWorkerManagerParent::RecvPropagateRemove( + const nsCString& aHost) { + AssertIsOnBackgroundThread(); + + if (NS_WARN_IF(!mService)) { + return IPC_FAIL_NO_REASON(this); + } + + mService->PropagateRemove(mID, aHost); + return IPC_OK(); +} + +mozilla::ipc::IPCResult ServiceWorkerManagerParent::RecvPropagateRemoveAll() { + AssertIsOnBackgroundThread(); + + if (NS_WARN_IF(!mService)) { + return IPC_FAIL_NO_REASON(this); + } + + mService->PropagateRemoveAll(mID); + return IPC_OK(); +} + +mozilla::ipc::IPCResult ServiceWorkerManagerParent::RecvShutdown() { + AssertIsOnBackgroundThread(); + + if (NS_WARN_IF(!mService)) { + return IPC_FAIL_NO_REASON(this); + } + + mService->UnregisterActor(this); + mService = nullptr; + + Unused << Send__delete__(this); + return IPC_OK(); +} + +PServiceWorkerUpdaterParent* +ServiceWorkerManagerParent::AllocPServiceWorkerUpdaterParent( + const OriginAttributes& aOriginAttributes, const nsCString& aScope) { + AssertIsOnBackgroundThread(); + return new ServiceWorkerUpdaterParent(); +} + +mozilla::ipc::IPCResult +ServiceWorkerManagerParent::RecvPServiceWorkerUpdaterConstructor( + PServiceWorkerUpdaterParent* aActor, + const OriginAttributes& aOriginAttributes, const nsCString& aScope) { + AssertIsOnBackgroundThread(); + + if (NS_WARN_IF(!mService)) { + return IPC_FAIL_NO_REASON(this); + } + + mService->ProcessUpdaterActor( + static_cast(aActor), aOriginAttributes, + aScope, mID); + return IPC_OK(); +} + +bool ServiceWorkerManagerParent::DeallocPServiceWorkerUpdaterParent( + PServiceWorkerUpdaterParent* aActor) { + AssertIsOnBackgroundThread(); + delete aActor; + return true; +} + +void ServiceWorkerManagerParent::ActorDestroy(ActorDestroyReason aWhy) { + AssertIsOnBackgroundThread(); + + if (mService) { + // This object is about to be released and with it, also mService will be + // released too. + mService->UnregisterActor(this); + } +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerManagerParent.h b/dom/serviceworkers/ServiceWorkerManagerParent.h new file mode 100644 index 0000000000..40e0a62cd0 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerManagerParent.h @@ -0,0 +1,77 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this file, + * You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_ServiceWorkerManagerParent_h +#define mozilla_dom_ServiceWorkerManagerParent_h + +#include "mozilla/dom/PServiceWorkerManagerParent.h" + +namespace mozilla { + +class OriginAttributes; + +namespace ipc { +class BackgroundParentImpl; +} // namespace ipc + +namespace dom { + +class ServiceWorkerManagerService; + +class ServiceWorkerManagerParent final : public PServiceWorkerManagerParent { + friend class mozilla::ipc::BackgroundParentImpl; + friend class PServiceWorkerManagerParent; + + public: + NS_INLINE_DECL_THREADSAFE_REFCOUNTING(ServiceWorkerManagerParent) + + uint64_t ID() const { return mID; } + + private: + ServiceWorkerManagerParent(); + ~ServiceWorkerManagerParent(); + + mozilla::ipc::IPCResult RecvRegister( + const ServiceWorkerRegistrationData& aData); + + mozilla::ipc::IPCResult RecvUnregister(const PrincipalInfo& aPrincipalInfo, + const nsString& aScope); + + mozilla::ipc::IPCResult RecvPropagateSoftUpdate( + const OriginAttributes& aOriginAttributes, const nsString& aScope); + + mozilla::ipc::IPCResult RecvPropagateUnregister( + const PrincipalInfo& aPrincipalInfo, const nsString& aScope); + + mozilla::ipc::IPCResult RecvPropagateRemove(const nsCString& aHost); + + mozilla::ipc::IPCResult RecvPropagateRemoveAll(); + + mozilla::ipc::IPCResult RecvShutdown(); + + PServiceWorkerUpdaterParent* AllocPServiceWorkerUpdaterParent( + const OriginAttributes& aOriginAttributes, const nsCString& aScope); + + virtual mozilla::ipc::IPCResult RecvPServiceWorkerUpdaterConstructor( + PServiceWorkerUpdaterParent* aActor, + const OriginAttributes& aOriginAttributes, + const nsCString& aScope) override; + + bool DeallocPServiceWorkerUpdaterParent(PServiceWorkerUpdaterParent* aActor); + + virtual void ActorDestroy(ActorDestroyReason aWhy) override; + + RefPtr mService; + + // We use this ID in the Service in order to avoid the sending of messages to + // ourself. + uint64_t mID; +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_ServiceWorkerManagerParent_h diff --git a/dom/serviceworkers/ServiceWorkerManagerService.cpp b/dom/serviceworkers/ServiceWorkerManagerService.cpp new file mode 100644 index 0000000000..8539897e00 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerManagerService.cpp @@ -0,0 +1,259 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerManagerService.h" +#include "ServiceWorkerManagerParent.h" +#include "ServiceWorkerRegistrar.h" +#include "ServiceWorkerUpdaterParent.h" +#include "ServiceWorkerUtils.h" +#include "mozilla/dom/ContentParent.h" +#include "mozilla/ipc/BackgroundParent.h" +#include "mozilla/Unused.h" + +namespace mozilla { + +using namespace ipc; + +namespace dom { + +namespace { + +ServiceWorkerManagerService* sInstance = nullptr; + +} // namespace + +ServiceWorkerManagerService::ServiceWorkerManagerService() { + AssertIsOnBackgroundThread(); + + // sInstance is a raw ServiceWorkerManagerService*. + MOZ_ASSERT(!sInstance); + sInstance = this; +} + +ServiceWorkerManagerService::~ServiceWorkerManagerService() { + AssertIsOnBackgroundThread(); + MOZ_ASSERT(sInstance == this); + MOZ_ASSERT(mAgents.Count() == 0); + + sInstance = nullptr; +} + +/* static */ +already_AddRefed +ServiceWorkerManagerService::Get() { + AssertIsOnBackgroundThread(); + + RefPtr instance = sInstance; + return instance.forget(); +} + +/* static */ +already_AddRefed +ServiceWorkerManagerService::GetOrCreate() { + AssertIsOnBackgroundThread(); + + RefPtr instance = sInstance; + if (!instance) { + instance = new ServiceWorkerManagerService(); + } + return instance.forget(); +} + +void ServiceWorkerManagerService::RegisterActor( + ServiceWorkerManagerParent* aParent) { + AssertIsOnBackgroundThread(); + MOZ_ASSERT(aParent); + MOZ_ASSERT(!mAgents.Contains(aParent)); + + mAgents.PutEntry(aParent); +} + +void ServiceWorkerManagerService::UnregisterActor( + ServiceWorkerManagerParent* aParent) { + AssertIsOnBackgroundThread(); + MOZ_ASSERT(aParent); + MOZ_ASSERT(mAgents.Contains(aParent)); + + mAgents.RemoveEntry(aParent); +} + +void ServiceWorkerManagerService::PropagateRegistration( + uint64_t aParentID, ServiceWorkerRegistrationData& aData) { + AssertIsOnBackgroundThread(); + + if (ServiceWorkerParentInterceptEnabled()) { + return; + } + + for (auto iter = mAgents.Iter(); !iter.Done(); iter.Next()) { + RefPtr parent = iter.Get()->GetKey(); + MOZ_ASSERT(parent); + + if (parent->ID() != aParentID) { + Unused << parent->SendNotifyRegister(aData); + } + } + + // Send permissions fot the newly registered service worker to all of the + // content processes. + PrincipalInfo pi = aData.principal(); + NS_DispatchToMainThread(NS_NewRunnableFunction( + "dom::ServiceWorkerManagerService::PropagateRegistration", [pi]() { + nsTArray cps; + ContentParent::GetAll(cps); + for (auto* cp : cps) { + auto principalOrErr = PrincipalInfoToPrincipal(pi); + if (principalOrErr.isOk()) { + nsCOMPtr principal = principalOrErr.unwrap(); + cp->TransmitPermissionsForPrincipal(principal); + } + } + })); +} + +void ServiceWorkerManagerService::PropagateSoftUpdate( + uint64_t aParentID, const OriginAttributes& aOriginAttributes, + const nsAString& aScope) { + AssertIsOnBackgroundThread(); + + if (ServiceWorkerParentInterceptEnabled()) { + return; + } + + for (auto iter = mAgents.Iter(); !iter.Done(); iter.Next()) { + RefPtr parent = iter.Get()->GetKey(); + MOZ_ASSERT(parent); + + nsString scope(aScope); + Unused << parent->SendNotifySoftUpdate(aOriginAttributes, scope); + } +} + +void ServiceWorkerManagerService::PropagateUnregister( + uint64_t aParentID, const PrincipalInfo& aPrincipalInfo, + const nsAString& aScope) { + AssertIsOnBackgroundThread(); + + RefPtr service = + dom::ServiceWorkerRegistrar::Get(); + MOZ_ASSERT(service); + + // It's possible that we don't have any ServiceWorkerManager managing this + // scope but we still need to unregister it from the ServiceWorkerRegistrar. + service->UnregisterServiceWorker(aPrincipalInfo, + NS_ConvertUTF16toUTF8(aScope)); + + // There is no longer any point to propagating because the only sender is the + // one and only ServiceWorkerManager, but it is necessary for us to have run + // the unregister call above because until Bug 1183245 is fixed, + // nsIServiceWorkerManager.propagateUnregister() is a de facto API for + // clearing ServiceWorker registrations by Sanitizer.jsm via + // ServiceWorkerCleanUp.jsm, as well as devtools "unregister" affordance and + // the no-longer-relevant about:serviceworkers UI. + + if (ServiceWorkerParentInterceptEnabled()) { + return; + } + + for (auto iter = mAgents.Iter(); !iter.Done(); iter.Next()) { + RefPtr parent = iter.Get()->GetKey(); + MOZ_ASSERT(parent); + + if (parent->ID() != aParentID) { + nsString scope(aScope); + Unused << parent->SendNotifyUnregister(aPrincipalInfo, scope); + } + } +} + +void ServiceWorkerManagerService::PropagateRemove(uint64_t aParentID, + const nsACString& aHost) { + AssertIsOnBackgroundThread(); + + if (ServiceWorkerParentInterceptEnabled()) { + return; + } + + for (auto iter = mAgents.Iter(); !iter.Done(); iter.Next()) { + RefPtr parent = iter.Get()->GetKey(); + MOZ_ASSERT(parent); + + if (parent->ID() != aParentID) { + nsCString host(aHost); + Unused << parent->SendNotifyRemove(host); + } + } +} + +void ServiceWorkerManagerService::PropagateRemoveAll(uint64_t aParentID) { + AssertIsOnBackgroundThread(); + + if (ServiceWorkerParentInterceptEnabled()) { + return; + } + + RefPtr service = + dom::ServiceWorkerRegistrar::Get(); + MOZ_ASSERT(service); + + service->RemoveAll(); + + for (auto iter = mAgents.Iter(); !iter.Done(); iter.Next()) { + RefPtr parent = iter.Get()->GetKey(); + MOZ_ASSERT(parent); + + if (parent->ID() != aParentID) { + Unused << parent->SendNotifyRemoveAll(); + } + } +} + +void ServiceWorkerManagerService::ProcessUpdaterActor( + ServiceWorkerUpdaterParent* aActor, + const OriginAttributes& aOriginAttributes, const nsACString& aScope, + uint64_t aParentId) { + AssertIsOnBackgroundThread(); + + MOZ_DIAGNOSTIC_ASSERT(!ServiceWorkerParentInterceptEnabled()); + + nsAutoCString suffix; + aOriginAttributes.CreateSuffix(suffix); + + nsCString scope(aScope); + scope.Append(suffix); + + for (uint32_t i = 0; i < mPendingUpdaterActors.Length(); ++i) { + // We already have an actor doing this update on another process. + if (mPendingUpdaterActors[i].mScope.Equals(scope) && + mPendingUpdaterActors[i].mParentId != aParentId) { + Unused << aActor->SendProceed(false); + return; + } + } + + if (aActor->Proceed(this)) { + PendingUpdaterActor* pua = mPendingUpdaterActors.AppendElement(); + pua->mActor = aActor; + pua->mScope = scope; + pua->mParentId = aParentId; + } +} + +void ServiceWorkerManagerService::UpdaterActorDestroyed( + ServiceWorkerUpdaterParent* aActor) { + for (uint32_t i = 0; i < mPendingUpdaterActors.Length(); ++i) { + // We already have an actor doing the update for this scope. + if (mPendingUpdaterActors[i].mActor == aActor) { + mPendingUpdaterActors.RemoveElementAt(i); + return; + } + } + + MOZ_CRASH("The actor should be found"); +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerManagerService.h b/dom/serviceworkers/ServiceWorkerManagerService.h new file mode 100644 index 0000000000..b61adf1bf4 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerManagerService.h @@ -0,0 +1,78 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this file, + * You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_ServiceWorkerManagerService_h +#define mozilla_dom_ServiceWorkerManagerService_h + +#include "nsISupportsImpl.h" +#include "nsHashKeys.h" +#include "nsTArray.h" +#include "nsTHashtable.h" + +namespace mozilla { + +class OriginAttributes; + +namespace ipc { +class PrincipalInfo; +} // namespace ipc + +namespace dom { + +class ServiceWorkerManagerParent; +class ServiceWorkerRegistrationData; +class ServiceWorkerUpdaterParent; + +class ServiceWorkerManagerService final { + public: + NS_INLINE_DECL_REFCOUNTING(ServiceWorkerManagerService) + + static already_AddRefed Get(); + static already_AddRefed GetOrCreate(); + + void RegisterActor(ServiceWorkerManagerParent* aParent); + void UnregisterActor(ServiceWorkerManagerParent* aParent); + + void PropagateRegistration(uint64_t aParentID, + ServiceWorkerRegistrationData& aData); + + void PropagateSoftUpdate(uint64_t aParentID, + const OriginAttributes& aOriginAttributes, + const nsAString& aScope); + + void PropagateUnregister(uint64_t aParentID, + const mozilla::ipc::PrincipalInfo& aPrincipalInfo, + const nsAString& aScope); + + void PropagateRemove(uint64_t aParentID, const nsACString& aHost); + + void PropagateRemoveAll(uint64_t aParentID); + + void ProcessUpdaterActor(ServiceWorkerUpdaterParent* aActor, + const OriginAttributes& aOriginAttributes, + const nsACString& aScope, uint64_t aParentID); + + void UpdaterActorDestroyed(ServiceWorkerUpdaterParent* aActor); + + private: + ServiceWorkerManagerService(); + ~ServiceWorkerManagerService(); + + nsTHashtable> mAgents; + + struct PendingUpdaterActor { + nsCString mScope; + ServiceWorkerUpdaterParent* mActor; + uint64_t mParentId; + }; + + nsTArray mPendingUpdaterActors; +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_ServiceWorkerManagerService_h diff --git a/dom/serviceworkers/ServiceWorkerOp.cpp b/dom/serviceworkers/ServiceWorkerOp.cpp new file mode 100644 index 0000000000..448924f2df --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerOp.cpp @@ -0,0 +1,1729 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerOp.h" + +#include + +#include "js/Exception.h" // JS::ExceptionStack, JS::StealPendingExceptionStack +#include "jsapi.h" + +#include "nsCOMPtr.h" +#include "nsContentUtils.h" +#include "nsDebug.h" +#include "nsError.h" +#include "nsINamed.h" +#include "nsIPushErrorReporter.h" +#include "nsISupportsImpl.h" +#include "nsITimer.h" +#include "nsProxyRelease.h" +#include "nsServiceManagerUtils.h" +#include "nsTArray.h" +#include "nsThreadUtils.h" + +#include "ServiceWorkerCloneData.h" +#include "ServiceWorkerShutdownState.h" +#include "mozilla/Assertions.h" +#include "mozilla/CycleCollectedJSContext.h" +#include "mozilla/DebugOnly.h" +#include "mozilla/ErrorResult.h" +#include "mozilla/OwningNonNull.h" +#include "mozilla/SchedulerGroup.h" +#include "mozilla/ScopeExit.h" +#include "mozilla/Telemetry.h" +#include "mozilla/Unused.h" +#include "mozilla/dom/BindingDeclarations.h" +#include "mozilla/dom/Client.h" +#include "mozilla/dom/ExtendableMessageEventBinding.h" +#include "mozilla/dom/FetchEventBinding.h" +#include "mozilla/dom/FetchEventOpProxyChild.h" +#include "mozilla/dom/InternalHeaders.h" +#include "mozilla/dom/InternalRequest.h" +#include "mozilla/dom/InternalResponse.h" +#include "mozilla/dom/Notification.h" +#include "mozilla/dom/NotificationEvent.h" +#include "mozilla/dom/NotificationEventBinding.h" +#include "mozilla/dom/PushEventBinding.h" +#include "mozilla/dom/RemoteWorkerChild.h" +#include "mozilla/dom/RemoteWorkerService.h" +#include "mozilla/dom/Request.h" +#include "mozilla/dom/Response.h" +#include "mozilla/dom/RootedDictionary.h" +#include "mozilla/dom/ServiceWorkerBinding.h" +#include "mozilla/dom/WorkerCommon.h" +#include "mozilla/dom/WorkerPrivate.h" +#include "mozilla/dom/WorkerRef.h" +#include "mozilla/dom/WorkerScope.h" +#include "mozilla/ipc/IPCStreamUtils.h" +#include "mozilla/net/MozURL.h" + +namespace mozilla { +namespace dom { + +namespace { + +class ExtendableEventKeepAliveHandler final + : public ExtendableEvent::ExtensionsHandler, + public PromiseNativeHandler { + public: + NS_DECL_ISUPPORTS + + static RefPtr Create( + RefPtr aCallback) { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + + RefPtr self = + new ExtendableEventKeepAliveHandler(std::move(aCallback)); + + self->mWorkerRef = StrongWorkerRef::Create( + GetCurrentThreadWorkerPrivate(), "ExtendableEventKeepAliveHandler", + [self]() { self->Cleanup(); }); + + if (NS_WARN_IF(!self->mWorkerRef)) { + return nullptr; + } + + return self; + } + + /** + * ExtendableEvent::ExtensionsHandler interface + */ + bool WaitOnPromise(Promise& aPromise) override { + if (!mAcceptingPromises) { + MOZ_ASSERT(!GetDispatchFlag()); + MOZ_ASSERT(!mSelfRef, "We shouldn't be holding a self reference!"); + return false; + } + + if (!mSelfRef) { + MOZ_ASSERT(!mPendingPromisesCount); + mSelfRef = this; + } + + ++mPendingPromisesCount; + aPromise.AppendNativeHandler(this); + + return true; + } + + /** + * PromiseNativeHandler interface + */ + void ResolvedCallback(JSContext* aCx, JS::Handle aValue) override { + RemovePromise(Resolved); + } + + void RejectedCallback(JSContext* aCx, JS::Handle aValue) override { + RemovePromise(Rejected); + } + + void MaybeDone() { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + MOZ_ASSERT(!GetDispatchFlag()); + + if (mPendingPromisesCount) { + return; + } + + if (mCallback) { + mCallback->FinishedWithResult(mRejected ? Rejected : Resolved); + mCallback = nullptr; + } + + Cleanup(); + } + + private: + /** + * This class is useful for the case where pending microtasks will continue + * extending the event, which means that the event is not "done." For example: + * + * // `e` is an ExtendableEvent, `p` is a Promise + * e.waitUntil(p); + * p.then(() => e.waitUntil(otherPromise)); + */ + class MaybeDoneRunner : public MicroTaskRunnable { + public: + explicit MaybeDoneRunner(RefPtr aHandler) + : mHandler(std::move(aHandler)) {} + + void Run(AutoSlowOperation& /* unused */) override { + mHandler->MaybeDone(); + } + + private: + RefPtr mHandler; + }; + + explicit ExtendableEventKeepAliveHandler( + RefPtr aCallback) + : mCallback(std::move(aCallback)) {} + + ~ExtendableEventKeepAliveHandler() { Cleanup(); } + + void Cleanup() { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + + if (mCallback) { + mCallback->FinishedWithResult(Rejected); + } + + mSelfRef = nullptr; + mWorkerRef = nullptr; + mCallback = nullptr; + mAcceptingPromises = false; + } + + void RemovePromise(ExtendableEventResult aResult) { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + MOZ_DIAGNOSTIC_ASSERT(mPendingPromisesCount > 0); + + // NOTE: mSelfRef can be nullptr here if MaybeCleanup() was just called + // before a promise settled. This can happen, for example, if the worker + // thread is being terminated for running too long, browser shutdown, etc. + + mRejected |= (aResult == Rejected); + + --mPendingPromisesCount; + if (mPendingPromisesCount || GetDispatchFlag()) { + return; + } + + CycleCollectedJSContext* cx = CycleCollectedJSContext::Get(); + MOZ_ASSERT(cx); + + RefPtr r = new MaybeDoneRunner(this); + cx->DispatchToMicroTask(r.forget()); + } + + /** + * We start holding a self reference when the first extension promise is + * added, and this reference is released when the last promise settles or + * when the worker is shutting down. + * + * This is needed in the case that we're waiting indefinitely on a to-be-GC'ed + * promise that's no longer reachable and will never be settled. + */ + RefPtr mSelfRef; + + RefPtr mWorkerRef; + + RefPtr mCallback; + + uint32_t mPendingPromisesCount = 0; + + bool mRejected = false; + bool mAcceptingPromises = true; +}; + +NS_IMPL_ISUPPORTS0(ExtendableEventKeepAliveHandler) + +nsresult DispatchExtendableEventOnWorkerScope( + JSContext* aCx, WorkerGlobalScope* aWorkerScope, ExtendableEvent* aEvent, + RefPtr aCallback) { + MOZ_ASSERT(aCx); + MOZ_ASSERT(aWorkerScope); + MOZ_ASSERT(aEvent); + + nsCOMPtr globalObject = aWorkerScope; + WidgetEvent* internalEvent = aEvent->WidgetEventPtr(); + + RefPtr keepAliveHandler = + ExtendableEventKeepAliveHandler::Create(std::move(aCallback)); + if (NS_WARN_IF(!keepAliveHandler)) { + return NS_ERROR_FAILURE; + } + + // This must be always set *before* dispatching the event, otherwise + // waitUntil() calls will fail. + aEvent->SetKeepAliveHandler(keepAliveHandler); + + ErrorResult result; + aWorkerScope->DispatchEvent(*aEvent, result); + if (NS_WARN_IF(result.Failed())) { + result.SuppressException(); + return NS_ERROR_FAILURE; + } + + keepAliveHandler->MaybeDone(); + + // We don't block the event when getting an exception but still report the + // error message. NOTE: this will not stop the event. + if (internalEvent->mFlags.mExceptionWasRaised) { + return NS_ERROR_XPC_JS_THREW_EXCEPTION; + } + + return NS_OK; +} + +bool DispatchFailed(nsresult aStatus) { + return NS_FAILED(aStatus) && aStatus != NS_ERROR_XPC_JS_THREW_EXCEPTION; +} + +} // anonymous namespace + +class ServiceWorkerOp::ServiceWorkerOpRunnable : public WorkerDebuggeeRunnable { + public: + NS_DECL_ISUPPORTS_INHERITED + + ServiceWorkerOpRunnable(RefPtr aOwner, + WorkerPrivate* aWorkerPrivate) + : WorkerDebuggeeRunnable(aWorkerPrivate, WorkerThreadModifyBusyCount), + mOwner(std::move(aOwner)) { + AssertIsOnMainThread(); + MOZ_ASSERT(mOwner); + MOZ_ASSERT(aWorkerPrivate); + } + + private: + ~ServiceWorkerOpRunnable() = default; + + bool WorkerRun(JSContext* aCx, WorkerPrivate* aWorkerPrivate) override { + MOZ_ASSERT(aWorkerPrivate); + aWorkerPrivate->AssertIsOnWorkerThread(); + MOZ_ASSERT(aWorkerPrivate->IsServiceWorker()); + MOZ_ASSERT(mOwner); + + bool rv = mOwner->Exec(aCx, aWorkerPrivate); + Unused << NS_WARN_IF(!rv); + mOwner = nullptr; + + return rv; + } + + nsresult Cancel() override { + MOZ_ASSERT(mOwner); + + mOwner->RejectAll(NS_ERROR_DOM_ABORT_ERR); + mOwner = nullptr; + + return WorkerRunnable::Cancel(); + } + + RefPtr mOwner; +}; + +NS_IMPL_ISUPPORTS_INHERITED0(ServiceWorkerOp::ServiceWorkerOpRunnable, + WorkerRunnable) + +bool ServiceWorkerOp::MaybeStart(RemoteWorkerChild* aOwner, + RemoteWorkerChild::State& aState) { + MOZ_ASSERT(!mStarted); + MOZ_ASSERT(aOwner); + MOZ_ASSERT(aOwner->GetOwningEventTarget()->IsOnCurrentThread()); + + auto launcherData = aOwner->mLauncherData.Access(); + + if (NS_WARN_IF(!launcherData->mIPCActive)) { + RejectAll(NS_ERROR_DOM_ABORT_ERR); + mStarted = true; + return true; + } + + // Allow termination to happen while the Service Worker is initializing. + if (aState.is() && !IsTerminationOp()) { + return false; + } + + if (NS_WARN_IF(aState.is()) || + NS_WARN_IF(aState.is())) { + RejectAll(NS_ERROR_DOM_INVALID_STATE_ERR); + mStarted = true; + return true; + } + + MOZ_ASSERT(aState.is() || IsTerminationOp()); + + RefPtr self = this; + + if (IsTerminationOp()) { + aOwner->GetTerminationPromise()->Then( + GetCurrentSerialEventTarget(), __func__, + [self]( + const GenericNonExclusivePromise::ResolveOrRejectValue& aResult) { + MaybeReportServiceWorkerShutdownProgress(self->mArgs, true); + + MOZ_ASSERT(!self->mPromiseHolder.IsEmpty()); + + if (NS_WARN_IF(aResult.IsReject())) { + self->mPromiseHolder.Reject(aResult.RejectValue(), __func__); + return; + } + + self->mPromiseHolder.Resolve(NS_OK, __func__); + }); + } + + RefPtr owner = aOwner; + + nsCOMPtr r = NS_NewRunnableFunction( + __func__, [self = std::move(self), owner = std::move(owner)]() mutable { + MaybeReportServiceWorkerShutdownProgress(self->mArgs); + + auto lock = owner->mState.Lock(); + auto& state = lock.ref(); + + if (NS_WARN_IF(!state.is() && !self->IsTerminationOp())) { + self->RejectAll(NS_ERROR_DOM_INVALID_STATE_ERR); + return; + } + + if (self->IsTerminationOp()) { + owner->CloseWorkerOnMainThread(state); + } else { + MOZ_ASSERT(state.is()); + + RefPtr workerRunnable = + self->GetRunnable(state.as().mWorkerPrivate); + + if (NS_WARN_IF(!workerRunnable->Dispatch())) { + self->RejectAll(NS_ERROR_FAILURE); + } + } + + nsCOMPtr target = owner->GetOwningEventTarget(); + NS_ProxyRelease(__func__, target, owner.forget()); + }); + + mStarted = true; + + MOZ_ALWAYS_SUCCEEDS( + SchedulerGroup::Dispatch(TaskCategory::Other, r.forget())); + + return true; +} + +void ServiceWorkerOp::Cancel() { RejectAll(NS_ERROR_DOM_ABORT_ERR); } + +ServiceWorkerOp::ServiceWorkerOp( + ServiceWorkerOpArgs&& aArgs, + std::function&& aCallback) + : mArgs(std::move(aArgs)) { + MOZ_ASSERT(RemoteWorkerService::Thread()->IsOnCurrentThread()); + + RefPtr promise = mPromiseHolder.Ensure(__func__); + + promise->Then( + GetCurrentSerialEventTarget(), __func__, + [callback = std::move(aCallback)]( + ServiceWorkerOpPromise::ResolveOrRejectValue&& aResult) mutable { + if (NS_WARN_IF(aResult.IsReject())) { + MOZ_ASSERT(NS_FAILED(aResult.RejectValue())); + callback(aResult.RejectValue()); + return; + } + + callback(aResult.ResolveValue()); + }); +} + +ServiceWorkerOp::~ServiceWorkerOp() { + Unused << NS_WARN_IF(!mPromiseHolder.IsEmpty()); + mPromiseHolder.RejectIfExists(NS_ERROR_DOM_ABORT_ERR, __func__); +} + +bool ServiceWorkerOp::Started() const { + MOZ_ASSERT(RemoteWorkerService::Thread()->IsOnCurrentThread()); + + return mStarted; +} + +bool ServiceWorkerOp::IsTerminationOp() const { + return mArgs.type() == + ServiceWorkerOpArgs::TServiceWorkerTerminateWorkerOpArgs; +} + +RefPtr ServiceWorkerOp::GetRunnable( + WorkerPrivate* aWorkerPrivate) { + AssertIsOnMainThread(); + MOZ_ASSERT(aWorkerPrivate); + + return new ServiceWorkerOpRunnable(this, aWorkerPrivate); +} + +void ServiceWorkerOp::RejectAll(nsresult aStatus) { + MOZ_ASSERT(!mPromiseHolder.IsEmpty()); + mPromiseHolder.Reject(aStatus, __func__); +} + +class CheckScriptEvaluationOp final : public ServiceWorkerOp { + using ServiceWorkerOp::ServiceWorkerOp; + + public: + NS_INLINE_DECL_THREADSAFE_REFCOUNTING(CheckScriptEvaluationOp, override) + + private: + ~CheckScriptEvaluationOp() = default; + + bool Exec(JSContext* aCx, WorkerPrivate* aWorkerPrivate) override { + MOZ_ASSERT(aWorkerPrivate); + aWorkerPrivate->AssertIsOnWorkerThread(); + MOZ_ASSERT(aWorkerPrivate->IsServiceWorker()); + MOZ_ASSERT(!mPromiseHolder.IsEmpty()); + + ServiceWorkerCheckScriptEvaluationOpResult result; + result.workerScriptExecutedSuccessfully() = + aWorkerPrivate->WorkerScriptExecutedSuccessfully(); + result.fetchHandlerWasAdded() = aWorkerPrivate->FetchHandlerWasAdded(); + + mPromiseHolder.Resolve(result, __func__); + + return true; + } +}; + +class TerminateServiceWorkerOp final : public ServiceWorkerOp { + using ServiceWorkerOp::ServiceWorkerOp; + + public: + NS_INLINE_DECL_THREADSAFE_REFCOUNTING(TerminateServiceWorkerOp, override) + + private: + ~TerminateServiceWorkerOp() = default; + + bool Exec(JSContext*, WorkerPrivate*) override { + MOZ_ASSERT_UNREACHABLE( + "Worker termination should be handled in " + "`ServiceWorkerOp::MaybeStart()`"); + + return false; + } +}; + +class UpdateServiceWorkerStateOp final : public ServiceWorkerOp { + using ServiceWorkerOp::ServiceWorkerOp; + + public: + NS_INLINE_DECL_THREADSAFE_REFCOUNTING(UpdateServiceWorkerStateOp, override); + + private: + class UpdateStateOpRunnable final : public MainThreadWorkerControlRunnable { + public: + NS_DECL_ISUPPORTS_INHERITED + + UpdateStateOpRunnable(RefPtr aOwner, + WorkerPrivate* aWorkerPrivate) + : MainThreadWorkerControlRunnable(aWorkerPrivate), + mOwner(std::move(aOwner)) { + AssertIsOnMainThread(); + MOZ_ASSERT(mOwner); + MOZ_ASSERT(aWorkerPrivate); + } + + private: + ~UpdateStateOpRunnable() = default; + + bool WorkerRun(JSContext* aCx, WorkerPrivate* aWorkerPrivate) override { + MOZ_ASSERT(aWorkerPrivate); + aWorkerPrivate->AssertIsOnWorkerThread(); + MOZ_ASSERT(aWorkerPrivate->IsServiceWorker()); + + if (mOwner) { + Unused << mOwner->Exec(aCx, aWorkerPrivate); + mOwner = nullptr; + } + + return true; + } + + nsresult Cancel() override { + MOZ_ASSERT(mOwner); + + mOwner->RejectAll(NS_ERROR_DOM_ABORT_ERR); + mOwner = nullptr; + + return MainThreadWorkerControlRunnable::Cancel(); + } + + RefPtr mOwner; + }; + + ~UpdateServiceWorkerStateOp() = default; + + RefPtr GetRunnable(WorkerPrivate* aWorkerPrivate) override { + AssertIsOnMainThread(); + MOZ_ASSERT(aWorkerPrivate); + MOZ_ASSERT(mArgs.type() == + ServiceWorkerOpArgs::TServiceWorkerUpdateStateOpArgs); + + return new UpdateStateOpRunnable(this, aWorkerPrivate); + } + + bool Exec(JSContext* aCx, WorkerPrivate* aWorkerPrivate) override { + MOZ_ASSERT(aWorkerPrivate); + aWorkerPrivate->AssertIsOnWorkerThread(); + MOZ_ASSERT(aWorkerPrivate->IsServiceWorker()); + MOZ_ASSERT(!mPromiseHolder.IsEmpty()); + + ServiceWorkerState state = + mArgs.get_ServiceWorkerUpdateStateOpArgs().state(); + aWorkerPrivate->UpdateServiceWorkerState(state); + + mPromiseHolder.Resolve(NS_OK, __func__); + + return true; + } +}; + +NS_IMPL_ISUPPORTS_INHERITED0(UpdateServiceWorkerStateOp::UpdateStateOpRunnable, + MainThreadWorkerControlRunnable) + +void ExtendableEventOp::FinishedWithResult(ExtendableEventResult aResult) { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + MOZ_ASSERT(!mPromiseHolder.IsEmpty()); + + mPromiseHolder.Resolve(aResult == Resolved ? NS_OK : NS_ERROR_FAILURE, + __func__); +} + +class LifeCycleEventOp final : public ExtendableEventOp { + using ExtendableEventOp::ExtendableEventOp; + + public: + NS_INLINE_DECL_THREADSAFE_REFCOUNTING(LifeCycleEventOp, override) + + private: + ~LifeCycleEventOp() = default; + + bool Exec(JSContext* aCx, WorkerPrivate* aWorkerPrivate) override { + MOZ_ASSERT(aWorkerPrivate); + aWorkerPrivate->AssertIsOnWorkerThread(); + MOZ_ASSERT(aWorkerPrivate->IsServiceWorker()); + MOZ_ASSERT(!mPromiseHolder.IsEmpty()); + + RefPtr event; + RefPtr target = aWorkerPrivate->GlobalScope(); + + const nsString& eventName = + mArgs.get_ServiceWorkerLifeCycleEventOpArgs().eventName(); + + if (eventName.EqualsASCII("install") || eventName.EqualsASCII("activate")) { + ExtendableEventInit init; + init.mBubbles = false; + init.mCancelable = false; + event = ExtendableEvent::Constructor(target, eventName, init); + } else { + MOZ_CRASH("Unexpected lifecycle event"); + } + + event->SetTrusted(true); + + nsresult rv = DispatchExtendableEventOnWorkerScope( + aCx, aWorkerPrivate->GlobalScope(), event, this); + + if (NS_WARN_IF(DispatchFailed(rv))) { + RejectAll(rv); + } + + return !DispatchFailed(rv); + } +}; + +/** + * PushEventOp + */ +class PushEventOp final : public ExtendableEventOp { + using ExtendableEventOp::ExtendableEventOp; + + public: + NS_INLINE_DECL_THREADSAFE_REFCOUNTING(PushEventOp, override) + + private: + ~PushEventOp() = default; + + bool Exec(JSContext* aCx, WorkerPrivate* aWorkerPrivate) override { + MOZ_ASSERT(aWorkerPrivate); + aWorkerPrivate->AssertIsOnWorkerThread(); + MOZ_ASSERT(aWorkerPrivate->IsServiceWorker()); + MOZ_ASSERT(!mPromiseHolder.IsEmpty()); + + ErrorResult result; + + auto scopeExit = MakeScopeExit([&] { + MOZ_ASSERT(result.Failed()); + + RejectAll(result.StealNSResult()); + ReportError(aWorkerPrivate); + }); + + const ServiceWorkerPushEventOpArgs& args = + mArgs.get_ServiceWorkerPushEventOpArgs(); + + PushEventInit pushEventInit; + + if (args.data().type() != OptionalPushData::Tvoid_t) { + auto& bytes = args.data().get_ArrayOfuint8_t(); + JSObject* data = + Uint8Array::Create(aCx, bytes.Length(), bytes.Elements()); + + if (!data) { + result = ErrorResult(NS_ERROR_FAILURE); + return false; + } + + DebugOnly inited = + pushEventInit.mData.Construct().SetAsArrayBufferView().Init(data); + MOZ_ASSERT(inited); + } + + pushEventInit.mBubbles = false; + pushEventInit.mCancelable = false; + + GlobalObject globalObj(aCx, aWorkerPrivate->GlobalScope()->GetWrapper()); + RefPtr pushEvent = + PushEvent::Constructor(globalObj, u"push"_ns, pushEventInit, result); + + if (NS_WARN_IF(result.Failed())) { + return false; + } + + pushEvent->SetTrusted(true); + + scopeExit.release(); + + nsresult rv = DispatchExtendableEventOnWorkerScope( + aCx, aWorkerPrivate->GlobalScope(), pushEvent, this); + + if (NS_FAILED(rv)) { + if (NS_WARN_IF(DispatchFailed(rv))) { + RejectAll(rv); + } + + // We don't cancel WorkerPrivate when catching an exception. + ReportError(aWorkerPrivate, + nsIPushErrorReporter::DELIVERY_UNCAUGHT_EXCEPTION); + } + + return !DispatchFailed(rv); + } + + void FinishedWithResult(ExtendableEventResult aResult) override { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + + WorkerPrivate* workerPrivate = GetCurrentThreadWorkerPrivate(); + + if (aResult == Rejected) { + ReportError(workerPrivate, + nsIPushErrorReporter::DELIVERY_UNHANDLED_REJECTION); + } + + ExtendableEventOp::FinishedWithResult(aResult); + } + + void ReportError( + WorkerPrivate* aWorkerPrivate, + uint16_t aError = nsIPushErrorReporter::DELIVERY_INTERNAL_ERROR) { + MOZ_ASSERT(aWorkerPrivate); + aWorkerPrivate->AssertIsOnWorkerThread(); + MOZ_ASSERT(aWorkerPrivate->IsServiceWorker()); + + if (NS_WARN_IF(aError > nsIPushErrorReporter::DELIVERY_INTERNAL_ERROR) || + mArgs.get_ServiceWorkerPushEventOpArgs().messageId().IsEmpty()) { + return; + } + + nsString messageId = mArgs.get_ServiceWorkerPushEventOpArgs().messageId(); + nsCOMPtr r = NS_NewRunnableFunction( + __func__, [messageId = std::move(messageId), error = aError] { + nsCOMPtr reporter = + do_GetService("@mozilla.org/push/Service;1"); + + if (reporter) { + nsresult rv = reporter->ReportDeliveryError(messageId, error); + Unused << NS_WARN_IF(NS_FAILED(rv)); + } + }); + + MOZ_ALWAYS_SUCCEEDS(aWorkerPrivate->DispatchToMainThread(r.forget())); + } +}; + +class PushSubscriptionChangeEventOp final : public ExtendableEventOp { + using ExtendableEventOp::ExtendableEventOp; + + public: + NS_INLINE_DECL_THREADSAFE_REFCOUNTING(PushSubscriptionChangeEventOp, override) + + private: + ~PushSubscriptionChangeEventOp() = default; + + bool Exec(JSContext* aCx, WorkerPrivate* aWorkerPrivate) override { + MOZ_ASSERT(aWorkerPrivate); + aWorkerPrivate->AssertIsOnWorkerThread(); + MOZ_ASSERT(aWorkerPrivate->IsServiceWorker()); + MOZ_ASSERT(!mPromiseHolder.IsEmpty()); + + RefPtr target = aWorkerPrivate->GlobalScope(); + + ExtendableEventInit init; + init.mBubbles = false; + init.mCancelable = false; + + RefPtr event = ExtendableEvent::Constructor( + target, u"pushsubscriptionchange"_ns, init); + event->SetTrusted(true); + + nsresult rv = DispatchExtendableEventOnWorkerScope( + aCx, aWorkerPrivate->GlobalScope(), event, this); + + if (NS_WARN_IF(DispatchFailed(rv))) { + RejectAll(rv); + } + + return !DispatchFailed(rv); + } +}; + +class NotificationEventOp : public ExtendableEventOp, + public nsITimerCallback, + public nsINamed { + using ExtendableEventOp::ExtendableEventOp; + + public: + NS_DECL_THREADSAFE_ISUPPORTS + + private: + ~NotificationEventOp() { + MOZ_DIAGNOSTIC_ASSERT(!mTimer); + MOZ_DIAGNOSTIC_ASSERT(!mWorkerRef); + } + + void ClearWindowAllowed(WorkerPrivate* aWorkerPrivate) { + MOZ_ASSERT(aWorkerPrivate); + aWorkerPrivate->AssertIsOnWorkerThread(); + MOZ_ASSERT(aWorkerPrivate->IsServiceWorker()); + + if (!mTimer) { + return; + } + + // This might be executed after the global was unrooted, in which case + // GlobalScope() will return null. Making the check here just to be safe. + WorkerGlobalScope* globalScope = aWorkerPrivate->GlobalScope(); + if (!globalScope) { + return; + } + + globalScope->ConsumeWindowInteraction(); + mTimer->Cancel(); + mTimer = nullptr; + + mWorkerRef = nullptr; + } + + void StartClearWindowTimer(WorkerPrivate* aWorkerPrivate) { + MOZ_ASSERT(aWorkerPrivate); + aWorkerPrivate->AssertIsOnWorkerThread(); + MOZ_ASSERT(!mTimer); + + nsresult rv; + nsCOMPtr timer = + NS_NewTimer(aWorkerPrivate->ControlEventTarget()); + if (NS_WARN_IF(!timer)) { + return; + } + + MOZ_ASSERT(!mWorkerRef); + RefPtr self = this; + mWorkerRef = StrongWorkerRef::Create( + aWorkerPrivate, "NotificationEventOp", [self = std::move(self)] { + // We could try to hold the worker alive until the timer fires, but + // other APIs are not likely to work in this partially shutdown state. + // We might as well let the worker thread exit. + self->ClearWindowAllowed(self->mWorkerRef->Private()); + }); + + if (!mWorkerRef) { + return; + } + + aWorkerPrivate->GlobalScope()->AllowWindowInteraction(); + timer.swap(mTimer); + + // We swap first and then initialize the timer so that even if initializing + // fails, we still clean the busy count and interaction count correctly. + // The timer can't be initialized before modyfing the busy count since the + // timer thread could run and call the timeout but the worker may + // already be terminating and modifying the busy count could fail. + uint32_t delay = mArgs.get_ServiceWorkerNotificationEventOpArgs() + .disableOpenClickDelay(); + rv = mTimer->InitWithCallback(this, delay, nsITimer::TYPE_ONE_SHOT); + + if (NS_WARN_IF(NS_FAILED(rv))) { + ClearWindowAllowed(aWorkerPrivate); + return; + } + } + + // ExtendableEventOp interface + bool Exec(JSContext* aCx, WorkerPrivate* aWorkerPrivate) override { + MOZ_ASSERT(aWorkerPrivate); + aWorkerPrivate->AssertIsOnWorkerThread(); + MOZ_ASSERT(aWorkerPrivate->IsServiceWorker()); + MOZ_ASSERT(!mPromiseHolder.IsEmpty()); + + RefPtr target = aWorkerPrivate->GlobalScope(); + + ServiceWorkerNotificationEventOpArgs& args = + mArgs.get_ServiceWorkerNotificationEventOpArgs(); + + ErrorResult result; + RefPtr notification = Notification::ConstructFromFields( + aWorkerPrivate->GlobalScope(), args.id(), args.title(), args.dir(), + args.lang(), args.body(), args.tag(), args.icon(), args.data(), + args.scope(), result); + + if (NS_WARN_IF(result.Failed())) { + return false; + } + + NotificationEventInit init; + init.mNotification = notification; + init.mBubbles = false; + init.mCancelable = false; + + RefPtr notificationEvent = + NotificationEvent::Constructor(target, args.eventName(), init); + + notificationEvent->SetTrusted(true); + + if (args.eventName().EqualsLiteral("notificationclick")) { + StartClearWindowTimer(aWorkerPrivate); + } + + nsresult rv = DispatchExtendableEventOnWorkerScope( + aCx, aWorkerPrivate->GlobalScope(), notificationEvent, this); + + if (NS_WARN_IF(DispatchFailed(rv))) { + // This will reject mPromiseHolder. + FinishedWithResult(Rejected); + } + + return !DispatchFailed(rv); + } + + void FinishedWithResult(ExtendableEventResult aResult) override { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + + WorkerPrivate* workerPrivate = GetCurrentThreadWorkerPrivate(); + MOZ_ASSERT(workerPrivate); + + ClearWindowAllowed(workerPrivate); + + ExtendableEventOp::FinishedWithResult(aResult); + } + + // nsITimerCallback interface + NS_IMETHOD Notify(nsITimer* aTimer) override { + MOZ_DIAGNOSTIC_ASSERT(mTimer == aTimer); + WorkerPrivate* workerPrivate = GetCurrentThreadWorkerPrivate(); + ClearWindowAllowed(workerPrivate); + return NS_OK; + } + + // nsINamed interface + NS_IMETHOD GetName(nsACString& aName) override { + aName.AssignLiteral("NotificationEventOp"); + return NS_OK; + } + + nsCOMPtr mTimer; + RefPtr mWorkerRef; +}; + +NS_IMPL_ISUPPORTS(NotificationEventOp, nsITimerCallback, nsINamed) + +class MessageEventOp final : public ExtendableEventOp { + using ExtendableEventOp::ExtendableEventOp; + + public: + NS_INLINE_DECL_THREADSAFE_REFCOUNTING(MessageEventOp, override) + + MessageEventOp(ServiceWorkerOpArgs&& aArgs, + std::function&& aCallback) + : ExtendableEventOp(std::move(aArgs), std::move(aCallback)), + mData(new ServiceWorkerCloneData()) { + mData->CopyFromClonedMessageDataForBackgroundChild( + mArgs.get_ServiceWorkerMessageEventOpArgs().clonedData()); + } + + private: + ~MessageEventOp() = default; + + bool Exec(JSContext* aCx, WorkerPrivate* aWorkerPrivate) override { + MOZ_ASSERT(aWorkerPrivate); + aWorkerPrivate->AssertIsOnWorkerThread(); + MOZ_ASSERT(aWorkerPrivate->IsServiceWorker()); + MOZ_ASSERT(!mPromiseHolder.IsEmpty()); + + JS::Rooted messageData(aCx); + nsCOMPtr sgo = aWorkerPrivate->GlobalScope(); + ErrorResult rv; + if (!mData->IsErrorMessageData()) { + mData->Read(aCx, &messageData, rv); + } + + // If mData is an error message data, then it means that it failed to + // serialize on the caller side because it contains a shared memory object. + // If deserialization fails, we will fire a messageerror event. + const bool deserializationFailed = + rv.Failed() || mData->IsErrorMessageData(); + + Sequence> ports; + if (!mData->TakeTransferredPortsAsSequence(ports)) { + RejectAll(NS_ERROR_FAILURE); + rv.SuppressException(); + return false; + } + + RootedDictionary init(aCx); + + init.mBubbles = false; + init.mCancelable = false; + + // On a messageerror event, we disregard ports: + // https://w3c.github.io/ServiceWorker/#service-worker-postmessage + if (!deserializationFailed) { + init.mData = messageData; + init.mPorts = std::move(ports); + } + + RefPtr mozUrl; + nsresult result = net::MozURL::Init( + getter_AddRefs(mozUrl), mArgs.get_ServiceWorkerMessageEventOpArgs() + .clientInfoAndState() + .info() + .url()); + if (NS_WARN_IF(NS_FAILED(result))) { + RejectAll(result); + rv.SuppressException(); + return false; + } + + nsCString origin; + mozUrl->Origin(origin); + + CopyUTF8toUTF16(origin, init.mOrigin); + + init.mSource.SetValue().SetAsClient() = new Client( + sgo, mArgs.get_ServiceWorkerMessageEventOpArgs().clientInfoAndState()); + + rv.SuppressException(); + RefPtr target = aWorkerPrivate->GlobalScope(); + RefPtr extendableEvent = + ExtendableMessageEvent::Constructor( + target, deserializationFailed ? u"messageerror"_ns : u"message"_ns, + init); + + extendableEvent->SetTrusted(true); + + nsresult rv2 = DispatchExtendableEventOnWorkerScope( + aCx, aWorkerPrivate->GlobalScope(), extendableEvent, this); + + if (NS_WARN_IF(DispatchFailed(rv2))) { + RejectAll(rv2); + } + + return !DispatchFailed(rv2); + } + + RefPtr mData; +}; + +/** + * Used for ScopeExit-style network request cancelation in + * `ResolvedCallback()` (e.g. if `FetchEvent::RespondWith()` is resolved with + * a non-JS object). + */ +class MOZ_STACK_CLASS FetchEventOp::AutoCancel { + public: + explicit AutoCancel(FetchEventOp* aOwner) + : mOwner(aOwner), + mLine(0), + mColumn(0), + mMessageName("InterceptionFailedWithURL"_ns) { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + MOZ_ASSERT(mOwner); + + nsAutoString requestURL; + mOwner->GetRequestURL(requestURL); + mParams.AppendElement(requestURL); + } + + ~AutoCancel() { + if (mOwner) { + if (mSourceSpec.IsEmpty()) { + mOwner->AsyncLog(mMessageName, std::move(mParams)); + } else { + mOwner->AsyncLog(mSourceSpec, mLine, mColumn, mMessageName, + std::move(mParams)); + } + + MOZ_ASSERT(!mOwner->mRespondWithPromiseHolder.IsEmpty()); + mOwner->mHandled->MaybeRejectWithNetworkError("AutoCancel"_ns); + mOwner->mRespondWithPromiseHolder.Reject(NS_ERROR_INTERCEPTION_FAILED, + __func__); + } + } + + // This function steals the error message from a ErrorResult. + void SetCancelErrorResult(JSContext* aCx, ErrorResult& aRv) { + MOZ_DIAGNOSTIC_ASSERT(aRv.Failed()); + MOZ_DIAGNOSTIC_ASSERT(!JS_IsExceptionPending(aCx)); + + // Storing the error as exception in the JSContext. + if (!aRv.MaybeSetPendingException(aCx)) { + return; + } + + MOZ_ASSERT(!aRv.Failed()); + + // Let's take the pending exception. + JS::ExceptionStack exnStack(aCx); + if (!JS::StealPendingExceptionStack(aCx, &exnStack)) { + return; + } + + // Converting the exception in a JS::ErrorReportBuilder. + JS::ErrorReportBuilder report(aCx); + if (!report.init(aCx, exnStack, JS::ErrorReportBuilder::WithSideEffects)) { + JS_ClearPendingException(aCx); + return; + } + + MOZ_ASSERT(mOwner); + MOZ_ASSERT(mMessageName.EqualsLiteral("InterceptionFailedWithURL")); + MOZ_ASSERT(mParams.Length() == 1); + + // Let's store the error message here. + mMessageName.Assign(report.toStringResult().c_str()); + mParams.Clear(); + } + + template + void SetCancelMessage(const nsACString& aMessageName, Params&&... aParams) { + MOZ_ASSERT(mOwner); + MOZ_ASSERT(mMessageName.EqualsLiteral("InterceptionFailedWithURL")); + MOZ_ASSERT(mParams.Length() == 1); + mMessageName = aMessageName; + mParams.Clear(); + StringArrayAppender::Append(mParams, sizeof...(Params), + std::forward(aParams)...); + } + + template + void SetCancelMessageAndLocation(const nsACString& aSourceSpec, + uint32_t aLine, uint32_t aColumn, + const nsACString& aMessageName, + Params&&... aParams) { + MOZ_ASSERT(mOwner); + MOZ_ASSERT(mMessageName.EqualsLiteral("InterceptionFailedWithURL")); + MOZ_ASSERT(mParams.Length() == 1); + + mSourceSpec = aSourceSpec; + mLine = aLine; + mColumn = aColumn; + + mMessageName = aMessageName; + mParams.Clear(); + StringArrayAppender::Append(mParams, sizeof...(Params), + std::forward(aParams)...); + } + + void Reset() { mOwner = nullptr; } + + private: + FetchEventOp* MOZ_NON_OWNING_REF mOwner; + nsCString mSourceSpec; + uint32_t mLine; + uint32_t mColumn; + nsCString mMessageName; + nsTArray mParams; +}; + +NS_IMPL_ISUPPORTS0(FetchEventOp) + +void FetchEventOp::SetActor(RefPtr aActor) { + MOZ_ASSERT(RemoteWorkerService::Thread()->IsOnCurrentThread()); + MOZ_ASSERT(!Started()); + MOZ_ASSERT(!mActor); + + mActor = std::move(aActor); +} + +void FetchEventOp::RevokeActor(FetchEventOpProxyChild* aActor) { + MOZ_ASSERT(aActor); + MOZ_ASSERT_IF(mActor, mActor == aActor); + + mActor = nullptr; +} + +RefPtr FetchEventOp::GetRespondWithPromise() { + MOZ_ASSERT(RemoteWorkerService::Thread()->IsOnCurrentThread()); + MOZ_ASSERT(!Started()); + MOZ_ASSERT(mRespondWithPromiseHolder.IsEmpty()); + + return mRespondWithPromiseHolder.Ensure(__func__); +} + +void FetchEventOp::RespondWithCalledAt(const nsCString& aRespondWithScriptSpec, + uint32_t aRespondWithLineNumber, + uint32_t aRespondWithColumnNumber) { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + MOZ_ASSERT(!mRespondWithClosure); + + mRespondWithClosure.emplace(aRespondWithScriptSpec, aRespondWithLineNumber, + aRespondWithColumnNumber); +} + +void FetchEventOp::ReportCanceled(const nsCString& aPreventDefaultScriptSpec, + uint32_t aPreventDefaultLineNumber, + uint32_t aPreventDefaultColumnNumber) { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + MOZ_ASSERT(mActor); + MOZ_ASSERT(!mPromiseHolder.IsEmpty()); + + nsString requestURL; + GetRequestURL(requestURL); + + AsyncLog(aPreventDefaultScriptSpec, aPreventDefaultLineNumber, + aPreventDefaultColumnNumber, "InterceptionCanceledWithURL"_ns, + {std::move(requestURL)}); +} + +FetchEventOp::~FetchEventOp() { + mRespondWithPromiseHolder.RejectIfExists(NS_ERROR_DOM_ABORT_ERR, __func__); + + if (mActor) { + NS_ProxyRelease("FetchEventOp::mActor", RemoteWorkerService::Thread(), + mActor.forget()); + } +} + +void FetchEventOp::RejectAll(nsresult aStatus) { + MOZ_ASSERT(!mRespondWithPromiseHolder.IsEmpty()); + MOZ_ASSERT(!mPromiseHolder.IsEmpty()); + + mRespondWithPromiseHolder.Reject(aStatus, __func__); + mPromiseHolder.Reject(aStatus, __func__); +} + +void FetchEventOp::FinishedWithResult(ExtendableEventResult aResult) { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + MOZ_ASSERT(!mPromiseHolder.IsEmpty()); + MOZ_ASSERT(!mResult); + + mResult.emplace(aResult); + + /** + * This should only return early if neither waitUntil() nor respondWith() + * are called. The early return is so that mRespondWithPromiseHolder has a + * chance to settle before mPromiseHolder does. + */ + if (!mPostDispatchChecksDone) { + return; + } + + MaybeFinished(); +} + +void FetchEventOp::MaybeFinished() { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + MOZ_ASSERT(!mPromiseHolder.IsEmpty()); + + if (mResult) { + // It's possible that mRespondWithPromiseHolder wasn't settled. That happens + // if the worker was terminated before the respondWith promise settled. + + mHandled = nullptr; + + ServiceWorkerFetchEventOpResult result( + mResult.value() == Resolved ? NS_OK : NS_ERROR_FAILURE); + + mPromiseHolder.Resolve(result, __func__); + } +} + +bool FetchEventOp::Exec(JSContext* aCx, WorkerPrivate* aWorkerPrivate) { + aWorkerPrivate->AssertIsOnWorkerThread(); + MOZ_ASSERT(aWorkerPrivate->IsServiceWorker()); + MOZ_ASSERT(!mRespondWithPromiseHolder.IsEmpty()); + MOZ_ASSERT(!mPromiseHolder.IsEmpty()); + + nsresult rv = DispatchFetchEvent(aCx, aWorkerPrivate); + + if (NS_WARN_IF(NS_FAILED(rv))) { + RejectAll(rv); + } + + return NS_SUCCEEDED(rv); +} + +void FetchEventOp::AsyncLog(const nsCString& aMessageName, + nsTArray aParams) { + MOZ_ASSERT(mActor); + MOZ_ASSERT(!mPromiseHolder.IsEmpty()); + MOZ_ASSERT(mRespondWithClosure); + + const FetchEventRespondWithClosure& closure = mRespondWithClosure.ref(); + + AsyncLog(closure.respondWithScriptSpec(), closure.respondWithLineNumber(), + closure.respondWithColumnNumber(), aMessageName, std::move(aParams)); +} + +void FetchEventOp::AsyncLog(const nsCString& aScriptSpec, uint32_t aLineNumber, + uint32_t aColumnNumber, + const nsCString& aMessageName, + nsTArray aParams) { + MOZ_ASSERT(mActor); + MOZ_ASSERT(!mPromiseHolder.IsEmpty()); + + // Capture `this` because FetchEventOpProxyChild (mActor) is not thread + // safe, so an AddRef from RefPtr's constructor will + // assert. + RefPtr self = this; + + nsCOMPtr r = NS_NewRunnableFunction( + __func__, [self = std::move(self), spec = aScriptSpec, line = aLineNumber, + column = aColumnNumber, messageName = aMessageName, + params = std::move(aParams)] { + if (NS_WARN_IF(!self->mActor)) { + return; + } + + Unused << self->mActor->SendAsyncLog(spec, line, column, messageName, + params); + }); + + MOZ_ALWAYS_SUCCEEDS( + RemoteWorkerService::Thread()->Dispatch(r.forget(), NS_DISPATCH_NORMAL)); +} + +void FetchEventOp::GetRequestURL(nsAString& aOutRequestURL) { + nsTArray& urls = + mArgs.get_ServiceWorkerFetchEventOpArgs().internalRequest().urlList(); + MOZ_ASSERT(!urls.IsEmpty()); + + CopyUTF8toUTF16(urls.LastElement(), aOutRequestURL); +} + +void FetchEventOp::ResolvedCallback(JSContext* aCx, + JS::Handle aValue) { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + MOZ_ASSERT(mRespondWithClosure); + MOZ_ASSERT(!mRespondWithPromiseHolder.IsEmpty()); + MOZ_ASSERT(!mPromiseHolder.IsEmpty()); + + nsAutoString requestURL; + GetRequestURL(requestURL); + + AutoCancel autoCancel(this); + + if (!aValue.isObject()) { + NS_WARNING( + "FetchEvent::RespondWith was passed a promise resolved to a " + "non-Object " + "value"); + + nsCString sourceSpec; + uint32_t line = 0; + uint32_t column = 0; + nsString valueString; + nsContentUtils::ExtractErrorValues(aCx, aValue, sourceSpec, &line, &column, + valueString); + + autoCancel.SetCancelMessageAndLocation(sourceSpec, line, column, + "InterceptedNonResponseWithURL"_ns, + requestURL, valueString); + return; + } + + RefPtr response; + nsresult rv = UNWRAP_OBJECT(Response, &aValue.toObject(), response); + if (NS_FAILED(rv)) { + nsCString sourceSpec; + uint32_t line = 0; + uint32_t column = 0; + nsString valueString; + nsContentUtils::ExtractErrorValues(aCx, aValue, sourceSpec, &line, &column, + valueString); + + autoCancel.SetCancelMessageAndLocation(sourceSpec, line, column, + "InterceptedNonResponseWithURL"_ns, + requestURL, valueString); + return; + } + + WorkerPrivate* worker = GetCurrentThreadWorkerPrivate(); + MOZ_ASSERT(worker); + worker->AssertIsOnWorkerThread(); + + // Section "HTTP Fetch", step 3.3: + // If one of the following conditions is true, return a network error: + // * response's type is "error". + // * request's mode is not "no-cors" and response's type is "opaque". + // * request's redirect mode is not "manual" and response's type is + // "opaqueredirect". + // * request's redirect mode is not "follow" and response's url list + // has more than one item. + + if (response->Type() == ResponseType::Error) { + autoCancel.SetCancelMessage("InterceptedErrorResponseWithURL"_ns, + requestURL); + return; + } + + const ServiceWorkerFetchEventOpArgs& args = + mArgs.get_ServiceWorkerFetchEventOpArgs(); + const RequestMode requestMode = args.internalRequest().requestMode(); + + if (response->Type() == ResponseType::Opaque && + requestMode != RequestMode::No_cors) { + NS_ConvertASCIItoUTF16 modeString( + RequestModeValues::GetString(requestMode)); + + nsAutoString requestURL; + GetRequestURL(requestURL); + + autoCancel.SetCancelMessage("BadOpaqueInterceptionRequestModeWithURL"_ns, + requestURL, modeString); + return; + } + + const RequestRedirect requestRedirectMode = + args.internalRequest().requestRedirect(); + + if (requestRedirectMode != RequestRedirect::Manual && + response->Type() == ResponseType::Opaqueredirect) { + autoCancel.SetCancelMessage("BadOpaqueRedirectInterceptionWithURL"_ns, + requestURL); + return; + } + + if (requestRedirectMode != RequestRedirect::Follow && + response->Redirected()) { + autoCancel.SetCancelMessage("BadRedirectModeInterceptionWithURL"_ns, + requestURL); + return; + } + + { + ErrorResult error; + bool bodyUsed = response->GetBodyUsed(error); + error.WouldReportJSException(); + if (NS_WARN_IF(error.Failed())) { + autoCancel.SetCancelErrorResult(aCx, error); + return; + } + if (NS_WARN_IF(bodyUsed)) { + autoCancel.SetCancelMessage("InterceptedUsedResponseWithURL"_ns, + requestURL); + return; + } + } + + RefPtr ir = response->GetInternalResponse(); + if (NS_WARN_IF(!ir)) { + return; + } + + // An extra safety check to make sure our invariant that opaque and cors + // responses always have a URL does not break. + if (NS_WARN_IF((response->Type() == ResponseType::Opaque || + response->Type() == ResponseType::Cors) && + ir->GetUnfilteredURL().IsEmpty())) { + MOZ_DIAGNOSTIC_ASSERT(false, "Cors or opaque Response without a URL"); + return; + } + + Telemetry::ScalarAdd(Telemetry::ScalarID::SW_SYNTHESIZED_RES_COUNT, 1); + + if (requestMode == RequestMode::Same_origin && + response->Type() == ResponseType::Cors) { + Telemetry::ScalarAdd(Telemetry::ScalarID::SW_CORS_RES_FOR_SO_REQ_COUNT, 1); + + // XXXtt: Will have a pref to enable the quirk response in bug 1419684. + // The variadic template provided by StringArrayAppender requires exactly + // an nsString. + NS_ConvertUTF8toUTF16 responseURL(ir->GetUnfilteredURL()); + autoCancel.SetCancelMessage("CorsResponseForSameOriginRequest"_ns, + requestURL, responseURL); + return; + } + + nsCOMPtr body; + ir->GetUnfilteredBody(getter_AddRefs(body)); + // Errors and redirects may not have a body. + if (body) { + ErrorResult error; + response->SetBodyUsed(aCx, error); + error.WouldReportJSException(); + if (NS_WARN_IF(error.Failed())) { + autoCancel.SetCancelErrorResult(aCx, error); + return; + } + } + + if (!ir->GetChannelInfo().IsInitialized()) { + // This is a synthetic response (I think and hope so). + ir->InitChannelInfo(worker->GetChannelInfo()); + } + + autoCancel.Reset(); + + // https://w3c.github.io/ServiceWorker/#on-fetch-request-algorithm Step 26: If + // eventHandled is not null, then resolve eventHandled. + // + // mRespondWithPromiseHolder will resolve a MozPromise that will resolve on + // the worker owner's thread, so it's fine to resolve the mHandled promise now + // because content will not interfere with respondWith getting the Response to + // where it's going. + mHandled->MaybeResolveWithUndefined(); + mRespondWithPromiseHolder.Resolve( + FetchEventRespondWithResult( + SynthesizeResponseArgs(ir, mRespondWithClosure.ref())), + __func__); +} + +void FetchEventOp::RejectedCallback(JSContext* aCx, + JS::Handle aValue) { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + MOZ_ASSERT(mRespondWithClosure); + MOZ_ASSERT(!mRespondWithPromiseHolder.IsEmpty()); + MOZ_ASSERT(!mPromiseHolder.IsEmpty()); + + FetchEventRespondWithClosure& closure = mRespondWithClosure.ref(); + + nsCString sourceSpec = closure.respondWithScriptSpec(); + uint32_t line = closure.respondWithLineNumber(); + uint32_t column = closure.respondWithColumnNumber(); + nsString valueString; + + nsContentUtils::ExtractErrorValues(aCx, aValue, sourceSpec, &line, &column, + valueString); + + nsString requestURL; + GetRequestURL(requestURL); + + AsyncLog(sourceSpec, line, column, "InterceptionRejectedResponseWithURL"_ns, + {std::move(requestURL), valueString}); + + // https://w3c.github.io/ServiceWorker/#on-fetch-request-algorithm Step 25.1: + // If eventHandled is not null, then reject eventHandled with a "NetworkError" + // DOMException in workerRealm. + mHandled->MaybeRejectWithNetworkError( + "FetchEvent.respondWith() Promise rejected"_ns); + mRespondWithPromiseHolder.Resolve( + FetchEventRespondWithResult( + CancelInterceptionArgs(NS_ERROR_INTERCEPTION_FAILED)), + __func__); +} + +nsresult FetchEventOp::DispatchFetchEvent(JSContext* aCx, + WorkerPrivate* aWorkerPrivate) { + MOZ_ASSERT(aCx); + MOZ_ASSERT(aWorkerPrivate); + aWorkerPrivate->AssertIsOnWorkerThread(); + MOZ_ASSERT(aWorkerPrivate->IsServiceWorker()); + + ServiceWorkerFetchEventOpArgs& args = + mArgs.get_ServiceWorkerFetchEventOpArgs(); + + /** + * Step 1: get the InternalRequest. The InternalRequest can't be constructed + * here from mArgs because the IPCStream has to be deserialized on the + * thread receiving the ServiceWorkerFetchEventOpArgs. + * FetchEventOpProxyChild will have already deserialized the stream on the + * correct thread before creating this op, so we can take its saved + * InternalRequest. + */ + SafeRefPtr internalRequest = + mActor->ExtractInternalRequest(); + + /** + * Step 2: get the worker's global object + */ + GlobalObject globalObject(aCx, aWorkerPrivate->GlobalScope()->GetWrapper()); + nsCOMPtr globalObjectAsSupports = + do_QueryInterface(globalObject.GetAsSupports()); + if (NS_WARN_IF(!globalObjectAsSupports)) { + return NS_ERROR_DOM_INVALID_STATE_ERR; + } + + /** + * Step 3: create the public DOM Request object + * TODO: this Request object should be created with an AbortSignal object + * which should be aborted if the loading is aborted. See but 1394102. + */ + RefPtr request = + new Request(globalObjectAsSupports, internalRequest.clonePtr(), nullptr); + MOZ_ASSERT_IF(internalRequest->IsNavigationRequest(), + request->Redirect() == RequestRedirect::Manual); + + /** + * Step 4a: create the FetchEventInit + */ + RootedDictionary fetchEventInit(aCx); + fetchEventInit.mRequest = request; + fetchEventInit.mBubbles = false; + fetchEventInit.mCancelable = true; + + /** + * TODO: only expose the FetchEvent.clientId on subresource requests for + * now. Once we implement .targetClientId we can then start exposing + * .clientId on non-subresource requests as well. See bug 1487534. + */ + if (!args.clientId().IsEmpty() && !internalRequest->IsNavigationRequest()) { + fetchEventInit.mClientId = args.clientId(); + } + + /* + * https://w3c.github.io/ServiceWorker/#on-fetch-request-algorithm + * + * "If request is a non-subresource request and request’s + * destination is not "report", initialize e’s resultingClientId attribute + * to reservedClient’s [resultingClient's] id, and to the empty string + * otherwise." (Step 18.8) + */ + if (!args.resultingClientId().IsEmpty() && args.isNonSubresourceRequest() && + internalRequest->Destination() != RequestDestination::Report) { + fetchEventInit.mResultingClientId = args.resultingClientId(); + } + + /** + * Step 4b: create the FetchEvent + */ + RefPtr fetchEvent = + FetchEvent::Constructor(globalObject, u"fetch"_ns, fetchEventInit); + fetchEvent->SetTrusted(true); + fetchEvent->PostInit(args.workerScriptSpec(), this); + mHandled = fetchEvent->Handled(); + + /** + * Step 5: Dispatch the FetchEvent to the worker's global object + */ + nsresult rv = DispatchExtendableEventOnWorkerScope( + aCx, aWorkerPrivate->GlobalScope(), fetchEvent, this); + bool dispatchFailed = NS_FAILED(rv) && rv != NS_ERROR_XPC_JS_THREW_EXCEPTION; + + if (NS_WARN_IF(dispatchFailed)) { + mHandled = nullptr; + return rv; + } + + /** + * At this point, there are 4 (legal) scenarios: + * + * 1) If neither waitUntil() nor respondWith() are called, + * DispatchExtendableEventOnWorkerScope() will have already called + * FinishedWithResult(), but this call will have recorded the result + * (mResult) and returned early so that mRespondWithPromiseHolder can be + * settled first. mRespondWithPromiseHolder will be settled below, followed + * by a call to MaybeFinished() which settles mPromiseHolder. + * + * 2) If waitUntil() is called at least once, and respondWith() is not + * called, DispatchExtendableEventOnWorkerScope() will NOT have called + * FinishedWithResult(). We'll settle mRespondWithPromiseHolder first, and + * at some point in the future when the last waitUntil() promise settles, + * FinishedWithResult() will be called, settling mPromiseHolder. + * + * 3) If waitUntil() is not called, and respondWith() is called, + * DispatchExtendableEventOnWorkerScope() will NOT have called + * FinishedWithResult(). We can also guarantee that + * mRespondWithPromiseHolder will be settled before mPromiseHolder, due to + * the Promise::AppendNativeHandler() call ordering in + * FetchEvent::RespondWith(). + * + * 4) If waitUntil() is called at least once, and respondWith() is also + * called, the effect is similar to scenario 3), with the most imporant + * property being mRespondWithPromiseHolder settling before mPromiseHolder. + * + * Note that if mPromiseHolder is settled before mRespondWithPromiseHolder, + * FetchEventOpChild will cancel the interception. + */ + if (!fetchEvent->WaitToRespond()) { + MOZ_ASSERT(!mRespondWithPromiseHolder.IsEmpty()); + MOZ_ASSERT(!aWorkerPrivate->UsesSystemPrincipal(), + "We don't support system-principal serviceworkers"); + + if (fetchEvent->DefaultPrevented(CallerType::NonSystem)) { + // https://w3c.github.io/ServiceWorker/#on-fetch-request-algorithm + // Step 24.1.1: If eventHandled is not null, then reject eventHandled with + // a "NetworkError" DOMException in workerRealm. + mHandled->MaybeRejectWithNetworkError( + "FetchEvent.preventDefault() called"_ns); + mRespondWithPromiseHolder.Resolve( + FetchEventRespondWithResult( + CancelInterceptionArgs(NS_ERROR_INTERCEPTION_FAILED)), + __func__); + } else { + // https://w3c.github.io/ServiceWorker/#on-fetch-request-algorithm + // Step 24.2: If eventHandled is not null, then resolve eventHandled. + mHandled->MaybeResolveWithUndefined(); + mRespondWithPromiseHolder.Resolve( + FetchEventRespondWithResult(ResetInterceptionArgs()), __func__); + } + } else { + MOZ_ASSERT(mRespondWithClosure); + } + + mPostDispatchChecksDone = true; + MaybeFinished(); + + return NS_OK; +} + +/* static */ already_AddRefed ServiceWorkerOp::Create( + ServiceWorkerOpArgs&& aArgs, + std::function&& aCallback) { + MOZ_ASSERT(RemoteWorkerService::Thread()->IsOnCurrentThread()); + + RefPtr op; + + switch (aArgs.type()) { + case ServiceWorkerOpArgs::TServiceWorkerCheckScriptEvaluationOpArgs: + op = MakeRefPtr(std::move(aArgs), + std::move(aCallback)); + break; + case ServiceWorkerOpArgs::TServiceWorkerUpdateStateOpArgs: + op = MakeRefPtr(std::move(aArgs), + std::move(aCallback)); + break; + case ServiceWorkerOpArgs::TServiceWorkerTerminateWorkerOpArgs: + op = MakeRefPtr(std::move(aArgs), + std::move(aCallback)); + break; + case ServiceWorkerOpArgs::TServiceWorkerLifeCycleEventOpArgs: + op = MakeRefPtr(std::move(aArgs), std::move(aCallback)); + break; + case ServiceWorkerOpArgs::TServiceWorkerPushEventOpArgs: + op = MakeRefPtr(std::move(aArgs), std::move(aCallback)); + break; + case ServiceWorkerOpArgs::TServiceWorkerPushSubscriptionChangeEventOpArgs: + op = MakeRefPtr(std::move(aArgs), + std::move(aCallback)); + break; + case ServiceWorkerOpArgs::TServiceWorkerNotificationEventOpArgs: + op = MakeRefPtr(std::move(aArgs), + std::move(aCallback)); + break; + case ServiceWorkerOpArgs::TServiceWorkerMessageEventOpArgs: + op = MakeRefPtr(std::move(aArgs), std::move(aCallback)); + break; + case ServiceWorkerOpArgs::TServiceWorkerFetchEventOpArgs: + op = MakeRefPtr(std::move(aArgs), std::move(aCallback)); + break; + default: + MOZ_CRASH("Unknown Service Worker operation!"); + return nullptr; + } + + return op.forget(); +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerOp.h b/dom/serviceworkers/ServiceWorkerOp.h new file mode 100644 index 0000000000..b553154f12 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerOp.h @@ -0,0 +1,180 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworkerop_h__ +#define mozilla_dom_serviceworkerop_h__ + +#include + +#include "nsISupportsImpl.h" + +#include "ServiceWorkerEvents.h" +#include "ServiceWorkerOpPromise.h" +#include "mozilla/Attributes.h" +#include "mozilla/Maybe.h" +#include "mozilla/RefPtr.h" +#include "mozilla/dom/PromiseNativeHandler.h" +#include "mozilla/dom/RemoteWorkerChild.h" +#include "mozilla/dom/ServiceWorkerOpArgs.h" +#include "mozilla/dom/WorkerRunnable.h" + +namespace mozilla { +namespace dom { + +class FetchEventOpProxyChild; + +class ServiceWorkerOp : public RemoteWorkerChild::Op { + public: + // `aCallback` will be called when the operation completes or is canceled. + static already_AddRefed Create( + ServiceWorkerOpArgs&& aArgs, + std::function&& aCallback); + + ServiceWorkerOp( + ServiceWorkerOpArgs&& aArgs, + std::function&& aCallback); + + ServiceWorkerOp(const ServiceWorkerOp&) = delete; + + ServiceWorkerOp& operator=(const ServiceWorkerOp&) = delete; + + ServiceWorkerOp(ServiceWorkerOp&&) = default; + + ServiceWorkerOp& operator=(ServiceWorkerOp&&) = default; + + // Returns `true` if the operation has started and `false` otherwise. + bool MaybeStart(RemoteWorkerChild* aOwner, + RemoteWorkerChild::State& aState) final; + + void Cancel() final; + + protected: + ~ServiceWorkerOp(); + + bool Started() const; + + bool IsTerminationOp() const; + + // Override to provide a runnable that's not a `ServiceWorkerOpRunnable.` + virtual RefPtr GetRunnable(WorkerPrivate* aWorkerPrivate); + + // Overridden by ServiceWorkerOp subclasses, it should return true when + // the ServiceWorkerOp was executed successfully (and false if it did fail). + // Content throwing an exception during event dispatch is still considered + // success. + virtual bool Exec(JSContext* aCx, WorkerPrivate* aWorkerPrivate) = 0; + + // Override to reject any additional MozPromises that subclasses may contain. + virtual void RejectAll(nsresult aStatus); + + ServiceWorkerOpArgs mArgs; + + // Subclasses must settle this promise when appropriate. + MozPromiseHolder mPromiseHolder; + + private: + class ServiceWorkerOpRunnable; + + bool mStarted = false; +}; + +class ExtendableEventOp : public ServiceWorkerOp, + public ExtendableEventCallback { + using ServiceWorkerOp::ServiceWorkerOp; + + protected: + ~ExtendableEventOp() = default; + + void FinishedWithResult(ExtendableEventResult aResult) override; +}; + +class FetchEventOp final : public ExtendableEventOp, + public PromiseNativeHandler { + using ExtendableEventOp::ExtendableEventOp; + + public: + NS_DECL_THREADSAFE_ISUPPORTS + + /** + * This must be called once and only once before the first call to + * `MaybeStart()`; `aActor` will be used for `AsyncLog()` and + * `ReportCanceled().` + */ + void SetActor(RefPtr aActor); + + void RevokeActor(FetchEventOpProxyChild* aActor); + + // This must be called at most once before the first call to `MaybeStart().` + RefPtr GetRespondWithPromise(); + + // This must be called when `FetchEvent::RespondWith()` is called. + void RespondWithCalledAt(const nsCString& aRespondWithScriptSpec, + uint32_t aRespondWithLineNumber, + uint32_t aRespondWithColumnNumber); + + void ReportCanceled(const nsCString& aPreventDefaultScriptSpec, + uint32_t aPreventDefaultLineNumber, + uint32_t aPreventDefaultColumnNumber); + + private: + class AutoCancel; + + ~FetchEventOp(); + + bool Exec(JSContext* aCx, WorkerPrivate* aWorkerPrivate) override; + + void RejectAll(nsresult aStatus) override; + + void FinishedWithResult(ExtendableEventResult aResult) override; + + /** + * `{Resolved,Reject}Callback()` are use to handle the + * `FetchEvent::RespondWith()` promise. + */ + void ResolvedCallback(JSContext* aCx, JS::Handle aValue) override; + + void RejectedCallback(JSContext* aCx, JS::Handle aValue) override; + + void MaybeFinished(); + + // Requires mRespondWithClosure to be non-empty. + void AsyncLog(const nsCString& aMessageName, nsTArray aParams); + + void AsyncLog(const nsCString& aScriptSpec, uint32_t aLineNumber, + uint32_t aColumnNumber, const nsCString& aMessageName, + nsTArray aParams); + + void GetRequestURL(nsAString& aOutRequestURL); + + // A failure code means that the dispatch failed. + nsresult DispatchFetchEvent(JSContext* aCx, WorkerPrivate* aWorkerPrivate); + + // Worker Launcher thread only. Used for `AsyncLog().` + RefPtr mActor; + + /** + * Created on the Worker Launcher thread and settled on the worker thread. + * If this isn't settled before `mPromiseHolder` (which it should be), + * `FetchEventOpChild` will cancel the intercepted network request. + */ + MozPromiseHolder mRespondWithPromiseHolder; + + // Worker thread only. + Maybe mResult; + bool mPostDispatchChecksDone = false; + + // Worker thread only; set when `FetchEvent::RespondWith()` is called. + Maybe mRespondWithClosure; + + // Must be set to `nullptr` on the worker thread because `Promise`'s + // destructor must be called on the worker thread. + RefPtr mHandled; +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_serviceworkerop_h__ diff --git a/dom/serviceworkers/ServiceWorkerOpArgs.ipdlh b/dom/serviceworkers/ServiceWorkerOpArgs.ipdlh new file mode 100644 index 0000000000..4c3504ed47 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerOpArgs.ipdlh @@ -0,0 +1,132 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +include ChannelInfo; +include ClientIPCTypes; +include DOMTypes; +include FetchTypes; + +include "mozilla/dom/ServiceWorkerIPCUtils.h"; + +using ServiceWorkerState from "mozilla/dom/ServiceWorkerBinding.h"; + +namespace mozilla { +namespace dom { + +/** + * ServiceWorkerOpArgs + */ +struct ServiceWorkerCheckScriptEvaluationOpArgs {}; + +struct ServiceWorkerUpdateStateOpArgs { + ServiceWorkerState state; +}; + +struct ServiceWorkerTerminateWorkerOpArgs { + uint32_t shutdownStateId; +}; + +struct ServiceWorkerLifeCycleEventOpArgs { + nsString eventName; +}; + +// Possibly need to differentiate an empty array from the absence of an array. +union OptionalPushData { + void_t; + uint8_t[]; +}; + +struct ServiceWorkerPushEventOpArgs { + nsString messageId; + OptionalPushData data; +}; + +struct ServiceWorkerPushSubscriptionChangeEventOpArgs {}; + +struct ServiceWorkerNotificationEventOpArgs { + nsString eventName; + nsString id; + nsString title; + nsString dir; + nsString lang; + nsString body; + nsString tag; + nsString icon; + nsString data; + nsString behavior; + nsString scope; + uint32_t disableOpenClickDelay; +}; + +struct ServiceWorkerMessageEventOpArgs { + ClientInfoAndState clientInfoAndState; + ClonedOrErrorMessageData clonedData; +}; + +struct ServiceWorkerFetchEventOpArgs { + nsCString workerScriptSpec; + IPCInternalRequest internalRequest; + nsString clientId; + nsString resultingClientId; + bool isNonSubresourceRequest; +}; + +union ServiceWorkerOpArgs { + ServiceWorkerCheckScriptEvaluationOpArgs; + ServiceWorkerUpdateStateOpArgs; + ServiceWorkerTerminateWorkerOpArgs; + ServiceWorkerLifeCycleEventOpArgs; + ServiceWorkerPushEventOpArgs; + ServiceWorkerPushSubscriptionChangeEventOpArgs; + ServiceWorkerNotificationEventOpArgs; + ServiceWorkerMessageEventOpArgs; + ServiceWorkerFetchEventOpArgs; +}; + +/** + * IPCFetchEventRespondWithResult + */ +struct FetchEventRespondWithClosure { + nsCString respondWithScriptSpec; + uint32_t respondWithLineNumber; + uint32_t respondWithColumnNumber; +}; + +struct IPCSynthesizeResponseArgs { + IPCInternalResponse internalResponse; + FetchEventRespondWithClosure closure; +}; + +struct ResetInterceptionArgs {}; + +struct CancelInterceptionArgs { + nsresult status; +}; + +union IPCFetchEventRespondWithResult { + IPCSynthesizeResponseArgs; + ResetInterceptionArgs; + CancelInterceptionArgs; +}; + +/** + * ServiceWorkerOpResult + */ +struct ServiceWorkerCheckScriptEvaluationOpResult { + bool workerScriptExecutedSuccessfully; + bool fetchHandlerWasAdded; +}; + +struct ServiceWorkerFetchEventOpResult { + nsresult rv; +}; + +union ServiceWorkerOpResult { + nsresult; + ServiceWorkerCheckScriptEvaluationOpResult; + ServiceWorkerFetchEventOpResult; +}; + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerOpPromise.h b/dom/serviceworkers/ServiceWorkerOpPromise.h new file mode 100644 index 0000000000..f38aad358f --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerOpPromise.h @@ -0,0 +1,40 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworkeroppromise_h__ +#define mozilla_dom_serviceworkeroppromise_h__ + +#include + +#include "mozilla/MozPromise.h" +#include "mozilla/RefPtr.h" +#include "mozilla/dom/ServiceWorkerOpArgs.h" + +namespace mozilla { +namespace dom { + +class InternalResponse; + +using SynthesizeResponseArgs = + std::pair, FetchEventRespondWithClosure>; + +using FetchEventRespondWithResult = + Variant; + +using FetchEventRespondWithPromise = + MozPromise; + +using ServiceWorkerOpPromise = + MozPromise; + +using ServiceWorkerFetchEventOpPromise = + MozPromise; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_serviceworkeroppromise_h__ diff --git a/dom/serviceworkers/ServiceWorkerParent.cpp b/dom/serviceworkers/ServiceWorkerParent.cpp new file mode 100644 index 0000000000..87d81987e0 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerParent.cpp @@ -0,0 +1,64 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerParent.h" + +#include "ServiceWorkerCloneData.h" +#include "ServiceWorkerProxy.h" +#include "mozilla/dom/ClientInfo.h" +#include "mozilla/dom/ClientState.h" +#include "mozilla/dom/ipc/StructuredCloneData.h" + +namespace mozilla { +namespace dom { + +using mozilla::dom::ipc::StructuredCloneData; +using mozilla::ipc::IPCResult; + +void ServiceWorkerParent::ActorDestroy(ActorDestroyReason aReason) { + if (mProxy) { + mProxy->RevokeActor(this); + mProxy = nullptr; + } +} + +IPCResult ServiceWorkerParent::RecvTeardown() { + MaybeSendDelete(); + return IPC_OK(); +} + +IPCResult ServiceWorkerParent::RecvPostMessage( + const ClonedOrErrorMessageData& aClonedData, + const ClientInfoAndState& aSource) { + RefPtr data = new ServiceWorkerCloneData(); + data->CopyFromClonedMessageDataForBackgroundParent(aClonedData); + + mProxy->PostMessage(std::move(data), ClientInfo(aSource.info()), + ClientState::FromIPC(aSource.state())); + + return IPC_OK(); +} + +ServiceWorkerParent::ServiceWorkerParent() : mDeleteSent(false) {} + +ServiceWorkerParent::~ServiceWorkerParent() { MOZ_DIAGNOSTIC_ASSERT(!mProxy); } + +void ServiceWorkerParent::Init(const IPCServiceWorkerDescriptor& aDescriptor) { + MOZ_DIAGNOSTIC_ASSERT(!mProxy); + mProxy = new ServiceWorkerProxy(ServiceWorkerDescriptor(aDescriptor)); + mProxy->Init(this); +} + +void ServiceWorkerParent::MaybeSendDelete() { + if (mDeleteSent) { + return; + } + mDeleteSent = true; + Unused << Send__delete__(this); +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerParent.h b/dom/serviceworkers/ServiceWorkerParent.h new file mode 100644 index 0000000000..f3a4138cbf --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerParent.h @@ -0,0 +1,46 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworkerparent_h__ +#define mozilla_dom_serviceworkerparent_h__ + +#include "mozilla/dom/PServiceWorkerParent.h" + +namespace mozilla { +namespace dom { + +class IPCServiceWorkerDescriptor; +class ServiceWorkerProxy; + +class ServiceWorkerParent final : public PServiceWorkerParent { + RefPtr mProxy; + bool mDeleteSent; + + ~ServiceWorkerParent(); + + // PServiceWorkerParent + void ActorDestroy(ActorDestroyReason aReason) override; + + mozilla::ipc::IPCResult RecvTeardown() override; + + mozilla::ipc::IPCResult RecvPostMessage( + const ClonedOrErrorMessageData& aClonedData, + const ClientInfoAndState& aSource) override; + + public: + NS_INLINE_DECL_REFCOUNTING(ServiceWorkerParent, override); + + ServiceWorkerParent(); + + void Init(const IPCServiceWorkerDescriptor& aDescriptor); + + void MaybeSendDelete(); +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_serviceworkerparent_h__ diff --git a/dom/serviceworkers/ServiceWorkerPrivate.cpp b/dom/serviceworkers/ServiceWorkerPrivate.cpp new file mode 100644 index 0000000000..10536d0797 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerPrivate.cpp @@ -0,0 +1,2139 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerPrivate.h" + +#include + +#include "ServiceWorkerCloneData.h" +#include "ServiceWorkerManager.h" +#include "ServiceWorkerPrivateImpl.h" +#include "ServiceWorkerUtils.h" +#include "nsContentUtils.h" +#include "nsICacheInfoChannel.h" +#include "nsIHttpChannel.h" +#include "nsIHttpChannelInternal.h" +#include "nsIHttpHeaderVisitor.h" +#include "nsINamed.h" +#include "nsINetworkInterceptController.h" +#include "nsIPushErrorReporter.h" +#include "nsISupportsImpl.h" +#include "nsIUploadChannel2.h" +#include "nsNetUtil.h" +#include "nsProxyRelease.h" +#include "nsQueryObject.h" +#include "nsStreamUtils.h" +#include "nsStringStream.h" +#include "mozilla/Assertions.h" +#include "mozilla/CycleCollectedJSContext.h" // for MicroTaskRunnable +#include "mozilla/JSObjectHolder.h" +#include "mozilla/Preferences.h" +#include "mozilla/dom/Client.h" +#include "mozilla/dom/ClientIPCTypes.h" +#include "mozilla/dom/FetchUtil.h" +#include "mozilla/dom/IndexedDatabaseManager.h" +#include "mozilla/dom/InternalHeaders.h" +#include "mozilla/dom/NotificationEvent.h" +#include "mozilla/dom/PromiseNativeHandler.h" +#include "mozilla/dom/PushEventBinding.h" +#include "mozilla/dom/RequestBinding.h" +#include "mozilla/dom/WorkerDebugger.h" +#include "mozilla/dom/WorkerRef.h" +#include "mozilla/dom/WorkerRunnable.h" +#include "mozilla/dom/WorkerScope.h" +#include "mozilla/dom/ipc/StructuredCloneData.h" +#include "mozilla/ipc/BackgroundUtils.h" +#include "mozilla/net/CookieJarSettings.h" +#include "mozilla/net/NeckoChannelParams.h" +#include "mozilla/Services.h" +#include "mozilla/Telemetry.h" +#include "mozilla/DebugOnly.h" +#include "mozilla/StaticPrefs_dom.h" +#include "mozilla/Unused.h" +#include "nsIReferrerInfo.h" + +using namespace mozilla; +using namespace mozilla::dom; + +namespace mozilla { +namespace dom { + +using mozilla::ipc::PrincipalInfo; + +NS_IMPL_CYCLE_COLLECTING_NATIVE_ADDREF(ServiceWorkerPrivate) +NS_IMPL_CYCLE_COLLECTING_NATIVE_RELEASE(ServiceWorkerPrivate) +NS_IMPL_CYCLE_COLLECTION(ServiceWorkerPrivate, mSupportsArray) +NS_IMPL_CYCLE_COLLECTION_ROOT_NATIVE(ServiceWorkerPrivate, AddRef) +NS_IMPL_CYCLE_COLLECTION_UNROOT_NATIVE(ServiceWorkerPrivate, Release) + +// Tracks the "dom.serviceWorkers.disable_open_click_delay" preference. Modified +// on main thread, read on worker threads. +// It is updated every time a "notificationclick" event is dispatched. While +// this is done without synchronization, at the worst, the thread will just get +// an older value within which a popup is allowed to be displayed, which will +// still be a valid value since it was set prior to dispatching the runnable. +Atomic gDOMDisableOpenClickDelay(0); + +KeepAliveToken::KeepAliveToken(ServiceWorkerPrivate* aPrivate) + : mPrivate(aPrivate) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aPrivate); + mPrivate->AddToken(); +} + +KeepAliveToken::~KeepAliveToken() { + MOZ_ASSERT(NS_IsMainThread()); + mPrivate->ReleaseToken(); +} + +NS_IMPL_ISUPPORTS0(KeepAliveToken) + +ServiceWorkerPrivate::ServiceWorkerPrivate(ServiceWorkerInfo* aInfo) + : mInfo(aInfo), mDebuggerCount(0), mTokenCount(0) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aInfo); + + mIdleWorkerTimer = NS_NewTimer(); + MOZ_ASSERT(mIdleWorkerTimer); + + if (ServiceWorkerParentInterceptEnabled()) { + RefPtr inner = new ServiceWorkerPrivateImpl(this); + + // Assert in all debug builds as well as non-debug Nightly and Dev Edition. +#ifdef MOZ_DIAGNOSTIC_ASSERT_ENABLED + MOZ_DIAGNOSTIC_ASSERT(NS_SUCCEEDED(inner->Initialize())); +#else + MOZ_ALWAYS_SUCCEEDS(inner->Initialize()); +#endif + + mInner = std::move(inner); + } +} + +ServiceWorkerPrivate::~ServiceWorkerPrivate() { + MOZ_ASSERT(!mWorkerPrivate); + MOZ_ASSERT(!mTokenCount); + MOZ_ASSERT(!mInner); + MOZ_ASSERT(!mInfo); + MOZ_ASSERT(mSupportsArray.IsEmpty()); + MOZ_ASSERT(mIdlePromiseHolder.IsEmpty()); + + mIdleWorkerTimer->Cancel(); +} + +namespace { + +class CheckScriptEvaluationWithCallback final : public WorkerDebuggeeRunnable { + nsMainThreadPtrHandle mServiceWorkerPrivate; + nsMainThreadPtrHandle mKeepAliveToken; + + // The script evaluation result must be reported even if the runnable + // is cancelled. + RefPtr mScriptEvaluationCallback; + +#ifdef DEBUG + bool mDone; +#endif + + public: + CheckScriptEvaluationWithCallback( + WorkerPrivate* aWorkerPrivate, + ServiceWorkerPrivate* aServiceWorkerPrivate, + KeepAliveToken* aKeepAliveToken, + LifeCycleEventCallback* aScriptEvaluationCallback) + : WorkerDebuggeeRunnable(aWorkerPrivate, WorkerThreadModifyBusyCount), + mServiceWorkerPrivate(new nsMainThreadPtrHolder( + "CheckScriptEvaluationWithCallback::mServiceWorkerPrivate", + aServiceWorkerPrivate)), + mKeepAliveToken(new nsMainThreadPtrHolder( + "CheckScriptEvaluationWithCallback::mKeepAliveToken", + aKeepAliveToken)), + mScriptEvaluationCallback(aScriptEvaluationCallback) +#ifdef DEBUG + , + mDone(false) +#endif + { + MOZ_ASSERT(NS_IsMainThread()); + } + + ~CheckScriptEvaluationWithCallback() { MOZ_ASSERT(mDone); } + + bool WorkerRun(JSContext* aCx, WorkerPrivate* aWorkerPrivate) override { + aWorkerPrivate->AssertIsOnWorkerThread(); + + bool fetchHandlerWasAdded = aWorkerPrivate->FetchHandlerWasAdded(); + nsCOMPtr runnable = NewRunnableMethod( + "dom::CheckScriptEvaluationWithCallback::ReportFetchFlag", this, + &CheckScriptEvaluationWithCallback::ReportFetchFlag, + fetchHandlerWasAdded); + aWorkerPrivate->DispatchToMainThread(runnable.forget()); + + ReportScriptEvaluationResult( + aWorkerPrivate->WorkerScriptExecutedSuccessfully()); + + return true; + } + + void ReportFetchFlag(bool aFetchHandlerWasAdded) { + MOZ_ASSERT(NS_IsMainThread()); + mServiceWorkerPrivate->SetHandlesFetch(aFetchHandlerWasAdded); + } + + nsresult Cancel() override { + ReportScriptEvaluationResult(false); + return WorkerRunnable::Cancel(); + } + + private: + void ReportScriptEvaluationResult(bool aScriptEvaluationResult) { +#ifdef DEBUG + mDone = true; +#endif + mScriptEvaluationCallback->SetResult(aScriptEvaluationResult); + MOZ_ALWAYS_SUCCEEDS( + mWorkerPrivate->DispatchToMainThread(mScriptEvaluationCallback)); + } +}; + +} // anonymous namespace + +nsresult ServiceWorkerPrivate::CheckScriptEvaluation( + LifeCycleEventCallback* aScriptEvaluationCallback) { + MOZ_ASSERT(NS_IsMainThread()); + + if (mInner) { + return mInner->CheckScriptEvaluation(aScriptEvaluationCallback); + } + + nsresult rv = SpawnWorkerIfNeeded(LifeCycleEvent); + NS_ENSURE_SUCCESS(rv, rv); + + RefPtr token = CreateEventKeepAliveToken(); + RefPtr r = new CheckScriptEvaluationWithCallback( + mWorkerPrivate, this, token, aScriptEvaluationCallback); + if (NS_WARN_IF(!r->Dispatch())) { + return NS_ERROR_FAILURE; + } + + return NS_OK; +} + +namespace { + +class KeepAliveHandler final : public ExtendableEvent::ExtensionsHandler, + public PromiseNativeHandler { + // This class manages lifetime extensions added by calling WaitUntil() + // or RespondWith(). We allow new extensions as long as we still hold + // |mKeepAliveToken|. Once the last promise was settled, we queue a microtask + // which releases the token and prevents further extensions. By doing this, + // we give other pending microtasks a chance to continue adding extensions. + + RefPtr mWorkerRef; + nsMainThreadPtrHandle mKeepAliveToken; + + // We start holding a self reference when the first extension promise is + // added. As far as I can tell, the only case where this is useful is when + // we're waiting indefinitely on a promise that's no longer reachable + // and will never be settled. + // The cycle is broken when the last promise was settled or when the + // worker is shutting down. + RefPtr mSelfRef; + + // Called when the last promise was settled. + RefPtr mCallback; + + uint32_t mPendingPromisesCount; + + // We don't actually care what values the promises resolve to, only whether + // any of them were rejected. + bool mRejected; + + public: + NS_DECL_ISUPPORTS + + explicit KeepAliveHandler( + const nsMainThreadPtrHandle& aKeepAliveToken, + ExtendableEventCallback* aCallback) + : mKeepAliveToken(aKeepAliveToken), + mCallback(aCallback), + mPendingPromisesCount(0), + mRejected(false) { + MOZ_ASSERT(mKeepAliveToken); + } + + bool Init() { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + + RefPtr self = this; + mWorkerRef = StrongWorkerRef::Create(GetCurrentThreadWorkerPrivate(), + "KeepAliveHandler", + [self]() { self->MaybeCleanup(); }); + + if (NS_WARN_IF(!mWorkerRef)) { + return false; + } + + return true; + } + + bool WaitOnPromise(Promise& aPromise) override { + if (!mKeepAliveToken) { + MOZ_ASSERT(!GetDispatchFlag()); + MOZ_ASSERT(!mSelfRef, "We shouldn't be holding a self reference!"); + return false; + } + if (!mSelfRef) { + MOZ_ASSERT(!mPendingPromisesCount); + mSelfRef = this; + } + + ++mPendingPromisesCount; + aPromise.AppendNativeHandler(this); + + return true; + } + + void ResolvedCallback(JSContext* aCx, JS::Handle aValue) override { + RemovePromise(Resolved); + } + + void RejectedCallback(JSContext* aCx, JS::Handle aValue) override { + RemovePromise(Rejected); + } + + void MaybeDone() { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + MOZ_ASSERT(!GetDispatchFlag()); + + if (mPendingPromisesCount || !mKeepAliveToken) { + return; + } + if (mCallback) { + mCallback->FinishedWithResult(mRejected ? Rejected : Resolved); + } + + MaybeCleanup(); + } + + private: + ~KeepAliveHandler() { MaybeCleanup(); } + + void MaybeCleanup() { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + + if (!mKeepAliveToken) { + return; + } + + mWorkerRef = nullptr; + mKeepAliveToken = nullptr; + mSelfRef = nullptr; + } + + class MaybeDoneRunner : public MicroTaskRunnable { + public: + explicit MaybeDoneRunner(KeepAliveHandler* aHandler) : mHandler(aHandler) {} + virtual void Run(AutoSlowOperation& aAso) override { + mHandler->MaybeDone(); + } + + RefPtr mHandler; + }; + + void RemovePromise(ExtendableEventResult aResult) { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + MOZ_DIAGNOSTIC_ASSERT(mPendingPromisesCount > 0); + + // Note: mSelfRef and mKeepAliveToken can be nullptr here + // if MaybeCleanup() was called just before a promise + // settled. This can happen, for example, if the + // worker thread is being terminated for running too + // long, browser shutdown, etc. + + mRejected |= (aResult == Rejected); + + --mPendingPromisesCount; + if (mPendingPromisesCount || GetDispatchFlag()) { + return; + } + + CycleCollectedJSContext* cx = CycleCollectedJSContext::Get(); + MOZ_ASSERT(cx); + + RefPtr r = new MaybeDoneRunner(this); + cx->DispatchToMicroTask(r.forget()); + } +}; + +NS_IMPL_ISUPPORTS0(KeepAliveHandler) + +class RegistrationUpdateRunnable : public Runnable { + nsMainThreadPtrHandle mRegistration; + const bool mNeedTimeCheck; + + public: + RegistrationUpdateRunnable( + nsMainThreadPtrHandle& aRegistration, + bool aNeedTimeCheck) + : Runnable("dom::RegistrationUpdateRunnable"), + mRegistration(aRegistration), + mNeedTimeCheck(aNeedTimeCheck) { + MOZ_DIAGNOSTIC_ASSERT(mRegistration); + } + + NS_IMETHOD + Run() override { + if (mNeedTimeCheck) { + mRegistration->MaybeScheduleTimeCheckAndUpdate(); + } else { + mRegistration->MaybeScheduleUpdate(); + } + return NS_OK; + } +}; + +class ExtendableEventWorkerRunnable : public WorkerRunnable { + protected: + nsMainThreadPtrHandle mKeepAliveToken; + + public: + ExtendableEventWorkerRunnable(WorkerPrivate* aWorkerPrivate, + KeepAliveToken* aKeepAliveToken) + : WorkerRunnable(aWorkerPrivate) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aWorkerPrivate); + MOZ_ASSERT(aKeepAliveToken); + + mKeepAliveToken = new nsMainThreadPtrHolder( + "ExtendableEventWorkerRunnable::mKeepAliveToken", aKeepAliveToken); + } + + nsresult DispatchExtendableEventOnWorkerScope( + JSContext* aCx, WorkerGlobalScope* aWorkerScope, ExtendableEvent* aEvent, + ExtendableEventCallback* aCallback) { + MOZ_ASSERT(aWorkerScope); + MOZ_ASSERT(aEvent); + nsCOMPtr sgo = aWorkerScope; + WidgetEvent* internalEvent = aEvent->WidgetEventPtr(); + + RefPtr keepAliveHandler = + new KeepAliveHandler(mKeepAliveToken, aCallback); + if (NS_WARN_IF(!keepAliveHandler->Init())) { + return NS_ERROR_FAILURE; + } + + // This must always be set *before* dispatching the event, otherwise + // waitUntil calls will fail. + aEvent->SetKeepAliveHandler(keepAliveHandler); + + ErrorResult result; + aWorkerScope->DispatchEvent(*aEvent, result); + if (NS_WARN_IF(result.Failed())) { + result.SuppressException(); + return NS_ERROR_FAILURE; + } + + // [[ If e’s extend lifetime promises is empty, unset e’s extensions allowed + // flag and abort these steps. ]] + keepAliveHandler->MaybeDone(); + + // We don't block the event when getting an exception but still report the + // error message. + // Report exception message. Note: This will not stop the event. + if (internalEvent->mFlags.mExceptionWasRaised) { + result.SuppressException(); + return NS_ERROR_XPC_JS_THREW_EXCEPTION; + } + + return NS_OK; + } +}; + +class SendMessageEventRunnable final : public ExtendableEventWorkerRunnable { + const ClientInfoAndState mClientInfoAndState; + RefPtr mData; + + public: + SendMessageEventRunnable(WorkerPrivate* aWorkerPrivate, + KeepAliveToken* aKeepAliveToken, + const ClientInfoAndState& aClientInfoAndState, + RefPtr&& aData) + : ExtendableEventWorkerRunnable(aWorkerPrivate, aKeepAliveToken), + mClientInfoAndState(aClientInfoAndState), + mData(std::move(aData)) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_DIAGNOSTIC_ASSERT(mData); + } + + bool WorkerRun(JSContext* aCx, WorkerPrivate* aWorkerPrivate) override { + JS::Rooted messageData(aCx); + nsCOMPtr sgo = aWorkerPrivate->GlobalScope(); + ErrorResult rv; + mData->Read(aCx, &messageData, rv); + + // If deserialization fails, we will fire a messageerror event + bool deserializationFailed = rv.Failed(); + + if (!deserializationFailed && NS_WARN_IF(rv.Failed())) { + rv.SuppressException(); + return true; + } + + Sequence> ports; + if (!mData->TakeTransferredPortsAsSequence(ports)) { + return true; + } + + RootedDictionary init(aCx); + + init.mBubbles = false; + init.mCancelable = false; + + // On a messageerror event, we disregard ports: + // https://w3c.github.io/ServiceWorker/#service-worker-postmessage + if (!deserializationFailed) { + init.mData = messageData; + init.mPorts = std::move(ports); + } + + init.mSource.SetValue().SetAsClient() = + new Client(sgo, mClientInfoAndState); + + rv.SuppressException(); + RefPtr target = aWorkerPrivate->GlobalScope(); + RefPtr extendableEvent = + ExtendableMessageEvent::Constructor( + target, deserializationFailed ? u"messageerror"_ns : u"message"_ns, + init); + + extendableEvent->SetTrusted(true); + + return NS_SUCCEEDED(DispatchExtendableEventOnWorkerScope( + aCx, aWorkerPrivate->GlobalScope(), extendableEvent, nullptr)); + } +}; + +} // anonymous namespace + +nsresult ServiceWorkerPrivate::SendMessageEvent( + RefPtr&& aData, + const ClientInfoAndState& aClientInfoAndState) { + MOZ_ASSERT(NS_IsMainThread()); + + if (mInner) { + return mInner->SendMessageEvent(std::move(aData), aClientInfoAndState); + } + + nsresult rv = SpawnWorkerIfNeeded(MessageEvent); + NS_ENSURE_SUCCESS(rv, rv); + + RefPtr token = CreateEventKeepAliveToken(); + RefPtr runnable = new SendMessageEventRunnable( + mWorkerPrivate, token, aClientInfoAndState, std::move(aData)); + + if (!runnable->Dispatch()) { + return NS_ERROR_FAILURE; + } + + return NS_OK; +} + +namespace { + +// Handle functional event +// 9.9.7 If the time difference in seconds calculated by the current time minus +// registration's last update check time is greater than 86400, invoke Soft +// Update algorithm. +class ExtendableFunctionalEventWorkerRunnable + : public ExtendableEventWorkerRunnable { + protected: + nsMainThreadPtrHandle mRegistration; + + public: + ExtendableFunctionalEventWorkerRunnable( + WorkerPrivate* aWorkerPrivate, KeepAliveToken* aKeepAliveToken, + nsMainThreadPtrHandle& aRegistration) + : ExtendableEventWorkerRunnable(aWorkerPrivate, aKeepAliveToken), + mRegistration(aRegistration) { + MOZ_DIAGNOSTIC_ASSERT(aRegistration); + } + + void PostRun(JSContext* aCx, WorkerPrivate* aWorkerPrivate, + bool aRunResult) override { + // Sub-class PreRun() or WorkerRun() methods could clear our mRegistration. + if (mRegistration) { + nsCOMPtr runnable = + new RegistrationUpdateRunnable(mRegistration, true /* time check */); + aWorkerPrivate->DispatchToMainThread(runnable.forget()); + } + + ExtendableEventWorkerRunnable::PostRun(aCx, aWorkerPrivate, aRunResult); + } +}; + +/* + * Fires 'install' event on the ServiceWorkerGlobalScope. Modifies busy count + * since it fires the event. This is ok since there can't be nested + * ServiceWorkers, so the parent thread -> worker thread requirement for + * runnables is satisfied. + */ +class LifecycleEventWorkerRunnable : public ExtendableEventWorkerRunnable { + nsString mEventName; + RefPtr mCallback; + + public: + LifecycleEventWorkerRunnable(WorkerPrivate* aWorkerPrivate, + KeepAliveToken* aToken, + const nsAString& aEventName, + LifeCycleEventCallback* aCallback) + : ExtendableEventWorkerRunnable(aWorkerPrivate, aToken), + mEventName(aEventName), + mCallback(aCallback) { + MOZ_ASSERT(NS_IsMainThread()); + } + + bool WorkerRun(JSContext* aCx, WorkerPrivate* aWorkerPrivate) override { + MOZ_ASSERT(aWorkerPrivate); + return DispatchLifecycleEvent(aCx, aWorkerPrivate); + } + + nsresult Cancel() override { + mCallback->SetResult(false); + MOZ_ALWAYS_SUCCEEDS(mWorkerPrivate->DispatchToMainThread(mCallback)); + + return WorkerRunnable::Cancel(); + } + + private: + bool DispatchLifecycleEvent(JSContext* aCx, WorkerPrivate* aWorkerPrivate); +}; + +/* + * Used to handle ExtendableEvent::waitUntil() and catch abnormal worker + * termination during the execution of life cycle events. It is responsible + * with advancing the job queue for install/activate tasks. + */ +class LifeCycleEventWatcher final : public ExtendableEventCallback { + RefPtr mWorkerRef; + RefPtr mCallback; + + ~LifeCycleEventWatcher() { + // XXXcatalinb: If all the promises passed to waitUntil go out of scope, + // the resulting Promise.all will be cycle collected and it will drop its + // native handlers (including this object). Instead of waiting for a timeout + // we report the failure now. + ReportResult(false); + } + + public: + NS_INLINE_DECL_REFCOUNTING(LifeCycleEventWatcher, override) + + explicit LifeCycleEventWatcher(LifeCycleEventCallback* aCallback) + : mCallback(aCallback) { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + } + + bool Init() { + WorkerPrivate* workerPrivate = GetCurrentThreadWorkerPrivate(); + MOZ_ASSERT(workerPrivate); + + // We need to listen for worker termination in case the event handler + // never completes or never resolves the waitUntil promise. There are + // two possible scenarios: + // 1. The keepAlive token expires and the worker is terminated, in which + // case the registration/update promise will be rejected + // 2. A new service worker is registered which will terminate the current + // installing worker. + RefPtr self = this; + mWorkerRef = + StrongWorkerRef::Create(workerPrivate, "LifeCycleEventWatcher", + [self]() { self->ReportResult(false); }); + if (NS_WARN_IF(!mWorkerRef)) { + mCallback->SetResult(false); + // Using DispatchToMainThreadForMessaging so that state update on + // the main thread doesn't happen too soon. + nsresult rv = workerPrivate->DispatchToMainThreadForMessaging(mCallback); + Unused << NS_WARN_IF(NS_FAILED(rv)); + return false; + } + + return true; + } + + void ReportResult(bool aResult) { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + + if (!mWorkerRef) { + return; + } + + mCallback->SetResult(aResult); + // Using DispatchToMainThreadForMessaging so that state update on + // the main thread doesn't happen too soon. + nsresult rv = + mWorkerRef->Private()->DispatchToMainThreadForMessaging(mCallback); + if (NS_WARN_IF(NS_FAILED(rv))) { + MOZ_CRASH("Failed to dispatch life cycle event handler."); + } + + mWorkerRef = nullptr; + } + + void FinishedWithResult(ExtendableEventResult aResult) override { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + ReportResult(aResult == Resolved); + + // Note, all WaitUntil() rejections are reported to client consoles + // by the WaitUntilHandler in ServiceWorkerEvents. This ensures that + // errors in non-lifecycle events like FetchEvent and PushEvent are + // reported properly. + } +}; + +bool LifecycleEventWorkerRunnable::DispatchLifecycleEvent( + JSContext* aCx, WorkerPrivate* aWorkerPrivate) { + aWorkerPrivate->AssertIsOnWorkerThread(); + MOZ_ASSERT(aWorkerPrivate->IsServiceWorker()); + + RefPtr event; + RefPtr target = aWorkerPrivate->GlobalScope(); + + if (mEventName.EqualsASCII("install") || mEventName.EqualsASCII("activate")) { + ExtendableEventInit init; + init.mBubbles = false; + init.mCancelable = false; + event = ExtendableEvent::Constructor(target, mEventName, init); + } else { + MOZ_CRASH("Unexpected lifecycle event"); + } + + event->SetTrusted(true); + + // It is important to initialize the watcher before actually dispatching + // the event in order to catch worker termination while the event handler + // is still executing. This can happen with infinite loops, for example. + RefPtr watcher = new LifeCycleEventWatcher(mCallback); + + if (!watcher->Init()) { + return true; + } + + nsresult rv = DispatchExtendableEventOnWorkerScope( + aCx, aWorkerPrivate->GlobalScope(), event, watcher); + // Do not fail event processing when an exception is thrown. + if (NS_FAILED(rv) && rv != NS_ERROR_XPC_JS_THREW_EXCEPTION) { + watcher->ReportResult(false); + } + + return true; +} + +} // anonymous namespace + +nsresult ServiceWorkerPrivate::SendLifeCycleEvent( + const nsAString& aEventType, LifeCycleEventCallback* aCallback) { + MOZ_ASSERT(NS_IsMainThread()); + + if (mInner) { + return mInner->SendLifeCycleEvent(aEventType, aCallback); + } + + nsresult rv = SpawnWorkerIfNeeded(LifeCycleEvent); + NS_ENSURE_SUCCESS(rv, rv); + + RefPtr token = CreateEventKeepAliveToken(); + RefPtr r = new LifecycleEventWorkerRunnable( + mWorkerPrivate, token, aEventType, aCallback); + if (NS_WARN_IF(!r->Dispatch())) { + return NS_ERROR_FAILURE; + } + + return NS_OK; +} + +namespace { + +class PushErrorReporter final : public ExtendableEventCallback { + WorkerPrivate* mWorkerPrivate; + nsString mMessageId; + + ~PushErrorReporter() = default; + + public: + NS_INLINE_DECL_THREADSAFE_REFCOUNTING(PushErrorReporter, override) + + PushErrorReporter(WorkerPrivate* aWorkerPrivate, const nsAString& aMessageId) + : mWorkerPrivate(aWorkerPrivate), mMessageId(aMessageId) { + mWorkerPrivate->AssertIsOnWorkerThread(); + } + + void FinishedWithResult(ExtendableEventResult aResult) override { + if (aResult == Rejected) { + Report(nsIPushErrorReporter::DELIVERY_UNHANDLED_REJECTION); + } + } + + void Report( + uint16_t aReason = nsIPushErrorReporter::DELIVERY_INTERNAL_ERROR) { + WorkerPrivate* workerPrivate = mWorkerPrivate; + mWorkerPrivate->AssertIsOnWorkerThread(); + + if (NS_WARN_IF(aReason > nsIPushErrorReporter::DELIVERY_INTERNAL_ERROR) || + mMessageId.IsEmpty()) { + return; + } + nsCOMPtr runnable = NewRunnableMethod( + "dom::PushErrorReporter::ReportOnMainThread", this, + &PushErrorReporter::ReportOnMainThread, aReason); + MOZ_ALWAYS_TRUE( + NS_SUCCEEDED(workerPrivate->DispatchToMainThread(runnable.forget()))); + } + + void ReportOnMainThread(uint16_t aReason) { + MOZ_ASSERT(NS_IsMainThread()); + nsCOMPtr reporter = + do_GetService("@mozilla.org/push/Service;1"); + if (reporter) { + nsresult rv = reporter->ReportDeliveryError(mMessageId, aReason); + Unused << NS_WARN_IF(NS_FAILED(rv)); + } + } +}; + +class SendPushEventRunnable final + : public ExtendableFunctionalEventWorkerRunnable { + nsString mMessageId; + Maybe> mData; + + public: + SendPushEventRunnable( + WorkerPrivate* aWorkerPrivate, KeepAliveToken* aKeepAliveToken, + const nsAString& aMessageId, const Maybe>& aData, + nsMainThreadPtrHandle aRegistration) + : ExtendableFunctionalEventWorkerRunnable(aWorkerPrivate, aKeepAliveToken, + aRegistration), + mMessageId(aMessageId), + mData(aData ? Some(aData->Clone()) : Nothing()) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aWorkerPrivate); + MOZ_ASSERT(aWorkerPrivate->IsServiceWorker()); + } + + bool WorkerRun(JSContext* aCx, WorkerPrivate* aWorkerPrivate) override { + MOZ_ASSERT(aWorkerPrivate); + GlobalObject globalObj(aCx, aWorkerPrivate->GlobalScope()->GetWrapper()); + + RefPtr errorReporter = + new PushErrorReporter(aWorkerPrivate, mMessageId); + + PushEventInit pei; + if (mData) { + const nsTArray& bytes = mData.ref(); + JSObject* data = + Uint8Array::Create(aCx, bytes.Length(), bytes.Elements()); + if (!data) { + errorReporter->Report(); + return false; + } + pei.mData.Construct().SetAsArrayBufferView().Init(data); + } + pei.mBubbles = false; + pei.mCancelable = false; + + ErrorResult result; + RefPtr event = + PushEvent::Constructor(globalObj, u"push"_ns, pei, result); + if (NS_WARN_IF(result.Failed())) { + result.SuppressException(); + errorReporter->Report(); + return false; + } + event->SetTrusted(true); + + nsresult rv = DispatchExtendableEventOnWorkerScope( + aCx, aWorkerPrivate->GlobalScope(), event, errorReporter); + if (NS_FAILED(rv)) { + // We don't cancel WorkerPrivate when catching an excetpion. + errorReporter->Report(nsIPushErrorReporter::DELIVERY_UNCAUGHT_EXCEPTION); + } + + return true; + } +}; + +class SendPushSubscriptionChangeEventRunnable final + : public ExtendableEventWorkerRunnable { + public: + explicit SendPushSubscriptionChangeEventRunnable( + WorkerPrivate* aWorkerPrivate, KeepAliveToken* aKeepAliveToken) + : ExtendableEventWorkerRunnable(aWorkerPrivate, aKeepAliveToken) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aWorkerPrivate); + MOZ_ASSERT(aWorkerPrivate->IsServiceWorker()); + } + + bool WorkerRun(JSContext* aCx, WorkerPrivate* aWorkerPrivate) override { + MOZ_ASSERT(aWorkerPrivate); + + RefPtr target = aWorkerPrivate->GlobalScope(); + + ExtendableEventInit init; + init.mBubbles = false; + init.mCancelable = false; + + RefPtr event = ExtendableEvent::Constructor( + target, u"pushsubscriptionchange"_ns, init); + + event->SetTrusted(true); + + DispatchExtendableEventOnWorkerScope(aCx, aWorkerPrivate->GlobalScope(), + event, nullptr); + + return true; + } +}; + +} // anonymous namespace + +nsresult ServiceWorkerPrivate::SendPushEvent( + const nsAString& aMessageId, const Maybe>& aData, + ServiceWorkerRegistrationInfo* aRegistration) { + MOZ_ASSERT(NS_IsMainThread()); + + if (mInner) { + return mInner->SendPushEvent(aRegistration, aMessageId, aData); + } + + nsresult rv = SpawnWorkerIfNeeded(PushEvent); + NS_ENSURE_SUCCESS(rv, rv); + + RefPtr token = CreateEventKeepAliveToken(); + + nsMainThreadPtrHandle regInfo( + new nsMainThreadPtrHolder( + "ServiceWorkerRegistrationInfoProxy", aRegistration, false)); + + RefPtr r = new SendPushEventRunnable( + mWorkerPrivate, token, aMessageId, aData, regInfo); + + if (mInfo->State() == ServiceWorkerState::Activating) { + mPendingFunctionalEvents.AppendElement(r.forget()); + return NS_OK; + } + + MOZ_ASSERT(mInfo->State() == ServiceWorkerState::Activated); + + if (NS_WARN_IF(!r->Dispatch())) { + return NS_ERROR_FAILURE; + } + + return NS_OK; +} + +nsresult ServiceWorkerPrivate::SendPushSubscriptionChangeEvent() { + MOZ_ASSERT(NS_IsMainThread()); + + if (mInner) { + return mInner->SendPushSubscriptionChangeEvent(); + } + + nsresult rv = SpawnWorkerIfNeeded(PushSubscriptionChangeEvent); + NS_ENSURE_SUCCESS(rv, rv); + + RefPtr token = CreateEventKeepAliveToken(); + RefPtr r = + new SendPushSubscriptionChangeEventRunnable(mWorkerPrivate, token); + if (NS_WARN_IF(!r->Dispatch())) { + return NS_ERROR_FAILURE; + } + + return NS_OK; +} + +namespace { + +class AllowWindowInteractionHandler final : public ExtendableEventCallback, + public nsITimerCallback, + public nsINamed { + nsCOMPtr mTimer; + RefPtr mWorkerRef; + + ~AllowWindowInteractionHandler() { + // We must either fail to initialize or call ClearWindowAllowed. + MOZ_DIAGNOSTIC_ASSERT(!mTimer); + MOZ_DIAGNOSTIC_ASSERT(!mWorkerRef); + } + + void ClearWindowAllowed(WorkerPrivate* aWorkerPrivate) { + MOZ_ASSERT(aWorkerPrivate); + aWorkerPrivate->AssertIsOnWorkerThread(); + + if (!mTimer) { + return; + } + + // XXXcatalinb: This *might* be executed after the global was unrooted, in + // which case GlobalScope() will return null. Making the check here just + // to be safe. + WorkerGlobalScope* globalScope = aWorkerPrivate->GlobalScope(); + if (!globalScope) { + return; + } + + globalScope->ConsumeWindowInteraction(); + mTimer->Cancel(); + mTimer = nullptr; + + mWorkerRef = nullptr; + } + + void StartClearWindowTimer(WorkerPrivate* aWorkerPrivate) { + MOZ_ASSERT(aWorkerPrivate); + aWorkerPrivate->AssertIsOnWorkerThread(); + MOZ_ASSERT(!mTimer); + + nsresult rv; + nsCOMPtr timer = + NS_NewTimer(aWorkerPrivate->ControlEventTarget()); + if (NS_WARN_IF(!timer)) { + return; + } + + MOZ_ASSERT(!mWorkerRef); + RefPtr self = this; + mWorkerRef = StrongWorkerRef::Create( + aWorkerPrivate, "AllowWindowInteractionHandler", [self]() { + // We could try to hold the worker alive until the timer fires, but + // other APIs are not likely to work in this partially shutdown state. + // We might as well let the worker thread exit. + self->ClearWindowAllowed(self->mWorkerRef->Private()); + }); + + if (!mWorkerRef) { + return; + } + + aWorkerPrivate->GlobalScope()->AllowWindowInteraction(); + timer.swap(mTimer); + + // We swap first and then initialize the timer so that even if initializing + // fails, we still clean the busy count and interaction count correctly. + // The timer can't be initialized before modifying the busy count since the + // timer thread could run and call the timeout but the worker may + // already be terminating and modifying the busy count could fail. + rv = mTimer->InitWithCallback(this, gDOMDisableOpenClickDelay, + nsITimer::TYPE_ONE_SHOT); + if (NS_WARN_IF(NS_FAILED(rv))) { + ClearWindowAllowed(aWorkerPrivate); + return; + } + } + + // nsITimerCallback virtual methods + NS_IMETHOD + Notify(nsITimer* aTimer) override { + MOZ_DIAGNOSTIC_ASSERT(mTimer == aTimer); + WorkerPrivate* workerPrivate = GetCurrentThreadWorkerPrivate(); + ClearWindowAllowed(workerPrivate); + return NS_OK; + } + + // nsINamed virtual methods + NS_IMETHOD + GetName(nsACString& aName) override { + aName.AssignLiteral("AllowWindowInteractionHandler"); + return NS_OK; + } + + public: + NS_DECL_THREADSAFE_ISUPPORTS + + explicit AllowWindowInteractionHandler(WorkerPrivate* aWorkerPrivate) { + StartClearWindowTimer(aWorkerPrivate); + } + + void FinishedWithResult(ExtendableEventResult /* aResult */) override { + WorkerPrivate* workerPrivate = GetCurrentThreadWorkerPrivate(); + ClearWindowAllowed(workerPrivate); + } +}; + +NS_IMPL_ISUPPORTS(AllowWindowInteractionHandler, nsITimerCallback, nsINamed) + +class SendNotificationEventRunnable final + : public ExtendableEventWorkerRunnable { + const nsString mEventName; + const nsString mID; + const nsString mTitle; + const nsString mDir; + const nsString mLang; + const nsString mBody; + const nsString mTag; + const nsString mIcon; + const nsString mData; + const nsString mBehavior; + const nsString mScope; + + public: + SendNotificationEventRunnable(WorkerPrivate* aWorkerPrivate, + KeepAliveToken* aKeepAliveToken, + const nsAString& aEventName, + const nsAString& aID, const nsAString& aTitle, + const nsAString& aDir, const nsAString& aLang, + const nsAString& aBody, const nsAString& aTag, + const nsAString& aIcon, const nsAString& aData, + const nsAString& aBehavior, + const nsAString& aScope) + : ExtendableEventWorkerRunnable(aWorkerPrivate, aKeepAliveToken), + mEventName(aEventName), + mID(aID), + mTitle(aTitle), + mDir(aDir), + mLang(aLang), + mBody(aBody), + mTag(aTag), + mIcon(aIcon), + mData(aData), + mBehavior(aBehavior), + mScope(aScope) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aWorkerPrivate); + MOZ_ASSERT(aWorkerPrivate->IsServiceWorker()); + } + + bool WorkerRun(JSContext* aCx, WorkerPrivate* aWorkerPrivate) override { + MOZ_ASSERT(aWorkerPrivate); + + RefPtr target = do_QueryObject(aWorkerPrivate->GlobalScope()); + + ErrorResult result; + RefPtr notification = Notification::ConstructFromFields( + aWorkerPrivate->GlobalScope(), mID, mTitle, mDir, mLang, mBody, mTag, + mIcon, mData, mScope, result); + if (NS_WARN_IF(result.Failed())) { + return false; + } + + NotificationEventInit nei; + nei.mNotification = notification; + nei.mBubbles = false; + nei.mCancelable = false; + + RefPtr event = + NotificationEvent::Constructor(target, mEventName, nei); + + event->SetTrusted(true); + + RefPtr allowWindowInteraction; + if (mEventName.EqualsLiteral(NOTIFICATION_CLICK_EVENT_NAME)) { + allowWindowInteraction = + new AllowWindowInteractionHandler(aWorkerPrivate); + } + + nsresult rv = DispatchExtendableEventOnWorkerScope( + aCx, aWorkerPrivate->GlobalScope(), event, allowWindowInteraction); + // Don't reject when catching an exception + if (NS_FAILED(rv) && rv != NS_ERROR_XPC_JS_THREW_EXCEPTION && + allowWindowInteraction) { + allowWindowInteraction->FinishedWithResult(Rejected); + } + + return true; + } +}; + +} // namespace + +nsresult ServiceWorkerPrivate::SendNotificationEvent( + const nsAString& aEventName, const nsAString& aID, const nsAString& aTitle, + const nsAString& aDir, const nsAString& aLang, const nsAString& aBody, + const nsAString& aTag, const nsAString& aIcon, const nsAString& aData, + const nsAString& aBehavior, const nsAString& aScope) { + MOZ_ASSERT(NS_IsMainThread()); + + WakeUpReason why; + if (aEventName.EqualsLiteral(NOTIFICATION_CLICK_EVENT_NAME)) { + why = NotificationClickEvent; + gDOMDisableOpenClickDelay = + Preferences::GetInt("dom.serviceWorkers.disable_open_click_delay"); + } else if (aEventName.EqualsLiteral(NOTIFICATION_CLOSE_EVENT_NAME)) { + why = NotificationCloseEvent; + } else { + MOZ_ASSERT_UNREACHABLE("Invalid notification event name"); + return NS_ERROR_FAILURE; + } + + if (mInner) { + return mInner->SendNotificationEvent(aEventName, aID, aTitle, aDir, aLang, + aBody, aTag, aIcon, aData, aBehavior, + aScope, gDOMDisableOpenClickDelay); + } + + nsresult rv = SpawnWorkerIfNeeded(why); + NS_ENSURE_SUCCESS(rv, rv); + + RefPtr token = CreateEventKeepAliveToken(); + + RefPtr r = new SendNotificationEventRunnable( + mWorkerPrivate, token, aEventName, aID, aTitle, aDir, aLang, aBody, aTag, + aIcon, aData, aBehavior, aScope); + if (NS_WARN_IF(!r->Dispatch())) { + return NS_ERROR_FAILURE; + } + + return NS_OK; +} + +namespace { + +// Inheriting ExtendableEventWorkerRunnable so that the worker is not terminated +// while handling the fetch event, though that's very unlikely. +class FetchEventRunnable : public ExtendableFunctionalEventWorkerRunnable, + public nsIHttpHeaderVisitor { + nsMainThreadPtrHandle mInterceptedChannel; + const nsCString mScriptSpec; + nsTArray mHeaderNames; + nsTArray mHeaderValues; + nsCString mSpec; + nsCString mFragment; + nsCString mMethod; + nsString mClientId; + nsString mResultingClientId; + bool mMarkLaunchServiceWorkerEnd; + RequestCache mCacheMode; + RequestMode mRequestMode; + RequestRedirect mRequestRedirect; + RequestCredentials mRequestCredentials; + nsContentPolicyType mContentPolicyType; + nsCOMPtr mUploadStream; + int64_t mUploadStreamContentLength; + nsString mReferrer; + ReferrerPolicy mReferrerPolicy; + nsString mIntegrity; + const bool mIsNonSubresourceRequest; + + public: + FetchEventRunnable( + WorkerPrivate* aWorkerPrivate, KeepAliveToken* aKeepAliveToken, + nsMainThreadPtrHandle& aChannel, + // CSP checks might require the worker script spec + // later on. + const nsACString& aScriptSpec, + nsMainThreadPtrHandle& aRegistration, + const nsAString& aClientId, const nsAString& aResultingClientId, + bool aMarkLaunchServiceWorkerEnd, bool aIsNonSubresourceRequest) + : ExtendableFunctionalEventWorkerRunnable(aWorkerPrivate, aKeepAliveToken, + aRegistration), + mInterceptedChannel(aChannel), + mScriptSpec(aScriptSpec), + mClientId(aClientId), + mResultingClientId(aResultingClientId), + mMarkLaunchServiceWorkerEnd(aMarkLaunchServiceWorkerEnd), + mCacheMode(RequestCache::Default), + mRequestMode(RequestMode::No_cors), + mRequestRedirect(RequestRedirect::Follow) + // By default we set it to same-origin since normal HTTP fetches always + // send credentials to same-origin websites unless explicitly forbidden. + , + mRequestCredentials(RequestCredentials::Same_origin), + mContentPolicyType(nsIContentPolicy::TYPE_INVALID), + mUploadStreamContentLength(-1), + mReferrer(NS_LITERAL_STRING_FROM_CSTRING(kFETCH_CLIENT_REFERRER_STR)), + mReferrerPolicy(ReferrerPolicy::_empty), + mIsNonSubresourceRequest(aIsNonSubresourceRequest) { + MOZ_ASSERT(aWorkerPrivate); + } + + NS_DECL_ISUPPORTS_INHERITED + + NS_IMETHOD + VisitHeader(const nsACString& aHeader, const nsACString& aValue) override { + mHeaderNames.AppendElement(aHeader); + mHeaderValues.AppendElement(aValue); + return NS_OK; + } + + nsresult Init() { + MOZ_ASSERT(NS_IsMainThread()); + nsCOMPtr channel; + nsresult rv = mInterceptedChannel->GetChannel(getter_AddRefs(channel)); + NS_ENSURE_SUCCESS(rv, rv); + + nsCOMPtr uri; + rv = mInterceptedChannel->GetSecureUpgradedChannelURI(getter_AddRefs(uri)); + NS_ENSURE_SUCCESS(rv, rv); + + // Normally we rely on the Request constructor to strip the fragment, but + // when creating the FetchEvent we bypass the constructor. So strip the + // fragment manually here instead. We can't do it later when we create + // the Request because that code executes off the main thread. + nsCOMPtr uriNoFragment; + rv = NS_GetURIWithoutRef(uri, getter_AddRefs(uriNoFragment)); + NS_ENSURE_SUCCESS(rv, rv); + rv = uriNoFragment->GetSpec(mSpec); + NS_ENSURE_SUCCESS(rv, rv); + rv = uri->GetRef(mFragment); + NS_ENSURE_SUCCESS(rv, rv); + + uint32_t loadFlags; + rv = channel->GetLoadFlags(&loadFlags); + NS_ENSURE_SUCCESS(rv, rv); + nsCOMPtr loadInfo = channel->LoadInfo(); + mContentPolicyType = loadInfo->InternalContentPolicyType(); + + nsCOMPtr httpChannel = do_QueryInterface(channel); + MOZ_ASSERT(httpChannel, "How come we don't have an HTTP channel?"); + + mReferrerPolicy = ReferrerPolicy::_empty; + mReferrer.Truncate(); + nsCOMPtr referrerInfo = httpChannel->GetReferrerInfo(); + if (referrerInfo) { + mReferrerPolicy = referrerInfo->ReferrerPolicy(); + Unused << referrerInfo->GetComputedReferrerSpec(mReferrer); + } + + rv = httpChannel->GetRequestMethod(mMethod); + NS_ENSURE_SUCCESS(rv, rv); + + nsCOMPtr internalChannel = + do_QueryInterface(httpChannel); + NS_ENSURE_TRUE(internalChannel, NS_ERROR_NOT_AVAILABLE); + + mRequestMode = InternalRequest::MapChannelToRequestMode(channel); + + // This is safe due to static_asserts in ServiceWorkerManager.cpp. + uint32_t redirectMode; + rv = internalChannel->GetRedirectMode(&redirectMode); + MOZ_ASSERT(NS_SUCCEEDED(rv)); + mRequestRedirect = static_cast(redirectMode); + + // This is safe due to static_asserts in ServiceWorkerManager.cpp. + uint32_t cacheMode; + rv = internalChannel->GetFetchCacheMode(&cacheMode); + MOZ_ASSERT(NS_SUCCEEDED(rv)); + mCacheMode = static_cast(cacheMode); + + rv = internalChannel->GetIntegrityMetadata(mIntegrity); + MOZ_ASSERT(NS_SUCCEEDED(rv)); + + mRequestCredentials = + InternalRequest::MapChannelToRequestCredentials(channel); + + rv = httpChannel->VisitNonDefaultRequestHeaders(this); + NS_ENSURE_SUCCESS(rv, rv); + + nsCOMPtr uploadChannel = do_QueryInterface(httpChannel); + if (uploadChannel) { + MOZ_ASSERT(!mUploadStream); + nsCOMPtr uploadStream; + rv = uploadChannel->CloneUploadStream(&mUploadStreamContentLength, + getter_AddRefs(uploadStream)); + NS_ENSURE_SUCCESS(rv, rv); + mUploadStream = uploadStream; + } + + return NS_OK; + } + + bool WorkerRun(JSContext* aCx, WorkerPrivate* aWorkerPrivate) override { + MOZ_ASSERT(aWorkerPrivate); + + if (mMarkLaunchServiceWorkerEnd) { + mInterceptedChannel->SetLaunchServiceWorkerEnd(TimeStamp::Now()); + + // A probe to measure sw launch time for telemetry. + TimeStamp launchStartTime = TimeStamp(); + mInterceptedChannel->GetLaunchServiceWorkerStart(&launchStartTime); + + TimeStamp launchEndTime = TimeStamp(); + mInterceptedChannel->GetLaunchServiceWorkerEnd(&launchEndTime); + Telemetry::AccumulateTimeDelta(Telemetry::SERVICE_WORKER_LAUNCH_TIME, + launchStartTime, launchEndTime); + } + + mInterceptedChannel->SetDispatchFetchEventEnd(TimeStamp::Now()); + return DispatchFetchEvent(aCx, aWorkerPrivate); + } + + nsresult Cancel() override { + nsCOMPtr runnable = new ResumeRequest(mInterceptedChannel); + if (NS_FAILED(mWorkerPrivate->DispatchToMainThread(runnable))) { + NS_WARNING("Failed to resume channel on FetchEventRunnable::Cancel()!\n"); + } + WorkerRunnable::Cancel(); + return NS_OK; + } + + private: + ~FetchEventRunnable() = default; + + class ResumeRequest final : public Runnable { + nsMainThreadPtrHandle mChannel; + + public: + explicit ResumeRequest( + nsMainThreadPtrHandle& aChannel) + : Runnable("dom::FetchEventRunnable::ResumeRequest"), + mChannel(aChannel) { + mChannel->SetFinishResponseStart(TimeStamp::Now()); + } + + NS_IMETHOD Run() override { + MOZ_ASSERT(NS_IsMainThread()); + + TimeStamp timeStamp = TimeStamp::Now(); + mChannel->SetHandleFetchEventEnd(timeStamp); + mChannel->SetChannelResetEnd(timeStamp); + mChannel->SaveTimeStamps(); + + nsresult rv = mChannel->ResetInterception(); + if (NS_FAILED(rv)) { + NS_WARNING("Failed to resume intercepted network request"); + mChannel->CancelInterception(rv); + } + return rv; + } + }; + + bool DispatchFetchEvent(JSContext* aCx, WorkerPrivate* aWorkerPrivate) { + MOZ_ASSERT(aCx); + MOZ_ASSERT(aWorkerPrivate); + MOZ_ASSERT(aWorkerPrivate->IsServiceWorker()); + GlobalObject globalObj(aCx, aWorkerPrivate->GlobalScope()->GetWrapper()); + + RefPtr internalHeaders = + new InternalHeaders(HeadersGuardEnum::Request); + MOZ_ASSERT(mHeaderNames.Length() == mHeaderValues.Length()); + for (uint32_t i = 0; i < mHeaderNames.Length(); i++) { + ErrorResult result; + internalHeaders->Set(mHeaderNames[i], mHeaderValues[i], result); + if (NS_WARN_IF(result.Failed())) { + result.SuppressException(); + return false; + } + } + + ErrorResult result; + internalHeaders->SetGuard(HeadersGuardEnum::Immutable, result); + if (NS_WARN_IF(result.Failed())) { + result.SuppressException(); + return false; + } + auto internalReq = MakeSafeRefPtr( + mSpec, mFragment, mMethod, internalHeaders.forget(), mCacheMode, + mRequestMode, mRequestRedirect, mRequestCredentials, mReferrer, + mReferrerPolicy, mContentPolicyType, mIntegrity); + internalReq->SetBody(mUploadStream, mUploadStreamContentLength); + + nsCOMPtr channel; + nsresult rv = mInterceptedChannel->GetChannel(getter_AddRefs(channel)); + NS_ENSURE_SUCCESS(rv, false); + + nsCOMPtr cic = do_QueryInterface(channel); + if (cic && !cic->PreferredAlternativeDataTypes().IsEmpty()) { + // TODO: the internal request probably needs all the preferred types. + nsAutoCString alternativeDataType; + alternativeDataType.Assign( + cic->PreferredAlternativeDataTypes()[0].type()); + internalReq->SetPreferredAlternativeDataType(alternativeDataType); + } + + nsCOMPtr global = + do_QueryInterface(globalObj.GetAsSupports()); + if (NS_WARN_IF(!global)) { + return false; + } + + // TODO This request object should be created with a AbortSignal object + // which should be aborted if the loading is aborted. See bug 1394102. + RefPtr request = + new Request(global, internalReq.clonePtr(), nullptr); + + MOZ_ASSERT_IF(internalReq->IsNavigationRequest(), + request->Redirect() == RequestRedirect::Manual); + + RootedDictionary init(aCx); + init.mRequest = request; + init.mBubbles = false; + init.mCancelable = true; + // Only expose the FetchEvent.clientId on subresource requests for now. + // Once we implement .targetClientId we can then start exposing .clientId + // on non-subresource requests as well. See bug 1487534. + if (!mClientId.IsEmpty() && !internalReq->IsNavigationRequest()) { + init.mClientId = mClientId; + } + + /* + * https://w3c.github.io/ServiceWorker/#on-fetch-request-algorithm + * + * "If request is a non-subresource request and request’s + * destination is not "report", initialize e’s resultingClientId attribute + * to reservedClient’s [resultingClient's] id, and to the empty string + * otherwise." (Step 18.8) + */ + if (!mResultingClientId.IsEmpty() && mIsNonSubresourceRequest && + internalReq->Destination() != RequestDestination::Report) { + init.mResultingClientId = mResultingClientId; + } + + RefPtr event = + FetchEvent::Constructor(globalObj, u"fetch"_ns, init); + + event->PostInit(mInterceptedChannel, mRegistration, mScriptSpec); + event->SetTrusted(true); + + mInterceptedChannel->SetHandleFetchEventStart(TimeStamp::Now()); + + nsresult rv2 = DispatchExtendableEventOnWorkerScope( + aCx, aWorkerPrivate->GlobalScope(), event, nullptr); + if ((NS_WARN_IF(NS_FAILED(rv2)) && + rv2 != NS_ERROR_XPC_JS_THREW_EXCEPTION) || + !event->WaitToRespond()) { + nsCOMPtr runnable; + MOZ_ASSERT(!aWorkerPrivate->UsesSystemPrincipal(), + "We don't support system-principal serviceworkers"); + if (event->DefaultPrevented(CallerType::NonSystem)) { + runnable = new CancelChannelRunnable(mInterceptedChannel, mRegistration, + NS_ERROR_INTERCEPTION_FAILED); + } else { + runnable = new ResumeRequest(mInterceptedChannel); + } + + MOZ_ALWAYS_SUCCEEDS( + mWorkerPrivate->DispatchToMainThread(runnable.forget())); + } + + return true; + } +}; + +NS_IMPL_ISUPPORTS_INHERITED(FetchEventRunnable, WorkerRunnable, + nsIHttpHeaderVisitor) + +} // anonymous namespace + +nsresult ServiceWorkerPrivate::SendFetchEvent( + nsIInterceptedChannel* aChannel, nsILoadGroup* aLoadGroup, + const nsAString& aClientId, const nsAString& aResultingClientId) { + MOZ_ASSERT(NS_IsMainThread()); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (NS_WARN_IF(!mInfo || !swm)) { + return NS_ERROR_FAILURE; + } + + nsCOMPtr channel; + nsresult rv = aChannel->GetChannel(getter_AddRefs(channel)); + NS_ENSURE_SUCCESS(rv, rv); + bool isNonSubresourceRequest = + nsContentUtils::IsNonSubresourceRequest(channel); + + RefPtr registration; + if (isNonSubresourceRequest) { + registration = swm->GetRegistration(mInfo->Principal(), mInfo->Scope()); + } else { + nsCOMPtr loadInfo = channel->LoadInfo(); + + // We'll check for a null registration below rather than an error code here. + Unused << swm->GetClientRegistration(loadInfo->GetClientInfo().ref(), + getter_AddRefs(registration)); + } + + // Its possible the registration is removed between starting the interception + // and actually dispatching the fetch event. In these cases we simply + // want to restart the original network request. Since this is a normal + // condition we handle the reset here instead of returning an error which + // would in turn trigger a console report. + if (!registration) { + nsresult rv = aChannel->ResetInterception(); + if (NS_FAILED(rv)) { + NS_WARNING("Failed to resume intercepted network request"); + aChannel->CancelInterception(rv); + } + return NS_OK; + } + + // Handle Fetch algorithm - step 16. If the service worker didn't register + // any fetch event handlers, then abort the interception and maybe trigger + // the soft update algorithm. + if (!mInfo->HandlesFetch()) { + nsresult rv = aChannel->ResetInterception(); + if (NS_FAILED(rv)) { + NS_WARNING("Failed to resume intercepted network request"); + aChannel->CancelInterception(rv); + } + + // Trigger soft updates if necessary. + registration->MaybeScheduleTimeCheckAndUpdate(); + + return NS_OK; + } + + if (mInner) { + return mInner->SendFetchEvent(std::move(registration), aChannel, aClientId, + aResultingClientId); + } + + aChannel->SetLaunchServiceWorkerStart(TimeStamp::Now()); + aChannel->SetDispatchFetchEventStart(TimeStamp::Now()); + + bool newWorkerCreated = false; + rv = SpawnWorkerIfNeeded(FetchEvent, &newWorkerCreated, aLoadGroup); + NS_ENSURE_SUCCESS(rv, rv); + + if (!newWorkerCreated) { + aChannel->SetLaunchServiceWorkerEnd(TimeStamp::Now()); + } + + nsMainThreadPtrHandle handle( + new nsMainThreadPtrHolder("nsIInterceptedChannel", + aChannel, false)); + + nsMainThreadPtrHandle regInfo( + new nsMainThreadPtrHolder( + "ServiceWorkerRegistrationInfoProxy", registration, false)); + + RefPtr token = CreateEventKeepAliveToken(); + + RefPtr r = new FetchEventRunnable( + mWorkerPrivate, token, handle, mInfo->ScriptSpec(), regInfo, aClientId, + aResultingClientId, newWorkerCreated, isNonSubresourceRequest); + rv = r->Init(); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + if (mInfo->State() == ServiceWorkerState::Activating) { + mPendingFunctionalEvents.AppendElement(r.forget()); + return NS_OK; + } + + MOZ_ASSERT(mInfo->State() == ServiceWorkerState::Activated); + + if (NS_WARN_IF(!r->Dispatch())) { + return NS_ERROR_FAILURE; + } + + return NS_OK; +} + +nsresult ServiceWorkerPrivate::SpawnWorkerIfNeeded(WakeUpReason aWhy, + bool* aNewWorkerCreated, + nsILoadGroup* aLoadGroup) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(!mInner); + + // Defaults to no new worker created, but if there is one, we'll set the value + // to true at the end of this function. + if (aNewWorkerCreated) { + *aNewWorkerCreated = false; + } + + // If the worker started shutting down on itself we may have a stale + // reference here. Invoke our termination code to clean it out. + if (mWorkerPrivate && mWorkerPrivate->ParentStatusProtected() > Running) { + TerminateWorker(); + MOZ_DIAGNOSTIC_ASSERT(!mWorkerPrivate); + } + + if (mWorkerPrivate) { + // If we have a load group here then use it to update the service worker + // load group. This was added when we needed the load group's tab child + // to pass some security checks. Those security checks are gone, though, + // and we could possibly remove this now. For now we just do it + // opportunistically. When the service worker is running in a separate + // process from the client that initiated the intercepted channel, then + // the load group will be nullptr. UpdateOverrideLoadGroup ignores nullptr + // load groups. + mWorkerPrivate->UpdateOverridenLoadGroup(aLoadGroup); + RenewKeepAliveToken(aWhy); + + return NS_OK; + } + + // Sanity check: mSupportsArray should be empty if we're about to + // spin up a new worker. + MOZ_ASSERT(mSupportsArray.IsEmpty()); + + if (NS_WARN_IF(!mInfo)) { + NS_WARNING("Trying to wake up a dead service worker."); + return NS_ERROR_FAILURE; + } + + RefPtr swm = ServiceWorkerManager::GetInstance(); + NS_ENSURE_TRUE(swm, NS_ERROR_FAILURE); + + RefPtr reg = + swm->GetRegistration(mInfo->Principal(), mInfo->Scope()); + NS_ENSURE_TRUE(reg, NS_ERROR_FAILURE); + + // TODO(catalinb): Bug 1192138 - Add telemetry for service worker wake-ups. + + // Ensure that the IndexedDatabaseManager is initialized + Unused << NS_WARN_IF(!IndexedDatabaseManager::GetOrCreate()); + + WorkerLoadInfo info; + nsresult rv = NS_NewURI(getter_AddRefs(info.mBaseURI), mInfo->ScriptSpec()); + + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + info.mResolvedScriptURI = info.mBaseURI; + MOZ_ASSERT(!mInfo->CacheName().IsEmpty()); + info.mServiceWorkerCacheName = mInfo->CacheName(); + + info.mServiceWorkerDescriptor.emplace(mInfo->Descriptor()); + info.mServiceWorkerRegistrationDescriptor.emplace(reg->Descriptor()); + + info.mLoadGroup = aLoadGroup; + + // If we are loading a script for a ServiceWorker then we must not + // try to intercept it. If the interception matches the current + // ServiceWorker's scope then we could deadlock the load. + info.mLoadFlags = + mInfo->GetImportsLoadFlags() | nsIChannel::LOAD_BYPASS_SERVICE_WORKER; + + rv = info.mBaseURI->GetHost(info.mDomain); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + info.mPrincipal = mInfo->Principal(); + info.mLoadingPrincipal = info.mPrincipal; + // PartitionedPrincipal for ServiceWorkers is equal to mPrincipal because, at + // the moment, ServiceWorkers are not exposed in partitioned contexts. + info.mPartitionedPrincipal = info.mPrincipal; + + info.mCookieJarSettings = mozilla::net::CookieJarSettings::Create(); + MOZ_ASSERT(info.mCookieJarSettings); + + net::CookieJarSettings::Cast(info.mCookieJarSettings) + ->SetPartitionKey(info.mResolvedScriptURI); + + info.mStorageAccess = + StorageAllowedForServiceWorker(info.mPrincipal, info.mCookieJarSettings); + + info.mOriginAttributes = mInfo->GetOriginAttributes(); + + // Verify that we don't have any CSP on pristine client. +#ifdef MOZ_DIAGNOSTIC_ASSERT_ENABLED + nsCOMPtr csp; + if (info.mChannel) { + nsCOMPtr loadinfo = info.mChannel->LoadInfo(); + csp = loadinfo->GetCsp(); + } + MOZ_DIAGNOSTIC_ASSERT(!csp); +#endif + + // Default CSP permissions for now. These will be overrided if necessary + // based on the script CSP headers during load in ScriptLoader. + info.mEvalAllowed = true; + info.mReportCSPViolations = false; + + WorkerPrivate::OverrideLoadInfoLoadGroup(info, info.mPrincipal); + + rv = info.SetPrincipalsAndCSPOnMainThread( + info.mPrincipal, info.mPartitionedPrincipal, info.mLoadGroup, nullptr); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + info.mAgentClusterId = reg->AgentClusterId(); + + AutoJSAPI jsapi; + jsapi.Init(); + ErrorResult error; + NS_ConvertUTF8toUTF16 scriptSpec(mInfo->ScriptSpec()); + + mWorkerPrivate = WorkerPrivate::Constructor(jsapi.cx(), scriptSpec, false, + WorkerTypeService, VoidString(), + ""_ns, &info, error); + if (NS_WARN_IF(error.Failed())) { + return error.StealNSResult(); + } + + RenewKeepAliveToken(aWhy); + + if (aNewWorkerCreated) { + *aNewWorkerCreated = true; + } + + return NS_OK; +} + +bool ServiceWorkerPrivate::MaybeStoreISupports(nsISupports* aSupports) { + MOZ_ASSERT(NS_IsMainThread()); + + if (!mWorkerPrivate) { + MOZ_DIAGNOSTIC_ASSERT(mSupportsArray.IsEmpty()); + return false; + } + + MOZ_ASSERT(!mSupportsArray.Contains(aSupports)); + mSupportsArray.AppendElement(aSupports); + return true; +} + +void ServiceWorkerPrivate::RemoveISupports(nsISupports* aSupports) { + MOZ_ASSERT(NS_IsMainThread()); + mSupportsArray.RemoveElement(aSupports); +} + +void ServiceWorkerPrivate::TerminateWorker() { + MOZ_ASSERT(NS_IsMainThread()); + + if (mInner) { + return mInner->TerminateWorker(); + } + + mIdleWorkerTimer->Cancel(); + mIdleKeepAliveToken = nullptr; + if (mWorkerPrivate) { + if (StaticPrefs::dom_serviceWorkers_testing_enabled()) { + nsCOMPtr os = services::GetObserverService(); + if (os) { + os->NotifyObservers(nullptr, "service-worker-shutdown", nullptr); + } + } + + Unused << NS_WARN_IF(!mWorkerPrivate->Cancel()); + RefPtr workerPrivate = std::move(mWorkerPrivate); + mozilla::Unused << workerPrivate; + mSupportsArray.Clear(); + + // Any pending events are never going to fire on this worker. Cancel + // them so that intercepted channels can be reset and other resources + // cleaned up. + nsTArray> pendingEvents = + std::move(mPendingFunctionalEvents); + for (uint32_t i = 0; i < pendingEvents.Length(); ++i) { + pendingEvents[i]->Cancel(); + } + } +} + +void ServiceWorkerPrivate::NoteDeadServiceWorkerInfo() { + MOZ_ASSERT(NS_IsMainThread()); + + if (mInner) { + mInner->NoteDeadOuter(); + mInner = nullptr; + } else { + TerminateWorker(); + } + + mInfo = nullptr; +} + +namespace { + +class UpdateStateControlRunnable final + : public MainThreadWorkerControlRunnable { + const ServiceWorkerState mState; + + bool WorkerRun(JSContext* aCx, WorkerPrivate* aWorkerPrivate) override { + MOZ_DIAGNOSTIC_ASSERT(aWorkerPrivate); + aWorkerPrivate->UpdateServiceWorkerState(mState); + return true; + } + + public: + UpdateStateControlRunnable(WorkerPrivate* aWorkerPrivate, + ServiceWorkerState aState) + : MainThreadWorkerControlRunnable(aWorkerPrivate), mState(aState) {} +}; + +} // anonymous namespace + +void ServiceWorkerPrivate::UpdateState(ServiceWorkerState aState) { + MOZ_ASSERT(NS_IsMainThread()); + + if (mInner) { + return mInner->UpdateState(aState); + } + + if (!mWorkerPrivate) { + MOZ_DIAGNOSTIC_ASSERT(mPendingFunctionalEvents.IsEmpty()); + return; + } + + RefPtr r = + new UpdateStateControlRunnable(mWorkerPrivate, aState); + Unused << r->Dispatch(); + + if (aState != ServiceWorkerState::Activated) { + return; + } + + nsTArray> pendingEvents = + std::move(mPendingFunctionalEvents); + + for (uint32_t i = 0; i < pendingEvents.Length(); ++i) { + RefPtr r = std::move(pendingEvents[i]); + if (NS_WARN_IF(!r->Dispatch())) { + NS_WARNING("Failed to dispatch pending functional event!"); + } + } +} + +nsresult ServiceWorkerPrivate::GetDebugger(nsIWorkerDebugger** aResult) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aResult); + + if (mInner) { + *aResult = nullptr; + return NS_ERROR_NOT_IMPLEMENTED; + } + + if (!mDebuggerCount) { + return NS_OK; + } + + MOZ_ASSERT(mWorkerPrivate); + + nsCOMPtr debugger = mWorkerPrivate->Debugger(); + debugger.forget(aResult); + + return NS_OK; +} + +nsresult ServiceWorkerPrivate::AttachDebugger() { + MOZ_ASSERT(NS_IsMainThread()); + + // When the first debugger attaches to a worker, we spawn a worker if needed, + // and cancel the idle timeout. The idle timeout should not be reset until + // the last debugger detached from the worker. + if (!mDebuggerCount) { + nsresult rv = mInner ? mInner->SpawnWorkerIfNeeded() + : SpawnWorkerIfNeeded(AttachEvent); + NS_ENSURE_SUCCESS(rv, rv); + + /** + * Under parent-intercept mode (i.e. non-null `mInner`), renewing the idle + * KeepAliveToken for spawning workers happens asynchronously, rather than + * synchronously without parent-intercept (see + * `ServiceWorkerPrivate::SpawnWorkerIfNeeded`). The asynchronous renewal is + * because the actual spawning of workers under parent-intercept occurs in a + * content process, so we will only renew once notified that the worker has + * been successfully created + * (see `ServiceWorkerPrivateImpl::CreationSucceeded`). + * + * This means that the DevTools way of starting up a worker by calling + * `AttachDebugger` immediately followed by `DetachDebugger` will spawn and + * immediately terminate a worker (because `mTokenCount` is possibly 0 + * due to the idle KeepAliveToken being created asynchronously). So, just + * renew the KeepAliveToken right now. + */ + if (mInner) { + RenewKeepAliveToken(AttachEvent); + } + + mIdleWorkerTimer->Cancel(); + } + + ++mDebuggerCount; + + return NS_OK; +} + +nsresult ServiceWorkerPrivate::DetachDebugger() { + MOZ_ASSERT(NS_IsMainThread()); + + if (!mDebuggerCount) { + return NS_ERROR_UNEXPECTED; + } + + --mDebuggerCount; + + // When the last debugger detaches from a worker, we either reset the idle + // timeout, or terminate the worker if there are no more active tokens. + if (!mDebuggerCount) { + if (mTokenCount) { + ResetIdleTimeout(); + } else { + TerminateWorker(); + } + } + + return NS_OK; +} + +bool ServiceWorkerPrivate::IsIdle() const { + MOZ_ASSERT(NS_IsMainThread()); + return mTokenCount == 0 || (mTokenCount == 1 && mIdleKeepAliveToken); +} + +RefPtr ServiceWorkerPrivate::GetIdlePromise() { +#ifdef DEBUG + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(!IsIdle()); + MOZ_ASSERT(!mIdlePromiseObtained, "Idle promise may only be obtained once!"); + mIdlePromiseObtained = true; +#endif + + return mIdlePromiseHolder.Ensure(__func__); +} + +namespace { + +class ServiceWorkerPrivateTimerCallback final : public nsITimerCallback, + public nsINamed { + public: + typedef void (ServiceWorkerPrivate::*Method)(nsITimer*); + + ServiceWorkerPrivateTimerCallback(ServiceWorkerPrivate* aServiceWorkerPrivate, + Method aMethod) + : mServiceWorkerPrivate(aServiceWorkerPrivate), mMethod(aMethod) {} + + NS_IMETHOD + Notify(nsITimer* aTimer) override { + (mServiceWorkerPrivate->*mMethod)(aTimer); + mServiceWorkerPrivate = nullptr; + return NS_OK; + } + + NS_IMETHOD + GetName(nsACString& aName) override { + aName.AssignLiteral("ServiceWorkerPrivateTimerCallback"); + return NS_OK; + } + + private: + ~ServiceWorkerPrivateTimerCallback() = default; + + RefPtr mServiceWorkerPrivate; + Method mMethod; + + NS_DECL_THREADSAFE_ISUPPORTS +}; + +NS_IMPL_ISUPPORTS(ServiceWorkerPrivateTimerCallback, nsITimerCallback, + nsINamed); + +} // anonymous namespace + +void ServiceWorkerPrivate::NoteIdleWorkerCallback(nsITimer* aTimer) { + MOZ_ASSERT(NS_IsMainThread()); + + MOZ_ASSERT(aTimer == mIdleWorkerTimer, "Invalid timer!"); + + // Release ServiceWorkerPrivate's token, since the grace period has ended. + mIdleKeepAliveToken = nullptr; + + if (mWorkerPrivate || (mInner && !mInner->WorkerIsDead())) { + // There sould only be EITHER mWorkerPrivate or mInner (but not both). + MOZ_ASSERT(!(mWorkerPrivate && mInner)); + + // If we still have a living worker at this point it means that either there + // are pending waitUntil promises or the worker is doing some long-running + // computation. Wait a bit more until we forcibly terminate the worker. + uint32_t timeout = + Preferences::GetInt("dom.serviceWorkers.idle_extended_timeout"); + nsCOMPtr cb = new ServiceWorkerPrivateTimerCallback( + this, &ServiceWorkerPrivate::TerminateWorkerCallback); + DebugOnly rv = mIdleWorkerTimer->InitWithCallback( + cb, timeout, nsITimer::TYPE_ONE_SHOT); + MOZ_ASSERT(NS_SUCCEEDED(rv)); + } +} + +void ServiceWorkerPrivate::TerminateWorkerCallback(nsITimer* aTimer) { + MOZ_ASSERT(NS_IsMainThread()); + + MOZ_ASSERT(aTimer == this->mIdleWorkerTimer, "Invalid timer!"); + + // mInfo must be non-null at this point because NoteDeadServiceWorkerInfo + // which zeroes it calls TerminateWorker which cancels our timer which will + // ensure we don't get invoked even if the nsTimerEvent is in the event queue. + ServiceWorkerManager::LocalizeAndReportToAllClients( + mInfo->Scope(), "ServiceWorkerGraceTimeoutTermination", + nsTArray{NS_ConvertUTF8toUTF16(mInfo->Scope())}); + + TerminateWorker(); +} + +void ServiceWorkerPrivate::RenewKeepAliveToken(WakeUpReason aWhy) { + // We should have an active worker if we're renewing the keep alive token. + MOZ_ASSERT(mWorkerPrivate || (mInner && !mInner->WorkerIsDead())); + + // If there is at least one debugger attached to the worker, the idle worker + // timeout was canceled when the first debugger attached to the worker. It + // should not be reset until the last debugger detaches from the worker. + if (!mDebuggerCount) { + ResetIdleTimeout(); + } + + if (!mIdleKeepAliveToken) { + mIdleKeepAliveToken = new KeepAliveToken(this); + } +} + +void ServiceWorkerPrivate::ResetIdleTimeout() { + uint32_t timeout = Preferences::GetInt("dom.serviceWorkers.idle_timeout"); + nsCOMPtr cb = new ServiceWorkerPrivateTimerCallback( + this, &ServiceWorkerPrivate::NoteIdleWorkerCallback); + DebugOnly rv = + mIdleWorkerTimer->InitWithCallback(cb, timeout, nsITimer::TYPE_ONE_SHOT); + MOZ_ASSERT(NS_SUCCEEDED(rv)); +} + +void ServiceWorkerPrivate::AddToken() { + MOZ_ASSERT(NS_IsMainThread()); + ++mTokenCount; +} + +void ServiceWorkerPrivate::ReleaseToken() { + MOZ_ASSERT(NS_IsMainThread()); + + MOZ_ASSERT(mTokenCount > 0); + --mTokenCount; + + if (IsIdle()) { + mIdlePromiseHolder.ResolveIfExists(true, __func__); + + if (!mTokenCount) { + TerminateWorker(); + } + + // mInfo can be nullptr here if NoteDeadServiceWorkerInfo() is called while + // the KeepAliveToken is being proxy released as a runnable. + else if (mInfo) { + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (swm) { + swm->WorkerIsIdle(mInfo); + } + } + } +} + +already_AddRefed +ServiceWorkerPrivate::CreateEventKeepAliveToken() { + MOZ_ASSERT(NS_IsMainThread()); + + // When the WorkerPrivate is in a separate process, we first hold a normal + // KeepAliveToken. Then, after we're notified that the worker is alive, we + // create the idle KeepAliveToken. + MOZ_ASSERT(mWorkerPrivate || (mInner && !mInner->WorkerIsDead())); + MOZ_ASSERT(mIdleKeepAliveToken || (mInner && !mInner->WorkerIsDead())); + + RefPtr ref = new KeepAliveToken(this); + return ref.forget(); +} + +void ServiceWorkerPrivate::SetHandlesFetch(bool aValue) { + MOZ_ASSERT(NS_IsMainThread()); + + if (NS_WARN_IF(!mInfo)) { + return; + } + + mInfo->SetHandlesFetch(aValue); +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerPrivate.h b/dom/serviceworkers/ServiceWorkerPrivate.h new file mode 100644 index 0000000000..528baad17d --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerPrivate.h @@ -0,0 +1,305 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworkerprivate_h +#define mozilla_dom_serviceworkerprivate_h + +#include + +#include "nsCOMPtr.h" +#include "mozilla/dom/WorkerPrivate.h" +#include "mozilla/MozPromise.h" + +#define NOTIFICATION_CLICK_EVENT_NAME u"notificationclick" +#define NOTIFICATION_CLOSE_EVENT_NAME u"notificationclose" + +class nsIInterceptedChannel; +class nsIWorkerDebugger; + +namespace mozilla { + +class JSObjectHolder; + +namespace dom { + +class ClientInfoAndState; +class ServiceWorkerCloneData; +class ServiceWorkerInfo; +class ServiceWorkerPrivate; +class ServiceWorkerPrivateImpl; +class ServiceWorkerRegistrationInfo; + +namespace ipc { +class StructuredCloneData; +} // namespace ipc + +class LifeCycleEventCallback : public Runnable { + public: + LifeCycleEventCallback() : Runnable("dom::LifeCycleEventCallback") {} + + // Called on the worker thread. + virtual void SetResult(bool aResult) = 0; +}; + +// Used to keep track of pending waitUntil as well as in-flight extendable +// events. When the last token is released, we attempt to terminate the worker. +class KeepAliveToken final : public nsISupports { + public: + NS_DECL_ISUPPORTS + + explicit KeepAliveToken(ServiceWorkerPrivate* aPrivate); + + private: + ~KeepAliveToken(); + + RefPtr mPrivate; +}; + +// ServiceWorkerPrivate is a wrapper for managing the on-demand aspect of +// service workers. It handles all event dispatching to the worker and ensures +// the worker thread is running when needed. +// +// Lifetime management: To spin up the worker thread we own a |WorkerPrivate| +// object which can be cancelled if no events are received for a certain +// amount of time. The worker is kept alive by holding a |KeepAliveToken| +// reference. +// +// Extendable events hold tokens for the duration of their handler execution +// and until their waitUntil promise is resolved, while ServiceWorkerPrivate +// will hold a token for |dom.serviceWorkers.idle_timeout| seconds after each +// new event. +// +// Note: All timer events must be handled on the main thread because the +// worker may block indefinitely the worker thread (e. g. infinite loop in the +// script). +// +// There are 3 cases where we may ignore keep alive tokens: +// 1. When ServiceWorkerPrivate's token expired, if there are still waitUntil +// handlers holding tokens, we wait another +// |dom.serviceWorkers.idle_extended_timeout| seconds before forcibly +// terminating the worker. +// 2. If the worker stopped controlling documents and it is not handling push +// events. +// 3. The content process is shutting down. +// +// Adding an API function for a new event requires calling |SpawnWorkerIfNeeded| +// with an appropriate reason before any runnable is dispatched to the worker. +// If the event is extendable then the runnable should inherit +// ExtendableEventWorkerRunnable. +class ServiceWorkerPrivate final { + friend class KeepAliveToken; + friend class ServiceWorkerPrivateImpl; + + public: + NS_IMETHOD_(MozExternalRefCountType) AddRef(); + NS_IMETHOD_(MozExternalRefCountType) Release(); + NS_DECL_CYCLE_COLLECTION_NATIVE_CLASS(ServiceWorkerPrivate) + + using HasThreadSafeRefCnt = std::false_type; + + protected: + nsCycleCollectingAutoRefCnt mRefCnt; + NS_DECL_OWNINGTHREAD + + public: + // TODO: remove this class. There's one (and only should be one) concrete + // class that derives this abstract base class. + class Inner { + public: + NS_INLINE_DECL_PURE_VIRTUAL_REFCOUNTING + + virtual nsresult SendMessageEvent( + RefPtr&& aData, + const ClientInfoAndState& aClientInfoAndState) = 0; + + virtual nsresult CheckScriptEvaluation( + RefPtr aScriptEvaluationCallback) = 0; + + virtual nsresult SendLifeCycleEvent( + const nsAString& aEventName, + RefPtr aCallback) = 0; + + virtual nsresult SendPushEvent( + RefPtr aRegistration, + const nsAString& aMessageId, const Maybe>& aData) = 0; + + virtual nsresult SendPushSubscriptionChangeEvent() = 0; + + virtual nsresult SendNotificationEvent( + const nsAString& aEventName, const nsAString& aID, + const nsAString& aTitle, const nsAString& aDir, const nsAString& aLang, + const nsAString& aBody, const nsAString& aTag, const nsAString& aIcon, + const nsAString& aData, const nsAString& aBehavior, + const nsAString& aScope, uint32_t aDisableOpenClickDelay) = 0; + + virtual nsresult SendFetchEvent( + RefPtr aRegistration, + nsCOMPtr aChannel, const nsAString& aClientId, + const nsAString& aResultingClientId) = 0; + + virtual nsresult SpawnWorkerIfNeeded() = 0; + + virtual void TerminateWorker() = 0; + + virtual void UpdateState(ServiceWorkerState aState) = 0; + + virtual void NoteDeadOuter() = 0; + + virtual bool WorkerIsDead() const = 0; + }; + + explicit ServiceWorkerPrivate(ServiceWorkerInfo* aInfo); + + nsresult SendMessageEvent(RefPtr&& aData, + const ClientInfoAndState& aClientInfoAndState); + + // This is used to validate the worker script and continue the installation + // process. + nsresult CheckScriptEvaluation(LifeCycleEventCallback* aCallback); + + nsresult SendLifeCycleEvent(const nsAString& aEventType, + LifeCycleEventCallback* aCallback); + + nsresult SendPushEvent(const nsAString& aMessageId, + const Maybe>& aData, + ServiceWorkerRegistrationInfo* aRegistration); + + nsresult SendPushSubscriptionChangeEvent(); + + nsresult SendNotificationEvent(const nsAString& aEventName, + const nsAString& aID, const nsAString& aTitle, + const nsAString& aDir, const nsAString& aLang, + const nsAString& aBody, const nsAString& aTag, + const nsAString& aIcon, const nsAString& aData, + const nsAString& aBehavior, + const nsAString& aScope); + + nsresult SendFetchEvent(nsIInterceptedChannel* aChannel, + nsILoadGroup* aLoadGroup, const nsAString& aClientId, + const nsAString& aResultingClientId); + + bool MaybeStoreISupports(nsISupports* aSupports); + + void RemoveISupports(nsISupports* aSupports); + + // This will terminate the current running worker thread and drop the + // workerPrivate reference. + // Called by ServiceWorkerInfo when [[Clear Registration]] is invoked + // or whenever the spec mandates that we terminate the worker. + // This is a no-op if the worker has already been stopped. + void TerminateWorker(); + + void NoteDeadServiceWorkerInfo(); + + void NoteStoppedControllingDocuments(); + + void UpdateState(ServiceWorkerState aState); + + nsresult GetDebugger(nsIWorkerDebugger** aResult); + + nsresult AttachDebugger(); + + nsresult DetachDebugger(); + + bool IsIdle() const; + + // This promise is used schedule clearing of the owning registrations and its + // associated Service Workers if that registration becomes "unreachable" by + // the ServiceWorkerManager. This occurs under two conditions, which are the + // preconditions to calling this method: + // - The owning registration must be unregistered. + // - The associated Service Worker must *not* be controlling clients. + // + // Additionally, perhaps stating the obvious, the associated Service Worker + // must *not* be idle (whatever must be done "when idle" can just be done + // immediately). + RefPtr GetIdlePromise(); + + void SetHandlesFetch(bool aValue); + + private: + enum WakeUpReason { + FetchEvent = 0, + PushEvent, + PushSubscriptionChangeEvent, + MessageEvent, + NotificationClickEvent, + NotificationCloseEvent, + LifeCycleEvent, + AttachEvent, + Unknown + }; + + // Timer callbacks + void NoteIdleWorkerCallback(nsITimer* aTimer); + + void TerminateWorkerCallback(nsITimer* aTimer); + + void RenewKeepAliveToken(WakeUpReason aWhy); + + void ResetIdleTimeout(); + + void AddToken(); + + void ReleaseToken(); + + nsresult SpawnWorkerIfNeeded(WakeUpReason aWhy, + bool* aNewWorkerCreated = nullptr, + nsILoadGroup* aLoadGroup = nullptr); + + ~ServiceWorkerPrivate(); + + already_AddRefed CreateEventKeepAliveToken(); + + // The info object owns us. It is possible to outlive it for a brief period + // of time if there are pending waitUntil promises, in which case it + // will be null and |SpawnWorkerIfNeeded| will always fail. + ServiceWorkerInfo* MOZ_NON_OWNING_REF mInfo; + + // The WorkerPrivate object can only be closed by this class or by the + // RuntimeService class if gecko is shutting down. Closing the worker + // multiple times is OK, since the second attempt will be a no-op. + RefPtr mWorkerPrivate; + + nsCOMPtr mIdleWorkerTimer; + + // We keep a token for |dom.serviceWorkers.idle_timeout| seconds to give the + // worker a grace period after each event. + RefPtr mIdleKeepAliveToken; + + uint64_t mDebuggerCount; + + uint64_t mTokenCount; + + // Meant for keeping objects alive while handling requests from the worker + // on the main thread. Access to this array is provided through + // |StoreISupports| and |RemoveISupports|. Note that the array is also + // cleared whenever the worker is terminated. + nsTArray> mSupportsArray; + + // Array of function event worker runnables that are pending due to + // the worker activating. Main thread only. + nsTArray> mPendingFunctionalEvents; + + RefPtr mInner; + + // Used by the owning `ServiceWorkerRegistrationInfo` when it wants to call + // `Clear` after being unregistered and isn't controlling any clients but this + // worker (i.e. the registration's active worker) isn't idle yet. Note that + // such an event should happen at most once in a + // `ServiceWorkerRegistrationInfo`s lifetime, so this promise should also only + // be obtained at most once. + MozPromiseHolder mIdlePromiseHolder; + +#ifdef DEBUG + bool mIdlePromiseObtained = false; +#endif +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_serviceworkerprivate_h diff --git a/dom/serviceworkers/ServiceWorkerPrivateImpl.cpp b/dom/serviceworkers/ServiceWorkerPrivateImpl.cpp new file mode 100644 index 0000000000..54bef4bd1b --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerPrivateImpl.cpp @@ -0,0 +1,1085 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerPrivateImpl.h" + +#include + +#include "MainThreadUtils.h" +#include "js/ErrorReport.h" +#include "nsContentUtils.h" +#include "nsDebug.h" +#include "nsError.h" +#include "nsIChannel.h" +#include "nsIHttpChannel.h" +#include "nsIHttpChannelInternal.h" +#include "nsIHttpHeaderVisitor.h" +#include "nsINetworkInterceptController.h" +#include "nsIObserverService.h" +#include "nsIScriptError.h" +#include "nsIURI.h" +#include "nsIUploadChannel2.h" +#include "nsThreadUtils.h" +#include "nsICacheInfoChannel.h" +#include "nsNetUtil.h" + +#include "ServiceWorkerCloneData.h" +#include "ServiceWorkerManager.h" +#include "ServiceWorkerRegistrationInfo.h" +#include "mozilla/Assertions.h" +#include "mozilla/ErrorResult.h" +#include "mozilla/ipc/PBackgroundChild.h" +#include "mozilla/Maybe.h" +#include "mozilla/Result.h" +#include "mozilla/ResultExtensions.h" +#include "mozilla/ScopeExit.h" +#include "mozilla/Services.h" +#include "mozilla/StaticPrefs_dom.h" +#include "mozilla/StoragePrincipalHelper.h" +#include "mozilla/Unused.h" +#include "mozilla/dom/ClientIPCTypes.h" +#include "mozilla/dom/DOMTypes.h" +#include "mozilla/dom/FetchEventOpChild.h" +#include "mozilla/dom/InternalHeaders.h" +#include "mozilla/dom/InternalRequest.h" +#include "mozilla/dom/ReferrerInfo.h" +#include "mozilla/dom/RemoteWorkerControllerChild.h" +#include "mozilla/dom/RemoteWorkerManager.h" // RemoteWorkerManager::GetRemoteType +#include "mozilla/dom/ServiceWorkerBinding.h" +#include "mozilla/ipc/BackgroundChild.h" +#include "mozilla/ipc/IPCStreamUtils.h" +#include "mozilla/ipc/URIUtils.h" +#include "mozilla/net/CookieJarSettings.h" +#include "mozilla/RemoteLazyInputStreamStorage.h" + +namespace mozilla { + +using namespace ipc; + +namespace dom { + +ServiceWorkerPrivateImpl::RAIIActorPtrHolder::RAIIActorPtrHolder( + already_AddRefed aActor) + : mActor(aActor) { + AssertIsOnMainThread(); + MOZ_ASSERT(mActor); + MOZ_ASSERT(mActor->Manager()); +} + +ServiceWorkerPrivateImpl::RAIIActorPtrHolder::~RAIIActorPtrHolder() { + AssertIsOnMainThread(); + + mDestructorPromiseHolder.ResolveIfExists(true, __func__); + + mActor->MaybeSendDelete(); +} + +RemoteWorkerControllerChild* +ServiceWorkerPrivateImpl::RAIIActorPtrHolder::operator->() const { + AssertIsOnMainThread(); + + return get(); +} + +RemoteWorkerControllerChild* ServiceWorkerPrivateImpl::RAIIActorPtrHolder::get() + const { + AssertIsOnMainThread(); + + return mActor.get(); +} + +RefPtr +ServiceWorkerPrivateImpl::RAIIActorPtrHolder::OnDestructor() { + AssertIsOnMainThread(); + + return mDestructorPromiseHolder.Ensure(__func__); +} + +ServiceWorkerPrivateImpl::ServiceWorkerPrivateImpl( + RefPtr aOuter) + : mOuter(std::move(aOuter)) { + AssertIsOnMainThread(); + MOZ_ASSERT(mOuter); + MOZ_ASSERT(WorkerIsDead()); +} + +nsresult ServiceWorkerPrivateImpl::Initialize() { + AssertIsOnMainThread(); + MOZ_ASSERT(mOuter); + MOZ_ASSERT(mOuter->mInfo); + + nsCOMPtr principal = mOuter->mInfo->Principal(); + + nsCOMPtr uri; + auto* basePrin = BasePrincipal::Cast(principal); + nsresult rv = basePrin->GetURI(getter_AddRefs(uri)); + + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + if (NS_WARN_IF(!uri)) { + return NS_ERROR_FAILURE; + } + + URIParams baseScriptURL; + SerializeURI(uri, baseScriptURL); + + nsString id; + rv = mOuter->mInfo->GetId(id); + + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + PrincipalInfo principalInfo; + rv = PrincipalToPrincipalInfo(principal, &principalInfo); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + RefPtr swm = ServiceWorkerManager::GetInstance(); + + if (NS_WARN_IF(!swm)) { + return NS_ERROR_DOM_ABORT_ERR; + } + + RefPtr regInfo = + swm->GetRegistration(principal, mOuter->mInfo->Scope()); + + if (NS_WARN_IF(!regInfo)) { + return NS_ERROR_DOM_INVALID_STATE_ERR; + } + + nsCOMPtr cookieJarSettings = + net::CookieJarSettings::Create(); + MOZ_ASSERT(cookieJarSettings); + + net::CookieJarSettings::Cast(cookieJarSettings)->SetPartitionKey(uri); + + net::CookieJarSettingsArgs cjsData; + net::CookieJarSettings::Cast(cookieJarSettings)->Serialize(cjsData); + + nsCOMPtr partitionedPrincipal; + rv = StoragePrincipalHelper::CreatePartitionedPrincipalForServiceWorker( + principal, cookieJarSettings, getter_AddRefs(partitionedPrincipal)); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + PrincipalInfo partitionedPrincipalInfo; + rv = + PrincipalToPrincipalInfo(partitionedPrincipal, &partitionedPrincipalInfo); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + StorageAccess storageAccess = + StorageAllowedForServiceWorker(principal, cookieJarSettings); + + ServiceWorkerData serviceWorkerData; + serviceWorkerData.cacheName() = mOuter->mInfo->CacheName(); + serviceWorkerData.loadFlags() = + static_cast(mOuter->mInfo->GetImportsLoadFlags() | + nsIChannel::LOAD_BYPASS_SERVICE_WORKER); + serviceWorkerData.id() = std::move(id); + + nsAutoCString domain; + rv = uri->GetHost(domain); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + auto remoteType = RemoteWorkerManager::GetRemoteType( + principal, WorkerType::WorkerTypeService); + if (NS_WARN_IF(remoteType.isErr())) { + return remoteType.unwrapErr(); + } + + mRemoteWorkerData = RemoteWorkerData( + NS_ConvertUTF8toUTF16(mOuter->mInfo->ScriptSpec()), baseScriptURL, + baseScriptURL, /* name */ VoidString(), + /* loading principal */ principalInfo, principalInfo, + partitionedPrincipalInfo, + /* useRegularPrincipal */ true, + + // ServiceWorkers run as first-party, no storage-access permission needed. + /* hasStorageAccessPermissionGranted */ false, + + cjsData, domain, + /* isSecureContext */ true, + /* clientInfo*/ Nothing(), + + // The RemoteWorkerData CTOR doesn't allow to set the referrerInfo via + // already_AddRefed<>. Let's set it to null. + /* referrerInfo */ nullptr, + + storageAccess, std::move(serviceWorkerData), regInfo->AgentClusterId(), + remoteType.unwrap()); + + mRemoteWorkerData.referrerInfo() = MakeAndAddRef(); + + // This fills in the rest of mRemoteWorkerData.serviceWorkerData(). + RefreshRemoteWorkerData(regInfo); + + return NS_OK; +} + +RefPtr ServiceWorkerPrivateImpl::SetSkipWaitingFlag() { + AssertIsOnMainThread(); + MOZ_ASSERT(mOuter); + MOZ_ASSERT(mOuter->mInfo); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + + if (!swm) { + return GenericPromise::CreateAndReject(NS_ERROR_FAILURE, __func__); + } + + RefPtr regInfo = + swm->GetRegistration(mOuter->mInfo->Principal(), mOuter->mInfo->Scope()); + + if (!regInfo) { + return GenericPromise::CreateAndReject(NS_ERROR_FAILURE, __func__); + } + + mOuter->mInfo->SetSkipWaitingFlag(); + + RefPtr promise = + new GenericPromise::Private(__func__); + + regInfo->TryToActivateAsync([promise] { promise->Resolve(true, __func__); }); + + return promise; +} + +void ServiceWorkerPrivateImpl::RefreshRemoteWorkerData( + const RefPtr& aRegistration) { + AssertIsOnMainThread(); + MOZ_ASSERT(mOuter); + MOZ_ASSERT(mOuter->mInfo); + + ServiceWorkerData& serviceWorkerData = + mRemoteWorkerData.serviceWorkerData().get_ServiceWorkerData(); + serviceWorkerData.descriptor() = mOuter->mInfo->Descriptor().ToIPC(); + serviceWorkerData.registrationDescriptor() = + aRegistration->Descriptor().ToIPC(); +} + +nsresult ServiceWorkerPrivateImpl::SpawnWorkerIfNeeded() { + AssertIsOnMainThread(); + MOZ_ASSERT(mOuter); + MOZ_ASSERT(mOuter->mInfo); + + if (mControllerChild) { + mOuter->RenewKeepAliveToken(ServiceWorkerPrivate::WakeUpReason::Unknown); + return NS_OK; + } + + PBackgroundChild* bgChild = BackgroundChild::GetForCurrentThread(); + + if (NS_WARN_IF(!bgChild)) { + return NS_ERROR_DOM_INVALID_STATE_ERR; + } + + RefPtr swm = ServiceWorkerManager::GetInstance(); + + if (NS_WARN_IF(!swm)) { + return NS_ERROR_DOM_ABORT_ERR; + } + + RefPtr regInfo = + swm->GetRegistration(mOuter->mInfo->Principal(), mOuter->mInfo->Scope()); + + if (NS_WARN_IF(!regInfo)) { + return NS_ERROR_DOM_INVALID_STATE_ERR; + } + + RefreshRemoteWorkerData(regInfo); + + RefPtr controllerChild = + new RemoteWorkerControllerChild(this); + + if (NS_WARN_IF(!bgChild->SendPRemoteWorkerControllerConstructor( + controllerChild, mRemoteWorkerData))) { + return NS_ERROR_DOM_INVALID_STATE_ERR; + } + + /** + * Manutally `AddRef()` because `DeallocPRemoteWorkerControllerChild()` + * calls `Release()` and the `AllocPRemoteWorkerControllerChild()` function + * is not called. + */ + // NOLINTNEXTLINE(readability-redundant-smartptr-get) + controllerChild.get()->AddRef(); + + mControllerChild = new RAIIActorPtrHolder(controllerChild.forget()); + + return NS_OK; +} + +ServiceWorkerPrivateImpl::~ServiceWorkerPrivateImpl() { + AssertIsOnMainThread(); + MOZ_ASSERT(!mOuter); + MOZ_ASSERT(WorkerIsDead()); +} + +nsresult ServiceWorkerPrivateImpl::SendMessageEvent( + RefPtr&& aData, + const ClientInfoAndState& aClientInfoAndState) { + AssertIsOnMainThread(); + MOZ_ASSERT(mOuter); + MOZ_ASSERT(aData); + + auto scopeExit = MakeScopeExit([&] { Shutdown(); }); + + PBackgroundChild* bgChild = BackgroundChild::GetForCurrentThread(); + + if (NS_WARN_IF(!bgChild)) { + return NS_ERROR_DOM_INVALID_STATE_ERR; + } + + ServiceWorkerMessageEventOpArgs args; + args.clientInfoAndState() = aClientInfoAndState; + if (!aData->BuildClonedMessageDataForBackgroundChild(bgChild, + args.clonedData())) { + return NS_ERROR_DOM_DATA_CLONE_ERR; + } + + scopeExit.release(); + + return ExecServiceWorkerOp( + std::move(args), [](ServiceWorkerOpResult&& aResult) { + MOZ_ASSERT(aResult.type() == ServiceWorkerOpResult::Tnsresult); + }); +} + +nsresult ServiceWorkerPrivateImpl::CheckScriptEvaluation( + RefPtr aCallback) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(mOuter); + MOZ_ASSERT(aCallback); + + RefPtr self = this; + + /** + * We need to capture the actor associated with the current Service Worker so + * we can terminate it if script evaluation failed. + */ + nsresult rv = SpawnWorkerIfNeeded(); + + if (NS_WARN_IF(NS_FAILED(rv))) { + aCallback->SetResult(false); + aCallback->Run(); + + return rv; + } + + MOZ_ASSERT(mControllerChild); + + RefPtr holder = mControllerChild; + + return ExecServiceWorkerOp( + ServiceWorkerCheckScriptEvaluationOpArgs(), + [self = std::move(self), holder = std::move(holder), + callback = aCallback](ServiceWorkerOpResult&& aResult) mutable { + if (aResult.type() == ServiceWorkerOpResult:: + TServiceWorkerCheckScriptEvaluationOpResult) { + auto& result = + aResult.get_ServiceWorkerCheckScriptEvaluationOpResult(); + + if (result.workerScriptExecutedSuccessfully()) { + if (self->mOuter) { + self->mOuter->SetHandlesFetch(result.fetchHandlerWasAdded()); + } + + Unused << NS_WARN_IF(!self->mOuter); + + callback->SetResult(result.workerScriptExecutedSuccessfully()); + callback->Run(); + + return; + } + } + + /** + * If script evaluation failed, first terminate the Service Worker + * before invoking the callback. + */ + MOZ_ASSERT_IF(aResult.type() == ServiceWorkerOpResult::Tnsresult, + NS_FAILED(aResult.get_nsresult())); + + // If a termination operation was already issued using `holder`... + if (self->mControllerChild != holder) { + holder->OnDestructor()->Then( + GetCurrentSerialEventTarget(), __func__, + [callback = std::move(callback)]( + const GenericPromise::ResolveOrRejectValue&) { + callback->SetResult(false); + callback->Run(); + }); + + return; + } + + RefPtr swm = ServiceWorkerManager::GetInstance(); + MOZ_ASSERT(swm); + + auto shutdownStateId = swm->MaybeInitServiceWorkerShutdownProgress(); + + RefPtr promise = + self->ShutdownInternal(shutdownStateId); + + swm->BlockShutdownOn(promise, shutdownStateId); + + promise->Then( + GetCurrentSerialEventTarget(), __func__, + [callback = std::move(callback)]( + const GenericNonExclusivePromise::ResolveOrRejectValue&) { + callback->SetResult(false); + callback->Run(); + }); + }, + [callback = aCallback] { + callback->SetResult(false); + callback->Run(); + }); +} + +nsresult ServiceWorkerPrivateImpl::SendLifeCycleEvent( + const nsAString& aEventName, RefPtr aCallback) { + AssertIsOnMainThread(); + MOZ_ASSERT(mOuter); + MOZ_ASSERT(aCallback); + + return ExecServiceWorkerOp( + ServiceWorkerLifeCycleEventOpArgs(nsString(aEventName)), + [callback = aCallback](ServiceWorkerOpResult&& aResult) { + MOZ_ASSERT(aResult.type() == ServiceWorkerOpResult::Tnsresult); + + callback->SetResult(NS_SUCCEEDED(aResult.get_nsresult())); + callback->Run(); + }, + [callback = aCallback] { + callback->SetResult(false); + callback->Run(); + }); +} + +nsresult ServiceWorkerPrivateImpl::SendPushEvent( + RefPtr aRegistration, + const nsAString& aMessageId, const Maybe>& aData) { + AssertIsOnMainThread(); + MOZ_ASSERT(mOuter); + MOZ_ASSERT(aRegistration); + + ServiceWorkerPushEventOpArgs args; + args.messageId() = nsString(aMessageId); + + if (aData) { + args.data() = aData.ref(); + } else { + args.data() = void_t(); + } + + if (mOuter->mInfo->State() == ServiceWorkerState::Activating) { + UniquePtr pendingEvent = + MakeUnique(this, std::move(aRegistration), + std::move(args)); + + mPendingFunctionalEvents.AppendElement(std::move(pendingEvent)); + + return NS_OK; + } + + MOZ_ASSERT(mOuter->mInfo->State() == ServiceWorkerState::Activated); + + return SendPushEventInternal(std::move(aRegistration), std::move(args)); +} + +nsresult ServiceWorkerPrivateImpl::SendPushEventInternal( + RefPtr&& aRegistration, + ServiceWorkerPushEventOpArgs&& aArgs) { + AssertIsOnMainThread(); + MOZ_ASSERT(mOuter); + MOZ_ASSERT(aRegistration); + + return ExecServiceWorkerOp( + std::move(aArgs), + [registration = aRegistration](ServiceWorkerOpResult&& aResult) { + MOZ_ASSERT(aResult.type() == ServiceWorkerOpResult::Tnsresult); + + registration->MaybeScheduleTimeCheckAndUpdate(); + }, + [registration = aRegistration]() { + registration->MaybeScheduleTimeCheckAndUpdate(); + }); +} + +nsresult ServiceWorkerPrivateImpl::SendPushSubscriptionChangeEvent() { + AssertIsOnMainThread(); + MOZ_ASSERT(mOuter); + + return ExecServiceWorkerOp( + ServiceWorkerPushSubscriptionChangeEventOpArgs(), + [](ServiceWorkerOpResult&& aResult) { + MOZ_ASSERT(aResult.type() == ServiceWorkerOpResult::Tnsresult); + }); +} + +nsresult ServiceWorkerPrivateImpl::SendNotificationEvent( + const nsAString& aEventName, const nsAString& aID, const nsAString& aTitle, + const nsAString& aDir, const nsAString& aLang, const nsAString& aBody, + const nsAString& aTag, const nsAString& aIcon, const nsAString& aData, + const nsAString& aBehavior, const nsAString& aScope, + uint32_t aDisableOpenClickDelay) { + AssertIsOnMainThread(); + MOZ_ASSERT(mOuter); + + ServiceWorkerNotificationEventOpArgs args; + args.eventName() = nsString(aEventName); + args.id() = nsString(aID); + args.title() = nsString(aTitle); + args.dir() = nsString(aDir); + args.lang() = nsString(aLang); + args.body() = nsString(aBody); + args.tag() = nsString(aTag); + args.icon() = nsString(aIcon); + args.data() = nsString(aData); + args.behavior() = nsString(aBehavior); + args.scope() = nsString(aScope); + args.disableOpenClickDelay() = aDisableOpenClickDelay; + + return ExecServiceWorkerOp( + std::move(args), [](ServiceWorkerOpResult&& aResult) { + MOZ_ASSERT(aResult.type() == ServiceWorkerOpResult::Tnsresult); + }); +} + +ServiceWorkerPrivateImpl::PendingFunctionalEvent::PendingFunctionalEvent( + ServiceWorkerPrivateImpl* aOwner, + RefPtr&& aRegistration) + : mOwner(aOwner), mRegistration(std::move(aRegistration)) { + AssertIsOnMainThread(); + MOZ_ASSERT(mOwner); + MOZ_ASSERT(mOwner->mOuter); + MOZ_ASSERT(mOwner->mOuter->mInfo); + MOZ_ASSERT(mOwner->mOuter->mInfo->State() == ServiceWorkerState::Activating); + MOZ_ASSERT(mRegistration); +} + +ServiceWorkerPrivateImpl::PendingFunctionalEvent::~PendingFunctionalEvent() { + AssertIsOnMainThread(); +} + +ServiceWorkerPrivateImpl::PendingPushEvent::PendingPushEvent( + ServiceWorkerPrivateImpl* aOwner, + RefPtr&& aRegistration, + ServiceWorkerPushEventOpArgs&& aArgs) + : PendingFunctionalEvent(aOwner, std::move(aRegistration)), + mArgs(std::move(aArgs)) { + AssertIsOnMainThread(); +} + +nsresult ServiceWorkerPrivateImpl::PendingPushEvent::Send() { + AssertIsOnMainThread(); + MOZ_ASSERT(mOwner->mOuter); + MOZ_ASSERT(mOwner->mOuter->mInfo); + + return mOwner->SendPushEventInternal(std::move(mRegistration), + std::move(mArgs)); +} + +ServiceWorkerPrivateImpl::PendingFetchEvent::PendingFetchEvent( + ServiceWorkerPrivateImpl* aOwner, + RefPtr&& aRegistration, + ServiceWorkerFetchEventOpArgs&& aArgs, + nsCOMPtr&& aChannel) + : PendingFunctionalEvent(aOwner, std::move(aRegistration)), + mArgs(std::move(aArgs)), + mChannel(std::move(aChannel)) { + AssertIsOnMainThread(); + MOZ_ASSERT(mChannel); +} + +nsresult ServiceWorkerPrivateImpl::PendingFetchEvent::Send() { + AssertIsOnMainThread(); + MOZ_ASSERT(mOwner->mOuter); + MOZ_ASSERT(mOwner->mOuter->mInfo); + + return mOwner->SendFetchEventInternal(std::move(mRegistration), + std::move(mArgs), std::move(mChannel)); +} + +ServiceWorkerPrivateImpl::PendingFetchEvent::~PendingFetchEvent() { + AssertIsOnMainThread(); + + if (NS_WARN_IF(mChannel)) { + mChannel->CancelInterception(NS_ERROR_INTERCEPTION_FAILED); + } +} + +namespace { + +class HeaderFiller final : public nsIHttpHeaderVisitor { + public: + NS_DECL_ISUPPORTS + + explicit HeaderFiller(HeadersGuardEnum aGuard) + : mInternalHeaders(new InternalHeaders(aGuard)) { + MOZ_ASSERT(mInternalHeaders); + } + + NS_IMETHOD + VisitHeader(const nsACString& aHeader, const nsACString& aValue) override { + ErrorResult result; + mInternalHeaders->Append(aHeader, aValue, result); + + if (NS_WARN_IF(result.Failed())) { + return result.StealNSResult(); + } + + return NS_OK; + } + + RefPtr Extract() { + return RefPtr(std::move(mInternalHeaders)); + } + + private: + ~HeaderFiller() = default; + + RefPtr mInternalHeaders; +}; + +NS_IMPL_ISUPPORTS(HeaderFiller, nsIHttpHeaderVisitor) + +Result GetIPCInternalRequest( + nsIInterceptedChannel* aChannel) { + AssertIsOnMainThread(); + + nsCOMPtr uri; + MOZ_TRY(aChannel->GetSecureUpgradedChannelURI(getter_AddRefs(uri))); + + nsCOMPtr uriNoFragment; + MOZ_TRY(NS_GetURIWithoutRef(uri, getter_AddRefs(uriNoFragment))); + + nsCOMPtr underlyingChannel; + MOZ_TRY(aChannel->GetChannel(getter_AddRefs(underlyingChannel))); + + nsCOMPtr httpChannel = do_QueryInterface(underlyingChannel); + MOZ_ASSERT(httpChannel, "How come we don't have an HTTP channel?"); + + nsCOMPtr internalChannel = + do_QueryInterface(httpChannel); + NS_ENSURE_TRUE(internalChannel, Err(NS_ERROR_NOT_AVAILABLE)); + + nsCOMPtr cacheInfoChannel = + do_QueryInterface(underlyingChannel); + + nsAutoCString spec; + MOZ_TRY(uriNoFragment->GetSpec(spec)); + + nsAutoCString fragment; + MOZ_TRY(uri->GetRef(fragment)); + + nsAutoCString method; + MOZ_TRY(httpChannel->GetRequestMethod(method)); + + // This is safe due to static_asserts in ServiceWorkerManager.cpp + uint32_t cacheModeInt; + MOZ_ALWAYS_SUCCEEDS(internalChannel->GetFetchCacheMode(&cacheModeInt)); + RequestCache cacheMode = static_cast(cacheModeInt); + + RequestMode requestMode = + InternalRequest::MapChannelToRequestMode(underlyingChannel); + + // This is safe due to static_asserts in ServiceWorkerManager.cpp + uint32_t redirectMode; + MOZ_ALWAYS_SUCCEEDS(internalChannel->GetRedirectMode(&redirectMode)); + RequestRedirect requestRedirect = static_cast(redirectMode); + + RequestCredentials requestCredentials = + InternalRequest::MapChannelToRequestCredentials(underlyingChannel); + + nsAutoString referrer; + ReferrerPolicy referrerPolicy = ReferrerPolicy::_empty; + + nsCOMPtr referrerInfo = httpChannel->GetReferrerInfo(); + if (referrerInfo) { + referrerPolicy = referrerInfo->ReferrerPolicy(); + Unused << referrerInfo->GetComputedReferrerSpec(referrer); + } + + uint32_t loadFlags; + MOZ_TRY(underlyingChannel->GetLoadFlags(&loadFlags)); + + nsCOMPtr loadInfo = underlyingChannel->LoadInfo(); + nsContentPolicyType contentPolicyType = loadInfo->InternalContentPolicyType(); + + nsAutoString integrity; + MOZ_TRY(internalChannel->GetIntegrityMetadata(integrity)); + + RefPtr headerFiller = + MakeRefPtr(HeadersGuardEnum::Request); + MOZ_TRY(httpChannel->VisitNonDefaultRequestHeaders(headerFiller)); + + RefPtr internalHeaders = headerFiller->Extract(); + + ErrorResult result; + internalHeaders->SetGuard(HeadersGuardEnum::Immutable, result); + if (NS_WARN_IF(result.Failed())) { + return Err(result.StealNSResult()); + } + + nsTArray ipcHeaders; + HeadersGuardEnum ipcHeadersGuard; + internalHeaders->ToIPC(ipcHeaders, ipcHeadersGuard); + + nsAutoCString alternativeDataType; + if (cacheInfoChannel && + !cacheInfoChannel->PreferredAlternativeDataTypes().IsEmpty()) { + // TODO: the internal request probably needs all the preferred types. + alternativeDataType.Assign( + cacheInfoChannel->PreferredAlternativeDataTypes()[0].type()); + } + + Maybe principalInfo; + + if (loadInfo->TriggeringPrincipal()) { + principalInfo.emplace(); + MOZ_ALWAYS_SUCCEEDS(PrincipalToPrincipalInfo( + loadInfo->TriggeringPrincipal(), principalInfo.ptr())); + } + + // Note: all the arguments are copied rather than moved, which would be more + // efficient, because there's no move-friendly constructor generated. + return IPCInternalRequest( + method, {spec}, ipcHeadersGuard, ipcHeaders, Nothing(), -1, + alternativeDataType, contentPolicyType, referrer, referrerPolicy, + requestMode, requestCredentials, cacheMode, requestRedirect, integrity, + fragment, principalInfo); +} + +nsresult MaybeStoreStreamForBackgroundThread(nsIInterceptedChannel* aChannel, + IPCInternalRequest& aIPCRequest) { + nsCOMPtr channel; + MOZ_ALWAYS_SUCCEEDS(aChannel->GetChannel(getter_AddRefs(channel))); + + Maybe body; + int64_t bodySize = -1; + nsCOMPtr uploadChannel = do_QueryInterface(channel); + + if (uploadChannel) { + nsCOMPtr uploadStream; + MOZ_TRY(uploadChannel->CloneUploadStream(&aIPCRequest.bodySize(), + getter_AddRefs(uploadStream))); + + if (uploadStream) { + Maybe& body = aIPCRequest.body(); + body.emplace(ParentToParentStream()); + + MOZ_TRY(nsContentUtils::GenerateUUIDInPlace( + body->get_ParentToParentStream().uuid())); + + auto storageOrErr = RemoteLazyInputStreamStorage::Get(); + if (NS_WARN_IF(storageOrErr.isErr())) { + return storageOrErr.unwrapErr(); + } + + auto storage = storageOrErr.unwrap(); + storage->AddStream(uploadStream, body->get_ParentToParentStream().uuid(), + bodySize, 0); + } + } + + return NS_OK; +} + +} // anonymous namespace + +nsresult ServiceWorkerPrivateImpl::SendFetchEvent( + RefPtr aRegistration, + nsCOMPtr aChannel, const nsAString& aClientId, + const nsAString& aResultingClientId) { + AssertIsOnMainThread(); + MOZ_ASSERT(mOuter); + MOZ_ASSERT(mOuter->mInfo); + MOZ_ASSERT(aRegistration); + MOZ_ASSERT(aChannel); + + auto scopeExit = MakeScopeExit([&] { + aChannel->CancelInterception(NS_ERROR_INTERCEPTION_FAILED); + Shutdown(); + }); + + nsCOMPtr channel; + MOZ_TRY(aChannel->GetChannel(getter_AddRefs(channel))); + + IPCInternalRequest request; + MOZ_TRY_VAR(request, GetIPCInternalRequest(aChannel)); + + scopeExit.release(); + + ServiceWorkerFetchEventOpArgs args( + mOuter->mInfo->ScriptSpec(), std::move(request), nsString(aClientId), + nsString(aResultingClientId), + nsContentUtils::IsNonSubresourceRequest(channel)); + + if (mOuter->mInfo->State() == ServiceWorkerState::Activating) { + UniquePtr pendingEvent = + MakeUnique(this, std::move(aRegistration), + std::move(args), std::move(aChannel)); + + mPendingFunctionalEvents.AppendElement(std::move(pendingEvent)); + + return NS_OK; + } + + MOZ_ASSERT(mOuter->mInfo->State() == ServiceWorkerState::Activated); + + return SendFetchEventInternal(std::move(aRegistration), std::move(args), + std::move(aChannel)); +} + +nsresult ServiceWorkerPrivateImpl::SendFetchEventInternal( + RefPtr&& aRegistration, + ServiceWorkerFetchEventOpArgs&& aArgs, + nsCOMPtr&& aChannel) { + AssertIsOnMainThread(); + MOZ_ASSERT(mOuter); + + auto scopeExit = MakeScopeExit([&] { Shutdown(); }); + + if (NS_WARN_IF(!mOuter->mInfo)) { + return NS_ERROR_DOM_INVALID_STATE_ERR; + } + + MOZ_TRY(SpawnWorkerIfNeeded()); + MOZ_TRY( + MaybeStoreStreamForBackgroundThread(aChannel, aArgs.internalRequest())); + + scopeExit.release(); + + MOZ_ASSERT(mControllerChild); + + RefPtr holder = mControllerChild; + + FetchEventOpChild::SendFetchEvent( + mControllerChild->get(), std::move(aArgs), std::move(aChannel), + std::move(aRegistration), mOuter->CreateEventKeepAliveToken()) + ->Then(GetCurrentSerialEventTarget(), __func__, + [holder = std::move(holder)]( + const GenericPromise::ResolveOrRejectValue& aResult) { + Unused << NS_WARN_IF(aResult.IsReject()); + }); + + return NS_OK; +} + +void ServiceWorkerPrivateImpl::TerminateWorker() { + AssertIsOnMainThread(); + MOZ_ASSERT(mOuter); + + mOuter->mIdleWorkerTimer->Cancel(); + mOuter->mIdleKeepAliveToken = nullptr; + + Shutdown(); +} + +void ServiceWorkerPrivateImpl::Shutdown() { + AssertIsOnMainThread(); + + if (!WorkerIsDead()) { + RefPtr swm = ServiceWorkerManager::GetInstance(); + + MOZ_ASSERT(swm, + "All Service Workers should start shutting down before the " + "ServiceWorkerManager does!"); + + auto shutdownStateId = swm->MaybeInitServiceWorkerShutdownProgress(); + + RefPtr promise = + ShutdownInternal(shutdownStateId); + swm->BlockShutdownOn(promise, shutdownStateId); + } + + MOZ_ASSERT(WorkerIsDead()); +} + +RefPtr ServiceWorkerPrivateImpl::ShutdownInternal( + uint32_t aShutdownStateId) { + AssertIsOnMainThread(); + MOZ_ASSERT(mControllerChild); + + mPendingFunctionalEvents.Clear(); + + mControllerChild->get()->RevokeObserver(this); + + if (StaticPrefs::dom_serviceWorkers_testing_enabled()) { + nsCOMPtr os = services::GetObserverService(); + if (os) { + os->NotifyObservers(nullptr, "service-worker-shutdown", nullptr); + } + } + + RefPtr promise = + new GenericNonExclusivePromise::Private(__func__); + + Unused << ExecServiceWorkerOp( + ServiceWorkerTerminateWorkerOpArgs(aShutdownStateId), + [promise](ServiceWorkerOpResult&& aResult) { + MOZ_ASSERT(aResult.type() == ServiceWorkerOpResult::Tnsresult); + promise->Resolve(true, __func__); + }, + [promise]() { promise->Reject(NS_ERROR_DOM_ABORT_ERR, __func__); }); + + /** + * After dispatching a termination operation, no new operations should + * be routed through this actor anymore. + */ + mControllerChild = nullptr; + + return promise; +} + +void ServiceWorkerPrivateImpl::UpdateState(ServiceWorkerState aState) { + AssertIsOnMainThread(); + MOZ_ASSERT(mOuter); + + if (WorkerIsDead()) { + return; + } + + nsresult rv = ExecServiceWorkerOp( + ServiceWorkerUpdateStateOpArgs(aState), + [](ServiceWorkerOpResult&& aResult) { + MOZ_ASSERT(aResult.type() == ServiceWorkerOpResult::Tnsresult); + }); + + if (NS_WARN_IF(NS_FAILED(rv))) { + Shutdown(); + return; + } + + if (aState != ServiceWorkerState::Activated) { + return; + } + + for (auto& event : mPendingFunctionalEvents) { + Unused << NS_WARN_IF(NS_FAILED(event->Send())); + } + + mPendingFunctionalEvents.Clear(); +} + +void ServiceWorkerPrivateImpl::NoteDeadOuter() { + AssertIsOnMainThread(); + MOZ_ASSERT(mOuter); + + Shutdown(); + mOuter = nullptr; +} + +void ServiceWorkerPrivateImpl::CreationFailed() { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(mOuter); + MOZ_ASSERT(mControllerChild); + + Shutdown(); +} + +void ServiceWorkerPrivateImpl::CreationSucceeded() { + AssertIsOnMainThread(); + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(mOuter); + MOZ_ASSERT(mControllerChild); + + mOuter->RenewKeepAliveToken(ServiceWorkerPrivate::WakeUpReason::Unknown); +} + +void ServiceWorkerPrivateImpl::ErrorReceived(const ErrorValue& aError) { + AssertIsOnMainThread(); + MOZ_ASSERT(mOuter); + MOZ_ASSERT(mOuter->mInfo); + MOZ_ASSERT(mControllerChild); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + MOZ_ASSERT(swm); + + ServiceWorkerInfo* info = mOuter->mInfo; + + swm->HandleError(nullptr, info->Principal(), info->Scope(), + NS_ConvertUTF8toUTF16(info->ScriptSpec()), u""_ns, u""_ns, + u""_ns, 0, 0, nsIScriptError::errorFlag, JSEXN_ERR); +} + +void ServiceWorkerPrivateImpl::Terminated() { + AssertIsOnMainThread(); + MOZ_ASSERT(mOuter); + MOZ_ASSERT(mControllerChild); + + Shutdown(); +} + +bool ServiceWorkerPrivateImpl::WorkerIsDead() const { + AssertIsOnMainThread(); + + return !mControllerChild; +} + +nsresult ServiceWorkerPrivateImpl::ExecServiceWorkerOp( + ServiceWorkerOpArgs&& aArgs, + std::function&& aSuccessCallback, + std::function&& aFailureCallback) { + AssertIsOnMainThread(); + MOZ_ASSERT(mOuter); + MOZ_ASSERT( + aArgs.type() != ServiceWorkerOpArgs::TServiceWorkerFetchEventOpArgs, + "FetchEvent operations should be sent through FetchEventOp(Proxy) " + "actors!"); + MOZ_ASSERT(aSuccessCallback); + + nsresult rv = SpawnWorkerIfNeeded(); + + if (NS_WARN_IF(NS_FAILED(rv))) { + aFailureCallback(); + return rv; + } + + MOZ_ASSERT(mControllerChild); + + RefPtr self = this; + RefPtr holder = mControllerChild; + RefPtr token = + aArgs.type() == ServiceWorkerOpArgs::TServiceWorkerTerminateWorkerOpArgs + ? nullptr + : mOuter->CreateEventKeepAliveToken(); + + /** + * NOTE: moving `aArgs` won't do anything until IPDL `SendMethod()` methods + * can accept rvalue references rather than just const references. + */ + mControllerChild->get()->SendExecServiceWorkerOp(aArgs)->Then( + GetCurrentSerialEventTarget(), __func__, + [self = std::move(self), holder = std::move(holder), + token = std::move(token), onSuccess = std::move(aSuccessCallback), + onFailure = std::move(aFailureCallback)]( + PRemoteWorkerControllerChild::ExecServiceWorkerOpPromise:: + ResolveOrRejectValue&& aResult) { + if (NS_WARN_IF(aResult.IsReject())) { + onFailure(); + return; + } + + onSuccess(std::move(aResult.ResolveValue())); + }); + + return NS_OK; +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerPrivateImpl.h b/dom/serviceworkers/ServiceWorkerPrivateImpl.h new file mode 100644 index 0000000000..9d5ad9c5a7 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerPrivateImpl.h @@ -0,0 +1,233 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworkerprivateimpl_h__ +#define mozilla_dom_serviceworkerprivateimpl_h__ + +#include + +#include "nsCOMPtr.h" +#include "nsISupportsImpl.h" +#include "nsTArray.h" + +#include "ServiceWorkerPrivate.h" +#include "mozilla/Attributes.h" +#include "mozilla/MozPromise.h" +#include "mozilla/RefPtr.h" +#include "mozilla/UniquePtr.h" +#include "mozilla/dom/RemoteWorkerController.h" +#include "mozilla/dom/RemoteWorkerTypes.h" +#include "mozilla/dom/ServiceWorkerOpArgs.h" + +class nsIInterceptedChannel; + +namespace mozilla { + +template +class Maybe; + +namespace dom { + +class ClientInfoAndState; +class LifeCycleEventCallback; +class RemoteWorkerControllerChild; +class ServiceWorkerCloneData; +class ServiceWorkerRegistrationInfo; + +class ServiceWorkerPrivateImpl final : public ServiceWorkerPrivate::Inner, + public RemoteWorkerObserver { + public: + NS_INLINE_DECL_REFCOUNTING(ServiceWorkerPrivateImpl, override); + + explicit ServiceWorkerPrivateImpl(RefPtr aOuter); + + nsresult Initialize(); + + RefPtr SetSkipWaitingFlag(); + + private: + class RAIIActorPtrHolder; + + ~ServiceWorkerPrivateImpl(); + + /** + * ServiceWorkerPrivate::Inner + */ + nsresult SendMessageEvent( + RefPtr&& aData, + const ClientInfoAndState& aClientInfoAndState) override; + + nsresult CheckScriptEvaluation( + RefPtr aCallback) override; + + nsresult SendLifeCycleEvent( + const nsAString& aEventName, + RefPtr aCallback) override; + + nsresult SendPushEvent(RefPtr aRegistration, + const nsAString& aMessageId, + const Maybe>& aData) override; + + nsresult SendPushSubscriptionChangeEvent() override; + + nsresult SendNotificationEvent(const nsAString& aEventName, + const nsAString& aID, const nsAString& aTitle, + const nsAString& aDir, const nsAString& aLang, + const nsAString& aBody, const nsAString& aTag, + const nsAString& aIcon, const nsAString& aData, + const nsAString& aBehavior, + const nsAString& aScope, + uint32_t aDisableOpenClickDelay) override; + + nsresult SendFetchEvent(RefPtr aRegistration, + nsCOMPtr aChannel, + const nsAString& aClientId, + const nsAString& aResultingClientId) override; + + nsresult SpawnWorkerIfNeeded() override; + + void TerminateWorker() override; + + void UpdateState(ServiceWorkerState aState) override; + + void NoteDeadOuter() override; + + bool WorkerIsDead() const override; + + /** + * RemoteWorkerObserver + */ + void CreationFailed() override; + + void CreationSucceeded() override; + + void ErrorReceived(const ErrorValue& aError) override; + + void Terminated() override; + + // Refreshes only the parts of mRemoteWorkerData that may change over time. + void RefreshRemoteWorkerData( + const RefPtr& aRegistration); + + nsresult SendPushEventInternal( + RefPtr&& aRegistration, + ServiceWorkerPushEventOpArgs&& aArgs); + + nsresult SendFetchEventInternal( + RefPtr&& aRegistration, + ServiceWorkerFetchEventOpArgs&& aArgs, + nsCOMPtr&& aChannel); + + void Shutdown(); + + RefPtr ShutdownInternal( + uint32_t aShutdownStateId); + + nsresult ExecServiceWorkerOp( + ServiceWorkerOpArgs&& aArgs, + std::function&& aSuccessCallback, + std::function&& aFailureCallback = [] {}); + + class PendingFunctionalEvent { + public: + PendingFunctionalEvent( + ServiceWorkerPrivateImpl* aOwner, + RefPtr&& aRegistration); + + virtual ~PendingFunctionalEvent(); + + virtual nsresult Send() = 0; + + protected: + ServiceWorkerPrivateImpl* const MOZ_NON_OWNING_REF mOwner; + RefPtr mRegistration; + }; + + class PendingPushEvent final : public PendingFunctionalEvent { + public: + PendingPushEvent(ServiceWorkerPrivateImpl* aOwner, + RefPtr&& aRegistration, + ServiceWorkerPushEventOpArgs&& aArgs); + + nsresult Send() override; + + private: + ServiceWorkerPushEventOpArgs mArgs; + }; + + class PendingFetchEvent final : public PendingFunctionalEvent { + public: + PendingFetchEvent(ServiceWorkerPrivateImpl* aOwner, + RefPtr&& aRegistration, + ServiceWorkerFetchEventOpArgs&& aArgs, + nsCOMPtr&& aChannel); + + nsresult Send() override; + + ~PendingFetchEvent(); + + private: + ServiceWorkerFetchEventOpArgs mArgs; + nsCOMPtr mChannel; + }; + + nsTArray> mPendingFunctionalEvents; + + /** + * It's possible that there are still in-progress operations when a + * a termination operation is issued. In this case, it's important to keep + * the RemoteWorkerControllerChild actor alive until all pending operations + * have completed before destroying it with Send__delete__(). + * + * RAIIActorPtrHolder holds a singular, owning reference to a + * RemoteWorkerControllerChild actor and is responsible for destroying the + * actor in its (i.e. the holder's) destructor. This implies that all + * in-progress operations must maintain a strong reference to their + * corresponding holders and release the reference once completed/canceled. + * + * Additionally a RAIIActorPtrHolder must be initialized with a non-null actor + * and cannot be moved or copied. Therefore, the identities of two held + * actors can be compared by simply comparing their holders' addresses. + */ + class RAIIActorPtrHolder final { + public: + NS_INLINE_DECL_REFCOUNTING(RAIIActorPtrHolder) + + explicit RAIIActorPtrHolder( + already_AddRefed aActor); + + RAIIActorPtrHolder(const RAIIActorPtrHolder& aOther) = delete; + RAIIActorPtrHolder& operator=(const RAIIActorPtrHolder& aOther) = delete; + + RAIIActorPtrHolder(RAIIActorPtrHolder&& aOther) = delete; + RAIIActorPtrHolder& operator=(RAIIActorPtrHolder&& aOther) = delete; + + RemoteWorkerControllerChild* operator->() const + MOZ_NO_ADDREF_RELEASE_ON_RETURN; + + RemoteWorkerControllerChild* get() const; + + RefPtr OnDestructor(); + + private: + ~RAIIActorPtrHolder(); + + MozPromiseHolder mDestructorPromiseHolder; + + const RefPtr mActor; + }; + + RefPtr mControllerChild; + + RefPtr mOuter; + + RemoteWorkerData mRemoteWorkerData; +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_serviceworkerprivateimpl_h__ diff --git a/dom/serviceworkers/ServiceWorkerProxy.cpp b/dom/serviceworkers/ServiceWorkerProxy.cpp new file mode 100644 index 0000000000..227f43a89d --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerProxy.cpp @@ -0,0 +1,124 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerProxy.h" +#include "ServiceWorkerCloneData.h" +#include "ServiceWorkerManager.h" +#include "ServiceWorkerParent.h" + +#include "mozilla/SchedulerGroup.h" +#include "mozilla/ScopeExit.h" +#include "mozilla/dom/ClientState.h" +#include "mozilla/ipc/BackgroundParent.h" +#include "ServiceWorkerInfo.h" + +namespace mozilla { +namespace dom { + +using mozilla::ipc::AssertIsOnBackgroundThread; + +ServiceWorkerProxy::~ServiceWorkerProxy() { + // Any thread + MOZ_DIAGNOSTIC_ASSERT(!mActor); + MOZ_DIAGNOSTIC_ASSERT(!mInfo); +} + +void ServiceWorkerProxy::MaybeShutdownOnBGThread() { + AssertIsOnBackgroundThread(); + if (!mActor) { + return; + } + mActor->MaybeSendDelete(); +} + +void ServiceWorkerProxy::InitOnMainThread() { + AssertIsOnMainThread(); + + auto scopeExit = MakeScopeExit([&] { MaybeShutdownOnMainThread(); }); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + NS_ENSURE_TRUE_VOID(swm); + + RefPtr reg = + swm->GetRegistration(mDescriptor.PrincipalInfo(), mDescriptor.Scope()); + NS_ENSURE_TRUE_VOID(reg); + + RefPtr info = reg->GetByDescriptor(mDescriptor); + NS_ENSURE_TRUE_VOID(info); + + scopeExit.release(); + + mInfo = new nsMainThreadPtrHolder( + "ServiceWorkerProxy::mInfo", info); +} + +void ServiceWorkerProxy::MaybeShutdownOnMainThread() { + AssertIsOnMainThread(); + + nsCOMPtr r = NewRunnableMethod( + __func__, this, &ServiceWorkerProxy::MaybeShutdownOnBGThread); + + MOZ_ALWAYS_SUCCEEDS(mEventTarget->Dispatch(r.forget(), NS_DISPATCH_NORMAL)); +} + +void ServiceWorkerProxy::StopListeningOnMainThread() { + AssertIsOnMainThread(); + mInfo = nullptr; +} + +ServiceWorkerProxy::ServiceWorkerProxy( + const ServiceWorkerDescriptor& aDescriptor) + : mEventTarget(GetCurrentSerialEventTarget()), mDescriptor(aDescriptor) {} + +void ServiceWorkerProxy::Init(ServiceWorkerParent* aActor) { + AssertIsOnBackgroundThread(); + MOZ_DIAGNOSTIC_ASSERT(aActor); + MOZ_DIAGNOSTIC_ASSERT(!mActor); + MOZ_DIAGNOSTIC_ASSERT(mEventTarget); + + mActor = aActor; + + // Note, this must be done from a separate Init() method and not in + // the constructor. If done from the constructor the runnable can + // execute, complete, and release its reference before the constructor + // returns. + nsCOMPtr r = NewRunnableMethod( + "ServiceWorkerProxy::Init", this, &ServiceWorkerProxy::InitOnMainThread); + MOZ_ALWAYS_SUCCEEDS( + SchedulerGroup::Dispatch(TaskCategory::Other, r.forget())); +} + +void ServiceWorkerProxy::RevokeActor(ServiceWorkerParent* aActor) { + AssertIsOnBackgroundThread(); + MOZ_DIAGNOSTIC_ASSERT(mActor); + MOZ_DIAGNOSTIC_ASSERT(mActor == aActor); + mActor = nullptr; + + nsCOMPtr r = NewRunnableMethod( + __func__, this, &ServiceWorkerProxy::StopListeningOnMainThread); + MOZ_ALWAYS_SUCCEEDS( + SchedulerGroup::Dispatch(TaskCategory::Other, r.forget())); +} + +void ServiceWorkerProxy::PostMessage(RefPtr&& aData, + const ClientInfo& aClientInfo, + const ClientState& aClientState) { + AssertIsOnBackgroundThread(); + RefPtr self = this; + nsCOMPtr r = NS_NewRunnableFunction( + __func__, + [self, data = std::move(aData), aClientInfo, aClientState]() mutable { + if (!self->mInfo) { + return; + } + self->mInfo->PostMessage(std::move(data), aClientInfo, aClientState); + }); + MOZ_ALWAYS_SUCCEEDS( + SchedulerGroup::Dispatch(TaskCategory::Other, r.forget())); +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerProxy.h b/dom/serviceworkers/ServiceWorkerProxy.h new file mode 100644 index 0000000000..440d3f2c20 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerProxy.h @@ -0,0 +1,63 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef moz_dom_ServiceWorkerProxy_h +#define moz_dom_ServiceWorkerProxy_h + +#include "nsProxyRelease.h" +#include "ServiceWorkerDescriptor.h" + +namespace mozilla { +namespace dom { + +class ClientInfo; +class ClientState; +class ServiceWorkerCloneData; +class ServiceWorkerInfo; +class ServiceWorkerParent; + +class ServiceWorkerProxy final { + // Background thread only + RefPtr mActor; + + // Written on background thread and read on main thread + nsCOMPtr mEventTarget; + + // Main thread only + ServiceWorkerDescriptor mDescriptor; + nsMainThreadPtrHandle mInfo; + + ~ServiceWorkerProxy(); + + // Background thread methods + void MaybeShutdownOnBGThread(); + + void SetStateOnBGThread(ServiceWorkerState aState); + + // Main thread methods + void InitOnMainThread(); + + void MaybeShutdownOnMainThread(); + + void StopListeningOnMainThread(); + + public: + explicit ServiceWorkerProxy(const ServiceWorkerDescriptor& aDescriptor); + + void Init(ServiceWorkerParent* aActor); + + void RevokeActor(ServiceWorkerParent* aActor); + + void PostMessage(RefPtr&& aData, + const ClientInfo& aClientInfo, const ClientState& aState); + + NS_INLINE_DECL_THREADSAFE_REFCOUNTING(ServiceWorkerProxy); +}; + +} // namespace dom +} // namespace mozilla + +#endif // moz_dom_ServiceWorkerProxy_h diff --git a/dom/serviceworkers/ServiceWorkerRegisterJob.cpp b/dom/serviceworkers/ServiceWorkerRegisterJob.cpp new file mode 100644 index 0000000000..d5ec4269f5 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerRegisterJob.cpp @@ -0,0 +1,59 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerRegisterJob.h" + +#include "mozilla/dom/WorkerCommon.h" +#include "ServiceWorkerManager.h" + +namespace mozilla { +namespace dom { + +ServiceWorkerRegisterJob::ServiceWorkerRegisterJob( + nsIPrincipal* aPrincipal, const nsACString& aScope, + const nsACString& aScriptSpec, ServiceWorkerUpdateViaCache aUpdateViaCache) + : ServiceWorkerUpdateJob(Type::Register, aPrincipal, aScope, + nsCString(aScriptSpec), aUpdateViaCache) {} + +void ServiceWorkerRegisterJob::AsyncExecute() { + MOZ_ASSERT(NS_IsMainThread()); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (Canceled() || !swm) { + FailUpdateJob(NS_ERROR_DOM_ABORT_ERR); + return; + } + + RefPtr registration = + swm->GetRegistration(mPrincipal, mScope); + + if (registration) { + bool sameUVC = GetUpdateViaCache() == registration->GetUpdateViaCache(); + registration->SetUpdateViaCache(GetUpdateViaCache()); + + RefPtr newest = registration->Newest(); + if (newest && mScriptSpec.Equals(newest->ScriptSpec()) && sameUVC) { + SetRegistration(registration); + Finish(NS_OK); + return; + } + } else { + registration = + swm->CreateNewRegistration(mScope, mPrincipal, GetUpdateViaCache()); + if (!registration) { + FailUpdateJob(NS_ERROR_DOM_ABORT_ERR); + return; + } + } + + SetRegistration(registration); + Update(); +} + +ServiceWorkerRegisterJob::~ServiceWorkerRegisterJob() = default; + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerRegisterJob.h b/dom/serviceworkers/ServiceWorkerRegisterJob.h new file mode 100644 index 0000000000..b41affe036 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerRegisterJob.h @@ -0,0 +1,35 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworkerregisterjob_h +#define mozilla_dom_serviceworkerregisterjob_h + +#include "ServiceWorkerUpdateJob.h" + +namespace mozilla { +namespace dom { + +// The register job. This implements the steps in the spec Register algorithm, +// but then uses ServiceWorkerUpdateJob to implement the Update and Install +// spec algorithms. +class ServiceWorkerRegisterJob final : public ServiceWorkerUpdateJob { + public: + ServiceWorkerRegisterJob(nsIPrincipal* aPrincipal, const nsACString& aScope, + const nsACString& aScriptSpec, + ServiceWorkerUpdateViaCache aUpdateViaCache); + + private: + // Implement the Register algorithm steps and then call the parent class + // Update() to complete the job execution. + virtual void AsyncExecute() override; + + virtual ~ServiceWorkerRegisterJob(); +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_serviceworkerregisterjob_h diff --git a/dom/serviceworkers/ServiceWorkerRegistrar.cpp b/dom/serviceworkers/ServiceWorkerRegistrar.cpp new file mode 100644 index 0000000000..0aad701e7d --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerRegistrar.cpp @@ -0,0 +1,1280 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerRegistrar.h" +#include "mozilla/dom/ServiceWorkerRegistrarTypes.h" +#include "mozilla/dom/DOMException.h" +#include "mozilla/net/MozURL.h" + +#include "nsIEventTarget.h" +#include "nsIInputStream.h" +#include "nsILineInputStream.h" +#include "nsIObserverService.h" +#include "nsIOutputStream.h" +#include "nsISafeOutputStream.h" +#include "nsIServiceWorkerManager.h" +#include "nsIWritablePropertyBag2.h" + +#include "MainThreadUtils.h" +#include "mozilla/ClearOnShutdown.h" +#include "mozilla/CycleCollectedJSContext.h" +#include "mozilla/dom/StorageActivityService.h" +#include "mozilla/ErrorNames.h" +#include "mozilla/ipc/BackgroundChild.h" +#include "mozilla/ipc/BackgroundParent.h" +#include "mozilla/ipc/PBackgroundChild.h" +#include "mozilla/ModuleUtils.h" +#include "mozilla/Result.h" +#include "mozilla/ResultExtensions.h" +#include "mozilla/Services.h" +#include "mozilla/StaticPtr.h" +#include "mozJSComponentLoader.h" +#include "nsAppDirectoryServiceDefs.h" +#include "nsComponentManagerUtils.h" +#include "nsContentUtils.h" +#include "nsDirectoryServiceUtils.h" +#include "nsNetCID.h" +#include "nsNetUtil.h" +#include "nsServiceManagerUtils.h" +#include "nsThreadUtils.h" +#include "nsXULAppAPI.h" +#include "ServiceWorkerUtils.h" + +using namespace mozilla::ipc; + +namespace mozilla { +namespace dom { + +namespace { + +static const char* gSupportedRegistrarVersions[] = { + SERVICEWORKERREGISTRAR_VERSION, "7", "6", "5", "4", "3", "2"}; + +static const uint32_t kInvalidGeneration = static_cast(-1); + +StaticRefPtr gServiceWorkerRegistrar; + +nsresult GetOriginAndBaseDomain(const nsACString& aURL, nsACString& aOrigin, + nsACString& aBaseDomain) { + RefPtr url; + nsresult rv = net::MozURL::Init(getter_AddRefs(url), aURL); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + url->Origin(aOrigin); + + rv = url->BaseDomain(aBaseDomain); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + return NS_OK; +} + +nsresult ReadLine(nsILineInputStream* aStream, nsACString& aValue) { + bool hasMoreLines; + nsresult rv = aStream->ReadLine(aValue, &hasMoreLines); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + if (NS_WARN_IF(!hasMoreLines)) { + return NS_ERROR_FAILURE; + } + + return NS_OK; +} + +nsresult CreatePrincipalInfo(nsILineInputStream* aStream, + ServiceWorkerRegistrationData* aEntry, + bool aSkipSpec = false) { + nsAutoCString suffix; + nsresult rv = ReadLine(aStream, suffix); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + OriginAttributes attrs; + if (!attrs.PopulateFromSuffix(suffix)) { + return NS_ERROR_INVALID_ARG; + } + + if (aSkipSpec) { + nsAutoCString unused; + nsresult rv = ReadLine(aStream, unused); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + } + + rv = ReadLine(aStream, aEntry->scope()); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + nsCString origin; + nsCString baseDomain; + rv = GetOriginAndBaseDomain(aEntry->scope(), origin, baseDomain); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + aEntry->principal() = mozilla::ipc::ContentPrincipalInfo( + attrs, origin, aEntry->scope(), Nothing(), baseDomain); + + return NS_OK; +} + +} // namespace + +NS_IMPL_ISUPPORTS(ServiceWorkerRegistrar, nsIObserver, nsIAsyncShutdownBlocker) + +void ServiceWorkerRegistrar::Initialize() { + MOZ_ASSERT(!gServiceWorkerRegistrar); + + if (!XRE_IsParentProcess()) { + return; + } + + gServiceWorkerRegistrar = new ServiceWorkerRegistrar(); + ClearOnShutdown(&gServiceWorkerRegistrar); + + nsCOMPtr obs = mozilla::services::GetObserverService(); + if (obs) { + DebugOnly rv = obs->AddObserver(gServiceWorkerRegistrar, + "profile-after-change", false); + MOZ_ASSERT(NS_SUCCEEDED(rv)); + } +} + +/* static */ +already_AddRefed ServiceWorkerRegistrar::Get() { + MOZ_ASSERT(XRE_IsParentProcess()); + + MOZ_ASSERT(gServiceWorkerRegistrar); + RefPtr service = gServiceWorkerRegistrar.get(); + return service.forget(); +} + +ServiceWorkerRegistrar::ServiceWorkerRegistrar() + : mMonitor("ServiceWorkerRegistrar.mMonitor"), + mDataLoaded(false), + mDataGeneration(kInvalidGeneration), + mFileGeneration(kInvalidGeneration), + mRetryCount(0), + mShuttingDown(false), + mRunnableDispatched(false) { + MOZ_ASSERT(NS_IsMainThread()); +} + +ServiceWorkerRegistrar::~ServiceWorkerRegistrar() { + MOZ_ASSERT(!mRunnableDispatched); +} + +void ServiceWorkerRegistrar::GetRegistrations( + nsTArray& aValues) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aValues.IsEmpty()); + + MonitorAutoLock lock(mMonitor); + + // If we don't have the profile directory, profile is not started yet (and + // probably we are in a utest). + if (!mProfileDir) { + return; + } + + // We care just about the first execution because this can be blocked by + // loading data from disk. + static bool firstTime = true; + TimeStamp startTime; + + if (firstTime) { + startTime = TimeStamp::NowLoRes(); + } + + // Waiting for data loaded. + mMonitor.AssertCurrentThreadOwns(); + while (!mDataLoaded) { + mMonitor.Wait(); + } + + aValues.AppendElements(mData); + + MaybeResetGeneration(); + MOZ_DIAGNOSTIC_ASSERT(mDataGeneration != kInvalidGeneration); + MOZ_DIAGNOSTIC_ASSERT(mFileGeneration != kInvalidGeneration); + + if (firstTime) { + firstTime = false; + Telemetry::AccumulateTimeDelta( + Telemetry::SERVICE_WORKER_REGISTRATION_LOADING, startTime); + } +} + +namespace { + +bool Equivalent(const ServiceWorkerRegistrationData& aLeft, + const ServiceWorkerRegistrationData& aRight) { + MOZ_ASSERT(aLeft.principal().type() == + mozilla::ipc::PrincipalInfo::TContentPrincipalInfo); + MOZ_ASSERT(aRight.principal().type() == + mozilla::ipc::PrincipalInfo::TContentPrincipalInfo); + + const auto& leftPrincipal = aLeft.principal().get_ContentPrincipalInfo(); + const auto& rightPrincipal = aRight.principal().get_ContentPrincipalInfo(); + + // Only compare the attributes, not the spec part of the principal. + // The scope comparison above already covers the origin and codebase + // principals include the full path in their spec which is not what + // we want here. + return aLeft.scope() == aRight.scope() && + leftPrincipal.attrs() == rightPrincipal.attrs(); +} + +} // anonymous namespace + +void ServiceWorkerRegistrar::RegisterServiceWorker( + const ServiceWorkerRegistrationData& aData) { + AssertIsOnBackgroundThread(); + + if (mShuttingDown) { + NS_WARNING("Failed to register a serviceWorker during shutting down."); + return; + } + + { + MonitorAutoLock lock(mMonitor); + MOZ_ASSERT(mDataLoaded); + RegisterServiceWorkerInternal(aData); + } + + MaybeScheduleSaveData(); + StorageActivityService::SendActivity(aData.principal()); +} + +void ServiceWorkerRegistrar::UnregisterServiceWorker( + const PrincipalInfo& aPrincipalInfo, const nsACString& aScope) { + AssertIsOnBackgroundThread(); + + if (mShuttingDown) { + NS_WARNING("Failed to unregister a serviceWorker during shutting down."); + return; + } + + bool deleted = false; + + { + MonitorAutoLock lock(mMonitor); + MOZ_ASSERT(mDataLoaded); + + ServiceWorkerRegistrationData tmp; + tmp.principal() = aPrincipalInfo; + tmp.scope() = aScope; + + for (uint32_t i = 0; i < mData.Length(); ++i) { + if (Equivalent(tmp, mData[i])) { + mData.RemoveElementAt(i); + mDataGeneration = GetNextGeneration(); + deleted = true; + break; + } + } + } + + if (deleted) { + MaybeScheduleSaveData(); + StorageActivityService::SendActivity(aPrincipalInfo); + } +} + +void ServiceWorkerRegistrar::RemoveAll() { + AssertIsOnBackgroundThread(); + + if (mShuttingDown) { + NS_WARNING("Failed to remove all the serviceWorkers during shutting down."); + return; + } + + bool deleted = false; + + nsTArray data; + { + MonitorAutoLock lock(mMonitor); + MOZ_ASSERT(mDataLoaded); + + // Let's take a copy in order to inform StorageActivityService. + data = mData.Clone(); + + deleted = !mData.IsEmpty(); + mData.Clear(); + + mDataGeneration = GetNextGeneration(); + } + + if (!deleted) { + return; + } + + MaybeScheduleSaveData(); + + for (uint32_t i = 0, len = data.Length(); i < len; ++i) { + StorageActivityService::SendActivity(data[i].principal()); + } +} + +void ServiceWorkerRegistrar::LoadData() { + MOZ_ASSERT(!NS_IsMainThread()); + MOZ_ASSERT(!mDataLoaded); + + nsresult rv = ReadData(); + + if (NS_WARN_IF(NS_FAILED(rv))) { + DeleteData(); + // Also if the reading failed we have to notify what is waiting for data. + } + + MonitorAutoLock lock(mMonitor); + MOZ_ASSERT(!mDataLoaded); + mDataLoaded = true; + mMonitor.Notify(); +} + +nsresult ServiceWorkerRegistrar::ReadData() { + // We cannot assert about the correct thread because normally this method + // runs on a IO thread, but in gTests we call it from the main-thread. + + nsCOMPtr file; + + { + MonitorAutoLock lock(mMonitor); + + if (!mProfileDir) { + return NS_ERROR_FAILURE; + } + + nsresult rv = mProfileDir->Clone(getter_AddRefs(file)); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + } + + nsresult rv = file->Append(nsLiteralString(SERVICEWORKERREGISTRAR_FILE)); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + bool exists; + rv = file->Exists(&exists); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + if (!exists) { + return NS_OK; + } + + nsCOMPtr stream; + rv = NS_NewLocalFileInputStream(getter_AddRefs(stream), file); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + nsCOMPtr lineInputStream = do_QueryInterface(stream); + MOZ_ASSERT(lineInputStream); + + nsAutoCString version; + bool hasMoreLines; + rv = lineInputStream->ReadLine(version, &hasMoreLines); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + if (!IsSupportedVersion(version)) { + nsContentUtils::LogMessageToConsole( + nsPrintfCString("Unsupported service worker registrar version: %s", + version.get()) + .get()); + return NS_ERROR_FAILURE; + } + + nsTArray tmpData; + + bool overwrite = false; + bool dedupe = false; + while (hasMoreLines) { + ServiceWorkerRegistrationData* entry = tmpData.AppendElement(); + +#define GET_LINE(x) \ + rv = lineInputStream->ReadLine(x, &hasMoreLines); \ + if (NS_WARN_IF(NS_FAILED(rv))) { \ + return rv; \ + } \ + if (NS_WARN_IF(!hasMoreLines)) { \ + return NS_ERROR_FAILURE; \ + } + + nsAutoCString line; + if (version.EqualsLiteral(SERVICEWORKERREGISTRAR_VERSION)) { + rv = CreatePrincipalInfo(lineInputStream, entry); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + GET_LINE(entry->currentWorkerURL()); + + nsAutoCString fetchFlag; + GET_LINE(fetchFlag); + if (!fetchFlag.EqualsLiteral(SERVICEWORKERREGISTRAR_TRUE) && + !fetchFlag.EqualsLiteral(SERVICEWORKERREGISTRAR_FALSE)) { + return NS_ERROR_INVALID_ARG; + } + entry->currentWorkerHandlesFetch() = + fetchFlag.EqualsLiteral(SERVICEWORKERREGISTRAR_TRUE); + + nsAutoCString cacheName; + GET_LINE(cacheName); + CopyUTF8toUTF16(cacheName, entry->cacheName()); + + nsAutoCString updateViaCache; + GET_LINE(updateViaCache); + entry->updateViaCache() = updateViaCache.ToInteger(&rv, 16); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } else if (entry->updateViaCache() > + nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_NONE) { + return NS_ERROR_INVALID_ARG; + } + + nsAutoCString installedTimeStr; + GET_LINE(installedTimeStr); + int64_t installedTime = installedTimeStr.ToInteger64(&rv); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + entry->currentWorkerInstalledTime() = installedTime; + + nsAutoCString activatedTimeStr; + GET_LINE(activatedTimeStr); + int64_t activatedTime = activatedTimeStr.ToInteger64(&rv); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + entry->currentWorkerActivatedTime() = activatedTime; + + nsAutoCString lastUpdateTimeStr; + GET_LINE(lastUpdateTimeStr); + int64_t lastUpdateTime = lastUpdateTimeStr.ToInteger64(&rv); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + entry->lastUpdateTime() = lastUpdateTime; + } else if (version.EqualsLiteral("7")) { + rv = CreatePrincipalInfo(lineInputStream, entry); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + GET_LINE(entry->currentWorkerURL()); + + nsAutoCString fetchFlag; + GET_LINE(fetchFlag); + if (!fetchFlag.EqualsLiteral(SERVICEWORKERREGISTRAR_TRUE) && + !fetchFlag.EqualsLiteral(SERVICEWORKERREGISTRAR_FALSE)) { + return NS_ERROR_INVALID_ARG; + } + entry->currentWorkerHandlesFetch() = + fetchFlag.EqualsLiteral(SERVICEWORKERREGISTRAR_TRUE); + + nsAutoCString cacheName; + GET_LINE(cacheName); + CopyUTF8toUTF16(cacheName, entry->cacheName()); + + nsAutoCString loadFlags; + GET_LINE(loadFlags); + entry->updateViaCache() = + loadFlags.ToInteger(&rv, 16) == nsIRequest::LOAD_NORMAL + ? nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_ALL + : nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS; + + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + nsAutoCString installedTimeStr; + GET_LINE(installedTimeStr); + int64_t installedTime = installedTimeStr.ToInteger64(&rv); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + entry->currentWorkerInstalledTime() = installedTime; + + nsAutoCString activatedTimeStr; + GET_LINE(activatedTimeStr); + int64_t activatedTime = activatedTimeStr.ToInteger64(&rv); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + entry->currentWorkerActivatedTime() = activatedTime; + + nsAutoCString lastUpdateTimeStr; + GET_LINE(lastUpdateTimeStr); + int64_t lastUpdateTime = lastUpdateTimeStr.ToInteger64(&rv); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + entry->lastUpdateTime() = lastUpdateTime; + } else if (version.EqualsLiteral("6")) { + rv = CreatePrincipalInfo(lineInputStream, entry); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + GET_LINE(entry->currentWorkerURL()); + + nsAutoCString fetchFlag; + GET_LINE(fetchFlag); + if (!fetchFlag.EqualsLiteral(SERVICEWORKERREGISTRAR_TRUE) && + !fetchFlag.EqualsLiteral(SERVICEWORKERREGISTRAR_FALSE)) { + return NS_ERROR_INVALID_ARG; + } + entry->currentWorkerHandlesFetch() = + fetchFlag.EqualsLiteral(SERVICEWORKERREGISTRAR_TRUE); + + nsAutoCString cacheName; + GET_LINE(cacheName); + CopyUTF8toUTF16(cacheName, entry->cacheName()); + + nsAutoCString loadFlags; + GET_LINE(loadFlags); + entry->updateViaCache() = + loadFlags.ToInteger(&rv, 16) == nsIRequest::LOAD_NORMAL + ? nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_ALL + : nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS; + + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + entry->currentWorkerInstalledTime() = 0; + entry->currentWorkerActivatedTime() = 0; + entry->lastUpdateTime() = 0; + } else if (version.EqualsLiteral("5")) { + overwrite = true; + dedupe = true; + + rv = CreatePrincipalInfo(lineInputStream, entry); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + GET_LINE(entry->currentWorkerURL()); + + nsAutoCString fetchFlag; + GET_LINE(fetchFlag); + if (!fetchFlag.EqualsLiteral(SERVICEWORKERREGISTRAR_TRUE) && + !fetchFlag.EqualsLiteral(SERVICEWORKERREGISTRAR_FALSE)) { + return NS_ERROR_INVALID_ARG; + } + entry->currentWorkerHandlesFetch() = + fetchFlag.EqualsLiteral(SERVICEWORKERREGISTRAR_TRUE); + + nsAutoCString cacheName; + GET_LINE(cacheName); + CopyUTF8toUTF16(cacheName, entry->cacheName()); + + entry->updateViaCache() = + nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS; + + entry->currentWorkerInstalledTime() = 0; + entry->currentWorkerActivatedTime() = 0; + entry->lastUpdateTime() = 0; + } else if (version.EqualsLiteral("4")) { + overwrite = true; + dedupe = true; + + rv = CreatePrincipalInfo(lineInputStream, entry); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + GET_LINE(entry->currentWorkerURL()); + + // default handlesFetch flag to Enabled + entry->currentWorkerHandlesFetch() = true; + + nsAutoCString cacheName; + GET_LINE(cacheName); + CopyUTF8toUTF16(cacheName, entry->cacheName()); + + entry->updateViaCache() = + nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS; + + entry->currentWorkerInstalledTime() = 0; + entry->currentWorkerActivatedTime() = 0; + entry->lastUpdateTime() = 0; + } else if (version.EqualsLiteral("3")) { + overwrite = true; + dedupe = true; + + rv = CreatePrincipalInfo(lineInputStream, entry, true); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + GET_LINE(entry->currentWorkerURL()); + + // default handlesFetch flag to Enabled + entry->currentWorkerHandlesFetch() = true; + + nsAutoCString cacheName; + GET_LINE(cacheName); + CopyUTF8toUTF16(cacheName, entry->cacheName()); + + entry->updateViaCache() = + nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS; + + entry->currentWorkerInstalledTime() = 0; + entry->currentWorkerActivatedTime() = 0; + entry->lastUpdateTime() = 0; + } else if (version.EqualsLiteral("2")) { + overwrite = true; + dedupe = true; + + rv = CreatePrincipalInfo(lineInputStream, entry, true); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + // scriptSpec is no more used in latest version. + nsAutoCString unused; + GET_LINE(unused); + + GET_LINE(entry->currentWorkerURL()); + + // default handlesFetch flag to Enabled + entry->currentWorkerHandlesFetch() = true; + + nsAutoCString cacheName; + GET_LINE(cacheName); + CopyUTF8toUTF16(cacheName, entry->cacheName()); + + // waitingCacheName is no more used in latest version. + GET_LINE(unused); + + entry->updateViaCache() = + nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS; + + entry->currentWorkerInstalledTime() = 0; + entry->currentWorkerActivatedTime() = 0; + entry->lastUpdateTime() = 0; + } else { + MOZ_ASSERT_UNREACHABLE("Should never get here!"); + } + +#undef GET_LINE + + rv = lineInputStream->ReadLine(line, &hasMoreLines); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + if (!line.EqualsLiteral(SERVICEWORKERREGISTRAR_TERMINATOR)) { + return NS_ERROR_FAILURE; + } + } + + stream->Close(); + + // XXX: The following code is writing to mData without holding a + // monitor lock. This might be ok since this is currently + // only called at startup where we block the main thread + // preventing further operation until it completes. We should + // consider better locking here in the future. + + // Copy data over to mData. + for (uint32_t i = 0; i < tmpData.Length(); ++i) { + // Older versions could sometimes write out empty, useless entries. + // Prune those here. + if (!ServiceWorkerRegistrationDataIsValid(tmpData[i])) { + continue; + } + + bool match = false; + if (dedupe) { + MOZ_ASSERT(overwrite); + // If this is an old profile, then we might need to deduplicate. In + // theory this can be removed in the future (Bug 1248449) + for (uint32_t j = 0; j < mData.Length(); ++j) { + // Use same comparison as RegisterServiceWorker. Scope contains + // basic origin information. Combine with any principal attributes. + if (Equivalent(tmpData[i], mData[j])) { + // Last match wins, just like legacy loading used to do in + // the ServiceWorkerManager. + mData[j] = tmpData[i]; + // Dupe found, so overwrite file with reduced list. + match = true; + break; + } + } + } else { +#ifdef DEBUG + // Otherwise assert no duplications in debug builds. + for (uint32_t j = 0; j < mData.Length(); ++j) { + MOZ_ASSERT(!Equivalent(tmpData[i], mData[j])); + } +#endif + } + if (!match) { + mData.AppendElement(tmpData[i]); + } + } + + // Overwrite previous version. + // Cannot call SaveData directly because gtest uses main-thread. + if (overwrite && NS_FAILED(WriteData(mData))) { + NS_WARNING("Failed to write data for the ServiceWorker Registations."); + DeleteData(); + } + + return NS_OK; +} + +void ServiceWorkerRegistrar::DeleteData() { + // We cannot assert about the correct thread because normally this method + // runs on a IO thread, but in gTests we call it from the main-thread. + + nsCOMPtr file; + + { + MonitorAutoLock lock(mMonitor); + mData.Clear(); + + if (!mProfileDir) { + return; + } + + nsresult rv = mProfileDir->Clone(getter_AddRefs(file)); + if (NS_WARN_IF(NS_FAILED(rv))) { + return; + } + } + + nsresult rv = file->Append(nsLiteralString(SERVICEWORKERREGISTRAR_FILE)); + if (NS_WARN_IF(NS_FAILED(rv))) { + return; + } + + rv = file->Remove(false); + if (rv == NS_ERROR_FILE_NOT_FOUND) { + return; + } + + if (NS_WARN_IF(NS_FAILED(rv))) { + return; + } +} + +void ServiceWorkerRegistrar::RegisterServiceWorkerInternal( + const ServiceWorkerRegistrationData& aData) { + bool found = false; + for (uint32_t i = 0, len = mData.Length(); i < len; ++i) { + if (Equivalent(aData, mData[i])) { + mData[i] = aData; + found = true; + break; + } + } + + if (!found) { + MOZ_ASSERT(ServiceWorkerRegistrationDataIsValid(aData)); + mData.AppendElement(aData); + } + + mDataGeneration = GetNextGeneration(); +} + +class ServiceWorkerRegistrarSaveDataRunnable final : public Runnable { + nsCOMPtr mEventTarget; + const nsTArray mData; + const uint32_t mGeneration; + + public: + ServiceWorkerRegistrarSaveDataRunnable( + nsTArray&& aData, uint32_t aGeneration) + : Runnable("dom::ServiceWorkerRegistrarSaveDataRunnable"), + mEventTarget(GetCurrentEventTarget()), + mData(std::move(aData)), + mGeneration(aGeneration) { + AssertIsOnBackgroundThread(); + MOZ_DIAGNOSTIC_ASSERT(mGeneration != kInvalidGeneration); + } + + NS_IMETHOD + Run() override { + RefPtr service = ServiceWorkerRegistrar::Get(); + MOZ_ASSERT(service); + + uint32_t fileGeneration = kInvalidGeneration; + + if (NS_SUCCEEDED(service->SaveData(mData))) { + fileGeneration = mGeneration; + } + + RefPtr runnable = NewRunnableMethod( + "ServiceWorkerRegistrar::DataSaved", service, + &ServiceWorkerRegistrar::DataSaved, fileGeneration); + MOZ_ALWAYS_SUCCEEDS( + mEventTarget->Dispatch(runnable.forget(), NS_DISPATCH_NORMAL)); + + return NS_OK; + } +}; + +void ServiceWorkerRegistrar::MaybeScheduleSaveData() { + AssertIsOnBackgroundThread(); + MOZ_ASSERT(!mShuttingDown); + + if (mShuttingDown || mRunnableDispatched || + mDataGeneration <= mFileGeneration) { + return; + } + + nsCOMPtr target = + do_GetService(NS_STREAMTRANSPORTSERVICE_CONTRACTID); + MOZ_ASSERT(target, "Must have stream transport service"); + + uint32_t generation = kInvalidGeneration; + nsTArray data; + + { + MonitorAutoLock lock(mMonitor); + generation = mDataGeneration; + data.AppendElements(mData); + } + + RefPtr runnable = + new ServiceWorkerRegistrarSaveDataRunnable(std::move(data), generation); + nsresult rv = target->Dispatch(runnable.forget(), NS_DISPATCH_NORMAL); + NS_ENSURE_SUCCESS_VOID(rv); + + mRunnableDispatched = true; +} + +void ServiceWorkerRegistrar::ShutdownCompleted() { + MOZ_ASSERT(NS_IsMainThread()); + + DebugOnly rv = GetShutdownPhase()->RemoveBlocker(this); + MOZ_ASSERT(NS_SUCCEEDED(rv)); +} + +nsresult ServiceWorkerRegistrar::SaveData( + const nsTArray& aData) { + MOZ_ASSERT(!NS_IsMainThread()); + + nsresult rv = WriteData(aData); + if (NS_FAILED(rv)) { + NS_WARNING("Failed to write data for the ServiceWorker Registations."); + // Don't touch the file or in-memory state. Writing files can + // sometimes fail due to virus scanning, etc. We should just leave + // things as is so the next save operation can pick up any changes + // without losing data. + } + return rv; +} + +void ServiceWorkerRegistrar::DataSaved(uint32_t aFileGeneration) { + AssertIsOnBackgroundThread(); + MOZ_ASSERT(mRunnableDispatched); + + mRunnableDispatched = false; + + // Check for shutdown before possibly triggering any more saves + // runnables. + MaybeScheduleShutdownCompleted(); + if (mShuttingDown) { + return; + } + + // If we got a valid generation, then the save was successful. + if (aFileGeneration != kInvalidGeneration) { + // Update the file generation. We also check to see if we + // can reset the generation back to zero if the file and data + // are now in sync. This allows us to avoid dealing with wrap + // around of the generation count. + mFileGeneration = aFileGeneration; + MaybeResetGeneration(); + + // Successful write resets the retry count. + mRetryCount = 0; + + // Possibly schedule another save operation if more data + // has come in while processing this one. + MaybeScheduleSaveData(); + + return; + } + + // Otherwise, the save failed since the generation is invalid. We + // want to retry the save, but only a limited number of times. + static const uint32_t kMaxRetryCount = 2; + if (mRetryCount >= kMaxRetryCount) { + return; + } + + mRetryCount += 1; + MaybeScheduleSaveData(); +} + +void ServiceWorkerRegistrar::MaybeScheduleShutdownCompleted() { + AssertIsOnBackgroundThread(); + + if (mRunnableDispatched || !mShuttingDown) { + return; + } + + RefPtr runnable = + NewRunnableMethod("dom::ServiceWorkerRegistrar::ShutdownCompleted", this, + &ServiceWorkerRegistrar::ShutdownCompleted); + MOZ_ALWAYS_SUCCEEDS(NS_DispatchToMainThread(runnable.forget())); +} + +uint32_t ServiceWorkerRegistrar::GetNextGeneration() { + uint32_t ret = mDataGeneration + 1; + if (ret == kInvalidGeneration) { + ret += 1; + } + return ret; +} + +void ServiceWorkerRegistrar::MaybeResetGeneration() { + if (mDataGeneration != mFileGeneration) { + return; + } + mDataGeneration = mFileGeneration = 0; +} + +bool ServiceWorkerRegistrar::IsSupportedVersion( + const nsACString& aVersion) const { + uint32_t numVersions = ArrayLength(gSupportedRegistrarVersions); + for (uint32_t i = 0; i < numVersions; i++) { + if (aVersion.EqualsASCII(gSupportedRegistrarVersions[i])) { + return true; + } + } + return false; +} + +nsresult ServiceWorkerRegistrar::WriteData( + const nsTArray& aData) { + // We cannot assert about the correct thread because normally this method + // runs on a IO thread, but in gTests we call it from the main-thread. + + nsCOMPtr file; + + { + MonitorAutoLock lock(mMonitor); + + if (!mProfileDir) { + return NS_ERROR_FAILURE; + } + + nsresult rv = mProfileDir->Clone(getter_AddRefs(file)); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + } + + nsresult rv = file->Append(nsLiteralString(SERVICEWORKERREGISTRAR_FILE)); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + nsCOMPtr stream; + rv = NS_NewSafeLocalFileOutputStream(getter_AddRefs(stream), file); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + nsAutoCString buffer; + buffer.AppendLiteral(SERVICEWORKERREGISTRAR_VERSION); + buffer.Append('\n'); + + uint32_t count; + rv = stream->Write(buffer.Data(), buffer.Length(), &count); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + if (count != buffer.Length()) { + return NS_ERROR_UNEXPECTED; + } + + for (uint32_t i = 0, len = aData.Length(); i < len; ++i) { + // We have an assertion further up the stack, but as a last + // resort avoid writing out broken entries here. + if (!ServiceWorkerRegistrationDataIsValid(aData[i])) { + continue; + } + + const mozilla::ipc::PrincipalInfo& info = aData[i].principal(); + + MOZ_ASSERT(info.type() == + mozilla::ipc::PrincipalInfo::TContentPrincipalInfo); + + const mozilla::ipc::ContentPrincipalInfo& cInfo = + info.get_ContentPrincipalInfo(); + + nsAutoCString suffix; + cInfo.attrs().CreateSuffix(suffix); + + buffer.Truncate(); + buffer.Append(suffix.get()); + buffer.Append('\n'); + + buffer.Append(aData[i].scope()); + buffer.Append('\n'); + + buffer.Append(aData[i].currentWorkerURL()); + buffer.Append('\n'); + + buffer.Append(aData[i].currentWorkerHandlesFetch() + ? SERVICEWORKERREGISTRAR_TRUE + : SERVICEWORKERREGISTRAR_FALSE); + buffer.Append('\n'); + + buffer.Append(NS_ConvertUTF16toUTF8(aData[i].cacheName())); + buffer.Append('\n'); + + buffer.AppendInt(aData[i].updateViaCache(), 16); + buffer.Append('\n'); + MOZ_DIAGNOSTIC_ASSERT( + aData[i].updateViaCache() == + nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS || + aData[i].updateViaCache() == + nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_ALL || + aData[i].updateViaCache() == + nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_NONE); + + static_assert(nsIRequest::LOAD_NORMAL == 0, + "LOAD_NORMAL matches serialized value."); + static_assert(nsIRequest::VALIDATE_ALWAYS == (1 << 11), + "VALIDATE_ALWAYS matches serialized value"); + + buffer.AppendInt(aData[i].currentWorkerInstalledTime()); + buffer.Append('\n'); + + buffer.AppendInt(aData[i].currentWorkerActivatedTime()); + buffer.Append('\n'); + + buffer.AppendInt(aData[i].lastUpdateTime()); + buffer.Append('\n'); + + buffer.AppendLiteral(SERVICEWORKERREGISTRAR_TERMINATOR); + buffer.Append('\n'); + + rv = stream->Write(buffer.Data(), buffer.Length(), &count); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + if (count != buffer.Length()) { + return NS_ERROR_UNEXPECTED; + } + } + + nsCOMPtr safeStream = do_QueryInterface(stream); + MOZ_ASSERT(safeStream); + + rv = safeStream->Finish(); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + return NS_OK; +} + +void ServiceWorkerRegistrar::ProfileStarted() { + MOZ_ASSERT(NS_IsMainThread()); + + MonitorAutoLock lock(mMonitor); + MOZ_DIAGNOSTIC_ASSERT(!mProfileDir); + + nsresult rv = NS_GetSpecialDirectory(NS_APP_USER_PROFILE_50_DIR, + getter_AddRefs(mProfileDir)); + if (NS_WARN_IF(NS_FAILED(rv))) { + return; + } + + nsAutoString blockerName; + MOZ_ALWAYS_SUCCEEDS(GetName(blockerName)); + + rv = GetShutdownPhase()->AddBlocker( + this, NS_LITERAL_STRING_FROM_CSTRING(__FILE__), __LINE__, blockerName); + if (NS_WARN_IF(NS_FAILED(rv))) { + return; + } + + nsCOMPtr target = + do_GetService(NS_STREAMTRANSPORTSERVICE_CONTRACTID); + MOZ_ASSERT(target, "Must have stream transport service"); + + nsCOMPtr runnable = + NewRunnableMethod("dom::ServiceWorkerRegistrar::LoadData", this, + &ServiceWorkerRegistrar::LoadData); + rv = target->Dispatch(runnable.forget(), NS_DISPATCH_NORMAL); + if (NS_FAILED(rv)) { + NS_WARNING("Failed to dispatch the LoadDataRunnable."); + } +} + +void ServiceWorkerRegistrar::ProfileStopped() { + MOZ_ASSERT(NS_IsMainThread()); + + MonitorAutoLock lock(mMonitor); + + if (!mProfileDir) { + nsresult rv = NS_GetSpecialDirectory(NS_APP_USER_PROFILE_50_DIR, + getter_AddRefs(mProfileDir)); + if (NS_WARN_IF(NS_FAILED(rv))) { + return; + } + } + + PBackgroundChild* child = BackgroundChild::GetForCurrentThread(); + if (!child) { + // Mutations to the ServiceWorkerRegistrar happen on the PBackground thread, + // issued by the ServiceWorkerManagerService, so the appropriate place to + // trigger shutdown is on that thread. + // + // However, it's quite possible that the PBackground thread was not brought + // into existence for xpcshell tests. We don't cause it to be created + // ourselves for any reason, for example. + // + // In this scenario, we know that: + // - We will receive exactly one call to ourself from BlockShutdown() and + // BlockShutdown() will be called (at most) once. + // - The only way our Shutdown() method gets called is via + // BackgroundParentImpl::RecvShutdownServiceWorkerRegistrar() being + // invoked, which only happens if we get to that send below here that we + // can't get to. + // - All Shutdown() does is set mShuttingDown=true (essential for + // invariants) and invoke MaybeScheduleShutdownCompleted(). + // - Since there is no PBackground thread, mRunnableDispatched must be false + // because only MaybeScheduleSaveData() set it and it only runs on the + // background thread, so it cannot have run. And so we would expect + // MaybeScheduleShutdownCompleted() to schedule an invocation of + // ShutdownCompleted on the main thread. + // + // So it's appropriate for us to set mShuttingDown=true (as Shutdown would + // do) and directly invoke ShutdownCompleted() (as Shutdown would indirectly + // do via MaybeScheduleShutdownCompleted). + mShuttingDown = true; + ShutdownCompleted(); + return; + } + + child->SendShutdownServiceWorkerRegistrar(); +} + +// Async shutdown blocker methods + +NS_IMETHODIMP +ServiceWorkerRegistrar::BlockShutdown(nsIAsyncShutdownClient* aClient) { + ProfileStopped(); + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerRegistrar::GetName(nsAString& aName) { + aName = u"ServiceWorkerRegistrar: Flushing data"_ns; + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerRegistrar::GetState(nsIPropertyBag** aBagOut) { + nsCOMPtr propertyBag = + do_CreateInstance("@mozilla.org/hash-property-bag;1"); + + MOZ_TRY(propertyBag->SetPropertyAsBool(u"shuttingDown"_ns, mShuttingDown)); + + MOZ_TRY(propertyBag->SetPropertyAsBool(u"saveDataRunnableDispatched"_ns, + mRunnableDispatched)); + + propertyBag.forget(aBagOut); + + return NS_OK; +} + +#define RELEASE_ASSERT_SUCCEEDED(rv, name) \ + do { \ + if (NS_FAILED(rv)) { \ + mozJSComponentLoader::Get()->AnnotateCrashReport(); \ + if (rv == NS_ERROR_XPC_JAVASCRIPT_ERROR_WITH_DETAILS) { \ + if (auto* context = CycleCollectedJSContext::Get()) { \ + if (RefPtr exn = context->GetPendingException()) { \ + MOZ_CRASH_UNSAFE_PRINTF("Failed to get " name ": %s", \ + exn->GetMessageMoz().get()); \ + } \ + } \ + } \ + \ + nsAutoCString errorName; \ + GetErrorName(rv, errorName); \ + MOZ_CRASH_UNSAFE_PRINTF("Failed to get " name ": %s", errorName.get()); \ + } \ + } while (0) + +nsCOMPtr ServiceWorkerRegistrar::GetShutdownPhase() + const { + nsresult rv; + nsCOMPtr svc = + do_GetService("@mozilla.org/async-shutdown-service;1", &rv); + // If this fails, something is very wrong on the JS side (or we're out of + // memory), and there's no point in continuing startup. Include as much + // information as possible in the crash report. + RELEASE_ASSERT_SUCCEEDED(rv, "async shutdown service"); + + nsCOMPtr client; + rv = svc->GetProfileBeforeChange(getter_AddRefs(client)); + RELEASE_ASSERT_SUCCEEDED(rv, "profileBeforeChange shutdown blocker"); + return client; +} + +#undef RELEASE_ASSERT_SUCCEEDED + +void ServiceWorkerRegistrar::Shutdown() { + AssertIsOnBackgroundThread(); + MOZ_ASSERT(!mShuttingDown); + + mShuttingDown = true; + MaybeScheduleShutdownCompleted(); +} + +NS_IMETHODIMP +ServiceWorkerRegistrar::Observe(nsISupports* aSubject, const char* aTopic, + const char16_t* aData) { + MOZ_ASSERT(NS_IsMainThread()); + + if (!strcmp(aTopic, "profile-after-change")) { + nsCOMPtr observerService = + services::GetObserverService(); + observerService->RemoveObserver(this, "profile-after-change"); + + // The profile is fully loaded, now we can proceed with the loading of data + // from disk. + ProfileStarted(); + + return NS_OK; + } + + MOZ_ASSERT(false, "ServiceWorkerRegistrar got unexpected topic!"); + return NS_ERROR_UNEXPECTED; +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerRegistrar.h b/dom/serviceworkers/ServiceWorkerRegistrar.h new file mode 100644 index 0000000000..d710cc2fde --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerRegistrar.h @@ -0,0 +1,115 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_ServiceWorkerRegistrar_h +#define mozilla_dom_ServiceWorkerRegistrar_h + +#include "mozilla/Monitor.h" +#include "mozilla/Telemetry.h" +#include "nsClassHashtable.h" +#include "nsIAsyncShutdown.h" +#include "nsIObserver.h" +#include "nsCOMPtr.h" +#include "nsString.h" +#include "nsTArray.h" + +#define SERVICEWORKERREGISTRAR_FILE u"serviceworker.txt" +#define SERVICEWORKERREGISTRAR_VERSION "8" +#define SERVICEWORKERREGISTRAR_TERMINATOR "#" +#define SERVICEWORKERREGISTRAR_TRUE "true" +#define SERVICEWORKERREGISTRAR_FALSE "false" + +class nsIFile; + +namespace mozilla { + +namespace ipc { +class PrincipalInfo; +} // namespace ipc + +namespace dom { + +class ServiceWorkerRegistrationData; +} +} // namespace mozilla + +namespace mozilla::dom { + +class ServiceWorkerRegistrar : public nsIObserver, + public nsIAsyncShutdownBlocker { + friend class ServiceWorkerRegistrarSaveDataRunnable; + + public: + NS_DECL_THREADSAFE_ISUPPORTS + NS_DECL_NSIOBSERVER + NS_DECL_NSIASYNCSHUTDOWNBLOCKER + + static void Initialize(); + + void Shutdown(); + + void DataSaved(uint32_t aFileGeneration); + + static already_AddRefed Get(); + + void GetRegistrations(nsTArray& aValues); + + void RegisterServiceWorker(const ServiceWorkerRegistrationData& aData); + void UnregisterServiceWorker( + const mozilla::ipc::PrincipalInfo& aPrincipalInfo, + const nsACString& aScope); + void RemoveAll(); + + protected: + // These methods are protected because we test this class using gTest + // subclassing it. + void LoadData(); + nsresult SaveData(const nsTArray& aData); + + nsresult ReadData(); + nsresult WriteData(const nsTArray& aData); + void DeleteData(); + + void RegisterServiceWorkerInternal( + const ServiceWorkerRegistrationData& aData); + + ServiceWorkerRegistrar(); + virtual ~ServiceWorkerRegistrar(); + + private: + void ProfileStarted(); + void ProfileStopped(); + + void MaybeScheduleSaveData(); + void ShutdownCompleted(); + void MaybeScheduleShutdownCompleted(); + + uint32_t GetNextGeneration(); + void MaybeResetGeneration(); + + nsCOMPtr GetShutdownPhase() const; + + bool IsSupportedVersion(const nsACString& aVersion) const; + + mozilla::Monitor mMonitor; + + protected: + // protected by mMonitor. + nsCOMPtr mProfileDir; + nsTArray mData; + bool mDataLoaded; + + // PBackground thread only + uint32_t mDataGeneration; + uint32_t mFileGeneration; + uint32_t mRetryCount; + bool mShuttingDown; + bool mRunnableDispatched; +}; + +} // namespace mozilla::dom + +#endif // mozilla_dom_ServiceWorkerRegistrar_h diff --git a/dom/serviceworkers/ServiceWorkerRegistrarTypes.ipdlh b/dom/serviceworkers/ServiceWorkerRegistrarTypes.ipdlh new file mode 100644 index 0000000000..cb6aff4c5e --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerRegistrarTypes.ipdlh @@ -0,0 +1,30 @@ +/* -*- Mode: C++; c-basic-offset: 2; indent-tabs-mode: nil; tab-width: 8 -*- */ +/* vim: set sw=4 ts=8 et tw=80 ft=cpp : */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +include PBackgroundSharedTypes; + +namespace mozilla { +namespace dom { + +struct ServiceWorkerRegistrationData +{ + nsCString scope; + nsCString currentWorkerURL; + bool currentWorkerHandlesFetch; + + nsString cacheName; + + PrincipalInfo principal; + + uint16_t updateViaCache; + + int64_t currentWorkerInstalledTime; + int64_t currentWorkerActivatedTime; + int64_t lastUpdateTime; +}; + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerRegistration.cpp b/dom/serviceworkers/ServiceWorkerRegistration.cpp new file mode 100644 index 0000000000..59a7615b75 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerRegistration.cpp @@ -0,0 +1,548 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerRegistration.h" + +#include "mozilla/dom/DOMMozPromiseRequestHolder.h" +#include "mozilla/dom/Notification.h" +#include "mozilla/dom/Promise.h" +#include "mozilla/dom/PushManager.h" +#include "mozilla/dom/ServiceWorker.h" +#include "mozilla/dom/ServiceWorkerRegistrationBinding.h" +#include "mozilla/dom/ServiceWorkerUtils.h" +#include "mozilla/dom/WorkerPrivate.h" +#include "mozilla/ScopeExit.h" +#include "nsCycleCollectionParticipant.h" +#include "nsPIDOMWindow.h" +#include "RemoteServiceWorkerRegistrationImpl.h" +#include "ServiceWorkerRegistrationImpl.h" + +namespace mozilla { +namespace dom { + +NS_IMPL_CYCLE_COLLECTION_INHERITED(ServiceWorkerRegistration, + DOMEventTargetHelper, mInstallingWorker, + mWaitingWorker, mActiveWorker, mPushManager); + +NS_IMPL_ADDREF_INHERITED(ServiceWorkerRegistration, DOMEventTargetHelper) +NS_IMPL_RELEASE_INHERITED(ServiceWorkerRegistration, DOMEventTargetHelper) + +NS_INTERFACE_MAP_BEGIN_CYCLE_COLLECTION(ServiceWorkerRegistration) + NS_INTERFACE_MAP_ENTRY(ServiceWorkerRegistration) +NS_INTERFACE_MAP_END_INHERITING(DOMEventTargetHelper) + +namespace { +const uint64_t kInvalidUpdateFoundId = 0; +} // anonymous namespace + +ServiceWorkerRegistration::ServiceWorkerRegistration( + nsIGlobalObject* aGlobal, + const ServiceWorkerRegistrationDescriptor& aDescriptor, + ServiceWorkerRegistration::Inner* aInner) + : DOMEventTargetHelper(aGlobal), + mDescriptor(aDescriptor), + mInner(aInner), + mScheduledUpdateFoundId(kInvalidUpdateFoundId), + mDispatchedUpdateFoundId(kInvalidUpdateFoundId) { + MOZ_DIAGNOSTIC_ASSERT(mInner); + + KeepAliveIfHasListenersFor(u"updatefound"_ns); + + mInner->SetServiceWorkerRegistration(this); +} + +ServiceWorkerRegistration::~ServiceWorkerRegistration() { + mInner->ClearServiceWorkerRegistration(this); +} + +JSObject* ServiceWorkerRegistration::WrapObject( + JSContext* aCx, JS::Handle aGivenProto) { + return ServiceWorkerRegistration_Binding::Wrap(aCx, this, aGivenProto); +} + +/* static */ +already_AddRefed +ServiceWorkerRegistration::CreateForMainThread( + nsPIDOMWindowInner* aWindow, + const ServiceWorkerRegistrationDescriptor& aDescriptor) { + MOZ_ASSERT(aWindow); + MOZ_ASSERT(NS_IsMainThread()); + + RefPtr inner; + if (ServiceWorkerParentInterceptEnabled()) { + inner = new RemoteServiceWorkerRegistrationImpl(aDescriptor); + } else { + inner = new ServiceWorkerRegistrationMainThread(aDescriptor); + } + NS_ENSURE_TRUE(inner, nullptr); + + RefPtr registration = + new ServiceWorkerRegistration(aWindow->AsGlobal(), aDescriptor, inner); + // This is not called from within the constructor, as it may call content code + // which can cause the deletion of the registration, so we need to keep a + // strong reference while calling it. + registration->UpdateState(aDescriptor); + + return registration.forget(); +} + +/* static */ +already_AddRefed +ServiceWorkerRegistration::CreateForWorker( + WorkerPrivate* aWorkerPrivate, nsIGlobalObject* aGlobal, + const ServiceWorkerRegistrationDescriptor& aDescriptor) { + MOZ_DIAGNOSTIC_ASSERT(aWorkerPrivate); + MOZ_DIAGNOSTIC_ASSERT(aGlobal); + aWorkerPrivate->AssertIsOnWorkerThread(); + + RefPtr inner; + if (ServiceWorkerParentInterceptEnabled()) { + inner = new RemoteServiceWorkerRegistrationImpl(aDescriptor); + } else { + inner = new ServiceWorkerRegistrationWorkerThread(aDescriptor); + } + NS_ENSURE_TRUE(inner, nullptr); + + RefPtr registration = + new ServiceWorkerRegistration(aGlobal, aDescriptor, inner); + // This is not called from within the constructor, as it may call content code + // which can cause the deletion of the registration, so we need to keep a + // strong reference while calling it. + registration->UpdateState(aDescriptor); + + return registration.forget(); +} + +void ServiceWorkerRegistration::DisconnectFromOwner() { + DOMEventTargetHelper::DisconnectFromOwner(); +} + +void ServiceWorkerRegistration::RegistrationCleared() { + // Its possible that the registration will fail to install and be + // immediately removed. In that case we may never receive the + // UpdateState() call if the actor was too slow to connect, etc. + // Ensure that we force all our known actors to redundant so that + // the appropriate statechange events are fired. If we got the + // UpdateState() already then this will be a no-op. + UpdateStateInternal(Maybe(), + Maybe(), + Maybe()); + + // Our underlying registration was removed from SWM, so we + // will never get an updatefound event again. We can let + // the object GC if content is not holding it alive. + IgnoreKeepAliveIfHasListenersFor(u"updatefound"_ns); +} + +already_AddRefed ServiceWorkerRegistration::GetInstalling() + const { + RefPtr ref = mInstallingWorker; + return ref.forget(); +} + +already_AddRefed ServiceWorkerRegistration::GetWaiting() const { + RefPtr ref = mWaitingWorker; + return ref.forget(); +} + +already_AddRefed ServiceWorkerRegistration::GetActive() const { + RefPtr ref = mActiveWorker; + return ref.forget(); +} + +void ServiceWorkerRegistration::UpdateState( + const ServiceWorkerRegistrationDescriptor& aDescriptor) { + MOZ_DIAGNOSTIC_ASSERT(MatchesDescriptor(aDescriptor)); + + mDescriptor = aDescriptor; + + UpdateStateInternal(aDescriptor.GetInstalling(), aDescriptor.GetWaiting(), + aDescriptor.GetActive()); + + nsTArray> callbackList = + std::move(mVersionCallbackList); + for (auto& cb : callbackList) { + if (cb->mVersion > mDescriptor.Version()) { + mVersionCallbackList.AppendElement(std::move(cb)); + continue; + } + + cb->mFunc(cb->mVersion == mDescriptor.Version()); + } +} + +bool ServiceWorkerRegistration::MatchesDescriptor( + const ServiceWorkerRegistrationDescriptor& aDescriptor) const { + return aDescriptor.Id() == mDescriptor.Id() && + aDescriptor.PrincipalInfo() == mDescriptor.PrincipalInfo() && + aDescriptor.Scope() == mDescriptor.Scope(); +} + +void ServiceWorkerRegistration::GetScope(nsAString& aScope) const { + CopyUTF8toUTF16(mDescriptor.Scope(), aScope); +} + +ServiceWorkerUpdateViaCache ServiceWorkerRegistration::GetUpdateViaCache( + ErrorResult& aRv) const { + return mDescriptor.UpdateViaCache(); +} + +already_AddRefed ServiceWorkerRegistration::Update(ErrorResult& aRv) { + if (!mInner) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return nullptr; + } + + nsIGlobalObject* global = GetParentObject(); + if (!global) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return nullptr; + } + + RefPtr outer = Promise::Create(global, aRv); + if (NS_WARN_IF(aRv.Failed())) { + return nullptr; + } + + // `ServiceWorker` objects are not exposed on worker threads yet, so calling + // `ServiceWorkerRegistration::Get{Installing,Waiting,Active}` won't work. + const Maybe newestWorkerDescriptor = + mDescriptor.Newest(); + + // "If newestWorker is null, return a promise rejected with an + // "InvalidStateError" DOMException and abort these steps." + if (newestWorkerDescriptor.isNothing()) { + outer->MaybeReject(NS_ERROR_DOM_INVALID_STATE_ERR); + return outer.forget(); + } + + // "If the context object’s relevant settings object’s global object + // globalObject is a ServiceWorkerGlobalScope object, and globalObject’s + // associated service worker's state is "installing", return a promise + // rejected with an "InvalidStateError" DOMException and abort these steps." + if (!NS_IsMainThread()) { + WorkerPrivate* workerPrivate = GetCurrentThreadWorkerPrivate(); + MOZ_ASSERT(workerPrivate); + + if (workerPrivate->IsServiceWorker() && + (workerPrivate->GetServiceWorkerDescriptor().State() == + ServiceWorkerState::Installing)) { + outer->MaybeReject(NS_ERROR_DOM_INVALID_STATE_ERR); + return outer.forget(); + } + } + + RefPtr self = this; + + mInner->Update( + newestWorkerDescriptor.ref().ScriptURL(), + [outer, self](const ServiceWorkerRegistrationDescriptor& aDesc) { + nsIGlobalObject* global = self->GetParentObject(); + // It's possible this binding was detached from the global. In cases + // where we use IPC with Promise callbacks, we use + // DOMMozPromiseRequestHolder in order to auto-disconnect the promise + // that would hold these callbacks. However in bug 1466681 we changed + // this call to use (synchronous) callbacks because the use of + // MozPromise introduced an additional runnable scheduling which made + // it very difficult to maintain ordering required by the standard. + // + // If we were to delete this actor at the time of DETH detaching, we + // would not need to do this check because the IPC callback of the + // RemoteServiceWorkerRegistrationImpl lambdas would never occur. + // However, its actors currently depend on asking the parent to delete + // the actor for us. Given relaxations in the IPC lifecyle, we could + // potentially issue a direct termination, but that requires additional + // evaluation. + if (!global) { + outer->MaybeReject(NS_ERROR_DOM_INVALID_STATE_ERR); + return; + } + RefPtr ref = + global->GetOrCreateServiceWorkerRegistration(aDesc); + if (!ref) { + outer->MaybeReject(NS_ERROR_DOM_INVALID_STATE_ERR); + return; + } + outer->MaybeResolve(ref); + }, + [outer, self](ErrorResult&& aRv) { outer->MaybeReject(std::move(aRv)); }); + + return outer.forget(); +} + +already_AddRefed ServiceWorkerRegistration::Unregister( + ErrorResult& aRv) { + nsIGlobalObject* global = GetParentObject(); + if (NS_WARN_IF(!global)) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return nullptr; + } + + RefPtr outer = Promise::Create(global, aRv); + if (NS_WARN_IF(aRv.Failed())) { + return nullptr; + } + + if (!mInner) { + outer->MaybeResolve(false); + return outer.forget(); + } + + mInner->Unregister([outer](bool aSuccess) { outer->MaybeResolve(aSuccess); }, + [outer](ErrorResult&& aRv) { + // register() should be resilient and resolve false + // instead of rejecting in most cases. + aRv.SuppressException(); + outer->MaybeResolve(false); + }); + + return outer.forget(); +} + +already_AddRefed ServiceWorkerRegistration::GetPushManager( + JSContext* aCx, ErrorResult& aRv) { + if (!mPushManager) { + nsCOMPtr globalObject = GetParentObject(); + + if (!globalObject) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return nullptr; + } + + GlobalObject global(aCx, globalObject->GetGlobalJSObject()); + mPushManager = PushManager::Constructor( + global, NS_ConvertUTF8toUTF16(mDescriptor.Scope()), aRv); + if (aRv.Failed()) { + return nullptr; + } + } + + RefPtr ret = mPushManager; + return ret.forget(); +} + +already_AddRefed ServiceWorkerRegistration::ShowNotification( + JSContext* aCx, const nsAString& aTitle, + const NotificationOptions& aOptions, ErrorResult& aRv) { + nsIGlobalObject* global = GetParentObject(); + if (!global) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return nullptr; + } + + // Until we ship ServiceWorker objects on worker threads the active + // worker will always be nullptr. So limit this check to main + // thread for now. + if (mDescriptor.GetActive().isNothing() && NS_IsMainThread()) { + aRv.ThrowTypeError(mDescriptor.Scope()); + return nullptr; + } + + NS_ConvertUTF8toUTF16 scope(mDescriptor.Scope()); + + RefPtr p = Notification::ShowPersistentNotification( + aCx, global, scope, aTitle, aOptions, mDescriptor, aRv); + if (NS_WARN_IF(aRv.Failed())) { + return nullptr; + } + + return p.forget(); +} + +already_AddRefed ServiceWorkerRegistration::GetNotifications( + const GetNotificationOptions& aOptions, ErrorResult& aRv) { + nsIGlobalObject* global = GetParentObject(); + if (!global) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return nullptr; + } + + NS_ConvertUTF8toUTF16 scope(mDescriptor.Scope()); + + if (NS_IsMainThread()) { + nsCOMPtr window = do_QueryInterface(global); + if (NS_WARN_IF(!window)) { + aRv.Throw(NS_ERROR_DOM_INVALID_STATE_ERR); + return nullptr; + } + return Notification::Get(window, aOptions, scope, aRv); + } + + WorkerPrivate* worker = GetCurrentThreadWorkerPrivate(); + worker->AssertIsOnWorkerThread(); + return Notification::WorkerGet(worker, aOptions, scope, aRv); +} + +const ServiceWorkerRegistrationDescriptor& +ServiceWorkerRegistration::Descriptor() const { + return mDescriptor; +} + +void ServiceWorkerRegistration::WhenVersionReached( + uint64_t aVersion, ServiceWorkerBoolCallback&& aCallback) { + if (aVersion <= mDescriptor.Version()) { + aCallback(aVersion == mDescriptor.Version()); + return; + } + + mVersionCallbackList.AppendElement( + MakeUnique(aVersion, std::move(aCallback))); +} + +void ServiceWorkerRegistration::MaybeScheduleUpdateFound( + const Maybe& aInstallingDescriptor) { + // This function sets mScheduledUpdateFoundId to note when we were told about + // a new installing worker. We rely on a call to + // MaybeDispatchUpdateFoundRunnable (called indirectly from UpdateJobCallback) + // to actually fire the event. + uint64_t newId = aInstallingDescriptor.isSome() + ? aInstallingDescriptor.ref().Id() + : kInvalidUpdateFoundId; + + if (mScheduledUpdateFoundId != kInvalidUpdateFoundId) { + if (mScheduledUpdateFoundId == newId) { + return; + } + MaybeDispatchUpdateFound(); + MOZ_DIAGNOSTIC_ASSERT(mScheduledUpdateFoundId == kInvalidUpdateFoundId); + } + + bool updateFound = + newId != kInvalidUpdateFoundId && mDispatchedUpdateFoundId != newId; + + if (!updateFound) { + return; + } + + mScheduledUpdateFoundId = newId; +} + +void ServiceWorkerRegistration::MaybeDispatchUpdateFoundRunnable() { + if (mScheduledUpdateFoundId == kInvalidUpdateFoundId) { + return; + } + + nsIGlobalObject* global = GetParentObject(); + NS_ENSURE_TRUE_VOID(global); + + nsCOMPtr r = NewCancelableRunnableMethod( + "ServiceWorkerRegistration::MaybeDispatchUpdateFound", this, + &ServiceWorkerRegistration::MaybeDispatchUpdateFound); + + Unused << global->EventTargetFor(TaskCategory::Other) + ->Dispatch(r.forget(), NS_DISPATCH_NORMAL); +} + +void ServiceWorkerRegistration::MaybeDispatchUpdateFound() { + uint64_t scheduledId = mScheduledUpdateFoundId; + mScheduledUpdateFoundId = kInvalidUpdateFoundId; + + if (scheduledId == kInvalidUpdateFoundId || + scheduledId == mDispatchedUpdateFoundId) { + return; + } + + mDispatchedUpdateFoundId = scheduledId; + DispatchTrustedEvent(u"updatefound"_ns); +} + +void ServiceWorkerRegistration::UpdateStateInternal( + const Maybe& aInstalling, + const Maybe& aWaiting, + const Maybe& aActive) { + // Do this immediately as it may flush an already pending updatefound + // event. In that case we want to fire the pending event before + // modifying any of the registration properties. + MaybeScheduleUpdateFound(aInstalling); + + // Move the currently exposed workers into a separate list + // of "old" workers. We will then potentially add them + // back to the registration properties below based on the + // given descriptor. Any that are not restored will need + // to be moved to the redundant state. + AutoTArray, 3> oldWorkerList({ + std::move(mInstallingWorker), + std::move(mWaitingWorker), + std::move(mActiveWorker), + }); + + // Its important that all state changes are actually applied before + // dispatching any statechange events. Each ServiceWorker object + // should be in the correct state and the ServiceWorkerRegistration + // properties need to be set correctly as well. To accomplish this + // we use a ScopeExit to dispatch any statechange events. + auto scopeExit = MakeScopeExit([&] { + // Check to see if any of the "old" workers was completely discarded. + // Set these workers to the redundant state. + for (auto& oldWorker : oldWorkerList) { + if (!oldWorker || oldWorker == mInstallingWorker || + oldWorker == mWaitingWorker || oldWorker == mActiveWorker) { + continue; + } + + oldWorker->SetState(ServiceWorkerState::Redundant); + } + + // Check each worker to see if it needs a statechange event dispatched. + if (mInstallingWorker) { + mInstallingWorker->MaybeDispatchStateChangeEvent(); + } + if (mWaitingWorker) { + mWaitingWorker->MaybeDispatchStateChangeEvent(); + } + if (mActiveWorker) { + mActiveWorker->MaybeDispatchStateChangeEvent(); + } + + // We also check the "old" workers to see if they need a statechange + // event as well. Note, these may overlap with the known worker properties + // above, but MaybeDispatchStateChangeEvent() will ignore duplicated calls. + for (auto& oldWorker : oldWorkerList) { + if (!oldWorker) { + continue; + } + + oldWorker->MaybeDispatchStateChangeEvent(); + } + }); + + // Clear all workers if the registration has been detached from the global. + // Also, we cannot expose ServiceWorker objects on worker threads yet, so + // do the same on when off-main-thread. This main thread check should be + // removed as part of bug 1113522. + nsCOMPtr global = GetParentObject(); + if (!global || !NS_IsMainThread()) { + return; + } + + if (aActive.isSome()) { + if ((mActiveWorker = global->GetOrCreateServiceWorker(aActive.ref()))) { + mActiveWorker->SetState(aActive.ref().State()); + } + } else { + mActiveWorker = nullptr; + } + + if (aWaiting.isSome()) { + if ((mWaitingWorker = global->GetOrCreateServiceWorker(aWaiting.ref()))) { + mWaitingWorker->SetState(aWaiting.ref().State()); + } + } else { + mWaitingWorker = nullptr; + } + + if (aInstalling.isSome()) { + if ((mInstallingWorker = + global->GetOrCreateServiceWorker(aInstalling.ref()))) { + mInstallingWorker->SetState(aInstalling.ref().State()); + } + } else { + mInstallingWorker = nullptr; + } +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerRegistration.h b/dom/serviceworkers/ServiceWorkerRegistration.h new file mode 100644 index 0000000000..66598fc6cd --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerRegistration.h @@ -0,0 +1,159 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_ServiceWorkerRegistration_h +#define mozilla_dom_ServiceWorkerRegistration_h + +#include "mozilla/DOMEventTargetHelper.h" +#include "mozilla/dom/ServiceWorkerBinding.h" +#include "mozilla/dom/ServiceWorkerRegistrationBinding.h" +#include "mozilla/dom/ServiceWorkerRegistrationDescriptor.h" +#include "mozilla/dom/ServiceWorkerUtils.h" + +// Support for Notification API extension. +#include "mozilla/dom/NotificationBinding.h" + +class nsIGlobalObject; + +namespace mozilla { +namespace dom { + +class Promise; +class PushManager; +class WorkerPrivate; +class ServiceWorker; + +#define NS_DOM_SERVICEWORKERREGISTRATION_IID \ + { \ + 0x4578a90e, 0xa427, 0x4237, { \ + 0x98, 0x4a, 0xbd, 0x98, 0xe4, 0xcd, 0x5f, 0x3a \ + } \ + } + +class ServiceWorkerRegistration final : public DOMEventTargetHelper { + public: + class Inner { + public: + NS_INLINE_DECL_PURE_VIRTUAL_REFCOUNTING + + virtual void SetServiceWorkerRegistration( + ServiceWorkerRegistration* aReg) = 0; + + virtual void ClearServiceWorkerRegistration( + ServiceWorkerRegistration* aReg) = 0; + + virtual void Update(const nsCString& aNewestWorkerScriptUrl, + ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) = 0; + + virtual void Unregister(ServiceWorkerBoolCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) = 0; + }; + + NS_DECLARE_STATIC_IID_ACCESSOR(NS_DOM_SERVICEWORKERREGISTRATION_IID) + NS_DECL_ISUPPORTS_INHERITED + NS_DECL_CYCLE_COLLECTION_CLASS_INHERITED(ServiceWorkerRegistration, + DOMEventTargetHelper) + + IMPL_EVENT_HANDLER(updatefound) + + static already_AddRefed CreateForMainThread( + nsPIDOMWindowInner* aWindow, + const ServiceWorkerRegistrationDescriptor& aDescriptor); + + static already_AddRefed CreateForWorker( + WorkerPrivate* aWorkerPrivate, nsIGlobalObject* aGlobal, + const ServiceWorkerRegistrationDescriptor& aDescriptor); + + JSObject* WrapObject(JSContext* aCx, + JS::Handle aGivenProto) override; + + void DisconnectFromOwner() override; + + void RegistrationCleared(); + + already_AddRefed GetInstalling() const; + + already_AddRefed GetWaiting() const; + + already_AddRefed GetActive() const; + + void UpdateState(const ServiceWorkerRegistrationDescriptor& aDescriptor); + + bool MatchesDescriptor( + const ServiceWorkerRegistrationDescriptor& aDescriptor) const; + + void GetScope(nsAString& aScope) const; + + ServiceWorkerUpdateViaCache GetUpdateViaCache(ErrorResult& aRv) const; + + already_AddRefed Update(ErrorResult& aRv); + + already_AddRefed Unregister(ErrorResult& aRv); + + already_AddRefed GetPushManager(JSContext* aCx, + ErrorResult& aRv); + + already_AddRefed ShowNotification( + JSContext* aCx, const nsAString& aTitle, + const NotificationOptions& aOptions, ErrorResult& aRv); + + already_AddRefed GetNotifications( + const GetNotificationOptions& aOptions, ErrorResult& aRv); + + const ServiceWorkerRegistrationDescriptor& Descriptor() const; + + void WhenVersionReached(uint64_t aVersion, + ServiceWorkerBoolCallback&& aCallback); + + void MaybeDispatchUpdateFoundRunnable(); + + private: + ServiceWorkerRegistration( + nsIGlobalObject* aGlobal, + const ServiceWorkerRegistrationDescriptor& aDescriptor, Inner* aInner); + + ~ServiceWorkerRegistration(); + + void UpdateStateInternal(const Maybe& aInstalling, + const Maybe& aWaiting, + const Maybe& aActive); + + void MaybeScheduleUpdateFound( + const Maybe& aInstallingDescriptor); + + void MaybeDispatchUpdateFound(); + + ServiceWorkerRegistrationDescriptor mDescriptor; + RefPtr mInner; + + RefPtr mInstallingWorker; + RefPtr mWaitingWorker; + RefPtr mActiveWorker; + RefPtr mPushManager; + + struct VersionCallback { + uint64_t mVersion; + ServiceWorkerBoolCallback mFunc; + + VersionCallback(uint64_t aVersion, ServiceWorkerBoolCallback&& aFunc) + : mVersion(aVersion), mFunc(std::move(aFunc)) { + MOZ_DIAGNOSTIC_ASSERT(mFunc); + } + }; + nsTArray> mVersionCallbackList; + + uint64_t mScheduledUpdateFoundId; + uint64_t mDispatchedUpdateFoundId; +}; + +NS_DEFINE_STATIC_IID_ACCESSOR(ServiceWorkerRegistration, + NS_DOM_SERVICEWORKERREGISTRATION_IID) + +} // namespace dom +} // namespace mozilla + +#endif /* mozilla_dom_ServiceWorkerRegistration_h */ diff --git a/dom/serviceworkers/ServiceWorkerRegistrationChild.cpp b/dom/serviceworkers/ServiceWorkerRegistrationChild.cpp new file mode 100644 index 0000000000..93d702be50 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerRegistrationChild.cpp @@ -0,0 +1,92 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerRegistrationChild.h" + +#include "RemoteServiceWorkerRegistrationImpl.h" +#include "mozilla/dom/WorkerCommon.h" +#include "mozilla/dom/WorkerRef.h" + +namespace mozilla { +namespace dom { + +using mozilla::ipc::IPCResult; + +void ServiceWorkerRegistrationChild::ActorDestroy(ActorDestroyReason aReason) { + mIPCWorkerRef = nullptr; + + if (mOwner) { + mOwner->RevokeActor(this); + MOZ_DIAGNOSTIC_ASSERT(!mOwner); + } +} + +IPCResult ServiceWorkerRegistrationChild::RecvUpdateState( + const IPCServiceWorkerRegistrationDescriptor& aDescriptor) { + if (mOwner) { + mOwner->UpdateState(ServiceWorkerRegistrationDescriptor(aDescriptor)); + } + return IPC_OK(); +} + +IPCResult ServiceWorkerRegistrationChild::RecvFireUpdateFound() { + if (mOwner) { + mOwner->FireUpdateFound(); + } + return IPC_OK(); +} + +// static +RefPtr +ServiceWorkerRegistrationChild::Create() { + RefPtr actor = new ServiceWorkerRegistrationChild; + + if (!NS_IsMainThread()) { + WorkerPrivate* workerPrivate = GetCurrentThreadWorkerPrivate(); + MOZ_DIAGNOSTIC_ASSERT(workerPrivate); + + RefPtr> helper = + new IPCWorkerRefHelper(actor); + + actor->mIPCWorkerRef = IPCWorkerRef::Create( + workerPrivate, "ServiceWorkerRegistrationChild", + [helper] { helper->Actor()->MaybeStartTeardown(); }); + + if (NS_WARN_IF(!actor->mIPCWorkerRef)) { + return nullptr; + } + } + + return actor; +} + +ServiceWorkerRegistrationChild::ServiceWorkerRegistrationChild() + : mOwner(nullptr), mTeardownStarted(false) {} + +void ServiceWorkerRegistrationChild::SetOwner( + RemoteServiceWorkerRegistrationImpl* aOwner) { + MOZ_DIAGNOSTIC_ASSERT(!mOwner); + MOZ_DIAGNOSTIC_ASSERT(aOwner); + mOwner = aOwner; +} + +void ServiceWorkerRegistrationChild::RevokeOwner( + RemoteServiceWorkerRegistrationImpl* aOwner) { + MOZ_DIAGNOSTIC_ASSERT(mOwner); + MOZ_DIAGNOSTIC_ASSERT(aOwner == mOwner); + mOwner = nullptr; +} + +void ServiceWorkerRegistrationChild::MaybeStartTeardown() { + if (mTeardownStarted) { + return; + } + mTeardownStarted = true; + Unused << SendTeardown(); +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerRegistrationChild.h b/dom/serviceworkers/ServiceWorkerRegistrationChild.h new file mode 100644 index 0000000000..681fcdbaa5 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerRegistrationChild.h @@ -0,0 +1,54 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworkerregistrationchild_h__ +#define mozilla_dom_serviceworkerregistrationchild_h__ + +#include "mozilla/dom/PServiceWorkerRegistrationChild.h" + +// XXX Avoid including this here by moving function bodies to the cpp file +#include "mozilla/dom/WorkerRef.h" + +namespace mozilla { +namespace dom { + +class IPCWorkerRef; +class RemoteServiceWorkerRegistrationImpl; + +class ServiceWorkerRegistrationChild final + : public PServiceWorkerRegistrationChild { + RefPtr mIPCWorkerRef; + RemoteServiceWorkerRegistrationImpl* mOwner; + bool mTeardownStarted; + + ServiceWorkerRegistrationChild(); + + ~ServiceWorkerRegistrationChild() = default; + + // PServiceWorkerRegistrationChild + void ActorDestroy(ActorDestroyReason aReason) override; + + mozilla::ipc::IPCResult RecvUpdateState( + const IPCServiceWorkerRegistrationDescriptor& aDescriptor) override; + + mozilla::ipc::IPCResult RecvFireUpdateFound() override; + + public: + NS_INLINE_DECL_REFCOUNTING(ServiceWorkerRegistrationChild, override); + + static RefPtr Create(); + + void SetOwner(RemoteServiceWorkerRegistrationImpl* aOwner); + + void RevokeOwner(RemoteServiceWorkerRegistrationImpl* aOwner); + + void MaybeStartTeardown(); +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_serviceworkerregistrationchild_h__ diff --git a/dom/serviceworkers/ServiceWorkerRegistrationDescriptor.cpp b/dom/serviceworkers/ServiceWorkerRegistrationDescriptor.cpp new file mode 100644 index 0000000000..0cb6ab9179 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerRegistrationDescriptor.cpp @@ -0,0 +1,276 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "mozilla/dom/ServiceWorkerRegistrationDescriptor.h" + +#include "mozilla/dom/IPCServiceWorkerRegistrationDescriptor.h" +#include "mozilla/ipc/PBackgroundSharedTypes.h" +#include "ServiceWorkerInfo.h" + +namespace mozilla { +namespace dom { + +using mozilla::ipc::PrincipalInfo; +using mozilla::ipc::PrincipalInfoToPrincipal; + +Maybe +ServiceWorkerRegistrationDescriptor::NewestInternal() const { + Maybe result; + if (mData->installing().isSome()) { + result.emplace(mData->installing().ref()); + } else if (mData->waiting().isSome()) { + result.emplace(mData->waiting().ref()); + } else if (mData->active().isSome()) { + result.emplace(mData->active().ref()); + } + return result; +} + +ServiceWorkerRegistrationDescriptor::ServiceWorkerRegistrationDescriptor( + uint64_t aId, uint64_t aVersion, nsIPrincipal* aPrincipal, + const nsACString& aScope, ServiceWorkerUpdateViaCache aUpdateViaCache) + : mData(MakeUnique()) { + MOZ_ALWAYS_SUCCEEDS( + PrincipalToPrincipalInfo(aPrincipal, &mData->principalInfo())); + + mData->id() = aId; + mData->version() = aVersion; + mData->scope() = aScope; + mData->updateViaCache() = aUpdateViaCache; + mData->installing() = Nothing(); + mData->waiting() = Nothing(); + mData->active() = Nothing(); +} + +ServiceWorkerRegistrationDescriptor::ServiceWorkerRegistrationDescriptor( + uint64_t aId, uint64_t aVersion, + const mozilla::ipc::PrincipalInfo& aPrincipalInfo, const nsACString& aScope, + ServiceWorkerUpdateViaCache aUpdateViaCache) + : mData(MakeUnique( + aId, aVersion, aPrincipalInfo, nsCString(aScope), aUpdateViaCache, + Nothing(), Nothing(), Nothing())) {} + +ServiceWorkerRegistrationDescriptor::ServiceWorkerRegistrationDescriptor( + const IPCServiceWorkerRegistrationDescriptor& aDescriptor) + : mData(MakeUnique(aDescriptor)) { + MOZ_DIAGNOSTIC_ASSERT(IsValid()); +} + +ServiceWorkerRegistrationDescriptor::ServiceWorkerRegistrationDescriptor( + const ServiceWorkerRegistrationDescriptor& aRight) { + // UniquePtr doesn't have a default copy constructor, so we can't rely + // on default copy construction. Use the assignment operator to + // minimize duplication. + operator=(aRight); +} + +ServiceWorkerRegistrationDescriptor& +ServiceWorkerRegistrationDescriptor::operator=( + const ServiceWorkerRegistrationDescriptor& aRight) { + if (this == &aRight) { + return *this; + } + mData.reset(); + mData = MakeUnique(*aRight.mData); + MOZ_DIAGNOSTIC_ASSERT(IsValid()); + return *this; +} + +ServiceWorkerRegistrationDescriptor::ServiceWorkerRegistrationDescriptor( + ServiceWorkerRegistrationDescriptor&& aRight) + : mData(std::move(aRight.mData)) { + MOZ_DIAGNOSTIC_ASSERT(IsValid()); +} + +ServiceWorkerRegistrationDescriptor& +ServiceWorkerRegistrationDescriptor::operator=( + ServiceWorkerRegistrationDescriptor&& aRight) { + mData.reset(); + mData = std::move(aRight.mData); + MOZ_DIAGNOSTIC_ASSERT(IsValid()); + return *this; +} + +ServiceWorkerRegistrationDescriptor::~ServiceWorkerRegistrationDescriptor() { + // Non-default destructor to avoid exposing the IPC type in the header. +} + +bool ServiceWorkerRegistrationDescriptor::operator==( + const ServiceWorkerRegistrationDescriptor& aRight) const { + return *mData == *aRight.mData; +} + +uint64_t ServiceWorkerRegistrationDescriptor::Id() const { return mData->id(); } + +uint64_t ServiceWorkerRegistrationDescriptor::Version() const { + return mData->version(); +} + +ServiceWorkerUpdateViaCache +ServiceWorkerRegistrationDescriptor::UpdateViaCache() const { + return mData->updateViaCache(); +} + +const mozilla::ipc::PrincipalInfo& +ServiceWorkerRegistrationDescriptor::PrincipalInfo() const { + return mData->principalInfo(); +} + +Result, nsresult> +ServiceWorkerRegistrationDescriptor::GetPrincipal() const { + AssertIsOnMainThread(); + return PrincipalInfoToPrincipal(mData->principalInfo()); +} + +const nsCString& ServiceWorkerRegistrationDescriptor::Scope() const { + return mData->scope(); +} + +Maybe +ServiceWorkerRegistrationDescriptor::GetInstalling() const { + Maybe result; + + if (mData->installing().isSome()) { + result.emplace(ServiceWorkerDescriptor(mData->installing().ref())); + } + + return result; +} + +Maybe ServiceWorkerRegistrationDescriptor::GetWaiting() + const { + Maybe result; + + if (mData->waiting().isSome()) { + result.emplace(ServiceWorkerDescriptor(mData->waiting().ref())); + } + + return result; +} + +Maybe ServiceWorkerRegistrationDescriptor::GetActive() + const { + Maybe result; + + if (mData->active().isSome()) { + result.emplace(ServiceWorkerDescriptor(mData->active().ref())); + } + + return result; +} + +Maybe ServiceWorkerRegistrationDescriptor::Newest() + const { + Maybe result; + Maybe newest(NewestInternal()); + if (newest.isSome()) { + result.emplace(ServiceWorkerDescriptor(newest.ref())); + } + return result; +} + +bool ServiceWorkerRegistrationDescriptor::HasWorker( + const ServiceWorkerDescriptor& aDescriptor) const { + Maybe installing = GetInstalling(); + Maybe waiting = GetWaiting(); + Maybe active = GetActive(); + return (installing.isSome() && installing.ref().Matches(aDescriptor)) || + (waiting.isSome() && waiting.ref().Matches(aDescriptor)) || + (active.isSome() && active.ref().Matches(aDescriptor)); +} + +namespace { + +bool IsValidWorker( + const Maybe& aWorker, const nsACString& aScope, + const mozilla::ipc::ContentPrincipalInfo& aContentPrincipal) { + if (aWorker.isNothing()) { + return true; + } + + auto& worker = aWorker.ref(); + if (worker.scope() != aScope) { + return false; + } + + auto& principalInfo = worker.principalInfo(); + if (principalInfo.type() != + mozilla::ipc::PrincipalInfo::TContentPrincipalInfo) { + return false; + } + + auto& contentPrincipal = principalInfo.get_ContentPrincipalInfo(); + if (contentPrincipal.originNoSuffix() != aContentPrincipal.originNoSuffix() || + contentPrincipal.attrs() != aContentPrincipal.attrs()) { + return false; + } + + return true; +} + +} // anonymous namespace + +bool ServiceWorkerRegistrationDescriptor::IsValid() const { + auto& principalInfo = PrincipalInfo(); + if (principalInfo.type() != + mozilla::ipc::PrincipalInfo::TContentPrincipalInfo) { + return false; + } + + auto& contentPrincipal = principalInfo.get_ContentPrincipalInfo(); + if (!IsValidWorker(mData->installing(), Scope(), contentPrincipal) || + !IsValidWorker(mData->waiting(), Scope(), contentPrincipal) || + !IsValidWorker(mData->active(), Scope(), contentPrincipal)) { + return false; + } + + return true; +} + +void ServiceWorkerRegistrationDescriptor::SetUpdateViaCache( + ServiceWorkerUpdateViaCache aUpdateViaCache) { + mData->updateViaCache() = aUpdateViaCache; +} + +void ServiceWorkerRegistrationDescriptor::SetWorkers( + ServiceWorkerInfo* aInstalling, ServiceWorkerInfo* aWaiting, + ServiceWorkerInfo* aActive) { + if (aInstalling) { + aInstalling->SetRegistrationVersion(Version()); + mData->installing() = Some(aInstalling->Descriptor().ToIPC()); + } else { + mData->installing() = Nothing(); + } + + if (aWaiting) { + aWaiting->SetRegistrationVersion(Version()); + mData->waiting() = Some(aWaiting->Descriptor().ToIPC()); + } else { + mData->waiting() = Nothing(); + } + + if (aActive) { + aActive->SetRegistrationVersion(Version()); + mData->active() = Some(aActive->Descriptor().ToIPC()); + } else { + mData->active() = Nothing(); + } + + MOZ_DIAGNOSTIC_ASSERT(IsValid()); +} + +void ServiceWorkerRegistrationDescriptor::SetVersion(uint64_t aVersion) { + MOZ_DIAGNOSTIC_ASSERT(aVersion > mData->version()); + mData->version() = aVersion; +} + +const IPCServiceWorkerRegistrationDescriptor& +ServiceWorkerRegistrationDescriptor::ToIPC() const { + return *mData; +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerRegistrationDescriptor.h b/dom/serviceworkers/ServiceWorkerRegistrationDescriptor.h new file mode 100644 index 0000000000..ec0f969868 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerRegistrationDescriptor.h @@ -0,0 +1,103 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ +#ifndef _mozilla_dom_ServiceWorkerRegistrationDescriptor_h +#define _mozilla_dom_ServiceWorkerRegistrationDescriptor_h + +#include "mozilla/Maybe.h" +#include "mozilla/dom/ServiceWorkerDescriptor.h" +#include "mozilla/UniquePtr.h" + +namespace mozilla { + +namespace ipc { +class PrincipalInfo; +} // namespace ipc + +namespace dom { + +class IPCServiceWorkerRegistrationDescriptor; +class ServiceWorkerInfo; +enum class ServiceWorkerUpdateViaCache : uint8_t; + +// This class represents a snapshot of a particular +// ServiceWorkerRegistrationInfo object. It is threadsafe and can be +// transferred across processes. +class ServiceWorkerRegistrationDescriptor final { + // This class is largely a wrapper wround an IPDL generated struct. We + // need the wrapper class since IPDL generated code includes windows.h + // which is in turn incompatible with bindings code. + UniquePtr mData; + + Maybe NewestInternal() const; + + public: + ServiceWorkerRegistrationDescriptor( + uint64_t aId, uint64_t aVersion, nsIPrincipal* aPrincipal, + const nsACString& aScope, ServiceWorkerUpdateViaCache aUpdateViaCache); + + ServiceWorkerRegistrationDescriptor( + uint64_t aId, uint64_t aVersion, + const mozilla::ipc::PrincipalInfo& aPrincipalInfo, + const nsACString& aScope, ServiceWorkerUpdateViaCache aUpdateViaCache); + + explicit ServiceWorkerRegistrationDescriptor( + const IPCServiceWorkerRegistrationDescriptor& aDescriptor); + + ServiceWorkerRegistrationDescriptor( + const ServiceWorkerRegistrationDescriptor& aRight); + + ServiceWorkerRegistrationDescriptor& operator=( + const ServiceWorkerRegistrationDescriptor& aRight); + + ServiceWorkerRegistrationDescriptor( + ServiceWorkerRegistrationDescriptor&& aRight); + + ServiceWorkerRegistrationDescriptor& operator=( + ServiceWorkerRegistrationDescriptor&& aRight); + + ~ServiceWorkerRegistrationDescriptor(); + + bool operator==(const ServiceWorkerRegistrationDescriptor& aRight) const; + + uint64_t Id() const; + + uint64_t Version() const; + + ServiceWorkerUpdateViaCache UpdateViaCache() const; + + const mozilla::ipc::PrincipalInfo& PrincipalInfo() const; + + Result, nsresult> GetPrincipal() const; + + const nsCString& Scope() const; + + Maybe GetInstalling() const; + + Maybe GetWaiting() const; + + Maybe GetActive() const; + + Maybe Newest() const; + + bool HasWorker(const ServiceWorkerDescriptor& aDescriptor) const; + + bool IsValid() const; + + void SetUpdateViaCache(ServiceWorkerUpdateViaCache aUpdateViaCache); + + void SetWorkers(ServiceWorkerInfo* aInstalling, ServiceWorkerInfo* aWaiting, + ServiceWorkerInfo* aActive); + + void SetVersion(uint64_t aVersion); + + // Expose the underlying IPC type so that it can be passed via IPC. + const IPCServiceWorkerRegistrationDescriptor& ToIPC() const; +}; + +} // namespace dom +} // namespace mozilla + +#endif // _mozilla_dom_ServiceWorkerRegistrationDescriptor_h diff --git a/dom/serviceworkers/ServiceWorkerRegistrationImpl.cpp b/dom/serviceworkers/ServiceWorkerRegistrationImpl.cpp new file mode 100644 index 0000000000..c0e2fa3417 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerRegistrationImpl.cpp @@ -0,0 +1,982 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerRegistrationImpl.h" + +#include "ipc/ErrorIPCUtils.h" +#include "mozilla/dom/DOMMozPromiseRequestHolder.h" +#include "mozilla/dom/Promise.h" +#include "mozilla/dom/PromiseWorkerProxy.h" +#include "mozilla/dom/PushManagerBinding.h" +#include "mozilla/dom/PushManager.h" +#include "mozilla/dom/ServiceWorkerRegistrationBinding.h" +#include "mozilla/dom/WorkerCommon.h" +#include "mozilla/dom/WorkerPrivate.h" +#include "mozilla/dom/WorkerRef.h" +#include "mozilla/dom/WorkerRunnable.h" +#include "mozilla/dom/WorkerScope.h" +#include "mozilla/Services.h" +#include "mozilla/Unused.h" +#include "nsCycleCollectionParticipant.h" +#include "nsIPrincipal.h" +#include "nsNetUtil.h" +#include "nsServiceManagerUtils.h" +#include "ServiceWorker.h" +#include "ServiceWorkerManager.h" +#include "ServiceWorkerPrivate.h" +#include "ServiceWorkerRegistration.h" +#include "ServiceWorkerUnregisterCallback.h" + +#include "mozilla/dom/Document.h" +#include "nsIServiceWorkerManager.h" +#include "nsPIDOMWindow.h" +#include "nsContentUtils.h" + +namespace mozilla { +namespace dom { + +//////////////////////////////////////////////////// +// Main Thread implementation + +ServiceWorkerRegistrationMainThread::ServiceWorkerRegistrationMainThread( + const ServiceWorkerRegistrationDescriptor& aDescriptor) + : mOuter(nullptr), + mDescriptor(aDescriptor), + mScope(NS_ConvertUTF8toUTF16(aDescriptor.Scope())), + mListeningForEvents(false) { + MOZ_ASSERT(NS_IsMainThread()); +} + +ServiceWorkerRegistrationMainThread::~ServiceWorkerRegistrationMainThread() { + MOZ_DIAGNOSTIC_ASSERT(!mListeningForEvents); + MOZ_DIAGNOSTIC_ASSERT(!mOuter); +} + +// XXXnsm, maybe this can be optimized to only add when a event handler is +// registered. +void ServiceWorkerRegistrationMainThread::StartListeningForEvents() { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(!mListeningForEvents); + MOZ_DIAGNOSTIC_ASSERT(!mInfo); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + NS_ENSURE_TRUE_VOID(swm); + + mInfo = + swm->GetRegistration(mDescriptor.PrincipalInfo(), mDescriptor.Scope()); + NS_ENSURE_TRUE_VOID(mInfo); + + mInfo->AddInstance(this, mDescriptor); + mListeningForEvents = true; +} + +void ServiceWorkerRegistrationMainThread::StopListeningForEvents() { + MOZ_ASSERT(NS_IsMainThread()); + if (!mListeningForEvents) { + return; + } + + MOZ_DIAGNOSTIC_ASSERT(mInfo); + mInfo->RemoveInstance(this); + mInfo = nullptr; + + mListeningForEvents = false; +} + +void ServiceWorkerRegistrationMainThread::RegistrationClearedInternal() { + MOZ_ASSERT(NS_IsMainThread()); + // Its possible for the binding object to be collected while we the + // runnable to call this method is in the event queue. Double check + // whether there is still anything to do here. + if (mOuter) { + mOuter->RegistrationCleared(); + } + StopListeningForEvents(); +} + +// NB: These functions use NS_ENSURE_TRUE_VOID to be noisy about preconditions +// that would otherwise cause things to silently not happen if they were false. +void ServiceWorkerRegistrationMainThread::UpdateState( + const ServiceWorkerRegistrationDescriptor& aDescriptor) { + NS_ENSURE_TRUE_VOID(mOuter); + + nsIGlobalObject* global = mOuter->GetParentObject(); + NS_ENSURE_TRUE_VOID(global); + + RefPtr self = this; + nsCOMPtr r = + NS_NewRunnableFunction("ServiceWorkerRegistrationMainThread::UpdateState", + [self, desc = std::move(aDescriptor)]() mutable { + self->mDescriptor = std::move(desc); + NS_ENSURE_TRUE_VOID(self->mOuter); + self->mOuter->UpdateState(self->mDescriptor); + }); + + Unused << global->EventTargetFor(TaskCategory::Other) + ->Dispatch(r.forget(), NS_DISPATCH_NORMAL); +} + +void ServiceWorkerRegistrationMainThread::FireUpdateFound() { + NS_ENSURE_TRUE_VOID(mOuter); + + nsIGlobalObject* global = mOuter->GetParentObject(); + NS_ENSURE_TRUE_VOID(global); + + RefPtr self = this; + nsCOMPtr r = NS_NewRunnableFunction( + "ServiceWorkerRegistrationMainThread::FireUpdateFound", [self]() mutable { + NS_ENSURE_TRUE_VOID(self->mOuter); + self->mOuter->MaybeDispatchUpdateFoundRunnable(); + }); + + Unused << global->EventTargetFor(TaskCategory::Other) + ->Dispatch(r.forget(), NS_DISPATCH_NORMAL); +} + +void ServiceWorkerRegistrationMainThread::RegistrationCleared() { + NS_ENSURE_TRUE_VOID(mOuter); + + nsIGlobalObject* global = mOuter->GetParentObject(); + NS_ENSURE_TRUE_VOID(global); + + // Queue a runnable to clean up the registration. This is necessary + // because there may be runnables in the event queue already to + // update the registration state. We want to let those run + // if possible before clearing our mOuter reference. + nsCOMPtr r = NewRunnableMethod( + "ServiceWorkerRegistrationMainThread::RegistrationCleared", this, + &ServiceWorkerRegistrationMainThread::RegistrationClearedInternal); + + Unused << global->EventTargetFor(TaskCategory::Other) + ->Dispatch(r.forget(), NS_DISPATCH_NORMAL); +} + +bool ServiceWorkerRegistrationMainThread::MatchesDescriptor( + const ServiceWorkerRegistrationDescriptor& aDescriptor) { + return mOuter->MatchesDescriptor(aDescriptor); +} + +void ServiceWorkerRegistrationMainThread::SetServiceWorkerRegistration( + ServiceWorkerRegistration* aReg) { + MOZ_DIAGNOSTIC_ASSERT(aReg); + MOZ_DIAGNOSTIC_ASSERT(!mOuter); + mOuter = aReg; + StartListeningForEvents(); +} + +void ServiceWorkerRegistrationMainThread::ClearServiceWorkerRegistration( + ServiceWorkerRegistration* aReg) { + MOZ_ASSERT_IF(mOuter, mOuter == aReg); + StopListeningForEvents(); + mOuter = nullptr; +} + +namespace { + +void UpdateInternal(nsIPrincipal* aPrincipal, const nsACString& aScope, + nsCString aNewestWorkerScriptUrl, + ServiceWorkerUpdateFinishCallback* aCallback) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aPrincipal); + MOZ_ASSERT(aCallback); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (!swm) { + // browser shutdown + return; + } + + swm->Update(aPrincipal, aScope, std::move(aNewestWorkerScriptUrl), aCallback); +} + +class MainThreadUpdateCallback final + : public ServiceWorkerUpdateFinishCallback { + RefPtr mPromise; + + ~MainThreadUpdateCallback() { + mPromise->Reject(NS_ERROR_DOM_ABORT_ERR, __func__); + } + + public: + MainThreadUpdateCallback() + : mPromise(new ServiceWorkerRegistrationPromise::Private(__func__)) {} + + void UpdateSucceeded(ServiceWorkerRegistrationInfo* aRegistration) override { + mPromise->Resolve(aRegistration->Descriptor(), __func__); + } + + void UpdateFailed(ErrorResult& aStatus) override { + mPromise->Reject(std::move(aStatus), __func__); + } + + RefPtr Promise() const { return mPromise; } +}; + +class WorkerThreadUpdateCallback final + : public ServiceWorkerUpdateFinishCallback { + RefPtr mWorkerRef; + RefPtr mPromise; + + ~WorkerThreadUpdateCallback() = default; + + public: + WorkerThreadUpdateCallback( + RefPtr&& aWorkerRef, + ServiceWorkerRegistrationPromise::Private* aPromise) + : mWorkerRef(std::move(aWorkerRef)), mPromise(aPromise) { + MOZ_ASSERT(NS_IsMainThread()); + } + + void UpdateSucceeded(ServiceWorkerRegistrationInfo* aRegistration) override { + mPromise->Resolve(aRegistration->Descriptor(), __func__); + mWorkerRef = nullptr; + } + + void UpdateFailed(ErrorResult& aStatus) override { + mPromise->Reject(std::move(aStatus), __func__); + mWorkerRef = nullptr; + } +}; + +class SWRUpdateRunnable final : public Runnable { + class TimerCallback final : public nsITimerCallback { + RefPtr mPrivate; + RefPtr mRunnable; + + public: + TimerCallback(ServiceWorkerPrivate* aPrivate, Runnable* aRunnable) + : mPrivate(aPrivate), mRunnable(aRunnable) { + MOZ_ASSERT(mPrivate); + MOZ_ASSERT(aRunnable); + } + + NS_IMETHOD + Notify(nsITimer* aTimer) override { + mRunnable->Run(); + mPrivate->RemoveISupports(aTimer); + + return NS_OK; + } + + NS_DECL_THREADSAFE_ISUPPORTS + + private: + ~TimerCallback() = default; + }; + + public: + SWRUpdateRunnable(StrongWorkerRef* aWorkerRef, + ServiceWorkerRegistrationPromise::Private* aPromise, + const ServiceWorkerDescriptor& aDescriptor, + const nsCString& aNewestWorkerScriptUrl) + : Runnable("dom::SWRUpdateRunnable"), + mMutex("SWRUpdateRunnable"), + mWorkerRef(new ThreadSafeWorkerRef(aWorkerRef)), + mPromise(aPromise), + mDescriptor(aDescriptor), + mDelayed(false), + mNewestWorkerScriptUrl(aNewestWorkerScriptUrl) { + MOZ_DIAGNOSTIC_ASSERT(mWorkerRef); + MOZ_DIAGNOSTIC_ASSERT(mPromise); + } + + NS_IMETHOD + Run() override { + MOZ_ASSERT(NS_IsMainThread()); + ErrorResult result; + + auto principalOrErr = mDescriptor.GetPrincipal(); + if (NS_WARN_IF(principalOrErr.isErr())) { + mPromise->Reject(NS_ERROR_DOM_INVALID_STATE_ERR, __func__); + return NS_OK; + } + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (NS_WARN_IF(!swm)) { + mPromise->Reject(NS_ERROR_DOM_INVALID_STATE_ERR, __func__); + return NS_OK; + } + + nsCOMPtr principal = principalOrErr.unwrap(); + + // This will delay update jobs originating from a service worker thread. + // We don't currently handle ServiceWorkerRegistration.update() from other + // worker types. Also, we assume this registration matches self.registration + // on the service worker global. This is ok for now because service worker + // globals are the only worker contexts where we expose + // ServiceWorkerRegistration. + RefPtr registration = + swm->GetRegistration(principal, mDescriptor.Scope()); + if (NS_WARN_IF(!registration)) { + return NS_OK; + } + + RefPtr worker = + registration->GetByDescriptor(mDescriptor); + uint32_t delay = registration->GetUpdateDelay(); + + // if we have a timer object, it means we've already been delayed once. + if (delay && !mDelayed) { + nsCOMPtr cb = + new TimerCallback(worker->WorkerPrivate(), this); + Result, nsresult> result = + NS_NewTimerWithCallback(cb, delay, nsITimer::TYPE_ONE_SHOT); + + nsCOMPtr timer = result.unwrapOr(nullptr); + if (NS_WARN_IF(!timer)) { + return NS_OK; + } + + mDelayed = true; + + // We're storing the timer object on the calling service worker's private. + // ServiceWorkerPrivate will drop the reference if the worker terminates, + // which will cancel the timer. + if (!worker->WorkerPrivate()->MaybeStoreISupports(timer)) { + // The worker thread is already shutting down. Just cancel the timer + // and let the update runnable be destroyed. + timer->Cancel(); + return NS_OK; + } + + return NS_OK; + } + + RefPtr promise; + { + MutexAutoLock lock(mMutex); + promise.swap(mPromise); + } + + RefPtr cb = + new WorkerThreadUpdateCallback(std::move(mWorkerRef), promise); + UpdateInternal(principal, mDescriptor.Scope(), + std::move(mNewestWorkerScriptUrl), cb); + + return NS_OK; + } + + private: + ~SWRUpdateRunnable() { + MutexAutoLock lock(mMutex); + if (mPromise) { + mPromise->Reject(NS_ERROR_DOM_INVALID_STATE_ERR, __func__); + } + } + + // Protects promise access across threads + Mutex mMutex; + + RefPtr mWorkerRef; + RefPtr mPromise; + const ServiceWorkerDescriptor mDescriptor; + bool mDelayed; + nsCString mNewestWorkerScriptUrl; +}; + +NS_IMPL_ISUPPORTS(SWRUpdateRunnable::TimerCallback, nsITimerCallback) + +class WorkerUnregisterCallback final + : public nsIServiceWorkerUnregisterCallback { + RefPtr mWorkerRef; + RefPtr mPromise; + + public: + NS_DECL_ISUPPORTS + + WorkerUnregisterCallback(RefPtr&& aWorkerRef, + RefPtr&& aPromise) + : mWorkerRef(std::move(aWorkerRef)), mPromise(std::move(aPromise)) { + MOZ_DIAGNOSTIC_ASSERT(mWorkerRef); + MOZ_DIAGNOSTIC_ASSERT(mPromise); + } + + NS_IMETHOD + UnregisterSucceeded(bool aState) override { + mPromise->Resolve(aState, __func__); + mWorkerRef = nullptr; + return NS_OK; + } + + NS_IMETHOD + UnregisterFailed() override { + mPromise->Reject(NS_ERROR_DOM_SECURITY_ERR, __func__); + mWorkerRef = nullptr; + return NS_OK; + } + + private: + ~WorkerUnregisterCallback() = default; +}; + +NS_IMPL_ISUPPORTS(WorkerUnregisterCallback, nsIServiceWorkerUnregisterCallback); + +/* + * If the worker goes away, we still continue to unregister, but we don't try to + * resolve the worker Promise (which doesn't exist by that point). + */ +class StartUnregisterRunnable final : public Runnable { + // The promise is protected by the mutex. + Mutex mMutex; + + RefPtr mWorkerRef; + RefPtr mPromise; + const ServiceWorkerRegistrationDescriptor mDescriptor; + + ~StartUnregisterRunnable() { + MutexAutoLock lock(mMutex); + if (mPromise) { + mPromise->Reject(NS_ERROR_DOM_INVALID_STATE_ERR, __func__); + } + } + + public: + StartUnregisterRunnable( + StrongWorkerRef* aWorkerRef, GenericPromise::Private* aPromise, + const ServiceWorkerRegistrationDescriptor& aDescriptor) + : Runnable("dom::StartUnregisterRunnable"), + mMutex("StartUnregisterRunnable"), + mWorkerRef(new ThreadSafeWorkerRef(aWorkerRef)), + mPromise(aPromise), + mDescriptor(aDescriptor) { + MOZ_DIAGNOSTIC_ASSERT(mWorkerRef); + MOZ_DIAGNOSTIC_ASSERT(mPromise); + } + + NS_IMETHOD + Run() override { + MOZ_ASSERT(NS_IsMainThread()); + + auto principalOrErr = mDescriptor.GetPrincipal(); + if (NS_WARN_IF(principalOrErr.isErr())) { + mPromise->Reject(NS_ERROR_DOM_INVALID_STATE_ERR, __func__); + return NS_OK; + } + + nsCOMPtr principal = principalOrErr.unwrap(); + + nsCOMPtr swm = + mozilla::services::GetServiceWorkerManager(); + if (!swm) { + mPromise->Reject(NS_ERROR_DOM_INVALID_STATE_ERR, __func__); + return NS_OK; + } + + RefPtr promise; + { + MutexAutoLock lock(mMutex); + promise = std::move(mPromise); + } + + RefPtr cb = + new WorkerUnregisterCallback(std::move(mWorkerRef), std::move(promise)); + + nsresult rv = swm->Unregister(principal, cb, + NS_ConvertUTF8toUTF16(mDescriptor.Scope())); + if (NS_WARN_IF(NS_FAILED(rv))) { + mPromise->Reject(rv, __func__); + return NS_OK; + } + + return NS_OK; + } +}; + +} // namespace + +void ServiceWorkerRegistrationMainThread::Update( + const nsCString& aNewestWorkerScriptUrl, + ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_DIAGNOSTIC_ASSERT(mOuter); + + nsIGlobalObject* global = mOuter->GetParentObject(); + if (!global) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + auto principalOrErr = mDescriptor.GetPrincipal(); + if (NS_WARN_IF(principalOrErr.isErr())) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + nsCOMPtr principal = principalOrErr.unwrap(); + + RefPtr cb = new MainThreadUpdateCallback(); + UpdateInternal(principal, NS_ConvertUTF16toUTF8(mScope), + aNewestWorkerScriptUrl, cb); + + auto holder = + MakeRefPtr>( + global); + + cb->Promise() + ->Then( + global->EventTargetFor(TaskCategory::Other), __func__, + [successCB = std::move(aSuccessCB), + holder](const ServiceWorkerRegistrationDescriptor& aDescriptor) { + holder->Complete(); + successCB(aDescriptor); + }, + [failureCB = std::move(aFailureCB), + holder](const CopyableErrorResult& aRv) { + holder->Complete(); + failureCB(CopyableErrorResult(aRv)); + }) + ->Track(*holder); +} + +void ServiceWorkerRegistrationMainThread::Unregister( + ServiceWorkerBoolCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_DIAGNOSTIC_ASSERT(mOuter); + + nsIGlobalObject* global = mOuter->GetParentObject(); + if (!global) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + nsCOMPtr swm = + mozilla::services::GetServiceWorkerManager(); + if (!swm) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + auto principalOrErr = mDescriptor.GetPrincipal(); + if (NS_WARN_IF(principalOrErr.isErr())) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + nsCOMPtr principal = principalOrErr.unwrap(); + + RefPtr cb = new UnregisterCallback(); + + nsresult rv = swm->Unregister(principal, cb, + NS_ConvertUTF8toUTF16(mDescriptor.Scope())); + if (NS_FAILED(rv)) { + aFailureCB(CopyableErrorResult(rv)); + return; + } + + auto holder = MakeRefPtr>(global); + + cb->Promise() + ->Then( + global->EventTargetFor(TaskCategory::Other), __func__, + [successCB = std::move(aSuccessCB), holder](bool aResult) { + holder->Complete(); + successCB(aResult); + }, + [failureCB = std::move(aFailureCB), holder](nsresult aRv) { + holder->Complete(); + failureCB(CopyableErrorResult(aRv)); + }) + ->Track(*holder); +} + +//////////////////////////////////////////////////// +// Worker Thread implementation + +class WorkerListener final : public ServiceWorkerRegistrationListener { + ServiceWorkerRegistrationDescriptor mDescriptor; + nsMainThreadPtrHandle mInfo; + nsCOMPtr mEventTarget; + bool mListeningForEvents; + + // Set and unset on worker thread, used on main-thread and protected by mutex. + ServiceWorkerRegistrationWorkerThread* mRegistration; + + Mutex mMutex; + + public: + NS_INLINE_DECL_THREADSAFE_REFCOUNTING(WorkerListener, override) + + WorkerListener(ServiceWorkerRegistrationWorkerThread* aReg, + const ServiceWorkerRegistrationDescriptor& aDescriptor, + nsISerialEventTarget* aEventTarget) + : mDescriptor(aDescriptor), + mEventTarget(aEventTarget), + mListeningForEvents(false), + mRegistration(aReg), + mMutex("WorkerListener::mMutex") { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + MOZ_ASSERT(mEventTarget); + MOZ_ASSERT(mRegistration); + } + + void StartListeningForEvents() { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_DIAGNOSTIC_ASSERT(!mListeningForEvents); + MOZ_DIAGNOSTIC_ASSERT(!mInfo); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + NS_ENSURE_TRUE_VOID(swm); + + RefPtr info = + swm->GetRegistration(mDescriptor.PrincipalInfo(), mDescriptor.Scope()); + NS_ENSURE_TRUE_VOID(info); + + mInfo = new nsMainThreadPtrHolder( + "WorkerListener::mInfo", info); + + mInfo->AddInstance(this, mDescriptor); + mListeningForEvents = true; + } + + void StopListeningForEvents() { + MOZ_ASSERT(NS_IsMainThread()); + + if (!mListeningForEvents) { + return; + } + + MOZ_DIAGNOSTIC_ASSERT(mInfo); + mInfo->RemoveInstance(this); + mListeningForEvents = false; + } + + // ServiceWorkerRegistrationListener + void UpdateState( + const ServiceWorkerRegistrationDescriptor& aDescriptor) override { + MOZ_ASSERT(NS_IsMainThread()); + + mDescriptor = aDescriptor; + + nsCOMPtr r = + NewCancelableRunnableMethod( + "WorkerListener::UpdateState", this, + &WorkerListener::UpdateStateOnWorkerThread, aDescriptor); + + Unused << mEventTarget->Dispatch(r.forget(), NS_DISPATCH_NORMAL); + } + + void FireUpdateFound() override { + MOZ_ASSERT(NS_IsMainThread()); + + nsCOMPtr r = NewCancelableRunnableMethod( + "WorkerListener::FireUpdateFound", this, + &WorkerListener::FireUpdateFoundOnWorkerThread); + + Unused << mEventTarget->Dispatch(r.forget(), NS_DISPATCH_NORMAL); + } + + void UpdateStateOnWorkerThread( + const ServiceWorkerRegistrationDescriptor& aDescriptor) { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + if (mRegistration) { + mRegistration->UpdateState(aDescriptor); + } + } + + void FireUpdateFoundOnWorkerThread() { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + if (mRegistration) { + mRegistration->FireUpdateFound(); + } + } + + void RegistrationCleared() override; + + void GetScope(nsAString& aScope) const override { + CopyUTF8toUTF16(mDescriptor.Scope(), aScope); + } + + bool MatchesDescriptor( + const ServiceWorkerRegistrationDescriptor& aDescriptor) override { + // TODO: Not implemented + return false; + } + + void ClearRegistration() { + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + MutexAutoLock lock(mMutex); + mRegistration = nullptr; + } + + private: + ~WorkerListener() { MOZ_ASSERT(!mListeningForEvents); } +}; + +ServiceWorkerRegistrationWorkerThread::ServiceWorkerRegistrationWorkerThread( + const ServiceWorkerRegistrationDescriptor& aDescriptor) + : mOuter(nullptr), + mDescriptor(aDescriptor), + mScope(NS_ConvertUTF8toUTF16(aDescriptor.Scope())) {} + +ServiceWorkerRegistrationWorkerThread:: + ~ServiceWorkerRegistrationWorkerThread() { + MOZ_DIAGNOSTIC_ASSERT(!mListener); + MOZ_DIAGNOSTIC_ASSERT(!mOuter); +} + +void ServiceWorkerRegistrationWorkerThread::RegistrationCleared() { + // The SWM notifying us that the registration was removed on the MT may + // race with ClearServiceWorkerRegistration() on the worker thread. So + // double-check that mOuter is still valid. + if (mOuter) { + mOuter->RegistrationCleared(); + } +} + +void ServiceWorkerRegistrationWorkerThread::SetServiceWorkerRegistration( + ServiceWorkerRegistration* aReg) { + MOZ_DIAGNOSTIC_ASSERT(aReg); + MOZ_DIAGNOSTIC_ASSERT(!mOuter); + mOuter = aReg; + InitListener(); +} + +void ServiceWorkerRegistrationWorkerThread::ClearServiceWorkerRegistration( + ServiceWorkerRegistration* aReg) { + MOZ_ASSERT_IF(mOuter, mOuter == aReg); + ReleaseListener(); + mOuter = nullptr; +} + +void ServiceWorkerRegistrationWorkerThread::Update( + const nsCString& aNewestWorkerScriptUrl, + ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) { + if (NS_WARN_IF(!mWorkerRef->GetPrivate())) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + RefPtr workerRef = StrongWorkerRef::Create( + mWorkerRef->GetPrivate(), "ServiceWorkerRegistration::Update"); + if (NS_WARN_IF(!workerRef)) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + nsIGlobalObject* global = workerRef->Private()->GlobalScope(); + if (NS_WARN_IF(!global)) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + // Eventually we need to support all workers, but for right now this + // code assumes we're on a service worker global as self.registration. + if (NS_WARN_IF(!workerRef->Private()->IsServiceWorker())) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + // Avoid infinite update loops by ignoring update() calls during top + // level script evaluation. See: + // https://github.com/slightlyoff/ServiceWorker/issues/800 + if (workerRef->Private()->IsLoadingWorkerScript()) { + aSuccessCB(mDescriptor); + return; + } + + auto promise = + MakeRefPtr(__func__); + auto holder = + MakeRefPtr>( + global); + + promise + ->Then( + global->EventTargetFor(TaskCategory::Other), __func__, + [successCB = std::move(aSuccessCB), + holder](const ServiceWorkerRegistrationDescriptor& aDescriptor) { + holder->Complete(); + successCB(aDescriptor); + }, + [failureCB = std::move(aFailureCB), + holder](const CopyableErrorResult& aRv) { + holder->Complete(); + failureCB(CopyableErrorResult(aRv)); + }) + ->Track(*holder); + + RefPtr r = new SWRUpdateRunnable( + workerRef, promise, workerRef->Private()->GetServiceWorkerDescriptor(), + aNewestWorkerScriptUrl); + + nsresult rv = workerRef->Private()->DispatchToMainThread(r.forget()); + if (NS_FAILED(rv)) { + promise->Reject(NS_ERROR_DOM_INVALID_STATE_ERR, __func__); + return; + } +} + +void ServiceWorkerRegistrationWorkerThread::Unregister( + ServiceWorkerBoolCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) { + if (NS_WARN_IF(!mWorkerRef->GetPrivate())) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + RefPtr workerRef = + StrongWorkerRef::Create(mWorkerRef->GetPrivate(), __func__); + if (NS_WARN_IF(!workerRef)) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + // Eventually we need to support all workers, but for right now this + // code assumes we're on a service worker global as self.registration. + if (NS_WARN_IF(!workerRef->Private()->IsServiceWorker())) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + nsIGlobalObject* global = workerRef->Private()->GlobalScope(); + if (!global) { + aFailureCB(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return; + } + + auto promise = MakeRefPtr(__func__); + auto holder = MakeRefPtr>(global); + + promise + ->Then( + global->EventTargetFor(TaskCategory::Other), __func__, + [successCB = std::move(aSuccessCB), holder](bool aResult) { + holder->Complete(); + successCB(aResult); + }, + [failureCB = std::move(aFailureCB), holder](nsresult aRv) { + holder->Complete(); + failureCB(CopyableErrorResult(aRv)); + }) + ->Track(*holder); + + RefPtr r = + new StartUnregisterRunnable(workerRef, promise, mDescriptor); + + nsresult rv = workerRef->Private()->DispatchToMainThread(r); + if (NS_FAILED(rv)) { + promise->Reject(NS_ERROR_DOM_INVALID_STATE_ERR, __func__); + return; + } +} + +void ServiceWorkerRegistrationWorkerThread::InitListener() { + MOZ_ASSERT(!mListener); + WorkerPrivate* worker = GetCurrentThreadWorkerPrivate(); + MOZ_ASSERT(worker); + worker->AssertIsOnWorkerThread(); + + RefPtr self = this; + mWorkerRef = WeakWorkerRef::Create(worker, [self]() { + self->ReleaseListener(); + + // Break the ref-cycle immediately when the worker thread starts to + // teardown. We must make sure its GC'd before the worker RuntimeService is + // destroyed. The WorkerListener may not be able to post a runnable + // clearing this value after shutdown begins and thus delaying cleanup too + // late. + self->mOuter = nullptr; + }); + + if (NS_WARN_IF(!mWorkerRef)) { + return; + } + + mListener = + new WorkerListener(this, mDescriptor, worker->HybridEventTarget()); + + nsCOMPtr r = + NewRunnableMethod("dom::WorkerListener::StartListeningForEvents", + mListener, &WorkerListener::StartListeningForEvents); + MOZ_ALWAYS_SUCCEEDS(worker->DispatchToMainThread(r.forget())); +} + +void ServiceWorkerRegistrationWorkerThread::ReleaseListener() { + if (!mListener) { + return; + } + + MOZ_ASSERT(IsCurrentThreadRunningWorker()); + + mListener->ClearRegistration(); + + nsCOMPtr r = NewCancelableRunnableMethod( + "dom::WorkerListener::StopListeningForEvents", mListener, + &WorkerListener::StopListeningForEvents); + // Calling GetPrivate() is safe because this method is called when the + // WorkerRef is notified. + MOZ_ALWAYS_SUCCEEDS( + mWorkerRef->GetPrivate()->DispatchToMainThread(r.forget())); + + mListener = nullptr; + mWorkerRef = nullptr; +} + +void ServiceWorkerRegistrationWorkerThread::UpdateState( + const ServiceWorkerRegistrationDescriptor& aDescriptor) { + if (mOuter) { + mOuter->UpdateState(aDescriptor); + } +} + +void ServiceWorkerRegistrationWorkerThread::FireUpdateFound() { + if (mOuter) { + mOuter->MaybeDispatchUpdateFoundRunnable(); + } +} + +class RegistrationClearedWorkerRunnable final : public WorkerRunnable { + RefPtr mListener; + + public: + RegistrationClearedWorkerRunnable(WorkerPrivate* aWorkerPrivate, + WorkerListener* aListener) + : WorkerRunnable(aWorkerPrivate), mListener(aListener) { + // Need this assertion for now since runnables which modify busy count can + // only be dispatched from parent thread to worker thread and we don't deal + // with nested workers. SW threads can't be nested. + MOZ_ASSERT(aWorkerPrivate->IsServiceWorker()); + } + + bool WorkerRun(JSContext* aCx, WorkerPrivate* aWorkerPrivate) override { + MOZ_ASSERT(aWorkerPrivate); + aWorkerPrivate->AssertIsOnWorkerThread(); + mListener->RegistrationCleared(); + return true; + } +}; + +void WorkerListener::RegistrationCleared() { + MutexAutoLock lock(mMutex); + if (!mRegistration) { + return; + } + + if (NS_IsMainThread()) { + RefPtr r = new RegistrationClearedWorkerRunnable( + mRegistration->GetWorkerPrivate(lock), this); + Unused << r->Dispatch(); + + StopListeningForEvents(); + return; + } + + mRegistration->RegistrationCleared(); +} + +WorkerPrivate* ServiceWorkerRegistrationWorkerThread::GetWorkerPrivate( + const MutexAutoLock& aProofOfLock) { + // In this case, calling GetUnsafePrivate() is ok because we have a proof of + // mutex lock. + MOZ_ASSERT(mWorkerRef && mWorkerRef->GetUnsafePrivate()); + return mWorkerRef->GetUnsafePrivate(); +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerRegistrationImpl.h b/dom/serviceworkers/ServiceWorkerRegistrationImpl.h new file mode 100644 index 0000000000..a5e57c508a --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerRegistrationImpl.h @@ -0,0 +1,133 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworkerregistrationimpl_h +#define mozilla_dom_serviceworkerregistrationimpl_h + +#include "ServiceWorkerRegistration.h" +#include "ServiceWorkerRegistrationListener.h" +#include "mozilla/Assertions.h" +#include "mozilla/Mutex.h" +#include "mozilla/RefPtr.h" +#include "mozilla/dom/ServiceWorkerRegistrationDescriptor.h" +#include "mozilla/dom/ServiceWorkerUtils.h" +#include "nsISupports.h" +#include "nsStringFwd.h" + +namespace mozilla { +namespace dom { + +class ServiceWorkerRegistrationInfo; +class WeakWorkerRef; +class WorkerPrivate; + +//////////////////////////////////////////////////// +// Main Thread implementation + +class ServiceWorkerRegistrationMainThread final + : public ServiceWorkerRegistration::Inner, + public ServiceWorkerRegistrationListener { + public: + NS_INLINE_DECL_REFCOUNTING(ServiceWorkerRegistrationMainThread, override) + + explicit ServiceWorkerRegistrationMainThread( + const ServiceWorkerRegistrationDescriptor& aDescriptor); + + // ServiceWorkerRegistration::Inner + void SetServiceWorkerRegistration(ServiceWorkerRegistration* aReg) override; + + void ClearServiceWorkerRegistration(ServiceWorkerRegistration* aReg) override; + + void Update(const nsCString& aNewestWorkerScriptUrl, + ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) override; + + void Unregister(ServiceWorkerBoolCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) override; + + // ServiceWorkerRegistrationListener + void UpdateState( + const ServiceWorkerRegistrationDescriptor& aDescriptor) override; + + void FireUpdateFound() override; + + void RegistrationCleared() override; + + void GetScope(nsAString& aScope) const override { aScope = mScope; } + + bool MatchesDescriptor( + const ServiceWorkerRegistrationDescriptor& aDescriptor) override; + + private: + ~ServiceWorkerRegistrationMainThread(); + + void StartListeningForEvents(); + + void StopListeningForEvents(); + + void RegistrationClearedInternal(); + + ServiceWorkerRegistration* mOuter; + ServiceWorkerRegistrationDescriptor mDescriptor; + RefPtr mInfo; + const nsString mScope; + bool mListeningForEvents; +}; + +//////////////////////////////////////////////////// +// Worker Thread implementation + +class WorkerListener; + +class ServiceWorkerRegistrationWorkerThread final + : public ServiceWorkerRegistration::Inner { + friend class WorkerListener; + + public: + NS_INLINE_DECL_REFCOUNTING(ServiceWorkerRegistrationWorkerThread, override) + + explicit ServiceWorkerRegistrationWorkerThread( + const ServiceWorkerRegistrationDescriptor& aDescriptor); + + void RegistrationCleared(); + + // ServiceWorkerRegistration::Inner + void SetServiceWorkerRegistration(ServiceWorkerRegistration* aReg) override; + + void ClearServiceWorkerRegistration(ServiceWorkerRegistration* aReg) override; + + void Update(const nsCString& aNewestWorkerScriptUrl, + ServiceWorkerRegistrationCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) override; + + void Unregister(ServiceWorkerBoolCallback&& aSuccessCB, + ServiceWorkerFailureCallback&& aFailureCB) override; + + private: + ~ServiceWorkerRegistrationWorkerThread(); + + void InitListener(); + + void ReleaseListener(); + + void UpdateState(const ServiceWorkerRegistrationDescriptor& aDescriptor); + + void FireUpdateFound(); + + // This can be called only by WorkerListener. + WorkerPrivate* GetWorkerPrivate(const MutexAutoLock& aProofOfLock); + + ServiceWorkerRegistration* mOuter; + const ServiceWorkerRegistrationDescriptor mDescriptor; + const nsString mScope; + RefPtr mListener; + RefPtr mWorkerRef; +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_serviceworkerregistrationimpl_h diff --git a/dom/serviceworkers/ServiceWorkerRegistrationInfo.cpp b/dom/serviceworkers/ServiceWorkerRegistrationInfo.cpp new file mode 100644 index 0000000000..cda10b7b2b --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerRegistrationInfo.cpp @@ -0,0 +1,838 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerRegistrationInfo.h" + +#include "ServiceWorkerManager.h" +#include "ServiceWorkerPrivate.h" +#include "ServiceWorkerRegistrationListener.h" + +#include "mozilla/Preferences.h" +#include "mozilla/SchedulerGroup.h" + +namespace mozilla { +namespace dom { + +namespace { + +class ContinueActivateRunnable final : public LifeCycleEventCallback { + nsMainThreadPtrHandle mRegistration; + bool mSuccess; + + public: + explicit ContinueActivateRunnable( + const nsMainThreadPtrHandle& aRegistration) + : mRegistration(aRegistration), mSuccess(false) { + MOZ_ASSERT(NS_IsMainThread()); + } + + void SetResult(bool aResult) override { mSuccess = aResult; } + + NS_IMETHOD + Run() override { + MOZ_ASSERT(NS_IsMainThread()); + mRegistration->FinishActivate(mSuccess); + mRegistration = nullptr; + return NS_OK; + } +}; + +} // anonymous namespace + +void ServiceWorkerRegistrationInfo::ShutdownWorkers() { + ForEachWorker([](RefPtr& aWorker) { + aWorker->WorkerPrivate()->NoteDeadServiceWorkerInfo(); + aWorker = nullptr; + }); +} + +void ServiceWorkerRegistrationInfo::Clear() { + ForEachWorker([](RefPtr& aWorker) { + aWorker->UpdateState(ServiceWorkerState::Redundant); + aWorker->UpdateRedundantTime(); + }); + + // FIXME: Abort any inflight requests from installing worker. + + ShutdownWorkers(); + UpdateRegistrationState(); + NotifyChromeRegistrationListeners(); + NotifyCleared(); +} + +void ServiceWorkerRegistrationInfo::ClearAsCorrupt() { + mCorrupt = true; + Clear(); +} + +bool ServiceWorkerRegistrationInfo::IsCorrupt() const { return mCorrupt; } + +ServiceWorkerRegistrationInfo::ServiceWorkerRegistrationInfo( + const nsACString& aScope, nsIPrincipal* aPrincipal, + ServiceWorkerUpdateViaCache aUpdateViaCache) + : mPrincipal(aPrincipal), + mDescriptor(GetNextId(), GetNextVersion(), aPrincipal, aScope, + aUpdateViaCache), + mControlledClientsCounter(0), + mDelayMultiplier(0), + mUpdateState(NoUpdate), + mCreationTime(PR_Now()), + mCreationTimeStamp(TimeStamp::Now()), + mLastUpdateTime(0), + mUnregistered(false), + mCorrupt(false) { + MOZ_ASSERT_IF(ServiceWorkerParentInterceptEnabled(), + XRE_GetProcessType() == GeckoProcessType_Default); +} + +ServiceWorkerRegistrationInfo::~ServiceWorkerRegistrationInfo() { + MOZ_DIAGNOSTIC_ASSERT(!IsControllingClients()); +} + +void ServiceWorkerRegistrationInfo::AddInstance( + ServiceWorkerRegistrationListener* aInstance, + const ServiceWorkerRegistrationDescriptor& aDescriptor) { + MOZ_DIAGNOSTIC_ASSERT(aInstance); + MOZ_ASSERT(!mInstanceList.Contains(aInstance)); + MOZ_DIAGNOSTIC_ASSERT(aDescriptor.Id() == mDescriptor.Id()); + MOZ_DIAGNOSTIC_ASSERT(aDescriptor.PrincipalInfo() == + mDescriptor.PrincipalInfo()); + MOZ_DIAGNOSTIC_ASSERT(aDescriptor.Scope() == mDescriptor.Scope()); + MOZ_DIAGNOSTIC_ASSERT(aDescriptor.Version() <= mDescriptor.Version()); + uint64_t lastVersion = aDescriptor.Version(); + for (auto& entry : mVersionList) { + if (lastVersion > entry->mDescriptor.Version()) { + continue; + } + lastVersion = entry->mDescriptor.Version(); + aInstance->UpdateState(entry->mDescriptor); + } + // Note, the mDescriptor may be contained in the version list. Since the + // version list is aged out, though, it may also not be in the version list. + // So always check for the mDescriptor update here. + if (lastVersion < mDescriptor.Version()) { + aInstance->UpdateState(mDescriptor); + } + mInstanceList.AppendElement(aInstance); +} + +void ServiceWorkerRegistrationInfo::RemoveInstance( + ServiceWorkerRegistrationListener* aInstance) { + MOZ_DIAGNOSTIC_ASSERT(aInstance); + DebugOnly removed = mInstanceList.RemoveElement(aInstance); + MOZ_ASSERT(removed); +} + +const nsCString& ServiceWorkerRegistrationInfo::Scope() const { + return mDescriptor.Scope(); +} + +nsIPrincipal* ServiceWorkerRegistrationInfo::Principal() const { + return mPrincipal; +} + +bool ServiceWorkerRegistrationInfo::IsUnregistered() const { + return mUnregistered; +} + +void ServiceWorkerRegistrationInfo::SetUnregistered() { +#ifdef DEBUG + MOZ_ASSERT(!mUnregistered); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + MOZ_ASSERT(swm); + + RefPtr registration = + swm->GetRegistration(Principal(), Scope()); + MOZ_ASSERT(registration != this); +#endif + + mUnregistered = true; +} + +NS_IMPL_ISUPPORTS(ServiceWorkerRegistrationInfo, + nsIServiceWorkerRegistrationInfo) + +NS_IMETHODIMP +ServiceWorkerRegistrationInfo::GetPrincipal(nsIPrincipal** aPrincipal) { + MOZ_ASSERT(NS_IsMainThread()); + NS_ADDREF(*aPrincipal = mPrincipal); + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerRegistrationInfo::GetScope(nsAString& aScope) { + MOZ_ASSERT(NS_IsMainThread()); + CopyUTF8toUTF16(Scope(), aScope); + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerRegistrationInfo::GetScriptSpec(nsAString& aScriptSpec) { + MOZ_ASSERT(NS_IsMainThread()); + RefPtr newest = NewestIncludingEvaluating(); + if (newest) { + CopyUTF8toUTF16(newest->ScriptSpec(), aScriptSpec); + } + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerRegistrationInfo::GetUpdateViaCache(uint16_t* aUpdateViaCache) { + *aUpdateViaCache = static_cast(GetUpdateViaCache()); + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerRegistrationInfo::GetLastUpdateTime(PRTime* _retval) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(_retval); + *_retval = mLastUpdateTime; + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerRegistrationInfo::GetEvaluatingWorker( + nsIServiceWorkerInfo** aResult) { + MOZ_ASSERT(NS_IsMainThread()); + RefPtr info = mEvaluatingWorker; + info.forget(aResult); + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerRegistrationInfo::GetInstallingWorker( + nsIServiceWorkerInfo** aResult) { + MOZ_ASSERT(NS_IsMainThread()); + RefPtr info = mInstallingWorker; + info.forget(aResult); + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerRegistrationInfo::GetWaitingWorker( + nsIServiceWorkerInfo** aResult) { + MOZ_ASSERT(NS_IsMainThread()); + RefPtr info = mWaitingWorker; + info.forget(aResult); + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerRegistrationInfo::GetActiveWorker(nsIServiceWorkerInfo** aResult) { + MOZ_ASSERT(NS_IsMainThread()); + RefPtr info = mActiveWorker; + info.forget(aResult); + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerRegistrationInfo::GetWorkerByID(uint64_t aID, + nsIServiceWorkerInfo** aResult) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aResult); + + RefPtr info = GetServiceWorkerInfoById(aID); + // It is ok to return null for a missing service worker info. + info.forget(aResult); + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerRegistrationInfo::AddListener( + nsIServiceWorkerRegistrationInfoListener* aListener) { + MOZ_ASSERT(NS_IsMainThread()); + + if (!aListener || mListeners.Contains(aListener)) { + return NS_ERROR_INVALID_ARG; + } + + mListeners.AppendElement(aListener); + + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerRegistrationInfo::RemoveListener( + nsIServiceWorkerRegistrationInfoListener* aListener) { + MOZ_ASSERT(NS_IsMainThread()); + + if (!aListener || !mListeners.Contains(aListener)) { + return NS_ERROR_INVALID_ARG; + } + + mListeners.RemoveElement(aListener); + + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerRegistrationInfo::ForceShutdown() { + ClearInstalling(); + ShutdownWorkers(); + return NS_OK; +} + +already_AddRefed +ServiceWorkerRegistrationInfo::GetServiceWorkerInfoById(uint64_t aId) { + MOZ_ASSERT(NS_IsMainThread()); + + RefPtr serviceWorker; + if (mEvaluatingWorker && mEvaluatingWorker->ID() == aId) { + serviceWorker = mEvaluatingWorker; + } else if (mInstallingWorker && mInstallingWorker->ID() == aId) { + serviceWorker = mInstallingWorker; + } else if (mWaitingWorker && mWaitingWorker->ID() == aId) { + serviceWorker = mWaitingWorker; + } else if (mActiveWorker && mActiveWorker->ID() == aId) { + serviceWorker = mActiveWorker; + } + + return serviceWorker.forget(); +} + +void ServiceWorkerRegistrationInfo::TryToActivateAsync( + TryToActivateCallback&& aCallback) { + MOZ_ALWAYS_SUCCEEDS(NS_DispatchToMainThread( + NewRunnableMethod>( + "ServiceWorkerRegistrationInfo::TryToActivate", this, + &ServiceWorkerRegistrationInfo::TryToActivate, + std::move(aCallback)))); +} + +/* + * TryToActivate should not be called directly, use TryToActivateAsync instead. + */ +void ServiceWorkerRegistrationInfo::TryToActivate( + TryToActivateCallback&& aCallback) { + MOZ_ASSERT(NS_IsMainThread()); + bool controlling = IsControllingClients(); + bool skipWaiting = mWaitingWorker && mWaitingWorker->SkipWaitingFlag(); + bool idle = IsIdle(); + if (idle && (!controlling || skipWaiting)) { + Activate(); + } + + if (aCallback) { + aCallback(); + } +} + +void ServiceWorkerRegistrationInfo::Activate() { + if (!mWaitingWorker) { + return; + } + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (!swm) { + // browser shutdown began during async activation step + return; + } + + TransitionWaitingToActive(); + + // FIXME(nsm): Unlink appcache if there is one. + + // "Queue a task to fire a simple event named controllerchange..." + MOZ_DIAGNOSTIC_ASSERT(mActiveWorker); + swm->UpdateClientControllers(this); + + nsMainThreadPtrHandle handle( + new nsMainThreadPtrHolder( + "ServiceWorkerRegistrationInfoProxy", this)); + RefPtr callback = + new ContinueActivateRunnable(handle); + + ServiceWorkerPrivate* workerPrivate = mActiveWorker->WorkerPrivate(); + MOZ_ASSERT(workerPrivate); + nsresult rv = workerPrivate->SendLifeCycleEvent(u"activate"_ns, callback); + if (NS_WARN_IF(NS_FAILED(rv))) { + nsCOMPtr failRunnable = NewRunnableMethod( + "dom::ServiceWorkerRegistrationInfo::FinishActivate", this, + &ServiceWorkerRegistrationInfo::FinishActivate, false /* success */); + MOZ_ALWAYS_SUCCEEDS(NS_DispatchToMainThread(failRunnable.forget())); + return; + } +} + +void ServiceWorkerRegistrationInfo::FinishActivate(bool aSuccess) { + if (mUnregistered || !mActiveWorker || + mActiveWorker->State() != ServiceWorkerState::Activating) { + return; + } + + // Activation never fails, so aSuccess is ignored. + mActiveWorker->UpdateState(ServiceWorkerState::Activated); + mActiveWorker->UpdateActivatedTime(); + + UpdateRegistrationState(); + NotifyChromeRegistrationListeners(); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (!swm) { + // browser shutdown started during async activation completion step + return; + } + swm->StoreRegistration(mPrincipal, this); +} + +void ServiceWorkerRegistrationInfo::RefreshLastUpdateCheckTime() { + MOZ_ASSERT(NS_IsMainThread()); + + mLastUpdateTime = + mCreationTime + + static_cast( + (TimeStamp::Now() - mCreationTimeStamp).ToMicroseconds()); + NotifyChromeRegistrationListeners(); +} + +bool ServiceWorkerRegistrationInfo::IsLastUpdateCheckTimeOverOneDay() const { + MOZ_ASSERT(NS_IsMainThread()); + + // For testing. + if (Preferences::GetBool("dom.serviceWorkers.testUpdateOverOneDay")) { + return true; + } + + const int64_t kSecondsPerDay = 86400; + const int64_t nowMicros = + mCreationTime + + static_cast( + (TimeStamp::Now() - mCreationTimeStamp).ToMicroseconds()); + + // now < mLastUpdateTime if the system time is reset between storing + // and loading mLastUpdateTime from ServiceWorkerRegistrar. + if (nowMicros < mLastUpdateTime || + (nowMicros - mLastUpdateTime) / PR_USEC_PER_SEC > kSecondsPerDay) { + return true; + } + return false; +} + +void ServiceWorkerRegistrationInfo::UpdateRegistrationState() { + UpdateRegistrationState(mDescriptor.UpdateViaCache()); +} + +void ServiceWorkerRegistrationInfo::UpdateRegistrationState( + ServiceWorkerUpdateViaCache aUpdateViaCache) { + MOZ_ASSERT(NS_IsMainThread()); + + TimeStamp oldest = TimeStamp::Now() - TimeDuration::FromSeconds(30); + if (!mVersionList.IsEmpty() && mVersionList[0]->mTimeStamp < oldest) { + nsTArray> list = std::move(mVersionList); + for (auto& entry : list) { + if (entry->mTimeStamp >= oldest) { + mVersionList.AppendElement(std::move(entry)); + } + } + } + mVersionList.AppendElement(MakeUnique(mDescriptor)); + + // We are going to modify the descriptor, so increase its version number. + mDescriptor.SetVersion(GetNextVersion()); + + // Note, this also sets the new version number on the ServiceWorkerInfo + // objects before we copy over their updated descriptors. + mDescriptor.SetWorkers(mInstallingWorker, mWaitingWorker, mActiveWorker); + + mDescriptor.SetUpdateViaCache(aUpdateViaCache); + + for (RefPtr pinnedTarget : + mInstanceList.ForwardRange()) { + pinnedTarget->UpdateState(mDescriptor); + } +} + +void ServiceWorkerRegistrationInfo::NotifyChromeRegistrationListeners() { + nsTArray> listeners( + mListeners.Clone()); + for (size_t index = 0; index < listeners.Length(); ++index) { + listeners[index]->OnChange(); + } +} + +void ServiceWorkerRegistrationInfo::MaybeScheduleTimeCheckAndUpdate() { + MOZ_ASSERT(NS_IsMainThread()); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (!swm) { + // shutting down, do nothing + return; + } + + if (mUpdateState == NoUpdate) { + mUpdateState = NeedTimeCheckAndUpdate; + } + + swm->ScheduleUpdateTimer(mPrincipal, Scope()); +} + +void ServiceWorkerRegistrationInfo::MaybeScheduleUpdate() { + MOZ_ASSERT(NS_IsMainThread()); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (!swm) { + // shutting down, do nothing + return; + } + + mUpdateState = NeedUpdate; + + swm->ScheduleUpdateTimer(mPrincipal, Scope()); +} + +bool ServiceWorkerRegistrationInfo::CheckAndClearIfUpdateNeeded() { + MOZ_ASSERT(NS_IsMainThread()); + + bool result = + mUpdateState == NeedUpdate || (mUpdateState == NeedTimeCheckAndUpdate && + IsLastUpdateCheckTimeOverOneDay()); + + mUpdateState = NoUpdate; + + return result; +} + +ServiceWorkerInfo* ServiceWorkerRegistrationInfo::GetEvaluating() const { + MOZ_ASSERT(NS_IsMainThread()); + return mEvaluatingWorker; +} + +ServiceWorkerInfo* ServiceWorkerRegistrationInfo::GetInstalling() const { + MOZ_ASSERT(NS_IsMainThread()); + return mInstallingWorker; +} + +ServiceWorkerInfo* ServiceWorkerRegistrationInfo::GetWaiting() const { + MOZ_ASSERT(NS_IsMainThread()); + return mWaitingWorker; +} + +ServiceWorkerInfo* ServiceWorkerRegistrationInfo::GetActive() const { + MOZ_ASSERT(NS_IsMainThread()); + return mActiveWorker; +} + +ServiceWorkerInfo* ServiceWorkerRegistrationInfo::GetByDescriptor( + const ServiceWorkerDescriptor& aDescriptor) const { + if (mActiveWorker && mActiveWorker->Descriptor().Matches(aDescriptor)) { + return mActiveWorker; + } + if (mWaitingWorker && mWaitingWorker->Descriptor().Matches(aDescriptor)) { + return mWaitingWorker; + } + if (mInstallingWorker && + mInstallingWorker->Descriptor().Matches(aDescriptor)) { + return mInstallingWorker; + } + if (mEvaluatingWorker && + mEvaluatingWorker->Descriptor().Matches(aDescriptor)) { + return mEvaluatingWorker; + } + return nullptr; +} + +void ServiceWorkerRegistrationInfo::SetEvaluating( + ServiceWorkerInfo* aServiceWorker) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aServiceWorker); + MOZ_ASSERT(!mEvaluatingWorker); + MOZ_ASSERT(!mInstallingWorker); + MOZ_ASSERT(mWaitingWorker != aServiceWorker); + MOZ_ASSERT(mActiveWorker != aServiceWorker); + + mEvaluatingWorker = aServiceWorker; + + // We don't call UpdateRegistrationState() here because the evaluating worker + // is currently not exposed to content on the registration, so calling it here + // would produce redundant IPC traffic. + NotifyChromeRegistrationListeners(); +} + +void ServiceWorkerRegistrationInfo::ClearEvaluating() { + MOZ_ASSERT(NS_IsMainThread()); + + if (!mEvaluatingWorker) { + return; + } + + mEvaluatingWorker->UpdateState(ServiceWorkerState::Redundant); + // We don't update the redundant time for the sw here, since we've not expose + // evalutingWorker yet. + mEvaluatingWorker = nullptr; + + // As for SetEvaluating, UpdateRegistrationState() does not need to be called. + NotifyChromeRegistrationListeners(); +} + +void ServiceWorkerRegistrationInfo::ClearInstalling() { + MOZ_ASSERT(NS_IsMainThread()); + + if (!mInstallingWorker) { + return; + } + + RefPtr installing = std::move(mInstallingWorker); + installing->UpdateState(ServiceWorkerState::Redundant); + installing->UpdateRedundantTime(); + + UpdateRegistrationState(); + NotifyChromeRegistrationListeners(); +} + +void ServiceWorkerRegistrationInfo::TransitionEvaluatingToInstalling() { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(mEvaluatingWorker); + MOZ_ASSERT(!mInstallingWorker); + + mInstallingWorker = std::move(mEvaluatingWorker); + mInstallingWorker->UpdateState(ServiceWorkerState::Installing); + + UpdateRegistrationState(); + NotifyChromeRegistrationListeners(); +} + +void ServiceWorkerRegistrationInfo::TransitionInstallingToWaiting() { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(mInstallingWorker); + + if (mWaitingWorker) { + MOZ_ASSERT(mInstallingWorker->CacheName() != mWaitingWorker->CacheName()); + mWaitingWorker->UpdateState(ServiceWorkerState::Redundant); + mWaitingWorker->UpdateRedundantTime(); + } + + mWaitingWorker = std::move(mInstallingWorker); + mWaitingWorker->UpdateState(ServiceWorkerState::Installed); + mWaitingWorker->UpdateInstalledTime(); + + UpdateRegistrationState(); + NotifyChromeRegistrationListeners(); + + // TODO: When bug 1426401 is implemented we will need to call + // StoreRegistration() here to persist the waiting worker. +} + +void ServiceWorkerRegistrationInfo::SetActive( + ServiceWorkerInfo* aServiceWorker) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aServiceWorker); + + // TODO: Assert installing, waiting, and active are nullptr once the SWM + // moves to the parent process. After that happens this code will + // only run for browser initialization and not for cross-process + // overrides. + MOZ_ASSERT(mInstallingWorker != aServiceWorker); + MOZ_ASSERT(mWaitingWorker != aServiceWorker); + MOZ_ASSERT(mActiveWorker != aServiceWorker); + + if (mActiveWorker) { + MOZ_ASSERT(aServiceWorker->CacheName() != mActiveWorker->CacheName()); + mActiveWorker->UpdateState(ServiceWorkerState::Redundant); + mActiveWorker->UpdateRedundantTime(); + } + + // The active worker is being overriden due to initial load or + // another process activating a worker. Move straight to the + // Activated state. + mActiveWorker = aServiceWorker; + mActiveWorker->SetActivateStateUncheckedWithoutEvent( + ServiceWorkerState::Activated); + + // We don't need to update activated time when we load registration from + // registrar. + UpdateRegistrationState(); + NotifyChromeRegistrationListeners(); +} + +void ServiceWorkerRegistrationInfo::TransitionWaitingToActive() { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(mWaitingWorker); + + if (mActiveWorker) { + MOZ_ASSERT(mWaitingWorker->CacheName() != mActiveWorker->CacheName()); + mActiveWorker->UpdateState(ServiceWorkerState::Redundant); + mActiveWorker->UpdateRedundantTime(); + } + + // We are transitioning from waiting to active normally, so go to + // the activating state. + mActiveWorker = std::move(mWaitingWorker); + mActiveWorker->UpdateState(ServiceWorkerState::Activating); + + nsCOMPtr r = NS_NewRunnableFunction( + "ServiceWorkerRegistrationInfo::TransitionWaitingToActive", [] { + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (swm) { + swm->CheckPendingReadyPromises(); + } + }); + MOZ_ALWAYS_SUCCEEDS( + SchedulerGroup::Dispatch(TaskCategory::Other, r.forget())); + + UpdateRegistrationState(); + NotifyChromeRegistrationListeners(); +} + +bool ServiceWorkerRegistrationInfo::IsIdle() const { + return !mActiveWorker || mActiveWorker->WorkerPrivate()->IsIdle(); +} + +ServiceWorkerUpdateViaCache ServiceWorkerRegistrationInfo::GetUpdateViaCache() + const { + return mDescriptor.UpdateViaCache(); +} + +void ServiceWorkerRegistrationInfo::SetUpdateViaCache( + ServiceWorkerUpdateViaCache aUpdateViaCache) { + UpdateRegistrationState(aUpdateViaCache); +} + +int64_t ServiceWorkerRegistrationInfo::GetLastUpdateTime() const { + return mLastUpdateTime; +} + +void ServiceWorkerRegistrationInfo::SetLastUpdateTime(const int64_t aTime) { + if (aTime == 0) { + return; + } + + mLastUpdateTime = aTime; +} + +const ServiceWorkerRegistrationDescriptor& +ServiceWorkerRegistrationInfo::Descriptor() const { + return mDescriptor; +} + +uint64_t ServiceWorkerRegistrationInfo::Id() const { return mDescriptor.Id(); } + +uint64_t ServiceWorkerRegistrationInfo::Version() const { + return mDescriptor.Version(); +} + +uint32_t ServiceWorkerRegistrationInfo::GetUpdateDelay( + const bool aWithMultiplier) { + uint32_t delay = Preferences::GetInt("dom.serviceWorkers.update_delay", 1000); + + if (!aWithMultiplier) { + return delay; + } + + // This can potentially happen if you spam registration->Update(). We don't + // want to wrap to a lower value. + if (mDelayMultiplier >= INT_MAX / (delay ? delay : 1)) { + return INT_MAX; + } + + delay *= mDelayMultiplier; + + if (!mControlledClientsCounter && mDelayMultiplier < (INT_MAX / 30)) { + mDelayMultiplier = (mDelayMultiplier ? mDelayMultiplier : 1) * 30; + } + + return delay; +} + +void ServiceWorkerRegistrationInfo::FireUpdateFound() { + for (RefPtr pinnedTarget : + mInstanceList.ForwardRange()) { + pinnedTarget->FireUpdateFound(); + } +} + +void ServiceWorkerRegistrationInfo::NotifyCleared() { + for (RefPtr pinnedTarget : + mInstanceList.ForwardRange()) { + pinnedTarget->RegistrationCleared(); + } +} + +void ServiceWorkerRegistrationInfo::ClearWhenIdle() { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(IsUnregistered()); + MOZ_ASSERT(!IsControllingClients()); + MOZ_ASSERT(!IsIdle(), "Already idle!"); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + MOZ_ASSERT(swm); + + swm->AddOrphanedRegistration(this); + + /** + * Although a Service Worker will transition to idle many times during its + * lifetime, the promise is only resolved once `GetIdlePromise` has been + * called, populating the `MozPromiseHolder`. Additionally, this is the only + * time this method will be called for the given ServiceWorker. This means we + * will be notified to the transition we are interested in, and there are no + * other callers to get confused. + * + * Note that because we are using `MozPromise`, our callback will be invoked + * as a separate task, so there is a small potential for races in the event + * code if things are still holding onto the ServiceWorker binding and using + * `postMessage()` or other mechanisms to schedule new events on it, which + * would make it non-idle. However, this is a race inherent in the spec which + * does not deal with the reality of multiple threads in "Try Clear + * Registration". + */ + GetActive()->WorkerPrivate()->GetIdlePromise()->Then( + GetCurrentSerialEventTarget(), __func__, + [self = RefPtr(this)]( + const GenericPromise::ResolveOrRejectValue& aResult) { + MOZ_ASSERT(aResult.IsResolve()); + // This registration was already unregistered and not controlling + // clients when `ClearWhenIdle` was called, so there should be no way + // that more clients were acquired. + MOZ_ASSERT(!self->IsControllingClients()); + MOZ_ASSERT(self->IsIdle()); + self->Clear(); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (swm) { + swm->RemoveOrphanedRegistration(self); + } + }); +} + +const nsID& ServiceWorkerRegistrationInfo::AgentClusterId() const { + return mAgentClusterId; +} + +// static +uint64_t ServiceWorkerRegistrationInfo::GetNextId() { + MOZ_ASSERT(NS_IsMainThread()); + static uint64_t sNextId = 0; + return ++sNextId; +} + +// static +uint64_t ServiceWorkerRegistrationInfo::GetNextVersion() { + MOZ_ASSERT(NS_IsMainThread()); + static uint64_t sNextVersion = 0; + return ++sNextVersion; +} + +void ServiceWorkerRegistrationInfo::ForEachWorker( + void (*aFunc)(RefPtr&)) { + if (mEvaluatingWorker) { + aFunc(mEvaluatingWorker); + } + + if (mInstallingWorker) { + aFunc(mInstallingWorker); + } + + if (mWaitingWorker) { + aFunc(mWaitingWorker); + } + + if (mActiveWorker) { + aFunc(mActiveWorker); + } +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerRegistrationInfo.h b/dom/serviceworkers/ServiceWorkerRegistrationInfo.h new file mode 100644 index 0000000000..f3f6226c14 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerRegistrationInfo.h @@ -0,0 +1,259 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworkerregistrationinfo_h +#define mozilla_dom_serviceworkerregistrationinfo_h + +#include + +#include "mozilla/dom/ServiceWorkerInfo.h" +#include "mozilla/dom/ServiceWorkerRegistrationBinding.h" +#include "mozilla/dom/ServiceWorkerRegistrationDescriptor.h" +#include "nsContentUtils.h" +#include "nsProxyRelease.h" +#include "nsTObserverArray.h" + +namespace mozilla { +namespace dom { + +class ServiceWorkerRegistrationListener; + +class ServiceWorkerRegistrationInfo final + : public nsIServiceWorkerRegistrationInfo { + nsCOMPtr mPrincipal; + ServiceWorkerRegistrationDescriptor mDescriptor; + nsTArray> mListeners; + nsTObserverArray mInstanceList; + + struct VersionEntry { + const ServiceWorkerRegistrationDescriptor mDescriptor; + TimeStamp mTimeStamp; + + explicit VersionEntry( + const ServiceWorkerRegistrationDescriptor& aDescriptor) + : mDescriptor(aDescriptor), mTimeStamp(TimeStamp::Now()) {} + }; + nsTArray> mVersionList; + + const nsID mAgentClusterId = nsContentUtils::GenerateUUID(); + + uint32_t mControlledClientsCounter; + uint32_t mDelayMultiplier; + + enum { NoUpdate, NeedTimeCheckAndUpdate, NeedUpdate } mUpdateState; + + // Timestamp to track SWR's last update time + PRTime mCreationTime; + TimeStamp mCreationTimeStamp; + // The time of update is 0, if SWR've never been updated yet. + PRTime mLastUpdateTime; + + RefPtr mEvaluatingWorker; + RefPtr mActiveWorker; + RefPtr mWaitingWorker; + RefPtr mInstallingWorker; + + virtual ~ServiceWorkerRegistrationInfo(); + + // When unregister() is called on a registration, it is removed from the + // "scope to registration map" but not immediately "cleared" (i.e. its workers + // terminated, updated to the redundant state, etc.) because it may still be + // controlling clients. It is marked as unregistered and when all controlled + // clients go away, cleared. This way we can tell if a registration + // is unregistered by querying the object itself rather than incurring a table + // lookup (in the case when the registrations are passed around as pointers). + bool mUnregistered; + + bool mCorrupt; + + public: + NS_DECL_ISUPPORTS + NS_DECL_NSISERVICEWORKERREGISTRATIONINFO + + typedef std::function TryToActivateCallback; + + ServiceWorkerRegistrationInfo(const nsACString& aScope, + nsIPrincipal* aPrincipal, + ServiceWorkerUpdateViaCache aUpdateViaCache); + + void AddInstance(ServiceWorkerRegistrationListener* aInstance, + const ServiceWorkerRegistrationDescriptor& aDescriptor); + + void RemoveInstance(ServiceWorkerRegistrationListener* aInstance); + + const nsCString& Scope() const; + + nsIPrincipal* Principal() const; + + bool IsUnregistered() const; + + void SetUnregistered(); + + already_AddRefed Newest() const { + RefPtr newest; + if (mInstallingWorker) { + newest = mInstallingWorker; + } else if (mWaitingWorker) { + newest = mWaitingWorker; + } else { + newest = mActiveWorker; + } + + return newest.forget(); + } + + already_AddRefed NewestIncludingEvaluating() const { + if (mEvaluatingWorker) { + RefPtr newest = mEvaluatingWorker; + return newest.forget(); + } + return Newest(); + } + + already_AddRefed GetServiceWorkerInfoById(uint64_t aId); + + void StartControllingClient() { + ++mControlledClientsCounter; + mDelayMultiplier = 0; + } + + void StopControllingClient() { + MOZ_ASSERT(mControlledClientsCounter); + --mControlledClientsCounter; + } + + bool IsControllingClients() const { + return mActiveWorker && mControlledClientsCounter; + } + + // As a side effect, this nullifies + // `m{Evaluating,Installing,Waiting,Active}Worker`s. + void ShutdownWorkers(); + + void Clear(); + + void ClearAsCorrupt(); + + bool IsCorrupt() const; + + void TryToActivateAsync(TryToActivateCallback&& aCallback = nullptr); + + void TryToActivate(TryToActivateCallback&& aCallback); + + void Activate(); + + void FinishActivate(bool aSuccess); + + void RefreshLastUpdateCheckTime(); + + bool IsLastUpdateCheckTimeOverOneDay() const; + + void MaybeScheduleTimeCheckAndUpdate(); + + void MaybeScheduleUpdate(); + + bool CheckAndClearIfUpdateNeeded(); + + ServiceWorkerInfo* GetEvaluating() const; + + ServiceWorkerInfo* GetInstalling() const; + + ServiceWorkerInfo* GetWaiting() const; + + ServiceWorkerInfo* GetActive() const; + + ServiceWorkerInfo* GetByDescriptor( + const ServiceWorkerDescriptor& aDescriptor) const; + + // Set the given worker as the evaluating service worker. The worker + // state is not changed. + void SetEvaluating(ServiceWorkerInfo* aServiceWorker); + + // Remove an existing evaluating worker, if present. The worker will + // be transitioned to the Redundant state. + void ClearEvaluating(); + + // Remove an existing installing worker, if present. The worker will + // be transitioned to the Redundant state. + void ClearInstalling(); + + // Transition the current evaluating worker to be the installing worker. The + // worker's state is update to Installing. + void TransitionEvaluatingToInstalling(); + + // Transition the current installing worker to be the waiting worker. The + // worker's state is updated to Installed. + void TransitionInstallingToWaiting(); + + // Override the current active worker. This is used during browser + // initialization to load persisted workers. Its also used to propagate + // active workers across child processes in e10s. This second use will + // go away once the ServiceWorkerManager moves to the parent process. + // The worker is transitioned to the Activated state. + void SetActive(ServiceWorkerInfo* aServiceWorker); + + // Transition the current waiting worker to be the new active worker. The + // worker is updated to the Activating state. + void TransitionWaitingToActive(); + + // Determine if the registration is actively performing work. + bool IsIdle() const; + + ServiceWorkerUpdateViaCache GetUpdateViaCache() const; + + void SetUpdateViaCache(ServiceWorkerUpdateViaCache aUpdateViaCache); + + int64_t GetLastUpdateTime() const; + + void SetLastUpdateTime(const int64_t aTime); + + const ServiceWorkerRegistrationDescriptor& Descriptor() const; + + uint64_t Id() const; + + uint64_t Version() const; + + uint32_t GetUpdateDelay(const bool aWithMultiplier = true); + + void FireUpdateFound(); + + void NotifyCleared(); + + void ClearWhenIdle(); + + const nsID& AgentClusterId() const; + + private: + // Roughly equivalent to [[Update Registration State algorithm]]. Make sure + // this is called *before* updating SW instances' state, otherwise they + // may get CC-ed. + void UpdateRegistrationState(); + + void UpdateRegistrationState(ServiceWorkerUpdateViaCache aUpdateViaCache); + + // Used by devtools to track changes to the properties of + // *nsIServiceWorkerRegistrationInfo*. Note, this doesn't necessarily need to + // be in sync with the DOM registration objects, but it does need to be called + // in the same task that changed |mInstallingWorker|, |mWaitingWorker| or + // |mActiveWorker|. + void NotifyChromeRegistrationListeners(); + + static uint64_t GetNextId(); + + static uint64_t GetNextVersion(); + + // `aFunc`'s argument will be a reference to + // `m{Evaluating,Installing,Waiting,Active}Worker` (not to copy of them). + // Additionally, a null check will be performed for each worker before each + // call to `aFunc`, so `aFunc` will always get a reference to a non-null + // pointer. + void ForEachWorker(void (*aFunc)(RefPtr&)); +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_serviceworkerregistrationinfo_h diff --git a/dom/serviceworkers/ServiceWorkerRegistrationListener.h b/dom/serviceworkers/ServiceWorkerRegistrationListener.h new file mode 100644 index 0000000000..f68de51273 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerRegistrationListener.h @@ -0,0 +1,37 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_ServiceWorkerRegistrationListener_h +#define mozilla_dom_ServiceWorkerRegistrationListener_h + +namespace mozilla { +namespace dom { + +class ServiceWorkerRegistrationDescriptor; + +// Used by ServiceWorkerManager to notify ServiceWorkerRegistrations of +// updatefound event and invalidating ServiceWorker instances. +class ServiceWorkerRegistrationListener { + public: + NS_INLINE_DECL_PURE_VIRTUAL_REFCOUNTING + + virtual void UpdateState( + const ServiceWorkerRegistrationDescriptor& aDescriptor) = 0; + + virtual void FireUpdateFound() = 0; + + virtual void RegistrationCleared() = 0; + + virtual void GetScope(nsAString& aScope) const = 0; + + virtual bool MatchesDescriptor( + const ServiceWorkerRegistrationDescriptor& aDescriptor) = 0; +}; + +} // namespace dom +} // namespace mozilla + +#endif /* mozilla_dom_ServiceWorkerRegistrationListener_h */ diff --git a/dom/serviceworkers/ServiceWorkerRegistrationParent.cpp b/dom/serviceworkers/ServiceWorkerRegistrationParent.cpp new file mode 100644 index 0000000000..de6730d7a7 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerRegistrationParent.cpp @@ -0,0 +1,105 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerRegistrationParent.h" + +#include + +#include "ServiceWorkerRegistrationProxy.h" + +namespace mozilla { +namespace dom { + +using mozilla::ipc::IPCResult; + +void ServiceWorkerRegistrationParent::ActorDestroy(ActorDestroyReason aReason) { + if (mProxy) { + mProxy->RevokeActor(this); + mProxy = nullptr; + } +} + +IPCResult ServiceWorkerRegistrationParent::RecvTeardown() { + MaybeSendDelete(); + return IPC_OK(); +} + +namespace { + +void ResolveUnregister( + PServiceWorkerRegistrationParent::UnregisterResolver&& aResolver, + bool aSuccess, nsresult aRv) { + aResolver(Tuple( + aSuccess, CopyableErrorResult(aRv))); +} + +} // anonymous namespace + +IPCResult ServiceWorkerRegistrationParent::RecvUnregister( + UnregisterResolver&& aResolver) { + if (!mProxy) { + ResolveUnregister(std::move(aResolver), false, + NS_ERROR_DOM_INVALID_STATE_ERR); + return IPC_OK(); + } + + mProxy->Unregister()->Then( + GetCurrentSerialEventTarget(), __func__, + [aResolver](bool aSuccess) mutable { + ResolveUnregister(std::move(aResolver), aSuccess, NS_OK); + }, + [aResolver](nsresult aRv) mutable { + ResolveUnregister(std::move(aResolver), false, aRv); + }); + + return IPC_OK(); +} + +IPCResult ServiceWorkerRegistrationParent::RecvUpdate( + const nsCString& aNewestWorkerScriptUrl, UpdateResolver&& aResolver) { + if (!mProxy) { + aResolver(CopyableErrorResult(NS_ERROR_DOM_INVALID_STATE_ERR)); + return IPC_OK(); + } + + mProxy->Update(aNewestWorkerScriptUrl) + ->Then( + GetCurrentSerialEventTarget(), __func__, + [aResolver](const ServiceWorkerRegistrationDescriptor& aDescriptor) { + aResolver(aDescriptor.ToIPC()); + }, + [aResolver](const CopyableErrorResult& aResult) { + aResolver(aResult); + }); + + return IPC_OK(); +} + +ServiceWorkerRegistrationParent::ServiceWorkerRegistrationParent() + : mDeleteSent(false) {} + +ServiceWorkerRegistrationParent::~ServiceWorkerRegistrationParent() { + MOZ_DIAGNOSTIC_ASSERT(!mProxy); +} + +void ServiceWorkerRegistrationParent::Init( + const IPCServiceWorkerRegistrationDescriptor& aDescriptor) { + MOZ_DIAGNOSTIC_ASSERT(!mProxy); + mProxy = new ServiceWorkerRegistrationProxy( + ServiceWorkerRegistrationDescriptor(aDescriptor)); + mProxy->Init(this); +} + +void ServiceWorkerRegistrationParent::MaybeSendDelete() { + if (mDeleteSent) { + return; + } + mDeleteSent = true; + Unused << Send__delete__(this); +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerRegistrationParent.h b/dom/serviceworkers/ServiceWorkerRegistrationParent.h new file mode 100644 index 0000000000..298ad79557 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerRegistrationParent.h @@ -0,0 +1,49 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworkerregistrationparent_h__ +#define mozilla_dom_serviceworkerregistrationparent_h__ + +#include "mozilla/dom/PServiceWorkerRegistrationParent.h" + +namespace mozilla { +namespace dom { + +class IPCServiceWorkerRegistrationDescriptor; +class ServiceWorkerRegistrationProxy; + +class ServiceWorkerRegistrationParent final + : public PServiceWorkerRegistrationParent { + RefPtr mProxy; + bool mDeleteSent; + + ~ServiceWorkerRegistrationParent(); + + // PServiceWorkerRegistrationParent + void ActorDestroy(ActorDestroyReason aReason) override; + + mozilla::ipc::IPCResult RecvTeardown() override; + + mozilla::ipc::IPCResult RecvUnregister( + UnregisterResolver&& aResolver) override; + + mozilla::ipc::IPCResult RecvUpdate(const nsCString& aNewestWorkerScriptUrl, + UpdateResolver&& aResolver) override; + + public: + NS_INLINE_DECL_REFCOUNTING(ServiceWorkerRegistrationParent, override); + + ServiceWorkerRegistrationParent(); + + void Init(const IPCServiceWorkerRegistrationDescriptor& aDescriptor); + + void MaybeSendDelete(); +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_serviceworkerregistrationparent_h__ diff --git a/dom/serviceworkers/ServiceWorkerRegistrationProxy.cpp b/dom/serviceworkers/ServiceWorkerRegistrationProxy.cpp new file mode 100644 index 0000000000..3c5846c32c --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerRegistrationProxy.cpp @@ -0,0 +1,388 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerRegistrationProxy.h" + +#include "mozilla/SchedulerGroup.h" +#include "mozilla/ScopeExit.h" +#include "mozilla/ipc/BackgroundParent.h" +#include "ServiceWorkerManager.h" +#include "ServiceWorkerRegistrationParent.h" +#include "ServiceWorkerUnregisterCallback.h" + +namespace mozilla { +namespace dom { + +using mozilla::ipc::AssertIsOnBackgroundThread; + +class ServiceWorkerRegistrationProxy::DelayedUpdate final + : public nsITimerCallback { + RefPtr mProxy; + RefPtr mPromise; + nsCOMPtr mTimer; + nsCString mNewestWorkerScriptUrl; + + ~DelayedUpdate() = default; + + public: + NS_DECL_THREADSAFE_ISUPPORTS + NS_DECL_NSITIMERCALLBACK + + DelayedUpdate(RefPtr&& aProxy, + RefPtr&& aPromise, + nsCString&& aNewestWorkerScriptUrl, uint32_t delay); + + void ChainTo(RefPtr aPromise); + + void Reject(); + + void SetNewestWorkerScriptUrl(nsCString&& aNewestWorkerScriptUrl); +}; + +ServiceWorkerRegistrationProxy::~ServiceWorkerRegistrationProxy() { + // Any thread + MOZ_DIAGNOSTIC_ASSERT(!mActor); + MOZ_DIAGNOSTIC_ASSERT(!mReg); +} + +void ServiceWorkerRegistrationProxy::MaybeShutdownOnBGThread() { + AssertIsOnBackgroundThread(); + if (!mActor) { + return; + } + mActor->MaybeSendDelete(); +} + +void ServiceWorkerRegistrationProxy::UpdateStateOnBGThread( + const ServiceWorkerRegistrationDescriptor& aDescriptor) { + AssertIsOnBackgroundThread(); + if (!mActor) { + return; + } + Unused << mActor->SendUpdateState(aDescriptor.ToIPC()); +} + +void ServiceWorkerRegistrationProxy::FireUpdateFoundOnBGThread() { + AssertIsOnBackgroundThread(); + if (!mActor) { + return; + } + Unused << mActor->SendFireUpdateFound(); +} + +void ServiceWorkerRegistrationProxy::InitOnMainThread() { + AssertIsOnMainThread(); + + auto scopeExit = MakeScopeExit([&] { MaybeShutdownOnMainThread(); }); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + NS_ENSURE_TRUE_VOID(swm); + + RefPtr reg = + swm->GetRegistration(mDescriptor.PrincipalInfo(), mDescriptor.Scope()); + NS_ENSURE_TRUE_VOID(reg); + + if (reg->Id() != mDescriptor.Id()) { + // This registration has already been replaced by another one. + return; + } + + scopeExit.release(); + + mReg = new nsMainThreadPtrHolder( + "ServiceWorkerRegistrationProxy::mInfo", reg); + + mReg->AddInstance(this, mDescriptor); +} + +void ServiceWorkerRegistrationProxy::MaybeShutdownOnMainThread() { + AssertIsOnMainThread(); + + if (mDelayedUpdate) { + mDelayedUpdate->Reject(); + mDelayedUpdate = nullptr; + } + nsCOMPtr r = NewRunnableMethod( + __func__, this, &ServiceWorkerRegistrationProxy::MaybeShutdownOnBGThread); + + MOZ_ALWAYS_SUCCEEDS(mEventTarget->Dispatch(r.forget(), NS_DISPATCH_NORMAL)); +} + +void ServiceWorkerRegistrationProxy::StopListeningOnMainThread() { + AssertIsOnMainThread(); + + if (!mReg) { + return; + } + + mReg->RemoveInstance(this); + mReg = nullptr; +} + +void ServiceWorkerRegistrationProxy::UpdateState( + const ServiceWorkerRegistrationDescriptor& aDescriptor) { + AssertIsOnMainThread(); + + if (mDescriptor == aDescriptor) { + return; + } + mDescriptor = aDescriptor; + + nsCOMPtr r = + NewRunnableMethod( + __func__, this, + &ServiceWorkerRegistrationProxy::UpdateStateOnBGThread, aDescriptor); + + MOZ_ALWAYS_SUCCEEDS(mEventTarget->Dispatch(r.forget(), NS_DISPATCH_NORMAL)); +} + +void ServiceWorkerRegistrationProxy::FireUpdateFound() { + AssertIsOnMainThread(); + + nsCOMPtr r = NewRunnableMethod( + __func__, this, + &ServiceWorkerRegistrationProxy::FireUpdateFoundOnBGThread); + + MOZ_ALWAYS_SUCCEEDS(mEventTarget->Dispatch(r.forget(), NS_DISPATCH_NORMAL)); +} + +void ServiceWorkerRegistrationProxy::RegistrationCleared() { + MaybeShutdownOnMainThread(); +} + +void ServiceWorkerRegistrationProxy::GetScope(nsAString& aScope) const { + CopyUTF8toUTF16(mDescriptor.Scope(), aScope); +} + +bool ServiceWorkerRegistrationProxy::MatchesDescriptor( + const ServiceWorkerRegistrationDescriptor& aDescriptor) { + AssertIsOnMainThread(); + return aDescriptor.Id() == mDescriptor.Id() && + aDescriptor.PrincipalInfo() == mDescriptor.PrincipalInfo() && + aDescriptor.Scope() == mDescriptor.Scope(); +} + +ServiceWorkerRegistrationProxy::ServiceWorkerRegistrationProxy( + const ServiceWorkerRegistrationDescriptor& aDescriptor) + : mEventTarget(GetCurrentSerialEventTarget()), mDescriptor(aDescriptor) {} + +void ServiceWorkerRegistrationProxy::Init( + ServiceWorkerRegistrationParent* aActor) { + AssertIsOnBackgroundThread(); + MOZ_DIAGNOSTIC_ASSERT(aActor); + MOZ_DIAGNOSTIC_ASSERT(!mActor); + MOZ_DIAGNOSTIC_ASSERT(mEventTarget); + + mActor = aActor; + + // Note, this must be done from a separate Init() method and not in + // the constructor. If done from the constructor the runnable can + // execute, complete, and release its reference before the constructor + // returns. + nsCOMPtr r = + NewRunnableMethod("ServiceWorkerRegistrationProxy::Init", this, + &ServiceWorkerRegistrationProxy::InitOnMainThread); + MOZ_ALWAYS_SUCCEEDS( + SchedulerGroup::Dispatch(TaskCategory::Other, r.forget())); +} + +void ServiceWorkerRegistrationProxy::RevokeActor( + ServiceWorkerRegistrationParent* aActor) { + AssertIsOnBackgroundThread(); + MOZ_DIAGNOSTIC_ASSERT(mActor); + MOZ_DIAGNOSTIC_ASSERT(mActor == aActor); + mActor = nullptr; + + nsCOMPtr r = NewRunnableMethod( + __func__, this, + &ServiceWorkerRegistrationProxy::StopListeningOnMainThread); + MOZ_ALWAYS_SUCCEEDS( + SchedulerGroup::Dispatch(TaskCategory::Other, r.forget())); +} + +RefPtr ServiceWorkerRegistrationProxy::Unregister() { + AssertIsOnBackgroundThread(); + + RefPtr self = this; + RefPtr promise = + new GenericPromise::Private(__func__); + + nsCOMPtr r = + NS_NewRunnableFunction(__func__, [self, promise]() mutable { + nsresult rv = NS_ERROR_DOM_INVALID_STATE_ERR; + auto scopeExit = MakeScopeExit([&] { promise->Reject(rv, __func__); }); + + NS_ENSURE_TRUE_VOID(self->mReg); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + NS_ENSURE_TRUE_VOID(swm); + + RefPtr cb = new UnregisterCallback(promise); + + rv = swm->Unregister(self->mReg->Principal(), cb, + NS_ConvertUTF8toUTF16(self->mReg->Scope())); + NS_ENSURE_SUCCESS_VOID(rv); + + scopeExit.release(); + }); + + MOZ_ALWAYS_SUCCEEDS( + SchedulerGroup::Dispatch(TaskCategory::Other, r.forget())); + + return promise; +} + +namespace { + +class UpdateCallback final : public ServiceWorkerUpdateFinishCallback { + RefPtr mPromise; + + ~UpdateCallback() = default; + + public: + explicit UpdateCallback( + RefPtr&& aPromise) + : mPromise(std::move(aPromise)) { + MOZ_DIAGNOSTIC_ASSERT(mPromise); + } + + void UpdateSucceeded(ServiceWorkerRegistrationInfo* aInfo) override { + mPromise->Resolve(aInfo->Descriptor(), __func__); + } + + void UpdateFailed(ErrorResult& aResult) override { + mPromise->Reject(CopyableErrorResult(aResult), __func__); + } +}; + +} // anonymous namespace + +NS_IMPL_ISUPPORTS(ServiceWorkerRegistrationProxy::DelayedUpdate, + nsITimerCallback) + +ServiceWorkerRegistrationProxy::DelayedUpdate::DelayedUpdate( + RefPtr&& aProxy, + RefPtr&& aPromise, + nsCString&& aNewestWorkerScriptUrl, uint32_t delay) + : mProxy(std::move(aProxy)), + mPromise(std::move(aPromise)), + mNewestWorkerScriptUrl(std::move(aNewestWorkerScriptUrl)) { + MOZ_DIAGNOSTIC_ASSERT(mProxy); + MOZ_DIAGNOSTIC_ASSERT(mPromise); + MOZ_ASSERT(!mNewestWorkerScriptUrl.IsEmpty()); + mProxy->mDelayedUpdate = this; + Result, nsresult> result = + NS_NewTimerWithCallback(this, delay, nsITimer::TYPE_ONE_SHOT); + mTimer = result.unwrapOr(nullptr); + MOZ_DIAGNOSTIC_ASSERT(mTimer); +} + +void ServiceWorkerRegistrationProxy::DelayedUpdate::ChainTo( + RefPtr aPromise) { + AssertIsOnMainThread(); + MOZ_ASSERT(mProxy->mDelayedUpdate == this); + MOZ_ASSERT(mPromise); + + mPromise->ChainTo(aPromise.forget(), __func__); +} + +void ServiceWorkerRegistrationProxy::DelayedUpdate::Reject() { + MOZ_DIAGNOSTIC_ASSERT(mPromise); + if (mTimer) { + mTimer->Cancel(); + mTimer = nullptr; + } + mPromise->Reject(NS_ERROR_DOM_INVALID_STATE_ERR, __func__); +} + +void ServiceWorkerRegistrationProxy::DelayedUpdate::SetNewestWorkerScriptUrl( + nsCString&& aNewestWorkerScriptUrl) { + MOZ_ASSERT(NS_IsMainThread()); + mNewestWorkerScriptUrl = std::move(aNewestWorkerScriptUrl); +} + +NS_IMETHODIMP +ServiceWorkerRegistrationProxy::DelayedUpdate::Notify(nsITimer* aTimer) { + // Already shutting down. + if (mProxy->mDelayedUpdate != this) { + return NS_OK; + } + + auto scopeExit = MakeScopeExit( + [&] { mPromise->Reject(NS_ERROR_DOM_INVALID_STATE_ERR, __func__); }); + + NS_ENSURE_TRUE(mProxy->mReg, NS_ERROR_FAILURE); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + NS_ENSURE_TRUE(swm, NS_ERROR_FAILURE); + + RefPtr cb = new UpdateCallback(std::move(mPromise)); + swm->Update(mProxy->mReg->Principal(), mProxy->mReg->Scope(), + std::move(mNewestWorkerScriptUrl), cb); + + mTimer = nullptr; + mProxy->mDelayedUpdate = nullptr; + + scopeExit.release(); + return NS_OK; +} + +RefPtr ServiceWorkerRegistrationProxy::Update( + const nsCString& aNewestWorkerScriptUrl) { + AssertIsOnBackgroundThread(); + + RefPtr self = this; + RefPtr promise = + new ServiceWorkerRegistrationPromise::Private(__func__); + + nsCOMPtr r = NS_NewRunnableFunction( + __func__, [self, promise, + newestWorkerScriptUrl = aNewestWorkerScriptUrl]() mutable { + auto scopeExit = MakeScopeExit( + [&] { promise->Reject(NS_ERROR_DOM_INVALID_STATE_ERR, __func__); }); + + // Get the delay value for the update + NS_ENSURE_TRUE_VOID(self->mReg); + uint32_t delay = self->mReg->GetUpdateDelay(false); + + // If the delay value does not equal to 0, create a timer and a timer + // callback to perform the delayed update. Otherwise, update directly. + if (delay) { + if (self->mDelayedUpdate) { + // NOTE: if we `ChainTo(),` there will ultimately be a single + // update, and this update will resolve all promises that were + // issued while the update's timer was ticking down. + self->mDelayedUpdate->ChainTo(std::move(promise)); + + // Use the "newest newest worker"'s script URL. + self->mDelayedUpdate->SetNewestWorkerScriptUrl( + std::move(newestWorkerScriptUrl)); + } else { + RefPtr du = + new ServiceWorkerRegistrationProxy::DelayedUpdate( + std::move(self), std::move(promise), + std::move(newestWorkerScriptUrl), delay); + } + } else { + RefPtr swm = + ServiceWorkerManager::GetInstance(); + NS_ENSURE_TRUE_VOID(swm); + + RefPtr cb = new UpdateCallback(std::move(promise)); + swm->Update(self->mReg->Principal(), self->mReg->Scope(), + std::move(newestWorkerScriptUrl), cb); + } + scopeExit.release(); + }); + + MOZ_ALWAYS_SUCCEEDS( + SchedulerGroup::Dispatch(TaskCategory::Other, r.forget())); + + return promise; +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerRegistrationProxy.h b/dom/serviceworkers/ServiceWorkerRegistrationProxy.h new file mode 100644 index 0000000000..9bf9c27e56 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerRegistrationProxy.h @@ -0,0 +1,88 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef moz_dom_ServiceWorkerRegistrationProxy_h +#define moz_dom_ServiceWorkerRegistrationProxy_h + +#include "mozilla/dom/PServiceWorkerRegistrationParent.h" +#include "nsProxyRelease.h" +#include "ServiceWorkerRegistrationDescriptor.h" +#include "ServiceWorkerRegistrationListener.h" +#include "ServiceWorkerUtils.h" + +namespace mozilla { +namespace dom { + +class ServiceWorkerRegistrationInfo; +class ServiceWorkerRegistrationParent; + +class ServiceWorkerRegistrationProxy final + : public ServiceWorkerRegistrationListener { + // Background thread only + RefPtr mActor; + + // Written on background thread and read on main thread + nsCOMPtr mEventTarget; + + // Main thread only + ServiceWorkerRegistrationDescriptor mDescriptor; + nsMainThreadPtrHandle mReg; + + ~ServiceWorkerRegistrationProxy(); + + // Background thread methods + void MaybeShutdownOnBGThread(); + + void UpdateStateOnBGThread( + const ServiceWorkerRegistrationDescriptor& aDescriptor); + + void FireUpdateFoundOnBGThread(); + + // Main thread methods + void InitOnMainThread(); + + void MaybeShutdownOnMainThread(); + + void StopListeningOnMainThread(); + + // The timer callback to perform the delayed update + class DelayedUpdate; + RefPtr mDelayedUpdate; + + // ServiceWorkerRegistrationListener interface + void UpdateState( + const ServiceWorkerRegistrationDescriptor& aDescriptor) override; + + void FireUpdateFound() override; + + void RegistrationCleared() override; + + void GetScope(nsAString& aScope) const override; + + bool MatchesDescriptor( + const ServiceWorkerRegistrationDescriptor& aDescriptor) override; + + public: + explicit ServiceWorkerRegistrationProxy( + const ServiceWorkerRegistrationDescriptor& aDescriptor); + + void Init(ServiceWorkerRegistrationParent* aActor); + + void RevokeActor(ServiceWorkerRegistrationParent* aActor); + + RefPtr Unregister(); + + RefPtr Update( + const nsCString& aNewestWorkerScriptUrl); + + NS_INLINE_DECL_THREADSAFE_REFCOUNTING(ServiceWorkerRegistrationProxy, + override); +}; + +} // namespace dom +} // namespace mozilla + +#endif // moz_dom_ServiceWorkerRegistrationProxy_h diff --git a/dom/serviceworkers/ServiceWorkerScriptCache.cpp b/dom/serviceworkers/ServiceWorkerScriptCache.cpp new file mode 100644 index 0000000000..060d26da0c --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerScriptCache.cpp @@ -0,0 +1,1509 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerScriptCache.h" + +#include "js/Array.h" // JS::GetArrayLength +#include "mozilla/Unused.h" +#include "mozilla/dom/CacheBinding.h" +#include "mozilla/dom/cache/CacheStorage.h" +#include "mozilla/dom/cache/Cache.h" +#include "mozilla/dom/Promise.h" +#include "mozilla/dom/PromiseWorkerProxy.h" +#include "mozilla/dom/ScriptLoader.h" +#include "mozilla/dom/WorkerCommon.h" +#include "mozilla/ipc/BackgroundUtils.h" +#include "mozilla/ipc/PBackgroundSharedTypes.h" +#include "mozilla/net/CookieJarSettings.h" +#include "mozilla/ScopeExit.h" +#include "mozilla/StaticPrefs_extensions.h" +#include "nsICacheInfoChannel.h" +#include "nsIHttpChannel.h" +#include "nsIStreamLoader.h" +#include "nsIThreadRetargetableRequest.h" +#include "nsIUUIDGenerator.h" +#include "nsIXPConnect.h" + +#include "nsIInputStreamPump.h" +#include "nsIPrincipal.h" +#include "nsIScriptSecurityManager.h" +#include "nsContentUtils.h" +#include "nsNetUtil.h" +#include "ServiceWorkerManager.h" +#include "nsStringStream.h" + +using mozilla::dom::cache::Cache; +using mozilla::dom::cache::CacheStorage; +using mozilla::ipc::PrincipalInfo; + +namespace mozilla { +namespace dom { + +namespace serviceWorkerScriptCache { + +namespace { + +already_AddRefed CreateCacheStorage(JSContext* aCx, + nsIPrincipal* aPrincipal, + ErrorResult& aRv) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aPrincipal); + + nsIXPConnect* xpc = nsContentUtils::XPConnect(); + MOZ_ASSERT(xpc, "This should never be null!"); + JS::Rooted sandbox(aCx); + aRv = xpc->CreateSandbox(aCx, aPrincipal, sandbox.address()); + if (NS_WARN_IF(aRv.Failed())) { + return nullptr; + } + + // This is called when the JSContext is not in a realm, so CreateSandbox + // returned an unwrapped global. + MOZ_ASSERT(JS_IsGlobalObject(sandbox)); + + nsCOMPtr sandboxGlobalObject = xpc::NativeGlobal(sandbox); + if (!sandboxGlobalObject) { + aRv.Throw(NS_ERROR_FAILURE); + return nullptr; + } + + // We assume private browsing is not enabled here. The ScriptLoader + // explicitly fails for private browsing so there should never be + // a service worker running in private browsing mode. Therefore if + // we are purging scripts or running a comparison algorithm we cannot + // be in private browsing. + // + // Also, bypass the CacheStorage trusted origin checks. The ServiceWorker + // has validated the origin prior to this point. All the information + // to revalidate is not available now. + return CacheStorage::CreateOnMainThread(cache::CHROME_ONLY_NAMESPACE, + sandboxGlobalObject, aPrincipal, + true /* force trusted origin */, aRv); +} + +class CompareManager; +class CompareCache; + +// This class downloads a URL from the network, compare the downloaded script +// with an existing cache if provided, and report to CompareManager via calling +// ComparisonFinished(). +class CompareNetwork final : public nsIStreamLoaderObserver, + public nsIRequestObserver { + public: + NS_DECL_ISUPPORTS + NS_DECL_NSISTREAMLOADEROBSERVER + NS_DECL_NSIREQUESTOBSERVER + + CompareNetwork(CompareManager* aManager, + ServiceWorkerRegistrationInfo* aRegistration, + bool aIsMainScript) + : mManager(aManager), + mRegistration(aRegistration), + mInternalHeaders(new InternalHeaders()), + mLoadFlags(nsIChannel::LOAD_BYPASS_SERVICE_WORKER), + mState(WaitingForInitialization), + mNetworkResult(NS_OK), + mCacheResult(NS_OK), + mIsMainScript(aIsMainScript), + mIsFromCache(false) { + MOZ_ASSERT(aManager); + MOZ_ASSERT(NS_IsMainThread()); + } + + nsresult Initialize(nsIPrincipal* aPrincipal, const nsAString& aURL, + Cache* const aCache); + + void Abort(); + + void NetworkFinish(nsresult aRv); + + void CacheFinish(nsresult aRv); + + const nsString& URL() const { + MOZ_ASSERT(NS_IsMainThread()); + return mURL; + } + + const nsString& Buffer() const { + MOZ_ASSERT(NS_IsMainThread()); + return mBuffer; + } + + const ChannelInfo& GetChannelInfo() const { return mChannelInfo; } + + already_AddRefed GetInternalHeaders() const { + RefPtr internalHeaders = mInternalHeaders; + return internalHeaders.forget(); + } + + UniquePtr TakePrincipalInfo() { + return std::move(mPrincipalInfo); + } + + bool Succeeded() const { return NS_SUCCEEDED(mNetworkResult); } + + const nsTArray& URLList() const { return mURLList; } + + private: + ~CompareNetwork() { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(!mCC); + } + + void Finish(); + + nsresult SetPrincipalInfo(nsIChannel* aChannel); + + RefPtr mManager; + RefPtr mCC; + RefPtr mRegistration; + + nsCOMPtr mChannel; + nsString mBuffer; + nsString mURL; + ChannelInfo mChannelInfo; + RefPtr mInternalHeaders; + UniquePtr mPrincipalInfo; + nsTArray mURLList; + + nsCString mMaxScope; + nsLoadFlags mLoadFlags; + + enum { + WaitingForInitialization, + WaitingForBothFinished, + WaitingForNetworkFinished, + WaitingForCacheFinished, + Finished + } mState; + + nsresult mNetworkResult; + nsresult mCacheResult; + + const bool mIsMainScript; + bool mIsFromCache; +}; + +NS_IMPL_ISUPPORTS(CompareNetwork, nsIStreamLoaderObserver, nsIRequestObserver) + +// This class gets a cached Response from the CacheStorage and then it calls +// CacheFinish() in the CompareNetwork. +class CompareCache final : public PromiseNativeHandler, + public nsIStreamLoaderObserver { + public: + NS_DECL_ISUPPORTS + NS_DECL_NSISTREAMLOADEROBSERVER + + explicit CompareCache(CompareNetwork* aCN) + : mCN(aCN), mState(WaitingForInitialization), mInCache(false) { + MOZ_ASSERT(aCN); + MOZ_ASSERT(NS_IsMainThread()); + } + + nsresult Initialize(Cache* const aCache, const nsAString& aURL); + + void Finish(nsresult aStatus, bool aInCache); + + void Abort(); + + virtual void ResolvedCallback(JSContext* aCx, + JS::Handle aValue) override; + + virtual void RejectedCallback(JSContext* aCx, + JS::Handle aValue) override; + + const nsString& Buffer() const { + MOZ_ASSERT(NS_IsMainThread()); + return mBuffer; + } + + bool InCache() { return mInCache; } + + private: + ~CompareCache() { MOZ_ASSERT(NS_IsMainThread()); } + + void ManageValueResult(JSContext* aCx, JS::Handle aValue); + + RefPtr mCN; + nsCOMPtr mPump; + + nsString mURL; + nsString mBuffer; + + enum { + WaitingForInitialization, + WaitingForScript, + Finished, + } mState; + + bool mInCache; +}; + +NS_IMPL_ISUPPORTS(CompareCache, nsIStreamLoaderObserver) + +class CompareManager final : public PromiseNativeHandler { + public: + NS_DECL_ISUPPORTS + + explicit CompareManager(ServiceWorkerRegistrationInfo* aRegistration, + CompareCallback* aCallback) + : mRegistration(aRegistration), + mCallback(aCallback), + mLoadFlags(nsIChannel::LOAD_BYPASS_SERVICE_WORKER), + mState(WaitingForInitialization), + mPendingCount(0), + mOnFailure(OnFailure::DoNothing), + mAreScriptsEqual(true) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aRegistration); + } + + nsresult Initialize(nsIPrincipal* aPrincipal, const nsAString& aURL, + const nsAString& aCacheName); + + void ResolvedCallback(JSContext* aCx, JS::Handle aValue) override; + + void RejectedCallback(JSContext* aCx, JS::Handle aValue) override; + + CacheStorage* CacheStorage_() { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(mCacheStorage); + return mCacheStorage; + } + + void ComparisonFinished(nsresult aStatus, bool aIsMainScript, bool aIsEqual, + const nsACString& aMaxScope, nsLoadFlags aLoadFlags) { + MOZ_ASSERT(NS_IsMainThread()); + if (mState == Finished) { + return; + } + + MOZ_DIAGNOSTIC_ASSERT(mState == WaitingForScriptOrComparisonResult); + + if (NS_WARN_IF(NS_FAILED(aStatus))) { + Fail(aStatus); + return; + } + + mAreScriptsEqual = mAreScriptsEqual && aIsEqual; + + if (aIsMainScript) { + mMaxScope = aMaxScope; + mLoadFlags = aLoadFlags; + } + + // Check whether all CompareNetworks finished their jobs. + MOZ_DIAGNOSTIC_ASSERT(mPendingCount > 0); + if (--mPendingCount) { + return; + } + + if (mAreScriptsEqual) { + MOZ_ASSERT(mCallback); + mCallback->ComparisonResult(aStatus, true /* aSameScripts */, mOnFailure, + u""_ns, mMaxScope, mLoadFlags); + Cleanup(); + return; + } + + // Write to Cache so ScriptLoader reads succeed. + WriteNetworkBufferToNewCache(); + } + + private: + ~CompareManager() { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(mCNList.Length() == 0); + } + + void Fail(nsresult aStatus); + + void Cleanup(); + + nsresult FetchScript(const nsAString& aURL, bool aIsMainScript, + Cache* const aCache = nullptr) { + MOZ_ASSERT(NS_IsMainThread()); + + MOZ_DIAGNOSTIC_ASSERT(mState == WaitingForInitialization || + mState == WaitingForScriptOrComparisonResult); + + RefPtr cn = + new CompareNetwork(this, mRegistration, aIsMainScript); + mCNList.AppendElement(cn); + mPendingCount += 1; + + nsresult rv = cn->Initialize(mPrincipal, aURL, aCache); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + return NS_OK; + } + + void ManageOldCache(JSContext* aCx, JS::Handle aValue) { + MOZ_DIAGNOSTIC_ASSERT(mState == WaitingForExistingOpen); + + // RAII Cleanup when fails. + nsresult rv = NS_ERROR_FAILURE; + auto guard = MakeScopeExit([&] { Fail(rv); }); + + if (NS_WARN_IF(!aValue.isObject())) { + return; + } + + MOZ_ASSERT(!mOldCache); + JS::Rooted obj(aCx, &aValue.toObject()); + if (NS_WARN_IF(!obj) || + NS_WARN_IF(NS_FAILED(UNWRAP_OBJECT(Cache, obj, mOldCache)))) { + return; + } + + Optional request; + CacheQueryOptions options; + ErrorResult error; + RefPtr promise = mOldCache->Keys(aCx, request, options, error); + if (NS_WARN_IF(error.Failed())) { + // No exception here because there are no ReadableStreams involved here. + MOZ_ASSERT(!error.IsJSException()); + rv = error.StealNSResult(); + return; + } + + mState = WaitingForExistingKeys; + promise->AppendNativeHandler(this); + guard.release(); + } + + void ManageOldKeys(JSContext* aCx, JS::Handle aValue) { + MOZ_DIAGNOSTIC_ASSERT(mState == WaitingForExistingKeys); + + // RAII Cleanup when fails. + nsresult rv = NS_ERROR_FAILURE; + auto guard = MakeScopeExit([&] { Fail(rv); }); + + if (NS_WARN_IF(!aValue.isObject())) { + return; + } + + JS::Rooted obj(aCx, &aValue.toObject()); + if (NS_WARN_IF(!obj)) { + return; + } + + uint32_t len = 0; + if (!JS::GetArrayLength(aCx, obj, &len)) { + return; + } + + // Fetch and compare the source scripts. + MOZ_ASSERT(mPendingCount == 0); + + mState = WaitingForScriptOrComparisonResult; + + bool hasMainScript = false; + AutoTArray urlList; + + // Extract the list of URLs in the old cache. + for (uint32_t i = 0; i < len; ++i) { + JS::Rooted val(aCx); + if (NS_WARN_IF(!JS_GetElement(aCx, obj, i, &val)) || + NS_WARN_IF(!val.isObject())) { + return; + } + + Request* request; + JS::Rooted requestObj(aCx, &val.toObject()); + if (NS_WARN_IF(NS_FAILED(UNWRAP_OBJECT(Request, &requestObj, request)))) { + return; + }; + + nsString url; + request->GetUrl(url); + + if (!hasMainScript && url == mURL) { + hasMainScript = true; + } + + urlList.AppendElement(url); + } + + // If the main script is missing, then something has gone wrong. We + // will try to continue with the update process to trigger a new + // installation. If that fails, however, then uninstall the registration + // because it is broken in a way that cannot be fixed. + if (!hasMainScript) { + mOnFailure = OnFailure::Uninstall; + } + + // Always make sure to fetch the main script. If the old cache has + // no entries or the main script entry is missing, then the loop below + // may not trigger it. This should not really happen, but we handle it + // gracefully if it does occur. Its possible the bad cache state is due + // to a crash or shutdown during an update, etc. + rv = FetchScript(mURL, true /* aIsMainScript */, mOldCache); + if (NS_WARN_IF(NS_FAILED(rv))) { + return; + } + + for (const auto& url : urlList) { + // We explicitly start the fetch for the main script above. + if (mURL == url) { + continue; + } + + rv = FetchScript(url, false /* aIsMainScript */, mOldCache); + if (NS_WARN_IF(NS_FAILED(rv))) { + return; + } + } + + guard.release(); + } + + void ManageNewCache(JSContext* aCx, JS::Handle aValue) { + MOZ_DIAGNOSTIC_ASSERT(mState == WaitingForOpen); + + // RAII Cleanup when fails. + nsresult rv = NS_ERROR_FAILURE; + auto guard = MakeScopeExit([&] { Fail(rv); }); + + if (NS_WARN_IF(!aValue.isObject())) { + return; + } + + JS::Rooted obj(aCx, &aValue.toObject()); + if (NS_WARN_IF(!obj)) { + return; + } + + Cache* cache = nullptr; + rv = UNWRAP_OBJECT(Cache, &obj, cache); + if (NS_WARN_IF(NS_FAILED(rv))) { + return; + } + + // Just to be safe. + RefPtr kungfuDeathGrip = cache; + + MOZ_ASSERT(mPendingCount == 0); + for (uint32_t i = 0; i < mCNList.Length(); ++i) { + // We bail out immediately when something goes wrong. + rv = WriteToCache(aCx, cache, mCNList[i]); + if (NS_WARN_IF(NS_FAILED(rv))) { + return; + } + } + + mState = WaitingForPut; + guard.release(); + } + + void WriteNetworkBufferToNewCache() { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(mCNList.Length() != 0); + MOZ_ASSERT(mCacheStorage); + MOZ_ASSERT(mNewCacheName.IsEmpty()); + + ErrorResult result; + result = serviceWorkerScriptCache::GenerateCacheName(mNewCacheName); + if (NS_WARN_IF(result.Failed())) { + MOZ_ASSERT(!result.IsErrorWithMessage()); + Fail(result.StealNSResult()); + return; + } + + RefPtr cacheOpenPromise = + mCacheStorage->Open(mNewCacheName, result); + if (NS_WARN_IF(result.Failed())) { + MOZ_ASSERT(!result.IsErrorWithMessage()); + Fail(result.StealNSResult()); + return; + } + + mState = WaitingForOpen; + cacheOpenPromise->AppendNativeHandler(this); + } + + nsresult WriteToCache(JSContext* aCx, Cache* aCache, CompareNetwork* aCN) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aCache); + MOZ_ASSERT(aCN); + MOZ_DIAGNOSTIC_ASSERT(mState == WaitingForOpen); + + // We don't have to save any information from a failed CompareNetwork. + if (!aCN->Succeeded()) { + return NS_OK; + } + + nsCOMPtr body; + nsresult rv = NS_NewCStringInputStream( + getter_AddRefs(body), NS_ConvertUTF16toUTF8(aCN->Buffer())); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + RefPtr ir = new InternalResponse(200, "OK"_ns); + ir->SetBody(body, aCN->Buffer().Length()); + ir->SetURLList(aCN->URLList()); + + ir->InitChannelInfo(aCN->GetChannelInfo()); + UniquePtr principalInfo = aCN->TakePrincipalInfo(); + if (principalInfo) { + ir->SetPrincipalInfo(std::move(principalInfo)); + } + + RefPtr internalHeaders = aCN->GetInternalHeaders(); + ir->Headers()->Fill(*(internalHeaders.get()), IgnoreErrors()); + + RefPtr response = + new Response(aCache->GetGlobalObject(), ir, nullptr); + + RequestOrUSVString request; + request.SetAsUSVString().ShareOrDependUpon(aCN->URL()); + + // For now we have to wait until the Put Promise is fulfilled before we can + // continue since Cache does not yet support starting a read that is being + // written to. + ErrorResult result; + RefPtr cachePromise = aCache->Put(aCx, request, *response, result); + result.WouldReportJSException(); + if (NS_WARN_IF(result.Failed())) { + // No exception here because there are no ReadableStreams involved here. + MOZ_ASSERT(!result.IsJSException()); + MOZ_ASSERT(!result.IsErrorWithMessage()); + return result.StealNSResult(); + } + + mPendingCount += 1; + cachePromise->AppendNativeHandler(this); + return NS_OK; + } + + RefPtr mRegistration; + RefPtr mCallback; + RefPtr mCacheStorage; + + nsTArray> mCNList; + + nsString mURL; + RefPtr mPrincipal; + + // Used for the old cache where saves the old source scripts. + RefPtr mOldCache; + + // Only used if the network script has changed and needs to be cached. + nsString mNewCacheName; + + nsCString mMaxScope; + nsLoadFlags mLoadFlags; + + enum { + WaitingForInitialization, + WaitingForExistingOpen, + WaitingForExistingKeys, + WaitingForScriptOrComparisonResult, + WaitingForOpen, + WaitingForPut, + Finished + } mState; + + uint32_t mPendingCount; + OnFailure mOnFailure; + bool mAreScriptsEqual; +}; + +NS_IMPL_ISUPPORTS0(CompareManager) + +nsresult CompareNetwork::Initialize(nsIPrincipal* aPrincipal, + const nsAString& aURL, + Cache* const aCache) { + MOZ_ASSERT(aPrincipal); + MOZ_ASSERT(NS_IsMainThread()); + + nsCOMPtr uri; + nsresult rv = NS_NewURI(getter_AddRefs(uri), aURL); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + mURL = aURL; + mURLList.AppendElement(NS_ConvertUTF16toUTF8(mURL)); + + nsCOMPtr loadGroup; + rv = NS_NewLoadGroup(getter_AddRefs(loadGroup), aPrincipal); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + // Update LoadFlags for propagating to ServiceWorkerInfo. + mLoadFlags = nsIChannel::LOAD_BYPASS_SERVICE_WORKER; + + ServiceWorkerUpdateViaCache uvc = mRegistration->GetUpdateViaCache(); + if (uvc == ServiceWorkerUpdateViaCache::None || + (uvc == ServiceWorkerUpdateViaCache::Imports && mIsMainScript)) { + mLoadFlags |= nsIRequest::VALIDATE_ALWAYS; + } + + if (mRegistration->IsLastUpdateCheckTimeOverOneDay()) { + mLoadFlags |= nsIRequest::LOAD_BYPASS_CACHE; + } + + // Different settings are needed for fetching imported scripts, since they + // might be cross-origin scripts. + uint32_t secFlags = + mIsMainScript ? nsILoadInfo::SEC_REQUIRE_SAME_ORIGIN_DATA_IS_BLOCKED + : nsILoadInfo::SEC_ALLOW_CROSS_ORIGIN_INHERITS_SEC_CONTEXT; + + nsContentPolicyType contentPolicyType = + mIsMainScript ? nsIContentPolicy::TYPE_INTERNAL_SERVICE_WORKER + : nsIContentPolicy::TYPE_INTERNAL_WORKER_IMPORT_SCRIPTS; + + // Create a new cookieJarSettings. + nsCOMPtr cookieJarSettings = + mozilla::net::CookieJarSettings::Create(); + + net::CookieJarSettings::Cast(cookieJarSettings)->SetPartitionKey(uri); + + // Note that because there is no "serviceworker" RequestContext type, we can + // use the TYPE_INTERNAL_SCRIPT content policy types when loading a service + // worker. + rv = NS_NewChannel(getter_AddRefs(mChannel), uri, aPrincipal, secFlags, + contentPolicyType, cookieJarSettings, + nullptr /* aPerformanceStorage */, loadGroup, + nullptr /* aCallbacks */, mLoadFlags); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + nsCOMPtr httpChannel = do_QueryInterface(mChannel); + if (httpChannel) { + // Spec says no redirects allowed for top-level SW scripts. + if (mIsMainScript) { + rv = httpChannel->SetRedirectionLimit(0); + MOZ_ASSERT(NS_SUCCEEDED(rv)); + } + + rv = httpChannel->SetRequestHeader("Service-Worker"_ns, "script"_ns, + /* merge */ false); + MOZ_ASSERT(NS_SUCCEEDED(rv)); + } + + nsCOMPtr loader; + rv = NS_NewStreamLoader(getter_AddRefs(loader), this, this); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + rv = mChannel->AsyncOpen(loader); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + // If we do have an existing cache to compare with. + if (aCache) { + mCC = new CompareCache(this); + rv = mCC->Initialize(aCache, aURL); + if (NS_WARN_IF(NS_FAILED(rv))) { + Abort(); + return rv; + } + + mState = WaitingForBothFinished; + return NS_OK; + } + + mState = WaitingForNetworkFinished; + return NS_OK; +} + +void CompareNetwork::Finish() { + if (mState == Finished) { + return; + } + + bool same = true; + nsresult rv = NS_OK; + + // mNetworkResult is prior to mCacheResult, since it's needed for reporting + // various errors to web content. + if (NS_FAILED(mNetworkResult)) { + // An imported script could become offline, since it might no longer be + // needed by the new importing script. In that case, the importing script + // must be different, and thus, it's okay to report same script found here. + rv = mIsMainScript ? mNetworkResult : NS_OK; + same = true; + } else if (mCC && NS_FAILED(mCacheResult)) { + rv = mCacheResult; + } else { // Both passed. + same = mCC && mCC->InCache() && mCC->Buffer().Equals(mBuffer); + } + + mManager->ComparisonFinished(rv, mIsMainScript, same, mMaxScope, mLoadFlags); + + // We have done with the CompareCache. + mCC = nullptr; +} + +void CompareNetwork::NetworkFinish(nsresult aRv) { + MOZ_DIAGNOSTIC_ASSERT(mState == WaitingForBothFinished || + mState == WaitingForNetworkFinished); + + mNetworkResult = aRv; + + if (mState == WaitingForBothFinished) { + mState = WaitingForCacheFinished; + return; + } + + if (mState == WaitingForNetworkFinished) { + Finish(); + return; + } +} + +void CompareNetwork::CacheFinish(nsresult aRv) { + MOZ_DIAGNOSTIC_ASSERT(mState == WaitingForBothFinished || + mState == WaitingForCacheFinished); + + mCacheResult = aRv; + + if (mState == WaitingForBothFinished) { + mState = WaitingForNetworkFinished; + return; + } + + if (mState == WaitingForCacheFinished) { + Finish(); + return; + } +} + +void CompareNetwork::Abort() { + MOZ_ASSERT(NS_IsMainThread()); + + if (mState != Finished) { + mState = Finished; + + MOZ_ASSERT(mChannel); + mChannel->Cancel(NS_BINDING_ABORTED); + mChannel = nullptr; + + if (mCC) { + mCC->Abort(); + mCC = nullptr; + } + } +} + +NS_IMETHODIMP +CompareNetwork::OnStartRequest(nsIRequest* aRequest) { + MOZ_ASSERT(NS_IsMainThread()); + + if (mState == Finished) { + return NS_OK; + } + + nsCOMPtr channel = do_QueryInterface(aRequest); + MOZ_ASSERT_IF(mIsMainScript, channel == mChannel); + mChannel = channel; + + MOZ_ASSERT(!mChannelInfo.IsInitialized()); + mChannelInfo.InitFromChannel(mChannel); + + nsresult rv = SetPrincipalInfo(mChannel); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + mInternalHeaders->FillResponseHeaders(mChannel); + + nsCOMPtr cacheChannel(do_QueryInterface(channel)); + if (cacheChannel) { + cacheChannel->IsFromCache(&mIsFromCache); + } + + return NS_OK; +} + +nsresult CompareNetwork::SetPrincipalInfo(nsIChannel* aChannel) { + nsIScriptSecurityManager* ssm = nsContentUtils::GetSecurityManager(); + if (!ssm) { + return NS_ERROR_FAILURE; + } + + nsCOMPtr channelPrincipal; + nsresult rv = ssm->GetChannelResultPrincipal( + aChannel, getter_AddRefs(channelPrincipal)); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + UniquePtr principalInfo = MakeUnique(); + rv = PrincipalToPrincipalInfo(channelPrincipal, principalInfo.get()); + + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + mPrincipalInfo = std::move(principalInfo); + return NS_OK; +} + +NS_IMETHODIMP +CompareNetwork::OnStopRequest(nsIRequest* aRequest, nsresult aStatusCode) { + // Nothing to do here! + return NS_OK; +} + +NS_IMETHODIMP +CompareNetwork::OnStreamComplete(nsIStreamLoader* aLoader, + nsISupports* aContext, nsresult aStatus, + uint32_t aLen, const uint8_t* aString) { + MOZ_ASSERT(NS_IsMainThread()); + + if (mState == Finished) { + return NS_OK; + } + + nsresult rv = NS_ERROR_FAILURE; + auto guard = MakeScopeExit([&] { NetworkFinish(rv); }); + + if (NS_WARN_IF(NS_FAILED(aStatus))) { + rv = (aStatus == NS_ERROR_REDIRECT_LOOP) ? NS_ERROR_DOM_SECURITY_ERR + : aStatus; + return NS_OK; + } + + nsCOMPtr request; + rv = aLoader->GetRequest(getter_AddRefs(request)); + if (NS_WARN_IF(NS_FAILED(rv))) { + return NS_OK; + } + + nsCOMPtr channel = do_QueryInterface(request); + MOZ_ASSERT(channel, "How come we don't have any channel?"); + + nsCOMPtr uri; + channel->GetOriginalURI(getter_AddRefs(uri)); + bool isExtension = uri->SchemeIs("moz-extension"); + + if (isExtension && + !StaticPrefs::extensions_backgroundServiceWorker_enabled_AtStartup()) { + // Return earlier with error is the worker script is a moz-extension url + // but the feature isn't enabled by prefs. + return NS_ERROR_FAILURE; + } + + if (isExtension) { + // NOTE: trying to register any moz-extension use that doesn't ends + // with .js/.jsm/.mjs seems to be already completing with an error + // in aStatus and they never reach this point. + + // TODO: look into avoid duplicated parts that could be shared with the HTTP + // channel scenario. + nsCOMPtr channelURL; + rv = channel->GetURI(getter_AddRefs(channelURL)); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + nsCString channelURLSpec; + MOZ_ALWAYS_SUCCEEDS(channelURL->GetSpec(channelURLSpec)); + + // Append the final URL (which for an extension worker script is going to + // be a file or jar url). + MOZ_DIAGNOSTIC_ASSERT(!mURLList.IsEmpty()); + if (channelURLSpec != mURLList[0]) { + mURLList.AppendElement(channelURLSpec); + } + + char16_t* buffer = nullptr; + size_t len = 0; + + rv = ScriptLoader::ConvertToUTF16(channel, aString, aLen, u"UTF-8"_ns, + nullptr, buffer, len); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + mBuffer.Adopt(buffer, len); + + rv = NS_OK; + return NS_OK; + } + + nsCOMPtr httpChannel = do_QueryInterface(request); + + // Main scripts cannot be redirected successfully, however extensions + // may successfuly redirect imported scripts to a moz-extension url + // (if listed in the web_accessible_resources manifest property). + // + // When the service worker is initially registered the imported scripts + // will be loaded from the child process (see dom/workers/ScriptLoader.cpp) + // and in that case this method will only be called for the main script. + // + // When a registered worker is loaded again (e.g. when the webpage calls + // the ServiceWorkerRegistration's update method): + // + // - both the main and imported scripts are loaded by the + // CompareManager::FetchScript + // - the update requests for the imported scripts will also be calling this + // method and we should expect scripts redirected to an extension script + // to have a null httpChannel. + // + // The request that triggers this method is: + // + // - the one that is coming from the network (which may be intercepted by + // WebRequest listeners in extensions and redirected to a web_accessible + // moz-extension url) + // - it will then be compared with a previous response that we may have + // in the cache + // + // When the next service worker update occurs, if the request (for an imported + // script) is not redirected by an extension the cache entry is invalidated + // and a network request is triggered for the import. + if (!httpChannel) { + // Redirecting a service worker main script should fail before reaching this + // method. + // If a main script is somehow redirected, the diagnostic assert will crash + // in non-release builds. Release builds will return an explicit error. + MOZ_DIAGNOSTIC_ASSERT(!mIsMainScript, + "Unexpected ServiceWorker main script redirected"); + if (mIsMainScript) { + return NS_ERROR_UNEXPECTED; + } + + nsCOMPtr channelPrincipal; + + nsIScriptSecurityManager* ssm = nsContentUtils::GetSecurityManager(); + if (!ssm) { + return NS_ERROR_UNEXPECTED; + } + + nsresult rv = ssm->GetChannelResultPrincipal( + channel, getter_AddRefs(channelPrincipal)); + + // An extension did redirect a non-MainScript request to a moz-extension url + // (in that case the originalURL is the resolved jar URI and so we have to + // look to the channel principal instead). + if (channelPrincipal->SchemeIs("moz-extension")) { + char16_t* buffer = nullptr; + size_t len = 0; + + rv = ScriptLoader::ConvertToUTF16(channel, aString, aLen, u"UTF-8"_ns, + nullptr, buffer, len); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + mBuffer.Adopt(buffer, len); + + return NS_OK; + } + + // Make non-release and debug builds to crash if this happens and fail + // explicitly on release builds. + MOZ_DIAGNOSTIC_ASSERT(false, + "ServiceWorker imported script redirected to an url " + "with an unexpected scheme"); + return NS_ERROR_UNEXPECTED; + } + + bool requestSucceeded; + rv = httpChannel->GetRequestSucceeded(&requestSucceeded); + if (NS_WARN_IF(NS_FAILED(rv))) { + return NS_OK; + } + + if (NS_WARN_IF(!requestSucceeded)) { + // Get the stringified numeric status code, not statusText which could be + // something misleading like OK for a 404. + uint32_t status = 0; + Unused << httpChannel->GetResponseStatus( + &status); // don't care if this fails, use 0. + nsAutoString statusAsText; + statusAsText.AppendInt(status); + + ServiceWorkerManager::LocalizeAndReportToAllClients( + mRegistration->Scope(), "ServiceWorkerRegisterNetworkError", + nsTArray{NS_ConvertUTF8toUTF16(mRegistration->Scope()), + statusAsText, mURL}); + + rv = NS_ERROR_FAILURE; + return NS_OK; + } + + // Note: we explicitly don't check for the return value here, because the + // absence of the header is not an error condition. + Unused << httpChannel->GetResponseHeader("Service-Worker-Allowed"_ns, + mMaxScope); + + // [9.2 Update]4.13, If response's cache state is not "local", + // set registration's last update check time to the current time + if (!mIsFromCache) { + mRegistration->RefreshLastUpdateCheckTime(); + } + + nsAutoCString mimeType; + rv = httpChannel->GetContentType(mimeType); + if (NS_WARN_IF(NS_FAILED(rv))) { + // We should only end up here if !mResponseHead in the channel. If headers + // were received but no content type was specified, we'll be given + // UNKNOWN_CONTENT_TYPE "application/x-unknown-content-type" and so fall + // into the next case with its better error message. + rv = NS_ERROR_DOM_SECURITY_ERR; + return rv; + } + + if (mimeType.IsEmpty() || + !nsContentUtils::IsJavascriptMIMEType(NS_ConvertUTF8toUTF16(mimeType))) { + ServiceWorkerManager::LocalizeAndReportToAllClients( + mRegistration->Scope(), "ServiceWorkerRegisterMimeTypeError2", + nsTArray{NS_ConvertUTF8toUTF16(mRegistration->Scope()), + NS_ConvertUTF8toUTF16(mimeType), mURL}); + rv = NS_ERROR_DOM_SECURITY_ERR; + return rv; + } + + nsCOMPtr channelURL; + rv = httpChannel->GetURI(getter_AddRefs(channelURL)); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + nsCString channelURLSpec; + MOZ_ALWAYS_SUCCEEDS(channelURL->GetSpec(channelURLSpec)); + + // Append the final URL if its different from the original + // request URL. This lets us note that a redirect occurred + // even though we don't track every redirect URL here. + MOZ_DIAGNOSTIC_ASSERT(!mURLList.IsEmpty()); + if (channelURLSpec != mURLList[0]) { + mURLList.AppendElement(channelURLSpec); + } + + char16_t* buffer = nullptr; + size_t len = 0; + + rv = ScriptLoader::ConvertToUTF16(httpChannel, aString, aLen, u"UTF-8"_ns, + nullptr, buffer, len); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + mBuffer.Adopt(buffer, len); + + rv = NS_OK; + return NS_OK; +} + +nsresult CompareCache::Initialize(Cache* const aCache, const nsAString& aURL) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aCache); + MOZ_DIAGNOSTIC_ASSERT(mState == WaitingForInitialization); + + // This JSContext will not end up executing JS code because here there are + // no ReadableStreams involved. + AutoJSAPI jsapi; + jsapi.Init(); + + RequestOrUSVString request; + request.SetAsUSVString().ShareOrDependUpon(aURL); + ErrorResult error; + CacheQueryOptions params; + RefPtr promise = aCache->Match(jsapi.cx(), request, params, error); + if (NS_WARN_IF(error.Failed())) { + // No exception here because there are no ReadableStreams involved here. + MOZ_ASSERT(!error.IsJSException()); + mState = Finished; + return error.StealNSResult(); + } + + // Retrieve the script from aCache. + mState = WaitingForScript; + promise->AppendNativeHandler(this); + return NS_OK; +} + +void CompareCache::Finish(nsresult aStatus, bool aInCache) { + if (mState != Finished) { + mState = Finished; + mInCache = aInCache; + mCN->CacheFinish(aStatus); + } +} + +void CompareCache::Abort() { + MOZ_ASSERT(NS_IsMainThread()); + + if (mState != Finished) { + mState = Finished; + + if (mPump) { + mPump->Cancel(NS_BINDING_ABORTED); + mPump = nullptr; + } + } +} + +NS_IMETHODIMP +CompareCache::OnStreamComplete(nsIStreamLoader* aLoader, nsISupports* aContext, + nsresult aStatus, uint32_t aLen, + const uint8_t* aString) { + MOZ_ASSERT(NS_IsMainThread()); + + if (mState == Finished) { + return aStatus; + } + + if (NS_WARN_IF(NS_FAILED(aStatus))) { + Finish(aStatus, false); + return aStatus; + } + + char16_t* buffer = nullptr; + size_t len = 0; + + nsresult rv = ScriptLoader::ConvertToUTF16(nullptr, aString, aLen, + u"UTF-8"_ns, nullptr, buffer, len); + if (NS_WARN_IF(NS_FAILED(rv))) { + Finish(rv, false); + return rv; + } + + mBuffer.Adopt(buffer, len); + + Finish(NS_OK, true); + return NS_OK; +} + +void CompareCache::ResolvedCallback(JSContext* aCx, + JS::Handle aValue) { + MOZ_ASSERT(NS_IsMainThread()); + + switch (mState) { + case Finished: + return; + case WaitingForScript: + ManageValueResult(aCx, aValue); + return; + default: + MOZ_CRASH("Unacceptable state."); + } +} + +void CompareCache::RejectedCallback(JSContext* aCx, + JS::Handle aValue) { + MOZ_ASSERT(NS_IsMainThread()); + + if (mState != Finished) { + Finish(NS_ERROR_FAILURE, false); + return; + } +} + +void CompareCache::ManageValueResult(JSContext* aCx, + JS::Handle aValue) { + MOZ_ASSERT(NS_IsMainThread()); + + // The cache returns undefined if the object is not stored. + if (aValue.isUndefined()) { + Finish(NS_OK, false); + return; + } + + MOZ_ASSERT(aValue.isObject()); + + JS::Rooted obj(aCx, &aValue.toObject()); + if (NS_WARN_IF(!obj)) { + Finish(NS_ERROR_FAILURE, false); + return; + } + + Response* response = nullptr; + nsresult rv = UNWRAP_OBJECT(Response, &obj, response); + if (NS_WARN_IF(NS_FAILED(rv))) { + Finish(rv, false); + return; + } + + MOZ_ASSERT(response->Ok()); + + nsCOMPtr inputStream; + response->GetBody(getter_AddRefs(inputStream)); + MOZ_ASSERT(inputStream); + + MOZ_ASSERT(!mPump); + rv = NS_NewInputStreamPump(getter_AddRefs(mPump), inputStream.forget(), + 0, /* default segsize */ + 0, /* default segcount */ + false, /* default closeWhenDone */ + GetMainThreadSerialEventTarget()); + if (NS_WARN_IF(NS_FAILED(rv))) { + Finish(rv, false); + return; + } + + nsCOMPtr loader; + rv = NS_NewStreamLoader(getter_AddRefs(loader), this); + if (NS_WARN_IF(NS_FAILED(rv))) { + Finish(rv, false); + return; + } + + rv = mPump->AsyncRead(loader); + if (NS_WARN_IF(NS_FAILED(rv))) { + mPump = nullptr; + Finish(rv, false); + return; + } + + nsCOMPtr rr = do_QueryInterface(mPump); + if (rr) { + nsCOMPtr sts = + do_GetService(NS_STREAMTRANSPORTSERVICE_CONTRACTID); + rv = rr->RetargetDeliveryTo(sts); + if (NS_WARN_IF(NS_FAILED(rv))) { + mPump = nullptr; + Finish(rv, false); + return; + } + } +} + +nsresult CompareManager::Initialize(nsIPrincipal* aPrincipal, + const nsAString& aURL, + const nsAString& aCacheName) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aPrincipal); + MOZ_ASSERT(mPendingCount == 0); + MOZ_DIAGNOSTIC_ASSERT(mState == WaitingForInitialization); + + // RAII Cleanup when fails. + auto guard = MakeScopeExit([&] { Cleanup(); }); + + mURL = aURL; + mPrincipal = aPrincipal; + + // Always create a CacheStorage since we want to write the network entry to + // the cache even if there isn't an existing one. + AutoJSAPI jsapi; + jsapi.Init(); + ErrorResult result; + mCacheStorage = CreateCacheStorage(jsapi.cx(), aPrincipal, result); + if (NS_WARN_IF(result.Failed())) { + MOZ_ASSERT(!result.IsErrorWithMessage()); + return result.StealNSResult(); + } + + // If there is no existing cache, proceed to fetch the script directly. + if (aCacheName.IsEmpty()) { + mState = WaitingForScriptOrComparisonResult; + nsresult rv = FetchScript(aURL, true /* aIsMainScript */); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + guard.release(); + return NS_OK; + } + + // Open the cache saving the old source scripts. + RefPtr promise = mCacheStorage->Open(aCacheName, result); + if (NS_WARN_IF(result.Failed())) { + MOZ_ASSERT(!result.IsErrorWithMessage()); + return result.StealNSResult(); + } + + mState = WaitingForExistingOpen; + promise->AppendNativeHandler(this); + + guard.release(); + return NS_OK; +} + +// This class manages 4 promises if needed: +// 1. Retrieve the Cache object by a given CacheName of OldCache. +// 2. Retrieve the URLs saved in OldCache. +// 3. Retrieve the Cache object of the NewCache for the newly created SW. +// 4. Put the value in the cache. +// For this reason we have mState to know what callback we are handling. +void CompareManager::ResolvedCallback(JSContext* aCx, + JS::Handle aValue) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(mCallback); + + switch (mState) { + case Finished: + return; + case WaitingForExistingOpen: + ManageOldCache(aCx, aValue); + return; + case WaitingForExistingKeys: + ManageOldKeys(aCx, aValue); + return; + case WaitingForOpen: + ManageNewCache(aCx, aValue); + return; + case WaitingForPut: + MOZ_DIAGNOSTIC_ASSERT(mPendingCount > 0); + if (--mPendingCount == 0) { + mCallback->ComparisonResult(NS_OK, false /* aIsEqual */, mOnFailure, + mNewCacheName, mMaxScope, mLoadFlags); + Cleanup(); + } + return; + default: + MOZ_DIAGNOSTIC_ASSERT(false); + } +} + +void CompareManager::RejectedCallback(JSContext* aCx, + JS::Handle aValue) { + MOZ_ASSERT(NS_IsMainThread()); + switch (mState) { + case Finished: + return; + case WaitingForExistingOpen: + NS_WARNING("Could not open the existing cache."); + break; + case WaitingForExistingKeys: + NS_WARNING("Could not get the existing URLs."); + break; + case WaitingForOpen: + NS_WARNING("Could not open cache."); + break; + case WaitingForPut: + NS_WARNING("Could not write to cache."); + break; + default: + MOZ_DIAGNOSTIC_ASSERT(false); + } + + Fail(NS_ERROR_FAILURE); +} + +void CompareManager::Fail(nsresult aStatus) { + MOZ_ASSERT(NS_IsMainThread()); + mCallback->ComparisonResult(aStatus, false /* aIsEqual */, mOnFailure, u""_ns, + ""_ns, mLoadFlags); + Cleanup(); +} + +void CompareManager::Cleanup() { + MOZ_ASSERT(NS_IsMainThread()); + + if (mState != Finished) { + mState = Finished; + + MOZ_ASSERT(mCallback); + mCallback = nullptr; + + // Abort and release CompareNetworks. + for (uint32_t i = 0; i < mCNList.Length(); ++i) { + mCNList[i]->Abort(); + } + mCNList.Clear(); + } +} + +class NoopPromiseHandler final : public PromiseNativeHandler { + public: + NS_DECL_ISUPPORTS + + NoopPromiseHandler() { AssertIsOnMainThread(); } + + void ResolvedCallback(JSContext* aCx, JS::Handle aValue) override { + } + void RejectedCallback(JSContext* aCx, JS::Handle aValue) override { + } + + private: + ~NoopPromiseHandler() { AssertIsOnMainThread(); } +}; + +NS_IMPL_ISUPPORTS0(NoopPromiseHandler) + +} // namespace + +nsresult PurgeCache(nsIPrincipal* aPrincipal, const nsAString& aCacheName) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aPrincipal); + + if (aCacheName.IsEmpty()) { + return NS_OK; + } + + AutoJSAPI jsapi; + jsapi.Init(); + ErrorResult rv; + RefPtr cacheStorage = + CreateCacheStorage(jsapi.cx(), aPrincipal, rv); + if (NS_WARN_IF(rv.Failed())) { + return rv.StealNSResult(); + } + + // We use the ServiceWorker scope as key for the cacheStorage. + RefPtr promise = cacheStorage->Delete(aCacheName, rv); + if (NS_WARN_IF(rv.Failed())) { + return rv.StealNSResult(); + } + + // Add a no-op promise handler to ensure that if this promise gets rejected, + // we don't end up reporting a rejected promise to the console. + RefPtr promiseHandler = new NoopPromiseHandler(); + promise->AppendNativeHandler(promiseHandler); + + // We don't actually care about the result of the delete operation. + return NS_OK; +} + +nsresult GenerateCacheName(nsAString& aName) { + nsresult rv; + nsCOMPtr uuidGenerator = + do_GetService("@mozilla.org/uuid-generator;1", &rv); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + nsID id; + rv = uuidGenerator->GenerateUUIDInPlace(&id); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + char chars[NSID_LENGTH]; + id.ToProvidedString(chars); + + // NSID_LENGTH counts the null terminator. + aName.AssignASCII(chars, NSID_LENGTH - 1); + + return NS_OK; +} + +nsresult Compare(ServiceWorkerRegistrationInfo* aRegistration, + nsIPrincipal* aPrincipal, const nsAString& aCacheName, + const nsAString& aURL, CompareCallback* aCallback) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aRegistration); + MOZ_ASSERT(aPrincipal); + MOZ_ASSERT(!aURL.IsEmpty()); + MOZ_ASSERT(aCallback); + + RefPtr cm = new CompareManager(aRegistration, aCallback); + + nsresult rv = cm->Initialize(aPrincipal, aURL, aCacheName); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + return NS_OK; +} + +} // namespace serviceWorkerScriptCache + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerScriptCache.h b/dom/serviceworkers/ServiceWorkerScriptCache.h new file mode 100644 index 0000000000..034f2a1022 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerScriptCache.h @@ -0,0 +1,56 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_ServiceWorkerScriptCache_h +#define mozilla_dom_ServiceWorkerScriptCache_h + +#include "nsIRequest.h" +#include "nsISupportsImpl.h" +#include "nsString.h" + +class nsILoadGroup; +class nsIPrincipal; + +namespace mozilla { +namespace dom { + +class ServiceWorkerRegistrationInfo; + +namespace serviceWorkerScriptCache { + +nsresult PurgeCache(nsIPrincipal* aPrincipal, const nsAString& aCacheName); + +nsresult GenerateCacheName(nsAString& aName); + +enum class OnFailure : uint8_t { DoNothing, Uninstall }; + +class CompareCallback { + public: + /* + * If there is an error, ignore aInCacheAndEqual and aNewCacheName. + * On success, if the cached result and network result matched, + * aInCacheAndEqual will be true and no new cache name is passed, otherwise + * use the new cache name to load the ServiceWorker. + */ + virtual void ComparisonResult(nsresult aStatus, bool aInCacheAndEqual, + OnFailure aOnFailure, + const nsAString& aNewCacheName, + const nsACString& aMaxScope, + nsLoadFlags aLoadFlags) = 0; + + NS_INLINE_DECL_PURE_VIRTUAL_REFCOUNTING +}; + +nsresult Compare(ServiceWorkerRegistrationInfo* aRegistration, + nsIPrincipal* aPrincipal, const nsAString& aCacheName, + const nsAString& aURL, CompareCallback* aCallback); + +} // namespace serviceWorkerScriptCache + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_ServiceWorkerScriptCache_h diff --git a/dom/serviceworkers/ServiceWorkerShutdownBlocker.cpp b/dom/serviceworkers/ServiceWorkerShutdownBlocker.cpp new file mode 100644 index 0000000000..2aa19653ec --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerShutdownBlocker.cpp @@ -0,0 +1,286 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerShutdownBlocker.h" + +#include +#include + +#include "MainThreadUtils.h" +#include "nsComponentManagerUtils.h" +#include "nsDebug.h" +#include "nsError.h" +#include "nsIWritablePropertyBag2.h" +#include "nsThreadUtils.h" +#include "ServiceWorkerManager.h" + +#include "mozilla/Assertions.h" +#include "mozilla/RefPtr.h" + +namespace mozilla { +namespace dom { + +NS_IMPL_ISUPPORTS(ServiceWorkerShutdownBlocker, nsIAsyncShutdownBlocker) + +NS_IMETHODIMP ServiceWorkerShutdownBlocker::GetName(nsAString& aNameOut) { + aNameOut = nsLiteralString( + u"ServiceWorkerShutdownBlocker: shutting down Service Workers"); + return NS_OK; +} + +NS_IMETHODIMP +ServiceWorkerShutdownBlocker::BlockShutdown(nsIAsyncShutdownClient* aClient) { + AssertIsOnMainThread(); + MOZ_ASSERT(!mShutdownClient); + MOZ_ASSERT(mServiceWorkerManager); + + mShutdownClient = aClient; + + (*mServiceWorkerManager)->MaybeStartShutdown(); + mServiceWorkerManager.destroy(); + + MaybeUnblockShutdown(); + MaybeInitUnblockShutdownTimer(); + + return NS_OK; +} + +NS_IMETHODIMP ServiceWorkerShutdownBlocker::GetState(nsIPropertyBag** aBagOut) { + AssertIsOnMainThread(); + MOZ_ASSERT(aBagOut); + + nsCOMPtr propertyBag = + do_CreateInstance("@mozilla.org/hash-property-bag;1"); + + if (NS_WARN_IF(!propertyBag)) { + return NS_ERROR_OUT_OF_MEMORY; + } + + nsresult rv = propertyBag->SetPropertyAsBool(u"acceptingPromises"_ns, + IsAcceptingPromises()); + + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + rv = propertyBag->SetPropertyAsUint32(u"pendingPromises"_ns, + GetPendingPromises()); + + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + nsAutoCString shutdownStates; + + for (auto iter = mShutdownStates.iter(); !iter.done(); iter.next()) { + shutdownStates.Append(iter.get().value().GetProgressString()); + shutdownStates.Append(", "); + } + + rv = propertyBag->SetPropertyAsACString(u"shutdownStates"_ns, shutdownStates); + + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + + propertyBag.forget(aBagOut); + + return NS_OK; +} + +/* static */ already_AddRefed +ServiceWorkerShutdownBlocker::CreateAndRegisterOn( + nsIAsyncShutdownClient& aShutdownBarrier, + ServiceWorkerManager& aServiceWorkerManager) { + AssertIsOnMainThread(); + + RefPtr blocker = + new ServiceWorkerShutdownBlocker(aServiceWorkerManager); + + nsresult rv = aShutdownBarrier.AddBlocker( + blocker.get(), NS_LITERAL_STRING_FROM_CSTRING(__FILE__), __LINE__, + u"Service Workers shutdown"_ns); + + if (NS_WARN_IF(NS_FAILED(rv))) { + return nullptr; + } + + return blocker.forget(); +} + +void ServiceWorkerShutdownBlocker::WaitOnPromise( + GenericNonExclusivePromise* aPromise, uint32_t aShutdownStateId) { + AssertIsOnMainThread(); + MOZ_DIAGNOSTIC_ASSERT(IsAcceptingPromises()); + MOZ_ASSERT(aPromise); + MOZ_ASSERT(mShutdownStates.has(aShutdownStateId)); + + ++mState.as().mPendingPromises; + + RefPtr self = this; + + aPromise->Then(GetCurrentSerialEventTarget(), __func__, + [self = std::move(self), shutdownStateId = aShutdownStateId]( + const GenericNonExclusivePromise::ResolveOrRejectValue&) { + // Progress reporting might race with aPromise settling. + self->mShutdownStates.remove(shutdownStateId); + + if (!self->PromiseSettled()) { + self->MaybeUnblockShutdown(); + } + }); +} + +void ServiceWorkerShutdownBlocker::StopAcceptingPromises() { + AssertIsOnMainThread(); + MOZ_ASSERT(IsAcceptingPromises()); + + mState = AsVariant(NotAcceptingPromises(mState.as())); + + MaybeUnblockShutdown(); + MaybeInitUnblockShutdownTimer(); +} + +uint32_t ServiceWorkerShutdownBlocker::CreateShutdownState() { + AssertIsOnMainThread(); + + static uint32_t nextShutdownStateId = 1; + + MOZ_ALWAYS_TRUE(mShutdownStates.putNew(nextShutdownStateId, + ServiceWorkerShutdownState())); + + return nextShutdownStateId++; +} + +void ServiceWorkerShutdownBlocker::ReportShutdownProgress( + uint32_t aShutdownStateId, Progress aProgress) { + AssertIsOnMainThread(); + MOZ_RELEASE_ASSERT(aShutdownStateId != kInvalidShutdownStateId); + + auto lookup = mShutdownStates.lookup(aShutdownStateId); + + // Progress reporting might race with the promise that WaitOnPromise is called + // with settling. + if (!lookup) { + return; + } + + // This will check for a valid progress transition with assertions. + lookup->value().SetProgress(aProgress); + + if (aProgress == Progress::ShutdownCompleted) { + mShutdownStates.remove(lookup); + } +} + +ServiceWorkerShutdownBlocker::ServiceWorkerShutdownBlocker( + ServiceWorkerManager& aServiceWorkerManager) + : mState(VariantType()), + mServiceWorkerManager(WrapNotNull(&aServiceWorkerManager)) { + AssertIsOnMainThread(); +} + +ServiceWorkerShutdownBlocker::~ServiceWorkerShutdownBlocker() { + MOZ_ASSERT(!IsAcceptingPromises()); + MOZ_ASSERT(!GetPendingPromises()); + MOZ_ASSERT(!mShutdownClient); + MOZ_ASSERT(!mServiceWorkerManager); +} + +void ServiceWorkerShutdownBlocker::MaybeUnblockShutdown() { + AssertIsOnMainThread(); + + if (!mShutdownClient || IsAcceptingPromises() || GetPendingPromises()) { + return; + } + + UnblockShutdown(); +} + +void ServiceWorkerShutdownBlocker::UnblockShutdown() { + MOZ_ASSERT(mShutdownClient); + + mShutdownClient->RemoveBlocker(this); + mShutdownClient = nullptr; + + if (mTimer) { + mTimer->Cancel(); + } +} + +uint32_t ServiceWorkerShutdownBlocker::PromiseSettled() { + AssertIsOnMainThread(); + MOZ_ASSERT(GetPendingPromises()); + + if (IsAcceptingPromises()) { + return --mState.as().mPendingPromises; + } + + return --mState.as().mPendingPromises; +} + +bool ServiceWorkerShutdownBlocker::IsAcceptingPromises() const { + AssertIsOnMainThread(); + + return mState.is(); +} + +uint32_t ServiceWorkerShutdownBlocker::GetPendingPromises() const { + AssertIsOnMainThread(); + + if (IsAcceptingPromises()) { + return mState.as().mPendingPromises; + } + + return mState.as().mPendingPromises; +} + +ServiceWorkerShutdownBlocker::NotAcceptingPromises::NotAcceptingPromises( + AcceptingPromises aPreviousState) + : mPendingPromises(aPreviousState.mPendingPromises) { + AssertIsOnMainThread(); +} + +NS_IMETHODIMP ServiceWorkerShutdownBlocker::Notify(nsITimer*) { + // TODO: this method being called indicates that there are ServiceWorkers + // that did not complete shutdown before the timer expired - there should be + // a telemetry ping or some other way of recording the state of when this + // happens (e.g. what's returned by GetState()). + UnblockShutdown(); + return NS_OK; +} + +#ifdef RELEASE_OR_BETA +# define SW_UNBLOCK_SHUTDOWN_TIMER_DURATION 10s +#else +// In Nightly, we do want a shutdown hang to be reported so we pick a value +// notably longer than the 60s of the RunWatchDog timeout. +# define SW_UNBLOCK_SHUTDOWN_TIMER_DURATION 200s +#endif + +void ServiceWorkerShutdownBlocker::MaybeInitUnblockShutdownTimer() { + AssertIsOnMainThread(); + + if (mTimer || !mShutdownClient || IsAcceptingPromises()) { + return; + } + + MOZ_ASSERT(GetPendingPromises(), + "Shouldn't be blocking shutdown with zero pending promises."); + + using namespace std::chrono_literals; + + static constexpr auto delay = + std::chrono::duration_cast( + SW_UNBLOCK_SHUTDOWN_TIMER_DURATION); + + mTimer = NS_NewTimer(); + + mTimer->InitWithCallback(this, delay.count(), nsITimer::TYPE_ONE_SHOT); +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerShutdownBlocker.h b/dom/serviceworkers/ServiceWorkerShutdownBlocker.h new file mode 100644 index 0000000000..ab5a42e070 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerShutdownBlocker.h @@ -0,0 +1,157 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworkershutdownblocker_h__ +#define mozilla_dom_serviceworkershutdownblocker_h__ + +#include "nsCOMPtr.h" +#include "nsIAsyncShutdown.h" +#include "nsISupportsImpl.h" +#include "nsITimer.h" + +#include "ServiceWorkerShutdownState.h" +#include "mozilla/InitializedOnce.h" +#include "mozilla/MozPromise.h" +#include "mozilla/NotNull.h" +#include "mozilla/HashTable.h" + +namespace mozilla { +namespace dom { + +class ServiceWorkerManager; + +/** + * Main thread only. + * + * A ServiceWorkerShutdownBlocker will "accept promises", and each of these + * promises will be a "pending promise" while it hasn't settled. At some point, + * `StopAcceptingPromises()` should be called and the state will change to "not + * accepting promises" (this is a one way state transition). The shutdown phase + * of the shutdown client the blocker is created with will be blocked until + * there are no more pending promises. + * + * It doesn't matter whether the state changes to "not accepting promises" + * before or during the associated shutdown phase. + * + * In beta/release builds there will be an additional timer that starts ticking + * once both the shutdown phase has been reached and the state is "not accepting + * promises". If when the timer expire there are still pending promises, + * shutdown will be forcefully unblocked. + */ +class ServiceWorkerShutdownBlocker final : public nsIAsyncShutdownBlocker, + public nsITimerCallback { + public: + using Progress = ServiceWorkerShutdownState::Progress; + static const uint32_t kInvalidShutdownStateId = 0; + + NS_DECL_ISUPPORTS + NS_DECL_NSIASYNCSHUTDOWNBLOCKER + NS_DECL_NSITIMERCALLBACK + + /** + * Returns the registered shutdown blocker if registration succeeded and + * nullptr otherwise. + */ + static already_AddRefed CreateAndRegisterOn( + nsIAsyncShutdownClient& aShutdownBarrier, + ServiceWorkerManager& aServiceWorkerManager); + + /** + * Blocks shutdown until `aPromise` settles. + * + * Can be called multiple times, and shutdown will be blocked until all the + * calls' promises settle, but all of these calls must happen before + * `StopAcceptingPromises()` is called (assertions will enforce this). + * + * See `CreateShutdownState` for aShutdownStateId, which is needed to clear + * the shutdown state if the shutdown process aborts for some reason. + */ + void WaitOnPromise(GenericNonExclusivePromise* aPromise, + uint32_t aShutdownStateId); + + /** + * Once this is called, shutdown will be blocked until all promises + * passed to `WaitOnPromise()` settle, and there must be no more calls to + * `WaitOnPromise()` (assertions will enforce this). + */ + void StopAcceptingPromises(); + + /** + * Start tracking the shutdown of an individual ServiceWorker for hang + * reporting purposes. Returns a "shutdown state ID" that should be used + * in subsequent calls to ReportShutdownProgress. The shutdown of an + * individual ServiceWorker is presumed to be completed when its `Progress` + * reaches `Progress::ShutdownCompleted`. + */ + uint32_t CreateShutdownState(); + + void ReportShutdownProgress(uint32_t aShutdownStateId, Progress aProgress); + + private: + explicit ServiceWorkerShutdownBlocker( + ServiceWorkerManager& aServiceWorkerManager); + + ~ServiceWorkerShutdownBlocker(); + + /** + * No-op if any of the following are true: + * 1) `BlockShutdown()` hasn't been called yet, or + * 2) `StopAcceptingPromises()` hasn't been called yet, or + * 3) `StopAcceptingPromises()` HAS been called, but there are still pending + * promises. + */ + void MaybeUnblockShutdown(); + + /** + * Requires `BlockShutdown()` to have been called. + */ + void UnblockShutdown(); + + /** + * Returns the remaining pending promise count (i.e. excluding the promise + * that just settled). + */ + uint32_t PromiseSettled(); + + bool IsAcceptingPromises() const; + + uint32_t GetPendingPromises() const; + + /** + * Initializes a timer that will unblock shutdown unconditionally once it's + * expired (even if there are still pending promises). No-op if: + * 1) not a beta or release build, or + * 2) shutdown is not being blocked or `StopAcceptingPromises()` has not been + * called. + */ + void MaybeInitUnblockShutdownTimer(); + + struct AcceptingPromises { + uint32_t mPendingPromises = 0; + }; + + struct NotAcceptingPromises { + explicit NotAcceptingPromises(AcceptingPromises aPreviousState); + + uint32_t mPendingPromises = 0; + }; + + Variant mState; + + nsCOMPtr mShutdownClient; + + HashMap mShutdownStates; + + nsCOMPtr mTimer; + LazyInitializedOnceEarlyDestructible< + const NotNull>> + mServiceWorkerManager; +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_serviceworkershutdownblocker_h__ diff --git a/dom/serviceworkers/ServiceWorkerShutdownState.cpp b/dom/serviceworkers/ServiceWorkerShutdownState.cpp new file mode 100644 index 0000000000..c47191888e --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerShutdownState.cpp @@ -0,0 +1,168 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerShutdownState.h" + +#include +#include + +#include "MainThreadUtils.h" +#include "ServiceWorkerUtils.h" +#include "mozilla/Assertions.h" +#include "mozilla/SchedulerGroup.h" +#include "mozilla/Unused.h" +#include "mozilla/dom/ContentChild.h" +#include "mozilla/dom/RemoteWorkerService.h" +#include "mozilla/dom/ServiceWorkerManager.h" +#include "mozilla/dom/WorkerCommon.h" +#include "mozilla/ipc/BackgroundParent.h" +#include "nsDebug.h" +#include "nsThreadUtils.h" +#include "nsXULAppAPI.h" + +namespace mozilla { +namespace dom { + +using Progress = ServiceWorkerShutdownState::Progress; + +namespace { + +constexpr inline auto UnderlyingProgressValue(Progress aProgress) { + return std::underlying_type_t(aProgress); +} + +constexpr std::array + gProgressStrings = {{ + // clang-format off + "parent process main thread", + "parent process IPDL background thread", + "content process worker launcher thread", + "content process main thread", + "shutdown completed" + // clang-format on + }}; + +} // anonymous namespace + +ServiceWorkerShutdownState::ServiceWorkerShutdownState() + : mProgress(Progress::ParentProcessMainThread) { + MOZ_ASSERT(XRE_IsParentProcess()); + MOZ_ASSERT(NS_IsMainThread()); +} + +ServiceWorkerShutdownState::~ServiceWorkerShutdownState() { + Unused << NS_WARN_IF(mProgress != Progress::ShutdownCompleted); +} + +const char* ServiceWorkerShutdownState::GetProgressString() const { + return gProgressStrings[UnderlyingProgressValue(mProgress)]; +} + +void ServiceWorkerShutdownState::SetProgress(Progress aProgress) { + MOZ_ASSERT(aProgress != Progress::EndGuard_); + MOZ_RELEASE_ASSERT(UnderlyingProgressValue(mProgress) + 1 == + UnderlyingProgressValue(aProgress)); + + mProgress = aProgress; +} + +namespace { + +void ReportProgressToServiceWorkerManager(uint32_t aShutdownStateId, + Progress aProgress) { + MOZ_ASSERT(XRE_IsParentProcess()); + MOZ_ASSERT(NS_IsMainThread()); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + MOZ_RELEASE_ASSERT(swm, "ServiceWorkers should shutdown before SWM."); + + swm->ReportServiceWorkerShutdownProgress(aShutdownStateId, aProgress); +} + +void ReportProgressToParentProcess(uint32_t aShutdownStateId, + Progress aProgress) { + MOZ_ASSERT(XRE_IsContentProcess()); + MOZ_ASSERT(NS_IsMainThread()); + + ContentChild* contentChild = ContentChild::GetSingleton(); + MOZ_ASSERT(contentChild); + + contentChild->SendReportServiceWorkerShutdownProgress(aShutdownStateId, + aProgress); +} + +void ReportServiceWorkerShutdownProgress(uint32_t aShutdownStateId, + Progress aProgress) { + MOZ_ASSERT(UnderlyingProgressValue(Progress::ParentProcessMainThread) < + UnderlyingProgressValue(aProgress)); + MOZ_ASSERT(UnderlyingProgressValue(aProgress) < + UnderlyingProgressValue(Progress::EndGuard_)); + + nsCOMPtr r = NS_NewRunnableFunction( + __func__, [shutdownStateId = aShutdownStateId, progress = aProgress] { + if (XRE_IsParentProcess()) { + ReportProgressToServiceWorkerManager(shutdownStateId, progress); + } else { + ReportProgressToParentProcess(shutdownStateId, progress); + } + }); + + if (NS_IsMainThread()) { + MOZ_ALWAYS_SUCCEEDS(r->Run()); + } else { + MOZ_ALWAYS_SUCCEEDS( + SchedulerGroup::Dispatch(TaskCategory::Other, r.forget())); + } +} + +void ReportServiceWorkerShutdownProgress(uint32_t aShutdownStateId) { + Progress progress = Progress::EndGuard_; + + if (XRE_IsParentProcess()) { + mozilla::ipc::AssertIsOnBackgroundThread(); + + progress = Progress::ParentProcessIpdlBackgroundThread; + } else { + if (NS_IsMainThread()) { + progress = Progress::ContentProcessMainThread; + } else { + MOZ_ASSERT(RemoteWorkerService::Thread()->IsOnCurrentThread()); + progress = Progress::ContentProcessWorkerLauncherThread; + } + } + + ReportServiceWorkerShutdownProgress(aShutdownStateId, progress); +} + +} // anonymous namespace + +void MaybeReportServiceWorkerShutdownProgress(const ServiceWorkerOpArgs& aArgs, + bool aShutdownCompleted) { + if (!ServiceWorkerParentInterceptEnabled() || + (XRE_IsParentProcess() && !XRE_IsE10sParentProcess())) { + return; + } + + if (aShutdownCompleted) { + MOZ_ASSERT(aArgs.type() == + ServiceWorkerOpArgs::TServiceWorkerTerminateWorkerOpArgs); + + ReportServiceWorkerShutdownProgress( + aArgs.get_ServiceWorkerTerminateWorkerOpArgs().shutdownStateId(), + Progress::ShutdownCompleted); + + return; + } + + if (aArgs.type() == + ServiceWorkerOpArgs::TServiceWorkerTerminateWorkerOpArgs) { + ReportServiceWorkerShutdownProgress( + aArgs.get_ServiceWorkerTerminateWorkerOpArgs().shutdownStateId()); + } +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerShutdownState.h b/dom/serviceworkers/ServiceWorkerShutdownState.h new file mode 100644 index 0000000000..8e87817ea3 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerShutdownState.h @@ -0,0 +1,63 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef DOM_SERVICEWORKERS_SERVICEWORKERSHUTDOWNSTATE_H_ +#define DOM_SERVICEWORKERS_SERVICEWORKERSHUTDOWNSTATE_H_ + +#include + +#include "ipc/EnumSerializer.h" +#include "mozilla/dom/ServiceWorkerOpArgs.h" + +namespace mozilla { +namespace dom { + +class ServiceWorkerShutdownState { + public: + // Represents the "location" of the shutdown message or completion of + // shutdown. + enum class Progress { + ParentProcessMainThread, + ParentProcessIpdlBackgroundThread, + ContentProcessWorkerLauncherThread, + ContentProcessMainThread, + ShutdownCompleted, + EndGuard_, + }; + + ServiceWorkerShutdownState(); + + ~ServiceWorkerShutdownState(); + + const char* GetProgressString() const; + + void SetProgress(Progress aProgress); + + private: + Progress mProgress; +}; + +// Asynchronously reports that shutdown has progressed to the calling thread +// if aArgs is for shutdown. If aShutdownCompleted is true, aArgs must be for +// shutdown. +void MaybeReportServiceWorkerShutdownProgress(const ServiceWorkerOpArgs& aArgs, + bool aShutdownCompleted = false); + +} // namespace dom +} // namespace mozilla + +namespace IPC { + +using Progress = mozilla::dom::ServiceWorkerShutdownState::Progress; + +template <> +struct ParamTraits + : public ContiguousEnumSerializer< + Progress, Progress::ParentProcessMainThread, Progress::EndGuard_> {}; + +} // namespace IPC + +#endif // DOM_SERVICEWORKERS_SERVICEWORKERSHUTDOWNSTATE_H_ diff --git a/dom/serviceworkers/ServiceWorkerUnregisterCallback.cpp b/dom/serviceworkers/ServiceWorkerUnregisterCallback.cpp new file mode 100644 index 0000000000..3632173747 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerUnregisterCallback.cpp @@ -0,0 +1,37 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerUnregisterCallback.h" + +namespace mozilla { +namespace dom { + +NS_IMPL_ISUPPORTS(UnregisterCallback, nsIServiceWorkerUnregisterCallback) + +UnregisterCallback::UnregisterCallback() + : mPromise(new GenericPromise::Private(__func__)) {} + +UnregisterCallback::UnregisterCallback(GenericPromise::Private* aPromise) + : mPromise(aPromise) { + MOZ_DIAGNOSTIC_ASSERT(mPromise); +} + +NS_IMETHODIMP +UnregisterCallback::UnregisterSucceeded(bool aState) { + mPromise->Resolve(aState, __func__); + return NS_OK; +} + +NS_IMETHODIMP +UnregisterCallback::UnregisterFailed() { + mPromise->Reject(NS_ERROR_DOM_SECURITY_ERR, __func__); + return NS_OK; +} + +RefPtr UnregisterCallback::Promise() const { return mPromise; } + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerUnregisterCallback.h b/dom/serviceworkers/ServiceWorkerUnregisterCallback.h new file mode 100644 index 0000000000..3a5c23d0ab --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerUnregisterCallback.h @@ -0,0 +1,43 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_ServiceWorkerUnregisterCallback_h +#define mozilla_dom_ServiceWorkerUnregisterCallback_h + +#include "mozilla/MozPromise.h" +#include "mozilla/RefPtr.h" +#include "nsIServiceWorkerManager.h" + +namespace mozilla { +namespace dom { + +class UnregisterCallback final : public nsIServiceWorkerUnregisterCallback { + public: + NS_DECL_ISUPPORTS + + UnregisterCallback(); + + explicit UnregisterCallback(GenericPromise::Private* aPromise); + + // nsIServiceWorkerUnregisterCallback implementation + NS_IMETHOD + UnregisterSucceeded(bool aState) override; + + NS_IMETHOD + UnregisterFailed() override; + + RefPtr Promise() const; + + private: + ~UnregisterCallback() = default; + + RefPtr mPromise; +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_ServiceWorkerUnregisterCallback_h diff --git a/dom/serviceworkers/ServiceWorkerUnregisterJob.cpp b/dom/serviceworkers/ServiceWorkerUnregisterJob.cpp new file mode 100644 index 0000000000..47fdf92591 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerUnregisterJob.cpp @@ -0,0 +1,139 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerUnregisterJob.h" + +#include "mozilla/Unused.h" +#include "nsIPushService.h" +#include "nsServiceManagerUtils.h" +#include "nsThreadUtils.h" +#include "ServiceWorkerManager.h" + +namespace mozilla { +namespace dom { + +class ServiceWorkerUnregisterJob::PushUnsubscribeCallback final + : public nsIUnsubscribeResultCallback { + public: + NS_DECL_ISUPPORTS + + explicit PushUnsubscribeCallback(ServiceWorkerUnregisterJob* aJob) + : mJob(aJob) { + MOZ_ASSERT(NS_IsMainThread()); + } + + NS_IMETHOD + OnUnsubscribe(nsresult aStatus, bool) override { + // Warn if unsubscribing fails, but don't prevent the worker from + // unregistering. + Unused << NS_WARN_IF(NS_FAILED(aStatus)); + mJob->Unregister(); + return NS_OK; + } + + private: + ~PushUnsubscribeCallback() = default; + + RefPtr mJob; +}; + +NS_IMPL_ISUPPORTS(ServiceWorkerUnregisterJob::PushUnsubscribeCallback, + nsIUnsubscribeResultCallback) + +ServiceWorkerUnregisterJob::ServiceWorkerUnregisterJob(nsIPrincipal* aPrincipal, + const nsACString& aScope, + bool aSendToParent) + : ServiceWorkerJob(Type::Unregister, aPrincipal, aScope, ""_ns), + mResult(false), + mSendToParent(aSendToParent) {} + +bool ServiceWorkerUnregisterJob::GetResult() const { + MOZ_ASSERT(NS_IsMainThread()); + return mResult; +} + +ServiceWorkerUnregisterJob::~ServiceWorkerUnregisterJob() = default; + +void ServiceWorkerUnregisterJob::AsyncExecute() { + MOZ_ASSERT(NS_IsMainThread()); + + if (Canceled()) { + Finish(NS_ERROR_DOM_ABORT_ERR); + return; + } + + // Push API, section 5: "When a service worker registration is unregistered, + // any associated push subscription must be deactivated." To ensure the + // service worker registration isn't cleared as we're unregistering, we + // unsubscribe first. + nsCOMPtr pushService = + do_GetService("@mozilla.org/push/Service;1"); + if (NS_WARN_IF(!pushService)) { + Unregister(); + return; + } + nsCOMPtr unsubscribeCallback = + new PushUnsubscribeCallback(this); + nsresult rv = pushService->Unsubscribe(NS_ConvertUTF8toUTF16(mScope), + mPrincipal, unsubscribeCallback); + if (NS_WARN_IF(NS_FAILED(rv))) { + Unregister(); + } +} + +void ServiceWorkerUnregisterJob::Unregister() { + MOZ_ASSERT(NS_IsMainThread()); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (Canceled() || !swm) { + Finish(NS_ERROR_DOM_ABORT_ERR); + return; + } + + // Step 1 of the Unregister algorithm requires checking that the + // client origin matches the scope's origin. We perform this in + // registration->update() method directly since we don't have that + // client information available here. + + // "Let registration be the result of running [[Get Registration]] + // algorithm passing scope as the argument." + RefPtr registration = + swm->GetRegistration(mPrincipal, mScope); + if (!registration) { + // "If registration is null, then, resolve promise with false." + Finish(NS_OK); + return; + } + + // Note, we send the message to remove the registration from disk now. This is + // necessary to ensure the registration is removed if the controlled + // clients are closed by shutting down the browser. + if (mSendToParent) { + swm->MaybeSendUnregister(mPrincipal, mScope); + } + + // "Remove scope to registration map[job's scope url]." + swm->RemoveRegistration(registration); + MOZ_ASSERT(registration->IsUnregistered()); + + // "Resolve promise with true" + mResult = true; + InvokeResultCallbacks(NS_OK); + + // "Invoke Try Clear Registration with registration" + if (!registration->IsControllingClients()) { + if (registration->IsIdle()) { + registration->Clear(); + } else { + registration->ClearWhenIdle(); + } + } + + Finish(NS_OK); +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerUnregisterJob.h b/dom/serviceworkers/ServiceWorkerUnregisterJob.h new file mode 100644 index 0000000000..13bc969a6b --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerUnregisterJob.h @@ -0,0 +1,38 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworkerunregisterjob_h +#define mozilla_dom_serviceworkerunregisterjob_h + +#include "ServiceWorkerJob.h" + +namespace mozilla { +namespace dom { + +class ServiceWorkerUnregisterJob final : public ServiceWorkerJob { + public: + ServiceWorkerUnregisterJob(nsIPrincipal* aPrincipal, const nsACString& aScope, + bool aSendToParent); + + bool GetResult() const; + + private: + class PushUnsubscribeCallback; + + virtual ~ServiceWorkerUnregisterJob(); + + virtual void AsyncExecute() override; + + void Unregister(); + + bool mResult; + bool mSendToParent; +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_serviceworkerunregisterjob_h diff --git a/dom/serviceworkers/ServiceWorkerUpdateJob.cpp b/dom/serviceworkers/ServiceWorkerUpdateJob.cpp new file mode 100644 index 0000000000..993e63694d --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerUpdateJob.cpp @@ -0,0 +1,543 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerUpdateJob.h" + +#include "mozilla/Telemetry.h" +#include "nsIScriptError.h" +#include "nsIURL.h" +#include "nsNetUtil.h" +#include "nsProxyRelease.h" +#include "ServiceWorkerManager.h" +#include "ServiceWorkerPrivate.h" +#include "ServiceWorkerRegistrationInfo.h" +#include "ServiceWorkerScriptCache.h" +#include "mozilla/dom/WorkerCommon.h" + +namespace mozilla { +namespace dom { + +using serviceWorkerScriptCache::OnFailure; + +namespace { + +/** + * The spec mandates slightly different behaviors for computing the scope + * prefix string in case a Service-Worker-Allowed header is specified versus + * when it's not available. + * + * With the header: + * "Set maxScopeString to "/" concatenated with the strings in maxScope's + * path (including empty strings), separated from each other by "/"." + * Without the header: + * "Set maxScopeString to "/" concatenated with the strings, except the last + * string that denotes the script's file name, in registration's registering + * script url's path (including empty strings), separated from each other by + * "/"." + * + * In simpler terms, if the header is not present, we should only use the + * "directory" part of the pathname, and otherwise the entire pathname should be + * used. ScopeStringPrefixMode allows the caller to specify the desired + * behavior. + */ +enum ScopeStringPrefixMode { eUseDirectory, eUsePath }; + +nsresult GetRequiredScopeStringPrefix(nsIURI* aScriptURI, nsACString& aPrefix, + ScopeStringPrefixMode aPrefixMode) { + nsresult rv; + if (aPrefixMode == eUseDirectory) { + nsCOMPtr scriptURL(do_QueryInterface(aScriptURI)); + if (NS_WARN_IF(!scriptURL)) { + return NS_ERROR_FAILURE; + } + + rv = scriptURL->GetDirectory(aPrefix); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + } else if (aPrefixMode == eUsePath) { + rv = aScriptURI->GetPathQueryRef(aPrefix); + if (NS_WARN_IF(NS_FAILED(rv))) { + return rv; + } + } else { + MOZ_ASSERT_UNREACHABLE("Invalid value for aPrefixMode"); + } + return NS_OK; +} + +} // anonymous namespace + +class ServiceWorkerUpdateJob::CompareCallback final + : public serviceWorkerScriptCache::CompareCallback { + RefPtr mJob; + + ~CompareCallback() = default; + + public: + explicit CompareCallback(ServiceWorkerUpdateJob* aJob) : mJob(aJob) { + MOZ_ASSERT(mJob); + } + + virtual void ComparisonResult(nsresult aStatus, bool aInCacheAndEqual, + OnFailure aOnFailure, + const nsAString& aNewCacheName, + const nsACString& aMaxScope, + nsLoadFlags aLoadFlags) override { + mJob->ComparisonResult(aStatus, aInCacheAndEqual, aOnFailure, aNewCacheName, + aMaxScope, aLoadFlags); + } + + NS_INLINE_DECL_REFCOUNTING(ServiceWorkerUpdateJob::CompareCallback, override) +}; + +class ServiceWorkerUpdateJob::ContinueUpdateRunnable final + : public LifeCycleEventCallback { + nsMainThreadPtrHandle mJob; + bool mSuccess; + + public: + explicit ContinueUpdateRunnable( + const nsMainThreadPtrHandle& aJob) + : mJob(aJob), mSuccess(false) { + MOZ_ASSERT(NS_IsMainThread()); + } + + void SetResult(bool aResult) override { mSuccess = aResult; } + + NS_IMETHOD + Run() override { + MOZ_ASSERT(NS_IsMainThread()); + mJob->ContinueUpdateAfterScriptEval(mSuccess); + mJob = nullptr; + return NS_OK; + } +}; + +class ServiceWorkerUpdateJob::ContinueInstallRunnable final + : public LifeCycleEventCallback { + nsMainThreadPtrHandle mJob; + bool mSuccess; + + public: + explicit ContinueInstallRunnable( + const nsMainThreadPtrHandle& aJob) + : mJob(aJob), mSuccess(false) { + MOZ_ASSERT(NS_IsMainThread()); + } + + void SetResult(bool aResult) override { mSuccess = aResult; } + + NS_IMETHOD + Run() override { + MOZ_ASSERT(NS_IsMainThread()); + mJob->ContinueAfterInstallEvent(mSuccess); + mJob = nullptr; + return NS_OK; + } +}; + +ServiceWorkerUpdateJob::ServiceWorkerUpdateJob( + nsIPrincipal* aPrincipal, const nsACString& aScope, nsCString aScriptSpec, + ServiceWorkerUpdateViaCache aUpdateViaCache) + : ServiceWorkerUpdateJob(Type::Update, aPrincipal, aScope, + std::move(aScriptSpec), aUpdateViaCache) {} + +already_AddRefed +ServiceWorkerUpdateJob::GetRegistration() const { + MOZ_ASSERT(NS_IsMainThread()); + RefPtr ref = mRegistration; + return ref.forget(); +} + +ServiceWorkerUpdateJob::ServiceWorkerUpdateJob( + Type aType, nsIPrincipal* aPrincipal, const nsACString& aScope, + nsCString aScriptSpec, ServiceWorkerUpdateViaCache aUpdateViaCache) + : ServiceWorkerJob(aType, aPrincipal, aScope, std::move(aScriptSpec)), + mUpdateViaCache(aUpdateViaCache), + mOnFailure(serviceWorkerScriptCache::OnFailure::DoNothing) {} + +ServiceWorkerUpdateJob::~ServiceWorkerUpdateJob() = default; + +void ServiceWorkerUpdateJob::FailUpdateJob(ErrorResult& aRv) { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(aRv.Failed()); + + // Cleanup after a failed installation. This essentially implements + // step 13 of the Install algorithm. + // + // https://w3c.github.io/ServiceWorker/#installation-algorithm + // + // The spec currently only runs this after an install event fails, + // but we must handle many more internal errors. So we check for + // cleanup on every non-successful exit. + if (mRegistration) { + // Some kinds of failures indicate there is something broken in the + // currently installed registration. In these cases we want to fully + // unregister. + if (mOnFailure == OnFailure::Uninstall) { + mRegistration->ClearAsCorrupt(); + } + + // Otherwise just clear the workers we may have created as part of the + // update process. + else { + mRegistration->ClearEvaluating(); + mRegistration->ClearInstalling(); + } + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (swm) { + swm->MaybeRemoveRegistration(mRegistration); + + // Also clear the registration on disk if we are forcing uninstall + // due to a particularly bad failure. + if (mOnFailure == OnFailure::Uninstall) { + swm->MaybeSendUnregister(mRegistration->Principal(), + mRegistration->Scope()); + } + } + } + + mRegistration = nullptr; + + Finish(aRv); +} + +void ServiceWorkerUpdateJob::FailUpdateJob(nsresult aRv) { + ErrorResult rv(aRv); + FailUpdateJob(rv); +} + +void ServiceWorkerUpdateJob::AsyncExecute() { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(GetType() == Type::Update); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (Canceled() || !swm) { + FailUpdateJob(NS_ERROR_DOM_ABORT_ERR); + return; + } + + // Invoke Update algorithm: + // https://w3c.github.io/ServiceWorker/#update-algorithm + // + // "Let registration be the result of running the Get Registration algorithm + // passing job’s scope url as the argument." + RefPtr registration = + swm->GetRegistration(mPrincipal, mScope); + + if (!registration) { + ErrorResult rv; + rv.ThrowTypeError(mScope, "uninstalled"); + FailUpdateJob(rv); + return; + } + + // "Let newestWorker be the result of running Get Newest Worker algorithm + // passing registration as the argument." + RefPtr newest = registration->Newest(); + + // "If job’s job type is update, and newestWorker is not null and its script + // url does not equal job’s script url, then: + // 1. Invoke Reject Job Promise with job and TypeError. + // 2. Invoke Finish Job with job and abort these steps." + if (newest && !newest->ScriptSpec().Equals(mScriptSpec)) { + ErrorResult rv; + rv.ThrowTypeError(mScope, "changed"); + FailUpdateJob(rv); + return; + } + + SetRegistration(registration); + Update(); +} + +void ServiceWorkerUpdateJob::SetRegistration( + ServiceWorkerRegistrationInfo* aRegistration) { + MOZ_ASSERT(NS_IsMainThread()); + + MOZ_ASSERT(!mRegistration); + MOZ_ASSERT(aRegistration); + mRegistration = aRegistration; +} + +void ServiceWorkerUpdateJob::Update() { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_ASSERT(!Canceled()); + + // SetRegistration() must be called before Update(). + MOZ_ASSERT(mRegistration); + MOZ_ASSERT(!mRegistration->GetInstalling()); + + // Begin the script download and comparison steps starting at step 5 + // of the Update algorithm. + + RefPtr workerInfo = mRegistration->Newest(); + nsAutoString cacheName; + + // If the script has not changed, we need to perform a byte-for-byte + // comparison. + if (workerInfo && workerInfo->ScriptSpec().Equals(mScriptSpec)) { + cacheName = workerInfo->CacheName(); + } + + RefPtr callback = new CompareCallback(this); + + nsresult rv = serviceWorkerScriptCache::Compare( + mRegistration, mPrincipal, cacheName, NS_ConvertUTF8toUTF16(mScriptSpec), + callback); + if (NS_WARN_IF(NS_FAILED(rv))) { + FailUpdateJob(rv); + return; + } +} + +ServiceWorkerUpdateViaCache ServiceWorkerUpdateJob::GetUpdateViaCache() const { + return mUpdateViaCache; +} + +void ServiceWorkerUpdateJob::ComparisonResult(nsresult aStatus, + bool aInCacheAndEqual, + OnFailure aOnFailure, + const nsAString& aNewCacheName, + const nsACString& aMaxScope, + nsLoadFlags aLoadFlags) { + MOZ_ASSERT(NS_IsMainThread()); + + mOnFailure = aOnFailure; + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (NS_WARN_IF(Canceled() || !swm)) { + FailUpdateJob(NS_ERROR_DOM_ABORT_ERR); + return; + } + + // Handle failure of the download or comparison. This is part of Update + // step 5 as "If the algorithm asynchronously completes with null, then:". + if (NS_WARN_IF(NS_FAILED(aStatus))) { + FailUpdateJob(aStatus); + return; + } + + // The spec validates the response before performing the byte-for-byte check. + // Here we perform the comparison in another module and then validate the + // script URL and scope. Make sure to do this validation before accepting + // an byte-for-byte match since the service-worker-allowed header might have + // changed since the last time it was installed. + + // This is step 2 the "validate response" section of Update algorithm step 5. + // Step 1 is performed in the serviceWorkerScriptCache code. + + nsCOMPtr scriptURI; + nsresult rv = NS_NewURI(getter_AddRefs(scriptURI), mScriptSpec); + if (NS_WARN_IF(NS_FAILED(rv))) { + FailUpdateJob(NS_ERROR_DOM_SECURITY_ERR); + return; + } + + nsCOMPtr maxScopeURI; + if (!aMaxScope.IsEmpty()) { + rv = NS_NewURI(getter_AddRefs(maxScopeURI), aMaxScope, nullptr, scriptURI); + if (NS_WARN_IF(NS_FAILED(rv))) { + FailUpdateJob(NS_ERROR_DOM_SECURITY_ERR); + return; + } + } + + nsAutoCString defaultAllowedPrefix; + rv = GetRequiredScopeStringPrefix(scriptURI, defaultAllowedPrefix, + eUseDirectory); + if (NS_WARN_IF(NS_FAILED(rv))) { + FailUpdateJob(NS_ERROR_DOM_SECURITY_ERR); + return; + } + + nsAutoCString maxPrefix(defaultAllowedPrefix); + if (maxScopeURI) { + rv = GetRequiredScopeStringPrefix(maxScopeURI, maxPrefix, eUsePath); + if (NS_WARN_IF(NS_FAILED(rv))) { + FailUpdateJob(NS_ERROR_DOM_SECURITY_ERR); + return; + } + } + + nsCOMPtr scopeURI; + rv = NS_NewURI(getter_AddRefs(scopeURI), mRegistration->Scope(), nullptr, + scriptURI); + if (NS_WARN_IF(NS_FAILED(rv))) { + FailUpdateJob(NS_ERROR_FAILURE); + return; + } + + nsAutoCString scopeString; + rv = scopeURI->GetPathQueryRef(scopeString); + if (NS_WARN_IF(NS_FAILED(rv))) { + FailUpdateJob(NS_ERROR_FAILURE); + return; + } + + if (!StringBeginsWith(scopeString, maxPrefix)) { + nsAutoString message; + NS_ConvertUTF8toUTF16 reportScope(mRegistration->Scope()); + NS_ConvertUTF8toUTF16 reportMaxPrefix(maxPrefix); + + rv = nsContentUtils::FormatLocalizedString( + message, nsContentUtils::eDOM_PROPERTIES, + "ServiceWorkerScopePathMismatch", reportScope, reportMaxPrefix); + NS_WARNING_ASSERTION(NS_SUCCEEDED(rv), "Failed to format localized string"); + swm->ReportToAllClients(mScope, message, u""_ns, u""_ns, 0, 0, + nsIScriptError::errorFlag); + FailUpdateJob(NS_ERROR_DOM_SECURITY_ERR); + return; + } + + // The response has been validated, so now we can consider if its a + // byte-for-byte match. This is step 6 of the Update algorithm. + if (aInCacheAndEqual) { + Finish(NS_OK); + return; + } + + Telemetry::Accumulate(Telemetry::SERVICE_WORKER_UPDATED, 1); + + // Begin step 7 of the Update algorithm to evaluate the new script. + nsLoadFlags flags = aLoadFlags; + if (GetUpdateViaCache() == ServiceWorkerUpdateViaCache::None) { + flags |= nsIRequest::VALIDATE_ALWAYS; + } + + RefPtr sw = new ServiceWorkerInfo( + mRegistration->Principal(), mRegistration->Scope(), mRegistration->Id(), + mRegistration->Version(), mScriptSpec, aNewCacheName, flags); + + // If the registration is corrupt enough to force an uninstall if the + // upgrade fails, then we want to make sure the upgrade takes effect + // if it succeeds. Therefore force the skip-waiting flag on to replace + // the broken worker after install. + if (aOnFailure == OnFailure::Uninstall) { + sw->SetSkipWaitingFlag(); + } + + mRegistration->SetEvaluating(sw); + + nsMainThreadPtrHandle handle( + new nsMainThreadPtrHolder( + "ServiceWorkerUpdateJob", this)); + RefPtr callback = new ContinueUpdateRunnable(handle); + + ServiceWorkerPrivate* workerPrivate = sw->WorkerPrivate(); + MOZ_ASSERT(workerPrivate); + rv = workerPrivate->CheckScriptEvaluation(callback); + + if (NS_WARN_IF(NS_FAILED(rv))) { + FailUpdateJob(NS_ERROR_DOM_ABORT_ERR); + return; + } +} + +void ServiceWorkerUpdateJob::ContinueUpdateAfterScriptEval( + bool aScriptEvaluationResult) { + MOZ_ASSERT(NS_IsMainThread()); + + RefPtr swm = ServiceWorkerManager::GetInstance(); + if (Canceled() || !swm) { + FailUpdateJob(NS_ERROR_DOM_ABORT_ERR); + return; + } + + // Step 7.5 of the Update algorithm verifying that the script evaluated + // successfully. + + if (NS_WARN_IF(!aScriptEvaluationResult)) { + ErrorResult error; + error.ThrowTypeError(mScriptSpec, + mRegistration->Scope()); + FailUpdateJob(error); + return; + } + + Install(); +} + +void ServiceWorkerUpdateJob::Install() { + MOZ_ASSERT(NS_IsMainThread()); + MOZ_DIAGNOSTIC_ASSERT(!Canceled()); + + MOZ_ASSERT(!mRegistration->GetInstalling()); + + // Begin step 2 of the Install algorithm. + // + // https://slightlyoff.github.io/ServiceWorker/spec/service_worker/index.html#installation-algorithm + + mRegistration->TransitionEvaluatingToInstalling(); + + // Step 6 of the Install algorithm resolving the job promise. + InvokeResultCallbacks(NS_OK); + + // Queue a task to fire an event named updatefound at all the + // ServiceWorkerRegistration. + mRegistration->FireUpdateFound(); + + nsMainThreadPtrHandle handle( + new nsMainThreadPtrHolder( + "ServiceWorkerUpdateJob", this)); + RefPtr callback = new ContinueInstallRunnable(handle); + + // Send the install event to the worker thread + ServiceWorkerPrivate* workerPrivate = + mRegistration->GetInstalling()->WorkerPrivate(); + nsresult rv = workerPrivate->SendLifeCycleEvent(u"install"_ns, callback); + if (NS_WARN_IF(NS_FAILED(rv))) { + ContinueAfterInstallEvent(false /* aSuccess */); + } +} + +void ServiceWorkerUpdateJob::ContinueAfterInstallEvent( + bool aInstallEventSuccess) { + if (Canceled()) { + return FailUpdateJob(NS_ERROR_DOM_ABORT_ERR); + } + + // If we haven't been canceled we should have a registration. There appears + // to be a path where it gets cleared before we call into here. Assert + // to try to catch this condition, but don't crash in release. + MOZ_DIAGNOSTIC_ASSERT(mRegistration); + if (!mRegistration) { + return FailUpdateJob(NS_ERROR_DOM_ABORT_ERR); + } + + // Continue executing the Install algorithm at step 12. + + // "If installFailed is true" + if (NS_WARN_IF(!aInstallEventSuccess)) { + // The installing worker is cleaned up by FailUpdateJob(). + FailUpdateJob(NS_ERROR_DOM_ABORT_ERR); + return; + } + + // Abort the update Job if the installWorker is null (e.g. when an extension + // is shutting down and all its workers have been terminated). + if (!mRegistration->GetInstalling()) { + return FailUpdateJob(NS_ERROR_DOM_ABORT_ERR); + } + + mRegistration->TransitionInstallingToWaiting(); + + Finish(NS_OK); + + // Step 20 calls for explicitly waiting for queued event tasks to fire. + // Instead, we simply queue a runnable to execute Activate. This ensures the + // events are flushed from the queue before proceeding. + + // Step 22 of the Install algorithm. Activate is executed after the + // completion of this job. The controlling client and skipWaiting checks are + // performed in TryToActivate(). + mRegistration->TryToActivateAsync(); +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerUpdateJob.h b/dom/serviceworkers/ServiceWorkerUpdateJob.h new file mode 100644 index 0000000000..bbc2fbbd82 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerUpdateJob.h @@ -0,0 +1,99 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_serviceworkerupdatejob_h +#define mozilla_dom_serviceworkerupdatejob_h + +#include "ServiceWorkerJob.h" +#include "ServiceWorkerRegistration.h" + +#include "nsIRequest.h" + +namespace mozilla { +namespace dom { + +namespace serviceWorkerScriptCache { +enum class OnFailure : uint8_t; +} // namespace serviceWorkerScriptCache + +class ServiceWorkerManager; +class ServiceWorkerRegistrationInfo; + +// A job class that performs the Update and Install algorithms from the +// service worker spec. This class is designed to be inherited and customized +// as a different job type. This is necessary because the register job +// performs largely the same operations as the update job, but has a few +// different starting steps. +class ServiceWorkerUpdateJob : public ServiceWorkerJob { + public: + // Construct an update job to be used only for updates. + ServiceWorkerUpdateJob(nsIPrincipal* aPrincipal, const nsACString& aScope, + nsCString aScriptSpec, + ServiceWorkerUpdateViaCache aUpdateViaCache); + + already_AddRefed GetRegistration() const; + + protected: + // Construct an update job that is overriden as another job type. + ServiceWorkerUpdateJob(Type aType, nsIPrincipal* aPrincipal, + const nsACString& aScope, nsCString aScriptSpec, + ServiceWorkerUpdateViaCache aUpdateViaCache); + + virtual ~ServiceWorkerUpdateJob(); + + // FailUpdateJob() must be called if an update job needs Finish() with + // an error. + void FailUpdateJob(ErrorResult& aRv); + + void FailUpdateJob(nsresult aRv); + + // The entry point when the update job is being used directly. Job + // types overriding this class should override this method to + // customize behavior. + virtual void AsyncExecute() override; + + // Set the registration to be operated on by Update() or to be immediately + // returned as a result of the job. This must be called before Update(). + void SetRegistration(ServiceWorkerRegistrationInfo* aRegistration); + + // Execute the bulk of the update job logic using the registration defined + // by a previous SetRegistration() call. This can be called by the overriden + // AsyncExecute() to complete the job. The Update() method will always call + // Finish(). This method corresponds to the spec Update algorithm. + void Update(); + + ServiceWorkerUpdateViaCache GetUpdateViaCache() const; + + private: + class CompareCallback; + class ContinueUpdateRunnable; + class ContinueInstallRunnable; + + // Utility method called after a script is loaded and compared to + // our current cached script. + void ComparisonResult(nsresult aStatus, bool aInCacheAndEqual, + serviceWorkerScriptCache::OnFailure aOnFailure, + const nsAString& aNewCacheName, + const nsACString& aMaxScope, nsLoadFlags aLoadFlags); + + // Utility method called after evaluating the worker script. + void ContinueUpdateAfterScriptEval(bool aScriptEvaluationResult); + + // Utility method corresponding to the spec Install algorithm. + void Install(); + + // Utility method called after the install event is handled. + void ContinueAfterInstallEvent(bool aInstallEventSuccess); + + RefPtr mRegistration; + ServiceWorkerUpdateViaCache mUpdateViaCache; + serviceWorkerScriptCache::OnFailure mOnFailure; +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_serviceworkerupdatejob_h diff --git a/dom/serviceworkers/ServiceWorkerUpdaterChild.cpp b/dom/serviceworkers/ServiceWorkerUpdaterChild.cpp new file mode 100644 index 0000000000..4c12dad11a --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerUpdaterChild.cpp @@ -0,0 +1,67 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this file, + * You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerUpdaterChild.h" +#include "ServiceWorkerUtils.h" +#include "nsThreadUtils.h" + +namespace mozilla { +namespace dom { + +ServiceWorkerUpdaterChild::ServiceWorkerUpdaterChild( + GenericPromise* aPromise, CancelableRunnable* aSuccessRunnable, + CancelableRunnable* aFailureRunnable) + : mSuccessRunnable(aSuccessRunnable), mFailureRunnable(aFailureRunnable) { + // TODO: remove the main thread restriction after fixing bug 1364821. + MOZ_ASSERT(NS_IsMainThread()); + + MOZ_DIAGNOSTIC_ASSERT(!ServiceWorkerParentInterceptEnabled()); + + MOZ_ASSERT(aPromise); + MOZ_ASSERT(aSuccessRunnable); + MOZ_ASSERT(aFailureRunnable); + + aPromise + ->Then(GetMainThreadSerialEventTarget(), __func__, + [this]() { + mPromiseHolder.Complete(); + Unused << Send__delete__(this); + }) + .Track(mPromiseHolder); +} + +mozilla::ipc::IPCResult ServiceWorkerUpdaterChild::RecvProceed( + const bool& aAllowed) { + // If we have a callback, it will resolve the promise. + + if (aAllowed) { + mSuccessRunnable->Run(); + mFailureRunnable->Cancel(); + } else { + mFailureRunnable->Run(); + mSuccessRunnable->Cancel(); + } + + mSuccessRunnable = nullptr; + mFailureRunnable = nullptr; + + return IPC_OK(); +} + +void ServiceWorkerUpdaterChild::ActorDestroy(ActorDestroyReason aWhy) { + if (mSuccessRunnable) { + mSuccessRunnable->Cancel(); + } + + if (mFailureRunnable) { + mFailureRunnable->Cancel(); + } + + mPromiseHolder.DisconnectIfExists(); +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerUpdaterChild.h b/dom/serviceworkers/ServiceWorkerUpdaterChild.h new file mode 100644 index 0000000000..32f34ca730 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerUpdaterChild.h @@ -0,0 +1,37 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this file, + * You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_ServiceWorkerUpdaterChild_h +#define mozilla_dom_ServiceWorkerUpdaterChild_h + +#include "mozilla/dom/PServiceWorkerUpdaterChild.h" +#include "mozilla/BasePrincipal.h" +#include "mozilla/MozPromise.h" + +namespace mozilla { +namespace dom { + +class ServiceWorkerUpdaterChild final : public PServiceWorkerUpdaterChild { + public: + ServiceWorkerUpdaterChild(GenericPromise* aPromise, + CancelableRunnable* aSuccessRunnable, + CancelableRunnable* aFailureRunnable); + + mozilla::ipc::IPCResult RecvProceed(const bool& aAllowed) override; + + private: + void ActorDestroy(ActorDestroyReason aWhy) override; + + MozPromiseRequestHolder mPromiseHolder; + + RefPtr mSuccessRunnable; + RefPtr mFailureRunnable; +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_ServiceWorkerUpdaterChild_h diff --git a/dom/serviceworkers/ServiceWorkerUpdaterParent.cpp b/dom/serviceworkers/ServiceWorkerUpdaterParent.cpp new file mode 100644 index 0000000000..7ed5303859 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerUpdaterParent.cpp @@ -0,0 +1,30 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this file, + * You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerUpdaterParent.h" +#include "ServiceWorkerManagerService.h" + +namespace mozilla { +namespace dom { + +bool ServiceWorkerUpdaterParent::Proceed( + ServiceWorkerManagerService* aService) { + if (!SendProceed(true)) { + return false; + } + + mService = aService; + return true; +} + +void ServiceWorkerUpdaterParent::ActorDestroy(ActorDestroyReason aWhy) { + if (mService) { + mService->UpdaterActorDestroyed(this); + } +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerUpdaterParent.h b/dom/serviceworkers/ServiceWorkerUpdaterParent.h new file mode 100644 index 0000000000..b106fd9512 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerUpdaterParent.h @@ -0,0 +1,31 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this file, + * You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef mozilla_dom_ServiceWorkerUpdaterParent_h +#define mozilla_dom_ServiceWorkerUpdaterParent_h + +#include "mozilla/dom/PServiceWorkerUpdaterParent.h" +#include "mozilla/BasePrincipal.h" + +namespace mozilla { +namespace dom { + +class ServiceWorkerManagerService; + +class ServiceWorkerUpdaterParent final : public PServiceWorkerUpdaterParent { + public: + void ActorDestroy(ActorDestroyReason aWhy) override; + + bool Proceed(ServiceWorkerManagerService* aService); + + private: + RefPtr mService; +}; + +} // namespace dom +} // namespace mozilla + +#endif // mozilla_dom_ServiceWorkerUpdaterParent_h diff --git a/dom/serviceworkers/ServiceWorkerUtils.cpp b/dom/serviceworkers/ServiceWorkerUtils.cpp new file mode 100644 index 0000000000..ba4e8dc959 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerUtils.cpp @@ -0,0 +1,150 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#include "ServiceWorkerUtils.h" + +#include "mozilla/BasePrincipal.h" +#include "mozilla/ErrorResult.h" +#include "mozilla/Preferences.h" +#include "mozilla/dom/ClientInfo.h" +#include "mozilla/dom/ServiceWorkerRegistrarTypes.h" +#include "nsCOMPtr.h" +#include "nsIPrincipal.h" +#include "nsIURL.h" +#include "nsPrintfCString.h" + +namespace mozilla { +namespace dom { + +bool ServiceWorkerParentInterceptEnabled() { return true; } + +bool ServiceWorkerRegistrationDataIsValid( + const ServiceWorkerRegistrationData& aData) { + return !aData.scope().IsEmpty() && !aData.currentWorkerURL().IsEmpty() && + !aData.cacheName().IsEmpty(); +} + +namespace { + +void CheckForSlashEscapedCharsInPath(nsIURI* aURI, const char* aURLDescription, + ErrorResult& aRv) { + MOZ_ASSERT(aURI); + + // A URL that can't be downcast to a standard URL is an invalid URL and should + // be treated as such and fail with SecurityError. + nsCOMPtr url(do_QueryInterface(aURI)); + if (NS_WARN_IF(!url)) { + // This really should not happen, since the caller checks that we + // have an http: or https: URL! + aRv.ThrowInvalidStateError("http: or https: URL without a concept of path"); + return; + } + + nsAutoCString path; + nsresult rv = url->GetFilePath(path); + if (NS_WARN_IF(NS_FAILED(rv))) { + // Again, should not happen. + aRv.ThrowInvalidStateError("http: or https: URL without a concept of path"); + return; + } + + ToLowerCase(path); + if (path.Find("%2f") != kNotFound || path.Find("%5c") != kNotFound) { + nsPrintfCString err("%s contains %%2f or %%5c", aURLDescription); + aRv.ThrowTypeError(err); + } +} + +} // anonymous namespace + +void ServiceWorkerScopeAndScriptAreValid(const ClientInfo& aClientInfo, + nsIURI* aScopeURI, nsIURI* aScriptURI, + ErrorResult& aRv) { + MOZ_DIAGNOSTIC_ASSERT(aScopeURI); + MOZ_DIAGNOSTIC_ASSERT(aScriptURI); + + auto principalOrErr = aClientInfo.GetPrincipal(); + if (NS_WARN_IF(principalOrErr.isErr())) { + aRv.ThrowInvalidStateError("Can't make security decisions about Client"); + return; + } + + auto hasHTTPScheme = [](nsIURI* aURI) -> bool { + return aURI->SchemeIs("http") || aURI->SchemeIs("https"); + }; + auto hasMozExtScheme = [](nsIURI* aURI) -> bool { + return aURI->SchemeIs("moz-extension"); + }; + + nsCOMPtr principal = principalOrErr.unwrap(); + + auto isExtension = !!BasePrincipal::Cast(principal)->AddonPolicy(); + auto hasValidURISchemes = !isExtension ? hasHTTPScheme : hasMozExtScheme; + + // https://w3c.github.io/ServiceWorker/#start-register-algorithm step 3. + if (!hasValidURISchemes(aScriptURI)) { + auto message = !isExtension + ? "Script URL's scheme is not 'http' or 'https'"_ns + : "Script URL's scheme is not 'moz-extension'"_ns; + aRv.ThrowTypeError(message); + return; + } + + // https://w3c.github.io/ServiceWorker/#start-register-algorithm step 4. + CheckForSlashEscapedCharsInPath(aScriptURI, "script URL", aRv); + if (NS_WARN_IF(aRv.Failed())) { + return; + } + + // https://w3c.github.io/ServiceWorker/#start-register-algorithm step 8. + if (!hasValidURISchemes(aScopeURI)) { + auto message = !isExtension + ? "Scope URL's scheme is not 'http' or 'https'"_ns + : "Scope URL's scheme is not 'moz-extension'"_ns; + aRv.ThrowTypeError(message); + return; + } + + // https://w3c.github.io/ServiceWorker/#start-register-algorithm step 9. + CheckForSlashEscapedCharsInPath(aScopeURI, "scope URL", aRv); + if (NS_WARN_IF(aRv.Failed())) { + return; + } + + // The refs should really be empty coming in here, but if someone + // injects bad data into IPC, who knows. So let's revalidate that. + nsAutoCString ref; + Unused << aScopeURI->GetRef(ref); + if (NS_WARN_IF(!ref.IsEmpty())) { + aRv.ThrowSecurityError("Non-empty fragment on scope URL"); + return; + } + + Unused << aScriptURI->GetRef(ref); + if (NS_WARN_IF(!ref.IsEmpty())) { + aRv.ThrowSecurityError("Non-empty fragment on script URL"); + return; + } + + // Unfortunately we don't seem to have an obvious window id here; in + // particular ClientInfo does not have one. + nsresult rv = principal->CheckMayLoadWithReporting( + aScopeURI, false /* allowIfInheritsPrincipal */, 0 /* innerWindowID */); + if (NS_WARN_IF(NS_FAILED(rv))) { + aRv.ThrowSecurityError("Scope URL is not same-origin with Client"); + return; + } + + rv = principal->CheckMayLoadWithReporting( + aScriptURI, false /* allowIfInheritsPrincipal */, 0 /* innerWindowID */); + if (NS_WARN_IF(NS_FAILED(rv))) { + aRv.ThrowSecurityError("Script URL is not same-origin with Client"); + return; + } +} + +} // namespace dom +} // namespace mozilla diff --git a/dom/serviceworkers/ServiceWorkerUtils.h b/dom/serviceworkers/ServiceWorkerUtils.h new file mode 100644 index 0000000000..9128783f81 --- /dev/null +++ b/dom/serviceworkers/ServiceWorkerUtils.h @@ -0,0 +1,57 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */ +/* vim: set ts=8 sts=2 et sw=2 tw=80: */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ +#ifndef _mozilla_dom_ServiceWorkerUtils_h +#define _mozilla_dom_ServiceWorkerUtils_h + +#include "mozilla/MozPromise.h" +#include "mozilla/dom/ServiceWorkerRegistrationDescriptor.h" +#include "nsTArray.h" + +class nsIURI; + +namespace mozilla { + +class CopyableErrorResult; +class ErrorResult; + +namespace dom { + +class ClientInfo; +class ServiceWorkerRegistrationData; +class ServiceWorkerRegistrationDescriptor; + +typedef MozPromise + ServiceWorkerRegistrationPromise; + +typedef MozPromise, + CopyableErrorResult, false> + ServiceWorkerRegistrationListPromise; + +typedef std::function + ServiceWorkerRegistrationCallback; + +typedef std::function&)> + ServiceWorkerRegistrationListCallback; + +typedef std::function ServiceWorkerBoolCallback; + +typedef std::function ServiceWorkerFailureCallback; + +bool ServiceWorkerParentInterceptEnabled(); + +bool ServiceWorkerRegistrationDataIsValid( + const ServiceWorkerRegistrationData& aData); + +void ServiceWorkerScopeAndScriptAreValid(const ClientInfo& aClientInfo, + nsIURI* aScopeURI, nsIURI* aScriptURI, + ErrorResult& aRv); + +} // namespace dom +} // namespace mozilla + +#endif // _mozilla_dom_ServiceWorkerUtils_h diff --git a/dom/serviceworkers/moz.build b/dom/serviceworkers/moz.build new file mode 100644 index 0000000000..7f7fac7ba7 --- /dev/null +++ b/dom/serviceworkers/moz.build @@ -0,0 +1,132 @@ +# -*- Mode: python; indent-tabs-mode: nil; tab-width: 40 -*- +# vim: set filetype=python: +# This Source Code Form is subject to the terms of the Mozilla Public +# License, v. 2.0. If a copy of the MPL was not distributed with this +# file, You can obtain one at http://mozilla.org/MPL/2.0/. + +with Files("**"): + BUG_COMPONENT = ("Core", "DOM: Service Workers") + +# Public stuff. +EXPORTS.mozilla.dom += [ + "FetchEventOpChild.h", + "FetchEventOpParent.h", + "FetchEventOpProxyChild.h", + "FetchEventOpProxyParent.h", + "ServiceWorker.h", + "ServiceWorkerActors.h", + "ServiceWorkerChild.h", + "ServiceWorkerCloneData.h", + "ServiceWorkerContainer.h", + "ServiceWorkerContainerChild.h", + "ServiceWorkerContainerParent.h", + "ServiceWorkerDescriptor.h", + "ServiceWorkerEvents.h", + "ServiceWorkerInfo.h", + "ServiceWorkerInterceptController.h", + "ServiceWorkerIPCUtils.h", + "ServiceWorkerManager.h", + "ServiceWorkerManagerChild.h", + "ServiceWorkerManagerParent.h", + "ServiceWorkerOp.h", + "ServiceWorkerOpPromise.h", + "ServiceWorkerParent.h", + "ServiceWorkerRegistrar.h", + "ServiceWorkerRegistration.h", + "ServiceWorkerRegistrationChild.h", + "ServiceWorkerRegistrationDescriptor.h", + "ServiceWorkerRegistrationInfo.h", + "ServiceWorkerRegistrationParent.h", + "ServiceWorkerShutdownState.h", + "ServiceWorkerUtils.h", +] + +UNIFIED_SOURCES += [ + "FetchEventOpChild.cpp", + "FetchEventOpParent.cpp", + "FetchEventOpProxyChild.cpp", + "FetchEventOpProxyParent.cpp", + "RemoteServiceWorkerContainerImpl.cpp", + "RemoteServiceWorkerImpl.cpp", + "RemoteServiceWorkerRegistrationImpl.cpp", + "ServiceWorker.cpp", + "ServiceWorkerActors.cpp", + "ServiceWorkerChild.cpp", + "ServiceWorkerCloneData.cpp", + "ServiceWorkerContainer.cpp", + "ServiceWorkerContainerChild.cpp", + "ServiceWorkerContainerImpl.cpp", + "ServiceWorkerContainerParent.cpp", + "ServiceWorkerContainerProxy.cpp", + "ServiceWorkerDescriptor.cpp", + "ServiceWorkerEvents.cpp", + "ServiceWorkerImpl.cpp", + "ServiceWorkerInfo.cpp", + "ServiceWorkerInterceptController.cpp", + "ServiceWorkerJob.cpp", + "ServiceWorkerJobQueue.cpp", + "ServiceWorkerManager.cpp", + "ServiceWorkerManagerChild.cpp", + "ServiceWorkerManagerParent.cpp", + "ServiceWorkerManagerService.cpp", + "ServiceWorkerOp.cpp", + "ServiceWorkerParent.cpp", + "ServiceWorkerPrivate.cpp", + "ServiceWorkerPrivateImpl.cpp", + "ServiceWorkerProxy.cpp", + "ServiceWorkerRegisterJob.cpp", + "ServiceWorkerRegistrar.cpp", + "ServiceWorkerRegistration.cpp", + "ServiceWorkerRegistrationChild.cpp", + "ServiceWorkerRegistrationDescriptor.cpp", + "ServiceWorkerRegistrationImpl.cpp", + "ServiceWorkerRegistrationInfo.cpp", + "ServiceWorkerRegistrationParent.cpp", + "ServiceWorkerRegistrationProxy.cpp", + "ServiceWorkerScriptCache.cpp", + "ServiceWorkerShutdownBlocker.cpp", + "ServiceWorkerShutdownState.cpp", + "ServiceWorkerUnregisterCallback.cpp", + "ServiceWorkerUnregisterJob.cpp", + "ServiceWorkerUpdateJob.cpp", + "ServiceWorkerUpdaterChild.cpp", + "ServiceWorkerUpdaterParent.cpp", + "ServiceWorkerUtils.cpp", +] + +IPDL_SOURCES += [ + "IPCServiceWorkerDescriptor.ipdlh", + "IPCServiceWorkerRegistrationDescriptor.ipdlh", + "PFetchEventOp.ipdl", + "PFetchEventOpProxy.ipdl", + "PServiceWorker.ipdl", + "PServiceWorkerContainer.ipdl", + "PServiceWorkerManager.ipdl", + "PServiceWorkerRegistration.ipdl", + "PServiceWorkerUpdater.ipdl", + "ServiceWorkerOpArgs.ipdlh", + "ServiceWorkerRegistrarTypes.ipdlh", +] + +include("/ipc/chromium/chromium-config.mozbuild") + +FINAL_LIBRARY = "xul" + +LOCAL_INCLUDES += [ + "/js/xpconnect/loader", +] + +MOCHITEST_MANIFESTS += [ + "test/mochitest.ini", +] + +MOCHITEST_CHROME_MANIFESTS += [ + "test/chrome.ini", +] + +BROWSER_CHROME_MANIFESTS += [ + "test/browser.ini", + "test/isolated/multi-e10s-update/browser.ini", +] + +TEST_DIRS += ["test/gtest"] diff --git a/dom/serviceworkers/test/.eslintrc.js b/dom/serviceworkers/test/.eslintrc.js new file mode 100644 index 0000000000..6499767b2d --- /dev/null +++ b/dom/serviceworkers/test/.eslintrc.js @@ -0,0 +1,9 @@ +"use strict"; + +module.exports = { + extends: [ + "plugin:mozilla/mochitest-test", + "plugin:mozilla/browser-test", + "plugin:mozilla/chrome-test", + ], +}; diff --git a/dom/serviceworkers/test/ForceRefreshChild.jsm b/dom/serviceworkers/test/ForceRefreshChild.jsm new file mode 100644 index 0000000000..613b6ea535 --- /dev/null +++ b/dom/serviceworkers/test/ForceRefreshChild.jsm @@ -0,0 +1,14 @@ +var EXPORTED_SYMBOLS = ["ForceRefreshChild"]; + +class ForceRefreshChild extends JSWindowActorChild { + constructor() { + super(); + } + + handleEvent(evt) { + this.sendAsyncMessage("test:event", { + type: evt.type, + detail: evt.details, + }); + } +} diff --git a/dom/serviceworkers/test/ForceRefreshParent.jsm b/dom/serviceworkers/test/ForceRefreshParent.jsm new file mode 100644 index 0000000000..ad22b216de --- /dev/null +++ b/dom/serviceworkers/test/ForceRefreshParent.jsm @@ -0,0 +1,79 @@ +var EXPORTED_SYMBOLS = ["ForceRefreshParent"]; + +var maxCacheLoadCount = 3; +var cachedLoadCount = 0; +var baseLoadCount = 0; +var done = false; + +class ForceRefreshParent extends JSWindowActorParent { + constructor() { + super(); + } + + receiveMessage(msg) { + // if done is called, ignore the msg. + if (done) { + return; + } + if (msg.data.type === "base-load") { + baseLoadCount += 1; + if (cachedLoadCount === maxCacheLoadCount) { + ForceRefreshParent.SimpleTest.is( + baseLoadCount, + 2, + "cached load should occur before second base load" + ); + done = true; + return ForceRefreshParent.done(); + } + if (baseLoadCount !== 1) { + ForceRefreshParent.SimpleTest.ok( + false, + "base load without cached load should only occur once" + ); + done = true; + return ForceRefreshParent.done(); + } + } else if (msg.data.type === "base-register") { + ForceRefreshParent.SimpleTest.ok( + !cachedLoadCount, + "cached load should not occur before base register" + ); + ForceRefreshParent.SimpleTest.is( + baseLoadCount, + 1, + "register should occur after first base load" + ); + } else if (msg.data.type === "base-sw-ready") { + ForceRefreshParent.SimpleTest.ok( + !cachedLoadCount, + "cached load should not occur before base ready" + ); + ForceRefreshParent.SimpleTest.is( + baseLoadCount, + 1, + "ready should occur after first base load" + ); + ForceRefreshParent.refresh(); + } else if (msg.data.type === "cached-load") { + ForceRefreshParent.SimpleTest.ok( + cachedLoadCount < maxCacheLoadCount, + "cached load should not occur too many times" + ); + ForceRefreshParent.SimpleTest.is( + baseLoadCount, + 1, + "cache load occur after first base load" + ); + cachedLoadCount += 1; + if (cachedLoadCount < maxCacheLoadCount) { + return ForceRefreshParent.refresh(); + } + ForceRefreshParent.forceRefresh(); + } else if (msg.data.type === "cached-failure") { + ForceRefreshParent.SimpleTest.ok(false, "failure: " + msg.data.detail); + done = true; + ForceRefreshParent.done(); + } + } +} diff --git a/dom/serviceworkers/test/abrupt_completion_worker.js b/dom/serviceworkers/test/abrupt_completion_worker.js new file mode 100644 index 0000000000..7afebc6d45 --- /dev/null +++ b/dom/serviceworkers/test/abrupt_completion_worker.js @@ -0,0 +1,18 @@ +function setMessageHandler(response) { + onmessage = e => { + e.source.postMessage(response); + }; +} + +setMessageHandler("handler-before-throw"); + +// importScripts will throw when the ServiceWorker is past the "intalling" state. +importScripts(`empty.js?${Date.now()}`); + +// When importScripts throws an uncaught exception, these calls should never be +// made and the message handler should remain responding "handler-before-throw". +setMessageHandler("handler-after-throw"); + +// There needs to be a fetch handler to avoid the no-fetch optimizaiton, +// which will skip starting up this worker. +onfetch = e => e.respondWith(new Response("handler-after-throw")); diff --git a/dom/serviceworkers/test/activate_event_error_worker.js b/dom/serviceworkers/test/activate_event_error_worker.js new file mode 100644 index 0000000000..9f09cc5225 --- /dev/null +++ b/dom/serviceworkers/test/activate_event_error_worker.js @@ -0,0 +1,4 @@ +// Worker that errors on receiving an activate event. +onactivate = function(e) { + undefined.doSomething; +}; diff --git a/dom/serviceworkers/test/async_waituntil_worker.js b/dom/serviceworkers/test/async_waituntil_worker.js new file mode 100644 index 0000000000..94219e4879 --- /dev/null +++ b/dom/serviceworkers/test/async_waituntil_worker.js @@ -0,0 +1,53 @@ +var keepAlivePromise; +var resolvePromise; +var result = "Failed"; + +onactivate = function(event) { + event.waitUntil(clients.claim()); +}; + +onmessage = function(event) { + if (event.data === "Start") { + event.waitUntil(Promise.reject()); + + keepAlivePromise = new Promise(function(resolve, reject) { + resolvePromise = resolve; + }); + + result = "Success"; + event.waitUntil(keepAlivePromise); + event.source.postMessage("Started"); + } else if (event.data === "Result") { + event.source.postMessage(result); + if (resolvePromise !== undefined) { + resolvePromise(); + } + } +}; + +addEventListener("fetch", e => { + let respondWithPromise = new Promise(function(res, rej) { + setTimeout(() => { + res(new Response("ok")); + }, 0); + }); + e.respondWith(respondWithPromise); + // Test that waitUntil can be called in the promise handler of the existing + // lifetime extension promise. + respondWithPromise.then(() => { + e.waitUntil( + clients.matchAll().then(cls => { + dump(`matchAll returned ${cls.length} client(s) with URLs:\n`); + cls.forEach(cl => { + dump(`${cl.url}\n`); + }); + + if (cls.length != 1) { + dump("ERROR: no controlled clients.\n"); + } + client = cls[0]; + client.postMessage("Done"); + }) + ); + }); +}); diff --git a/dom/serviceworkers/test/blocking_install_event_worker.js b/dom/serviceworkers/test/blocking_install_event_worker.js new file mode 100644 index 0000000000..5cb9270b04 --- /dev/null +++ b/dom/serviceworkers/test/blocking_install_event_worker.js @@ -0,0 +1,22 @@ +function postMessageToTest(msg) { + return clients.matchAll({ includeUncontrolled: true }).then(list => { + for (var client of list) { + if (client.url.endsWith("test_install_event_gc.html")) { + client.postMessage(msg); + break; + } + } + }); +} + +addEventListener("install", evt => { + // This must be a simple promise to trigger the CC failure. + evt.waitUntil(new Promise(function() {})); + postMessageToTest({ type: "INSTALL_EVENT" }); +}); + +addEventListener("message", evt => { + if (evt.data.type === "ping") { + postMessageToTest({ type: "pong" }); + } +}); diff --git a/dom/serviceworkers/test/browser.ini b/dom/serviceworkers/test/browser.ini new file mode 100644 index 0000000000..f671d4a655 --- /dev/null +++ b/dom/serviceworkers/test/browser.ini @@ -0,0 +1,43 @@ +[DEFAULT] +support-files = + browser_base_force_refresh.html + browser_cached_force_refresh.html + download/window.html + download/worker.js + download_canceled/page_download_canceled.html + download_canceled/server-stream-download.sjs + download_canceled/sw_download_canceled.js + fetch.js + file_userContextId_openWindow.js + force_refresh_browser_worker.js + ForceRefreshChild.jsm + ForceRefreshParent.jsm + empty.html + empty_with_utils.html + empty.js + intercepted_channel_process_swap_worker.js + page_post_controlled.html + redirect.sjs + storage_recovery_worker.sjs + utils.js + +[browser_antitracking.js] +[browser_antitracking_subiframes.js] +[browser_devtools_serviceworker_interception.js] +skip-if = serviceworker_e10s +[browser_force_refresh.js] +skip-if = verify # Bug 1603340 +[browser_download.js] +[browser_download_canceled.js] +skip-if = verify +[browser_intercepted_channel_process_swap.js] +skip-if = !fission +[browser_remote_type_process_swap.js] +skip-if = !e10s +[browser_storage_permission.js] +skip-if = true # Crashes: @ mozilla::dom::ServiceWorkerManagerService::PropagateUnregister(unsigned long, mozilla::ipc::PrincipalInfo const&, nsTSubstring const&), #Bug 1578337 +[browser_storage_recovery.js] +skip-if = serviceworker_e10s +[browser_unregister_with_containers.js] +[browser_userContextId_openWindow.js] +skip-if = !e10s || serviceworker_e10s diff --git a/dom/serviceworkers/test/browser_antitracking.js b/dom/serviceworkers/test/browser_antitracking.js new file mode 100644 index 0000000000..cb72f1c7e8 --- /dev/null +++ b/dom/serviceworkers/test/browser_antitracking.js @@ -0,0 +1,104 @@ +const BEHAVIOR_ACCEPT = Ci.nsICookieService.BEHAVIOR_ACCEPT; +const BEHAVIOR_REJECT_TRACKER = Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER; + +let { UrlClassifierTestUtils } = ChromeUtils.import( + "resource://testing-common/UrlClassifierTestUtils.jsm" +); + +const TOP_DOMAIN = "http://mochi.test:8888/"; +const SW_DOMAIN = "https://tracking.example.org/"; + +const TOP_TEST_ROOT = getRootDirectory(gTestPath).replace( + "chrome://mochitests/content/", + TOP_DOMAIN +); +const SW_TEST_ROOT = getRootDirectory(gTestPath).replace( + "chrome://mochitests/content/", + SW_DOMAIN +); + +const TOP_EMPTY_PAGE = `${TOP_TEST_ROOT}empty_with_utils.html`; +const SW_REGISTER_PAGE = `${SW_TEST_ROOT}empty_with_utils.html`; +const SW_IFRAME_PAGE = `${SW_TEST_ROOT}page_post_controlled.html`; +// An empty script suffices for our SW needs; it's by definition no-fetch. +const SW_REL_SW_SCRIPT = "empty.js"; + +/** + * Set up a no-fetch-optimized ServiceWorker on a domain that will be covered by + * tracking protection (but is not yet). Once the SW is installed, activate TP + * and create a tab that embeds that tracking-site in an iframe. + */ +add_task(async function() { + await SpecialPowers.pushPrefEnv({ + set: [ + ["dom.serviceWorkers.enabled", true], + ["dom.serviceWorkers.exemptFromPerDomainMax", true], + ["dom.serviceWorkers.testing.enabled", true], + ["network.cookie.cookieBehavior", BEHAVIOR_ACCEPT], + ], + }); + + // Open the top-level page. + info("Opening a new tab: " + SW_REGISTER_PAGE); + let topTab = await BrowserTestUtils.openNewForegroundTab({ + gBrowser, + opening: SW_REGISTER_PAGE, + }); + + // ## Install SW + info("Installing SW"); + await SpecialPowers.spawn( + topTab.linkedBrowser, + [{ sw: SW_REL_SW_SCRIPT }], + async function({ sw }) { + // Waive the xray to use the content utils.js script functions. + await content.wrappedJSObject.registerAndWaitForActive(sw); + } + ); + + // Enable Anti-tracking. + await SpecialPowers.pushPrefEnv({ + set: [ + ["privacy.trackingprotection.enabled", false], + ["privacy.trackingprotection.pbmode.enabled", false], + ["privacy.trackingprotection.annotate_channels", true], + ["network.cookie.cookieBehavior", BEHAVIOR_REJECT_TRACKER], + ], + }); + await UrlClassifierTestUtils.addTestTrackers(); + + // Open the top-level URL. + info("Loading a new top-level URL: " + TOP_EMPTY_PAGE); + let browserLoadedPromise = BrowserTestUtils.browserLoaded( + topTab.linkedBrowser + ); + BrowserTestUtils.loadURI(topTab.linkedBrowser, TOP_EMPTY_PAGE); + await browserLoadedPromise; + + // Create Iframe in the top-level page and verify its state. + let { controlled } = await SpecialPowers.spawn( + topTab.linkedBrowser, + [{ url: SW_IFRAME_PAGE }], + async function({ url }) { + const payload = await content.wrappedJSObject.createIframeAndWaitForMessage( + url + ); + return payload; + } + ); + + ok(!controlled, "Should not be controlled!"); + + // ## Cleanup + info("Loading the SW unregister page: " + SW_REGISTER_PAGE); + browserLoadedPromise = BrowserTestUtils.browserLoaded(topTab.linkedBrowser); + BrowserTestUtils.loadURI(topTab.linkedBrowser, SW_REGISTER_PAGE); + await browserLoadedPromise; + + await SpecialPowers.spawn(topTab.linkedBrowser, [], async function() { + await content.wrappedJSObject.unregisterAll(); + }); + + // Close the testing tab. + BrowserTestUtils.removeTab(topTab); +}); diff --git a/dom/serviceworkers/test/browser_antitracking_subiframes.js b/dom/serviceworkers/test/browser_antitracking_subiframes.js new file mode 100644 index 0000000000..d2b7a97c96 --- /dev/null +++ b/dom/serviceworkers/test/browser_antitracking_subiframes.js @@ -0,0 +1,105 @@ +const BEHAVIOR_REJECT_TRACKER = Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER; + +const TOP_DOMAIN = "http://mochi.test:8888/"; +const SW_DOMAIN = "https://example.org/"; + +const TOP_TEST_ROOT = getRootDirectory(gTestPath).replace( + "chrome://mochitests/content/", + TOP_DOMAIN +); +const SW_TEST_ROOT = getRootDirectory(gTestPath).replace( + "chrome://mochitests/content/", + SW_DOMAIN +); + +const TOP_EMPTY_PAGE = `${TOP_TEST_ROOT}empty_with_utils.html`; +const SW_REGISTER_PAGE = `${SW_TEST_ROOT}empty_with_utils.html`; +const SW_IFRAME_PAGE = `${SW_TEST_ROOT}page_post_controlled.html`; +const SW_REL_SW_SCRIPT = "empty.js"; + +/** + * Set up a ServiceWorker on a domain that will be used as 3rd party iframe. + * That 3rd party frame should be controlled by the ServiceWorker. + * After that, we open a second iframe into the first one. That should not be + * controlled. + */ +add_task(async function() { + await SpecialPowers.pushPrefEnv({ + set: [ + ["dom.serviceWorkers.enabled", true], + ["dom.serviceWorkers.exemptFromPerDomainMax", true], + ["dom.serviceWorkers.testing.enabled", true], + ["network.cookie.cookieBehavior", BEHAVIOR_REJECT_TRACKER], + ], + }); + + // Open the top-level page. + info("Opening a new tab: " + SW_REGISTER_PAGE); + let topTab = await BrowserTestUtils.openNewForegroundTab({ + gBrowser, + opening: SW_REGISTER_PAGE, + }); + + // Install SW + info("Registering a SW: " + SW_REL_SW_SCRIPT); + await SpecialPowers.spawn( + topTab.linkedBrowser, + [{ sw: SW_REL_SW_SCRIPT }], + async function({ sw }) { + // Waive the xray to use the content utils.js script functions. + await content.wrappedJSObject.registerAndWaitForActive(sw); + // User interaction + content.document.userInteractionForTesting(); + } + ); + + info("Loading a new top-level URL: " + TOP_EMPTY_PAGE); + let browserLoadedPromise = BrowserTestUtils.browserLoaded( + topTab.linkedBrowser + ); + BrowserTestUtils.loadURI(topTab.linkedBrowser, TOP_EMPTY_PAGE); + await browserLoadedPromise; + + // Create Iframe in the top-level page and verify its state. + info("Creating iframe and checking if controlled"); + let { controlled } = await SpecialPowers.spawn( + topTab.linkedBrowser, + [{ url: SW_IFRAME_PAGE }], + async function({ url }) { + content.document.userInteractionForTesting(); + const payload = await content.wrappedJSObject.createIframeAndWaitForMessage( + url + ); + return payload; + } + ); + + ok(controlled, "Should be controlled!"); + + // Create a nested Iframe. + info("Creating nested-iframe and checking if controlled"); + let { nested_controlled } = await SpecialPowers.spawn( + topTab.linkedBrowser, + [{ url: SW_IFRAME_PAGE }], + async function({ url }) { + const payload = await content.wrappedJSObject.createNestedIframeAndWaitForMessage( + url + ); + return payload; + } + ); + + ok(!nested_controlled, "Should not be controlled!"); + + info("Loading the SW unregister page: " + SW_REGISTER_PAGE); + browserLoadedPromise = BrowserTestUtils.browserLoaded(topTab.linkedBrowser); + BrowserTestUtils.loadURI(topTab.linkedBrowser, SW_REGISTER_PAGE); + await browserLoadedPromise; + + await SpecialPowers.spawn(topTab.linkedBrowser, [], async function() { + await content.wrappedJSObject.unregisterAll(); + }); + + // Close the testing tab. + BrowserTestUtils.removeTab(topTab); +}); diff --git a/dom/serviceworkers/test/browser_base_force_refresh.html b/dom/serviceworkers/test/browser_base_force_refresh.html new file mode 100644 index 0000000000..1c3d02d42f --- /dev/null +++ b/dom/serviceworkers/test/browser_base_force_refresh.html @@ -0,0 +1,27 @@ + + + + + + + + + diff --git a/dom/serviceworkers/test/browser_cached_force_refresh.html b/dom/serviceworkers/test/browser_cached_force_refresh.html new file mode 100644 index 0000000000..faf2ee7a83 --- /dev/null +++ b/dom/serviceworkers/test/browser_cached_force_refresh.html @@ -0,0 +1,59 @@ + + + + + + + + + diff --git a/dom/serviceworkers/test/browser_devtools_serviceworker_interception.js b/dom/serviceworkers/test/browser_devtools_serviceworker_interception.js new file mode 100644 index 0000000000..a771a455fb --- /dev/null +++ b/dom/serviceworkers/test/browser_devtools_serviceworker_interception.js @@ -0,0 +1,297 @@ +"use strict"; + +const BASE_URI = "http://mochi.test:8888/browser/dom/serviceworkers/test/"; +const emptyDoc = BASE_URI + "empty.html"; +const fakeDoc = BASE_URI + "fake.html"; +const helloDoc = BASE_URI + "hello.html"; + +const CROSS_URI = "http://example.com/browser/dom/serviceworkers/test/"; +const crossRedirect = CROSS_URI + "redirect"; +const crossHelloDoc = CROSS_URI + "hello.html"; + +const sw = BASE_URI + "fetch.js"; + +const gIsParentInterceptEnabled = Cc["@mozilla.org/serviceworkers/manager;1"] + .getService(Ci.nsIServiceWorkerManager) + .isParentInterceptEnabled(); + +async function checkObserver({ aInput, isParentInterceptEnabled }) { + let interceptedChannel = null; + + // We always get two channels which receive the "http-on-stop-request" + // notification if the service worker hijacks the request and respondWith an + // another fetch. One is for the "outer" window request when the other one is + // for the "inner" service worker request. Therefore, distinguish them by the + // order. + let waitForSecondOnStopRequest = aInput.intercepted; + + let promiseResolve; + + function observer(aSubject) { + let channel = aSubject.QueryInterface(Ci.nsIChannel); + // Since we cannot make sure that the network event triggered by the fetch() + // in this testcase is the very next event processed by ObserverService, we + // have to wait until we catch the one we want. + if (!channel.URI.spec.includes(aInput.expectedURL)) { + return; + } + + if (waitForSecondOnStopRequest) { + waitForSecondOnStopRequest = false; + return; + } + + // Wait for the service worker to intercept the request if it's expected to + // be intercepted + if (aInput.intercepted && interceptedChannel === null) { + return; + } else if (interceptedChannel) { + ok( + aInput.intercepted, + "Service worker intercepted the channel as expected" + ); + } else { + ok(!aInput.intercepted, "The channel doesn't be intercepted"); + } + + var tc = interceptedChannel + ? interceptedChannel.QueryInterface(Ci.nsITimedChannel) + : aSubject.QueryInterface(Ci.nsITimedChannel); + + // Check service worker related timings. + var serviceWorkerTimings = [ + { + start: tc.launchServiceWorkerStartTime, + end: tc.launchServiceWorkerEndTime, + }, + { + start: tc.dispatchFetchEventStartTime, + end: tc.dispatchFetchEventEndTime, + }, + { start: tc.handleFetchEventStartTime, end: tc.handleFetchEventEndTime }, + ]; + if (aInput.swPresent) { + // TODO: remove this condition (but keep the if statement's body) when + // bug 1577829 is resolved. + if (!isParentInterceptEnabled) { + serviceWorkerTimings.reduce((aPreviousTimings, aCurrentTimings) => { + ok(aPreviousTimings.start !== 0, "Start time check."); + ok( + aPreviousTimings.start <= aCurrentTimings.start, + "Start time order check." + ); + ok( + aPreviousTimings.end <= aCurrentTimings.end, + "End time order check." + ); + ok( + aCurrentTimings.start <= aCurrentTimings.end, + "Start time should be smaller than end time." + ); + return aCurrentTimings; + }); + } + } else { + serviceWorkerTimings.forEach(aTimings => { + is(aTimings.start, 0, "SW timings should be 0."); + is(aTimings.end, 0, "SW timings should be 0."); + }); + } + + // Check network related timings. + var networkTimings = [ + tc.domainLookupStartTime, + tc.domainLookupEndTime, + tc.connectStartTime, + tc.connectEndTime, + tc.requestStartTime, + tc.responseStartTime, + tc.responseEndTime, + ]; + if (aInput.fetch) { + networkTimings.reduce((aPreviousTiming, aCurrentTiming) => { + ok(aPreviousTiming <= aCurrentTiming, "Checking network timings"); + return aCurrentTiming; + }); + } else { + networkTimings.forEach(aTiming => + is(aTiming, 0, "Network timings should be 0.") + ); + } + + interceptedChannel = null; + Services.obs.removeObserver(observer, topic); + promiseResolve(); + } + + function addInterceptedChannel(aSubject) { + let channel = aSubject.QueryInterface(Ci.nsIChannel); + if (!channel.URI.spec.includes(aInput.url)) { + return; + } + + // Hold the interceptedChannel until checking timing information. + // Note: It's a interceptedChannel in the type of httpChannel + interceptedChannel = channel; + Services.obs.removeObserver(addInterceptedChannel, topic_SW); + } + + const topic = "http-on-stop-request"; + const topic_SW = "service-worker-synthesized-response"; + + Services.obs.addObserver(observer, topic); + if (aInput.intercepted) { + Services.obs.addObserver(addInterceptedChannel, topic_SW); + } + + await new Promise(resolve => { + promiseResolve = resolve; + }); +} + +async function contentFetch(aURL) { + if (aURL.includes("redirect")) { + await content.window.fetch(aURL, { mode: "no-cors" }); + return; + } + await content.window.fetch(aURL); +} + +// The observer topics are fired in the parent process in parent-intercept +// and the content process in child-intercept. This function will handle running +// the check in the correct process. Note that it will block until the observers +// are notified. +async function fetchAndCheckObservers( + aFetchBrowser, + aObserverBrowser, + aTestCase +) { + let promise = null; + + let checkArgs = { + aInput: aTestCase, + isParentInterceptEnabled: gIsParentInterceptEnabled, + }; + if (gIsParentInterceptEnabled) { + promise = checkObserver(checkArgs); + } else { + promise = SpecialPowers.spawn(aObserverBrowser, [checkArgs], checkObserver); + } + + await SpecialPowers.spawn(aFetchBrowser, [aTestCase.url], contentFetch); + await promise; +} + +async function registerSWAndWaitForActive(aServiceWorker) { + let swr = await content.navigator.serviceWorker.register(aServiceWorker, { + scope: "empty.html", + }); + await new Promise(resolve => { + let worker = swr.installing || swr.waiting || swr.active; + if (worker.state === "activated") { + return resolve(); + } + + worker.addEventListener("statechange", () => { + if (worker.state === "activated") { + return resolve(); + } + }); + }); + + await new Promise(resolve => { + if (content.navigator.serviceWorker.controller) { + return resolve(); + } + + content.navigator.serviceWorker.addEventListener( + "controllerchange", + resolve, + { once: true } + ); + }); +} + +async function unregisterSW() { + let swr = await content.navigator.serviceWorker.getRegistration(); + swr.unregister(); +} + +add_task(async function test_serivce_worker_interception() { + info("Setting the prefs to having e10s enabled"); + await SpecialPowers.pushPrefEnv({ + set: [ + // Make sure observer and testing function run in the same process + ["dom.ipc.processCount", 1], + ["dom.serviceWorkers.enabled", true], + ["dom.serviceWorkers.testing.enabled", true], + ], + }); + + waitForExplicitFinish(); + + info("Open the tab"); + let tab = BrowserTestUtils.addTab(gBrowser, emptyDoc); + let tabBrowser = gBrowser.getBrowserForTab(tab); + await BrowserTestUtils.browserLoaded(tabBrowser); + + info("Open the tab for observing"); + let tab_observer = BrowserTestUtils.addTab(gBrowser, emptyDoc); + let tabBrowser_observer = gBrowser.getBrowserForTab(tab_observer); + await BrowserTestUtils.browserLoaded(tabBrowser_observer); + + let testcases = [ + { + url: helloDoc, + expectedURL: helloDoc, + swPresent: false, + intercepted: false, + fetch: true, + }, + { + url: fakeDoc, + expectedURL: helloDoc, + swPresent: true, + intercepted: true, + fetch: false, // should use HTTP cache + }, + { + // Bypass http cache + url: helloDoc + "?ForBypassingHttpCache=" + Date.now(), + expectedURL: helloDoc, + swPresent: true, + intercepted: false, + fetch: true, + }, + { + // no-cors mode redirect to no-cors mode (trigger internal redirect) + url: crossRedirect + "?url=" + crossHelloDoc + "&mode=no-cors", + expectedURL: crossHelloDoc, + swPresent: true, + redirect: "hello.html", + intercepted: true, + fetch: true, + }, + ]; + + info("Test 1: Verify simple fetch"); + await fetchAndCheckObservers(tabBrowser, tabBrowser_observer, testcases[0]); + + info("Register a service worker"); + await SpecialPowers.spawn(tabBrowser, [sw], registerSWAndWaitForActive); + + info("Test 2: Verify simple hijack"); + await fetchAndCheckObservers(tabBrowser, tabBrowser_observer, testcases[1]); + + info("Test 3: Verify fetch without using http cache"); + await fetchAndCheckObservers(tabBrowser, tabBrowser_observer, testcases[2]); + + info("Test 4: make a internal redirect"); + await fetchAndCheckObservers(tabBrowser, tabBrowser_observer, testcases[3]); + + info("Clean up"); + await SpecialPowers.spawn(tabBrowser, [undefined], unregisterSW); + + gBrowser.removeTab(tab); + gBrowser.removeTab(tab_observer); +}); diff --git a/dom/serviceworkers/test/browser_download.js b/dom/serviceworkers/test/browser_download.js new file mode 100644 index 0000000000..d7cadb0e99 --- /dev/null +++ b/dom/serviceworkers/test/browser_download.js @@ -0,0 +1,96 @@ +/* Any copyright is dedicated to the Public Domain. + * http://creativecommons.org/publicdomain/zero/1.0/ */ + +var Downloads = ChromeUtils.import("resource://gre/modules/Downloads.jsm", {}) + .Downloads; + +var gTestRoot = getRootDirectory(gTestPath).replace( + "chrome://mochitests/content/", + "http://mochi.test:8888/" +); + +function getFile(aFilename) { + if (aFilename.startsWith("file:")) { + var url = NetUtil.newURI(aFilename).QueryInterface(Ci.nsIFileURL); + return url.file.clone(); + } + + var file = Cc["@mozilla.org/file/local;1"].createInstance(Ci.nsIFile); + file.initWithPath(aFilename); + return file; +} + +function windowObserver(win, topic) { + if (topic !== "domwindowopened") { + return; + } + + win.addEventListener( + "load", + function() { + if ( + win.document.documentURI === + "chrome://mozapps/content/downloads/unknownContentType.xhtml" + ) { + executeSoon(function() { + let dialog = win.document.getElementById("unknownContentType"); + let button = dialog.getButton("accept"); + button.disabled = false; + dialog.acceptDialog(); + }); + } + }, + { once: true } + ); +} + +function test() { + waitForExplicitFinish(); + + Services.ww.registerNotification(windowObserver); + + SpecialPowers.pushPrefEnv( + { + set: [ + ["dom.serviceWorkers.enabled", true], + ["dom.serviceWorkers.exemptFromPerDomainMax", true], + ["dom.serviceWorkers.testing.enabled", true], + ], + }, + function() { + var url = gTestRoot + "download/window.html"; + var tab = BrowserTestUtils.addTab(gBrowser); + gBrowser.selectedTab = tab; + + Downloads.getList(Downloads.ALL) + .then(function(downloadList) { + var downloadListener; + + function downloadVerifier(aDownload) { + if (aDownload.succeeded) { + var file = getFile(aDownload.target.path); + ok(file.exists(), "download completed"); + is(file.fileSize, 33, "downloaded file has correct size"); + file.remove(false); + downloadList.remove(aDownload).catch(Cu.reportError); + downloadList.removeView(downloadListener).catch(Cu.reportError); + gBrowser.removeTab(tab); + Services.ww.unregisterNotification(windowObserver); + + executeSoon(finish); + } + } + + downloadListener = { + onDownloadAdded: downloadVerifier, + onDownloadChanged: downloadVerifier, + }; + + return downloadList.addView(downloadListener); + }) + .then(function() { + BrowserTestUtils.loadURI(gBrowser, url); + }); + } + ); +} diff --git a/dom/serviceworkers/test/browser_download_canceled.js b/dom/serviceworkers/test/browser_download_canceled.js new file mode 100644 index 0000000000..1a71a44e78 --- /dev/null +++ b/dom/serviceworkers/test/browser_download_canceled.js @@ -0,0 +1,155 @@ +/* Any copyright is dedicated to the Public Domain. + * http://creativecommons.org/publicdomain/zero/1.0/ */ + +/* + * Test cancellation of a download in order to test edge-cases related to + * channel diversion. Channel diversion occurs in cases of file (and PSM cert) + * downloads where we realize in the child that we really want to consume the + * channel data in the parent. For data "sourced" by the parent, like network + * data, data streaming to the child is suspended and the parent waits for the + * child to send back the data it already received, then the channel is resumed. + * For data generated by the child, such as (the current, to be mooted by + * parent-intercept) child-side intercept, the data (currently) stream is + * continually pumped up to the parent. + * + * In particular, we want to reproduce the circumstances of Bug 1418795 where + * the child-side input-stream pump attempts to send data to the parent process + * but the parent has canceled the channel and so the IPC Actor has been torn + * down. Diversion begins once the nsURILoader receives the OnStartRequest + * notification with the headers, so there are two ways to produce + */ + +ChromeUtils.import("resource://gre/modules/Services.jsm"); +const { Downloads } = ChromeUtils.import( + "resource://gre/modules/Downloads.jsm" +); + +/** + * Clear the downloads list so other tests don't see our byproducts. + */ +async function clearDownloads() { + const downloads = await Downloads.getList(Downloads.ALL); + downloads.removeFinished(); +} + +/** + * Returns a Promise that will be resolved once the download dialog shows up and + * we have clicked the given button. + */ +function promiseClickDownloadDialogButton(buttonAction) { + const uri = "chrome://mozapps/content/downloads/unknownContentType.xhtml"; + return BrowserTestUtils.promiseAlertDialogOpen( + buttonAction, + uri, + async win => { + // nsHelperAppDlg.js currently uses an eval-based setTimeout(0) to invoke + // its postShowCallback that results in a misleading error to the console + // if we close the dialog before it gets a chance to run. Just a + // setTimeout is not sufficient because it appears we get our "load" + // listener before the document's, so we use TestUtils.waitForTick() to + // defer until after its load handler runs, then use setTimeout(0) to end + // up after its eval. + await TestUtils.waitForTick(); + + await new Promise(resolve => setTimeout(resolve, 0)); + + const button = win.document + .getElementById("unknownContentType") + .getButton(buttonAction); + button.disabled = false; + info(`clicking ${buttonAction} button`); + button.click(); + } + ); +} + +async function performCanceledDownload(tab, path) { + // Start waiting for the download dialog before triggering the download. + info("watching for download popup"); + const cancelDownload = promiseClickDownloadDialogButton("cancel"); + + // Trigger the download. + info(`triggering download of "${path}"`); + /* eslint-disable no-shadow */ + await SpecialPowers.spawn(tab.linkedBrowser, [path], function(path) { + // Put a Promise in place that we can wait on for stream closure. + content.wrappedJSObject.trackStreamClosure(path); + // Create the link and trigger the download. + const link = content.document.createElement("a"); + link.href = path; + link.download = path; + content.document.body.appendChild(link); + link.click(); + }); + /* eslint-enable no-shadow */ + + // Wait for the cancelation to have been triggered. + info("waiting for download popup"); + await cancelDownload; + ok(true, "canceled download"); + + // Wait for confirmation that the stream stopped. + info(`wait for the ${path} stream to close.`); + /* eslint-disable no-shadow */ + const why = await SpecialPowers.spawn(tab.linkedBrowser, [path], function( + path + ) { + return content.wrappedJSObject.streamClosed[path].promise; + }); + /* eslint-enable no-shadow */ + is(why.why, "canceled", "Ensure the stream canceled instead of timing out."); + // Note that for the "sw-stream-download" case, we end up with a bogus + // reason of "'close' may only be called on a stream in the 'readable' state." + // Since we aren't actually invoking close(), I'm assuming this is an + // implementation bug that will be corrected in the web platform tests. + info(`Cancellation reason: ${why.message} after ${why.ticks} ticks`); +} + +const gTestRoot = getRootDirectory(gTestPath).replace( + "chrome://mochitests/content/", + "http://mochi.test:8888/" +); + +const PAGE_URL = `${gTestRoot}download_canceled/page_download_canceled.html`; + +add_task(async function interruptedDownloads() { + await SpecialPowers.pushPrefEnv({ + set: [ + ["dom.serviceWorkers.enabled", true], + ["dom.serviceWorkers.exemptFromPerDomainMax", true], + ["dom.serviceWorkers.testing.enabled", true], + ["javascript.options.streams", true], + ], + }); + + // Open the tab + const tab = await BrowserTestUtils.openNewForegroundTab({ + gBrowser, + opening: PAGE_URL, + }); + + // Wait for it to become controlled. Check that it was a promise that + // resolved as expected rather than undefined by checking the return value. + const controlled = await SpecialPowers.spawn( + tab.linkedBrowser, + [], + function() { + // This is a promise set up by the page during load, and we are post-load. + return content.wrappedJSObject.controlled; + } + ); + is(controlled, "controlled", "page became controlled"); + + // Download a pass-through fetch stream. + await performCanceledDownload(tab, "sw-passthrough-download"); + + // Download a SW-generated stream + await performCanceledDownload(tab, "sw-stream-download"); + + // Cleanup + await SpecialPowers.spawn(tab.linkedBrowser, [], function() { + return content.wrappedJSObject.registration.unregister(); + }); + BrowserTestUtils.removeTab(tab); + await clearDownloads(); +}); diff --git a/dom/serviceworkers/test/browser_force_refresh.js b/dom/serviceworkers/test/browser_force_refresh.js new file mode 100644 index 0000000000..f1660ba669 --- /dev/null +++ b/dom/serviceworkers/test/browser_force_refresh.js @@ -0,0 +1,85 @@ +/* Any copyright is dedicated to the Public Domain. + * http://creativecommons.org/publicdomain/zero/1.0/ */ + +var gTestRoot = getRootDirectory(gTestPath).replace( + "chrome://mochitests/content/", + "http://mochi.test:8888/" +); + +async function refresh() { + EventUtils.synthesizeKey("R", { accelKey: true }); +} + +async function forceRefresh() { + EventUtils.synthesizeKey("R", { accelKey: true, shiftKey: true }); +} + +async function done() { + // unregister window actors + ChromeUtils.unregisterWindowActor("ForceRefresh"); + let tab = gBrowser.selectedTab; + let tabBrowser = gBrowser.getBrowserForTab(tab); + await ContentTask.spawn(tabBrowser, null, async function() { + const swr = await content.navigator.serviceWorker.getRegistration(); + await swr.unregister(); + }); + + BrowserTestUtils.removeTab(tab); + executeSoon(finish); +} + +function test() { + waitForExplicitFinish(); + SpecialPowers.pushPrefEnv( + { + set: [ + ["dom.serviceWorkers.enabled", true], + ["dom.serviceWorkers.exemptFromPerDomainMax", true], + ["dom.serviceWorkers.testing.enabled", true], + ["dom.caches.enabled", true], + ["browser.cache.disk.enable", false], + ["browser.cache.memory.enable", false], + ], + }, + async function() { + // create ForceRefreseh window actor + const { ForceRefreshParent } = ChromeUtils.import( + getRootDirectory(gTestPath) + "ForceRefreshParent.jsm" + ); + + // setup helper functions for ForceRefreshParent + ForceRefreshParent.SimpleTest = SimpleTest; + ForceRefreshParent.refresh = refresh; + ForceRefreshParent.forceRefresh = forceRefresh; + ForceRefreshParent.done = done; + + // setup window actor options + let windowActorOptions = { + parent: { + moduleURI: getRootDirectory(gTestPath) + "ForceRefreshParent.jsm", + }, + child: { + moduleURI: getRootDirectory(gTestPath) + "ForceRefreshChild.jsm", + events: { + "base-register": { capture: true, wantUntrusted: true }, + "base-sw-ready": { capture: true, wantUntrusted: true }, + "base-load": { capture: true, wantUntrusted: true }, + "cached-load": { capture: true, wantUntrusted: true }, + "cached-failure": { capture: true, wantUntrusted: true }, + }, + }, + allFrames: true, + }; + + // register ForceRefresh window actors + ChromeUtils.registerWindowActor("ForceRefresh", windowActorOptions); + + // create a new tab and load test url + var url = gTestRoot + "browser_base_force_refresh.html"; + var tab = BrowserTestUtils.addTab(gBrowser); + var tabBrowser = gBrowser.getBrowserForTab(tab); + gBrowser.selectedTab = tab; + BrowserTestUtils.loadURI(gBrowser, url); + } + ); +} diff --git a/dom/serviceworkers/test/browser_intercepted_channel_process_swap.js b/dom/serviceworkers/test/browser_intercepted_channel_process_swap.js new file mode 100644 index 0000000000..f4722e91c0 --- /dev/null +++ b/dom/serviceworkers/test/browser_intercepted_channel_process_swap.js @@ -0,0 +1,110 @@ +/* Any copyright is dedicated to the Public Domain. + http://creativecommons.org/publicdomain/zero/1.0/ */ + +// Tests that navigation loads through intercepted channels result in the +// appropriate process swaps. This appears to only be possible when navigating +// to a cross-origin URL, where that navigation is controlled by a ServiceWorker. + +"use strict"; + +const SAME_ORIGIN = "https://example.com"; +const CROSS_ORIGIN = "https://example.org"; + +const SAME_ORIGIN_ROOT = getRootDirectory(gTestPath).replace( + "chrome://mochitests/content", + SAME_ORIGIN +); +const CROSS_ORIGIN_ROOT = SAME_ORIGIN_ROOT.replace(SAME_ORIGIN, CROSS_ORIGIN); + +const SW_REGISTER_URL = `${CROSS_ORIGIN_ROOT}empty_with_utils.html`; +const SW_SCRIPT_URL = `${CROSS_ORIGIN_ROOT}intercepted_channel_process_swap_worker.js`; +const URL_BEFORE_NAVIGATION = `${SAME_ORIGIN_ROOT}empty.html`; +const CROSS_ORIGIN_URL = `${CROSS_ORIGIN_ROOT}empty.html`; + +const TESTCASES = [ + { + url: CROSS_ORIGIN_URL, + description: + "Controlled cross-origin navigation with network-provided response", + }, + { + url: `${CROSS_ORIGIN_ROOT}this-path-does-not-exist?respondWith=${CROSS_ORIGIN_URL}`, + description: + "Controlled cross-origin navigation with ServiceWorker-provided response", + }, +]; + +async function navigateTab(aTab, aUrl) { + BrowserTestUtils.loadURI(aTab.linkedBrowser, aUrl); + + await BrowserTestUtils.waitForLocationChange(gBrowser, aUrl).then(() => + BrowserTestUtils.browserStopped(aTab.linkedBrowser) + ); +} + +async function runTestcase(aTab, aTestcase) { + info(`Testing ${aTestcase.description}`); + + await navigateTab(aTab, URL_BEFORE_NAVIGATION); + + const [initialPid] = E10SUtils.getBrowserPids(aTab.linkedBrowser); + + await navigateTab(aTab, aTestcase.url); + + const [finalPid] = E10SUtils.getBrowserPids(aTab.linkedBrowser); + + await SpecialPowers.spawn(aTab.linkedBrowser, [], () => { + Assert.ok( + content.navigator.serviceWorker.controller, + `${content.location} should be controlled.` + ); + }); + + Assert.notEqual( + initialPid, + finalPid, + `Navigating from ${URL_BEFORE_NAVIGATION} to ${aTab.linkedBrowser.currentURI.spec} should have resulted in a different PID.` + ); +} + +add_task(async function setupPrefs() { + await SpecialPowers.pushPrefEnv({ + set: [ + ["dom.serviceWorkers.enabled", true], + ["dom.serviceWorkers.testing.enabled", true], + ], + }); +}); + +add_task(async function setupBrowser() { + const tab = await BrowserTestUtils.openNewForegroundTab({ + gBrowser, + opening: SW_REGISTER_URL, + }); + + await SpecialPowers.spawn( + tab.linkedBrowser, + [SW_SCRIPT_URL], + async scriptUrl => { + await content.wrappedJSObject.registerAndWaitForActive(scriptUrl); + } + ); +}); + +add_task(async function runTestcases() { + for (const testcase of TESTCASES) { + await runTestcase(gBrowser.selectedTab, testcase); + } +}); + +add_task(async function cleanup() { + const tab = gBrowser.selectedTab; + + await navigateTab(tab, SW_REGISTER_URL); + + await SpecialPowers.spawn(tab.linkedBrowser, [], async () => { + await content.wrappedJSObject.unregisterAll(); + }); + + BrowserTestUtils.removeTab(tab); +}); diff --git a/dom/serviceworkers/test/browser_remote_type_process_swap.js b/dom/serviceworkers/test/browser_remote_type_process_swap.js new file mode 100644 index 0000000000..b1824a7144 --- /dev/null +++ b/dom/serviceworkers/test/browser_remote_type_process_swap.js @@ -0,0 +1,138 @@ +/* Any copyright is dedicated to the Public Domain. + http://creativecommons.org/publicdomain/zero/1.0/ */ + +"use strict"; + +/** + * This test tests a navigation request to a Service Worker-controlled origin & + * scope that results in a cross-origin redirect to a + * non-Service Worker-controlled scope which additionally participates in + * cross-process redirect. + * + * On success, the test will not crash. + */ + +const ORIGIN = "http://mochi.test:8888"; +const TEST_ROOT = getRootDirectory(gTestPath).replace( + "chrome://mochitests/content", + ORIGIN +); + +const SW_REGISTER_PAGE_URL = `${TEST_ROOT}empty_with_utils.html`; +const SW_SCRIPT_URL = `${TEST_ROOT}empty.js`; + +const FILE_URL = (() => { + // Get the file as an nsIFile. + const file = getChromeDir(getResolvedURI(gTestPath)); + file.append("empty.html"); + + // Convert the nsIFile to an nsIURI to access the path. + return Services.io.newFileURI(file).spec; +})(); + +const CROSS_ORIGIN = "http://example.com"; +const CROSS_ORIGIN_URL = SW_REGISTER_PAGE_URL.replace(ORIGIN, CROSS_ORIGIN); +const CROSS_ORIGIN_REDIRECT_URL = `${TEST_ROOT}redirect.sjs?${CROSS_ORIGIN_URL}`; + +async function loadURI(aXULBrowser, aURI) { + const browserLoadedPromise = BrowserTestUtils.browserLoaded(aXULBrowser); + BrowserTestUtils.loadURI(aXULBrowser, aURI); + + return browserLoadedPromise; +} + +async function runTest() { + // Step 1: register a Service Worker under `ORIGIN` so that all subsequent + // requests to `ORIGIN` will be marked as controlled. + await SpecialPowers.pushPrefEnv({ + set: [ + ["dom.serviceWorkers.enabled", true], + ["dom.serviceWorkers.exemptFromPerDomainMax", true], + ["dom.serviceWorkers.testing.enabled", true], + ["devtools.console.stdout.content", true], + ], + }); + + info(`Loading tab with page ${SW_REGISTER_PAGE_URL}`); + const tab = await BrowserTestUtils.openNewForegroundTab({ + gBrowser, + opening: SW_REGISTER_PAGE_URL, + }); + info(`Loaded page ${SW_REGISTER_PAGE_URL}`); + + info(`Registering Service Worker ${SW_SCRIPT_URL}`); + await SpecialPowers.spawn( + tab.linkedBrowser, + [{ scriptURL: SW_SCRIPT_URL }], + async ({ scriptURL }) => { + await content.wrappedJSObject.registerAndWaitForActive(scriptURL); + } + ); + info(`Registered and activated Service Worker ${SW_SCRIPT_URL}`); + + // Step 2: open a page over file:// and navigate to trigger a process swap + // for the response. + info(`Loading ${FILE_URL}`); + await loadURI(tab.linkedBrowser, FILE_URL); + + Assert.equal( + tab.linkedBrowser.remoteType, + E10SUtils.FILE_REMOTE_TYPE, + `${FILE_URL} should load in a file process` + ); + + info(`Dynamically creating ${FILE_URL}'s link`); + await SpecialPowers.spawn( + tab.linkedBrowser, + [{ href: CROSS_ORIGIN_REDIRECT_URL }], + ({ href }) => { + const { document } = content; + const link = document.createElement("a"); + link.href = href; + link.id = "link"; + link.appendChild(document.createTextNode(href)); + document.body.appendChild(link); + } + ); + + const redirectPromise = BrowserTestUtils.waitForLocationChange( + gBrowser, + CROSS_ORIGIN_URL + ); + + info("Starting navigation"); + await BrowserTestUtils.synthesizeMouseAtCenter( + "#link", + {}, + tab.linkedBrowser + ); + + info(`Waiting for location to change to ${CROSS_ORIGIN_URL}`); + await redirectPromise; + + info("Waiting for the browser to stop"); + await BrowserTestUtils.browserStopped(tab.linkedBrowser); + + if (SpecialPowers.useRemoteSubframes) { + Assert.ok( + E10SUtils.isWebRemoteType(tab.linkedBrowser.remoteType), + `${CROSS_ORIGIN_URL} should load in a web-content process` + ); + } + + // Step 3: cleanup. + info("Loading initial page to unregister all Service Workers"); + await loadURI(tab.linkedBrowser, SW_REGISTER_PAGE_URL); + + info("Unregistering all Service Workers"); + await SpecialPowers.spawn( + tab.linkedBrowser, + [], + async () => await content.wrappedJSObject.unregisterAll() + ); + + info("Closing tab"); + BrowserTestUtils.removeTab(tab); +} + +add_task(runTest); diff --git a/dom/serviceworkers/test/browser_storage_permission.js b/dom/serviceworkers/test/browser_storage_permission.js new file mode 100644 index 0000000000..4d9823c9e4 --- /dev/null +++ b/dom/serviceworkers/test/browser_storage_permission.js @@ -0,0 +1,297 @@ +"use strict"; + +const { PermissionTestUtils } = ChromeUtils.import( + "resource://testing-common/PermissionTestUtils.jsm" +); + +const BASE_URI = "http://mochi.test:8888/browser/dom/serviceworkers/test/"; +const PAGE_URI = BASE_URI + "empty.html"; +const SCOPE = PAGE_URI + "?storage_permission"; +const SW_SCRIPT = BASE_URI + "empty.js"; + +add_task(async function setup() { + await SpecialPowers.pushPrefEnv({ + set: [ + // Until the e10s refactor is complete, use a single process to avoid + // service worker propagation race. + ["dom.ipc.processCount", 1], + ["dom.serviceWorkers.enabled", true], + ["dom.serviceWorkers.testing.enabled", true], + ], + }); + + let tab = BrowserTestUtils.addTab(gBrowser, PAGE_URI); + let browser = gBrowser.getBrowserForTab(tab); + await BrowserTestUtils.browserLoaded(browser); + + await SpecialPowers.spawn( + browser, + [{ script: SW_SCRIPT, scope: SCOPE }], + async function(opts) { + let reg = await content.navigator.serviceWorker.register(opts.script, { + scope: opts.scope, + }); + let worker = reg.installing || reg.waiting || reg.active; + await new Promise(resolve => { + if (worker.state === "activated") { + resolve(); + return; + } + worker.addEventListener("statechange", function onStateChange() { + if (worker.state === "activated") { + worker.removeEventListener("statechange", onStateChange); + resolve(); + } + }); + }); + } + ); + + BrowserTestUtils.removeTab(tab); +}); + +add_task(async function test_allow_permission() { + PermissionTestUtils.add( + PAGE_URI, + "cookie", + Ci.nsICookiePermission.ACCESS_ALLOW + ); + + let tab = BrowserTestUtils.addTab(gBrowser, SCOPE); + let browser = gBrowser.getBrowserForTab(tab); + await BrowserTestUtils.browserLoaded(browser); + + let controller = await SpecialPowers.spawn(browser, [], async function() { + return content.navigator.serviceWorker.controller; + }); + + ok(!!controller, "page should be controlled with storage allowed"); + + BrowserTestUtils.removeTab(tab); +}); + +add_task(async function test_deny_permission() { + PermissionTestUtils.add( + PAGE_URI, + "cookie", + Ci.nsICookiePermission.ACCESS_DENY + ); + + let tab = BrowserTestUtils.addTab(gBrowser, SCOPE); + let browser = gBrowser.getBrowserForTab(tab); + await BrowserTestUtils.browserLoaded(browser); + + let controller = await SpecialPowers.spawn(browser, [], async function() { + return content.navigator.serviceWorker.controller; + }); + + is(controller, null, "page should be not controlled with storage denied"); + + BrowserTestUtils.removeTab(tab); + PermissionTestUtils.remove(PAGE_URI, "cookie"); +}); + +add_task(async function test_session_permission() { + PermissionTestUtils.add( + PAGE_URI, + "cookie", + Ci.nsICookiePermission.ACCESS_SESSION + ); + + let tab = BrowserTestUtils.addTab(gBrowser, SCOPE); + let browser = gBrowser.getBrowserForTab(tab); + await BrowserTestUtils.browserLoaded(browser); + + let controller = await SpecialPowers.spawn(browser, [], async function() { + return content.navigator.serviceWorker.controller; + }); + + is(controller, null, "page should be not controlled with session storage"); + + BrowserTestUtils.removeTab(tab); + PermissionTestUtils.remove(PAGE_URI, "cookie"); +}); + +// Test to verify an about:blank iframe successfully inherits the +// parent's controller when storage is blocked between opening the +// parent page and creating the iframe. +add_task(async function test_block_storage_before_blank_iframe() { + PermissionTestUtils.remove(PAGE_URI, "cookie"); + + let tab = BrowserTestUtils.addTab(gBrowser, SCOPE); + let browser = gBrowser.getBrowserForTab(tab); + await BrowserTestUtils.browserLoaded(browser); + + let controller = await SpecialPowers.spawn(browser, [], async function() { + return content.navigator.serviceWorker.controller; + }); + + ok(!!controller, "page should be controlled with storage allowed"); + + let controller2 = await SpecialPowers.spawn(browser, [], async function() { + let f = content.document.createElement("iframe"); + content.document.body.appendChild(f); + await new Promise(resolve => (f.onload = resolve)); + return !!f.contentWindow.navigator.serviceWorker.controller; + }); + + ok(!!controller2, "page should be controlled with storage allowed"); + + await SpecialPowers.pushPrefEnv({ + set: [ + ["network.cookie.cookieBehavior", Ci.nsICookieService.BEHAVIOR_REJECT], + ], + }); + + let controller3 = await SpecialPowers.spawn(browser, [], async function() { + let f = content.document.createElement("iframe"); + content.document.body.appendChild(f); + await new Promise(resolve => (f.onload = resolve)); + return !!f.contentWindow.navigator.serviceWorker.controller; + }); + + ok(!!controller3, "page should be controlled with storage allowed"); + + await SpecialPowers.popPrefEnv(); + BrowserTestUtils.removeTab(tab); +}); + +// Test to verify a blob URL iframe successfully inherits the +// parent's controller when storage is blocked between opening the +// parent page and creating the iframe. +add_task(async function test_block_storage_before_blob_iframe() { + PermissionTestUtils.remove(PAGE_URI, "cookie"); + + let tab = BrowserTestUtils.addTab(gBrowser, SCOPE); + let browser = gBrowser.getBrowserForTab(tab); + await BrowserTestUtils.browserLoaded(browser); + + let controller = await SpecialPowers.spawn(browser, [], async function() { + return content.navigator.serviceWorker.controller; + }); + + ok(!!controller, "page should be controlled with storage allowed"); + + let controller2 = await SpecialPowers.spawn(browser, [], async function() { + let b = new content.Blob([""], { + type: "text/html", + }); + let f = content.document.createElement("iframe"); + // No need to call revokeObjectURL() since the window will be closed shortly. + f.src = content.URL.createObjectURL(b); + content.document.body.appendChild(f); + await new Promise(resolve => (f.onload = resolve)); + return !!f.contentWindow.navigator.serviceWorker.controller; + }); + + ok(!!controller2, "page should be controlled with storage allowed"); + + await SpecialPowers.pushPrefEnv({ + set: [ + ["network.cookie.cookieBehavior", Ci.nsICookieService.BEHAVIOR_REJECT], + ], + }); + + let controller3 = await SpecialPowers.spawn(browser, [], async function() { + let b = new content.Blob([""], { + type: "text/html", + }); + let f = content.document.createElement("iframe"); + // No need to call revokeObjectURL() since the window will be closed shortly. + f.src = content.URL.createObjectURL(b); + content.document.body.appendChild(f); + await new Promise(resolve => (f.onload = resolve)); + return !!f.contentWindow.navigator.serviceWorker.controller; + }); + + ok(!!controller3, "page should be controlled with storage allowed"); + + await SpecialPowers.popPrefEnv(); + BrowserTestUtils.removeTab(tab); +}); + +// Test to verify a blob worker script does not hit our service +// worker storage assertions when storage is blocked between opening +// the parent page and creating the worker. Note, we cannot +// explicitly check if the worker is controlled since we don't expose +// WorkerNavigator.serviceWorkers.controller yet. +add_task(async function test_block_storage_before_blob_worker() { + PermissionTestUtils.remove(PAGE_URI, "cookie"); + + let tab = BrowserTestUtils.addTab(gBrowser, SCOPE); + let browser = gBrowser.getBrowserForTab(tab); + await BrowserTestUtils.browserLoaded(browser); + + let controller = await SpecialPowers.spawn(browser, [], async function() { + return content.navigator.serviceWorker.controller; + }); + + ok(!!controller, "page should be controlled with storage allowed"); + + let scriptURL = await SpecialPowers.spawn(browser, [], async function() { + let b = new content.Blob( + ["self.postMessage(self.location.href);self.close()"], + { type: "application/javascript" } + ); + // No need to call revokeObjectURL() since the window will be closed shortly. + let u = content.URL.createObjectURL(b); + let w = new content.Worker(u); + return await new Promise(resolve => { + w.onmessage = e => resolve(e.data); + }); + }); + + ok(scriptURL.startsWith("blob:"), "blob URL worker should run"); + + await SpecialPowers.pushPrefEnv({ + set: [ + ["network.cookie.cookieBehavior", Ci.nsICookieService.BEHAVIOR_REJECT], + ], + }); + + let scriptURL2 = await SpecialPowers.spawn(browser, [], async function() { + let b = new content.Blob( + ["self.postMessage(self.location.href);self.close()"], + { type: "application/javascript" } + ); + // No need to call revokeObjectURL() since the window will be closed shortly. + let u = content.URL.createObjectURL(b); + let w = new content.Worker(u); + return await new Promise(resolve => { + w.onmessage = e => resolve(e.data); + }); + }); + + ok(scriptURL2.startsWith("blob:"), "blob URL worker should run"); + + await SpecialPowers.popPrefEnv(); + BrowserTestUtils.removeTab(tab); +}); + +add_task(async function cleanup() { + PermissionTestUtils.remove(PAGE_URI, "cookie"); + + let tab = BrowserTestUtils.addTab(gBrowser, PAGE_URI); + let browser = gBrowser.getBrowserForTab(tab); + await BrowserTestUtils.browserLoaded(browser); + + await SpecialPowers.spawn(browser, [SCOPE], async function(uri) { + let reg = await content.navigator.serviceWorker.getRegistration(uri); + let worker = reg.active; + await reg.unregister(); + await new Promise(resolve => { + if (worker.state === "redundant") { + resolve(); + return; + } + worker.addEventListener("statechange", function onStateChange() { + if (worker.state === "redundant") { + worker.removeEventListener("statechange", onStateChange); + resolve(); + } + }); + }); + }); + + BrowserTestUtils.removeTab(tab); +}); diff --git a/dom/serviceworkers/test/browser_storage_recovery.js b/dom/serviceworkers/test/browser_storage_recovery.js new file mode 100644 index 0000000000..d9e3e7314f --- /dev/null +++ b/dom/serviceworkers/test/browser_storage_recovery.js @@ -0,0 +1,155 @@ +"use strict"; + +// This test registers a SW for a scope that will never control a document +// and therefore never trigger a "fetch" functional event that would +// automatically attempt to update the registration. The overlap of the +// PAGE_URI and SCOPE is incidental. checkForUpdate is the only thing that +// will trigger an update of the registration and so there is no need to +// worry about Schedule Job races to coalesce an update job. + +const BASE_URI = "http://mochi.test:8888/browser/dom/serviceworkers/test/"; +const PAGE_URI = BASE_URI + "empty.html"; +const SCOPE = PAGE_URI + "?storage_recovery"; +const SW_SCRIPT = BASE_URI + "storage_recovery_worker.sjs"; + +async function checkForUpdate(browser) { + return SpecialPowers.spawn(browser, [SCOPE], async function(uri) { + let reg = await content.navigator.serviceWorker.getRegistration(uri); + await reg.update(); + return !!reg.installing; + }); +} + +// Delete all of our chrome-namespace Caches for this origin, leaving any +// content-owned caches in place. This is exclusively for simulating loss +// of the origin's storage without loss of the registration and without +// having to worry that future enhancements to QuotaClients/ServiceWorkerRegistrar +// will break this test. If you want to wipe storage for an origin, use +// QuotaManager APIs +async function wipeStorage(u) { + let uri = Services.io.newURI(u); + let principal = Services.scriptSecurityManager.createContentPrincipal( + uri, + {} + ); + let caches = new CacheStorage("chrome", principal); + let list = await caches.keys(); + return Promise.all(list.map(c => caches.delete(c))); +} + +add_task(async function setup() { + await SpecialPowers.pushPrefEnv({ + set: [ + // Until the e10s refactor is complete, use a single process to avoid + // service worker propagation race. + ["dom.ipc.processCount", 1], + ["dom.serviceWorkers.enabled", true], + ["dom.serviceWorkers.testing.enabled", true], + ["dom.serviceWorkers.idle_timeout", 0], + ], + }); + + // Configure the server script to not redirect. + await fetch(SW_SCRIPT + "?clear-redirect"); + + let tab = BrowserTestUtils.addTab(gBrowser, PAGE_URI); + let browser = gBrowser.getBrowserForTab(tab); + await BrowserTestUtils.browserLoaded(browser); + + await SpecialPowers.spawn( + browser, + [{ script: SW_SCRIPT, scope: SCOPE }], + async function(opts) { + let reg = await content.navigator.serviceWorker.register(opts.script, { + scope: opts.scope, + }); + let worker = reg.installing || reg.waiting || reg.active; + await new Promise(resolve => { + if (worker.state === "activated") { + resolve(); + return; + } + worker.addEventListener("statechange", function onStateChange() { + if (worker.state === "activated") { + worker.removeEventListener("statechange", onStateChange); + resolve(); + } + }); + }); + } + ); + + BrowserTestUtils.removeTab(tab); +}); + +// Verify that our service worker doesn't update normally. +add_task(async function normal_update_check() { + let tab = BrowserTestUtils.addTab(gBrowser, PAGE_URI); + let browser = gBrowser.getBrowserForTab(tab); + await BrowserTestUtils.browserLoaded(browser); + + let updated = await checkForUpdate(browser); + ok(!updated, "normal update check should not trigger an update"); + + BrowserTestUtils.removeTab(tab); +}); + +// Test what happens when we wipe the service worker scripts +// out from under the site before triggering the update. This +// should cause an update to occur. +add_task(async function wiped_update_check() { + // Wipe the backing cache storage, but leave the SW registered. + await wipeStorage(PAGE_URI); + + let tab = BrowserTestUtils.addTab(gBrowser, PAGE_URI); + let browser = gBrowser.getBrowserForTab(tab); + await BrowserTestUtils.browserLoaded(browser); + + let updated = await checkForUpdate(browser); + ok(updated, "wiping the service worker scripts should trigger an update"); + + BrowserTestUtils.removeTab(tab); +}); + +// Test what happens when we wipe the service worker scripts +// out from under the site before triggering the update. This +// should cause an update to occur. +add_task(async function wiped_and_failed_update_check() { + // Wipe the backing cache storage, but leave the SW registered. + await wipeStorage(PAGE_URI); + + // Configure the service worker script to redirect. This will + // prevent the update from completing successfully. + await fetch(SW_SCRIPT + "?set-redirect"); + + let tab = BrowserTestUtils.addTab(gBrowser, PAGE_URI); + let browser = gBrowser.getBrowserForTab(tab); + await BrowserTestUtils.browserLoaded(browser); + + // Attempt to update the service worker. This should throw + // an error because the script is now redirecting. + let updateFailed = false; + try { + await checkForUpdate(browser); + } catch (e) { + updateFailed = true; + } + ok(updateFailed, "redirecting service worker script should fail to update"); + + // Also, since the existing service worker's scripts are broken + // we should also remove the registration completely when the + // update fails. + let exists = await SpecialPowers.spawn(browser, [SCOPE], async function(uri) { + let reg = await content.navigator.serviceWorker.getRegistration(uri); + return !!reg; + }); + ok( + !exists, + "registration should be removed after scripts are wiped and update fails" + ); + + // Note, we don't have to clean up the service worker registration + // since its effectively been force-removed here. + + BrowserTestUtils.removeTab(tab); +}); diff --git a/dom/serviceworkers/test/browser_unregister_with_containers.js b/dom/serviceworkers/test/browser_unregister_with_containers.js new file mode 100644 index 0000000000..0304f70c1d --- /dev/null +++ b/dom/serviceworkers/test/browser_unregister_with_containers.js @@ -0,0 +1,153 @@ +"use strict"; + +const BASE_URI = "http://mochi.test:8888/browser/dom/serviceworkers/test/"; +const PAGE_URI = BASE_URI + "empty.html"; +const SCOPE = PAGE_URI + "?unregister_with_containers"; +const SW_SCRIPT = BASE_URI + "empty.js"; + +function doRegister(browser) { + return SpecialPowers.spawn( + browser, + [{ script: SW_SCRIPT, scope: SCOPE }], + async function(opts) { + let reg = await content.navigator.serviceWorker.register(opts.script, { + scope: opts.scope, + }); + let worker = reg.installing || reg.waiting || reg.active; + await new Promise(resolve => { + if (worker.state === "activated") { + resolve(); + return; + } + worker.addEventListener("statechange", function onStateChange() { + if (worker.state === "activated") { + worker.removeEventListener("statechange", onStateChange); + resolve(); + } + }); + }); + } + ); +} + +function doUnregister(browser) { + return SpecialPowers.spawn(browser, [SCOPE], async function(uri) { + let reg = await content.navigator.serviceWorker.getRegistration(uri); + let worker = reg.active; + await reg.unregister(); + await new Promise(resolve => { + if (worker.state === "redundant") { + resolve(); + return; + } + worker.addEventListener("statechange", function onStateChange() { + if (worker.state === "redundant") { + worker.removeEventListener("statechange", onStateChange); + resolve(); + } + }); + }); + }); +} + +function isControlled(browser) { + return SpecialPowers.spawn(browser, [], function() { + return !!content.navigator.serviceWorker.controller; + }); +} + +async function checkControlled(browser) { + let controlled = await isControlled(browser); + ok(controlled, "window should be controlled"); +} + +async function checkUncontrolled(browser) { + let controlled = await isControlled(browser); + ok(!controlled, "window should not be controlled"); +} + +add_task(async function test() { + await SpecialPowers.pushPrefEnv({ + set: [ + // Avoid service worker propagation races by disabling multi-e10s for now. + // This can be removed after the e10s refactor is complete. + ["dom.ipc.processCount", 1], + ["dom.serviceWorkers.enabled", true], + ["dom.serviceWorkers.testing.enabled", true], + ], + }); + + // Setup service workers in two different contexts with the same scope. + let containerTab1 = BrowserTestUtils.addTab(gBrowser, PAGE_URI, { + userContextId: 1, + }); + let containerBrowser1 = gBrowser.getBrowserForTab(containerTab1); + await BrowserTestUtils.browserLoaded(containerBrowser1); + + let containerTab2 = BrowserTestUtils.addTab(gBrowser, PAGE_URI, { + userContextId: 2, + }); + let containerBrowser2 = gBrowser.getBrowserForTab(containerTab2); + await BrowserTestUtils.browserLoaded(containerBrowser2); + + await doRegister(containerBrowser1); + await doRegister(containerBrowser2); + + await checkUncontrolled(containerBrowser1); + await checkUncontrolled(containerBrowser2); + + // Close the tabs we used to register the service workers. These are not + // controlled. + BrowserTestUtils.removeTab(containerTab1); + BrowserTestUtils.removeTab(containerTab2); + + // Open a controlled tab in each container. + containerTab1 = BrowserTestUtils.addTab(gBrowser, SCOPE, { + userContextId: 1, + }); + containerBrowser1 = gBrowser.getBrowserForTab(containerTab1); + await BrowserTestUtils.browserLoaded(containerBrowser1); + + containerTab2 = BrowserTestUtils.addTab(gBrowser, SCOPE, { + userContextId: 2, + }); + containerBrowser2 = gBrowser.getBrowserForTab(containerTab2); + await BrowserTestUtils.browserLoaded(containerBrowser2); + + await checkControlled(containerBrowser1); + await checkControlled(containerBrowser2); + + // Remove the first container's controlled tab + BrowserTestUtils.removeTab(containerTab1); + + // Create a new uncontrolled tab for the first container and use it to + // unregister the service worker. + containerTab1 = BrowserTestUtils.addTab(gBrowser, PAGE_URI, { + userContextId: 1, + }); + containerBrowser1 = gBrowser.getBrowserForTab(containerTab1); + await BrowserTestUtils.browserLoaded(containerBrowser1); + await doUnregister(containerBrowser1); + + await checkUncontrolled(containerBrowser1); + await checkControlled(containerBrowser2); + + // Remove the second container's controlled tab + BrowserTestUtils.removeTab(containerTab2); + + // Create a new uncontrolled tab for the second container and use it to + // unregister the service worker. + containerTab2 = BrowserTestUtils.addTab(gBrowser, PAGE_URI, { + userContextId: 2, + }); + containerBrowser2 = gBrowser.getBrowserForTab(containerTab2); + await BrowserTestUtils.browserLoaded(containerBrowser2); + await doUnregister(containerBrowser2); + + await checkUncontrolled(containerBrowser1); + await checkUncontrolled(containerBrowser2); + + // Close the two tabs we used to unregister the service worker. + BrowserTestUtils.removeTab(containerTab1); + BrowserTestUtils.removeTab(containerTab2); +}); diff --git a/dom/serviceworkers/test/browser_userContextId_openWindow.js b/dom/serviceworkers/test/browser_userContextId_openWindow.js new file mode 100644 index 0000000000..591d9a9574 --- /dev/null +++ b/dom/serviceworkers/test/browser_userContextId_openWindow.js @@ -0,0 +1,166 @@ +let Cm = Components.manager; + +let swm = Cc["@mozilla.org/serviceworkers/manager;1"].getService( + Ci.nsIServiceWorkerManager +); + +const URI = "https://example.com/browser/dom/serviceworkers/test/empty.html"; +const MOCK_CID = Components.ID("{2a0f83c4-8818-4914-a184-f1172b4eaaa7}"); +const ALERTS_SERVICE_CONTRACT_ID = "@mozilla.org/alerts-service;1"; +const USER_CONTEXT_ID = 3; + +let mockAlertsService = { + showAlert(alert, alertListener) { + ok(true, "Showing alert"); + // eslint-disable-next-line mozilla/no-arbitrary-setTimeout + setTimeout(function() { + alertListener.observe(null, "alertshow", alert.cookie); + }, 100); + // eslint-disable-next-line mozilla/no-arbitrary-setTimeout + setTimeout(function() { + alertListener.observe(null, "alertclickcallback", alert.cookie); + }, 100); + }, + + showAlertNotification( + imageUrl, + title, + text, + textClickable, + cookie, + alertListener, + name, + dir, + lang, + data + ) { + this.showAlert(); + }, + + QueryInterface(aIID) { + if (aIID.equals(Ci.nsISupports) || aIID.equals(Ci.nsIAlertsService)) { + return this; + } + throw Components.Exception("", Cr.NS_ERROR_NO_INTERFACE); + }, + + createInstance(aOuter, aIID) { + if (aOuter != null) { + throw Components.Exception("", Cr.NS_ERROR_NO_AGGREGATION); + } + return this.QueryInterface(aIID); + }, +}; + +registerCleanupFunction(() => { + Cm.QueryInterface(Ci.nsIComponentRegistrar).unregisterFactory( + MOCK_CID, + mockAlertsService + ); +}); + +add_task(async function setup() { + // make sure userContext, SW and notifications are enabled. + await SpecialPowers.pushPrefEnv({ + set: [ + ["privacy.userContext.enabled", true], + ["dom.serviceWorkers.exemptFromPerDomainMax", true], + ["dom.serviceWorkers.enabled", true], + ["dom.serviceWorkers.testing.enabled", true], + ["dom.webnotifications.workers.enabled", true], + ["dom.webnotifications.serviceworker.enabled", true], + ["notification.prompt.testing", true], + ["dom.serviceWorkers.disable_open_click_delay", 1000], + ["dom.serviceWorkers.idle_timeout", 299999], + ["dom.serviceWorkers.idle_extended_timeout", 299999], + ["browser.link.open_newwindow", 3], + ], + }); +}); + +add_task(async function test() { + Cm.QueryInterface(Ci.nsIComponentRegistrar).registerFactory( + MOCK_CID, + "alerts service", + ALERTS_SERVICE_CONTRACT_ID, + mockAlertsService + ); + + // open the tab in the correct userContextId + let tab = BrowserTestUtils.addTab(gBrowser, URI, { + userContextId: USER_CONTEXT_ID, + }); + let browser = gBrowser.getBrowserForTab(tab); + + // select tab and make sure its browser is focused + gBrowser.selectedTab = tab; + tab.ownerGlobal.focus(); + + // wait for tab load + await BrowserTestUtils.browserLoaded(gBrowser.getBrowserForTab(tab)); + + // Waiting for new tab. + let newTabPromise = BrowserTestUtils.waitForNewTab(gBrowser, null, true); + + // here the test. + /* eslint-disable no-shadow */ + let uci = await SpecialPowers.spawn(browser, [URI], uri => { + let uci = content.document.nodePrincipal.userContextId; + + // Registration of the SW + return ( + content.navigator.serviceWorker + .register("file_userContextId_openWindow.js") + + // Activation + .then(swr => { + return new content.window.Promise(resolve => { + let worker = swr.installing; + worker.addEventListener("statechange", () => { + if (worker.state === "activated") { + resolve(swr); + } + }); + }); + }) + + // Ask for an openWindow. + .then(swr => { + swr.showNotification("testPopup"); + return uci; + }) + ); + }); + /* eslint-enable no-shadow */ + + is(uci, USER_CONTEXT_ID, "Tab runs with UCI " + USER_CONTEXT_ID); + + let newTab = await newTabPromise; + + is( + newTab.getAttribute("usercontextid"), + USER_CONTEXT_ID, + "New tab has UCI equal " + USER_CONTEXT_ID + ); + + // wait for SW unregistration + /* eslint-disable no-shadow */ + uci = await SpecialPowers.spawn(browser, [], () => { + let uci = content.document.nodePrincipal.userContextId; + + return content.navigator.serviceWorker + .getRegistration(".") + .then(registration => { + return registration.unregister(); + }) + .then(() => { + return uci; + }); + }); + /* eslint-enable no-shadow */ + + is(uci, USER_CONTEXT_ID, "Tab runs with UCI " + USER_CONTEXT_ID); + + BrowserTestUtils.removeTab(newTab); + BrowserTestUtils.removeTab(tab); +}); diff --git a/dom/serviceworkers/test/bug1151916_driver.html b/dom/serviceworkers/test/bug1151916_driver.html new file mode 100644 index 0000000000..08e7d9414f --- /dev/null +++ b/dom/serviceworkers/test/bug1151916_driver.html @@ -0,0 +1,53 @@ + + + + + diff --git a/dom/serviceworkers/test/bug1151916_worker.js b/dom/serviceworkers/test/bug1151916_worker.js new file mode 100644 index 0000000000..2688b78668 --- /dev/null +++ b/dom/serviceworkers/test/bug1151916_worker.js @@ -0,0 +1,15 @@ +onactivate = function(e) { + e.waitUntil( + self.caches.open("default-cache").then(function(cache) { + var response = new Response("Hi there"); + return cache.put("madeup.txt", response); + }) + ); +}; + +onfetch = function(e) { + if (e.request.url.match(/madeup.txt$/)) { + var p = self.caches.match("madeup.txt", { cacheName: "default-cache" }); + e.respondWith(p); + } +}; diff --git a/dom/serviceworkers/test/bug1240436_worker.js b/dom/serviceworkers/test/bug1240436_worker.js new file mode 100644 index 0000000000..c21f60b60f --- /dev/null +++ b/dom/serviceworkers/test/bug1240436_worker.js @@ -0,0 +1,2 @@ +// a contains a ZERO WIDTH JOINER (0x200D) +var a = "‍"; diff --git a/dom/serviceworkers/test/chrome.ini b/dom/serviceworkers/test/chrome.ini new file mode 100644 index 0000000000..b5cae318e1 --- /dev/null +++ b/dom/serviceworkers/test/chrome.ini @@ -0,0 +1,21 @@ +[DEFAULT] +skip-if = os == 'android' +support-files = + chrome_helpers.js + empty.js + fetch.js + hello.html + serviceworker.html + serviceworkerinfo_iframe.html + serviceworkermanager_iframe.html + serviceworkerregistrationinfo_iframe.html + utils.js + worker.js + worker2.js + +[test_devtools_track_serviceworker_time.html] +[test_privateBrowsing.html] +[test_serviceworkerinfo.xhtml] +skip-if = serviceworker_e10s # nsIWorkerDebugger attribute not implemented +[test_serviceworkermanager.xhtml] +[test_serviceworkerregistrationinfo.xhtml] diff --git a/dom/serviceworkers/test/chrome_helpers.js b/dom/serviceworkers/test/chrome_helpers.js new file mode 100644 index 0000000000..566ba52eca --- /dev/null +++ b/dom/serviceworkers/test/chrome_helpers.js @@ -0,0 +1,71 @@ +let swm = Cc["@mozilla.org/serviceworkers/manager;1"].getService( + Ci.nsIServiceWorkerManager +); + +let EXAMPLE_URL = "https://example.com/chrome/dom/serviceworkers/test/"; + +function waitForIframeLoad(iframe) { + return new Promise(function(resolve) { + iframe.onload = resolve; + }); +} + +function waitForRegister(scope, callback) { + return new Promise(function(resolve) { + let listener = { + onRegister(registration) { + if (registration.scope !== scope) { + return; + } + swm.removeListener(listener); + resolve(callback ? callback(registration) : registration); + }, + }; + swm.addListener(listener); + }); +} + +function waitForUnregister(scope) { + return new Promise(function(resolve) { + let listener = { + onUnregister(registration) { + if (registration.scope !== scope) { + return; + } + swm.removeListener(listener); + resolve(registration); + }, + }; + swm.addListener(listener); + }); +} + +function waitForServiceWorkerRegistrationChange(registration, callback) { + return new Promise(function(resolve) { + let listener = { + onChange() { + registration.removeListener(listener); + if (callback) { + callback(); + } + resolve(callback ? callback() : undefined); + }, + }; + registration.addListener(listener); + }); +} + +function waitForServiceWorkerShutdown() { + return new Promise(function(resolve) { + let observer = { + observe(subject, topic, data) { + if (topic !== "service-worker-shutdown") { + return; + } + SpecialPowers.removeObserver(observer, "service-worker-shutdown"); + resolve(); + }, + }; + SpecialPowers.addObserver(observer, "service-worker-shutdown"); + }); +} diff --git a/dom/serviceworkers/test/claim_clients/client.html b/dom/serviceworkers/test/claim_clients/client.html new file mode 100644 index 0000000000..969a6dbf10 --- /dev/null +++ b/dom/serviceworkers/test/claim_clients/client.html @@ -0,0 +1,43 @@ + + + + + Bug 1130684 - claim client + + + + +

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/claim_oninstall_worker.js b/dom/serviceworkers/test/claim_oninstall_worker.js
new file mode 100644
index 0000000000..6d79c919b0
--- /dev/null
+++ b/dom/serviceworkers/test/claim_oninstall_worker.js
@@ -0,0 +1,7 @@
+oninstall = function(e) {
+  var claimFailedPromise = new Promise(function(resolve, reject) {
+    clients.claim().then(reject, () => resolve());
+  });
+
+  e.waitUntil(claimFailedPromise);
+};
diff --git a/dom/serviceworkers/test/claim_worker_1.js b/dom/serviceworkers/test/claim_worker_1.js
new file mode 100644
index 0000000000..493798a88b
--- /dev/null
+++ b/dom/serviceworkers/test/claim_worker_1.js
@@ -0,0 +1,32 @@
+onactivate = function(e) {
+  var result = {
+    resolve_value: false,
+    match_count_before: -1,
+    match_count_after: -1,
+    message: "claim_worker_1",
+  };
+
+  self.clients
+    .matchAll()
+    .then(function(matched) {
+      // should be 0
+      result.match_count_before = matched.length;
+    })
+    .then(function() {
+      return self.clients.claim();
+    })
+    .then(function(ret) {
+      result.resolve_value = ret;
+      return self.clients.matchAll();
+    })
+    .then(function(matched) {
+      // should be 2
+      result.match_count_after = matched.length;
+      for (i = 0; i < matched.length; i++) {
+        matched[i].postMessage(result);
+      }
+      if (result.match_count_after !== 2) {
+        dump("ERROR: claim_worker_1 failed to capture clients.\n");
+      }
+    });
+};
diff --git a/dom/serviceworkers/test/claim_worker_2.js b/dom/serviceworkers/test/claim_worker_2.js
new file mode 100644
index 0000000000..b244495ecd
--- /dev/null
+++ b/dom/serviceworkers/test/claim_worker_2.js
@@ -0,0 +1,34 @@
+onactivate = function(e) {
+  var result = {
+    resolve_value: false,
+    match_count_before: -1,
+    match_count_after: -1,
+    message: "claim_worker_2",
+  };
+
+  self.clients
+    .matchAll()
+    .then(function(matched) {
+      // should be 0
+      result.match_count_before = matched.length;
+    })
+    .then(function() {
+      return clients.claim();
+    })
+    .then(function(ret) {
+      result.resolve_value = ret;
+      return clients.matchAll();
+    })
+    .then(function(matched) {
+      // should be 1
+      result.match_count_after = matched.length;
+      if (result.match_count_after === 1) {
+        matched[0].postMessage(result);
+      } else {
+        dump("ERROR: claim_worker_2 failed to capture clients.\n");
+        for (let i = 0; i < matched.length; ++i) {
+          dump("### ### matched[" + i + "]: " + matched[i].url + "\n");
+        }
+      }
+    });
+};
diff --git a/dom/serviceworkers/test/close_test.js b/dom/serviceworkers/test/close_test.js
new file mode 100644
index 0000000000..cc0ec4d335
--- /dev/null
+++ b/dom/serviceworkers/test/close_test.js
@@ -0,0 +1,22 @@
+function ok(v, msg) {
+  client.postMessage({ status: "ok", result: !!v, message: msg });
+}
+
+var client;
+onmessage = function(e) {
+  if (e.data.message == "start") {
+    self.clients.matchAll().then(function(clients) {
+      client = clients[0];
+      try {
+        close();
+        ok(false, "close() should throw");
+      } catch (ex) {
+        ok(
+          ex.name === "InvalidAccessError",
+          "close() should throw InvalidAccessError"
+        );
+      }
+      client.postMessage({ status: "done" });
+    });
+  }
+};
diff --git a/dom/serviceworkers/test/console_monitor.js b/dom/serviceworkers/test/console_monitor.js
new file mode 100644
index 0000000000..3aa51d2996
--- /dev/null
+++ b/dom/serviceworkers/test/console_monitor.js
@@ -0,0 +1,44 @@
+const { Services } = ChromeUtils.import("resource://gre/modules/Services.jsm");
+
+let consoleListener;
+
+function ConsoleListener() {
+  Services.console.registerListener(this);
+}
+
+ConsoleListener.prototype = {
+  callbacks: [],
+
+  observe: aMsg => {
+    if (!(aMsg instanceof Ci.nsIScriptError)) {
+      return;
+    }
+
+    let msg = {
+      cssSelectors: aMsg.cssSelectors,
+      errorMessage: aMsg.errorMessage,
+      sourceName: aMsg.sourceName,
+      sourceLine: aMsg.sourceLine,
+      lineNumber: aMsg.lineNumber,
+      columnNumber: aMsg.columnNumber,
+      category: aMsg.category,
+      windowID: aMsg.outerWindowID,
+      innerWindowID: aMsg.innerWindowID,
+      isScriptError: true,
+      isWarning: (aMsg.flags & Ci.nsIScriptError.warningFlag) === 1,
+    };
+
+    sendAsyncMessage("monitor", msg);
+  },
+};
+
+addMessageListener("load", function(e) {
+  consoleListener = new ConsoleListener();
+  sendAsyncMessage("ready", {});
+});
+
+addMessageListener("unload", function(e) {
+  Services.console.unregisterListener(consoleListener);
+  consoleListener = null;
+  sendAsyncMessage("unloaded", {});
+});
diff --git a/dom/serviceworkers/test/controller/index.html b/dom/serviceworkers/test/controller/index.html
new file mode 100644
index 0000000000..2a68e3f4bb
--- /dev/null
+++ b/dom/serviceworkers/test/controller/index.html
@@ -0,0 +1,72 @@
+
+
+
+
+  Bug 94048 - test install event.
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/create_another_sharedWorker.html b/dom/serviceworkers/test/create_another_sharedWorker.html
new file mode 100644
index 0000000000..f49194fa50
--- /dev/null
+++ b/dom/serviceworkers/test/create_another_sharedWorker.html
@@ -0,0 +1,6 @@
+
+Shared workers: create antoehr sharedworekr client
+
Hello World
+ diff --git a/dom/serviceworkers/test/download/window.html b/dom/serviceworkers/test/download/window.html new file mode 100644 index 0000000000..7d7893e0e6 --- /dev/null +++ b/dom/serviceworkers/test/download/window.html @@ -0,0 +1,46 @@ + + + + + + + + + diff --git a/dom/serviceworkers/test/download/worker.js b/dom/serviceworkers/test/download/worker.js new file mode 100644 index 0000000000..71fb502f1c --- /dev/null +++ b/dom/serviceworkers/test/download/worker.js @@ -0,0 +1,34 @@ +addEventListener("install", function(evt) { + evt.waitUntil(self.skipWaiting()); +}); + +addEventListener("activate", function(evt) { + // We claim the current clients in order to ensure that we have an + // active client when we call unregister in the fetch handler. Otherwise + // the unregister() can kill the current worker before returning a + // response. + evt.waitUntil(clients.claim()); +}); + +addEventListener("fetch", function(evt) { + // This worker may live long enough to receive a fetch event from the next + // test. Just pass such requests through to the network. + if (!evt.request.url.includes("fake_download")) { + return; + } + + // We should only get a single download fetch event. Automatically unregister. + evt.respondWith( + registration.unregister().then(function() { + return new Response("service worker generated download", { + headers: { + "Content-Disposition": 'attachment; filename="fake_download.bin"', + // Prevent the default text editor from being launched + "Content-Type": "application/octet-stream", + // fake encoding header that should have no effect + "Content-Encoding": "gzip", + }, + }); + }) + ); +}); diff --git a/dom/serviceworkers/test/download_canceled/page_download_canceled.html b/dom/serviceworkers/test/download_canceled/page_download_canceled.html new file mode 100644 index 0000000000..e3904c4967 --- /dev/null +++ b/dom/serviceworkers/test/download_canceled/page_download_canceled.html @@ -0,0 +1,58 @@ + + + + + + + + + + + + + diff --git a/dom/serviceworkers/test/download_canceled/server-stream-download.sjs b/dom/serviceworkers/test/download_canceled/server-stream-download.sjs new file mode 100644 index 0000000000..efcc310420 --- /dev/null +++ b/dom/serviceworkers/test/download_canceled/server-stream-download.sjs @@ -0,0 +1,121 @@ +/* Any copyright is dedicated to the Public Domain. + * http://creativecommons.org/publicdomain/zero/1.0/ */ + +Cu.import("resource://gre/modules/Timer.jsm"); +Cu.import("resource://gre/modules/NetUtil.jsm"); + +// stolen from file_blocked_script.sjs +function setGlobalState(data, key) +{ + x = { data: data, QueryInterface: function(iid) { return this } }; + x.wrappedJSObject = x; + setObjectState(key, x); +} + +function getGlobalState(key) +{ + var data; + getObjectState(key, function(x) { + data = x && x.wrappedJSObject.data; + }); + return data; +} + +/* + * We want to let the sw_download_canceled.js service worker know when the + * stream was canceled. To this end, we let it issue a monitor request which we + * fulfill when the stream has been canceled. In order to coordinate between + * multiple requests, we use the getObjectState/setObjectState mechanism that + * httpd.js exposes to let data be shared and/or persist between requests. We + * handle both possible orderings of the requests because we currently don't + * try and impose an ordering between the two requests as issued by the SW, and + * file_blocked_script.sjs encourages us to do this, but we probably could order + * them. + */ +const MONITOR_KEY = "stream-monitor"; +function completeMonitorResponse(response, data) { + response.write(JSON.stringify(data)); + response.finish(); +} +function handleMonitorRequest(request, response) { + response.setHeader("Content-Type", "application/json"); + response.setStatusLine(request.httpVersion, 200, "Found"); + + response.processAsync(); + // Necessary to cause the headers to be flushed; that or touching the + // bodyOutputStream getter. + response.write(""); + dump("server-stream-download.js: monitor headers issued\n"); + + const alreadyCompleted = getGlobalState(MONITOR_KEY); + if (alreadyCompleted) { + completeMonitorResponse(response, alreadyCompleted); + setGlobalState(null, MONITOR_KEY); + } else { + setGlobalState(response, MONITOR_KEY); + } +} + +const MAX_TICK_COUNT = 3000; +const TICK_INTERVAL = 2; +function handleStreamRequest(request, response) { + const name = "server-stream-download"; + + // Create some payload to send. + let strChunk = + 'Static routes are the future of ServiceWorkers! So say we all!\n'; + while (strChunk.length < 1024) { + strChunk += strChunk; + } + + response.setHeader("Content-Disposition", `attachment; filename="${name}"`); + response.setHeader("Content-Type", `application/octet-stream; name="${name}"`); + response.setHeader("Content-Length", `${strChunk.length * MAX_TICK_COUNT}`); + response.setStatusLine(request.httpVersion, 200, "Found"); + + response.processAsync(); + response.write(strChunk); + dump("server-stream-download.js: stream headers + first payload issued\n"); + + let count = 0; + let intervalId; + function closeStream(why, message) { + dump("server-stream-download.js: closing stream: " + why + "\n"); + clearInterval(intervalId); + response.finish(); + + const data = { why, message }; + const monitorResponse = getGlobalState(MONITOR_KEY); + if (monitorResponse) { + completeMonitorResponse(monitorResponse, data); + setGlobalState(null, MONITOR_KEY); + } else { + setGlobalState(data, MONITOR_KEY); + } + } + function tick() { + try { + // bound worst-case behavior. + if (count++ > MAX_TICK_COUNT) { + closeStream("timeout", "timeout"); + return; + } + response.write(strChunk); + } catch(e) { + closeStream("canceled", e.message); + } + } + intervalId = setInterval(tick, TICK_INTERVAL); +} + +Components.utils.importGlobalProperties(["URLSearchParams"]); +function handleRequest(request, response) { + dump("server-stream-download.js: processing request for " + request.path + + "?" + request.queryString + "\n"); + const query = new URLSearchParams(request.queryString); + if (query.has("monitor")) { + handleMonitorRequest(request, response); + } else { + handleStreamRequest(request, response); + } +} \ No newline at end of file diff --git a/dom/serviceworkers/test/download_canceled/sw_download_canceled.js b/dom/serviceworkers/test/download_canceled/sw_download_canceled.js new file mode 100644 index 0000000000..5d9d5f9bfd --- /dev/null +++ b/dom/serviceworkers/test/download_canceled/sw_download_canceled.js @@ -0,0 +1,150 @@ +/* Any copyright is dedicated to the Public Domain. + * http://creativecommons.org/publicdomain/zero/1.0/ */ + +// This file is derived from :bkelly's https://glitch.com/edit/#!/html-sw-stream + +addEventListener("install", evt => { + evt.waitUntil(self.skipWaiting()); +}); + +// Create a BroadcastChannel to notify when we have closed our streams. +const channel = new BroadcastChannel("stream-closed"); + +const MAX_TICK_COUNT = 3000; +const TICK_INTERVAL = 4; +/** + * Generate a continuous stream of data at a sufficiently high frequency that a + * there"s a good chance of racing channel cancellation. + */ +function handleStream(evt, filename) { + // Create some payload to send. + const encoder = new TextEncoder(); + let strChunk = + "Static routes are the future of ServiceWorkers! So say we all!\n"; + while (strChunk.length < 1024) { + strChunk += strChunk; + } + const dataChunk = encoder.encode(strChunk); + + evt.waitUntil( + new Promise(resolve => { + let body = new ReadableStream({ + start: controller => { + const closeStream = why => { + console.log("closing stream: " + JSON.stringify(why) + "\n"); + clearInterval(intervalId); + resolve(); + // In event of error, the controller will automatically have closed. + if (why.why != "canceled") { + try { + controller.close(); + } catch (ex) { + // If we thought we should cancel but experienced a problem, + // that's a different kind of failure and we need to report it. + // (If we didn't catch the exception here, we'd end up erroneously + // in the tick() method's canceled handler.) + channel.postMessage({ + what: filename, + why: "close-failure", + message: ex.message, + ticks: why.ticks, + }); + return; + } + } + // Post prior to performing any attempt to close... + channel.postMessage(why); + }; + + controller.enqueue(dataChunk); + let count = 0; + let intervalId; + function tick() { + try { + // bound worst-case behavior. + if (count++ > MAX_TICK_COUNT) { + closeStream({ + what: filename, + why: "timeout", + message: "timeout", + ticks: count, + }); + return; + } + controller.enqueue(dataChunk); + } catch (e) { + closeStream({ + what: filename, + why: "canceled", + message: e.message, + ticks: count, + }); + } + } + // Alternately, streams' pull mechanism could be used here, but this + // test doesn't so much want to saturate the stream as to make sure the + // data is at least flowing a little bit. (Also, the author had some + // concern about slowing down the test by overwhelming the event loop + // and concern that we might not have sufficent back-pressure plumbed + // through and an infinite pipe might make bad things happen.) + intervalId = setInterval(tick, TICK_INTERVAL); + tick(); + }, + }); + evt.respondWith( + new Response(body, { + headers: { + "Content-Disposition": `attachment; filename="${filename}"`, + "Content-Type": "application/octet-stream", + }, + }) + ); + }) + ); +} + +/** + * Use an .sjs to generate a similar stream of data to the above, passing the + * response through directly. Because we're handing off the response but also + * want to be able to report when cancellation occurs, we create a second, + * overlapping long-poll style fetch that will not finish resolving until the + * .sjs experiences closure of its socket and terminates the payload stream. + */ +function handlePassThrough(evt, filename) { + evt.waitUntil( + (async () => { + console.log("issuing monitor fetch request"); + const response = await fetch("server-stream-download.sjs?monitor"); + console.log("monitor headers received, awaiting body"); + const data = await response.json(); + console.log("passthrough monitor fetch completed, notifying."); + channel.postMessage({ + what: filename, + why: data.why, + message: data.message, + }); + })() + ); + evt.respondWith( + fetch("server-stream-download.sjs").then(response => { + console.log("server-stream-download.sjs Response received, propagating"); + return response; + }) + ); +} + +addEventListener("fetch", evt => { + console.log(`SW processing fetch of ${evt.request.url}`); + if (evt.request.url.includes("sw-stream-download")) { + return handleStream(evt, "sw-stream-download"); + } + if (evt.request.url.includes("sw-passthrough-download")) { + return handlePassThrough(evt, "sw-passthrough-download"); + } +}); + +addEventListener("message", evt => { + if (evt.data === "claim") { + evt.waitUntil(clients.claim()); + } +}); diff --git a/dom/serviceworkers/test/empty.html b/dom/serviceworkers/test/empty.html new file mode 100644 index 0000000000..e69de29bb2 diff --git a/dom/serviceworkers/test/empty.js b/dom/serviceworkers/test/empty.js new file mode 100644 index 0000000000..e69de29bb2 diff --git a/dom/serviceworkers/test/empty_with_utils.html b/dom/serviceworkers/test/empty_with_utils.html new file mode 100644 index 0000000000..75f0aa8872 --- /dev/null +++ b/dom/serviceworkers/test/empty_with_utils.html @@ -0,0 +1,13 @@ + + + + + + + + + + diff --git a/dom/serviceworkers/test/error_reporting_helpers.js b/dom/serviceworkers/test/error_reporting_helpers.js new file mode 100644 index 0000000000..42ddbe42a2 --- /dev/null +++ b/dom/serviceworkers/test/error_reporting_helpers.js @@ -0,0 +1,73 @@ +"use strict"; + +/** + * Helpers for use in tests that want to verify that localized error messages + * are logged during the test. Because most of our errors (ex: + * ServiceWorkerManager) generate nsIScriptError instances with flattened + * strings (the interpolated arguments aren't kept around), we load the string + * bundle and use it to derive the exact string message we expect for the given + * payload. + **/ + +let stringBundleService = SpecialPowers.Cc[ + "@mozilla.org/intl/stringbundle;1" +].getService(SpecialPowers.Ci.nsIStringBundleService); +let localizer = stringBundleService.createBundle( + "chrome://global/locale/dom/dom.properties" +); + +/** + * Start monitoring the console for the given localized error message string(s) + * with the given arguments to be logged. Call before running code that will + * generate the console message. Pair with a call to + * `wait_for_expected_message` invoked after the message should have been + * generated. + * + * Multiple error messages can be expected, just repeat the msgId and args + * argument pair as needed. + * + * @param {String} msgId + * The localization message identifier used in the properties file. + * @param {String[]} args + * The list of formatting arguments we expect the error to be generated with. + * @return {Object} Promise/handle to pass to wait_for_expected_message. + */ +function expect_console_message(/* msgId, args, ... */) { + let expectations = []; + // process repeated paired arguments of: msgId, args + for (let i = 0; i < arguments.length; i += 2) { + let msgId = arguments[i]; + let args = arguments[i + 1]; + if (args.length === 0) { + expectations.push({ errorMessage: localizer.GetStringFromName(msgId) }); + } else { + expectations.push({ + errorMessage: localizer.formatStringFromName(msgId, args), + }); + } + } + return new Promise(resolve => { + SimpleTest.monitorConsole(resolve, expectations); + }); +} +let expect_console_messages = expect_console_message; + +/** + * Stop monitoring the console, returning a Promise that will be resolved when + * the sentinel console message sent through the async data path has been + * received. The Promise will not reject on failure; instead a mochitest + * failure will have been generated by ok(false)/equivalent by the time it is + * resolved. + */ +function wait_for_expected_message(expectedPromise) { + SimpleTest.endMonitorConsole(); + return expectedPromise; +} + +/** + * Derive an absolute URL string from a relative URL to simplify error message + * argument generation. + */ +function make_absolute_url(relUrl) { + return new URL(relUrl, window.location).href; +} diff --git a/dom/serviceworkers/test/eval_worker.js b/dom/serviceworkers/test/eval_worker.js new file mode 100644 index 0000000000..79b4808e66 --- /dev/null +++ b/dom/serviceworkers/test/eval_worker.js @@ -0,0 +1 @@ +eval("1+1"); diff --git a/dom/serviceworkers/test/eventsource/eventsource.resource b/dom/serviceworkers/test/eventsource/eventsource.resource new file mode 100644 index 0000000000..eb62cbd4c5 --- /dev/null +++ b/dom/serviceworkers/test/eventsource/eventsource.resource @@ -0,0 +1,22 @@ +:this file must be enconded in utf8 +:and its Content-Type must be equal to text/event-stream + +retry:500 +data: 2 +unknow: unknow + +event: other_event_name +retry:500 +data: 2 +unknow: unknow + +event: click +retry:500 + +event: blur +retry:500 + +event:keypress +retry:500 + + diff --git a/dom/serviceworkers/test/eventsource/eventsource.resource^headers^ b/dom/serviceworkers/test/eventsource/eventsource.resource^headers^ new file mode 100644 index 0000000000..5b88be7c32 --- /dev/null +++ b/dom/serviceworkers/test/eventsource/eventsource.resource^headers^ @@ -0,0 +1,3 @@ +Content-Type: text/event-stream +Cache-Control: no-cache, must-revalidate +Access-Control-Allow-Origin: * diff --git a/dom/serviceworkers/test/eventsource/eventsource_cors_response.html b/dom/serviceworkers/test/eventsource/eventsource_cors_response.html new file mode 100644 index 0000000000..115a0f5c65 --- /dev/null +++ b/dom/serviceworkers/test/eventsource/eventsource_cors_response.html @@ -0,0 +1,75 @@ + + + + + Bug 1182103 - Test EventSource scenarios with fetch interception + + + + + diff --git a/dom/serviceworkers/test/eventsource/eventsource_cors_response_intercept_worker.js b/dom/serviceworkers/test/eventsource/eventsource_cors_response_intercept_worker.js new file mode 100644 index 0000000000..0b9535d08e --- /dev/null +++ b/dom/serviceworkers/test/eventsource/eventsource_cors_response_intercept_worker.js @@ -0,0 +1,30 @@ +// Cross origin request +var prefix = "http://example.com/tests/dom/serviceworkers/test/eventsource/"; + +self.importScripts("eventsource_worker_helper.js"); + +self.addEventListener("fetch", function(event) { + var request = event.request; + var url = new URL(request.url); + + if ( + url.pathname !== + "/tests/dom/serviceworkers/test/eventsource/eventsource.resource" + ) { + return; + } + + ok(request.mode === "cors", "EventSource should make a CORS request"); + ok( + request.cache === "no-store", + "EventSource should make a no-store request" + ); + var fetchRequest = new Request(prefix + "eventsource.resource", { + mode: "cors", + }); + event.respondWith( + fetch(fetchRequest).then(fetchResponse => { + return fetchResponse; + }) + ); +}); diff --git a/dom/serviceworkers/test/eventsource/eventsource_mixed_content_cors_response.html b/dom/serviceworkers/test/eventsource/eventsource_mixed_content_cors_response.html new file mode 100644 index 0000000000..970cae517f --- /dev/null +++ b/dom/serviceworkers/test/eventsource/eventsource_mixed_content_cors_response.html @@ -0,0 +1,75 @@ + + + + + Bug 1182103 - Test EventSource scenarios with fetch interception + + + + + diff --git a/dom/serviceworkers/test/eventsource/eventsource_mixed_content_cors_response_intercept_worker.js b/dom/serviceworkers/test/eventsource/eventsource_mixed_content_cors_response_intercept_worker.js new file mode 100644 index 0000000000..754e461a01 --- /dev/null +++ b/dom/serviceworkers/test/eventsource/eventsource_mixed_content_cors_response_intercept_worker.js @@ -0,0 +1,29 @@ +var prefix = "http://example.com/tests/dom/serviceworkers/test/eventsource/"; + +self.importScripts("eventsource_worker_helper.js"); + +self.addEventListener("fetch", function(event) { + var request = event.request; + var url = new URL(request.url); + + if ( + url.pathname !== + "/tests/dom/serviceworkers/test/eventsource/eventsource.resource" + ) { + return; + } + + ok(request.mode === "cors", "EventSource should make a CORS request"); + ok( + request.cache === "no-store", + "EventSource should make a no-store request" + ); + var fetchRequest = new Request(prefix + "eventsource.resource", { + mode: "cors", + }); + event.respondWith( + fetch(fetchRequest).then(fetchResponse => { + return fetchResponse; + }) + ); +}); diff --git a/dom/serviceworkers/test/eventsource/eventsource_opaque_response.html b/dom/serviceworkers/test/eventsource/eventsource_opaque_response.html new file mode 100644 index 0000000000..bce12259cc --- /dev/null +++ b/dom/serviceworkers/test/eventsource/eventsource_opaque_response.html @@ -0,0 +1,75 @@ + + + + + Bug 1182103 - Test EventSource scenarios with fetch interception + + + + + diff --git a/dom/serviceworkers/test/eventsource/eventsource_opaque_response_intercept_worker.js b/dom/serviceworkers/test/eventsource/eventsource_opaque_response_intercept_worker.js new file mode 100644 index 0000000000..f663e7e39c --- /dev/null +++ b/dom/serviceworkers/test/eventsource/eventsource_opaque_response_intercept_worker.js @@ -0,0 +1,30 @@ +// Cross origin request +var prefix = "http://example.com/tests/dom/serviceworkers/test/eventsource/"; + +self.importScripts("eventsource_worker_helper.js"); + +self.addEventListener("fetch", function(event) { + var request = event.request; + var url = new URL(request.url); + + if ( + url.pathname !== + "/tests/dom/serviceworkers/test/eventsource/eventsource.resource" + ) { + return; + } + + ok(request.mode === "cors", "EventSource should make a CORS request"); + ok( + request.cache === "no-store", + "EventSource should make a no-store request" + ); + var fetchRequest = new Request(prefix + "eventsource.resource", { + mode: "no-cors", + }); + event.respondWith( + fetch(fetchRequest).then(fetchResponse => { + return fetchResponse; + }) + ); +}); diff --git a/dom/serviceworkers/test/eventsource/eventsource_register_worker.html b/dom/serviceworkers/test/eventsource/eventsource_register_worker.html new file mode 100644 index 0000000000..59e8e92ab6 --- /dev/null +++ b/dom/serviceworkers/test/eventsource/eventsource_register_worker.html @@ -0,0 +1,27 @@ + + + + + Bug 1182103 - Test EventSource scenarios with fetch interception + + + + + diff --git a/dom/serviceworkers/test/eventsource/eventsource_synthetic_response.html b/dom/serviceworkers/test/eventsource/eventsource_synthetic_response.html new file mode 100644 index 0000000000..7f6228c91e --- /dev/null +++ b/dom/serviceworkers/test/eventsource/eventsource_synthetic_response.html @@ -0,0 +1,75 @@ + + + + + Bug 1182103 - Test EventSource scenarios with fetch interception + + + + + diff --git a/dom/serviceworkers/test/eventsource/eventsource_synthetic_response_intercept_worker.js b/dom/serviceworkers/test/eventsource/eventsource_synthetic_response_intercept_worker.js new file mode 100644 index 0000000000..32aeb91b81 --- /dev/null +++ b/dom/serviceworkers/test/eventsource/eventsource_synthetic_response_intercept_worker.js @@ -0,0 +1,27 @@ +self.importScripts("eventsource_worker_helper.js"); + +self.addEventListener("fetch", function(event) { + var request = event.request; + var url = new URL(request.url); + + if ( + url.pathname !== + "/tests/dom/serviceworkers/test/eventsource/eventsource.resource" + ) { + return; + } + + ok(request.mode === "cors", "EventSource should make a CORS request"); + var headerList = { + "Content-Type": "text/event-stream", + "Cache-Control": "no-cache, must-revalidate", + }; + var headers = new Headers(headerList); + var init = { + headers, + mode: "cors", + }; + var body = "data: data0\r\r"; + var response = new Response(body, init); + event.respondWith(response); +}); diff --git a/dom/serviceworkers/test/eventsource/eventsource_worker_helper.js b/dom/serviceworkers/test/eventsource/eventsource_worker_helper.js new file mode 100644 index 0000000000..b110ae5f58 --- /dev/null +++ b/dom/serviceworkers/test/eventsource/eventsource_worker_helper.js @@ -0,0 +1,17 @@ +function ok(aCondition, aMessage) { + return new Promise(function(resolve, reject) { + self.clients.matchAll().then(function(res) { + if (!res.length) { + reject(); + return; + } + res[0].postMessage({ + status: "callback", + data: "ok", + condition: aCondition, + message: aMessage, + }); + resolve(); + }); + }); +} diff --git a/dom/serviceworkers/test/fetch.js b/dom/serviceworkers/test/fetch.js new file mode 100644 index 0000000000..ca723821ea --- /dev/null +++ b/dom/serviceworkers/test/fetch.js @@ -0,0 +1,33 @@ +function get_query_params(url) { + var search = new URL(url).search; + if (!search) { + return {}; + } + var ret = {}; + var params = search.substring(1).split("&"); + params.forEach(function(param) { + var element = param.split("="); + ret[decodeURIComponent(element[0])] = decodeURIComponent(element[1]); + }); + return ret; +} + +addEventListener("fetch", function(event) { + if (event.request.url.includes("fail.html")) { + event.respondWith(fetch("hello.html", { integrity: "abc" })); + } else if (event.request.url.includes("fake.html")) { + event.respondWith(fetch("hello.html")); + } else if (event.request.url.includes("file_js_cache")) { + event.respondWith(fetch(event.request)); + } else if (event.request.url.includes("redirect")) { + let param = get_query_params(event.request.url); + let url = param.url; + let mode = param.mode; + + event.respondWith(fetch(url, { mode })); + } +}); + +addEventListener("activate", function(event) { + event.waitUntil(clients.claim()); +}); diff --git a/dom/serviceworkers/test/fetch/cookie/cookie_test.js b/dom/serviceworkers/test/fetch/cookie/cookie_test.js new file mode 100644 index 0000000000..cdfee8949d --- /dev/null +++ b/dom/serviceworkers/test/fetch/cookie/cookie_test.js @@ -0,0 +1,11 @@ +self.addEventListener("fetch", function(event) { + if (event.request.url.includes("synth.html")) { + var body = + ""; + event.respondWith( + new Response(body, { headers: { "Content-Type": "text/html" } }) + ); + } +}); diff --git a/dom/serviceworkers/test/fetch/cookie/register.html b/dom/serviceworkers/test/fetch/cookie/register.html new file mode 100644 index 0000000000..99eabaf0a2 --- /dev/null +++ b/dom/serviceworkers/test/fetch/cookie/register.html @@ -0,0 +1,19 @@ + + + diff --git a/dom/serviceworkers/test/fetch/cookie/unregister.html b/dom/serviceworkers/test/fetch/cookie/unregister.html new file mode 100644 index 0000000000..1f13508fa7 --- /dev/null +++ b/dom/serviceworkers/test/fetch/cookie/unregister.html @@ -0,0 +1,12 @@ + + diff --git a/dom/serviceworkers/test/fetch/deliver-gzip.sjs b/dom/serviceworkers/test/fetch/deliver-gzip.sjs new file mode 100644 index 0000000000..30c9e69ce7 --- /dev/null +++ b/dom/serviceworkers/test/fetch/deliver-gzip.sjs @@ -0,0 +1,17 @@ +function handleRequest(request, response) { + // The string "hello" repeated 10 times followed by newline. Compressed using gzip. + var bytes = [0x1f, 0x8b, 0x08, 0x08, 0x4d, 0xe2, 0xf9, 0x54, 0x00, 0x03, 0x68, + 0x65, 0x6c, 0x6c, 0x6f, 0x00, 0xcb, 0x48, 0xcd, 0xc9, 0xc9, 0xcf, + 0x20, 0x85, 0xe0, 0x02, 0x00, 0xf5, 0x4b, 0x38, 0xcf, 0x33, 0x00, + 0x00, 0x00]; + + response.setHeader("Content-Encoding", "gzip", false); + response.setHeader("Content-Length", "" + bytes.length, false); + response.setHeader("Content-Type", "text/plain", false); + + var bos = Components.classes["@mozilla.org/binaryoutputstream;1"] + .createInstance(Components.interfaces.nsIBinaryOutputStream); + bos.setOutputStream(response.bodyOutputStream); + + bos.writeByteArray(bytes); +} diff --git a/dom/serviceworkers/test/fetch/fetch_tests.js b/dom/serviceworkers/test/fetch/fetch_tests.js new file mode 100644 index 0000000000..bbe55c3a35 --- /dev/null +++ b/dom/serviceworkers/test/fetch/fetch_tests.js @@ -0,0 +1,716 @@ +var origin = "http://mochi.test:8888"; + +function fetchXHRWithMethod(name, method, onload, onerror, headers) { + expectAsyncResult(); + + onload = + onload || + function() { + my_ok(false, "XHR load should not complete successfully"); + finish(); + }; + onerror = + onerror || + function() { + my_ok( + false, + "XHR load for " + name + " should be intercepted successfully" + ); + finish(); + }; + + var x = new XMLHttpRequest(); + x.open(method, name, true); + x.onload = function() { + onload(x); + }; + x.onerror = function() { + onerror(x); + }; + headers = headers || []; + headers.forEach(function(header) { + x.setRequestHeader(header[0], header[1]); + }); + x.send(); +} + +var corsServerPath = + "/tests/dom/security/test/cors/file_CrossSiteXHR_server.sjs"; +var corsServerURL = "http://example.com" + corsServerPath; + +function redirectURL(hops) { + return ( + hops[0].server + + corsServerPath + + "?hop=1&hops=" + + encodeURIComponent(JSON.stringify(hops)) + ); +} + +function fetchXHR(name, onload, onerror, headers) { + return fetchXHRWithMethod(name, "GET", onload, onerror, headers); +} + +fetchXHR("bare-synthesized.txt", function(xhr) { + my_ok(xhr.status == 200, "load should be successful"); + my_ok( + xhr.responseText == "synthesized response body", + "load should have synthesized response" + ); + finish(); +}); + +fetchXHR("test-respondwith-response.txt", function(xhr) { + my_ok( + xhr.status == 200, + "test-respondwith-response load should be successful" + ); + my_ok( + xhr.responseText == "test-respondwith-response response body", + "load should have response" + ); + finish(); +}); + +fetchXHR("synthesized-404.txt", function(xhr) { + my_ok(xhr.status == 404, "load should 404"); + my_ok( + xhr.responseText == "synthesized response body", + "404 load should have synthesized response" + ); + finish(); +}); + +fetchXHR("synthesized-headers.txt", function(xhr) { + my_ok(xhr.status == 200, "load should be successful"); + my_ok( + xhr.getResponseHeader("X-Custom-Greeting") === "Hello", + "custom header should be set" + ); + my_ok( + xhr.responseText == "synthesized response body", + "custom header load should have synthesized response" + ); + finish(); +}); + +fetchXHR("synthesized-redirect-real-file.txt", function(xhr) { + dump("Got status AARRGH " + xhr.status + " " + xhr.responseText + "\n"); + my_ok(xhr.status == 200, "load should be successful"); + my_ok( + xhr.responseText == "This is a real file.\n", + "Redirect to real file should complete." + ); + finish(); +}); + +fetchXHR("synthesized-redirect-twice-real-file.txt", function(xhr) { + my_ok(xhr.status == 200, "load should be successful"); + my_ok( + xhr.responseText == "This is a real file.\n", + "Redirect to real file (twice) should complete." + ); + finish(); +}); + +fetchXHR("synthesized-redirect-synthesized.txt", function(xhr) { + my_ok(xhr.status == 200, "synth+redirect+synth load should be successful"); + my_ok( + xhr.responseText == "synthesized response body", + "load should have redirected+synthesized response" + ); + finish(); +}); + +fetchXHR("synthesized-redirect-twice-synthesized.txt", function(xhr) { + my_ok( + xhr.status == 200, + "synth+redirect+synth (twice) load should be successful" + ); + my_ok( + xhr.responseText == "synthesized response body", + "load should have redirected+synthesized (twice) response" + ); + finish(); +}); + +fetchXHR("redirect.sjs", function(xhr) { + my_ok(xhr.status == 404, "redirected load should be uninterrupted"); + finish(); +}); + +fetchXHR("ignored.txt", function(xhr) { + my_ok(xhr.status == 404, "load should be uninterrupted"); + finish(); +}); + +fetchXHR("rejected.txt", null, function(xhr) { + my_ok(xhr.status == 0, "load should not complete"); + finish(); +}); + +fetchXHR("nonresponse.txt", null, function(xhr) { + my_ok(xhr.status == 0, "load should not complete"); + finish(); +}); + +fetchXHR("nonresponse2.txt", null, function(xhr) { + my_ok(xhr.status == 0, "load should not complete"); + finish(); +}); + +fetchXHR("nonpromise.txt", null, function(xhr) { + my_ok(xhr.status == 0, "load should not complete"); + finish(); +}); + +fetchXHR( + "headers.txt", + function(xhr) { + my_ok(xhr.status == 200, "load should be successful"); + my_ok(xhr.responseText == "1", "request header checks should have passed"); + finish(); + }, + null, + [ + ["X-Test1", "header1"], + ["X-Test2", "header2"], + ] +); + +fetchXHR("http://user:pass@mochi.test:8888/user-pass", function(xhr) { + my_ok(xhr.status == 200, "load should be successful"); + my_ok( + xhr.responseText == "http://user:pass@mochi.test:8888/user-pass", + "The username and password should be preserved" + ); + finish(); +}); + +fetchXHR("readable-stream.txt", function(xhr) { + my_ok(xhr.status == 200, "loading completed"); + my_ok(xhr.responseText == "Hello!", "The message is correct!"); + finish(); +}); + +fetchXHR( + "readable-stream-locked.txt", + function(xhr) { + my_ok(false, "This should not be called!"); + finish(); + }, + function() { + my_ok(true, "The exception has been correctly handled!"); + finish(); + } +); + +fetchXHR( + "readable-stream-with-exception.txt", + function(xhr) { + my_ok(false, "This should not be called!"); + finish(); + }, + function() { + my_ok(true, "The exception has been correctly handled!"); + finish(); + } +); + +fetchXHR( + "readable-stream-with-exception2.txt", + function(xhr) { + my_ok(false, "This should not be called!"); + finish(); + }, + function() { + my_ok(true, "The exception has been correctly handled!"); + finish(); + } +); + +fetchXHR( + "readable-stream-already-consumed.txt", + function(xhr) { + my_ok(false, "This should not be called!"); + finish(); + }, + function() { + my_ok(true, "The exception has been correctly handled!"); + finish(); + } +); + +var expectedUncompressedResponse = ""; +for (let i = 0; i < 10; ++i) { + expectedUncompressedResponse += "hello"; +} +expectedUncompressedResponse += "\n"; + +// ServiceWorker does not intercept, at which point the network request should +// be correctly decoded. +fetchXHR("deliver-gzip.sjs", function(xhr) { + my_ok(xhr.status == 200, "network gzip load should be successful"); + my_ok( + xhr.responseText == expectedUncompressedResponse, + "network gzip load should have synthesized response." + ); + my_ok( + xhr.getResponseHeader("Content-Encoding") == "gzip", + "network Content-Encoding should be gzip." + ); + my_ok( + xhr.getResponseHeader("Content-Length") == "35", + "network Content-Length should be of original gzipped file." + ); + finish(); +}); + +fetchXHR("hello.gz", function(xhr) { + my_ok(xhr.status == 200, "gzip load should be successful"); + my_ok( + xhr.responseText == expectedUncompressedResponse, + "gzip load should have synthesized response." + ); + my_ok( + xhr.getResponseHeader("Content-Encoding") == "gzip", + "Content-Encoding should be gzip." + ); + my_ok( + xhr.getResponseHeader("Content-Length") == "35", + "Content-Length should be of original gzipped file." + ); + finish(); +}); + +fetchXHR("hello-after-extracting.gz", function(xhr) { + my_ok(xhr.status == 200, "gzip load after extracting should be successful"); + my_ok( + xhr.responseText == expectedUncompressedResponse, + "gzip load after extracting should have synthesized response." + ); + my_ok( + xhr.getResponseHeader("Content-Encoding") == "gzip", + "Content-Encoding after extracting should be gzip." + ); + my_ok( + xhr.getResponseHeader("Content-Length") == "35", + "Content-Length after extracting should be of original gzipped file." + ); + finish(); +}); + +fetchXHR(corsServerURL + "?status=200&allowOrigin=*", function(xhr) { + my_ok( + xhr.status == 200, + "cross origin load with correct headers should be successful" + ); + my_ok( + xhr.getResponseHeader("access-control-allow-origin") == null, + "cors headers should be filtered out" + ); + finish(); +}); + +// Verify origin header is sent properly even when we have a no-intercept SW. +var uriOrigin = encodeURIComponent(origin); +fetchXHR( + "http://example.org" + + corsServerPath + + "?ignore&status=200&origin=" + + uriOrigin + + "&allowOrigin=" + + uriOrigin, + function(xhr) { + my_ok( + xhr.status == 200, + "cross origin load with correct headers should be successful" + ); + my_ok( + xhr.getResponseHeader("access-control-allow-origin") == null, + "cors headers should be filtered out" + ); + finish(); + } +); + +// Verify that XHR is considered CORS tainted even when original URL is same-origin +// redirected to cross-origin. +fetchXHR( + redirectURL([ + { server: origin }, + { server: "http://example.org", allowOrigin: origin }, + ]), + function(xhr) { + my_ok( + xhr.status == 200, + "cross origin load with correct headers should be successful" + ); + my_ok( + xhr.getResponseHeader("access-control-allow-origin") == null, + "cors headers should be filtered out" + ); + finish(); + } +); + +// Test that CORS preflight requests cannot be intercepted. Performs a +// cross-origin XHR that the SW chooses not to intercept. This requires a +// preflight request, which the SW must not be allowed to intercept. +fetchXHR( + corsServerURL + "?status=200&allowOrigin=*", + null, + function(xhr) { + my_ok( + xhr.status == 0, + "cross origin load with incorrect headers should be a failure" + ); + finish(); + }, + [["X-Unsafe", "unsafe"]] +); + +// Test that CORS preflight requests cannot be intercepted. Performs a +// cross-origin XHR that the SW chooses to intercept and respond with a +// cross-origin fetch. This requires a preflight request, which the SW must not +// be allowed to intercept. +fetchXHR( + "http://example.org" + corsServerPath + "?status=200&allowOrigin=*", + null, + function(xhr) { + my_ok( + xhr.status == 0, + "cross origin load with incorrect headers should be a failure" + ); + finish(); + }, + [["X-Unsafe", "unsafe"]] +); + +// Test that when the page fetches a url the controlling SW forces a redirect to +// another location. This other location fetch should also be intercepted by +// the SW. +fetchXHR("something.txt", function(xhr) { + my_ok(xhr.status == 200, "load should be successful"); + my_ok( + xhr.responseText == "something else response body", + "load should have something else" + ); + finish(); +}); + +// Test fetch will internally get it's SkipServiceWorker flag set. The request is +// made from the SW through fetch(). fetch() fetches a server-side JavaScript +// file that force a redirect. The redirect location fetch does not go through +// the SW. +fetchXHR("redirect_serviceworker.sjs", function(xhr) { + my_ok(xhr.status == 200, "load should be successful"); + my_ok( + xhr.responseText == "// empty worker, always succeed!\n", + "load should have redirection content" + ); + finish(); +}); + +fetchXHR( + "empty-header", + function(xhr) { + my_ok(xhr.status == 200, "load should be successful"); + my_ok( + xhr.responseText == "emptyheader", + "load should have the expected content" + ); + finish(); + }, + null, + [["emptyheader", ""]] +); + +expectAsyncResult(); +fetch( + "http://example.com/tests/dom/security/test/cors/file_CrossSiteXHR_server.sjs?status=200&allowOrigin=*" +).then( + function(res) { + my_ok(res.ok, "Valid CORS request should receive valid response"); + my_ok(res.type == "cors", "Response type should be CORS"); + res.text().then(function(body) { + my_ok( + body === "hello pass\n", + "cors response body should match" + ); + finish(); + }); + }, + function(e) { + my_ok(false, "CORS Fetch failed"); + finish(); + } +); + +expectAsyncResult(); +fetch( + "http://example.com/tests/dom/security/test/cors/file_CrossSiteXHR_server.sjs?status=200", + { mode: "no-cors" } +).then( + function(res) { + my_ok(res.type == "opaque", "Response type should be opaque"); + my_ok(res.status == 0, "Status should be 0"); + res.text().then(function(body) { + my_ok(body === "", "opaque response body should be empty"); + finish(); + }); + }, + function(e) { + my_ok(false, "no-cors Fetch failed"); + finish(); + } +); + +expectAsyncResult(); +fetch("opaque-on-same-origin").then( + function(res) { + my_ok( + false, + "intercepted opaque response for non no-cors request should fail." + ); + finish(); + }, + function(e) { + my_ok( + true, + "intercepted opaque response for non no-cors request should fail." + ); + finish(); + } +); + +expectAsyncResult(); +fetch("http://example.com/opaque-no-cors", { mode: "no-cors" }).then( + function(res) { + my_ok( + res.type == "opaque", + "intercepted opaque response for no-cors request should have type opaque." + ); + finish(); + }, + function(e) { + my_ok( + false, + "intercepted opaque response for no-cors request should pass." + ); + finish(); + } +); + +expectAsyncResult(); +fetch("http://example.com/cors-for-no-cors", { mode: "no-cors" }).then( + function(res) { + my_ok( + res.type == "cors", + "synthesize CORS response should result in outer CORS response" + ); + finish(); + }, + function(e) { + my_ok(false, "cors-for-no-cors request should not reject"); + finish(); + } +); + +function arrayBufferFromString(str) { + var arr = new Uint8Array(str.length); + for (let i = 0; i < str.length; ++i) { + arr[i] = str.charCodeAt(i); + } + return arr; +} + +expectAsyncResult(); +fetch(new Request("body-simple", { method: "POST", body: "my body" })) + .then(function(res) { + return res.text(); + }) + .then(function(body) { + my_ok( + body == "my bodymy body", + "the body of the intercepted fetch should be visible in the SW" + ); + finish(); + }); + +expectAsyncResult(); +fetch( + new Request("body-arraybufferview", { + method: "POST", + body: arrayBufferFromString("my body"), + }) +) + .then(function(res) { + return res.text(); + }) + .then(function(body) { + my_ok( + body == "my bodymy body", + "the ArrayBufferView body of the intercepted fetch should be visible in the SW" + ); + finish(); + }); + +expectAsyncResult(); +fetch( + new Request("body-arraybuffer", { + method: "POST", + body: arrayBufferFromString("my body").buffer, + }) +) + .then(function(res) { + return res.text(); + }) + .then(function(body) { + my_ok( + body == "my bodymy body", + "the ArrayBuffer body of the intercepted fetch should be visible in the SW" + ); + finish(); + }); + +expectAsyncResult(); +var usp = new URLSearchParams(); +usp.set("foo", "bar"); +usp.set("baz", "qux"); +fetch(new Request("body-urlsearchparams", { method: "POST", body: usp })) + .then(function(res) { + return res.text(); + }) + .then(function(body) { + my_ok( + body == "foo=bar&baz=quxfoo=bar&baz=qux", + "the URLSearchParams body of the intercepted fetch should be visible in the SW" + ); + finish(); + }); + +expectAsyncResult(); +var fd = new FormData(); +fd.set("foo", "bar"); +fd.set("baz", "qux"); +fetch(new Request("body-formdata", { method: "POST", body: fd })) + .then(function(res) { + return res.text(); + }) + .then(function(body) { + my_ok( + body.indexOf('Content-Disposition: form-data; name="foo"\r\n\r\nbar') < + body.indexOf('Content-Disposition: form-data; name="baz"\r\n\r\nqux'), + "the FormData body of the intercepted fetch should be visible in the SW" + ); + finish(); + }); + +expectAsyncResult(); +fetch( + new Request("body-blob", { + method: "POST", + body: new Blob(new String("my body")), + }) +) + .then(function(res) { + return res.text(); + }) + .then(function(body) { + my_ok( + body == "my bodymy body", + "the Blob body of the intercepted fetch should be visible in the SW" + ); + finish(); + }); + +expectAsyncResult(); +fetch("interrupt.sjs").then( + function(res) { + my_ok(true, "interrupted fetch succeeded"); + res.text().then( + function(body) { + my_ok(false, "interrupted fetch shouldn't have complete body"); + finish(); + }, + function() { + my_ok(true, "interrupted fetch shouldn't have complete body"); + finish(); + } + ); + }, + function(e) { + my_ok(false, "interrupted fetch failed"); + finish(); + } +); + +["DELETE", "GET", "HEAD", "OPTIONS", "POST", "PUT"].forEach(function(method) { + fetchXHRWithMethod("xhr-method-test.txt", method, function(xhr) { + my_ok(xhr.status == 200, method + " load should be successful"); + if (method === "HEAD") { + my_ok( + xhr.responseText == "", + method + "load should not have synthesized response" + ); + } else { + my_ok( + xhr.responseText == "intercepted " + method, + method + " load should have synthesized response" + ); + } + finish(); + }); +}); + +expectAsyncResult(); +fetch(new Request("empty-header", { headers: { emptyheader: "" } })) + .then(function(res) { + return res.text(); + }) + .then( + function(body) { + my_ok( + body == "emptyheader", + "The empty header was observed in the fetch event" + ); + finish(); + }, + function(err) { + my_ok(false, "A promise was rejected with " + err); + finish(); + } + ); + +expectAsyncResult(); +fetch("fetchevent-extendable") + .then(function(res) { + return res.text(); + }) + .then( + function(body) { + my_ok(body == "extendable", "FetchEvent inherits from ExtendableEvent"); + finish(); + }, + function(err) { + my_ok(false, "A promise was rejected with " + err); + finish(); + } + ); + +expectAsyncResult(); +fetch("fetchevent-request") + .then(function(res) { + return res.text(); + }) + .then( + function(body) { + my_ok(body == "non-nullable", "FetchEvent.request must be non-nullable"); + finish(); + }, + function(err) { + my_ok(false, "A promise was rejected with " + err); + finish(); + } + ); diff --git a/dom/serviceworkers/test/fetch/fetch_worker_script.js b/dom/serviceworkers/test/fetch/fetch_worker_script.js new file mode 100644 index 0000000000..6eb0b18a77 --- /dev/null +++ b/dom/serviceworkers/test/fetch/fetch_worker_script.js @@ -0,0 +1,28 @@ +function my_ok(v, msg) { + postMessage({ type: "ok", value: v, msg }); +} + +function finish() { + postMessage("finish"); +} + +function expectAsyncResult() { + postMessage("expect"); +} + +expectAsyncResult(); +try { + var success = false; + importScripts("nonexistent_imported_script.js"); +} catch (x) {} + +my_ok(success, "worker imported script should be intercepted"); +finish(); + +function check_intercepted_script() { + success = true; +} + +importScripts("fetch_tests.js"); + +finish(); //corresponds to the gExpected increment before creating this worker diff --git a/dom/serviceworkers/test/fetch/hsts/embedder.html b/dom/serviceworkers/test/fetch/hsts/embedder.html new file mode 100644 index 0000000000..ad44809042 --- /dev/null +++ b/dom/serviceworkers/test/fetch/hsts/embedder.html @@ -0,0 +1,7 @@ + + + diff --git a/dom/serviceworkers/test/fetch/hsts/hsts_test.js b/dom/serviceworkers/test/fetch/hsts/hsts_test.js new file mode 100644 index 0000000000..f79307f4e4 --- /dev/null +++ b/dom/serviceworkers/test/fetch/hsts/hsts_test.js @@ -0,0 +1,11 @@ +self.addEventListener("fetch", function(event) { + if (event.request.url.includes("index.html")) { + event.respondWith(fetch("realindex.html")); + } else if (event.request.url.includes("image-20px.png")) { + if (event.request.url.indexOf("https://") == 0) { + event.respondWith(fetch("image-40px.png")); + } else { + event.respondWith(Response.error()); + } + } +}); diff --git a/dom/serviceworkers/test/fetch/hsts/image-20px.png b/dom/serviceworkers/test/fetch/hsts/image-20px.png new file mode 100644 index 0000000000..ae6a8a6b88 Binary files /dev/null and b/dom/serviceworkers/test/fetch/hsts/image-20px.png differ diff --git a/dom/serviceworkers/test/fetch/hsts/image-40px.png b/dom/serviceworkers/test/fetch/hsts/image-40px.png new file mode 100644 index 0000000000..fe391dc8a2 Binary files /dev/null and b/dom/serviceworkers/test/fetch/hsts/image-40px.png differ diff --git a/dom/serviceworkers/test/fetch/hsts/image.html b/dom/serviceworkers/test/fetch/hsts/image.html new file mode 100644 index 0000000000..7036ea954e --- /dev/null +++ b/dom/serviceworkers/test/fetch/hsts/image.html @@ -0,0 +1,13 @@ + + diff --git a/dom/serviceworkers/test/fetch/hsts/realindex.html b/dom/serviceworkers/test/fetch/hsts/realindex.html new file mode 100644 index 0000000000..e7d282fe83 --- /dev/null +++ b/dom/serviceworkers/test/fetch/hsts/realindex.html @@ -0,0 +1,8 @@ + + diff --git a/dom/serviceworkers/test/fetch/hsts/register.html b/dom/serviceworkers/test/fetch/hsts/register.html new file mode 100644 index 0000000000..bcdc146aec --- /dev/null +++ b/dom/serviceworkers/test/fetch/hsts/register.html @@ -0,0 +1,14 @@ + + diff --git a/dom/serviceworkers/test/fetch/hsts/register.html^headers^ b/dom/serviceworkers/test/fetch/hsts/register.html^headers^ new file mode 100644 index 0000000000..a46bf65bd9 --- /dev/null +++ b/dom/serviceworkers/test/fetch/hsts/register.html^headers^ @@ -0,0 +1,2 @@ +Cache-Control: no-cache +Strict-Transport-Security: max-age=60 diff --git a/dom/serviceworkers/test/fetch/hsts/unregister.html b/dom/serviceworkers/test/fetch/hsts/unregister.html new file mode 100644 index 0000000000..1f13508fa7 --- /dev/null +++ b/dom/serviceworkers/test/fetch/hsts/unregister.html @@ -0,0 +1,12 @@ + + diff --git a/dom/serviceworkers/test/fetch/https/clonedresponse/https_test.js b/dom/serviceworkers/test/fetch/https/clonedresponse/https_test.js new file mode 100644 index 0000000000..0490017332 --- /dev/null +++ b/dom/serviceworkers/test/fetch/https/clonedresponse/https_test.js @@ -0,0 +1,19 @@ +self.addEventListener("install", function(event) { + event.waitUntil( + caches.open("cache").then(function(cache) { + return cache.add("index.html"); + }) + ); +}); + +self.addEventListener("fetch", function(event) { + if (event.request.url.includes("index.html")) { + event.respondWith( + new Promise(function(resolve, reject) { + caches.match(event.request).then(function(response) { + resolve(response.clone()); + }); + }) + ); + } +}); diff --git a/dom/serviceworkers/test/fetch/https/clonedresponse/index.html b/dom/serviceworkers/test/fetch/https/clonedresponse/index.html new file mode 100644 index 0000000000..a435548443 --- /dev/null +++ b/dom/serviceworkers/test/fetch/https/clonedresponse/index.html @@ -0,0 +1,4 @@ + + diff --git a/dom/serviceworkers/test/fetch/https/clonedresponse/register.html b/dom/serviceworkers/test/fetch/https/clonedresponse/register.html new file mode 100644 index 0000000000..41774f70d1 --- /dev/null +++ b/dom/serviceworkers/test/fetch/https/clonedresponse/register.html @@ -0,0 +1,14 @@ + + diff --git a/dom/serviceworkers/test/fetch/https/clonedresponse/unregister.html b/dom/serviceworkers/test/fetch/https/clonedresponse/unregister.html new file mode 100644 index 0000000000..1f13508fa7 --- /dev/null +++ b/dom/serviceworkers/test/fetch/https/clonedresponse/unregister.html @@ -0,0 +1,12 @@ + + diff --git a/dom/serviceworkers/test/fetch/https/https_test.js b/dom/serviceworkers/test/fetch/https/https_test.js new file mode 100644 index 0000000000..ad144d58ab --- /dev/null +++ b/dom/serviceworkers/test/fetch/https/https_test.js @@ -0,0 +1,31 @@ +self.addEventListener("install", function(event) { + event.waitUntil( + caches.open("cache").then(function(cache) { + var synth = new Response( + '', + { headers: { "Content-Type": "text/html" } } + ); + return Promise.all([ + cache.add("index.html"), + cache.put("synth-sw.html", synth), + ]); + }) + ); +}); + +self.addEventListener("fetch", function(event) { + if (event.request.url.includes("index.html")) { + event.respondWith(caches.match(event.request)); + } else if (event.request.url.includes("synth-sw.html")) { + event.respondWith(caches.match(event.request)); + } else if (event.request.url.includes("synth-window.html")) { + event.respondWith(caches.match(event.request)); + } else if (event.request.url.includes("synth.html")) { + event.respondWith( + new Response( + '', + { headers: { "Content-Type": "text/html" } } + ) + ); + } +}); diff --git a/dom/serviceworkers/test/fetch/https/index.html b/dom/serviceworkers/test/fetch/https/index.html new file mode 100644 index 0000000000..a435548443 --- /dev/null +++ b/dom/serviceworkers/test/fetch/https/index.html @@ -0,0 +1,4 @@ + + diff --git a/dom/serviceworkers/test/fetch/https/register.html b/dom/serviceworkers/test/fetch/https/register.html new file mode 100644 index 0000000000..fa666fe957 --- /dev/null +++ b/dom/serviceworkers/test/fetch/https/register.html @@ -0,0 +1,20 @@ + + diff --git a/dom/serviceworkers/test/fetch/https/unregister.html b/dom/serviceworkers/test/fetch/https/unregister.html new file mode 100644 index 0000000000..1f13508fa7 --- /dev/null +++ b/dom/serviceworkers/test/fetch/https/unregister.html @@ -0,0 +1,12 @@ + + diff --git a/dom/serviceworkers/test/fetch/imagecache-maxage/image-20px.png b/dom/serviceworkers/test/fetch/imagecache-maxage/image-20px.png new file mode 100644 index 0000000000..ae6a8a6b88 Binary files /dev/null and b/dom/serviceworkers/test/fetch/imagecache-maxage/image-20px.png differ diff --git a/dom/serviceworkers/test/fetch/imagecache-maxage/image-40px.png b/dom/serviceworkers/test/fetch/imagecache-maxage/image-40px.png new file mode 100644 index 0000000000..fe391dc8a2 Binary files /dev/null and b/dom/serviceworkers/test/fetch/imagecache-maxage/image-40px.png differ diff --git a/dom/serviceworkers/test/fetch/imagecache-maxage/index.html b/dom/serviceworkers/test/fetch/imagecache-maxage/index.html new file mode 100644 index 0000000000..0d4c52eedd --- /dev/null +++ b/dom/serviceworkers/test/fetch/imagecache-maxage/index.html @@ -0,0 +1,29 @@ + + + + diff --git a/dom/serviceworkers/test/fetch/imagecache-maxage/maxage_test.js b/dom/serviceworkers/test/fetch/imagecache-maxage/maxage_test.js new file mode 100644 index 0000000000..62707566ea --- /dev/null +++ b/dom/serviceworkers/test/fetch/imagecache-maxage/maxage_test.js @@ -0,0 +1,45 @@ +function synthesizeImage(suffix) { + // Serve image-20px for the first page, and image-40px for the second page. + return clients + .matchAll() + .then(clients => { + var url = "image-20px.png"; + clients.forEach(client => { + if (client.url.indexOf("?new") > 0) { + url = "image-40px.png"; + } + client.postMessage({ suffix, url }); + }); + return fetch(url); + }) + .then(response => { + return response.arrayBuffer(); + }) + .then(ab => { + var headers; + if (suffix == "") { + headers = { + "Content-Type": "image/png", + Date: "Tue, 1 Jan 1990 01:02:03 GMT", + "Cache-Control": "max-age=1", + }; + } else { + headers = { + "Content-Type": "image/png", + "Cache-Control": "no-cache", + }; + } + return new Response(ab, { + status: 200, + headers, + }); + }); +} + +self.addEventListener("fetch", function(event) { + if (event.request.url.includes("image.png")) { + event.respondWith(synthesizeImage("")); + } else if (event.request.url.includes("image2.png")) { + event.respondWith(synthesizeImage("2")); + } +}); diff --git a/dom/serviceworkers/test/fetch/imagecache-maxage/register.html b/dom/serviceworkers/test/fetch/imagecache-maxage/register.html new file mode 100644 index 0000000000..af4dde2e29 --- /dev/null +++ b/dom/serviceworkers/test/fetch/imagecache-maxage/register.html @@ -0,0 +1,14 @@ + + diff --git a/dom/serviceworkers/test/fetch/imagecache-maxage/unregister.html b/dom/serviceworkers/test/fetch/imagecache-maxage/unregister.html new file mode 100644 index 0000000000..1f13508fa7 --- /dev/null +++ b/dom/serviceworkers/test/fetch/imagecache-maxage/unregister.html @@ -0,0 +1,12 @@ + + diff --git a/dom/serviceworkers/test/fetch/imagecache/image-20px.png b/dom/serviceworkers/test/fetch/imagecache/image-20px.png new file mode 100644 index 0000000000..ae6a8a6b88 Binary files /dev/null and b/dom/serviceworkers/test/fetch/imagecache/image-20px.png differ diff --git a/dom/serviceworkers/test/fetch/imagecache/image-40px.png b/dom/serviceworkers/test/fetch/imagecache/image-40px.png new file mode 100644 index 0000000000..fe391dc8a2 Binary files /dev/null and b/dom/serviceworkers/test/fetch/imagecache/image-40px.png differ diff --git a/dom/serviceworkers/test/fetch/imagecache/imagecache_test.js b/dom/serviceworkers/test/fetch/imagecache/imagecache_test.js new file mode 100644 index 0000000000..e1f2af736b --- /dev/null +++ b/dom/serviceworkers/test/fetch/imagecache/imagecache_test.js @@ -0,0 +1,15 @@ +function synthesizeImage() { + return clients.matchAll().then(clients => { + var url = "image-40px.png"; + clients.forEach(client => { + client.postMessage(url); + }); + return fetch(url); + }); +} + +self.addEventListener("fetch", function(event) { + if (event.request.url.includes("image-20px.png")) { + event.respondWith(synthesizeImage()); + } +}); diff --git a/dom/serviceworkers/test/fetch/imagecache/index.html b/dom/serviceworkers/test/fetch/imagecache/index.html new file mode 100644 index 0000000000..f634f68bb7 --- /dev/null +++ b/dom/serviceworkers/test/fetch/imagecache/index.html @@ -0,0 +1,20 @@ + + + diff --git a/dom/serviceworkers/test/fetch/imagecache/postmortem.html b/dom/serviceworkers/test/fetch/imagecache/postmortem.html new file mode 100644 index 0000000000..53356cd02c --- /dev/null +++ b/dom/serviceworkers/test/fetch/imagecache/postmortem.html @@ -0,0 +1,9 @@ + + + diff --git a/dom/serviceworkers/test/fetch/imagecache/register.html b/dom/serviceworkers/test/fetch/imagecache/register.html new file mode 100644 index 0000000000..f6d1eb382f --- /dev/null +++ b/dom/serviceworkers/test/fetch/imagecache/register.html @@ -0,0 +1,16 @@ + + + + diff --git a/dom/serviceworkers/test/fetch/imagecache/unregister.html b/dom/serviceworkers/test/fetch/imagecache/unregister.html new file mode 100644 index 0000000000..1f13508fa7 --- /dev/null +++ b/dom/serviceworkers/test/fetch/imagecache/unregister.html @@ -0,0 +1,12 @@ + + diff --git a/dom/serviceworkers/test/fetch/importscript-mixedcontent/https_test.js b/dom/serviceworkers/test/fetch/importscript-mixedcontent/https_test.js new file mode 100644 index 0000000000..593171bafe --- /dev/null +++ b/dom/serviceworkers/test/fetch/importscript-mixedcontent/https_test.js @@ -0,0 +1,31 @@ +function sendResponseToParent(response) { + return ` + + + `; +} + +self.addEventListener("fetch", function(event) { + if (event.request.url.includes("index.html")) { + var response = "good"; + try { + importScripts("http://example.org/tests/dom/workers/test/foreign.js"); + } catch (e) { + dump("Got error " + e + " when importing the script\n"); + } + if (response === "good") { + try { + importScripts("/tests/dom/workers/test/redirect_to_foreign.sjs"); + } catch (e) { + dump("Got error " + e + " when importing the script\n"); + } + } + event.respondWith( + new Response(sendResponseToParent(response), { + headers: { "Content-Type": "text/html" }, + }) + ); + } +}); diff --git a/dom/serviceworkers/test/fetch/importscript-mixedcontent/register.html b/dom/serviceworkers/test/fetch/importscript-mixedcontent/register.html new file mode 100644 index 0000000000..41774f70d1 --- /dev/null +++ b/dom/serviceworkers/test/fetch/importscript-mixedcontent/register.html @@ -0,0 +1,14 @@ + + diff --git a/dom/serviceworkers/test/fetch/importscript-mixedcontent/unregister.html b/dom/serviceworkers/test/fetch/importscript-mixedcontent/unregister.html new file mode 100644 index 0000000000..1f13508fa7 --- /dev/null +++ b/dom/serviceworkers/test/fetch/importscript-mixedcontent/unregister.html @@ -0,0 +1,12 @@ + + diff --git a/dom/serviceworkers/test/fetch/index.html b/dom/serviceworkers/test/fetch/index.html new file mode 100644 index 0000000000..693810c6fc --- /dev/null +++ b/dom/serviceworkers/test/fetch/index.html @@ -0,0 +1,191 @@ + + + + + Bug 94048 - test install event. + + + + +

+ +
+

+
+
+
+
+
+
diff --git a/dom/serviceworkers/test/fetch/interrupt.sjs b/dom/serviceworkers/test/fetch/interrupt.sjs
new file mode 100644
index 0000000000..f6fe870efa
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/interrupt.sjs
@@ -0,0 +1,20 @@
+function handleRequest(request, response) {
+  var body = "a";
+  for (var i = 0; i < 20; i++) {
+    body += body;
+  }
+
+  response.seizePower();
+  response.write("HTTP/1.1 200 OK\r\n")
+  var count = 10;
+  response.write("Content-Length: " + body.length * count + "\r\n");
+  response.write("Content-Type: text/plain; charset=utf-8\r\n");
+  response.write("Cache-Control: no-cache, must-revalidate\r\n");
+  response.write("\r\n");
+
+  for (var i = 0; i < count; i++) {
+    response.write(body);
+  }
+
+  throw Components.results.NS_BINDING_ABORTED;
+}
diff --git a/dom/serviceworkers/test/fetch/origin/https/index-https.sjs b/dom/serviceworkers/test/fetch/origin/https/index-https.sjs
new file mode 100644
index 0000000000..eb5df0724f
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/origin/https/index-https.sjs
@@ -0,0 +1,4 @@
+function handleRequest(request, response) {
+  response.setStatusLine(null, 308, "Permanent Redirect");
+  response.setHeader("Location", "https://example.org/tests/dom/serviceworkers/test/fetch/origin/https/realindex.html", false);
+}
diff --git a/dom/serviceworkers/test/fetch/origin/https/origin_test.js b/dom/serviceworkers/test/fetch/origin/https/origin_test.js
new file mode 100644
index 0000000000..5f76befc00
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/origin/https/origin_test.js
@@ -0,0 +1,29 @@
+var prefix = "/tests/dom/serviceworkers/test/fetch/origin/https/";
+
+function addOpaqueRedirect(cache, file) {
+  return fetch(new Request(prefix + file, { redirect: "manual" })).then(
+    function(response) {
+      return cache.put(prefix + file, response);
+    }
+  );
+}
+
+self.addEventListener("install", function(event) {
+  event.waitUntil(
+    self.caches.open("origin-cache").then(c => {
+      return addOpaqueRedirect(c, "index-https.sjs");
+    })
+  );
+});
+
+self.addEventListener("fetch", function(event) {
+  if (event.request.url.includes("index-cached-https.sjs")) {
+    event.respondWith(
+      self.caches.open("origin-cache").then(c => {
+        return c.match(prefix + "index-https.sjs");
+      })
+    );
+  } else {
+    event.respondWith(fetch(event.request));
+  }
+});
diff --git a/dom/serviceworkers/test/fetch/origin/https/realindex.html b/dom/serviceworkers/test/fetch/origin/https/realindex.html
new file mode 100644
index 0000000000..87f3489455
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/origin/https/realindex.html
@@ -0,0 +1,6 @@
+
+
diff --git a/dom/serviceworkers/test/fetch/origin/https/realindex.html^headers^ b/dom/serviceworkers/test/fetch/origin/https/realindex.html^headers^
new file mode 100644
index 0000000000..5ed82fd065
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/origin/https/realindex.html^headers^
@@ -0,0 +1 @@
+Access-Control-Allow-Origin: https://example.com
diff --git a/dom/serviceworkers/test/fetch/origin/https/register.html b/dom/serviceworkers/test/fetch/origin/https/register.html
new file mode 100644
index 0000000000..2e99adba53
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/origin/https/register.html
@@ -0,0 +1,14 @@
+
+
diff --git a/dom/serviceworkers/test/fetch/origin/https/unregister.html b/dom/serviceworkers/test/fetch/origin/https/unregister.html
new file mode 100644
index 0000000000..1f13508fa7
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/origin/https/unregister.html
@@ -0,0 +1,12 @@
+
+
diff --git a/dom/serviceworkers/test/fetch/origin/index-to-https.sjs b/dom/serviceworkers/test/fetch/origin/index-to-https.sjs
new file mode 100644
index 0000000000..76c80cfb50
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/origin/index-to-https.sjs
@@ -0,0 +1,4 @@
+function handleRequest(request, response) {
+  response.setStatusLine(null, 308, "Permanent Redirect");
+  response.setHeader("Location", "https://example.org/tests/dom/serviceworkers/test/fetch/origin/realindex.html", false);
+}
diff --git a/dom/serviceworkers/test/fetch/origin/index.sjs b/dom/serviceworkers/test/fetch/origin/index.sjs
new file mode 100644
index 0000000000..c07cc9a718
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/origin/index.sjs
@@ -0,0 +1,4 @@
+function handleRequest(request, response) {
+  response.setStatusLine(null, 308, "Permanent Redirect");
+  response.setHeader("Location", "http://example.org/tests/dom/serviceworkers/test/fetch/origin/realindex.html", false);
+}
diff --git a/dom/serviceworkers/test/fetch/origin/origin_test.js b/dom/serviceworkers/test/fetch/origin/origin_test.js
new file mode 100644
index 0000000000..005c3b8c39
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/origin/origin_test.js
@@ -0,0 +1,38 @@
+var prefix = "/tests/dom/serviceworkers/test/fetch/origin/";
+
+function addOpaqueRedirect(cache, file) {
+  return fetch(new Request(prefix + file, { redirect: "manual" })).then(
+    function(response) {
+      return cache.put(prefix + file, response);
+    }
+  );
+}
+
+self.addEventListener("install", function(event) {
+  event.waitUntil(
+    self.caches.open("origin-cache").then(c => {
+      return Promise.all([
+        addOpaqueRedirect(c, "index.sjs"),
+        addOpaqueRedirect(c, "index-to-https.sjs"),
+      ]);
+    })
+  );
+});
+
+self.addEventListener("fetch", function(event) {
+  if (event.request.url.includes("index-cached.sjs")) {
+    event.respondWith(
+      self.caches.open("origin-cache").then(c => {
+        return c.match(prefix + "index.sjs");
+      })
+    );
+  } else if (event.request.url.includes("index-to-https-cached.sjs")) {
+    event.respondWith(
+      self.caches.open("origin-cache").then(c => {
+        return c.match(prefix + "index-to-https.sjs");
+      })
+    );
+  } else {
+    event.respondWith(fetch(event.request));
+  }
+});
diff --git a/dom/serviceworkers/test/fetch/origin/realindex.html b/dom/serviceworkers/test/fetch/origin/realindex.html
new file mode 100644
index 0000000000..87f3489455
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/origin/realindex.html
@@ -0,0 +1,6 @@
+
+
diff --git a/dom/serviceworkers/test/fetch/origin/realindex.html^headers^ b/dom/serviceworkers/test/fetch/origin/realindex.html^headers^
new file mode 100644
index 0000000000..3a6a85d894
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/origin/realindex.html^headers^
@@ -0,0 +1 @@
+Access-Control-Allow-Origin: http://mochi.test:8888
diff --git a/dom/serviceworkers/test/fetch/origin/register.html b/dom/serviceworkers/test/fetch/origin/register.html
new file mode 100644
index 0000000000..2e99adba53
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/origin/register.html
@@ -0,0 +1,14 @@
+
+
diff --git a/dom/serviceworkers/test/fetch/origin/unregister.html b/dom/serviceworkers/test/fetch/origin/unregister.html
new file mode 100644
index 0000000000..1f13508fa7
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/origin/unregister.html
@@ -0,0 +1,12 @@
+
+
diff --git a/dom/serviceworkers/test/fetch/plugin/plugins.html b/dom/serviceworkers/test/fetch/plugin/plugins.html
new file mode 100644
index 0000000000..b268f6d99e
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/plugin/plugins.html
@@ -0,0 +1,43 @@
+
+
diff --git a/dom/serviceworkers/test/fetch/plugin/worker.js b/dom/serviceworkers/test/fetch/plugin/worker.js
new file mode 100644
index 0000000000..da3c1ba54a
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/plugin/worker.js
@@ -0,0 +1,15 @@
+self.addEventListener("fetch", function(event) {
+  var resource = event.request.url.split("/").pop();
+  event.waitUntil(
+    clients.matchAll().then(clients => {
+      clients.forEach(client => {
+        if (client.url.includes("plugins.html")) {
+          client.postMessage({
+            destination: event.request.destination,
+            resource,
+          });
+        }
+      });
+    })
+  );
+});
diff --git a/dom/serviceworkers/test/fetch/real-file.txt b/dom/serviceworkers/test/fetch/real-file.txt
new file mode 100644
index 0000000000..3ca2088ec0
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/real-file.txt
@@ -0,0 +1 @@
+This is a real file.
diff --git a/dom/serviceworkers/test/fetch/redirect.sjs b/dom/serviceworkers/test/fetch/redirect.sjs
new file mode 100644
index 0000000000..dab558f4a8
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/redirect.sjs
@@ -0,0 +1,4 @@
+function handleRequest(request, response) {
+  response.setStatusLine(request.httpVersion, 301, "Moved Permanently");
+  response.setHeader("Location", "synthesized-redirect-twice-real-file.txt");
+}
diff --git a/dom/serviceworkers/test/fetch/requesturl/index.html b/dom/serviceworkers/test/fetch/requesturl/index.html
new file mode 100644
index 0000000000..bc3e400a94
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/requesturl/index.html
@@ -0,0 +1,7 @@
+
+
+
diff --git a/dom/serviceworkers/test/fetch/requesturl/redirect.sjs b/dom/serviceworkers/test/fetch/requesturl/redirect.sjs
new file mode 100644
index 0000000000..be0e60a367
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/requesturl/redirect.sjs
@@ -0,0 +1,4 @@
+function handleRequest(request, response) {
+  response.setStatusLine(null, 308, "Permanent Redirect");
+  response.setHeader("Location", "http://example.org/tests/dom/serviceworkers/test/fetch/requesturl/secret.html", false);
+}
diff --git a/dom/serviceworkers/test/fetch/requesturl/redirector.html b/dom/serviceworkers/test/fetch/requesturl/redirector.html
new file mode 100644
index 0000000000..0a3afab9ee
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/requesturl/redirector.html
@@ -0,0 +1,2 @@
+
+
diff --git a/dom/serviceworkers/test/fetch/requesturl/register.html b/dom/serviceworkers/test/fetch/requesturl/register.html
new file mode 100644
index 0000000000..19a2e022c2
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/requesturl/register.html
@@ -0,0 +1,14 @@
+
+
diff --git a/dom/serviceworkers/test/fetch/requesturl/requesturl_test.js b/dom/serviceworkers/test/fetch/requesturl/requesturl_test.js
new file mode 100644
index 0000000000..4d2680538f
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/requesturl/requesturl_test.js
@@ -0,0 +1,21 @@
+addEventListener("fetch", event => {
+  var url = event.request.url;
+  var badURL = url.indexOf("secret.html") > -1;
+  event.respondWith(
+    new Promise(resolve => {
+      clients.matchAll().then(clients => {
+        for (var client of clients) {
+          if (client.url.indexOf("index.html") > -1) {
+            client.postMessage({
+              status: "ok",
+              result: !badURL,
+              message: "Should not find a bad URL (" + url + ")",
+            });
+            break;
+          }
+        }
+        resolve(fetch(event.request));
+      });
+    })
+  );
+});
diff --git a/dom/serviceworkers/test/fetch/requesturl/secret.html b/dom/serviceworkers/test/fetch/requesturl/secret.html
new file mode 100644
index 0000000000..694c336355
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/requesturl/secret.html
@@ -0,0 +1,5 @@
+
+secret stuff
+
diff --git a/dom/serviceworkers/test/fetch/requesturl/unregister.html b/dom/serviceworkers/test/fetch/requesturl/unregister.html
new file mode 100644
index 0000000000..1f13508fa7
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/requesturl/unregister.html
@@ -0,0 +1,12 @@
+
+
diff --git a/dom/serviceworkers/test/fetch/sandbox/index.html b/dom/serviceworkers/test/fetch/sandbox/index.html
new file mode 100644
index 0000000000..1094a3995d
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/sandbox/index.html
@@ -0,0 +1,5 @@
+
+
diff --git a/dom/serviceworkers/test/fetch/sandbox/intercepted_index.html b/dom/serviceworkers/test/fetch/sandbox/intercepted_index.html
new file mode 100644
index 0000000000..87261a495f
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/sandbox/intercepted_index.html
@@ -0,0 +1,5 @@
+
+
diff --git a/dom/serviceworkers/test/fetch/sandbox/register.html b/dom/serviceworkers/test/fetch/sandbox/register.html
new file mode 100644
index 0000000000..427b1a8da9
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/sandbox/register.html
@@ -0,0 +1,14 @@
+
+
diff --git a/dom/serviceworkers/test/fetch/sandbox/sandbox_test.js b/dom/serviceworkers/test/fetch/sandbox/sandbox_test.js
new file mode 100644
index 0000000000..81740edf6d
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/sandbox/sandbox_test.js
@@ -0,0 +1,5 @@
+self.addEventListener("fetch", function(event) {
+  if (event.request.url.includes("index.html")) {
+    event.respondWith(fetch("intercepted_index.html"));
+  }
+});
diff --git a/dom/serviceworkers/test/fetch/sandbox/unregister.html b/dom/serviceworkers/test/fetch/sandbox/unregister.html
new file mode 100644
index 0000000000..1f13508fa7
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/sandbox/unregister.html
@@ -0,0 +1,12 @@
+
+
diff --git a/dom/serviceworkers/test/fetch/upgrade-insecure/embedder.html b/dom/serviceworkers/test/fetch/upgrade-insecure/embedder.html
new file mode 100644
index 0000000000..e99209aa4d
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/upgrade-insecure/embedder.html
@@ -0,0 +1,10 @@
+
+
+
diff --git a/dom/serviceworkers/test/fetch/upgrade-insecure/embedder.html^headers^ b/dom/serviceworkers/test/fetch/upgrade-insecure/embedder.html^headers^
new file mode 100644
index 0000000000..602d9dc38d
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/upgrade-insecure/embedder.html^headers^
@@ -0,0 +1 @@
+Content-Security-Policy: upgrade-insecure-requests
diff --git a/dom/serviceworkers/test/fetch/upgrade-insecure/image-20px.png b/dom/serviceworkers/test/fetch/upgrade-insecure/image-20px.png
new file mode 100644
index 0000000000..ae6a8a6b88
Binary files /dev/null and b/dom/serviceworkers/test/fetch/upgrade-insecure/image-20px.png differ
diff --git a/dom/serviceworkers/test/fetch/upgrade-insecure/image-40px.png b/dom/serviceworkers/test/fetch/upgrade-insecure/image-40px.png
new file mode 100644
index 0000000000..fe391dc8a2
Binary files /dev/null and b/dom/serviceworkers/test/fetch/upgrade-insecure/image-40px.png differ
diff --git a/dom/serviceworkers/test/fetch/upgrade-insecure/image.html b/dom/serviceworkers/test/fetch/upgrade-insecure/image.html
new file mode 100644
index 0000000000..dfcfd80014
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/upgrade-insecure/image.html
@@ -0,0 +1,13 @@
+
+
diff --git a/dom/serviceworkers/test/fetch/upgrade-insecure/realindex.html b/dom/serviceworkers/test/fetch/upgrade-insecure/realindex.html
new file mode 100644
index 0000000000..aaa255aad3
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/upgrade-insecure/realindex.html
@@ -0,0 +1,4 @@
+
+
diff --git a/dom/serviceworkers/test/fetch/upgrade-insecure/register.html b/dom/serviceworkers/test/fetch/upgrade-insecure/register.html
new file mode 100644
index 0000000000..6309b9b218
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/upgrade-insecure/register.html
@@ -0,0 +1,14 @@
+
+
diff --git a/dom/serviceworkers/test/fetch/upgrade-insecure/unregister.html b/dom/serviceworkers/test/fetch/upgrade-insecure/unregister.html
new file mode 100644
index 0000000000..1f13508fa7
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/upgrade-insecure/unregister.html
@@ -0,0 +1,12 @@
+
+
diff --git a/dom/serviceworkers/test/fetch/upgrade-insecure/upgrade-insecure_test.js b/dom/serviceworkers/test/fetch/upgrade-insecure/upgrade-insecure_test.js
new file mode 100644
index 0000000000..f79307f4e4
--- /dev/null
+++ b/dom/serviceworkers/test/fetch/upgrade-insecure/upgrade-insecure_test.js
@@ -0,0 +1,11 @@
+self.addEventListener("fetch", function(event) {
+  if (event.request.url.includes("index.html")) {
+    event.respondWith(fetch("realindex.html"));
+  } else if (event.request.url.includes("image-20px.png")) {
+    if (event.request.url.indexOf("https://") == 0) {
+      event.respondWith(fetch("image-40px.png"));
+    } else {
+      event.respondWith(Response.error());
+    }
+  }
+});
diff --git a/dom/serviceworkers/test/fetch_event_worker.js b/dom/serviceworkers/test/fetch_event_worker.js
new file mode 100644
index 0000000000..2775ef5068
--- /dev/null
+++ b/dom/serviceworkers/test/fetch_event_worker.js
@@ -0,0 +1,364 @@
+// eslint-disable-next-line complexity
+onfetch = function(ev) {
+  if (ev.request.url.includes("ignore")) {
+    return;
+  }
+
+  if (ev.request.url.includes("bare-synthesized.txt")) {
+    ev.respondWith(
+      Promise.resolve(new Response("synthesized response body", {}))
+    );
+  } else if (ev.request.url.includes("file_CrossSiteXHR_server.sjs")) {
+    // N.B. this response would break the rules of CORS if it were allowed, but
+    //      this test relies upon the preflight request not being intercepted and
+    //      thus this response should not be used.
+    if (ev.request.method == "OPTIONS") {
+      ev.respondWith(
+        new Response("", {
+          headers: {
+            "Access-Control-Allow-Origin": "*",
+            "Access-Control-Allow-Headers": "X-Unsafe",
+          },
+        })
+      );
+    } else if (ev.request.url.includes("example.org")) {
+      ev.respondWith(fetch(ev.request));
+    }
+  } else if (ev.request.url.includes("synthesized-404.txt")) {
+    ev.respondWith(
+      Promise.resolve(
+        new Response("synthesized response body", { status: 404 })
+      )
+    );
+  } else if (ev.request.url.includes("synthesized-headers.txt")) {
+    ev.respondWith(
+      Promise.resolve(
+        new Response("synthesized response body", {
+          headers: {
+            "X-Custom-Greeting": "Hello",
+          },
+        })
+      )
+    );
+  } else if (ev.request.url.includes("test-respondwith-response.txt")) {
+    ev.respondWith(new Response("test-respondwith-response response body", {}));
+  } else if (ev.request.url.includes("synthesized-redirect-real-file.txt")) {
+    ev.respondWith(Promise.resolve(Response.redirect("fetch/real-file.txt")));
+  } else if (
+    ev.request.url.includes("synthesized-redirect-twice-real-file.txt")
+  ) {
+    ev.respondWith(
+      Promise.resolve(Response.redirect("synthesized-redirect-real-file.txt"))
+    );
+  } else if (ev.request.url.includes("synthesized-redirect-synthesized.txt")) {
+    ev.respondWith(Promise.resolve(Response.redirect("bare-synthesized.txt")));
+  } else if (
+    ev.request.url.includes("synthesized-redirect-twice-synthesized.txt")
+  ) {
+    ev.respondWith(
+      Promise.resolve(Response.redirect("synthesized-redirect-synthesized.txt"))
+    );
+  } else if (ev.request.url.includes("rejected.txt")) {
+    ev.respondWith(Promise.reject());
+  } else if (ev.request.url.includes("nonresponse.txt")) {
+    ev.respondWith(Promise.resolve(5));
+  } else if (ev.request.url.includes("nonresponse2.txt")) {
+    ev.respondWith(Promise.resolve({}));
+  } else if (ev.request.url.includes("nonpromise.txt")) {
+    try {
+      // This should coerce to Promise(5) instead of throwing
+      ev.respondWith(5);
+    } catch (e) {
+      // test is expecting failure, so return a success if we get a thrown
+      // exception
+      ev.respondWith(new Response("respondWith(5) threw " + e));
+    }
+  } else if (ev.request.url.includes("headers.txt")) {
+    var ok = true;
+    ok &= ev.request.headers.get("X-Test1") == "header1";
+    ok &= ev.request.headers.get("X-Test2") == "header2";
+    ev.respondWith(Promise.resolve(new Response(ok.toString(), {})));
+  } else if (ev.request.url.includes("readable-stream.txt")) {
+    ev.respondWith(
+      new Response(
+        new ReadableStream({
+          start(controller) {
+            controller.enqueue(
+              new Uint8Array([0x48, 0x65, 0x6c, 0x6c, 0x6f, 0x21])
+            );
+            controller.close();
+          },
+        })
+      )
+    );
+  } else if (ev.request.url.includes("readable-stream-locked.txt")) {
+    let stream = new ReadableStream({
+      start(controller) {
+        controller.enqueue(
+          new Uint8Array([0x48, 0x65, 0x6c, 0x6c, 0x6f, 0x21])
+        );
+        controller.close();
+      },
+    });
+
+    ev.respondWith(new Response(stream));
+
+    // This locks the stream.
+    stream.getReader();
+  } else if (ev.request.url.includes("readable-stream-with-exception.txt")) {
+    ev.respondWith(
+      new Response(
+        new ReadableStream({
+          start(controller) {},
+          pull() {
+            throw "EXCEPTION!";
+          },
+        })
+      )
+    );
+  } else if (ev.request.url.includes("readable-stream-with-exception2.txt")) {
+    ev.respondWith(
+      new Response(
+        new ReadableStream({
+          _controller: null,
+          _count: 0,
+
+          start(controller) {
+            this._controller = controller;
+          },
+          pull() {
+            if (++this._count == 5) {
+              throw "EXCEPTION 2!";
+            }
+            this._controller.enqueue(new Uint8Array([this._count]));
+          },
+        })
+      )
+    );
+  } else if (ev.request.url.includes("readable-stream-already-consumed.txt")) {
+    let r = new Response(
+      new ReadableStream({
+        start(controller) {
+          controller.enqueue(
+            new Uint8Array([0x48, 0x65, 0x6c, 0x6c, 0x6f, 0x21])
+          );
+          controller.close();
+        },
+      })
+    );
+
+    r.blob();
+
+    ev.respondWith(r);
+  } else if (ev.request.url.includes("user-pass")) {
+    ev.respondWith(new Response(ev.request.url));
+  } else if (ev.request.url.includes("nonexistent_image.gif")) {
+    var imageAsBinaryString = atob(
+      "R0lGODlhAQABAIAAAAUEBAAAACwAAAAAAQABAAACAkQBADs"
+    );
+    var imageLength = imageAsBinaryString.length;
+
+    // If we just pass |imageAsBinaryString| to the Response constructor, an
+    // encoding conversion occurs that corrupts the image. Instead, we need to
+    // convert it to a typed array.
+    // typed array.
+    var imageAsArray = new Uint8Array(imageLength);
+    for (var i = 0; i < imageLength; ++i) {
+      imageAsArray[i] = imageAsBinaryString.charCodeAt(i);
+    }
+
+    ev.respondWith(
+      Promise.resolve(
+        new Response(imageAsArray, { headers: { "Content-Type": "image/gif" } })
+      )
+    );
+  } else if (ev.request.url.includes("nonexistent_script.js")) {
+    ev.respondWith(
+      Promise.resolve(new Response("check_intercepted_script();", {}))
+    );
+  } else if (ev.request.url.includes("nonexistent_stylesheet.css")) {
+    ev.respondWith(
+      Promise.resolve(
+        new Response("#style-test { background-color: black !important; }", {
+          headers: {
+            "Content-Type": "text/css",
+          },
+        })
+      )
+    );
+  } else if (ev.request.url.includes("nonexistent_page.html")) {
+    ev.respondWith(
+      Promise.resolve(
+        new Response(
+          "",
+          {
+            headers: {
+              "Content-Type": "text/html",
+            },
+          }
+        )
+      )
+    );
+  } else if (ev.request.url.includes("navigate.html")) {
+    var requests = [
+      // should not throw
+      new Request(ev.request),
+      new Request(ev.request, undefined),
+      new Request(ev.request, null),
+      new Request(ev.request, {}),
+      new Request(ev.request, { someUnrelatedProperty: 42 }),
+      new Request(ev.request, { method: "GET" }),
+    ];
+    ev.respondWith(
+      Promise.resolve(
+        new Response(
+          "",
+          {
+            headers: {
+              "Content-Type": "text/html",
+            },
+          }
+        )
+      )
+    );
+  } else if (ev.request.url.includes("nonexistent_worker_script.js")) {
+    ev.respondWith(
+      Promise.resolve(
+        new Response("postMessage('worker-intercept-success')", {
+          headers: { "Content-Type": "text/javascript" },
+        })
+      )
+    );
+  } else if (ev.request.url.includes("nonexistent_imported_script.js")) {
+    ev.respondWith(
+      Promise.resolve(
+        new Response("check_intercepted_script();", {
+          headers: { "Content-Type": "text/javascript" },
+        })
+      )
+    );
+  } else if (ev.request.url.includes("deliver-gzip")) {
+    // Don't handle the request, this will make Necko perform a network request, at
+    // which point SetApplyConversion must be re-enabled, otherwise the request
+    // will fail.
+    return;
+  } else if (ev.request.url.includes("hello.gz")) {
+    ev.respondWith(fetch("fetch/deliver-gzip.sjs"));
+  } else if (ev.request.url.includes("hello-after-extracting.gz")) {
+    ev.respondWith(
+      fetch("fetch/deliver-gzip.sjs").then(function(res) {
+        return res.text().then(function(body) {
+          return new Response(body, {
+            status: res.status,
+            statusText: res.statusText,
+            headers: res.headers,
+          });
+        });
+      })
+    );
+  } else if (ev.request.url.includes("opaque-on-same-origin")) {
+    var url =
+      "http://example.com/tests/dom/security/test/cors/file_CrossSiteXHR_server.sjs?status=200";
+    ev.respondWith(fetch(url, { mode: "no-cors" }));
+  } else if (ev.request.url.includes("opaque-no-cors")) {
+    if (ev.request.mode != "no-cors") {
+      ev.respondWith(Promise.reject());
+      return;
+    }
+
+    var url =
+      "http://example.com/tests/dom/security/test/cors/file_CrossSiteXHR_server.sjs?status=200";
+    ev.respondWith(fetch(url, { mode: ev.request.mode }));
+  } else if (ev.request.url.includes("cors-for-no-cors")) {
+    if (ev.request.mode != "no-cors") {
+      ev.respondWith(Promise.reject());
+      return;
+    }
+
+    var url =
+      "http://example.com/tests/dom/security/test/cors/file_CrossSiteXHR_server.sjs?status=200&allowOrigin=*";
+    ev.respondWith(fetch(url));
+  } else if (ev.request.url.includes("example.com")) {
+    ev.respondWith(fetch(ev.request));
+  } else if (ev.request.url.includes("body-")) {
+    ev.respondWith(
+      ev.request.text().then(function(body) {
+        return new Response(body + body);
+      })
+    );
+  } else if (ev.request.url.includes("something.txt")) {
+    ev.respondWith(Response.redirect("fetch/somethingelse.txt"));
+  } else if (ev.request.url.includes("somethingelse.txt")) {
+    ev.respondWith(new Response("something else response body", {}));
+  } else if (ev.request.url.includes("redirect_serviceworker.sjs")) {
+    // The redirect_serviceworker.sjs server-side JavaScript file redirects to
+    // 'http://mochi.test:8888/tests/dom/serviceworkers/test/worker.js'
+    // The redirected fetch should not go through the SW since the original
+    // fetch was initiated from a SW.
+    ev.respondWith(fetch("redirect_serviceworker.sjs"));
+  } else if (
+    ev.request.url.includes("load_cross_origin_xml_document_synthetic.xml")
+  ) {
+    ev.respondWith(
+      Promise.resolve(
+        new Response("body", {
+          headers: { "Content-Type": "text/xtml" },
+        })
+      )
+    );
+  } else if (
+    ev.request.url.includes("load_cross_origin_xml_document_cors.xml")
+  ) {
+    if (ev.request.mode != "same-origin") {
+      ev.respondWith(Promise.reject());
+      return;
+    }
+
+    var url =
+      "http://example.com/tests/dom/security/test/cors/file_CrossSiteXHR_server.sjs?status=200&allowOrigin=*";
+    ev.respondWith(fetch(url, { mode: "cors" }));
+  } else if (
+    ev.request.url.includes("load_cross_origin_xml_document_opaque.xml")
+  ) {
+    if (ev.request.mode != "same-origin") {
+      Promise.resolve(
+        new Response("Invalid Request mode", {
+          headers: { "Content-Type": "text/xtml" },
+        })
+      );
+      return;
+    }
+
+    var url =
+      "http://example.com/tests/dom/security/test/cors/file_CrossSiteXHR_server.sjs?status=200";
+    ev.respondWith(fetch(url, { mode: "no-cors" }));
+  } else if (ev.request.url.includes("xhr-method-test.txt")) {
+    ev.respondWith(new Response("intercepted " + ev.request.method));
+  } else if (ev.request.url.includes("empty-header")) {
+    if (
+      !ev.request.headers.has("emptyheader") ||
+      ev.request.headers.get("emptyheader") !== ""
+    ) {
+      ev.respondWith(Promise.reject());
+      return;
+    }
+    ev.respondWith(new Response("emptyheader"));
+  } else if (ev.request.url.includes("fetchevent-extendable")) {
+    if (ev instanceof ExtendableEvent) {
+      ev.respondWith(new Response("extendable"));
+    } else {
+      ev.respondWith(Promise.reject());
+    }
+  } else if (ev.request.url.includes("fetchevent-request")) {
+    var threw = false;
+    try {
+      new FetchEvent("foo");
+    } catch (e) {
+      if (e.name == "TypeError") {
+        threw = true;
+      }
+    } finally {
+      ev.respondWith(new Response(threw ? "non-nullable" : "nullable"));
+    }
+  }
+};
diff --git a/dom/serviceworkers/test/file_blob_response_worker.js b/dom/serviceworkers/test/file_blob_response_worker.js
new file mode 100644
index 0000000000..05e82b8c5d
--- /dev/null
+++ b/dom/serviceworkers/test/file_blob_response_worker.js
@@ -0,0 +1,39 @@
+function makeFileBlob(obj) {
+  return new Promise(function(resolve, reject) {
+    var request = indexedDB.open("file_blob_response_worker", 1);
+    request.onerror = reject;
+    request.onupgradeneeded = function(evt) {
+      var db = evt.target.result;
+      db.onerror = reject;
+
+      var objectStore = db.createObjectStore("test", { autoIncrement: true });
+      var index = objectStore.createIndex("test", "index");
+    };
+
+    request.onsuccess = function(evt) {
+      var db = evt.target.result;
+      db.onerror = reject;
+
+      var blob = new Blob([JSON.stringify(obj)], { type: "application/json" });
+      var data = { blob, index: 5 };
+
+      objectStore = db.transaction("test", "readwrite").objectStore("test");
+      objectStore.add(data).onsuccess = function(event) {
+        var key = event.target.result;
+        objectStore = db.transaction("test").objectStore("test");
+        objectStore.get(key).onsuccess = function(event1) {
+          resolve(event1.target.result.blob);
+        };
+      };
+    };
+  });
+}
+
+self.addEventListener("fetch", function(evt) {
+  var result = { value: "success" };
+  evt.respondWith(
+    makeFileBlob(result).then(function(blob) {
+      return new Response(blob);
+    })
+  );
+});
diff --git a/dom/serviceworkers/test/file_js_cache.html b/dom/serviceworkers/test/file_js_cache.html
new file mode 100644
index 0000000000..6feb94d872
--- /dev/null
+++ b/dom/serviceworkers/test/file_js_cache.html
@@ -0,0 +1,10 @@
+
+
+
+  
+  Add a tag script to save the bytecode
+
+
+  
+
+
diff --git a/dom/serviceworkers/test/file_js_cache.js b/dom/serviceworkers/test/file_js_cache.js
new file mode 100644
index 0000000000..b9b966775c
--- /dev/null
+++ b/dom/serviceworkers/test/file_js_cache.js
@@ -0,0 +1,5 @@
+function baz() {}
+function bar() {}
+function foo() { bar() }
+foo();
+
diff --git a/dom/serviceworkers/test/file_js_cache_cleanup.js b/dom/serviceworkers/test/file_js_cache_cleanup.js
new file mode 100644
index 0000000000..6798618604
--- /dev/null
+++ b/dom/serviceworkers/test/file_js_cache_cleanup.js
@@ -0,0 +1,16 @@
+"use strict";
+const { XPCOMUtils } = ChromeUtils.import(
+  "resource://gre/modules/XPCOMUtils.jsm"
+);
+
+function clearCache() {
+  const cacheStorageSrv = Cc[
+    "@mozilla.org/netwerk/cache-storage-service;1"
+  ].getService(Ci.nsICacheStorageService);
+  cacheStorageSrv.clear();
+}
+
+addMessageListener("teardown", function() {
+  clearCache();
+  sendAsyncMessage("teardown-complete");
+});
diff --git a/dom/serviceworkers/test/file_js_cache_save_after_load.html b/dom/serviceworkers/test/file_js_cache_save_after_load.html
new file mode 100644
index 0000000000..8a696c0026
--- /dev/null
+++ b/dom/serviceworkers/test/file_js_cache_save_after_load.html
@@ -0,0 +1,10 @@
+
+
+
+  
+  Save the bytecode when all scripts are executed
+
+
+  
+
+
diff --git a/dom/serviceworkers/test/file_js_cache_save_after_load.js b/dom/serviceworkers/test/file_js_cache_save_after_load.js
new file mode 100644
index 0000000000..2c2536c584
--- /dev/null
+++ b/dom/serviceworkers/test/file_js_cache_save_after_load.js
@@ -0,0 +1,15 @@
+function send_ping() {
+  window.dispatchEvent(new Event("ping"));
+}
+send_ping(); // ping (=1)
+
+window.addEventListener("load", function() {
+  send_ping(); // ping (=2)
+
+  // Append a script which should call |foo|, before the encoding of this script
+  // bytecode.
+  var script = document.createElement("script");
+  script.type = "text/javascript";
+  script.innerText = "send_ping();"; // ping (=3)
+  document.head.appendChild(script);
+});
diff --git a/dom/serviceworkers/test/file_js_cache_syntax_error.html b/dom/serviceworkers/test/file_js_cache_syntax_error.html
new file mode 100644
index 0000000000..cc4a9b2daa
--- /dev/null
+++ b/dom/serviceworkers/test/file_js_cache_syntax_error.html
@@ -0,0 +1,10 @@
+
+
+
+  
+  Do not save bytecode on compilation errors
+
+
+  
+
+
diff --git a/dom/serviceworkers/test/file_js_cache_syntax_error.js b/dom/serviceworkers/test/file_js_cache_syntax_error.js
new file mode 100644
index 0000000000..fcf587ae70
--- /dev/null
+++ b/dom/serviceworkers/test/file_js_cache_syntax_error.js
@@ -0,0 +1 @@
+var // SyntaxError: missing variable name.
diff --git a/dom/serviceworkers/test/file_js_cache_with_sri.html b/dom/serviceworkers/test/file_js_cache_with_sri.html
new file mode 100644
index 0000000000..38ecb26984
--- /dev/null
+++ b/dom/serviceworkers/test/file_js_cache_with_sri.html
@@ -0,0 +1,12 @@
+
+
+
+  
+  Add a tag script to save the bytecode
+
+
+  
+
+
diff --git a/dom/serviceworkers/test/file_notification_openWindow.html b/dom/serviceworkers/test/file_notification_openWindow.html
new file mode 100644
index 0000000000..f220f4808d
--- /dev/null
+++ b/dom/serviceworkers/test/file_notification_openWindow.html
@@ -0,0 +1,26 @@
+
+
+
+  Bug 1578070
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/file_userContextId_openWindow.js b/dom/serviceworkers/test/file_userContextId_openWindow.js
new file mode 100644
index 0000000000..649a3152ba
--- /dev/null
+++ b/dom/serviceworkers/test/file_userContextId_openWindow.js
@@ -0,0 +1,3 @@
+onnotificationclick = event => {
+  clients.openWindow("empty.html");
+};
diff --git a/dom/serviceworkers/test/force_refresh_browser_worker.js b/dom/serviceworkers/test/force_refresh_browser_worker.js
new file mode 100644
index 0000000000..9c5be48530
--- /dev/null
+++ b/dom/serviceworkers/test/force_refresh_browser_worker.js
@@ -0,0 +1,42 @@
+var name = "browserRefresherCache";
+
+self.addEventListener("install", function(event) {
+  event.waitUntil(
+    Promise.all([
+      caches.open(name),
+      fetch("./browser_cached_force_refresh.html"),
+    ]).then(function(results) {
+      var cache = results[0];
+      var response = results[1];
+      return cache.put("./browser_base_force_refresh.html", response);
+    })
+  );
+});
+
+self.addEventListener("fetch", function(event) {
+  event.respondWith(
+    caches
+      .open(name)
+      .then(function(cache) {
+        return cache.match(event.request);
+      })
+      .then(function(response) {
+        return response || fetch(event.request);
+      })
+  );
+});
+
+self.addEventListener("message", function(event) {
+  if (event.data.type === "GET_UNCONTROLLED_CLIENTS") {
+    event.waitUntil(
+      clients
+        .matchAll({ includeUncontrolled: true })
+        .then(function(clientList) {
+          var resultList = clientList.map(function(c) {
+            return { url: c.url, frameType: c.frameType };
+          });
+          event.source.postMessage({ type: "CLIENTS", detail: resultList });
+        })
+    );
+  }
+});
diff --git a/dom/serviceworkers/test/force_refresh_worker.js b/dom/serviceworkers/test/force_refresh_worker.js
new file mode 100644
index 0000000000..2e266b54d7
--- /dev/null
+++ b/dom/serviceworkers/test/force_refresh_worker.js
@@ -0,0 +1,43 @@
+var name = "refresherCache";
+
+self.addEventListener("install", function(event) {
+  event.waitUntil(
+    Promise.all([
+      caches.open(name),
+      fetch("./sw_clients/refresher_cached.html"),
+      fetch("./sw_clients/refresher_cached_compressed.html"),
+    ]).then(function(results) {
+      var cache = results[0];
+      var response = results[1];
+      var compressed = results[2];
+      return Promise.all([
+        cache.put("./sw_clients/refresher.html", response),
+        cache.put("./sw_clients/refresher_compressed.html", compressed),
+      ]);
+    })
+  );
+});
+
+self.addEventListener("fetch", function(event) {
+  event.respondWith(
+    caches
+      .open(name)
+      .then(function(cache) {
+        return cache.match(event.request);
+      })
+      .then(function(response) {
+        // If this is one of our primary cached responses, then the window
+        // must have generated the request via a normal window reload.  That
+        // should be detectable in the event.request.cache attribute.
+        if (response && event.request.cache !== "no-cache") {
+          dump(
+            '### ### FetchEvent.request.cache is "' +
+              event.request.cache +
+              '" instead of expected "no-cache"\n'
+          );
+          return Response.error();
+        }
+        return response || fetch(event.request);
+      })
+  );
+});
diff --git a/dom/serviceworkers/test/gtest/TestReadWrite.cpp b/dom/serviceworkers/test/gtest/TestReadWrite.cpp
new file mode 100644
index 0000000000..1d628f46d8
--- /dev/null
+++ b/dom/serviceworkers/test/gtest/TestReadWrite.cpp
@@ -0,0 +1,939 @@
+/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 2 -*- */
+/* vim: set ts=8 sts=2 et sw=2 tw=80: */
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this file,
+ * You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+#include "gtest/gtest.h"
+#include "mozilla/BasePrincipal.h"
+#include "mozilla/dom/ServiceWorkerRegistrar.h"
+#include "mozilla/dom/ServiceWorkerRegistrarTypes.h"
+#include "mozilla/ipc/PBackgroundSharedTypes.h"
+
+#include "nsAppDirectoryServiceDefs.h"
+#include "nsIFile.h"
+#include "nsIOutputStream.h"
+#include "nsNetUtil.h"
+#include "nsPrintfCString.h"
+#include "nsIServiceWorkerManager.h"
+
+#include "prtime.h"
+
+using namespace mozilla::dom;
+using namespace mozilla::ipc;
+
+class ServiceWorkerRegistrarTest : public ServiceWorkerRegistrar {
+ public:
+  ServiceWorkerRegistrarTest() {
+#ifdef MOZ_DIAGNOSTIC_ASSERT_ENABLED
+    nsresult rv = NS_GetSpecialDirectory(NS_APP_USER_PROFILE_50_DIR,
+                                         getter_AddRefs(mProfileDir));
+    MOZ_DIAGNOSTIC_ASSERT(NS_SUCCEEDED(rv));
+#else
+    NS_GetSpecialDirectory(NS_APP_USER_PROFILE_50_DIR,
+                           getter_AddRefs(mProfileDir));
+#endif
+    MOZ_DIAGNOSTIC_ASSERT(mProfileDir);
+  }
+
+  nsresult TestReadData() { return ReadData(); }
+  nsresult TestWriteData() { return WriteData(mData); }
+  void TestDeleteData() { DeleteData(); }
+
+  void TestRegisterServiceWorker(const ServiceWorkerRegistrationData& aData) {
+    RegisterServiceWorkerInternal(aData);
+  }
+
+  nsTArray& TestGetData() { return mData; }
+};
+
+already_AddRefed GetFile() {
+  nsCOMPtr file;
+  nsresult rv =
+      NS_GetSpecialDirectory(NS_APP_USER_PROFILE_50_DIR, getter_AddRefs(file));
+  if (NS_WARN_IF(NS_FAILED(rv))) {
+    return nullptr;
+  }
+
+  file->Append(nsLiteralString(SERVICEWORKERREGISTRAR_FILE));
+  return file.forget();
+}
+
+bool CreateFile(const nsACString& aData) {
+  nsCOMPtr file = GetFile();
+
+  nsCOMPtr stream;
+  nsresult rv = NS_NewLocalFileOutputStream(getter_AddRefs(stream), file);
+  if (NS_WARN_IF(NS_FAILED(rv))) {
+    return false;
+  }
+
+  uint32_t count;
+  rv = stream->Write(aData.Data(), aData.Length(), &count);
+  if (NS_WARN_IF(NS_FAILED(rv))) {
+    return false;
+  }
+
+  if (count != aData.Length()) {
+    return false;
+  }
+
+  return true;
+}
+
+TEST(ServiceWorkerRegistrar, TestNoFile)
+{
+  nsCOMPtr file = GetFile();
+  ASSERT_TRUE(file)
+  << "GetFile must return a nsIFIle";
+
+  bool exists;
+  nsresult rv = file->Exists(&exists);
+  ASSERT_EQ(NS_OK, rv) << "nsIFile::Exists cannot fail";
+
+  if (exists) {
+    rv = file->Remove(false);
+    ASSERT_EQ(NS_OK, rv) << "nsIFile::Remove cannot fail";
+  }
+
+  RefPtr swr = new ServiceWorkerRegistrarTest;
+
+  rv = swr->TestReadData();
+  ASSERT_EQ(NS_OK, rv) << "ReadData() should not fail";
+
+  const nsTArray& data = swr->TestGetData();
+  ASSERT_EQ((uint32_t)0, data.Length())
+      << "No data should be found in an empty file";
+}
+
+TEST(ServiceWorkerRegistrar, TestEmptyFile)
+{
+  ASSERT_TRUE(CreateFile(""_ns))
+  << "CreateFile should not fail";
+
+  RefPtr swr = new ServiceWorkerRegistrarTest;
+
+  nsresult rv = swr->TestReadData();
+  ASSERT_NE(NS_OK, rv) << "ReadData() should fail if the file is empty";
+
+  const nsTArray& data = swr->TestGetData();
+  ASSERT_EQ((uint32_t)0, data.Length())
+      << "No data should be found in an empty file";
+}
+
+TEST(ServiceWorkerRegistrar, TestRightVersionFile)
+{
+  ASSERT_TRUE(CreateFile(nsLiteralCString(SERVICEWORKERREGISTRAR_VERSION "\n")))
+  << "CreateFile should not fail";
+
+  RefPtr swr = new ServiceWorkerRegistrarTest;
+
+  nsresult rv = swr->TestReadData();
+  ASSERT_EQ(NS_OK, rv)
+      << "ReadData() should not fail when the version is correct";
+
+  const nsTArray& data = swr->TestGetData();
+  ASSERT_EQ((uint32_t)0, data.Length())
+      << "No data should be found in an empty file";
+}
+
+TEST(ServiceWorkerRegistrar, TestWrongVersionFile)
+{
+  ASSERT_TRUE(
+      CreateFile(nsLiteralCString(SERVICEWORKERREGISTRAR_VERSION "bla\n")))
+  << "CreateFile should not fail";
+
+  RefPtr swr = new ServiceWorkerRegistrarTest;
+
+  nsresult rv = swr->TestReadData();
+  ASSERT_NE(NS_OK, rv)
+      << "ReadData() should fail when the version is not correct";
+
+  const nsTArray& data = swr->TestGetData();
+  ASSERT_EQ((uint32_t)0, data.Length())
+      << "No data should be found in an empty file";
+}
+
+TEST(ServiceWorkerRegistrar, TestReadData)
+{
+  nsAutoCString buffer(SERVICEWORKERREGISTRAR_VERSION "\n");
+
+  buffer.AppendLiteral("^inBrowser=1\n");
+  buffer.AppendLiteral("https://scope_0.org\ncurrentWorkerURL 0\n");
+  buffer.Append(SERVICEWORKERREGISTRAR_TRUE "\n");
+  buffer.AppendLiteral("cacheName 0\n");
+  buffer.AppendInt(nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS,
+                   16);
+  buffer.AppendLiteral("\n");
+  buffer.AppendInt(0);
+  buffer.AppendLiteral("\n");
+  buffer.AppendInt(0);
+  buffer.AppendLiteral("\n");
+  buffer.AppendInt(0);
+  buffer.AppendLiteral("\n");
+  buffer.Append(SERVICEWORKERREGISTRAR_TERMINATOR "\n");
+
+  buffer.AppendLiteral("\n");
+  buffer.AppendLiteral("https://scope_1.org\ncurrentWorkerURL 1\n");
+  buffer.Append(SERVICEWORKERREGISTRAR_FALSE "\n");
+  buffer.AppendLiteral("cacheName 1\n");
+  buffer.AppendInt(nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_ALL, 16);
+  buffer.AppendLiteral("\n");
+  PRTime ts = PR_Now();
+  buffer.AppendInt(ts);
+  buffer.AppendLiteral("\n");
+  buffer.AppendInt(ts);
+  buffer.AppendLiteral("\n");
+  buffer.AppendInt(ts);
+  buffer.AppendLiteral("\n");
+  buffer.Append(SERVICEWORKERREGISTRAR_TERMINATOR "\n");
+
+  ASSERT_TRUE(CreateFile(buffer))
+  << "CreateFile should not fail";
+
+  RefPtr swr = new ServiceWorkerRegistrarTest;
+
+  nsresult rv = swr->TestReadData();
+  ASSERT_EQ(NS_OK, rv) << "ReadData() should not fail";
+
+  const nsTArray& data = swr->TestGetData();
+  ASSERT_EQ((uint32_t)2, data.Length()) << "2 entries should be found";
+
+  const mozilla::ipc::PrincipalInfo& info0 = data[0].principal();
+  ASSERT_EQ(info0.type(), mozilla::ipc::PrincipalInfo::TContentPrincipalInfo)
+      << "First principal must be content";
+  const mozilla::ipc::ContentPrincipalInfo& cInfo0 = data[0].principal();
+
+  nsAutoCString suffix0;
+  cInfo0.attrs().CreateSuffix(suffix0);
+
+  ASSERT_STREQ("^inBrowser=1", suffix0.get());
+  ASSERT_STREQ("https://scope_0.org", cInfo0.spec().get());
+  ASSERT_STREQ("https://scope_0.org", data[0].scope().get());
+  ASSERT_STREQ("currentWorkerURL 0", data[0].currentWorkerURL().get());
+  ASSERT_TRUE(data[0].currentWorkerHandlesFetch());
+  ASSERT_STREQ("cacheName 0", NS_ConvertUTF16toUTF8(data[0].cacheName()).get());
+  ASSERT_EQ(nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS,
+            data[0].updateViaCache());
+  ASSERT_EQ((int64_t)0, data[0].currentWorkerInstalledTime());
+  ASSERT_EQ((int64_t)0, data[0].currentWorkerActivatedTime());
+  ASSERT_EQ((int64_t)0, data[0].lastUpdateTime());
+
+  const mozilla::ipc::PrincipalInfo& info1 = data[1].principal();
+  ASSERT_EQ(info1.type(), mozilla::ipc::PrincipalInfo::TContentPrincipalInfo)
+      << "First principal must be content";
+  const mozilla::ipc::ContentPrincipalInfo& cInfo1 = data[1].principal();
+
+  nsAutoCString suffix1;
+  cInfo1.attrs().CreateSuffix(suffix1);
+
+  ASSERT_STREQ("", suffix1.get());
+  ASSERT_STREQ("https://scope_1.org", cInfo1.spec().get());
+  ASSERT_STREQ("https://scope_1.org", data[1].scope().get());
+  ASSERT_STREQ("currentWorkerURL 1", data[1].currentWorkerURL().get());
+  ASSERT_FALSE(data[1].currentWorkerHandlesFetch());
+  ASSERT_STREQ("cacheName 1", NS_ConvertUTF16toUTF8(data[1].cacheName()).get());
+  ASSERT_EQ(nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_ALL,
+            data[1].updateViaCache());
+  ASSERT_EQ((int64_t)ts, data[1].currentWorkerInstalledTime());
+  ASSERT_EQ((int64_t)ts, data[1].currentWorkerActivatedTime());
+  ASSERT_EQ((int64_t)ts, data[1].lastUpdateTime());
+}
+
+TEST(ServiceWorkerRegistrar, TestDeleteData)
+{
+  ASSERT_TRUE(CreateFile("Foobar"_ns))
+  << "CreateFile should not fail";
+
+  RefPtr swr = new ServiceWorkerRegistrarTest;
+
+  swr->TestDeleteData();
+
+  nsCOMPtr file = GetFile();
+
+  bool exists;
+  nsresult rv = file->Exists(&exists);
+  ASSERT_EQ(NS_OK, rv) << "nsIFile::Exists cannot fail";
+
+  ASSERT_FALSE(exists)
+  << "The file should not exist after a DeleteData().";
+}
+
+TEST(ServiceWorkerRegistrar, TestWriteData)
+{
+  {
+    RefPtr swr = new ServiceWorkerRegistrarTest;
+
+    for (int i = 0; i < 2; ++i) {
+      ServiceWorkerRegistrationData reg;
+
+      reg.scope() = nsPrintfCString("https://scope_write_%d.org", i);
+      reg.currentWorkerURL() = nsPrintfCString("currentWorkerURL write %d", i);
+      reg.currentWorkerHandlesFetch() = true;
+      reg.cacheName() =
+          NS_ConvertUTF8toUTF16(nsPrintfCString("cacheName write %d", i));
+      reg.updateViaCache() =
+          nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS;
+
+      reg.currentWorkerInstalledTime() = PR_Now();
+      reg.currentWorkerActivatedTime() = PR_Now();
+      reg.lastUpdateTime() = PR_Now();
+
+      nsAutoCString spec;
+      spec.AppendPrintf("spec write %d", i);
+
+      reg.principal() = mozilla::ipc::ContentPrincipalInfo(
+          mozilla::OriginAttributes(i % 2), spec, spec, mozilla::Nothing(),
+          spec);
+
+      swr->TestRegisterServiceWorker(reg);
+    }
+
+    nsresult rv = swr->TestWriteData();
+    ASSERT_EQ(NS_OK, rv) << "WriteData() should not fail";
+  }
+
+  RefPtr swr = new ServiceWorkerRegistrarTest;
+
+  nsresult rv = swr->TestReadData();
+  ASSERT_EQ(NS_OK, rv) << "ReadData() should not fail";
+
+  const nsTArray& data = swr->TestGetData();
+  ASSERT_EQ((uint32_t)2, data.Length()) << "2 entries should be found";
+
+  for (int i = 0; i < 2; ++i) {
+    nsAutoCString test;
+
+    ASSERT_EQ(data[i].principal().type(),
+              mozilla::ipc::PrincipalInfo::TContentPrincipalInfo);
+    const mozilla::ipc::ContentPrincipalInfo& cInfo = data[i].principal();
+
+    mozilla::OriginAttributes attrs(i % 2);
+    nsAutoCString suffix, expectSuffix;
+    attrs.CreateSuffix(expectSuffix);
+    cInfo.attrs().CreateSuffix(suffix);
+
+    ASSERT_STREQ(expectSuffix.get(), suffix.get());
+
+    test.AppendPrintf("https://scope_write_%d.org", i);
+    ASSERT_STREQ(test.get(), cInfo.spec().get());
+
+    test.Truncate();
+    test.AppendPrintf("https://scope_write_%d.org", i);
+    ASSERT_STREQ(test.get(), data[i].scope().get());
+
+    test.Truncate();
+    test.AppendPrintf("currentWorkerURL write %d", i);
+    ASSERT_STREQ(test.get(), data[i].currentWorkerURL().get());
+
+    ASSERT_EQ(true, data[i].currentWorkerHandlesFetch());
+
+    test.Truncate();
+    test.AppendPrintf("cacheName write %d", i);
+    ASSERT_STREQ(test.get(), NS_ConvertUTF16toUTF8(data[i].cacheName()).get());
+
+    ASSERT_EQ(nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS,
+              data[i].updateViaCache());
+
+    ASSERT_NE((int64_t)0, data[i].currentWorkerInstalledTime());
+    ASSERT_NE((int64_t)0, data[i].currentWorkerActivatedTime());
+    ASSERT_NE((int64_t)0, data[i].lastUpdateTime());
+  }
+}
+
+TEST(ServiceWorkerRegistrar, TestVersion2Migration)
+{
+  nsAutoCString buffer(
+      "2"
+      "\n");
+
+  buffer.AppendLiteral("^appId=123&inBrowser=1\n");
+  buffer.AppendLiteral(
+      "spec 0\nhttps://scope_0.org\nscriptSpec 0\ncurrentWorkerURL "
+      "0\nactiveCache 0\nwaitingCache 0\n");
+  buffer.AppendLiteral(SERVICEWORKERREGISTRAR_TERMINATOR "\n");
+
+  buffer.AppendLiteral("\n");
+  buffer.AppendLiteral(
+      "spec 1\nhttps://scope_1.org\nscriptSpec 1\ncurrentWorkerURL "
+      "1\nactiveCache 1\nwaitingCache 1\n");
+  buffer.AppendLiteral(SERVICEWORKERREGISTRAR_TERMINATOR "\n");
+
+  ASSERT_TRUE(CreateFile(buffer))
+  << "CreateFile should not fail";
+
+  RefPtr swr = new ServiceWorkerRegistrarTest;
+
+  nsresult rv = swr->TestReadData();
+  ASSERT_EQ(NS_OK, rv) << "ReadData() should not fail";
+
+  const nsTArray& data = swr->TestGetData();
+  ASSERT_EQ((uint32_t)2, data.Length()) << "2 entries should be found";
+
+  const mozilla::ipc::PrincipalInfo& info0 = data[0].principal();
+  ASSERT_EQ(info0.type(), mozilla::ipc::PrincipalInfo::TContentPrincipalInfo)
+      << "First principal must be content";
+  const mozilla::ipc::ContentPrincipalInfo& cInfo0 = data[0].principal();
+
+  nsAutoCString suffix0;
+  cInfo0.attrs().CreateSuffix(suffix0);
+
+  ASSERT_STREQ("^inBrowser=1", suffix0.get());
+  ASSERT_STREQ("https://scope_0.org", cInfo0.spec().get());
+  ASSERT_STREQ("https://scope_0.org", data[0].scope().get());
+  ASSERT_STREQ("currentWorkerURL 0", data[0].currentWorkerURL().get());
+  ASSERT_EQ(true, data[0].currentWorkerHandlesFetch());
+  ASSERT_STREQ("activeCache 0",
+               NS_ConvertUTF16toUTF8(data[0].cacheName()).get());
+  ASSERT_EQ(nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS,
+            data[0].updateViaCache());
+  ASSERT_EQ((int64_t)0, data[0].currentWorkerInstalledTime());
+  ASSERT_EQ((int64_t)0, data[0].currentWorkerActivatedTime());
+  ASSERT_EQ((int64_t)0, data[0].lastUpdateTime());
+
+  const mozilla::ipc::PrincipalInfo& info1 = data[1].principal();
+  ASSERT_EQ(info1.type(), mozilla::ipc::PrincipalInfo::TContentPrincipalInfo)
+      << "First principal must be content";
+  const mozilla::ipc::ContentPrincipalInfo& cInfo1 = data[1].principal();
+
+  nsAutoCString suffix1;
+  cInfo1.attrs().CreateSuffix(suffix1);
+
+  ASSERT_STREQ("", suffix1.get());
+  ASSERT_STREQ("https://scope_1.org", cInfo1.spec().get());
+  ASSERT_STREQ("https://scope_1.org", data[1].scope().get());
+  ASSERT_STREQ("currentWorkerURL 1", data[1].currentWorkerURL().get());
+  ASSERT_EQ(true, data[1].currentWorkerHandlesFetch());
+  ASSERT_STREQ("activeCache 1",
+               NS_ConvertUTF16toUTF8(data[1].cacheName()).get());
+  ASSERT_EQ(nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS,
+            data[1].updateViaCache());
+  ASSERT_EQ((int64_t)0, data[1].currentWorkerInstalledTime());
+  ASSERT_EQ((int64_t)0, data[1].currentWorkerActivatedTime());
+  ASSERT_EQ((int64_t)0, data[1].lastUpdateTime());
+}
+
+TEST(ServiceWorkerRegistrar, TestVersion3Migration)
+{
+  nsAutoCString buffer(
+      "3"
+      "\n");
+
+  buffer.AppendLiteral("^appId=123&inBrowser=1\n");
+  buffer.AppendLiteral(
+      "spec 0\nhttps://scope_0.org\ncurrentWorkerURL 0\ncacheName 0\n");
+  buffer.AppendLiteral(SERVICEWORKERREGISTRAR_TERMINATOR "\n");
+
+  buffer.AppendLiteral("\n");
+  buffer.AppendLiteral(
+      "spec 1\nhttps://scope_1.org\ncurrentWorkerURL 1\ncacheName 1\n");
+  buffer.AppendLiteral(SERVICEWORKERREGISTRAR_TERMINATOR "\n");
+
+  ASSERT_TRUE(CreateFile(buffer))
+  << "CreateFile should not fail";
+
+  RefPtr swr = new ServiceWorkerRegistrarTest;
+
+  nsresult rv = swr->TestReadData();
+  ASSERT_EQ(NS_OK, rv) << "ReadData() should not fail";
+
+  const nsTArray& data = swr->TestGetData();
+  ASSERT_EQ((uint32_t)2, data.Length()) << "2 entries should be found";
+
+  const mozilla::ipc::PrincipalInfo& info0 = data[0].principal();
+  ASSERT_EQ(info0.type(), mozilla::ipc::PrincipalInfo::TContentPrincipalInfo)
+      << "First principal must be content";
+  const mozilla::ipc::ContentPrincipalInfo& cInfo0 = data[0].principal();
+
+  nsAutoCString suffix0;
+  cInfo0.attrs().CreateSuffix(suffix0);
+
+  ASSERT_STREQ("^inBrowser=1", suffix0.get());
+  ASSERT_STREQ("https://scope_0.org", cInfo0.spec().get());
+  ASSERT_STREQ("https://scope_0.org", data[0].scope().get());
+  ASSERT_STREQ("currentWorkerURL 0", data[0].currentWorkerURL().get());
+  ASSERT_EQ(true, data[0].currentWorkerHandlesFetch());
+  ASSERT_STREQ("cacheName 0", NS_ConvertUTF16toUTF8(data[0].cacheName()).get());
+  ASSERT_EQ(nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS,
+            data[0].updateViaCache());
+  ASSERT_EQ((int64_t)0, data[0].currentWorkerInstalledTime());
+  ASSERT_EQ((int64_t)0, data[0].currentWorkerActivatedTime());
+  ASSERT_EQ((int64_t)0, data[0].lastUpdateTime());
+
+  const mozilla::ipc::PrincipalInfo& info1 = data[1].principal();
+  ASSERT_EQ(info1.type(), mozilla::ipc::PrincipalInfo::TContentPrincipalInfo)
+      << "First principal must be content";
+  const mozilla::ipc::ContentPrincipalInfo& cInfo1 = data[1].principal();
+
+  nsAutoCString suffix1;
+  cInfo1.attrs().CreateSuffix(suffix1);
+
+  ASSERT_STREQ("", suffix1.get());
+  ASSERT_STREQ("https://scope_1.org", cInfo1.spec().get());
+  ASSERT_STREQ("https://scope_1.org", data[1].scope().get());
+  ASSERT_STREQ("currentWorkerURL 1", data[1].currentWorkerURL().get());
+  ASSERT_EQ(true, data[1].currentWorkerHandlesFetch());
+  ASSERT_STREQ("cacheName 1", NS_ConvertUTF16toUTF8(data[1].cacheName()).get());
+  ASSERT_EQ(nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS,
+            data[1].updateViaCache());
+  ASSERT_EQ((int64_t)0, data[1].currentWorkerInstalledTime());
+  ASSERT_EQ((int64_t)0, data[1].currentWorkerActivatedTime());
+  ASSERT_EQ((int64_t)0, data[1].lastUpdateTime());
+}
+
+TEST(ServiceWorkerRegistrar, TestVersion4Migration)
+{
+  nsAutoCString buffer(
+      "4"
+      "\n");
+
+  buffer.AppendLiteral("^appId=123&inBrowser=1\n");
+  buffer.AppendLiteral(
+      "https://scope_0.org\ncurrentWorkerURL 0\ncacheName 0\n");
+  buffer.AppendLiteral(SERVICEWORKERREGISTRAR_TERMINATOR "\n");
+
+  buffer.AppendLiteral("\n");
+  buffer.AppendLiteral(
+      "https://scope_1.org\ncurrentWorkerURL 1\ncacheName 1\n");
+  buffer.AppendLiteral(SERVICEWORKERREGISTRAR_TERMINATOR "\n");
+
+  ASSERT_TRUE(CreateFile(buffer))
+  << "CreateFile should not fail";
+
+  RefPtr swr = new ServiceWorkerRegistrarTest;
+
+  nsresult rv = swr->TestReadData();
+  ASSERT_EQ(NS_OK, rv) << "ReadData() should not fail";
+
+  const nsTArray& data = swr->TestGetData();
+  ASSERT_EQ((uint32_t)2, data.Length()) << "2 entries should be found";
+
+  const mozilla::ipc::PrincipalInfo& info0 = data[0].principal();
+  ASSERT_EQ(info0.type(), mozilla::ipc::PrincipalInfo::TContentPrincipalInfo)
+      << "First principal must be content";
+  const mozilla::ipc::ContentPrincipalInfo& cInfo0 = data[0].principal();
+
+  nsAutoCString suffix0;
+  cInfo0.attrs().CreateSuffix(suffix0);
+
+  ASSERT_STREQ("^inBrowser=1", suffix0.get());
+  ASSERT_STREQ("https://scope_0.org", cInfo0.spec().get());
+  ASSERT_STREQ("https://scope_0.org", data[0].scope().get());
+  ASSERT_STREQ("currentWorkerURL 0", data[0].currentWorkerURL().get());
+  // default is true
+  ASSERT_EQ(true, data[0].currentWorkerHandlesFetch());
+  ASSERT_STREQ("cacheName 0", NS_ConvertUTF16toUTF8(data[0].cacheName()).get());
+  ASSERT_EQ(nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS,
+            data[0].updateViaCache());
+  ASSERT_EQ((int64_t)0, data[0].currentWorkerInstalledTime());
+  ASSERT_EQ((int64_t)0, data[0].currentWorkerActivatedTime());
+  ASSERT_EQ((int64_t)0, data[0].lastUpdateTime());
+
+  const mozilla::ipc::PrincipalInfo& info1 = data[1].principal();
+  ASSERT_EQ(info1.type(), mozilla::ipc::PrincipalInfo::TContentPrincipalInfo)
+      << "First principal must be content";
+  const mozilla::ipc::ContentPrincipalInfo& cInfo1 = data[1].principal();
+
+  nsAutoCString suffix1;
+  cInfo1.attrs().CreateSuffix(suffix1);
+
+  ASSERT_STREQ("", suffix1.get());
+  ASSERT_STREQ("https://scope_1.org", cInfo1.spec().get());
+  ASSERT_STREQ("https://scope_1.org", data[1].scope().get());
+  ASSERT_STREQ("currentWorkerURL 1", data[1].currentWorkerURL().get());
+  // default is true
+  ASSERT_EQ(true, data[1].currentWorkerHandlesFetch());
+  ASSERT_STREQ("cacheName 1", NS_ConvertUTF16toUTF8(data[1].cacheName()).get());
+  ASSERT_EQ(nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS,
+            data[1].updateViaCache());
+  ASSERT_EQ((int64_t)0, data[1].currentWorkerInstalledTime());
+  ASSERT_EQ((int64_t)0, data[1].currentWorkerActivatedTime());
+  ASSERT_EQ((int64_t)0, data[1].lastUpdateTime());
+}
+
+TEST(ServiceWorkerRegistrar, TestVersion5Migration)
+{
+  nsAutoCString buffer(
+      "5"
+      "\n");
+
+  buffer.AppendLiteral("^appId=123&inBrowser=1\n");
+  buffer.AppendLiteral("https://scope_0.org\ncurrentWorkerURL 0\n");
+  buffer.AppendLiteral(SERVICEWORKERREGISTRAR_TRUE "\n");
+  buffer.AppendLiteral("cacheName 0\n");
+  buffer.AppendLiteral(SERVICEWORKERREGISTRAR_TERMINATOR "\n");
+
+  buffer.AppendLiteral("\n");
+  buffer.AppendLiteral("https://scope_1.org\ncurrentWorkerURL 1\n");
+  buffer.AppendLiteral(SERVICEWORKERREGISTRAR_FALSE "\n");
+  buffer.AppendLiteral("cacheName 1\n");
+  buffer.AppendLiteral(SERVICEWORKERREGISTRAR_TERMINATOR "\n");
+
+  ASSERT_TRUE(CreateFile(buffer))
+  << "CreateFile should not fail";
+
+  RefPtr swr = new ServiceWorkerRegistrarTest;
+
+  nsresult rv = swr->TestReadData();
+  ASSERT_EQ(NS_OK, rv) << "ReadData() should not fail";
+
+  const nsTArray& data = swr->TestGetData();
+  ASSERT_EQ((uint32_t)2, data.Length()) << "2 entries should be found";
+
+  const mozilla::ipc::PrincipalInfo& info0 = data[0].principal();
+  ASSERT_EQ(info0.type(), mozilla::ipc::PrincipalInfo::TContentPrincipalInfo)
+      << "First principal must be content";
+  const mozilla::ipc::ContentPrincipalInfo& cInfo0 = data[0].principal();
+
+  nsAutoCString suffix0;
+  cInfo0.attrs().CreateSuffix(suffix0);
+
+  ASSERT_STREQ("^inBrowser=1", suffix0.get());
+  ASSERT_STREQ("https://scope_0.org", cInfo0.spec().get());
+  ASSERT_STREQ("https://scope_0.org", data[0].scope().get());
+  ASSERT_STREQ("currentWorkerURL 0", data[0].currentWorkerURL().get());
+  ASSERT_TRUE(data[0].currentWorkerHandlesFetch());
+  ASSERT_STREQ("cacheName 0", NS_ConvertUTF16toUTF8(data[0].cacheName()).get());
+  ASSERT_EQ(nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS,
+            data[0].updateViaCache());
+  ASSERT_EQ((int64_t)0, data[0].currentWorkerInstalledTime());
+  ASSERT_EQ((int64_t)0, data[0].currentWorkerActivatedTime());
+  ASSERT_EQ((int64_t)0, data[0].lastUpdateTime());
+
+  const mozilla::ipc::PrincipalInfo& info1 = data[1].principal();
+  ASSERT_EQ(info1.type(), mozilla::ipc::PrincipalInfo::TContentPrincipalInfo)
+      << "First principal must be content";
+  const mozilla::ipc::ContentPrincipalInfo& cInfo1 = data[1].principal();
+
+  nsAutoCString suffix1;
+  cInfo1.attrs().CreateSuffix(suffix1);
+
+  ASSERT_STREQ("", suffix1.get());
+  ASSERT_STREQ("https://scope_1.org", cInfo1.spec().get());
+  ASSERT_STREQ("https://scope_1.org", data[1].scope().get());
+  ASSERT_STREQ("currentWorkerURL 1", data[1].currentWorkerURL().get());
+  ASSERT_FALSE(data[1].currentWorkerHandlesFetch());
+  ASSERT_STREQ("cacheName 1", NS_ConvertUTF16toUTF8(data[1].cacheName()).get());
+  ASSERT_EQ(nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS,
+            data[1].updateViaCache());
+  ASSERT_EQ((int64_t)0, data[1].currentWorkerInstalledTime());
+  ASSERT_EQ((int64_t)0, data[1].currentWorkerActivatedTime());
+  ASSERT_EQ((int64_t)0, data[1].lastUpdateTime());
+}
+
+TEST(ServiceWorkerRegistrar, TestVersion6Migration)
+{
+  nsAutoCString buffer(
+      "6"
+      "\n");
+
+  buffer.AppendLiteral("^appId=123&inBrowser=1\n");
+  buffer.AppendLiteral("https://scope_0.org\ncurrentWorkerURL 0\n");
+  buffer.AppendLiteral(SERVICEWORKERREGISTRAR_TRUE "\n");
+  buffer.AppendLiteral("cacheName 0\n");
+  buffer.AppendInt(nsIRequest::LOAD_NORMAL, 16);
+  buffer.AppendLiteral("\n");
+  buffer.AppendLiteral(SERVICEWORKERREGISTRAR_TERMINATOR "\n");
+
+  buffer.AppendLiteral("\n");
+  buffer.AppendLiteral("https://scope_1.org\ncurrentWorkerURL 1\n");
+  buffer.AppendLiteral(SERVICEWORKERREGISTRAR_FALSE "\n");
+  buffer.AppendLiteral("cacheName 1\n");
+  buffer.AppendInt(nsIRequest::VALIDATE_ALWAYS, 16);
+  buffer.AppendLiteral("\n");
+  buffer.AppendLiteral(SERVICEWORKERREGISTRAR_TERMINATOR "\n");
+
+  ASSERT_TRUE(CreateFile(buffer))
+  << "CreateFile should not fail";
+
+  RefPtr swr = new ServiceWorkerRegistrarTest;
+
+  nsresult rv = swr->TestReadData();
+  ASSERT_EQ(NS_OK, rv) << "ReadData() should not fail";
+
+  const nsTArray& data = swr->TestGetData();
+  ASSERT_EQ((uint32_t)2, data.Length()) << "2 entries should be found";
+
+  const mozilla::ipc::PrincipalInfo& info0 = data[0].principal();
+  ASSERT_EQ(info0.type(), mozilla::ipc::PrincipalInfo::TContentPrincipalInfo)
+      << "First principal must be content";
+  const mozilla::ipc::ContentPrincipalInfo& cInfo0 = data[0].principal();
+
+  nsAutoCString suffix0;
+  cInfo0.attrs().CreateSuffix(suffix0);
+
+  ASSERT_STREQ("^inBrowser=1", suffix0.get());
+  ASSERT_STREQ("https://scope_0.org", cInfo0.spec().get());
+  ASSERT_STREQ("https://scope_0.org", data[0].scope().get());
+  ASSERT_STREQ("currentWorkerURL 0", data[0].currentWorkerURL().get());
+  ASSERT_TRUE(data[0].currentWorkerHandlesFetch());
+  ASSERT_STREQ("cacheName 0", NS_ConvertUTF16toUTF8(data[0].cacheName()).get());
+  ASSERT_EQ(nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_ALL,
+            data[0].updateViaCache());
+  ASSERT_EQ((int64_t)0, data[0].currentWorkerInstalledTime());
+  ASSERT_EQ((int64_t)0, data[0].currentWorkerActivatedTime());
+  ASSERT_EQ((int64_t)0, data[0].lastUpdateTime());
+
+  const mozilla::ipc::PrincipalInfo& info1 = data[1].principal();
+  ASSERT_EQ(info1.type(), mozilla::ipc::PrincipalInfo::TContentPrincipalInfo)
+      << "First principal must be content";
+  const mozilla::ipc::ContentPrincipalInfo& cInfo1 = data[1].principal();
+
+  nsAutoCString suffix1;
+  cInfo1.attrs().CreateSuffix(suffix1);
+
+  ASSERT_STREQ("", suffix1.get());
+  ASSERT_STREQ("https://scope_1.org", cInfo1.spec().get());
+  ASSERT_STREQ("https://scope_1.org", data[1].scope().get());
+  ASSERT_STREQ("currentWorkerURL 1", data[1].currentWorkerURL().get());
+  ASSERT_FALSE(data[1].currentWorkerHandlesFetch());
+  ASSERT_STREQ("cacheName 1", NS_ConvertUTF16toUTF8(data[1].cacheName()).get());
+  ASSERT_EQ(nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS,
+            data[1].updateViaCache());
+  ASSERT_EQ((int64_t)0, data[1].currentWorkerInstalledTime());
+  ASSERT_EQ((int64_t)0, data[1].currentWorkerActivatedTime());
+  ASSERT_EQ((int64_t)0, data[1].lastUpdateTime());
+}
+
+TEST(ServiceWorkerRegistrar, TestVersion7Migration)
+{
+  nsAutoCString buffer(
+      "7"
+      "\n");
+
+  buffer.AppendLiteral("^appId=123&inBrowser=1\n");
+  buffer.AppendLiteral("https://scope_0.org\ncurrentWorkerURL 0\n");
+  buffer.AppendLiteral(SERVICEWORKERREGISTRAR_TRUE "\n");
+  buffer.AppendLiteral("cacheName 0\n");
+  buffer.AppendInt(nsIRequest::LOAD_NORMAL, 16);
+  buffer.AppendLiteral("\n");
+  buffer.AppendInt(0);
+  buffer.AppendLiteral("\n");
+  buffer.AppendInt(0);
+  buffer.AppendLiteral("\n");
+  buffer.AppendInt(0);
+  buffer.AppendLiteral("\n");
+  buffer.AppendLiteral(SERVICEWORKERREGISTRAR_TERMINATOR "\n");
+
+  buffer.AppendLiteral("\n");
+  buffer.AppendLiteral("https://scope_1.org\ncurrentWorkerURL 1\n");
+  buffer.AppendLiteral(SERVICEWORKERREGISTRAR_FALSE "\n");
+  buffer.AppendLiteral("cacheName 1\n");
+  buffer.AppendInt(nsIRequest::VALIDATE_ALWAYS, 16);
+  buffer.AppendLiteral("\n");
+  PRTime ts = PR_Now();
+  buffer.AppendInt(ts);
+  buffer.AppendLiteral("\n");
+  buffer.AppendInt(ts);
+  buffer.AppendLiteral("\n");
+  buffer.AppendInt(ts);
+  buffer.AppendLiteral("\n");
+  buffer.AppendLiteral(SERVICEWORKERREGISTRAR_TERMINATOR "\n");
+
+  ASSERT_TRUE(CreateFile(buffer))
+  << "CreateFile should not fail";
+
+  RefPtr swr = new ServiceWorkerRegistrarTest;
+
+  nsresult rv = swr->TestReadData();
+  ASSERT_EQ(NS_OK, rv) << "ReadData() should not fail";
+
+  const nsTArray& data = swr->TestGetData();
+  ASSERT_EQ((uint32_t)2, data.Length()) << "2 entries should be found";
+
+  const mozilla::ipc::PrincipalInfo& info0 = data[0].principal();
+  ASSERT_EQ(info0.type(), mozilla::ipc::PrincipalInfo::TContentPrincipalInfo)
+      << "First principal must be content";
+  const mozilla::ipc::ContentPrincipalInfo& cInfo0 = data[0].principal();
+
+  nsAutoCString suffix0;
+  cInfo0.attrs().CreateSuffix(suffix0);
+
+  ASSERT_STREQ("^inBrowser=1", suffix0.get());
+  ASSERT_STREQ("https://scope_0.org", cInfo0.spec().get());
+  ASSERT_STREQ("https://scope_0.org", data[0].scope().get());
+  ASSERT_STREQ("currentWorkerURL 0", data[0].currentWorkerURL().get());
+  ASSERT_TRUE(data[0].currentWorkerHandlesFetch());
+  ASSERT_STREQ("cacheName 0", NS_ConvertUTF16toUTF8(data[0].cacheName()).get());
+  ASSERT_EQ(nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_ALL,
+            data[0].updateViaCache());
+  ASSERT_EQ((int64_t)0, data[0].currentWorkerInstalledTime());
+  ASSERT_EQ((int64_t)0, data[0].currentWorkerActivatedTime());
+  ASSERT_EQ((int64_t)0, data[0].lastUpdateTime());
+
+  const mozilla::ipc::PrincipalInfo& info1 = data[1].principal();
+  ASSERT_EQ(info1.type(), mozilla::ipc::PrincipalInfo::TContentPrincipalInfo)
+      << "First principal must be content";
+  const mozilla::ipc::ContentPrincipalInfo& cInfo1 = data[1].principal();
+
+  nsAutoCString suffix1;
+  cInfo1.attrs().CreateSuffix(suffix1);
+
+  ASSERT_STREQ("", suffix1.get());
+  ASSERT_STREQ("https://scope_1.org", cInfo1.spec().get());
+  ASSERT_STREQ("https://scope_1.org", data[1].scope().get());
+  ASSERT_STREQ("currentWorkerURL 1", data[1].currentWorkerURL().get());
+  ASSERT_FALSE(data[1].currentWorkerHandlesFetch());
+  ASSERT_STREQ("cacheName 1", NS_ConvertUTF16toUTF8(data[1].cacheName()).get());
+  ASSERT_EQ(nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS,
+            data[1].updateViaCache());
+  ASSERT_EQ((int64_t)ts, data[1].currentWorkerInstalledTime());
+  ASSERT_EQ((int64_t)ts, data[1].currentWorkerActivatedTime());
+  ASSERT_EQ((int64_t)ts, data[1].lastUpdateTime());
+}
+
+TEST(ServiceWorkerRegistrar, TestDedupeRead)
+{
+  nsAutoCString buffer(
+      "3"
+      "\n");
+
+  // unique entries
+  buffer.AppendLiteral("^inBrowser=1\n");
+  buffer.AppendLiteral(
+      "spec 0\nhttps://scope_0.org\ncurrentWorkerURL 0\ncacheName 0\n");
+  buffer.AppendLiteral(SERVICEWORKERREGISTRAR_TERMINATOR "\n");
+
+  buffer.AppendLiteral("\n");
+  buffer.AppendLiteral(
+      "spec 1\nhttps://scope_1.org\ncurrentWorkerURL 1\ncacheName 1\n");
+  buffer.AppendLiteral(SERVICEWORKERREGISTRAR_TERMINATOR "\n");
+
+  // dupe entries
+  buffer.AppendLiteral("^inBrowser=1\n");
+  buffer.AppendLiteral(
+      "spec 1\nhttps://scope_0.org\ncurrentWorkerURL 0\ncacheName 0\n");
+  buffer.AppendLiteral(SERVICEWORKERREGISTRAR_TERMINATOR "\n");
+
+  buffer.AppendLiteral("^inBrowser=1\n");
+  buffer.AppendLiteral(
+      "spec 2\nhttps://scope_0.org\ncurrentWorkerURL 0\ncacheName 0\n");
+  buffer.AppendLiteral(SERVICEWORKERREGISTRAR_TERMINATOR "\n");
+
+  buffer.AppendLiteral("\n");
+  buffer.AppendLiteral(
+      "spec 3\nhttps://scope_1.org\ncurrentWorkerURL 1\ncacheName 1\n");
+  buffer.AppendLiteral(SERVICEWORKERREGISTRAR_TERMINATOR "\n");
+
+  ASSERT_TRUE(CreateFile(buffer))
+  << "CreateFile should not fail";
+
+  RefPtr swr = new ServiceWorkerRegistrarTest;
+
+  nsresult rv = swr->TestReadData();
+  ASSERT_EQ(NS_OK, rv) << "ReadData() should not fail";
+
+  const nsTArray& data = swr->TestGetData();
+  ASSERT_EQ((uint32_t)2, data.Length()) << "2 entries should be found";
+
+  const mozilla::ipc::PrincipalInfo& info0 = data[0].principal();
+  ASSERT_EQ(info0.type(), mozilla::ipc::PrincipalInfo::TContentPrincipalInfo)
+      << "First principal must be content";
+  const mozilla::ipc::ContentPrincipalInfo& cInfo0 = data[0].principal();
+
+  nsAutoCString suffix0;
+  cInfo0.attrs().CreateSuffix(suffix0);
+
+  ASSERT_STREQ("^inBrowser=1", suffix0.get());
+  ASSERT_STREQ("https://scope_0.org", cInfo0.spec().get());
+  ASSERT_STREQ("https://scope_0.org", data[0].scope().get());
+  ASSERT_STREQ("currentWorkerURL 0", data[0].currentWorkerURL().get());
+  ASSERT_EQ(true, data[0].currentWorkerHandlesFetch());
+  ASSERT_STREQ("cacheName 0", NS_ConvertUTF16toUTF8(data[0].cacheName()).get());
+  ASSERT_EQ(nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS,
+            data[0].updateViaCache());
+  ASSERT_EQ((int64_t)0, data[0].currentWorkerInstalledTime());
+  ASSERT_EQ((int64_t)0, data[0].currentWorkerActivatedTime());
+  ASSERT_EQ((int64_t)0, data[0].lastUpdateTime());
+
+  const mozilla::ipc::PrincipalInfo& info1 = data[1].principal();
+  ASSERT_EQ(info1.type(), mozilla::ipc::PrincipalInfo::TContentPrincipalInfo)
+      << "First principal must be content";
+  const mozilla::ipc::ContentPrincipalInfo& cInfo1 = data[1].principal();
+
+  nsAutoCString suffix1;
+  cInfo1.attrs().CreateSuffix(suffix1);
+
+  ASSERT_STREQ("", suffix1.get());
+  ASSERT_STREQ("https://scope_1.org", cInfo1.spec().get());
+  ASSERT_STREQ("https://scope_1.org", data[1].scope().get());
+  ASSERT_STREQ("currentWorkerURL 1", data[1].currentWorkerURL().get());
+  ASSERT_EQ(true, data[1].currentWorkerHandlesFetch());
+  ASSERT_STREQ("cacheName 1", NS_ConvertUTF16toUTF8(data[1].cacheName()).get());
+  ASSERT_EQ(nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS,
+            data[1].updateViaCache());
+  ASSERT_EQ((int64_t)0, data[1].currentWorkerInstalledTime());
+  ASSERT_EQ((int64_t)0, data[1].currentWorkerActivatedTime());
+  ASSERT_EQ((int64_t)0, data[1].lastUpdateTime());
+}
+
+TEST(ServiceWorkerRegistrar, TestDedupeWrite)
+{
+  {
+    RefPtr swr = new ServiceWorkerRegistrarTest;
+
+    for (int i = 0; i < 2; ++i) {
+      ServiceWorkerRegistrationData reg;
+
+      reg.scope() = "https://scope_write.dedupe"_ns;
+      reg.currentWorkerURL() = nsPrintfCString("currentWorkerURL write %d", i);
+      reg.currentWorkerHandlesFetch() = true;
+      reg.cacheName() =
+          NS_ConvertUTF8toUTF16(nsPrintfCString("cacheName write %d", i));
+      reg.updateViaCache() =
+          nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS;
+
+      nsAutoCString spec;
+      spec.AppendPrintf("spec write dedupe/%d", i);
+
+      reg.principal() = mozilla::ipc::ContentPrincipalInfo(
+          mozilla::OriginAttributes(false), spec, spec, mozilla::Nothing(),
+          spec);
+
+      swr->TestRegisterServiceWorker(reg);
+    }
+
+    nsresult rv = swr->TestWriteData();
+    ASSERT_EQ(NS_OK, rv) << "WriteData() should not fail";
+  }
+
+  RefPtr swr = new ServiceWorkerRegistrarTest;
+
+  nsresult rv = swr->TestReadData();
+  ASSERT_EQ(NS_OK, rv) << "ReadData() should not fail";
+
+  // Duplicate entries should be removed.
+  const nsTArray& data = swr->TestGetData();
+  ASSERT_EQ((uint32_t)1, data.Length()) << "1 entry should be found";
+
+  ASSERT_EQ(data[0].principal().type(),
+            mozilla::ipc::PrincipalInfo::TContentPrincipalInfo);
+  const mozilla::ipc::ContentPrincipalInfo& cInfo = data[0].principal();
+
+  mozilla::OriginAttributes attrs(false);
+  nsAutoCString suffix, expectSuffix;
+  attrs.CreateSuffix(expectSuffix);
+  cInfo.attrs().CreateSuffix(suffix);
+
+  // Last entry passed to RegisterServiceWorkerInternal() should overwrite
+  // previous values.  So expect "1" in values here.
+  ASSERT_STREQ(expectSuffix.get(), suffix.get());
+  ASSERT_STREQ("https://scope_write.dedupe", cInfo.spec().get());
+  ASSERT_STREQ("https://scope_write.dedupe", data[0].scope().get());
+  ASSERT_STREQ("currentWorkerURL write 1", data[0].currentWorkerURL().get());
+  ASSERT_EQ(true, data[0].currentWorkerHandlesFetch());
+  ASSERT_STREQ("cacheName write 1",
+               NS_ConvertUTF16toUTF8(data[0].cacheName()).get());
+  ASSERT_EQ(nsIServiceWorkerRegistrationInfo::UPDATE_VIA_CACHE_IMPORTS,
+            data[0].updateViaCache());
+  ASSERT_EQ((int64_t)0, data[0].currentWorkerInstalledTime());
+  ASSERT_EQ((int64_t)0, data[0].currentWorkerActivatedTime());
+  ASSERT_EQ((int64_t)0, data[0].lastUpdateTime());
+}
+
+int main(int argc, char** argv) {
+  ::testing::InitGoogleTest(&argc, argv);
+
+  int rv = RUN_ALL_TESTS();
+  return rv;
+}
diff --git a/dom/serviceworkers/test/gtest/moz.build b/dom/serviceworkers/test/gtest/moz.build
new file mode 100644
index 0000000000..99e2945332
--- /dev/null
+++ b/dom/serviceworkers/test/gtest/moz.build
@@ -0,0 +1,13 @@
+# -*- Mode: python; indent-tabs-mode: nil; tab-width: 40 -*-
+# vim: set filetype=python:
+# This Source Code Form is subject to the terms of the Mozilla Public
+# License, v. 2.0. If a copy of the MPL was not distributed with this
+# file, you can obtain one at http://mozilla.org/MPL/2.0/.
+
+UNIFIED_SOURCES = [
+    "TestReadWrite.cpp",
+]
+
+include("/ipc/chromium/chromium-config.mozbuild")
+
+FINAL_LIBRARY = "xul-gtest"
diff --git a/dom/serviceworkers/test/gzip_redirect_worker.js b/dom/serviceworkers/test/gzip_redirect_worker.js
new file mode 100644
index 0000000000..b66df51478
--- /dev/null
+++ b/dom/serviceworkers/test/gzip_redirect_worker.js
@@ -0,0 +1,15 @@
+self.addEventListener("fetch", function(event) {
+  if (!event.request.url.endsWith("sw_clients/does_not_exist.html")) {
+    return;
+  }
+
+  event.respondWith(
+    new Response("", {
+      status: 301,
+      statusText: "Moved Permanently",
+      headers: {
+        Location: "refresher_compressed.html",
+      },
+    })
+  );
+});
diff --git a/dom/serviceworkers/test/header_checker.sjs b/dom/serviceworkers/test/header_checker.sjs
new file mode 100644
index 0000000000..7061041039
--- /dev/null
+++ b/dom/serviceworkers/test/header_checker.sjs
@@ -0,0 +1,9 @@
+function handleRequest(request, response) {
+  if (request.getHeader("Service-Worker") === "script") {
+    response.setStatusLine("1.1", 200, "OK");
+    response.setHeader("Content-Type", "text/javascript");
+    response.write("// empty");
+  } else {
+    response.setStatusLine("1.1", 404, "Not Found");
+  }
+}
diff --git a/dom/serviceworkers/test/hello.html b/dom/serviceworkers/test/hello.html
new file mode 100644
index 0000000000..97eb03c902
--- /dev/null
+++ b/dom/serviceworkers/test/hello.html
@@ -0,0 +1,9 @@
+
+
+  
+    
+  
+  
+    Hello.
+  
+
diff --git a/dom/serviceworkers/test/importscript.sjs b/dom/serviceworkers/test/importscript.sjs
new file mode 100644
index 0000000000..6d177a7341
--- /dev/null
+++ b/dom/serviceworkers/test/importscript.sjs
@@ -0,0 +1,11 @@
+function handleRequest(request, response) {
+  if (request.queryString == 'clearcounter') {
+    setState('counter', '');
+  } else if (!getState('counter')) {
+    response.setHeader("Content-Type", "application/javascript", false);
+    response.write("callByScript();");
+    setState('counter', '1');
+  } else {
+    response.write("no cache no party!");
+  }
+}
diff --git a/dom/serviceworkers/test/importscript_worker.js b/dom/serviceworkers/test/importscript_worker.js
new file mode 100644
index 0000000000..6d639e792c
--- /dev/null
+++ b/dom/serviceworkers/test/importscript_worker.js
@@ -0,0 +1,46 @@
+var counter = 0;
+function callByScript() {
+  ++counter;
+}
+
+// Use multiple scripts in this load to verify we support that case correctly.
+// See bug 1249351 for a case where we broke this.
+importScripts("lorem_script.js", "importscript.sjs");
+
+importScripts("importscript.sjs");
+
+var missingScriptFailed = false;
+try {
+  importScripts(["there-is-nothing-here.js"]);
+} catch (e) {
+  missingScriptFailed = true;
+}
+
+onmessage = function(e) {
+  self.clients.matchAll().then(function(res) {
+    if (!res.length) {
+      dump("ERROR: no clients are currently controlled.\n");
+    }
+
+    if (!missingScriptFailed) {
+      res[0].postMessage("KO");
+    }
+
+    try {
+      // new unique script should fail
+      importScripts(["importscript.sjs?unique=true"]);
+      res[0].postMessage("KO");
+      return;
+    } catch (ex) {}
+
+    try {
+      // duplicate script previously offlined should succeed
+      importScripts(["importscript.sjs"]);
+    } catch (ex) {
+      res[0].postMessage("KO");
+      return;
+    }
+
+    res[0].postMessage(counter == 3 ? "OK" : "KO");
+  });
+};
diff --git a/dom/serviceworkers/test/install_event_error_worker.js b/dom/serviceworkers/test/install_event_error_worker.js
new file mode 100644
index 0000000000..e4208705b3
--- /dev/null
+++ b/dom/serviceworkers/test/install_event_error_worker.js
@@ -0,0 +1,9 @@
+// Worker that errors on receiving an install event.
+oninstall = function(e) {
+  e.waitUntil(
+    new Promise(function(resolve, reject) {
+      undefined.doSomething;
+      resolve();
+    })
+  );
+};
diff --git a/dom/serviceworkers/test/install_event_worker.js b/dom/serviceworkers/test/install_event_worker.js
new file mode 100644
index 0000000000..1f0815c8f0
--- /dev/null
+++ b/dom/serviceworkers/test/install_event_worker.js
@@ -0,0 +1,3 @@
+oninstall = function(e) {
+  dump("Got install event\n");
+};
diff --git a/dom/serviceworkers/test/intercepted_channel_process_swap_worker.js b/dom/serviceworkers/test/intercepted_channel_process_swap_worker.js
new file mode 100644
index 0000000000..ccc74bc895
--- /dev/null
+++ b/dom/serviceworkers/test/intercepted_channel_process_swap_worker.js
@@ -0,0 +1,7 @@
+onfetch = e => {
+  const url = new URL(e.request.url).searchParams.get("respondWith");
+
+  if (url) {
+    e.respondWith(fetch(url));
+  }
+};
diff --git a/dom/serviceworkers/test/isolated/README.md b/dom/serviceworkers/test/isolated/README.md
new file mode 100644
index 0000000000..2b462385af
--- /dev/null
+++ b/dom/serviceworkers/test/isolated/README.md
@@ -0,0 +1,19 @@
+This directory contains tests that are flaky when run with other tests
+but that we don't want to disable and where it's not trivial to make
+the tests not flaky at this time, but we have a plan to fix them via
+systemic fixes that are improving the codebase rather than hacking a
+test until it works.
+
+This directory and ugly hack structure needs to exist because of
+multi-e10s propagation races that will go away when we finish
+implementing the multi-e10s overhaul for ServiceWorkers.  Most
+specifically, unregister() calls need to propagate across all
+content processes.  There are fixes on bug 1318142, but they're
+ugly and complicate things.
+
+Specific test notes and rationalizations:
+- multi-e10s-update: This test relies on there being no registrations
+  existing at its start.  The preceding test that induces the breakage
+  (`browser_force_refresh.js`) was made to clean itself up, but the
+  unregister() race issue is not easily/cleanly hacked around and this
+  test will itself become moot when the multi-e10s changes land.
diff --git a/dom/serviceworkers/test/isolated/multi-e10s-update/browser.ini b/dom/serviceworkers/test/isolated/multi-e10s-update/browser.ini
new file mode 100644
index 0000000000..8f452dd18f
--- /dev/null
+++ b/dom/serviceworkers/test/isolated/multi-e10s-update/browser.ini
@@ -0,0 +1,8 @@
+[DEFAULT]
+support-files =
+  file_multie10s_update.html
+  server_multie10s_update.sjs
+
+[browser_multie10s_update.js]
+skip-if = true # bug 1429794 is to re-enable, then un-comment the below.
+#skip-if = !e10s # this is an e10s-only test.
diff --git a/dom/serviceworkers/test/isolated/multi-e10s-update/browser_multie10s_update.js b/dom/serviceworkers/test/isolated/multi-e10s-update/browser_multie10s_update.js
new file mode 100644
index 0000000000..4b9a2b9ca4
--- /dev/null
+++ b/dom/serviceworkers/test/isolated/multi-e10s-update/browser_multie10s_update.js
@@ -0,0 +1,143 @@
+"use strict";
+
+// Testing if 2 child processes are correctly managed when they both try to do
+// an SW update.
+
+const BASE_URI =
+  "http://mochi.test:8888/browser/dom/serviceworkers/test/isolated/multi-e10s-update/";
+
+add_task(async function test_update() {
+  info("Setting the prefs to having multi-e10s enabled");
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["dom.ipc.processCount", 4],
+      ["dom.serviceWorkers.enabled", true],
+      ["dom.serviceWorkers.testing.enabled", true],
+    ],
+  });
+
+  let url = BASE_URI + "file_multie10s_update.html";
+
+  info("Creating the first tab...");
+  let tab1 = BrowserTestUtils.addTab(gBrowser, url);
+  let browser1 = gBrowser.getBrowserForTab(tab1);
+  await BrowserTestUtils.browserLoaded(browser1);
+
+  info("Creating the second tab...");
+  let tab2 = BrowserTestUtils.addTab(gBrowser, url);
+  let browser2 = gBrowser.getBrowserForTab(tab2);
+  await BrowserTestUtils.browserLoaded(browser2);
+
+  let sw = BASE_URI + "server_multie10s_update.sjs";
+
+  info("Let's make sure there are no existing registrations...");
+  let existingCount = await SpecialPowers.spawn(browser1, [], async function() {
+    const regs = await content.navigator.serviceWorker.getRegistrations();
+    return regs.length;
+  });
+  is(existingCount, 0, "Previous tests should have cleaned up!");
+
+  info("Let's start the test...");
+  /* eslint-disable no-shadow */
+  let status = await SpecialPowers.spawn(browser1, [sw], function(url) {
+    // Let the SW be served immediately once by triggering a relase immediately.
+    // We don't need to await this.  We do this from a frame script because
+    // it has fetch.
+    content.fetch(url + "?release");
+
+    // Registration of the SW
+    return (
+      content.navigator.serviceWorker
+        .register(url)
+
+        // Activation
+        .then(function(r) {
+          content.registration = r;
+          return new content.window.Promise(resolve => {
+            let worker = r.installing;
+            worker.addEventListener("statechange", () => {
+              if (worker.state === "installed") {
+                resolve(true);
+              }
+            });
+          });
+        })
+
+        // Waiting for the result.
+        .then(() => {
+          return new content.window.Promise(resolveResults => {
+            // Once both updates have been issued and a single update has failed, we
+            // can tell the .sjs to release a single copy of the SW script.
+            let updateCount = 0;
+            const uc = new content.window.BroadcastChannel("update");
+            // This promise tracks the updates tally.
+            const updatesIssued = new Promise(resolveUpdatesIssued => {
+              uc.onmessage = function(e) {
+                updateCount++;
+                console.log("got update() number", updateCount);
+                if (updateCount === 2) {
+                  resolveUpdatesIssued();
+                }
+              };
+            });
+
+            let results = [];
+            const rc = new content.window.BroadcastChannel("result");
+            // This promise resolves when an update has failed.
+            const oneFailed = new Promise(resolveOneFailed => {
+              rc.onmessage = function(e) {
+                console.log("got result", e.data);
+                results.push(e.data);
+                if (e.data === 1) {
+                  resolveOneFailed();
+                }
+                if (results.length != 2) {
+                  return;
+                }
+
+                resolveResults(results[0] + results[1]);
+              };
+            });
+
+            Promise.all([updatesIssued, oneFailed]).then(() => {
+              console.log("releasing update");
+              content.fetch(url + "?release").catch(ex => {
+                console.error("problem releasing:", ex);
+              });
+            });
+
+            // Let's inform the tabs.
+            const sc = new content.window.BroadcastChannel("start");
+            sc.postMessage("go");
+          });
+        })
+    );
+  });
+  /* eslint-enable no-shadow */
+
+  if (status == 0) {
+    ok(false, "both succeeded. This is wrong.");
+  } else if (status == 1) {
+    ok(true, "one succeded, one failed. This is good.");
+  } else {
+    ok(false, "both failed. This is definitely wrong.");
+  }
+
+  // let's clean up the registration and get the fetch count.  The count
+  // should be 1 for the initial fetch and 1 for the update.
+  /* eslint-disable no-shadow */
+  const count = await SpecialPowers.spawn(browser1, [sw], async function(url) {
+    // We stored the registration on the frame script's wrapper, hence directly
+    // accesss content without using wrappedJSObject.
+    await content.registration.unregister();
+    const { count } = await content
+      .fetch(url + "?get-and-clear-count")
+      .then(r => r.json());
+    return count;
+  });
+  /* eslint-enable no-shadow */
+  is(count, 2, "SW should have been fetched only twice");
+
+  BrowserTestUtils.removeTab(tab1);
+  BrowserTestUtils.removeTab(tab2);
+});
diff --git a/dom/serviceworkers/test/isolated/multi-e10s-update/file_multie10s_update.html b/dom/serviceworkers/test/isolated/multi-e10s-update/file_multie10s_update.html
new file mode 100644
index 0000000000..beadfad0d4
--- /dev/null
+++ b/dom/serviceworkers/test/isolated/multi-e10s-update/file_multie10s_update.html
@@ -0,0 +1,40 @@
+
+
+
+
+
diff --git a/dom/serviceworkers/test/isolated/multi-e10s-update/server_multie10s_update.sjs b/dom/serviceworkers/test/isolated/multi-e10s-update/server_multie10s_update.sjs
new file mode 100644
index 0000000000..7d0669aa6e
--- /dev/null
+++ b/dom/serviceworkers/test/isolated/multi-e10s-update/server_multie10s_update.sjs
@@ -0,0 +1,97 @@
+
+// stolen from file_blocked_script.sjs
+function setGlobalState(data, key)
+{
+  x = { data: data, QueryInterface: function(iid) { return this } };
+  x.wrappedJSObject = x;
+  setObjectState(key, x);
+}
+
+function getGlobalState(key)
+{
+  var data;
+  getObjectState(key, function(x) {
+    data = x && x.wrappedJSObject.data;
+  });
+  return data;
+}
+
+function completeBlockingRequest(response)
+{
+  response.write("42");
+  response.finish();
+}
+
+// This stores the response that's currently blocking, or true if the release
+// got here before the blocking request.
+const BLOCKING_KEY = "multie10s-update-release";
+// This tracks the number of blocking requests we received up to this point in
+// time.  This value will be cleared when fetched.  It's on the caller to make
+// sure that all the blocking requests that might occurr have already occurred.
+const COUNT_KEY = "multie10s-update-count";
+
+/**
+ * Serve a request that will only be completed when the ?release variant of this
+ * .sjs is fetched.  This allows us to avoid using a timer, which slows down the
+ * tests and is brittle under slow hardware.
+ */
+function handleBlockingRequest(request, response)
+{
+  response.processAsync();
+  response.setHeader("Content-Type", "application/javascript", false);
+
+  const existingCount = getGlobalState(COUNT_KEY) || 0;
+  setGlobalState(existingCount + 1, COUNT_KEY);
+
+  const alreadyReleased = getGlobalState(BLOCKING_KEY);
+  if (alreadyReleased === true) {
+    completeBlockingRequest(response);
+    setGlobalState(null, BLOCKING_KEY);
+  } else if (alreadyReleased) {
+    // If we've got another response stacked up, this means something is wrong
+    // with the test.  The count mechanism will detect this, so just let this
+    // one through so we fail fast rather than hanging.
+    dump("we got multiple blocking requests stacked up!!\n");
+    completeBlockingRequest(response);
+  } else {
+    setGlobalState(response, BLOCKING_KEY);
+  }
+}
+
+function handleReleaseRequest(request, response)
+{
+  const blockingResponse = getGlobalState(BLOCKING_KEY);
+  if (blockingResponse) {
+    completeBlockingRequest(blockingResponse);
+    setGlobalState(null, BLOCKING_KEY);
+  } else {
+    setGlobalState(true, BLOCKING_KEY);
+  }
+
+  response.setHeader("Content-Type", "application/json", false);
+  response.write(JSON.stringify({ released: true }));
+}
+
+function handleCountRequest(request, response)
+{
+  const count = getGlobalState(COUNT_KEY) || 0;
+  // --verify requires that we clear this so the test can be re-run.
+  setGlobalState(0, COUNT_KEY);
+
+  response.setHeader("Content-Type", "application/json", false);
+  response.write(JSON.stringify({ count: count }));
+}
+
+Components.utils.importGlobalProperties(["URLSearchParams"]);
+function handleRequest(request, response) {
+  dump("server_multie10s_update.sjs: processing request for " + request.path +
+       "?" + request.queryString + "\n");
+  const query = new URLSearchParams(request.queryString);
+  if (query.has("release")) {
+    handleReleaseRequest(request, response);
+  } else if (query.has("get-and-clear-count")) {
+    handleCountRequest(request, response);
+  } else {
+    handleBlockingRequest(request, response);
+  }
+}
\ No newline at end of file
diff --git a/dom/serviceworkers/test/lazy_worker.js b/dom/serviceworkers/test/lazy_worker.js
new file mode 100644
index 0000000000..08a0ec13f7
--- /dev/null
+++ b/dom/serviceworkers/test/lazy_worker.js
@@ -0,0 +1,8 @@
+onactivate = function(event) {
+  var promise = new Promise(function(res) {
+    setTimeout(function() {
+      res();
+    }, 500);
+  });
+  event.waitUntil(promise);
+};
diff --git a/dom/serviceworkers/test/lorem_script.js b/dom/serviceworkers/test/lorem_script.js
new file mode 100644
index 0000000000..bc8f3c8085
--- /dev/null
+++ b/dom/serviceworkers/test/lorem_script.js
@@ -0,0 +1,8 @@
+var lorem_str = `
+Lorem ipsum dolor sit amet, consectetur adipiscing elit, sed do eiusmod tempor
+incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis
+nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo
+consequat. Duis aute irure dolor in reprehenderit in voluptate velit esse cillum
+dolore eu fugiat nulla pariatur. Excepteur sint occaecat cupidatat non proident,
+sunt in culpa qui officia deserunt mollit anim id est laborum.
+`;
diff --git a/dom/serviceworkers/test/match_all_advanced_worker.js b/dom/serviceworkers/test/match_all_advanced_worker.js
new file mode 100644
index 0000000000..d1bc5ab323
--- /dev/null
+++ b/dom/serviceworkers/test/match_all_advanced_worker.js
@@ -0,0 +1,5 @@
+onmessage = function(e) {
+  self.clients.matchAll().then(function(clients) {
+    e.source.postMessage(clients.length);
+  });
+};
diff --git a/dom/serviceworkers/test/match_all_client/match_all_client_id.html b/dom/serviceworkers/test/match_all_client/match_all_client_id.html
new file mode 100644
index 0000000000..7ac6fc9d05
--- /dev/null
+++ b/dom/serviceworkers/test/match_all_client/match_all_client_id.html
@@ -0,0 +1,31 @@
+
+
+
+
+  Bug 1139425 - controlled page
+
+
+
+
+
+
diff --git a/dom/serviceworkers/test/match_all_client_id_worker.js b/dom/serviceworkers/test/match_all_client_id_worker.js
new file mode 100644
index 0000000000..e8e51a00e7
--- /dev/null
+++ b/dom/serviceworkers/test/match_all_client_id_worker.js
@@ -0,0 +1,28 @@
+onmessage = function(e) {
+  dump("MatchAllClientIdWorker:" + e.data + "\n");
+  var id = [];
+  var iterations = 5;
+  var counter = 0;
+
+  for (var i = 0; i < iterations; i++) {
+    self.clients.matchAll().then(function(res) {
+      if (!res.length) {
+        dump("ERROR: no clients are currently controlled.\n");
+      }
+
+      client = res[0];
+      id[counter] = client.id;
+      counter++;
+      if (counter >= iterations) {
+        var response = true;
+        for (var index = 1; index < iterations; index++) {
+          if (id[0] != id[index]) {
+            response = false;
+            break;
+          }
+        }
+        client.postMessage(response);
+      }
+    });
+  }
+};
diff --git a/dom/serviceworkers/test/match_all_clients/match_all_controlled.html b/dom/serviceworkers/test/match_all_clients/match_all_controlled.html
new file mode 100644
index 0000000000..35f064815d
--- /dev/null
+++ b/dom/serviceworkers/test/match_all_clients/match_all_controlled.html
@@ -0,0 +1,83 @@
+
+
+
+
+  Bug 1058311 - controlled page
+
+
+
+
+
+
diff --git a/dom/serviceworkers/test/match_all_properties_worker.js b/dom/serviceworkers/test/match_all_properties_worker.js
new file mode 100644
index 0000000000..84156c93e0
--- /dev/null
+++ b/dom/serviceworkers/test/match_all_properties_worker.js
@@ -0,0 +1,28 @@
+onfetch = function(e) {
+  if (/\/clientId$/.test(e.request.url)) {
+    e.respondWith(new Response(e.clientId));
+    return;
+  }
+};
+
+onmessage = function(e) {
+  dump("MatchAllPropertiesWorker:" + e.data + "\n");
+  self.clients.matchAll().then(function(res) {
+    if (!res.length) {
+      dump("ERROR: no clients are currently controlled.\n");
+    }
+
+    for (i = 0; i < res.length; i++) {
+      client = res[i];
+      response = {
+        type: client.type,
+        id: client.id,
+        url: client.url,
+        visibilityState: client.visibilityState,
+        focused: client.focused,
+        frameType: client.frameType,
+      };
+      client.postMessage(response);
+    }
+  });
+};
diff --git a/dom/serviceworkers/test/match_all_worker.js b/dom/serviceworkers/test/match_all_worker.js
new file mode 100644
index 0000000000..3eddbe1191
--- /dev/null
+++ b/dom/serviceworkers/test/match_all_worker.js
@@ -0,0 +1,10 @@
+function loop() {
+  self.clients.matchAll().then(function(result) {
+    setTimeout(loop, 0);
+  });
+}
+
+onactivate = function(e) {
+  // spam matchAll until the worker is closed.
+  loop();
+};
diff --git a/dom/serviceworkers/test/message_posting_worker.js b/dom/serviceworkers/test/message_posting_worker.js
new file mode 100644
index 0000000000..26db997759
--- /dev/null
+++ b/dom/serviceworkers/test/message_posting_worker.js
@@ -0,0 +1,8 @@
+onmessage = function(e) {
+  self.clients.matchAll().then(function(res) {
+    if (!res.length) {
+      dump("ERROR: no clients are currently controlled.\n");
+    }
+    res[0].postMessage(e.data);
+  });
+};
diff --git a/dom/serviceworkers/test/message_receiver.html b/dom/serviceworkers/test/message_receiver.html
new file mode 100644
index 0000000000..82cb587c72
--- /dev/null
+++ b/dom/serviceworkers/test/message_receiver.html
@@ -0,0 +1,6 @@
+
+
diff --git a/dom/serviceworkers/test/mochitest.ini b/dom/serviceworkers/test/mochitest.ini
new file mode 100644
index 0000000000..6b44b2943d
--- /dev/null
+++ b/dom/serviceworkers/test/mochitest.ini
@@ -0,0 +1,348 @@
+[DEFAULT]
+# Mochitests are executed in iframes. Several ServiceWorker tests use iframes
+# too. The result is that we have nested iframes. CookieBehavior 4
+# (BEHAVIOR_REJECT_TRACKER) doesn't grant storage access permission to nested
+# iframes because trackers could use them to follow users across sites. Let's
+# use cookieBehavior 0 (BEHAVIOR_ACCEPT) here.
+prefs =
+  network.cookie.cookieBehavior=0
+  plugin.load_flash_only=false
+support-files =
+  abrupt_completion_worker.js
+  worker.js
+  worker2.js
+  worker3.js
+  fetch_event_worker.js
+  parse_error_worker.js
+  activate_event_error_worker.js
+  install_event_worker.js
+  install_event_error_worker.js
+  simpleregister/index.html
+  simpleregister/ready.html
+  controller/index.html
+  unregister/index.html
+  unregister/unregister.html
+  workerUpdate/update.html
+  sw_clients/simple.html
+  sw_clients/service_worker_controlled.html
+  match_all_worker.js
+  match_all_advanced_worker.js
+  worker_unregister.js
+  worker_update.js
+  message_posting_worker.js
+  fetch/index.html
+  fetch/fetch_worker_script.js
+  fetch/fetch_tests.js
+  fetch/deliver-gzip.sjs
+  fetch/redirect.sjs
+  fetch/real-file.txt
+  fetch/cookie/cookie_test.js
+  fetch/cookie/register.html
+  fetch/cookie/unregister.html
+  fetch/hsts/hsts_test.js
+  fetch/hsts/embedder.html
+  fetch/hsts/image.html
+  fetch/hsts/image-20px.png
+  fetch/hsts/image-40px.png
+  fetch/hsts/realindex.html
+  fetch/hsts/register.html
+  fetch/hsts/register.html^headers^
+  fetch/hsts/unregister.html
+  fetch/https/index.html
+  fetch/https/register.html
+  fetch/https/unregister.html
+  fetch/https/https_test.js
+  fetch/https/clonedresponse/index.html
+  fetch/https/clonedresponse/register.html
+  fetch/https/clonedresponse/unregister.html
+  fetch/https/clonedresponse/https_test.js
+  fetch/imagecache/image-20px.png
+  fetch/imagecache/image-40px.png
+  fetch/imagecache/imagecache_test.js
+  fetch/imagecache/index.html
+  fetch/imagecache/postmortem.html
+  fetch/imagecache/register.html
+  fetch/imagecache/unregister.html
+  fetch/imagecache-maxage/index.html
+  fetch/imagecache-maxage/image-20px.png
+  fetch/imagecache-maxage/image-40px.png
+  fetch/imagecache-maxage/maxage_test.js
+  fetch/imagecache-maxage/register.html
+  fetch/imagecache-maxage/unregister.html
+  fetch/importscript-mixedcontent/register.html
+  fetch/importscript-mixedcontent/unregister.html
+  fetch/importscript-mixedcontent/https_test.js
+  fetch/interrupt.sjs
+  fetch/origin/index.sjs
+  fetch/origin/index-to-https.sjs
+  fetch/origin/realindex.html
+  fetch/origin/realindex.html^headers^
+  fetch/origin/register.html
+  fetch/origin/unregister.html
+  fetch/origin/origin_test.js
+  fetch/origin/https/index-https.sjs
+  fetch/origin/https/realindex.html
+  fetch/origin/https/realindex.html^headers^
+  fetch/origin/https/register.html
+  fetch/origin/https/unregister.html
+  fetch/origin/https/origin_test.js
+  fetch/requesturl/index.html
+  fetch/requesturl/redirect.sjs
+  fetch/requesturl/redirector.html
+  fetch/requesturl/register.html
+  fetch/requesturl/requesturl_test.js
+  fetch/requesturl/secret.html
+  fetch/requesturl/unregister.html
+  fetch/sandbox/index.html
+  fetch/sandbox/intercepted_index.html
+  fetch/sandbox/register.html
+  fetch/sandbox/unregister.html
+  fetch/sandbox/sandbox_test.js
+  fetch/upgrade-insecure/upgrade-insecure_test.js
+  fetch/upgrade-insecure/embedder.html
+  fetch/upgrade-insecure/embedder.html^headers^
+  fetch/upgrade-insecure/image.html
+  fetch/upgrade-insecure/image-20px.png
+  fetch/upgrade-insecure/image-40px.png
+  fetch/upgrade-insecure/realindex.html
+  fetch/upgrade-insecure/register.html
+  fetch/upgrade-insecure/unregister.html
+  match_all_properties_worker.js
+  match_all_clients/match_all_controlled.html
+  test_serviceworker_interfaces.js
+  serviceworker_wrapper.js
+  message_receiver.html
+  serviceworker_not_sharedworker.js
+  match_all_client/match_all_client_id.html
+  match_all_client_id_worker.js
+  source_message_posting_worker.js
+  scope/scope_worker.js
+  redirect_serviceworker.sjs
+  importscript.sjs
+  importscript_worker.js
+  bug1151916_worker.js
+  bug1151916_driver.html
+  bug1240436_worker.js
+  notificationclick.html
+  notificationclick-otherwindow.html
+  notificationclick.js
+  notificationclick_focus.html
+  notificationclick_focus.js
+  notificationclose.html
+  notificationclose.js
+  worker_updatefoundevent.js
+  worker_updatefoundevent2.js
+  updatefoundevent.html
+  empty.html
+  empty.js
+  notification_constructor_error.js
+  notification_get_sw.js
+  notification/register.html
+  notification/unregister.html
+  notification/listener.html
+  notification_alt/register.html
+  notification_alt/unregister.html
+  sanitize/frame.html
+  sanitize/register.html
+  sanitize/example_check_and_unregister.html
+  sanitize_worker.js
+  streamfilter_server.sjs
+  streamfilter_worker.js
+  swa/worker_scope_different.js
+  swa/worker_scope_different.js^headers^
+  swa/worker_scope_different2.js
+  swa/worker_scope_different2.js^headers^
+  swa/worker_scope_precise.js
+  swa/worker_scope_precise.js^headers^
+  swa/worker_scope_too_deep.js
+  swa/worker_scope_too_deep.js^headers^
+  swa/worker_scope_too_narrow.js
+  swa/worker_scope_too_narrow.js^headers^
+  claim_oninstall_worker.js
+  claim_worker_1.js
+  claim_worker_2.js
+  claim_clients/client.html
+  force_refresh_worker.js
+  sw_clients/refresher.html
+  sw_clients/refresher_compressed.html
+  sw_clients/refresher_compressed.html^headers^
+  sw_clients/refresher_cached.html
+  sw_clients/refresher_cached_compressed.html
+  sw_clients/refresher_cached_compressed.html^headers^
+  strict_mode_warning.js
+  skip_waiting_installed_worker.js
+  skip_waiting_scope/index.html
+  thirdparty/iframe1.html
+  thirdparty/iframe2.html
+  thirdparty/register.html
+  thirdparty/unregister.html
+  thirdparty/sw.js
+  thirdparty/worker.js
+  register_https.html
+  gzip_redirect_worker.js
+  sw_clients/navigator.html
+  eval_worker.js
+  test_eval_allowed.html^headers^
+  opaque_intercept_worker.js
+  notify_loaded.js
+  fetch/plugin/worker.js
+  fetch/plugin/plugins.html
+  eventsource/*
+  sw_clients/file_blob_upload_frame.html
+  redirect_post.sjs
+  xslt_worker.js
+  xslt/*
+  unresolved_fetch_worker.js
+  header_checker.sjs
+  openWindow_worker.js
+  redirect.sjs
+  open_window/client.sjs
+  lorem_script.js
+  file_blob_response_worker.js
+  file_js_cache_cleanup.js
+  file_js_cache.html
+  file_js_cache_with_sri.html
+  file_js_cache.js
+  file_js_cache_save_after_load.html
+  file_js_cache_save_after_load.js
+  file_js_cache_syntax_error.html
+  file_js_cache_syntax_error.js
+  !/dom/security/test/cors/file_CrossSiteXHR_server.sjs
+  !/dom/notification/test/mochitest/MockServices.js
+  !/dom/notification/test/mochitest/NotificationTest.js
+  blocking_install_event_worker.js
+  sw_bad_mime_type.js
+  sw_bad_mime_type.js^headers^
+  error_reporting_helpers.js
+  fetch.js
+  hello.html
+  create_another_sharedWorker.html
+  sharedWorker_fetch.js
+  async_waituntil_worker.js
+  lazy_worker.js
+  nofetch_handler_worker.js
+  service_worker.js
+  service_worker_client.html
+  utils.js
+  sw_storage_not_allow.js
+  update_worker.sjs
+  self_update_worker.sjs
+  !/dom/events/test/event_leak_utils.js
+  onmessageerror_worker.js
+
+[test_abrupt_completion.html]
+skip-if = os == 'linux' #Bug 1615164 
+[test_bug1151916.html]
+[test_bug1240436.html]
+[test_bug1408734.html]
+[test_claim.html]
+[test_claim_oninstall.html]
+[test_controller.html]
+[test_cookie_fetch.html]
+[test_cross_origin_url_after_redirect.html]
+skip-if = debug # Bug 1262224
+[test_csp_upgrade-insecure_intercept.html]
+[test_devtools_bypass_serviceworker.html]
+[test_empty_serviceworker.html]
+[test_error_reporting.html]
+skip-if = serviceworker_e10s
+[test_escapedSlashes.html]
+[test_eval_allowed.html]
+[test_eventsource_intercept.html]
+[test_event_listener_leaks.html]
+skip-if = (os == "win" && processor == "aarch64") #bug 1535784
+[test_fetch_event.html]
+skip-if = (debug && e10s) # Bug 1262224
+[test_fetch_event_with_thirdpartypref.html]
+skip-if = (debug && e10s) # Bug 1262224
+[test_fetch_integrity.html]
+skip-if = serviceworker_e10s
+support-files = console_monitor.js
+[test_file_blob_response.html]
+[test_file_blob_upload.html]
+[test_force_refresh.html]
+[test_gzip_redirect.html]
+[test_hsts_upgrade_intercept.html]
+[test_https_fetch.html]
+[test_https_fetch_cloned_response.html]
+[test_https_origin_after_redirect.html]
+[test_https_origin_after_redirect_cached.html]
+[test_https_synth_fetch_from_cached_sw.html]
+[test_imagecache.html]
+[test_imagecache_max_age.html]
+[test_importscript.html]
+[test_importscript_mixedcontent.html]
+tags = mcb
+[test_install_event.html]
+[test_install_event_gc.html]
+skip-if = xorigin # JavaScript error: http://mochi.xorigin-test:8888/tests/SimpleTest/TestRunner.js, line 157: SecurityError: Permission denied to access property "wrappedJSObject" on cross-origin object
+[test_installation_simple.html]
+[test_match_all.html]
+[test_match_all_advanced.html]
+[test_match_all_client_id.html]
+skip-if = toolkit == 'android' && !is_fennec
+[test_match_all_client_properties.html]
+skip-if = toolkit == 'android' && !is_fennec
+[test_navigator.html]
+[test_not_intercept_plugin.html]
+skip-if = serviceworker_e10s # leaks InterceptedHttpChannel and others things
+[test_notification_constructor_error.html]
+[test_notification_get.html]
+[test_notification_openWindow.html]
+skip-if =
+    toolkit == 'android' && !is_fennec  # Bug 1620052
+    xorigin  # JavaScript error: http://mochi.xorigin-test:8888/tests/SimpleTest/TestRunner.js, line 157: SecurityError: Permission denied to access property "wrappedJSObject" on cross-origin object
+support-files = notification_openWindow_worker.js file_notification_openWindow.html
+tags = openwindow
+[test_notificationclick.html]
+[test_notificationclick_focus.html]
+[test_notificationclick-otherwindow.html]
+[test_notificationclose.html]
+[test_onmessageerror.html]
+skip-if = xorigin # Hangs with no error log
+[test_opaque_intercept.html]
+[test_openWindow.html]
+skip-if = toolkit == 'android' && !is_fennec # Bug 1620052
+tags = openwindow
+[test_origin_after_redirect.html]
+[test_origin_after_redirect_cached.html]
+[test_origin_after_redirect_to_https.html]
+[test_origin_after_redirect_to_https_cached.html]
+[test_post_message.html]
+[test_post_message_advanced.html]
+[test_post_message_source.html]
+[test_register_base.html]
+[test_register_https_in_http.html]
+[test_sandbox_intercept.html]
+[test_scopes.html]
+[test_script_loader_intercepted_js_cache.html]
+skip-if = serviceworker_e10s
+[test_sanitize.html]
+[test_sanitize_domain.html]
+[test_serviceworker.html]
+[test_service_worker_allowed.html]
+[test_serviceworker_header.html]
+[test_serviceworker_interfaces.html]
+[test_serviceworker_not_sharedworker.html]
+[test_skip_waiting.html]
+[test_streamfilter.html]
+[test_strict_mode_warning.html]
+[test_third_party_iframes.html]
+support-files =
+  window_party_iframes.html
+[test_unregister.html]
+[test_unresolved_fetch_interception.html]
+skip-if = verify || serviceworker_e10s
+[test_workerUnregister.html]
+[test_workerUpdate.html]
+[test_workerupdatefoundevent.html]
+[test_xslt.html]
+[test_async_waituntil.html]
+[test_worker_reference_gc_timeout.html]
+[test_nofetch_handler.html]
+[test_bad_script_cache.html]
+[test_file_upload.html]
+skip-if = toolkit == 'android' #Bug 1430182
+support-files = script_file_upload.js sw_file_upload.js server_file_upload.sjs
+[test_self_update_worker.html]
+skip-if = serviceworker_e10s || (toolkit == 'android' && !is_fennec)
diff --git a/dom/serviceworkers/test/nofetch_handler_worker.js b/dom/serviceworkers/test/nofetch_handler_worker.js
new file mode 100644
index 0000000000..77ba0c734a
--- /dev/null
+++ b/dom/serviceworkers/test/nofetch_handler_worker.js
@@ -0,0 +1,14 @@
+function handleFetch(event) {
+  event.respondWith(new Response("intercepted"));
+}
+
+self.oninstall = function(event) {
+  addEventListener("fetch", handleFetch);
+  self.onfetch = handleFetch;
+};
+
+// Bug 1325101. Make sure adding event listeners for other events
+// doesn't set the fetch flag.
+addEventListener("push", function() {});
+addEventListener("message", function() {});
+addEventListener("non-sw-event", function() {});
diff --git a/dom/serviceworkers/test/notification/listener.html b/dom/serviceworkers/test/notification/listener.html
new file mode 100644
index 0000000000..1c6e282ece
--- /dev/null
+++ b/dom/serviceworkers/test/notification/listener.html
@@ -0,0 +1,27 @@
+
+
+
+
+  Bug 1114554 - proxy to forward messages from SW to test
+
+
+
+
+
+
diff --git a/dom/serviceworkers/test/notification/register.html b/dom/serviceworkers/test/notification/register.html
new file mode 100644
index 0000000000..b7df73bede
--- /dev/null
+++ b/dom/serviceworkers/test/notification/register.html
@@ -0,0 +1,11 @@
+
+
diff --git a/dom/serviceworkers/test/notification/unregister.html b/dom/serviceworkers/test/notification/unregister.html
new file mode 100644
index 0000000000..d5a141f830
--- /dev/null
+++ b/dom/serviceworkers/test/notification/unregister.html
@@ -0,0 +1,12 @@
+
+
diff --git a/dom/serviceworkers/test/notification_alt/register.html b/dom/serviceworkers/test/notification_alt/register.html
new file mode 100644
index 0000000000..b7df73bede
--- /dev/null
+++ b/dom/serviceworkers/test/notification_alt/register.html
@@ -0,0 +1,11 @@
+
+
diff --git a/dom/serviceworkers/test/notification_alt/unregister.html b/dom/serviceworkers/test/notification_alt/unregister.html
new file mode 100644
index 0000000000..d5a141f830
--- /dev/null
+++ b/dom/serviceworkers/test/notification_alt/unregister.html
@@ -0,0 +1,12 @@
+
+
diff --git a/dom/serviceworkers/test/notification_constructor_error.js b/dom/serviceworkers/test/notification_constructor_error.js
new file mode 100644
index 0000000000..644dba480e
--- /dev/null
+++ b/dom/serviceworkers/test/notification_constructor_error.js
@@ -0,0 +1 @@
+new Notification("Hi there");
diff --git a/dom/serviceworkers/test/notification_get_sw.js b/dom/serviceworkers/test/notification_get_sw.js
new file mode 100644
index 0000000000..c6b100f142
--- /dev/null
+++ b/dom/serviceworkers/test/notification_get_sw.js
@@ -0,0 +1,55 @@
+function postAll(data) {
+  self.clients.matchAll().then(function(clients) {
+    if (clients.length == 0) {
+      dump(
+        "***************** NO CLIENTS FOUND! Test messages are being lost *******************\n"
+      );
+    }
+    clients.forEach(function(client) {
+      client.postMessage(data);
+    });
+  });
+}
+
+function ok(a, msg) {
+  postAll({ type: "status", status: !!a, msg: a + ": " + msg });
+}
+
+function is(a, b, msg) {
+  postAll({
+    type: "status",
+    status: a === b,
+    msg: a + " === " + b + ": " + msg,
+  });
+}
+
+function done() {
+  postAll({ type: "finish" });
+}
+
+onmessage = function(e) {
+  dump("%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% MESSAGE " + e.data + "\n");
+  var start;
+  if (e.data == "create") {
+    start = registration.showNotification("This is a title");
+  } else {
+    start = Promise.resolve();
+  }
+
+  start.then(function() {
+    dump("CALLING getNotification\n");
+    registration.getNotifications().then(function(notifications) {
+      dump("RECD getNotification\n");
+      is(notifications.length, 1, "There should be one stored notification");
+      var notification = notifications[0];
+      if (!notification) {
+        done();
+        return;
+      }
+      ok(notification instanceof Notification, "Should be a Notification");
+      is(notification.title, "This is a title", "Title should match");
+      notification.close();
+      done();
+    });
+  });
+};
diff --git a/dom/serviceworkers/test/notification_openWindow_worker.js b/dom/serviceworkers/test/notification_openWindow_worker.js
new file mode 100644
index 0000000000..174199b14a
--- /dev/null
+++ b/dom/serviceworkers/test/notification_openWindow_worker.js
@@ -0,0 +1,25 @@
+const gRoot = "http://mochi.test:8888/tests/dom/serviceworkers/test/";
+const gTestURL = gRoot + "test_notification_openWindow.html";
+const gClientURL = gRoot + "file_notification_openWindow.html";
+
+onmessage = function(event) {
+  if (event.data !== "DONE") {
+    dump(`ERROR: received unexpected message: ${JSON.stringify(event.data)}\n`);
+  }
+
+  event.waitUntil(
+    clients.matchAll({ includeUncontrolled: true }).then(cl => {
+      for (let client of cl) {
+        // The |gClientURL| window closes itself after posting the DONE message,
+        // so we don't need to send it anything here.
+        if (client.url === gTestURL) {
+          client.postMessage("DONE");
+        }
+      }
+    })
+  );
+};
+
+onnotificationclick = function(event) {
+  clients.openWindow(gClientURL);
+};
diff --git a/dom/serviceworkers/test/notificationclick-otherwindow.html b/dom/serviceworkers/test/notificationclick-otherwindow.html
new file mode 100644
index 0000000000..f64e82aabd
--- /dev/null
+++ b/dom/serviceworkers/test/notificationclick-otherwindow.html
@@ -0,0 +1,30 @@
+
+
+
+
+  Bug 1114554 - controlled page
+
+
+
+
+
+
diff --git a/dom/serviceworkers/test/notificationclick.html b/dom/serviceworkers/test/notificationclick.html
new file mode 100644
index 0000000000..448764a1cb
--- /dev/null
+++ b/dom/serviceworkers/test/notificationclick.html
@@ -0,0 +1,27 @@
+
+
+
+
+  Bug 1114554 - controlled page
+
+
+
+
+
+
diff --git a/dom/serviceworkers/test/notificationclick.js b/dom/serviceworkers/test/notificationclick.js
new file mode 100644
index 0000000000..ba7a7cb14a
--- /dev/null
+++ b/dom/serviceworkers/test/notificationclick.js
@@ -0,0 +1,23 @@
+// Any copyright is dedicated to the Public Domain.
+// http://creativecommons.org/publicdomain/zero/1.0/
+//
+onnotificationclick = function(e) {
+  self.clients.matchAll().then(function(clients) {
+    if (clients.length === 0) {
+      dump(
+        "********************* CLIENTS LIST EMPTY! Test will timeout! ***********************\n"
+      );
+      return;
+    }
+
+    clients.forEach(function(client) {
+      client.postMessage({
+        result:
+          e.notification.data &&
+          e.notification.data.complex &&
+          e.notification.data.complex[0] == "jsval" &&
+          e.notification.data.complex[1] == 5,
+      });
+    });
+  });
+};
diff --git a/dom/serviceworkers/test/notificationclick_focus.html b/dom/serviceworkers/test/notificationclick_focus.html
new file mode 100644
index 0000000000..0152d397f3
--- /dev/null
+++ b/dom/serviceworkers/test/notificationclick_focus.html
@@ -0,0 +1,28 @@
+
+
+
+
+  Bug 1144660 - controlled page
+
+
+
+
+
+
diff --git a/dom/serviceworkers/test/notificationclick_focus.js b/dom/serviceworkers/test/notificationclick_focus.js
new file mode 100644
index 0000000000..4c88340041
--- /dev/null
+++ b/dom/serviceworkers/test/notificationclick_focus.js
@@ -0,0 +1,49 @@
+// Any copyright is dedicated to the Public Domain.
+// http://creativecommons.org/publicdomain/zero/1.0/
+//
+
+function promisifyTimerFocus(client, delay) {
+  return new Promise(function(resolve, reject) {
+    setTimeout(function() {
+      client.focus().then(resolve, reject);
+    }, delay);
+  });
+}
+
+onnotificationclick = function(e) {
+  e.waitUntil(
+    self.clients.matchAll().then(function(clients) {
+      if (clients.length === 0) {
+        dump(
+          "********************* CLIENTS LIST EMPTY! Test will timeout! ***********************\n"
+        );
+        return Promise.resolve();
+      }
+
+      var immediatePromise = clients[0].focus();
+      var withinTimeout = promisifyTimerFocus(clients[0], 100);
+
+      var afterTimeout = promisifyTimerFocus(clients[0], 2000).then(
+        function() {
+          throw "Should have failed!";
+        },
+        function() {
+          return Promise.resolve();
+        }
+      );
+
+      return Promise.all([immediatePromise, withinTimeout, afterTimeout])
+        .then(function() {
+          clients.forEach(function(client) {
+            client.postMessage({ ok: true });
+          });
+        })
+        .catch(function(ex) {
+          dump("Error " + ex + "\n");
+          clients.forEach(function(client) {
+            client.postMessage({ ok: false });
+          });
+        });
+    })
+  );
+};
diff --git a/dom/serviceworkers/test/notificationclose.html b/dom/serviceworkers/test/notificationclose.html
new file mode 100644
index 0000000000..f18801122e
--- /dev/null
+++ b/dom/serviceworkers/test/notificationclose.html
@@ -0,0 +1,37 @@
+
+
+
+
+  Bug 1265841 - controlled page
+
+
+
+
+
+
diff --git a/dom/serviceworkers/test/notificationclose.js b/dom/serviceworkers/test/notificationclose.js
new file mode 100644
index 0000000000..75271e604e
--- /dev/null
+++ b/dom/serviceworkers/test/notificationclose.js
@@ -0,0 +1,31 @@
+// Any copyright is dedicated to the Public Domain.
+// http://creativecommons.org/publicdomain/zero/1.0/
+//
+onnotificationclose = function(e) {
+  e.waitUntil(
+    (async function() {
+      let windowOpened = true;
+      await clients.openWindow("hello.html").catch(err => {
+        windowOpened = false;
+      });
+
+      self.clients.matchAll().then(function(clients) {
+        if (clients.length === 0) {
+          dump("*** CLIENTS LIST EMPTY! Test will timeout! ***\n");
+          return;
+        }
+
+        clients.forEach(function(client) {
+          client.postMessage({
+            result:
+              e.notification.data &&
+              e.notification.data.complex &&
+              e.notification.data.complex[0] == "jsval" &&
+              e.notification.data.complex[1] == 5,
+            windowOpened,
+          });
+        });
+      });
+    })()
+  );
+};
diff --git a/dom/serviceworkers/test/notify_loaded.js b/dom/serviceworkers/test/notify_loaded.js
new file mode 100644
index 0000000000..3bf001abd6
--- /dev/null
+++ b/dom/serviceworkers/test/notify_loaded.js
@@ -0,0 +1 @@
+parent.postMessage("SCRIPT_LOADED", "*");
diff --git a/dom/serviceworkers/test/onmessageerror_worker.js b/dom/serviceworkers/test/onmessageerror_worker.js
new file mode 100644
index 0000000000..15426128a6
--- /dev/null
+++ b/dom/serviceworkers/test/onmessageerror_worker.js
@@ -0,0 +1,54 @@
+async function getSwContainer() {
+  const clients = await self.clients.matchAll({
+    type: "window",
+    includeUncontrolled: true,
+  });
+
+  for (let client of clients) {
+    if (client.url.endsWith("test_onmessageerror.html")) {
+      return client;
+    }
+  }
+}
+
+self.addEventListener("message", async e => {
+  const config = e.data;
+  const swContainer = await getSwContainer();
+
+  if (config == "send-bad-message") {
+    const serializable = true;
+    const deserializable = false;
+
+    swContainer.postMessage(
+      new StructuredCloneTester(serializable, deserializable)
+    );
+
+    return;
+  }
+
+  if (!config.serializable) {
+    swContainer.postMessage({
+      result: "Error",
+      reason: "Service Worker received an unserializable object",
+    });
+
+    return;
+  }
+
+  if (!config.deserializable) {
+    swContainer.postMessage({
+      result: "Error",
+      reason:
+        "Service Worker received (and deserialized) an un-deserializable object",
+    });
+
+    return;
+  }
+
+  swContainer.postMessage({ received: "message" });
+});
+
+self.addEventListener("messageerror", async () => {
+  const swContainer = await getSwContainer();
+  swContainer.postMessage({ received: "messageerror" });
+});
diff --git a/dom/serviceworkers/test/opaque_intercept_worker.js b/dom/serviceworkers/test/opaque_intercept_worker.js
new file mode 100644
index 0000000000..5dbf6fbc28
--- /dev/null
+++ b/dom/serviceworkers/test/opaque_intercept_worker.js
@@ -0,0 +1,40 @@
+var name = "opaqueInterceptCache";
+
+// Cross origin request to ensure that an opaque response is used
+var prefix = "http://example.com/tests/dom/serviceworkers/test/";
+
+var testReady = new Promise(resolve => {
+  self.addEventListener(
+    "message",
+    m => {
+      resolve();
+    },
+    { once: true }
+  );
+});
+
+self.addEventListener("install", function(event) {
+  var request = new Request(prefix + "notify_loaded.js", { mode: "no-cors" });
+  event.waitUntil(
+    Promise.all([caches.open(name), fetch(request), testReady]).then(function(
+      results
+    ) {
+      var cache = results[0];
+      var response = results[1];
+      return cache.put("./sw_clients/does_not_exist.js", response);
+    })
+  );
+});
+
+self.addEventListener("fetch", function(event) {
+  event.respondWith(
+    caches
+      .open(name)
+      .then(function(cache) {
+        return cache.match(event.request);
+      })
+      .then(function(response) {
+        return response || fetch(event.request);
+      })
+  );
+});
diff --git a/dom/serviceworkers/test/openWindow_worker.js b/dom/serviceworkers/test/openWindow_worker.js
new file mode 100644
index 0000000000..49db32c391
--- /dev/null
+++ b/dom/serviceworkers/test/openWindow_worker.js
@@ -0,0 +1,178 @@
+// the worker won't shut down between events because we increased
+// the timeout values.
+var client;
+var window_count = 0;
+var expected_window_count = 9;
+var isolated_window_count = 0;
+var expected_isolated_window_count = 2;
+var resolve_got_all_windows = null;
+var got_all_windows = new Promise(function(res, rej) {
+  resolve_got_all_windows = res;
+});
+
+// |expected_window_count| needs to be updated for every new call that's
+// expected to actually open a new window regardless of what |clients.openWindow|
+// returns.
+function testForUrl(url, throwType, clientProperties, resultsArray) {
+  return clients
+    .openWindow(url)
+    .then(function(e) {
+      if (throwType != null) {
+        resultsArray.push({
+          result: false,
+          message: "openWindow should throw " + throwType,
+        });
+      } else if (clientProperties) {
+        resultsArray.push({
+          result: e instanceof WindowClient,
+          message: "openWindow should resolve to a WindowClient",
+        });
+        resultsArray.push({
+          result: e.url == clientProperties.url,
+          message: "Client url should be " + clientProperties.url,
+        });
+        // Add more properties
+      } else {
+        resultsArray.push({
+          result: e == null,
+          message: "Open window should resolve to null. Got: " + e,
+        });
+      }
+    })
+    .catch(function(err) {
+      if (throwType == null) {
+        resultsArray.push({
+          result: false,
+          message: "Unexpected throw: " + err,
+        });
+      } else {
+        resultsArray.push({
+          result: err.toString().includes(throwType),
+          message: "openWindow should throw: " + err,
+        });
+      }
+    });
+}
+
+onmessage = function(event) {
+  if (event.data == "testNoPopup") {
+    client = event.source;
+
+    var results = [];
+    var promises = [];
+    promises.push(testForUrl("about:blank", "TypeError", null, results));
+    promises.push(
+      testForUrl("http://example.com", "InvalidAccessError", null, results)
+    );
+    promises.push(
+      testForUrl("_._*`InvalidURL", "InvalidAccessError", null, results)
+    );
+    event.waitUntil(
+      Promise.all(promises).then(function(e) {
+        client.postMessage(results);
+      })
+    );
+  }
+
+  if (event.data == "NEW_WINDOW" || event.data == "NEW_ISOLATED_WINDOW") {
+    window_count += 1;
+    if (event.data == "NEW_ISOLATED_WINDOW") {
+      isolated_window_count += 1;
+    }
+    if (window_count == expected_window_count) {
+      resolve_got_all_windows();
+    }
+  }
+
+  if (event.data == "CHECK_NUMBER_OF_WINDOWS") {
+    event.waitUntil(
+      got_all_windows
+        .then(function() {
+          return clients.matchAll();
+        })
+        .then(function(cl) {
+          event.source.postMessage([
+            {
+              result: cl.length == expected_window_count,
+              message: `The number of windows is correct. ${cl.length} == ${expected_window_count}`,
+            },
+            {
+              result: isolated_window_count == expected_isolated_window_count,
+              message: `The number of isolated windows is correct. ${isolated_window_count} == ${expected_isolated_window_count}`,
+            },
+          ]);
+          for (i = 0; i < cl.length; i++) {
+            cl[i].postMessage("CLOSE");
+          }
+        })
+    );
+  }
+};
+
+onnotificationclick = function(e) {
+  var results = [];
+  var promises = [];
+
+  var redirect =
+    "http://mochi.test:8888/tests/dom/serviceworkers/test/redirect.sjs?";
+  var redirect_xorigin =
+    "http://example.com/tests/dom/serviceworkers/test/redirect.sjs?";
+  var same_origin =
+    "http://mochi.test:8888/tests/dom/serviceworkers/test/open_window/client.sjs";
+  var different_origin =
+    "http://example.com/tests/dom/serviceworkers/test/open_window/client.sjs";
+
+  promises.push(testForUrl("about:blank", "TypeError", null, results));
+  promises.push(testForUrl(different_origin, null, null, results));
+  promises.push(testForUrl(same_origin, null, { url: same_origin }, results));
+  promises.push(
+    testForUrl("open_window/client.sjs", null, { url: same_origin }, results)
+  );
+
+  // redirect tests
+  promises.push(
+    testForUrl(
+      redirect + "open_window/client.sjs",
+      null,
+      { url: same_origin },
+      results
+    )
+  );
+  promises.push(testForUrl(redirect + different_origin, null, null, results));
+
+  promises.push(
+    testForUrl(redirect_xorigin + "open_window/client.sjs", null, null, results)
+  );
+  promises.push(
+    testForUrl(
+      redirect_xorigin + same_origin,
+      null,
+      { url: same_origin },
+      results
+    )
+  );
+
+  // coop+coep tests
+  promises.push(
+    testForUrl(
+      same_origin + "?crossOriginIsolated=true",
+      null,
+      { url: same_origin + "?crossOriginIsolated=true" },
+      results
+    )
+  );
+  promises.push(
+    testForUrl(
+      different_origin + "?crossOriginIsolated=true",
+      null,
+      null,
+      results
+    )
+  );
+
+  e.waitUntil(
+    Promise.all(promises).then(function() {
+      client.postMessage(results);
+    })
+  );
+};
diff --git a/dom/serviceworkers/test/open_window/client.sjs b/dom/serviceworkers/test/open_window/client.sjs
new file mode 100644
index 0000000000..236a4a1226
--- /dev/null
+++ b/dom/serviceworkers/test/open_window/client.sjs
@@ -0,0 +1,69 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+const RESPONSE = `
+
+
+
+  Bug 1172870 - page opened by ServiceWorkerClients.OpenWindow
+
+
+

+ +

+

client.sjs

+ + + + +`; + +function handleRequest(request, response) { + Components.utils.importGlobalProperties(["URLSearchParams"]); + let query = new URLSearchParams(request.queryString); + + // If the request has been marked to be isolated with COOP+COEP, set the appropriate headers. + if (query.get("crossOriginIsolated") == "true") { + response.setHeader("Cross-Origin-Opener-Policy", "same-origin", false); + } + + // Always set the COEP and CORP headers, so that this document can be framed + // by a document which has also set COEP to require-corp. + response.setHeader("Cross-Origin-Embedder-Policy", "require-corp", false); + response.setHeader("Cross-Origin-Resource-Policy", "cross-origin", false); + + response.setHeader("Content-Type", "text/html", false); + response.write(RESPONSE); +} diff --git a/dom/serviceworkers/test/page_post_controlled.html b/dom/serviceworkers/test/page_post_controlled.html new file mode 100644 index 0000000000..27694c0027 --- /dev/null +++ b/dom/serviceworkers/test/page_post_controlled.html @@ -0,0 +1,27 @@ + + + + + + + + + + diff --git a/dom/serviceworkers/test/parse_error_worker.js b/dom/serviceworkers/test/parse_error_worker.js new file mode 100644 index 0000000000..b6a8ef0a1a --- /dev/null +++ b/dom/serviceworkers/test/parse_error_worker.js @@ -0,0 +1,2 @@ +// intentional parse error. +var foo = {; diff --git a/dom/serviceworkers/test/redirect.sjs b/dom/serviceworkers/test/redirect.sjs new file mode 100644 index 0000000000..b6249cadff --- /dev/null +++ b/dom/serviceworkers/test/redirect.sjs @@ -0,0 +1,5 @@ +function handleRequest(request, response) +{ + response.setStatusLine(request.httpVersion, 301, "Moved Permanently"); + response.setHeader("Location", request.queryString, false); +} diff --git a/dom/serviceworkers/test/redirect_post.sjs b/dom/serviceworkers/test/redirect_post.sjs new file mode 100644 index 0000000000..408fbfbfe6 --- /dev/null +++ b/dom/serviceworkers/test/redirect_post.sjs @@ -0,0 +1,35 @@ +const CC = Components.Constructor; +const BinaryInputStream = CC("@mozilla.org/binaryinputstream;1", + "nsIBinaryInputStream", + "setInputStream"); + +function handleRequest(request, response) +{ + var query = {}; + request.queryString.split('&').forEach(function (val) { + var [name, value] = val.split('='); + query[name] = unescape(value); + }); + + var bodyStream = new BinaryInputStream(request.bodyInputStream); + var bodyBytes = []; + while ((bodyAvail = bodyStream.available()) > 0) + Array.prototype.push.apply(bodyBytes, bodyStream.readByteArray(bodyAvail)); + + var body = decodeURIComponent( + escape(String.fromCharCode.apply(null, bodyBytes))); + + var currentHop = query.hop ? parseInt(query.hop) : 0; + + var obj = JSON.parse(body); + if (currentHop < obj.hops) { + var newURL = '/tests/dom/serviceworkers/test/redirect_post.sjs?hop=' + + (1 + currentHop); + response.setStatusLine(null, 307, 'redirect'); + response.setHeader('Location', newURL); + return; + } + + response.setHeader('Content-Type', 'application/json'); + response.write(body); +} diff --git a/dom/serviceworkers/test/redirect_serviceworker.sjs b/dom/serviceworkers/test/redirect_serviceworker.sjs new file mode 100644 index 0000000000..19596158e4 --- /dev/null +++ b/dom/serviceworkers/test/redirect_serviceworker.sjs @@ -0,0 +1,4 @@ +function handleRequest(request, response) { + response.setStatusLine("1.1", 302, "Found"); + response.setHeader("Location", "http://mochi.test:8888/tests/dom/serviceworkers/test/worker.js"); +} diff --git a/dom/serviceworkers/test/register_https.html b/dom/serviceworkers/test/register_https.html new file mode 100644 index 0000000000..572c7ce6b8 --- /dev/null +++ b/dom/serviceworkers/test/register_https.html @@ -0,0 +1,15 @@ + + diff --git a/dom/serviceworkers/test/sanitize/example_check_and_unregister.html b/dom/serviceworkers/test/sanitize/example_check_and_unregister.html new file mode 100644 index 0000000000..8553e442d6 --- /dev/null +++ b/dom/serviceworkers/test/sanitize/example_check_and_unregister.html @@ -0,0 +1,22 @@ + + diff --git a/dom/serviceworkers/test/sanitize/frame.html b/dom/serviceworkers/test/sanitize/frame.html new file mode 100644 index 0000000000..b4bf7a1ff1 --- /dev/null +++ b/dom/serviceworkers/test/sanitize/frame.html @@ -0,0 +1,11 @@ + + diff --git a/dom/serviceworkers/test/sanitize/register.html b/dom/serviceworkers/test/sanitize/register.html new file mode 100644 index 0000000000..4ae74bec11 --- /dev/null +++ b/dom/serviceworkers/test/sanitize/register.html @@ -0,0 +1,9 @@ + + diff --git a/dom/serviceworkers/test/sanitize_worker.js b/dom/serviceworkers/test/sanitize_worker.js new file mode 100644 index 0000000000..efd25a3856 --- /dev/null +++ b/dom/serviceworkers/test/sanitize_worker.js @@ -0,0 +1,5 @@ +onfetch = function(e) { + if (e.request.url.includes("intercept-this")) { + e.respondWith(new Response("intercepted")); + } +}; diff --git a/dom/serviceworkers/test/scope/scope_worker.js b/dom/serviceworkers/test/scope/scope_worker.js new file mode 100644 index 0000000000..4164e7a244 --- /dev/null +++ b/dom/serviceworkers/test/scope/scope_worker.js @@ -0,0 +1,2 @@ +// This worker is used to test if calling register() without a scope argument +// leads to scope being relative to service worker script. diff --git a/dom/serviceworkers/test/script_file_upload.js b/dom/serviceworkers/test/script_file_upload.js new file mode 100644 index 0000000000..c97c804f76 --- /dev/null +++ b/dom/serviceworkers/test/script_file_upload.js @@ -0,0 +1,13 @@ +Cu.importGlobalProperties(["File"]); + +addMessageListener("file.open", function(e) { + var testFile = Cc["@mozilla.org/file/directory_service;1"] + .getService(Ci.nsIDirectoryService) + .QueryInterface(Ci.nsIProperties) + .get("ProfD", Ci.nsIFile); + testFile.append("prefs.js"); + + File.createFromNsIFile(testFile).then(function(file) { + sendAsyncMessage("file.opened", { file }); + }); +}); diff --git a/dom/serviceworkers/test/self_update_worker.sjs b/dom/serviceworkers/test/self_update_worker.sjs new file mode 100644 index 0000000000..f8f728d38a --- /dev/null +++ b/dom/serviceworkers/test/self_update_worker.sjs @@ -0,0 +1,43 @@ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ +"use strict"; + +const WORKER_BODY = ` +onactivate = function(event) { + let promise = clients.matchAll({includeUncontrolled: true}).then(function(clients) { + for (i = 0; i < clients.length; i++) { + clients[i].postMessage({version: version}); + } + }).then(function() { + return self.registration.update(); + }); + event.waitUntil(promise); +}; +`; + +function handleRequest(request, response) { + if (request.queryString == 'clearcounter') { + setState('count', "1"); + response.write("ok"); + return; + } + + let count = getState("count"); + if (count === "") { + count = 1; + } else { + count = parseInt(count); + } + + let worker = "var version = " + count + ";\n"; + worker = worker + WORKER_BODY; + + // This header is necessary for making this script able to be loaded. + response.setHeader("Content-Type", "application/javascript"); + + // If this is the first request, return the first source. + response.write(worker); + setState("count", "" + (count + 1)); +} + diff --git a/dom/serviceworkers/test/server_file_upload.sjs b/dom/serviceworkers/test/server_file_upload.sjs new file mode 100644 index 0000000000..f448cc27e9 --- /dev/null +++ b/dom/serviceworkers/test/server_file_upload.sjs @@ -0,0 +1,17 @@ +const CC = Components.Constructor; +const BinaryInputStream = CC("@mozilla.org/binaryinputstream;1", + "nsIBinaryInputStream", + "setInputStream"); +const BinaryOutputStream = CC("@mozilla.org/binaryoutputstream;1", + "nsIBinaryOutputStream", + "setOutputStream"); + +function handleRequest(request, response) { + var bodyStream = new BinaryInputStream(request.bodyInputStream); + var bodyBytes = []; + while ((bodyAvail = bodyStream.available()) > 0) + Array.prototype.push.apply(bodyBytes, bodyStream.readByteArray(bodyAvail)); + + var bos = new BinaryOutputStream(response.bodyOutputStream); + bos.writeByteArray(bodyBytes, bodyBytes.length); +} diff --git a/dom/serviceworkers/test/service_worker.js b/dom/serviceworkers/test/service_worker.js new file mode 100644 index 0000000000..432b943d8b --- /dev/null +++ b/dom/serviceworkers/test/service_worker.js @@ -0,0 +1,9 @@ +onmessage = function(e) { + self.clients.matchAll().then(function(res) { + if (!res.length) { + dump("Error: no clients are currently controlled.\n"); + return; + } + res[0].postMessage(indexedDB ? { available: true } : { available: false }); + }); +}; diff --git a/dom/serviceworkers/test/service_worker_client.html b/dom/serviceworkers/test/service_worker_client.html new file mode 100644 index 0000000000..c1c98eaabb --- /dev/null +++ b/dom/serviceworkers/test/service_worker_client.html @@ -0,0 +1,28 @@ + + + + +controlled page + + + + + + diff --git a/dom/serviceworkers/test/serviceworker.html b/dom/serviceworkers/test/serviceworker.html new file mode 100644 index 0000000000..11edd001a2 --- /dev/null +++ b/dom/serviceworkers/test/serviceworker.html @@ -0,0 +1,12 @@ + + + + + + + + This is a test page. + + diff --git a/dom/serviceworkers/test/serviceworker_not_sharedworker.js b/dom/serviceworkers/test/serviceworker_not_sharedworker.js new file mode 100644 index 0000000000..ef89fb01b4 --- /dev/null +++ b/dom/serviceworkers/test/serviceworker_not_sharedworker.js @@ -0,0 +1,20 @@ +function OnMessage(e) { + if (e.data.msg == "whoareyou") { + if ("ServiceWorker" in self) { + self.clients.matchAll().then(function(clients) { + clients[0].postMessage({ result: "serviceworker" }); + }); + } else { + port.postMessage({ result: "sharedworker" }); + } + } +} + +var port; +onconnect = function(e) { + port = e.ports[0]; + port.onmessage = OnMessage; + port.start(); +}; + +onmessage = OnMessage; diff --git a/dom/serviceworkers/test/serviceworker_wrapper.js b/dom/serviceworkers/test/serviceworker_wrapper.js new file mode 100644 index 0000000000..3c9d432708 --- /dev/null +++ b/dom/serviceworkers/test/serviceworker_wrapper.js @@ -0,0 +1,92 @@ +// Any copyright is dedicated to the Public Domain. +// http://creativecommons.org/publicdomain/zero/1.0/ +// +// ServiceWorker equivalent of worker_wrapper.js. + +var client; + +function ok(a, msg) { + dump("OK: " + !!a + " => " + a + ": " + msg + "\n"); + client.postMessage({ type: "status", status: !!a, msg: a + ": " + msg }); +} + +function is(a, b, msg) { + dump("IS: " + (a === b) + " => " + a + " | " + b + ": " + msg + "\n"); + client.postMessage({ + type: "status", + status: a === b, + msg: a + " === " + b + ": " + msg, + }); +} + +function workerTestArrayEquals(a, b) { + if (!Array.isArray(a) || !Array.isArray(b) || a.length != b.length) { + return false; + } + for (var i = 0, n = a.length; i < n; ++i) { + if (a[i] !== b[i]) { + return false; + } + } + return true; +} + +function workerTestDone() { + client.postMessage({ type: "finish" }); +} + +function workerTestGetHelperData(cb) { + addEventListener("message", function workerTestGetHelperDataCB(e) { + if (e.data.type !== "returnHelperData") { + return; + } + removeEventListener("message", workerTestGetHelperDataCB); + cb(e.data.result); + }); + client.postMessage({ + type: "getHelperData", + }); +} + +function workerTestGetStorageManager(cb) { + addEventListener("message", function workerTestGetStorageManagerCB(e) { + if (e.data.type !== "returnStorageManager") { + return; + } + removeEventListener("message", workerTestGetStorageManagerCB); + cb(e.data.result); + }); + client.postMessage({ + type: "getStorageManager", + }); +} + +var completeInstall; + +addEventListener("message", function workerWrapperOnMessage(e) { + removeEventListener("message", workerWrapperOnMessage); + var data = e.data; + self.clients.matchAll({ includeUncontrolled: true }).then(function(clients) { + for (var i = 0; i < clients.length; ++i) { + if (clients[i].url.includes("message_receiver.html")) { + client = clients[i]; + break; + } + } + try { + importScripts(data.script); + } catch (ex) { + client.postMessage({ + type: "status", + status: false, + msg: + "worker failed to import " + data.script + "; error: " + ex.message, + }); + } + completeInstall(); + }); +}); + +addEventListener("install", e => { + e.waitUntil(new Promise(resolve => (completeInstall = resolve))); +}); diff --git a/dom/serviceworkers/test/serviceworkerinfo_iframe.html b/dom/serviceworkers/test/serviceworkerinfo_iframe.html new file mode 100644 index 0000000000..24103d1757 --- /dev/null +++ b/dom/serviceworkers/test/serviceworkerinfo_iframe.html @@ -0,0 +1,27 @@ + + + + + + + + This is a test page. + + diff --git a/dom/serviceworkers/test/serviceworkermanager_iframe.html b/dom/serviceworkers/test/serviceworkermanager_iframe.html new file mode 100644 index 0000000000..4ea21010cb --- /dev/null +++ b/dom/serviceworkers/test/serviceworkermanager_iframe.html @@ -0,0 +1,34 @@ + + + + + + + + This is a test page. + + diff --git a/dom/serviceworkers/test/serviceworkerregistrationinfo_iframe.html b/dom/serviceworkers/test/serviceworkerregistrationinfo_iframe.html new file mode 100644 index 0000000000..8f382cf0dc --- /dev/null +++ b/dom/serviceworkers/test/serviceworkerregistrationinfo_iframe.html @@ -0,0 +1,30 @@ + + + + + + + + This is a test page. + + diff --git a/dom/serviceworkers/test/sharedWorker_fetch.js b/dom/serviceworkers/test/sharedWorker_fetch.js new file mode 100644 index 0000000000..b0a72674d4 --- /dev/null +++ b/dom/serviceworkers/test/sharedWorker_fetch.js @@ -0,0 +1,30 @@ +var clients = new Array(); +clients.length = 0; + +var broadcast = function(message) { + var length = clients.length; + for (var i = 0; i < length; i++) { + port = clients[i]; + port.postMessage(message); + } +}; + +onconnect = function(e) { + clients.push(e.ports[0]); + if (clients.length == 1) { + clients[0].postMessage("Connected"); + } else if (clients.length == 2) { + broadcast("BothConnected"); + clients[0].onmessage = function(msg) { + if (msg.data == "StartFetchWithWrongIntegrity") { + // The fetch will succeed because the integrity value is invalid and we + // are looking for the console message regarding the bad integrity value. + fetch("SharedWorker_SRIFailed.html", { integrity: "abc" }).then( + function() { + clients[0].postMessage("SRI_failed"); + } + ); + } + }; + } +}; diff --git a/dom/serviceworkers/test/simpleregister/index.html b/dom/serviceworkers/test/simpleregister/index.html new file mode 100644 index 0000000000..f258809c57 --- /dev/null +++ b/dom/serviceworkers/test/simpleregister/index.html @@ -0,0 +1,51 @@ + + + + + + diff --git a/dom/serviceworkers/test/simpleregister/ready.html b/dom/serviceworkers/test/simpleregister/ready.html new file mode 100644 index 0000000000..6bc163e5f4 --- /dev/null +++ b/dom/serviceworkers/test/simpleregister/ready.html @@ -0,0 +1,14 @@ + + + + + + diff --git a/dom/serviceworkers/test/skip_waiting_installed_worker.js b/dom/serviceworkers/test/skip_waiting_installed_worker.js new file mode 100644 index 0000000000..a142576b9d --- /dev/null +++ b/dom/serviceworkers/test/skip_waiting_installed_worker.js @@ -0,0 +1,6 @@ +/* Any copyright is dedicated to the Public Domain. + * http://creativecommons.org/publicdomain/zero/1.0/ */ + +self.addEventListener("install", evt => { + evt.waitUntil(self.skipWaiting()); +}); diff --git a/dom/serviceworkers/test/skip_waiting_scope/index.html b/dom/serviceworkers/test/skip_waiting_scope/index.html new file mode 100644 index 0000000000..2b480d8707 --- /dev/null +++ b/dom/serviceworkers/test/skip_waiting_scope/index.html @@ -0,0 +1,33 @@ + + + + + Bug 1131352 - Add ServiceWorkerGlobalScope skipWaiting() + + + + +

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/source_message_posting_worker.js b/dom/serviceworkers/test/source_message_posting_worker.js
new file mode 100644
index 0000000000..e48c005294
--- /dev/null
+++ b/dom/serviceworkers/test/source_message_posting_worker.js
@@ -0,0 +1,16 @@
+onmessage = function(e) {
+  if (!e.source) {
+    dump("ERROR: message doesn't have a source.");
+  }
+
+  if (!(e instanceof ExtendableMessageEvent)) {
+    e.source.postMessage("ERROR. event is not an extendable message event.");
+  }
+
+  // The client should be a window client
+  if (e.source instanceof WindowClient) {
+    e.source.postMessage(e.data);
+  } else {
+    e.source.postMessage("ERROR. source is not a window client.");
+  }
+};
diff --git a/dom/serviceworkers/test/storage_recovery_worker.sjs b/dom/serviceworkers/test/storage_recovery_worker.sjs
new file mode 100644
index 0000000000..9c9ce6a8d7
--- /dev/null
+++ b/dom/serviceworkers/test/storage_recovery_worker.sjs
@@ -0,0 +1,23 @@
+const BASE_URI = "http://mochi.test:8888/browser/dom/serviceworkers/test/";
+
+function handleRequest(request, response) {
+  let redirect = getState("redirect");
+  setState("redirect", "false");
+
+  if (request.queryString.includes("set-redirect")) {
+    setState("redirect", "true");
+  } else if (request.queryString.includes("clear-redirect")) {
+    setState("redirect", "false");
+  }
+
+  response.setHeader("Cache-Control", "no-store");
+
+  if (redirect === "true") {
+    response.setStatusLine(request.httpVersion, 307, "Moved Temporarily");
+    response.setHeader("Location", BASE_URI + "empty.js");
+    return;
+  }
+
+  response.setHeader("Content-Type", "application/javascript");
+  response.write("");
+}
diff --git a/dom/serviceworkers/test/streamfilter_server.sjs b/dom/serviceworkers/test/streamfilter_server.sjs
new file mode 100644
index 0000000000..0e5a62d1dd
--- /dev/null
+++ b/dom/serviceworkers/test/streamfilter_server.sjs
@@ -0,0 +1,9 @@
+Components.utils.importGlobalProperties(["URLSearchParams"]);
+
+function handleRequest(request, response) {
+  const searchParams = new URLSearchParams(request.queryString);
+
+  if (searchParams.get("syntheticResponse") === "0") {
+    response.write(String(searchParams));
+  }
+}
diff --git a/dom/serviceworkers/test/streamfilter_worker.js b/dom/serviceworkers/test/streamfilter_worker.js
new file mode 100644
index 0000000000..03a0f0a933
--- /dev/null
+++ b/dom/serviceworkers/test/streamfilter_worker.js
@@ -0,0 +1,9 @@
+onactivate = e => e.waitUntil(clients.claim());
+
+onfetch = e => {
+  const searchParams = new URL(e.request.url).searchParams;
+
+  if (searchParams.get("syntheticResponse") === "1") {
+    e.respondWith(new Response(String(searchParams)));
+  }
+};
diff --git a/dom/serviceworkers/test/strict_mode_warning.js b/dom/serviceworkers/test/strict_mode_warning.js
new file mode 100644
index 0000000000..38418de3d8
--- /dev/null
+++ b/dom/serviceworkers/test/strict_mode_warning.js
@@ -0,0 +1,4 @@
+function f() {
+  return 1;
+  return 2;
+}
diff --git a/dom/serviceworkers/test/sw_bad_mime_type.js b/dom/serviceworkers/test/sw_bad_mime_type.js
new file mode 100644
index 0000000000..f371807db9
--- /dev/null
+++ b/dom/serviceworkers/test/sw_bad_mime_type.js
@@ -0,0 +1 @@
+// I need some contents.
diff --git a/dom/serviceworkers/test/sw_bad_mime_type.js^headers^ b/dom/serviceworkers/test/sw_bad_mime_type.js^headers^
new file mode 100644
index 0000000000..a1f9e38d90
--- /dev/null
+++ b/dom/serviceworkers/test/sw_bad_mime_type.js^headers^
@@ -0,0 +1 @@
+Content-Type: text/plain
diff --git a/dom/serviceworkers/test/sw_clients/file_blob_upload_frame.html b/dom/serviceworkers/test/sw_clients/file_blob_upload_frame.html
new file mode 100644
index 0000000000..ff9803622a
--- /dev/null
+++ b/dom/serviceworkers/test/sw_clients/file_blob_upload_frame.html
@@ -0,0 +1,76 @@
+
+
+
+
+  test file blob upload with SW interception
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/sw_clients/navigator.html b/dom/serviceworkers/test/sw_clients/navigator.html
new file mode 100644
index 0000000000..16a4fe9189
--- /dev/null
+++ b/dom/serviceworkers/test/sw_clients/navigator.html
@@ -0,0 +1,34 @@
+
+
+
+
+  Bug 982726 - test match_all not crashing
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/sw_clients/refresher.html b/dom/serviceworkers/test/sw_clients/refresher.html
new file mode 100644
index 0000000000..b3c6e00152
--- /dev/null
+++ b/dom/serviceworkers/test/sw_clients/refresher.html
@@ -0,0 +1,38 @@
+
+
+
+
+  Bug 982726 - test match_all not crashing
+  
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/sw_clients/refresher_cached.html b/dom/serviceworkers/test/sw_clients/refresher_cached.html
new file mode 100644
index 0000000000..4a91e46e99
--- /dev/null
+++ b/dom/serviceworkers/test/sw_clients/refresher_cached.html
@@ -0,0 +1,37 @@
+
+
+
+
+  Bug 982726 - test match_all not crashing
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/sw_clients/refresher_cached_compressed.html b/dom/serviceworkers/test/sw_clients/refresher_cached_compressed.html
new file mode 100644
index 0000000000..6b6a328211
Binary files /dev/null and b/dom/serviceworkers/test/sw_clients/refresher_cached_compressed.html differ
diff --git a/dom/serviceworkers/test/sw_clients/refresher_cached_compressed.html^headers^ b/dom/serviceworkers/test/sw_clients/refresher_cached_compressed.html^headers^
new file mode 100644
index 0000000000..4204d8601d
--- /dev/null
+++ b/dom/serviceworkers/test/sw_clients/refresher_cached_compressed.html^headers^
@@ -0,0 +1,2 @@
+Content-Type: text/html
+Content-Encoding: gzip
diff --git a/dom/serviceworkers/test/sw_clients/refresher_compressed.html b/dom/serviceworkers/test/sw_clients/refresher_compressed.html
new file mode 100644
index 0000000000..e0861a5180
Binary files /dev/null and b/dom/serviceworkers/test/sw_clients/refresher_compressed.html differ
diff --git a/dom/serviceworkers/test/sw_clients/refresher_compressed.html^headers^ b/dom/serviceworkers/test/sw_clients/refresher_compressed.html^headers^
new file mode 100644
index 0000000000..4204d8601d
--- /dev/null
+++ b/dom/serviceworkers/test/sw_clients/refresher_compressed.html^headers^
@@ -0,0 +1,2 @@
+Content-Type: text/html
+Content-Encoding: gzip
diff --git a/dom/serviceworkers/test/sw_clients/service_worker_controlled.html b/dom/serviceworkers/test/sw_clients/service_worker_controlled.html
new file mode 100644
index 0000000000..e0d7bce573
--- /dev/null
+++ b/dom/serviceworkers/test/sw_clients/service_worker_controlled.html
@@ -0,0 +1,38 @@
+
+
+
+
+  controlled page
+  
+
+
+
+
+
+
diff --git a/dom/serviceworkers/test/sw_clients/simple.html b/dom/serviceworkers/test/sw_clients/simple.html
new file mode 100644
index 0000000000..bbe6782e2a
--- /dev/null
+++ b/dom/serviceworkers/test/sw_clients/simple.html
@@ -0,0 +1,29 @@
+
+
+
+
+  Bug 982726 - test match_all not crashing
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/sw_file_upload.js b/dom/serviceworkers/test/sw_file_upload.js
new file mode 100644
index 0000000000..c35269924b
--- /dev/null
+++ b/dom/serviceworkers/test/sw_file_upload.js
@@ -0,0 +1,16 @@
+self.skipWaiting();
+
+addEventListener("fetch", event => {
+  const url = new URL(event.request.url);
+  const params = new URLSearchParams(url.search);
+
+  if (params.get("clone") === "1") {
+    event.respondWith(fetch(event.request.clone()));
+  } else {
+    event.respondWith(fetch(event.request));
+  }
+});
+
+addEventListener("activate", function(event) {
+  event.waitUntil(clients.claim());
+});
diff --git a/dom/serviceworkers/test/sw_storage_not_allow.js b/dom/serviceworkers/test/sw_storage_not_allow.js
new file mode 100644
index 0000000000..c0bd782326
--- /dev/null
+++ b/dom/serviceworkers/test/sw_storage_not_allow.js
@@ -0,0 +1,33 @@
+let clientId;
+addEventListener("fetch", function(event) {
+  event.respondWith(
+    (async function() {
+      if (event.request.url.includes("getClients")) {
+        // Expected to fail since the storage access is not allowed.
+        try {
+          await self.clients.matchAll();
+        } catch (e) {
+          // expected failure
+        }
+      } else if (event.request.url.includes("getClient-stage1")) {
+        let clients = await self.clients.matchAll();
+        clientId = clients[0].id;
+      } else if (event.request.url.includes("getClient-stage2")) {
+        // Expected to fail since the storage access is not allowed.
+        try {
+          await self.clients.get(clientId);
+        } catch (e) {
+          // expected failure
+        }
+      }
+
+      // Pass through the network request once our various Clients API
+      // promises have completed.
+      return await fetch(event.request);
+    })()
+  );
+});
+
+addEventListener("activate", function(event) {
+  event.waitUntil(clients.claim());
+});
diff --git a/dom/serviceworkers/test/swa/worker_scope_different.js b/dom/serviceworkers/test/swa/worker_scope_different.js
new file mode 100644
index 0000000000..e69de29bb2
diff --git a/dom/serviceworkers/test/swa/worker_scope_different.js^headers^ b/dom/serviceworkers/test/swa/worker_scope_different.js^headers^
new file mode 100644
index 0000000000..e85a7f09de
--- /dev/null
+++ b/dom/serviceworkers/test/swa/worker_scope_different.js^headers^
@@ -0,0 +1 @@
+Service-Worker-Allowed: different/path
diff --git a/dom/serviceworkers/test/swa/worker_scope_different2.js b/dom/serviceworkers/test/swa/worker_scope_different2.js
new file mode 100644
index 0000000000..e69de29bb2
diff --git a/dom/serviceworkers/test/swa/worker_scope_different2.js^headers^ b/dom/serviceworkers/test/swa/worker_scope_different2.js^headers^
new file mode 100644
index 0000000000..e37307d666
--- /dev/null
+++ b/dom/serviceworkers/test/swa/worker_scope_different2.js^headers^
@@ -0,0 +1 @@
+Service-Worker-Allowed: /different/path
diff --git a/dom/serviceworkers/test/swa/worker_scope_precise.js b/dom/serviceworkers/test/swa/worker_scope_precise.js
new file mode 100644
index 0000000000..e69de29bb2
diff --git a/dom/serviceworkers/test/swa/worker_scope_precise.js^headers^ b/dom/serviceworkers/test/swa/worker_scope_precise.js^headers^
new file mode 100644
index 0000000000..7488cafbb0
--- /dev/null
+++ b/dom/serviceworkers/test/swa/worker_scope_precise.js^headers^
@@ -0,0 +1 @@
+Service-Worker-Allowed: /tests/dom/serviceworkers/test/swa
diff --git a/dom/serviceworkers/test/swa/worker_scope_too_deep.js b/dom/serviceworkers/test/swa/worker_scope_too_deep.js
new file mode 100644
index 0000000000..e69de29bb2
diff --git a/dom/serviceworkers/test/swa/worker_scope_too_deep.js^headers^ b/dom/serviceworkers/test/swa/worker_scope_too_deep.js^headers^
new file mode 100644
index 0000000000..9a66c3d153
--- /dev/null
+++ b/dom/serviceworkers/test/swa/worker_scope_too_deep.js^headers^
@@ -0,0 +1 @@
+Service-Worker-Allowed: /tests/dom/serviceworkers/test/swa/deep/way/too/specific
diff --git a/dom/serviceworkers/test/swa/worker_scope_too_narrow.js b/dom/serviceworkers/test/swa/worker_scope_too_narrow.js
new file mode 100644
index 0000000000..e69de29bb2
diff --git a/dom/serviceworkers/test/swa/worker_scope_too_narrow.js^headers^ b/dom/serviceworkers/test/swa/worker_scope_too_narrow.js^headers^
new file mode 100644
index 0000000000..407361a3c7
--- /dev/null
+++ b/dom/serviceworkers/test/swa/worker_scope_too_narrow.js^headers^
@@ -0,0 +1 @@
+Service-Worker-Allowed: /tests/dom/serviceworkers
diff --git a/dom/serviceworkers/test/test_abrupt_completion.html b/dom/serviceworkers/test/test_abrupt_completion.html
new file mode 100644
index 0000000000..d0060e4330
--- /dev/null
+++ b/dom/serviceworkers/test/test_abrupt_completion.html
@@ -0,0 +1,146 @@
+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_async_waituntil.html b/dom/serviceworkers/test/test_async_waituntil.html
new file mode 100644
index 0000000000..8c15eb2b11
--- /dev/null
+++ b/dom/serviceworkers/test/test_async_waituntil.html
@@ -0,0 +1,91 @@
+
+
+
+
+  Test for Bug 1263304
+  
+  
+  
+  
+
+Mozilla Bug 1263304
+

+ +
+
+ + + + + diff --git a/dom/serviceworkers/test/test_bad_script_cache.html b/dom/serviceworkers/test/test_bad_script_cache.html new file mode 100644 index 0000000000..7919802678 --- /dev/null +++ b/dom/serviceworkers/test/test_bad_script_cache.html @@ -0,0 +1,96 @@ + + + + + Test updating a service worker with a bad script cache. + + + + + + + + + diff --git a/dom/serviceworkers/test/test_bug1151916.html b/dom/serviceworkers/test/test_bug1151916.html new file mode 100644 index 0000000000..b541129ccb --- /dev/null +++ b/dom/serviceworkers/test/test_bug1151916.html @@ -0,0 +1,104 @@ + + + + + Bug 1151916 - Test principal is set on cached serviceworkers + + + + + +

+
+

+
+
+
+
diff --git a/dom/serviceworkers/test/test_bug1240436.html b/dom/serviceworkers/test/test_bug1240436.html
new file mode 100644
index 0000000000..8b76ada6a8
--- /dev/null
+++ b/dom/serviceworkers/test/test_bug1240436.html
@@ -0,0 +1,34 @@
+
+
+
+
+  Test for encoding of service workers
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_bug1408734.html b/dom/serviceworkers/test/test_bug1408734.html
new file mode 100644
index 0000000000..27559e695f
--- /dev/null
+++ b/dom/serviceworkers/test/test_bug1408734.html
@@ -0,0 +1,52 @@
+
+
+
+
+  Bug 1408734
+  
+  
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_claim.html b/dom/serviceworkers/test/test_claim.html
new file mode 100644
index 0000000000..e72f1173e8
--- /dev/null
+++ b/dom/serviceworkers/test/test_claim.html
@@ -0,0 +1,171 @@
+
+
+
+
+  Bug 1130684 - Test service worker clients claim onactivate 
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_claim_oninstall.html b/dom/serviceworkers/test/test_claim_oninstall.html
new file mode 100644
index 0000000000..54933405ce
--- /dev/null
+++ b/dom/serviceworkers/test/test_claim_oninstall.html
@@ -0,0 +1,77 @@
+
+
+
+
+  Bug 1130684 - Test service worker clients.claim oninstall
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_client_focus.html b/dom/serviceworkers/test/test_client_focus.html
new file mode 100644
index 0000000000..0764ff28e4
--- /dev/null
+++ b/dom/serviceworkers/test/test_client_focus.html
@@ -0,0 +1,99 @@
+
+
+
+
+  Bug 1130686 - Test service worker client.focus 
+  
+  
+
+
+
+

+
+

+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_controller.html b/dom/serviceworkers/test/test_controller.html
new file mode 100644
index 0000000000..c0e220a36e
--- /dev/null
+++ b/dom/serviceworkers/test/test_controller.html
@@ -0,0 +1,83 @@
+
+
+
+
+  Bug 1002570 - test controller instance.
+  
+  
+
+
+

+ +

+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_cookie_fetch.html b/dom/serviceworkers/test/test_cookie_fetch.html
new file mode 100644
index 0000000000..6ae407b1ff
--- /dev/null
+++ b/dom/serviceworkers/test/test_cookie_fetch.html
@@ -0,0 +1,61 @@
+
+
+
+
+  Bug 1331680 - test access to cookies in the documents synthesized from service worker responses
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_cross_origin_url_after_redirect.html b/dom/serviceworkers/test/test_cross_origin_url_after_redirect.html
new file mode 100644
index 0000000000..bfd4f700be
--- /dev/null
+++ b/dom/serviceworkers/test/test_cross_origin_url_after_redirect.html
@@ -0,0 +1,50 @@
+
+
+
+
+  Test access to a cross origin Request.url property from a service worker for a redirected intercepted iframe
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_csp_upgrade-insecure_intercept.html b/dom/serviceworkers/test/test_csp_upgrade-insecure_intercept.html
new file mode 100644
index 0000000000..b5ddbb97b6
--- /dev/null
+++ b/dom/serviceworkers/test/test_csp_upgrade-insecure_intercept.html
@@ -0,0 +1,55 @@
+
+
+
+
+  Test that a CSP upgraded request can be intercepted by a service worker
+  
+  
+
+
+

+
+ +
+

+
+
+
+
diff --git a/dom/serviceworkers/test/test_devtools_bypass_serviceworker.html b/dom/serviceworkers/test/test_devtools_bypass_serviceworker.html
new file mode 100644
index 0000000000..09c05d557a
--- /dev/null
+++ b/dom/serviceworkers/test/test_devtools_bypass_serviceworker.html
@@ -0,0 +1,107 @@
+
+
+
+   Verify devtools can utilize nsIChannel::LOAD_BYPASS_SERVICE_WORKER to bypass the service worker 
+  
+  
+  
+  
+
+
+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_devtools_track_serviceworker_time.html b/dom/serviceworkers/test/test_devtools_track_serviceworker_time.html
new file mode 100644
index 0000000000..2944a814f3
--- /dev/null
+++ b/dom/serviceworkers/test/test_devtools_track_serviceworker_time.html
@@ -0,0 +1,230 @@
+
+
+  Bug 1251238 - track service worker install time
+  
+  
+
+
+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_empty_serviceworker.html b/dom/serviceworkers/test/test_empty_serviceworker.html
new file mode 100644
index 0000000000..00b77939f8
--- /dev/null
+++ b/dom/serviceworkers/test/test_empty_serviceworker.html
@@ -0,0 +1,46 @@
+
+
+
+
+  Test that registering an empty service worker works
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_error_reporting.html b/dom/serviceworkers/test/test_error_reporting.html
new file mode 100644
index 0000000000..8450d7d20a
--- /dev/null
+++ b/dom/serviceworkers/test/test_error_reporting.html
@@ -0,0 +1,247 @@
+
+
+
+  Test Error Reporting of Service Worker Failures
+  
+  
+  
+  
+  
+
+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_escapedSlashes.html b/dom/serviceworkers/test/test_escapedSlashes.html
new file mode 100644
index 0000000000..001c660242
--- /dev/null
+++ b/dom/serviceworkers/test/test_escapedSlashes.html
@@ -0,0 +1,102 @@
+
+
+
+
+  Test for escaped slashes in navigator.serviceWorker.register
+  
+  
+  
+
+
+

+ +

+
+
+
diff --git a/dom/serviceworkers/test/test_eval_allowed.html b/dom/serviceworkers/test/test_eval_allowed.html
new file mode 100644
index 0000000000..5d6d7a7d9c
--- /dev/null
+++ b/dom/serviceworkers/test/test_eval_allowed.html
@@ -0,0 +1,51 @@
+
+
+
+
+  Bug 1160458 - CSP activated by default in Service Workers
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_eval_allowed.html^headers^ b/dom/serviceworkers/test/test_eval_allowed.html^headers^
new file mode 100644
index 0000000000..51ffaa71dd
--- /dev/null
+++ b/dom/serviceworkers/test/test_eval_allowed.html^headers^
@@ -0,0 +1 @@
+Content-Security-Policy: "default-src 'self'; script-src 'self' 'unsafe-inline'; style-src 'self' 'unsafe-inline'; img-src 'self'"
diff --git a/dom/serviceworkers/test/test_event_listener_leaks.html b/dom/serviceworkers/test/test_event_listener_leaks.html
new file mode 100644
index 0000000000..33ffeb44c4
--- /dev/null
+++ b/dom/serviceworkers/test/test_event_listener_leaks.html
@@ -0,0 +1,63 @@
+
+
+
+
+  Bug 1447871 - Test some service worker leak conditions
+  
+  
+  
+  
+
+
+

+ + + + diff --git a/dom/serviceworkers/test/test_eventsource_intercept.html b/dom/serviceworkers/test/test_eventsource_intercept.html new file mode 100644 index 0000000000..b76c0d1d1a --- /dev/null +++ b/dom/serviceworkers/test/test_eventsource_intercept.html @@ -0,0 +1,103 @@ + + + + + Bug 1182103 - Test EventSource scenarios with fetch interception + + + + +

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_fetch_event.html b/dom/serviceworkers/test/test_fetch_event.html
new file mode 100644
index 0000000000..71537a034c
--- /dev/null
+++ b/dom/serviceworkers/test/test_fetch_event.html
@@ -0,0 +1,76 @@
+
+
+
+
+  Bug 94048 - test install event.
+  
+  
+
+
+

+ +

+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_fetch_event_with_thirdpartypref.html b/dom/serviceworkers/test/test_fetch_event_with_thirdpartypref.html
new file mode 100644
index 0000000000..7ab08af9e4
--- /dev/null
+++ b/dom/serviceworkers/test/test_fetch_event_with_thirdpartypref.html
@@ -0,0 +1,91 @@
+
+
+
+
+  Bug 94048 - test install event.
+  
+  
+
+
+

+ +

+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_fetch_integrity.html b/dom/serviceworkers/test/test_fetch_integrity.html
new file mode 100644
index 0000000000..da2ffd2c6f
--- /dev/null
+++ b/dom/serviceworkers/test/test_fetch_integrity.html
@@ -0,0 +1,228 @@
+
+
+
+   Test fetch.integrity on console report for serviceWorker and sharedWorker 
+  
+  
+  
+  
+
+
+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_file_blob_response.html b/dom/serviceworkers/test/test_file_blob_response.html
new file mode 100644
index 0000000000..3aa72c3dda
--- /dev/null
+++ b/dom/serviceworkers/test/test_file_blob_response.html
@@ -0,0 +1,78 @@
+
+
+
+
+  Bug 1253777 - Test interception using file blob response body
+  
+  
+
+
+

+ +

+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_file_blob_upload.html b/dom/serviceworkers/test/test_file_blob_upload.html
new file mode 100644
index 0000000000..e60e65badd
--- /dev/null
+++ b/dom/serviceworkers/test/test_file_blob_upload.html
@@ -0,0 +1,146 @@
+
+
+
+
+  Bug 1203680 - Test interception of file blob uploads
+  
+  
+
+
+

+ +

+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_file_upload.html b/dom/serviceworkers/test/test_file_upload.html
new file mode 100644
index 0000000000..1fd07d7308
--- /dev/null
+++ b/dom/serviceworkers/test/test_file_upload.html
@@ -0,0 +1,68 @@
+
+
+
+
+  Bug 1424701 - Test for service worker + file upload
+  
+  
+  
+
+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_force_refresh.html b/dom/serviceworkers/test/test_force_refresh.html
new file mode 100644
index 0000000000..69da7b7de3
--- /dev/null
+++ b/dom/serviceworkers/test/test_force_refresh.html
@@ -0,0 +1,105 @@
+
+
+
+
+  Bug 982726 - Test service worker post message 
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_gzip_redirect.html b/dom/serviceworkers/test/test_gzip_redirect.html
new file mode 100644
index 0000000000..8119303ae7
--- /dev/null
+++ b/dom/serviceworkers/test/test_gzip_redirect.html
@@ -0,0 +1,88 @@
+
+
+
+
+  Bug 982726 - Test service worker post message 
+  
+  
+
+
+

+ +

+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_hsts_upgrade_intercept.html b/dom/serviceworkers/test/test_hsts_upgrade_intercept.html
new file mode 100644
index 0000000000..59fef0ec14
--- /dev/null
+++ b/dom/serviceworkers/test/test_hsts_upgrade_intercept.html
@@ -0,0 +1,66 @@
+
+
+
+
+  Test that an HSTS upgraded request can be intercepted by a service worker
+  
+  
+
+
+

+
+ +
+

+
+
+
+
diff --git a/dom/serviceworkers/test/test_https_fetch.html b/dom/serviceworkers/test/test_https_fetch.html
new file mode 100644
index 0000000000..4ac4255889
--- /dev/null
+++ b/dom/serviceworkers/test/test_https_fetch.html
@@ -0,0 +1,62 @@
+
+
+
+
+  Bug 1133763 - test fetch event in HTTPS origins
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_https_fetch_cloned_response.html b/dom/serviceworkers/test/test_https_fetch_cloned_response.html
new file mode 100644
index 0000000000..8c7129d39d
--- /dev/null
+++ b/dom/serviceworkers/test/test_https_fetch_cloned_response.html
@@ -0,0 +1,56 @@
+
+
+
+
+  Bug 1133763 - test fetch event in HTTPS origins with a cloned response
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_https_origin_after_redirect.html b/dom/serviceworkers/test/test_https_origin_after_redirect.html
new file mode 100644
index 0000000000..31ce173f34
--- /dev/null
+++ b/dom/serviceworkers/test/test_https_origin_after_redirect.html
@@ -0,0 +1,57 @@
+
+
+
+
+  Test the origin of a redirected response from a service worker
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_https_origin_after_redirect_cached.html b/dom/serviceworkers/test/test_https_origin_after_redirect_cached.html
new file mode 100644
index 0000000000..8bce413f21
--- /dev/null
+++ b/dom/serviceworkers/test/test_https_origin_after_redirect_cached.html
@@ -0,0 +1,57 @@
+
+
+
+
+  Test the origin of a redirected response from a service worker
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_https_synth_fetch_from_cached_sw.html b/dom/serviceworkers/test/test_https_synth_fetch_from_cached_sw.html
new file mode 100644
index 0000000000..4186cfc340
--- /dev/null
+++ b/dom/serviceworkers/test/test_https_synth_fetch_from_cached_sw.html
@@ -0,0 +1,69 @@
+
+
+
+
+  Bug 1156847 - test fetch event generating a synthesized response in HTTPS origins from a cached SW
+  
+  
+
+
+

+
+ +
+

+
+
+
+
diff --git a/dom/serviceworkers/test/test_imagecache.html b/dom/serviceworkers/test/test_imagecache.html
new file mode 100644
index 0000000000..52a793bfb9
--- /dev/null
+++ b/dom/serviceworkers/test/test_imagecache.html
@@ -0,0 +1,55 @@
+
+
+
+
+  Bug 1202085 - Test that images from different controllers don't cached together
+  
+  
+
+
+

+
+ +
+

+
+
+
+
diff --git a/dom/serviceworkers/test/test_imagecache_max_age.html b/dom/serviceworkers/test/test_imagecache_max_age.html
new file mode 100644
index 0000000000..fcb8d3e306
--- /dev/null
+++ b/dom/serviceworkers/test/test_imagecache_max_age.html
@@ -0,0 +1,71 @@
+
+
+
+
+  Test that the image cache respects a synthesized image's Cache headers
+  
+  
+
+
+

+
+ +
+

+
+
+
+
diff --git a/dom/serviceworkers/test/test_importscript.html b/dom/serviceworkers/test/test_importscript.html
new file mode 100644
index 0000000000..c0a894cf3c
--- /dev/null
+++ b/dom/serviceworkers/test/test_importscript.html
@@ -0,0 +1,74 @@
+
+
+
+
+  Test service worker - script cache policy
+  
+  
+
+
+
+ + + + + diff --git a/dom/serviceworkers/test/test_importscript_mixedcontent.html b/dom/serviceworkers/test/test_importscript_mixedcontent.html new file mode 100644 index 0000000000..15fe5e88b6 --- /dev/null +++ b/dom/serviceworkers/test/test_importscript_mixedcontent.html @@ -0,0 +1,53 @@ + + + + + Bug 1198078 - test that we respect mixed content blocking in importScript() inside service workers + + + + +

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_install_event.html b/dom/serviceworkers/test/test_install_event.html
new file mode 100644
index 0000000000..87f89725dc
--- /dev/null
+++ b/dom/serviceworkers/test/test_install_event.html
@@ -0,0 +1,143 @@
+
+
+
+
+  Bug 94048 - test install event.
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_install_event_gc.html b/dom/serviceworkers/test/test_install_event_gc.html
new file mode 100644
index 0000000000..8b68b8ac47
--- /dev/null
+++ b/dom/serviceworkers/test/test_install_event_gc.html
@@ -0,0 +1,121 @@
+
+
+
+
+  Test install event being GC'd before waitUntil fulfills
+  
+  
+
+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_installation_simple.html b/dom/serviceworkers/test/test_installation_simple.html
new file mode 100644
index 0000000000..db94b0096f
--- /dev/null
+++ b/dom/serviceworkers/test/test_installation_simple.html
@@ -0,0 +1,208 @@
+
+
+
+
+  Bug 930348 - test stub Navigator ServiceWorker utilities.
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_match_all.html b/dom/serviceworkers/test/test_match_all.html
new file mode 100644
index 0000000000..a1ee01507c
--- /dev/null
+++ b/dom/serviceworkers/test/test_match_all.html
@@ -0,0 +1,83 @@
+
+
+
+
+  Bug 982726 - test match_all not crashing
+  
+  
+
+
+

+ +

+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_match_all_advanced.html b/dom/serviceworkers/test/test_match_all_advanced.html
new file mode 100644
index 0000000000..b4359511f3
--- /dev/null
+++ b/dom/serviceworkers/test/test_match_all_advanced.html
@@ -0,0 +1,102 @@
+
+
+
+
+  Bug 982726 - Test matchAll with multiple clients
+  
+  
+
+
+

+ +

+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_match_all_client_id.html b/dom/serviceworkers/test/test_match_all_client_id.html
new file mode 100644
index 0000000000..0294c00aba
--- /dev/null
+++ b/dom/serviceworkers/test/test_match_all_client_id.html
@@ -0,0 +1,95 @@
+
+
+
+
+  Bug 1058311 - Test matchAll client id 
+  
+  
+
+
+

+ +

+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_match_all_client_properties.html b/dom/serviceworkers/test/test_match_all_client_properties.html
new file mode 100644
index 0000000000..c8a0b448c2
--- /dev/null
+++ b/dom/serviceworkers/test/test_match_all_client_properties.html
@@ -0,0 +1,101 @@
+
+
+
+
+  Bug 1058311 - Test matchAll clients properties 
+  
+  
+
+
+

+ +

+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_navigator.html b/dom/serviceworkers/test/test_navigator.html
new file mode 100644
index 0000000000..aaac04e926
--- /dev/null
+++ b/dom/serviceworkers/test/test_navigator.html
@@ -0,0 +1,40 @@
+
+
+
+
+  Bug 930348 - test stub Navigator ServiceWorker utilities.
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_nofetch_handler.html b/dom/serviceworkers/test/test_nofetch_handler.html
new file mode 100644
index 0000000000..0725a68561
--- /dev/null
+++ b/dom/serviceworkers/test/test_nofetch_handler.html
@@ -0,0 +1,57 @@
+
+
+
+  Test for Bugs 1181127 and 1325101
+  
+  
+  
+  
+
+Mozilla Bug 1181127
+Mozilla Bug 1325101
+

+ +
+
+ + + + + diff --git a/dom/serviceworkers/test/test_not_intercept_plugin.html b/dom/serviceworkers/test/test_not_intercept_plugin.html new file mode 100644 index 0000000000..4e7654deea --- /dev/null +++ b/dom/serviceworkers/test/test_not_intercept_plugin.html @@ -0,0 +1,75 @@ + + + + + Bug 1187766 - Test loading plugins scenarios with fetch interception. + + + + +

+ +

+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_notification_constructor_error.html b/dom/serviceworkers/test/test_notification_constructor_error.html
new file mode 100644
index 0000000000..46d93e781f
--- /dev/null
+++ b/dom/serviceworkers/test/test_notification_constructor_error.html
@@ -0,0 +1,51 @@
+
+
+
+
+  Bug XXXXXXX - Check that Notification constructor throws in ServiceWorkerGlobalScope
+  
+  
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_notification_get.html b/dom/serviceworkers/test/test_notification_get.html
new file mode 100644
index 0000000000..44239b4f9e
--- /dev/null
+++ b/dom/serviceworkers/test/test_notification_get.html
@@ -0,0 +1,213 @@
+
+
+
+  ServiceWorkerRegistration.getNotifications() on main thread and worker thread.
+  
+  
+  
+  
+
+
+

+ +

+
+
+
diff --git a/dom/serviceworkers/test/test_notification_openWindow.html b/dom/serviceworkers/test/test_notification_openWindow.html
new file mode 100644
index 0000000000..3e5a91c744
--- /dev/null
+++ b/dom/serviceworkers/test/test_notification_openWindow.html
@@ -0,0 +1,90 @@
+
+
+
+  Bug 1578070
+  
+  
+  
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_notificationclick-otherwindow.html b/dom/serviceworkers/test/test_notificationclick-otherwindow.html
new file mode 100644
index 0000000000..a1ffb71c39
--- /dev/null
+++ b/dom/serviceworkers/test/test_notificationclick-otherwindow.html
@@ -0,0 +1,65 @@
+
+
+
+
+  Bug 1114554 - Test ServiceWorkerGlobalScope.notificationclick event.
+  
+  
+  
+  
+
+
+Bug 1114554
+

+ +
+
+ + + + diff --git a/dom/serviceworkers/test/test_notificationclick.html b/dom/serviceworkers/test/test_notificationclick.html new file mode 100644 index 0000000000..f733a3703f --- /dev/null +++ b/dom/serviceworkers/test/test_notificationclick.html @@ -0,0 +1,66 @@ + + + + + Bug 1114554 - Test ServiceWorkerGlobalScope.notificationclick event. + + + + + + +Bug 1114554 +

+ +
+
+ + + + diff --git a/dom/serviceworkers/test/test_notificationclick_focus.html b/dom/serviceworkers/test/test_notificationclick_focus.html new file mode 100644 index 0000000000..6a99112313 --- /dev/null +++ b/dom/serviceworkers/test/test_notificationclick_focus.html @@ -0,0 +1,66 @@ + + + + + Bug 1144660 - Test client.focus() permissions on notification click + + + + + + +Bug 1114554 +

+ +
+
+ + + + diff --git a/dom/serviceworkers/test/test_notificationclose.html b/dom/serviceworkers/test/test_notificationclose.html new file mode 100644 index 0000000000..a1ae4f0a4e --- /dev/null +++ b/dom/serviceworkers/test/test_notificationclose.html @@ -0,0 +1,67 @@ + + + + + Bug 1265841 - Test ServiceWorkerGlobalScope.notificationclose event. + + + + + + +Bug 1265841 +

+ +
+
+ + + + diff --git a/dom/serviceworkers/test/test_onmessageerror.html b/dom/serviceworkers/test/test_onmessageerror.html new file mode 100644 index 0000000000..425b890951 --- /dev/null +++ b/dom/serviceworkers/test/test_onmessageerror.html @@ -0,0 +1,128 @@ + + + + Test onmessageerror event handlers + + + + + + + diff --git a/dom/serviceworkers/test/test_opaque_intercept.html b/dom/serviceworkers/test/test_opaque_intercept.html new file mode 100644 index 0000000000..f0e40e0402 --- /dev/null +++ b/dom/serviceworkers/test/test_opaque_intercept.html @@ -0,0 +1,93 @@ + + + + + Bug 982726 - Test service worker post message + + + + +

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_openWindow.html b/dom/serviceworkers/test/test_openWindow.html
new file mode 100644
index 0000000000..3d1c63a496
--- /dev/null
+++ b/dom/serviceworkers/test/test_openWindow.html
@@ -0,0 +1,112 @@
+
+
+
+
+  Bug 1172870 - Test clients.openWindow
+  
+  
+  
+  
+
+
+Bug 1172870
+

+ +
+
+ + + + diff --git a/dom/serviceworkers/test/test_origin_after_redirect.html b/dom/serviceworkers/test/test_origin_after_redirect.html new file mode 100644 index 0000000000..f3cddfb450 --- /dev/null +++ b/dom/serviceworkers/test/test_origin_after_redirect.html @@ -0,0 +1,57 @@ + + + + + Test the origin of a redirected response from a service worker + + + + +

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_origin_after_redirect_cached.html b/dom/serviceworkers/test/test_origin_after_redirect_cached.html
new file mode 100644
index 0000000000..af9b47db64
--- /dev/null
+++ b/dom/serviceworkers/test/test_origin_after_redirect_cached.html
@@ -0,0 +1,57 @@
+
+
+
+
+  Test the origin of a redirected response from a service worker
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_origin_after_redirect_to_https.html b/dom/serviceworkers/test/test_origin_after_redirect_to_https.html
new file mode 100644
index 0000000000..927a68ef3a
--- /dev/null
+++ b/dom/serviceworkers/test/test_origin_after_redirect_to_https.html
@@ -0,0 +1,57 @@
+
+
+
+
+  Test the origin of a redirected response from a service worker
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_origin_after_redirect_to_https_cached.html b/dom/serviceworkers/test/test_origin_after_redirect_to_https_cached.html
new file mode 100644
index 0000000000..29686e2302
--- /dev/null
+++ b/dom/serviceworkers/test/test_origin_after_redirect_to_https_cached.html
@@ -0,0 +1,57 @@
+
+
+
+
+  Test the origin of a redirected response from a service worker
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_post_message.html b/dom/serviceworkers/test/test_post_message.html
new file mode 100644
index 0000000000..b72f948dd6
--- /dev/null
+++ b/dom/serviceworkers/test/test_post_message.html
@@ -0,0 +1,80 @@
+
+
+
+
+  Bug 982726 - Test service worker post message 
+  
+  
+
+
+

+ +

+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_post_message_advanced.html b/dom/serviceworkers/test/test_post_message_advanced.html
new file mode 100644
index 0000000000..580dfd3f07
--- /dev/null
+++ b/dom/serviceworkers/test/test_post_message_advanced.html
@@ -0,0 +1,109 @@
+
+
+
+
+  Bug 982726 - Test service worker post message advanced 
+  
+  
+
+
+

+ +

+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_post_message_source.html b/dom/serviceworkers/test/test_post_message_source.html
new file mode 100644
index 0000000000..b72ebe3a7c
--- /dev/null
+++ b/dom/serviceworkers/test/test_post_message_source.html
@@ -0,0 +1,66 @@
+
+
+
+
+  Bug 1142015 - Test service worker post message source 
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_privateBrowsing.html b/dom/serviceworkers/test/test_privateBrowsing.html
new file mode 100644
index 0000000000..6a10f375f9
--- /dev/null
+++ b/dom/serviceworkers/test/test_privateBrowsing.html
@@ -0,0 +1,103 @@
+
+
+  Test for ServiceWorker - Private Browsing
+  
+  
+
+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_register_base.html b/dom/serviceworkers/test/test_register_base.html
new file mode 100644
index 0000000000..3a1f2f2621
--- /dev/null
+++ b/dom/serviceworkers/test/test_register_base.html
@@ -0,0 +1,34 @@
+
+
+
+
+  Test that registering a service worker uses the docuemnt URI for the secure origin check
+  
+  
+  
+
+
+

+ +

+
+
+
diff --git a/dom/serviceworkers/test/test_register_https_in_http.html b/dom/serviceworkers/test/test_register_https_in_http.html
new file mode 100644
index 0000000000..096c3733a0
--- /dev/null
+++ b/dom/serviceworkers/test/test_register_https_in_http.html
@@ -0,0 +1,45 @@
+
+
+
+
+  Bug 1172948 - Test that registering a service worker from inside an HTTPS iframe embedded in an HTTP iframe doesn't work
+  
+  
+
+
+

+ +

+
+
+
diff --git a/dom/serviceworkers/test/test_sandbox_intercept.html b/dom/serviceworkers/test/test_sandbox_intercept.html
new file mode 100644
index 0000000000..2aa120994f
--- /dev/null
+++ b/dom/serviceworkers/test/test_sandbox_intercept.html
@@ -0,0 +1,56 @@
+
+
+
+
+  Bug 1142727 - Test that sandboxed iframes are not intercepted
+  
+  
+
+
+

+
+ + +
+

+
+
+
+
diff --git a/dom/serviceworkers/test/test_sanitize.html b/dom/serviceworkers/test/test_sanitize.html
new file mode 100644
index 0000000000..dd6bd42c8f
--- /dev/null
+++ b/dom/serviceworkers/test/test_sanitize.html
@@ -0,0 +1,86 @@
+
+
+
+
+  Bug 1080109 - Clear ServiceWorker registrations for all domains
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_sanitize_domain.html b/dom/serviceworkers/test/test_sanitize_domain.html
new file mode 100644
index 0000000000..d0f5f7f69a
--- /dev/null
+++ b/dom/serviceworkers/test/test_sanitize_domain.html
@@ -0,0 +1,89 @@
+
+
+
+
+  Bug 1080109 - Clear ServiceWorker registrations for specific domains
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_scopes.html b/dom/serviceworkers/test/test_scopes.html
new file mode 100644
index 0000000000..795dfe1ac4
--- /dev/null
+++ b/dom/serviceworkers/test/test_scopes.html
@@ -0,0 +1,149 @@
+
+
+
+
+  Bug 984048 - Test scope glob matching.
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_script_loader_intercepted_js_cache.html b/dom/serviceworkers/test/test_script_loader_intercepted_js_cache.html
new file mode 100644
index 0000000000..d0073705bb
--- /dev/null
+++ b/dom/serviceworkers/test/test_script_loader_intercepted_js_cache.html
@@ -0,0 +1,224 @@
+
+
+
+
+
+  
+  Test for saving and loading bytecode in/from the necko cache
+  
+  
+  
+  
+
+
+  Mozilla Bug 1350359
+
+
diff --git a/dom/serviceworkers/test/test_self_update_worker.html b/dom/serviceworkers/test/test_self_update_worker.html
new file mode 100644
index 0000000000..d6d4544dd9
--- /dev/null
+++ b/dom/serviceworkers/test/test_self_update_worker.html
@@ -0,0 +1,136 @@
+
+
+
+
+  Test for Bug 1432846
+  
+  
+  
+  
+
+Mozilla Bug 1432846
+

+ +
+
+ + + + + diff --git a/dom/serviceworkers/test/test_service_worker_allowed.html b/dom/serviceworkers/test/test_service_worker_allowed.html new file mode 100644 index 0000000000..a74379f383 --- /dev/null +++ b/dom/serviceworkers/test/test_service_worker_allowed.html @@ -0,0 +1,74 @@ + + + + + Test the Service-Worker-Allowed header + + + + +
+ + + + diff --git a/dom/serviceworkers/test/test_serviceworker.html b/dom/serviceworkers/test/test_serviceworker.html new file mode 100644 index 0000000000..bfc5749405 --- /dev/null +++ b/dom/serviceworkers/test/test_serviceworker.html @@ -0,0 +1,79 @@ + + + + + Bug 1137245 - Allow IndexedDB usage in ServiceWorkers + + + + +

+ +

+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_serviceworker_header.html b/dom/serviceworkers/test/test_serviceworker_header.html
new file mode 100644
index 0000000000..f607aeba3d
--- /dev/null
+++ b/dom/serviceworkers/test/test_serviceworker_header.html
@@ -0,0 +1,41 @@
+
+
+
+
+  Test that service worker scripts are fetched with a Service-Worker: script header
+  
+  
+  
+
+
+

+ +

+
+
+
diff --git a/dom/serviceworkers/test/test_serviceworker_interfaces.html b/dom/serviceworkers/test/test_serviceworker_interfaces.html
new file mode 100644
index 0000000000..2ee4609f68
--- /dev/null
+++ b/dom/serviceworkers/test/test_serviceworker_interfaces.html
@@ -0,0 +1,114 @@
+
+
+
+
+  Validate Interfaces Exposed to Service Workers
+  
+  
+  
+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_serviceworker_interfaces.js b/dom/serviceworkers/test/test_serviceworker_interfaces.js
new file mode 100644
index 0000000000..4ae800b126
--- /dev/null
+++ b/dom/serviceworkers/test/test_serviceworker_interfaces.js
@@ -0,0 +1,361 @@
+// This is a list of all interfaces that are exposed to workers.
+// Please only add things to this list with great care and proper review
+// from the associated module peers.
+
+// This file lists global interfaces we want exposed and verifies they
+// are what we intend. Each entry in the arrays below can either be a
+// simple string with the interface name, or an object with a 'name'
+// property giving the interface name as a string, and additional
+// properties which qualify the exposure of that interface. For example:
+//
+// [
+//   "AGlobalInterface",
+//   { name: "ExperimentalThing", release: false },
+//   { name: "ReallyExperimentalThing", nightly: true },
+//   { name: "DesktopOnlyThing", desktop: true },
+//   { name: "FancyControl", xbl: true },
+//   { name: "DisabledEverywhere", disabled: true },
+// ];
+//
+// See createInterfaceMap() below for a complete list of properties.
+
+// IMPORTANT: Do not change this list without review from
+//            a JavaScript Engine peer!
+var ecmaGlobals = [
+  "AggregateError",
+  "Array",
+  "ArrayBuffer",
+  "Atomics",
+  "Boolean",
+  "BigInt",
+  "BigInt64Array",
+  "BigUint64Array",
+  { name: "ByteLengthQueuingStrategy", optional: true },
+  { name: "CountQueuingStrategy", optional: true },
+  "DataView",
+  "Date",
+  "Error",
+  "EvalError",
+  "FinalizationRegistry",
+  "Float32Array",
+  "Float64Array",
+  "Function",
+  "Infinity",
+  "Int16Array",
+  "Int32Array",
+  "Int8Array",
+  "InternalError",
+  "Intl",
+  "JSON",
+  "Map",
+  "Math",
+  "NaN",
+  "Number",
+  "Object",
+  "Promise",
+  "Proxy",
+  "RangeError",
+  { name: "ReadableStream", optional: true },
+  "ReferenceError",
+  "Reflect",
+  "RegExp",
+  "Set",
+  {
+    name: "SharedArrayBuffer",
+    crossOriginIsolated: true,
+  },
+  "String",
+  "Symbol",
+  "SyntaxError",
+  "TypeError",
+  "Uint16Array",
+  "Uint32Array",
+  "Uint8Array",
+  "Uint8ClampedArray",
+  "URIError",
+  "WeakMap",
+  "WeakRef",
+  "WeakSet",
+  { name: "WebAssembly", optional: true },
+];
+// IMPORTANT: Do not change the list above without review from
+//            a JavaScript Engine peer!
+
+// IMPORTANT: Do not change the list below without review from a DOM peer!
+var interfaceNamesInGlobalScope = [
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "AbortController",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "AbortSignal",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "Blob",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "BroadcastChannel",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "Cache",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "CacheStorage",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "Client",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "Clients",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "CloseEvent",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "Crypto",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "CustomEvent",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "Directory",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "DOMException",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "DOMMatrix",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "DOMMatrixReadOnly",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "DOMPoint",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "DOMPointReadOnly",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "DOMQuad",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "DOMRect",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "DOMRectReadOnly",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "DOMRequest",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "DOMStringList",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "ErrorEvent",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "Event",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "EventTarget",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "ExtendableEvent",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "ExtendableMessageEvent",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "FetchEvent",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "File",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "FileList",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "FileReader",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "FormData",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "Headers",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "IDBCursor",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "IDBCursorWithValue",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "IDBDatabase",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "IDBFactory",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "IDBIndex",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "IDBKeyRange",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "IDBObjectStore",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "IDBOpenDBRequest",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "IDBRequest",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "IDBTransaction",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "IDBVersionChangeEvent",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "ImageBitmap",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "ImageBitmapRenderingContext",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "ImageData",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "MediaCapabilities",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "MediaCapabilitiesInfo",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "MessageChannel",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "MessageEvent",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "MessagePort",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  { name: "NetworkInformation", android: true },
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "Notification",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "NotificationEvent",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "Performance",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "PerformanceEntry",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "PerformanceMark",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "PerformanceMeasure",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "PerformanceObserver",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "PerformanceObserverEntryList",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "PerformanceResourceTiming",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "PerformanceServerTiming",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "ProgressEvent",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "PromiseRejectionEvent",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  { name: "PushEvent" },
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  { name: "PushManager" },
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  { name: "PushMessageData" },
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  { name: "PushSubscription" },
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  { name: "PushSubscriptionOptions" },
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  { name: "Report", nightly: true },
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  { name: "ReportBody", nightly: true },
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  { name: "ReportingObserver", nightly: true },
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "Request",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "Response",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "ServiceWorker",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "ServiceWorkerGlobalScope",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "ServiceWorkerRegistration",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  { name: "StorageManager", fennec: false },
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "SubtleCrypto",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "TextDecoder",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "TextEncoder",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "URL",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "URLSearchParams",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "WebSocket",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "WindowClient",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "WorkerGlobalScope",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "WorkerLocation",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+  "WorkerNavigator",
+  // IMPORTANT: Do not change this list without review from a DOM peer!
+];
+// IMPORTANT: Do not change the list above without review from a DOM peer!
+
+function createInterfaceMap({
+  isNightly,
+  isEarlyBetaOrEarlier,
+  isRelease,
+  isDesktop,
+  isAndroid,
+  isInsecureContext,
+  isFennec,
+  isCrossOriginIsolated,
+}) {
+  var interfaceMap = {};
+
+  function addInterfaces(interfaces) {
+    for (var entry of interfaces) {
+      if (typeof entry === "string") {
+        interfaceMap[entry] = true;
+      } else {
+        ok(!("pref" in entry), "Bogus pref annotation for " + entry.name);
+        if (
+          entry.nightly === !isNightly ||
+          (entry.nightlyAndroid === !(isAndroid && isNightly) && isAndroid) ||
+          (entry.nonReleaseAndroid === !(isAndroid && !isRelease) &&
+            isAndroid) ||
+          entry.desktop === !isDesktop ||
+          (entry.android === !isAndroid &&
+            !entry.nonReleaseAndroid &&
+            !entry.nightlyAndroid) ||
+          entry.fennecOrDesktop === (isAndroid && !isFennec) ||
+          entry.fennec === !isFennec ||
+          entry.release === !isRelease ||
+          entry.earlyBetaOrEarlier === !isEarlyBetaOrEarlier ||
+          entry.crossOriginIsolated === !isCrossOriginIsolated ||
+          entry.disabled
+        ) {
+          interfaceMap[entry.name] = false;
+        } else if (entry.optional) {
+          interfaceMap[entry.name] = "optional";
+        } else {
+          interfaceMap[entry.name] = true;
+        }
+      }
+    }
+  }
+
+  addInterfaces(ecmaGlobals);
+  addInterfaces(interfaceNamesInGlobalScope);
+
+  return interfaceMap;
+}
+
+function runTest(data) {
+  var interfaceMap = createInterfaceMap(data);
+  for (var name of Object.getOwnPropertyNames(self)) {
+    // An interface name should start with an upper case character.
+    if (!/^[A-Z]/.test(name)) {
+      continue;
+    }
+    ok(
+      interfaceMap[name] === "optional" || interfaceMap[name],
+      "If this is failing: DANGER, are you sure you want to expose the new interface " +
+        name +
+        " to all webpages as a property on the service worker? Do not make a change to this file without a " +
+        " review from a DOM peer for that specific change!!! (or a JS peer for changes to ecmaGlobals)"
+    );
+    delete interfaceMap[name];
+  }
+  for (var name of Object.keys(interfaceMap)) {
+    if (interfaceMap[name] === "optional") {
+      delete interfaceMap[name];
+    } else {
+      ok(
+        name in self === interfaceMap[name],
+        name +
+          " should " +
+          (interfaceMap[name] ? "" : " NOT") +
+          " be defined on the global scope"
+      );
+      if (!interfaceMap[name]) {
+        delete interfaceMap[name];
+      }
+    }
+  }
+  is(
+    Object.keys(interfaceMap).length,
+    0,
+    "The following interface(s) are not enumerated: " +
+      Object.keys(interfaceMap).join(", ")
+  );
+}
+
+workerTestGetHelperData(function(data) {
+  runTest(data);
+  workerTestDone();
+});
diff --git a/dom/serviceworkers/test/test_serviceworker_not_sharedworker.html b/dom/serviceworkers/test/test_serviceworker_not_sharedworker.html
new file mode 100644
index 0000000000..33b4428e95
--- /dev/null
+++ b/dom/serviceworkers/test/test_serviceworker_not_sharedworker.html
@@ -0,0 +1,66 @@
+
+
+
+
+  Bug 1141274 - test that service workers and shared workers are separate
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_serviceworkerinfo.xhtml b/dom/serviceworkers/test/test_serviceworkerinfo.xhtml
new file mode 100644
index 0000000000..a3b0fe8e53
--- /dev/null
+++ b/dom/serviceworkers/test/test_serviceworkerinfo.xhtml
@@ -0,0 +1,114 @@
+
+
+
+  
+
+  
+    

+ +

+    
+  
+  
diff --git a/dom/serviceworkers/test/test_serviceworkermanager.xhtml b/dom/serviceworkers/test/test_serviceworkermanager.xhtml new file mode 100644 index 0000000000..b118b7d3f1 --- /dev/null +++ b/dom/serviceworkers/test/test_serviceworkermanager.xhtml @@ -0,0 +1,79 @@ + + + + + + +

+ +

+    
+  
+  
diff --git a/dom/serviceworkers/test/test_serviceworkerregistrationinfo.xhtml b/dom/serviceworkers/test/test_serviceworkerregistrationinfo.xhtml new file mode 100644 index 0000000000..5b39350897 --- /dev/null +++ b/dom/serviceworkers/test/test_serviceworkerregistrationinfo.xhtml @@ -0,0 +1,155 @@ + + + + + + +

+ +

+    
+  
+  
diff --git a/dom/serviceworkers/test/test_skip_waiting.html b/dom/serviceworkers/test/test_skip_waiting.html new file mode 100644 index 0000000000..6147ad6b38 --- /dev/null +++ b/dom/serviceworkers/test/test_skip_waiting.html @@ -0,0 +1,86 @@ + + + + + Bug 1131352 - Add ServiceWorkerGlobalScope skipWaiting() + + + + +

+ +

+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_streamfilter.html b/dom/serviceworkers/test/test_streamfilter.html
new file mode 100644
index 0000000000..f4d7b155ac
--- /dev/null
+++ b/dom/serviceworkers/test/test_streamfilter.html
@@ -0,0 +1,206 @@
+
+
+
+  
+  
+    Test StreamFilter-monitored responses for ServiceWorker-intercepted requests
+  
+  
+  
+  
+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_strict_mode_warning.html b/dom/serviceworkers/test/test_strict_mode_warning.html
new file mode 100644
index 0000000000..4df0d1a380
--- /dev/null
+++ b/dom/serviceworkers/test/test_strict_mode_warning.html
@@ -0,0 +1,42 @@
+
+
+
+
+  Bug 1170550 - test registration of service worker scripts with a strict mode warning
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_third_party_iframes.html b/dom/serviceworkers/test/test_third_party_iframes.html
new file mode 100644
index 0000000000..e25f362824
--- /dev/null
+++ b/dom/serviceworkers/test/test_third_party_iframes.html
@@ -0,0 +1,288 @@
+
+
+
+
+  
+  Bug 1152899 - Disallow the interception of third-party iframes using service workers when the third-party cookie preference is set
+  
+  
+
+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_unregister.html b/dom/serviceworkers/test/test_unregister.html
new file mode 100644
index 0000000000..959378f03a
--- /dev/null
+++ b/dom/serviceworkers/test/test_unregister.html
@@ -0,0 +1,137 @@
+
+
+
+
+  Bug 984048 - Test unregister
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/test_unresolved_fetch_interception.html b/dom/serviceworkers/test/test_unresolved_fetch_interception.html
new file mode 100644
index 0000000000..7182b0fb86
--- /dev/null
+++ b/dom/serviceworkers/test/test_unresolved_fetch_interception.html
@@ -0,0 +1,95 @@
+
+
+
+
+  Test for Bug 1188545
+  
+  
+  
+  
+
+Mozilla Bug 118845
+

+ +
+
+ + + + + diff --git a/dom/serviceworkers/test/test_workerUnregister.html b/dom/serviceworkers/test/test_workerUnregister.html new file mode 100644 index 0000000000..d0bc1d6ce4 --- /dev/null +++ b/dom/serviceworkers/test/test_workerUnregister.html @@ -0,0 +1,81 @@ + + + + + Bug 982728 - Test ServiceWorkerGlobalScope.unregister + + + + +
+ + + + diff --git a/dom/serviceworkers/test/test_workerUpdate.html b/dom/serviceworkers/test/test_workerUpdate.html new file mode 100644 index 0000000000..015e6bb4ae --- /dev/null +++ b/dom/serviceworkers/test/test_workerUpdate.html @@ -0,0 +1,63 @@ + + + + + Bug 1065366 - Test ServiceWorkerGlobalScope.update + + + + +
+ + + + + diff --git a/dom/serviceworkers/test/test_worker_reference_gc_timeout.html b/dom/serviceworkers/test/test_worker_reference_gc_timeout.html new file mode 100644 index 0000000000..cf04e13f2e --- /dev/null +++ b/dom/serviceworkers/test/test_worker_reference_gc_timeout.html @@ -0,0 +1,76 @@ + + + + + Test for Bug 1317266 + + + + + +Mozilla Bug 1317266 +

+ +
+
+ + + + diff --git a/dom/serviceworkers/test/test_workerupdatefoundevent.html b/dom/serviceworkers/test/test_workerupdatefoundevent.html new file mode 100644 index 0000000000..1c3ced13bd --- /dev/null +++ b/dom/serviceworkers/test/test_workerupdatefoundevent.html @@ -0,0 +1,91 @@ + + + + + Bug 1131327 - Test ServiceWorkerRegistration.onupdatefound on ServiceWorker + + + + +

+
+

+
+
+
+
+
diff --git a/dom/serviceworkers/test/test_xslt.html b/dom/serviceworkers/test/test_xslt.html
new file mode 100644
index 0000000000..a955c843ac
--- /dev/null
+++ b/dom/serviceworkers/test/test_xslt.html
@@ -0,0 +1,117 @@
+
+
+
+
+  Bug 1182113 - Test service worker XSLT interception
+  
+  
+
+
+

+
+

+
+
+
+
+
diff --git a/dom/serviceworkers/test/thirdparty/iframe1.html b/dom/serviceworkers/test/thirdparty/iframe1.html
new file mode 100644
index 0000000000..e8982d306a
--- /dev/null
+++ b/dom/serviceworkers/test/thirdparty/iframe1.html
@@ -0,0 +1,42 @@
+
+
+
+  
+  SW third party iframe test
+
+  
+
+
+
+
+  
+  
+
+
+
diff --git a/dom/serviceworkers/test/thirdparty/iframe2.html b/dom/serviceworkers/test/thirdparty/iframe2.html
new file mode 100644
index 0000000000..8013899195
--- /dev/null
+++ b/dom/serviceworkers/test/thirdparty/iframe2.html
@@ -0,0 +1,14 @@
+
+
diff --git a/dom/serviceworkers/test/thirdparty/register.html b/dom/serviceworkers/test/thirdparty/register.html
new file mode 100644
index 0000000000..b166acb8a4
--- /dev/null
+++ b/dom/serviceworkers/test/thirdparty/register.html
@@ -0,0 +1,29 @@
+
+
diff --git a/dom/serviceworkers/test/thirdparty/sw.js b/dom/serviceworkers/test/thirdparty/sw.js
new file mode 100644
index 0000000000..ea844e8f2b
--- /dev/null
+++ b/dom/serviceworkers/test/thirdparty/sw.js
@@ -0,0 +1,33 @@
+self.addEventListener("fetch", function(event) {
+  dump("fetch " + event.request.url + "\n");
+  if (event.request.url.includes("iframe2.html")) {
+    var body =
+      "";
+    event.respondWith(
+      new Response(body, {
+        headers: { "Content-Type": "text/html" },
+      })
+    );
+    return;
+  }
+  if (event.request.url.includes("worker.js")) {
+    var body = "self.postMessage('worker-swresponse');";
+    event.respondWith(
+      new Response(body, {
+        headers: { "Content-Type": "application/javascript" },
+      })
+    );
+    return;
+  }
+});
diff --git a/dom/serviceworkers/test/thirdparty/unregister.html b/dom/serviceworkers/test/thirdparty/unregister.html
new file mode 100644
index 0000000000..65b29d5648
--- /dev/null
+++ b/dom/serviceworkers/test/thirdparty/unregister.html
@@ -0,0 +1,19 @@
+
+
diff --git a/dom/serviceworkers/test/thirdparty/worker.js b/dom/serviceworkers/test/thirdparty/worker.js
new file mode 100644
index 0000000000..bbdc608cde
--- /dev/null
+++ b/dom/serviceworkers/test/thirdparty/worker.js
@@ -0,0 +1 @@
+self.postMessage("worker-networkresponse");
diff --git a/dom/serviceworkers/test/unregister/index.html b/dom/serviceworkers/test/unregister/index.html
new file mode 100644
index 0000000000..36cac9fcf6
--- /dev/null
+++ b/dom/serviceworkers/test/unregister/index.html
@@ -0,0 +1,26 @@
+
+
+
+
+  Bug 984048 - Test unregister
+  
+  
+
+
+

+ +

+
+
+
+
diff --git a/dom/serviceworkers/test/unregister/unregister.html b/dom/serviceworkers/test/unregister/unregister.html
new file mode 100644
index 0000000000..42633ca343
--- /dev/null
+++ b/dom/serviceworkers/test/unregister/unregister.html
@@ -0,0 +1,21 @@
+
+
+
+
+  Test worker::unregister
+  
+  
+
+
+
+
+
+
diff --git a/dom/serviceworkers/test/unresolved_fetch_worker.js b/dom/serviceworkers/test/unresolved_fetch_worker.js
new file mode 100644
index 0000000000..80d39b037a
--- /dev/null
+++ b/dom/serviceworkers/test/unresolved_fetch_worker.js
@@ -0,0 +1,18 @@
+var keepPromiseAlive;
+onfetch = function(event) {
+  event.waitUntil(
+    clients.matchAll().then(clients => {
+      clients.forEach(client => {
+        client.postMessage("continue");
+      });
+    })
+  );
+
+  // Never resolve, and keep it alive on our global so it can't get GC'ed and
+  // make this test weird and intermittent.
+  event.respondWith((keepPromiseAlive = new Promise(function(res, rej) {})));
+};
+
+addEventListener("activate", function(event) {
+  event.waitUntil(clients.claim());
+});
diff --git a/dom/serviceworkers/test/update_worker.sjs b/dom/serviceworkers/test/update_worker.sjs
new file mode 100644
index 0000000000..a92eeabc22
--- /dev/null
+++ b/dom/serviceworkers/test/update_worker.sjs
@@ -0,0 +1,13 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+"use strict";
+
+function handleRequest(request, response) {
+  // This header is necessary for making this script able to be loaded.
+  response.setHeader("Content-Type", "application/javascript");
+
+  var body = '/* ' + Date.now() + ' */';
+  response.write(body);
+}
+
diff --git a/dom/serviceworkers/test/updatefoundevent.html b/dom/serviceworkers/test/updatefoundevent.html
new file mode 100644
index 0000000000..78088c7cd0
--- /dev/null
+++ b/dom/serviceworkers/test/updatefoundevent.html
@@ -0,0 +1,13 @@
+
+
+
+  Bug 1131327 - Test ServiceWorkerRegistration.onupdatefound on ServiceWorker
+
+
+
+
diff --git a/dom/serviceworkers/test/utils.js b/dom/serviceworkers/test/utils.js
new file mode 100644
index 0000000000..15ab203972
--- /dev/null
+++ b/dom/serviceworkers/test/utils.js
@@ -0,0 +1,85 @@
+function waitForState(worker, state, context) {
+  return new Promise(resolve => {
+    function onStateChange() {
+      if (worker.state === state) {
+        worker.removeEventListener("statechange", onStateChange);
+        resolve(context);
+      }
+    }
+
+    // First add an event listener, so we won't miss any change that happens
+    // before we check the current state.
+    worker.addEventListener("statechange", onStateChange);
+
+    // Now check if the worker is already in the desired state.
+    onStateChange();
+  });
+}
+
+/**
+ * Helper for browser tests to issue register calls from the content global and
+ * wait for the SW to progress to the active state, as most tests desire.
+ * From the ContentTask.spawn, use via
+ * `content.wrappedJSObject.registerAndWaitForActive`.
+ */
+async function registerAndWaitForActive(...args) {
+  console.log("...calling register");
+  const reg = await navigator.serviceWorker.register(...args);
+  // Unless registration resurrection happens, the SW should be in the
+  // installing slot.
+  console.log("...waiting for activation");
+  await waitForState(reg.installing, "activated", reg);
+  console.log("...activated!");
+  return reg;
+}
+
+/**
+ * Helper to create an iframe with the given URL and return the first
+ * postMessage payload received.  This is intended to be used when creating
+ * cross-origin iframes.
+ *
+ * A promise will be returned that resolves with the payload of the postMessage
+ * call.
+ */
+function createIframeAndWaitForMessage(url) {
+  const iframe = document.createElement("iframe");
+  document.body.appendChild(iframe);
+  return new Promise(resolve => {
+    window.addEventListener(
+      "message",
+      event => {
+        resolve(event.data);
+      },
+      { once: true }
+    );
+    iframe.src = url;
+  });
+}
+
+/**
+ * Helper to create a nested iframe into the iframe created by
+ * createIframeAndWaitForMessage().
+ *
+ * A promise will be returned that resolves with the payload of the postMessage
+ * call.
+ */
+function createNestedIframeAndWaitForMessage(url) {
+  const iframe = document.getElementsByTagName("iframe")[0];
+  iframe.contentWindow.postMessage("create nested iframe", "*");
+  return new Promise(resolve => {
+    window.addEventListener(
+      "message",
+      event => {
+        resolve(event.data);
+      },
+      { once: true }
+    );
+  });
+}
+
+async function unregisterAll() {
+  const registrations = await navigator.serviceWorker.getRegistrations();
+  for (const reg of registrations) {
+    await reg.unregister();
+  }
+}
diff --git a/dom/serviceworkers/test/window_party_iframes.html b/dom/serviceworkers/test/window_party_iframes.html
new file mode 100644
index 0000000000..abeea4449b
--- /dev/null
+++ b/dom/serviceworkers/test/window_party_iframes.html
@@ -0,0 +1,18 @@
+
+
+
+
+  
+
+
+
+
+
+
diff --git a/dom/serviceworkers/test/worker.js b/dom/serviceworkers/test/worker.js
new file mode 100644
index 0000000000..2aba167d18
--- /dev/null
+++ b/dom/serviceworkers/test/worker.js
@@ -0,0 +1 @@
+// empty worker, always succeed!
diff --git a/dom/serviceworkers/test/worker2.js b/dom/serviceworkers/test/worker2.js
new file mode 100644
index 0000000000..3072d0817f
--- /dev/null
+++ b/dom/serviceworkers/test/worker2.js
@@ -0,0 +1 @@
+// worker2.js
diff --git a/dom/serviceworkers/test/worker3.js b/dom/serviceworkers/test/worker3.js
new file mode 100644
index 0000000000..449fc2f976
--- /dev/null
+++ b/dom/serviceworkers/test/worker3.js
@@ -0,0 +1 @@
+// worker3.js
diff --git a/dom/serviceworkers/test/workerUpdate/update.html b/dom/serviceworkers/test/workerUpdate/update.html
new file mode 100644
index 0000000000..666e213d14
--- /dev/null
+++ b/dom/serviceworkers/test/workerUpdate/update.html
@@ -0,0 +1,23 @@
+
+
+
+
+  Test worker::update
+  
+  
+
+
+
+
+
+
diff --git a/dom/serviceworkers/test/worker_unregister.js b/dom/serviceworkers/test/worker_unregister.js
new file mode 100644
index 0000000000..a2b45245b4
--- /dev/null
+++ b/dom/serviceworkers/test/worker_unregister.js
@@ -0,0 +1,22 @@
+onmessage = function(e) {
+  clients.matchAll().then(function(c) {
+    if (c.length === 0) {
+      // We cannot proceed.
+      return;
+    }
+
+    registration
+      .unregister()
+      .then(
+        function() {
+          c[0].postMessage("DONE");
+        },
+        function() {
+          c[0].postMessage("ERROR");
+        }
+      )
+      .then(function() {
+        c[0].postMessage("FINISH");
+      });
+  });
+};
diff --git a/dom/serviceworkers/test/worker_update.js b/dom/serviceworkers/test/worker_update.js
new file mode 100644
index 0000000000..38dcf3e1ca
--- /dev/null
+++ b/dom/serviceworkers/test/worker_update.js
@@ -0,0 +1,25 @@
+// For now this test only calls update to verify that our registration
+// job queueing works properly when called from the worker thread. We should
+// test actual update scenarios with a SJS test.
+onmessage = function(e) {
+  self.registration
+    .update()
+    .then(function(v) {
+      return v instanceof ServiceWorkerRegistration ? "FINISH" : "FAIL";
+    })
+    .catch(function(ex) {
+      return "FAIL";
+    })
+    .then(function(result) {
+      clients.matchAll().then(function(c) {
+        if (c.length == 0) {
+          dump(
+            "!!!!!!!!!!! WORKER HAS NO CLIENTS TO FINISH TEST !!!!!!!!!!!!\n"
+          );
+          return;
+        }
+
+        c[0].postMessage(result);
+      });
+    });
+};
diff --git a/dom/serviceworkers/test/worker_updatefoundevent.js b/dom/serviceworkers/test/worker_updatefoundevent.js
new file mode 100644
index 0000000000..cb6c6fa862
--- /dev/null
+++ b/dom/serviceworkers/test/worker_updatefoundevent.js
@@ -0,0 +1,20 @@
+/**
+ * Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/
+ */
+
+registration.onupdatefound = function(e) {
+  clients.matchAll().then(function(clients) {
+    if (!clients.length) {
+      // We don't control any clients when the first update event is fired
+      // because we haven't reached the 'activated' state.
+      return;
+    }
+
+    if (registration.scope.match(/updatefoundevent\.html$/)) {
+      clients[0].postMessage("finish");
+    } else {
+      dump("Scope did not match");
+    }
+  });
+};
diff --git a/dom/serviceworkers/test/worker_updatefoundevent2.js b/dom/serviceworkers/test/worker_updatefoundevent2.js
new file mode 100644
index 0000000000..da4c592aad
--- /dev/null
+++ b/dom/serviceworkers/test/worker_updatefoundevent2.js
@@ -0,0 +1 @@
+// Not useful.
diff --git a/dom/serviceworkers/test/xslt/test.xml b/dom/serviceworkers/test/xslt/test.xml
new file mode 100644
index 0000000000..83c7776339
--- /dev/null
+++ b/dom/serviceworkers/test/xslt/test.xml
@@ -0,0 +1,6 @@
+
+
+
+  Example
+  Error
+
diff --git a/dom/serviceworkers/test/xslt/xslt.sjs b/dom/serviceworkers/test/xslt/xslt.sjs
new file mode 100644
index 0000000000..db681ab500
--- /dev/null
+++ b/dom/serviceworkers/test/xslt/xslt.sjs
@@ -0,0 +1,12 @@
+function handleRequest(request, response) {
+  response.setHeader("Content-Type", "application/xslt+xml", false);
+  response.setHeader("Access-Control-Allow-Origin", "*");
+
+  var body = request.queryString;
+  if (!body) {
+    response.setStatusLine(null, 500, "Invalid querystring");
+    return;
+  }
+
+  response.write(unescape(body));
+}
diff --git a/dom/serviceworkers/test/xslt_worker.js b/dom/serviceworkers/test/xslt_worker.js
new file mode 100644
index 0000000000..d3c4383f22
--- /dev/null
+++ b/dom/serviceworkers/test/xslt_worker.js
@@ -0,0 +1,58 @@
+var testType = "synthetic";
+
+var xslt =
+  ' ' +
+  '' +
+  '  ' +
+  "    " +
+  '      ' +
+  "    " +
+  "  " +
+  '  ' +
+  "";
+
+onfetch = function(event) {
+  if (event.request.url.includes("test.xsl")) {
+    if (testType == "synthetic") {
+      if (event.request.mode != "cors") {
+        event.respondWith(Response.error());
+        return;
+      }
+
+      event.respondWith(
+        Promise.resolve(
+          new Response(xslt, {
+            headers: { "Content-Type": "application/xslt+xml" },
+          })
+        )
+      );
+    } else if (testType == "cors") {
+      if (event.request.mode != "cors") {
+        event.respondWith(Response.error());
+        return;
+      }
+
+      var url =
+        "http://example.com/tests/dom/serviceworkers/test/xslt/xslt.sjs?" +
+        escape(xslt);
+      event.respondWith(fetch(url, { mode: "cors" }));
+    } else if (testType == "opaque") {
+      if (event.request.mode != "cors") {
+        event.respondWith(Response.error());
+        return;
+      }
+
+      var url =
+        "http://example.com/tests/dom/serviceworkers/test/xslt/xslt.sjs?" +
+        escape(xslt);
+      event.respondWith(fetch(url, { mode: "no-cors" }));
+    } else {
+      event.respondWith(Response.error());
+    }
+  }
+};
+
+onmessage = function(event) {
+  testType = event.data;
+};
-- 
cgit v1.2.3