Adding upstream version 18.2.2.upstream/18.2.2

Signed-off-by: Daniel Baumann <daniel.baumann@progress-linux.org>

87 files changed, 16009 insertions, 0 deletions

diff --git a/src/arrow/dev/archery/MANIFEST.in b/src/arrow/dev/archery/MANIFEST.in
new file mode 100644
index 000000000..90fe034c2
--- /dev/null
+++ b/src/arrow/dev/archery/MANIFEST.in
@@ -0,0 +1,4 @@
+include ../../LICENSE.txt
+include ../../NOTICE.txt
+
+include archery/reports/*
diff --git a/src/arrow/dev/archery/README.md b/src/arrow/dev/archery/README.md
new file mode 100644
index 000000000..eff654416
--- /dev/null
+++ b/src/arrow/dev/archery/README.md
@@ -0,0 +1,49 @@
+<!--
+  ~ Licensed to the Apache Software Foundation (ASF) under one
+  ~ or more contributor license agreements.  See the NOTICE file
+  ~ distributed with this work for additional information
+  ~ regarding copyright ownership.  The ASF licenses this file
+  ~ to you under the Apache License, Version 2.0 (the
+  ~ "License"); you may not use this file except in compliance
+  ~ with the License.  You may obtain a copy of the License at
+  ~
+  ~   http://www.apache.org/licenses/LICENSE-2.0
+  ~
+  ~ Unless required by applicable law or agreed to in writing,
+  ~ software distributed under the License is distributed on an
+  ~ "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  ~ KIND, either express or implied.  See the License for the
+  ~ specific language governing permissions and limitations
+  ~ under the License.
+  -->
+
+# Developing with Archery
+
+Archery is documented on the Arrow website:
+
+* [Daily development using Archery](https://arrow.apache.org/docs/developers/archery.html)
+* [Using Archery and Crossbow](https://arrow.apache.org/docs/developers/crossbow.html)
+* [Using Archer and Docker](https://arrow.apache.org/docs/developers/docker.html)
+
+# Installing Archery
+
+See the pages linked aboved for more details. As a general overview, Archery
+comes in a number of subpackages, each needing to be installed if you want
+to use the functionality of it:
+
+* lint – lint (and in some cases auto-format) code in the Arrow repo
+  To install: `pip install -e "arrow/dev/archery[lint]"`
+* benchmark – to run Arrow benchmarks using Archery
+  To install: `pip install -e "arrow/dev/archery[benchmark]"`
+* docker – to run docker-compose based tasks more easily
+  To install: `pip install -e "arrow/dev/archery[docker]"`
+* release – release related helpers
+  To install: `pip install -e "arrow/dev/archery[release]"`
+* crossbow – to trigger + interact with the crossbow build system
+  To install: `pip install -e "arrow/dev/archery[crossbow]"`
+* crossbow-upload
+  To install: `pip install -e "arrow/dev/archery[crossbow-upload]"`
+
+Additionally, if you would prefer to install everything at once,
+`pip install -e "arrow/dev/archery[all]"` is an alias for all of
+the above subpackages.
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/__init__.py b/src/arrow/dev/archery/archery/__init__.py
new file mode 100644
index 000000000..13a83393a
--- /dev/null
+++ b/src/arrow/dev/archery/archery/__init__.py
@@ -0,0 +1,16 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
diff --git a/src/arrow/dev/archery/archery/benchmark/__init__.py b/src/arrow/dev/archery/archery/benchmark/__init__.py
new file mode 100644
index 000000000..13a83393a
--- /dev/null
+++ b/src/arrow/dev/archery/archery/benchmark/__init__.py
@@ -0,0 +1,16 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
diff --git a/src/arrow/dev/archery/archery/benchmark/codec.py b/src/arrow/dev/archery/archery/benchmark/codec.py
new file mode 100644
index 000000000..4157890d1
--- /dev/null
+++ b/src/arrow/dev/archery/archery/benchmark/codec.py
@@ -0,0 +1,97 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+
+import json
+
+from ..benchmark.core import Benchmark, BenchmarkSuite
+from ..benchmark.runner import BenchmarkRunner, StaticBenchmarkRunner
+from ..benchmark.compare import BenchmarkComparator
+
+
+class JsonEncoder(json.JSONEncoder):
+    def default(self, o):
+        if isinstance(o, Benchmark):
+            return BenchmarkCodec.encode(o)
+
+        if isinstance(o, BenchmarkSuite):
+            return BenchmarkSuiteCodec.encode(o)
+
+        if isinstance(o, BenchmarkRunner):
+            return BenchmarkRunnerCodec.encode(o)
+
+        if isinstance(o, BenchmarkComparator):
+            return BenchmarkComparatorCodec.encode(o)
+
+        return json.JSONEncoder.default(self, o)
+
+
+class BenchmarkCodec:
+    @staticmethod
+    def encode(b):
+        return {
+            "name": b.name,
+            "unit": b.unit,
+            "less_is_better": b.less_is_better,
+            "values": b.values,
+            "time_unit": b.time_unit,
+            "times": b.times,
+            "counters": b.counters,
+        }
+
+    @staticmethod
+    def decode(dct, **kwargs):
+        return Benchmark(**dct, **kwargs)
+
+
+class BenchmarkSuiteCodec:
+    @staticmethod
+    def encode(bs):
+        return {
+            "name": bs.name,
+            "benchmarks": [BenchmarkCodec.encode(b) for b in bs.benchmarks]
+        }
+
+    @staticmethod
+    def decode(dct, **kwargs):
+        benchmarks = [BenchmarkCodec.decode(b)
+                      for b in dct.pop("benchmarks", [])]
+        return BenchmarkSuite(benchmarks=benchmarks, **dct, **kwargs)
+
+
+class BenchmarkRunnerCodec:
+    @staticmethod
+    def encode(br):
+        return {"suites": [BenchmarkSuiteCodec.encode(s) for s in br.suites]}
+
+    @staticmethod
+    def decode(dct, **kwargs):
+        suites = [BenchmarkSuiteCodec.decode(s)
+                  for s in dct.pop("suites", [])]
+        return StaticBenchmarkRunner(suites=suites, **dct, **kwargs)
+
+
+class BenchmarkComparatorCodec:
+    @staticmethod
+    def encode(bc):
+        comparator = bc.formatted
+
+        suite_name = bc.suite_name
+        if suite_name:
+            comparator["suite"] = suite_name
+
+        return comparator
diff --git a/src/arrow/dev/archery/archery/benchmark/compare.py b/src/arrow/dev/archery/archery/benchmark/compare.py
new file mode 100644
index 000000000..622b80179
--- /dev/null
+++ b/src/arrow/dev/archery/archery/benchmark/compare.py
@@ -0,0 +1,173 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+
+# Define a global regression threshold as 5%. This is purely subjective and
+# flawed. This does not track cumulative regression.
+DEFAULT_THRESHOLD = 0.05
+
+
+def items_per_seconds_fmt(value):
+    if value < 1000:
+        return "{} items/sec".format(value)
+    if value < 1000**2:
+        return "{:.3f}K items/sec".format(value / 1000)
+    if value < 1000**3:
+        return "{:.3f}M items/sec".format(value / 1000**2)
+    else:
+        return "{:.3f}G items/sec".format(value / 1000**3)
+
+
+def bytes_per_seconds_fmt(value):
+    if value < 1024:
+        return "{} bytes/sec".format(value)
+    if value < 1024**2:
+        return "{:.3f} KiB/sec".format(value / 1024)
+    if value < 1024**3:
+        return "{:.3f} MiB/sec".format(value / 1024**2)
+    if value < 1024**4:
+        return "{:.3f} GiB/sec".format(value / 1024**3)
+    else:
+        return "{:.3f} TiB/sec".format(value / 1024**4)
+
+
+def change_fmt(value):
+    return "{:.3%}".format(value)
+
+
+def formatter_for_unit(unit):
+    if unit == "bytes_per_second":
+        return bytes_per_seconds_fmt
+    elif unit == "items_per_second":
+        return items_per_seconds_fmt
+    else:
+        return lambda x: x
+
+
+class BenchmarkComparator:
+    """ Compares two benchmarks.
+
+    Encodes the logic of comparing two benchmarks and taking a decision on
+    if it induce a regression.
+    """
+
+    def __init__(self, contender, baseline, threshold=DEFAULT_THRESHOLD,
+                 suite_name=None):
+        self.contender = contender
+        self.baseline = baseline
+        self.threshold = threshold
+        self.suite_name = suite_name
+
+    @property
+    def name(self):
+        return self.baseline.name
+
+    @property
+    def less_is_better(self):
+        return self.baseline.less_is_better
+
+    @property
+    def unit(self):
+        return self.baseline.unit
+
+    @property
+    def change(self):
+        new = self.contender.value
+        old = self.baseline.value
+
+        if old == 0 and new == 0:
+            return 0.0
+        if old == 0:
+            return 0.0
+
+        return float(new - old) / abs(old)
+
+    @property
+    def confidence(self):
+        """ Indicate if a comparison of benchmarks should be trusted. """
+        return True
+
+    @property
+    def regression(self):
+        change = self.change
+        adjusted_change = change if self.less_is_better else -change
+        return (self.confidence and adjusted_change > self.threshold)
+
+    @property
+    def formatted(self):
+        fmt = formatter_for_unit(self.unit)
+        return {
+            "benchmark": self.name,
+            "change": change_fmt(self.change),
+            "regression": self.regression,
+            "baseline": fmt(self.baseline.value),
+            "contender": fmt(self.contender.value),
+            "unit": self.unit,
+            "less_is_better": self.less_is_better,
+            "counters": str(self.baseline.counters)
+        }
+
+    def compare(self, comparator=None):
+        return {
+            "benchmark": self.name,
+            "change": self.change,
+            "regression": self.regression,
+            "baseline": self.baseline.value,
+            "contender": self.contender.value,
+            "unit": self.unit,
+            "less_is_better": self.less_is_better,
+            "counters": self.baseline.counters
+        }
+
+    def __call__(self, **kwargs):
+        return self.compare(**kwargs)
+
+
+def pairwise_compare(contender, baseline):
+    dict_contender = {e.name: e for e in contender}
+    dict_baseline = {e.name: e for e in baseline}
+
+    for name in (dict_contender.keys() & dict_baseline.keys()):
+        yield name, (dict_contender[name], dict_baseline[name])
+
+
+class RunnerComparator:
+    """ Compares suites/benchmarks from runners.
+
+    It is up to the caller that ensure that runners are compatible (both from
+    the same language implementation).
+    """
+
+    def __init__(self, contender, baseline, threshold=DEFAULT_THRESHOLD):
+        self.contender = contender
+        self.baseline = baseline
+        self.threshold = threshold
+
+    @property
+    def comparisons(self):
+        contender = self.contender.suites
+        baseline = self.baseline.suites
+        suites = pairwise_compare(contender, baseline)
+
+        for suite_name, (suite_cont, suite_base) in suites:
+            benchmarks = pairwise_compare(
+                suite_cont.benchmarks, suite_base.benchmarks)
+
+            for _, (bench_cont, bench_base) in benchmarks:
+                yield BenchmarkComparator(bench_cont, bench_base,
+                                          threshold=self.threshold,
+                                          suite_name=suite_name)
diff --git a/src/arrow/dev/archery/archery/benchmark/core.py b/src/arrow/dev/archery/archery/benchmark/core.py
new file mode 100644
index 000000000..5a92271a3
--- /dev/null
+++ b/src/arrow/dev/archery/archery/benchmark/core.py
@@ -0,0 +1,57 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+
+def median(values):
+    n = len(values)
+    if n == 0:
+        raise ValueError("median requires at least one value")
+    elif n % 2 == 0:
+        return (values[(n // 2) - 1] + values[n // 2]) / 2
+    else:
+        return values[n // 2]
+
+
+class Benchmark:
+    def __init__(self, name, unit, less_is_better, values, time_unit,
+                 times, counters=None):
+        self.name = name
+        self.unit = unit
+        self.less_is_better = less_is_better
+        self.values = sorted(values)
+        self.time_unit = time_unit
+        self.times = sorted(times)
+        self.median = median(self.values)
+        self.counters = counters or {}
+
+    @property
+    def value(self):
+        return self.median
+
+    def __repr__(self):
+        return "Benchmark[name={},value={}]".format(self.name, self.value)
+
+
+class BenchmarkSuite:
+    def __init__(self, name, benchmarks):
+        self.name = name
+        self.benchmarks = benchmarks
+
+    def __repr__(self):
+        return "BenchmarkSuite[name={}, benchmarks={}]".format(
+            self.name, self.benchmarks
+        )
diff --git a/src/arrow/dev/archery/archery/benchmark/google.py b/src/arrow/dev/archery/archery/benchmark/google.py
new file mode 100644
index 000000000..ebcc52636
--- /dev/null
+++ b/src/arrow/dev/archery/archery/benchmark/google.py
@@ -0,0 +1,174 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from itertools import filterfalse, groupby, tee
+import json
+import subprocess
+from tempfile import NamedTemporaryFile
+
+from .core import Benchmark
+from ..utils.command import Command
+
+
+def partition(pred, iterable):
+    # adapted from python's examples
+    t1, t2 = tee(iterable)
+    return list(filter(pred, t1)), list(filterfalse(pred, t2))
+
+
+class GoogleBenchmarkCommand(Command):
+    """ Run a google benchmark binary.
+
+    This assumes the binary supports the standard command line options,
+    notably `--benchmark_filter`, `--benchmark_format`, etc...
+    """
+
+    def __init__(self, benchmark_bin, benchmark_filter=None):
+        self.bin = benchmark_bin
+        self.benchmark_filter = benchmark_filter
+
+    def list_benchmarks(self):
+        argv = ["--benchmark_list_tests"]
+        if self.benchmark_filter:
+            argv.append("--benchmark_filter={}".format(self.benchmark_filter))
+        result = self.run(*argv, stdout=subprocess.PIPE,
+                          stderr=subprocess.PIPE)
+        return str.splitlines(result.stdout.decode("utf-8"))
+
+    def results(self, repetitions=1):
+        with NamedTemporaryFile() as out:
+            argv = ["--benchmark_repetitions={}".format(repetitions),
+                    "--benchmark_out={}".format(out.name),
+                    "--benchmark_out_format=json"]
+
+            if self.benchmark_filter:
+                argv.append(
+                    "--benchmark_filter={}".format(self.benchmark_filter)
+                )
+
+            self.run(*argv, check=True)
+            return json.load(out)
+
+
+class GoogleBenchmarkObservation:
+    """ Represents one run of a single (google c++) benchmark.
+
+    Aggregates are reported by Google Benchmark executables alongside
+    other observations whenever repetitions are specified (with
+    `--benchmark_repetitions` on the bare benchmark, or with the
+    archery option `--repetitions`). Aggregate observations are not
+    included in `GoogleBenchmark.runs`.
+
+    RegressionSumKernel/32768/0                 1 us          1 us  25.8077GB/s
+    RegressionSumKernel/32768/0                 1 us          1 us  25.7066GB/s
+    RegressionSumKernel/32768/0                 1 us          1 us  25.1481GB/s
+    RegressionSumKernel/32768/0                 1 us          1 us  25.846GB/s
+    RegressionSumKernel/32768/0                 1 us          1 us  25.6453GB/s
+    RegressionSumKernel/32768/0_mean            1 us          1 us  25.6307GB/s
+    RegressionSumKernel/32768/0_median          1 us          1 us  25.7066GB/s
+    RegressionSumKernel/32768/0_stddev          0 us          0 us  288.046MB/s
+    """
+
+    def __init__(self, name, real_time, cpu_time, time_unit, run_type,
+                 size=None, bytes_per_second=None, items_per_second=None,
+                 **counters):
+        self._name = name
+        self.real_time = real_time
+        self.cpu_time = cpu_time
+        self.time_unit = time_unit
+        self.run_type = run_type
+        self.size = size
+        self.bytes_per_second = bytes_per_second
+        self.items_per_second = items_per_second
+        self.counters = counters
+
+    @property
+    def is_aggregate(self):
+        """ Indicate if the observation is a run or an aggregate. """
+        return self.run_type == "aggregate"
+
+    @property
+    def is_realtime(self):
+        """ Indicate if the preferred value is realtime instead of cputime. """
+        return self.name.find("/real_time") != -1
+
+    @property
+    def name(self):
+        name = self._name
+        return name.rsplit("_", maxsplit=1)[0] if self.is_aggregate else name
+
+    @property
+    def time(self):
+        return self.real_time if self.is_realtime else self.cpu_time
+
+    @property
+    def value(self):
+        """ Return the benchmark value."""
+        return self.bytes_per_second or self.items_per_second or self.time
+
+    @property
+    def unit(self):
+        if self.bytes_per_second:
+            return "bytes_per_second"
+        elif self.items_per_second:
+            return "items_per_second"
+        else:
+            return self.time_unit
+
+    def __repr__(self):
+        return str(self.value)
+
+
+class GoogleBenchmark(Benchmark):
+    """ A set of GoogleBenchmarkObservations. """
+
+    def __init__(self, name, runs):
+        """ Initialize a GoogleBenchmark.
+
+        Parameters
+        ----------
+        name: str
+              Name of the benchmark
+        runs: list(GoogleBenchmarkObservation)
+              Repetitions of GoogleBenchmarkObservation run.
+
+        """
+        self.name = name
+        # exclude google benchmark aggregate artifacts
+        _, runs = partition(lambda b: b.is_aggregate, runs)
+        self.runs = sorted(runs, key=lambda b: b.value)
+        unit = self.runs[0].unit
+        time_unit = self.runs[0].time_unit
+        less_is_better = not unit.endswith("per_second")
+        values = [b.value for b in self.runs]
+        times = [b.real_time for b in self.runs]
+        # Slight kludge to extract the UserCounters for each benchmark
+        counters = self.runs[0].counters
+        super().__init__(name, unit, less_is_better, values, time_unit, times,
+                         counters)
+
+    def __repr__(self):
+        return "GoogleBenchmark[name={},runs={}]".format(self.names, self.runs)
+
+    @classmethod
+    def from_json(cls, payload):
+        def group_key(x):
+            return x.name
+
+        benchmarks = map(lambda x: GoogleBenchmarkObservation(**x), payload)
+        groups = groupby(sorted(benchmarks, key=group_key), group_key)
+        return [cls(k, list(bs)) for k, bs in groups]
diff --git a/src/arrow/dev/archery/archery/benchmark/jmh.py b/src/arrow/dev/archery/archery/benchmark/jmh.py
new file mode 100644
index 000000000..f531b6de1
--- /dev/null
+++ b/src/arrow/dev/archery/archery/benchmark/jmh.py
@@ -0,0 +1,201 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from itertools import filterfalse, groupby, tee
+import json
+import subprocess
+from tempfile import NamedTemporaryFile
+
+from .core import Benchmark
+from ..utils.command import Command
+from ..utils.maven import Maven
+
+
+def partition(pred, iterable):
+    # adapted from python's examples
+    t1, t2 = tee(iterable)
+    return list(filter(pred, t1)), list(filterfalse(pred, t2))
+
+
+class JavaMicrobenchmarkHarnessCommand(Command):
+    """ Run a Java Micro Benchmark Harness
+
+    This assumes the binary supports the standard command line options,
+    notably `-Dbenchmark_filter`
+    """
+
+    def __init__(self, build, benchmark_filter=None):
+        self.benchmark_filter = benchmark_filter
+        self.build = build
+        self.maven = Maven()
+
+    """ Extract benchmark names from output between "Benchmarks:" and "[INFO]".
+    Assume the following output:
+      ...
+      Benchmarks:
+      org.apache.arrow.vector.IntBenchmarks.setIntDirectly
+      ...
+      org.apache.arrow.vector.IntBenchmarks.setWithValueHolder
+      org.apache.arrow.vector.IntBenchmarks.setWithWriter
+      ...
+      [INFO]
+    """
+
+    def list_benchmarks(self):
+        argv = []
+        if self.benchmark_filter:
+            argv.append("-Dbenchmark.filter={}".format(self.benchmark_filter))
+        result = self.build.list(
+            *argv, stdout=subprocess.PIPE, stderr=subprocess.PIPE)
+
+        lists = []
+        benchmarks = False
+        for line in str.splitlines(result.stdout.decode("utf-8")):
+            if not benchmarks:
+                if line.startswith("Benchmarks:"):
+                    benchmarks = True
+            else:
+                if line.startswith("org.apache.arrow"):
+                    lists.append(line)
+                if line.startswith("[INFO]"):
+                    break
+        return lists
+
+    def results(self, repetitions):
+        with NamedTemporaryFile(suffix=".json") as out:
+            argv = ["-Dbenchmark.runs={}".format(repetitions),
+                    "-Dbenchmark.resultfile={}".format(out.name),
+                    "-Dbenchmark.resultformat=json"]
+            if self.benchmark_filter:
+                argv.append(
+                    "-Dbenchmark.filter={}".format(self.benchmark_filter)
+                )
+
+            self.build.benchmark(*argv, check=True)
+            return json.load(out)
+
+
+class JavaMicrobenchmarkHarnessObservation:
+    """ Represents one run of a single Java Microbenchmark Harness
+    """
+
+    def __init__(self, benchmark, primaryMetric,
+                 forks, warmupIterations, measurementIterations, **counters):
+        self.name = benchmark
+        self.primaryMetric = primaryMetric
+        self.score = primaryMetric["score"]
+        self.score_unit = primaryMetric["scoreUnit"]
+        self.forks = forks
+        self.warmups = warmupIterations
+        self.runs = measurementIterations
+        self.counters = {
+            "mode": counters["mode"],
+            "threads": counters["threads"],
+            "warmups": warmupIterations,
+            "warmupTime": counters["warmupTime"],
+            "measurements": measurementIterations,
+            "measurementTime": counters["measurementTime"],
+            "jvmArgs": counters["jvmArgs"]
+        }
+        self.reciprocal_value = True if self.score_unit.endswith(
+            "/op") else False
+        if self.score_unit.startswith("ops/"):
+            idx = self.score_unit.find("/")
+            self.normalizePerSec(self.score_unit[idx+1:])
+        elif self.score_unit.endswith("/op"):
+            idx = self.score_unit.find("/")
+            self.normalizePerSec(self.score_unit[:idx])
+        else:
+            self.normalizeFactor = 1
+
+    @property
+    def value(self):
+        """ Return the benchmark value."""
+        val = 1 / self.score if self.reciprocal_value else self.score
+        return val * self.normalizeFactor
+
+    def normalizePerSec(self, unit):
+        if unit == "ns":
+            self.normalizeFactor = 1000 * 1000 * 1000
+        elif unit == "us":
+            self.normalizeFactor = 1000 * 1000
+        elif unit == "ms":
+            self.normalizeFactor = 1000
+        elif unit == "min":
+            self.normalizeFactor = 1 / 60
+        elif unit == "hr":
+            self.normalizeFactor = 1 / (60 * 60)
+        elif unit == "day":
+            self.normalizeFactor = 1 / (60 * 60 * 24)
+        else:
+            self.normalizeFactor = 1
+
+    @property
+    def unit(self):
+        if self.score_unit.startswith("ops/"):
+            return "items_per_second"
+        elif self.score_unit.endswith("/op"):
+            return "items_per_second"
+        else:
+            return "?"
+
+    def __repr__(self):
+        return str(self.value)
+
+
+class JavaMicrobenchmarkHarness(Benchmark):
+    """ A set of JavaMicrobenchmarkHarnessObservations. """
+
+    def __init__(self, name, runs):
+        """ Initialize a JavaMicrobenchmarkHarness.
+
+        Parameters
+        ----------
+        name: str
+              Name of the benchmark
+        forks: int
+        warmups: int
+        runs: int
+        runs: list(JavaMicrobenchmarkHarnessObservation)
+              Repetitions of JavaMicrobenchmarkHarnessObservation run.
+
+        """
+        self.name = name
+        self.runs = sorted(runs, key=lambda b: b.value)
+        unit = self.runs[0].unit
+        time_unit = "N/A"
+        less_is_better = not unit.endswith("per_second")
+        values = [b.value for b in self.runs]
+        times = []
+        # Slight kludge to extract the UserCounters for each benchmark
+        counters = self.runs[0].counters
+        super().__init__(name, unit, less_is_better, values, time_unit, times,
+                         counters)
+
+    def __repr__(self):
+        return "JavaMicrobenchmark[name={},runs={}]".format(
+            self.name, self.runs)
+
+    @classmethod
+    def from_json(cls, payload):
+        def group_key(x):
+            return x.name
+
+        benchmarks = map(
+            lambda x: JavaMicrobenchmarkHarnessObservation(**x), payload)
+        groups = groupby(sorted(benchmarks, key=group_key), group_key)
+        return [cls(k, list(bs)) for k, bs in groups]
diff --git a/src/arrow/dev/archery/archery/benchmark/runner.py b/src/arrow/dev/archery/archery/benchmark/runner.py
new file mode 100644
index 000000000..fc6d354b1
--- /dev/null
+++ b/src/arrow/dev/archery/archery/benchmark/runner.py
@@ -0,0 +1,313 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import glob
+import json
+import os
+import re
+
+from .core import BenchmarkSuite
+from .google import GoogleBenchmarkCommand, GoogleBenchmark
+from .jmh import JavaMicrobenchmarkHarnessCommand, JavaMicrobenchmarkHarness
+from ..lang.cpp import CppCMakeDefinition, CppConfiguration
+from ..lang.java import JavaMavenDefinition, JavaConfiguration
+from ..utils.cmake import CMakeBuild
+from ..utils.maven import MavenBuild
+from ..utils.logger import logger
+
+
+def regex_filter(re_expr):
+    if re_expr is None:
+        return lambda s: True
+    re_comp = re.compile(re_expr)
+    return lambda s: re_comp.search(s)
+
+
+DEFAULT_REPETITIONS = 1
+
+
+class BenchmarkRunner:
+    def __init__(self, suite_filter=None, benchmark_filter=None,
+                 repetitions=DEFAULT_REPETITIONS):
+        self.suite_filter = suite_filter
+        self.benchmark_filter = benchmark_filter
+        self.repetitions = repetitions
+
+    @property
+    def suites(self):
+        raise NotImplementedError("BenchmarkRunner must implement suites")
+
+    @staticmethod
+    def from_rev_or_path(src, root, rev_or_path, cmake_conf, **kwargs):
+        raise NotImplementedError(
+            "BenchmarkRunner must implement from_rev_or_path")
+
+
+class StaticBenchmarkRunner(BenchmarkRunner):
+    """ Run suites from a (static) set of suites. """
+
+    def __init__(self, suites, **kwargs):
+        self._suites = suites
+        super().__init__(**kwargs)
+
+    @property
+    def list_benchmarks(self):
+        for suite in self._suites:
+            for benchmark in suite.benchmarks:
+                yield "{}.{}".format(suite.name, benchmark.name)
+
+    @property
+    def suites(self):
+        suite_fn = regex_filter(self.suite_filter)
+        benchmark_fn = regex_filter(self.benchmark_filter)
+
+        for suite in (s for s in self._suites if suite_fn(s.name)):
+            benchmarks = [b for b in suite.benchmarks if benchmark_fn(b.name)]
+            yield BenchmarkSuite(suite.name, benchmarks)
+
+    @classmethod
+    def is_json_result(cls, path_or_str):
+        builder = None
+        try:
+            builder = cls.from_json(path_or_str)
+        except BaseException:
+            pass
+
+        return builder is not None
+
+    @staticmethod
+    def from_json(path_or_str, **kwargs):
+        # .codec imported here to break recursive imports
+        from .codec import BenchmarkRunnerCodec
+        if os.path.isfile(path_or_str):
+            with open(path_or_str) as f:
+                loaded = json.load(f)
+        else:
+            loaded = json.loads(path_or_str)
+        return BenchmarkRunnerCodec.decode(loaded, **kwargs)
+
+    def __repr__(self):
+        return "BenchmarkRunner[suites={}]".format(list(self.suites))
+
+
+class CppBenchmarkRunner(BenchmarkRunner):
+    """ Run suites from a CMakeBuild. """
+
+    def __init__(self, build, **kwargs):
+        """ Initialize a CppBenchmarkRunner. """
+        self.build = build
+        super().__init__(**kwargs)
+
+    @staticmethod
+    def default_configuration(**kwargs):
+        """ Returns the default benchmark configuration. """
+        return CppConfiguration(
+            build_type="release", with_tests=False, with_benchmarks=True,
+            with_compute=True,
+            with_csv=True,
+            with_dataset=True,
+            with_json=True,
+            with_parquet=True,
+            with_python=False,
+            with_brotli=True,
+            with_bz2=True,
+            with_lz4=True,
+            with_snappy=True,
+            with_zlib=True,
+            with_zstd=True,
+            **kwargs)
+
+    @property
+    def suites_binaries(self):
+        """ Returns a list of benchmark binaries for this build. """
+        # Ensure build is up-to-date to run benchmarks
+        self.build()
+        # Not the best method, but works for now
+        glob_expr = os.path.join(self.build.binaries_dir, "*-benchmark")
+        return {os.path.basename(b): b for b in glob.glob(glob_expr)}
+
+    def suite(self, name, suite_bin):
+        """ Returns the resulting benchmarks for a given suite. """
+        suite_cmd = GoogleBenchmarkCommand(suite_bin, self.benchmark_filter)
+
+        # Ensure there will be data
+        benchmark_names = suite_cmd.list_benchmarks()
+        if not benchmark_names:
+            return None
+
+        results = suite_cmd.results(repetitions=self.repetitions)
+        benchmarks = GoogleBenchmark.from_json(results.get("benchmarks"))
+        return BenchmarkSuite(name, benchmarks)
+
+    @property
+    def list_benchmarks(self):
+        for suite_name, suite_bin in self.suites_binaries.items():
+            suite_cmd = GoogleBenchmarkCommand(suite_bin)
+            for benchmark_name in suite_cmd.list_benchmarks():
+                yield "{}.{}".format(suite_name, benchmark_name)
+
+    @property
+    def suites(self):
+        """ Returns all suite for a runner. """
+        suite_matcher = regex_filter(self.suite_filter)
+
+        suite_and_binaries = self.suites_binaries
+        for suite_name in suite_and_binaries:
+            if not suite_matcher(suite_name):
+                logger.debug("Ignoring suite {}".format(suite_name))
+                continue
+
+            suite_bin = suite_and_binaries[suite_name]
+            suite = self.suite(suite_name, suite_bin)
+
+            # Filter may exclude all benchmarks
+            if not suite:
+                logger.debug("Suite {} executed but no results"
+                             .format(suite_name))
+                continue
+
+            yield suite
+
+    @staticmethod
+    def from_rev_or_path(src, root, rev_or_path, cmake_conf, **kwargs):
+        """ Returns a BenchmarkRunner from a path or a git revision.
+
+        First, it checks if `rev_or_path` is a valid path (or string) of a json
+        object that can deserialize to a BenchmarkRunner. If so, it initialize
+        a StaticBenchmarkRunner from it. This allows memoizing the result of a
+        run in a file or a string.
+
+        Second, it checks if `rev_or_path` points to a valid CMake build
+        directory.  If so, it creates a CppBenchmarkRunner with this existing
+        CMakeBuild.
+
+        Otherwise, it assumes `rev_or_path` is a revision and clone/checkout
+        the given revision and create a fresh CMakeBuild.
+        """
+        build = None
+        if StaticBenchmarkRunner.is_json_result(rev_or_path):
+            return StaticBenchmarkRunner.from_json(rev_or_path, **kwargs)
+        elif CMakeBuild.is_build_dir(rev_or_path):
+            build = CMakeBuild.from_path(rev_or_path)
+            return CppBenchmarkRunner(build, **kwargs)
+        else:
+            # Revisions can references remote via the `/` character, ensure
+            # that the revision is path friendly
+            path_rev = rev_or_path.replace("/", "_")
+            root_rev = os.path.join(root, path_rev)
+            os.mkdir(root_rev)
+
+            clone_dir = os.path.join(root_rev, "arrow")
+            # Possibly checkout the sources at given revision, no need to
+            # perform cleanup on cloned repository as root_rev is reclaimed.
+            src_rev, _ = src.at_revision(rev_or_path, clone_dir)
+            cmake_def = CppCMakeDefinition(src_rev.cpp, cmake_conf)
+            build_dir = os.path.join(root_rev, "build")
+            return CppBenchmarkRunner(cmake_def.build(build_dir), **kwargs)
+
+
+class JavaBenchmarkRunner(BenchmarkRunner):
+    """ Run suites for Java. """
+
+    # default repetitions is 5 for Java microbenchmark harness
+    def __init__(self, build, **kwargs):
+        """ Initialize a JavaBenchmarkRunner. """
+        self.build = build
+        super().__init__(**kwargs)
+
+    @staticmethod
+    def default_configuration(**kwargs):
+        """ Returns the default benchmark configuration. """
+        return JavaConfiguration(**kwargs)
+
+    def suite(self, name):
+        """ Returns the resulting benchmarks for a given suite. """
+        # update .m2 directory, which installs target jars
+        self.build.build()
+
+        suite_cmd = JavaMicrobenchmarkHarnessCommand(
+            self.build, self.benchmark_filter)
+
+        # Ensure there will be data
+        benchmark_names = suite_cmd.list_benchmarks()
+        if not benchmark_names:
+            return None
+
+        results = suite_cmd.results(repetitions=self.repetitions)
+        benchmarks = JavaMicrobenchmarkHarness.from_json(results)
+        return BenchmarkSuite(name, benchmarks)
+
+    @property
+    def list_benchmarks(self):
+        """ Returns all suite names """
+        # Ensure build is up-to-date to run benchmarks
+        self.build.build()
+
+        suite_cmd = JavaMicrobenchmarkHarnessCommand(self.build)
+        benchmark_names = suite_cmd.list_benchmarks()
+        for benchmark_name in benchmark_names:
+            yield "{}".format(benchmark_name)
+
+    @property
+    def suites(self):
+        """ Returns all suite for a runner. """
+        suite_name = "JavaBenchmark"
+        suite = self.suite(suite_name)
+
+        # Filter may exclude all benchmarks
+        if not suite:
+            logger.debug("Suite {} executed but no results"
+                         .format(suite_name))
+            return
+
+        yield suite
+
+    @staticmethod
+    def from_rev_or_path(src, root, rev_or_path, maven_conf, **kwargs):
+        """ Returns a BenchmarkRunner from a path or a git revision.
+
+        First, it checks if `rev_or_path` is a valid path (or string) of a json
+        object that can deserialize to a BenchmarkRunner. If so, it initialize
+        a StaticBenchmarkRunner from it. This allows memoizing the result of a
+        run in a file or a string.
+
+        Second, it checks if `rev_or_path` points to a valid Maven build
+        directory.  If so, it creates a JavaBenchmarkRunner with this existing
+        MavenBuild.
+
+        Otherwise, it assumes `rev_or_path` is a revision and clone/checkout
+        the given revision and create a fresh MavenBuild.
+        """
+        if StaticBenchmarkRunner.is_json_result(rev_or_path):
+            return StaticBenchmarkRunner.from_json(rev_or_path, **kwargs)
+        elif MavenBuild.is_build_dir(rev_or_path):
+            maven_def = JavaMavenDefinition(rev_or_path, maven_conf)
+            return JavaBenchmarkRunner(maven_def.build(rev_or_path), **kwargs)
+        else:
+            # Revisions can references remote via the `/` character, ensure
+            # that the revision is path friendly
+            path_rev = rev_or_path.replace("/", "_")
+            root_rev = os.path.join(root, path_rev)
+            os.mkdir(root_rev)
+
+            clone_dir = os.path.join(root_rev, "arrow")
+            # Possibly checkout the sources at given revision, no need to
+            # perform cleanup on cloned repository as root_rev is reclaimed.
+            src_rev, _ = src.at_revision(rev_or_path, clone_dir)
+            maven_def = JavaMavenDefinition(src_rev.java, maven_conf)
+            build_dir = os.path.join(root_rev, "arrow/java")
+            return JavaBenchmarkRunner(maven_def.build(build_dir), **kwargs)
diff --git a/src/arrow/dev/archery/archery/bot.py b/src/arrow/dev/archery/archery/bot.py
new file mode 100644
index 000000000..e8fbbdd04
--- /dev/null
+++ b/src/arrow/dev/archery/archery/bot.py
@@ -0,0 +1,267 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+import shlex
+from pathlib import Path
+from functools import partial
+import tempfile
+
+import click
+import github
+
+from .utils.git import git
+from .utils.logger import logger
+from .crossbow import Repo, Queue, Config, Target, Job, CommentReport
+
+
+class EventError(Exception):
+    pass
+
+
+class CommandError(Exception):
+
+    def __init__(self, message):
+        self.message = message
+
+
+class _CommandMixin:
+
+    def get_help_option(self, ctx):
+        def show_help(ctx, param, value):
+            if value and not ctx.resilient_parsing:
+                raise click.UsageError(ctx.get_help())
+        option = super().get_help_option(ctx)
+        option.callback = show_help
+        return option
+
+    def __call__(self, message, **kwargs):
+        args = shlex.split(message)
+        try:
+            with self.make_context(self.name, args=args, obj=kwargs) as ctx:
+                return self.invoke(ctx)
+        except click.ClickException as e:
+            raise CommandError(e.format_message())
+
+
+class Command(_CommandMixin, click.Command):
+    pass
+
+
+class Group(_CommandMixin, click.Group):
+
+    def command(self, *args, **kwargs):
+        kwargs.setdefault('cls', Command)
+        return super().command(*args, **kwargs)
+
+    def group(self, *args, **kwargs):
+        kwargs.setdefault('cls', Group)
+        return super().group(*args, **kwargs)
+
+    def parse_args(self, ctx, args):
+        if not args and self.no_args_is_help and not ctx.resilient_parsing:
+            raise click.UsageError(ctx.get_help())
+        return super().parse_args(ctx, args)
+
+
+command = partial(click.command, cls=Command)
+group = partial(click.group, cls=Group)
+
+
+class CommentBot:
+
+    def __init__(self, name, handler, token=None):
+        # TODO(kszucs): validate
+        assert isinstance(name, str)
+        assert callable(handler)
+        self.name = name
+        self.handler = handler
+        self.github = github.Github(token)
+
+    def parse_command(self, payload):
+        # only allow users of apache org to submit commands, for more see
+        # https://developer.github.com/v4/enum/commentauthorassociation/
+        allowed_roles = {'OWNER', 'MEMBER', 'CONTRIBUTOR'}
+        mention = '@{}'.format(self.name)
+        comment = payload['comment']
+
+        if payload['sender']['login'] == self.name:
+            raise EventError("Don't respond to itself")
+        elif payload['action'] not in {'created', 'edited'}:
+            raise EventError("Don't respond to comment deletion")
+        elif comment['author_association'] not in allowed_roles:
+            raise EventError(
+                "Don't respond to comments from non-authorized users"
+            )
+        elif not comment['body'].lstrip().startswith(mention):
+            raise EventError("The bot is not mentioned")
+
+        # Parse the comment, removing the bot mentioned (and everything
+        # before it)
+        command = payload['comment']['body'].split(mention)[-1]
+
+        # then split on newlines and keep only the first line
+        # (ignoring all other lines)
+        return command.split("\n")[0].strip()
+
+    def handle(self, event, payload):
+        try:
+            command = self.parse_command(payload)
+        except EventError as e:
+            logger.error(e)
+            # see the possible reasons in the validate method
+            return
+
+        if event == 'issue_comment':
+            return self.handle_issue_comment(command, payload)
+        elif event == 'pull_request_review_comment':
+            return self.handle_review_comment(command, payload)
+        else:
+            raise ValueError("Unexpected event type {}".format(event))
+
+    def handle_issue_comment(self, command, payload):
+        repo = self.github.get_repo(payload['repository']['id'], lazy=True)
+        issue = repo.get_issue(payload['issue']['number'])
+
+        try:
+            pull = issue.as_pull_request()
+        except github.GithubException:
+            return issue.create_comment(
+                "The comment bot only listens to pull request comments!"
+            )
+
+        comment = pull.get_issue_comment(payload['comment']['id'])
+        try:
+            self.handler(command, issue=issue, pull_request=pull,
+                         comment=comment)
+        except CommandError as e:
+            logger.error(e)
+            pull.create_issue_comment("```\n{}\n```".format(e.message))
+        except Exception as e:
+            logger.exception(e)
+            comment.create_reaction('-1')
+        else:
+            comment.create_reaction('+1')
+
+    def handle_review_comment(self, payload):
+        raise NotImplementedError()
+
+
+@group(name='@github-actions')
+@click.pass_context
+def actions(ctx):
+    """Ursabot"""
+    ctx.ensure_object(dict)
+
+
+@actions.group()
+@click.option('--crossbow', '-c', default='ursacomputing/crossbow',
+              help='Crossbow repository on github to use')
+@click.pass_obj
+def crossbow(obj, crossbow):
+    """
+    Trigger crossbow builds for this pull request
+    """
+    obj['crossbow_repo'] = crossbow
+
+
+def _clone_arrow_and_crossbow(dest, crossbow_repo, pull_request):
+    """
+    Clone the repositories and initialize crossbow objects.
+
+    Parameters
+    ----------
+    dest : Path
+        Filesystem path to clone the repositories to.
+    crossbow_repo : str
+        Github repository name, like kszucs/crossbow.
+    pull_request : pygithub.PullRequest
+        Object containing information about the pull request the comment bot
+        was triggered from.
+    """
+    arrow_path = dest / 'arrow'
+    queue_path = dest / 'crossbow'
+
+    # clone arrow and checkout the pull request's branch
+    pull_request_ref = 'pull/{}/head:{}'.format(
+        pull_request.number, pull_request.head.ref
+    )
+    git.clone(pull_request.base.repo.clone_url, str(arrow_path))
+    git.fetch('origin', pull_request_ref, git_dir=arrow_path)
+    git.checkout(pull_request.head.ref, git_dir=arrow_path)
+
+    # clone crossbow repository
+    crossbow_url = 'https://github.com/{}'.format(crossbow_repo)
+    git.clone(crossbow_url, str(queue_path))
+
+    # initialize crossbow objects
+    github_token = os.environ['CROSSBOW_GITHUB_TOKEN']
+    arrow = Repo(arrow_path)
+    queue = Queue(queue_path, github_token=github_token, require_https=True)
+
+    return (arrow, queue)
+
+
+@crossbow.command()
+@click.argument('tasks', nargs=-1, required=False)
+@click.option('--group', '-g', 'groups', multiple=True,
+              help='Submit task groups as defined in tests.yml')
+@click.option('--param', '-p', 'params', multiple=True,
+              help='Additional task parameters for rendering the CI templates')
+@click.option('--arrow-version', '-v', default=None,
+              help='Set target version explicitly.')
+@click.pass_obj
+def submit(obj, tasks, groups, params, arrow_version):
+    """
+    Submit crossbow testing tasks.
+
+    See groups defined in arrow/dev/tasks/tasks.yml
+    """
+    crossbow_repo = obj['crossbow_repo']
+    pull_request = obj['pull_request']
+    with tempfile.TemporaryDirectory() as tmpdir:
+        tmpdir = Path(tmpdir)
+        arrow, queue = _clone_arrow_and_crossbow(
+            dest=Path(tmpdir),
+            crossbow_repo=crossbow_repo,
+            pull_request=pull_request,
+        )
+        # load available tasks configuration and groups from yaml
+        config = Config.load_yaml(arrow.path / "dev" / "tasks" / "tasks.yml")
+        config.validate()
+
+        # initialize the crossbow build's target repository
+        target = Target.from_repo(arrow, version=arrow_version,
+                                  remote=pull_request.head.repo.clone_url,
+                                  branch=pull_request.head.ref)
+
+        # parse additional job parameters
+        params = dict([p.split("=") for p in params])
+
+        # instantiate the job object
+        job = Job.from_config(config=config, target=target, tasks=tasks,
+                              groups=groups, params=params)
+
+        # add the job to the crossbow queue and push to the remote repository
+        queue.put(job, prefix="actions")
+        queue.push()
+
+        # render the response comment's content
+        report = CommentReport(job, crossbow_repo=crossbow_repo)
+
+        # send the response
+        pull_request.create_issue_comment(report.show())
diff --git a/src/arrow/dev/archery/archery/cli.py b/src/arrow/dev/archery/archery/cli.py
new file mode 100644
index 000000000..d408be3cc
--- /dev/null
+++ b/src/arrow/dev/archery/archery/cli.py
@@ -0,0 +1,943 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from collections import namedtuple
+from io import StringIO
+import click
+import errno
+import json
+import logging
+import os
+import pathlib
+import sys
+
+from .benchmark.codec import JsonEncoder
+from .benchmark.compare import RunnerComparator, DEFAULT_THRESHOLD
+from .benchmark.runner import CppBenchmarkRunner, JavaBenchmarkRunner
+from .compat import _import_pandas
+from .lang.cpp import CppCMakeDefinition, CppConfiguration
+from .utils.cli import ArrowBool, validate_arrow_sources, add_optional_command
+from .utils.lint import linter, python_numpydoc, LintValidationException
+from .utils.logger import logger, ctx as log_ctx
+from .utils.source import ArrowSources
+from .utils.tmpdir import tmpdir
+
+# Set default logging to INFO in command line.
+logging.basicConfig(level=logging.INFO)
+
+
+BOOL = ArrowBool()
+
+
+@click.group()
+@click.option("--debug", type=BOOL, is_flag=True, default=False,
+              help="Increase logging with debugging output.")
+@click.option("--pdb", type=BOOL, is_flag=True, default=False,
+              help="Invoke pdb on uncaught exception.")
+@click.option("-q", "--quiet", type=BOOL, is_flag=True, default=False,
+              help="Silence executed commands.")
+@click.pass_context
+def archery(ctx, debug, pdb, quiet):
+    """ Apache Arrow developer utilities.
+
+    See sub-commands help with `archery <cmd> --help`.
+
+    """
+    # Ensure ctx.obj exists
+    ctx.ensure_object(dict)
+
+    log_ctx.quiet = quiet
+    if debug:
+        logger.setLevel(logging.DEBUG)
+
+    ctx.debug = debug
+
+    if pdb:
+        import pdb
+        sys.excepthook = lambda t, v, e: pdb.pm()
+
+
+build_dir_type = click.Path(dir_okay=True, file_okay=False, resolve_path=True)
+# Supported build types
+build_type = click.Choice(["debug", "relwithdebinfo", "release"],
+                          case_sensitive=False)
+# Supported warn levels
+warn_level_type = click.Choice(["everything", "checkin", "production"],
+                               case_sensitive=False)
+
+simd_level = click.Choice(["NONE", "SSE4_2", "AVX2", "AVX512"],
+                          case_sensitive=True)
+
+
+def cpp_toolchain_options(cmd):
+    options = [
+        click.option("--cc", metavar="<compiler>", help="C compiler."),
+        click.option("--cxx", metavar="<compiler>", help="C++ compiler."),
+        click.option("--cxx-flags", help="C++ compiler flags."),
+        click.option("--cpp-package-prefix",
+                     help=("Value to pass for ARROW_PACKAGE_PREFIX and "
+                           "use ARROW_DEPENDENCY_SOURCE=SYSTEM"))
+    ]
+    return _apply_options(cmd, options)
+
+
+def java_toolchain_options(cmd):
+    options = [
+        click.option("--java-home", metavar="<java_home>",
+                     help="Path to Java Developers Kit."),
+        click.option("--java-options", help="java compiler options."),
+    ]
+    return _apply_options(cmd, options)
+
+
+def _apply_options(cmd, options):
+    for option in options:
+        cmd = option(cmd)
+    return cmd
+
+
+@archery.command(short_help="Initialize an Arrow C++ build")
+@click.option("--src", metavar="<arrow_src>", default=None,
+              callback=validate_arrow_sources,
+              help="Specify Arrow source directory")
+# toolchain
+@cpp_toolchain_options
+@click.option("--build-type", default=None, type=build_type,
+              help="CMake's CMAKE_BUILD_TYPE")
+@click.option("--warn-level", default="production", type=warn_level_type,
+              help="Controls compiler warnings -W(no-)error.")
+@click.option("--use-gold-linker", default=True, type=BOOL,
+              help="Toggles ARROW_USE_LD_GOLD option.")
+@click.option("--simd-level", default="SSE4_2", type=simd_level,
+              help="Toggles ARROW_SIMD_LEVEL option.")
+# Tests and benchmarks
+@click.option("--with-tests", default=True, type=BOOL,
+              help="Build with tests.")
+@click.option("--with-benchmarks", default=None, type=BOOL,
+              help="Build with benchmarks.")
+@click.option("--with-examples", default=None, type=BOOL,
+              help="Build with examples.")
+@click.option("--with-integration", default=None, type=BOOL,
+              help="Build with integration test executables.")
+# Static checks
+@click.option("--use-asan", default=None, type=BOOL,
+              help="Toggle ARROW_USE_ASAN sanitizer.")
+@click.option("--use-tsan", default=None, type=BOOL,
+              help="Toggle ARROW_USE_TSAN sanitizer.")
+@click.option("--use-ubsan", default=None, type=BOOL,
+              help="Toggle ARROW_USE_UBSAN sanitizer.")
+@click.option("--with-fuzzing", default=None, type=BOOL,
+              help="Toggle ARROW_FUZZING.")
+# Components
+@click.option("--with-compute", default=None, type=BOOL,
+              help="Build the Arrow compute module.")
+@click.option("--with-csv", default=None, type=BOOL,
+              help="Build the Arrow CSV parser module.")
+@click.option("--with-cuda", default=None, type=BOOL,
+              help="Build the Arrow CUDA extensions.")
+@click.option("--with-dataset", default=None, type=BOOL,
+              help="Build the Arrow dataset module.")
+@click.option("--with-filesystem", default=None, type=BOOL,
+              help="Build the Arrow filesystem layer.")
+@click.option("--with-flight", default=None, type=BOOL,
+              help="Build with Flight rpc support.")
+@click.option("--with-gandiva", default=None, type=BOOL,
+              help="Build with Gandiva expression compiler support.")
+@click.option("--with-hdfs", default=None, type=BOOL,
+              help="Build the Arrow HDFS bridge.")
+@click.option("--with-hiveserver2", default=None, type=BOOL,
+              help="Build the HiveServer2 client and arrow adapater.")
+@click.option("--with-ipc", default=None, type=BOOL,
+              help="Build the Arrow IPC extensions.")
+@click.option("--with-json", default=None, type=BOOL,
+              help="Build the Arrow JSON parser module.")
+@click.option("--with-jni", default=None, type=BOOL,
+              help="Build the Arrow JNI lib.")
+@click.option("--with-mimalloc", default=None, type=BOOL,
+              help="Build the Arrow mimalloc based allocator.")
+@click.option("--with-parquet", default=None, type=BOOL,
+              help="Build with Parquet file support.")
+@click.option("--with-plasma", default=None, type=BOOL,
+              help="Build with Plasma object store support.")
+@click.option("--with-python", default=None, type=BOOL,
+              help="Build the Arrow CPython extesions.")
+@click.option("--with-r", default=None, type=BOOL,
+              help="Build the Arrow R extensions. This is not a CMake option, "
+              "it will toggle required options")
+@click.option("--with-s3", default=None, type=BOOL,
+              help="Build Arrow with S3 support.")
+# Compressions
+@click.option("--with-brotli", default=None, type=BOOL,
+              help="Build Arrow with brotli compression.")
+@click.option("--with-bz2", default=None, type=BOOL,
+              help="Build Arrow with bz2 compression.")
+@click.option("--with-lz4", default=None, type=BOOL,
+              help="Build Arrow with lz4 compression.")
+@click.option("--with-snappy", default=None, type=BOOL,
+              help="Build Arrow with snappy compression.")
+@click.option("--with-zlib", default=None, type=BOOL,
+              help="Build Arrow with zlib compression.")
+@click.option("--with-zstd", default=None, type=BOOL,
+              help="Build Arrow with zstd compression.")
+# CMake extra feature
+@click.option("--cmake-extras", type=str, multiple=True,
+              help="Extra flags/options to pass to cmake invocation. "
+              "Can be stacked")
+@click.option("--install-prefix", type=str,
+              help="Destination directory where files are installed. Expand to"
+              "CMAKE_INSTALL_PREFIX. Defaults to to $CONDA_PREFIX if the"
+              "variable exists.")
+# misc
+@click.option("-f", "--force", type=BOOL, is_flag=True, default=False,
+              help="Delete existing build directory if found.")
+@click.option("--targets", type=str, multiple=True,
+              help="Generator targets to run. Can be stacked.")
+@click.argument("build_dir", type=build_dir_type)
+@click.pass_context
+def build(ctx, src, build_dir, force, targets, **kwargs):
+    """ Initialize a C++ build directory.
+
+    The build command creates a directory initialized with Arrow's cpp source
+    cmake and configuration. It can also optionally invoke the generator to
+    test the build (and used in scripts).
+
+    Note that archery will carry the caller environment. It will also not touch
+    an existing directory, one must use the `--force` option to remove the
+    existing directory.
+
+    Examples:
+
+    \b
+    # Initialize build with clang8 and avx2 support in directory `clang8-build`
+    \b
+    archery build --cc=clang-8 --cxx=clang++-8 --cxx-flags=-mavx2 clang8-build
+
+    \b
+    # Builds and run test
+    archery build --targets=all --targets=test build
+    """
+    # Arrow's cpp cmake configuration
+    conf = CppConfiguration(**kwargs)
+    # This is a closure around cmake invocation, e.g. calling `def.build()`
+    # yields a directory ready to be run with the generator
+    cmake_def = CppCMakeDefinition(src.cpp, conf)
+    # Create build directory
+    build = cmake_def.build(build_dir, force=force)
+
+    for target in targets:
+        build.run(target)
+
+
+LintCheck = namedtuple('LintCheck', ('option_name', 'help'))
+
+lint_checks = [
+    LintCheck('clang-format', "Format C++ files with clang-format."),
+    LintCheck('clang-tidy', "Lint C++ files with clang-tidy."),
+    LintCheck('cpplint', "Lint C++ files with cpplint."),
+    LintCheck('iwyu', "Lint changed C++ files with Include-What-You-Use."),
+    LintCheck('python',
+              "Format and lint Python files with autopep8 and flake8."),
+    LintCheck('numpydoc', "Lint Python files with numpydoc."),
+    LintCheck('cmake-format', "Format CMake files with cmake-format.py."),
+    LintCheck('rat',
+              "Check all sources files for license texts via Apache RAT."),
+    LintCheck('r', "Lint R files."),
+    LintCheck('docker', "Lint Dockerfiles with hadolint."),
+]
+
+
+def decorate_lint_command(cmd):
+    """
+    Decorate the lint() command function to add individual per-check options.
+    """
+    for check in lint_checks:
+        option = click.option("--{0}/--no-{0}".format(check.option_name),
+                              default=None, help=check.help)
+        cmd = option(cmd)
+    return cmd
+
+
+@archery.command(short_help="Check Arrow source tree for errors")
+@click.option("--src", metavar="<arrow_src>", default=None,
+              callback=validate_arrow_sources,
+              help="Specify Arrow source directory")
+@click.option("--fix", is_flag=True, type=BOOL, default=False,
+              help="Toggle fixing the lint errors if the linter supports it.")
+@click.option("--iwyu_all", is_flag=True, type=BOOL, default=False,
+              help="Run IWYU on all C++ files if enabled")
+@click.option("-a", "--all", is_flag=True, default=False,
+              help="Enable all checks.")
+@decorate_lint_command
+@click.pass_context
+def lint(ctx, src, fix, iwyu_all, **checks):
+    if checks.pop('all'):
+        # "--all" is given => enable all non-selected checks
+        for k, v in checks.items():
+            if v is None:
+                checks[k] = True
+    if not any(checks.values()):
+        raise click.UsageError(
+            "Need to enable at least one lint check (try --help)")
+    try:
+        linter(src, fix, iwyu_all=iwyu_all, **checks)
+    except LintValidationException:
+        sys.exit(1)
+
+
+@archery.command(short_help="Lint python docstring with NumpyDoc")
+@click.argument('symbols', nargs=-1)
+@click.option("--src", metavar="<arrow_src>", default=None,
+              callback=validate_arrow_sources,
+              help="Specify Arrow source directory")
+@click.option("--allow-rule", "-a", multiple=True,
+              help="Allow only these rules")
+@click.option("--disallow-rule", "-d", multiple=True,
+              help="Disallow these rules")
+def numpydoc(src, symbols, allow_rule, disallow_rule):
+    """
+    Pass list of modules or symbols as arguments to restrict the validation.
+
+    By default all modules of pyarrow are tried to be validated.
+
+    Examples
+    --------
+    archery numpydoc pyarrow.dataset
+    archery numpydoc pyarrow.csv pyarrow.json pyarrow.parquet
+    archery numpydoc pyarrow.array
+    """
+    disallow_rule = disallow_rule or {'GL01', 'SA01', 'EX01', 'ES01'}
+    try:
+        results = python_numpydoc(symbols, allow_rules=allow_rule,
+                                  disallow_rules=disallow_rule)
+        for result in results:
+            result.ok()
+    except LintValidationException:
+        sys.exit(1)
+
+
+@archery.group()
+@click.pass_context
+def benchmark(ctx):
+    """ Arrow benchmarking.
+
+    Use the diff sub-command to benchmark revisions, and/or build directories.
+    """
+    pass
+
+
+def benchmark_common_options(cmd):
+    def check_language(ctx, param, value):
+        if value not in {"cpp", "java"}:
+            raise click.BadParameter("cpp or java is supported now")
+        return value
+
+    options = [
+        click.option("--src", metavar="<arrow_src>", show_default=True,
+                     default=None, callback=validate_arrow_sources,
+                     help="Specify Arrow source directory"),
+        click.option("--preserve", type=BOOL, default=False, show_default=True,
+                     is_flag=True,
+                     help="Preserve workspace for investigation."),
+        click.option("--output", metavar="<output>",
+                     type=click.File("w", encoding="utf8"), default="-",
+                     help="Capture output result into file."),
+        click.option("--language", metavar="<lang>", type=str, default="cpp",
+                     show_default=True, callback=check_language,
+                     help="Specify target language for the benchmark"),
+        click.option("--build-extras", type=str, multiple=True,
+                     help="Extra flags/options to pass to mvn build. "
+                     "Can be stacked. For language=java"),
+        click.option("--benchmark-extras", type=str, multiple=True,
+                     help="Extra flags/options to pass to mvn benchmark. "
+                     "Can be stacked. For language=java"),
+        click.option("--cmake-extras", type=str, multiple=True,
+                     help="Extra flags/options to pass to cmake invocation. "
+                     "Can be stacked. For language=cpp")
+    ]
+
+    cmd = java_toolchain_options(cmd)
+    cmd = cpp_toolchain_options(cmd)
+    return _apply_options(cmd, options)
+
+
+def benchmark_filter_options(cmd):
+    options = [
+        click.option("--suite-filter", metavar="<regex>", show_default=True,
+                     type=str, default=None,
+                     help="Regex filtering benchmark suites."),
+        click.option("--benchmark-filter", metavar="<regex>",
+                     show_default=True, type=str, default=None,
+                     help="Regex filtering benchmarks.")
+    ]
+    return _apply_options(cmd, options)
+
+
+@benchmark.command(name="list", short_help="List benchmark suite")
+@click.argument("rev_or_path", metavar="[<rev_or_path>]",
+                default="WORKSPACE", required=False)
+@benchmark_common_options
+@click.pass_context
+def benchmark_list(ctx, rev_or_path, src, preserve, output, cmake_extras,
+                   java_home, java_options, build_extras, benchmark_extras,
+                   language, **kwargs):
+    """ List benchmark suite.
+    """
+    with tmpdir(preserve=preserve) as root:
+        logger.debug("Running benchmark {}".format(rev_or_path))
+
+        if language == "cpp":
+            conf = CppBenchmarkRunner.default_configuration(
+                cmake_extras=cmake_extras, **kwargs)
+
+            runner_base = CppBenchmarkRunner.from_rev_or_path(
+                src, root, rev_or_path, conf)
+
+        elif language == "java":
+            for key in {'cpp_package_prefix', 'cxx_flags', 'cxx', 'cc'}:
+                del kwargs[key]
+            conf = JavaBenchmarkRunner.default_configuration(
+                java_home=java_home, java_options=java_options,
+                build_extras=build_extras, benchmark_extras=benchmark_extras,
+                **kwargs)
+
+            runner_base = JavaBenchmarkRunner.from_rev_or_path(
+                src, root, rev_or_path, conf)
+
+        for b in runner_base.list_benchmarks:
+            click.echo(b, file=output)
+
+
+@benchmark.command(name="run", short_help="Run benchmark suite")
+@click.argument("rev_or_path", metavar="[<rev_or_path>]",
+                default="WORKSPACE", required=False)
+@benchmark_common_options
+@benchmark_filter_options
+@click.option("--repetitions", type=int, default=-1,
+              help=("Number of repetitions of each benchmark. Increasing "
+                    "may improve result precision. "
+                    "[default: 1 for cpp, 5 for java"))
+@click.pass_context
+def benchmark_run(ctx, rev_or_path, src, preserve, output, cmake_extras,
+                  java_home, java_options, build_extras, benchmark_extras,
+                  language, suite_filter, benchmark_filter, repetitions,
+                  **kwargs):
+    """ Run benchmark suite.
+
+    This command will run the benchmark suite for a single build. This is
+    used to capture (and/or publish) the results.
+
+    The caller can optionally specify a target which is either a git revision
+    (commit, tag, special values like HEAD) or a cmake build directory.
+
+    When a commit is referenced, a local clone of the arrow sources (specified
+    via --src) is performed and the proper branch is created. This is done in
+    a temporary directory which can be left intact with the `--preserve` flag.
+
+    The special token "WORKSPACE" is reserved to specify the current git
+    workspace. This imply that no clone will be performed.
+
+    Examples:
+
+    \b
+    # Run the benchmarks on current git workspace
+    \b
+    archery benchmark run
+
+    \b
+    # Run the benchmarks on current previous commit
+    \b
+    archery benchmark run HEAD~1
+
+    \b
+    # Run the benchmarks on current previous commit
+    \b
+    archery benchmark run --output=run.json
+    """
+    with tmpdir(preserve=preserve) as root:
+        logger.debug("Running benchmark {}".format(rev_or_path))
+
+        if language == "cpp":
+            conf = CppBenchmarkRunner.default_configuration(
+                cmake_extras=cmake_extras, **kwargs)
+
+            repetitions = repetitions if repetitions != -1 else 1
+            runner_base = CppBenchmarkRunner.from_rev_or_path(
+                src, root, rev_or_path, conf,
+                repetitions=repetitions,
+                suite_filter=suite_filter, benchmark_filter=benchmark_filter)
+
+        elif language == "java":
+            for key in {'cpp_package_prefix', 'cxx_flags', 'cxx', 'cc'}:
+                del kwargs[key]
+            conf = JavaBenchmarkRunner.default_configuration(
+                java_home=java_home, java_options=java_options,
+                build_extras=build_extras, benchmark_extras=benchmark_extras,
+                **kwargs)
+
+            repetitions = repetitions if repetitions != -1 else 5
+            runner_base = JavaBenchmarkRunner.from_rev_or_path(
+                src, root, rev_or_path, conf,
+                repetitions=repetitions,
+                benchmark_filter=benchmark_filter)
+
+        json.dump(runner_base, output, cls=JsonEncoder)
+
+
+@benchmark.command(name="diff", short_help="Compare benchmark suites")
+@benchmark_common_options
+@benchmark_filter_options
+@click.option("--threshold", type=float, default=DEFAULT_THRESHOLD,
+              show_default=True,
+              help="Regression failure threshold in percentage.")
+@click.option("--repetitions", type=int, default=1, show_default=True,
+              help=("Number of repetitions of each benchmark. Increasing "
+                    "may improve result precision. "
+                    "[default: 1 for cpp, 5 for java"))
+@click.option("--no-counters", type=BOOL, default=False, is_flag=True,
+              help="Hide counters field in diff report.")
+@click.argument("contender", metavar="[<contender>",
+                default=ArrowSources.WORKSPACE, required=False)
+@click.argument("baseline", metavar="[<baseline>]]", default="origin/master",
+                required=False)
+@click.pass_context
+def benchmark_diff(ctx, src, preserve, output, language, cmake_extras,
+                   suite_filter, benchmark_filter, repetitions, no_counters,
+                   java_home, java_options, build_extras, benchmark_extras,
+                   threshold, contender, baseline, **kwargs):
+    """Compare (diff) benchmark runs.
+
+    This command acts like git-diff but for benchmark results.
+
+    The caller can optionally specify both the contender and the baseline. If
+    unspecified, the contender will default to the current workspace (like git)
+    and the baseline will default to master.
+
+    Each target (contender or baseline) can either be a git revision
+    (commit, tag, special values like HEAD) or a cmake build directory. This
+    allow comparing git commits, and/or different compilers and/or compiler
+    flags.
+
+    When a commit is referenced, a local clone of the arrow sources (specified
+    via --src) is performed and the proper branch is created. This is done in
+    a temporary directory which can be left intact with the `--preserve` flag.
+
+    The special token "WORKSPACE" is reserved to specify the current git
+    workspace. This imply that no clone will be performed.
+
+    Examples:
+
+    \b
+    # Compare workspace (contender) with master (baseline)
+    \b
+    archery benchmark diff
+
+    \b
+    # Compare master (contender) with latest version (baseline)
+    \b
+    export LAST=$(git tag -l "apache-arrow-[0-9]*" | sort -rV | head -1)
+    \b
+    archery benchmark diff master "$LAST"
+
+    \b
+    # Compare g++7 (contender) with clang++-8 (baseline) builds
+    \b
+    archery build --with-benchmarks=true \\
+            --cxx-flags=-ftree-vectorize \\
+            --cc=gcc-7 --cxx=g++-7 gcc7-build
+    \b
+    archery build --with-benchmarks=true \\
+            --cxx-flags=-flax-vector-conversions \\
+            --cc=clang-8 --cxx=clang++-8 clang8-build
+    \b
+    archery benchmark diff gcc7-build clang8-build
+
+    \b
+    # Compare default targets but scoped to the suites matching
+    # `^arrow-compute-aggregate` and benchmarks matching `(Sum|Mean)Kernel`.
+    \b
+    archery benchmark diff --suite-filter="^arrow-compute-aggregate" \\
+            --benchmark-filter="(Sum|Mean)Kernel"
+
+    \b
+    # Capture result in file `result.json`
+    \b
+    archery benchmark diff --output=result.json
+    \b
+    # Equivalently with no stdout clutter.
+    archery --quiet benchmark diff > result.json
+
+    \b
+    # Comparing with a cached results from `archery benchmark run`
+    \b
+    archery benchmark run --output=run.json HEAD~1
+    \b
+    # This should not recompute the benchmark from run.json
+    archery --quiet benchmark diff WORKSPACE run.json > result.json
+    """
+    with tmpdir(preserve=preserve) as root:
+        logger.debug("Comparing {} (contender) with {} (baseline)"
+                     .format(contender, baseline))
+
+        if language == "cpp":
+            conf = CppBenchmarkRunner.default_configuration(
+                cmake_extras=cmake_extras, **kwargs)
+
+            repetitions = repetitions if repetitions != -1 else 1
+            runner_cont = CppBenchmarkRunner.from_rev_or_path(
+                src, root, contender, conf,
+                repetitions=repetitions,
+                suite_filter=suite_filter,
+                benchmark_filter=benchmark_filter)
+            runner_base = CppBenchmarkRunner.from_rev_or_path(
+                src, root, baseline, conf,
+                repetitions=repetitions,
+                suite_filter=suite_filter,
+                benchmark_filter=benchmark_filter)
+
+        elif language == "java":
+            for key in {'cpp_package_prefix', 'cxx_flags', 'cxx', 'cc'}:
+                del kwargs[key]
+            conf = JavaBenchmarkRunner.default_configuration(
+                java_home=java_home, java_options=java_options,
+                build_extras=build_extras, benchmark_extras=benchmark_extras,
+                **kwargs)
+
+            repetitions = repetitions if repetitions != -1 else 5
+            runner_cont = JavaBenchmarkRunner.from_rev_or_path(
+                src, root, contender, conf,
+                repetitions=repetitions,
+                benchmark_filter=benchmark_filter)
+            runner_base = JavaBenchmarkRunner.from_rev_or_path(
+                src, root, baseline, conf,
+                repetitions=repetitions,
+                benchmark_filter=benchmark_filter)
+
+        runner_comp = RunnerComparator(runner_cont, runner_base, threshold)
+
+        # TODO(kszucs): test that the output is properly formatted jsonlines
+        comparisons_json = _get_comparisons_as_json(runner_comp.comparisons)
+        ren_counters = language == "java"
+        formatted = _format_comparisons_with_pandas(comparisons_json,
+                                                    no_counters, ren_counters)
+        output.write(formatted)
+        output.write('\n')
+
+
+def _get_comparisons_as_json(comparisons):
+    buf = StringIO()
+    for comparator in comparisons:
+        json.dump(comparator, buf, cls=JsonEncoder)
+        buf.write("\n")
+
+    return buf.getvalue()
+
+
+def _format_comparisons_with_pandas(comparisons_json, no_counters,
+                                    ren_counters):
+    pd = _import_pandas()
+    df = pd.read_json(StringIO(comparisons_json), lines=True)
+    # parse change % so we can sort by it
+    df['change %'] = df.pop('change').str[:-1].map(float)
+    first_regression = len(df) - df['regression'].sum()
+
+    fields = ['benchmark', 'baseline', 'contender', 'change %']
+    if not no_counters:
+        fields += ['counters']
+
+    df = df[fields]
+    if ren_counters:
+        df = df.rename(columns={'counters': 'configurations'})
+    df = df.sort_values(by='change %', ascending=False)
+
+    def labelled(title, df):
+        if len(df) == 0:
+            return ''
+        title += ': ({})'.format(len(df))
+        df_str = df.to_string(index=False)
+        bar = '-' * df_str.index('\n')
+        return '\n'.join([bar, title, bar, df_str])
+
+    return '\n\n'.join([labelled('Non-regressions', df[:first_regression]),
+                        labelled('Regressions', df[first_regression:])])
+
+
+# ----------------------------------------------------------------------
+# Integration testing
+
+def _set_default(opt, default):
+    if opt is None:
+        return default
+    return opt
+
+
+@archery.command(short_help="Execute protocol and Flight integration tests")
+@click.option('--with-all', is_flag=True, default=False,
+              help=('Include all known languages by default '
+                    'in integration tests'))
+@click.option('--random-seed', type=int, default=12345,
+              help="Seed for PRNG when generating test data")
+@click.option('--with-cpp', type=bool, default=False,
+              help='Include C++ in integration tests')
+@click.option('--with-csharp', type=bool, default=False,
+              help='Include C# in integration tests')
+@click.option('--with-java', type=bool, default=False,
+              help='Include Java in integration tests')
+@click.option('--with-js', type=bool, default=False,
+              help='Include JavaScript in integration tests')
+@click.option('--with-go', type=bool, default=False,
+              help='Include Go in integration tests')
+@click.option('--with-rust', type=bool, default=False,
+              help='Include Rust in integration tests',
+              envvar="ARCHERY_INTEGRATION_WITH_RUST")
+@click.option('--write_generated_json', default=False,
+              help='Generate test JSON to indicated path')
+@click.option('--run-flight', is_flag=True, default=False,
+              help='Run Flight integration tests')
+@click.option('--debug', is_flag=True, default=False,
+              help='Run executables in debug mode as relevant')
+@click.option('--serial', is_flag=True, default=False,
+              help='Run tests serially, rather than in parallel')
+@click.option('--tempdir', default=None,
+              help=('Directory to use for writing '
+                    'integration test temporary files'))
+@click.option('stop_on_error', '-x', '--stop-on-error',
+              is_flag=True, default=False,
+              help='Stop on first error')
+@click.option('--gold-dirs', multiple=True,
+              help="gold integration test file paths")
+@click.option('-k', '--match',
+              help=("Substring for test names to include in run, "
+                    "e.g. -k primitive"))
+def integration(with_all=False, random_seed=12345, **args):
+    from .integration.runner import write_js_test_json, run_all_tests
+    import numpy as np
+
+    # FIXME(bkietz) Include help strings for individual testers.
+    # For example, CPPTester's ARROW_CPP_EXE_PATH environment variable.
+
+    # Make runs involving data generation deterministic
+    np.random.seed(random_seed)
+
+    gen_path = args['write_generated_json']
+
+    languages = ['cpp', 'csharp', 'java', 'js', 'go', 'rust']
+
+    enabled_languages = 0
+    for lang in languages:
+        param = 'with_{}'.format(lang)
+        if with_all:
+            args[param] = with_all
+
+        if args[param]:
+            enabled_languages += 1
+
+    if gen_path:
+        try:
+            os.makedirs(gen_path)
+        except OSError as e:
+            if e.errno != errno.EEXIST:
+                raise
+        write_js_test_json(gen_path)
+    else:
+        if enabled_languages == 0:
+            raise Exception("Must enable at least 1 language to test")
+        run_all_tests(**args)
+
+
+@archery.command()
+@click.option('--event-name', '-n', required=True)
+@click.option('--event-payload', '-p', type=click.File('r', encoding='utf8'),
+              default='-', required=True)
+@click.option('--arrow-token', envvar='ARROW_GITHUB_TOKEN',
+              help='OAuth token for responding comment in the arrow repo')
+def trigger_bot(event_name, event_payload, arrow_token):
+    from .bot import CommentBot, actions
+
+    event_payload = json.loads(event_payload.read())
+
+    bot = CommentBot(name='github-actions', handler=actions, token=arrow_token)
+    bot.handle(event_name, event_payload)
+
+
+@archery.group('release')
+@click.option("--src", metavar="<arrow_src>", default=None,
+              callback=validate_arrow_sources,
+              help="Specify Arrow source directory.")
+@click.option("--jira-cache", type=click.Path(), default=None,
+              help="File path to cache queried JIRA issues per version.")
+@click.pass_obj
+def release(obj, src, jira_cache):
+    """Release releated commands."""
+    from .release import Jira, CachedJira
+
+    jira = Jira()
+    if jira_cache is not None:
+        jira = CachedJira(jira_cache, jira=jira)
+
+    obj['jira'] = jira
+    obj['repo'] = src.path
+
+
+@release.command('curate')
+@click.argument('version')
+@click.pass_obj
+def release_curate(obj, version):
+    """Release curation."""
+    from .release import Release
+
+    release = Release.from_jira(version, jira=obj['jira'], repo=obj['repo'])
+    curation = release.curate()
+
+    click.echo(curation.render('console'))
+
+
+@release.group('changelog')
+def release_changelog():
+    """Release changelog."""
+    pass
+
+
+@release_changelog.command('add')
+@click.argument('version')
+@click.pass_obj
+def release_changelog_add(obj, version):
+    """Prepend the changelog with the current release"""
+    from .release import Release
+
+    jira, repo = obj['jira'], obj['repo']
+
+    # just handle the current version
+    release = Release.from_jira(version, jira=jira, repo=repo)
+    if release.is_released:
+        raise ValueError('This version has been already released!')
+
+    changelog = release.changelog()
+    changelog_path = pathlib.Path(repo) / 'CHANGELOG.md'
+
+    current_content = changelog_path.read_text()
+    new_content = changelog.render('markdown') + current_content
+
+    changelog_path.write_text(new_content)
+    click.echo("CHANGELOG.md is updated!")
+
+
+@release_changelog.command('generate')
+@click.argument('version')
+@click.argument('output', type=click.File('w', encoding='utf8'), default='-')
+@click.pass_obj
+def release_changelog_generate(obj, version, output):
+    """Generate the changelog of a specific release."""
+    from .release import Release
+
+    jira, repo = obj['jira'], obj['repo']
+
+    # just handle the current version
+    release = Release.from_jira(version, jira=jira, repo=repo)
+
+    changelog = release.changelog()
+    output.write(changelog.render('markdown'))
+
+
+@release_changelog.command('regenerate')
+@click.pass_obj
+def release_changelog_regenerate(obj):
+    """Regeneretate the whole CHANGELOG.md file"""
+    from .release import Release
+
+    jira, repo = obj['jira'], obj['repo']
+    changelogs = []
+
+    for version in jira.project_versions('ARROW'):
+        if not version.released:
+            continue
+        release = Release.from_jira(version, jira=jira, repo=repo)
+        click.echo('Querying changelog for version: {}'.format(version))
+        changelogs.append(release.changelog())
+
+    click.echo('Rendering new CHANGELOG.md file...')
+    changelog_path = pathlib.Path(repo) / 'CHANGELOG.md'
+    with changelog_path.open('w') as fp:
+        for cl in changelogs:
+            fp.write(cl.render('markdown'))
+
+
+@release.command('cherry-pick')
+@click.argument('version')
+@click.option('--dry-run/--execute', default=True,
+              help="Display the git commands instead of executing them.")
+@click.option('--recreate/--continue', default=True,
+              help="Recreate the maintenance branch or only apply unapplied "
+                   "patches.")
+@click.pass_obj
+def release_cherry_pick(obj, version, dry_run, recreate):
+    """
+    Cherry pick commits.
+    """
+    from .release import Release, MinorRelease, PatchRelease
+
+    release = Release.from_jira(version, jira=obj['jira'], repo=obj['repo'])
+    if not isinstance(release, (MinorRelease, PatchRelease)):
+        raise click.UsageError('Cherry-pick command only supported for minor '
+                               'and patch releases')
+
+    if not dry_run:
+        release.cherry_pick_commits(recreate_branch=recreate)
+        click.echo('Executed the following commands:\n')
+
+    click.echo(
+        'git checkout {} -b {}'.format(release.previous.tag, release.branch)
+    )
+    for commit in release.commits_to_pick():
+        click.echo('git cherry-pick {}'.format(commit.hexsha))
+
+
+@archery.group("linking")
+@click.pass_obj
+def linking(obj):
+    """
+    Quick and dirty utilities for checking library linkage.
+    """
+    pass
+
+
+@linking.command("check-dependencies")
+@click.argument("paths", nargs=-1)
+@click.option("--allow", "-a", "allowed", multiple=True,
+              help="Name of the allowed libraries")
+@click.option("--disallow", "-d", "disallowed", multiple=True,
+              help="Name of the disallowed libraries")
+@click.pass_obj
+def linking_check_dependencies(obj, allowed, disallowed, paths):
+    from .linking import check_dynamic_library_dependencies, DependencyError
+
+    allowed, disallowed = set(allowed), set(disallowed)
+    try:
+        for path in map(pathlib.Path, paths):
+            check_dynamic_library_dependencies(path, allowed=allowed,
+                                               disallowed=disallowed)
+    except DependencyError as e:
+        raise click.ClickException(str(e))
+
+
+add_optional_command("docker", module=".docker.cli", function="docker",
+                     parent=archery)
+add_optional_command("crossbow", module=".crossbow.cli", function="crossbow",
+                     parent=archery)
+
+
+if __name__ == "__main__":
+    archery(obj={})
diff --git a/src/arrow/dev/archery/archery/compat.py b/src/arrow/dev/archery/archery/compat.py
new file mode 100644
index 000000000..bb0b15428
--- /dev/null
+++ b/src/arrow/dev/archery/archery/compat.py
@@ -0,0 +1,59 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import pathlib
+import sys
+
+
+def _is_path_like(path):
+    # PEP519 filesystem path protocol is available from python 3.6, so pathlib
+    # doesn't implement __fspath__ for earlier versions
+    return (isinstance(path, str) or
+            hasattr(path, '__fspath__') or
+            isinstance(path, pathlib.Path))
+
+
+def _ensure_path(path):
+    if isinstance(path, pathlib.Path):
+        return path
+    else:
+        return pathlib.Path(_stringify_path(path))
+
+
+def _stringify_path(path):
+    """
+    Convert *path* to a string or unicode path if possible.
+    """
+    if isinstance(path, str):
+        return path
+
+    # checking whether path implements the filesystem protocol
+    try:
+        return path.__fspath__()  # new in python 3.6
+    except AttributeError:
+        # fallback pathlib ckeck for earlier python versions than 3.6
+        if isinstance(path, pathlib.Path):
+            return str(path)
+
+    raise TypeError("not a path-like object")
+
+
+def _import_pandas():
+    # ARROW-13425: avoid importing PyArrow from Pandas
+    sys.modules['pyarrow'] = None
+    import pandas as pd
+    return pd
diff --git a/src/arrow/dev/archery/archery/crossbow/__init__.py b/src/arrow/dev/archery/archery/crossbow/__init__.py
new file mode 100644
index 000000000..bc72e81f0
--- /dev/null
+++ b/src/arrow/dev/archery/archery/crossbow/__init__.py
@@ -0,0 +1,19 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from .core import Config, Repo, Queue, Target, Job  # noqa
+from .reports import CommentReport, ConsoleReport, EmailReport  # noqa
diff --git a/src/arrow/dev/archery/archery/crossbow/cli.py b/src/arrow/dev/archery/archery/crossbow/cli.py
new file mode 100644
index 000000000..1d0610343
--- /dev/null
+++ b/src/arrow/dev/archery/archery/crossbow/cli.py
@@ -0,0 +1,365 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from pathlib import Path
+
+import click
+
+from .core import Config, Repo, Queue, Target, Job, CrossbowError
+from .reports import EmailReport, ConsoleReport
+from ..utils.source import ArrowSources
+
+
+_default_arrow_path = ArrowSources.find().path
+_default_queue_path = _default_arrow_path.parent / "crossbow"
+_default_config_path = _default_arrow_path / "dev" / "tasks" / "tasks.yml"
+
+
+@click.group()
+@click.option('--github-token', '-t', default=None,
+              envvar="CROSSBOW_GITHUB_TOKEN",
+              help='OAuth token for GitHub authentication')
+@click.option('--arrow-path', '-a',
+              type=click.Path(), default=_default_arrow_path,
+              help='Arrow\'s repository path. Defaults to the repository of '
+                   'this script')
+@click.option('--queue-path', '-q',
+              type=click.Path(), default=_default_queue_path,
+              help='The repository path used for scheduling the tasks. '
+                   'Defaults to crossbow directory placed next to arrow')
+@click.option('--queue-remote', '-qr', default=None,
+              help='Force to use this remote URL for the Queue repository')
+@click.option('--output-file', metavar='<output>',
+              type=click.File('w', encoding='utf8'), default='-',
+              help='Capture output result into file.')
+@click.pass_context
+def crossbow(ctx, github_token, arrow_path, queue_path, queue_remote,
+             output_file):
+    """
+    Schedule packaging tasks or nightly builds on CI services.
+    """
+    ctx.ensure_object(dict)
+    ctx.obj['output'] = output_file
+    ctx.obj['arrow'] = Repo(arrow_path)
+    ctx.obj['queue'] = Queue(queue_path, remote_url=queue_remote,
+                             github_token=github_token, require_https=True)
+
+
+@crossbow.command()
+@click.option('--config-path', '-c',
+              type=click.Path(exists=True), default=_default_config_path,
+              help='Task configuration yml. Defaults to tasks.yml')
+@click.pass_obj
+def check_config(obj, config_path):
+    # load available tasks configuration and groups from yaml
+    config = Config.load_yaml(config_path)
+    config.validate()
+
+    output = obj['output']
+    config.show(output)
+
+
+@crossbow.command()
+@click.argument('tasks', nargs=-1, required=False)
+@click.option('--group', '-g', 'groups', multiple=True,
+              help='Submit task groups as defined in task.yml')
+@click.option('--param', '-p', 'params', multiple=True,
+              help='Additional task parameters for rendering the CI templates')
+@click.option('--job-prefix', default='build',
+              help='Arbitrary prefix for branch names, e.g. nightly')
+@click.option('--config-path', '-c',
+              type=click.Path(exists=True), default=_default_config_path,
+              help='Task configuration yml. Defaults to tasks.yml')
+@click.option('--arrow-version', '-v', default=None,
+              help='Set target version explicitly.')
+@click.option('--arrow-remote', '-r', default=None,
+              help='Set GitHub remote explicitly, which is going to be cloned '
+                   'on the CI services. Note, that no validation happens '
+                   'locally. Examples: https://github.com/apache/arrow or '
+                   'https://github.com/kszucs/arrow.')
+@click.option('--arrow-branch', '-b', default=None,
+              help='Give the branch name explicitly, e.g. master, ARROW-1949.')
+@click.option('--arrow-sha', '-t', default=None,
+              help='Set commit SHA or Tag name explicitly, e.g. f67a515, '
+                   'apache-arrow-0.11.1.')
+@click.option('--fetch/--no-fetch', default=True,
+              help='Fetch references (branches and tags) from the remote')
+@click.option('--dry-run/--commit', default=False,
+              help='Just display the rendered CI configurations without '
+                   'committing them')
+@click.option('--no-push/--push', default=False,
+              help='Don\'t push the changes')
+@click.pass_obj
+def submit(obj, tasks, groups, params, job_prefix, config_path, arrow_version,
+           arrow_remote, arrow_branch, arrow_sha, fetch, dry_run, no_push):
+    output = obj['output']
+    queue, arrow = obj['queue'], obj['arrow']
+
+    # load available tasks configuration and groups from yaml
+    config = Config.load_yaml(config_path)
+    try:
+        config.validate()
+    except CrossbowError as e:
+        raise click.ClickException(str(e))
+
+    # Override the detected repo url / remote, branch and sha - this aims to
+    # make release procedure a bit simpler.
+    # Note, that the target resivion's crossbow templates must be
+    # compatible with the locally checked out version of crossbow (which is
+    # in case of the release procedure), because the templates still
+    # contain some business logic (dependency installation, deployments)
+    # which will be reduced to a single command in the future.
+    target = Target.from_repo(arrow, remote=arrow_remote, branch=arrow_branch,
+                              head=arrow_sha, version=arrow_version)
+
+    # parse additional job parameters
+    params = dict([p.split("=") for p in params])
+
+    # instantiate the job object
+    try:
+        job = Job.from_config(config=config, target=target, tasks=tasks,
+                              groups=groups, params=params)
+    except CrossbowError as e:
+        raise click.ClickException(str(e))
+
+    job.show(output)
+    if dry_run:
+        return
+
+    if fetch:
+        queue.fetch()
+    queue.put(job, prefix=job_prefix)
+
+    if no_push:
+        click.echo('Branches and commits created but not pushed: `{}`'
+                   .format(job.branch))
+    else:
+        queue.push()
+        click.echo('Pushed job identifier is: `{}`'.format(job.branch))
+
+
+@crossbow.command()
+@click.argument('task', required=True)
+@click.option('--config-path', '-c',
+              type=click.Path(exists=True), default=_default_config_path,
+              help='Task configuration yml. Defaults to tasks.yml')
+@click.option('--arrow-version', '-v', default=None,
+              help='Set target version explicitly.')
+@click.option('--arrow-remote', '-r', default=None,
+              help='Set GitHub remote explicitly, which is going to be cloned '
+                   'on the CI services. Note, that no validation happens '
+                   'locally. Examples: https://github.com/apache/arrow or '
+                   'https://github.com/kszucs/arrow.')
+@click.option('--arrow-branch', '-b', default=None,
+              help='Give the branch name explicitly, e.g. master, ARROW-1949.')
+@click.option('--arrow-sha', '-t', default=None,
+              help='Set commit SHA or Tag name explicitly, e.g. f67a515, '
+                   'apache-arrow-0.11.1.')
+@click.option('--param', '-p', 'params', multiple=True,
+              help='Additional task parameters for rendering the CI templates')
+@click.pass_obj
+def render(obj, task, config_path, arrow_version, arrow_remote, arrow_branch,
+           arrow_sha, params):
+    """
+    Utility command to check the rendered CI templates.
+    """
+    from .core import _flatten
+
+    def highlight(code):
+        try:
+            from pygments import highlight
+            from pygments.lexers import YamlLexer
+            from pygments.formatters import TerminalFormatter
+            return highlight(code, YamlLexer(), TerminalFormatter())
+        except ImportError:
+            return code
+
+    arrow = obj['arrow']
+
+    target = Target.from_repo(arrow, remote=arrow_remote, branch=arrow_branch,
+                              head=arrow_sha, version=arrow_version)
+    config = Config.load_yaml(config_path)
+    params = dict([p.split("=") for p in params])
+    params["queue_remote_url"] = "https://github.com/org/crossbow"
+    job = Job.from_config(config=config, target=target, tasks=[task],
+                          params=params)
+
+    for task_name, rendered_files in job.render_tasks().items():
+        for path, content in _flatten(rendered_files).items():
+            click.echo('#' * 80)
+            click.echo('### {:^72} ###'.format("/".join(path)))
+            click.echo('#' * 80)
+            click.echo(highlight(content))
+
+
+@crossbow.command()
+@click.argument('job-name', required=True)
+@click.option('--fetch/--no-fetch', default=True,
+              help='Fetch references (branches and tags) from the remote')
+@click.option('--task-filter', '-f', 'task_filters', multiple=True,
+              help='Glob pattern for filtering relevant tasks')
+@click.pass_obj
+def status(obj, job_name, fetch, task_filters):
+    output = obj['output']
+    queue = obj['queue']
+    if fetch:
+        queue.fetch()
+    job = queue.get(job_name)
+
+    report = ConsoleReport(job, task_filters=task_filters)
+    report.show(output)
+
+
+@crossbow.command()
+@click.argument('prefix', required=True)
+@click.option('--fetch/--no-fetch', default=True,
+              help='Fetch references (branches and tags) from the remote')
+@click.pass_obj
+def latest_prefix(obj, prefix, fetch):
+    queue = obj['queue']
+    if fetch:
+        queue.fetch()
+    latest = queue.latest_for_prefix(prefix)
+    click.echo(latest.branch)
+
+
+@crossbow.command()
+@click.argument('job-name', required=True)
+@click.option('--sender-name', '-n',
+              help='Name to use for report e-mail.')
+@click.option('--sender-email', '-e',
+              help='E-mail to use for report e-mail.')
+@click.option('--recipient-email', '-r',
+              help='Where to send the e-mail report')
+@click.option('--smtp-user', '-u',
+              help='E-mail address to use for SMTP login')
+@click.option('--smtp-password', '-P',
+              help='SMTP password to use for report e-mail.')
+@click.option('--smtp-server', '-s', default='smtp.gmail.com',
+              help='SMTP server to use for report e-mail.')
+@click.option('--smtp-port', '-p', default=465,
+              help='SMTP port to use for report e-mail.')
+@click.option('--poll/--no-poll', default=False,
+              help='Wait for completion if there are tasks pending')
+@click.option('--poll-max-minutes', default=180,
+              help='Maximum amount of time waiting for job completion')
+@click.option('--poll-interval-minutes', default=10,
+              help='Number of minutes to wait to check job status again')
+@click.option('--send/--dry-run', default=False,
+              help='Just display the report, don\'t send it')
+@click.option('--fetch/--no-fetch', default=True,
+              help='Fetch references (branches and tags) from the remote')
+@click.pass_obj
+def report(obj, job_name, sender_name, sender_email, recipient_email,
+           smtp_user, smtp_password, smtp_server, smtp_port, poll,
+           poll_max_minutes, poll_interval_minutes, send, fetch):
+    """
+    Send an e-mail report showing success/failure of tasks in a Crossbow run
+    """
+    output = obj['output']
+    queue = obj['queue']
+    if fetch:
+        queue.fetch()
+
+    job = queue.get(job_name)
+    report = EmailReport(
+        job=job,
+        sender_name=sender_name,
+        sender_email=sender_email,
+        recipient_email=recipient_email
+    )
+
+    if poll:
+        job.wait_until_finished(
+            poll_max_minutes=poll_max_minutes,
+            poll_interval_minutes=poll_interval_minutes
+        )
+
+    if send:
+        report.send(
+            smtp_user=smtp_user,
+            smtp_password=smtp_password,
+            smtp_server=smtp_server,
+            smtp_port=smtp_port
+        )
+    else:
+        report.show(output)
+
+
+@crossbow.command()
+@click.argument('job-name', required=True)
+@click.option('-t', '--target-dir',
+              default=_default_arrow_path / 'packages',
+              type=click.Path(file_okay=False, dir_okay=True),
+              help='Directory to download the build artifacts')
+@click.option('--dry-run/--execute', default=False,
+              help='Just display process, don\'t download anything')
+@click.option('--fetch/--no-fetch', default=True,
+              help='Fetch references (branches and tags) from the remote')
+@click.option('--task-filter', '-f', 'task_filters', multiple=True,
+              help='Glob pattern for filtering relevant tasks')
+@click.option('--validate-patterns/--skip-pattern-validation', default=True,
+              help='Whether to validate artifact name patterns or not')
+@click.pass_obj
+def download_artifacts(obj, job_name, target_dir, dry_run, fetch,
+                       validate_patterns, task_filters):
+    """Download build artifacts from GitHub releases"""
+    output = obj['output']
+
+    # fetch the queue repository
+    queue = obj['queue']
+    if fetch:
+        queue.fetch()
+
+    # query the job's artifacts
+    job = queue.get(job_name)
+
+    # create directory to download the assets to
+    target_dir = Path(target_dir).absolute() / job_name
+    target_dir.mkdir(parents=True, exist_ok=True)
+
+    # download the assets while showing the job status
+    def asset_callback(task_name, task, asset):
+        if asset is not None:
+            path = target_dir / task_name / asset.name
+            path.parent.mkdir(exist_ok=True)
+            if not dry_run:
+                asset.download(path)
+
+    click.echo('Downloading {}\'s artifacts.'.format(job_name))
+    click.echo('Destination directory is {}'.format(target_dir))
+    click.echo()
+
+    report = ConsoleReport(job, task_filters=task_filters)
+    report.show(
+        output,
+        asset_callback=asset_callback,
+        validate_patterns=validate_patterns
+    )
+
+
+@crossbow.command()
+@click.argument('patterns', nargs=-1, required=True)
+@click.option('--sha', required=True, help='Target committish')
+@click.option('--tag', required=True, help='Target tag')
+@click.option('--method', default='curl', help='Use cURL to upload')
+@click.pass_obj
+def upload_artifacts(obj, tag, sha, patterns, method):
+    queue = obj['queue']
+    queue.github_overwrite_release_assets(
+        tag_name=tag, target_commitish=sha, method=method, patterns=patterns
+    )
diff --git a/src/arrow/dev/archery/archery/crossbow/core.py b/src/arrow/dev/archery/archery/crossbow/core.py
new file mode 100644
index 000000000..0f2309e47
--- /dev/null
+++ b/src/arrow/dev/archery/archery/crossbow/core.py
@@ -0,0 +1,1172 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+import re
+import fnmatch
+import glob
+import time
+import logging
+import mimetypes
+import subprocess
+import textwrap
+from io import StringIO
+from pathlib import Path
+from datetime import date
+
+import jinja2
+from ruamel.yaml import YAML
+
+try:
+    import github3
+    _have_github3 = True
+except ImportError:
+    github3 = object
+    _have_github3 = False
+
+try:
+    import pygit2
+except ImportError:
+    PygitRemoteCallbacks = object
+else:
+    PygitRemoteCallbacks = pygit2.RemoteCallbacks
+
+from ..utils.source import ArrowSources
+
+
+for pkg in ["requests", "urllib3", "github3"]:
+    logging.getLogger(pkg).setLevel(logging.WARNING)
+
+logger = logging.getLogger("crossbow")
+
+
+class CrossbowError(Exception):
+    pass
+
+
+def _flatten(mapping):
+    """Converts a hierarchical mapping to a flat dictionary"""
+    result = {}
+    for k, v in mapping.items():
+        if isinstance(v, dict):
+            for ik, iv in _flatten(v).items():
+                ik = ik if isinstance(ik, tuple) else (ik,)
+                result[(k,) + ik] = iv
+        elif isinstance(v, list):
+            for ik, iv in enumerate(_flatten(v)):
+                ik = ik if isinstance(ik, tuple) else (ik,)
+                result[(k,) + ik] = iv
+        else:
+            result[(k,)] = v
+    return result
+
+
+def _unflatten(mapping):
+    """Converts a flat tuple => object mapping to hierarchical one"""
+    result = {}
+    for path, value in mapping.items():
+        parents, leaf = path[:-1], path[-1]
+        # create the hierarchy until we reach the leaf value
+        temp = result
+        for parent in parents:
+            temp.setdefault(parent, {})
+            temp = temp[parent]
+        # set the leaf value
+        temp[leaf] = value
+
+    return result
+
+
+def _unflatten_tree(files):
+    """Converts a flat path => object mapping to a hierarchical directories
+
+    Input:
+        {
+            'path/to/file.a': a_content,
+            'path/to/file.b': b_content,
+            'path/file.c': c_content
+        }
+    Output:
+        {
+            'path': {
+                'to': {
+                    'file.a': a_content,
+                    'file.b': b_content
+                },
+                'file.c': c_content
+            }
+        }
+    """
+    files = {tuple(k.split('/')): v for k, v in files.items()}
+    return _unflatten(files)
+
+
+def _render_jinja_template(searchpath, template, params):
+    def format_all(items, pattern):
+        return [pattern.format(item) for item in items]
+
+    loader = jinja2.FileSystemLoader(searchpath)
+    env = jinja2.Environment(loader=loader, trim_blocks=True,
+                             lstrip_blocks=True,
+                             undefined=jinja2.StrictUndefined)
+    env.filters['format_all'] = format_all
+    template = env.get_template(template)
+    return template.render(**params)
+
+
+# configurations for setting up branch skipping
+# - appveyor has a feature to skip builds without an appveyor.yml
+# - travis reads from the master branch and applies the rules
+# - circle requires the configuration to be present on all branch, even ones
+#   that are configured to be skipped
+# - azure skips branches without azure-pipelines.yml by default
+# - github skips branches without .github/workflows/ by default
+
+_default_travis_yml = """
+branches:
+  only:
+    - master
+    - /.*-travis-.*/
+
+os: linux
+dist: trusty
+language: generic
+"""
+
+_default_circle_yml = """
+version: 2
+
+jobs:
+  build:
+    machine: true
+
+workflows:
+  version: 2
+  build:
+    jobs:
+      - build:
+          filters:
+            branches:
+              only:
+                - /.*-circle-.*/
+"""
+
+_default_tree = {
+    '.travis.yml': _default_travis_yml,
+    '.circleci/config.yml': _default_circle_yml
+}
+
+
+class GitRemoteCallbacks(PygitRemoteCallbacks):
+
+    def __init__(self, token):
+        self.token = token
+        self.attempts = 0
+        super().__init__()
+
+    def push_update_reference(self, refname, message):
+        pass
+
+    def update_tips(self, refname, old, new):
+        pass
+
+    def credentials(self, url, username_from_url, allowed_types):
+        # its a libgit2 bug, that it infinitely retries the authentication
+        self.attempts += 1
+
+        if self.attempts >= 5:
+            # pygit2 doesn't propagate the exception properly
+            msg = 'Wrong oauth personal access token'
+            print(msg)
+            raise CrossbowError(msg)
+
+        if (allowed_types &
+                pygit2.credentials.GIT_CREDENTIAL_USERPASS_PLAINTEXT):
+            return pygit2.UserPass(self.token, 'x-oauth-basic')
+        else:
+            return None
+
+
+def _git_ssh_to_https(url):
+    return url.replace('git@github.com:', 'https://github.com/')
+
+
+class Repo:
+    """
+    Base class for interaction with local git repositories
+
+    A high level wrapper used for both reading revision information from
+    arrow's repository and pushing continuous integration tasks to the queue
+    repository.
+
+    Parameters
+    ----------
+    require_https : boolean, default False
+        Raise exception for SSH origin URLs
+    """
+
+    def __init__(self, path, github_token=None, remote_url=None,
+                 require_https=False):
+        self.path = Path(path)
+        self.github_token = github_token
+        self.require_https = require_https
+        self._remote_url = remote_url
+        self._pygit_repo = None
+        self._github_repo = None  # set by as_github_repo()
+        self._updated_refs = []
+
+    def __str__(self):
+        tpl = textwrap.dedent('''
+            Repo: {remote}@{branch}
+            Commit: {head}
+        ''')
+        return tpl.format(
+            remote=self.remote_url,
+            branch=self.branch.branch_name,
+            head=self.head
+        )
+
+    @property
+    def repo(self):
+        if self._pygit_repo is None:
+            self._pygit_repo = pygit2.Repository(str(self.path))
+        return self._pygit_repo
+
+    @property
+    def origin(self):
+        remote = self.repo.remotes['origin']
+        if self.require_https and remote.url.startswith('git@github.com'):
+            raise CrossbowError("Change SSH origin URL to HTTPS to use "
+                                "Crossbow: {}".format(remote.url))
+        return remote
+
+    def fetch(self):
+        refspec = '+refs/heads/*:refs/remotes/origin/*'
+        self.origin.fetch([refspec])
+
+    def push(self, refs=None, github_token=None):
+        github_token = github_token or self.github_token
+        if github_token is None:
+            raise RuntimeError(
+                'Could not determine GitHub token. Please set the '
+                'CROSSBOW_GITHUB_TOKEN environment variable to a '
+                'valid GitHub access token or pass one to --github-token.'
+            )
+        callbacks = GitRemoteCallbacks(github_token)
+        refs = refs or []
+        try:
+            self.origin.push(refs + self._updated_refs, callbacks=callbacks)
+        except pygit2.GitError:
+            raise RuntimeError('Failed to push updated references, '
+                               'potentially because of credential issues: {}'
+                               .format(self._updated_refs))
+        else:
+            self.updated_refs = []
+
+    @property
+    def head(self):
+        """Currently checked out commit's sha"""
+        return self.repo.head
+
+    @property
+    def branch(self):
+        """Currently checked out branch"""
+        try:
+            return self.repo.branches[self.repo.head.shorthand]
+        except KeyError:
+            return None  # detached
+
+    @property
+    def remote(self):
+        """Currently checked out branch's remote counterpart"""
+        try:
+            return self.repo.remotes[self.branch.upstream.remote_name]
+        except (AttributeError, KeyError):
+            return None  # cannot detect
+
+    @property
+    def remote_url(self):
+        """Currently checked out branch's remote counterpart URL
+
+        If an SSH github url is set, it will be replaced by the https
+        equivalent usable with GitHub OAuth token.
+        """
+        try:
+            return self._remote_url or _git_ssh_to_https(self.remote.url)
+        except AttributeError:
+            return None
+
+    @property
+    def user_name(self):
+        try:
+            return next(self.repo.config.get_multivar('user.name'))
+        except StopIteration:
+            return os.environ.get('GIT_COMMITTER_NAME', 'unknown')
+
+    @property
+    def user_email(self):
+        try:
+            return next(self.repo.config.get_multivar('user.email'))
+        except StopIteration:
+            return os.environ.get('GIT_COMMITTER_EMAIL', 'unknown')
+
+    @property
+    def signature(self):
+        return pygit2.Signature(self.user_name, self.user_email,
+                                int(time.time()))
+
+    def create_tree(self, files):
+        builder = self.repo.TreeBuilder()
+
+        for filename, content in files.items():
+            if isinstance(content, dict):
+                # create a subtree
+                tree_id = self.create_tree(content)
+                builder.insert(filename, tree_id, pygit2.GIT_FILEMODE_TREE)
+            else:
+                # create a file
+                blob_id = self.repo.create_blob(content)
+                builder.insert(filename, blob_id, pygit2.GIT_FILEMODE_BLOB)
+
+        tree_id = builder.write()
+        return tree_id
+
+    def create_commit(self, files, parents=None, message='',
+                      reference_name=None):
+        if parents is None:
+            # by default use the main branch as the base of the new branch
+            # required to reuse github actions cache across crossbow tasks
+            commit, _ = self.repo.resolve_refish("master")
+            parents = [commit.id]
+        tree_id = self.create_tree(files)
+
+        author = committer = self.signature
+        commit_id = self.repo.create_commit(reference_name, author, committer,
+                                            message, tree_id, parents)
+        return self.repo[commit_id]
+
+    def create_branch(self, branch_name, files, parents=None, message='',
+                      signature=None):
+        # create commit with the passed tree
+        commit = self.create_commit(files, parents=parents, message=message)
+
+        # create branch pointing to the previously created commit
+        branch = self.repo.create_branch(branch_name, commit)
+
+        # append to the pushable references
+        self._updated_refs.append('refs/heads/{}'.format(branch_name))
+
+        return branch
+
+    def create_tag(self, tag_name, commit_id, message=''):
+        tag_id = self.repo.create_tag(tag_name, commit_id,
+                                      pygit2.GIT_OBJ_COMMIT, self.signature,
+                                      message)
+
+        # append to the pushable references
+        self._updated_refs.append('refs/tags/{}'.format(tag_name))
+
+        return self.repo[tag_id]
+
+    def file_contents(self, commit_id, file):
+        commit = self.repo[commit_id]
+        entry = commit.tree[file]
+        blob = self.repo[entry.id]
+        return blob.data
+
+    def _parse_github_user_repo(self):
+        m = re.match(r'.*\/([^\/]+)\/([^\/\.]+)(\.git)?$', self.remote_url)
+        if m is None:
+            raise CrossbowError(
+                "Unable to parse the github owner and repository from the "
+                "repository's remote url '{}'".format(self.remote_url)
+            )
+        user, repo = m.group(1), m.group(2)
+        return user, repo
+
+    def as_github_repo(self, github_token=None):
+        """Converts it to a repository object which wraps the GitHub API"""
+        if self._github_repo is None:
+            if not _have_github3:
+                raise ImportError('Must install github3.py')
+            github_token = github_token or self.github_token
+            username, reponame = self._parse_github_user_repo()
+            session = github3.session.GitHubSession(
+                default_connect_timeout=10,
+                default_read_timeout=30
+            )
+            github = github3.GitHub(session=session)
+            github.login(token=github_token)
+            self._github_repo = github.repository(username, reponame)
+        return self._github_repo
+
+    def github_commit(self, sha):
+        repo = self.as_github_repo()
+        return repo.commit(sha)
+
+    def github_release(self, tag):
+        repo = self.as_github_repo()
+        try:
+            return repo.release_from_tag(tag)
+        except github3.exceptions.NotFoundError:
+            return None
+
+    def github_upload_asset_requests(self, release, path, name, mime,
+                                     max_retries=None, retry_backoff=None):
+        if max_retries is None:
+            max_retries = int(os.environ.get('CROSSBOW_MAX_RETRIES', 8))
+        if retry_backoff is None:
+            retry_backoff = int(os.environ.get('CROSSBOW_RETRY_BACKOFF', 5))
+
+        for i in range(max_retries):
+            try:
+                with open(path, 'rb') as fp:
+                    result = release.upload_asset(name=name, asset=fp,
+                                                  content_type=mime)
+            except github3.exceptions.ResponseError as e:
+                logger.error('Attempt {} has failed with message: {}.'
+                             .format(i + 1, str(e)))
+                logger.error('Error message {}'.format(e.msg))
+                logger.error('List of errors provided by Github:')
+                for err in e.errors:
+                    logger.error(' - {}'.format(err))
+
+                if e.code == 422:
+                    # 422 Validation Failed, probably raised because
+                    # ReleaseAsset already exists, so try to remove it before
+                    # reattempting the asset upload
+                    for asset in release.assets():
+                        if asset.name == name:
+                            logger.info('Release asset {} already exists, '
+                                        'removing it...'.format(name))
+                            asset.delete()
+                            logger.info('Asset {} removed.'.format(name))
+                            break
+            except github3.exceptions.ConnectionError as e:
+                logger.error('Attempt {} has failed with message: {}.'
+                             .format(i + 1, str(e)))
+            else:
+                logger.info('Attempt {} has finished.'.format(i + 1))
+                return result
+
+            time.sleep(retry_backoff)
+
+        raise RuntimeError('Github asset uploading has failed!')
+
+    def github_upload_asset_curl(self, release, path, name, mime):
+        upload_url, _ = release.upload_url.split('{?')
+        upload_url += '?name={}'.format(name)
+
+        command = [
+            'curl',
+            '--fail',
+            '-H', "Authorization: token {}".format(self.github_token),
+            '-H', "Content-Type: {}".format(mime),
+            '--data-binary', '@{}'.format(path),
+            upload_url
+        ]
+        return subprocess.run(command, shell=False, check=True)
+
+    def github_overwrite_release_assets(self, tag_name, target_commitish,
+                                        patterns, method='requests'):
+        # Since github has changed something the asset uploading via requests
+        # got instable, so prefer the cURL alternative.
+        # Potential cause:
+        #    sigmavirus24/github3.py/issues/779#issuecomment-379470626
+        repo = self.as_github_repo()
+        if not tag_name:
+            raise CrossbowError('Empty tag name')
+        if not target_commitish:
+            raise CrossbowError('Empty target commit for the release tag')
+
+        # remove the whole release if it already exists
+        try:
+            release = repo.release_from_tag(tag_name)
+        except github3.exceptions.NotFoundError:
+            pass
+        else:
+            release.delete()
+
+        release = repo.create_release(tag_name, target_commitish)
+        for pattern in patterns:
+            for path in glob.glob(pattern, recursive=True):
+                name = os.path.basename(path)
+                size = os.path.getsize(path)
+                mime = mimetypes.guess_type(name)[0] or 'application/zip'
+
+                logger.info(
+                    'Uploading asset `{}` with mimetype {} and size {}...'
+                    .format(name, mime, size)
+                )
+
+                if method == 'requests':
+                    self.github_upload_asset_requests(release, path, name=name,
+                                                      mime=mime)
+                elif method == 'curl':
+                    self.github_upload_asset_curl(release, path, name=name,
+                                                  mime=mime)
+                else:
+                    raise CrossbowError(
+                        'Unsupported upload method {}'.format(method)
+                    )
+
+
+class Queue(Repo):
+
+    def _latest_prefix_id(self, prefix):
+        pattern = re.compile(r'[\w\/-]*{}-(\d+)'.format(prefix))
+        matches = list(filter(None, map(pattern.match, self.repo.branches)))
+        if matches:
+            latest = max(int(m.group(1)) for m in matches)
+        else:
+            latest = -1
+        return latest
+
+    def _next_job_id(self, prefix):
+        """Auto increments the branch's identifier based on the prefix"""
+        latest_id = self._latest_prefix_id(prefix)
+        return '{}-{}'.format(prefix, latest_id + 1)
+
+    def latest_for_prefix(self, prefix):
+        latest_id = self._latest_prefix_id(prefix)
+        if latest_id < 0:
+            raise RuntimeError(
+                'No job has been submitted with prefix {} yet'.format(prefix)
+            )
+        job_name = '{}-{}'.format(prefix, latest_id)
+        return self.get(job_name)
+
+    def date_of(self, job):
+        # it'd be better to bound to the queue repository on deserialization
+        # and reorganize these methods to Job
+        branch_name = 'origin/{}'.format(job.branch)
+        branch = self.repo.branches[branch_name]
+        commit = self.repo[branch.target]
+        return date.fromtimestamp(commit.commit_time)
+
+    def jobs(self, pattern):
+        """Return jobs sorted by its identifier in reverse order"""
+        job_names = []
+        for name in self.repo.branches.remote:
+            origin, name = name.split('/', 1)
+            result = re.match(pattern, name)
+            if result:
+                job_names.append(name)
+
+        for name in sorted(job_names, reverse=True):
+            yield self.get(name)
+
+    def get(self, job_name):
+        branch_name = 'origin/{}'.format(job_name)
+        branch = self.repo.branches[branch_name]
+        try:
+            content = self.file_contents(branch.target, 'job.yml')
+        except KeyError:
+            raise CrossbowError(
+                'No job is found with name: {}'.format(job_name)
+            )
+
+        buffer = StringIO(content.decode('utf-8'))
+        job = yaml.load(buffer)
+        job.queue = self
+        return job
+
+    def put(self, job, prefix='build'):
+        if not isinstance(job, Job):
+            raise CrossbowError('`job` must be an instance of Job')
+        if job.branch is not None:
+            raise CrossbowError('`job.branch` is automatically generated, '
+                                'thus it must be blank')
+
+        if job.target.remote is None:
+            raise CrossbowError(
+                'Cannot determine git remote for the Arrow repository to '
+                'clone or push to, try to push the `{}` branch first to have '
+                'a remote tracking counterpart.'.format(job.target.branch)
+            )
+        if job.target.branch is None:
+            raise CrossbowError(
+                'Cannot determine the current branch of the Arrow repository '
+                'to clone or push to, perhaps it is in detached HEAD state. '
+                'Please checkout a branch.'
+            )
+
+        # auto increment and set next job id, e.g. build-85
+        job._queue = self
+        job.branch = self._next_job_id(prefix)
+
+        # create tasks' branches
+        for task_name, task in job.tasks.items():
+            # adding CI's name to the end of the branch in order to use skip
+            # patterns on travis and circleci
+            task.branch = '{}-{}-{}'.format(job.branch, task.ci, task_name)
+            params = {
+                **job.params,
+                "arrow": job.target,
+                "queue_remote_url": self.remote_url
+            }
+            files = task.render_files(job.template_searchpath, params=params)
+            branch = self.create_branch(task.branch, files=files)
+            self.create_tag(task.tag, branch.target)
+            task.commit = str(branch.target)
+
+        # create job's branch with its description
+        return self.create_branch(job.branch, files=job.render_files())
+
+
+def get_version(root, **kwargs):
+    """
+    Parse function for setuptools_scm that ignores tags for non-C++
+    subprojects, e.g. apache-arrow-js-XXX tags.
+    """
+    from setuptools_scm.git import parse as parse_git_version
+
+    # query the calculated version based on the git tags
+    kwargs['describe_command'] = (
+        'git describe --dirty --tags --long --match "apache-arrow-[0-9].*"'
+    )
+    version = parse_git_version(root, **kwargs)
+    tag = str(version.tag)
+
+    # We may get a development tag for the next version, such as "5.0.0.dev0",
+    # or the tag of an already released version, such as "4.0.0".
+    # In the latter case, we need to increment the version so that the computed
+    # version comes after any patch release (the next feature version after
+    # 4.0.0 is 5.0.0).
+    pattern = r"^(\d+)\.(\d+)\.(\d+)"
+    match = re.match(pattern, tag)
+    major, minor, patch = map(int, match.groups())
+    if 'dev' not in tag:
+        major += 1
+
+    return "{}.{}.{}.dev{}".format(major, minor, patch, version.distance)
+
+
+class Serializable:
+
+    @classmethod
+    def to_yaml(cls, representer, data):
+        tag = '!{}'.format(cls.__name__)
+        dct = {k: v for k, v in data.__dict__.items() if not k.startswith('_')}
+        return representer.represent_mapping(tag, dct)
+
+
+class Target(Serializable):
+    """
+    Describes target repository and revision the builds run against
+
+    This serializable data container holding information about arrow's
+    git remote, branch, sha and version number as well as some metadata
+    (currently only an email address where the notification should be sent).
+    """
+
+    def __init__(self, head, branch, remote, version, email=None):
+        self.head = head
+        self.email = email
+        self.branch = branch
+        self.remote = remote
+        self.version = version
+        self.no_rc_version = re.sub(r'-rc\d+\Z', '', version)
+        # Semantic Versioning 1.0.0: https://semver.org/spec/v1.0.0.html
+        #
+        # > A pre-release version number MAY be denoted by appending an
+        # > arbitrary string immediately following the patch version and a
+        # > dash. The string MUST be comprised of only alphanumerics plus
+        # > dash [0-9A-Za-z-].
+        #
+        # Example:
+        #
+        #   '0.16.1.dev10' ->
+        #   '0.16.1-dev10'
+        self.no_rc_semver_version = \
+            re.sub(r'\.(dev\d+)\Z', r'-\1', self.no_rc_version)
+
+    @classmethod
+    def from_repo(cls, repo, head=None, branch=None, remote=None, version=None,
+                  email=None):
+        """Initialize from a repository
+
+        Optionally override detected remote, branch, head, and/or version.
+        """
+        assert isinstance(repo, Repo)
+
+        if head is None:
+            head = str(repo.head.target)
+        if branch is None:
+            branch = repo.branch.branch_name
+        if remote is None:
+            remote = repo.remote_url
+        if version is None:
+            version = get_version(repo.path)
+        if email is None:
+            email = repo.user_email
+
+        return cls(head=head, email=email, branch=branch, remote=remote,
+                   version=version)
+
+
+class Task(Serializable):
+    """
+    Describes a build task and metadata required to render CI templates
+
+    A task is represented as a single git commit and branch containing jinja2
+    rendered files (currently appveyor.yml or .travis.yml configurations).
+
+    A task can't be directly submitted to a queue, must belong to a job.
+    Each task's unique identifier is its branch name, which is generated after
+    submitting the job to a queue.
+    """
+
+    def __init__(self, ci, template, artifacts=None, params=None):
+        assert ci in {
+            'circle',
+            'travis',
+            'appveyor',
+            'azure',
+            'github',
+            'drone',
+        }
+        self.ci = ci
+        self.template = template
+        self.artifacts = artifacts or []
+        self.params = params or {}
+        self.branch = None  # filled after adding to a queue
+        self.commit = None  # filled after adding to a queue
+        self._queue = None  # set by the queue object after put or get
+        self._status = None  # status cache
+        self._assets = None  # assets cache
+
+    def render_files(self, searchpath, params=None):
+        params = {**self.params, **(params or {}), "task": self}
+        try:
+            rendered = _render_jinja_template(searchpath, self.template,
+                                              params=params)
+        except jinja2.TemplateError as e:
+            raise RuntimeError(
+                'Failed to render template `{}` with {}: {}'.format(
+                    self.template, e.__class__.__name__, str(e)
+                )
+            )
+
+        tree = {**_default_tree, self.filename: rendered}
+        return _unflatten_tree(tree)
+
+    @property
+    def tag(self):
+        return self.branch
+
+    @property
+    def filename(self):
+        config_files = {
+            'circle': '.circleci/config.yml',
+            'travis': '.travis.yml',
+            'appveyor': 'appveyor.yml',
+            'azure': 'azure-pipelines.yml',
+            'github': '.github/workflows/crossbow.yml',
+            'drone': '.drone.yml',
+        }
+        return config_files[self.ci]
+
+    def status(self, force_query=False):
+        _status = getattr(self, '_status', None)
+        if force_query or _status is None:
+            github_commit = self._queue.github_commit(self.commit)
+            self._status = TaskStatus(github_commit)
+        return self._status
+
+    def assets(self, force_query=False, validate_patterns=True):
+        _assets = getattr(self, '_assets', None)
+        if force_query or _assets is None:
+            github_release = self._queue.github_release(self.tag)
+            self._assets = TaskAssets(github_release,
+                                      artifact_patterns=self.artifacts,
+                                      validate_patterns=validate_patterns)
+        return self._assets
+
+
+class TaskStatus:
+    """
+    Combine the results from status and checks API to a single state.
+
+    Azure pipelines uses checks API which doesn't provide a combined
+    interface like status API does, so we need to manually combine
+    both the commit statuses and the commit checks coming from
+    different API endpoint
+
+    Status.state: error, failure, pending or success, default pending
+    CheckRun.status: queued, in_progress or completed, default: queued
+    CheckRun.conclusion: success, failure, neutral, cancelled, timed_out
+                            or action_required, only set if
+                            CheckRun.status == 'completed'
+
+    1. Convert CheckRun's status and conclusion to one of Status.state
+    2. Merge the states based on the following rules:
+        - failure if any of the contexts report as error or failure
+        - pending if there are no statuses or a context is pending
+        - success if the latest status for all contexts is success
+        error otherwise.
+
+    Parameters
+    ----------
+    commit : github3.Commit
+        Commit to query the combined status for.
+
+    Returns
+    -------
+    TaskStatus(
+        combined_state='error|failure|pending|success',
+        github_status='original github status object',
+        github_check_runs='github checks associated with the commit',
+        total_count='number of statuses and checks'
+    )
+    """
+
+    def __init__(self, commit):
+        status = commit.status()
+        check_runs = list(commit.check_runs())
+        states = [s.state for s in status.statuses]
+
+        for check in check_runs:
+            if check.status == 'completed':
+                if check.conclusion in {'success', 'failure'}:
+                    states.append(check.conclusion)
+                elif check.conclusion in {'cancelled', 'timed_out',
+                                          'action_required'}:
+                    states.append('error')
+                # omit `neutral` conclusion
+            else:
+                states.append('pending')
+
+        # it could be more effective, but the following is more descriptive
+        combined_state = 'error'
+        if len(states):
+            if any(state in {'error', 'failure'} for state in states):
+                combined_state = 'failure'
+            elif any(state == 'pending' for state in states):
+                combined_state = 'pending'
+            elif all(state == 'success' for state in states):
+                combined_state = 'success'
+
+        # show link to the actual build, some of the CI providers implement
+        # the statuses API others implement the checks API, so display both
+        build_links = [s.target_url for s in status.statuses]
+        build_links += [c.html_url for c in check_runs]
+
+        self.combined_state = combined_state
+        self.github_status = status
+        self.github_check_runs = check_runs
+        self.total_count = len(states)
+        self.build_links = build_links
+
+
+class TaskAssets(dict):
+
+    def __init__(self, github_release, artifact_patterns,
+                 validate_patterns=True):
+        # HACK(kszucs): don't expect uploaded assets of no atifacts were
+        # defiened for the tasks in order to spare a bit of github rate limit
+        if not artifact_patterns:
+            return
+
+        if github_release is None:
+            github_assets = {}  # no assets have been uploaded for the task
+        else:
+            github_assets = {a.name: a for a in github_release.assets()}
+
+        if not validate_patterns:
+            # shortcut to avoid pattern validation and just set all artifacts
+            return self.update(github_assets)
+
+        for pattern in artifact_patterns:
+            # artifact can be a regex pattern
+            compiled = re.compile(f"^{pattern}$")
+            matches = list(
+                filter(None, map(compiled.match, github_assets.keys()))
+            )
+            num_matches = len(matches)
+
+            # validate artifact pattern matches single asset
+            if num_matches == 0:
+                self[pattern] = None
+            elif num_matches == 1:
+                self[pattern] = github_assets[matches[0].group(0)]
+            else:
+                raise CrossbowError(
+                    'Only a single asset should match pattern `{}`, there are '
+                    'multiple ones: {}'.format(pattern, ', '.join(matches))
+                )
+
+    def missing_patterns(self):
+        return [pattern for pattern, asset in self.items() if asset is None]
+
+    def uploaded_assets(self):
+        return [asset for asset in self.values() if asset is not None]
+
+
+class Job(Serializable):
+    """Describes multiple tasks against a single target repository"""
+
+    def __init__(self, target, tasks, params=None, template_searchpath=None):
+        if not tasks:
+            raise ValueError('no tasks were provided for the job')
+        if not all(isinstance(task, Task) for task in tasks.values()):
+            raise ValueError('each `tasks` mus be an instance of Task')
+        if not isinstance(target, Target):
+            raise ValueError('`target` must be an instance of Target')
+        if not isinstance(target, Target):
+            raise ValueError('`target` must be an instance of Target')
+        if not isinstance(params, dict):
+            raise ValueError('`params` must be an instance of dict')
+
+        self.target = target
+        self.tasks = tasks
+        self.params = params or {}  # additional parameters for the tasks
+        self.branch = None  # filled after adding to a queue
+        self._queue = None  # set by the queue object after put or get
+        if template_searchpath is None:
+            self._template_searchpath = ArrowSources.find().path
+        else:
+            self._template_searchpath = template_searchpath
+
+    def render_files(self):
+        with StringIO() as buf:
+            yaml.dump(self, buf)
+            content = buf.getvalue()
+        tree = {**_default_tree, "job.yml": content}
+        return _unflatten_tree(tree)
+
+    def render_tasks(self, params=None):
+        result = {}
+        params = {
+            **self.params,
+            "arrow": self.target,
+            **(params or {})
+        }
+        for task_name, task in self.tasks.items():
+            files = task.render_files(self._template_searchpath, params)
+            result[task_name] = files
+        return result
+
+    @property
+    def template_searchpath(self):
+        return self._template_searchpath
+
+    @property
+    def queue(self):
+        assert isinstance(self._queue, Queue)
+        return self._queue
+
+    @queue.setter
+    def queue(self, queue):
+        assert isinstance(queue, Queue)
+        self._queue = queue
+        for task in self.tasks.values():
+            task._queue = queue
+
+    @property
+    def email(self):
+        return os.environ.get('CROSSBOW_EMAIL', self.target.email)
+
+    @property
+    def date(self):
+        return self.queue.date_of(self)
+
+    def show(self, stream=None):
+        return yaml.dump(self, stream=stream)
+
+    @classmethod
+    def from_config(cls, config, target, tasks=None, groups=None, params=None):
+        """
+        Intantiate a job from based on a config.
+
+        Parameters
+        ----------
+        config : dict
+            Deserialized content of tasks.yml
+        target : Target
+            Describes target repository and revision the builds run against.
+        tasks : Optional[List[str]], default None
+            List of glob patterns for matching task names.
+        groups : Optional[List[str]], default None
+            List of exact group names matching predefined task sets in the
+            config.
+        params : Optional[Dict[str, str]], default None
+            Additional rendering parameters for the task templates.
+
+        Returns
+        -------
+        Job
+
+        Raises
+        ------
+        Exception:
+            If invalid groups or tasks has been passed.
+        """
+        task_definitions = config.select(tasks, groups=groups)
+
+        # instantiate the tasks
+        tasks = {}
+        versions = {'version': target.version,
+                    'no_rc_version': target.no_rc_version,
+                    'no_rc_semver_version': target.no_rc_semver_version}
+        for task_name, task in task_definitions.items():
+            artifacts = task.pop('artifacts', None) or []  # because of yaml
+            artifacts = [fn.format(**versions) for fn in artifacts]
+            tasks[task_name] = Task(artifacts=artifacts, **task)
+
+        return cls(target=target, tasks=tasks, params=params,
+                   template_searchpath=config.template_searchpath)
+
+    def is_finished(self):
+        for task in self.tasks.values():
+            status = task.status(force_query=True)
+            if status.combined_state == 'pending':
+                return False
+        return True
+
+    def wait_until_finished(self, poll_max_minutes=120,
+                            poll_interval_minutes=10):
+        started_at = time.time()
+        while True:
+            if self.is_finished():
+                break
+
+            waited_for_minutes = (time.time() - started_at) / 60
+            if waited_for_minutes > poll_max_minutes:
+                msg = ('Exceeded the maximum amount of time waiting for job '
+                       'to finish, waited for {} minutes.')
+                raise RuntimeError(msg.format(waited_for_minutes))
+
+            logger.info('Waiting {} minutes and then checking again'
+                        .format(poll_interval_minutes))
+            time.sleep(poll_interval_minutes * 60)
+
+
+class Config(dict):
+
+    def __init__(self, tasks, template_searchpath):
+        super().__init__(tasks)
+        self.template_searchpath = template_searchpath
+
+    @classmethod
+    def load_yaml(cls, path):
+        path = Path(path)
+        searchpath = path.parent
+        rendered = _render_jinja_template(searchpath, template=path.name,
+                                          params={})
+        config = yaml.load(rendered)
+        return cls(config, template_searchpath=searchpath)
+
+    def show(self, stream=None):
+        return yaml.dump(dict(self), stream=stream)
+
+    def select(self, tasks=None, groups=None):
+        config_groups = dict(self['groups'])
+        config_tasks = dict(self['tasks'])
+        valid_groups = set(config_groups.keys())
+        valid_tasks = set(config_tasks.keys())
+        group_whitelist = list(groups or [])
+        task_whitelist = list(tasks or [])
+
+        # validate that the passed groups are defined in the config
+        requested_groups = set(group_whitelist)
+        invalid_groups = requested_groups - valid_groups
+        if invalid_groups:
+            msg = 'Invalid group(s) {!r}. Must be one of {!r}'.format(
+                invalid_groups, valid_groups
+            )
+            raise CrossbowError(msg)
+
+        # merge the tasks defined in the selected groups
+        task_patterns = [list(config_groups[name]) for name in group_whitelist]
+        task_patterns = set(sum(task_patterns, task_whitelist))
+
+        # treat the task names as glob patterns to select tasks more easily
+        requested_tasks = set()
+        for pattern in task_patterns:
+            matches = fnmatch.filter(valid_tasks, pattern)
+            if len(matches):
+                requested_tasks.update(matches)
+            else:
+                raise CrossbowError(
+                    "Unable to match any tasks for `{}`".format(pattern)
+                )
+
+        # validate that the passed and matched tasks are defined in the config
+        invalid_tasks = requested_tasks - valid_tasks
+        if invalid_tasks:
+            msg = 'Invalid task(s) {!r}. Must be one of {!r}'.format(
+                invalid_tasks, valid_tasks
+            )
+            raise CrossbowError(msg)
+
+        return {
+            task_name: config_tasks[task_name] for task_name in requested_tasks
+        }
+
+    def validate(self):
+        # validate that the task groups are properly referening the tasks
+        for group_name, group in self['groups'].items():
+            for pattern in group:
+                tasks = self.select(tasks=[pattern])
+                if not tasks:
+                    raise CrossbowError(
+                        "The pattern `{}` defined for task group `{}` is not "
+                        "matching any of the tasks defined in the "
+                        "configuration file.".format(pattern, group_name)
+                    )
+
+        # validate that the tasks are constructible
+        for task_name, task in self['tasks'].items():
+            try:
+                Task(**task)
+            except Exception as e:
+                raise CrossbowError(
+                    'Unable to construct a task object from the '
+                    'definition  of task `{}`. The original error message '
+                    'is: `{}`'.format(task_name, str(e))
+                )
+
+        # validate that the defined tasks are renderable, in order to to that
+        # define the required object with dummy data
+        target = Target(
+            head='e279a7e06e61c14868ca7d71dea795420aea6539',
+            branch='master',
+            remote='https://github.com/apache/arrow',
+            version='1.0.0dev123',
+            email='dummy@example.ltd'
+        )
+
+        for task_name, task in self['tasks'].items():
+            task = Task(**task)
+            files = task.render_files(
+                self.template_searchpath,
+                params=dict(
+                    arrow=target,
+                    queue_remote_url='https://github.com/org/crossbow'
+                )
+            )
+            if not files:
+                raise CrossbowError('No files have been rendered for task `{}`'
+                                    .format(task_name))
+
+
+# configure yaml serializer
+yaml = YAML()
+yaml.register_class(Job)
+yaml.register_class(Task)
+yaml.register_class(Target)
diff --git a/src/arrow/dev/archery/archery/crossbow/reports.py b/src/arrow/dev/archery/archery/crossbow/reports.py
new file mode 100644
index 000000000..f86a67a74
--- /dev/null
+++ b/src/arrow/dev/archery/archery/crossbow/reports.py
@@ -0,0 +1,315 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import click
+import collections
+import operator
+import fnmatch
+import functools
+from io import StringIO
+import textwrap
+
+
+# TODO(kszucs): use archery.report.JinjaReport instead
+class Report:
+
+    def __init__(self, job, task_filters=None):
+        self.job = job
+
+        tasks = sorted(job.tasks.items())
+        if task_filters:
+            filtered = set()
+            for pattern in task_filters:
+                filtered |= set(fnmatch.filter(job.tasks.keys(), pattern))
+
+            tasks = [(name, task) for name, task in tasks if name in filtered]
+
+        self._tasks = dict(tasks)
+
+    @property
+    def tasks(self):
+        return self._tasks
+
+    def show(self):
+        raise NotImplementedError()
+
+
+class ConsoleReport(Report):
+    """Report the status of a Job to the console using click"""
+
+    # output table's header template
+    HEADER = '[{state:>7}] {branch:<52} {content:>16}'
+    DETAILS = ' └ {url}'
+
+    # output table's row template for assets
+    ARTIFACT_NAME = '{artifact:>69} '
+    ARTIFACT_STATE = '[{state:>7}]'
+
+    # state color mapping to highlight console output
+    COLORS = {
+        # from CombinedStatus
+        'error': 'red',
+        'failure': 'red',
+        'pending': 'yellow',
+        'success': 'green',
+        # custom state messages
+        'ok': 'green',
+        'missing': 'red'
+    }
+
+    def lead(self, state, branch, n_uploaded, n_expected):
+        line = self.HEADER.format(
+            state=state.upper(),
+            branch=branch,
+            content='uploaded {} / {}'.format(n_uploaded, n_expected)
+        )
+        return click.style(line, fg=self.COLORS[state.lower()])
+
+    def header(self):
+        header = self.HEADER.format(
+            state='state',
+            branch='Task / Branch',
+            content='Artifacts'
+        )
+        delimiter = '-' * len(header)
+        return '{}\n{}'.format(header, delimiter)
+
+    def artifact(self, state, pattern, asset):
+        if asset is None:
+            artifact = pattern
+            state = 'pending' if state == 'pending' else 'missing'
+        else:
+            artifact = asset.name
+            state = 'ok'
+
+        name_ = self.ARTIFACT_NAME.format(artifact=artifact)
+        state_ = click.style(
+            self.ARTIFACT_STATE.format(state=state.upper()),
+            self.COLORS[state]
+        )
+        return name_ + state_
+
+    def show(self, outstream, asset_callback=None, validate_patterns=True):
+        echo = functools.partial(click.echo, file=outstream)
+
+        # write table's header
+        echo(self.header())
+
+        # write table's body
+        for task_name, task in self.tasks.items():
+            # write summary of the uploaded vs total assets
+            status = task.status()
+            assets = task.assets(validate_patterns=validate_patterns)
+
+            # mapping of artifact pattern to asset or None of not uploaded
+            n_expected = len(task.artifacts)
+            n_uploaded = len(assets.uploaded_assets())
+            echo(self.lead(status.combined_state, task_name, n_uploaded,
+                           n_expected))
+
+            # show link to the actual build, some of the CI providers implement
+            # the statuses API others implement the checks API, so display both
+            for link in status.build_links:
+                echo(self.DETAILS.format(url=link))
+
+            # write per asset status
+            for artifact_pattern, asset in assets.items():
+                if asset_callback is not None:
+                    asset_callback(task_name, task, asset)
+                echo(self.artifact(status.combined_state, artifact_pattern,
+                                   asset))
+
+
+class EmailReport(Report):
+
+    HEADER = textwrap.dedent("""
+        Arrow Build Report for Job {job_name}
+
+        All tasks: {all_tasks_url}
+    """)
+
+    TASK = textwrap.dedent("""
+          - {name}:
+            URL: {url}
+    """).strip()
+
+    EMAIL = textwrap.dedent("""
+        From: {sender_name} <{sender_email}>
+        To: {recipient_email}
+        Subject: {subject}
+
+        {body}
+    """).strip()
+
+    STATUS_HEADERS = {
+        # from CombinedStatus
+        'error': 'Errored Tasks:',
+        'failure': 'Failed Tasks:',
+        'pending': 'Pending Tasks:',
+        'success': 'Succeeded Tasks:',
+    }
+
+    def __init__(self, job, sender_name, sender_email, recipient_email):
+        self.sender_name = sender_name
+        self.sender_email = sender_email
+        self.recipient_email = recipient_email
+        super().__init__(job)
+
+    def url(self, query):
+        repo_url = self.job.queue.remote_url.strip('.git')
+        return '{}/branches/all?query={}'.format(repo_url, query)
+
+    def listing(self, tasks):
+        return '\n'.join(
+            sorted(
+                self.TASK.format(name=task_name, url=self.url(task.branch))
+                for task_name, task in tasks.items()
+            )
+        )
+
+    def header(self):
+        url = self.url(self.job.branch)
+        return self.HEADER.format(job_name=self.job.branch, all_tasks_url=url)
+
+    def subject(self):
+        return (
+            "[NIGHTLY] Arrow Build Report for Job {}".format(self.job.branch)
+        )
+
+    def body(self):
+        buffer = StringIO()
+        buffer.write(self.header())
+
+        tasks_by_state = collections.defaultdict(dict)
+        for task_name, task in self.job.tasks.items():
+            state = task.status().combined_state
+            tasks_by_state[state][task_name] = task
+
+        for state in ('failure', 'error', 'pending', 'success'):
+            if state in tasks_by_state:
+                tasks = tasks_by_state[state]
+                buffer.write('\n')
+                buffer.write(self.STATUS_HEADERS[state])
+                buffer.write('\n')
+                buffer.write(self.listing(tasks))
+                buffer.write('\n')
+
+        return buffer.getvalue()
+
+    def email(self):
+        return self.EMAIL.format(
+            sender_name=self.sender_name,
+            sender_email=self.sender_email,
+            recipient_email=self.recipient_email,
+            subject=self.subject(),
+            body=self.body()
+        )
+
+    def show(self, outstream):
+        outstream.write(self.email())
+
+    def send(self, smtp_user, smtp_password, smtp_server, smtp_port):
+        import smtplib
+
+        email = self.email()
+
+        server = smtplib.SMTP_SSL(smtp_server, smtp_port)
+        server.ehlo()
+        server.login(smtp_user, smtp_password)
+        server.sendmail(smtp_user, self.recipient_email, email)
+        server.close()
+
+
+class CommentReport(Report):
+
+    _markdown_badge = '[![{title}]({badge})]({url})'
+
+    badges = {
+        'github': _markdown_badge.format(
+            title='Github Actions',
+            url='https://github.com/{repo}/actions?query=branch:{branch}',
+            badge=(
+                'https://github.com/{repo}/workflows/Crossbow/'
+                'badge.svg?branch={branch}'
+            ),
+        ),
+        'azure': _markdown_badge.format(
+            title='Azure',
+            url=(
+                'https://dev.azure.com/{repo}/_build/latest'
+                '?definitionId=1&branchName={branch}'
+            ),
+            badge=(
+                'https://dev.azure.com/{repo}/_apis/build/status/'
+                '{repo_dotted}?branchName={branch}'
+            )
+        ),
+        'travis': _markdown_badge.format(
+            title='TravisCI',
+            url='https://travis-ci.com/{repo}/branches',
+            badge='https://img.shields.io/travis/{repo}/{branch}.svg'
+        ),
+        'circle': _markdown_badge.format(
+            title='CircleCI',
+            url='https://circleci.com/gh/{repo}/tree/{branch}',
+            badge=(
+                'https://img.shields.io/circleci/build/github'
+                '/{repo}/{branch}.svg'
+            )
+        ),
+        'appveyor': _markdown_badge.format(
+            title='Appveyor',
+            url='https://ci.appveyor.com/project/{repo}/history',
+            badge='https://img.shields.io/appveyor/ci/{repo}/{branch}.svg'
+        ),
+        'drone': _markdown_badge.format(
+            title='Drone',
+            url='https://cloud.drone.io/{repo}',
+            badge='https://img.shields.io/drone/build/{repo}/{branch}.svg'
+        ),
+    }
+
+    def __init__(self, job, crossbow_repo):
+        self.crossbow_repo = crossbow_repo
+        super().__init__(job)
+
+    def show(self):
+        url = 'https://github.com/{repo}/branches/all?query={branch}'
+        sha = self.job.target.head
+
+        msg = 'Revision: {}\n\n'.format(sha)
+        msg += 'Submitted crossbow builds: [{repo} @ {branch}]'
+        msg += '({})\n'.format(url)
+        msg += '\n|Task|Status|\n|----|------|'
+
+        tasks = sorted(self.job.tasks.items(), key=operator.itemgetter(0))
+        for key, task in tasks:
+            branch = task.branch
+
+            try:
+                template = self.badges[task.ci]
+                badge = template.format(
+                    repo=self.crossbow_repo,
+                    repo_dotted=self.crossbow_repo.replace('/', '.'),
+                    branch=branch
+                )
+            except KeyError:
+                badge = 'unsupported CI service `{}`'.format(task.ci)
+
+            msg += '\n|{}|{}|'.format(key, badge)
+
+        return msg.format(repo=self.crossbow_repo, branch=self.job.branch)
diff --git a/src/arrow/dev/archery/archery/crossbow/tests/fixtures/crossbow-job.yaml b/src/arrow/dev/archery/archery/crossbow/tests/fixtures/crossbow-job.yaml
new file mode 100644
index 000000000..c37c7b553
--- /dev/null
+++ b/src/arrow/dev/archery/archery/crossbow/tests/fixtures/crossbow-job.yaml
@@ -0,0 +1,51 @@
+!Job
+target: !Target
+  head: f766a1d615dd1b7ee706d05102e579195951a61c
+  email: unkown
+  branch: refs/pull/4435/merge
+  remote: https://github.com/apache/arrow
+  version: 0.13.0.dev306
+  no_rc_version: 0.13.0.dev306
+tasks:
+  docker-cpp-cmake32: !Task
+    ci: circle
+    platform: linux
+    template: docker-tests/circle.linux.yml
+    artifacts: []
+    params:
+      commands:
+      - docker-compose build cpp-cmake32
+      - docker-compose run cpp-cmake32
+    branch: ursabot-1-circle-docker-cpp-cmake32
+    commit: a56b077c8d1b891a7935048e5672bf6fc07599ec
+  wheel-osx-cp37m: !Task
+    ci: travis
+    platform: osx
+    template: python-wheels/travis.osx.yml
+    artifacts:
+    - pyarrow-0.13.0.dev306-cp37-cp37m-macosx_10_6_intel.whl
+    params:
+      python_version: 3.7
+    branch: ursabot-1-travis-wheel-osx-cp37m
+    commit: a56b077c8d1b891a7935048e5672bf6fc07599ec
+  wheel-osx-cp36m: !Task
+    ci: travis
+    platform: osx
+    template: python-wheels/travis.osx.yml
+    artifacts:
+    - pyarrow-0.13.0.dev306-cp36-cp36m-macosx_10_6_intel.whl
+    params:
+      python_version: 3.6
+    branch: ursabot-1-travis-wheel-osx-cp36m
+    commit: a56b077c8d1b891a7935048e5672bf6fc07599ec
+  wheel-win-cp36m: !Task
+    ci: appveyor
+    platform: win
+    template: python-wheels/appveyor.yml
+    artifacts:
+    - pyarrow-0.13.0.dev306-cp36-cp36m-win_amd64.whl
+    params:
+      python_version: 3.6
+    branch: ursabot-1-appveyor-wheel-win-cp36m
+    commit: a56b077c8d1b891a7935048e5672bf6fc07599ec
+branch: ursabot-1
diff --git a/src/arrow/dev/archery/archery/crossbow/tests/fixtures/crossbow-success-message.md b/src/arrow/dev/archery/archery/crossbow/tests/fixtures/crossbow-success-message.md
new file mode 100644
index 000000000..15825218c
--- /dev/null
+++ b/src/arrow/dev/archery/archery/crossbow/tests/fixtures/crossbow-success-message.md
@@ -0,0 +1,10 @@
+Revision: {revision}
+
+Submitted crossbow builds: [{repo} @ {branch}](https://github.com/{repo}/branches/all?query={branch})
+
+|Task|Status|
+|----|------|
+|docker-cpp-cmake32|[![CircleCI](https://img.shields.io/circleci/build/github/{repo}/{branch}-circle-docker-cpp-cmake32.svg)](https://circleci.com/gh/{repo}/tree/{branch}-circle-docker-cpp-cmake32)|
+|wheel-osx-cp36m|[![TravisCI](https://img.shields.io/travis/{repo}/{branch}-travis-wheel-osx-cp36m.svg)](https://travis-ci.com/{repo}/branches)|
+|wheel-osx-cp37m|[![TravisCI](https://img.shields.io/travis/{repo}/{branch}-travis-wheel-osx-cp37m.svg)](https://travis-ci.com/{repo}/branches)|
+|wheel-win-cp36m|[![Appveyor](https://img.shields.io/appveyor/ci/{repo}/{branch}-appveyor-wheel-win-cp36m.svg)](https://ci.appveyor.com/project/{repo}/history)|
diff --git a/src/arrow/dev/archery/archery/crossbow/tests/test_core.py b/src/arrow/dev/archery/archery/crossbow/tests/test_core.py
new file mode 100644
index 000000000..518474236
--- /dev/null
+++ b/src/arrow/dev/archery/archery/crossbow/tests/test_core.py
@@ -0,0 +1,25 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from archery.utils.source import ArrowSources
+from archery.crossbow import Config
+
+
+def test_config():
+    src = ArrowSources.find()
+    conf = Config.load_yaml(src.dev / "tasks" / "tasks.yml")
+    conf.validate()
diff --git a/src/arrow/dev/archery/archery/crossbow/tests/test_crossbow_cli.py b/src/arrow/dev/archery/archery/crossbow/tests/test_crossbow_cli.py
new file mode 100644
index 000000000..ee9ba1ee2
--- /dev/null
+++ b/src/arrow/dev/archery/archery/crossbow/tests/test_crossbow_cli.py
@@ -0,0 +1,43 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from click.testing import CliRunner
+import pytest
+
+from archery.crossbow.cli import crossbow
+from archery.utils.git import git
+
+
+@pytest.mark.integration
+def test_crossbow_submit(tmp_path):
+    runner = CliRunner()
+
+    def invoke(*args):
+        return runner.invoke(crossbow, ['--queue-path', str(tmp_path), *args])
+
+    # initialize an empty crossbow repository
+    git.run_cmd("init", str(tmp_path))
+    git.run_cmd("-C", str(tmp_path), "remote", "add", "origin",
+                "https://github.com/dummy/repo")
+    git.run_cmd("-C", str(tmp_path), "commit", "-m", "initial",
+                "--allow-empty")
+
+    result = invoke('check-config')
+    assert result.exit_code == 0
+
+    result = invoke('submit', '--no-fetch', '--no-push', '-g', 'wheel')
+    assert result.exit_code == 0
diff --git a/src/arrow/dev/archery/archery/crossbow/tests/test_reports.py b/src/arrow/dev/archery/archery/crossbow/tests/test_reports.py
new file mode 100644
index 000000000..0df292bb5
--- /dev/null
+++ b/src/arrow/dev/archery/archery/crossbow/tests/test_reports.py
@@ -0,0 +1,35 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import textwrap
+
+from archery.crossbow.core import yaml
+from archery.crossbow.reports import CommentReport
+
+
+def test_crossbow_comment_formatter(load_fixture):
+    msg = load_fixture('crossbow-success-message.md')
+    job = load_fixture('crossbow-job.yaml', decoder=yaml.load)
+
+    report = CommentReport(job, crossbow_repo='ursa-labs/crossbow')
+    expected = msg.format(
+        repo='ursa-labs/crossbow',
+        branch='ursabot-1',
+        revision='f766a1d615dd1b7ee706d05102e579195951a61c',
+        status='has been succeeded.'
+    )
+    assert report.show() == textwrap.dedent(expected).strip()
diff --git a/src/arrow/dev/archery/archery/docker.py b/src/arrow/dev/archery/archery/docker.py
new file mode 100644
index 000000000..17d4c713a
--- /dev/null
+++ b/src/arrow/dev/archery/archery/docker.py
@@ -0,0 +1,402 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+import re
+import subprocess
+from io import StringIO
+
+from dotenv import dotenv_values
+from ruamel.yaml import YAML
+
+from .utils.command import Command, default_bin
+from .compat import _ensure_path
+
+
+def flatten(node, parents=None):
+    parents = list(parents or [])
+    if isinstance(node, str):
+        yield (node, parents)
+    elif isinstance(node, list):
+        for value in node:
+            yield from flatten(value, parents=parents)
+    elif isinstance(node, dict):
+        for key, value in node.items():
+            yield (key, parents)
+            yield from flatten(value, parents=parents + [key])
+    else:
+        raise TypeError(node)
+
+
+def _sanitize_command(cmd):
+    if isinstance(cmd, list):
+        cmd = " ".join(cmd)
+    return re.sub(r"\s+", " ", cmd)
+
+
+class UndefinedImage(Exception):
+    pass
+
+
+class ComposeConfig:
+
+    def __init__(self, config_path, dotenv_path, compose_bin, params=None):
+        config_path = _ensure_path(config_path)
+        if dotenv_path:
+            dotenv_path = _ensure_path(dotenv_path)
+        else:
+            dotenv_path = config_path.parent / '.env'
+        self._read_env(dotenv_path, params)
+        self._read_config(config_path, compose_bin)
+
+    def _read_env(self, dotenv_path, params):
+        """
+        Read .env and merge it with explicitly passed parameters.
+        """
+        self.dotenv = dotenv_values(str(dotenv_path))
+        if params is None:
+            self.params = {}
+        else:
+            self.params = {k: v for k, v in params.items() if k in self.dotenv}
+
+        # forward the process' environment variables
+        self.env = os.environ.copy()
+        # set the defaults from the dotenv files
+        self.env.update(self.dotenv)
+        # override the defaults passed as parameters
+        self.env.update(self.params)
+
+        # translate docker's architecture notation to a more widely used one
+        arch = self.env.get('ARCH', 'amd64')
+        arch_aliases = {
+            'amd64': 'x86_64',
+            'arm64v8': 'aarch64',
+            's390x': 's390x'
+        }
+        arch_short_aliases = {
+            'amd64': 'x64',
+            'arm64v8': 'arm64',
+            's390x': 's390x'
+        }
+        self.env['ARCH_ALIAS'] = arch_aliases.get(arch, arch)
+        self.env['ARCH_SHORT_ALIAS'] = arch_short_aliases.get(arch, arch)
+
+    def _read_config(self, config_path, compose_bin):
+        """
+        Validate and read the docker-compose.yml
+        """
+        yaml = YAML()
+        with config_path.open() as fp:
+            config = yaml.load(fp)
+
+        services = config['services'].keys()
+        self.hierarchy = dict(flatten(config.get('x-hierarchy', {})))
+        self.with_gpus = config.get('x-with-gpus', [])
+        nodes = self.hierarchy.keys()
+        errors = []
+
+        for name in self.with_gpus:
+            if name not in services:
+                errors.append(
+                    'Service `{}` defined in `x-with-gpus` bot not in '
+                    '`services`'.format(name)
+                )
+        for name in nodes - services:
+            errors.append(
+                'Service `{}` is defined in `x-hierarchy` bot not in '
+                '`services`'.format(name)
+            )
+        for name in services - nodes:
+            errors.append(
+                'Service `{}` is defined in `services` but not in '
+                '`x-hierarchy`'.format(name)
+            )
+
+        # trigger docker-compose's own validation
+        compose = Command('docker-compose')
+        args = ['--file', str(config_path), 'config']
+        result = compose.run(*args, env=self.env, check=False,
+                             stderr=subprocess.PIPE, stdout=subprocess.PIPE)
+
+        if result.returncode != 0:
+            # strip the intro line of docker-compose errors
+            errors += result.stderr.decode().splitlines()
+
+        if errors:
+            msg = '\n'.join([' - {}'.format(msg) for msg in errors])
+            raise ValueError(
+                'Found errors with docker-compose:\n{}'.format(msg)
+            )
+
+        rendered_config = StringIO(result.stdout.decode())
+        self.path = config_path
+        self.config = yaml.load(rendered_config)
+
+    def get(self, service_name):
+        try:
+            service = self.config['services'][service_name]
+        except KeyError:
+            raise UndefinedImage(service_name)
+        service['name'] = service_name
+        service['need_gpu'] = service_name in self.with_gpus
+        service['ancestors'] = self.hierarchy[service_name]
+        return service
+
+    def __getitem__(self, service_name):
+        return self.get(service_name)
+
+
+class Docker(Command):
+
+    def __init__(self, docker_bin=None):
+        self.bin = default_bin(docker_bin, "docker")
+
+
+class DockerCompose(Command):
+
+    def __init__(self, config_path, dotenv_path=None, compose_bin=None,
+                 params=None):
+        compose_bin = default_bin(compose_bin, 'docker-compose')
+        self.config = ComposeConfig(config_path, dotenv_path, compose_bin,
+                                    params)
+        self.bin = compose_bin
+        self.pull_memory = set()
+
+    def clear_pull_memory(self):
+        self.pull_memory = set()
+
+    def _execute_compose(self, *args, **kwargs):
+        # execute as a docker compose command
+        try:
+            result = super().run('--file', str(self.config.path), *args,
+                                 env=self.config.env, **kwargs)
+            result.check_returncode()
+        except subprocess.CalledProcessError as e:
+            def formatdict(d, template):
+                return '\n'.join(
+                    template.format(k, v) for k, v in sorted(d.items())
+                )
+            msg = (
+                "`{cmd}` exited with a non-zero exit code {code}, see the "
+                "process log above.\n\nThe docker-compose command was "
+                "invoked with the following parameters:\n\nDefaults defined "
+                "in .env:\n{dotenv}\n\nArchery was called with:\n{params}"
+            )
+            raise RuntimeError(
+                msg.format(
+                    cmd=' '.join(e.cmd),
+                    code=e.returncode,
+                    dotenv=formatdict(self.config.dotenv, template='  {}: {}'),
+                    params=formatdict(
+                        self.config.params, template='  export {}={}'
+                    )
+                )
+            )
+
+    def _execute_docker(self, *args, **kwargs):
+        # execute as a plain docker cli command
+        try:
+            result = Docker().run(*args, **kwargs)
+            result.check_returncode()
+        except subprocess.CalledProcessError as e:
+            raise RuntimeError(
+                "{} exited with non-zero exit code {}".format(
+                    ' '.join(e.cmd), e.returncode
+                )
+            )
+
+    def pull(self, service_name, pull_leaf=True, using_docker=False):
+        def _pull(service):
+            args = ['pull']
+            if service['image'] in self.pull_memory:
+                return
+
+            if using_docker:
+                try:
+                    self._execute_docker(*args, service['image'])
+                except Exception as e:
+                    # better --ignore-pull-failures handling
+                    print(e)
+            else:
+                args.append('--ignore-pull-failures')
+                self._execute_compose(*args, service['name'])
+
+            self.pull_memory.add(service['image'])
+
+        service = self.config.get(service_name)
+        for ancestor in service['ancestors']:
+            _pull(self.config.get(ancestor))
+        if pull_leaf:
+            _pull(service)
+
+    def build(self, service_name, use_cache=True, use_leaf_cache=True,
+              using_docker=False, using_buildx=False):
+        def _build(service, use_cache):
+            if 'build' not in service:
+                # nothing to do
+                return
+
+            args = []
+            cache_from = list(service.get('build', {}).get('cache_from', []))
+            if use_cache:
+                for image in cache_from:
+                    if image not in self.pull_memory:
+                        try:
+                            self._execute_docker('pull', image)
+                        except Exception as e:
+                            print(e)
+                        finally:
+                            self.pull_memory.add(image)
+            else:
+                args.append('--no-cache')
+
+            # turn on inline build cache, this is a docker buildx feature
+            # used to bundle the image build cache to the pushed image manifest
+            # so the build cache can be reused across hosts, documented at
+            # https://github.com/docker/buildx#--cache-tonametypetypekeyvalue
+            if self.config.env.get('BUILDKIT_INLINE_CACHE') == '1':
+                args.extend(['--build-arg', 'BUILDKIT_INLINE_CACHE=1'])
+
+            if using_buildx:
+                for k, v in service['build'].get('args', {}).items():
+                    args.extend(['--build-arg', '{}={}'.format(k, v)])
+
+                if use_cache:
+                    cache_ref = '{}-cache'.format(service['image'])
+                    cache_from = 'type=registry,ref={}'.format(cache_ref)
+                    cache_to = (
+                        'type=registry,ref={},mode=max'.format(cache_ref)
+                    )
+                    args.extend([
+                        '--cache-from', cache_from,
+                        '--cache-to', cache_to,
+                    ])
+
+                args.extend([
+                    '--output', 'type=docker',
+                    '-f', service['build']['dockerfile'],
+                    '-t', service['image'],
+                    service['build'].get('context', '.')
+                ])
+                self._execute_docker("buildx", "build", *args)
+            elif using_docker:
+                # better for caching
+                for k, v in service['build'].get('args', {}).items():
+                    args.extend(['--build-arg', '{}={}'.format(k, v)])
+                for img in cache_from:
+                    args.append('--cache-from="{}"'.format(img))
+                args.extend([
+                    '-f', service['build']['dockerfile'],
+                    '-t', service['image'],
+                    service['build'].get('context', '.')
+                ])
+                self._execute_docker("build", *args)
+            else:
+                self._execute_compose("build", *args, service['name'])
+
+        service = self.config.get(service_name)
+        # build ancestor services
+        for ancestor in service['ancestors']:
+            _build(self.config.get(ancestor), use_cache=use_cache)
+        # build the leaf/target service
+        _build(service, use_cache=use_cache and use_leaf_cache)
+
+    def run(self, service_name, command=None, *, env=None, volumes=None,
+            user=None, using_docker=False):
+        service = self.config.get(service_name)
+
+        args = []
+        if user is not None:
+            args.extend(['-u', user])
+
+        if env is not None:
+            for k, v in env.items():
+                args.extend(['-e', '{}={}'.format(k, v)])
+
+        if volumes is not None:
+            for volume in volumes:
+                args.extend(['--volume', volume])
+
+        if using_docker or service['need_gpu']:
+            # use gpus, requires docker>=19.03
+            if service['need_gpu']:
+                args.extend(['--gpus', 'all'])
+
+            if service.get('shm_size'):
+                args.extend(['--shm-size', service['shm_size']])
+
+            # append env variables from the compose conf
+            for k, v in service.get('environment', {}).items():
+                args.extend(['-e', '{}={}'.format(k, v)])
+
+            # append volumes from the compose conf
+            for v in service.get('volumes', []):
+                if not isinstance(v, str):
+                    # if not the compact string volume definition
+                    v = "{}:{}".format(v['source'], v['target'])
+                args.extend(['-v', v])
+
+            # infer whether an interactive shell is desired or not
+            if command in ['cmd.exe', 'bash', 'sh', 'powershell']:
+                args.append('-it')
+
+            # get the actual docker image name instead of the compose service
+            # name which we refer as image in general
+            args.append(service['image'])
+
+            # add command from compose if it wasn't overridden
+            if command is not None:
+                args.append(command)
+            else:
+                # replace whitespaces from the preformatted compose command
+                cmd = _sanitize_command(service.get('command', ''))
+                if cmd:
+                    args.append(cmd)
+
+            # execute as a plain docker cli command
+            self._execute_docker('run', '--rm', *args)
+        else:
+            # execute as a docker-compose command
+            args.append(service_name)
+            if command is not None:
+                args.append(command)
+            self._execute_compose('run', '--rm', *args)
+
+    def push(self, service_name, user=None, password=None, using_docker=False):
+        def _push(service):
+            if using_docker:
+                return self._execute_docker('push', service['image'])
+            else:
+                return self._execute_compose('push', service['name'])
+
+        if user is not None:
+            try:
+                # TODO(kszucs): have an option for a prompt
+                self._execute_docker('login', '-u', user, '-p', password)
+            except subprocess.CalledProcessError:
+                # hide credentials
+                msg = ('Failed to push `{}`, check the passed credentials'
+                       .format(service_name))
+                raise RuntimeError(msg) from None
+
+        service = self.config.get(service_name)
+        for ancestor in service['ancestors']:
+            _push(self.config.get(ancestor))
+        _push(service)
+
+    def images(self):
+        return sorted(self.config.hierarchy.keys())
diff --git a/src/arrow/dev/archery/archery/docker/__init__.py b/src/arrow/dev/archery/archery/docker/__init__.py
new file mode 100644
index 000000000..6be29c916
--- /dev/null
+++ b/src/arrow/dev/archery/archery/docker/__init__.py
@@ -0,0 +1,18 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from .core import DockerCompose, UndefinedImage  # noqa
diff --git a/src/arrow/dev/archery/archery/docker/cli.py b/src/arrow/dev/archery/archery/docker/cli.py
new file mode 100644
index 000000000..c6b4a6473
--- /dev/null
+++ b/src/arrow/dev/archery/archery/docker/cli.py
@@ -0,0 +1,261 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+
+import click
+
+from ..utils.cli import validate_arrow_sources
+from .core import DockerCompose, UndefinedImage
+
+
+def _mock_compose_calls(compose):
+    from types import MethodType
+    from subprocess import CompletedProcess
+
+    def _mock(compose, executable):
+        def _execute(self, *args, **kwargs):
+            params = ['{}={}'.format(k, v)
+                      for k, v in self.config.params.items()]
+            command = ' '.join(params + [executable] + list(args))
+            click.echo(command)
+            return CompletedProcess([], 0)
+        return MethodType(_execute, compose)
+
+    compose._execute_docker = _mock(compose, executable='docker')
+    compose._execute_compose = _mock(compose, executable='docker-compose')
+
+
+@click.group()
+@click.option("--src", metavar="<arrow_src>", default=None,
+              callback=validate_arrow_sources,
+              help="Specify Arrow source directory.")
+@click.option('--dry-run/--execute', default=False,
+              help="Display the docker-compose commands instead of executing "
+                   "them.")
+@click.pass_context
+def docker(ctx, src, dry_run):
+    """
+    Interact with docker-compose based builds.
+    """
+    ctx.ensure_object(dict)
+
+    config_path = src.path / 'docker-compose.yml'
+    if not config_path.exists():
+        raise click.ClickException(
+            "Docker compose configuration cannot be found in directory {}, "
+            "try to pass the arrow source directory explicitly.".format(src)
+        )
+
+    # take the docker-compose parameters like PYTHON, PANDAS, UBUNTU from the
+    # environment variables to keep the usage similar to docker-compose
+    compose = DockerCompose(config_path, params=os.environ)
+    if dry_run:
+        _mock_compose_calls(compose)
+    ctx.obj['compose'] = compose
+
+
+@docker.command("check-config")
+@click.pass_obj
+def check_config(obj):
+    """
+    Validate docker-compose configuration.
+    """
+    # executes the body of the docker function above which does the validation
+    # during the configuration loading
+
+
+@docker.command('build')
+@click.argument('image')
+@click.option('--force-pull/--no-pull', default=True,
+              help="Whether to force pull the image and its ancestor images")
+@click.option('--using-docker-cli', default=False, is_flag=True,
+              envvar='ARCHERY_USE_DOCKER_CLI',
+              help="Use docker CLI directly for building instead of calling "
+                   "docker-compose. This may help to reuse cached layers.")
+@click.option('--using-docker-buildx', default=False, is_flag=True,
+              envvar='ARCHERY_USE_DOCKER_BUILDX',
+              help="Use buildx with docker CLI directly for building instead "
+                   "of calling docker-compose or the plain docker build "
+                   "command. This option makes the build cache reusable "
+                   "across hosts.")
+@click.option('--use-cache/--no-cache', default=True,
+              help="Whether to use cache when building the image and its "
+                   "ancestor images")
+@click.option('--use-leaf-cache/--no-leaf-cache', default=True,
+              help="Whether to use cache when building only the (leaf) image "
+                   "passed as the argument. To disable caching for both the "
+                   "image and its ancestors use --no-cache option.")
+@click.pass_obj
+def docker_build(obj, image, *, force_pull, using_docker_cli,
+                 using_docker_buildx, use_cache, use_leaf_cache):
+    """
+    Execute docker-compose builds.
+    """
+    compose = obj['compose']
+
+    using_docker_cli |= using_docker_buildx
+    try:
+        if force_pull:
+            compose.pull(image, pull_leaf=use_leaf_cache,
+                         using_docker=using_docker_cli)
+        compose.build(image, use_cache=use_cache,
+                      use_leaf_cache=use_leaf_cache,
+                      using_docker=using_docker_cli,
+                      using_buildx=using_docker_buildx,
+                      pull_parents=force_pull)
+    except UndefinedImage as e:
+        raise click.ClickException(
+            "There is no service/image defined in docker-compose.yml with "
+            "name: {}".format(str(e))
+        )
+    except RuntimeError as e:
+        raise click.ClickException(str(e))
+
+
+@docker.command('run')
+@click.argument('image')
+@click.argument('command', required=False, default=None)
+@click.option('--env', '-e', multiple=True,
+              help="Set environment variable within the container")
+@click.option('--user', '-u', default=None,
+              help="Username or UID to run the container with")
+@click.option('--force-pull/--no-pull', default=True,
+              help="Whether to force pull the image and its ancestor images")
+@click.option('--force-build/--no-build', default=True,
+              help="Whether to force build the image and its ancestor images")
+@click.option('--build-only', default=False, is_flag=True,
+              help="Pull and/or build the image, but do not run it")
+@click.option('--using-docker-cli', default=False, is_flag=True,
+              envvar='ARCHERY_USE_DOCKER_CLI',
+              help="Use docker CLI directly for building instead of calling "
+                   "docker-compose. This may help to reuse cached layers.")
+@click.option('--using-docker-buildx', default=False, is_flag=True,
+              envvar='ARCHERY_USE_DOCKER_BUILDX',
+              help="Use buildx with docker CLI directly for building instead "
+                   "of calling docker-compose or the plain docker build "
+                   "command. This option makes the build cache reusable "
+                   "across hosts.")
+@click.option('--use-cache/--no-cache', default=True,
+              help="Whether to use cache when building the image and its "
+                   "ancestor images")
+@click.option('--use-leaf-cache/--no-leaf-cache', default=True,
+              help="Whether to use cache when building only the (leaf) image "
+                   "passed as the argument. To disable caching for both the "
+                   "image and its ancestors use --no-cache option.")
+@click.option('--resource-limit', default=None,
+              help="A CPU/memory limit preset to mimic CI environments like "
+                   "GitHub Actions. Implies --using-docker-cli. Note that "
+                   "exporting ARCHERY_DOCKER_BIN=\"sudo docker\" is likely "
+                   "required, unless Docker is configured with cgroups v2 "
+                   "(else Docker will silently ignore the limits).")
+@click.option('--volume', '-v', multiple=True,
+              help="Set volume within the container")
+@click.pass_obj
+def docker_run(obj, image, command, *, env, user, force_pull, force_build,
+               build_only, using_docker_cli, using_docker_buildx, use_cache,
+               use_leaf_cache, resource_limit, volume):
+    """
+    Execute docker-compose builds.
+
+    To see the available builds run `archery docker images`.
+
+    Examples:
+
+    # execute a single build
+    archery docker run conda-python
+
+    # execute the builds but disable the image pulling
+    archery docker run --no-cache conda-python
+
+    # pass a docker-compose parameter, like the python version
+    PYTHON=3.8 archery docker run conda-python
+
+    # disable the cache only for the leaf image
+    PANDAS=master archery docker run --no-leaf-cache conda-python-pandas
+
+    # entirely skip building the image
+    archery docker run --no-pull --no-build conda-python
+
+    # pass runtime parameters via docker environment variables
+    archery docker run -e CMAKE_BUILD_TYPE=release ubuntu-cpp
+
+    # set a volume
+    archery docker run -v $PWD/build:/build ubuntu-cpp
+
+    # starting an interactive bash session for debugging
+    archery docker run ubuntu-cpp bash
+    """
+    compose = obj['compose']
+    using_docker_cli |= using_docker_buildx
+
+    env = dict(kv.split('=', 1) for kv in env)
+    try:
+        if force_pull:
+            compose.pull(image, pull_leaf=use_leaf_cache,
+                         using_docker=using_docker_cli)
+        if force_build:
+            compose.build(image, use_cache=use_cache,
+                          use_leaf_cache=use_leaf_cache,
+                          using_docker=using_docker_cli,
+                          using_buildx=using_docker_buildx)
+        if build_only:
+            return
+        compose.run(
+            image,
+            command=command,
+            env=env,
+            user=user,
+            using_docker=using_docker_cli,
+            resource_limit=resource_limit,
+            volumes=volume
+        )
+    except UndefinedImage as e:
+        raise click.ClickException(
+            "There is no service/image defined in docker-compose.yml with "
+            "name: {}".format(str(e))
+        )
+    except RuntimeError as e:
+        raise click.ClickException(str(e))
+
+
+@docker.command('push')
+@click.argument('image')
+@click.option('--user', '-u', required=False, envvar='ARCHERY_DOCKER_USER',
+              help='Docker repository username')
+@click.option('--password', '-p', required=False,
+              envvar='ARCHERY_DOCKER_PASSWORD',
+              help='Docker repository password')
+@click.option('--using-docker-cli', default=False, is_flag=True,
+              help="Use docker CLI directly for building instead of calling "
+                   "docker-compose. This may help to reuse cached layers.")
+@click.pass_obj
+def docker_compose_push(obj, image, user, password, using_docker_cli):
+    """Push the generated docker-compose image."""
+    compose = obj['compose']
+    compose.push(image, user=user, password=password,
+                 using_docker=using_docker_cli)
+
+
+@docker.command('images')
+@click.pass_obj
+def docker_compose_images(obj):
+    """List the available docker-compose images."""
+    compose = obj['compose']
+    click.echo('Available images:')
+    for image in compose.images():
+        click.echo(f' - {image}')
diff --git a/src/arrow/dev/archery/archery/docker/core.py b/src/arrow/dev/archery/archery/docker/core.py
new file mode 100644
index 000000000..aaf16bdfa
--- /dev/null
+++ b/src/arrow/dev/archery/archery/docker/core.py
@@ -0,0 +1,417 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+import re
+import subprocess
+from io import StringIO
+
+from dotenv import dotenv_values
+from ruamel.yaml import YAML
+
+from ..utils.command import Command, default_bin
+from ..compat import _ensure_path
+
+
+def flatten(node, parents=None):
+    parents = list(parents or [])
+    if isinstance(node, str):
+        yield (node, parents)
+    elif isinstance(node, list):
+        for value in node:
+            yield from flatten(value, parents=parents)
+    elif isinstance(node, dict):
+        for key, value in node.items():
+            yield (key, parents)
+            yield from flatten(value, parents=parents + [key])
+    else:
+        raise TypeError(node)
+
+
+def _sanitize_command(cmd):
+    if isinstance(cmd, list):
+        cmd = " ".join(cmd)
+    return re.sub(r"\s+", " ", cmd)
+
+
+class UndefinedImage(Exception):
+    pass
+
+
+class ComposeConfig:
+
+    def __init__(self, config_path, dotenv_path, compose_bin, params=None):
+        config_path = _ensure_path(config_path)
+        if dotenv_path:
+            dotenv_path = _ensure_path(dotenv_path)
+        else:
+            dotenv_path = config_path.parent / '.env'
+        self._read_env(dotenv_path, params)
+        self._read_config(config_path, compose_bin)
+
+    def _read_env(self, dotenv_path, params):
+        """
+        Read .env and merge it with explicitly passed parameters.
+        """
+        self.dotenv = dotenv_values(str(dotenv_path))
+        if params is None:
+            self.params = {}
+        else:
+            self.params = {k: v for k, v in params.items() if k in self.dotenv}
+
+        # forward the process' environment variables
+        self.env = os.environ.copy()
+        # set the defaults from the dotenv files
+        self.env.update(self.dotenv)
+        # override the defaults passed as parameters
+        self.env.update(self.params)
+
+        # translate docker's architecture notation to a more widely used one
+        arch = self.env.get('ARCH', 'amd64')
+        arch_aliases = {
+            'amd64': 'x86_64',
+            'arm64v8': 'aarch64',
+            's390x': 's390x'
+        }
+        arch_short_aliases = {
+            'amd64': 'x64',
+            'arm64v8': 'arm64',
+            's390x': 's390x'
+        }
+        self.env['ARCH_ALIAS'] = arch_aliases.get(arch, arch)
+        self.env['ARCH_SHORT_ALIAS'] = arch_short_aliases.get(arch, arch)
+
+    def _read_config(self, config_path, compose_bin):
+        """
+        Validate and read the docker-compose.yml
+        """
+        yaml = YAML()
+        with config_path.open() as fp:
+            config = yaml.load(fp)
+
+        services = config['services'].keys()
+        self.hierarchy = dict(flatten(config.get('x-hierarchy', {})))
+        self.limit_presets = config.get('x-limit-presets', {})
+        self.with_gpus = config.get('x-with-gpus', [])
+        nodes = self.hierarchy.keys()
+        errors = []
+
+        for name in self.with_gpus:
+            if name not in services:
+                errors.append(
+                    'Service `{}` defined in `x-with-gpus` bot not in '
+                    '`services`'.format(name)
+                )
+        for name in nodes - services:
+            errors.append(
+                'Service `{}` is defined in `x-hierarchy` bot not in '
+                '`services`'.format(name)
+            )
+        for name in services - nodes:
+            errors.append(
+                'Service `{}` is defined in `services` but not in '
+                '`x-hierarchy`'.format(name)
+            )
+
+        # trigger docker-compose's own validation
+        compose = Command('docker-compose')
+        args = ['--file', str(config_path), 'config']
+        result = compose.run(*args, env=self.env, check=False,
+                             stderr=subprocess.PIPE, stdout=subprocess.PIPE)
+
+        if result.returncode != 0:
+            # strip the intro line of docker-compose errors
+            errors += result.stderr.decode().splitlines()
+
+        if errors:
+            msg = '\n'.join([' - {}'.format(msg) for msg in errors])
+            raise ValueError(
+                'Found errors with docker-compose:\n{}'.format(msg)
+            )
+
+        rendered_config = StringIO(result.stdout.decode())
+        self.path = config_path
+        self.config = yaml.load(rendered_config)
+
+    def get(self, service_name):
+        try:
+            service = self.config['services'][service_name]
+        except KeyError:
+            raise UndefinedImage(service_name)
+        service['name'] = service_name
+        service['need_gpu'] = service_name in self.with_gpus
+        service['ancestors'] = self.hierarchy[service_name]
+        return service
+
+    def __getitem__(self, service_name):
+        return self.get(service_name)
+
+
+class Docker(Command):
+
+    def __init__(self, docker_bin=None):
+        self.bin = default_bin(docker_bin, "docker")
+
+
+class DockerCompose(Command):
+
+    def __init__(self, config_path, dotenv_path=None, compose_bin=None,
+                 params=None):
+        compose_bin = default_bin(compose_bin, 'docker-compose')
+        self.config = ComposeConfig(config_path, dotenv_path, compose_bin,
+                                    params)
+        self.bin = compose_bin
+        self.pull_memory = set()
+
+    def clear_pull_memory(self):
+        self.pull_memory = set()
+
+    def _execute_compose(self, *args, **kwargs):
+        # execute as a docker compose command
+        try:
+            result = super().run('--file', str(self.config.path), *args,
+                                 env=self.config.env, **kwargs)
+            result.check_returncode()
+        except subprocess.CalledProcessError as e:
+            def formatdict(d, template):
+                return '\n'.join(
+                    template.format(k, v) for k, v in sorted(d.items())
+                )
+            msg = (
+                "`{cmd}` exited with a non-zero exit code {code}, see the "
+                "process log above.\n\nThe docker-compose command was "
+                "invoked with the following parameters:\n\nDefaults defined "
+                "in .env:\n{dotenv}\n\nArchery was called with:\n{params}"
+            )
+            raise RuntimeError(
+                msg.format(
+                    cmd=' '.join(e.cmd),
+                    code=e.returncode,
+                    dotenv=formatdict(self.config.dotenv, template='  {}: {}'),
+                    params=formatdict(
+                        self.config.params, template='  export {}={}'
+                    )
+                )
+            )
+
+    def _execute_docker(self, *args, **kwargs):
+        # execute as a plain docker cli command
+        try:
+            result = Docker().run(*args, **kwargs)
+            result.check_returncode()
+        except subprocess.CalledProcessError as e:
+            raise RuntimeError(
+                "{} exited with non-zero exit code {}".format(
+                    ' '.join(e.cmd), e.returncode
+                )
+            )
+
+    def pull(self, service_name, pull_leaf=True, using_docker=False):
+        def _pull(service):
+            args = ['pull']
+            if service['image'] in self.pull_memory:
+                return
+
+            if using_docker:
+                try:
+                    self._execute_docker(*args, service['image'])
+                except Exception as e:
+                    # better --ignore-pull-failures handling
+                    print(e)
+            else:
+                args.append('--ignore-pull-failures')
+                self._execute_compose(*args, service['name'])
+
+            self.pull_memory.add(service['image'])
+
+        service = self.config.get(service_name)
+        for ancestor in service['ancestors']:
+            _pull(self.config.get(ancestor))
+        if pull_leaf:
+            _pull(service)
+
+    def build(self, service_name, use_cache=True, use_leaf_cache=True,
+              using_docker=False, using_buildx=False, pull_parents=True):
+        def _build(service, use_cache):
+            if 'build' not in service:
+                # nothing to do
+                return
+
+            args = []
+            cache_from = list(service.get('build', {}).get('cache_from', []))
+            if pull_parents:
+                for image in cache_from:
+                    if image not in self.pull_memory:
+                        try:
+                            self._execute_docker('pull', image)
+                        except Exception as e:
+                            print(e)
+                        finally:
+                            self.pull_memory.add(image)
+
+            if not use_cache:
+                args.append('--no-cache')
+
+            # turn on inline build cache, this is a docker buildx feature
+            # used to bundle the image build cache to the pushed image manifest
+            # so the build cache can be reused across hosts, documented at
+            # https://github.com/docker/buildx#--cache-tonametypetypekeyvalue
+            if self.config.env.get('BUILDKIT_INLINE_CACHE') == '1':
+                args.extend(['--build-arg', 'BUILDKIT_INLINE_CACHE=1'])
+
+            if using_buildx:
+                for k, v in service['build'].get('args', {}).items():
+                    args.extend(['--build-arg', '{}={}'.format(k, v)])
+
+                if use_cache:
+                    cache_ref = '{}-cache'.format(service['image'])
+                    cache_from = 'type=registry,ref={}'.format(cache_ref)
+                    cache_to = (
+                        'type=registry,ref={},mode=max'.format(cache_ref)
+                    )
+                    args.extend([
+                        '--cache-from', cache_from,
+                        '--cache-to', cache_to,
+                    ])
+
+                args.extend([
+                    '--output', 'type=docker',
+                    '-f', service['build']['dockerfile'],
+                    '-t', service['image'],
+                    service['build'].get('context', '.')
+                ])
+                self._execute_docker("buildx", "build", *args)
+            elif using_docker:
+                # better for caching
+                for k, v in service['build'].get('args', {}).items():
+                    args.extend(['--build-arg', '{}={}'.format(k, v)])
+                for img in cache_from:
+                    args.append('--cache-from="{}"'.format(img))
+                args.extend([
+                    '-f', service['build']['dockerfile'],
+                    '-t', service['image'],
+                    service['build'].get('context', '.')
+                ])
+                self._execute_docker("build", *args)
+            else:
+                self._execute_compose("build", *args, service['name'])
+
+        service = self.config.get(service_name)
+        # build ancestor services
+        for ancestor in service['ancestors']:
+            _build(self.config.get(ancestor), use_cache=use_cache)
+        # build the leaf/target service
+        _build(service, use_cache=use_cache and use_leaf_cache)
+
+    def run(self, service_name, command=None, *, env=None, volumes=None,
+            user=None, using_docker=False, resource_limit=None):
+        service = self.config.get(service_name)
+
+        args = []
+        if user is not None:
+            args.extend(['-u', user])
+
+        if env is not None:
+            for k, v in env.items():
+                args.extend(['-e', '{}={}'.format(k, v)])
+
+        if volumes is not None:
+            for volume in volumes:
+                args.extend(['--volume', volume])
+
+        if using_docker or service['need_gpu'] or resource_limit:
+            # use gpus, requires docker>=19.03
+            if service['need_gpu']:
+                args.extend(['--gpus', 'all'])
+
+            if service.get('shm_size'):
+                args.extend(['--shm-size', service['shm_size']])
+
+            # append env variables from the compose conf
+            for k, v in service.get('environment', {}).items():
+                args.extend(['-e', '{}={}'.format(k, v)])
+
+            # append volumes from the compose conf
+            for v in service.get('volumes', []):
+                if not isinstance(v, str):
+                    # if not the compact string volume definition
+                    v = "{}:{}".format(v['source'], v['target'])
+                args.extend(['-v', v])
+
+            # infer whether an interactive shell is desired or not
+            if command in ['cmd.exe', 'bash', 'sh', 'powershell']:
+                args.append('-it')
+
+            if resource_limit:
+                limits = self.config.limit_presets.get(resource_limit)
+                if not limits:
+                    raise ValueError(
+                        f"Unknown resource limit preset '{resource_limit}'")
+                cpuset = limits.get('cpuset_cpus', [])
+                if cpuset:
+                    args.append(f'--cpuset-cpus={",".join(map(str, cpuset))}')
+                memory = limits.get('memory')
+                if memory:
+                    args.append(f'--memory={memory}')
+                    args.append(f'--memory-swap={memory}')
+
+            # get the actual docker image name instead of the compose service
+            # name which we refer as image in general
+            args.append(service['image'])
+
+            # add command from compose if it wasn't overridden
+            if command is not None:
+                args.append(command)
+            else:
+                # replace whitespaces from the preformatted compose command
+                cmd = _sanitize_command(service.get('command', ''))
+                if cmd:
+                    args.append(cmd)
+
+            # execute as a plain docker cli command
+            self._execute_docker('run', '--rm', *args)
+        else:
+            # execute as a docker-compose command
+            args.append(service_name)
+            if command is not None:
+                args.append(command)
+            self._execute_compose('run', '--rm', *args)
+
+    def push(self, service_name, user=None, password=None, using_docker=False):
+        def _push(service):
+            if using_docker:
+                return self._execute_docker('push', service['image'])
+            else:
+                return self._execute_compose('push', service['name'])
+
+        if user is not None:
+            try:
+                # TODO(kszucs): have an option for a prompt
+                self._execute_docker('login', '-u', user, '-p', password)
+            except subprocess.CalledProcessError:
+                # hide credentials
+                msg = ('Failed to push `{}`, check the passed credentials'
+                       .format(service_name))
+                raise RuntimeError(msg) from None
+
+        service = self.config.get(service_name)
+        for ancestor in service['ancestors']:
+            _push(self.config.get(ancestor))
+        _push(service)
+
+    def images(self):
+        return sorted(self.config.hierarchy.keys())
diff --git a/src/arrow/dev/archery/archery/docker/tests/test_docker.py b/src/arrow/dev/archery/archery/docker/tests/test_docker.py
new file mode 100644
index 000000000..982f3bfc1
--- /dev/null
+++ b/src/arrow/dev/archery/archery/docker/tests/test_docker.py
@@ -0,0 +1,531 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import collections
+import os
+import re
+import subprocess
+from unittest import mock
+
+import pytest
+
+from archery.docker import DockerCompose
+from archery.testing import assert_subprocess_calls, override_env, PartialEnv
+
+
+missing_service_compose_yml = """
+version: '3.5'
+
+x-hierarchy:
+  - foo:
+    - sub-foo:
+      - sub-sub-foo
+      - another-sub-sub-foo
+  - bar:
+    - sub-bar
+  - baz
+
+services:
+  foo:
+    image: org/foo
+  sub-sub-foo:
+    image: org/sub-sub-foo
+  another-sub-sub-foo:
+    image: org/another-sub-sub-foo
+  bar:
+    image: org/bar
+  sub-bar:
+    image: org/sub-bar
+  baz:
+    image: org/baz
+"""
+
+missing_node_compose_yml = """
+version: '3.5'
+
+x-hierarchy:
+  - foo:
+    - sub-foo:
+      - sub-sub-foo
+      - another-sub-sub-foo
+  - bar
+  - baz
+
+services:
+  foo:
+    image: org/foo
+  sub-foo:
+    image: org/sub-foo
+  sub-sub-foo:
+    image: org/sub-foo-foo
+  another-sub-sub-foo:
+    image: org/another-sub-sub-foo
+  bar:
+    image: org/bar
+  sub-bar:
+    image: org/sub-bar
+  baz:
+    image: org/baz
+"""
+
+ok_compose_yml = """
+version: '3.5'
+
+x-hierarchy:
+  - foo:
+    - sub-foo:
+      - sub-sub-foo
+      - another-sub-sub-foo
+  - bar:
+    - sub-bar
+  - baz
+
+services:
+  foo:
+    image: org/foo
+  sub-foo:
+    image: org/sub-foo
+  sub-sub-foo:
+    image: org/sub-sub-foo
+  another-sub-sub-foo:
+    image: org/another-sub-sub-foo
+  bar:
+    image: org/bar
+  sub-bar:
+    image: org/sub-bar
+  baz:
+    image: org/baz
+"""
+
+arrow_compose_yml = """
+version: '3.5'
+
+x-with-gpus:
+  - ubuntu-cuda
+
+x-hierarchy:
+  - conda-cpp:
+    - conda-python:
+      - conda-python-pandas
+      - conda-python-dask
+  - ubuntu-cpp:
+    - ubuntu-cpp-cmake32
+    - ubuntu-c-glib:
+      - ubuntu-ruby
+  - ubuntu-cuda
+
+x-limit-presets:
+  github:
+    cpuset_cpus: [0, 1]
+    memory: 7g
+
+services:
+  conda-cpp:
+    image: org/conda-cpp
+    build:
+      context: .
+      dockerfile: ci/docker/conda-cpp.dockerfile
+  conda-python:
+    image: org/conda-python
+    build:
+      context: .
+      dockerfile: ci/docker/conda-cpp.dockerfile
+      args:
+        python: 3.6
+  conda-python-pandas:
+    image: org/conda-python-pandas
+    build:
+      context: .
+      dockerfile: ci/docker/conda-python-pandas.dockerfile
+  conda-python-dask:
+    image: org/conda-python-dask
+  ubuntu-cpp:
+    image: org/ubuntu-cpp
+    build:
+      context: .
+      dockerfile: ci/docker/ubuntu-${UBUNTU}-cpp.dockerfile
+  ubuntu-cpp-cmake32:
+    image: org/ubuntu-cpp-cmake32
+  ubuntu-c-glib:
+    image: org/ubuntu-c-glib
+  ubuntu-ruby:
+    image: org/ubuntu-ruby
+  ubuntu-cuda:
+    image: org/ubuntu-cuda
+    environment:
+      CUDA_ENV: 1
+      OTHER_ENV: 2
+    volumes:
+     - /host:/container
+    command: /bin/bash -c "echo 1 > /tmp/dummy && cat /tmp/dummy"
+"""
+
+arrow_compose_env = {
+    'UBUNTU': '20.04',  # overridden below
+    'PYTHON': '3.6',
+    'PANDAS': 'latest',
+    'DASK': 'latest',  # overridden below
+}
+
+
+def create_config(directory, yml_content, env_content=None):
+    env_path = directory / '.env'
+    config_path = directory / 'docker-compose.yml'
+
+    with config_path.open('w') as fp:
+        fp.write(yml_content)
+
+    if env_content is not None:
+        with env_path.open('w') as fp:
+            for k, v in env_content.items():
+                fp.write("{}={}\n".format(k, v))
+
+    return config_path
+
+
+def format_run(args):
+    cmd = ["run", "--rm"]
+    if isinstance(args, str):
+        return " ".join(cmd + [args])
+    else:
+        return cmd + args
+
+
+@pytest.fixture
+def arrow_compose_path(tmpdir):
+    return create_config(tmpdir, arrow_compose_yml, arrow_compose_env)
+
+
+def test_config_validation(tmpdir):
+    config_path = create_config(tmpdir, missing_service_compose_yml)
+    msg = "`sub-foo` is defined in `x-hierarchy` bot not in `services`"
+    with pytest.raises(ValueError, match=msg):
+        DockerCompose(config_path)
+
+    config_path = create_config(tmpdir, missing_node_compose_yml)
+    msg = "`sub-bar` is defined in `services` but not in `x-hierarchy`"
+    with pytest.raises(ValueError, match=msg):
+        DockerCompose(config_path)
+
+    config_path = create_config(tmpdir, ok_compose_yml)
+    DockerCompose(config_path)  # no issue
+
+
+def assert_docker_calls(compose, expected_args):
+    base_command = ['docker']
+    expected_commands = []
+    for args in expected_args:
+        if isinstance(args, str):
+            args = re.split(r"\s", args)
+        expected_commands.append(base_command + args)
+    return assert_subprocess_calls(expected_commands, check=True)
+
+
+def assert_compose_calls(compose, expected_args, env=mock.ANY):
+    base_command = ['docker-compose', '--file', str(compose.config.path)]
+    expected_commands = []
+    for args in expected_args:
+        if isinstance(args, str):
+            args = re.split(r"\s", args)
+        expected_commands.append(base_command + args)
+    return assert_subprocess_calls(expected_commands, check=True, env=env)
+
+
+def test_arrow_example_validation_passes(arrow_compose_path):
+    DockerCompose(arrow_compose_path)
+
+
+def test_compose_default_params_and_env(arrow_compose_path):
+    compose = DockerCompose(arrow_compose_path, params=dict(
+        UBUNTU='18.04',
+        DASK='master'
+    ))
+    assert compose.config.dotenv == arrow_compose_env
+    assert compose.config.params == {
+        'UBUNTU': '18.04',
+        'DASK': 'master',
+    }
+
+
+def test_forwarding_env_variables(arrow_compose_path):
+    expected_calls = [
+        "pull --ignore-pull-failures conda-cpp",
+        "build conda-cpp",
+    ]
+    expected_env = PartialEnv(
+        MY_CUSTOM_VAR_A='a',
+        MY_CUSTOM_VAR_B='b'
+    )
+    with override_env({'MY_CUSTOM_VAR_A': 'a', 'MY_CUSTOM_VAR_B': 'b'}):
+        compose = DockerCompose(arrow_compose_path)
+        with assert_compose_calls(compose, expected_calls, env=expected_env):
+            assert os.environ['MY_CUSTOM_VAR_A'] == 'a'
+            assert os.environ['MY_CUSTOM_VAR_B'] == 'b'
+            compose.pull('conda-cpp')
+            compose.build('conda-cpp')
+
+
+def test_compose_pull(arrow_compose_path):
+    compose = DockerCompose(arrow_compose_path)
+
+    expected_calls = [
+        "pull --ignore-pull-failures conda-cpp",
+    ]
+    with assert_compose_calls(compose, expected_calls):
+        compose.clear_pull_memory()
+        compose.pull('conda-cpp')
+
+    expected_calls = [
+        "pull --ignore-pull-failures conda-cpp",
+        "pull --ignore-pull-failures conda-python",
+        "pull --ignore-pull-failures conda-python-pandas"
+    ]
+    with assert_compose_calls(compose, expected_calls):
+        compose.clear_pull_memory()
+        compose.pull('conda-python-pandas')
+
+    expected_calls = [
+        "pull --ignore-pull-failures conda-cpp",
+        "pull --ignore-pull-failures conda-python",
+    ]
+    with assert_compose_calls(compose, expected_calls):
+        compose.clear_pull_memory()
+        compose.pull('conda-python-pandas', pull_leaf=False)
+
+
+def test_compose_pull_params(arrow_compose_path):
+    expected_calls = [
+        "pull --ignore-pull-failures conda-cpp",
+        "pull --ignore-pull-failures conda-python",
+    ]
+    compose = DockerCompose(arrow_compose_path, params=dict(UBUNTU='18.04'))
+    expected_env = PartialEnv(PYTHON='3.6', PANDAS='latest')
+    with assert_compose_calls(compose, expected_calls, env=expected_env):
+        compose.clear_pull_memory()
+        compose.pull('conda-python-pandas', pull_leaf=False)
+
+
+def test_compose_build(arrow_compose_path):
+    compose = DockerCompose(arrow_compose_path)
+
+    expected_calls = [
+        "build conda-cpp",
+    ]
+    with assert_compose_calls(compose, expected_calls):
+        compose.build('conda-cpp')
+
+    expected_calls = [
+        "build --no-cache conda-cpp"
+    ]
+    with assert_compose_calls(compose, expected_calls):
+        compose.build('conda-cpp', use_cache=False)
+
+    expected_calls = [
+        "build conda-cpp",
+        "build conda-python",
+        "build conda-python-pandas"
+    ]
+    with assert_compose_calls(compose, expected_calls):
+        compose.build('conda-python-pandas')
+
+    expected_calls = [
+        "build --no-cache conda-cpp",
+        "build --no-cache conda-python",
+        "build --no-cache conda-python-pandas",
+    ]
+    with assert_compose_calls(compose, expected_calls):
+        compose.build('conda-python-pandas', use_cache=False)
+
+    expected_calls = [
+        "build conda-cpp",
+        "build conda-python",
+        "build --no-cache conda-python-pandas",
+    ]
+    with assert_compose_calls(compose, expected_calls):
+        compose.build('conda-python-pandas', use_cache=True,
+                      use_leaf_cache=False)
+
+
+@mock.patch.dict(os.environ, {"BUILDKIT_INLINE_CACHE": "1"})
+def test_compose_buildkit_inline_cache(arrow_compose_path):
+    compose = DockerCompose(arrow_compose_path)
+
+    expected_calls = [
+        "build --build-arg BUILDKIT_INLINE_CACHE=1 conda-cpp",
+    ]
+    with assert_compose_calls(compose, expected_calls):
+        compose.build('conda-cpp')
+
+
+def test_compose_build_params(arrow_compose_path):
+    expected_calls = [
+        "build ubuntu-cpp",
+    ]
+
+    compose = DockerCompose(arrow_compose_path, params=dict(UBUNTU='18.04'))
+    expected_env = PartialEnv(UBUNTU="18.04")
+    with assert_compose_calls(compose, expected_calls, env=expected_env):
+        compose.build('ubuntu-cpp')
+
+    compose = DockerCompose(arrow_compose_path, params=dict(UBUNTU='16.04'))
+    expected_env = PartialEnv(UBUNTU="16.04")
+    with assert_compose_calls(compose, expected_calls, env=expected_env):
+        compose.build('ubuntu-cpp')
+
+    expected_calls = [
+        "build --no-cache conda-cpp",
+        "build --no-cache conda-python",
+        "build --no-cache conda-python-pandas",
+    ]
+    compose = DockerCompose(arrow_compose_path, params=dict(UBUNTU='18.04'))
+    expected_env = PartialEnv(PYTHON='3.6', PANDAS='latest')
+    with assert_compose_calls(compose, expected_calls, env=expected_env):
+        compose.build('conda-python-pandas', use_cache=False)
+
+
+def test_compose_run(arrow_compose_path):
+    expected_calls = [
+        format_run("conda-cpp"),
+    ]
+    compose = DockerCompose(arrow_compose_path)
+    with assert_compose_calls(compose, expected_calls):
+        compose.run('conda-cpp')
+
+    expected_calls = [
+        format_run("conda-python")
+    ]
+    expected_env = PartialEnv(PYTHON='3.6')
+    with assert_compose_calls(compose, expected_calls, env=expected_env):
+        compose.run('conda-python')
+
+    compose = DockerCompose(arrow_compose_path, params=dict(PYTHON='3.8'))
+    expected_env = PartialEnv(PYTHON='3.8')
+    with assert_compose_calls(compose, expected_calls, env=expected_env):
+        compose.run('conda-python')
+
+    compose = DockerCompose(arrow_compose_path, params=dict(PYTHON='3.8'))
+    for command in ["bash", "echo 1"]:
+        expected_calls = [
+            format_run(["conda-python", command]),
+        ]
+        expected_env = PartialEnv(PYTHON='3.8')
+        with assert_compose_calls(compose, expected_calls, env=expected_env):
+            compose.run('conda-python', command)
+
+    expected_calls = [
+        (
+            format_run("-e CONTAINER_ENV_VAR_A=a -e CONTAINER_ENV_VAR_B=b "
+                       "conda-python")
+        )
+    ]
+    compose = DockerCompose(arrow_compose_path)
+    expected_env = PartialEnv(PYTHON='3.6')
+    with assert_compose_calls(compose, expected_calls, env=expected_env):
+        env = collections.OrderedDict([
+            ("CONTAINER_ENV_VAR_A", "a"),
+            ("CONTAINER_ENV_VAR_B", "b")
+        ])
+        compose.run('conda-python', env=env)
+
+    expected_calls = [
+        (
+            format_run("--volume /host/build:/build --volume "
+                       "/host/ccache:/ccache:delegated conda-python")
+        )
+    ]
+    compose = DockerCompose(arrow_compose_path)
+    with assert_compose_calls(compose, expected_calls):
+        volumes = ("/host/build:/build", "/host/ccache:/ccache:delegated")
+        compose.run('conda-python', volumes=volumes)
+
+
+def test_compose_run_with_resource_limits(arrow_compose_path):
+    expected_calls = [
+        format_run([
+            "--cpuset-cpus=0,1",
+            "--memory=7g",
+            "--memory-swap=7g",
+            "org/conda-cpp"
+        ]),
+    ]
+    compose = DockerCompose(arrow_compose_path)
+    with assert_docker_calls(compose, expected_calls):
+        compose.run('conda-cpp', resource_limit="github")
+
+
+def test_compose_push(arrow_compose_path):
+    compose = DockerCompose(arrow_compose_path, params=dict(PYTHON='3.8'))
+    expected_env = PartialEnv(PYTHON="3.8")
+    expected_calls = [
+        mock.call(["docker", "login", "-u", "user", "-p", "pass"], check=True),
+    ]
+    for image in ["conda-cpp", "conda-python", "conda-python-pandas"]:
+        expected_calls.append(
+            mock.call(["docker-compose", "--file", str(compose.config.path),
+                       "push", image], check=True, env=expected_env)
+        )
+    with assert_subprocess_calls(expected_calls):
+        compose.push('conda-python-pandas', user='user', password='pass')
+
+
+def test_compose_error(arrow_compose_path):
+    compose = DockerCompose(arrow_compose_path, params=dict(
+        PYTHON='3.8',
+        PANDAS='master'
+    ))
+
+    error = subprocess.CalledProcessError(99, [])
+    with mock.patch('subprocess.run', side_effect=error):
+        with pytest.raises(RuntimeError) as exc:
+            compose.run('conda-cpp')
+
+    exception_message = str(exc.value)
+    assert "exited with a non-zero exit code 99" in exception_message
+    assert "PANDAS: latest" in exception_message
+    assert "export PANDAS=master" in exception_message
+
+
+def test_image_with_gpu(arrow_compose_path):
+    compose = DockerCompose(arrow_compose_path)
+
+    expected_calls = [
+        [
+            "run", "--rm", "--gpus", "all",
+            "-e", "CUDA_ENV=1",
+            "-e", "OTHER_ENV=2",
+            "-v", "/host:/container:rw",
+            "org/ubuntu-cuda",
+            '/bin/bash -c "echo 1 > /tmp/dummy && cat /tmp/dummy"'
+        ]
+    ]
+    with assert_docker_calls(compose, expected_calls):
+        compose.run('ubuntu-cuda')
+
+
+def test_listing_images(arrow_compose_path):
+    compose = DockerCompose(arrow_compose_path)
+    assert sorted(compose.images()) == [
+        'conda-cpp',
+        'conda-python',
+        'conda-python-dask',
+        'conda-python-pandas',
+        'ubuntu-c-glib',
+        'ubuntu-cpp',
+        'ubuntu-cpp-cmake32',
+        'ubuntu-cuda',
+        'ubuntu-ruby',
+    ]
diff --git a/src/arrow/dev/archery/archery/docker/tests/test_docker_cli.py b/src/arrow/dev/archery/archery/docker/tests/test_docker_cli.py
new file mode 100644
index 000000000..ab39c7b9d
--- /dev/null
+++ b/src/arrow/dev/archery/archery/docker/tests/test_docker_cli.py
@@ -0,0 +1,201 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from unittest.mock import patch
+
+from click.testing import CliRunner
+
+from archery.docker import DockerCompose
+from archery.docker.cli import docker
+
+
+@patch.object(DockerCompose, "pull")
+@patch.object(DockerCompose, "build")
+@patch.object(DockerCompose, "run")
+def test_docker_run_with_custom_command(run, build, pull):
+    # with custom command
+    args = ["run", "ubuntu-cpp", "bash"]
+    result = CliRunner().invoke(docker, args)
+
+    assert result.exit_code == 0
+    pull.assert_called_once_with(
+        "ubuntu-cpp", pull_leaf=True, using_docker=False
+    )
+    build.assert_called_once_with(
+        "ubuntu-cpp",
+        use_cache=True,
+        use_leaf_cache=True,
+        using_docker=False,
+        using_buildx=False
+    )
+    run.assert_called_once_with(
+        "ubuntu-cpp",
+        command="bash",
+        env={},
+        resource_limit=None,
+        user=None,
+        using_docker=False,
+        volumes=(),
+    )
+
+
+@patch.object(DockerCompose, "pull")
+@patch.object(DockerCompose, "build")
+@patch.object(DockerCompose, "run")
+def test_docker_run_options(run, build, pull):
+    # environment variables and volumes
+    args = [
+        "run",
+        "-e",
+        "ARROW_GANDIVA=OFF",
+        "-e",
+        "ARROW_FLIGHT=ON",
+        "--volume",
+        "./build:/build",
+        "-v",
+        "./ccache:/ccache:delegated",
+        "-u",
+        "root",
+        "ubuntu-cpp",
+    ]
+    result = CliRunner().invoke(docker, args)
+    assert result.exit_code == 0
+    pull.assert_called_once_with(
+        "ubuntu-cpp", pull_leaf=True, using_docker=False
+    )
+    build.assert_called_once_with(
+        "ubuntu-cpp",
+        use_cache=True,
+        use_leaf_cache=True,
+        using_docker=False,
+        using_buildx=False
+    )
+    run.assert_called_once_with(
+        "ubuntu-cpp",
+        command=None,
+        env={"ARROW_GANDIVA": "OFF", "ARROW_FLIGHT": "ON"},
+        resource_limit=None,
+        user="root",
+        using_docker=False,
+        volumes=(
+            "./build:/build",
+            "./ccache:/ccache:delegated",
+        ),
+    )
+
+
+@patch.object(DockerCompose, "run")
+def test_docker_limit_options(run):
+    # environment variables and volumes
+    args = [
+        "run",
+        "-e",
+        "ARROW_GANDIVA=OFF",
+        "-e",
+        "ARROW_FLIGHT=ON",
+        "--volume",
+        "./build:/build",
+        "-v",
+        "./ccache:/ccache:delegated",
+        "-u",
+        "root",
+        "--resource-limit=github",
+        "--no-build",
+        "--no-pull",
+        "ubuntu-cpp",
+    ]
+    result = CliRunner().invoke(docker, args)
+    assert result.exit_code == 0
+    run.assert_called_once_with(
+        "ubuntu-cpp",
+        command=None,
+        env={"ARROW_GANDIVA": "OFF", "ARROW_FLIGHT": "ON"},
+        resource_limit="github",
+        user="root",
+        using_docker=False,
+        volumes=(
+            "./build:/build",
+            "./ccache:/ccache:delegated",
+        ),
+    )
+
+
+@patch.object(DockerCompose, "run")
+def test_docker_run_without_pulling_or_building(run):
+    args = ["run", "--no-pull", "--no-build", "ubuntu-cpp"]
+    result = CliRunner().invoke(docker, args)
+    assert result.exit_code == 0
+    run.assert_called_once_with(
+        "ubuntu-cpp",
+        command=None,
+        env={},
+        resource_limit=None,
+        user=None,
+        using_docker=False,
+        volumes=(),
+    )
+
+
+@patch.object(DockerCompose, "pull")
+@patch.object(DockerCompose, "build")
+def test_docker_run_only_pulling_and_building(build, pull):
+    args = ["run", "ubuntu-cpp", "--build-only"]
+    result = CliRunner().invoke(docker, args)
+    assert result.exit_code == 0
+    pull.assert_called_once_with(
+        "ubuntu-cpp", pull_leaf=True, using_docker=False
+    )
+    build.assert_called_once_with(
+        "ubuntu-cpp",
+        use_cache=True,
+        use_leaf_cache=True,
+        using_docker=False,
+        using_buildx=False
+    )
+
+
+@patch.object(DockerCompose, "build")
+@patch.object(DockerCompose, "run")
+def test_docker_run_without_build_cache(run, build):
+    args = [
+        "run",
+        "--no-pull",
+        "--force-build",
+        "--user",
+        "me",
+        "--no-cache",
+        "--no-leaf-cache",
+        "ubuntu-cpp",
+    ]
+    result = CliRunner().invoke(docker, args)
+    assert result.exit_code == 0
+    build.assert_called_once_with(
+        "ubuntu-cpp",
+        use_cache=False,
+        use_leaf_cache=False,
+        using_docker=False,
+        using_buildx=False
+    )
+    run.assert_called_once_with(
+        "ubuntu-cpp",
+        command=None,
+        env={},
+        resource_limit=None,
+        user="me",
+        using_docker=False,
+        volumes=(),
+    )
diff --git a/src/arrow/dev/archery/archery/integration/__init__.py b/src/arrow/dev/archery/archery/integration/__init__.py
new file mode 100644
index 000000000..13a83393a
--- /dev/null
+++ b/src/arrow/dev/archery/archery/integration/__init__.py
@@ -0,0 +1,16 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
diff --git a/src/arrow/dev/archery/archery/integration/datagen.py b/src/arrow/dev/archery/archery/integration/datagen.py
new file mode 100644
index 000000000..b764982bd
--- /dev/null
+++ b/src/arrow/dev/archery/archery/integration/datagen.py
@@ -0,0 +1,1662 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from collections import namedtuple, OrderedDict
+import binascii
+import json
+import os
+import random
+import tempfile
+
+import numpy as np
+
+from .util import frombytes, tobytes, random_bytes, random_utf8
+
+
+def metadata_key_values(pairs):
+    return [{'key': k, 'value': v} for k, v in pairs]
+
+
+class Field(object):
+
+    def __init__(self, name, *, nullable=True, metadata=None):
+        self.name = name
+        self.nullable = nullable
+        self.metadata = metadata or []
+
+    def get_json(self):
+        entries = [
+            ('name', self.name),
+            ('type', self._get_type()),
+            ('nullable', self.nullable),
+            ('children', self._get_children()),
+        ]
+
+        dct = self._get_dictionary()
+        if dct:
+            entries.append(('dictionary', dct))
+
+        if self.metadata is not None and len(self.metadata) > 0:
+            entries.append(('metadata', metadata_key_values(self.metadata)))
+
+        return OrderedDict(entries)
+
+    def _get_dictionary(self):
+        return None
+
+    def _make_is_valid(self, size, null_probability=0.4):
+        if self.nullable:
+            return (np.random.random_sample(size) > null_probability
+                    ).astype(np.int8)
+        else:
+            return np.ones(size, dtype=np.int8)
+
+
+class Column(object):
+
+    def __init__(self, name, count):
+        self.name = name
+        self.count = count
+
+    def __len__(self):
+        return self.count
+
+    def _get_children(self):
+        return []
+
+    def _get_buffers(self):
+        return []
+
+    def get_json(self):
+        entries = [
+            ('name', self.name),
+            ('count', self.count)
+        ]
+
+        buffers = self._get_buffers()
+        entries.extend(buffers)
+
+        children = self._get_children()
+        if len(children) > 0:
+            entries.append(('children', children))
+
+        return OrderedDict(entries)
+
+
+class PrimitiveField(Field):
+
+    def _get_children(self):
+        return []
+
+
+class PrimitiveColumn(Column):
+
+    def __init__(self, name, count, is_valid, values):
+        super().__init__(name, count)
+        self.is_valid = is_valid
+        self.values = values
+
+    def _encode_value(self, x):
+        return x
+
+    def _get_buffers(self):
+        return [
+            ('VALIDITY', [int(v) for v in self.is_valid]),
+            ('DATA', list([self._encode_value(x) for x in self.values]))
+        ]
+
+
+class NullColumn(Column):
+    # This subclass is for readability only
+    pass
+
+
+class NullField(PrimitiveField):
+
+    def __init__(self, name, metadata=None):
+        super().__init__(name, nullable=True,
+                         metadata=metadata)
+
+    def _get_type(self):
+        return OrderedDict([('name', 'null')])
+
+    def generate_column(self, size, name=None):
+        return NullColumn(name or self.name, size)
+
+
+TEST_INT_MAX = 2 ** 31 - 1
+TEST_INT_MIN = ~TEST_INT_MAX
+
+
+class IntegerField(PrimitiveField):
+
+    def __init__(self, name, is_signed, bit_width, *, nullable=True,
+                 metadata=None,
+                 min_value=TEST_INT_MIN,
+                 max_value=TEST_INT_MAX):
+        super().__init__(name, nullable=nullable,
+                         metadata=metadata)
+        self.is_signed = is_signed
+        self.bit_width = bit_width
+        self.min_value = min_value
+        self.max_value = max_value
+
+    def _get_generated_data_bounds(self):
+        if self.is_signed:
+            signed_iinfo = np.iinfo('int' + str(self.bit_width))
+            min_value, max_value = signed_iinfo.min, signed_iinfo.max
+        else:
+            unsigned_iinfo = np.iinfo('uint' + str(self.bit_width))
+            min_value, max_value = 0, unsigned_iinfo.max
+
+        lower_bound = max(min_value, self.min_value)
+        upper_bound = min(max_value, self.max_value)
+        return lower_bound, upper_bound
+
+    def _get_type(self):
+        return OrderedDict([
+            ('name', 'int'),
+            ('isSigned', self.is_signed),
+            ('bitWidth', self.bit_width)
+        ])
+
+    def generate_column(self, size, name=None):
+        lower_bound, upper_bound = self._get_generated_data_bounds()
+        return self.generate_range(size, lower_bound, upper_bound,
+                                   name=name, include_extremes=True)
+
+    def generate_range(self, size, lower, upper, name=None,
+                       include_extremes=False):
+        values = np.random.randint(lower, upper, size=size, dtype=np.int64)
+        if include_extremes and size >= 2:
+            values[:2] = [lower, upper]
+        values = list(map(int if self.bit_width < 64 else str, values))
+
+        is_valid = self._make_is_valid(size)
+
+        if name is None:
+            name = self.name
+        return PrimitiveColumn(name, size, is_valid, values)
+
+
+class DateField(IntegerField):
+
+    DAY = 0
+    MILLISECOND = 1
+
+    # 1/1/1 to 12/31/9999
+    _ranges = {
+        DAY: [-719162, 2932896],
+        MILLISECOND: [-62135596800000, 253402214400000]
+    }
+
+    def __init__(self, name, unit, *, nullable=True, metadata=None):
+        bit_width = 32 if unit == self.DAY else 64
+
+        min_value, max_value = self._ranges[unit]
+        super().__init__(
+            name, True, bit_width,
+            nullable=nullable, metadata=metadata,
+            min_value=min_value, max_value=max_value
+        )
+        self.unit = unit
+
+    def _get_type(self):
+        return OrderedDict([
+            ('name', 'date'),
+            ('unit', 'DAY' if self.unit == self.DAY else 'MILLISECOND')
+        ])
+
+
+TIMEUNIT_NAMES = {
+    's': 'SECOND',
+    'ms': 'MILLISECOND',
+    'us': 'MICROSECOND',
+    'ns': 'NANOSECOND'
+}
+
+
+class TimeField(IntegerField):
+
+    BIT_WIDTHS = {
+        's': 32,
+        'ms': 32,
+        'us': 64,
+        'ns': 64
+    }
+
+    _ranges = {
+        's': [0, 86400],
+        'ms': [0, 86400000],
+        'us': [0, 86400000000],
+        'ns': [0, 86400000000000]
+    }
+
+    def __init__(self, name, unit='s', *, nullable=True,
+                 metadata=None):
+        min_val, max_val = self._ranges[unit]
+        super().__init__(name, True, self.BIT_WIDTHS[unit],
+                         nullable=nullable, metadata=metadata,
+                         min_value=min_val, max_value=max_val)
+        self.unit = unit
+
+    def _get_type(self):
+        return OrderedDict([
+            ('name', 'time'),
+            ('unit', TIMEUNIT_NAMES[self.unit]),
+            ('bitWidth', self.bit_width)
+        ])
+
+
+class TimestampField(IntegerField):
+
+    # 1/1/1 to 12/31/9999
+    _ranges = {
+        's': [-62135596800, 253402214400],
+        'ms': [-62135596800000, 253402214400000],
+        'us': [-62135596800000000, 253402214400000000],
+
+        # Physical range for int64, ~584 years and change
+        'ns': [np.iinfo('int64').min, np.iinfo('int64').max]
+    }
+
+    def __init__(self, name, unit='s', tz=None, *, nullable=True,
+                 metadata=None):
+        min_val, max_val = self._ranges[unit]
+        super().__init__(name, True, 64,
+                         nullable=nullable,
+                         metadata=metadata,
+                         min_value=min_val,
+                         max_value=max_val)
+        self.unit = unit
+        self.tz = tz
+
+    def _get_type(self):
+        fields = [
+            ('name', 'timestamp'),
+            ('unit', TIMEUNIT_NAMES[self.unit])
+        ]
+
+        if self.tz is not None:
+            fields.append(('timezone', self.tz))
+
+        return OrderedDict(fields)
+
+
+class DurationIntervalField(IntegerField):
+
+    def __init__(self, name, unit='s', *, nullable=True,
+                 metadata=None):
+        min_val, max_val = np.iinfo('int64').min, np.iinfo('int64').max,
+        super().__init__(
+            name, True, 64,
+            nullable=nullable, metadata=metadata,
+            min_value=min_val, max_value=max_val)
+        self.unit = unit
+
+    def _get_type(self):
+        fields = [
+            ('name', 'duration'),
+            ('unit', TIMEUNIT_NAMES[self.unit])
+        ]
+
+        return OrderedDict(fields)
+
+
+class YearMonthIntervalField(IntegerField):
+    def __init__(self, name, *, nullable=True, metadata=None):
+        min_val, max_val = [-10000*12, 10000*12]  # +/- 10000 years.
+        super().__init__(
+            name, True, 32,
+            nullable=nullable, metadata=metadata,
+            min_value=min_val, max_value=max_val)
+
+    def _get_type(self):
+        fields = [
+            ('name', 'interval'),
+            ('unit', 'YEAR_MONTH'),
+        ]
+
+        return OrderedDict(fields)
+
+
+class DayTimeIntervalField(PrimitiveField):
+    def __init__(self, name, *, nullable=True, metadata=None):
+        super().__init__(name,
+                         nullable=True,
+                         metadata=metadata)
+
+    @property
+    def numpy_type(self):
+        return object
+
+    def _get_type(self):
+
+        return OrderedDict([
+            ('name', 'interval'),
+            ('unit', 'DAY_TIME'),
+        ])
+
+    def generate_column(self, size, name=None):
+        min_day_value, max_day_value = -10000*366, 10000*366
+        values = [{'days': random.randint(min_day_value, max_day_value),
+                   'milliseconds': random.randint(-86400000, +86400000)}
+                  for _ in range(size)]
+
+        is_valid = self._make_is_valid(size)
+        if name is None:
+            name = self.name
+        return PrimitiveColumn(name, size, is_valid, values)
+
+
+class MonthDayNanoIntervalField(PrimitiveField):
+    def __init__(self, name, *, nullable=True, metadata=None):
+        super().__init__(name,
+                         nullable=True,
+                         metadata=metadata)
+
+    @property
+    def numpy_type(self):
+        return object
+
+    def _get_type(self):
+
+        return OrderedDict([
+            ('name', 'interval'),
+            ('unit', 'MONTH_DAY_NANO'),
+        ])
+
+    def generate_column(self, size, name=None):
+        I32 = 'int32'
+        min_int_value, max_int_value = np.iinfo(I32).min, np.iinfo(I32).max
+        I64 = 'int64'
+        min_nano_val, max_nano_val = np.iinfo(I64).min, np.iinfo(I64).max,
+        values = [{'months': random.randint(min_int_value, max_int_value),
+                   'days': random.randint(min_int_value, max_int_value),
+                   'nanoseconds': random.randint(min_nano_val, max_nano_val)}
+                  for _ in range(size)]
+
+        is_valid = self._make_is_valid(size)
+        if name is None:
+            name = self.name
+        return PrimitiveColumn(name, size, is_valid, values)
+
+
+class FloatingPointField(PrimitiveField):
+
+    def __init__(self, name, bit_width, *, nullable=True,
+                 metadata=None):
+        super().__init__(name,
+                         nullable=nullable,
+                         metadata=metadata)
+
+        self.bit_width = bit_width
+        self.precision = {
+            16: 'HALF',
+            32: 'SINGLE',
+            64: 'DOUBLE'
+        }[self.bit_width]
+
+    @property
+    def numpy_type(self):
+        return 'float' + str(self.bit_width)
+
+    def _get_type(self):
+        return OrderedDict([
+            ('name', 'floatingpoint'),
+            ('precision', self.precision)
+        ])
+
+    def generate_column(self, size, name=None):
+        values = np.random.randn(size) * 1000
+        values = np.round(values, 3)
+
+        is_valid = self._make_is_valid(size)
+        if name is None:
+            name = self.name
+        return PrimitiveColumn(name, size, is_valid, values)
+
+
+DECIMAL_PRECISION_TO_VALUE = {
+    key: (1 << (8 * i - 1)) - 1 for i, key in enumerate(
+        [1, 3, 5, 7, 10, 12, 15, 17, 19, 22, 24, 27, 29, 32, 34, 36,
+         40, 42, 44, 50, 60, 70],
+        start=1,
+    )
+}
+
+
+def decimal_range_from_precision(precision):
+    assert 1 <= precision <= 76
+    try:
+        max_value = DECIMAL_PRECISION_TO_VALUE[precision]
+    except KeyError:
+        return decimal_range_from_precision(precision - 1)
+    else:
+        return ~max_value, max_value
+
+
+class DecimalField(PrimitiveField):
+    def __init__(self, name, precision, scale, bit_width, *,
+                 nullable=True, metadata=None):
+        super().__init__(name, nullable=True,
+                         metadata=metadata)
+        self.precision = precision
+        self.scale = scale
+        self.bit_width = bit_width
+
+    @property
+    def numpy_type(self):
+        return object
+
+    def _get_type(self):
+        return OrderedDict([
+            ('name', 'decimal'),
+            ('precision', self.precision),
+            ('scale', self.scale),
+            ('bitWidth', self.bit_width),
+        ])
+
+    def generate_column(self, size, name=None):
+        min_value, max_value = decimal_range_from_precision(self.precision)
+        values = [random.randint(min_value, max_value) for _ in range(size)]
+
+        is_valid = self._make_is_valid(size)
+        if name is None:
+            name = self.name
+        return DecimalColumn(name, size, is_valid, values, self.bit_width)
+
+
+class DecimalColumn(PrimitiveColumn):
+
+    def __init__(self, name, count, is_valid, values, bit_width):
+        super().__init__(name, count, is_valid, values)
+        self.bit_width = bit_width
+
+    def _encode_value(self, x):
+        return str(x)
+
+
+class BooleanField(PrimitiveField):
+    bit_width = 1
+
+    def _get_type(self):
+        return OrderedDict([('name', 'bool')])
+
+    @property
+    def numpy_type(self):
+        return 'bool'
+
+    def generate_column(self, size, name=None):
+        values = list(map(bool, np.random.randint(0, 2, size=size)))
+        is_valid = self._make_is_valid(size)
+        if name is None:
+            name = self.name
+        return PrimitiveColumn(name, size, is_valid, values)
+
+
+class FixedSizeBinaryField(PrimitiveField):
+
+    def __init__(self, name, byte_width, *, nullable=True,
+                 metadata=None):
+        super().__init__(name, nullable=nullable,
+                         metadata=metadata)
+        self.byte_width = byte_width
+
+    @property
+    def numpy_type(self):
+        return object
+
+    @property
+    def column_class(self):
+        return FixedSizeBinaryColumn
+
+    def _get_type(self):
+        return OrderedDict([('name', 'fixedsizebinary'),
+                            ('byteWidth', self.byte_width)])
+
+    def generate_column(self, size, name=None):
+        is_valid = self._make_is_valid(size)
+        values = []
+
+        for i in range(size):
+            values.append(random_bytes(self.byte_width))
+
+        if name is None:
+            name = self.name
+        return self.column_class(name, size, is_valid, values)
+
+
+class BinaryField(PrimitiveField):
+
+    @property
+    def numpy_type(self):
+        return object
+
+    @property
+    def column_class(self):
+        return BinaryColumn
+
+    def _get_type(self):
+        return OrderedDict([('name', 'binary')])
+
+    def _random_sizes(self, size):
+        return np.random.exponential(scale=4, size=size).astype(np.int32)
+
+    def generate_column(self, size, name=None):
+        is_valid = self._make_is_valid(size)
+        values = []
+
+        sizes = self._random_sizes(size)
+
+        for i, nbytes in enumerate(sizes):
+            if is_valid[i]:
+                values.append(random_bytes(nbytes))
+            else:
+                values.append(b"")
+
+        if name is None:
+            name = self.name
+        return self.column_class(name, size, is_valid, values)
+
+
+class StringField(BinaryField):
+
+    @property
+    def column_class(self):
+        return StringColumn
+
+    def _get_type(self):
+        return OrderedDict([('name', 'utf8')])
+
+    def generate_column(self, size, name=None):
+        K = 7
+        is_valid = self._make_is_valid(size)
+        values = []
+
+        for i in range(size):
+            if is_valid[i]:
+                values.append(tobytes(random_utf8(K)))
+            else:
+                values.append(b"")
+
+        if name is None:
+            name = self.name
+        return self.column_class(name, size, is_valid, values)
+
+
+class LargeBinaryField(BinaryField):
+
+    @property
+    def column_class(self):
+        return LargeBinaryColumn
+
+    def _get_type(self):
+        return OrderedDict([('name', 'largebinary')])
+
+
+class LargeStringField(StringField):
+
+    @property
+    def column_class(self):
+        return LargeStringColumn
+
+    def _get_type(self):
+        return OrderedDict([('name', 'largeutf8')])
+
+
+class Schema(object):
+
+    def __init__(self, fields, metadata=None):
+        self.fields = fields
+        self.metadata = metadata
+
+    def get_json(self):
+        entries = [
+            ('fields', [field.get_json() for field in self.fields])
+        ]
+
+        if self.metadata is not None and len(self.metadata) > 0:
+            entries.append(('metadata', metadata_key_values(self.metadata)))
+
+        return OrderedDict(entries)
+
+
+class _NarrowOffsetsMixin:
+
+    def _encode_offsets(self, offsets):
+        return list(map(int, offsets))
+
+
+class _LargeOffsetsMixin:
+
+    def _encode_offsets(self, offsets):
+        # 64-bit offsets have to be represented as strings to roundtrip
+        # through JSON.
+        return list(map(str, offsets))
+
+
+class _BaseBinaryColumn(PrimitiveColumn):
+
+    def _encode_value(self, x):
+        return frombytes(binascii.hexlify(x).upper())
+
+    def _get_buffers(self):
+        offset = 0
+        offsets = [0]
+
+        data = []
+        for i, v in enumerate(self.values):
+            if self.is_valid[i]:
+                offset += len(v)
+            else:
+                v = b""
+
+            offsets.append(offset)
+            data.append(self._encode_value(v))
+
+        return [
+            ('VALIDITY', [int(x) for x in self.is_valid]),
+            ('OFFSET', self._encode_offsets(offsets)),
+            ('DATA', data)
+        ]
+
+
+class _BaseStringColumn(_BaseBinaryColumn):
+
+    def _encode_value(self, x):
+        return frombytes(x)
+
+
+class BinaryColumn(_BaseBinaryColumn, _NarrowOffsetsMixin):
+    pass
+
+
+class StringColumn(_BaseStringColumn, _NarrowOffsetsMixin):
+    pass
+
+
+class LargeBinaryColumn(_BaseBinaryColumn, _LargeOffsetsMixin):
+    pass
+
+
+class LargeStringColumn(_BaseStringColumn, _LargeOffsetsMixin):
+    pass
+
+
+class FixedSizeBinaryColumn(PrimitiveColumn):
+
+    def _encode_value(self, x):
+        return frombytes(binascii.hexlify(x).upper())
+
+    def _get_buffers(self):
+        data = []
+        for i, v in enumerate(self.values):
+            data.append(self._encode_value(v))
+
+        return [
+            ('VALIDITY', [int(x) for x in self.is_valid]),
+            ('DATA', data)
+        ]
+
+
+class ListField(Field):
+
+    def __init__(self, name, value_field, *, nullable=True,
+                 metadata=None):
+        super().__init__(name, nullable=nullable,
+                         metadata=metadata)
+        self.value_field = value_field
+
+    @property
+    def column_class(self):
+        return ListColumn
+
+    def _get_type(self):
+        return OrderedDict([
+            ('name', 'list')
+        ])
+
+    def _get_children(self):
+        return [self.value_field.get_json()]
+
+    def generate_column(self, size, name=None):
+        MAX_LIST_SIZE = 4
+
+        is_valid = self._make_is_valid(size)
+        list_sizes = np.random.randint(0, MAX_LIST_SIZE + 1, size=size)
+        offsets = [0]
+
+        offset = 0
+        for i in range(size):
+            if is_valid[i]:
+                offset += int(list_sizes[i])
+            offsets.append(offset)
+
+        # The offset now is the total number of elements in the child array
+        values = self.value_field.generate_column(offset)
+
+        if name is None:
+            name = self.name
+        return self.column_class(name, size, is_valid, offsets, values)
+
+
+class LargeListField(ListField):
+
+    @property
+    def column_class(self):
+        return LargeListColumn
+
+    def _get_type(self):
+        return OrderedDict([
+            ('name', 'largelist')
+        ])
+
+
+class _BaseListColumn(Column):
+
+    def __init__(self, name, count, is_valid, offsets, values):
+        super().__init__(name, count)
+        self.is_valid = is_valid
+        self.offsets = offsets
+        self.values = values
+
+    def _get_buffers(self):
+        return [
+            ('VALIDITY', [int(v) for v in self.is_valid]),
+            ('OFFSET', self._encode_offsets(self.offsets))
+        ]
+
+    def _get_children(self):
+        return [self.values.get_json()]
+
+
+class ListColumn(_BaseListColumn, _NarrowOffsetsMixin):
+    pass
+
+
+class LargeListColumn(_BaseListColumn, _LargeOffsetsMixin):
+    pass
+
+
+class MapField(Field):
+
+    def __init__(self, name, key_field, item_field, *, nullable=True,
+                 metadata=None, keys_sorted=False, entries_name='entries'):
+        super().__init__(name, nullable=nullable,
+                         metadata=metadata)
+
+        assert not key_field.nullable
+        self.key_field = key_field
+        self.item_field = item_field
+        self.pair_field = StructField(entries_name, [key_field, item_field],
+                                      nullable=False)
+        self.keys_sorted = keys_sorted
+
+    def _get_type(self):
+        return OrderedDict([
+            ('name', 'map'),
+            ('keysSorted', self.keys_sorted)
+        ])
+
+    def _get_children(self):
+        return [self.pair_field.get_json()]
+
+    def generate_column(self, size, name=None):
+        MAX_MAP_SIZE = 4
+
+        is_valid = self._make_is_valid(size)
+        map_sizes = np.random.randint(0, MAX_MAP_SIZE + 1, size=size)
+        offsets = [0]
+
+        offset = 0
+        for i in range(size):
+            if is_valid[i]:
+                offset += int(map_sizes[i])
+            offsets.append(offset)
+
+        # The offset now is the total number of elements in the child array
+        pairs = self.pair_field.generate_column(offset)
+        if name is None:
+            name = self.name
+
+        return MapColumn(name, size, is_valid, offsets, pairs)
+
+
+class MapColumn(Column):
+
+    def __init__(self, name, count, is_valid, offsets, pairs):
+        super().__init__(name, count)
+        self.is_valid = is_valid
+        self.offsets = offsets
+        self.pairs = pairs
+
+    def _get_buffers(self):
+        return [
+            ('VALIDITY', [int(v) for v in self.is_valid]),
+            ('OFFSET', list(self.offsets))
+        ]
+
+    def _get_children(self):
+        return [self.pairs.get_json()]
+
+
+class FixedSizeListField(Field):
+
+    def __init__(self, name, value_field, list_size, *, nullable=True,
+                 metadata=None):
+        super().__init__(name, nullable=nullable,
+                         metadata=metadata)
+        self.value_field = value_field
+        self.list_size = list_size
+
+    def _get_type(self):
+        return OrderedDict([
+            ('name', 'fixedsizelist'),
+            ('listSize', self.list_size)
+        ])
+
+    def _get_children(self):
+        return [self.value_field.get_json()]
+
+    def generate_column(self, size, name=None):
+        is_valid = self._make_is_valid(size)
+        values = self.value_field.generate_column(size * self.list_size)
+
+        if name is None:
+            name = self.name
+        return FixedSizeListColumn(name, size, is_valid, values)
+
+
+class FixedSizeListColumn(Column):
+
+    def __init__(self, name, count, is_valid, values):
+        super().__init__(name, count)
+        self.is_valid = is_valid
+        self.values = values
+
+    def _get_buffers(self):
+        return [
+            ('VALIDITY', [int(v) for v in self.is_valid])
+        ]
+
+    def _get_children(self):
+        return [self.values.get_json()]
+
+
+class StructField(Field):
+
+    def __init__(self, name, fields, *, nullable=True,
+                 metadata=None):
+        super().__init__(name, nullable=nullable,
+                         metadata=metadata)
+        self.fields = fields
+
+    def _get_type(self):
+        return OrderedDict([
+            ('name', 'struct')
+        ])
+
+    def _get_children(self):
+        return [field.get_json() for field in self.fields]
+
+    def generate_column(self, size, name=None):
+        is_valid = self._make_is_valid(size)
+
+        field_values = [field.generate_column(size) for field in self.fields]
+        if name is None:
+            name = self.name
+        return StructColumn(name, size, is_valid, field_values)
+
+
+class _BaseUnionField(Field):
+
+    def __init__(self, name, fields, type_ids=None, *, nullable=True,
+                 metadata=None):
+        super().__init__(name, nullable=nullable, metadata=metadata)
+        if type_ids is None:
+            type_ids = list(range(fields))
+        else:
+            assert len(fields) == len(type_ids)
+        self.fields = fields
+        self.type_ids = type_ids
+        assert all(x >= 0 for x in self.type_ids)
+
+    def _get_type(self):
+        return OrderedDict([
+            ('name', 'union'),
+            ('mode', self.mode),
+            ('typeIds', self.type_ids),
+        ])
+
+    def _get_children(self):
+        return [field.get_json() for field in self.fields]
+
+    def _make_type_ids(self, size):
+        return np.random.choice(self.type_ids, size)
+
+
+class SparseUnionField(_BaseUnionField):
+    mode = 'SPARSE'
+
+    def generate_column(self, size, name=None):
+        array_type_ids = self._make_type_ids(size)
+        field_values = [field.generate_column(size) for field in self.fields]
+
+        if name is None:
+            name = self.name
+        return SparseUnionColumn(name, size, array_type_ids, field_values)
+
+
+class DenseUnionField(_BaseUnionField):
+    mode = 'DENSE'
+
+    def generate_column(self, size, name=None):
+        # Reverse mapping {logical type id => physical child id}
+        child_ids = [None] * (max(self.type_ids) + 1)
+        for i, type_id in enumerate(self.type_ids):
+            child_ids[type_id] = i
+
+        array_type_ids = self._make_type_ids(size)
+        offsets = []
+        child_sizes = [0] * len(self.fields)
+
+        for i in range(size):
+            child_id = child_ids[array_type_ids[i]]
+            offset = child_sizes[child_id]
+            offsets.append(offset)
+            child_sizes[child_id] = offset + 1
+
+        field_values = [
+            field.generate_column(child_size)
+            for field, child_size in zip(self.fields, child_sizes)]
+
+        if name is None:
+            name = self.name
+        return DenseUnionColumn(name, size, array_type_ids, offsets,
+                                field_values)
+
+
+class Dictionary(object):
+
+    def __init__(self, id_, field, size, name=None, ordered=False):
+        self.id_ = id_
+        self.field = field
+        self.values = field.generate_column(size=size, name=name)
+        self.ordered = ordered
+
+    def __len__(self):
+        return len(self.values)
+
+    def get_json(self):
+        dummy_batch = RecordBatch(len(self.values), [self.values])
+        return OrderedDict([
+            ('id', self.id_),
+            ('data', dummy_batch.get_json())
+        ])
+
+
+class DictionaryField(Field):
+
+    def __init__(self, name, index_field, dictionary, *, nullable=True,
+                 metadata=None):
+        super().__init__(name, nullable=nullable,
+                         metadata=metadata)
+        assert index_field.name == ''
+        assert isinstance(index_field, IntegerField)
+        assert isinstance(dictionary, Dictionary)
+
+        self.index_field = index_field
+        self.dictionary = dictionary
+
+    def _get_type(self):
+        return self.dictionary.field._get_type()
+
+    def _get_children(self):
+        return self.dictionary.field._get_children()
+
+    def _get_dictionary(self):
+        return OrderedDict([
+            ('id', self.dictionary.id_),
+            ('indexType', self.index_field._get_type()),
+            ('isOrdered', self.dictionary.ordered)
+        ])
+
+    def generate_column(self, size, name=None):
+        if name is None:
+            name = self.name
+        return self.index_field.generate_range(size, 0, len(self.dictionary),
+                                               name=name)
+
+
+ExtensionType = namedtuple(
+    'ExtensionType', ['extension_name', 'serialized', 'storage_field'])
+
+
+class ExtensionField(Field):
+
+    def __init__(self, name, extension_type, *, nullable=True, metadata=None):
+        metadata = (metadata or []) + [
+            ('ARROW:extension:name', extension_type.extension_name),
+            ('ARROW:extension:metadata', extension_type.serialized),
+        ]
+        super().__init__(name, nullable=nullable, metadata=metadata)
+        self.extension_type = extension_type
+
+    def _get_type(self):
+        return self.extension_type.storage_field._get_type()
+
+    def _get_children(self):
+        return self.extension_type.storage_field._get_children()
+
+    def _get_dictionary(self):
+        return self.extension_type.storage_field._get_dictionary()
+
+    def generate_column(self, size, name=None):
+        if name is None:
+            name = self.name
+        return self.extension_type.storage_field.generate_column(size, name)
+
+
+class StructColumn(Column):
+
+    def __init__(self, name, count, is_valid, field_values):
+        super().__init__(name, count)
+        self.is_valid = is_valid
+        self.field_values = field_values
+
+    def _get_buffers(self):
+        return [
+            ('VALIDITY', [int(v) for v in self.is_valid])
+        ]
+
+    def _get_children(self):
+        return [field.get_json() for field in self.field_values]
+
+
+class SparseUnionColumn(Column):
+
+    def __init__(self, name, count, type_ids, field_values):
+        super().__init__(name, count)
+        self.type_ids = type_ids
+        self.field_values = field_values
+
+    def _get_buffers(self):
+        return [
+            ('TYPE_ID', [int(v) for v in self.type_ids])
+        ]
+
+    def _get_children(self):
+        return [field.get_json() for field in self.field_values]
+
+
+class DenseUnionColumn(Column):
+
+    def __init__(self, name, count, type_ids, offsets, field_values):
+        super().__init__(name, count)
+        self.type_ids = type_ids
+        self.offsets = offsets
+        self.field_values = field_values
+
+    def _get_buffers(self):
+        return [
+            ('TYPE_ID', [int(v) for v in self.type_ids]),
+            ('OFFSET', [int(v) for v in self.offsets]),
+        ]
+
+    def _get_children(self):
+        return [field.get_json() for field in self.field_values]
+
+
+class RecordBatch(object):
+
+    def __init__(self, count, columns):
+        self.count = count
+        self.columns = columns
+
+    def get_json(self):
+        return OrderedDict([
+            ('count', self.count),
+            ('columns', [col.get_json() for col in self.columns])
+        ])
+
+
+class File(object):
+
+    def __init__(self, name, schema, batches, dictionaries=None,
+                 skip=None, path=None):
+        self.name = name
+        self.schema = schema
+        self.dictionaries = dictionaries or []
+        self.batches = batches
+        self.skip = set()
+        self.path = path
+        if skip:
+            self.skip.update(skip)
+
+    def get_json(self):
+        entries = [
+            ('schema', self.schema.get_json())
+        ]
+
+        if len(self.dictionaries) > 0:
+            entries.append(('dictionaries',
+                            [dictionary.get_json()
+                             for dictionary in self.dictionaries]))
+
+        entries.append(('batches', [batch.get_json()
+                                    for batch in self.batches]))
+        return OrderedDict(entries)
+
+    def write(self, path):
+        with open(path, 'wb') as f:
+            f.write(json.dumps(self.get_json(), indent=2).encode('utf-8'))
+        self.path = path
+
+    def skip_category(self, category):
+        """Skip this test for the given category.
+
+        Category should be SKIP_ARROW or SKIP_FLIGHT.
+        """
+        self.skip.add(category)
+        return self
+
+
+def get_field(name, type_, **kwargs):
+    if type_ == 'binary':
+        return BinaryField(name, **kwargs)
+    elif type_ == 'utf8':
+        return StringField(name, **kwargs)
+    elif type_ == 'largebinary':
+        return LargeBinaryField(name, **kwargs)
+    elif type_ == 'largeutf8':
+        return LargeStringField(name, **kwargs)
+    elif type_.startswith('fixedsizebinary_'):
+        byte_width = int(type_.split('_')[1])
+        return FixedSizeBinaryField(name, byte_width=byte_width, **kwargs)
+
+    dtype = np.dtype(type_)
+
+    if dtype.kind in ('i', 'u'):
+        signed = dtype.kind == 'i'
+        bit_width = dtype.itemsize * 8
+        return IntegerField(name, signed, bit_width, **kwargs)
+    elif dtype.kind == 'f':
+        bit_width = dtype.itemsize * 8
+        return FloatingPointField(name, bit_width, **kwargs)
+    elif dtype.kind == 'b':
+        return BooleanField(name, **kwargs)
+    else:
+        raise TypeError(dtype)
+
+
+def _generate_file(name, fields, batch_sizes, dictionaries=None, skip=None,
+                   metadata=None):
+    schema = Schema(fields, metadata=metadata)
+    batches = []
+    for size in batch_sizes:
+        columns = []
+        for field in fields:
+            col = field.generate_column(size)
+            columns.append(col)
+
+        batches.append(RecordBatch(size, columns))
+
+    return File(name, schema, batches, dictionaries, skip=skip)
+
+
+def generate_custom_metadata_case():
+    def meta(items):
+        # Generate a simple block of metadata where each value is '{}'.
+        # Keys are delimited by whitespace in `items`.
+        return [(k, '{}') for k in items.split()]
+
+    fields = [
+        get_field('sort_of_pandas', 'int8', metadata=meta('pandas')),
+
+        get_field('lots_of_meta', 'int8', metadata=meta('a b c d .. w x y z')),
+
+        get_field(
+            'unregistered_extension', 'int8',
+            metadata=[
+                ('ARROW:extension:name', '!nonexistent'),
+                ('ARROW:extension:metadata', ''),
+                ('ARROW:integration:allow_unregistered_extension', 'true'),
+            ]),
+
+        ListField('list_with_odd_values',
+                  get_field('item', 'int32', metadata=meta('odd_values'))),
+    ]
+
+    batch_sizes = [1]
+    return _generate_file('custom_metadata', fields, batch_sizes,
+                          metadata=meta('schema_custom_0 schema_custom_1'))
+
+
+def generate_duplicate_fieldnames_case():
+    fields = [
+        get_field('ints', 'int8'),
+        get_field('ints', 'int32'),
+
+        StructField('struct', [get_field('', 'int32'), get_field('', 'utf8')]),
+    ]
+
+    batch_sizes = [1]
+    return _generate_file('duplicate_fieldnames', fields, batch_sizes)
+
+
+def generate_primitive_case(batch_sizes, name='primitive'):
+    types = ['bool', 'int8', 'int16', 'int32', 'int64',
+             'uint8', 'uint16', 'uint32', 'uint64',
+             'float32', 'float64', 'binary', 'utf8',
+             'fixedsizebinary_19', 'fixedsizebinary_120']
+
+    fields = []
+
+    for type_ in types:
+        fields.append(get_field(type_ + "_nullable", type_, nullable=True))
+        fields.append(get_field(type_ + "_nonnullable", type_, nullable=False))
+
+    return _generate_file(name, fields, batch_sizes)
+
+
+def generate_primitive_large_offsets_case(batch_sizes):
+    types = ['largebinary', 'largeutf8']
+
+    fields = []
+
+    for type_ in types:
+        fields.append(get_field(type_ + "_nullable", type_, nullable=True))
+        fields.append(get_field(type_ + "_nonnullable", type_, nullable=False))
+
+    return _generate_file('primitive_large_offsets', fields, batch_sizes)
+
+
+def generate_null_case(batch_sizes):
+    # Interleave null with non-null types to ensure the appropriate number of
+    # buffers (0) is read and written
+    fields = [
+        NullField(name='f0'),
+        get_field('f1', 'int32'),
+        NullField(name='f2'),
+        get_field('f3', 'float64'),
+        NullField(name='f4')
+    ]
+    return _generate_file('null', fields, batch_sizes)
+
+
+def generate_null_trivial_case(batch_sizes):
+    # Generate a case with no buffers
+    fields = [
+        NullField(name='f0'),
+    ]
+    return _generate_file('null_trivial', fields, batch_sizes)
+
+
+def generate_decimal128_case():
+    fields = [
+        DecimalField(name='f{}'.format(i), precision=precision, scale=2,
+                     bit_width=128)
+        for i, precision in enumerate(range(3, 39))
+    ]
+
+    possible_batch_sizes = 7, 10
+    batch_sizes = [possible_batch_sizes[i % 2] for i in range(len(fields))]
+    # 'decimal' is the original name for the test, and it must match
+    # provide "gold" files that test backwards compatibility, so they
+    # can be appropriately skipped.
+    return _generate_file('decimal', fields, batch_sizes)
+
+
+def generate_decimal256_case():
+    fields = [
+        DecimalField(name='f{}'.format(i), precision=precision, scale=5,
+                     bit_width=256)
+        for i, precision in enumerate(range(37, 70))
+    ]
+
+    possible_batch_sizes = 7, 10
+    batch_sizes = [possible_batch_sizes[i % 2] for i in range(len(fields))]
+    return _generate_file('decimal256', fields, batch_sizes)
+
+
+def generate_datetime_case():
+    fields = [
+        DateField('f0', DateField.DAY),
+        DateField('f1', DateField.MILLISECOND),
+        TimeField('f2', 's'),
+        TimeField('f3', 'ms'),
+        TimeField('f4', 'us'),
+        TimeField('f5', 'ns'),
+        TimestampField('f6', 's'),
+        TimestampField('f7', 'ms'),
+        TimestampField('f8', 'us'),
+        TimestampField('f9', 'ns'),
+        TimestampField('f10', 'ms', tz=None),
+        TimestampField('f11', 's', tz='UTC'),
+        TimestampField('f12', 'ms', tz='US/Eastern'),
+        TimestampField('f13', 'us', tz='Europe/Paris'),
+        TimestampField('f14', 'ns', tz='US/Pacific'),
+    ]
+
+    batch_sizes = [7, 10]
+    return _generate_file("datetime", fields, batch_sizes)
+
+
+def generate_interval_case():
+    fields = [
+        DurationIntervalField('f1', 's'),
+        DurationIntervalField('f2', 'ms'),
+        DurationIntervalField('f3', 'us'),
+        DurationIntervalField('f4', 'ns'),
+        YearMonthIntervalField('f5'),
+        DayTimeIntervalField('f6'),
+    ]
+
+    batch_sizes = [7, 10]
+    return _generate_file("interval", fields, batch_sizes)
+
+
+def generate_month_day_nano_interval_case():
+    fields = [
+        MonthDayNanoIntervalField('f1'),
+    ]
+
+    batch_sizes = [7, 10]
+    return _generate_file("interval_mdn", fields, batch_sizes)
+
+
+def generate_map_case():
+    fields = [
+        MapField('map_nullable', get_field('key', 'utf8', nullable=False),
+                 get_field('value', 'int32')),
+    ]
+
+    batch_sizes = [7, 10]
+    return _generate_file("map", fields, batch_sizes)
+
+
+def generate_non_canonical_map_case():
+    fields = [
+        MapField('map_other_names',
+                 get_field('some_key', 'utf8', nullable=False),
+                 get_field('some_value', 'int32'),
+                 entries_name='some_entries'),
+    ]
+
+    batch_sizes = [7]
+    return _generate_file("map_non_canonical", fields, batch_sizes)
+
+
+def generate_nested_case():
+    fields = [
+        ListField('list_nullable', get_field('item', 'int32')),
+        FixedSizeListField('fixedsizelist_nullable',
+                           get_field('item', 'int32'), 4),
+        StructField('struct_nullable', [get_field('f1', 'int32'),
+                                        get_field('f2', 'utf8')]),
+        # Fails on Go (ARROW-8452)
+        # ListField('list_nonnullable', get_field('item', 'int32'),
+        #           nullable=False),
+    ]
+
+    batch_sizes = [7, 10]
+    return _generate_file("nested", fields, batch_sizes)
+
+
+def generate_recursive_nested_case():
+    fields = [
+        ListField('lists_list',
+                  ListField('inner_list', get_field('item', 'int16'))),
+        ListField('structs_list',
+                  StructField('inner_struct',
+                              [get_field('f1', 'int32'),
+                               get_field('f2', 'utf8')])),
+    ]
+
+    batch_sizes = [7, 10]
+    return _generate_file("recursive_nested", fields, batch_sizes)
+
+
+def generate_nested_large_offsets_case():
+    fields = [
+        LargeListField('large_list_nullable', get_field('item', 'int32')),
+        LargeListField('large_list_nonnullable',
+                       get_field('item', 'int32'), nullable=False),
+        LargeListField('large_list_nested',
+                       ListField('inner_list', get_field('item', 'int16'))),
+    ]
+
+    batch_sizes = [0, 13]
+    return _generate_file("nested_large_offsets", fields, batch_sizes)
+
+
+def generate_unions_case():
+    fields = [
+        SparseUnionField('sparse', [get_field('f1', 'int32'),
+                                    get_field('f2', 'utf8')],
+                         type_ids=[5, 7]),
+        DenseUnionField('dense', [get_field('f1', 'int16'),
+                                  get_field('f2', 'binary')],
+                        type_ids=[10, 20]),
+        SparseUnionField('sparse', [get_field('f1', 'float32', nullable=False),
+                                    get_field('f2', 'bool')],
+                         type_ids=[5, 7], nullable=False),
+        DenseUnionField('dense', [get_field('f1', 'uint8', nullable=False),
+                                  get_field('f2', 'uint16'),
+                                  NullField('f3')],
+                        type_ids=[42, 43, 44], nullable=False),
+    ]
+
+    batch_sizes = [0, 11]
+    return _generate_file("union", fields, batch_sizes)
+
+
+def generate_dictionary_case():
+    dict0 = Dictionary(0, StringField('dictionary1'), size=10, name='DICT0')
+    dict1 = Dictionary(1, StringField('dictionary1'), size=5, name='DICT1')
+    dict2 = Dictionary(2, get_field('dictionary2', 'int64'),
+                       size=50, name='DICT2')
+
+    fields = [
+        DictionaryField('dict0', get_field('', 'int8'), dict0),
+        DictionaryField('dict1', get_field('', 'int32'), dict1),
+        DictionaryField('dict2', get_field('', 'int16'), dict2)
+    ]
+    batch_sizes = [7, 10]
+    return _generate_file("dictionary", fields, batch_sizes,
+                          dictionaries=[dict0, dict1, dict2])
+
+
+def generate_dictionary_unsigned_case():
+    dict0 = Dictionary(0, StringField('dictionary0'), size=5, name='DICT0')
+    dict1 = Dictionary(1, StringField('dictionary1'), size=5, name='DICT1')
+    dict2 = Dictionary(2, StringField('dictionary2'), size=5, name='DICT2')
+
+    # TODO: JavaScript does not support uint64 dictionary indices, so disabled
+    # for now
+
+    # dict3 = Dictionary(3, StringField('dictionary3'), size=5, name='DICT3')
+    fields = [
+        DictionaryField('f0', get_field('', 'uint8'), dict0),
+        DictionaryField('f1', get_field('', 'uint16'), dict1),
+        DictionaryField('f2', get_field('', 'uint32'), dict2),
+        # DictionaryField('f3', get_field('', 'uint64'), dict3)
+    ]
+    batch_sizes = [7, 10]
+    return _generate_file("dictionary_unsigned", fields, batch_sizes,
+                          dictionaries=[dict0, dict1, dict2])
+
+
+def generate_nested_dictionary_case():
+    dict0 = Dictionary(0, StringField('str'), size=10, name='DICT0')
+
+    list_of_dict = ListField(
+        'list',
+        DictionaryField('str_dict', get_field('', 'int8'), dict0))
+    dict1 = Dictionary(1, list_of_dict, size=30, name='DICT1')
+
+    struct_of_dict = StructField('struct', [
+        DictionaryField('str_dict_a', get_field('', 'int8'), dict0),
+        DictionaryField('str_dict_b', get_field('', 'int8'), dict0)
+    ])
+    dict2 = Dictionary(2, struct_of_dict, size=30, name='DICT2')
+
+    fields = [
+        DictionaryField('list_dict', get_field('', 'int8'), dict1),
+        DictionaryField('struct_dict', get_field('', 'int8'), dict2)
+    ]
+
+    batch_sizes = [10, 13]
+    return _generate_file("nested_dictionary", fields, batch_sizes,
+                          dictionaries=[dict0, dict1, dict2])
+
+
+def generate_extension_case():
+    dict0 = Dictionary(0, StringField('dictionary0'), size=5, name='DICT0')
+
+    uuid_type = ExtensionType('uuid', 'uuid-serialized',
+                              FixedSizeBinaryField('', 16))
+    dict_ext_type = ExtensionType(
+        'dict-extension', 'dict-extension-serialized',
+        DictionaryField('str_dict', get_field('', 'int8'), dict0))
+
+    fields = [
+        ExtensionField('uuids', uuid_type),
+        ExtensionField('dict_exts', dict_ext_type),
+    ]
+
+    batch_sizes = [0, 13]
+    return _generate_file("extension", fields, batch_sizes,
+                          dictionaries=[dict0])
+
+
+def get_generated_json_files(tempdir=None):
+    tempdir = tempdir or tempfile.mkdtemp(prefix='arrow-integration-')
+
+    def _temp_path():
+        return
+
+    file_objs = [
+        generate_primitive_case([], name='primitive_no_batches'),
+        generate_primitive_case([17, 20], name='primitive'),
+        generate_primitive_case([0, 0, 0], name='primitive_zerolength'),
+
+        generate_primitive_large_offsets_case([17, 20])
+        .skip_category('C#')
+        .skip_category('Go')
+        .skip_category('JS'),
+
+        generate_null_case([10, 0])
+        .skip_category('C#')
+        .skip_category('JS'),   # TODO(ARROW-7900)
+
+        generate_null_trivial_case([0, 0])
+        .skip_category('C#')
+        .skip_category('JS'),   # TODO(ARROW-7900)
+
+        generate_decimal128_case()
+        .skip_category('Rust'),
+
+        generate_decimal256_case()
+        .skip_category('Go')  # TODO(ARROW-7948): Decimal + Go
+        .skip_category('JS')
+        .skip_category('Rust'),
+
+        generate_datetime_case()
+        .skip_category('C#'),
+
+        generate_interval_case()
+        .skip_category('C#')
+        .skip_category('JS')  # TODO(ARROW-5239): Intervals + JS
+        .skip_category('Rust'),
+
+        generate_month_day_nano_interval_case()
+        .skip_category('C#')
+        .skip_category('JS')
+        .skip_category('Rust'),
+
+
+        generate_map_case()
+        .skip_category('C#')
+        .skip_category('Rust'),
+
+        generate_non_canonical_map_case()
+        .skip_category('C#')
+        .skip_category('Java')   # TODO(ARROW-8715)
+        .skip_category('JS')     # TODO(ARROW-8716)
+        .skip_category('Rust'),
+
+        generate_nested_case()
+        .skip_category('C#'),
+
+        generate_recursive_nested_case()
+        .skip_category('C#'),
+
+        generate_nested_large_offsets_case()
+        .skip_category('C#')
+        .skip_category('Go')
+        .skip_category('JS')
+        .skip_category('Rust'),
+
+        generate_unions_case()
+        .skip_category('C#')
+        .skip_category('Go')
+        .skip_category('JS')
+        .skip_category('Rust'),
+
+        generate_custom_metadata_case()
+        .skip_category('C#')
+        .skip_category('JS'),
+
+        generate_duplicate_fieldnames_case()
+        .skip_category('C#')
+        .skip_category('Go')
+        .skip_category('JS'),
+
+        # TODO(ARROW-3039, ARROW-5267): Dictionaries in GO
+        generate_dictionary_case()
+        .skip_category('C#')
+        .skip_category('Go'),
+
+        generate_dictionary_unsigned_case()
+        .skip_category('C#')
+        .skip_category('Go')     # TODO(ARROW-9378)
+        .skip_category('Java'),  # TODO(ARROW-9377)
+
+        generate_nested_dictionary_case()
+        .skip_category('C#')
+        .skip_category('Go')
+        .skip_category('Java')  # TODO(ARROW-7779)
+        .skip_category('JS')
+        .skip_category('Rust'),
+
+        generate_extension_case()
+        .skip_category('C#')
+        .skip_category('Go')  # TODO(ARROW-3039): requires dictionaries
+        .skip_category('JS')
+        .skip_category('Rust'),
+    ]
+
+    generated_paths = []
+    for file_obj in file_objs:
+        out_path = os.path.join(tempdir, 'generated_' +
+                                file_obj.name + '.json')
+        file_obj.write(out_path)
+        generated_paths.append(file_obj)
+
+    return generated_paths
diff --git a/src/arrow/dev/archery/archery/integration/runner.py b/src/arrow/dev/archery/archery/integration/runner.py
new file mode 100644
index 000000000..463917b81
--- /dev/null
+++ b/src/arrow/dev/archery/archery/integration/runner.py
@@ -0,0 +1,429 @@
+# licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from collections import namedtuple
+from concurrent.futures import ThreadPoolExecutor
+from functools import partial
+import glob
+import gzip
+import itertools
+import os
+import sys
+import tempfile
+import traceback
+
+from .scenario import Scenario
+from .tester_cpp import CPPTester
+from .tester_go import GoTester
+from .tester_rust import RustTester
+from .tester_java import JavaTester
+from .tester_js import JSTester
+from .tester_csharp import CSharpTester
+from .util import (ARROW_ROOT_DEFAULT, guid, SKIP_ARROW, SKIP_FLIGHT,
+                   printer)
+from . import datagen
+
+
+Failure = namedtuple('Failure',
+                     ('test_case', 'producer', 'consumer', 'exc_info'))
+
+log = printer.print
+
+
+class Outcome:
+    def __init__(self):
+        self.failure = None
+        self.skipped = False
+
+
+class IntegrationRunner(object):
+
+    def __init__(self, json_files, flight_scenarios, testers, tempdir=None,
+                 debug=False, stop_on_error=True, gold_dirs=None,
+                 serial=False, match=None, **unused_kwargs):
+        self.json_files = json_files
+        self.flight_scenarios = flight_scenarios
+        self.testers = testers
+        self.temp_dir = tempdir or tempfile.mkdtemp()
+        self.debug = debug
+        self.stop_on_error = stop_on_error
+        self.serial = serial
+        self.gold_dirs = gold_dirs
+        self.failures = []
+        self.match = match
+
+        if self.match is not None:
+            print("-- Only running tests with {} in their name"
+                  .format(self.match))
+            self.json_files = [json_file for json_file in self.json_files
+                               if self.match in json_file.name]
+
+    def run(self):
+        """
+        Run Arrow IPC integration tests for the matrix of enabled
+        implementations.
+        """
+        for producer, consumer in itertools.product(
+                filter(lambda t: t.PRODUCER, self.testers),
+                filter(lambda t: t.CONSUMER, self.testers)):
+            self._compare_implementations(
+                producer, consumer, self._produce_consume,
+                self.json_files)
+        if self.gold_dirs:
+            for gold_dir, consumer in itertools.product(
+                    self.gold_dirs,
+                    filter(lambda t: t.CONSUMER, self.testers)):
+                log('\n\n\n\n')
+                log('******************************************************')
+                log('Tests against golden files in {}'.format(gold_dir))
+                log('******************************************************')
+
+                def run_gold(producer, consumer, outcome, test_case):
+                    self._run_gold(gold_dir, producer, consumer, outcome,
+                                   test_case)
+                self._compare_implementations(
+                    consumer, consumer, run_gold,
+                    self._gold_tests(gold_dir))
+
+    def run_flight(self):
+        """
+        Run Arrow Flight integration tests for the matrix of enabled
+        implementations.
+        """
+        servers = filter(lambda t: t.FLIGHT_SERVER, self.testers)
+        clients = filter(lambda t: (t.FLIGHT_CLIENT and t.CONSUMER),
+                         self.testers)
+        for server, client in itertools.product(servers, clients):
+            self._compare_flight_implementations(server, client)
+
+    def _gold_tests(self, gold_dir):
+        prefix = os.path.basename(os.path.normpath(gold_dir))
+        SUFFIX = ".json.gz"
+        golds = [jf for jf in os.listdir(gold_dir) if jf.endswith(SUFFIX)]
+        for json_path in golds:
+            name = json_path[json_path.index('_')+1: -len(SUFFIX)]
+            base_name = prefix + "_" + name + ".gold.json"
+            out_path = os.path.join(self.temp_dir, base_name)
+            with gzip.open(os.path.join(gold_dir, json_path)) as i:
+                with open(out_path, "wb") as out:
+                    out.write(i.read())
+
+            try:
+                skip = next(f for f in self.json_files
+                            if f.name == name).skip
+            except StopIteration:
+                skip = set()
+            if name == 'union' and prefix == '0.17.1':
+                skip.add("Java")
+            if prefix == '1.0.0-bigendian' or prefix == '1.0.0-littleendian':
+                skip.add("C#")
+                skip.add("Go")
+                skip.add("Java")
+                skip.add("JS")
+                skip.add("Rust")
+            if prefix == '2.0.0-compression':
+                skip.add("C#")
+                skip.add("JS")
+                skip.add("Rust")
+
+            # See https://github.com/apache/arrow/pull/9822 for how to
+            # disable specific compression type tests.
+
+            if prefix == '4.0.0-shareddict':
+                skip.add("C#")
+                skip.add("Go")
+
+            yield datagen.File(name, None, None, skip=skip, path=out_path)
+
+    def _run_test_cases(self, producer, consumer, case_runner,
+                        test_cases):
+        def case_wrapper(test_case):
+            with printer.cork():
+                return case_runner(test_case)
+
+        if self.failures and self.stop_on_error:
+            return
+
+        if self.serial:
+            for outcome in map(case_wrapper, test_cases):
+                if outcome.failure is not None:
+                    self.failures.append(outcome.failure)
+                    if self.stop_on_error:
+                        break
+
+        else:
+            with ThreadPoolExecutor() as executor:
+                for outcome in executor.map(case_wrapper, test_cases):
+                    if outcome.failure is not None:
+                        self.failures.append(outcome.failure)
+                        if self.stop_on_error:
+                            break
+
+    def _compare_implementations(
+            self, producer, consumer, run_binaries, test_cases):
+        """
+        Compare Arrow IPC for two implementations (one producer, one consumer).
+        """
+        log('##########################################################')
+        log('IPC: {0} producing, {1} consuming'
+            .format(producer.name, consumer.name))
+        log('##########################################################')
+
+        case_runner = partial(self._run_ipc_test_case,
+                              producer, consumer, run_binaries)
+        self._run_test_cases(producer, consumer, case_runner, test_cases)
+
+    def _run_ipc_test_case(self, producer, consumer, run_binaries, test_case):
+        """
+        Run one IPC test case.
+        """
+        outcome = Outcome()
+
+        json_path = test_case.path
+        log('==========================================================')
+        log('Testing file {0}'.format(json_path))
+        log('==========================================================')
+
+        if producer.name in test_case.skip:
+            log('-- Skipping test because producer {0} does '
+                'not support'.format(producer.name))
+            outcome.skipped = True
+
+        elif consumer.name in test_case.skip:
+            log('-- Skipping test because consumer {0} does '
+                'not support'.format(consumer.name))
+            outcome.skipped = True
+
+        elif SKIP_ARROW in test_case.skip:
+            log('-- Skipping test')
+            outcome.skipped = True
+
+        else:
+            try:
+                run_binaries(producer, consumer, outcome, test_case)
+            except Exception:
+                traceback.print_exc(file=printer.stdout)
+                outcome.failure = Failure(test_case, producer, consumer,
+                                          sys.exc_info())
+
+        return outcome
+
+    def _produce_consume(self, producer, consumer, outcome, test_case):
+        # Make the random access file
+        json_path = test_case.path
+        file_id = guid()[:8]
+        name = os.path.splitext(os.path.basename(json_path))[0]
+
+        producer_file_path = os.path.join(self.temp_dir, file_id + '_' +
+                                          name + '.json_as_file')
+        producer_stream_path = os.path.join(self.temp_dir, file_id + '_' +
+                                            name + '.producer_file_as_stream')
+        consumer_file_path = os.path.join(self.temp_dir, file_id + '_' +
+                                          name + '.consumer_stream_as_file')
+
+        log('-- Creating binary inputs')
+        producer.json_to_file(json_path, producer_file_path)
+
+        # Validate the file
+        log('-- Validating file')
+        consumer.validate(json_path, producer_file_path)
+
+        log('-- Validating stream')
+        producer.file_to_stream(producer_file_path, producer_stream_path)
+        consumer.stream_to_file(producer_stream_path, consumer_file_path)
+        consumer.validate(json_path, consumer_file_path)
+
+    def _run_gold(self, gold_dir, producer, consumer, outcome, test_case):
+        json_path = test_case.path
+
+        # Validate the file
+        log('-- Validating file')
+        producer_file_path = os.path.join(
+            gold_dir, "generated_" + test_case.name + ".arrow_file")
+        consumer.validate(json_path, producer_file_path)
+
+        log('-- Validating stream')
+        consumer_stream_path = os.path.join(
+            gold_dir, "generated_" + test_case.name + ".stream")
+        file_id = guid()[:8]
+        name = os.path.splitext(os.path.basename(json_path))[0]
+
+        consumer_file_path = os.path.join(self.temp_dir, file_id + '_' +
+                                          name + '.consumer_stream_as_file')
+
+        consumer.stream_to_file(consumer_stream_path, consumer_file_path)
+        consumer.validate(json_path, consumer_file_path)
+
+    def _compare_flight_implementations(self, producer, consumer):
+        log('##########################################################')
+        log('Flight: {0} serving, {1} requesting'
+            .format(producer.name, consumer.name))
+        log('##########################################################')
+
+        case_runner = partial(self._run_flight_test_case, producer, consumer)
+        self._run_test_cases(producer, consumer, case_runner,
+                             self.json_files + self.flight_scenarios)
+
+    def _run_flight_test_case(self, producer, consumer, test_case):
+        """
+        Run one Flight test case.
+        """
+        outcome = Outcome()
+
+        log('=' * 58)
+        log('Testing file {0}'.format(test_case.name))
+        log('=' * 58)
+
+        if producer.name in test_case.skip:
+            log('-- Skipping test because producer {0} does '
+                'not support'.format(producer.name))
+            outcome.skipped = True
+
+        elif consumer.name in test_case.skip:
+            log('-- Skipping test because consumer {0} does '
+                'not support'.format(consumer.name))
+            outcome.skipped = True
+
+        elif SKIP_FLIGHT in test_case.skip:
+            log('-- Skipping test')
+            outcome.skipped = True
+
+        else:
+            try:
+                if isinstance(test_case, Scenario):
+                    server = producer.flight_server(test_case.name)
+                    client_args = {'scenario_name': test_case.name}
+                else:
+                    server = producer.flight_server()
+                    client_args = {'json_path': test_case.path}
+
+                with server as port:
+                    # Have the client upload the file, then download and
+                    # compare
+                    consumer.flight_request(port, **client_args)
+            except Exception:
+                traceback.print_exc(file=printer.stdout)
+                outcome.failure = Failure(test_case, producer, consumer,
+                                          sys.exc_info())
+
+        return outcome
+
+
+def get_static_json_files():
+    glob_pattern = os.path.join(ARROW_ROOT_DEFAULT,
+                                'integration', 'data', '*.json')
+    return [
+        datagen.File(name=os.path.basename(p), path=p, skip=set(),
+                     schema=None, batches=None)
+        for p in glob.glob(glob_pattern)
+    ]
+
+
+def run_all_tests(with_cpp=True, with_java=True, with_js=True,
+                  with_csharp=True, with_go=True, with_rust=False,
+                  run_flight=False, tempdir=None, **kwargs):
+    tempdir = tempdir or tempfile.mkdtemp(prefix='arrow-integration-')
+
+    testers = []
+
+    if with_cpp:
+        testers.append(CPPTester(**kwargs))
+
+    if with_java:
+        testers.append(JavaTester(**kwargs))
+
+    if with_js:
+        testers.append(JSTester(**kwargs))
+
+    if with_csharp:
+        testers.append(CSharpTester(**kwargs))
+
+    if with_go:
+        testers.append(GoTester(**kwargs))
+
+    if with_rust:
+        testers.append(RustTester(**kwargs))
+
+    static_json_files = get_static_json_files()
+    generated_json_files = datagen.get_generated_json_files(tempdir=tempdir)
+    json_files = static_json_files + generated_json_files
+
+    # Additional integration test cases for Arrow Flight.
+    flight_scenarios = [
+        Scenario(
+            "auth:basic_proto",
+            description="Authenticate using the BasicAuth protobuf."),
+        Scenario(
+            "middleware",
+            description="Ensure headers are propagated via middleware.",
+            skip={"Rust"}   # TODO(ARROW-10961): tonic upgrade needed
+        ),
+    ]
+
+    runner = IntegrationRunner(json_files, flight_scenarios, testers, **kwargs)
+    runner.run()
+    if run_flight:
+        runner.run_flight()
+
+    fail_count = 0
+    if runner.failures:
+        log("################# FAILURES #################")
+        for test_case, producer, consumer, exc_info in runner.failures:
+            fail_count += 1
+            log("FAILED TEST:", end=" ")
+            log(test_case.name, producer.name, "producing, ",
+                consumer.name, "consuming")
+            if exc_info:
+                traceback.print_exception(*exc_info)
+            log()
+
+    log(fail_count, "failures")
+    if fail_count > 0:
+        sys.exit(1)
+
+
+def write_js_test_json(directory):
+    datagen.generate_map_case().write(
+        os.path.join(directory, 'map.json')
+    )
+    datagen.generate_nested_case().write(
+        os.path.join(directory, 'nested.json')
+    )
+    datagen.generate_decimal128_case().write(
+        os.path.join(directory, 'decimal.json')
+    )
+    datagen.generate_decimal256_case().write(
+        os.path.join(directory, 'decimal256.json')
+    )
+    datagen.generate_datetime_case().write(
+        os.path.join(directory, 'datetime.json')
+    )
+    datagen.generate_dictionary_case().write(
+        os.path.join(directory, 'dictionary.json')
+    )
+    datagen.generate_dictionary_unsigned_case().write(
+        os.path.join(directory, 'dictionary_unsigned.json')
+    )
+    datagen.generate_primitive_case([]).write(
+        os.path.join(directory, 'primitive_no_batches.json')
+    )
+    datagen.generate_primitive_case([7, 10]).write(
+        os.path.join(directory, 'primitive.json')
+    )
+    datagen.generate_primitive_case([0, 0, 0]).write(
+        os.path.join(directory, 'primitive-empty.json')
+    )
diff --git a/src/arrow/dev/archery/archery/integration/scenario.py b/src/arrow/dev/archery/archery/integration/scenario.py
new file mode 100644
index 000000000..1fcbca64e
--- /dev/null
+++ b/src/arrow/dev/archery/archery/integration/scenario.py
@@ -0,0 +1,29 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+
+class Scenario:
+    """
+    An integration test scenario for Arrow Flight.
+
+    Does not correspond to a particular IPC JSON file.
+    """
+
+    def __init__(self, name, description, skip=None):
+        self.name = name
+        self.description = description
+        self.skip = skip or set()
diff --git a/src/arrow/dev/archery/archery/integration/tester.py b/src/arrow/dev/archery/archery/integration/tester.py
new file mode 100644
index 000000000..122e4f2e4
--- /dev/null
+++ b/src/arrow/dev/archery/archery/integration/tester.py
@@ -0,0 +1,62 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+# Base class for language-specific integration test harnesses
+
+import subprocess
+
+from .util import log
+
+
+class Tester(object):
+    PRODUCER = False
+    CONSUMER = False
+    FLIGHT_SERVER = False
+    FLIGHT_CLIENT = False
+
+    def __init__(self, debug=False, **args):
+        self.args = args
+        self.debug = debug
+
+    def run_shell_command(self, cmd):
+        cmd = ' '.join(cmd)
+        if self.debug:
+            log(cmd)
+        subprocess.check_call(cmd, shell=True)
+
+    def json_to_file(self, json_path, arrow_path):
+        raise NotImplementedError
+
+    def stream_to_file(self, stream_path, file_path):
+        raise NotImplementedError
+
+    def file_to_stream(self, file_path, stream_path):
+        raise NotImplementedError
+
+    def validate(self, json_path, arrow_path):
+        raise NotImplementedError
+
+    def flight_server(self, scenario_name=None):
+        """Start the Flight server on a free port.
+
+        This should be a context manager that returns the port as the
+        managed object, and cleans up the server on exit.
+        """
+        raise NotImplementedError
+
+    def flight_request(self, port, json_path=None, scenario_name=None):
+        raise NotImplementedError
diff --git a/src/arrow/dev/archery/archery/integration/tester_cpp.py b/src/arrow/dev/archery/archery/integration/tester_cpp.py
new file mode 100644
index 000000000..d35c9550e
--- /dev/null
+++ b/src/arrow/dev/archery/archery/integration/tester_cpp.py
@@ -0,0 +1,116 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import contextlib
+import os
+import subprocess
+
+from .tester import Tester
+from .util import run_cmd, ARROW_ROOT_DEFAULT, log
+
+
+class CPPTester(Tester):
+    PRODUCER = True
+    CONSUMER = True
+    FLIGHT_SERVER = True
+    FLIGHT_CLIENT = True
+
+    EXE_PATH = os.environ.get(
+        'ARROW_CPP_EXE_PATH',
+        os.path.join(ARROW_ROOT_DEFAULT, 'cpp/build/debug'))
+
+    CPP_INTEGRATION_EXE = os.path.join(EXE_PATH, 'arrow-json-integration-test')
+    STREAM_TO_FILE = os.path.join(EXE_PATH, 'arrow-stream-to-file')
+    FILE_TO_STREAM = os.path.join(EXE_PATH, 'arrow-file-to-stream')
+
+    FLIGHT_SERVER_CMD = [
+        os.path.join(EXE_PATH, 'flight-test-integration-server')]
+    FLIGHT_CLIENT_CMD = [
+        os.path.join(EXE_PATH, 'flight-test-integration-client'),
+        "-host", "localhost"]
+
+    name = 'C++'
+
+    def _run(self, arrow_path=None, json_path=None, command='VALIDATE'):
+        cmd = [self.CPP_INTEGRATION_EXE, '--integration']
+
+        if arrow_path is not None:
+            cmd.append('--arrow=' + arrow_path)
+
+        if json_path is not None:
+            cmd.append('--json=' + json_path)
+
+        cmd.append('--mode=' + command)
+
+        if self.debug:
+            log(' '.join(cmd))
+
+        run_cmd(cmd)
+
+    def validate(self, json_path, arrow_path):
+        return self._run(arrow_path, json_path, 'VALIDATE')
+
+    def json_to_file(self, json_path, arrow_path):
+        return self._run(arrow_path, json_path, 'JSON_TO_ARROW')
+
+    def stream_to_file(self, stream_path, file_path):
+        cmd = [self.STREAM_TO_FILE, '<', stream_path, '>', file_path]
+        self.run_shell_command(cmd)
+
+    def file_to_stream(self, file_path, stream_path):
+        cmd = [self.FILE_TO_STREAM, file_path, '>', stream_path]
+        self.run_shell_command(cmd)
+
+    @contextlib.contextmanager
+    def flight_server(self, scenario_name=None):
+        cmd = self.FLIGHT_SERVER_CMD + ['-port=0']
+        if scenario_name:
+            cmd = cmd + ["-scenario", scenario_name]
+        if self.debug:
+            log(' '.join(cmd))
+        server = subprocess.Popen(cmd,
+                                  stdout=subprocess.PIPE,
+                                  stderr=subprocess.PIPE)
+        try:
+            output = server.stdout.readline().decode()
+            if not output.startswith("Server listening on localhost:"):
+                server.kill()
+                out, err = server.communicate()
+                raise RuntimeError(
+                    "Flight-C++ server did not start properly, "
+                    "stdout:\n{}\n\nstderr:\n{}\n"
+                    .format(output + out.decode(), err.decode()))
+            port = int(output.split(":")[1])
+            yield port
+        finally:
+            server.kill()
+            server.wait(5)
+
+    def flight_request(self, port, json_path=None, scenario_name=None):
+        cmd = self.FLIGHT_CLIENT_CMD + [
+            '-port=' + str(port),
+        ]
+        if json_path:
+            cmd.extend(('-path', json_path))
+        elif scenario_name:
+            cmd.extend(('-scenario', scenario_name))
+        else:
+            raise TypeError("Must provide one of json_path or scenario_name")
+
+        if self.debug:
+            log(' '.join(cmd))
+        run_cmd(cmd)
diff --git a/src/arrow/dev/archery/archery/integration/tester_csharp.py b/src/arrow/dev/archery/archery/integration/tester_csharp.py
new file mode 100644
index 000000000..130c49cfe
--- /dev/null
+++ b/src/arrow/dev/archery/archery/integration/tester_csharp.py
@@ -0,0 +1,67 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+
+from .tester import Tester
+from .util import run_cmd, ARROW_ROOT_DEFAULT, log
+
+
+class CSharpTester(Tester):
+    PRODUCER = True
+    CONSUMER = True
+
+    EXE_PATH = os.path.join(
+        ARROW_ROOT_DEFAULT,
+        'csharp/artifacts/Apache.Arrow.IntegrationTest',
+        'Debug/netcoreapp3.1/Apache.Arrow.IntegrationTest')
+
+    name = 'C#'
+
+    def _run(self, json_path=None, arrow_path=None, command='validate'):
+        cmd = [self.EXE_PATH]
+
+        cmd.extend(['--mode', command])
+
+        if json_path is not None:
+            cmd.extend(['-j', json_path])
+
+        if arrow_path is not None:
+            cmd.extend(['-a', arrow_path])
+
+        if self.debug:
+            log(' '.join(cmd))
+
+        run_cmd(cmd)
+
+    def validate(self, json_path, arrow_path):
+        return self._run(json_path, arrow_path, 'validate')
+
+    def json_to_file(self, json_path, arrow_path):
+        return self._run(json_path, arrow_path, 'json-to-arrow')
+
+    def stream_to_file(self, stream_path, file_path):
+        cmd = [self.EXE_PATH]
+        cmd.extend(['--mode', 'stream-to-file', '-a', file_path])
+        cmd.extend(['<', stream_path])
+        self.run_shell_command(cmd)
+
+    def file_to_stream(self, file_path, stream_path):
+        cmd = [self.EXE_PATH]
+        cmd.extend(['--mode', 'file-to-stream'])
+        cmd.extend(['-a', file_path, '>', stream_path])
+        self.run_shell_command(cmd)
diff --git a/src/arrow/dev/archery/archery/integration/tester_go.py b/src/arrow/dev/archery/archery/integration/tester_go.py
new file mode 100644
index 000000000..eeba38fe5
--- /dev/null
+++ b/src/arrow/dev/archery/archery/integration/tester_go.py
@@ -0,0 +1,119 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import contextlib
+import os
+import subprocess
+
+from .tester import Tester
+from .util import run_cmd, log
+
+
+class GoTester(Tester):
+    PRODUCER = True
+    CONSUMER = True
+    FLIGHT_SERVER = True
+    FLIGHT_CLIENT = True
+
+    # FIXME(sbinet): revisit for Go modules
+    HOME = os.getenv('HOME', '~')
+    GOPATH = os.getenv('GOPATH', os.path.join(HOME, 'go'))
+    GOBIN = os.environ.get('GOBIN', os.path.join(GOPATH, 'bin'))
+
+    GO_INTEGRATION_EXE = os.path.join(GOBIN, 'arrow-json-integration-test')
+    STREAM_TO_FILE = os.path.join(GOBIN, 'arrow-stream-to-file')
+    FILE_TO_STREAM = os.path.join(GOBIN, 'arrow-file-to-stream')
+
+    FLIGHT_SERVER_CMD = [
+        os.path.join(GOBIN, 'arrow-flight-integration-server')]
+    FLIGHT_CLIENT_CMD = [
+        os.path.join(GOBIN, 'arrow-flight-integration-client'),
+        '-host', 'localhost']
+
+    name = 'Go'
+
+    def _run(self, arrow_path=None, json_path=None, command='VALIDATE'):
+        cmd = [self.GO_INTEGRATION_EXE]
+
+        if arrow_path is not None:
+            cmd.extend(['-arrow', arrow_path])
+
+        if json_path is not None:
+            cmd.extend(['-json', json_path])
+
+        cmd.extend(['-mode', command])
+
+        if self.debug:
+            log(' '.join(cmd))
+
+        run_cmd(cmd)
+
+    def validate(self, json_path, arrow_path):
+        return self._run(arrow_path, json_path, 'VALIDATE')
+
+    def json_to_file(self, json_path, arrow_path):
+        return self._run(arrow_path, json_path, 'JSON_TO_ARROW')
+
+    def stream_to_file(self, stream_path, file_path):
+        cmd = [self.STREAM_TO_FILE, '<', stream_path, '>', file_path]
+        self.run_shell_command(cmd)
+
+    def file_to_stream(self, file_path, stream_path):
+        cmd = [self.FILE_TO_STREAM, file_path, '>', stream_path]
+        self.run_shell_command(cmd)
+
+    @contextlib.contextmanager
+    def flight_server(self, scenario_name=None):
+        cmd = self.FLIGHT_SERVER_CMD + ['-port=0']
+        if scenario_name:
+            cmd = cmd + ['-scenario', scenario_name]
+        if self.debug:
+            log(' '.join(cmd))
+        server = subprocess.Popen(cmd,
+                                  stdout=subprocess.PIPE,
+                                  stderr=subprocess.PIPE)
+
+        try:
+            output = server.stdout.readline().decode()
+            if not output.startswith("Server listening on localhost:"):
+                server.kill()
+                out, err = server.communicate()
+                raise RuntimeError(
+                    "Flight-Go server did not start properly, "
+                    "stdout: \n{}\n\nstderr:\n{}\n"
+                    .format(output + out.decode(), err.decode())
+                )
+            port = int(output.split(":")[1])
+            yield port
+        finally:
+            server.kill()
+            server.wait(5)
+
+    def flight_request(self, port, json_path=None, scenario_name=None):
+        cmd = self.FLIGHT_CLIENT_CMD + [
+            '-port=' + str(port),
+        ]
+        if json_path:
+            cmd.extend(('-path', json_path))
+        elif scenario_name:
+            cmd.extend(('-scenario', scenario_name))
+        else:
+            raise TypeError("Must provide one of json_path or scenario_name")
+
+        if self.debug:
+            log(' '.join(cmd))
+        run_cmd(cmd)
diff --git a/src/arrow/dev/archery/archery/integration/tester_java.py b/src/arrow/dev/archery/archery/integration/tester_java.py
new file mode 100644
index 000000000..f283f6cd2
--- /dev/null
+++ b/src/arrow/dev/archery/archery/integration/tester_java.py
@@ -0,0 +1,140 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import contextlib
+import os
+import subprocess
+
+from .tester import Tester
+from .util import run_cmd, ARROW_ROOT_DEFAULT, log
+
+
+def load_version_from_pom():
+    import xml.etree.ElementTree as ET
+    tree = ET.parse(os.path.join(ARROW_ROOT_DEFAULT, 'java', 'pom.xml'))
+    tag_pattern = '{http://maven.apache.org/POM/4.0.0}version'
+    version_tag = list(tree.getroot().findall(tag_pattern))[0]
+    return version_tag.text
+
+
+class JavaTester(Tester):
+    PRODUCER = True
+    CONSUMER = True
+    FLIGHT_SERVER = True
+    FLIGHT_CLIENT = True
+
+    JAVA_OPTS = ['-Dio.netty.tryReflectionSetAccessible=true',
+                 '-Darrow.struct.conflict.policy=CONFLICT_APPEND']
+
+    _arrow_version = load_version_from_pom()
+    ARROW_TOOLS_JAR = os.environ.get(
+        'ARROW_JAVA_INTEGRATION_JAR',
+        os.path.join(ARROW_ROOT_DEFAULT,
+                     'java/tools/target/arrow-tools-{}-'
+                     'jar-with-dependencies.jar'.format(_arrow_version)))
+    ARROW_FLIGHT_JAR = os.environ.get(
+        'ARROW_FLIGHT_JAVA_INTEGRATION_JAR',
+        os.path.join(ARROW_ROOT_DEFAULT,
+                     'java/flight/flight-core/target/flight-core-{}-'
+                     'jar-with-dependencies.jar'.format(_arrow_version)))
+    ARROW_FLIGHT_SERVER = ('org.apache.arrow.flight.example.integration.'
+                           'IntegrationTestServer')
+    ARROW_FLIGHT_CLIENT = ('org.apache.arrow.flight.example.integration.'
+                           'IntegrationTestClient')
+
+    name = 'Java'
+
+    def _run(self, arrow_path=None, json_path=None, command='VALIDATE'):
+        cmd = ['java'] + self.JAVA_OPTS + \
+            ['-cp', self.ARROW_TOOLS_JAR, 'org.apache.arrow.tools.Integration']
+
+        if arrow_path is not None:
+            cmd.extend(['-a', arrow_path])
+
+        if json_path is not None:
+            cmd.extend(['-j', json_path])
+
+        cmd.extend(['-c', command])
+
+        if self.debug:
+            log(' '.join(cmd))
+
+        run_cmd(cmd)
+
+    def validate(self, json_path, arrow_path):
+        return self._run(arrow_path, json_path, 'VALIDATE')
+
+    def json_to_file(self, json_path, arrow_path):
+        return self._run(arrow_path, json_path, 'JSON_TO_ARROW')
+
+    def stream_to_file(self, stream_path, file_path):
+        cmd = ['java'] + self.JAVA_OPTS + \
+            ['-cp', self.ARROW_TOOLS_JAR,
+             'org.apache.arrow.tools.StreamToFile', stream_path, file_path]
+        if self.debug:
+            log(' '.join(cmd))
+        run_cmd(cmd)
+
+    def file_to_stream(self, file_path, stream_path):
+        cmd = ['java'] + self.JAVA_OPTS + \
+            ['-cp', self.ARROW_TOOLS_JAR,
+             'org.apache.arrow.tools.FileToStream', file_path, stream_path]
+        if self.debug:
+            log(' '.join(cmd))
+        run_cmd(cmd)
+
+    def flight_request(self, port, json_path=None, scenario_name=None):
+        cmd = ['java'] + self.JAVA_OPTS + \
+            ['-cp', self.ARROW_FLIGHT_JAR, self.ARROW_FLIGHT_CLIENT,
+             '-port', str(port)]
+
+        if json_path:
+            cmd.extend(('-j', json_path))
+        elif scenario_name:
+            cmd.extend(('-scenario', scenario_name))
+        else:
+            raise TypeError("Must provide one of json_path or scenario_name")
+
+        if self.debug:
+            log(' '.join(cmd))
+        run_cmd(cmd)
+
+    @contextlib.contextmanager
+    def flight_server(self, scenario_name=None):
+        cmd = ['java'] + self.JAVA_OPTS + \
+            ['-cp', self.ARROW_FLIGHT_JAR, self.ARROW_FLIGHT_SERVER,
+             '-port', '0']
+        if scenario_name:
+            cmd.extend(('-scenario', scenario_name))
+        if self.debug:
+            log(' '.join(cmd))
+        server = subprocess.Popen(cmd, stdout=subprocess.PIPE,
+                                  stderr=subprocess.PIPE)
+        try:
+            output = server.stdout.readline().decode()
+            if not output.startswith("Server listening on localhost:"):
+                server.kill()
+                out, err = server.communicate()
+                raise RuntimeError(
+                    "Flight-Java server did not start properly, "
+                    "stdout:\n{}\n\nstderr:\n{}\n"
+                    .format(output + out.decode(), err.decode()))
+            port = int(output.split(":")[1])
+            yield port
+        finally:
+            server.kill()
+            server.wait(5)
diff --git a/src/arrow/dev/archery/archery/integration/tester_js.py b/src/arrow/dev/archery/archery/integration/tester_js.py
new file mode 100644
index 000000000..e24eec0ca
--- /dev/null
+++ b/src/arrow/dev/archery/archery/integration/tester_js.py
@@ -0,0 +1,73 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+
+from .tester import Tester
+from .util import run_cmd, ARROW_ROOT_DEFAULT, log
+
+
+class JSTester(Tester):
+    PRODUCER = True
+    CONSUMER = True
+
+    EXE_PATH = os.path.join(ARROW_ROOT_DEFAULT, 'js/bin')
+    VALIDATE = os.path.join(EXE_PATH, 'integration.js')
+    JSON_TO_ARROW = os.path.join(EXE_PATH, 'json-to-arrow.js')
+    STREAM_TO_FILE = os.path.join(EXE_PATH, 'stream-to-file.js')
+    FILE_TO_STREAM = os.path.join(EXE_PATH, 'file-to-stream.js')
+
+    name = 'JS'
+
+    def _run(self, exe_cmd, arrow_path=None, json_path=None,
+             command='VALIDATE'):
+        cmd = [exe_cmd]
+
+        if arrow_path is not None:
+            cmd.extend(['-a', arrow_path])
+
+        if json_path is not None:
+            cmd.extend(['-j', json_path])
+
+        cmd.extend(['--mode', command])
+
+        if self.debug:
+            log(' '.join(cmd))
+
+        run_cmd(cmd)
+
+    def validate(self, json_path, arrow_path):
+        return self._run(self.VALIDATE, arrow_path, json_path, 'VALIDATE')
+
+    def json_to_file(self, json_path, arrow_path):
+        cmd = ['node',
+               '--no-warnings', self.JSON_TO_ARROW,
+               '-a', arrow_path,
+               '-j', json_path]
+        self.run_shell_command(cmd)
+
+    def stream_to_file(self, stream_path, file_path):
+        cmd = ['node', '--no-warnings', self.STREAM_TO_FILE,
+               '<', stream_path,
+               '>', file_path]
+        self.run_shell_command(cmd)
+
+    def file_to_stream(self, file_path, stream_path):
+        cmd = ['node', '--no-warnings', self.FILE_TO_STREAM,
+               '<', file_path,
+               '>', stream_path]
+        self.run_shell_command(cmd)
diff --git a/src/arrow/dev/archery/archery/integration/tester_rust.py b/src/arrow/dev/archery/archery/integration/tester_rust.py
new file mode 100644
index 000000000..bca80ebae
--- /dev/null
+++ b/src/arrow/dev/archery/archery/integration/tester_rust.py
@@ -0,0 +1,115 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import contextlib
+import os
+import subprocess
+
+from .tester import Tester
+from .util import run_cmd, ARROW_ROOT_DEFAULT, log
+
+
+class RustTester(Tester):
+    PRODUCER = True
+    CONSUMER = True
+    FLIGHT_SERVER = True
+    FLIGHT_CLIENT = True
+
+    EXE_PATH = os.path.join(ARROW_ROOT_DEFAULT, 'rust/target/debug')
+
+    RUST_INTEGRATION_EXE = os.path.join(EXE_PATH,
+                                        'arrow-json-integration-test')
+    STREAM_TO_FILE = os.path.join(EXE_PATH, 'arrow-stream-to-file')
+    FILE_TO_STREAM = os.path.join(EXE_PATH, 'arrow-file-to-stream')
+
+    FLIGHT_SERVER_CMD = [
+        os.path.join(EXE_PATH, 'flight-test-integration-server')]
+    FLIGHT_CLIENT_CMD = [
+        os.path.join(EXE_PATH, 'flight-test-integration-client'),
+        "--host", "localhost"]
+
+    name = 'Rust'
+
+    def _run(self, arrow_path=None, json_path=None, command='VALIDATE'):
+        cmd = [self.RUST_INTEGRATION_EXE, '--integration']
+
+        if arrow_path is not None:
+            cmd.append('--arrow=' + arrow_path)
+
+        if json_path is not None:
+            cmd.append('--json=' + json_path)
+
+        cmd.append('--mode=' + command)
+
+        if self.debug:
+            log(' '.join(cmd))
+
+        run_cmd(cmd)
+
+    def validate(self, json_path, arrow_path):
+        return self._run(arrow_path, json_path, 'VALIDATE')
+
+    def json_to_file(self, json_path, arrow_path):
+        return self._run(arrow_path, json_path, 'JSON_TO_ARROW')
+
+    def stream_to_file(self, stream_path, file_path):
+        cmd = [self.STREAM_TO_FILE, '<', stream_path, '>', file_path]
+        self.run_shell_command(cmd)
+
+    def file_to_stream(self, file_path, stream_path):
+        cmd = [self.FILE_TO_STREAM, file_path, '>', stream_path]
+        self.run_shell_command(cmd)
+
+    @contextlib.contextmanager
+    def flight_server(self, scenario_name=None):
+        cmd = self.FLIGHT_SERVER_CMD + ['--port=0']
+        if scenario_name:
+            cmd = cmd + ["--scenario", scenario_name]
+        if self.debug:
+            log(' '.join(cmd))
+        server = subprocess.Popen(cmd,
+                                  stdout=subprocess.PIPE,
+                                  stderr=subprocess.PIPE)
+        try:
+            output = server.stdout.readline().decode()
+            if not output.startswith("Server listening on localhost:"):
+                server.kill()
+                out, err = server.communicate()
+                raise RuntimeError(
+                    "Flight-Rust server did not start properly, "
+                    "stdout:\n{}\n\nstderr:\n{}\n"
+                    .format(output + out.decode(), err.decode()))
+            port = int(output.split(":")[1])
+            yield port
+        finally:
+            server.kill()
+            server.wait(5)
+
+    def flight_request(self, port, json_path=None, scenario_name=None):
+        cmd = self.FLIGHT_CLIENT_CMD + [
+            '--port=' + str(port),
+        ]
+        if json_path:
+            cmd.extend(('--path', json_path))
+        elif scenario_name:
+            cmd.extend(('--scenario', scenario_name))
+        else:
+            raise TypeError("Must provide one of json_path or scenario_name")
+
+        if self.debug:
+            log(' '.join(cmd))
+        run_cmd(cmd)
diff --git a/src/arrow/dev/archery/archery/integration/util.py b/src/arrow/dev/archery/archery/integration/util.py
new file mode 100644
index 000000000..a4c4982ec
--- /dev/null
+++ b/src/arrow/dev/archery/archery/integration/util.py
@@ -0,0 +1,166 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import contextlib
+import io
+import os
+import random
+import socket
+import subprocess
+import sys
+import threading
+import uuid
+
+import numpy as np
+
+
+def guid():
+    return uuid.uuid4().hex
+
+
+# SKIP categories
+SKIP_ARROW = 'arrow'
+SKIP_FLIGHT = 'flight'
+
+ARROW_ROOT_DEFAULT = os.environ.get(
+    'ARROW_ROOT',
+    os.path.abspath(__file__).rsplit("/", 5)[0]
+)
+
+
+class _Printer:
+    """
+    A print()-providing object that can override the stream output on
+    a per-thread basis.
+    """
+
+    def __init__(self):
+        self._tls = threading.local()
+
+    def _get_stdout(self):
+        try:
+            return self._tls.stdout
+        except AttributeError:
+            self._tls.stdout = sys.stdout
+            self._tls.corked = False
+            return self._tls.stdout
+
+    def print(self, *args, **kwargs):
+        """
+        A variant of print() that writes to a thread-local stream.
+        """
+        print(*args, file=self._get_stdout(), **kwargs)
+
+    @property
+    def stdout(self):
+        """
+        A thread-local stdout wrapper that may be temporarily buffered
+        using `cork()`.
+        """
+        return self._get_stdout()
+
+    @contextlib.contextmanager
+    def cork(self):
+        """
+        Temporarily buffer this thread's stream and write out its contents
+        at the end of the context manager.  Useful to avoid interleaved
+        output when multiple threads output progress information.
+        """
+        outer_stdout = self._get_stdout()
+        assert not self._tls.corked, "reentrant call"
+        inner_stdout = self._tls.stdout = io.StringIO()
+        self._tls.corked = True
+        try:
+            yield
+        finally:
+            self._tls.stdout = outer_stdout
+            self._tls.corked = False
+            outer_stdout.write(inner_stdout.getvalue())
+            outer_stdout.flush()
+
+
+printer = _Printer()
+log = printer.print
+
+
+_RAND_CHARS = np.array(list("abcdefghijklmnop123456Ârrôwµ£°€矢"), dtype="U")
+
+
+def random_utf8(nchars):
+    """
+    Generate one random UTF8 string.
+    """
+    return ''.join(np.random.choice(_RAND_CHARS, nchars))
+
+
+def random_bytes(nbytes):
+    """
+    Generate one random binary string.
+    """
+    # NOTE getrandbits(0) fails
+    if nbytes > 0:
+        return random.getrandbits(nbytes * 8).to_bytes(nbytes,
+                                                       byteorder='little')
+    else:
+        return b""
+
+
+def tobytes(o):
+    if isinstance(o, str):
+        return o.encode('utf8')
+    return o
+
+
+def frombytes(o):
+    if isinstance(o, bytes):
+        return o.decode('utf8')
+    return o
+
+
+def run_cmd(cmd):
+    if isinstance(cmd, str):
+        cmd = cmd.split(' ')
+
+    try:
+        output = subprocess.check_output(cmd, stderr=subprocess.STDOUT)
+    except subprocess.CalledProcessError as e:
+        # this avoids hiding the stdout / stderr of failed processes
+        sio = io.StringIO()
+        print('Command failed:', " ".join(cmd), file=sio)
+        print('With output:', file=sio)
+        print('--------------', file=sio)
+        print(frombytes(e.output), file=sio)
+        print('--------------', file=sio)
+        raise RuntimeError(sio.getvalue())
+
+    return frombytes(output)
+
+
+# Adapted from CPython
+def find_unused_port(family=socket.AF_INET, socktype=socket.SOCK_STREAM):
+    """Returns an unused port that should be suitable for binding.  This is
+    achieved by creating a temporary socket with the same family and type as
+    the 'sock' parameter (default is AF_INET, SOCK_STREAM), and binding it to
+    the specified host address (defaults to 0.0.0.0) with the port set to 0,
+    eliciting an unused ephemeral port from the OS.  The temporary socket is
+    then closed and deleted, and the ephemeral port is returned.
+    """
+    with socket.socket(family, socktype) as tempsock:
+        tempsock.bind(('', 0))
+        port = tempsock.getsockname()[1]
+    del tempsock
+    return port
diff --git a/src/arrow/dev/archery/archery/lang/__init__.py b/src/arrow/dev/archery/archery/lang/__init__.py
new file mode 100644
index 000000000..13a83393a
--- /dev/null
+++ b/src/arrow/dev/archery/archery/lang/__init__.py
@@ -0,0 +1,16 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
diff --git a/src/arrow/dev/archery/archery/lang/cpp.py b/src/arrow/dev/archery/archery/lang/cpp.py
new file mode 100644
index 000000000..c2b1ca680
--- /dev/null
+++ b/src/arrow/dev/archery/archery/lang/cpp.py
@@ -0,0 +1,296 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+
+from ..utils.cmake import CMakeDefinition
+
+
+def truthifier(value):
+    return "ON" if value else "OFF"
+
+
+def or_else(value, default):
+    return value if value else default
+
+
+def coalesce(value, fallback):
+    return fallback if value is None else value
+
+
+LLVM_VERSION = 7
+
+
+class CppConfiguration:
+    def __init__(self,
+
+                 # toolchain
+                 cc=None, cxx=None, cxx_flags=None,
+                 build_type=None, warn_level=None,
+                 cpp_package_prefix=None, install_prefix=None, use_conda=None,
+                 build_static=False, build_shared=True, build_unity=True,
+                 # tests & examples
+                 with_tests=None, with_benchmarks=None, with_examples=None,
+                 with_integration=None,
+                 # static checks
+                 use_asan=None, use_tsan=None, use_ubsan=None,
+                 with_fuzzing=None,
+                 # Components
+                 with_compute=None, with_csv=None, with_cuda=None,
+                 with_dataset=None, with_filesystem=None, with_flight=None,
+                 with_gandiva=None, with_hdfs=None, with_hiveserver2=None,
+                 with_ipc=True, with_json=None, with_jni=None,
+                 with_mimalloc=None,
+                 with_parquet=None, with_plasma=None, with_python=True,
+                 with_r=None, with_s3=None,
+                 # Compressions
+                 with_brotli=None, with_bz2=None, with_lz4=None,
+                 with_snappy=None, with_zlib=None, with_zstd=None,
+                 # extras
+                 with_lint_only=False,
+                 use_gold_linker=True,
+                 simd_level="SSE4_2",
+                 cmake_extras=None):
+        self._cc = cc
+        self._cxx = cxx
+        self.cxx_flags = cxx_flags
+
+        self._build_type = build_type
+        self.warn_level = warn_level
+        self._install_prefix = install_prefix
+        self._package_prefix = cpp_package_prefix
+        self._use_conda = use_conda
+        self.build_static = build_static
+        self.build_shared = build_shared
+        self.build_unity = build_unity
+
+        self.with_tests = with_tests
+        self.with_benchmarks = with_benchmarks
+        self.with_examples = with_examples
+        self.with_integration = with_integration
+
+        self.use_asan = use_asan
+        self.use_tsan = use_tsan
+        self.use_ubsan = use_ubsan
+        self.with_fuzzing = with_fuzzing
+
+        self.with_compute = with_compute
+        self.with_csv = with_csv
+        self.with_cuda = with_cuda
+        self.with_dataset = with_dataset
+        self.with_filesystem = with_filesystem
+        self.with_flight = with_flight
+        self.with_gandiva = with_gandiva
+        self.with_hdfs = with_hdfs
+        self.with_hiveserver2 = with_hiveserver2
+        self.with_ipc = with_ipc
+        self.with_json = with_json
+        self.with_jni = with_jni
+        self.with_mimalloc = with_mimalloc
+        self.with_parquet = with_parquet
+        self.with_plasma = with_plasma
+        self.with_python = with_python
+        self.with_r = with_r
+        self.with_s3 = with_s3
+
+        self.with_brotli = with_brotli
+        self.with_bz2 = with_bz2
+        self.with_lz4 = with_lz4
+        self.with_snappy = with_snappy
+        self.with_zlib = with_zlib
+        self.with_zstd = with_zstd
+
+        self.with_lint_only = with_lint_only
+        self.use_gold_linker = use_gold_linker
+        self.simd_level = simd_level
+
+        self.cmake_extras = cmake_extras
+
+        # Fixup required dependencies by providing sane defaults if the caller
+        # didn't specify the option.
+        if self.with_r:
+            self.with_csv = coalesce(with_csv, True)
+            self.with_dataset = coalesce(with_dataset, True)
+            self.with_filesystem = coalesce(with_filesystem, True)
+            self.with_ipc = coalesce(with_ipc, True)
+            self.with_json = coalesce(with_json, True)
+            self.with_parquet = coalesce(with_parquet, True)
+
+        if self.with_python:
+            self.with_zlib = coalesce(with_zlib, True)
+            self.with_lz4 = coalesce(with_lz4, True)
+
+        if self.with_dataset:
+            self.with_filesystem = coalesce(with_filesystem, True)
+            self.with_parquet = coalesce(with_parquet, True)
+
+        if self.with_parquet:
+            self.with_snappy = coalesce(with_snappy, True)
+
+    @property
+    def build_type(self):
+        if self._build_type:
+            return self._build_type
+
+        if self.with_fuzzing:
+            return "relwithdebinfo"
+
+        return "release"
+
+    @property
+    def cc(self):
+        if self._cc:
+            return self._cc
+
+        if self.with_fuzzing:
+            return "clang-{}".format(LLVM_VERSION)
+
+        return None
+
+    @property
+    def cxx(self):
+        if self._cxx:
+            return self._cxx
+
+        if self.with_fuzzing:
+            return "clang++-{}".format(LLVM_VERSION)
+
+        return None
+
+    def _gen_defs(self):
+        if self.cxx_flags:
+            yield ("ARROW_CXXFLAGS", self.cxx_flags)
+
+        yield ("CMAKE_EXPORT_COMPILE_COMMANDS", truthifier(True))
+        yield ("CMAKE_BUILD_TYPE", self.build_type)
+
+        if not self.with_lint_only:
+            yield ("BUILD_WARNING_LEVEL",
+                   or_else(self.warn_level, "production"))
+
+        # if not ctx.quiet:
+        #   yield ("ARROW_VERBOSE_THIRDPARTY_BUILD", "ON")
+
+        maybe_prefix = self.install_prefix
+        if maybe_prefix:
+            yield ("CMAKE_INSTALL_PREFIX", maybe_prefix)
+
+        if self._package_prefix is not None:
+            yield ("ARROW_DEPENDENCY_SOURCE", "SYSTEM")
+            yield ("ARROW_PACKAGE_PREFIX", self._package_prefix)
+
+        yield ("ARROW_BUILD_STATIC", truthifier(self.build_static))
+        yield ("ARROW_BUILD_SHARED", truthifier(self.build_shared))
+        yield ("CMAKE_UNITY_BUILD", truthifier(self.build_unity))
+
+        # Tests and benchmarks
+        yield ("ARROW_BUILD_TESTS", truthifier(self.with_tests))
+        yield ("ARROW_BUILD_BENCHMARKS", truthifier(self.with_benchmarks))
+        yield ("ARROW_BUILD_EXAMPLES", truthifier(self.with_examples))
+        yield ("ARROW_BUILD_INTEGRATION", truthifier(self.with_integration))
+
+        # Static checks
+        yield ("ARROW_USE_ASAN", truthifier(self.use_asan))
+        yield ("ARROW_USE_TSAN", truthifier(self.use_tsan))
+        yield ("ARROW_USE_UBSAN", truthifier(self.use_ubsan))
+        yield ("ARROW_FUZZING", truthifier(self.with_fuzzing))
+
+        # Components
+        yield ("ARROW_COMPUTE", truthifier(self.with_compute))
+        yield ("ARROW_CSV", truthifier(self.with_csv))
+        yield ("ARROW_CUDA", truthifier(self.with_cuda))
+        yield ("ARROW_DATASET", truthifier(self.with_dataset))
+        yield ("ARROW_FILESYSTEM", truthifier(self.with_filesystem))
+        yield ("ARROW_FLIGHT", truthifier(self.with_flight))
+        yield ("ARROW_GANDIVA", truthifier(self.with_gandiva))
+        yield ("ARROW_PARQUET", truthifier(self.with_parquet))
+        yield ("ARROW_HDFS", truthifier(self.with_hdfs))
+        yield ("ARROW_HIVESERVER2", truthifier(self.with_hiveserver2))
+        yield ("ARROW_IPC", truthifier(self.with_ipc))
+        yield ("ARROW_JSON", truthifier(self.with_json))
+        yield ("ARROW_JNI", truthifier(self.with_jni))
+        yield ("ARROW_MIMALLOC", truthifier(self.with_mimalloc))
+        yield ("ARROW_PLASMA", truthifier(self.with_plasma))
+        yield ("ARROW_PYTHON", truthifier(self.with_python))
+        yield ("ARROW_S3", truthifier(self.with_s3))
+
+        # Compressions
+        yield ("ARROW_WITH_BROTLI", truthifier(self.with_brotli))
+        yield ("ARROW_WITH_BZ2", truthifier(self.with_bz2))
+        yield ("ARROW_WITH_LZ4", truthifier(self.with_lz4))
+        yield ("ARROW_WITH_SNAPPY", truthifier(self.with_snappy))
+        yield ("ARROW_WITH_ZLIB", truthifier(self.with_zlib))
+        yield ("ARROW_WITH_ZSTD", truthifier(self.with_zstd))
+
+        yield ("ARROW_LINT_ONLY", truthifier(self.with_lint_only))
+
+        # Some configurations don't like gnu gold linker.
+        broken_with_gold_ld = [self.with_fuzzing, self.with_gandiva]
+        if self.use_gold_linker and not any(broken_with_gold_ld):
+            yield ("ARROW_USE_LD_GOLD", truthifier(self.use_gold_linker))
+        yield ("ARROW_SIMD_LEVEL", or_else(self.simd_level, "SSE4_2"))
+
+        # Detect custom conda toolchain
+        if self.use_conda:
+            for d, v in [('CMAKE_AR', 'AR'), ('CMAKE_RANLIB', 'RANLIB')]:
+                v = os.environ.get(v)
+                if v:
+                    yield (d, v)
+
+    @property
+    def install_prefix(self):
+        if self._install_prefix:
+            return self._install_prefix
+
+        if self.use_conda:
+            return os.environ.get("CONDA_PREFIX")
+
+        return None
+
+    @property
+    def use_conda(self):
+        # If the user didn't specify a preference, guess via environment
+        if self._use_conda is None:
+            return os.environ.get("CONDA_PREFIX") is not None
+
+        return self._use_conda
+
+    @property
+    def definitions(self):
+        extras = list(self.cmake_extras) if self.cmake_extras else []
+        definitions = ["-D{}={}".format(d[0], d[1]) for d in self._gen_defs()]
+        return definitions + extras
+
+    @property
+    def environment(self):
+        env = os.environ.copy()
+
+        if self.cc:
+            env["CC"] = self.cc
+
+        if self.cxx:
+            env["CXX"] = self.cxx
+
+        return env
+
+
+class CppCMakeDefinition(CMakeDefinition):
+    def __init__(self, source, conf, **kwargs):
+        self.configuration = conf
+        super().__init__(source, **kwargs,
+                         definitions=conf.definitions, env=conf.environment,
+                         build_type=conf.build_type)
diff --git a/src/arrow/dev/archery/archery/lang/java.py b/src/arrow/dev/archery/archery/lang/java.py
new file mode 100644
index 000000000..bc169adf6
--- /dev/null
+++ b/src/arrow/dev/archery/archery/lang/java.py
@@ -0,0 +1,77 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+
+from ..utils.command import Command, CommandStackMixin, default_bin
+from ..utils.maven import MavenDefinition
+
+
+class Java(Command):
+    def __init__(self, java_bin=None):
+        self.bin = default_bin(java_bin, "java")
+
+
+class Jar(CommandStackMixin, Java):
+    def __init__(self, jar, *args, **kwargs):
+        self.jar = jar
+        self.argv = ("-jar", jar)
+        Java.__init__(self, *args, **kwargs)
+
+
+class JavaConfiguration:
+    def __init__(self,
+
+                 # toolchain
+                 java_home=None, java_options=None,
+                 # build & benchmark
+                 build_extras=None, benchmark_extras=None):
+        self.java_home = java_home
+        self.java_options = java_options
+
+        self.build_extras = list(build_extras) if build_extras else []
+        self.benchmark_extras = list(
+            benchmark_extras) if benchmark_extras else []
+
+    @property
+    def build_definitions(self):
+        return self.build_extras
+
+    @property
+    def benchmark_definitions(self):
+        return self.benchmark_extras
+
+    @property
+    def environment(self):
+        env = os.environ.copy()
+
+        if self.java_home:
+            env["JAVA_HOME"] = self.java_home
+
+        if self.java_options:
+            env["JAVA_OPTIONS"] = self.java_options
+
+        return env
+
+
+class JavaMavenDefinition(MavenDefinition):
+    def __init__(self, source, conf, **kwargs):
+        self.configuration = conf
+        super().__init__(source, **kwargs,
+                         build_definitions=conf.build_definitions,
+                         benchmark_definitions=conf.benchmark_definitions,
+                         env=conf.environment)
diff --git a/src/arrow/dev/archery/archery/lang/python.py b/src/arrow/dev/archery/archery/lang/python.py
new file mode 100644
index 000000000..c6ebbe650
--- /dev/null
+++ b/src/arrow/dev/archery/archery/lang/python.py
@@ -0,0 +1,223 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import inspect
+import tokenize
+from contextlib import contextmanager
+
+try:
+    from numpydoc.validate import Docstring, validate
+except ImportError:
+    have_numpydoc = False
+else:
+    have_numpydoc = True
+
+from ..utils.logger import logger
+from ..utils.command import Command, capture_stdout, default_bin
+
+
+class Flake8(Command):
+    def __init__(self, flake8_bin=None):
+        self.bin = default_bin(flake8_bin, "flake8")
+
+
+class Autopep8(Command):
+    def __init__(self, autopep8_bin=None):
+        self.bin = default_bin(autopep8_bin, "autopep8")
+
+    @capture_stdout()
+    def run_captured(self, *args, **kwargs):
+        return self.run(*args, **kwargs)
+
+
+def _tokenize_signature(s):
+    lines = s.encode('ascii').splitlines()
+    generator = iter(lines).__next__
+    return tokenize.tokenize(generator)
+
+
+def _convert_typehint(tokens):
+    names = []
+    opening_bracket_reached = False
+    for token in tokens:
+        # omit the tokens before the opening bracket
+        if not opening_bracket_reached:
+            if token.string == '(':
+                opening_bracket_reached = True
+            else:
+                continue
+
+        if token.type == 1:  # type 1 means NAME token
+            names.append(token)
+        else:
+            if len(names) == 1:
+                yield (names[0].type, names[0].string)
+            elif len(names) == 2:
+                # two "NAME" tokens follow each other which means a cython
+                # typehint like `bool argument`, so remove the typehint
+                # note that we could convert it to python typehints, but hints
+                # are not supported by _signature_fromstr
+                yield (names[1].type, names[1].string)
+            elif len(names) > 2:
+                raise ValueError('More than two NAME tokens follow each other')
+            names = []
+            yield (token.type, token.string)
+
+
+def inspect_signature(obj):
+    """
+    Custom signature inspection primarily for cython generated callables.
+
+    Cython puts the signatures to the first line of the docstrings, which we
+    can reuse to parse the python signature from, but some gymnastics are
+    required, like removing the cython typehints.
+
+    It converts the cython signature:
+        array(obj, type=None, mask=None, size=None, from_pandas=None,
+              bool safe=True, MemoryPool memory_pool=None)
+    To:
+        <Signature (obj, type=None, mask=None, size=None, from_pandas=None,
+                    safe=True, memory_pool=None)>
+    """
+    cython_signature = obj.__doc__.splitlines()[0]
+    cython_tokens = _tokenize_signature(cython_signature)
+    python_tokens = _convert_typehint(cython_tokens)
+    python_signature = tokenize.untokenize(python_tokens)
+    return inspect._signature_fromstr(inspect.Signature, obj, python_signature)
+
+
+class NumpyDoc:
+
+    def __init__(self, symbols=None):
+        if not have_numpydoc:
+            raise RuntimeError(
+                'Numpydoc is not available, install the development version '
+                'with command: pip install numpydoc==1.1.0'
+            )
+        self.symbols = set(symbols or {'pyarrow'})
+
+    def traverse(self, fn, obj, from_package):
+        """Apply a function on publicly exposed API components.
+
+        Recursively iterates over the members of the passed object. It omits
+        any '_' prefixed and thirdparty (non pyarrow) symbols.
+
+        Parameters
+        ----------
+        obj : Any
+        from_package : string, default 'pyarrow'
+            Predicate to only consider objects from this package.
+        """
+        todo = [obj]
+        seen = set()
+
+        while todo:
+            obj = todo.pop()
+            if obj in seen:
+                continue
+            else:
+                seen.add(obj)
+
+            fn(obj)
+
+            for name in dir(obj):
+                if name.startswith('_'):
+                    continue
+
+                member = getattr(obj, name)
+                module = getattr(member, '__module__', None)
+                if not (module and module.startswith(from_package)):
+                    continue
+
+                todo.append(member)
+
+    @contextmanager
+    def _apply_patches(self):
+        """
+        Patch Docstring class to bypass loading already loaded python objects.
+        """
+        orig_load_obj = Docstring._load_obj
+        orig_signature = inspect.signature
+
+        @staticmethod
+        def _load_obj(obj):
+            # By default it expects a qualname and import the object, but we
+            # have already loaded object after the API traversal.
+            if isinstance(obj, str):
+                return orig_load_obj(obj)
+            else:
+                return obj
+
+        def signature(obj):
+            # inspect.signature tries to parse __text_signature__ if other
+            # properties like __signature__ doesn't exists, but cython
+            # doesn't set that property despite that embedsignature cython
+            # directive is set. The only way to inspect a cython compiled
+            # callable's signature to parse it from __doc__ while
+            # embedsignature directive is set during the build phase.
+            # So path inspect.signature function to attempt to parse the first
+            # line of callable.__doc__ as a signature.
+            try:
+                return orig_signature(obj)
+            except Exception as orig_error:
+                try:
+                    return inspect_signature(obj)
+                except Exception:
+                    raise orig_error
+
+        try:
+            Docstring._load_obj = _load_obj
+            inspect.signature = signature
+            yield
+        finally:
+            Docstring._load_obj = orig_load_obj
+            inspect.signature = orig_signature
+
+    def validate(self, from_package='', allow_rules=None,
+                 disallow_rules=None):
+        results = []
+
+        def callback(obj):
+            try:
+                result = validate(obj)
+            except OSError as e:
+                symbol = f"{obj.__module__}.{obj.__name__}"
+                logger.warning(f"Unable to validate `{symbol}` due to `{e}`")
+                return
+
+            errors = []
+            for errcode, errmsg in result.get('errors', []):
+                if allow_rules and errcode not in allow_rules:
+                    continue
+                if disallow_rules and errcode in disallow_rules:
+                    continue
+                errors.append((errcode, errmsg))
+
+            if len(errors):
+                result['errors'] = errors
+                results.append((obj, result))
+
+        with self._apply_patches():
+            for symbol in self.symbols:
+                try:
+                    obj = Docstring._load_obj(symbol)
+                except (ImportError, AttributeError):
+                    print('{} is not available for import'.format(symbol))
+                else:
+                    self.traverse(callback, obj, from_package=from_package)
+
+        return results
diff --git a/src/arrow/dev/archery/archery/linking.py b/src/arrow/dev/archery/archery/linking.py
new file mode 100644
index 000000000..c2e6f1772
--- /dev/null
+++ b/src/arrow/dev/archery/archery/linking.py
@@ -0,0 +1,75 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import platform
+import subprocess
+
+from .utils.command import Command
+
+
+_ldd = Command("ldd")
+_otool = Command("otool")
+
+
+class DependencyError(Exception):
+    pass
+
+
+class DynamicLibrary:
+
+    def __init__(self, path):
+        self.path = path
+
+    def list_dependencies(self):
+        """
+        List the full name of the library dependencies.
+        """
+        system = platform.system()
+        if system == "Linux":
+            result = _ldd.run(self.path, stdout=subprocess.PIPE)
+            lines = result.stdout.splitlines()
+            return [ll.split(None, 1)[0].decode() for ll in lines]
+        elif system == "Darwin":
+            result = _otool.run("-L", self.path, stdout=subprocess.PIPE)
+            lines = result.stdout.splitlines()
+            return [dl.split(None, 1)[0].decode() for dl in lines]
+        else:
+            raise ValueError(f"{platform} is not supported")
+
+    def list_dependency_names(self):
+        """
+        List the truncated names of the dynamic library dependencies.
+        """
+        names = []
+        for dependency in self.list_dependencies():
+            *_, library = dependency.rsplit("/", 1)
+            name, *_ = library.split(".", 1)
+            names.append(name)
+        return names
+
+
+def check_dynamic_library_dependencies(path, allowed, disallowed):
+    dylib = DynamicLibrary(path)
+    for dep in dylib.list_dependency_names():
+        if allowed and dep not in allowed:
+            raise DependencyError(
+                f"Unexpected shared dependency found in {dylib.path}: `{dep}`"
+            )
+        if disallowed and dep in disallowed:
+            raise DependencyError(
+                f"Disallowed shared dependency found in {dylib.path}: `{dep}`"
+            )
diff --git a/src/arrow/dev/archery/archery/release.py b/src/arrow/dev/archery/archery/release.py
new file mode 100644
index 000000000..6baeabc9d
--- /dev/null
+++ b/src/arrow/dev/archery/archery/release.py
@@ -0,0 +1,535 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from collections import defaultdict
+import functools
+import os
+import re
+import pathlib
+import shelve
+import warnings
+
+from git import Repo
+from jira import JIRA
+from semver import VersionInfo as SemVer
+
+from .utils.source import ArrowSources
+from .utils.report import JinjaReport
+
+
+def cached_property(fn):
+    return property(functools.lru_cache(maxsize=1)(fn))
+
+
+class Version(SemVer):
+
+    __slots__ = ('released', 'release_date')
+
+    def __init__(self, released=False, release_date=None, **kwargs):
+        super().__init__(**kwargs)
+        self.released = released
+        self.release_date = release_date
+
+    @classmethod
+    def parse(cls, version, **kwargs):
+        return cls(**SemVer.parse(version).to_dict(), **kwargs)
+
+    @classmethod
+    def from_jira(cls, jira_version):
+        return cls.parse(
+            jira_version.name,
+            released=jira_version.released,
+            release_date=getattr(jira_version, 'releaseDate', None)
+        )
+
+
+class Issue:
+
+    def __init__(self, key, type, summary):
+        self.key = key
+        self.type = type
+        self.summary = summary
+
+    @classmethod
+    def from_jira(cls, jira_issue):
+        return cls(
+            key=jira_issue.key,
+            type=jira_issue.fields.issuetype.name,
+            summary=jira_issue.fields.summary
+        )
+
+    @property
+    def project(self):
+        return self.key.split('-')[0]
+
+    @property
+    def number(self):
+        return int(self.key.split('-')[1])
+
+
+class Jira(JIRA):
+
+    def __init__(self, user=None, password=None,
+                 url='https://issues.apache.org/jira'):
+        user = user or os.environ.get('APACHE_JIRA_USER')
+        password = password or os.environ.get('APACHE_JIRA_PASSWORD')
+        super().__init__(url, basic_auth=(user, password))
+
+    def project_version(self, version_string, project='ARROW'):
+        # query version from jira to populated with additional metadata
+        versions = {str(v): v for v in self.project_versions(project)}
+        return versions[version_string]
+
+    def project_versions(self, project):
+        versions = []
+        for v in super().project_versions(project):
+            try:
+                versions.append(Version.from_jira(v))
+            except ValueError:
+                # ignore invalid semantic versions like JS-0.4.0
+                continue
+        return sorted(versions, reverse=True)
+
+    def issue(self, key):
+        return Issue.from_jira(super().issue(key))
+
+    def project_issues(self, version, project='ARROW'):
+        query = "project={} AND fixVersion={}".format(project, version)
+        issues = super().search_issues(query, maxResults=False)
+        return list(map(Issue.from_jira, issues))
+
+
+class CachedJira:
+
+    def __init__(self, cache_path, jira=None):
+        self.jira = jira or Jira()
+        self.cache_path = cache_path
+
+    def __getattr__(self, name):
+        attr = getattr(self.jira, name)
+        return self._cached(name, attr) if callable(attr) else attr
+
+    def _cached(self, name, method):
+        def wrapper(*args, **kwargs):
+            key = str((name, args, kwargs))
+            with shelve.open(self.cache_path) as cache:
+                try:
+                    result = cache[key]
+                except KeyError:
+                    cache[key] = result = method(*args, **kwargs)
+            return result
+        return wrapper
+
+
+_TITLE_REGEX = re.compile(
+    r"(?P<issue>(?P<project>(ARROW|PARQUET))\-\d+)?\s*:?\s*"
+    r"(?P<components>\[.*\])?\s*(?P<summary>.*)"
+)
+_COMPONENT_REGEX = re.compile(r"\[([^\[\]]+)\]")
+
+
+class CommitTitle:
+
+    def __init__(self, summary, project=None, issue=None, components=None):
+        self.project = project
+        self.issue = issue
+        self.components = components or []
+        self.summary = summary
+
+    def __str__(self):
+        out = ""
+        if self.issue:
+            out += "{}: ".format(self.issue)
+        if self.components:
+            for component in self.components:
+                out += "[{}]".format(component)
+            out += " "
+        out += self.summary
+        return out
+
+    def __eq__(self, other):
+        return (
+            self.summary == other.summary and
+            self.project == other.project and
+            self.issue == other.issue and
+            self.components == other.components
+        )
+
+    def __hash__(self):
+        return hash(
+            (self.summary, self.project, self.issue, tuple(self.components))
+        )
+
+    @classmethod
+    def parse(cls, headline):
+        matches = _TITLE_REGEX.match(headline)
+        if matches is None:
+            warnings.warn(
+                "Unable to parse commit message `{}`".format(headline)
+            )
+            return CommitTitle(headline)
+
+        values = matches.groupdict()
+        components = values.get('components') or ''
+        components = _COMPONENT_REGEX.findall(components)
+
+        return CommitTitle(
+            values['summary'],
+            project=values.get('project'),
+            issue=values.get('issue'),
+            components=components
+        )
+
+
+class Commit:
+
+    def __init__(self, wrapped):
+        self._title = CommitTitle.parse(wrapped.summary)
+        self._wrapped = wrapped
+
+    def __getattr__(self, attr):
+        if hasattr(self._title, attr):
+            return getattr(self._title, attr)
+        else:
+            return getattr(self._wrapped, attr)
+
+    def __repr__(self):
+        template = '<Commit sha={!r} issue={!r} components={!r} summary={!r}>'
+        return template.format(self.hexsha, self.issue, self.components,
+                               self.summary)
+
+    @property
+    def url(self):
+        return 'https://github.com/apache/arrow/commit/{}'.format(self.hexsha)
+
+    @property
+    def title(self):
+        return self._title
+
+
+class ReleaseCuration(JinjaReport):
+    templates = {
+        'console': 'release_curation.txt.j2'
+    }
+    fields = [
+        'release',
+        'within',
+        'outside',
+        'nojira',
+        'parquet',
+        'nopatch'
+    ]
+
+
+class JiraChangelog(JinjaReport):
+    templates = {
+        'markdown': 'release_changelog.md.j2',
+        'html': 'release_changelog.html.j2'
+    }
+    fields = [
+        'release',
+        'categories'
+    ]
+
+
+class Release:
+
+    def __init__(self):
+        raise TypeError("Do not initialize Release class directly, use "
+                        "Release.from_jira(version) instead.")
+
+    def __repr__(self):
+        if self.version.released:
+            status = "released_at={!r}".format(self.version.release_date)
+        else:
+            status = "pending"
+        return "<{} {!r} {}>".format(self.__class__.__name__,
+                                     str(self.version), status)
+
+    @staticmethod
+    def from_jira(version, jira=None, repo=None):
+        if jira is None:
+            jira = Jira()
+        elif isinstance(jira, str):
+            jira = Jira(jira)
+        elif not isinstance(jira, (Jira, CachedJira)):
+            raise TypeError("`jira` argument must be a server url or a valid "
+                            "Jira instance")
+
+        if repo is None:
+            arrow = ArrowSources.find()
+            repo = Repo(arrow.path)
+        elif isinstance(repo, (str, pathlib.Path)):
+            repo = Repo(repo)
+        elif not isinstance(repo, Repo):
+            raise TypeError("`repo` argument must be a path or a valid Repo "
+                            "instance")
+
+        if isinstance(version, str):
+            version = jira.project_version(version, project='ARROW')
+        elif not isinstance(version, Version):
+            raise TypeError(version)
+
+        # decide the type of the release based on the version number
+        if version.patch == 0:
+            if version.minor == 0:
+                klass = MajorRelease
+            elif version.major == 0:
+                # handle minor releases before 1.0 as major releases
+                klass = MajorRelease
+            else:
+                klass = MinorRelease
+        else:
+            klass = PatchRelease
+
+        # prevent instantiating release object directly
+        obj = klass.__new__(klass)
+        obj.version = version
+        obj.jira = jira
+        obj.repo = repo
+
+        return obj
+
+    @property
+    def is_released(self):
+        return self.version.released
+
+    @property
+    def tag(self):
+        return "apache-arrow-{}".format(str(self.version))
+
+    @property
+    def branch(self):
+        raise NotImplementedError()
+
+    @property
+    def siblings(self):
+        """
+        Releases to consider when calculating previous and next releases.
+        """
+        raise NotImplementedError()
+
+    @cached_property
+    def previous(self):
+        # select all non-patch releases
+        position = self.siblings.index(self.version)
+        try:
+            previous = self.siblings[position + 1]
+        except IndexError:
+            # first release doesn't have a previous one
+            return None
+        else:
+            return Release.from_jira(previous, jira=self.jira, repo=self.repo)
+
+    @cached_property
+    def next(self):
+        # select all non-patch releases
+        position = self.siblings.index(self.version)
+        if position <= 0:
+            raise ValueError("There is no upcoming release set in JIRA after "
+                             "version {}".format(self.version))
+        upcoming = self.siblings[position - 1]
+        return Release.from_jira(upcoming, jira=self.jira, repo=self.repo)
+
+    @cached_property
+    def issues(self):
+        issues = self.jira.project_issues(self.version, project='ARROW')
+        return {i.key: i for i in issues}
+
+    @cached_property
+    def commits(self):
+        """
+        All commits applied between two versions.
+        """
+        if self.previous is None:
+            # first release
+            lower = ''
+        else:
+            lower = self.repo.tags[self.previous.tag]
+
+        if self.version.released:
+            upper = self.repo.tags[self.tag]
+        else:
+            try:
+                upper = self.repo.branches[self.branch]
+            except IndexError:
+                warnings.warn("Release branch `{}` doesn't exist."
+                              .format(self.branch))
+                return []
+
+        commit_range = "{}..{}".format(lower, upper)
+        return list(map(Commit, self.repo.iter_commits(commit_range)))
+
+    def curate(self):
+        # handle commits with parquet issue key specially and query them from
+        # jira and add it to the issues
+        release_issues = self.issues
+
+        within, outside, nojira, parquet = [], [], [], []
+        for c in self.commits:
+            if c.issue is None:
+                nojira.append(c)
+            elif c.issue in release_issues:
+                within.append((release_issues[c.issue], c))
+            elif c.project == 'PARQUET':
+                parquet.append((self.jira.issue(c.issue), c))
+            else:
+                outside.append((self.jira.issue(c.issue), c))
+
+        # remaining jira tickets
+        within_keys = {i.key for i, c in within}
+        nopatch = [issue for key, issue in release_issues.items()
+                   if key not in within_keys]
+
+        return ReleaseCuration(release=self, within=within, outside=outside,
+                               nojira=nojira, parquet=parquet, nopatch=nopatch)
+
+    def changelog(self):
+        release_issues = []
+
+        # get organized report for the release
+        curation = self.curate()
+
+        # jira tickets having patches in the release
+        for issue, _ in curation.within:
+            release_issues.append(issue)
+
+        # jira tickets without patches
+        for issue in curation.nopatch:
+            release_issues.append(issue)
+
+        # parquet patches in the release
+        for issue, _ in curation.parquet:
+            release_issues.append(issue)
+
+        # organize issues into categories
+        issue_types = {
+            'Bug': 'Bug Fixes',
+            'Improvement': 'New Features and Improvements',
+            'New Feature': 'New Features and Improvements',
+            'Sub-task': 'New Features and Improvements',
+            'Task': 'New Features and Improvements',
+            'Test': 'Bug Fixes',
+            'Wish': 'New Features and Improvements',
+        }
+        categories = defaultdict(list)
+        for issue in release_issues:
+            categories[issue_types[issue.type]].append(issue)
+
+        # sort issues by the issue key in ascending order
+        for name, issues in categories.items():
+            issues.sort(key=lambda issue: (issue.project, issue.number))
+
+        return JiraChangelog(release=self, categories=categories)
+
+
+class MaintenanceMixin:
+    """
+    Utility methods for cherry-picking commits from the main branch.
+    """
+
+    def commits_to_pick(self, exclude_already_applied=True):
+        # collect commits applied on the main branch since the root of the
+        # maintenance branch (the previous major release)
+        if self.version.major == 0:
+            # treat minor releases as major releases preceeding 1.0.0 release
+            commit_range = "apache-arrow-0.{}.0..master".format(
+                self.version.minor
+            )
+        else:
+            commit_range = "apache-arrow-{}.0.0..master".format(
+                self.version.major
+            )
+
+        # keeping the original order of the commits helps to minimize the merge
+        # conflicts during cherry-picks
+        commits = map(Commit, self.repo.iter_commits(commit_range))
+
+        # exclude patches that have been already applied to the maintenance
+        # branch, we cannot identify patches based on sha because it changes
+        # after the cherry pick so use commit title instead
+        if exclude_already_applied:
+            already_applied = {c.title for c in self.commits}
+        else:
+            already_applied = set()
+
+        # iterate over the commits applied on the main branch and filter out
+        # the ones that are included in the jira release
+        patches_to_pick = [c for c in commits if
+                           c.issue in self.issues and
+                           c.title not in already_applied]
+
+        return reversed(patches_to_pick)
+
+    def cherry_pick_commits(self, recreate_branch=True):
+        if recreate_branch:
+            # delete, create and checkout the maintenance branch based off of
+            # the previous tag
+            if self.branch in self.repo.branches:
+                self.repo.git.branch('-D', self.branch)
+            self.repo.git.checkout(self.previous.tag, b=self.branch)
+        else:
+            # just checkout the already existing maintenance branch
+            self.repo.git.checkout(self.branch)
+
+        # cherry pick the commits based on the jira tickets
+        for commit in self.commits_to_pick():
+            self.repo.git.cherry_pick(commit.hexsha)
+
+
+class MajorRelease(Release):
+
+    @property
+    def branch(self):
+        return "master"
+
+    @cached_property
+    def siblings(self):
+        """
+        Filter only the major releases.
+        """
+        # handle minor releases before 1.0 as major releases
+        return [v for v in self.jira.project_versions('ARROW')
+                if v.patch == 0 and (v.major == 0 or v.minor == 0)]
+
+
+class MinorRelease(Release, MaintenanceMixin):
+
+    @property
+    def branch(self):
+        return "maint-{}.x.x".format(self.version.major)
+
+    @cached_property
+    def siblings(self):
+        """
+        Filter the major and minor releases.
+        """
+        return [v for v in self.jira.project_versions('ARROW') if v.patch == 0]
+
+
+class PatchRelease(Release, MaintenanceMixin):
+
+    @property
+    def branch(self):
+        return "maint-{}.{}.x".format(self.version.major, self.version.minor)
+
+    @cached_property
+    def siblings(self):
+        """
+        No filtering, consider all releases.
+        """
+        return self.jira.project_versions('ARROW')
diff --git a/src/arrow/dev/archery/archery/templates/release_changelog.md.j2 b/src/arrow/dev/archery/archery/templates/release_changelog.md.j2
new file mode 100644
index 000000000..c0406ddf4
--- /dev/null
+++ b/src/arrow/dev/archery/archery/templates/release_changelog.md.j2
@@ -0,0 +1,29 @@
+{#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#}
+# Apache Arrow {{ release.version }} ({{ release.version.release_date or today() }})
+
+{% for category, issues in categories.items() -%}
+
+## {{ category }}
+
+{% for issue in issues -%}
+* [{{ issue.key }}](https://issues.apache.org/jira/browse/{{ issue.key }}) - {{ issue.summary | md }}
+{% endfor %}
+
+{% endfor %}
diff --git a/src/arrow/dev/archery/archery/templates/release_curation.txt.j2 b/src/arrow/dev/archery/archery/templates/release_curation.txt.j2
new file mode 100644
index 000000000..a5d11e9d4
--- /dev/null
+++ b/src/arrow/dev/archery/archery/templates/release_curation.txt.j2
@@ -0,0 +1,41 @@
+{#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#}
+Total number of JIRA tickets assigned to version {{ release.version }}: {{ release.issues|length }}
+
+Total number of applied patches since version {{ release.previous.version }}: {{ release.commits|length }}
+
+Patches with assigned issue in version {{ release.version }}:
+{% for issue, commit in within -%}
+ - {{ commit.url }} {{ commit.title }}
+{% endfor %}
+
+Patches with assigned issue outside of version {{ release.version }}:
+{% for issue, commit in outside -%}
+ - {{ commit.url }} {{ commit.title }}
+{% endfor %}
+
+Patches in version {{ release.version }} without a linked issue:
+{% for commit in nojira -%}
+ - {{ commit.url }} {{ commit.title }}
+{% endfor %}
+
+JIRA issues in version {{ release.version }} without a linked patch:
+{% for issue in nopatch -%}
+ - https://issues.apache.org/jira/browse/{{ issue.key }}
+{% endfor %}
diff --git a/src/arrow/dev/archery/archery/testing.py b/src/arrow/dev/archery/archery/testing.py
new file mode 100644
index 000000000..471a54d4c
--- /dev/null
+++ b/src/arrow/dev/archery/archery/testing.py
@@ -0,0 +1,83 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from contextlib import contextmanager
+import os
+from unittest import mock
+import re
+
+
+class DotDict(dict):
+
+    def __getattr__(self, key):
+        try:
+            item = self[key]
+        except KeyError:
+            raise AttributeError(key)
+        if isinstance(item, dict):
+            return DotDict(item)
+        else:
+            return item
+
+
+class PartialEnv(dict):
+
+    def __eq__(self, other):
+        return self.items() <= other.items()
+
+
+_mock_call_type = type(mock.call())
+
+
+def _ensure_mock_call_object(obj, **kwargs):
+    if isinstance(obj, _mock_call_type):
+        return obj
+    elif isinstance(obj, str):
+        cmd = re.split(r"\s+", obj)
+        return mock.call(cmd, **kwargs)
+    elif isinstance(obj, list):
+        return mock.call(obj, **kwargs)
+    else:
+        raise TypeError(obj)
+
+
+class SuccessfulSubprocessResult:
+
+    def check_returncode(self):
+        return
+
+
+@contextmanager
+def assert_subprocess_calls(expected_commands_or_calls, **kwargs):
+    calls = [
+        _ensure_mock_call_object(obj, **kwargs)
+        for obj in expected_commands_or_calls
+    ]
+    with mock.patch('subprocess.run', autospec=True) as run:
+        run.return_value = SuccessfulSubprocessResult()
+        yield run
+        run.assert_has_calls(calls)
+
+
+@contextmanager
+def override_env(mapping):
+    original = os.environ
+    try:
+        os.environ = dict(os.environ, **mapping)
+        yield os.environ
+    finally:
+        os.environ = original
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/archery-benchmark-diff-empty-lines.jsonl b/src/arrow/dev/archery/archery/tests/fixtures/archery-benchmark-diff-empty-lines.jsonl
new file mode 100644
index 000000000..5854eb75c
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/archery-benchmark-diff-empty-lines.jsonl
@@ -0,0 +1,6 @@
+{"benchmark": "RegressionSumKernel/32768/10", "change": 0.0046756468886368545, "regression": false, "baseline": 13265442258.099466, "contender": 13327466781.91994, "unit": "bytes_per_second", "less_is_better": false, "suite": "arrow-compute-aggregate-benchmark"}
+{"benchmark": "RegressionSumKernel/32768/1", "change": 0.0025108399115900733, "regression": false, "baseline": 15181891659.539782, "contender": 15220010959.05199, "unit": "bytes_per_second", "less_is_better": false, "suite": "arrow-compute-aggregate-benchmark"}
+
+{"benchmark": "RegressionSumKernel/32768/50", "change": 0.00346735806287155, "regression": false, "baseline": 11471825667.817123, "contender": 11511602595.042286, "unit": "bytes_per_second", "less_is_better": false, "suite": "arrow-compute-aggregate-benchmark"}
+
+{"benchmark": "RegressionSumKernel/32768/0", "change": 0.010140954727954987, "regression": false, "baseline": 18316987019.994465, "contender": 18502738756.116768, "unit": "bytes_per_second", "less_is_better": false, "suite": "arrow-compute-aggregate-benchmark"}
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/archery-benchmark-diff.jsonl b/src/arrow/dev/archery/archery/tests/fixtures/archery-benchmark-diff.jsonl
new file mode 100644
index 000000000..1e25810d7
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/archery-benchmark-diff.jsonl
@@ -0,0 +1,4 @@
+{"benchmark":"RegressionSumKernel/32768/50","change":-0.001550846227215492,"regression":false,"baseline":19241207435.428757,"contender":19211367281.47045,"unit":"bytes_per_second","less_is_better":false,"suite":"arrow-compute-aggregate-benchmark"}
+{"benchmark":"RegressionSumKernel/32768/1","change":0.0020681767923465765,"regression":true,"baseline":24823170673.777943,"contender":24771831968.277977,"unit":"bytes_per_second","less_is_better":false,"suite":"arrow-compute-aggregate-benchmark"}
+{"benchmark":"RegressionSumKernel/32768/10","change":0.0033323376378746905,"regression":false,"baseline":21902707565.968014,"contender":21975694782.76145,"unit":"bytes_per_second","less_is_better":false,"suite":"arrow-compute-aggregate-benchmark"}
+{"benchmark":"RegressionSumKernel/32768/0","change":-0.004918126090954414,"regression":true,"baseline":27685006611.446762,"contender":27821164964.790764,"unit":"bytes_per_second","less_is_better":false,"suite":"arrow-compute-aggregate-benchmark"}
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-build-command.json b/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-build-command.json
new file mode 100644
index 000000000..d591105f0
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-build-command.json
@@ -0,0 +1,212 @@
+{
+    "action": "created",
+    "comment": {
+        "author_association": "MEMBER",
+        "body": "@ursabot build",
+        "created_at": "2019-04-05T11:55:43Z",
+        "html_url": "https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480248726",
+        "id": 480248726,
+        "issue_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+        "node_id": "MDEyOklzc3VlQ29tbWVudDQ4MDI0ODcyNg==",
+        "updated_at": "2019-04-05T11:55:43Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480248726",
+        "user": {
+            "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+            "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/kszucs/followers",
+            "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/kszucs",
+            "id": 961747,
+            "login": "kszucs",
+            "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+            "organizations_url": "https://api.github.com/users/kszucs/orgs",
+            "received_events_url": "https://api.github.com/users/kszucs/received_events",
+            "repos_url": "https://api.github.com/users/kszucs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+            "type": "User",
+            "url": "https://api.github.com/users/kszucs"
+        }
+    },
+    "issue": {
+        "assignee": null,
+        "assignees": [],
+        "author_association": "MEMBER",
+        "body": "",
+        "closed_at": null,
+        "comments": 3,
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments",
+        "created_at": "2019-04-05T11:22:15Z",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/events",
+        "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+        "id": 429706959,
+        "labels": [],
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}",
+        "locked": false,
+        "milestone": null,
+        "node_id": "MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy",
+        "number": 26,
+        "pull_request": {
+            "diff_url": "https://github.com/ursa-labs/ursabot/pull/26.diff",
+            "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+            "patch_url": "https://github.com/ursa-labs/ursabot/pull/26.patch",
+            "url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26"
+        },
+        "repository_url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "state": "open",
+        "title": "Unittests for GithubHook",
+        "updated_at": "2019-04-05T11:55:43Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+        "user": {
+            "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+            "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/kszucs/followers",
+            "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/kszucs",
+            "id": 961747,
+            "login": "kszucs",
+            "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+            "organizations_url": "https://api.github.com/users/kszucs/orgs",
+            "received_events_url": "https://api.github.com/users/kszucs/received_events",
+            "repos_url": "https://api.github.com/users/kszucs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+            "type": "User",
+            "url": "https://api.github.com/users/kszucs"
+        }
+    },
+    "organization": {
+        "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+        "description": "Innovation lab for open source data science tools, powered by Apache Arrow",
+        "events_url": "https://api.github.com/orgs/ursa-labs/events",
+        "hooks_url": "https://api.github.com/orgs/ursa-labs/hooks",
+        "id": 46514972,
+        "issues_url": "https://api.github.com/orgs/ursa-labs/issues",
+        "login": "ursa-labs",
+        "members_url": "https://api.github.com/orgs/ursa-labs/members{/member}",
+        "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+        "public_members_url": "https://api.github.com/orgs/ursa-labs/public_members{/member}",
+        "repos_url": "https://api.github.com/orgs/ursa-labs/repos",
+        "url": "https://api.github.com/orgs/ursa-labs"
+    },
+    "repository": {
+        "archive_url": "https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}",
+        "archived": false,
+        "assignees_url": "https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}",
+        "blobs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}",
+        "branches_url": "https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}",
+        "clone_url": "https://github.com/ursa-labs/ursabot.git",
+        "collaborators_url": "https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}",
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/comments{/number}",
+        "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}",
+        "compare_url": "https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}",
+        "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}",
+        "contributors_url": "https://api.github.com/repos/ursa-labs/ursabot/contributors",
+        "created_at": "2019-02-04T15:40:31Z",
+        "default_branch": "master",
+        "deployments_url": "https://api.github.com/repos/ursa-labs/ursabot/deployments",
+        "description": null,
+        "disabled": false,
+        "downloads_url": "https://api.github.com/repos/ursa-labs/ursabot/downloads",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/events",
+        "fork": false,
+        "forks": 0,
+        "forks_count": 0,
+        "forks_url": "https://api.github.com/repos/ursa-labs/ursabot/forks",
+        "full_name": "ursa-labs/ursabot",
+        "git_commits_url": "https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}",
+        "git_refs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}",
+        "git_tags_url": "https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}",
+        "git_url": "git://github.com/ursa-labs/ursabot.git",
+        "has_downloads": true,
+        "has_issues": true,
+        "has_pages": false,
+        "has_projects": true,
+        "has_wiki": true,
+        "homepage": null,
+        "hooks_url": "https://api.github.com/repos/ursa-labs/ursabot/hooks",
+        "html_url": "https://github.com/ursa-labs/ursabot",
+        "id": 169101701,
+        "issue_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}",
+        "issue_events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}",
+        "issues_url": "https://api.github.com/repos/ursa-labs/ursabot/issues{/number}",
+        "keys_url": "https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}",
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/labels{/name}",
+        "language": "Jupyter Notebook",
+        "languages_url": "https://api.github.com/repos/ursa-labs/ursabot/languages",
+        "license": null,
+        "merges_url": "https://api.github.com/repos/ursa-labs/ursabot/merges",
+        "milestones_url": "https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}",
+        "mirror_url": null,
+        "name": "ursabot",
+        "node_id": "MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=",
+        "notifications_url": "https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}",
+        "open_issues": 19,
+        "open_issues_count": 19,
+        "owner": {
+            "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+            "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/ursa-labs/followers",
+            "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/ursa-labs",
+            "id": 46514972,
+            "login": "ursa-labs",
+            "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+            "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+            "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+            "repos_url": "https://api.github.com/users/ursa-labs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+            "type": "Organization",
+            "url": "https://api.github.com/users/ursa-labs"
+        },
+        "private": false,
+        "pulls_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}",
+        "pushed_at": "2019-04-05T11:22:16Z",
+        "releases_url": "https://api.github.com/repos/ursa-labs/ursabot/releases{/id}",
+        "size": 892,
+        "ssh_url": "git@github.com:ursa-labs/ursabot.git",
+        "stargazers_count": 1,
+        "stargazers_url": "https://api.github.com/repos/ursa-labs/ursabot/stargazers",
+        "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}",
+        "subscribers_url": "https://api.github.com/repos/ursa-labs/ursabot/subscribers",
+        "subscription_url": "https://api.github.com/repos/ursa-labs/ursabot/subscription",
+        "svn_url": "https://github.com/ursa-labs/ursabot",
+        "tags_url": "https://api.github.com/repos/ursa-labs/ursabot/tags",
+        "teams_url": "https://api.github.com/repos/ursa-labs/ursabot/teams",
+        "trees_url": "https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}",
+        "updated_at": "2019-04-04T17:49:10Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "watchers": 1,
+        "watchers_count": 1
+    },
+    "sender": {
+        "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+        "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+        "followers_url": "https://api.github.com/users/kszucs/followers",
+        "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+        "gravatar_id": "",
+        "html_url": "https://github.com/kszucs",
+        "id": 961747,
+        "login": "kszucs",
+        "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+        "organizations_url": "https://api.github.com/users/kszucs/orgs",
+        "received_events_url": "https://api.github.com/users/kszucs/received_events",
+        "repos_url": "https://api.github.com/users/kszucs/repos",
+        "site_admin": false,
+        "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+        "type": "User",
+        "url": "https://api.github.com/users/kszucs"
+    }
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-by-non-authorized-user.json b/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-by-non-authorized-user.json
new file mode 100644
index 000000000..5a8f3461c
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-by-non-authorized-user.json
@@ -0,0 +1,212 @@
+{
+    "action": "created",
+    "comment": {
+        "author_association": "NONE",
+        "body": "Unknown command \"\"",
+        "created_at": "2019-04-05T11:35:47Z",
+        "html_url": "https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480243815",
+        "id": 480243815,
+        "issue_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+        "node_id": "MDEyOklzc3VlQ29tbWVudDQ4MDI0MzgxNQ==",
+        "updated_at": "2019-04-05T11:35:47Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480243815",
+        "user": {
+            "avatar_url": "https://avatars2.githubusercontent.com/u/49275095?v=4",
+            "events_url": "https://api.github.com/users/ursabot/events{/privacy}",
+            "followers_url": "https://api.github.com/users/ursabot/followers",
+            "following_url": "https://api.github.com/users/ursabot/following{/other_user}",
+            "gists_url": "https://api.github.com/users/ursabot/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/ursabot",
+            "id": 49275095,
+            "login": "someone",
+            "node_id": "MDQ6VXNlcjQ5Mjc1MDk1",
+            "organizations_url": "https://api.github.com/users/ursabot/orgs",
+            "received_events_url": "https://api.github.com/users/ursabot/received_events",
+            "repos_url": "https://api.github.com/users/ursabot/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/ursabot/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/ursabot/subscriptions",
+            "type": "User",
+            "url": "https://api.github.com/users/ursabot"
+        }
+    },
+    "issue": {
+        "assignee": null,
+        "assignees": [],
+        "author_association": "NONE",
+        "body": "",
+        "closed_at": null,
+        "comments": 2,
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments",
+        "created_at": "2019-04-05T11:22:15Z",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/events",
+        "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+        "id": 429706959,
+        "labels": [],
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}",
+        "locked": false,
+        "milestone": null,
+        "node_id": "MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy",
+        "number": 26,
+        "pull_request": {
+            "diff_url": "https://github.com/ursa-labs/ursabot/pull/26.diff",
+            "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+            "patch_url": "https://github.com/ursa-labs/ursabot/pull/26.patch",
+            "url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26"
+        },
+        "repository_url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "state": "open",
+        "title": "Unittests for GithubHook",
+        "updated_at": "2019-04-05T11:35:47Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+        "user": {
+            "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+            "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/kszucs/followers",
+            "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/kszucs",
+            "id": 961747,
+            "login": "kszucs",
+            "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+            "organizations_url": "https://api.github.com/users/kszucs/orgs",
+            "received_events_url": "https://api.github.com/users/kszucs/received_events",
+            "repos_url": "https://api.github.com/users/kszucs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+            "type": "User",
+            "url": "https://api.github.com/users/kszucs"
+        }
+    },
+    "organization": {
+        "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+        "description": "Innovation lab for open source data science tools, powered by Apache Arrow",
+        "events_url": "https://api.github.com/orgs/ursa-labs/events",
+        "hooks_url": "https://api.github.com/orgs/ursa-labs/hooks",
+        "id": 46514972,
+        "issues_url": "https://api.github.com/orgs/ursa-labs/issues",
+        "login": "ursa-labs",
+        "members_url": "https://api.github.com/orgs/ursa-labs/members{/member}",
+        "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+        "public_members_url": "https://api.github.com/orgs/ursa-labs/public_members{/member}",
+        "repos_url": "https://api.github.com/orgs/ursa-labs/repos",
+        "url": "https://api.github.com/orgs/ursa-labs"
+    },
+    "repository": {
+        "archive_url": "https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}",
+        "archived": false,
+        "assignees_url": "https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}",
+        "blobs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}",
+        "branches_url": "https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}",
+        "clone_url": "https://github.com/ursa-labs/ursabot.git",
+        "collaborators_url": "https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}",
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/comments{/number}",
+        "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}",
+        "compare_url": "https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}",
+        "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}",
+        "contributors_url": "https://api.github.com/repos/ursa-labs/ursabot/contributors",
+        "created_at": "2019-02-04T15:40:31Z",
+        "default_branch": "master",
+        "deployments_url": "https://api.github.com/repos/ursa-labs/ursabot/deployments",
+        "description": null,
+        "disabled": false,
+        "downloads_url": "https://api.github.com/repos/ursa-labs/ursabot/downloads",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/events",
+        "fork": false,
+        "forks": 0,
+        "forks_count": 0,
+        "forks_url": "https://api.github.com/repos/ursa-labs/ursabot/forks",
+        "full_name": "ursa-labs/ursabot",
+        "git_commits_url": "https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}",
+        "git_refs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}",
+        "git_tags_url": "https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}",
+        "git_url": "git://github.com/ursa-labs/ursabot.git",
+        "has_downloads": true,
+        "has_issues": true,
+        "has_pages": false,
+        "has_projects": true,
+        "has_wiki": true,
+        "homepage": null,
+        "hooks_url": "https://api.github.com/repos/ursa-labs/ursabot/hooks",
+        "html_url": "https://github.com/ursa-labs/ursabot",
+        "id": 169101701,
+        "issue_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}",
+        "issue_events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}",
+        "issues_url": "https://api.github.com/repos/ursa-labs/ursabot/issues{/number}",
+        "keys_url": "https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}",
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/labels{/name}",
+        "language": "Jupyter Notebook",
+        "languages_url": "https://api.github.com/repos/ursa-labs/ursabot/languages",
+        "license": null,
+        "merges_url": "https://api.github.com/repos/ursa-labs/ursabot/merges",
+        "milestones_url": "https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}",
+        "mirror_url": null,
+        "name": "someone",
+        "node_id": "MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=",
+        "notifications_url": "https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}",
+        "open_issues": 19,
+        "open_issues_count": 19,
+        "owner": {
+            "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+            "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/ursa-labs/followers",
+            "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/ursa-labs",
+            "id": 46514972,
+            "login": "ursa-labs",
+            "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+            "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+            "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+            "repos_url": "https://api.github.com/users/ursa-labs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+            "type": "Organization",
+            "url": "https://api.github.com/users/ursa-labs"
+        },
+        "private": false,
+        "pulls_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}",
+        "pushed_at": "2019-04-05T11:22:16Z",
+        "releases_url": "https://api.github.com/repos/ursa-labs/ursabot/releases{/id}",
+        "size": 892,
+        "ssh_url": "git@github.com:ursa-labs/ursabot.git",
+        "stargazers_count": 1,
+        "stargazers_url": "https://api.github.com/repos/ursa-labs/ursabot/stargazers",
+        "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}",
+        "subscribers_url": "https://api.github.com/repos/ursa-labs/ursabot/subscribers",
+        "subscription_url": "https://api.github.com/repos/ursa-labs/ursabot/subscription",
+        "svn_url": "https://github.com/ursa-labs/ursabot",
+        "tags_url": "https://api.github.com/repos/ursa-labs/ursabot/tags",
+        "teams_url": "https://api.github.com/repos/ursa-labs/ursabot/teams",
+        "trees_url": "https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}",
+        "updated_at": "2019-04-04T17:49:10Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "watchers": 1,
+        "watchers_count": 1
+    },
+    "sender": {
+        "avatar_url": "https://avatars2.githubusercontent.com/u/49275095?v=4",
+        "events_url": "https://api.github.com/users/ursabot/events{/privacy}",
+        "followers_url": "https://api.github.com/users/ursabot/followers",
+        "following_url": "https://api.github.com/users/ursabot/following{/other_user}",
+        "gists_url": "https://api.github.com/users/ursabot/gists{/gist_id}",
+        "gravatar_id": "",
+        "html_url": "https://github.com/ursabot",
+        "id": 49275095,
+        "login": "someone",
+        "node_id": "MDQ6VXNlcjQ5Mjc1MDk1",
+        "organizations_url": "https://api.github.com/users/ursabot/orgs",
+        "received_events_url": "https://api.github.com/users/ursabot/received_events",
+        "repos_url": "https://api.github.com/users/ursabot/repos",
+        "site_admin": false,
+        "starred_url": "https://api.github.com/users/ursabot/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/ursabot/subscriptions",
+        "type": "User",
+        "url": "https://api.github.com/users/ursabot"
+    }
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-by-ursabot.json b/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-by-ursabot.json
new file mode 100644
index 000000000..bfb7210df
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-by-ursabot.json
@@ -0,0 +1,212 @@
+{
+    "action": "created",
+    "comment": {
+        "author_association": "NONE",
+        "body": "Unknown command \"\"",
+        "created_at": "2019-04-05T11:35:47Z",
+        "html_url": "https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480243815",
+        "id": 480243815,
+        "issue_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+        "node_id": "MDEyOklzc3VlQ29tbWVudDQ4MDI0MzgxNQ==",
+        "updated_at": "2019-04-05T11:35:47Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480243815",
+        "user": {
+            "avatar_url": "https://avatars2.githubusercontent.com/u/49275095?v=4",
+            "events_url": "https://api.github.com/users/ursabot/events{/privacy}",
+            "followers_url": "https://api.github.com/users/ursabot/followers",
+            "following_url": "https://api.github.com/users/ursabot/following{/other_user}",
+            "gists_url": "https://api.github.com/users/ursabot/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/ursabot",
+            "id": 49275095,
+            "login": "ursabot",
+            "node_id": "MDQ6VXNlcjQ5Mjc1MDk1",
+            "organizations_url": "https://api.github.com/users/ursabot/orgs",
+            "received_events_url": "https://api.github.com/users/ursabot/received_events",
+            "repos_url": "https://api.github.com/users/ursabot/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/ursabot/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/ursabot/subscriptions",
+            "type": "User",
+            "url": "https://api.github.com/users/ursabot"
+        }
+    },
+    "issue": {
+        "assignee": null,
+        "assignees": [],
+        "author_association": "MEMBER",
+        "body": "",
+        "closed_at": null,
+        "comments": 2,
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments",
+        "created_at": "2019-04-05T11:22:15Z",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/events",
+        "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+        "id": 429706959,
+        "labels": [],
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}",
+        "locked": false,
+        "milestone": null,
+        "node_id": "MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy",
+        "number": 26,
+        "pull_request": {
+            "diff_url": "https://github.com/ursa-labs/ursabot/pull/26.diff",
+            "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+            "patch_url": "https://github.com/ursa-labs/ursabot/pull/26.patch",
+            "url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26"
+        },
+        "repository_url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "state": "open",
+        "title": "Unittests for GithubHook",
+        "updated_at": "2019-04-05T11:35:47Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+        "user": {
+            "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+            "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/kszucs/followers",
+            "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/kszucs",
+            "id": 961747,
+            "login": "kszucs",
+            "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+            "organizations_url": "https://api.github.com/users/kszucs/orgs",
+            "received_events_url": "https://api.github.com/users/kszucs/received_events",
+            "repos_url": "https://api.github.com/users/kszucs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+            "type": "User",
+            "url": "https://api.github.com/users/kszucs"
+        }
+    },
+    "organization": {
+        "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+        "description": "Innovation lab for open source data science tools, powered by Apache Arrow",
+        "events_url": "https://api.github.com/orgs/ursa-labs/events",
+        "hooks_url": "https://api.github.com/orgs/ursa-labs/hooks",
+        "id": 46514972,
+        "issues_url": "https://api.github.com/orgs/ursa-labs/issues",
+        "login": "ursa-labs",
+        "members_url": "https://api.github.com/orgs/ursa-labs/members{/member}",
+        "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+        "public_members_url": "https://api.github.com/orgs/ursa-labs/public_members{/member}",
+        "repos_url": "https://api.github.com/orgs/ursa-labs/repos",
+        "url": "https://api.github.com/orgs/ursa-labs"
+    },
+    "repository": {
+        "archive_url": "https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}",
+        "archived": false,
+        "assignees_url": "https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}",
+        "blobs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}",
+        "branches_url": "https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}",
+        "clone_url": "https://github.com/ursa-labs/ursabot.git",
+        "collaborators_url": "https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}",
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/comments{/number}",
+        "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}",
+        "compare_url": "https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}",
+        "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}",
+        "contributors_url": "https://api.github.com/repos/ursa-labs/ursabot/contributors",
+        "created_at": "2019-02-04T15:40:31Z",
+        "default_branch": "master",
+        "deployments_url": "https://api.github.com/repos/ursa-labs/ursabot/deployments",
+        "description": null,
+        "disabled": false,
+        "downloads_url": "https://api.github.com/repos/ursa-labs/ursabot/downloads",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/events",
+        "fork": false,
+        "forks": 0,
+        "forks_count": 0,
+        "forks_url": "https://api.github.com/repos/ursa-labs/ursabot/forks",
+        "full_name": "ursa-labs/ursabot",
+        "git_commits_url": "https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}",
+        "git_refs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}",
+        "git_tags_url": "https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}",
+        "git_url": "git://github.com/ursa-labs/ursabot.git",
+        "has_downloads": true,
+        "has_issues": true,
+        "has_pages": false,
+        "has_projects": true,
+        "has_wiki": true,
+        "homepage": null,
+        "hooks_url": "https://api.github.com/repos/ursa-labs/ursabot/hooks",
+        "html_url": "https://github.com/ursa-labs/ursabot",
+        "id": 169101701,
+        "issue_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}",
+        "issue_events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}",
+        "issues_url": "https://api.github.com/repos/ursa-labs/ursabot/issues{/number}",
+        "keys_url": "https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}",
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/labels{/name}",
+        "language": "Jupyter Notebook",
+        "languages_url": "https://api.github.com/repos/ursa-labs/ursabot/languages",
+        "license": null,
+        "merges_url": "https://api.github.com/repos/ursa-labs/ursabot/merges",
+        "milestones_url": "https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}",
+        "mirror_url": null,
+        "name": "ursabot",
+        "node_id": "MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=",
+        "notifications_url": "https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}",
+        "open_issues": 19,
+        "open_issues_count": 19,
+        "owner": {
+            "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+            "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/ursa-labs/followers",
+            "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/ursa-labs",
+            "id": 46514972,
+            "login": "ursa-labs",
+            "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+            "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+            "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+            "repos_url": "https://api.github.com/users/ursa-labs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+            "type": "Organization",
+            "url": "https://api.github.com/users/ursa-labs"
+        },
+        "private": false,
+        "pulls_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}",
+        "pushed_at": "2019-04-05T11:22:16Z",
+        "releases_url": "https://api.github.com/repos/ursa-labs/ursabot/releases{/id}",
+        "size": 892,
+        "ssh_url": "git@github.com:ursa-labs/ursabot.git",
+        "stargazers_count": 1,
+        "stargazers_url": "https://api.github.com/repos/ursa-labs/ursabot/stargazers",
+        "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}",
+        "subscribers_url": "https://api.github.com/repos/ursa-labs/ursabot/subscribers",
+        "subscription_url": "https://api.github.com/repos/ursa-labs/ursabot/subscription",
+        "svn_url": "https://github.com/ursa-labs/ursabot",
+        "tags_url": "https://api.github.com/repos/ursa-labs/ursabot/tags",
+        "teams_url": "https://api.github.com/repos/ursa-labs/ursabot/teams",
+        "trees_url": "https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}",
+        "updated_at": "2019-04-04T17:49:10Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "watchers": 1,
+        "watchers_count": 1
+    },
+    "sender": {
+        "avatar_url": "https://avatars2.githubusercontent.com/u/49275095?v=4",
+        "events_url": "https://api.github.com/users/ursabot/events{/privacy}",
+        "followers_url": "https://api.github.com/users/ursabot/followers",
+        "following_url": "https://api.github.com/users/ursabot/following{/other_user}",
+        "gists_url": "https://api.github.com/users/ursabot/gists{/gist_id}",
+        "gravatar_id": "",
+        "html_url": "https://github.com/ursabot",
+        "id": 49275095,
+        "login": "ursabot",
+        "node_id": "MDQ6VXNlcjQ5Mjc1MDk1",
+        "organizations_url": "https://api.github.com/users/ursabot/orgs",
+        "received_events_url": "https://api.github.com/users/ursabot/received_events",
+        "repos_url": "https://api.github.com/users/ursabot/repos",
+        "site_admin": false,
+        "starred_url": "https://api.github.com/users/ursabot/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/ursabot/subscriptions",
+        "type": "User",
+        "url": "https://api.github.com/users/ursabot"
+    }
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-not-mentioning-ursabot.json b/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-not-mentioning-ursabot.json
new file mode 100644
index 000000000..a3d450078
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-not-mentioning-ursabot.json
@@ -0,0 +1,212 @@
+{
+    "action": "created",
+    "comment": {
+        "author_association": "MEMBER",
+        "body": "bear is no game",
+        "created_at": "2019-04-05T11:26:56Z",
+        "html_url": "https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480241727",
+        "id": 480241727,
+        "issue_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+        "node_id": "MDEyOklzc3VlQ29tbWVudDQ4MDI0MTcyNw==",
+        "updated_at": "2019-04-05T11:26:56Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480241727",
+        "user": {
+            "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+            "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/kszucs/followers",
+            "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/kszucs",
+            "id": 961747,
+            "login": "kszucs",
+            "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+            "organizations_url": "https://api.github.com/users/kszucs/orgs",
+            "received_events_url": "https://api.github.com/users/kszucs/received_events",
+            "repos_url": "https://api.github.com/users/kszucs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+            "type": "User",
+            "url": "https://api.github.com/users/kszucs"
+        }
+    },
+    "issue": {
+        "assignee": null,
+        "assignees": [],
+        "author_association": "MEMBER",
+        "body": "",
+        "closed_at": null,
+        "comments": 0,
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments",
+        "created_at": "2019-04-05T11:22:15Z",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/events",
+        "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+        "id": 429706959,
+        "labels": [],
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}",
+        "locked": false,
+        "milestone": null,
+        "node_id": "MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy",
+        "number": 26,
+        "pull_request": {
+            "diff_url": "https://github.com/ursa-labs/ursabot/pull/26.diff",
+            "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+            "patch_url": "https://github.com/ursa-labs/ursabot/pull/26.patch",
+            "url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26"
+        },
+        "repository_url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "state": "open",
+        "title": "Unittests for GithubHook",
+        "updated_at": "2019-04-05T11:26:56Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+        "user": {
+            "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+            "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/kszucs/followers",
+            "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/kszucs",
+            "id": 961747,
+            "login": "kszucs",
+            "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+            "organizations_url": "https://api.github.com/users/kszucs/orgs",
+            "received_events_url": "https://api.github.com/users/kszucs/received_events",
+            "repos_url": "https://api.github.com/users/kszucs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+            "type": "User",
+            "url": "https://api.github.com/users/kszucs"
+        }
+    },
+    "organization": {
+        "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+        "description": "Innovation lab for open source data science tools, powered by Apache Arrow",
+        "events_url": "https://api.github.com/orgs/ursa-labs/events",
+        "hooks_url": "https://api.github.com/orgs/ursa-labs/hooks",
+        "id": 46514972,
+        "issues_url": "https://api.github.com/orgs/ursa-labs/issues",
+        "login": "ursa-labs",
+        "members_url": "https://api.github.com/orgs/ursa-labs/members{/member}",
+        "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+        "public_members_url": "https://api.github.com/orgs/ursa-labs/public_members{/member}",
+        "repos_url": "https://api.github.com/orgs/ursa-labs/repos",
+        "url": "https://api.github.com/orgs/ursa-labs"
+    },
+    "repository": {
+        "archive_url": "https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}",
+        "archived": false,
+        "assignees_url": "https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}",
+        "blobs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}",
+        "branches_url": "https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}",
+        "clone_url": "https://github.com/ursa-labs/ursabot.git",
+        "collaborators_url": "https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}",
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/comments{/number}",
+        "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}",
+        "compare_url": "https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}",
+        "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}",
+        "contributors_url": "https://api.github.com/repos/ursa-labs/ursabot/contributors",
+        "created_at": "2019-02-04T15:40:31Z",
+        "default_branch": "master",
+        "deployments_url": "https://api.github.com/repos/ursa-labs/ursabot/deployments",
+        "description": null,
+        "disabled": false,
+        "downloads_url": "https://api.github.com/repos/ursa-labs/ursabot/downloads",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/events",
+        "fork": false,
+        "forks": 0,
+        "forks_count": 0,
+        "forks_url": "https://api.github.com/repos/ursa-labs/ursabot/forks",
+        "full_name": "ursa-labs/ursabot",
+        "git_commits_url": "https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}",
+        "git_refs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}",
+        "git_tags_url": "https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}",
+        "git_url": "git://github.com/ursa-labs/ursabot.git",
+        "has_downloads": true,
+        "has_issues": true,
+        "has_pages": false,
+        "has_projects": true,
+        "has_wiki": true,
+        "homepage": null,
+        "hooks_url": "https://api.github.com/repos/ursa-labs/ursabot/hooks",
+        "html_url": "https://github.com/ursa-labs/ursabot",
+        "id": 169101701,
+        "issue_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}",
+        "issue_events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}",
+        "issues_url": "https://api.github.com/repos/ursa-labs/ursabot/issues{/number}",
+        "keys_url": "https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}",
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/labels{/name}",
+        "language": "Jupyter Notebook",
+        "languages_url": "https://api.github.com/repos/ursa-labs/ursabot/languages",
+        "license": null,
+        "merges_url": "https://api.github.com/repos/ursa-labs/ursabot/merges",
+        "milestones_url": "https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}",
+        "mirror_url": null,
+        "name": "ursabot",
+        "node_id": "MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=",
+        "notifications_url": "https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}",
+        "open_issues": 19,
+        "open_issues_count": 19,
+        "owner": {
+            "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+            "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/ursa-labs/followers",
+            "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/ursa-labs",
+            "id": 46514972,
+            "login": "ursa-labs",
+            "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+            "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+            "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+            "repos_url": "https://api.github.com/users/ursa-labs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+            "type": "Organization",
+            "url": "https://api.github.com/users/ursa-labs"
+        },
+        "private": false,
+        "pulls_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}",
+        "pushed_at": "2019-04-05T11:22:16Z",
+        "releases_url": "https://api.github.com/repos/ursa-labs/ursabot/releases{/id}",
+        "size": 892,
+        "ssh_url": "git@github.com:ursa-labs/ursabot.git",
+        "stargazers_count": 1,
+        "stargazers_url": "https://api.github.com/repos/ursa-labs/ursabot/stargazers",
+        "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}",
+        "subscribers_url": "https://api.github.com/repos/ursa-labs/ursabot/subscribers",
+        "subscription_url": "https://api.github.com/repos/ursa-labs/ursabot/subscription",
+        "svn_url": "https://github.com/ursa-labs/ursabot",
+        "tags_url": "https://api.github.com/repos/ursa-labs/ursabot/tags",
+        "teams_url": "https://api.github.com/repos/ursa-labs/ursabot/teams",
+        "trees_url": "https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}",
+        "updated_at": "2019-04-04T17:49:10Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "watchers": 1,
+        "watchers_count": 1
+    },
+    "sender": {
+        "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+        "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+        "followers_url": "https://api.github.com/users/kszucs/followers",
+        "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+        "gravatar_id": "",
+        "html_url": "https://github.com/kszucs",
+        "id": 961747,
+        "login": "kszucs",
+        "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+        "organizations_url": "https://api.github.com/users/kszucs/orgs",
+        "received_events_url": "https://api.github.com/users/kszucs/received_events",
+        "repos_url": "https://api.github.com/users/kszucs/repos",
+        "site_admin": false,
+        "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+        "type": "User",
+        "url": "https://api.github.com/users/kszucs"
+    }
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-with-empty-command.json b/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-with-empty-command.json
new file mode 100644
index 000000000..c88197c8e
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-with-empty-command.json
@@ -0,0 +1,217 @@
+{
+    "action": "created",
+    "comment": {
+        "author_association": "MEMBER",
+        "body": "@ursabot ",
+        "body_html": "",
+        "body_text": "",
+        "created_at": "2019-04-05T11:35:46Z",
+        "html_url": "https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480243811",
+        "id": 480243811,
+        "issue_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+        "node_id": "MDEyOklzc3VlQ29tbWVudDQ4MDI0MzgxMQ==",
+        "updated_at": "2019-04-05T11:35:46Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480243811",
+        "user": {
+            "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+            "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/kszucs/followers",
+            "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/kszucs",
+            "id": 961747,
+            "login": "kszucs",
+            "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+            "organizations_url": "https://api.github.com/users/kszucs/orgs",
+            "received_events_url": "https://api.github.com/users/kszucs/received_events",
+            "repos_url": "https://api.github.com/users/kszucs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+            "type": "User",
+            "url": "https://api.github.com/users/kszucs"
+        }
+    },
+    "issue": {
+        "assignee": null,
+        "assignees": [],
+        "author_association": "MEMBER",
+        "body": "",
+        "body_html": "",
+        "body_text": "",
+        "closed_at": null,
+        "closed_by": null,
+        "comments": 1,
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments",
+        "created_at": "2019-04-05T11:22:15Z",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/events",
+        "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+        "id": 429706959,
+        "labels": [],
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}",
+        "locked": false,
+        "milestone": null,
+        "node_id": "MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy",
+        "number": 26,
+        "pull_request": {
+            "diff_url": "https://github.com/ursa-labs/ursabot/pull/26.diff",
+            "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+            "patch_url": "https://github.com/ursa-labs/ursabot/pull/26.patch",
+            "url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26"
+        },
+        "repository_url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "state": "open",
+        "title": "Unittests for GithubHook",
+        "updated_at": "2019-04-05T11:35:46Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+        "user": {
+            "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+            "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/kszucs/followers",
+            "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/kszucs",
+            "id": 961747,
+            "login": "kszucs",
+            "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+            "organizations_url": "https://api.github.com/users/kszucs/orgs",
+            "received_events_url": "https://api.github.com/users/kszucs/received_events",
+            "repos_url": "https://api.github.com/users/kszucs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+            "type": "User",
+            "url": "https://api.github.com/users/kszucs"
+        }
+    },
+    "organization": {
+        "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+        "description": "Innovation lab for open source data science tools, powered by Apache Arrow",
+        "events_url": "https://api.github.com/orgs/ursa-labs/events",
+        "hooks_url": "https://api.github.com/orgs/ursa-labs/hooks",
+        "id": 46514972,
+        "issues_url": "https://api.github.com/orgs/ursa-labs/issues",
+        "login": "ursa-labs",
+        "members_url": "https://api.github.com/orgs/ursa-labs/members{/member}",
+        "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+        "public_members_url": "https://api.github.com/orgs/ursa-labs/public_members{/member}",
+        "repos_url": "https://api.github.com/orgs/ursa-labs/repos",
+        "url": "https://api.github.com/orgs/ursa-labs"
+    },
+    "repository": {
+        "archive_url": "https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}",
+        "archived": false,
+        "assignees_url": "https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}",
+        "blobs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}",
+        "branches_url": "https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}",
+        "clone_url": "https://github.com/ursa-labs/ursabot.git",
+        "collaborators_url": "https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}",
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/comments{/number}",
+        "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}",
+        "compare_url": "https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}",
+        "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}",
+        "contributors_url": "https://api.github.com/repos/ursa-labs/ursabot/contributors",
+        "created_at": "2019-02-04T15:40:31Z",
+        "default_branch": "master",
+        "deployments_url": "https://api.github.com/repos/ursa-labs/ursabot/deployments",
+        "description": null,
+        "disabled": false,
+        "downloads_url": "https://api.github.com/repos/ursa-labs/ursabot/downloads",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/events",
+        "fork": false,
+        "forks": 0,
+        "forks_count": 0,
+        "forks_url": "https://api.github.com/repos/ursa-labs/ursabot/forks",
+        "full_name": "ursa-labs/ursabot",
+        "git_commits_url": "https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}",
+        "git_refs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}",
+        "git_tags_url": "https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}",
+        "git_url": "git://github.com/ursa-labs/ursabot.git",
+        "has_downloads": true,
+        "has_issues": true,
+        "has_pages": false,
+        "has_projects": true,
+        "has_wiki": true,
+        "homepage": null,
+        "hooks_url": "https://api.github.com/repos/ursa-labs/ursabot/hooks",
+        "html_url": "https://github.com/ursa-labs/ursabot",
+        "id": 169101701,
+        "issue_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}",
+        "issue_events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}",
+        "issues_url": "https://api.github.com/repos/ursa-labs/ursabot/issues{/number}",
+        "keys_url": "https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}",
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/labels{/name}",
+        "language": "Jupyter Notebook",
+        "languages_url": "https://api.github.com/repos/ursa-labs/ursabot/languages",
+        "license": null,
+        "merges_url": "https://api.github.com/repos/ursa-labs/ursabot/merges",
+        "milestones_url": "https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}",
+        "mirror_url": null,
+        "name": "ursabot",
+        "node_id": "MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=",
+        "notifications_url": "https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}",
+        "open_issues": 19,
+        "open_issues_count": 19,
+        "owner": {
+            "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+            "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/ursa-labs/followers",
+            "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/ursa-labs",
+            "id": 46514972,
+            "login": "ursa-labs",
+            "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+            "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+            "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+            "repos_url": "https://api.github.com/users/ursa-labs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+            "type": "Organization",
+            "url": "https://api.github.com/users/ursa-labs"
+        },
+        "private": false,
+        "pulls_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}",
+        "pushed_at": "2019-04-05T11:22:16Z",
+        "releases_url": "https://api.github.com/repos/ursa-labs/ursabot/releases{/id}",
+        "size": 892,
+        "ssh_url": "git@github.com:ursa-labs/ursabot.git",
+        "stargazers_count": 1,
+        "stargazers_url": "https://api.github.com/repos/ursa-labs/ursabot/stargazers",
+        "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}",
+        "subscribers_url": "https://api.github.com/repos/ursa-labs/ursabot/subscribers",
+        "subscription_url": "https://api.github.com/repos/ursa-labs/ursabot/subscription",
+        "svn_url": "https://github.com/ursa-labs/ursabot",
+        "tags_url": "https://api.github.com/repos/ursa-labs/ursabot/tags",
+        "teams_url": "https://api.github.com/repos/ursa-labs/ursabot/teams",
+        "trees_url": "https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}",
+        "updated_at": "2019-04-04T17:49:10Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "watchers": 1,
+        "watchers_count": 1
+    },
+    "sender": {
+        "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+        "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+        "followers_url": "https://api.github.com/users/kszucs/followers",
+        "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+        "gravatar_id": "",
+        "html_url": "https://github.com/kszucs",
+        "id": 961747,
+        "login": "kszucs",
+        "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+        "organizations_url": "https://api.github.com/users/kszucs/orgs",
+        "received_events_url": "https://api.github.com/users/kszucs/received_events",
+        "repos_url": "https://api.github.com/users/kszucs/repos",
+        "site_admin": false,
+        "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+        "type": "User",
+        "url": "https://api.github.com/users/kszucs"
+    }
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-without-pull-request.json b/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-without-pull-request.json
new file mode 100644
index 000000000..9e362fc0e
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-without-pull-request.json
@@ -0,0 +1,206 @@
+{
+    "action": "created",
+    "comment": {
+        "author_association": "MEMBER",
+        "body": "@ursabot build",
+        "created_at": "2019-04-05T13:07:57Z",
+        "html_url": "https://github.com/ursa-labs/ursabot/issues/19#issuecomment-480268708",
+        "id": 480268708,
+        "issue_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/19",
+        "node_id": "MDEyOklzc3VlQ29tbWVudDQ4MDI2ODcwOA==",
+        "updated_at": "2019-04-05T13:07:57Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480268708",
+        "user": {
+            "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+            "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/kszucs/followers",
+            "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/kszucs",
+            "id": 961747,
+            "login": "kszucs",
+            "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+            "organizations_url": "https://api.github.com/users/kszucs/orgs",
+            "received_events_url": "https://api.github.com/users/kszucs/received_events",
+            "repos_url": "https://api.github.com/users/kszucs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+            "type": "User",
+            "url": "https://api.github.com/users/kszucs"
+        }
+    },
+    "issue": {
+        "assignee": null,
+        "assignees": [],
+        "author_association": "MEMBER",
+        "body": "",
+        "closed_at": null,
+        "comments": 5,
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/19/comments",
+        "created_at": "2019-04-02T09:56:41Z",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/19/events",
+        "html_url": "https://github.com/ursa-labs/ursabot/issues/19",
+        "id": 428131685,
+        "labels": [],
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/19/labels{/name}",
+        "locked": false,
+        "milestone": null,
+        "node_id": "MDU6SXNzdWU0MjgxMzE2ODU=",
+        "number": 19,
+        "repository_url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "state": "open",
+        "title": "Build ursabot itself via ursabot",
+        "updated_at": "2019-04-05T13:07:57Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/19",
+        "user": {
+            "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+            "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/kszucs/followers",
+            "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/kszucs",
+            "id": 961747,
+            "login": "kszucs",
+            "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+            "organizations_url": "https://api.github.com/users/kszucs/orgs",
+            "received_events_url": "https://api.github.com/users/kszucs/received_events",
+            "repos_url": "https://api.github.com/users/kszucs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+            "type": "User",
+            "url": "https://api.github.com/users/kszucs"
+        }
+    },
+    "organization": {
+        "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+        "description": "Innovation lab for open source data science tools, powered by Apache Arrow",
+        "events_url": "https://api.github.com/orgs/ursa-labs/events",
+        "hooks_url": "https://api.github.com/orgs/ursa-labs/hooks",
+        "id": 46514972,
+        "issues_url": "https://api.github.com/orgs/ursa-labs/issues",
+        "login": "ursa-labs",
+        "members_url": "https://api.github.com/orgs/ursa-labs/members{/member}",
+        "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+        "public_members_url": "https://api.github.com/orgs/ursa-labs/public_members{/member}",
+        "repos_url": "https://api.github.com/orgs/ursa-labs/repos",
+        "url": "https://api.github.com/orgs/ursa-labs"
+    },
+    "repository": {
+        "archive_url": "https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}",
+        "archived": false,
+        "assignees_url": "https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}",
+        "blobs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}",
+        "branches_url": "https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}",
+        "clone_url": "https://github.com/ursa-labs/ursabot.git",
+        "collaborators_url": "https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}",
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/comments{/number}",
+        "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}",
+        "compare_url": "https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}",
+        "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}",
+        "contributors_url": "https://api.github.com/repos/ursa-labs/ursabot/contributors",
+        "created_at": "2019-02-04T15:40:31Z",
+        "default_branch": "master",
+        "deployments_url": "https://api.github.com/repos/ursa-labs/ursabot/deployments",
+        "description": null,
+        "disabled": false,
+        "downloads_url": "https://api.github.com/repos/ursa-labs/ursabot/downloads",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/events",
+        "fork": false,
+        "forks": 0,
+        "forks_count": 0,
+        "forks_url": "https://api.github.com/repos/ursa-labs/ursabot/forks",
+        "full_name": "ursa-labs/ursabot",
+        "git_commits_url": "https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}",
+        "git_refs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}",
+        "git_tags_url": "https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}",
+        "git_url": "git://github.com/ursa-labs/ursabot.git",
+        "has_downloads": true,
+        "has_issues": true,
+        "has_pages": false,
+        "has_projects": true,
+        "has_wiki": true,
+        "homepage": null,
+        "hooks_url": "https://api.github.com/repos/ursa-labs/ursabot/hooks",
+        "html_url": "https://github.com/ursa-labs/ursabot",
+        "id": 169101701,
+        "issue_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}",
+        "issue_events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}",
+        "issues_url": "https://api.github.com/repos/ursa-labs/ursabot/issues{/number}",
+        "keys_url": "https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}",
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/labels{/name}",
+        "language": "Jupyter Notebook",
+        "languages_url": "https://api.github.com/repos/ursa-labs/ursabot/languages",
+        "license": null,
+        "merges_url": "https://api.github.com/repos/ursa-labs/ursabot/merges",
+        "milestones_url": "https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}",
+        "mirror_url": null,
+        "name": "ursabot",
+        "node_id": "MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=",
+        "notifications_url": "https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}",
+        "open_issues": 19,
+        "open_issues_count": 19,
+        "owner": {
+            "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+            "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/ursa-labs/followers",
+            "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/ursa-labs",
+            "id": 46514972,
+            "login": "ursa-labs",
+            "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+            "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+            "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+            "repos_url": "https://api.github.com/users/ursa-labs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+            "type": "Organization",
+            "url": "https://api.github.com/users/ursa-labs"
+        },
+        "private": false,
+        "pulls_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}",
+        "pushed_at": "2019-04-05T12:01:40Z",
+        "releases_url": "https://api.github.com/repos/ursa-labs/ursabot/releases{/id}",
+        "size": 898,
+        "ssh_url": "git@github.com:ursa-labs/ursabot.git",
+        "stargazers_count": 1,
+        "stargazers_url": "https://api.github.com/repos/ursa-labs/ursabot/stargazers",
+        "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}",
+        "subscribers_url": "https://api.github.com/repos/ursa-labs/ursabot/subscribers",
+        "subscription_url": "https://api.github.com/repos/ursa-labs/ursabot/subscription",
+        "svn_url": "https://github.com/ursa-labs/ursabot",
+        "tags_url": "https://api.github.com/repos/ursa-labs/ursabot/tags",
+        "teams_url": "https://api.github.com/repos/ursa-labs/ursabot/teams",
+        "trees_url": "https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}",
+        "updated_at": "2019-04-04T17:49:10Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "watchers": 1,
+        "watchers_count": 1
+    },
+    "sender": {
+        "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+        "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+        "followers_url": "https://api.github.com/users/kszucs/followers",
+        "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+        "gravatar_id": "",
+        "html_url": "https://github.com/kszucs",
+        "id": 961747,
+        "login": "kszucs",
+        "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+        "organizations_url": "https://api.github.com/users/kszucs/orgs",
+        "received_events_url": "https://api.github.com/users/kszucs/received_events",
+        "repos_url": "https://api.github.com/users/kszucs/repos",
+        "site_admin": false,
+        "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+        "type": "User",
+        "url": "https://api.github.com/users/kszucs"
+    }
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/event-pull-request-opened.json b/src/arrow/dev/archery/archery/tests/fixtures/event-pull-request-opened.json
new file mode 100644
index 000000000..9cf5c0dda
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/event-pull-request-opened.json
@@ -0,0 +1,445 @@
+{
+  "action": "opened",
+  "number": 26,
+  "pull_request": {
+    "url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26",
+    "id": 267785552,
+    "node_id": "MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy",
+    "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+    "diff_url": "https://github.com/ursa-labs/ursabot/pull/26.diff",
+    "patch_url": "https://github.com/ursa-labs/ursabot/pull/26.patch",
+    "issue_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+    "number": 26,
+    "state": "open",
+    "locked": false,
+    "title": "Unittests for GithubHook",
+    "user": {
+      "login": "kszucs",
+      "id": 961747,
+      "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+      "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+      "gravatar_id": "",
+      "url": "https://api.github.com/users/kszucs",
+      "html_url": "https://github.com/kszucs",
+      "followers_url": "https://api.github.com/users/kszucs/followers",
+      "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+      "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+      "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+      "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+      "organizations_url": "https://api.github.com/users/kszucs/orgs",
+      "repos_url": "https://api.github.com/users/kszucs/repos",
+      "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+      "received_events_url": "https://api.github.com/users/kszucs/received_events",
+      "type": "User",
+      "site_admin": false
+    },
+    "body": "",
+    "created_at": "2019-04-05T11:22:15Z",
+    "updated_at": "2019-04-05T12:01:40Z",
+    "closed_at": null,
+    "merged_at": null,
+    "merge_commit_sha": "cc5dc3606988b3824be54df779ed2028776113cb",
+    "assignee": null,
+    "assignees": [],
+    "requested_reviewers": [],
+    "requested_teams": [],
+    "labels": [],
+    "milestone": null,
+    "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26/commits",
+    "review_comments_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26/comments",
+    "review_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/comments{/number}",
+    "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments",
+    "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/2705da2b616b98fa6010a25813c5a7a27456f71d",
+    "head": {
+      "label": "ursa-labs:test-hook",
+      "ref": "test-hook",
+      "sha": "2705da2b616b98fa6010a25813c5a7a27456f71d",
+      "user": {
+        "login": "ursa-labs",
+        "id": 46514972,
+        "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+        "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+        "gravatar_id": "",
+        "url": "https://api.github.com/users/ursa-labs",
+        "html_url": "https://github.com/ursa-labs",
+        "followers_url": "https://api.github.com/users/ursa-labs/followers",
+        "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+        "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+        "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+        "repos_url": "https://api.github.com/users/ursa-labs/repos",
+        "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+        "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+        "type": "Organization",
+        "site_admin": false
+      },
+      "repo": {
+        "id": 169101701,
+        "node_id": "MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=",
+        "name": "ursabot",
+        "full_name": "ursa-labs/ursabot",
+        "private": false,
+        "owner": {
+          "login": "ursa-labs",
+          "id": 46514972,
+          "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+          "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+          "gravatar_id": "",
+          "url": "https://api.github.com/users/ursa-labs",
+          "html_url": "https://github.com/ursa-labs",
+          "followers_url": "https://api.github.com/users/ursa-labs/followers",
+          "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+          "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+          "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+          "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+          "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+          "repos_url": "https://api.github.com/users/ursa-labs/repos",
+          "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+          "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+          "type": "Organization",
+          "site_admin": false
+        },
+        "html_url": "https://github.com/ursa-labs/ursabot",
+        "description": null,
+        "fork": false,
+        "url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "forks_url": "https://api.github.com/repos/ursa-labs/ursabot/forks",
+        "keys_url": "https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}",
+        "collaborators_url": "https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}",
+        "teams_url": "https://api.github.com/repos/ursa-labs/ursabot/teams",
+        "hooks_url": "https://api.github.com/repos/ursa-labs/ursabot/hooks",
+        "issue_events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/events",
+        "assignees_url": "https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}",
+        "branches_url": "https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}",
+        "tags_url": "https://api.github.com/repos/ursa-labs/ursabot/tags",
+        "blobs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}",
+        "git_tags_url": "https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}",
+        "git_refs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}",
+        "trees_url": "https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}",
+        "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}",
+        "languages_url": "https://api.github.com/repos/ursa-labs/ursabot/languages",
+        "stargazers_url": "https://api.github.com/repos/ursa-labs/ursabot/stargazers",
+        "contributors_url": "https://api.github.com/repos/ursa-labs/ursabot/contributors",
+        "subscribers_url": "https://api.github.com/repos/ursa-labs/ursabot/subscribers",
+        "subscription_url": "https://api.github.com/repos/ursa-labs/ursabot/subscription",
+        "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}",
+        "git_commits_url": "https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}",
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/comments{/number}",
+        "issue_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}",
+        "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}",
+        "compare_url": "https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}",
+        "merges_url": "https://api.github.com/repos/ursa-labs/ursabot/merges",
+        "archive_url": "https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}",
+        "downloads_url": "https://api.github.com/repos/ursa-labs/ursabot/downloads",
+        "issues_url": "https://api.github.com/repos/ursa-labs/ursabot/issues{/number}",
+        "pulls_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}",
+        "milestones_url": "https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}",
+        "notifications_url": "https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}",
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/labels{/name}",
+        "releases_url": "https://api.github.com/repos/ursa-labs/ursabot/releases{/id}",
+        "deployments_url": "https://api.github.com/repos/ursa-labs/ursabot/deployments",
+        "created_at": "2019-02-04T15:40:31Z",
+        "updated_at": "2019-04-04T17:49:10Z",
+        "pushed_at": "2019-04-05T12:01:40Z",
+        "git_url": "git://github.com/ursa-labs/ursabot.git",
+        "ssh_url": "git@github.com:ursa-labs/ursabot.git",
+        "clone_url": "https://github.com/ursa-labs/ursabot.git",
+        "svn_url": "https://github.com/ursa-labs/ursabot",
+        "homepage": null,
+        "size": 898,
+        "stargazers_count": 1,
+        "watchers_count": 1,
+        "language": "Jupyter Notebook",
+        "has_issues": true,
+        "has_projects": true,
+        "has_downloads": true,
+        "has_wiki": true,
+        "has_pages": false,
+        "forks_count": 0,
+        "mirror_url": null,
+        "archived": false,
+        "disabled": false,
+        "open_issues_count": 19,
+        "license": null,
+        "forks": 0,
+        "open_issues": 19,
+        "watchers": 1,
+        "default_branch": "master"
+      }
+    },
+    "base": {
+      "label": "ursa-labs:master",
+      "ref": "master",
+      "sha": "a162ad254b589b924db47e057791191b39613fd5",
+      "user": {
+        "login": "ursa-labs",
+        "id": 46514972,
+        "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+        "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+        "gravatar_id": "",
+        "url": "https://api.github.com/users/ursa-labs",
+        "html_url": "https://github.com/ursa-labs",
+        "followers_url": "https://api.github.com/users/ursa-labs/followers",
+        "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+        "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+        "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+        "repos_url": "https://api.github.com/users/ursa-labs/repos",
+        "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+        "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+        "type": "Organization",
+        "site_admin": false
+      },
+      "repo": {
+        "id": 169101701,
+        "node_id": "MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=",
+        "name": "ursabot",
+        "full_name": "ursa-labs/ursabot",
+        "private": false,
+        "owner": {
+          "login": "ursa-labs",
+          "id": 46514972,
+          "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+          "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+          "gravatar_id": "",
+          "url": "https://api.github.com/users/ursa-labs",
+          "html_url": "https://github.com/ursa-labs",
+          "followers_url": "https://api.github.com/users/ursa-labs/followers",
+          "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+          "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+          "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+          "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+          "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+          "repos_url": "https://api.github.com/users/ursa-labs/repos",
+          "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+          "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+          "type": "Organization",
+          "site_admin": false
+        },
+        "html_url": "https://github.com/ursa-labs/ursabot",
+        "description": null,
+        "fork": false,
+        "url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "forks_url": "https://api.github.com/repos/ursa-labs/ursabot/forks",
+        "keys_url": "https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}",
+        "collaborators_url": "https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}",
+        "teams_url": "https://api.github.com/repos/ursa-labs/ursabot/teams",
+        "hooks_url": "https://api.github.com/repos/ursa-labs/ursabot/hooks",
+        "issue_events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/events",
+        "assignees_url": "https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}",
+        "branches_url": "https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}",
+        "tags_url": "https://api.github.com/repos/ursa-labs/ursabot/tags",
+        "blobs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}",
+        "git_tags_url": "https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}",
+        "git_refs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}",
+        "trees_url": "https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}",
+        "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}",
+        "languages_url": "https://api.github.com/repos/ursa-labs/ursabot/languages",
+        "stargazers_url": "https://api.github.com/repos/ursa-labs/ursabot/stargazers",
+        "contributors_url": "https://api.github.com/repos/ursa-labs/ursabot/contributors",
+        "subscribers_url": "https://api.github.com/repos/ursa-labs/ursabot/subscribers",
+        "subscription_url": "https://api.github.com/repos/ursa-labs/ursabot/subscription",
+        "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}",
+        "git_commits_url": "https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}",
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/comments{/number}",
+        "issue_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}",
+        "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}",
+        "compare_url": "https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}",
+        "merges_url": "https://api.github.com/repos/ursa-labs/ursabot/merges",
+        "archive_url": "https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}",
+        "downloads_url": "https://api.github.com/repos/ursa-labs/ursabot/downloads",
+        "issues_url": "https://api.github.com/repos/ursa-labs/ursabot/issues{/number}",
+        "pulls_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}",
+        "milestones_url": "https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}",
+        "notifications_url": "https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}",
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/labels{/name}",
+        "releases_url": "https://api.github.com/repos/ursa-labs/ursabot/releases{/id}",
+        "deployments_url": "https://api.github.com/repos/ursa-labs/ursabot/deployments",
+        "created_at": "2019-02-04T15:40:31Z",
+        "updated_at": "2019-04-04T17:49:10Z",
+        "pushed_at": "2019-04-05T12:01:40Z",
+        "git_url": "git://github.com/ursa-labs/ursabot.git",
+        "ssh_url": "git@github.com:ursa-labs/ursabot.git",
+        "clone_url": "https://github.com/ursa-labs/ursabot.git",
+        "svn_url": "https://github.com/ursa-labs/ursabot",
+        "homepage": null,
+        "size": 898,
+        "stargazers_count": 1,
+        "watchers_count": 1,
+        "language": "Jupyter Notebook",
+        "has_issues": true,
+        "has_projects": true,
+        "has_downloads": true,
+        "has_wiki": true,
+        "has_pages": false,
+        "forks_count": 0,
+        "mirror_url": null,
+        "archived": false,
+        "disabled": false,
+        "open_issues_count": 19,
+        "license": null,
+        "forks": 0,
+        "open_issues": 19,
+        "watchers": 1,
+        "default_branch": "master"
+      }
+    },
+    "_links": {
+      "self": {
+        "href": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26"
+      },
+      "html": {
+        "href": "https://github.com/ursa-labs/ursabot/pull/26"
+      },
+      "issue": {
+        "href": "https://api.github.com/repos/ursa-labs/ursabot/issues/26"
+      },
+      "comments": {
+        "href": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments"
+      },
+      "review_comments": {
+        "href": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26/comments"
+      },
+      "review_comment": {
+        "href": "https://api.github.com/repos/ursa-labs/ursabot/pulls/comments{/number}"
+      },
+      "commits": {
+        "href": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26/commits"
+      },
+      "statuses": {
+        "href": "https://api.github.com/repos/ursa-labs/ursabot/statuses/2705da2b616b98fa6010a25813c5a7a27456f71d"
+      }
+    },
+    "author_association": "MEMBER",
+    "merged": false,
+    "mergeable": true,
+    "rebaseable": true,
+    "mergeable_state": "unstable",
+    "merged_by": null,
+    "comments": 5,
+    "review_comments": 0,
+    "maintainer_can_modify": false,
+    "commits": 2,
+    "additions": 1124,
+    "deletions": 0,
+    "changed_files": 7
+  },
+  "repository": {
+    "archive_url": "https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}",
+    "archived": false,
+    "assignees_url": "https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}",
+    "blobs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}",
+    "branches_url": "https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}",
+    "clone_url": "https://github.com/ursa-labs/ursabot.git",
+    "collaborators_url": "https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}",
+    "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/comments{/number}",
+    "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}",
+    "compare_url": "https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}",
+    "contributors_url": "https://api.github.com/repos/ursa-labs/ursabot/contributors",
+    "created_at": "2019-02-04T15:40:31Z",
+    "default_branch": "master",
+    "deployments_url": "https://api.github.com/repos/ursa-labs/ursabot/deployments",
+    "description": null,
+    "disabled": false,
+    "downloads_url": "https://api.github.com/repos/ursa-labs/ursabot/downloads",
+    "events_url": "https://api.github.com/repos/ursa-labs/ursabot/events",
+    "fork": false,
+    "forks": 0,
+    "forks_count": 0,
+    "forks_url": "https://api.github.com/repos/ursa-labs/ursabot/forks",
+    "full_name": "ursa-labs/ursabot",
+    "git_commits_url": "https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}",
+    "git_refs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}",
+    "git_tags_url": "https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}",
+    "git_url": "git://github.com/ursa-labs/ursabot.git",
+    "has_downloads": true,
+    "has_issues": true,
+    "has_pages": false,
+    "has_projects": true,
+    "has_wiki": true,
+    "homepage": null,
+    "hooks_url": "https://api.github.com/repos/ursa-labs/ursabot/hooks",
+    "html_url": "https://github.com/ursa-labs/ursabot",
+    "id": 169101701,
+    "issue_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}",
+    "issue_events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}",
+    "issues_url": "https://api.github.com/repos/ursa-labs/ursabot/issues{/number}",
+    "keys_url": "https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}",
+    "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/labels{/name}",
+    "language": "Jupyter Notebook",
+    "languages_url": "https://api.github.com/repos/ursa-labs/ursabot/languages",
+    "license": null,
+    "merges_url": "https://api.github.com/repos/ursa-labs/ursabot/merges",
+    "milestones_url": "https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}",
+    "mirror_url": null,
+    "name": "ursabot",
+    "node_id": "MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=",
+    "notifications_url": "https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}",
+    "open_issues": 19,
+    "open_issues_count": 19,
+    "owner": {
+      "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+      "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+      "followers_url": "https://api.github.com/users/ursa-labs/followers",
+      "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+      "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+      "gravatar_id": "",
+      "html_url": "https://github.com/ursa-labs",
+      "id": 46514972,
+      "login": "ursa-labs",
+      "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+      "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+      "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+      "repos_url": "https://api.github.com/users/ursa-labs/repos",
+      "site_admin": false,
+      "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+      "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+      "type": "Organization",
+      "url": "https://api.github.com/users/ursa-labs"
+    },
+    "private": false,
+    "pulls_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}",
+    "pushed_at": "2019-04-05T11:22:16Z",
+    "releases_url": "https://api.github.com/repos/ursa-labs/ursabot/releases{/id}",
+    "size": 892,
+    "ssh_url": "git@github.com:ursa-labs/ursabot.git",
+    "stargazers_count": 1,
+    "stargazers_url": "https://api.github.com/repos/ursa-labs/ursabot/stargazers",
+    "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}",
+    "subscribers_url": "https://api.github.com/repos/ursa-labs/ursabot/subscribers",
+    "subscription_url": "https://api.github.com/repos/ursa-labs/ursabot/subscription",
+    "svn_url": "https://github.com/ursa-labs/ursabot",
+    "tags_url": "https://api.github.com/repos/ursa-labs/ursabot/tags",
+    "teams_url": "https://api.github.com/repos/ursa-labs/ursabot/teams",
+    "trees_url": "https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}",
+    "updated_at": "2019-04-04T17:49:10Z",
+    "url": "https://api.github.com/repos/ursa-labs/ursabot",
+    "watchers": 1,
+    "watchers_count": 1
+  },
+  "sender": {
+    "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+    "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+    "followers_url": "https://api.github.com/users/kszucs/followers",
+    "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+    "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+    "gravatar_id": "",
+    "html_url": "https://github.com/kszucs",
+    "id": 961747,
+    "login": "kszucs",
+    "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+    "organizations_url": "https://api.github.com/users/kszucs/orgs",
+    "received_events_url": "https://api.github.com/users/kszucs/received_events",
+    "repos_url": "https://api.github.com/users/kszucs/repos",
+    "site_admin": false,
+    "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+    "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+    "type": "User",
+    "url": "https://api.github.com/users/kszucs"
+  }
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/issue-19.json b/src/arrow/dev/archery/archery/tests/fixtures/issue-19.json
new file mode 100644
index 000000000..1e4939776
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/issue-19.json
@@ -0,0 +1,64 @@
+{
+    "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/19",
+    "repository_url": "https://api.github.com/repos/ursa-labs/ursabot",
+    "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/19/labels{/name}",
+    "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/19/comments",
+    "events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/19/events",
+    "html_url": "https://github.com/ursa-labs/ursabot/issues/19",
+    "id": 428131685,
+    "node_id": "MDU6SXNzdWU0MjgxMzE2ODU=",
+    "number": 19,
+    "title": "Build ursabot itself via ursabot",
+    "user": {
+        "login": "kszucs",
+        "id": 961747,
+        "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+        "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+        "gravatar_id": "",
+        "url": "https://api.github.com/users/kszucs",
+        "html_url": "https://github.com/kszucs",
+        "followers_url": "https://api.github.com/users/kszucs/followers",
+        "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+        "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+        "organizations_url": "https://api.github.com/users/kszucs/orgs",
+        "repos_url": "https://api.github.com/users/kszucs/repos",
+        "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+        "received_events_url": "https://api.github.com/users/kszucs/received_events",
+        "type": "User",
+        "site_admin": false
+    },
+    "labels": [],
+    "state": "closed",
+    "locked": false,
+    "assignee": null,
+    "assignees": [],
+    "milestone": null,
+    "comments": 8,
+    "created_at": "2019-04-02T09:56:41Z",
+    "updated_at": "2019-04-05T13:30:49Z",
+    "closed_at": "2019-04-05T13:30:49Z",
+    "author_association": "MEMBER",
+    "body": "",
+    "closed_by": {
+        "login": "kszucs",
+        "id": 961747,
+        "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+        "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+        "gravatar_id": "",
+        "url": "https://api.github.com/users/kszucs",
+        "html_url": "https://github.com/kszucs",
+        "followers_url": "https://api.github.com/users/kszucs/followers",
+        "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+        "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+        "organizations_url": "https://api.github.com/users/kszucs/orgs",
+        "repos_url": "https://api.github.com/users/kszucs/repos",
+        "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+        "received_events_url": "https://api.github.com/users/kszucs/received_events",
+        "type": "User",
+        "site_admin": false
+    }
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/issue-26.json b/src/arrow/dev/archery/archery/tests/fixtures/issue-26.json
new file mode 100644
index 000000000..44c4d3bed
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/issue-26.json
@@ -0,0 +1,70 @@
+{
+    "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+    "repository_url": "https://api.github.com/repos/ursa-labs/ursabot",
+    "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}",
+    "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments",
+    "events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/events",
+    "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+    "id": 429706959,
+    "node_id": "MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy",
+    "number": 26,
+    "title": "Unittests for GithubHook + native asyncio syntax",
+    "user": {
+        "login": "kszucs",
+        "id": 961747,
+        "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+        "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+        "gravatar_id": "",
+        "url": "https://api.github.com/users/kszucs",
+        "html_url": "https://github.com/kszucs",
+        "followers_url": "https://api.github.com/users/kszucs/followers",
+        "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+        "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+        "organizations_url": "https://api.github.com/users/kszucs/orgs",
+        "repos_url": "https://api.github.com/users/kszucs/repos",
+        "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+        "received_events_url": "https://api.github.com/users/kszucs/received_events",
+        "type": "User",
+        "site_admin": false
+    },
+    "labels": [],
+    "state": "closed",
+    "locked": false,
+    "assignee": null,
+    "assignees": [],
+    "milestone": null,
+    "comments": 9,
+    "created_at": "2019-04-05T11:22:15Z",
+    "updated_at": "2019-08-28T00:34:19Z",
+    "closed_at": "2019-04-05T13:54:34Z",
+    "author_association": "MEMBER",
+    "pull_request": {
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26",
+        "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+        "diff_url": "https://github.com/ursa-labs/ursabot/pull/26.diff",
+        "patch_url": "https://github.com/ursa-labs/ursabot/pull/26.patch"
+    },
+    "body": "Resolves:\r\n- #26 Unittests for GithubHook + native asyncio syntax\r\n- #27 Use native async/await keywords instead of @inlineCallbacks and yield\r\n",
+    "closed_by": {
+        "login": "kszucs",
+        "id": 961747,
+        "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+        "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+        "gravatar_id": "",
+        "url": "https://api.github.com/users/kszucs",
+        "html_url": "https://github.com/kszucs",
+        "followers_url": "https://api.github.com/users/kszucs/followers",
+        "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+        "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+        "organizations_url": "https://api.github.com/users/kszucs/orgs",
+        "repos_url": "https://api.github.com/users/kszucs/repos",
+        "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+        "received_events_url": "https://api.github.com/users/kszucs/received_events",
+        "type": "User",
+        "site_admin": false
+    }
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/issue-comment-480243811.json b/src/arrow/dev/archery/archery/tests/fixtures/issue-comment-480243811.json
new file mode 100644
index 000000000..93ee4b13c
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/issue-comment-480243811.json
@@ -0,0 +1,31 @@
+{
+    "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments/479081273",
+    "html_url": "https://github.com/ursa-labs/ursabot/pull/21#issuecomment-479081273",
+    "issue_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/21",
+    "id": 480243811,
+    "node_id": "MDEyOklzc3VlQ29tbWVudDQ3OTA4MTI3Mw==",
+    "user": {
+        "login": "kszucs",
+        "id": 961747,
+        "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+        "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+        "gravatar_id": "",
+        "url": "https://api.github.com/users/kszucs",
+        "html_url": "https://github.com/kszucs",
+        "followers_url": "https://api.github.com/users/kszucs/followers",
+        "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+        "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+        "organizations_url": "https://api.github.com/users/kszucs/orgs",
+        "repos_url": "https://api.github.com/users/kszucs/repos",
+        "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+        "received_events_url": "https://api.github.com/users/kszucs/received_events",
+        "type": "User",
+        "site_admin": false
+    },
+    "created_at": "2019-04-02T16:29:46Z",
+    "updated_at": "2019-04-02T16:29:46Z",
+    "author_association": "MEMBER",
+    "body": "@ursabot"
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/issue-comment-480248726.json b/src/arrow/dev/archery/archery/tests/fixtures/issue-comment-480248726.json
new file mode 100644
index 000000000..f3cd34083
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/issue-comment-480248726.json
@@ -0,0 +1,31 @@
+{
+    "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480248726",
+    "html_url": "https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480248726",
+    "issue_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+    "id": 480248726,
+    "node_id": "MDEyOklzc3VlQ29tbWVudDQ4MDI0ODcyNg==",
+    "user": {
+        "login": "kszucs",
+        "id": 961747,
+        "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+        "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+        "gravatar_id": "",
+        "url": "https://api.github.com/users/kszucs",
+        "html_url": "https://github.com/kszucs",
+        "followers_url": "https://api.github.com/users/kszucs/followers",
+        "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+        "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+        "organizations_url": "https://api.github.com/users/kszucs/orgs",
+        "repos_url": "https://api.github.com/users/kszucs/repos",
+        "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+        "received_events_url": "https://api.github.com/users/kszucs/received_events",
+        "type": "User",
+        "site_admin": false
+    },
+    "created_at": "2019-04-05T11:55:43Z",
+    "updated_at": "2019-04-05T11:55:43Z",
+    "author_association": "MEMBER",
+    "body": "@ursabot build"
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/pull-request-26-commit.json b/src/arrow/dev/archery/archery/tests/fixtures/pull-request-26-commit.json
new file mode 100644
index 000000000..ffc48943a
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/pull-request-26-commit.json
@@ -0,0 +1,158 @@
+{
+  "sha": "2705da2b616b98fa6010a25813c5a7a27456f71d",
+  "node_id": "MDY6Q29tbWl0MTY5MTAxNzAxOjI3MDVkYTJiNjE2Yjk4ZmE2MDEwYTI1ODEzYzVhN2EyNzQ1NmY3MWQ=",
+  "commit": {
+    "author": {
+      "name": "Krisztián Szűcs",
+      "email": "szucs.krisztian@gmail.com",
+      "date": "2019-04-05T12:01:31Z"
+    },
+    "committer": {
+      "name": "Krisztián Szűcs",
+      "email": "szucs.krisztian@gmail.com",
+      "date": "2019-04-05T12:01:31Z"
+    },
+    "message": "add recorded event requests",
+    "tree": {
+      "sha": "16a7bb186833a67e9c2d84a58393503b85500ceb",
+      "url": "https://api.github.com/repos/ursa-labs/ursabot/git/trees/16a7bb186833a67e9c2d84a58393503b85500ceb"
+    },
+    "url": "https://api.github.com/repos/ursa-labs/ursabot/git/commits/2705da2b616b98fa6010a25813c5a7a27456f71d",
+    "comment_count": 0,
+    "verification": {
+      "verified": true,
+      "reason": "valid",
+      "signature": "-----BEGIN PGP SIGNATURE-----\n\niQFOBAABCAA4FiEEOOW2r8dr6sA77zHlgjqBKYe1QKUFAlynQ58aHHN6dWNzLmty\naXN6dGlhbkBnbWFpbC5jb20ACgkQgjqBKYe1QKUYKwf6AiXDMaLqNLNSjRY7lIXX\nudioewz0hSb4bgIXBv30nswu9CoOA0+mHCokEVtZhYbXzXDsZ1KJrilSC4j+Ws4q\nkRGA6iEmrne2HcSKNZXzcVnwV9zpwKxlVh2QCTNb1PuOYFBLH0kwE704uWIWMGDN\nbo8cjQPwegePCRguCvPh/5wa5J3uiq5gmJLG6bC/d1XYE+FJVtlnyzqzLMIryGKe\ntIciw+wwkF413Q/YVbZ49vLUeCX9H8PHC4mZYGDWuvjFW1WTfkjK5bAH+oaTVM6h\n350I5ZFloHmMA/QeRge5qFxXoEBMDGiXHHktzYZDXnliFOQNxzqwirA5lQQ6LRSS\naQ==\n=7rqi\n-----END PGP SIGNATURE-----",
+      "payload": "tree 16a7bb186833a67e9c2d84a58393503b85500ceb\nparent 446ae69b9385e8d0f40aa9595f723d34383af2f7\nauthor Krisztián Szűcs <szucs.krisztian@gmail.com> 1554465691 +0200\ncommitter Krisztián Szűcs <szucs.krisztian@gmail.com> 1554465691 +0200\n\nadd recorded event requests\n"
+    }
+  },
+  "url": "https://api.github.com/repos/ursa-labs/ursabot/commits/2705da2b616b98fa6010a25813c5a7a27456f71d",
+  "html_url": "https://github.com/ursa-labs/ursabot/commit/2705da2b616b98fa6010a25813c5a7a27456f71d",
+  "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/commits/2705da2b616b98fa6010a25813c5a7a27456f71d/comments",
+  "author": {
+    "login": "kszucs",
+    "id": 961747,
+    "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+    "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+    "gravatar_id": "",
+    "url": "https://api.github.com/users/kszucs",
+    "html_url": "https://github.com/kszucs",
+    "followers_url": "https://api.github.com/users/kszucs/followers",
+    "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+    "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+    "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+    "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+    "organizations_url": "https://api.github.com/users/kszucs/orgs",
+    "repos_url": "https://api.github.com/users/kszucs/repos",
+    "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+    "received_events_url": "https://api.github.com/users/kszucs/received_events",
+    "type": "User",
+    "site_admin": false
+  },
+  "committer": {
+    "login": "kszucs",
+    "id": 961747,
+    "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+    "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+    "gravatar_id": "",
+    "url": "https://api.github.com/users/kszucs",
+    "html_url": "https://github.com/kszucs",
+    "followers_url": "https://api.github.com/users/kszucs/followers",
+    "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+    "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+    "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+    "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+    "organizations_url": "https://api.github.com/users/kszucs/orgs",
+    "repos_url": "https://api.github.com/users/kszucs/repos",
+    "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+    "received_events_url": "https://api.github.com/users/kszucs/received_events",
+    "type": "User",
+    "site_admin": false
+  },
+  "parents": [
+    {
+      "sha": "446ae69b9385e8d0f40aa9595f723d34383af2f7",
+      "url": "https://api.github.com/repos/ursa-labs/ursabot/commits/446ae69b9385e8d0f40aa9595f723d34383af2f7",
+      "html_url": "https://github.com/ursa-labs/ursabot/commit/446ae69b9385e8d0f40aa9595f723d34383af2f7"
+    }
+  ],
+  "stats": {
+    "total": 1062,
+    "additions": 1058,
+    "deletions": 4
+  },
+  "files": [
+    {
+      "sha": "dfae6eeaef384ae6180c6302a58b49e39982dc33",
+      "filename": "ursabot/tests/fixtures/issue-comment-build-command.json",
+      "status": "added",
+      "additions": 212,
+      "deletions": 0,
+      "changes": 212,
+      "blob_url": "https://github.com/ursa-labs/ursabot/blob/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-build-command.json",
+      "raw_url": "https://github.com/ursa-labs/ursabot/raw/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-build-command.json",
+      "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-build-command.json?ref=2705da2b616b98fa6010a25813c5a7a27456f71d",
+      "patch": "@@ -0,0 +1,212 @@\n+{\n+    \"action\": \"created\",\n+    \"comment\": {\n+        \"author_association\": \"NONE\",\n+        \"body\": \"I've successfully started builds for this PR\",\n+        \"created_at\": \"2019-04-05T11:55:44Z\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480248730\",\n+        \"id\": 480248730,\n+        \"issue_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"node_id\": \"MDEyOklzc3VlQ29tbWVudDQ4MDI0ODczMA==\",\n+        \"updated_at\": \"2019-04-05T11:55:44Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480248730\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/49275095?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursabot/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursabot/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursabot/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursabot/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursabot\",\n+            \"id\": 49275095,\n+            \"login\": \"ursabot\",\n+            \"node_id\": \"MDQ6VXNlcjQ5Mjc1MDk1\",\n+            \"organizations_url\": \"https://api.github.com/users/ursabot/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursabot/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursabot/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursabot/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursabot/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/ursabot\"\n+        }\n+    },\n+    \"issue\": {\n+        \"assignee\": null,\n+        \"assignees\": [],\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"\",\n+        \"closed_at\": null,\n+        \"comments\": 4,\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\",\n+        \"created_at\": \"2019-04-05T11:22:15Z\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/events\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+        \"id\": 429706959,\n+        \"labels\": [],\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}\",\n+        \"locked\": false,\n+        \"milestone\": null,\n+        \"node_id\": \"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\",\n+        \"number\": 26,\n+        \"pull_request\": {\n+            \"diff_url\": \"https://github.com/ursa-labs/ursabot/pull/26.diff\",\n+            \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+            \"patch_url\": \"https://github.com/ursa-labs/ursabot/pull/26.patch\",\n+            \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\"\n+        },\n+        \"repository_url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"state\": \"open\",\n+        \"title\": \"Unittests for GithubHook\",\n+        \"updated_at\": \"2019-04-05T11:55:44Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"organization\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+        \"description\": \"Innovation lab for open source data science tools, powered by Apache Arrow\",\n+        \"events_url\": \"https://api.github.com/orgs/ursa-labs/events\",\n+        \"hooks_url\": \"https://api.github.com/orgs/ursa-labs/hooks\",\n+        \"id\": 46514972,\n+        \"issues_url\": \"https://api.github.com/orgs/ursa-labs/issues\",\n+        \"login\": \"ursa-labs\",\n+        \"members_url\": \"https://api.github.com/orgs/ursa-labs/members{/member}\",\n+        \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+        \"public_members_url\": \"https://api.github.com/orgs/ursa-labs/public_members{/member}\",\n+        \"repos_url\": \"https://api.github.com/orgs/ursa-labs/repos\",\n+        \"url\": \"https://api.github.com/orgs/ursa-labs\"\n+    },\n+    \"repository\": {\n+        \"archive_url\": \"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\",\n+        \"archived\": false,\n+        \"assignees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\",\n+        \"blobs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\",\n+        \"branches_url\": \"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\",\n+        \"clone_url\": \"https://github.com/ursa-labs/ursabot.git\",\n+        \"collaborators_url\": \"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\",\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\",\n+        \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\",\n+        \"compare_url\": \"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\",\n+        \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\",\n+        \"contributors_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contributors\",\n+        \"created_at\": \"2019-02-04T15:40:31Z\",\n+        \"default_branch\": \"master\",\n+        \"deployments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/deployments\",\n+        \"description\": null,\n+        \"disabled\": false,\n+        \"downloads_url\": \"https://api.github.com/repos/ursa-labs/ursabot/downloads\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/events\",\n+        \"fork\": false,\n+        \"forks\": 0,\n+        \"forks_count\": 0,\n+        \"forks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/forks\",\n+        \"full_name\": \"ursa-labs/ursabot\",\n+        \"git_commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\",\n+        \"git_refs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\",\n+        \"git_tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\",\n+        \"git_url\": \"git://github.com/ursa-labs/ursabot.git\",\n+        \"has_downloads\": true,\n+        \"has_issues\": true,\n+        \"has_pages\": false,\n+        \"has_projects\": true,\n+        \"has_wiki\": true,\n+        \"homepage\": null,\n+        \"hooks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/hooks\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"id\": 169101701,\n+        \"issue_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\",\n+        \"issue_events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\",\n+        \"issues_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\",\n+        \"keys_url\": \"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\",\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\",\n+        \"language\": \"Jupyter Notebook\",\n+        \"languages_url\": \"https://api.github.com/repos/ursa-labs/ursabot/languages\",\n+        \"license\": null,\n+        \"merges_url\": \"https://api.github.com/repos/ursa-labs/ursabot/merges\",\n+        \"milestones_url\": \"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\",\n+        \"mirror_url\": null,\n+        \"name\": \"ursabot\",\n+        \"node_id\": \"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\",\n+        \"notifications_url\": \"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\",\n+        \"open_issues\": 19,\n+        \"open_issues_count\": 19,\n+        \"owner\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursa-labs\",\n+            \"id\": 46514972,\n+            \"login\": \"ursa-labs\",\n+            \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+            \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+            \"type\": \"Organization\",\n+            \"url\": \"https://api.github.com/users/ursa-labs\"\n+        },\n+        \"private\": false,\n+        \"pulls_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\",\n+        \"pushed_at\": \"2019-04-05T11:22:16Z\",\n+        \"releases_url\": \"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\",\n+        \"size\": 892,\n+        \"ssh_url\": \"git@github.com:ursa-labs/ursabot.git\",\n+        \"stargazers_count\": 1,\n+        \"stargazers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/stargazers\",\n+        \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\",\n+        \"subscribers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscribers\",\n+        \"subscription_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscription\",\n+        \"svn_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/tags\",\n+        \"teams_url\": \"https://api.github.com/repos/ursa-labs/ursabot/teams\",\n+        \"trees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\",\n+        \"updated_at\": \"2019-04-04T17:49:10Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"watchers\": 1,\n+        \"watchers_count\": 1\n+    },\n+    \"sender\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/49275095?v=4\",\n+        \"events_url\": \"https://api.github.com/users/ursabot/events{/privacy}\",\n+        \"followers_url\": \"https://api.github.com/users/ursabot/followers\",\n+        \"following_url\": \"https://api.github.com/users/ursabot/following{/other_user}\",\n+        \"gists_url\": \"https://api.github.com/users/ursabot/gists{/gist_id}\",\n+        \"gravatar_id\": \"\",\n+        \"html_url\": \"https://github.com/ursabot\",\n+        \"id\": 49275095,\n+        \"login\": \"ursabot\",\n+        \"node_id\": \"MDQ6VXNlcjQ5Mjc1MDk1\",\n+        \"organizations_url\": \"https://api.github.com/users/ursabot/orgs\",\n+        \"received_events_url\": \"https://api.github.com/users/ursabot/received_events\",\n+        \"repos_url\": \"https://api.github.com/users/ursabot/repos\",\n+        \"site_admin\": false,\n+        \"starred_url\": \"https://api.github.com/users/ursabot/starred{/owner}{/repo}\",\n+        \"subscriptions_url\": \"https://api.github.com/users/ursabot/subscriptions\",\n+        \"type\": \"User\",\n+        \"url\": \"https://api.github.com/users/ursabot\"\n+    }\n+}"
+    },
+    {
+      "sha": "7ef554e333327f0e62aa1fd76b4b17844a39adeb",
+      "filename": "ursabot/tests/fixtures/issue-comment-by-ursabot.json",
+      "status": "added",
+      "additions": 212,
+      "deletions": 0,
+      "changes": 212,
+      "blob_url": "https://github.com/ursa-labs/ursabot/blob/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-by-ursabot.json",
+      "raw_url": "https://github.com/ursa-labs/ursabot/raw/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-by-ursabot.json",
+      "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-by-ursabot.json?ref=2705da2b616b98fa6010a25813c5a7a27456f71d",
+      "patch": "@@ -0,0 +1,212 @@\n+{\n+    \"action\": \"created\",\n+    \"comment\": {\n+        \"author_association\": \"NONE\",\n+        \"body\": \"Unknown command \\\"\\\"\",\n+        \"created_at\": \"2019-04-05T11:35:47Z\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480243815\",\n+        \"id\": 480243815,\n+        \"issue_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"node_id\": \"MDEyOklzc3VlQ29tbWVudDQ4MDI0MzgxNQ==\",\n+        \"updated_at\": \"2019-04-05T11:35:47Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480243815\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/49275095?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursabot/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursabot/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursabot/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursabot/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursabot\",\n+            \"id\": 49275095,\n+            \"login\": \"ursabot\",\n+            \"node_id\": \"MDQ6VXNlcjQ5Mjc1MDk1\",\n+            \"organizations_url\": \"https://api.github.com/users/ursabot/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursabot/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursabot/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursabot/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursabot/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/ursabot\"\n+        }\n+    },\n+    \"issue\": {\n+        \"assignee\": null,\n+        \"assignees\": [],\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"\",\n+        \"closed_at\": null,\n+        \"comments\": 2,\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\",\n+        \"created_at\": \"2019-04-05T11:22:15Z\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/events\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+        \"id\": 429706959,\n+        \"labels\": [],\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}\",\n+        \"locked\": false,\n+        \"milestone\": null,\n+        \"node_id\": \"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\",\n+        \"number\": 26,\n+        \"pull_request\": {\n+            \"diff_url\": \"https://github.com/ursa-labs/ursabot/pull/26.diff\",\n+            \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+            \"patch_url\": \"https://github.com/ursa-labs/ursabot/pull/26.patch\",\n+            \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\"\n+        },\n+        \"repository_url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"state\": \"open\",\n+        \"title\": \"Unittests for GithubHook\",\n+        \"updated_at\": \"2019-04-05T11:35:47Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"organization\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+        \"description\": \"Innovation lab for open source data science tools, powered by Apache Arrow\",\n+        \"events_url\": \"https://api.github.com/orgs/ursa-labs/events\",\n+        \"hooks_url\": \"https://api.github.com/orgs/ursa-labs/hooks\",\n+        \"id\": 46514972,\n+        \"issues_url\": \"https://api.github.com/orgs/ursa-labs/issues\",\n+        \"login\": \"ursa-labs\",\n+        \"members_url\": \"https://api.github.com/orgs/ursa-labs/members{/member}\",\n+        \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+        \"public_members_url\": \"https://api.github.com/orgs/ursa-labs/public_members{/member}\",\n+        \"repos_url\": \"https://api.github.com/orgs/ursa-labs/repos\",\n+        \"url\": \"https://api.github.com/orgs/ursa-labs\"\n+    },\n+    \"repository\": {\n+        \"archive_url\": \"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\",\n+        \"archived\": false,\n+        \"assignees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\",\n+        \"blobs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\",\n+        \"branches_url\": \"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\",\n+        \"clone_url\": \"https://github.com/ursa-labs/ursabot.git\",\n+        \"collaborators_url\": \"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\",\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\",\n+        \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\",\n+        \"compare_url\": \"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\",\n+        \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\",\n+        \"contributors_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contributors\",\n+        \"created_at\": \"2019-02-04T15:40:31Z\",\n+        \"default_branch\": \"master\",\n+        \"deployments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/deployments\",\n+        \"description\": null,\n+        \"disabled\": false,\n+        \"downloads_url\": \"https://api.github.com/repos/ursa-labs/ursabot/downloads\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/events\",\n+        \"fork\": false,\n+        \"forks\": 0,\n+        \"forks_count\": 0,\n+        \"forks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/forks\",\n+        \"full_name\": \"ursa-labs/ursabot\",\n+        \"git_commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\",\n+        \"git_refs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\",\n+        \"git_tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\",\n+        \"git_url\": \"git://github.com/ursa-labs/ursabot.git\",\n+        \"has_downloads\": true,\n+        \"has_issues\": true,\n+        \"has_pages\": false,\n+        \"has_projects\": true,\n+        \"has_wiki\": true,\n+        \"homepage\": null,\n+        \"hooks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/hooks\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"id\": 169101701,\n+        \"issue_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\",\n+        \"issue_events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\",\n+        \"issues_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\",\n+        \"keys_url\": \"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\",\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\",\n+        \"language\": \"Jupyter Notebook\",\n+        \"languages_url\": \"https://api.github.com/repos/ursa-labs/ursabot/languages\",\n+        \"license\": null,\n+        \"merges_url\": \"https://api.github.com/repos/ursa-labs/ursabot/merges\",\n+        \"milestones_url\": \"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\",\n+        \"mirror_url\": null,\n+        \"name\": \"ursabot\",\n+        \"node_id\": \"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\",\n+        \"notifications_url\": \"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\",\n+        \"open_issues\": 19,\n+        \"open_issues_count\": 19,\n+        \"owner\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursa-labs\",\n+            \"id\": 46514972,\n+            \"login\": \"ursa-labs\",\n+            \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+            \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+            \"type\": \"Organization\",\n+            \"url\": \"https://api.github.com/users/ursa-labs\"\n+        },\n+        \"private\": false,\n+        \"pulls_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\",\n+        \"pushed_at\": \"2019-04-05T11:22:16Z\",\n+        \"releases_url\": \"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\",\n+        \"size\": 892,\n+        \"ssh_url\": \"git@github.com:ursa-labs/ursabot.git\",\n+        \"stargazers_count\": 1,\n+        \"stargazers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/stargazers\",\n+        \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\",\n+        \"subscribers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscribers\",\n+        \"subscription_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscription\",\n+        \"svn_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/tags\",\n+        \"teams_url\": \"https://api.github.com/repos/ursa-labs/ursabot/teams\",\n+        \"trees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\",\n+        \"updated_at\": \"2019-04-04T17:49:10Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"watchers\": 1,\n+        \"watchers_count\": 1\n+    },\n+    \"sender\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/49275095?v=4\",\n+        \"events_url\": \"https://api.github.com/users/ursabot/events{/privacy}\",\n+        \"followers_url\": \"https://api.github.com/users/ursabot/followers\",\n+        \"following_url\": \"https://api.github.com/users/ursabot/following{/other_user}\",\n+        \"gists_url\": \"https://api.github.com/users/ursabot/gists{/gist_id}\",\n+        \"gravatar_id\": \"\",\n+        \"html_url\": \"https://github.com/ursabot\",\n+        \"id\": 49275095,\n+        \"login\": \"ursabot\",\n+        \"node_id\": \"MDQ6VXNlcjQ5Mjc1MDk1\",\n+        \"organizations_url\": \"https://api.github.com/users/ursabot/orgs\",\n+        \"received_events_url\": \"https://api.github.com/users/ursabot/received_events\",\n+        \"repos_url\": \"https://api.github.com/users/ursabot/repos\",\n+        \"site_admin\": false,\n+        \"starred_url\": \"https://api.github.com/users/ursabot/starred{/owner}{/repo}\",\n+        \"subscriptions_url\": \"https://api.github.com/users/ursabot/subscriptions\",\n+        \"type\": \"User\",\n+        \"url\": \"https://api.github.com/users/ursabot\"\n+    }\n+}"
+    },
+    {
+      "sha": "a8082dbc91fdfe815b795e49ec10e49000771ef5",
+      "filename": "ursabot/tests/fixtures/issue-comment-not-mentioning-ursabot.json",
+      "status": "added",
+      "additions": 212,
+      "deletions": 0,
+      "changes": 212,
+      "blob_url": "https://github.com/ursa-labs/ursabot/blob/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-not-mentioning-ursabot.json",
+      "raw_url": "https://github.com/ursa-labs/ursabot/raw/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-not-mentioning-ursabot.json",
+      "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-not-mentioning-ursabot.json?ref=2705da2b616b98fa6010a25813c5a7a27456f71d",
+      "patch": "@@ -0,0 +1,212 @@\n+{\n+    \"action\": \"created\",\n+    \"comment\": {\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"bear is no game\",\n+        \"created_at\": \"2019-04-05T11:26:56Z\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480241727\",\n+        \"id\": 480241727,\n+        \"issue_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"node_id\": \"MDEyOklzc3VlQ29tbWVudDQ4MDI0MTcyNw==\",\n+        \"updated_at\": \"2019-04-05T11:26:56Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480241727\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"issue\": {\n+        \"assignee\": null,\n+        \"assignees\": [],\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"\",\n+        \"closed_at\": null,\n+        \"comments\": 0,\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\",\n+        \"created_at\": \"2019-04-05T11:22:15Z\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/events\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+        \"id\": 429706959,\n+        \"labels\": [],\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}\",\n+        \"locked\": false,\n+        \"milestone\": null,\n+        \"node_id\": \"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\",\n+        \"number\": 26,\n+        \"pull_request\": {\n+            \"diff_url\": \"https://github.com/ursa-labs/ursabot/pull/26.diff\",\n+            \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+            \"patch_url\": \"https://github.com/ursa-labs/ursabot/pull/26.patch\",\n+            \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\"\n+        },\n+        \"repository_url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"state\": \"open\",\n+        \"title\": \"Unittests for GithubHook\",\n+        \"updated_at\": \"2019-04-05T11:26:56Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"organization\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+        \"description\": \"Innovation lab for open source data science tools, powered by Apache Arrow\",\n+        \"events_url\": \"https://api.github.com/orgs/ursa-labs/events\",\n+        \"hooks_url\": \"https://api.github.com/orgs/ursa-labs/hooks\",\n+        \"id\": 46514972,\n+        \"issues_url\": \"https://api.github.com/orgs/ursa-labs/issues\",\n+        \"login\": \"ursa-labs\",\n+        \"members_url\": \"https://api.github.com/orgs/ursa-labs/members{/member}\",\n+        \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+        \"public_members_url\": \"https://api.github.com/orgs/ursa-labs/public_members{/member}\",\n+        \"repos_url\": \"https://api.github.com/orgs/ursa-labs/repos\",\n+        \"url\": \"https://api.github.com/orgs/ursa-labs\"\n+    },\n+    \"repository\": {\n+        \"archive_url\": \"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\",\n+        \"archived\": false,\n+        \"assignees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\",\n+        \"blobs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\",\n+        \"branches_url\": \"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\",\n+        \"clone_url\": \"https://github.com/ursa-labs/ursabot.git\",\n+        \"collaborators_url\": \"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\",\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\",\n+        \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\",\n+        \"compare_url\": \"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\",\n+        \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\",\n+        \"contributors_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contributors\",\n+        \"created_at\": \"2019-02-04T15:40:31Z\",\n+        \"default_branch\": \"master\",\n+        \"deployments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/deployments\",\n+        \"description\": null,\n+        \"disabled\": false,\n+        \"downloads_url\": \"https://api.github.com/repos/ursa-labs/ursabot/downloads\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/events\",\n+        \"fork\": false,\n+        \"forks\": 0,\n+        \"forks_count\": 0,\n+        \"forks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/forks\",\n+        \"full_name\": \"ursa-labs/ursabot\",\n+        \"git_commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\",\n+        \"git_refs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\",\n+        \"git_tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\",\n+        \"git_url\": \"git://github.com/ursa-labs/ursabot.git\",\n+        \"has_downloads\": true,\n+        \"has_issues\": true,\n+        \"has_pages\": false,\n+        \"has_projects\": true,\n+        \"has_wiki\": true,\n+        \"homepage\": null,\n+        \"hooks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/hooks\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"id\": 169101701,\n+        \"issue_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\",\n+        \"issue_events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\",\n+        \"issues_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\",\n+        \"keys_url\": \"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\",\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\",\n+        \"language\": \"Jupyter Notebook\",\n+        \"languages_url\": \"https://api.github.com/repos/ursa-labs/ursabot/languages\",\n+        \"license\": null,\n+        \"merges_url\": \"https://api.github.com/repos/ursa-labs/ursabot/merges\",\n+        \"milestones_url\": \"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\",\n+        \"mirror_url\": null,\n+        \"name\": \"ursabot\",\n+        \"node_id\": \"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\",\n+        \"notifications_url\": \"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\",\n+        \"open_issues\": 19,\n+        \"open_issues_count\": 19,\n+        \"owner\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursa-labs\",\n+            \"id\": 46514972,\n+            \"login\": \"ursa-labs\",\n+            \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+            \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+            \"type\": \"Organization\",\n+            \"url\": \"https://api.github.com/users/ursa-labs\"\n+        },\n+        \"private\": false,\n+        \"pulls_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\",\n+        \"pushed_at\": \"2019-04-05T11:22:16Z\",\n+        \"releases_url\": \"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\",\n+        \"size\": 892,\n+        \"ssh_url\": \"git@github.com:ursa-labs/ursabot.git\",\n+        \"stargazers_count\": 1,\n+        \"stargazers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/stargazers\",\n+        \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\",\n+        \"subscribers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscribers\",\n+        \"subscription_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscription\",\n+        \"svn_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/tags\",\n+        \"teams_url\": \"https://api.github.com/repos/ursa-labs/ursabot/teams\",\n+        \"trees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\",\n+        \"updated_at\": \"2019-04-04T17:49:10Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"watchers\": 1,\n+        \"watchers_count\": 1\n+    },\n+    \"sender\": {\n+        \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+        \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+        \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+        \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+        \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+        \"gravatar_id\": \"\",\n+        \"html_url\": \"https://github.com/kszucs\",\n+        \"id\": 961747,\n+        \"login\": \"kszucs\",\n+        \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+        \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+        \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+        \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+        \"site_admin\": false,\n+        \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+        \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+        \"type\": \"User\",\n+        \"url\": \"https://api.github.com/users/kszucs\"\n+    }\n+}"
+    },
+    {
+      "sha": "2770e29ba9086394455315e590c0b433d08e437e",
+      "filename": "ursabot/tests/fixtures/issue-comment-with-empty-command.json",
+      "status": "added",
+      "additions": 212,
+      "deletions": 0,
+      "changes": 212,
+      "blob_url": "https://github.com/ursa-labs/ursabot/blob/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-with-empty-command.json",
+      "raw_url": "https://github.com/ursa-labs/ursabot/raw/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-with-empty-command.json",
+      "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-with-empty-command.json?ref=2705da2b616b98fa6010a25813c5a7a27456f71d",
+      "patch": "@@ -0,0 +1,212 @@\n+{\n+    \"action\": \"created\",\n+    \"comment\": {\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"@ursabot \",\n+        \"created_at\": \"2019-04-05T11:35:46Z\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480243811\",\n+        \"id\": 480243811,\n+        \"issue_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"node_id\": \"MDEyOklzc3VlQ29tbWVudDQ4MDI0MzgxMQ==\",\n+        \"updated_at\": \"2019-04-05T11:35:46Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480243811\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"issue\": {\n+        \"assignee\": null,\n+        \"assignees\": [],\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"\",\n+        \"closed_at\": null,\n+        \"comments\": 1,\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\",\n+        \"created_at\": \"2019-04-05T11:22:15Z\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/events\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+        \"id\": 429706959,\n+        \"labels\": [],\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}\",\n+        \"locked\": false,\n+        \"milestone\": null,\n+        \"node_id\": \"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\",\n+        \"number\": 26,\n+        \"pull_request\": {\n+            \"diff_url\": \"https://github.com/ursa-labs/ursabot/pull/26.diff\",\n+            \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+            \"patch_url\": \"https://github.com/ursa-labs/ursabot/pull/26.patch\",\n+            \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\"\n+        },\n+        \"repository_url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"state\": \"open\",\n+        \"title\": \"Unittests for GithubHook\",\n+        \"updated_at\": \"2019-04-05T11:35:46Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"organization\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+        \"description\": \"Innovation lab for open source data science tools, powered by Apache Arrow\",\n+        \"events_url\": \"https://api.github.com/orgs/ursa-labs/events\",\n+        \"hooks_url\": \"https://api.github.com/orgs/ursa-labs/hooks\",\n+        \"id\": 46514972,\n+        \"issues_url\": \"https://api.github.com/orgs/ursa-labs/issues\",\n+        \"login\": \"ursa-labs\",\n+        \"members_url\": \"https://api.github.com/orgs/ursa-labs/members{/member}\",\n+        \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+        \"public_members_url\": \"https://api.github.com/orgs/ursa-labs/public_members{/member}\",\n+        \"repos_url\": \"https://api.github.com/orgs/ursa-labs/repos\",\n+        \"url\": \"https://api.github.com/orgs/ursa-labs\"\n+    },\n+    \"repository\": {\n+        \"archive_url\": \"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\",\n+        \"archived\": false,\n+        \"assignees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\",\n+        \"blobs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\",\n+        \"branches_url\": \"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\",\n+        \"clone_url\": \"https://github.com/ursa-labs/ursabot.git\",\n+        \"collaborators_url\": \"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\",\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\",\n+        \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\",\n+        \"compare_url\": \"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\",\n+        \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\",\n+        \"contributors_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contributors\",\n+        \"created_at\": \"2019-02-04T15:40:31Z\",\n+        \"default_branch\": \"master\",\n+        \"deployments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/deployments\",\n+        \"description\": null,\n+        \"disabled\": false,\n+        \"downloads_url\": \"https://api.github.com/repos/ursa-labs/ursabot/downloads\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/events\",\n+        \"fork\": false,\n+        \"forks\": 0,\n+        \"forks_count\": 0,\n+        \"forks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/forks\",\n+        \"full_name\": \"ursa-labs/ursabot\",\n+        \"git_commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\",\n+        \"git_refs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\",\n+        \"git_tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\",\n+        \"git_url\": \"git://github.com/ursa-labs/ursabot.git\",\n+        \"has_downloads\": true,\n+        \"has_issues\": true,\n+        \"has_pages\": false,\n+        \"has_projects\": true,\n+        \"has_wiki\": true,\n+        \"homepage\": null,\n+        \"hooks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/hooks\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"id\": 169101701,\n+        \"issue_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\",\n+        \"issue_events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\",\n+        \"issues_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\",\n+        \"keys_url\": \"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\",\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\",\n+        \"language\": \"Jupyter Notebook\",\n+        \"languages_url\": \"https://api.github.com/repos/ursa-labs/ursabot/languages\",\n+        \"license\": null,\n+        \"merges_url\": \"https://api.github.com/repos/ursa-labs/ursabot/merges\",\n+        \"milestones_url\": \"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\",\n+        \"mirror_url\": null,\n+        \"name\": \"ursabot\",\n+        \"node_id\": \"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\",\n+        \"notifications_url\": \"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\",\n+        \"open_issues\": 19,\n+        \"open_issues_count\": 19,\n+        \"owner\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursa-labs\",\n+            \"id\": 46514972,\n+            \"login\": \"ursa-labs\",\n+            \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+            \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+            \"type\": \"Organization\",\n+            \"url\": \"https://api.github.com/users/ursa-labs\"\n+        },\n+        \"private\": false,\n+        \"pulls_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\",\n+        \"pushed_at\": \"2019-04-05T11:22:16Z\",\n+        \"releases_url\": \"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\",\n+        \"size\": 892,\n+        \"ssh_url\": \"git@github.com:ursa-labs/ursabot.git\",\n+        \"stargazers_count\": 1,\n+        \"stargazers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/stargazers\",\n+        \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\",\n+        \"subscribers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscribers\",\n+        \"subscription_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscription\",\n+        \"svn_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/tags\",\n+        \"teams_url\": \"https://api.github.com/repos/ursa-labs/ursabot/teams\",\n+        \"trees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\",\n+        \"updated_at\": \"2019-04-04T17:49:10Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"watchers\": 1,\n+        \"watchers_count\": 1\n+    },\n+    \"sender\": {\n+        \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+        \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+        \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+        \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+        \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+        \"gravatar_id\": \"\",\n+        \"html_url\": \"https://github.com/kszucs\",\n+        \"id\": 961747,\n+        \"login\": \"kszucs\",\n+        \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+        \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+        \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+        \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+        \"site_admin\": false,\n+        \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+        \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+        \"type\": \"User\",\n+        \"url\": \"https://api.github.com/users/kszucs\"\n+    }\n+}"
+    },
+    {
+      "sha": "80ff46510a2f39ae60f7c3a98e5fdaef8e688784",
+      "filename": "ursabot/tests/fixtures/issue-comment-without-pull-request.json",
+      "status": "added",
+      "additions": 206,
+      "deletions": 0,
+      "changes": 206,
+      "blob_url": "https://github.com/ursa-labs/ursabot/blob/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-without-pull-request.json",
+      "raw_url": "https://github.com/ursa-labs/ursabot/raw/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-without-pull-request.json",
+      "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-without-pull-request.json?ref=2705da2b616b98fa6010a25813c5a7a27456f71d",
+      "patch": "@@ -0,0 +1,206 @@\n+{\n+    \"action\": \"created\",\n+    \"comment\": {\n+        \"author_association\": \"NONE\",\n+        \"body\": \"Ursabot only listens to pull request comments!\",\n+        \"created_at\": \"2019-04-05T11:53:43Z\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/issues/19#issuecomment-480248217\",\n+        \"id\": 480248217,\n+        \"issue_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/19\",\n+        \"node_id\": \"MDEyOklzc3VlQ29tbWVudDQ4MDI0ODIxNw==\",\n+        \"updated_at\": \"2019-04-05T11:53:43Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480248217\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/49275095?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursabot/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursabot/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursabot/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursabot/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursabot\",\n+            \"id\": 49275095,\n+            \"login\": \"ursabot\",\n+            \"node_id\": \"MDQ6VXNlcjQ5Mjc1MDk1\",\n+            \"organizations_url\": \"https://api.github.com/users/ursabot/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursabot/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursabot/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursabot/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursabot/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/ursabot\"\n+        }\n+    },\n+    \"issue\": {\n+        \"assignee\": null,\n+        \"assignees\": [],\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"\",\n+        \"closed_at\": null,\n+        \"comments\": 4,\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/19/comments\",\n+        \"created_at\": \"2019-04-02T09:56:41Z\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/19/events\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/issues/19\",\n+        \"id\": 428131685,\n+        \"labels\": [],\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/19/labels{/name}\",\n+        \"locked\": false,\n+        \"milestone\": null,\n+        \"node_id\": \"MDU6SXNzdWU0MjgxMzE2ODU=\",\n+        \"number\": 19,\n+        \"repository_url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"state\": \"open\",\n+        \"title\": \"Build ursabot itself via ursabot\",\n+        \"updated_at\": \"2019-04-05T11:53:43Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/19\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"organization\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+        \"description\": \"Innovation lab for open source data science tools, powered by Apache Arrow\",\n+        \"events_url\": \"https://api.github.com/orgs/ursa-labs/events\",\n+        \"hooks_url\": \"https://api.github.com/orgs/ursa-labs/hooks\",\n+        \"id\": 46514972,\n+        \"issues_url\": \"https://api.github.com/orgs/ursa-labs/issues\",\n+        \"login\": \"ursa-labs\",\n+        \"members_url\": \"https://api.github.com/orgs/ursa-labs/members{/member}\",\n+        \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+        \"public_members_url\": \"https://api.github.com/orgs/ursa-labs/public_members{/member}\",\n+        \"repos_url\": \"https://api.github.com/orgs/ursa-labs/repos\",\n+        \"url\": \"https://api.github.com/orgs/ursa-labs\"\n+    },\n+    \"repository\": {\n+        \"archive_url\": \"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\",\n+        \"archived\": false,\n+        \"assignees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\",\n+        \"blobs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\",\n+        \"branches_url\": \"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\",\n+        \"clone_url\": \"https://github.com/ursa-labs/ursabot.git\",\n+        \"collaborators_url\": \"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\",\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\",\n+        \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\",\n+        \"compare_url\": \"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\",\n+        \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\",\n+        \"contributors_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contributors\",\n+        \"created_at\": \"2019-02-04T15:40:31Z\",\n+        \"default_branch\": \"master\",\n+        \"deployments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/deployments\",\n+        \"description\": null,\n+        \"disabled\": false,\n+        \"downloads_url\": \"https://api.github.com/repos/ursa-labs/ursabot/downloads\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/events\",\n+        \"fork\": false,\n+        \"forks\": 0,\n+        \"forks_count\": 0,\n+        \"forks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/forks\",\n+        \"full_name\": \"ursa-labs/ursabot\",\n+        \"git_commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\",\n+        \"git_refs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\",\n+        \"git_tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\",\n+        \"git_url\": \"git://github.com/ursa-labs/ursabot.git\",\n+        \"has_downloads\": true,\n+        \"has_issues\": true,\n+        \"has_pages\": false,\n+        \"has_projects\": true,\n+        \"has_wiki\": true,\n+        \"homepage\": null,\n+        \"hooks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/hooks\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"id\": 169101701,\n+        \"issue_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\",\n+        \"issue_events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\",\n+        \"issues_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\",\n+        \"keys_url\": \"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\",\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\",\n+        \"language\": \"Jupyter Notebook\",\n+        \"languages_url\": \"https://api.github.com/repos/ursa-labs/ursabot/languages\",\n+        \"license\": null,\n+        \"merges_url\": \"https://api.github.com/repos/ursa-labs/ursabot/merges\",\n+        \"milestones_url\": \"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\",\n+        \"mirror_url\": null,\n+        \"name\": \"ursabot\",\n+        \"node_id\": \"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\",\n+        \"notifications_url\": \"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\",\n+        \"open_issues\": 19,\n+        \"open_issues_count\": 19,\n+        \"owner\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursa-labs\",\n+            \"id\": 46514972,\n+            \"login\": \"ursa-labs\",\n+            \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+            \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+            \"type\": \"Organization\",\n+            \"url\": \"https://api.github.com/users/ursa-labs\"\n+        },\n+        \"private\": false,\n+        \"pulls_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\",\n+        \"pushed_at\": \"2019-04-05T11:22:16Z\",\n+        \"releases_url\": \"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\",\n+        \"size\": 892,\n+        \"ssh_url\": \"git@github.com:ursa-labs/ursabot.git\",\n+        \"stargazers_count\": 1,\n+        \"stargazers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/stargazers\",\n+        \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\",\n+        \"subscribers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscribers\",\n+        \"subscription_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscription\",\n+        \"svn_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/tags\",\n+        \"teams_url\": \"https://api.github.com/repos/ursa-labs/ursabot/teams\",\n+        \"trees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\",\n+        \"updated_at\": \"2019-04-04T17:49:10Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"watchers\": 1,\n+        \"watchers_count\": 1\n+    },\n+    \"sender\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/49275095?v=4\",\n+        \"events_url\": \"https://api.github.com/users/ursabot/events{/privacy}\",\n+        \"followers_url\": \"https://api.github.com/users/ursabot/followers\",\n+        \"following_url\": \"https://api.github.com/users/ursabot/following{/other_user}\",\n+        \"gists_url\": \"https://api.github.com/users/ursabot/gists{/gist_id}\",\n+        \"gravatar_id\": \"\",\n+        \"html_url\": \"https://github.com/ursabot\",\n+        \"id\": 49275095,\n+        \"login\": \"ursabot\",\n+        \"node_id\": \"MDQ6VXNlcjQ5Mjc1MDk1\",\n+        \"organizations_url\": \"https://api.github.com/users/ursabot/orgs\",\n+        \"received_events_url\": \"https://api.github.com/users/ursabot/received_events\",\n+        \"repos_url\": \"https://api.github.com/users/ursabot/repos\",\n+        \"site_admin\": false,\n+        \"starred_url\": \"https://api.github.com/users/ursabot/starred{/owner}{/repo}\",\n+        \"subscriptions_url\": \"https://api.github.com/users/ursabot/subscriptions\",\n+        \"type\": \"User\",\n+        \"url\": \"https://api.github.com/users/ursabot\"\n+    }\n+}"
+    },
+    {
+      "sha": "c738bb0eb54c87ba0f23e97e827d77c2be74d0b6",
+      "filename": "ursabot/tests/test_hooks.py",
+      "status": "modified",
+      "additions": 4,
+      "deletions": 4,
+      "changes": 8,
+      "blob_url": "https://github.com/ursa-labs/ursabot/blob/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/test_hooks.py",
+      "raw_url": "https://github.com/ursa-labs/ursabot/raw/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/test_hooks.py",
+      "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/test_hooks.py?ref=2705da2b616b98fa6010a25813c5a7a27456f71d",
+      "patch": "@@ -54,7 +54,7 @@ class TestGithubHook(ChangeHookTestCase):\n         await self.request('ping', {})\n         assert len(self.hook.master.data.updates.changesAdded) == 0\n \n-    @ensure_deferred\n-    async def test_issue_comment(self):\n-        payload = {}\n-        await self.request('issue_comment', payload)\n+    # @ensure_deferred\n+    # async def test_issue_comment(self):\n+    #     payload = {}\n+    #     await self.request('issue_comment', payload)"
+    }
+  ]
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/pull-request-26-files.json b/src/arrow/dev/archery/archery/tests/fixtures/pull-request-26-files.json
new file mode 100644
index 000000000..b039b3d10
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/pull-request-26-files.json
@@ -0,0 +1,170 @@
+[
+  {
+    "sha": "ebfe3f6c5e98723f9751c99ce8ce798f1ba529c5",
+    "filename": ".travis.yml",
+    "status": "modified",
+    "additions": 4,
+    "deletions": 1,
+    "changes": 5,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/.travis.yml",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/.travis.yml",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/.travis.yml?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -4,7 +4,10 @@ services:\n python:\n   - 3.6\n script:\n-  - pip install \"pytest>=3.9\" flake8 -e .\n+  # --no-binary buildbot is required because buildbot doesn't bundle its tests\n+  # to binary wheels, but ursabot's test suite depends on buildbot's so install\n+  # it from source\n+  - pip install --no-binary buildbot \"pytest>=3.9\" mock flake8 -e .\n \n   # run linter\n   - flake8 ursabot"
+  },
+  {
+    "sha": "86ad809d3f74c175b92ac58c6c645b0fbf5fa2c5",
+    "filename": "setup.py",
+    "status": "modified",
+    "additions": 6,
+    "deletions": 1,
+    "changes": 7,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/setup.py",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/setup.py",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/setup.py?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -1,8 +1,13 @@\n #!/usr/bin/env python\n \n+import sys\n from setuptools import setup\n \n \n+if sys.version_info < (3, 6):\n+    sys.exit('Python < 3.6 is not supported due to missing asyncio support')\n+\n+\n # TODO(kszucs): add package data, change maintainer\n setup(\n     name='ursabot',\n@@ -15,7 +20,7 @@\n     setup_requires=['setuptools_scm'],\n     install_requires=['click', 'dask', 'docker', 'docker-map', 'toolz',\n                       'buildbot', 'treq'],\n-    tests_require=['pytest>=3.9'],\n+    tests_require=['pytest>=3.9', 'mock'],\n     entry_points='''\n         [console_scripts]\n         ursabot=ursabot.cli:ursabot"
+  },
+  {
+    "sha": "c884f3f85bba499d77d9ad28bcd0ff5edf80f957",
+    "filename": "ursabot/factories.py",
+    "status": "modified",
+    "additions": 6,
+    "deletions": 2,
+    "changes": 8,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/factories.py",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/factories.py",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/factories.py?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -79,8 +79,12 @@ def prepend_step(self, step):\n                repourl='https://github.com/ursa-labs/ursabot',\n                mode='full'),\n     ShellCommand(command=['ls', '-lah']),\n-    ShellCommand(command=['pip', 'install', 'pytest', 'flake8']),\n-    ShellCommand(command=['pip', 'install', '-e', '.']),\n+    ShellCommand(command=['pip', 'install', 'pytest', 'flake8', 'mock']),\n+    # --no-binary buildbot is required because buildbot doesn't bundle its\n+    # tests to binary wheels, but ursabot's test suite depends on buildbot's\n+    # so install it from source\n+    ShellCommand(command=['pip', 'install', '--no-binary', 'buildbot',\n+                          '-e', '.']),\n     ShellCommand(command=['flake8']),\n     ShellCommand(command=['pytest', '-v', '-m', 'not docker', 'ursabot']),\n     ShellCommand(command=['buildbot', 'checkconfig', '.'])"
+  },
+  {
+    "sha": "0265cfbd9c2882f492469882a7bf513a1c1b5af4",
+    "filename": "ursabot/hooks.py",
+    "status": "modified",
+    "additions": 17,
+    "deletions": 19,
+    "changes": 36,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/hooks.py",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/hooks.py",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/hooks.py?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -1,11 +1,11 @@\n from urllib.parse import urlparse\n \n from twisted.python import log\n-from twisted.internet import defer\n \n from buildbot.www.hooks.github import GitHubEventHandler\n from buildbot.util.httpclientservice import HTTPClientService\n \n+from .utils import ensure_deferred\n \n BOTNAME = 'ursabot'\n \n@@ -22,20 +22,18 @@ def _client(self):\n             self.master, self.github_api_endpoint, headers=headers,\n             debug=self.debug, verify=self.verify)\n \n-    @defer.inlineCallbacks\n-    def _get(self, url):\n+    async def _get(self, url):\n         url = urlparse(url)\n-        client = yield self._client()\n-        response = yield client.get(url.path)\n-        result = yield response.json()\n+        client = await self._client()\n+        response = await client.get(url.path)\n+        result = await response.json()\n         return result\n \n-    @defer.inlineCallbacks\n-    def _post(self, url, data):\n+    async def _post(self, url, data):\n         url = urlparse(url)\n-        client = yield self._client()\n-        response = yield client.post(url.path, json=data)\n-        result = yield response.json()\n+        client = await self._client()\n+        response = await client.post(url.path, json=data)\n+        result = await response.json()\n         log.msg(f'POST to {url} with the following result: {result}')\n         return result\n \n@@ -46,8 +44,8 @@ def _parse_command(self, message):\n             return message.split(mention)[-1].lower().strip()\n         return None\n \n-    @defer.inlineCallbacks\n-    def handle_issue_comment(self, payload, event):\n+    @ensure_deferred\n+    async def handle_issue_comment(self, payload, event):\n         issue = payload['issue']\n         comments_url = issue['comments_url']\n         command = self._parse_command(payload['comment']['body'])\n@@ -64,16 +62,16 @@ def handle_issue_comment(self, payload, event):\n         elif command == 'build':\n             if 'pull_request' not in issue:\n                 message = 'Ursabot only listens to pull request comments!'\n-                yield self._post(comments_url, {'body': message})\n+                await self._post(comments_url, {'body': message})\n                 return [], 'git'\n         else:\n             message = f'Unknown command \"{command}\"'\n-            yield self._post(comments_url, {'body': message})\n+            await self._post(comments_url, {'body': message})\n             return [], 'git'\n \n         try:\n-            pull_request = yield self._get(issue['pull_request']['url'])\n-            changes, _ = yield self.handle_pull_request({\n+            pull_request = await self._get(issue['pull_request']['url'])\n+            changes, _ = await self.handle_pull_request({\n                 'action': 'synchronize',\n                 'sender': payload['sender'],\n                 'repository': payload['repository'],\n@@ -82,11 +80,11 @@ def handle_issue_comment(self, payload, event):\n             }, event)\n         except Exception as e:\n             message = \"I've failed to start builds for this PR\"\n-            yield self._post(comments_url, {'body': message})\n+            await self._post(comments_url, {'body': message})\n             raise e\n         else:\n             message = \"I've successfully started builds for this PR\"\n-            yield self._post(comments_url, {'body': message})\n+            await self._post(comments_url, {'body': message})\n             return changes, 'git'\n \n     # TODO(kszucs):"
+  },
+  {
+    "sha": "1e1ecf2ce47da929dbf1b93632640e7e6ae1cfe0",
+    "filename": "ursabot/steps.py",
+    "status": "modified",
+    "additions": 13,
+    "deletions": 13,
+    "changes": 26,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/steps.py",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/steps.py",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/steps.py?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -1,9 +1,9 @@\n-from twisted.internet import defer\n-\n from buildbot.plugins import steps, util\n from buildbot.process import buildstep\n from buildbot.process.results import SUCCESS\n \n+from .utils import ensure_deferred\n+\n \n class ShellMixin(buildstep.ShellMixin):\n     \"\"\"Run command in a login bash shell\n@@ -49,10 +49,10 @@ def __init__(self, **kwargs):\n         kwargs = self.setupShellMixin(kwargs)\n         super().__init__(**kwargs)\n \n-    @defer.inlineCallbacks\n-    def run(self):\n-        cmd = yield self.makeRemoteShellCommand(command=self.command)\n-        yield self.runCommand(cmd)\n+    @ensure_deferred\n+    async def run(self):\n+        cmd = await self.makeRemoteShellCommand(command=self.command)\n+        await self.runCommand(cmd)\n         return cmd.results()\n \n \n@@ -71,8 +71,8 @@ class CMake(ShellMixin, steps.CMake):\n \n     name = 'CMake'\n \n-    @defer.inlineCallbacks\n-    def run(self):\n+    @ensure_deferred\n+    async def run(self):\n         \"\"\"Create and run CMake command\n \n         Copied from the original CMake implementation to handle None values as\n@@ -94,8 +94,8 @@ def run(self):\n         if self.options is not None:\n             command.extend(self.options)\n \n-        cmd = yield self.makeRemoteShellCommand(command=command)\n-        yield self.runCommand(cmd)\n+        cmd = await self.makeRemoteShellCommand(command=command)\n+        await self.runCommand(cmd)\n \n         return cmd.results()\n \n@@ -117,8 +117,8 @@ def __init__(self, variables, source='WorkerEnvironment', **kwargs):\n         self.source = source\n         super().__init__(**kwargs)\n \n-    @defer.inlineCallbacks\n-    def run(self):\n+    @ensure_deferred\n+    async def run(self):\n         # on Windows, environment variables are case-insensitive, but we have\n         # a case-sensitive dictionary in worker_environ.  Fortunately, that\n         # dictionary is also folded to uppercase, so we can simply fold the\n@@ -139,7 +139,7 @@ def run(self):\n                 # TODO(kszucs) try with self.setProperty similarly like in\n                 # SetProperties\n                 properties.setProperty(prop, value, self.source, runtime=True)\n-                yield self.addCompleteLog('set-prop', f'{prop}: {value}')\n+                await self.addCompleteLog('set-prop', f'{prop}: {value}')\n \n         return SUCCESS\n "
+  },
+  {
+    "sha": "6a7d5308be6608f542a810d410f9240157a1340f",
+    "filename": "ursabot/tests/fixtures/issue-comment-build-command.json",
+    "status": "added",
+    "additions": 212,
+    "deletions": 0,
+    "changes": 212,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/issue-comment-build-command.json",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/issue-comment-build-command.json",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-build-command.json?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -0,0 +1,212 @@\n+{\n+    \"action\": \"created\",\n+    \"comment\": {\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"@ursabot build\",\n+        \"created_at\": \"2019-04-05T11:55:43Z\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480248726\",\n+        \"id\": 480248726,\n+        \"issue_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"node_id\": \"MDEyOklzc3VlQ29tbWVudDQ4MDI0ODcyNg==\",\n+        \"updated_at\": \"2019-04-05T11:55:43Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480248726\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"issue\": {\n+        \"assignee\": null,\n+        \"assignees\": [],\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"\",\n+        \"closed_at\": null,\n+        \"comments\": 3,\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\",\n+        \"created_at\": \"2019-04-05T11:22:15Z\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/events\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+        \"id\": 429706959,\n+        \"labels\": [],\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}\",\n+        \"locked\": false,\n+        \"milestone\": null,\n+        \"node_id\": \"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\",\n+        \"number\": 26,\n+        \"pull_request\": {\n+            \"diff_url\": \"https://github.com/ursa-labs/ursabot/pull/26.diff\",\n+            \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+            \"patch_url\": \"https://github.com/ursa-labs/ursabot/pull/26.patch\",\n+            \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\"\n+        },\n+        \"repository_url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"state\": \"open\",\n+        \"title\": \"Unittests for GithubHook\",\n+        \"updated_at\": \"2019-04-05T11:55:43Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"organization\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+        \"description\": \"Innovation lab for open source data science tools, powered by Apache Arrow\",\n+        \"events_url\": \"https://api.github.com/orgs/ursa-labs/events\",\n+        \"hooks_url\": \"https://api.github.com/orgs/ursa-labs/hooks\",\n+        \"id\": 46514972,\n+        \"issues_url\": \"https://api.github.com/orgs/ursa-labs/issues\",\n+        \"login\": \"ursa-labs\",\n+        \"members_url\": \"https://api.github.com/orgs/ursa-labs/members{/member}\",\n+        \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+        \"public_members_url\": \"https://api.github.com/orgs/ursa-labs/public_members{/member}\",\n+        \"repos_url\": \"https://api.github.com/orgs/ursa-labs/repos\",\n+        \"url\": \"https://api.github.com/orgs/ursa-labs\"\n+    },\n+    \"repository\": {\n+        \"archive_url\": \"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\",\n+        \"archived\": false,\n+        \"assignees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\",\n+        \"blobs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\",\n+        \"branches_url\": \"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\",\n+        \"clone_url\": \"https://github.com/ursa-labs/ursabot.git\",\n+        \"collaborators_url\": \"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\",\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\",\n+        \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\",\n+        \"compare_url\": \"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\",\n+        \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\",\n+        \"contributors_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contributors\",\n+        \"created_at\": \"2019-02-04T15:40:31Z\",\n+        \"default_branch\": \"master\",\n+        \"deployments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/deployments\",\n+        \"description\": null,\n+        \"disabled\": false,\n+        \"downloads_url\": \"https://api.github.com/repos/ursa-labs/ursabot/downloads\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/events\",\n+        \"fork\": false,\n+        \"forks\": 0,\n+        \"forks_count\": 0,\n+        \"forks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/forks\",\n+        \"full_name\": \"ursa-labs/ursabot\",\n+        \"git_commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\",\n+        \"git_refs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\",\n+        \"git_tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\",\n+        \"git_url\": \"git://github.com/ursa-labs/ursabot.git\",\n+        \"has_downloads\": true,\n+        \"has_issues\": true,\n+        \"has_pages\": false,\n+        \"has_projects\": true,\n+        \"has_wiki\": true,\n+        \"homepage\": null,\n+        \"hooks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/hooks\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"id\": 169101701,\n+        \"issue_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\",\n+        \"issue_events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\",\n+        \"issues_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\",\n+        \"keys_url\": \"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\",\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\",\n+        \"language\": \"Jupyter Notebook\",\n+        \"languages_url\": \"https://api.github.com/repos/ursa-labs/ursabot/languages\",\n+        \"license\": null,\n+        \"merges_url\": \"https://api.github.com/repos/ursa-labs/ursabot/merges\",\n+        \"milestones_url\": \"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\",\n+        \"mirror_url\": null,\n+        \"name\": \"ursabot\",\n+        \"node_id\": \"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\",\n+        \"notifications_url\": \"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\",\n+        \"open_issues\": 19,\n+        \"open_issues_count\": 19,\n+        \"owner\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursa-labs\",\n+            \"id\": 46514972,\n+            \"login\": \"ursa-labs\",\n+            \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+            \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+            \"type\": \"Organization\",\n+            \"url\": \"https://api.github.com/users/ursa-labs\"\n+        },\n+        \"private\": false,\n+        \"pulls_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\",\n+        \"pushed_at\": \"2019-04-05T11:22:16Z\",\n+        \"releases_url\": \"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\",\n+        \"size\": 892,\n+        \"ssh_url\": \"git@github.com:ursa-labs/ursabot.git\",\n+        \"stargazers_count\": 1,\n+        \"stargazers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/stargazers\",\n+        \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\",\n+        \"subscribers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscribers\",\n+        \"subscription_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscription\",\n+        \"svn_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/tags\",\n+        \"teams_url\": \"https://api.github.com/repos/ursa-labs/ursabot/teams\",\n+        \"trees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\",\n+        \"updated_at\": \"2019-04-04T17:49:10Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"watchers\": 1,\n+        \"watchers_count\": 1\n+    },\n+    \"sender\": {\n+        \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+        \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+        \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+        \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+        \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+        \"gravatar_id\": \"\",\n+        \"html_url\": \"https://github.com/kszucs\",\n+        \"id\": 961747,\n+        \"login\": \"kszucs\",\n+        \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+        \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+        \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+        \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+        \"site_admin\": false,\n+        \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+        \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+        \"type\": \"User\",\n+        \"url\": \"https://api.github.com/users/kszucs\"\n+    }\n+}"
+  },
+  {
+    "sha": "7ef554e333327f0e62aa1fd76b4b17844a39adeb",
+    "filename": "ursabot/tests/fixtures/issue-comment-by-ursabot.json",
+    "status": "added",
+    "additions": 212,
+    "deletions": 0,
+    "changes": 212,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/issue-comment-by-ursabot.json",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/issue-comment-by-ursabot.json",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-by-ursabot.json?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -0,0 +1,212 @@\n+{\n+    \"action\": \"created\",\n+    \"comment\": {\n+        \"author_association\": \"NONE\",\n+        \"body\": \"Unknown command \\\"\\\"\",\n+        \"created_at\": \"2019-04-05T11:35:47Z\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480243815\",\n+        \"id\": 480243815,\n+        \"issue_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"node_id\": \"MDEyOklzc3VlQ29tbWVudDQ4MDI0MzgxNQ==\",\n+        \"updated_at\": \"2019-04-05T11:35:47Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480243815\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/49275095?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursabot/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursabot/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursabot/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursabot/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursabot\",\n+            \"id\": 49275095,\n+            \"login\": \"ursabot\",\n+            \"node_id\": \"MDQ6VXNlcjQ5Mjc1MDk1\",\n+            \"organizations_url\": \"https://api.github.com/users/ursabot/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursabot/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursabot/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursabot/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursabot/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/ursabot\"\n+        }\n+    },\n+    \"issue\": {\n+        \"assignee\": null,\n+        \"assignees\": [],\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"\",\n+        \"closed_at\": null,\n+        \"comments\": 2,\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\",\n+        \"created_at\": \"2019-04-05T11:22:15Z\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/events\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+        \"id\": 429706959,\n+        \"labels\": [],\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}\",\n+        \"locked\": false,\n+        \"milestone\": null,\n+        \"node_id\": \"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\",\n+        \"number\": 26,\n+        \"pull_request\": {\n+            \"diff_url\": \"https://github.com/ursa-labs/ursabot/pull/26.diff\",\n+            \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+            \"patch_url\": \"https://github.com/ursa-labs/ursabot/pull/26.patch\",\n+            \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\"\n+        },\n+        \"repository_url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"state\": \"open\",\n+        \"title\": \"Unittests for GithubHook\",\n+        \"updated_at\": \"2019-04-05T11:35:47Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"organization\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+        \"description\": \"Innovation lab for open source data science tools, powered by Apache Arrow\",\n+        \"events_url\": \"https://api.github.com/orgs/ursa-labs/events\",\n+        \"hooks_url\": \"https://api.github.com/orgs/ursa-labs/hooks\",\n+        \"id\": 46514972,\n+        \"issues_url\": \"https://api.github.com/orgs/ursa-labs/issues\",\n+        \"login\": \"ursa-labs\",\n+        \"members_url\": \"https://api.github.com/orgs/ursa-labs/members{/member}\",\n+        \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+        \"public_members_url\": \"https://api.github.com/orgs/ursa-labs/public_members{/member}\",\n+        \"repos_url\": \"https://api.github.com/orgs/ursa-labs/repos\",\n+        \"url\": \"https://api.github.com/orgs/ursa-labs\"\n+    },\n+    \"repository\": {\n+        \"archive_url\": \"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\",\n+        \"archived\": false,\n+        \"assignees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\",\n+        \"blobs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\",\n+        \"branches_url\": \"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\",\n+        \"clone_url\": \"https://github.com/ursa-labs/ursabot.git\",\n+        \"collaborators_url\": \"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\",\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\",\n+        \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\",\n+        \"compare_url\": \"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\",\n+        \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\",\n+        \"contributors_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contributors\",\n+        \"created_at\": \"2019-02-04T15:40:31Z\",\n+        \"default_branch\": \"master\",\n+        \"deployments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/deployments\",\n+        \"description\": null,\n+        \"disabled\": false,\n+        \"downloads_url\": \"https://api.github.com/repos/ursa-labs/ursabot/downloads\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/events\",\n+        \"fork\": false,\n+        \"forks\": 0,\n+        \"forks_count\": 0,\n+        \"forks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/forks\",\n+        \"full_name\": \"ursa-labs/ursabot\",\n+        \"git_commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\",\n+        \"git_refs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\",\n+        \"git_tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\",\n+        \"git_url\": \"git://github.com/ursa-labs/ursabot.git\",\n+        \"has_downloads\": true,\n+        \"has_issues\": true,\n+        \"has_pages\": false,\n+        \"has_projects\": true,\n+        \"has_wiki\": true,\n+        \"homepage\": null,\n+        \"hooks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/hooks\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"id\": 169101701,\n+        \"issue_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\",\n+        \"issue_events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\",\n+        \"issues_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\",\n+        \"keys_url\": \"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\",\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\",\n+        \"language\": \"Jupyter Notebook\",\n+        \"languages_url\": \"https://api.github.com/repos/ursa-labs/ursabot/languages\",\n+        \"license\": null,\n+        \"merges_url\": \"https://api.github.com/repos/ursa-labs/ursabot/merges\",\n+        \"milestones_url\": \"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\",\n+        \"mirror_url\": null,\n+        \"name\": \"ursabot\",\n+        \"node_id\": \"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\",\n+        \"notifications_url\": \"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\",\n+        \"open_issues\": 19,\n+        \"open_issues_count\": 19,\n+        \"owner\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursa-labs\",\n+            \"id\": 46514972,\n+            \"login\": \"ursa-labs\",\n+            \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+            \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+            \"type\": \"Organization\",\n+            \"url\": \"https://api.github.com/users/ursa-labs\"\n+        },\n+        \"private\": false,\n+        \"pulls_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\",\n+        \"pushed_at\": \"2019-04-05T11:22:16Z\",\n+        \"releases_url\": \"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\",\n+        \"size\": 892,\n+        \"ssh_url\": \"git@github.com:ursa-labs/ursabot.git\",\n+        \"stargazers_count\": 1,\n+        \"stargazers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/stargazers\",\n+        \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\",\n+        \"subscribers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscribers\",\n+        \"subscription_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscription\",\n+        \"svn_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/tags\",\n+        \"teams_url\": \"https://api.github.com/repos/ursa-labs/ursabot/teams\",\n+        \"trees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\",\n+        \"updated_at\": \"2019-04-04T17:49:10Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"watchers\": 1,\n+        \"watchers_count\": 1\n+    },\n+    \"sender\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/49275095?v=4\",\n+        \"events_url\": \"https://api.github.com/users/ursabot/events{/privacy}\",\n+        \"followers_url\": \"https://api.github.com/users/ursabot/followers\",\n+        \"following_url\": \"https://api.github.com/users/ursabot/following{/other_user}\",\n+        \"gists_url\": \"https://api.github.com/users/ursabot/gists{/gist_id}\",\n+        \"gravatar_id\": \"\",\n+        \"html_url\": \"https://github.com/ursabot\",\n+        \"id\": 49275095,\n+        \"login\": \"ursabot\",\n+        \"node_id\": \"MDQ6VXNlcjQ5Mjc1MDk1\",\n+        \"organizations_url\": \"https://api.github.com/users/ursabot/orgs\",\n+        \"received_events_url\": \"https://api.github.com/users/ursabot/received_events\",\n+        \"repos_url\": \"https://api.github.com/users/ursabot/repos\",\n+        \"site_admin\": false,\n+        \"starred_url\": \"https://api.github.com/users/ursabot/starred{/owner}{/repo}\",\n+        \"subscriptions_url\": \"https://api.github.com/users/ursabot/subscriptions\",\n+        \"type\": \"User\",\n+        \"url\": \"https://api.github.com/users/ursabot\"\n+    }\n+}"
+  },
+  {
+    "sha": "a8082dbc91fdfe815b795e49ec10e49000771ef5",
+    "filename": "ursabot/tests/fixtures/issue-comment-not-mentioning-ursabot.json",
+    "status": "added",
+    "additions": 212,
+    "deletions": 0,
+    "changes": 212,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/issue-comment-not-mentioning-ursabot.json",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/issue-comment-not-mentioning-ursabot.json",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-not-mentioning-ursabot.json?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -0,0 +1,212 @@\n+{\n+    \"action\": \"created\",\n+    \"comment\": {\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"bear is no game\",\n+        \"created_at\": \"2019-04-05T11:26:56Z\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480241727\",\n+        \"id\": 480241727,\n+        \"issue_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"node_id\": \"MDEyOklzc3VlQ29tbWVudDQ4MDI0MTcyNw==\",\n+        \"updated_at\": \"2019-04-05T11:26:56Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480241727\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"issue\": {\n+        \"assignee\": null,\n+        \"assignees\": [],\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"\",\n+        \"closed_at\": null,\n+        \"comments\": 0,\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\",\n+        \"created_at\": \"2019-04-05T11:22:15Z\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/events\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+        \"id\": 429706959,\n+        \"labels\": [],\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}\",\n+        \"locked\": false,\n+        \"milestone\": null,\n+        \"node_id\": \"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\",\n+        \"number\": 26,\n+        \"pull_request\": {\n+            \"diff_url\": \"https://github.com/ursa-labs/ursabot/pull/26.diff\",\n+            \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+            \"patch_url\": \"https://github.com/ursa-labs/ursabot/pull/26.patch\",\n+            \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\"\n+        },\n+        \"repository_url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"state\": \"open\",\n+        \"title\": \"Unittests for GithubHook\",\n+        \"updated_at\": \"2019-04-05T11:26:56Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"organization\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+        \"description\": \"Innovation lab for open source data science tools, powered by Apache Arrow\",\n+        \"events_url\": \"https://api.github.com/orgs/ursa-labs/events\",\n+        \"hooks_url\": \"https://api.github.com/orgs/ursa-labs/hooks\",\n+        \"id\": 46514972,\n+        \"issues_url\": \"https://api.github.com/orgs/ursa-labs/issues\",\n+        \"login\": \"ursa-labs\",\n+        \"members_url\": \"https://api.github.com/orgs/ursa-labs/members{/member}\",\n+        \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+        \"public_members_url\": \"https://api.github.com/orgs/ursa-labs/public_members{/member}\",\n+        \"repos_url\": \"https://api.github.com/orgs/ursa-labs/repos\",\n+        \"url\": \"https://api.github.com/orgs/ursa-labs\"\n+    },\n+    \"repository\": {\n+        \"archive_url\": \"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\",\n+        \"archived\": false,\n+        \"assignees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\",\n+        \"blobs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\",\n+        \"branches_url\": \"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\",\n+        \"clone_url\": \"https://github.com/ursa-labs/ursabot.git\",\n+        \"collaborators_url\": \"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\",\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\",\n+        \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\",\n+        \"compare_url\": \"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\",\n+        \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\",\n+        \"contributors_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contributors\",\n+        \"created_at\": \"2019-02-04T15:40:31Z\",\n+        \"default_branch\": \"master\",\n+        \"deployments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/deployments\",\n+        \"description\": null,\n+        \"disabled\": false,\n+        \"downloads_url\": \"https://api.github.com/repos/ursa-labs/ursabot/downloads\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/events\",\n+        \"fork\": false,\n+        \"forks\": 0,\n+        \"forks_count\": 0,\n+        \"forks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/forks\",\n+        \"full_name\": \"ursa-labs/ursabot\",\n+        \"git_commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\",\n+        \"git_refs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\",\n+        \"git_tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\",\n+        \"git_url\": \"git://github.com/ursa-labs/ursabot.git\",\n+        \"has_downloads\": true,\n+        \"has_issues\": true,\n+        \"has_pages\": false,\n+        \"has_projects\": true,\n+        \"has_wiki\": true,\n+        \"homepage\": null,\n+        \"hooks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/hooks\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"id\": 169101701,\n+        \"issue_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\",\n+        \"issue_events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\",\n+        \"issues_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\",\n+        \"keys_url\": \"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\",\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\",\n+        \"language\": \"Jupyter Notebook\",\n+        \"languages_url\": \"https://api.github.com/repos/ursa-labs/ursabot/languages\",\n+        \"license\": null,\n+        \"merges_url\": \"https://api.github.com/repos/ursa-labs/ursabot/merges\",\n+        \"milestones_url\": \"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\",\n+        \"mirror_url\": null,\n+        \"name\": \"ursabot\",\n+        \"node_id\": \"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\",\n+        \"notifications_url\": \"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\",\n+        \"open_issues\": 19,\n+        \"open_issues_count\": 19,\n+        \"owner\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursa-labs\",\n+            \"id\": 46514972,\n+            \"login\": \"ursa-labs\",\n+            \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+            \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+            \"type\": \"Organization\",\n+            \"url\": \"https://api.github.com/users/ursa-labs\"\n+        },\n+        \"private\": false,\n+        \"pulls_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\",\n+        \"pushed_at\": \"2019-04-05T11:22:16Z\",\n+        \"releases_url\": \"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\",\n+        \"size\": 892,\n+        \"ssh_url\": \"git@github.com:ursa-labs/ursabot.git\",\n+        \"stargazers_count\": 1,\n+        \"stargazers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/stargazers\",\n+        \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\",\n+        \"subscribers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscribers\",\n+        \"subscription_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscription\",\n+        \"svn_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/tags\",\n+        \"teams_url\": \"https://api.github.com/repos/ursa-labs/ursabot/teams\",\n+        \"trees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\",\n+        \"updated_at\": \"2019-04-04T17:49:10Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"watchers\": 1,\n+        \"watchers_count\": 1\n+    },\n+    \"sender\": {\n+        \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+        \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+        \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+        \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+        \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+        \"gravatar_id\": \"\",\n+        \"html_url\": \"https://github.com/kszucs\",\n+        \"id\": 961747,\n+        \"login\": \"kszucs\",\n+        \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+        \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+        \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+        \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+        \"site_admin\": false,\n+        \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+        \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+        \"type\": \"User\",\n+        \"url\": \"https://api.github.com/users/kszucs\"\n+    }\n+}"
+  },
+  {
+    "sha": "2770e29ba9086394455315e590c0b433d08e437e",
+    "filename": "ursabot/tests/fixtures/issue-comment-with-empty-command.json",
+    "status": "added",
+    "additions": 212,
+    "deletions": 0,
+    "changes": 212,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/issue-comment-with-empty-command.json",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/issue-comment-with-empty-command.json",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-with-empty-command.json?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -0,0 +1,212 @@\n+{\n+    \"action\": \"created\",\n+    \"comment\": {\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"@ursabot \",\n+        \"created_at\": \"2019-04-05T11:35:46Z\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480243811\",\n+        \"id\": 480243811,\n+        \"issue_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"node_id\": \"MDEyOklzc3VlQ29tbWVudDQ4MDI0MzgxMQ==\",\n+        \"updated_at\": \"2019-04-05T11:35:46Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480243811\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"issue\": {\n+        \"assignee\": null,\n+        \"assignees\": [],\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"\",\n+        \"closed_at\": null,\n+        \"comments\": 1,\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\",\n+        \"created_at\": \"2019-04-05T11:22:15Z\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/events\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+        \"id\": 429706959,\n+        \"labels\": [],\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}\",\n+        \"locked\": false,\n+        \"milestone\": null,\n+        \"node_id\": \"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\",\n+        \"number\": 26,\n+        \"pull_request\": {\n+            \"diff_url\": \"https://github.com/ursa-labs/ursabot/pull/26.diff\",\n+            \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+            \"patch_url\": \"https://github.com/ursa-labs/ursabot/pull/26.patch\",\n+            \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\"\n+        },\n+        \"repository_url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"state\": \"open\",\n+        \"title\": \"Unittests for GithubHook\",\n+        \"updated_at\": \"2019-04-05T11:35:46Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"organization\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+        \"description\": \"Innovation lab for open source data science tools, powered by Apache Arrow\",\n+        \"events_url\": \"https://api.github.com/orgs/ursa-labs/events\",\n+        \"hooks_url\": \"https://api.github.com/orgs/ursa-labs/hooks\",\n+        \"id\": 46514972,\n+        \"issues_url\": \"https://api.github.com/orgs/ursa-labs/issues\",\n+        \"login\": \"ursa-labs\",\n+        \"members_url\": \"https://api.github.com/orgs/ursa-labs/members{/member}\",\n+        \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+        \"public_members_url\": \"https://api.github.com/orgs/ursa-labs/public_members{/member}\",\n+        \"repos_url\": \"https://api.github.com/orgs/ursa-labs/repos\",\n+        \"url\": \"https://api.github.com/orgs/ursa-labs\"\n+    },\n+    \"repository\": {\n+        \"archive_url\": \"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\",\n+        \"archived\": false,\n+        \"assignees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\",\n+        \"blobs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\",\n+        \"branches_url\": \"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\",\n+        \"clone_url\": \"https://github.com/ursa-labs/ursabot.git\",\n+        \"collaborators_url\": \"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\",\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\",\n+        \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\",\n+        \"compare_url\": \"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\",\n+        \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\",\n+        \"contributors_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contributors\",\n+        \"created_at\": \"2019-02-04T15:40:31Z\",\n+        \"default_branch\": \"master\",\n+        \"deployments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/deployments\",\n+        \"description\": null,\n+        \"disabled\": false,\n+        \"downloads_url\": \"https://api.github.com/repos/ursa-labs/ursabot/downloads\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/events\",\n+        \"fork\": false,\n+        \"forks\": 0,\n+        \"forks_count\": 0,\n+        \"forks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/forks\",\n+        \"full_name\": \"ursa-labs/ursabot\",\n+        \"git_commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\",\n+        \"git_refs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\",\n+        \"git_tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\",\n+        \"git_url\": \"git://github.com/ursa-labs/ursabot.git\",\n+        \"has_downloads\": true,\n+        \"has_issues\": true,\n+        \"has_pages\": false,\n+        \"has_projects\": true,\n+        \"has_wiki\": true,\n+        \"homepage\": null,\n+        \"hooks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/hooks\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"id\": 169101701,\n+        \"issue_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\",\n+        \"issue_events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\",\n+        \"issues_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\",\n+        \"keys_url\": \"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\",\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\",\n+        \"language\": \"Jupyter Notebook\",\n+        \"languages_url\": \"https://api.github.com/repos/ursa-labs/ursabot/languages\",\n+        \"license\": null,\n+        \"merges_url\": \"https://api.github.com/repos/ursa-labs/ursabot/merges\",\n+        \"milestones_url\": \"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\",\n+        \"mirror_url\": null,\n+        \"name\": \"ursabot\",\n+        \"node_id\": \"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\",\n+        \"notifications_url\": \"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\",\n+        \"open_issues\": 19,\n+        \"open_issues_count\": 19,\n+        \"owner\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursa-labs\",\n+            \"id\": 46514972,\n+            \"login\": \"ursa-labs\",\n+            \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+            \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+            \"type\": \"Organization\",\n+            \"url\": \"https://api.github.com/users/ursa-labs\"\n+        },\n+        \"private\": false,\n+        \"pulls_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\",\n+        \"pushed_at\": \"2019-04-05T11:22:16Z\",\n+        \"releases_url\": \"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\",\n+        \"size\": 892,\n+        \"ssh_url\": \"git@github.com:ursa-labs/ursabot.git\",\n+        \"stargazers_count\": 1,\n+        \"stargazers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/stargazers\",\n+        \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\",\n+        \"subscribers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscribers\",\n+        \"subscription_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscription\",\n+        \"svn_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/tags\",\n+        \"teams_url\": \"https://api.github.com/repos/ursa-labs/ursabot/teams\",\n+        \"trees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\",\n+        \"updated_at\": \"2019-04-04T17:49:10Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"watchers\": 1,\n+        \"watchers_count\": 1\n+    },\n+    \"sender\": {\n+        \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+        \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+        \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+        \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+        \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+        \"gravatar_id\": \"\",\n+        \"html_url\": \"https://github.com/kszucs\",\n+        \"id\": 961747,\n+        \"login\": \"kszucs\",\n+        \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+        \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+        \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+        \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+        \"site_admin\": false,\n+        \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+        \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+        \"type\": \"User\",\n+        \"url\": \"https://api.github.com/users/kszucs\"\n+    }\n+}"
+  },
+  {
+    "sha": "b7de8d838332944101812ee2a46c08dd0144efe3",
+    "filename": "ursabot/tests/fixtures/issue-comment-without-pull-request.json",
+    "status": "added",
+    "additions": 206,
+    "deletions": 0,
+    "changes": 206,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/issue-comment-without-pull-request.json",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/issue-comment-without-pull-request.json",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-without-pull-request.json?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -0,0 +1,206 @@\n+{\n+    \"action\": \"created\",\n+    \"comment\": {\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"@ursabot build\",\n+        \"created_at\": \"2019-04-05T13:07:57Z\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/issues/19#issuecomment-480268708\",\n+        \"id\": 480268708,\n+        \"issue_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/19\",\n+        \"node_id\": \"MDEyOklzc3VlQ29tbWVudDQ4MDI2ODcwOA==\",\n+        \"updated_at\": \"2019-04-05T13:07:57Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480268708\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"issue\": {\n+        \"assignee\": null,\n+        \"assignees\": [],\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"\",\n+        \"closed_at\": null,\n+        \"comments\": 5,\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/19/comments\",\n+        \"created_at\": \"2019-04-02T09:56:41Z\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/19/events\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/issues/19\",\n+        \"id\": 428131685,\n+        \"labels\": [],\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/19/labels{/name}\",\n+        \"locked\": false,\n+        \"milestone\": null,\n+        \"node_id\": \"MDU6SXNzdWU0MjgxMzE2ODU=\",\n+        \"number\": 19,\n+        \"repository_url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"state\": \"open\",\n+        \"title\": \"Build ursabot itself via ursabot\",\n+        \"updated_at\": \"2019-04-05T13:07:57Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/19\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"organization\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+        \"description\": \"Innovation lab for open source data science tools, powered by Apache Arrow\",\n+        \"events_url\": \"https://api.github.com/orgs/ursa-labs/events\",\n+        \"hooks_url\": \"https://api.github.com/orgs/ursa-labs/hooks\",\n+        \"id\": 46514972,\n+        \"issues_url\": \"https://api.github.com/orgs/ursa-labs/issues\",\n+        \"login\": \"ursa-labs\",\n+        \"members_url\": \"https://api.github.com/orgs/ursa-labs/members{/member}\",\n+        \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+        \"public_members_url\": \"https://api.github.com/orgs/ursa-labs/public_members{/member}\",\n+        \"repos_url\": \"https://api.github.com/orgs/ursa-labs/repos\",\n+        \"url\": \"https://api.github.com/orgs/ursa-labs\"\n+    },\n+    \"repository\": {\n+        \"archive_url\": \"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\",\n+        \"archived\": false,\n+        \"assignees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\",\n+        \"blobs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\",\n+        \"branches_url\": \"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\",\n+        \"clone_url\": \"https://github.com/ursa-labs/ursabot.git\",\n+        \"collaborators_url\": \"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\",\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\",\n+        \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\",\n+        \"compare_url\": \"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\",\n+        \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\",\n+        \"contributors_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contributors\",\n+        \"created_at\": \"2019-02-04T15:40:31Z\",\n+        \"default_branch\": \"master\",\n+        \"deployments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/deployments\",\n+        \"description\": null,\n+        \"disabled\": false,\n+        \"downloads_url\": \"https://api.github.com/repos/ursa-labs/ursabot/downloads\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/events\",\n+        \"fork\": false,\n+        \"forks\": 0,\n+        \"forks_count\": 0,\n+        \"forks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/forks\",\n+        \"full_name\": \"ursa-labs/ursabot\",\n+        \"git_commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\",\n+        \"git_refs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\",\n+        \"git_tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\",\n+        \"git_url\": \"git://github.com/ursa-labs/ursabot.git\",\n+        \"has_downloads\": true,\n+        \"has_issues\": true,\n+        \"has_pages\": false,\n+        \"has_projects\": true,\n+        \"has_wiki\": true,\n+        \"homepage\": null,\n+        \"hooks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/hooks\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"id\": 169101701,\n+        \"issue_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\",\n+        \"issue_events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\",\n+        \"issues_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\",\n+        \"keys_url\": \"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\",\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\",\n+        \"language\": \"Jupyter Notebook\",\n+        \"languages_url\": \"https://api.github.com/repos/ursa-labs/ursabot/languages\",\n+        \"license\": null,\n+        \"merges_url\": \"https://api.github.com/repos/ursa-labs/ursabot/merges\",\n+        \"milestones_url\": \"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\",\n+        \"mirror_url\": null,\n+        \"name\": \"ursabot\",\n+        \"node_id\": \"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\",\n+        \"notifications_url\": \"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\",\n+        \"open_issues\": 19,\n+        \"open_issues_count\": 19,\n+        \"owner\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursa-labs\",\n+            \"id\": 46514972,\n+            \"login\": \"ursa-labs\",\n+            \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+            \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+            \"type\": \"Organization\",\n+            \"url\": \"https://api.github.com/users/ursa-labs\"\n+        },\n+        \"private\": false,\n+        \"pulls_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\",\n+        \"pushed_at\": \"2019-04-05T12:01:40Z\",\n+        \"releases_url\": \"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\",\n+        \"size\": 898,\n+        \"ssh_url\": \"git@github.com:ursa-labs/ursabot.git\",\n+        \"stargazers_count\": 1,\n+        \"stargazers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/stargazers\",\n+        \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\",\n+        \"subscribers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscribers\",\n+        \"subscription_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscription\",\n+        \"svn_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/tags\",\n+        \"teams_url\": \"https://api.github.com/repos/ursa-labs/ursabot/teams\",\n+        \"trees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\",\n+        \"updated_at\": \"2019-04-04T17:49:10Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"watchers\": 1,\n+        \"watchers_count\": 1\n+    },\n+    \"sender\": {\n+        \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+        \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+        \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+        \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+        \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+        \"gravatar_id\": \"\",\n+        \"html_url\": \"https://github.com/kszucs\",\n+        \"id\": 961747,\n+        \"login\": \"kszucs\",\n+        \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+        \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+        \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+        \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+        \"site_admin\": false,\n+        \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+        \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+        \"type\": \"User\",\n+        \"url\": \"https://api.github.com/users/kszucs\"\n+    }\n+}"
+  },
+  {
+    "sha": "33e051455e866fb4774a16ae02ad40dcf9e6a7fd",
+    "filename": "ursabot/tests/fixtures/pull-request-26-commit.json",
+    "status": "added",
+    "additions": 158,
+    "deletions": 0,
+    "changes": 158,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/pull-request-26-commit.json",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/pull-request-26-commit.json",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/pull-request-26-commit.json?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -0,0 +1,158 @@\n+{\n+  \"sha\": \"2705da2b616b98fa6010a25813c5a7a27456f71d\",\n+  \"node_id\": \"MDY6Q29tbWl0MTY5MTAxNzAxOjI3MDVkYTJiNjE2Yjk4ZmE2MDEwYTI1ODEzYzVhN2EyNzQ1NmY3MWQ=\",\n+  \"commit\": {\n+    \"author\": {\n+      \"name\": \"Krisztián Szűcs\",\n+      \"email\": \"szucs.krisztian@gmail.com\",\n+      \"date\": \"2019-04-05T12:01:31Z\"\n+    },\n+    \"committer\": {\n+      \"name\": \"Krisztián Szűcs\",\n+      \"email\": \"szucs.krisztian@gmail.com\",\n+      \"date\": \"2019-04-05T12:01:31Z\"\n+    },\n+    \"message\": \"add recorded event requests\",\n+    \"tree\": {\n+      \"sha\": \"16a7bb186833a67e9c2d84a58393503b85500ceb\",\n+      \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees/16a7bb186833a67e9c2d84a58393503b85500ceb\"\n+    },\n+    \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits/2705da2b616b98fa6010a25813c5a7a27456f71d\",\n+    \"comment_count\": 0,\n+    \"verification\": {\n+      \"verified\": true,\n+      \"reason\": \"valid\",\n+      \"signature\": \"-----BEGIN PGP SIGNATURE-----\\n\\niQFOBAABCAA4FiEEOOW2r8dr6sA77zHlgjqBKYe1QKUFAlynQ58aHHN6dWNzLmty\\naXN6dGlhbkBnbWFpbC5jb20ACgkQgjqBKYe1QKUYKwf6AiXDMaLqNLNSjRY7lIXX\\nudioewz0hSb4bgIXBv30nswu9CoOA0+mHCokEVtZhYbXzXDsZ1KJrilSC4j+Ws4q\\nkRGA6iEmrne2HcSKNZXzcVnwV9zpwKxlVh2QCTNb1PuOYFBLH0kwE704uWIWMGDN\\nbo8cjQPwegePCRguCvPh/5wa5J3uiq5gmJLG6bC/d1XYE+FJVtlnyzqzLMIryGKe\\ntIciw+wwkF413Q/YVbZ49vLUeCX9H8PHC4mZYGDWuvjFW1WTfkjK5bAH+oaTVM6h\\n350I5ZFloHmMA/QeRge5qFxXoEBMDGiXHHktzYZDXnliFOQNxzqwirA5lQQ6LRSS\\naQ==\\n=7rqi\\n-----END PGP SIGNATURE-----\",\n+      \"payload\": \"tree 16a7bb186833a67e9c2d84a58393503b85500ceb\\nparent 446ae69b9385e8d0f40aa9595f723d34383af2f7\\nauthor Krisztián Szűcs <szucs.krisztian@gmail.com> 1554465691 +0200\\ncommitter Krisztián Szűcs <szucs.krisztian@gmail.com> 1554465691 +0200\\n\\nadd recorded event requests\\n\"\n+    }\n+  },\n+  \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits/2705da2b616b98fa6010a25813c5a7a27456f71d\",\n+  \"html_url\": \"https://github.com/ursa-labs/ursabot/commit/2705da2b616b98fa6010a25813c5a7a27456f71d\",\n+  \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits/2705da2b616b98fa6010a25813c5a7a27456f71d/comments\",\n+  \"author\": {\n+    \"login\": \"kszucs\",\n+    \"id\": 961747,\n+    \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+    \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+    \"gravatar_id\": \"\",\n+    \"url\": \"https://api.github.com/users/kszucs\",\n+    \"html_url\": \"https://github.com/kszucs\",\n+    \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+    \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+    \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+    \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+    \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+    \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+    \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+    \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+    \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+    \"type\": \"User\",\n+    \"site_admin\": false\n+  },\n+  \"committer\": {\n+    \"login\": \"kszucs\",\n+    \"id\": 961747,\n+    \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+    \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+    \"gravatar_id\": \"\",\n+    \"url\": \"https://api.github.com/users/kszucs\",\n+    \"html_url\": \"https://github.com/kszucs\",\n+    \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+    \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+    \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+    \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+    \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+    \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+    \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+    \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+    \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+    \"type\": \"User\",\n+    \"site_admin\": false\n+  },\n+  \"parents\": [\n+    {\n+      \"sha\": \"446ae69b9385e8d0f40aa9595f723d34383af2f7\",\n+      \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits/446ae69b9385e8d0f40aa9595f723d34383af2f7\",\n+      \"html_url\": \"https://github.com/ursa-labs/ursabot/commit/446ae69b9385e8d0f40aa9595f723d34383af2f7\"\n+    }\n+  ],\n+  \"stats\": {\n+    \"total\": 1062,\n+    \"additions\": 1058,\n+    \"deletions\": 4\n+  },\n+  \"files\": [\n+    {\n+      \"sha\": \"dfae6eeaef384ae6180c6302a58b49e39982dc33\",\n+      \"filename\": \"ursabot/tests/fixtures/issue-comment-build-command.json\",\n+      \"status\": \"added\",\n+      \"additions\": 212,\n+      \"deletions\": 0,\n+      \"changes\": 212,\n+      \"blob_url\": \"https://github.com/ursa-labs/ursabot/blob/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-build-command.json\",\n+      \"raw_url\": \"https://github.com/ursa-labs/ursabot/raw/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-build-command.json\",\n+      \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-build-command.json?ref=2705da2b616b98fa6010a25813c5a7a27456f71d\",\n+      \"patch\": \"@@ -0,0 +1,212 @@\\n+{\\n+    \\\"action\\\": \\\"created\\\",\\n+    \\\"comment\\\": {\\n+        \\\"author_association\\\": \\\"NONE\\\",\\n+        \\\"body\\\": \\\"I've successfully started builds for this PR\\\",\\n+        \\\"created_at\\\": \\\"2019-04-05T11:55:44Z\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480248730\\\",\\n+        \\\"id\\\": 480248730,\\n+        \\\"issue_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26\\\",\\n+        \\\"node_id\\\": \\\"MDEyOklzc3VlQ29tbWVudDQ4MDI0ODczMA==\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-05T11:55:44Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480248730\\\",\\n+        \\\"user\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/49275095?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/ursabot/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/ursabot/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/ursabot/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/ursabot/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/ursabot\\\",\\n+            \\\"id\\\": 49275095,\\n+            \\\"login\\\": \\\"ursabot\\\",\\n+            \\\"node_id\\\": \\\"MDQ6VXNlcjQ5Mjc1MDk1\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/ursabot/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/ursabot/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/ursabot/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/ursabot/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/ursabot/subscriptions\\\",\\n+            \\\"type\\\": \\\"User\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/ursabot\\\"\\n+        }\\n+    },\\n+    \\\"issue\\\": {\\n+        \\\"assignee\\\": null,\\n+        \\\"assignees\\\": [],\\n+        \\\"author_association\\\": \\\"MEMBER\\\",\\n+        \\\"body\\\": \\\"\\\",\\n+        \\\"closed_at\\\": null,\\n+        \\\"comments\\\": 4,\\n+        \\\"comments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\\\",\\n+        \\\"created_at\\\": \\\"2019-04-05T11:22:15Z\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26/events\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26\\\",\\n+        \\\"id\\\": 429706959,\\n+        \\\"labels\\\": [],\\n+        \\\"labels_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}\\\",\\n+        \\\"locked\\\": false,\\n+        \\\"milestone\\\": null,\\n+        \\\"node_id\\\": \\\"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\\\",\\n+        \\\"number\\\": 26,\\n+        \\\"pull_request\\\": {\\n+            \\\"diff_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26.diff\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26\\\",\\n+            \\\"patch_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26.patch\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\\\"\\n+        },\\n+        \\\"repository_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot\\\",\\n+        \\\"state\\\": \\\"open\\\",\\n+        \\\"title\\\": \\\"Unittests for GithubHook\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-05T11:55:44Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26\\\",\\n+        \\\"user\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars1.githubusercontent.com/u/961747?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/kszucs/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/kszucs/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/kszucs/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/kszucs/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/kszucs\\\",\\n+            \\\"id\\\": 961747,\\n+            \\\"login\\\": \\\"kszucs\\\",\\n+            \\\"node_id\\\": \\\"MDQ6VXNlcjk2MTc0Nw==\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/kszucs/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/kszucs/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/kszucs/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/kszucs/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/kszucs/subscriptions\\\",\\n+            \\\"type\\\": \\\"User\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/kszucs\\\"\\n+        }\\n+    },\\n+    \\\"organization\\\": {\\n+        \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/46514972?v=4\\\",\\n+        \\\"description\\\": \\\"Innovation lab for open source data science tools, powered by Apache Arrow\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/orgs/ursa-labs/events\\\",\\n+        \\\"hooks_url\\\": \\\"https://api.github.com/orgs/ursa-labs/hooks\\\",\\n+        \\\"id\\\": 46514972,\\n+        \\\"issues_url\\\": \\\"https://api.github.com/orgs/ursa-labs/issues\\\",\\n+        \\\"login\\\": \\\"ursa-labs\\\",\\n+        \\\"members_url\\\": \\\"https://api.github.com/orgs/ursa-labs/members{/member}\\\",\\n+        \\\"node_id\\\": \\\"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\\\",\\n+        \\\"public_members_url\\\": \\\"https://api.github.com/orgs/ursa-labs/public_members{/member}\\\",\\n+        \\\"repos_url\\\": \\\"https://api.github.com/orgs/ursa-labs/repos\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/orgs/ursa-labs\\\"\\n+    },\\n+    \\\"repository\\\": {\\n+        \\\"archive_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\\\",\\n+        \\\"archived\\\": false,\\n+        \\\"assignees_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\\\",\\n+        \\\"blobs_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\\\",\\n+        \\\"branches_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\\\",\\n+        \\\"clone_url\\\": \\\"https://github.com/ursa-labs/ursabot.git\\\",\\n+        \\\"collaborators_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\\\",\\n+        \\\"comments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\\\",\\n+        \\\"commits_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\\\",\\n+        \\\"compare_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\\\",\\n+        \\\"contents_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\\\",\\n+        \\\"contributors_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/contributors\\\",\\n+        \\\"created_at\\\": \\\"2019-02-04T15:40:31Z\\\",\\n+        \\\"default_branch\\\": \\\"master\\\",\\n+        \\\"deployments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/deployments\\\",\\n+        \\\"description\\\": null,\\n+        \\\"disabled\\\": false,\\n+        \\\"downloads_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/downloads\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/events\\\",\\n+        \\\"fork\\\": false,\\n+        \\\"forks\\\": 0,\\n+        \\\"forks_count\\\": 0,\\n+        \\\"forks_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/forks\\\",\\n+        \\\"full_name\\\": \\\"ursa-labs/ursabot\\\",\\n+        \\\"git_commits_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\\\",\\n+        \\\"git_refs_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\\\",\\n+        \\\"git_tags_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\\\",\\n+        \\\"git_url\\\": \\\"git://github.com/ursa-labs/ursabot.git\\\",\\n+        \\\"has_downloads\\\": true,\\n+        \\\"has_issues\\\": true,\\n+        \\\"has_pages\\\": false,\\n+        \\\"has_projects\\\": true,\\n+        \\\"has_wiki\\\": true,\\n+        \\\"homepage\\\": null,\\n+        \\\"hooks_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/hooks\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot\\\",\\n+        \\\"id\\\": 169101701,\\n+        \\\"issue_comment_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\\\",\\n+        \\\"issue_events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\\\",\\n+        \\\"issues_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\\\",\\n+        \\\"keys_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\\\",\\n+        \\\"labels_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\\\",\\n+        \\\"language\\\": \\\"Jupyter Notebook\\\",\\n+        \\\"languages_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/languages\\\",\\n+        \\\"license\\\": null,\\n+        \\\"merges_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/merges\\\",\\n+        \\\"milestones_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\\\",\\n+        \\\"mirror_url\\\": null,\\n+        \\\"name\\\": \\\"ursabot\\\",\\n+        \\\"node_id\\\": \\\"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\\\",\\n+        \\\"notifications_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\\\",\\n+        \\\"open_issues\\\": 19,\\n+        \\\"open_issues_count\\\": 19,\\n+        \\\"owner\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/46514972?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/ursa-labs/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/ursa-labs/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/ursa-labs/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/ursa-labs/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/ursa-labs\\\",\\n+            \\\"id\\\": 46514972,\\n+            \\\"login\\\": \\\"ursa-labs\\\",\\n+            \\\"node_id\\\": \\\"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/ursa-labs/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/ursa-labs/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/ursa-labs/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/ursa-labs/subscriptions\\\",\\n+            \\\"type\\\": \\\"Organization\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/ursa-labs\\\"\\n+        },\\n+        \\\"private\\\": false,\\n+        \\\"pulls_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\\\",\\n+        \\\"pushed_at\\\": \\\"2019-04-05T11:22:16Z\\\",\\n+        \\\"releases_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\\\",\\n+        \\\"size\\\": 892,\\n+        \\\"ssh_url\\\": \\\"git@github.com:ursa-labs/ursabot.git\\\",\\n+        \\\"stargazers_count\\\": 1,\\n+        \\\"stargazers_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/stargazers\\\",\\n+        \\\"statuses_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\\\",\\n+        \\\"subscribers_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/subscribers\\\",\\n+        \\\"subscription_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/subscription\\\",\\n+        \\\"svn_url\\\": \\\"https://github.com/ursa-labs/ursabot\\\",\\n+        \\\"tags_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/tags\\\",\\n+        \\\"teams_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/teams\\\",\\n+        \\\"trees_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-04T17:49:10Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot\\\",\\n+        \\\"watchers\\\": 1,\\n+        \\\"watchers_count\\\": 1\\n+    },\\n+    \\\"sender\\\": {\\n+        \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/49275095?v=4\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/users/ursabot/events{/privacy}\\\",\\n+        \\\"followers_url\\\": \\\"https://api.github.com/users/ursabot/followers\\\",\\n+        \\\"following_url\\\": \\\"https://api.github.com/users/ursabot/following{/other_user}\\\",\\n+        \\\"gists_url\\\": \\\"https://api.github.com/users/ursabot/gists{/gist_id}\\\",\\n+        \\\"gravatar_id\\\": \\\"\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursabot\\\",\\n+        \\\"id\\\": 49275095,\\n+        \\\"login\\\": \\\"ursabot\\\",\\n+        \\\"node_id\\\": \\\"MDQ6VXNlcjQ5Mjc1MDk1\\\",\\n+        \\\"organizations_url\\\": \\\"https://api.github.com/users/ursabot/orgs\\\",\\n+        \\\"received_events_url\\\": \\\"https://api.github.com/users/ursabot/received_events\\\",\\n+        \\\"repos_url\\\": \\\"https://api.github.com/users/ursabot/repos\\\",\\n+        \\\"site_admin\\\": false,\\n+        \\\"starred_url\\\": \\\"https://api.github.com/users/ursabot/starred{/owner}{/repo}\\\",\\n+        \\\"subscriptions_url\\\": \\\"https://api.github.com/users/ursabot/subscriptions\\\",\\n+        \\\"type\\\": \\\"User\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/users/ursabot\\\"\\n+    }\\n+}\"\n+    },\n+    {\n+      \"sha\": \"7ef554e333327f0e62aa1fd76b4b17844a39adeb\",\n+      \"filename\": \"ursabot/tests/fixtures/issue-comment-by-ursabot.json\",\n+      \"status\": \"added\",\n+      \"additions\": 212,\n+      \"deletions\": 0,\n+      \"changes\": 212,\n+      \"blob_url\": \"https://github.com/ursa-labs/ursabot/blob/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-by-ursabot.json\",\n+      \"raw_url\": \"https://github.com/ursa-labs/ursabot/raw/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-by-ursabot.json\",\n+      \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-by-ursabot.json?ref=2705da2b616b98fa6010a25813c5a7a27456f71d\",\n+      \"patch\": \"@@ -0,0 +1,212 @@\\n+{\\n+    \\\"action\\\": \\\"created\\\",\\n+    \\\"comment\\\": {\\n+        \\\"author_association\\\": \\\"NONE\\\",\\n+        \\\"body\\\": \\\"Unknown command \\\\\\\"\\\\\\\"\\\",\\n+        \\\"created_at\\\": \\\"2019-04-05T11:35:47Z\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480243815\\\",\\n+        \\\"id\\\": 480243815,\\n+        \\\"issue_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26\\\",\\n+        \\\"node_id\\\": \\\"MDEyOklzc3VlQ29tbWVudDQ4MDI0MzgxNQ==\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-05T11:35:47Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480243815\\\",\\n+        \\\"user\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/49275095?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/ursabot/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/ursabot/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/ursabot/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/ursabot/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/ursabot\\\",\\n+            \\\"id\\\": 49275095,\\n+            \\\"login\\\": \\\"ursabot\\\",\\n+            \\\"node_id\\\": \\\"MDQ6VXNlcjQ5Mjc1MDk1\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/ursabot/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/ursabot/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/ursabot/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/ursabot/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/ursabot/subscriptions\\\",\\n+            \\\"type\\\": \\\"User\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/ursabot\\\"\\n+        }\\n+    },\\n+    \\\"issue\\\": {\\n+        \\\"assignee\\\": null,\\n+        \\\"assignees\\\": [],\\n+        \\\"author_association\\\": \\\"MEMBER\\\",\\n+        \\\"body\\\": \\\"\\\",\\n+        \\\"closed_at\\\": null,\\n+        \\\"comments\\\": 2,\\n+        \\\"comments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\\\",\\n+        \\\"created_at\\\": \\\"2019-04-05T11:22:15Z\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26/events\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26\\\",\\n+        \\\"id\\\": 429706959,\\n+        \\\"labels\\\": [],\\n+        \\\"labels_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}\\\",\\n+        \\\"locked\\\": false,\\n+        \\\"milestone\\\": null,\\n+        \\\"node_id\\\": \\\"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\\\",\\n+        \\\"number\\\": 26,\\n+        \\\"pull_request\\\": {\\n+            \\\"diff_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26.diff\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26\\\",\\n+            \\\"patch_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26.patch\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\\\"\\n+        },\\n+        \\\"repository_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot\\\",\\n+        \\\"state\\\": \\\"open\\\",\\n+        \\\"title\\\": \\\"Unittests for GithubHook\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-05T11:35:47Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26\\\",\\n+        \\\"user\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars1.githubusercontent.com/u/961747?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/kszucs/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/kszucs/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/kszucs/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/kszucs/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/kszucs\\\",\\n+            \\\"id\\\": 961747,\\n+            \\\"login\\\": \\\"kszucs\\\",\\n+            \\\"node_id\\\": \\\"MDQ6VXNlcjk2MTc0Nw==\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/kszucs/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/kszucs/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/kszucs/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/kszucs/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/kszucs/subscriptions\\\",\\n+            \\\"type\\\": \\\"User\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/kszucs\\\"\\n+        }\\n+    },\\n+    \\\"organization\\\": {\\n+        \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/46514972?v=4\\\",\\n+        \\\"description\\\": \\\"Innovation lab for open source data science tools, powered by Apache Arrow\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/orgs/ursa-labs/events\\\",\\n+        \\\"hooks_url\\\": \\\"https://api.github.com/orgs/ursa-labs/hooks\\\",\\n+        \\\"id\\\": 46514972,\\n+        \\\"issues_url\\\": \\\"https://api.github.com/orgs/ursa-labs/issues\\\",\\n+        \\\"login\\\": \\\"ursa-labs\\\",\\n+        \\\"members_url\\\": \\\"https://api.github.com/orgs/ursa-labs/members{/member}\\\",\\n+        \\\"node_id\\\": \\\"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\\\",\\n+        \\\"public_members_url\\\": \\\"https://api.github.com/orgs/ursa-labs/public_members{/member}\\\",\\n+        \\\"repos_url\\\": \\\"https://api.github.com/orgs/ursa-labs/repos\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/orgs/ursa-labs\\\"\\n+    },\\n+    \\\"repository\\\": {\\n+        \\\"archive_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\\\",\\n+        \\\"archived\\\": false,\\n+        \\\"assignees_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\\\",\\n+        \\\"blobs_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\\\",\\n+        \\\"branches_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\\\",\\n+        \\\"clone_url\\\": \\\"https://github.com/ursa-labs/ursabot.git\\\",\\n+        \\\"collaborators_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\\\",\\n+        \\\"comments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\\\",\\n+        \\\"commits_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\\\",\\n+        \\\"compare_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\\\",\\n+        \\\"contents_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\\\",\\n+        \\\"contributors_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/contributors\\\",\\n+        \\\"created_at\\\": \\\"2019-02-04T15:40:31Z\\\",\\n+        \\\"default_branch\\\": \\\"master\\\",\\n+        \\\"deployments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/deployments\\\",\\n+        \\\"description\\\": null,\\n+        \\\"disabled\\\": false,\\n+        \\\"downloads_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/downloads\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/events\\\",\\n+        \\\"fork\\\": false,\\n+        \\\"forks\\\": 0,\\n+        \\\"forks_count\\\": 0,\\n+        \\\"forks_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/forks\\\",\\n+        \\\"full_name\\\": \\\"ursa-labs/ursabot\\\",\\n+        \\\"git_commits_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\\\",\\n+        \\\"git_refs_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\\\",\\n+        \\\"git_tags_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\\\",\\n+        \\\"git_url\\\": \\\"git://github.com/ursa-labs/ursabot.git\\\",\\n+        \\\"has_downloads\\\": true,\\n+        \\\"has_issues\\\": true,\\n+        \\\"has_pages\\\": false,\\n+        \\\"has_projects\\\": true,\\n+        \\\"has_wiki\\\": true,\\n+        \\\"homepage\\\": null,\\n+        \\\"hooks_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/hooks\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot\\\",\\n+        \\\"id\\\": 169101701,\\n+        \\\"issue_comment_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\\\",\\n+        \\\"issue_events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\\\",\\n+        \\\"issues_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\\\",\\n+        \\\"keys_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\\\",\\n+        \\\"labels_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\\\",\\n+        \\\"language\\\": \\\"Jupyter Notebook\\\",\\n+        \\\"languages_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/languages\\\",\\n+        \\\"license\\\": null,\\n+        \\\"merges_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/merges\\\",\\n+        \\\"milestones_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\\\",\\n+        \\\"mirror_url\\\": null,\\n+        \\\"name\\\": \\\"ursabot\\\",\\n+        \\\"node_id\\\": \\\"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\\\",\\n+        \\\"notifications_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\\\",\\n+        \\\"open_issues\\\": 19,\\n+        \\\"open_issues_count\\\": 19,\\n+        \\\"owner\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/46514972?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/ursa-labs/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/ursa-labs/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/ursa-labs/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/ursa-labs/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/ursa-labs\\\",\\n+            \\\"id\\\": 46514972,\\n+            \\\"login\\\": \\\"ursa-labs\\\",\\n+            \\\"node_id\\\": \\\"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/ursa-labs/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/ursa-labs/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/ursa-labs/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/ursa-labs/subscriptions\\\",\\n+            \\\"type\\\": \\\"Organization\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/ursa-labs\\\"\\n+        },\\n+        \\\"private\\\": false,\\n+        \\\"pulls_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\\\",\\n+        \\\"pushed_at\\\": \\\"2019-04-05T11:22:16Z\\\",\\n+        \\\"releases_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\\\",\\n+        \\\"size\\\": 892,\\n+        \\\"ssh_url\\\": \\\"git@github.com:ursa-labs/ursabot.git\\\",\\n+        \\\"stargazers_count\\\": 1,\\n+        \\\"stargazers_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/stargazers\\\",\\n+        \\\"statuses_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\\\",\\n+        \\\"subscribers_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/subscribers\\\",\\n+        \\\"subscription_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/subscription\\\",\\n+        \\\"svn_url\\\": \\\"https://github.com/ursa-labs/ursabot\\\",\\n+        \\\"tags_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/tags\\\",\\n+        \\\"teams_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/teams\\\",\\n+        \\\"trees_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-04T17:49:10Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot\\\",\\n+        \\\"watchers\\\": 1,\\n+        \\\"watchers_count\\\": 1\\n+    },\\n+    \\\"sender\\\": {\\n+        \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/49275095?v=4\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/users/ursabot/events{/privacy}\\\",\\n+        \\\"followers_url\\\": \\\"https://api.github.com/users/ursabot/followers\\\",\\n+        \\\"following_url\\\": \\\"https://api.github.com/users/ursabot/following{/other_user}\\\",\\n+        \\\"gists_url\\\": \\\"https://api.github.com/users/ursabot/gists{/gist_id}\\\",\\n+        \\\"gravatar_id\\\": \\\"\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursabot\\\",\\n+        \\\"id\\\": 49275095,\\n+        \\\"login\\\": \\\"ursabot\\\",\\n+        \\\"node_id\\\": \\\"MDQ6VXNlcjQ5Mjc1MDk1\\\",\\n+        \\\"organizations_url\\\": \\\"https://api.github.com/users/ursabot/orgs\\\",\\n+        \\\"received_events_url\\\": \\\"https://api.github.com/users/ursabot/received_events\\\",\\n+        \\\"repos_url\\\": \\\"https://api.github.com/users/ursabot/repos\\\",\\n+        \\\"site_admin\\\": false,\\n+        \\\"starred_url\\\": \\\"https://api.github.com/users/ursabot/starred{/owner}{/repo}\\\",\\n+        \\\"subscriptions_url\\\": \\\"https://api.github.com/users/ursabot/subscriptions\\\",\\n+        \\\"type\\\": \\\"User\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/users/ursabot\\\"\\n+    }\\n+}\"\n+    },\n+    {\n+      \"sha\": \"a8082dbc91fdfe815b795e49ec10e49000771ef5\",\n+      \"filename\": \"ursabot/tests/fixtures/issue-comment-not-mentioning-ursabot.json\",\n+      \"status\": \"added\",\n+      \"additions\": 212,\n+      \"deletions\": 0,\n+      \"changes\": 212,\n+      \"blob_url\": \"https://github.com/ursa-labs/ursabot/blob/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-not-mentioning-ursabot.json\",\n+      \"raw_url\": \"https://github.com/ursa-labs/ursabot/raw/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-not-mentioning-ursabot.json\",\n+      \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-not-mentioning-ursabot.json?ref=2705da2b616b98fa6010a25813c5a7a27456f71d\",\n+      \"patch\": \"@@ -0,0 +1,212 @@\\n+{\\n+    \\\"action\\\": \\\"created\\\",\\n+    \\\"comment\\\": {\\n+        \\\"author_association\\\": \\\"MEMBER\\\",\\n+        \\\"body\\\": \\\"bear is no game\\\",\\n+        \\\"created_at\\\": \\\"2019-04-05T11:26:56Z\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480241727\\\",\\n+        \\\"id\\\": 480241727,\\n+        \\\"issue_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26\\\",\\n+        \\\"node_id\\\": \\\"MDEyOklzc3VlQ29tbWVudDQ4MDI0MTcyNw==\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-05T11:26:56Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480241727\\\",\\n+        \\\"user\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars1.githubusercontent.com/u/961747?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/kszucs/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/kszucs/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/kszucs/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/kszucs/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/kszucs\\\",\\n+            \\\"id\\\": 961747,\\n+            \\\"login\\\": \\\"kszucs\\\",\\n+            \\\"node_id\\\": \\\"MDQ6VXNlcjk2MTc0Nw==\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/kszucs/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/kszucs/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/kszucs/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/kszucs/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/kszucs/subscriptions\\\",\\n+            \\\"type\\\": \\\"User\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/kszucs\\\"\\n+        }\\n+    },\\n+    \\\"issue\\\": {\\n+        \\\"assignee\\\": null,\\n+        \\\"assignees\\\": [],\\n+        \\\"author_association\\\": \\\"MEMBER\\\",\\n+        \\\"body\\\": \\\"\\\",\\n+        \\\"closed_at\\\": null,\\n+        \\\"comments\\\": 0,\\n+        \\\"comments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\\\",\\n+        \\\"created_at\\\": \\\"2019-04-05T11:22:15Z\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26/events\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26\\\",\\n+        \\\"id\\\": 429706959,\\n+        \\\"labels\\\": [],\\n+        \\\"labels_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}\\\",\\n+        \\\"locked\\\": false,\\n+        \\\"milestone\\\": null,\\n+        \\\"node_id\\\": \\\"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\\\",\\n+        \\\"number\\\": 26,\\n+        \\\"pull_request\\\": {\\n+            \\\"diff_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26.diff\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26\\\",\\n+            \\\"patch_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26.patch\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\\\"\\n+        },\\n+        \\\"repository_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot\\\",\\n+        \\\"state\\\": \\\"open\\\",\\n+        \\\"title\\\": \\\"Unittests for GithubHook\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-05T11:26:56Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26\\\",\\n+        \\\"user\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars1.githubusercontent.com/u/961747?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/kszucs/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/kszucs/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/kszucs/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/kszucs/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/kszucs\\\",\\n+            \\\"id\\\": 961747,\\n+            \\\"login\\\": \\\"kszucs\\\",\\n+            \\\"node_id\\\": \\\"MDQ6VXNlcjk2MTc0Nw==\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/kszucs/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/kszucs/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/kszucs/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/kszucs/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/kszucs/subscriptions\\\",\\n+            \\\"type\\\": \\\"User\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/kszucs\\\"\\n+        }\\n+    },\\n+    \\\"organization\\\": {\\n+        \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/46514972?v=4\\\",\\n+        \\\"description\\\": \\\"Innovation lab for open source data science tools, powered by Apache Arrow\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/orgs/ursa-labs/events\\\",\\n+        \\\"hooks_url\\\": \\\"https://api.github.com/orgs/ursa-labs/hooks\\\",\\n+        \\\"id\\\": 46514972,\\n+        \\\"issues_url\\\": \\\"https://api.github.com/orgs/ursa-labs/issues\\\",\\n+        \\\"login\\\": \\\"ursa-labs\\\",\\n+        \\\"members_url\\\": \\\"https://api.github.com/orgs/ursa-labs/members{/member}\\\",\\n+        \\\"node_id\\\": \\\"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\\\",\\n+        \\\"public_members_url\\\": \\\"https://api.github.com/orgs/ursa-labs/public_members{/member}\\\",\\n+        \\\"repos_url\\\": \\\"https://api.github.com/orgs/ursa-labs/repos\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/orgs/ursa-labs\\\"\\n+    },\\n+    \\\"repository\\\": {\\n+        \\\"archive_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\\\",\\n+        \\\"archived\\\": false,\\n+        \\\"assignees_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\\\",\\n+        \\\"blobs_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\\\",\\n+        \\\"branches_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\\\",\\n+        \\\"clone_url\\\": \\\"https://github.com/ursa-labs/ursabot.git\\\",\\n+        \\\"collaborators_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\\\",\\n+        \\\"comments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\\\",\\n+        \\\"commits_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\\\",\\n+        \\\"compare_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\\\",\\n+        \\\"contents_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\\\",\\n+        \\\"contributors_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/contributors\\\",\\n+        \\\"created_at\\\": \\\"2019-02-04T15:40:31Z\\\",\\n+        \\\"default_branch\\\": \\\"master\\\",\\n+        \\\"deployments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/deployments\\\",\\n+        \\\"description\\\": null,\\n+        \\\"disabled\\\": false,\\n+        \\\"downloads_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/downloads\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/events\\\",\\n+        \\\"fork\\\": false,\\n+        \\\"forks\\\": 0,\\n+        \\\"forks_count\\\": 0,\\n+        \\\"forks_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/forks\\\",\\n+        \\\"full_name\\\": \\\"ursa-labs/ursabot\\\",\\n+        \\\"git_commits_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\\\",\\n+        \\\"git_refs_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\\\",\\n+        \\\"git_tags_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\\\",\\n+        \\\"git_url\\\": \\\"git://github.com/ursa-labs/ursabot.git\\\",\\n+        \\\"has_downloads\\\": true,\\n+        \\\"has_issues\\\": true,\\n+        \\\"has_pages\\\": false,\\n+        \\\"has_projects\\\": true,\\n+        \\\"has_wiki\\\": true,\\n+        \\\"homepage\\\": null,\\n+        \\\"hooks_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/hooks\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot\\\",\\n+        \\\"id\\\": 169101701,\\n+        \\\"issue_comment_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\\\",\\n+        \\\"issue_events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\\\",\\n+        \\\"issues_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\\\",\\n+        \\\"keys_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\\\",\\n+        \\\"labels_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\\\",\\n+        \\\"language\\\": \\\"Jupyter Notebook\\\",\\n+        \\\"languages_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/languages\\\",\\n+        \\\"license\\\": null,\\n+        \\\"merges_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/merges\\\",\\n+        \\\"milestones_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\\\",\\n+        \\\"mirror_url\\\": null,\\n+        \\\"name\\\": \\\"ursabot\\\",\\n+        \\\"node_id\\\": \\\"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\\\",\\n+        \\\"notifications_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\\\",\\n+        \\\"open_issues\\\": 19,\\n+        \\\"open_issues_count\\\": 19,\\n+        \\\"owner\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/46514972?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/ursa-labs/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/ursa-labs/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/ursa-labs/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/ursa-labs/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/ursa-labs\\\",\\n+            \\\"id\\\": 46514972,\\n+            \\\"login\\\": \\\"ursa-labs\\\",\\n+            \\\"node_id\\\": \\\"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/ursa-labs/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/ursa-labs/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/ursa-labs/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/ursa-labs/subscriptions\\\",\\n+            \\\"type\\\": \\\"Organization\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/ursa-labs\\\"\\n+        },\\n+        \\\"private\\\": false,\\n+        \\\"pulls_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\\\",\\n+        \\\"pushed_at\\\": \\\"2019-04-05T11:22:16Z\\\",\\n+        \\\"releases_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\\\",\\n+        \\\"size\\\": 892,\\n+        \\\"ssh_url\\\": \\\"git@github.com:ursa-labs/ursabot.git\\\",\\n+        \\\"stargazers_count\\\": 1,\\n+        \\\"stargazers_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/stargazers\\\",\\n+        \\\"statuses_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\\\",\\n+        \\\"subscribers_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/subscribers\\\",\\n+        \\\"subscription_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/subscription\\\",\\n+        \\\"svn_url\\\": \\\"https://github.com/ursa-labs/ursabot\\\",\\n+        \\\"tags_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/tags\\\",\\n+        \\\"teams_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/teams\\\",\\n+        \\\"trees_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-04T17:49:10Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot\\\",\\n+        \\\"watchers\\\": 1,\\n+        \\\"watchers_count\\\": 1\\n+    },\\n+    \\\"sender\\\": {\\n+        \\\"avatar_url\\\": \\\"https://avatars1.githubusercontent.com/u/961747?v=4\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/users/kszucs/events{/privacy}\\\",\\n+        \\\"followers_url\\\": \\\"https://api.github.com/users/kszucs/followers\\\",\\n+        \\\"following_url\\\": \\\"https://api.github.com/users/kszucs/following{/other_user}\\\",\\n+        \\\"gists_url\\\": \\\"https://api.github.com/users/kszucs/gists{/gist_id}\\\",\\n+        \\\"gravatar_id\\\": \\\"\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/kszucs\\\",\\n+        \\\"id\\\": 961747,\\n+        \\\"login\\\": \\\"kszucs\\\",\\n+        \\\"node_id\\\": \\\"MDQ6VXNlcjk2MTc0Nw==\\\",\\n+        \\\"organizations_url\\\": \\\"https://api.github.com/users/kszucs/orgs\\\",\\n+        \\\"received_events_url\\\": \\\"https://api.github.com/users/kszucs/received_events\\\",\\n+        \\\"repos_url\\\": \\\"https://api.github.com/users/kszucs/repos\\\",\\n+        \\\"site_admin\\\": false,\\n+        \\\"starred_url\\\": \\\"https://api.github.com/users/kszucs/starred{/owner}{/repo}\\\",\\n+        \\\"subscriptions_url\\\": \\\"https://api.github.com/users/kszucs/subscriptions\\\",\\n+        \\\"type\\\": \\\"User\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/users/kszucs\\\"\\n+    }\\n+}\"\n+    },\n+    {\n+      \"sha\": \"2770e29ba9086394455315e590c0b433d08e437e\",\n+      \"filename\": \"ursabot/tests/fixtures/issue-comment-with-empty-command.json\",\n+      \"status\": \"added\",\n+      \"additions\": 212,\n+      \"deletions\": 0,\n+      \"changes\": 212,\n+      \"blob_url\": \"https://github.com/ursa-labs/ursabot/blob/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-with-empty-command.json\",\n+      \"raw_url\": \"https://github.com/ursa-labs/ursabot/raw/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-with-empty-command.json\",\n+      \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-with-empty-command.json?ref=2705da2b616b98fa6010a25813c5a7a27456f71d\",\n+      \"patch\": \"@@ -0,0 +1,212 @@\\n+{\\n+    \\\"action\\\": \\\"created\\\",\\n+    \\\"comment\\\": {\\n+        \\\"author_association\\\": \\\"MEMBER\\\",\\n+        \\\"body\\\": \\\"@ursabot \\\",\\n+        \\\"created_at\\\": \\\"2019-04-05T11:35:46Z\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480243811\\\",\\n+        \\\"id\\\": 480243811,\\n+        \\\"issue_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26\\\",\\n+        \\\"node_id\\\": \\\"MDEyOklzc3VlQ29tbWVudDQ4MDI0MzgxMQ==\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-05T11:35:46Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480243811\\\",\\n+        \\\"user\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars1.githubusercontent.com/u/961747?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/kszucs/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/kszucs/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/kszucs/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/kszucs/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/kszucs\\\",\\n+            \\\"id\\\": 961747,\\n+            \\\"login\\\": \\\"kszucs\\\",\\n+            \\\"node_id\\\": \\\"MDQ6VXNlcjk2MTc0Nw==\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/kszucs/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/kszucs/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/kszucs/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/kszucs/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/kszucs/subscriptions\\\",\\n+            \\\"type\\\": \\\"User\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/kszucs\\\"\\n+        }\\n+    },\\n+    \\\"issue\\\": {\\n+        \\\"assignee\\\": null,\\n+        \\\"assignees\\\": [],\\n+        \\\"author_association\\\": \\\"MEMBER\\\",\\n+        \\\"body\\\": \\\"\\\",\\n+        \\\"closed_at\\\": null,\\n+        \\\"comments\\\": 1,\\n+        \\\"comments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\\\",\\n+        \\\"created_at\\\": \\\"2019-04-05T11:22:15Z\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26/events\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26\\\",\\n+        \\\"id\\\": 429706959,\\n+        \\\"labels\\\": [],\\n+        \\\"labels_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}\\\",\\n+        \\\"locked\\\": false,\\n+        \\\"milestone\\\": null,\\n+        \\\"node_id\\\": \\\"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\\\",\\n+        \\\"number\\\": 26,\\n+        \\\"pull_request\\\": {\\n+            \\\"diff_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26.diff\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26\\\",\\n+            \\\"patch_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26.patch\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\\\"\\n+        },\\n+        \\\"repository_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot\\\",\\n+        \\\"state\\\": \\\"open\\\",\\n+        \\\"title\\\": \\\"Unittests for GithubHook\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-05T11:35:46Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26\\\",\\n+        \\\"user\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars1.githubusercontent.com/u/961747?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/kszucs/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/kszucs/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/kszucs/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/kszucs/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/kszucs\\\",\\n+            \\\"id\\\": 961747,\\n+            \\\"login\\\": \\\"kszucs\\\",\\n+            \\\"node_id\\\": \\\"MDQ6VXNlcjk2MTc0Nw==\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/kszucs/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/kszucs/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/kszucs/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/kszucs/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/kszucs/subscriptions\\\",\\n+            \\\"type\\\": \\\"User\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/kszucs\\\"\\n+        }\\n+    },\\n+    \\\"organization\\\": {\\n+        \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/46514972?v=4\\\",\\n+        \\\"description\\\": \\\"Innovation lab for open source data science tools, powered by Apache Arrow\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/orgs/ursa-labs/events\\\",\\n+        \\\"hooks_url\\\": \\\"https://api.github.com/orgs/ursa-labs/hooks\\\",\\n+        \\\"id\\\": 46514972,\\n+        \\\"issues_url\\\": \\\"https://api.github.com/orgs/ursa-labs/issues\\\",\\n+        \\\"login\\\": \\\"ursa-labs\\\",\\n+        \\\"members_url\\\": \\\"https://api.github.com/orgs/ursa-labs/members{/member}\\\",\\n+        \\\"node_id\\\": \\\"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\\\",\\n+        \\\"public_members_url\\\": \\\"https://api.github.com/orgs/ursa-labs/public_members{/member}\\\",\\n+        \\\"repos_url\\\": \\\"https://api.github.com/orgs/ursa-labs/repos\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/orgs/ursa-labs\\\"\\n+    },\\n+    \\\"repository\\\": {\\n+        \\\"archive_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\\\",\\n+        \\\"archived\\\": false,\\n+        \\\"assignees_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\\\",\\n+        \\\"blobs_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\\\",\\n+        \\\"branches_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\\\",\\n+        \\\"clone_url\\\": \\\"https://github.com/ursa-labs/ursabot.git\\\",\\n+        \\\"collaborators_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\\\",\\n+        \\\"comments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\\\",\\n+        \\\"commits_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\\\",\\n+        \\\"compare_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\\\",\\n+        \\\"contents_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\\\",\\n+        \\\"contributors_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/contributors\\\",\\n+        \\\"created_at\\\": \\\"2019-02-04T15:40:31Z\\\",\\n+        \\\"default_branch\\\": \\\"master\\\",\\n+        \\\"deployments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/deployments\\\",\\n+        \\\"description\\\": null,\\n+        \\\"disabled\\\": false,\\n+        \\\"downloads_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/downloads\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/events\\\",\\n+        \\\"fork\\\": false,\\n+        \\\"forks\\\": 0,\\n+        \\\"forks_count\\\": 0,\\n+        \\\"forks_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/forks\\\",\\n+        \\\"full_name\\\": \\\"ursa-labs/ursabot\\\",\\n+        \\\"git_commits_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\\\",\\n+        \\\"git_refs_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\\\",\\n+        \\\"git_tags_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\\\",\\n+        \\\"git_url\\\": \\\"git://github.com/ursa-labs/ursabot.git\\\",\\n+        \\\"has_downloads\\\": true,\\n+        \\\"has_issues\\\": true,\\n+        \\\"has_pages\\\": false,\\n+        \\\"has_projects\\\": true,\\n+        \\\"has_wiki\\\": true,\\n+        \\\"homepage\\\": null,\\n+        \\\"hooks_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/hooks\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot\\\",\\n+        \\\"id\\\": 169101701,\\n+        \\\"issue_comment_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\\\",\\n+        \\\"issue_events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\\\",\\n+        \\\"issues_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\\\",\\n+        \\\"keys_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\\\",\\n+        \\\"labels_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\\\",\\n+        \\\"language\\\": \\\"Jupyter Notebook\\\",\\n+        \\\"languages_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/languages\\\",\\n+        \\\"license\\\": null,\\n+        \\\"merges_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/merges\\\",\\n+        \\\"milestones_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\\\",\\n+        \\\"mirror_url\\\": null,\\n+        \\\"name\\\": \\\"ursabot\\\",\\n+        \\\"node_id\\\": \\\"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\\\",\\n+        \\\"notifications_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\\\",\\n+        \\\"open_issues\\\": 19,\\n+        \\\"open_issues_count\\\": 19,\\n+        \\\"owner\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/46514972?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/ursa-labs/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/ursa-labs/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/ursa-labs/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/ursa-labs/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/ursa-labs\\\",\\n+            \\\"id\\\": 46514972,\\n+            \\\"login\\\": \\\"ursa-labs\\\",\\n+            \\\"node_id\\\": \\\"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/ursa-labs/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/ursa-labs/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/ursa-labs/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/ursa-labs/subscriptions\\\",\\n+            \\\"type\\\": \\\"Organization\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/ursa-labs\\\"\\n+        },\\n+        \\\"private\\\": false,\\n+        \\\"pulls_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\\\",\\n+        \\\"pushed_at\\\": \\\"2019-04-05T11:22:16Z\\\",\\n+        \\\"releases_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\\\",\\n+        \\\"size\\\": 892,\\n+        \\\"ssh_url\\\": \\\"git@github.com:ursa-labs/ursabot.git\\\",\\n+        \\\"stargazers_count\\\": 1,\\n+        \\\"stargazers_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/stargazers\\\",\\n+        \\\"statuses_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\\\",\\n+        \\\"subscribers_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/subscribers\\\",\\n+        \\\"subscription_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/subscription\\\",\\n+        \\\"svn_url\\\": \\\"https://github.com/ursa-labs/ursabot\\\",\\n+        \\\"tags_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/tags\\\",\\n+        \\\"teams_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/teams\\\",\\n+        \\\"trees_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-04T17:49:10Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot\\\",\\n+        \\\"watchers\\\": 1,\\n+        \\\"watchers_count\\\": 1\\n+    },\\n+    \\\"sender\\\": {\\n+        \\\"avatar_url\\\": \\\"https://avatars1.githubusercontent.com/u/961747?v=4\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/users/kszucs/events{/privacy}\\\",\\n+        \\\"followers_url\\\": \\\"https://api.github.com/users/kszucs/followers\\\",\\n+        \\\"following_url\\\": \\\"https://api.github.com/users/kszucs/following{/other_user}\\\",\\n+        \\\"gists_url\\\": \\\"https://api.github.com/users/kszucs/gists{/gist_id}\\\",\\n+        \\\"gravatar_id\\\": \\\"\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/kszucs\\\",\\n+        \\\"id\\\": 961747,\\n+        \\\"login\\\": \\\"kszucs\\\",\\n+        \\\"node_id\\\": \\\"MDQ6VXNlcjk2MTc0Nw==\\\",\\n+        \\\"organizations_url\\\": \\\"https://api.github.com/users/kszucs/orgs\\\",\\n+        \\\"received_events_url\\\": \\\"https://api.github.com/users/kszucs/received_events\\\",\\n+        \\\"repos_url\\\": \\\"https://api.github.com/users/kszucs/repos\\\",\\n+        \\\"site_admin\\\": false,\\n+        \\\"starred_url\\\": \\\"https://api.github.com/users/kszucs/starred{/owner}{/repo}\\\",\\n+        \\\"subscriptions_url\\\": \\\"https://api.github.com/users/kszucs/subscriptions\\\",\\n+        \\\"type\\\": \\\"User\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/users/kszucs\\\"\\n+    }\\n+}\"\n+    },\n+    {\n+      \"sha\": \"80ff46510a2f39ae60f7c3a98e5fdaef8e688784\",\n+      \"filename\": \"ursabot/tests/fixtures/issue-comment-without-pull-request.json\",\n+      \"status\": \"added\",\n+      \"additions\": 206,\n+      \"deletions\": 0,\n+      \"changes\": 206,\n+      \"blob_url\": \"https://github.com/ursa-labs/ursabot/blob/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-without-pull-request.json\",\n+      \"raw_url\": \"https://github.com/ursa-labs/ursabot/raw/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-without-pull-request.json\",\n+      \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-without-pull-request.json?ref=2705da2b616b98fa6010a25813c5a7a27456f71d\",\n+      \"patch\": \"@@ -0,0 +1,206 @@\\n+{\\n+    \\\"action\\\": \\\"created\\\",\\n+    \\\"comment\\\": {\\n+        \\\"author_association\\\": \\\"NONE\\\",\\n+        \\\"body\\\": \\\"Ursabot only listens to pull request comments!\\\",\\n+        \\\"created_at\\\": \\\"2019-04-05T11:53:43Z\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/issues/19#issuecomment-480248217\\\",\\n+        \\\"id\\\": 480248217,\\n+        \\\"issue_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/19\\\",\\n+        \\\"node_id\\\": \\\"MDEyOklzc3VlQ29tbWVudDQ4MDI0ODIxNw==\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-05T11:53:43Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480248217\\\",\\n+        \\\"user\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/49275095?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/ursabot/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/ursabot/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/ursabot/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/ursabot/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/ursabot\\\",\\n+            \\\"id\\\": 49275095,\\n+            \\\"login\\\": \\\"ursabot\\\",\\n+            \\\"node_id\\\": \\\"MDQ6VXNlcjQ5Mjc1MDk1\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/ursabot/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/ursabot/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/ursabot/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/ursabot/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/ursabot/subscriptions\\\",\\n+            \\\"type\\\": \\\"User\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/ursabot\\\"\\n+        }\\n+    },\\n+    \\\"issue\\\": {\\n+        \\\"assignee\\\": null,\\n+        \\\"assignees\\\": [],\\n+        \\\"author_association\\\": \\\"MEMBER\\\",\\n+        \\\"body\\\": \\\"\\\",\\n+        \\\"closed_at\\\": null,\\n+        \\\"comments\\\": 4,\\n+        \\\"comments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/19/comments\\\",\\n+        \\\"created_at\\\": \\\"2019-04-02T09:56:41Z\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/19/events\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/issues/19\\\",\\n+        \\\"id\\\": 428131685,\\n+        \\\"labels\\\": [],\\n+        \\\"labels_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/19/labels{/name}\\\",\\n+        \\\"locked\\\": false,\\n+        \\\"milestone\\\": null,\\n+        \\\"node_id\\\": \\\"MDU6SXNzdWU0MjgxMzE2ODU=\\\",\\n+        \\\"number\\\": 19,\\n+        \\\"repository_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot\\\",\\n+        \\\"state\\\": \\\"open\\\",\\n+        \\\"title\\\": \\\"Build ursabot itself via ursabot\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-05T11:53:43Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/19\\\",\\n+        \\\"user\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars1.githubusercontent.com/u/961747?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/kszucs/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/kszucs/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/kszucs/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/kszucs/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/kszucs\\\",\\n+            \\\"id\\\": 961747,\\n+            \\\"login\\\": \\\"kszucs\\\",\\n+            \\\"node_id\\\": \\\"MDQ6VXNlcjk2MTc0Nw==\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/kszucs/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/kszucs/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/kszucs/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/kszucs/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/kszucs/subscriptions\\\",\\n+            \\\"type\\\": \\\"User\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/kszucs\\\"\\n+        }\\n+    },\\n+    \\\"organization\\\": {\\n+        \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/46514972?v=4\\\",\\n+        \\\"description\\\": \\\"Innovation lab for open source data science tools, powered by Apache Arrow\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/orgs/ursa-labs/events\\\",\\n+        \\\"hooks_url\\\": \\\"https://api.github.com/orgs/ursa-labs/hooks\\\",\\n+        \\\"id\\\": 46514972,\\n+        \\\"issues_url\\\": \\\"https://api.github.com/orgs/ursa-labs/issues\\\",\\n+        \\\"login\\\": \\\"ursa-labs\\\",\\n+        \\\"members_url\\\": \\\"https://api.github.com/orgs/ursa-labs/members{/member}\\\",\\n+        \\\"node_id\\\": \\\"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\\\",\\n+        \\\"public_members_url\\\": \\\"https://api.github.com/orgs/ursa-labs/public_members{/member}\\\",\\n+        \\\"repos_url\\\": \\\"https://api.github.com/orgs/ursa-labs/repos\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/orgs/ursa-labs\\\"\\n+    },\\n+    \\\"repository\\\": {\\n+        \\\"archive_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\\\",\\n+        \\\"archived\\\": false,\\n+        \\\"assignees_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\\\",\\n+        \\\"blobs_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\\\",\\n+        \\\"branches_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\\\",\\n+        \\\"clone_url\\\": \\\"https://github.com/ursa-labs/ursabot.git\\\",\\n+        \\\"collaborators_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\\\",\\n+        \\\"comments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\\\",\\n+        \\\"commits_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\\\",\\n+        \\\"compare_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\\\",\\n+        \\\"contents_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\\\",\\n+        \\\"contributors_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/contributors\\\",\\n+        \\\"created_at\\\": \\\"2019-02-04T15:40:31Z\\\",\\n+        \\\"default_branch\\\": \\\"master\\\",\\n+        \\\"deployments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/deployments\\\",\\n+        \\\"description\\\": null,\\n+        \\\"disabled\\\": false,\\n+        \\\"downloads_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/downloads\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/events\\\",\\n+        \\\"fork\\\": false,\\n+        \\\"forks\\\": 0,\\n+        \\\"forks_count\\\": 0,\\n+        \\\"forks_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/forks\\\",\\n+        \\\"full_name\\\": \\\"ursa-labs/ursabot\\\",\\n+        \\\"git_commits_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\\\",\\n+        \\\"git_refs_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\\\",\\n+        \\\"git_tags_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\\\",\\n+        \\\"git_url\\\": \\\"git://github.com/ursa-labs/ursabot.git\\\",\\n+        \\\"has_downloads\\\": true,\\n+        \\\"has_issues\\\": true,\\n+        \\\"has_pages\\\": false,\\n+        \\\"has_projects\\\": true,\\n+        \\\"has_wiki\\\": true,\\n+        \\\"homepage\\\": null,\\n+        \\\"hooks_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/hooks\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot\\\",\\n+        \\\"id\\\": 169101701,\\n+        \\\"issue_comment_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\\\",\\n+        \\\"issue_events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\\\",\\n+        \\\"issues_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\\\",\\n+        \\\"keys_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\\\",\\n+        \\\"labels_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\\\",\\n+        \\\"language\\\": \\\"Jupyter Notebook\\\",\\n+        \\\"languages_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/languages\\\",\\n+        \\\"license\\\": null,\\n+        \\\"merges_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/merges\\\",\\n+        \\\"milestones_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\\\",\\n+        \\\"mirror_url\\\": null,\\n+        \\\"name\\\": \\\"ursabot\\\",\\n+        \\\"node_id\\\": \\\"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\\\",\\n+        \\\"notifications_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\\\",\\n+        \\\"open_issues\\\": 19,\\n+        \\\"open_issues_count\\\": 19,\\n+        \\\"owner\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/46514972?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/ursa-labs/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/ursa-labs/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/ursa-labs/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/ursa-labs/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/ursa-labs\\\",\\n+            \\\"id\\\": 46514972,\\n+            \\\"login\\\": \\\"ursa-labs\\\",\\n+            \\\"node_id\\\": \\\"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/ursa-labs/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/ursa-labs/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/ursa-labs/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/ursa-labs/subscriptions\\\",\\n+            \\\"type\\\": \\\"Organization\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/ursa-labs\\\"\\n+        },\\n+        \\\"private\\\": false,\\n+        \\\"pulls_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\\\",\\n+        \\\"pushed_at\\\": \\\"2019-04-05T11:22:16Z\\\",\\n+        \\\"releases_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\\\",\\n+        \\\"size\\\": 892,\\n+        \\\"ssh_url\\\": \\\"git@github.com:ursa-labs/ursabot.git\\\",\\n+        \\\"stargazers_count\\\": 1,\\n+        \\\"stargazers_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/stargazers\\\",\\n+        \\\"statuses_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\\\",\\n+        \\\"subscribers_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/subscribers\\\",\\n+        \\\"subscription_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/subscription\\\",\\n+        \\\"svn_url\\\": \\\"https://github.com/ursa-labs/ursabot\\\",\\n+        \\\"tags_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/tags\\\",\\n+        \\\"teams_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/teams\\\",\\n+        \\\"trees_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-04T17:49:10Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot\\\",\\n+        \\\"watchers\\\": 1,\\n+        \\\"watchers_count\\\": 1\\n+    },\\n+    \\\"sender\\\": {\\n+        \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/49275095?v=4\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/users/ursabot/events{/privacy}\\\",\\n+        \\\"followers_url\\\": \\\"https://api.github.com/users/ursabot/followers\\\",\\n+        \\\"following_url\\\": \\\"https://api.github.com/users/ursabot/following{/other_user}\\\",\\n+        \\\"gists_url\\\": \\\"https://api.github.com/users/ursabot/gists{/gist_id}\\\",\\n+        \\\"gravatar_id\\\": \\\"\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursabot\\\",\\n+        \\\"id\\\": 49275095,\\n+        \\\"login\\\": \\\"ursabot\\\",\\n+        \\\"node_id\\\": \\\"MDQ6VXNlcjQ5Mjc1MDk1\\\",\\n+        \\\"organizations_url\\\": \\\"https://api.github.com/users/ursabot/orgs\\\",\\n+        \\\"received_events_url\\\": \\\"https://api.github.com/users/ursabot/received_events\\\",\\n+        \\\"repos_url\\\": \\\"https://api.github.com/users/ursabot/repos\\\",\\n+        \\\"site_admin\\\": false,\\n+        \\\"starred_url\\\": \\\"https://api.github.com/users/ursabot/starred{/owner}{/repo}\\\",\\n+        \\\"subscriptions_url\\\": \\\"https://api.github.com/users/ursabot/subscriptions\\\",\\n+        \\\"type\\\": \\\"User\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/users/ursabot\\\"\\n+    }\\n+}\"\n+    },\n+    {\n+      \"sha\": \"c738bb0eb54c87ba0f23e97e827d77c2be74d0b6\",\n+      \"filename\": \"ursabot/tests/test_hooks.py\",\n+      \"status\": \"modified\",\n+      \"additions\": 4,\n+      \"deletions\": 4,\n+      \"changes\": 8,\n+      \"blob_url\": \"https://github.com/ursa-labs/ursabot/blob/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/test_hooks.py\",\n+      \"raw_url\": \"https://github.com/ursa-labs/ursabot/raw/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/test_hooks.py\",\n+      \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/test_hooks.py?ref=2705da2b616b98fa6010a25813c5a7a27456f71d\",\n+      \"patch\": \"@@ -54,7 +54,7 @@ class TestGithubHook(ChangeHookTestCase):\\n         await self.request('ping', {})\\n         assert len(self.hook.master.data.updates.changesAdded) == 0\\n \\n-    @ensure_deferred\\n-    async def test_issue_comment(self):\\n-        payload = {}\\n-        await self.request('issue_comment', payload)\\n+    # @ensure_deferred\\n+    # async def test_issue_comment(self):\\n+    #     payload = {}\\n+    #     await self.request('issue_comment', payload)\"\n+    }\n+  ]\n+}"
+  },
+  {
+    "sha": "ad061d7244b917e6ea3853698dc3bc2a8c9c6857",
+    "filename": "ursabot/tests/fixtures/pull-request-26.json",
+    "status": "added",
+    "additions": 335,
+    "deletions": 0,
+    "changes": 335,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/pull-request-26.json",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/pull-request-26.json",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/pull-request-26.json?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -0,0 +1,335 @@\n+{\n+  \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\",\n+  \"id\": 267785552,\n+  \"node_id\": \"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\",\n+  \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+  \"diff_url\": \"https://github.com/ursa-labs/ursabot/pull/26.diff\",\n+  \"patch_url\": \"https://github.com/ursa-labs/ursabot/pull/26.patch\",\n+  \"issue_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+  \"number\": 26,\n+  \"state\": \"open\",\n+  \"locked\": false,\n+  \"title\": \"Unittests for GithubHook\",\n+  \"user\": {\n+    \"login\": \"kszucs\",\n+    \"id\": 961747,\n+    \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+    \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+    \"gravatar_id\": \"\",\n+    \"url\": \"https://api.github.com/users/kszucs\",\n+    \"html_url\": \"https://github.com/kszucs\",\n+    \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+    \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+    \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+    \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+    \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+    \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+    \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+    \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+    \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+    \"type\": \"User\",\n+    \"site_admin\": false\n+  },\n+  \"body\": \"\",\n+  \"created_at\": \"2019-04-05T11:22:15Z\",\n+  \"updated_at\": \"2019-04-05T12:01:40Z\",\n+  \"closed_at\": null,\n+  \"merged_at\": null,\n+  \"merge_commit_sha\": \"cc5dc3606988b3824be54df779ed2028776113cb\",\n+  \"assignee\": null,\n+  \"assignees\": [\n+\n+  ],\n+  \"requested_reviewers\": [\n+\n+  ],\n+  \"requested_teams\": [\n+\n+  ],\n+  \"labels\": [\n+\n+  ],\n+  \"milestone\": null,\n+  \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26/commits\",\n+  \"review_comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26/comments\",\n+  \"review_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/comments{/number}\",\n+  \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\",\n+  \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/2705da2b616b98fa6010a25813c5a7a27456f71d\",\n+  \"head\": {\n+    \"label\": \"ursa-labs:test-hook\",\n+    \"ref\": \"test-hook\",\n+    \"sha\": \"2705da2b616b98fa6010a25813c5a7a27456f71d\",\n+    \"user\": {\n+      \"login\": \"ursa-labs\",\n+      \"id\": 46514972,\n+      \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+      \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+      \"gravatar_id\": \"\",\n+      \"url\": \"https://api.github.com/users/ursa-labs\",\n+      \"html_url\": \"https://github.com/ursa-labs\",\n+      \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+      \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+      \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+      \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+      \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+      \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+      \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+      \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+      \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+      \"type\": \"Organization\",\n+      \"site_admin\": false\n+    },\n+    \"repo\": {\n+      \"id\": 169101701,\n+      \"node_id\": \"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\",\n+      \"name\": \"ursabot\",\n+      \"full_name\": \"ursa-labs/ursabot\",\n+      \"private\": false,\n+      \"owner\": {\n+        \"login\": \"ursa-labs\",\n+        \"id\": 46514972,\n+        \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+        \"gravatar_id\": \"\",\n+        \"url\": \"https://api.github.com/users/ursa-labs\",\n+        \"html_url\": \"https://github.com/ursa-labs\",\n+        \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+        \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+        \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+        \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+        \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+        \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+        \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+        \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+        \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+        \"type\": \"Organization\",\n+        \"site_admin\": false\n+      },\n+      \"html_url\": \"https://github.com/ursa-labs/ursabot\",\n+      \"description\": null,\n+      \"fork\": false,\n+      \"url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+      \"forks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/forks\",\n+      \"keys_url\": \"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\",\n+      \"collaborators_url\": \"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\",\n+      \"teams_url\": \"https://api.github.com/repos/ursa-labs/ursabot/teams\",\n+      \"hooks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/hooks\",\n+      \"issue_events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\",\n+      \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/events\",\n+      \"assignees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\",\n+      \"branches_url\": \"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\",\n+      \"tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/tags\",\n+      \"blobs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\",\n+      \"git_tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\",\n+      \"git_refs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\",\n+      \"trees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\",\n+      \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\",\n+      \"languages_url\": \"https://api.github.com/repos/ursa-labs/ursabot/languages\",\n+      \"stargazers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/stargazers\",\n+      \"contributors_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contributors\",\n+      \"subscribers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscribers\",\n+      \"subscription_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscription\",\n+      \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\",\n+      \"git_commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\",\n+      \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\",\n+      \"issue_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\",\n+      \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\",\n+      \"compare_url\": \"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\",\n+      \"merges_url\": \"https://api.github.com/repos/ursa-labs/ursabot/merges\",\n+      \"archive_url\": \"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\",\n+      \"downloads_url\": \"https://api.github.com/repos/ursa-labs/ursabot/downloads\",\n+      \"issues_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\",\n+      \"pulls_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\",\n+      \"milestones_url\": \"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\",\n+      \"notifications_url\": \"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\",\n+      \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\",\n+      \"releases_url\": \"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\",\n+      \"deployments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/deployments\",\n+      \"created_at\": \"2019-02-04T15:40:31Z\",\n+      \"updated_at\": \"2019-04-04T17:49:10Z\",\n+      \"pushed_at\": \"2019-04-05T12:01:40Z\",\n+      \"git_url\": \"git://github.com/ursa-labs/ursabot.git\",\n+      \"ssh_url\": \"git@github.com:ursa-labs/ursabot.git\",\n+      \"clone_url\": \"https://github.com/ursa-labs/ursabot.git\",\n+      \"svn_url\": \"https://github.com/ursa-labs/ursabot\",\n+      \"homepage\": null,\n+      \"size\": 898,\n+      \"stargazers_count\": 1,\n+      \"watchers_count\": 1,\n+      \"language\": \"Jupyter Notebook\",\n+      \"has_issues\": true,\n+      \"has_projects\": true,\n+      \"has_downloads\": true,\n+      \"has_wiki\": true,\n+      \"has_pages\": false,\n+      \"forks_count\": 0,\n+      \"mirror_url\": null,\n+      \"archived\": false,\n+      \"disabled\": false,\n+      \"open_issues_count\": 19,\n+      \"license\": null,\n+      \"forks\": 0,\n+      \"open_issues\": 19,\n+      \"watchers\": 1,\n+      \"default_branch\": \"master\"\n+    }\n+  },\n+  \"base\": {\n+    \"label\": \"ursa-labs:master\",\n+    \"ref\": \"master\",\n+    \"sha\": \"a162ad254b589b924db47e057791191b39613fd5\",\n+    \"user\": {\n+      \"login\": \"ursa-labs\",\n+      \"id\": 46514972,\n+      \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+      \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+      \"gravatar_id\": \"\",\n+      \"url\": \"https://api.github.com/users/ursa-labs\",\n+      \"html_url\": \"https://github.com/ursa-labs\",\n+      \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+      \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+      \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+      \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+      \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+      \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+      \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+      \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+      \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+      \"type\": \"Organization\",\n+      \"site_admin\": false\n+    },\n+    \"repo\": {\n+      \"id\": 169101701,\n+      \"node_id\": \"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\",\n+      \"name\": \"ursabot\",\n+      \"full_name\": \"ursa-labs/ursabot\",\n+      \"private\": false,\n+      \"owner\": {\n+        \"login\": \"ursa-labs\",\n+        \"id\": 46514972,\n+        \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+        \"gravatar_id\": \"\",\n+        \"url\": \"https://api.github.com/users/ursa-labs\",\n+        \"html_url\": \"https://github.com/ursa-labs\",\n+        \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+        \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+        \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+        \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+        \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+        \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+        \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+        \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+        \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+        \"type\": \"Organization\",\n+        \"site_admin\": false\n+      },\n+      \"html_url\": \"https://github.com/ursa-labs/ursabot\",\n+      \"description\": null,\n+      \"fork\": false,\n+      \"url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+      \"forks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/forks\",\n+      \"keys_url\": \"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\",\n+      \"collaborators_url\": \"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\",\n+      \"teams_url\": \"https://api.github.com/repos/ursa-labs/ursabot/teams\",\n+      \"hooks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/hooks\",\n+      \"issue_events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\",\n+      \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/events\",\n+      \"assignees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\",\n+      \"branches_url\": \"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\",\n+      \"tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/tags\",\n+      \"blobs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\",\n+      \"git_tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\",\n+      \"git_refs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\",\n+      \"trees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\",\n+      \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\",\n+      \"languages_url\": \"https://api.github.com/repos/ursa-labs/ursabot/languages\",\n+      \"stargazers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/stargazers\",\n+      \"contributors_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contributors\",\n+      \"subscribers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscribers\",\n+      \"subscription_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscription\",\n+      \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\",\n+      \"git_commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\",\n+      \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\",\n+      \"issue_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\",\n+      \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\",\n+      \"compare_url\": \"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\",\n+      \"merges_url\": \"https://api.github.com/repos/ursa-labs/ursabot/merges\",\n+      \"archive_url\": \"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\",\n+      \"downloads_url\": \"https://api.github.com/repos/ursa-labs/ursabot/downloads\",\n+      \"issues_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\",\n+      \"pulls_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\",\n+      \"milestones_url\": \"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\",\n+      \"notifications_url\": \"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\",\n+      \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\",\n+      \"releases_url\": \"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\",\n+      \"deployments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/deployments\",\n+      \"created_at\": \"2019-02-04T15:40:31Z\",\n+      \"updated_at\": \"2019-04-04T17:49:10Z\",\n+      \"pushed_at\": \"2019-04-05T12:01:40Z\",\n+      \"git_url\": \"git://github.com/ursa-labs/ursabot.git\",\n+      \"ssh_url\": \"git@github.com:ursa-labs/ursabot.git\",\n+      \"clone_url\": \"https://github.com/ursa-labs/ursabot.git\",\n+      \"svn_url\": \"https://github.com/ursa-labs/ursabot\",\n+      \"homepage\": null,\n+      \"size\": 898,\n+      \"stargazers_count\": 1,\n+      \"watchers_count\": 1,\n+      \"language\": \"Jupyter Notebook\",\n+      \"has_issues\": true,\n+      \"has_projects\": true,\n+      \"has_downloads\": true,\n+      \"has_wiki\": true,\n+      \"has_pages\": false,\n+      \"forks_count\": 0,\n+      \"mirror_url\": null,\n+      \"archived\": false,\n+      \"disabled\": false,\n+      \"open_issues_count\": 19,\n+      \"license\": null,\n+      \"forks\": 0,\n+      \"open_issues\": 19,\n+      \"watchers\": 1,\n+      \"default_branch\": \"master\"\n+    }\n+  },\n+  \"_links\": {\n+    \"self\": {\n+      \"href\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\"\n+    },\n+    \"html\": {\n+      \"href\": \"https://github.com/ursa-labs/ursabot/pull/26\"\n+    },\n+    \"issue\": {\n+      \"href\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\"\n+    },\n+    \"comments\": {\n+      \"href\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\"\n+    },\n+    \"review_comments\": {\n+      \"href\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26/comments\"\n+    },\n+    \"review_comment\": {\n+      \"href\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/comments{/number}\"\n+    },\n+    \"commits\": {\n+      \"href\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26/commits\"\n+    },\n+    \"statuses\": {\n+      \"href\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/2705da2b616b98fa6010a25813c5a7a27456f71d\"\n+    }\n+  },\n+  \"author_association\": \"MEMBER\",\n+  \"merged\": false,\n+  \"mergeable\": true,\n+  \"rebaseable\": true,\n+  \"mergeable_state\": \"unstable\",\n+  \"merged_by\": null,\n+  \"comments\": 5,\n+  \"review_comments\": 0,\n+  \"maintainer_can_modify\": false,\n+  \"commits\": 2,\n+  \"additions\": 1124,\n+  \"deletions\": 0,\n+  \"changed_files\": 7\n+}"
+  },
+  {
+    "sha": "e87b27d2d7b4956d15f7468488b96cf6a06686f4",
+    "filename": "ursabot/tests/test_hooks.py",
+    "status": "added",
+    "additions": 116,
+    "deletions": 0,
+    "changes": 116,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/test_hooks.py",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/test_hooks.py",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/test_hooks.py?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -0,0 +1,116 @@\n+import json\n+from pathlib import Path\n+from twisted.trial import unittest\n+\n+from buildbot.test.util.misc import TestReactorMixin\n+from buildbot.test.fake.httpclientservice import \\\n+    HTTPClientService as FakeHTTPClientService\n+from buildbot.test.unit.test_www_hooks_github import (\n+    _prepare_request, _prepare_github_change_hook)\n+\n+from ursabot.utils import ensure_deferred\n+from ursabot.hooks import GithubHook\n+\n+\n+class ChangeHookTestCase(unittest.TestCase, TestReactorMixin):\n+\n+    klass = None\n+\n+    @ensure_deferred\n+    async def setUp(self):\n+        self.setUpTestReactor()\n+\n+        assert self.klass is not None\n+        self.hook = _prepare_github_change_hook(self, **{'class': self.klass})\n+        self.master = self.hook.master\n+        self.http = await FakeHTTPClientService.getFakeService(\n+            self.master, self, 'https://api.github.com',\n+            headers={'User-Agent': 'Buildbot'}, debug=False, verify=False)\n+\n+        await self.master.startService()\n+\n+    @ensure_deferred\n+    async def tearDown(self):\n+        await self.master.stopService()\n+\n+    async def trigger(self, event, payload, headers=None, _secret=None):\n+        payload = json.dumps(payload).encode()\n+        request = _prepare_request(event, payload, _secret=_secret,\n+                                   headers=headers)\n+        await request.test_render(self.hook)\n+        return request\n+\n+    def load_fixture(self, name):\n+        path = Path(__file__).parent / 'fixtures' / f'{name}.json'\n+        with path.open('r') as fp:\n+            return json.load(fp)\n+\n+\n+class TestGithubHook(ChangeHookTestCase):\n+\n+    klass = GithubHook\n+\n+    @ensure_deferred\n+    async def test_ping(self):\n+        await self.trigger('ping', {})\n+        assert len(self.hook.master.data.updates.changesAdded) == 0\n+\n+    @ensure_deferred\n+    async def test_issue_comment_not_mentioning_ursabot(self):\n+        payload = self.load_fixture('issue-comment-not-mentioning-ursabot')\n+        await self.trigger('issue_comment', payload=payload)\n+        assert len(self.hook.master.data.updates.changesAdded) == 0\n+\n+    @ensure_deferred\n+    async def test_issue_comment_by_ursabot(self):\n+        payload = self.load_fixture('issue-comment-by-ursabot')\n+        await self.trigger('issue_comment', payload=payload)\n+        assert len(self.hook.master.data.updates.changesAdded) == 0\n+\n+    @ensure_deferred\n+    async def test_issue_comment_with_empty_command(self):\n+        # responds to the comment\n+        request_json = {'body': 'Unknown command \"\"'}\n+        response_json = ''\n+        self.http.expect('post', '/repos/ursa-labs/ursabot/issues/26/comments',\n+                         json=request_json, content_json=response_json)\n+\n+        payload = self.load_fixture('issue-comment-with-empty-command')\n+        await self.trigger('issue_comment', payload=payload)\n+        assert len(self.hook.master.data.updates.changesAdded) == 0\n+\n+    @ensure_deferred\n+    async def test_issue_comment_without_pull_request(self):\n+        # responds to the comment\n+        request_json = {\n+            'body': 'Ursabot only listens to pull request comments!'\n+        }\n+        response_json = ''\n+        self.http.expect('post', '/repos/ursa-labs/ursabot/issues/19/comments',\n+                         json=request_json, content_json=response_json)\n+\n+        payload = self.load_fixture('issue-comment-without-pull-request')\n+        await self.trigger('issue_comment', payload=payload)\n+        assert len(self.hook.master.data.updates.changesAdded) == 0\n+\n+    @ensure_deferred\n+    async def test_issue_comment_build_command(self):\n+        # handle_issue_comment queries the pull request\n+        request_json = self.load_fixture('pull-request-26')\n+        self.http.expect('get', '/repos/ursa-labs/ursabot/pulls/26',\n+                         content_json=request_json)\n+        # tigger handle_pull_request which fetches the commit\n+        request_json = self.load_fixture('pull-request-26-commit')\n+        commit = '2705da2b616b98fa6010a25813c5a7a27456f71d'\n+        self.http.expect('get', f'/repos/ursa-labs/ursabot/commits/{commit}',\n+                         content_json=request_json)\n+\n+        # then responds to the comment\n+        request_json = {'body': \"I've successfully started builds for this PR\"}\n+        response_json = ''\n+        self.http.expect('post', '/repos/ursa-labs/ursabot/issues/26/comments',\n+                         json=request_json, content_json=response_json)\n+\n+        payload = self.load_fixture('issue-comment-build-command')\n+        await self.trigger('issue_comment', payload=payload)\n+        assert len(self.hook.master.data.updates.changesAdded) == 1"
+  },
+  {
+    "sha": "3ff0e88660cf186420e8bc672735e4d446963192",
+    "filename": "ursabot/utils.py",
+    "status": "added",
+    "additions": 10,
+    "deletions": 0,
+    "changes": 10,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/utils.py",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/utils.py",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/utils.py?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -0,0 +1,10 @@\n+import functools\n+from twisted.internet import defer\n+\n+\n+def ensure_deferred(f):\n+    @functools.wraps(f)\n+    def wrapper(*args, **kwargs):\n+        result = f(*args, **kwargs)\n+        return defer.ensureDeferred(result)\n+    return wrapper"
+  }
+]
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/pull-request-26.json b/src/arrow/dev/archery/archery/tests/fixtures/pull-request-26.json
new file mode 100644
index 000000000..d295afb39
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/pull-request-26.json
@@ -0,0 +1,329 @@
+{
+  "url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26",
+  "id": 267785552,
+  "node_id": "MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy",
+  "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+  "diff_url": "https://github.com/ursa-labs/ursabot/pull/26.diff",
+  "patch_url": "https://github.com/ursa-labs/ursabot/pull/26.patch",
+  "issue_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+  "number": 26,
+  "state": "open",
+  "locked": false,
+  "title": "Unittests for GithubHook",
+  "user": {
+    "login": "kszucs",
+    "id": 961747,
+    "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+    "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+    "gravatar_id": "",
+    "url": "https://api.github.com/users/kszucs",
+    "html_url": "https://github.com/kszucs",
+    "followers_url": "https://api.github.com/users/kszucs/followers",
+    "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+    "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+    "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+    "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+    "organizations_url": "https://api.github.com/users/kszucs/orgs",
+    "repos_url": "https://api.github.com/users/kszucs/repos",
+    "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+    "received_events_url": "https://api.github.com/users/kszucs/received_events",
+    "type": "User",
+    "site_admin": false
+  },
+  "body": "",
+  "body_html": "",
+  "body_text": "",
+  "created_at": "2019-04-05T11:22:15Z",
+  "updated_at": "2019-04-05T12:01:40Z",
+  "closed_at": null,
+  "merged_at": null,
+  "merge_commit_sha": "cc5dc3606988b3824be54df779ed2028776113cb",
+  "assignee": null,
+  "assignees": [],
+  "requested_reviewers": [],
+  "requested_teams": [],
+  "labels": [],
+  "milestone": null,
+  "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26/commits",
+  "review_comments_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26/comments",
+  "review_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/comments{/number}",
+  "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments",
+  "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/2705da2b616b98fa6010a25813c5a7a27456f71d",
+  "head": {
+    "label": "ursa-labs:test-hook",
+    "ref": "test-hook",
+    "sha": "2705da2b616b98fa6010a25813c5a7a27456f71d",
+    "user": {
+      "login": "ursa-labs",
+      "id": 46514972,
+      "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+      "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+      "gravatar_id": "",
+      "url": "https://api.github.com/users/ursa-labs",
+      "html_url": "https://github.com/ursa-labs",
+      "followers_url": "https://api.github.com/users/ursa-labs/followers",
+      "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+      "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+      "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+      "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+      "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+      "repos_url": "https://api.github.com/users/ursa-labs/repos",
+      "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+      "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+      "type": "Organization",
+      "site_admin": false
+    },
+    "repo": {
+      "id": 169101701,
+      "node_id": "MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=",
+      "name": "ursabot",
+      "full_name": "ursa-labs/ursabot",
+      "private": false,
+      "owner": {
+        "login": "ursa-labs",
+        "id": 46514972,
+        "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+        "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+        "gravatar_id": "",
+        "url": "https://api.github.com/users/ursa-labs",
+        "html_url": "https://github.com/ursa-labs",
+        "followers_url": "https://api.github.com/users/ursa-labs/followers",
+        "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+        "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+        "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+        "repos_url": "https://api.github.com/users/ursa-labs/repos",
+        "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+        "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+        "type": "Organization",
+        "site_admin": false
+      },
+      "html_url": "https://github.com/ursa-labs/ursabot",
+      "description": null,
+      "fork": false,
+      "url": "https://api.github.com/repos/ursa-labs/ursabot",
+      "forks_url": "https://api.github.com/repos/ursa-labs/ursabot/forks",
+      "keys_url": "https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}",
+      "collaborators_url": "https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}",
+      "teams_url": "https://api.github.com/repos/ursa-labs/ursabot/teams",
+      "hooks_url": "https://api.github.com/repos/ursa-labs/ursabot/hooks",
+      "issue_events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}",
+      "events_url": "https://api.github.com/repos/ursa-labs/ursabot/events",
+      "assignees_url": "https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}",
+      "branches_url": "https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}",
+      "tags_url": "https://api.github.com/repos/ursa-labs/ursabot/tags",
+      "blobs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}",
+      "git_tags_url": "https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}",
+      "git_refs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}",
+      "trees_url": "https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}",
+      "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}",
+      "languages_url": "https://api.github.com/repos/ursa-labs/ursabot/languages",
+      "stargazers_url": "https://api.github.com/repos/ursa-labs/ursabot/stargazers",
+      "contributors_url": "https://api.github.com/repos/ursa-labs/ursabot/contributors",
+      "subscribers_url": "https://api.github.com/repos/ursa-labs/ursabot/subscribers",
+      "subscription_url": "https://api.github.com/repos/ursa-labs/ursabot/subscription",
+      "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}",
+      "git_commits_url": "https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}",
+      "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/comments{/number}",
+      "issue_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}",
+      "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}",
+      "compare_url": "https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}",
+      "merges_url": "https://api.github.com/repos/ursa-labs/ursabot/merges",
+      "archive_url": "https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}",
+      "downloads_url": "https://api.github.com/repos/ursa-labs/ursabot/downloads",
+      "issues_url": "https://api.github.com/repos/ursa-labs/ursabot/issues{/number}",
+      "pulls_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}",
+      "milestones_url": "https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}",
+      "notifications_url": "https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}",
+      "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/labels{/name}",
+      "releases_url": "https://api.github.com/repos/ursa-labs/ursabot/releases{/id}",
+      "deployments_url": "https://api.github.com/repos/ursa-labs/ursabot/deployments",
+      "created_at": "2019-02-04T15:40:31Z",
+      "updated_at": "2019-04-04T17:49:10Z",
+      "pushed_at": "2019-04-05T12:01:40Z",
+      "git_url": "git://github.com/ursa-labs/ursabot.git",
+      "ssh_url": "git@github.com:ursa-labs/ursabot.git",
+      "clone_url": "https://github.com/ursa-labs/ursabot.git",
+      "svn_url": "https://github.com/ursa-labs/ursabot",
+      "homepage": null,
+      "size": 898,
+      "stargazers_count": 1,
+      "watchers_count": 1,
+      "language": "Jupyter Notebook",
+      "has_issues": true,
+      "has_projects": true,
+      "has_downloads": true,
+      "has_wiki": true,
+      "has_pages": false,
+      "forks_count": 0,
+      "mirror_url": null,
+      "archived": false,
+      "disabled": false,
+      "open_issues_count": 19,
+      "license": null,
+      "forks": 0,
+      "open_issues": 19,
+      "watchers": 1,
+      "default_branch": "master"
+    }
+  },
+  "base": {
+    "label": "ursa-labs:master",
+    "ref": "master",
+    "sha": "a162ad254b589b924db47e057791191b39613fd5",
+    "user": {
+      "login": "ursa-labs",
+      "id": 46514972,
+      "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+      "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+      "gravatar_id": "",
+      "url": "https://api.github.com/users/ursa-labs",
+      "html_url": "https://github.com/ursa-labs",
+      "followers_url": "https://api.github.com/users/ursa-labs/followers",
+      "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+      "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+      "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+      "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+      "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+      "repos_url": "https://api.github.com/users/ursa-labs/repos",
+      "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+      "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+      "type": "Organization",
+      "site_admin": false
+    },
+    "repo": {
+      "id": 169101701,
+      "node_id": "MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=",
+      "name": "ursabot",
+      "full_name": "ursa-labs/ursabot",
+      "private": false,
+      "owner": {
+        "login": "ursa-labs",
+        "id": 46514972,
+        "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+        "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+        "gravatar_id": "",
+        "url": "https://api.github.com/users/ursa-labs",
+        "html_url": "https://github.com/ursa-labs",
+        "followers_url": "https://api.github.com/users/ursa-labs/followers",
+        "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+        "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+        "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+        "repos_url": "https://api.github.com/users/ursa-labs/repos",
+        "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+        "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+        "type": "Organization",
+        "site_admin": false
+      },
+      "html_url": "https://github.com/ursa-labs/ursabot",
+      "description": null,
+      "fork": false,
+      "url": "https://api.github.com/repos/ursa-labs/ursabot",
+      "forks_url": "https://api.github.com/repos/ursa-labs/ursabot/forks",
+      "keys_url": "https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}",
+      "collaborators_url": "https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}",
+      "teams_url": "https://api.github.com/repos/ursa-labs/ursabot/teams",
+      "hooks_url": "https://api.github.com/repos/ursa-labs/ursabot/hooks",
+      "issue_events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}",
+      "events_url": "https://api.github.com/repos/ursa-labs/ursabot/events",
+      "assignees_url": "https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}",
+      "branches_url": "https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}",
+      "tags_url": "https://api.github.com/repos/ursa-labs/ursabot/tags",
+      "blobs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}",
+      "git_tags_url": "https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}",
+      "git_refs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}",
+      "trees_url": "https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}",
+      "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}",
+      "languages_url": "https://api.github.com/repos/ursa-labs/ursabot/languages",
+      "stargazers_url": "https://api.github.com/repos/ursa-labs/ursabot/stargazers",
+      "contributors_url": "https://api.github.com/repos/ursa-labs/ursabot/contributors",
+      "subscribers_url": "https://api.github.com/repos/ursa-labs/ursabot/subscribers",
+      "subscription_url": "https://api.github.com/repos/ursa-labs/ursabot/subscription",
+      "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}",
+      "git_commits_url": "https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}",
+      "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/comments{/number}",
+      "issue_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}",
+      "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}",
+      "compare_url": "https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}",
+      "merges_url": "https://api.github.com/repos/ursa-labs/ursabot/merges",
+      "archive_url": "https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}",
+      "downloads_url": "https://api.github.com/repos/ursa-labs/ursabot/downloads",
+      "issues_url": "https://api.github.com/repos/ursa-labs/ursabot/issues{/number}",
+      "pulls_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}",
+      "milestones_url": "https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}",
+      "notifications_url": "https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}",
+      "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/labels{/name}",
+      "releases_url": "https://api.github.com/repos/ursa-labs/ursabot/releases{/id}",
+      "deployments_url": "https://api.github.com/repos/ursa-labs/ursabot/deployments",
+      "created_at": "2019-02-04T15:40:31Z",
+      "updated_at": "2019-04-04T17:49:10Z",
+      "pushed_at": "2019-04-05T12:01:40Z",
+      "git_url": "git://github.com/ursa-labs/ursabot.git",
+      "ssh_url": "git@github.com:ursa-labs/ursabot.git",
+      "clone_url": "https://github.com/ursa-labs/ursabot.git",
+      "svn_url": "https://github.com/ursa-labs/ursabot",
+      "homepage": null,
+      "size": 898,
+      "stargazers_count": 1,
+      "watchers_count": 1,
+      "language": "Jupyter Notebook",
+      "has_issues": true,
+      "has_projects": true,
+      "has_downloads": true,
+      "has_wiki": true,
+      "has_pages": false,
+      "forks_count": 0,
+      "mirror_url": null,
+      "archived": false,
+      "disabled": false,
+      "open_issues_count": 19,
+      "license": null,
+      "forks": 0,
+      "open_issues": 19,
+      "watchers": 1,
+      "default_branch": "master"
+    }
+  },
+  "_links": {
+    "self": {
+      "href": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26"
+    },
+    "html": {
+      "href": "https://github.com/ursa-labs/ursabot/pull/26"
+    },
+    "issue": {
+      "href": "https://api.github.com/repos/ursa-labs/ursabot/issues/26"
+    },
+    "comments": {
+      "href": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments"
+    },
+    "review_comments": {
+      "href": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26/comments"
+    },
+    "review_comment": {
+      "href": "https://api.github.com/repos/ursa-labs/ursabot/pulls/comments{/number}"
+    },
+    "commits": {
+      "href": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26/commits"
+    },
+    "statuses": {
+      "href": "https://api.github.com/repos/ursa-labs/ursabot/statuses/2705da2b616b98fa6010a25813c5a7a27456f71d"
+    }
+  },
+  "author_association": "MEMBER",
+  "merged": false,
+  "mergeable": true,
+  "rebaseable": true,
+  "mergeable_state": "unstable",
+  "merged_by": null,
+  "comments": 5,
+  "review_comments": 0,
+  "maintainer_can_modify": false,
+  "commits": 2,
+  "additions": 1124,
+  "deletions": 0,
+  "changed_files": 7
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/test_benchmarks.py b/src/arrow/dev/archery/archery/tests/test_benchmarks.py
new file mode 100644
index 000000000..fab1e8d44
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/test_benchmarks.py
@@ -0,0 +1,383 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import json
+
+from archery.benchmark.codec import JsonEncoder
+from archery.benchmark.core import Benchmark, median
+from archery.benchmark.compare import (
+    BenchmarkComparator, RunnerComparator
+)
+from archery.benchmark.google import (
+    GoogleBenchmark, GoogleBenchmarkObservation
+)
+from archery.benchmark.runner import StaticBenchmarkRunner
+
+
+def test_benchmark_comparator():
+    unit = "micros"
+
+    assert not BenchmarkComparator(
+        Benchmark("contender", unit, True, [10], unit, [1]),
+        Benchmark("baseline", unit, True, [20], unit, [1]),
+    ).regression
+
+    assert BenchmarkComparator(
+        Benchmark("contender", unit, False, [10], unit, [1]),
+        Benchmark("baseline", unit, False, [20], unit, [1]),
+    ).regression
+
+    assert BenchmarkComparator(
+        Benchmark("contender", unit, True, [20], unit, [1]),
+        Benchmark("baseline", unit, True, [10], unit, [1]),
+    ).regression
+
+    assert not BenchmarkComparator(
+        Benchmark("contender", unit, False, [20], unit, [1]),
+        Benchmark("baseline", unit, False, [10], unit, [1]),
+    ).regression
+
+
+def test_static_runner_from_json_not_a_regression():
+    archery_result = {
+        "suites": [
+            {
+                "name": "arrow-value-parsing-benchmark",
+                "benchmarks": [
+                    {
+                        "name": "FloatParsing<DoubleType>",
+                        "unit": "items_per_second",
+                        "less_is_better": False,
+                        "values": [
+                            109941112.87296811
+                        ],
+                        "time_unit": "ns",
+                        "times": [
+                            9095.800104330105
+                        ]
+                    },
+                ]
+            }
+        ]
+    }
+
+    contender = StaticBenchmarkRunner.from_json(json.dumps(archery_result))
+    baseline = StaticBenchmarkRunner.from_json(json.dumps(archery_result))
+    [comparison] = RunnerComparator(contender, baseline).comparisons
+    assert not comparison.regression
+
+
+def test_static_runner_from_json_regression():
+    archery_result = {
+        "suites": [
+            {
+                "name": "arrow-value-parsing-benchmark",
+                "benchmarks": [
+                    {
+                        "name": "FloatParsing<DoubleType>",
+                        "unit": "items_per_second",
+                        "less_is_better": False,
+                        "values": [
+                            109941112.87296811
+                        ],
+                        "time_unit": "ns",
+                        "times": [
+                            9095.800104330105
+                        ]
+                    },
+                ]
+            }
+        ]
+    }
+
+    contender = StaticBenchmarkRunner.from_json(json.dumps(archery_result))
+
+    # introduce artificial regression
+    archery_result['suites'][0]['benchmarks'][0]['values'][0] *= 2
+    baseline = StaticBenchmarkRunner.from_json(json.dumps(archery_result))
+
+    [comparison] = RunnerComparator(contender, baseline).comparisons
+    assert comparison.regression
+
+
+def test_benchmark_median():
+    assert median([10]) == 10
+    assert median([1, 2, 3]) == 2
+    assert median([1, 2]) == 1.5
+    assert median([1, 2, 3, 4]) == 2.5
+    assert median([1, 1, 1, 1]) == 1
+    try:
+        median([])
+        assert False
+    except ValueError:
+        pass
+
+
+def assert_benchmark(name, google_result, archery_result):
+    observation = GoogleBenchmarkObservation(**google_result)
+    benchmark = GoogleBenchmark(name, [observation])
+    result = json.dumps(benchmark, cls=JsonEncoder)
+    assert json.loads(result) == archery_result
+
+
+def test_items_per_second():
+    name = "ArrayArrayKernel<AddChecked, UInt8Type>/32768/0"
+    google_result = {
+        "cpu_time": 116292.58886653671,
+        "items_per_second": 281772039.9844759,
+        "iterations": 5964,
+        "name": name,
+        "null_percent": 0.0,
+        "real_time": 119811.77313729875,
+        "repetition_index": 0,
+        "repetitions": 0,
+        "run_name": name,
+        "run_type": "iteration",
+        "size": 32768.0,
+        "threads": 1,
+        "time_unit": "ns",
+    }
+    archery_result = {
+        "counters": {"iterations": 5964,
+                     "null_percent": 0.0,
+                     "repetition_index": 0,
+                     "repetitions": 0,
+                     "run_name": name,
+                     "threads": 1},
+        "name": name,
+        "unit": "items_per_second",
+        "less_is_better": False,
+        "values": [281772039.9844759],
+        "time_unit": "ns",
+        "times": [119811.77313729875],
+    }
+    assert "items_per_second" in google_result
+    assert "bytes_per_second" not in google_result
+    assert_benchmark(name, google_result, archery_result)
+
+
+def test_bytes_per_second():
+    name = "BufferOutputStreamLargeWrites/real_time"
+    google_result = {
+        "bytes_per_second": 1890209037.3405428,
+        "cpu_time": 17018127.659574457,
+        "iterations": 47,
+        "name": name,
+        "real_time": 17458386.53190963,
+        "repetition_index": 1,
+        "repetitions": 0,
+        "run_name": name,
+        "run_type": "iteration",
+        "threads": 1,
+        "time_unit": "ns",
+    }
+    archery_result = {
+        "counters": {"iterations": 47,
+                     "repetition_index": 1,
+                     "repetitions": 0,
+                     "run_name": name,
+                     "threads": 1},
+        "name": name,
+        "unit": "bytes_per_second",
+        "less_is_better": False,
+        "values": [1890209037.3405428],
+        "time_unit": "ns",
+        "times": [17458386.53190963],
+    }
+    assert "items_per_second" not in google_result
+    assert "bytes_per_second" in google_result
+    assert_benchmark(name, google_result, archery_result)
+
+
+def test_both_items_and_bytes_per_second():
+    name = "ArrayArrayKernel<AddChecked, UInt8Type>/32768/0"
+    google_result = {
+        "bytes_per_second": 281772039.9844759,
+        "cpu_time": 116292.58886653671,
+        "items_per_second": 281772039.9844759,
+        "iterations": 5964,
+        "name": name,
+        "null_percent": 0.0,
+        "real_time": 119811.77313729875,
+        "repetition_index": 0,
+        "repetitions": 0,
+        "run_name": name,
+        "run_type": "iteration",
+        "size": 32768.0,
+        "threads": 1,
+        "time_unit": "ns",
+    }
+    # Note that bytes_per_second trumps items_per_second
+    archery_result = {
+        "counters": {"iterations": 5964,
+                     "null_percent": 0.0,
+                     "repetition_index": 0,
+                     "repetitions": 0,
+                     "run_name": name,
+                     "threads": 1},
+        "name": name,
+        "unit": "bytes_per_second",
+        "less_is_better": False,
+        "values": [281772039.9844759],
+        "time_unit": "ns",
+        "times": [119811.77313729875],
+    }
+    assert "items_per_second" in google_result
+    assert "bytes_per_second" in google_result
+    assert_benchmark(name, google_result, archery_result)
+
+
+def test_neither_items_nor_bytes_per_second():
+    name = "AllocateDeallocate<Jemalloc>/size:1048576/real_time"
+    google_result = {
+        "cpu_time": 1778.6004847419827,
+        "iterations": 352765,
+        "name": name,
+        "real_time": 1835.3137357788837,
+        "repetition_index": 0,
+        "repetitions": 0,
+        "run_name": name,
+        "run_type": "iteration",
+        "threads": 1,
+        "time_unit": "ns",
+    }
+    archery_result = {
+        "counters": {"iterations": 352765,
+                     "repetition_index": 0,
+                     "repetitions": 0,
+                     "run_name": name,
+                     "threads": 1},
+        "name": name,
+        "unit": "ns",
+        "less_is_better": True,
+        "values": [1835.3137357788837],
+        "time_unit": "ns",
+        "times": [1835.3137357788837],
+    }
+    assert "items_per_second" not in google_result
+    assert "bytes_per_second" not in google_result
+    assert_benchmark(name, google_result, archery_result)
+
+
+def test_prefer_real_time():
+    name = "AllocateDeallocate<Jemalloc>/size:1048576/real_time"
+    google_result = {
+        "cpu_time": 1778.6004847419827,
+        "iterations": 352765,
+        "name": name,
+        "real_time": 1835.3137357788837,
+        "repetition_index": 0,
+        "repetitions": 0,
+        "run_name": name,
+        "run_type": "iteration",
+        "threads": 1,
+        "time_unit": "ns",
+    }
+    archery_result = {
+        "counters": {"iterations": 352765,
+                     "repetition_index": 0,
+                     "repetitions": 0,
+                     "run_name": name,
+                     "threads": 1},
+        "name": name,
+        "unit": "ns",
+        "less_is_better": True,
+        "values": [1835.3137357788837],
+        "time_unit": "ns",
+        "times": [1835.3137357788837],
+    }
+    assert name.endswith("/real_time")
+    assert_benchmark(name, google_result, archery_result)
+
+
+def test_prefer_cpu_time():
+    name = "AllocateDeallocate<Jemalloc>/size:1048576"
+    google_result = {
+        "cpu_time": 1778.6004847419827,
+        "iterations": 352765,
+        "name": name,
+        "real_time": 1835.3137357788837,
+        "repetition_index": 0,
+        "repetitions": 0,
+        "run_name": name,
+        "run_type": "iteration",
+        "threads": 1,
+        "time_unit": "ns",
+    }
+    archery_result = {
+        "counters": {"iterations": 352765,
+                     "repetition_index": 0,
+                     "repetitions": 0,
+                     "run_name": name,
+                     "threads": 1},
+        "name": name,
+        "unit": "ns",
+        "less_is_better": True,
+        "values": [1778.6004847419827],
+        "time_unit": "ns",
+        "times": [1835.3137357788837],
+    }
+    assert not name.endswith("/real_time")
+    assert_benchmark(name, google_result, archery_result)
+
+
+def test_omits_aggregates():
+    name = "AllocateDeallocate<Jemalloc>/size:1048576/real_time"
+    google_aggregate = {
+        "aggregate_name": "mean",
+        "cpu_time": 1757.428694267678,
+        "iterations": 3,
+        "name": "AllocateDeallocate<Jemalloc>/size:1048576/real_time_mean",
+        "real_time": 1849.3869337041162,
+        "repetitions": 0,
+        "run_name": name,
+        "run_type": "aggregate",
+        "threads": 1,
+        "time_unit": "ns",
+    }
+    google_result = {
+        "cpu_time": 1778.6004847419827,
+        "iterations": 352765,
+        "name": name,
+        "real_time": 1835.3137357788837,
+        "repetition_index": 0,
+        "repetitions": 0,
+        "run_name": name,
+        "run_type": "iteration",
+        "threads": 1,
+        "time_unit": "ns",
+    }
+    archery_result = {
+        "counters": {"iterations": 352765,
+                     "repetition_index": 0,
+                     "repetitions": 0,
+                     "run_name": name,
+                     "threads": 1},
+        "name": name,
+        "unit": "ns",
+        "less_is_better": True,
+        "values": [1835.3137357788837],
+        "time_unit": "ns",
+        "times": [1835.3137357788837],
+    }
+    assert google_aggregate["run_type"] == "aggregate"
+    assert google_result["run_type"] == "iteration"
+    observation1 = GoogleBenchmarkObservation(**google_aggregate)
+    observation2 = GoogleBenchmarkObservation(**google_result)
+    benchmark = GoogleBenchmark(name, [observation1, observation2])
+    result = json.dumps(benchmark, cls=JsonEncoder)
+    assert json.loads(result) == archery_result
diff --git a/src/arrow/dev/archery/archery/tests/test_bot.py b/src/arrow/dev/archery/archery/tests/test_bot.py
new file mode 100644
index 000000000..e84fb7e27
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/test_bot.py
@@ -0,0 +1,215 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import json
+from unittest.mock import Mock
+
+import click
+import pytest
+import responses as rsps
+
+from archery.bot import CommentBot, CommandError, group
+
+
+@pytest.fixture
+def responses():
+    with rsps.RequestsMock() as mock:
+        yield mock
+
+
+def github_url(path):
+    return 'https://api.github.com:443/{}'.format(path.strip('/'))
+
+
+@group()
+def custom_handler():
+    pass
+
+
+@custom_handler.command()
+@click.pass_obj
+def extra(obj):
+    return obj
+
+
+@custom_handler.command()
+@click.option('--force', '-f', is_flag=True)
+def build(force):
+    return force
+
+
+@custom_handler.command()
+@click.option('--name', required=True)
+def benchmark(name):
+    return name
+
+
+def test_click_based_commands():
+    assert custom_handler('build') is False
+    assert custom_handler('build -f') is True
+
+    assert custom_handler('benchmark --name strings') == 'strings'
+    with pytest.raises(CommandError):
+        assert custom_handler('benchmark')
+
+    assert custom_handler('extra', extra='data') == {'extra': 'data'}
+
+
+@pytest.mark.parametrize('fixture_name', [
+    # the bot is not mentioned, nothing to do
+    'event-issue-comment-not-mentioning-ursabot.json',
+    # don't respond to itself, it prevents recursive comment storms!
+    'event-issue-comment-by-ursabot.json',
+    # non-authorized user sent the comment, do not respond
+    'event-issue-comment-by-non-authorized-user.json',
+])
+def test_noop_events(load_fixture, fixture_name):
+    payload = load_fixture(fixture_name)
+
+    handler = Mock()
+    bot = CommentBot(name='ursabot', token='', handler=handler)
+    bot.handle('issue_comment', payload)
+
+    handler.assert_not_called()
+
+
+def test_issue_comment_without_pull_request(load_fixture, responses):
+    responses.add(
+        responses.GET,
+        github_url('/repositories/169101701/issues/19'),
+        json=load_fixture('issue-19.json'),
+        status=200
+    )
+    responses.add(
+        responses.GET,
+        github_url('repos/ursa-labs/ursabot/pulls/19'),
+        json={},
+        status=404
+    )
+    responses.add(
+        responses.POST,
+        github_url('/repos/ursa-labs/ursabot/issues/19/comments'),
+        json={}
+    )
+
+    def handler(command, **kwargs):
+        pass
+
+    payload = load_fixture('event-issue-comment-without-pull-request.json')
+    bot = CommentBot(name='ursabot', token='', handler=handler)
+    bot.handle('issue_comment', payload)
+
+    post = responses.calls[2]
+    assert json.loads(post.request.body) == {
+        'body': "The comment bot only listens to pull request comments!"
+    }
+
+
+def test_respond_with_usage(load_fixture, responses):
+    responses.add(
+        responses.GET,
+        github_url('/repositories/169101701/issues/26'),
+        json=load_fixture('issue-26.json'),
+        status=200
+    )
+    responses.add(
+        responses.GET,
+        github_url('/repos/ursa-labs/ursabot/pulls/26'),
+        json=load_fixture('pull-request-26.json'),
+        status=200
+    )
+    responses.add(
+        responses.GET,
+        github_url('/repos/ursa-labs/ursabot/issues/comments/480243811'),
+        json=load_fixture('issue-comment-480243811.json')
+    )
+    responses.add(
+        responses.POST,
+        github_url('/repos/ursa-labs/ursabot/issues/26/comments'),
+        json={}
+    )
+
+    def handler(command, **kwargs):
+        raise CommandError('test-usage')
+
+    payload = load_fixture('event-issue-comment-with-empty-command.json')
+    bot = CommentBot(name='ursabot', token='', handler=handler)
+    bot.handle('issue_comment', payload)
+
+    post = responses.calls[3]
+    assert json.loads(post.request.body) == {'body': '```\ntest-usage\n```'}
+
+
+@pytest.mark.parametrize(('command', 'reaction'), [
+    ('@ursabot build', '+1'),
+    ('@ursabot build\nwith a comment', '+1'),
+    ('@ursabot listen', '-1'),
+])
+def test_issue_comment_with_commands(load_fixture, responses, command,
+                                     reaction):
+    responses.add(
+        responses.GET,
+        github_url('/repositories/169101701/issues/26'),
+        json=load_fixture('issue-26.json'),
+        status=200
+    )
+    responses.add(
+        responses.GET,
+        github_url('/repos/ursa-labs/ursabot/pulls/26'),
+        json=load_fixture('pull-request-26.json'),
+        status=200
+    )
+    responses.add(
+        responses.GET,
+        github_url('/repos/ursa-labs/ursabot/issues/comments/480248726'),
+        json=load_fixture('issue-comment-480248726.json')
+    )
+    responses.add(
+        responses.POST,
+        github_url(
+            '/repos/ursa-labs/ursabot/issues/comments/480248726/reactions'
+        ),
+        json={}
+    )
+
+    def handler(command, **kwargs):
+        if command == 'build':
+            return True
+        else:
+            raise ValueError('Only `build` command is supported.')
+
+    payload = load_fixture('event-issue-comment-build-command.json')
+    payload["comment"]["body"] = command
+
+    bot = CommentBot(name='ursabot', token='', handler=handler)
+    bot.handle('issue_comment', payload)
+
+    post = responses.calls[3]
+    assert json.loads(post.request.body) == {'content': reaction}
+
+
+def test_issue_comment_with_commands_bot_not_first(load_fixture, responses):
+    # when the @-mention is not first, this is a no-op
+    handler = Mock()
+
+    payload = load_fixture('event-issue-comment-build-command.json')
+    payload["comment"]["body"] = 'with a comment\n@ursabot build'
+
+    bot = CommentBot(name='ursabot', token='', handler=handler)
+    bot.handle('issue_comment', payload)
+
+    handler.assert_not_called()
diff --git a/src/arrow/dev/archery/archery/tests/test_cli.py b/src/arrow/dev/archery/archery/tests/test_cli.py
new file mode 100644
index 000000000..3891a2c28
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/test_cli.py
@@ -0,0 +1,39 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from pathlib import Path
+from unittest.mock import patch
+
+from click.testing import CliRunner
+
+from archery.cli import archery
+
+
+@patch("archery.linking.check_dynamic_library_dependencies")
+def test_linking_check_dependencies(fn):
+    args = [
+        "linking",
+        "check-dependencies",
+        "-a", "libarrow",
+        "-d", "libcurl",
+        "somelib.so"
+    ]
+    result = CliRunner().invoke(archery, args)
+    assert result.exit_code == 0
+    fn.assert_called_once_with(
+        Path('somelib.so'), allowed={'libarrow'}, disallowed={'libcurl'}
+    )
diff --git a/src/arrow/dev/archery/archery/tests/test_release.py b/src/arrow/dev/archery/archery/tests/test_release.py
new file mode 100644
index 000000000..75aac8921
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/test_release.py
@@ -0,0 +1,333 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import pytest
+
+from archery.release import (
+    Release, MajorRelease, MinorRelease, PatchRelease,
+    Jira, Version, Issue, CommitTitle, Commit
+)
+from archery.testing import DotDict
+
+
+# subset of issues per revision
+_issues = {
+    "1.0.1": [
+        Issue("ARROW-9684", type="Bug", summary="[C++] Title"),
+        Issue("ARROW-9667", type="New Feature", summary="[Crossbow] Title"),
+        Issue("ARROW-9659", type="Bug", summary="[C++] Title"),
+        Issue("ARROW-9644", type="Bug", summary="[C++][Dataset] Title"),
+        Issue("ARROW-9643", type="Bug", summary="[C++] Title"),
+        Issue("ARROW-9609", type="Bug", summary="[C++] Title"),
+        Issue("ARROW-9606", type="Bug", summary="[C++][Dataset] Title")
+    ],
+    "1.0.0": [
+        Issue("ARROW-300", type="New Feature", summary="[Format] Title"),
+        Issue("ARROW-4427", type="Task", summary="[Doc] Title"),
+        Issue("ARROW-5035", type="Improvement", summary="[C#] Title"),
+        Issue("ARROW-8473", type="Bug", summary="[Rust] Title"),
+        Issue("ARROW-8472", type="Bug", summary="[Go][Integration] Title"),
+        Issue("ARROW-8471", type="Bug", summary="[C++][Integration] Title"),
+        Issue("ARROW-8974", type="Improvement", summary="[C++] Title"),
+        Issue("ARROW-8973", type="New Feature", summary="[Java] Title")
+    ],
+    "0.17.1": [
+        Issue("ARROW-8684", type="Bug", summary="[Python] Title"),
+        Issue("ARROW-8657", type="Bug", summary="[C++][Parquet] Title"),
+        Issue("ARROW-8641", type="Bug", summary="[Python] Title"),
+        Issue("ARROW-8609", type="Bug", summary="[C++] Title"),
+    ],
+    "0.17.0": [
+        Issue("ARROW-2882", type="New Feature", summary="[C++][Python] Title"),
+        Issue("ARROW-2587", type="Bug", summary="[Python] Title"),
+        Issue("ARROW-2447", type="Improvement", summary="[C++] Title"),
+        Issue("ARROW-2255", type="Bug", summary="[Integration] Title"),
+        Issue("ARROW-1907", type="Bug", summary="[C++/Python] Title"),
+        Issue("ARROW-1636", type="New Feature", summary="[Format] Title")
+    ]
+}
+
+
+class FakeJira(Jira):
+
+    def __init__(self):
+        pass
+
+    def project_versions(self, project='ARROW'):
+        return [
+            Version.parse("3.0.0", released=False),
+            Version.parse("2.0.0", released=False),
+            Version.parse("1.1.0", released=False),
+            Version.parse("1.0.1", released=False),
+            Version.parse("1.0.0", released=True),
+            Version.parse("0.17.1", released=True),
+            Version.parse("0.17.0", released=True),
+            Version.parse("0.16.0", released=True),
+            Version.parse("0.15.2", released=True),
+            Version.parse("0.15.1", released=True),
+            Version.parse("0.15.0", released=True),
+        ]
+
+    def project_issues(self, version, project='ARROW'):
+        return _issues[str(version)]
+
+
+@pytest.fixture
+def fake_jira():
+    return FakeJira()
+
+
+def test_version(fake_jira):
+    v = Version.parse("1.2.5")
+    assert str(v) == "1.2.5"
+    assert v.major == 1
+    assert v.minor == 2
+    assert v.patch == 5
+    assert v.released is False
+    assert v.release_date is None
+
+    v = Version.parse("1.0.0", released=True, release_date="2020-01-01")
+    assert str(v) == "1.0.0"
+    assert v.major == 1
+    assert v.minor == 0
+    assert v.patch == 0
+    assert v.released is True
+    assert v.release_date == "2020-01-01"
+
+
+def test_issue(fake_jira):
+    i = Issue("ARROW-1234", type='Bug', summary="title")
+    assert i.key == "ARROW-1234"
+    assert i.type == "Bug"
+    assert i.summary == "title"
+    assert i.project == "ARROW"
+    assert i.number == 1234
+
+    i = Issue("PARQUET-1111", type='Improvement', summary="another title")
+    assert i.key == "PARQUET-1111"
+    assert i.type == "Improvement"
+    assert i.summary == "another title"
+    assert i.project == "PARQUET"
+    assert i.number == 1111
+
+    fake_jira_issue = DotDict({
+        'key': 'ARROW-2222',
+        'fields': {
+            'issuetype': {
+                'name': 'Feature'
+            },
+            'summary': 'Issue title'
+        }
+    })
+    i = Issue.from_jira(fake_jira_issue)
+    assert i.key == "ARROW-2222"
+    assert i.type == "Feature"
+    assert i.summary == "Issue title"
+    assert i.project == "ARROW"
+    assert i.number == 2222
+
+
+def test_commit_title():
+    t = CommitTitle.parse(
+        "ARROW-9598: [C++][Parquet] Fix writing nullable structs"
+    )
+    assert t.project == "ARROW"
+    assert t.issue == "ARROW-9598"
+    assert t.components == ["C++", "Parquet"]
+    assert t.summary == "Fix writing nullable structs"
+
+    t = CommitTitle.parse(
+        "ARROW-8002: [C++][Dataset][R] Support partitioned dataset writing"
+    )
+    assert t.project == "ARROW"
+    assert t.issue == "ARROW-8002"
+    assert t.components == ["C++", "Dataset", "R"]
+    assert t.summary == "Support partitioned dataset writing"
+
+    t = CommitTitle.parse(
+        "ARROW-9600: [Rust][Arrow] pin older version of proc-macro2 during "
+        "build"
+    )
+    assert t.project == "ARROW"
+    assert t.issue == "ARROW-9600"
+    assert t.components == ["Rust", "Arrow"]
+    assert t.summary == "pin older version of proc-macro2 during build"
+
+    t = CommitTitle.parse("[Release] Update versions for 1.0.0")
+    assert t.project is None
+    assert t.issue is None
+    assert t.components == ["Release"]
+    assert t.summary == "Update versions for 1.0.0"
+
+    t = CommitTitle.parse("[Python][Doc] Fix rst role dataset.rst (#7725)")
+    assert t.project is None
+    assert t.issue is None
+    assert t.components == ["Python", "Doc"]
+    assert t.summary == "Fix rst role dataset.rst (#7725)"
+
+    t = CommitTitle.parse(
+        "PARQUET-1882: [C++] Buffered Reads should allow for 0 length"
+    )
+    assert t.project == 'PARQUET'
+    assert t.issue == 'PARQUET-1882'
+    assert t.components == ["C++"]
+    assert t.summary == "Buffered Reads should allow for 0 length"
+
+    t = CommitTitle.parse(
+        "ARROW-9340 [R] Use CRAN version of decor package "
+        "\nsomething else\n"
+        "\nwhich should be truncated"
+    )
+    assert t.project == 'ARROW'
+    assert t.issue == 'ARROW-9340'
+    assert t.components == ["R"]
+    assert t.summary == "Use CRAN version of decor package "
+
+
+def test_release_basics(fake_jira):
+    r = Release.from_jira("1.0.0", jira=fake_jira)
+    assert isinstance(r, MajorRelease)
+    assert r.is_released is True
+    assert r.branch == 'master'
+    assert r.tag == 'apache-arrow-1.0.0'
+
+    r = Release.from_jira("1.1.0", jira=fake_jira)
+    assert isinstance(r, MinorRelease)
+    assert r.is_released is False
+    assert r.branch == 'maint-1.x.x'
+    assert r.tag == 'apache-arrow-1.1.0'
+
+    # minor releases before 1.0 are treated as major releases
+    r = Release.from_jira("0.17.0", jira=fake_jira)
+    assert isinstance(r, MajorRelease)
+    assert r.is_released is True
+    assert r.branch == 'master'
+    assert r.tag == 'apache-arrow-0.17.0'
+
+    r = Release.from_jira("0.17.1", jira=fake_jira)
+    assert isinstance(r, PatchRelease)
+    assert r.is_released is True
+    assert r.branch == 'maint-0.17.x'
+    assert r.tag == 'apache-arrow-0.17.1'
+
+
+def test_previous_and_next_release(fake_jira):
+    r = Release.from_jira("3.0.0", jira=fake_jira)
+    assert isinstance(r.previous, MajorRelease)
+    assert r.previous.version == Version.parse("2.0.0")
+    with pytest.raises(ValueError, match="There is no upcoming release set"):
+        assert r.next
+
+    r = Release.from_jira("2.0.0", jira=fake_jira)
+    assert isinstance(r.previous, MajorRelease)
+    assert isinstance(r.next, MajorRelease)
+    assert r.previous.version == Version.parse("1.0.0")
+    assert r.next.version == Version.parse("3.0.0")
+
+    r = Release.from_jira("1.1.0", jira=fake_jira)
+    assert isinstance(r.previous, MajorRelease)
+    assert isinstance(r.next, MajorRelease)
+    assert r.previous.version == Version.parse("1.0.0")
+    assert r.next.version == Version.parse("2.0.0")
+
+    r = Release.from_jira("1.0.0", jira=fake_jira)
+    assert isinstance(r.next, MajorRelease)
+    assert isinstance(r.previous, MajorRelease)
+    assert r.previous.version == Version.parse("0.17.0")
+    assert r.next.version == Version.parse("2.0.0")
+
+    r = Release.from_jira("0.17.0", jira=fake_jira)
+    assert isinstance(r.previous, MajorRelease)
+    assert r.previous.version == Version.parse("0.16.0")
+
+    r = Release.from_jira("0.15.2", jira=fake_jira)
+    assert isinstance(r.previous, PatchRelease)
+    assert isinstance(r.next, MajorRelease)
+    assert r.previous.version == Version.parse("0.15.1")
+    assert r.next.version == Version.parse("0.16.0")
+
+    r = Release.from_jira("0.15.1", jira=fake_jira)
+    assert isinstance(r.previous, MajorRelease)
+    assert isinstance(r.next, PatchRelease)
+    assert r.previous.version == Version.parse("0.15.0")
+    assert r.next.version == Version.parse("0.15.2")
+
+
+def test_release_issues(fake_jira):
+    # major release issues
+    r = Release.from_jira("1.0.0", jira=fake_jira)
+    assert r.issues.keys() == set([
+        "ARROW-300",
+        "ARROW-4427",
+        "ARROW-5035",
+        "ARROW-8473",
+        "ARROW-8472",
+        "ARROW-8471",
+        "ARROW-8974",
+        "ARROW-8973"
+    ])
+    # minor release issues
+    r = Release.from_jira("0.17.0", jira=fake_jira)
+    assert r.issues.keys() == set([
+        "ARROW-2882",
+        "ARROW-2587",
+        "ARROW-2447",
+        "ARROW-2255",
+        "ARROW-1907",
+        "ARROW-1636",
+    ])
+    # patch release issues
+    r = Release.from_jira("1.0.1", jira=fake_jira)
+    assert r.issues.keys() == set([
+        "ARROW-9684",
+        "ARROW-9667",
+        "ARROW-9659",
+        "ARROW-9644",
+        "ARROW-9643",
+        "ARROW-9609",
+        "ARROW-9606"
+    ])
+
+
+@pytest.mark.parametrize(('version', 'ncommits'), [
+    ("1.0.0", 771),
+    ("0.17.1", 27),
+    ("0.17.0", 569),
+    ("0.15.1", 41)
+])
+def test_release_commits(fake_jira, version, ncommits):
+    r = Release.from_jira(version, jira=fake_jira)
+    assert len(r.commits) == ncommits
+    for c in r.commits:
+        assert isinstance(c, Commit)
+        assert isinstance(c.title, CommitTitle)
+        assert c.url.endswith(c.hexsha)
+
+
+def test_maintenance_patch_selection(fake_jira):
+    r = Release.from_jira("0.17.1", jira=fake_jira)
+
+    shas_to_pick = [
+        c.hexsha for c in r.commits_to_pick(exclude_already_applied=False)
+    ]
+    expected = [
+        '8939b4bd446ee406d5225c79d563a27d30fd7d6d',
+        'bcef6c95a324417e85e0140f9745d342cd8784b3',
+        '6002ec388840de5622e39af85abdc57a2cccc9b2',
+        '9123dadfd123bca7af4eaa9455f5b0d1ca8b929d',
+    ]
+    assert shas_to_pick == expected
diff --git a/src/arrow/dev/archery/archery/tests/test_testing.py b/src/arrow/dev/archery/archery/tests/test_testing.py
new file mode 100644
index 000000000..117b9288d
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/test_testing.py
@@ -0,0 +1,62 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import subprocess
+
+import pytest
+
+from archery.testing import PartialEnv, assert_subprocess_calls
+
+
+def test_partial_env():
+    assert PartialEnv(a=1, b=2) == {'a': 1, 'b': 2, 'c': 3}
+    assert PartialEnv(a=1) == {'a': 1, 'b': 2, 'c': 3}
+    assert PartialEnv(a=1, b=2) == {'a': 1, 'b': 2}
+    assert PartialEnv(a=1, b=2) != {'b': 2, 'c': 3}
+    assert PartialEnv(a=1, b=2) != {'a': 1, 'c': 3}
+
+
+def test_assert_subprocess_calls():
+    expected_calls = [
+        "echo Hello",
+        ["echo", "World"]
+    ]
+    with assert_subprocess_calls(expected_calls):
+        subprocess.run(['echo', 'Hello'])
+        subprocess.run(['echo', 'World'])
+
+    expected_env = PartialEnv(
+        CUSTOM_ENV_A='a',
+        CUSTOM_ENV_C='c'
+    )
+    with assert_subprocess_calls(expected_calls, env=expected_env):
+        env = {
+            'CUSTOM_ENV_A': 'a',
+            'CUSTOM_ENV_B': 'b',
+            'CUSTOM_ENV_C': 'c'
+        }
+        subprocess.run(['echo', 'Hello'], env=env)
+        subprocess.run(['echo', 'World'], env=env)
+
+    with pytest.raises(AssertionError):
+        with assert_subprocess_calls(expected_calls, env=expected_env):
+            env = {
+                'CUSTOM_ENV_B': 'b',
+                'CUSTOM_ENV_C': 'c'
+            }
+            subprocess.run(['echo', 'Hello'], env=env)
+            subprocess.run(['echo', 'World'], env=env)
diff --git a/src/arrow/dev/archery/archery/utils/__init__.py b/src/arrow/dev/archery/archery/utils/__init__.py
new file mode 100644
index 000000000..13a83393a
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/__init__.py
@@ -0,0 +1,16 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
diff --git a/src/arrow/dev/archery/archery/utils/cache.py b/src/arrow/dev/archery/archery/utils/cache.py
new file mode 100644
index 000000000..d92c5f32e
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/cache.py
@@ -0,0 +1,80 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from pathlib import Path
+import os
+from urllib.request import urlopen
+
+from .logger import logger
+
+ARCHERY_CACHE_DIR = Path.home() / ".cache" / "archery"
+
+
+class Cache:
+    """ Cache stores downloaded objects, notably apache-rat.jar. """
+
+    def __init__(self, path=ARCHERY_CACHE_DIR):
+        self.root = path
+
+        if not path.exists():
+            os.makedirs(path)
+
+    def key_path(self, key):
+        """ Return the full path of a key. """
+        return self.root/key
+
+    def get(self, key):
+        """ Return the full path of a key if cached, None otherwise. """
+        path = self.key_path(key)
+        return path if path.exists() else None
+
+    def delete(self, key):
+        """ Remove a key (and the file) from the cache. """
+        path = self.get(key)
+        if path:
+            path.unlink()
+
+    def get_or_insert(self, key, create):
+        """
+        Get or Insert a key from the cache. If the key is not found, the
+        `create` closure will be evaluated.
+
+        The `create` closure takes a single parameter, the path where the
+        object should be store. The file should only be created upon success.
+        """
+        path = self.key_path(key)
+
+        if not path.exists():
+            create(path)
+
+        return path
+
+    def get_or_insert_from_url(self, key, url):
+        """
+        Get or Insert a key from the cache. If the key is not found, the file
+        is downloaded from `url`.
+        """
+        def download(path):
+            """ Tiny wrapper that download a file and save as key. """
+            logger.debug("Downloading {} as {}".format(url, path))
+            conn = urlopen(url)
+            # Ensure the download is completed before writing to disks.
+            content = conn.read()
+            with open(path, "wb") as path_fd:
+                path_fd.write(content)
+
+        return self.get_or_insert(key, download)
diff --git a/src/arrow/dev/archery/archery/utils/cli.py b/src/arrow/dev/archery/archery/utils/cli.py
new file mode 100644
index 000000000..701abe925
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/cli.py
@@ -0,0 +1,73 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import importlib
+
+import click
+
+from .source import ArrowSources, InvalidArrowSource
+
+
+class ArrowBool(click.types.BoolParamType):
+    """
+    ArrowBool supports the 'ON' and 'OFF' values on top of the values
+    supported by BoolParamType. This is convenient to port script which exports
+    CMake options variables.
+    """
+    name = "boolean"
+
+    def convert(self, value, param, ctx):
+        if isinstance(value, str):
+            lowered = value.lower()
+            if lowered == "on":
+                return True
+            elif lowered == "off":
+                return False
+
+        return super().convert(value, param, ctx)
+
+
+def validate_arrow_sources(ctx, param, src):
+    """
+    Ensure a directory contains Arrow cpp sources.
+    """
+    try:
+        return ArrowSources.find(src)
+    except InvalidArrowSource as e:
+        raise click.BadParameter(str(e))
+
+
+def add_optional_command(name, module, function, parent):
+    try:
+        module = importlib.import_module(module, package="archery")
+        command = getattr(module, function)
+    except ImportError as exc:
+        error_message = exc.name
+
+        @parent.command(
+            name,
+            context_settings={
+                "allow_extra_args": True,
+                "ignore_unknown_options": True,
+            }
+        )
+        def command():
+            raise click.ClickException(
+                f"Couldn't import command `{name}` due to {error_message}"
+            )
+    else:
+        parent.add_command(command)
diff --git a/src/arrow/dev/archery/archery/utils/cmake.py b/src/arrow/dev/archery/archery/utils/cmake.py
new file mode 100644
index 000000000..f93895b1a
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/cmake.py
@@ -0,0 +1,215 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+import re
+from shutil import rmtree, which
+
+from .command import Command, default_bin
+
+
+class CMake(Command):
+    def __init__(self, cmake_bin=None):
+        self.bin = default_bin(cmake_bin, "cmake")
+
+    @staticmethod
+    def default_generator():
+        """ Infer default generator.
+
+        Gives precedence to ninja if there exists an executable named `ninja`
+        in the search path.
+        """
+        found_ninja = which("ninja")
+        return "Ninja" if found_ninja else "Unix Makefiles"
+
+
+cmake = CMake()
+
+
+class CMakeDefinition:
+    """ CMakeDefinition captures the cmake invocation arguments.
+
+    It allows creating build directories with the same definition, e.g.
+    ```
+    build_1 = cmake_def.build("/tmp/build-1")
+    build_2 = cmake_def.build("/tmp/build-2")
+
+    ...
+
+    build1.all()
+    build2.all()
+    """
+
+    def __init__(self, source, build_type="release", generator=None,
+                 definitions=None, env=None):
+        """ Initialize a CMakeDefinition
+
+        Parameters
+        ----------
+        source : str
+                 Source directory where the top-level CMakeLists.txt is
+                 located. This is usually the root of the project.
+        generator : str, optional
+        definitions: list(str), optional
+        env : dict(str,str), optional
+              Environment to use when invoking cmake. This can be required to
+              work around cmake deficiencies, e.g. CC and CXX.
+        """
+        self.source = os.path.abspath(source)
+        self.build_type = build_type
+        self.generator = generator if generator else cmake.default_generator()
+        self.definitions = definitions if definitions else []
+        self.env = env
+
+    @property
+    def arguments(self):
+        """" Return the arguments to cmake invocation. """
+        arguments = [
+            "-G{}".format(self.generator),
+        ] + self.definitions + [
+            self.source
+        ]
+        return arguments
+
+    def build(self, build_dir, force=False, cmd_kwargs=None, **kwargs):
+        """ Invoke cmake into a build directory.
+
+        Parameters
+        ----------
+        build_dir : str
+                    Directory in which the CMake build will be instantiated.
+        force : bool
+                If the build folder exists, delete it before. Otherwise if it's
+                present, an error will be returned.
+        """
+        if os.path.exists(build_dir):
+            # Extra safety to ensure we're deleting a build folder.
+            if not CMakeBuild.is_build_dir(build_dir):
+                raise FileExistsError(
+                    "{} is not a cmake build".format(build_dir)
+                )
+            if not force:
+                raise FileExistsError(
+                    "{} exists use force=True".format(build_dir)
+                )
+            rmtree(build_dir)
+
+        os.mkdir(build_dir)
+
+        cmd_kwargs = cmd_kwargs if cmd_kwargs else {}
+        cmake(*self.arguments, cwd=build_dir, env=self.env, **cmd_kwargs)
+        return CMakeBuild(build_dir, self.build_type, definition=self,
+                          **kwargs)
+
+    def __repr__(self):
+        return "CMakeDefinition[source={}]".format(self.source)
+
+
+CMAKE_BUILD_TYPE_RE = re.compile("CMAKE_BUILD_TYPE:STRING=([a-zA-Z]+)")
+
+
+class CMakeBuild(CMake):
+    """ CMakeBuild represents a build directory initialized by cmake.
+
+    The build instance can be used to build/test/install. It alleviates the
+    user to know which generator is used.
+    """
+
+    def __init__(self, build_dir, build_type, definition=None):
+        """ Initialize a CMakeBuild.
+
+        The caller must ensure that cmake was invoked in the build directory.
+
+        Parameters
+        ----------
+        definition : CMakeDefinition
+                     The definition to build from.
+        build_dir : str
+                    The build directory to setup into.
+        """
+        assert CMakeBuild.is_build_dir(build_dir)
+        super().__init__()
+        self.build_dir = os.path.abspath(build_dir)
+        self.build_type = build_type
+        self.definition = definition
+
+    @property
+    def binaries_dir(self):
+        return os.path.join(self.build_dir, self.build_type)
+
+    def run(self, *argv, verbose=False, **kwargs):
+        cmake_args = ["--build", self.build_dir, "--"]
+        extra = []
+        if verbose:
+            extra.append("-v" if self.bin.endswith("ninja") else "VERBOSE=1")
+        # Commands must be ran under the build directory
+        return super().run(*cmake_args, *extra,
+                           *argv, **kwargs, cwd=self.build_dir)
+
+    def all(self):
+        return self.run("all")
+
+    def clean(self):
+        return self.run("clean")
+
+    def install(self):
+        return self.run("install")
+
+    def test(self):
+        return self.run("test")
+
+    @staticmethod
+    def is_build_dir(path):
+        """ Indicate if a path is CMake build directory.
+
+        This method only checks for the existence of paths and does not do any
+        validation whatsoever.
+        """
+        cmake_cache = os.path.join(path, "CMakeCache.txt")
+        cmake_files = os.path.join(path, "CMakeFiles")
+        return os.path.exists(cmake_cache) and os.path.exists(cmake_files)
+
+    @staticmethod
+    def from_path(path):
+        """ Instantiate a CMakeBuild from a path.
+
+        This is used to recover from an existing physical directory (created
+        with or without CMakeBuild).
+
+        Note that this method is not idempotent as the original definition will
+        be lost. Only build_type is recovered.
+        """
+        if not CMakeBuild.is_build_dir(path):
+            raise ValueError("Not a valid CMakeBuild path: {}".format(path))
+
+        build_type = None
+        # Infer build_type by looking at CMakeCache.txt and looking for a magic
+        # definition
+        cmake_cache_path = os.path.join(path, "CMakeCache.txt")
+        with open(cmake_cache_path, "r") as cmake_cache:
+            candidates = CMAKE_BUILD_TYPE_RE.findall(cmake_cache.read())
+            build_type = candidates[0].lower() if candidates else "release"
+
+        return CMakeBuild(path, build_type)
+
+    def __repr__(self):
+        return ("CMakeBuild["
+                "build = {},"
+                "build_type = {},"
+                "definition = {}]".format(self.build_dir,
+                                          self.build_type,
+                                          self.definition))
diff --git a/src/arrow/dev/archery/archery/utils/command.py b/src/arrow/dev/archery/archery/utils/command.py
new file mode 100644
index 000000000..f655e2ef2
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/command.py
@@ -0,0 +1,100 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+import shlex
+import shutil
+import subprocess
+
+from .logger import logger, ctx
+
+
+def default_bin(name, default):
+    assert(default)
+    env_name = "ARCHERY_{0}_BIN".format(default.upper())
+    return name if name else os.environ.get(env_name, default)
+
+
+# Decorator running a command and returning stdout
+class capture_stdout:
+    def __init__(self, strip=False, listify=False):
+        self.strip = strip
+        self.listify = listify
+
+    def __call__(self, f):
+        def strip_it(x):
+            return x.strip() if self.strip else x
+
+        def list_it(x):
+            return x.decode('utf-8').splitlines() if self.listify else x
+
+        def wrapper(*argv, **kwargs):
+            # Ensure stdout is captured
+            kwargs["stdout"] = subprocess.PIPE
+            return list_it(strip_it(f(*argv, **kwargs).stdout))
+        return wrapper
+
+
+class Command:
+    """
+    A runnable command.
+
+    Class inheriting from the Command class must provide the bin
+    property/attribute.
+    """
+
+    def __init__(self, bin):
+        self.bin = bin
+
+    def run(self, *argv, **kwargs):
+        assert hasattr(self, "bin")
+        invocation = shlex.split(self.bin)
+        invocation.extend(argv)
+
+        for key in ["stdout", "stderr"]:
+            # Preserve caller intention, otherwise silence
+            if key not in kwargs and ctx.quiet:
+                kwargs[key] = subprocess.PIPE
+
+        # Prefer safe by default
+        if "check" not in kwargs:
+            kwargs["check"] = True
+
+        logger.debug("Executing `{}`".format(invocation))
+        return subprocess.run(invocation, **kwargs)
+
+    @property
+    def available(self):
+        """
+        Indicate if the command binary is found in PATH.
+        """
+        binary = shlex.split(self.bin)[0]
+        return shutil.which(binary) is not None
+
+    def __call__(self, *argv, **kwargs):
+        return self.run(*argv, **kwargs)
+
+
+class CommandStackMixin:
+    def run(self, *argv, **kwargs):
+        stacked_args = self.argv + argv
+        return super(CommandStackMixin, self).run(*stacked_args, **kwargs)
+
+
+class Bash(Command):
+    def __init__(self, bash_bin=None):
+        self.bin = default_bin(bash_bin, "bash")
diff --git a/src/arrow/dev/archery/archery/utils/git.py b/src/arrow/dev/archery/archery/utils/git.py
new file mode 100644
index 000000000..798bc5d70
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/git.py
@@ -0,0 +1,100 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from .command import Command, capture_stdout, default_bin
+from ..compat import _stringify_path
+
+
+# Decorator prepending argv with the git sub-command found with the method
+# name.
+def git_cmd(fn):
+    # function name is the subcommand
+    sub_cmd = fn.__name__.replace("_", "-")
+
+    def wrapper(self, *argv, **kwargs):
+        return fn(self, sub_cmd, *argv, **kwargs)
+    return wrapper
+
+
+class Git(Command):
+    def __init__(self, git_bin=None):
+        self.bin = default_bin(git_bin, "git")
+
+    def run_cmd(self, cmd, *argv, git_dir=None, **kwargs):
+        """ Inject flags before sub-command in argv. """
+        opts = []
+        if git_dir is not None:
+            opts.extend(["-C", _stringify_path(git_dir)])
+
+        return self.run(*opts, cmd, *argv, **kwargs)
+
+    @capture_stdout(strip=False)
+    @git_cmd
+    def archive(self, *argv, **kwargs):
+        return self.run_cmd(*argv, **kwargs)
+
+    @git_cmd
+    def clone(self, *argv, **kwargs):
+        return self.run_cmd(*argv, **kwargs)
+
+    @git_cmd
+    def fetch(self, *argv, **kwargs):
+        return self.run_cmd(*argv, **kwargs)
+
+    @git_cmd
+    def checkout(self, *argv, **kwargs):
+        return self.run_cmd(*argv, **kwargs)
+
+    def dirty(self, **kwargs):
+        return len(self.status("--short", **kwargs)) > 0
+
+    @git_cmd
+    def log(self, *argv, **kwargs):
+        return self.run_cmd(*argv, **kwargs)
+
+    @capture_stdout(strip=True, listify=True)
+    @git_cmd
+    def ls_files(self, *argv, listify=False, **kwargs):
+        stdout = self.run_cmd(*argv, **kwargs)
+        return stdout
+
+    @capture_stdout(strip=True)
+    @git_cmd
+    def rev_parse(self, *argv, **kwargs):
+        return self.run_cmd(*argv, **kwargs)
+
+    @capture_stdout(strip=True)
+    @git_cmd
+    def status(self, *argv, **kwargs):
+        return self.run_cmd(*argv, **kwargs)
+
+    @capture_stdout(strip=True)
+    def head(self, **kwargs):
+        """ Return commit pointed by HEAD. """
+        return self.rev_parse("HEAD", **kwargs)
+
+    @capture_stdout(strip=True)
+    def current_branch(self, **kwargs):
+        return self.rev_parse("--abbrev-ref", "HEAD", **kwargs)
+
+    def repository_root(self, git_dir=None, **kwargs):
+        """ Locates the repository's root path from a subdirectory. """
+        stdout = self.rev_parse("--show-toplevel", git_dir=git_dir, **kwargs)
+        return stdout.decode('utf-8')
+
+
+git = Git()
diff --git a/src/arrow/dev/archery/archery/utils/lint.py b/src/arrow/dev/archery/archery/utils/lint.py
new file mode 100644
index 000000000..d95bfeea3
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/lint.py
@@ -0,0 +1,429 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import fnmatch
+import gzip
+import os
+from pathlib import Path
+
+import click
+
+from .command import Bash, Command, default_bin
+from .cmake import CMake
+from .git import git
+from .logger import logger
+from ..lang.cpp import CppCMakeDefinition, CppConfiguration
+from ..lang.python import Autopep8, Flake8, NumpyDoc
+from .rat import Rat, exclusion_from_globs
+from .tmpdir import tmpdir
+
+
+_archery_install_msg = (
+    "Please install archery using: `pip install -e dev/archery[lint]`. "
+)
+
+
+class LintValidationException(Exception):
+    pass
+
+
+class LintResult:
+    def __init__(self, success, reason=None):
+        self.success = success
+
+    def ok(self):
+        if not self.success:
+            raise LintValidationException
+
+    @staticmethod
+    def from_cmd(command_result):
+        return LintResult(command_result.returncode == 0)
+
+
+def cpp_linter(src, build_dir, clang_format=True, cpplint=True,
+               clang_tidy=False, iwyu=False, iwyu_all=False,
+               fix=False):
+    """ Run clang-format, cpplint and clang-tidy on cpp/ codebase. """
+    logger.info("Running C++ linters")
+
+    cmake = CMake()
+    if not cmake.available:
+        logger.error("cpp linter requested but cmake binary not found.")
+        return
+
+    # A cmake build directory is required to populate `compile_commands.json`
+    # which in turn is required by clang-tidy. It also provides a convenient
+    # way to hide clang-format/clang-tidy invocation via the Generate
+    # (ninja/make) targets.
+
+    # ARROW_LINT_ONLY exits early but ignore building compile_command.json
+    lint_only = not (iwyu or clang_tidy)
+    cmake_args = {"with_python": False, "with_lint_only": lint_only}
+    cmake_def = CppCMakeDefinition(src.cpp, CppConfiguration(**cmake_args))
+
+    build = cmake_def.build(build_dir)
+    if clang_format:
+        target = "format" if fix else "check-format"
+        yield LintResult.from_cmd(build.run(target, check=False))
+
+    if cpplint:
+        yield LintResult.from_cmd(build.run("lint", check=False))
+        yield LintResult.from_cmd(build.run("lint_cpp_cli", check=False))
+
+    if clang_tidy:
+        yield LintResult.from_cmd(build.run("check-clang-tidy", check=False))
+
+    if iwyu:
+        if iwyu_all:
+            iwyu_cmd = "iwyu-all"
+        else:
+            iwyu_cmd = "iwyu"
+        yield LintResult.from_cmd(build.run(iwyu_cmd, check=False))
+
+
+class CMakeFormat(Command):
+
+    def __init__(self, paths, cmake_format_bin=None):
+        self.check_version()
+        self.bin = default_bin(cmake_format_bin, "cmake-format")
+        self.paths = paths
+
+    @classmethod
+    def from_patterns(cls, base_path, include_patterns, exclude_patterns):
+        paths = {
+            str(path.as_posix())
+            for pattern in include_patterns
+            for path in base_path.glob(pattern)
+        }
+        for pattern in exclude_patterns:
+            pattern = (base_path / pattern).as_posix()
+            paths -= set(fnmatch.filter(paths, str(pattern)))
+        return cls(paths)
+
+    @staticmethod
+    def check_version():
+        try:
+            # cmake_format is part of the cmakelang package
+            import cmakelang
+        except ImportError:
+            raise ImportError(
+
+            )
+        # pin a specific version of cmake_format, must be updated in setup.py
+        if cmakelang.__version__ != "0.6.13":
+            raise LintValidationException(
+                f"Wrong version of cmake_format is detected. "
+                f"{_archery_install_msg}"
+            )
+
+    def check(self):
+        return self.run("-l", "error", "--check", *self.paths, check=False)
+
+    def fix(self):
+        return self.run("--in-place", *self.paths, check=False)
+
+
+def cmake_linter(src, fix=False):
+    """
+    Run cmake-format on all CMakeFiles.txt
+    """
+    logger.info("Running cmake-format linters")
+
+    cmake_format = CMakeFormat.from_patterns(
+        src.path,
+        include_patterns=[
+            'ci/**/*.cmake',
+            'cpp/CMakeLists.txt',
+            'cpp/src/**/CMakeLists.txt',
+            'cpp/cmake_modules/*.cmake',
+            'go/**/CMakeLists.txt',
+            'java/**/CMakeLists.txt',
+            'matlab/**/CMakeLists.txt',
+            'python/CMakeLists.txt',
+        ],
+        exclude_patterns=[
+            'cpp/cmake_modules/FindNumPy.cmake',
+            'cpp/cmake_modules/FindPythonLibsNew.cmake',
+            'cpp/cmake_modules/UseCython.cmake',
+            'cpp/src/arrow/util/config.h.cmake',
+        ]
+    )
+    method = cmake_format.fix if fix else cmake_format.check
+
+    yield LintResult.from_cmd(method())
+
+
+def python_linter(src, fix=False):
+    """Run Python linters on python/pyarrow, python/examples, setup.py
+    and dev/. """
+    setup_py = os.path.join(src.python, "setup.py")
+    setup_cfg = os.path.join(src.python, "setup.cfg")
+
+    logger.info("Running Python formatter (autopep8)")
+
+    autopep8 = Autopep8()
+    if not autopep8.available:
+        logger.error(
+            "Python formatter requested but autopep8 binary not found. "
+            f"{_archery_install_msg}")
+        return
+
+    # Gather files for autopep8
+    patterns = ["python/pyarrow/**/*.py",
+                "python/pyarrow/**/*.pyx",
+                "python/pyarrow/**/*.pxd",
+                "python/pyarrow/**/*.pxi",
+                "python/examples/**/*.py",
+                "dev/archery/**/*.py"]
+    files = [setup_py]
+    for pattern in patterns:
+        files += list(map(str, Path(src.path).glob(pattern)))
+
+    args = ['--global-config', setup_cfg, '--ignore-local-config']
+    if fix:
+        args += ['-j0', '--in-place']
+        args += sorted(files)
+        yield LintResult.from_cmd(autopep8(*args))
+    else:
+        # XXX `-j0` doesn't work well with `--exit-code`, so instead
+        # we capture the diff and check whether it's empty
+        # (https://github.com/hhatto/autopep8/issues/543)
+        args += ['-j0', '--diff']
+        args += sorted(files)
+        diff = autopep8.run_captured(*args)
+        if diff:
+            print(diff.decode('utf8'))
+            yield LintResult(success=False)
+        else:
+            yield LintResult(success=True)
+
+    # Run flake8 after autopep8 (the latter may have modified some files)
+    logger.info("Running Python linter (flake8)")
+
+    flake8 = Flake8()
+    if not flake8.available:
+        logger.error(
+            "Python linter requested but flake8 binary not found. "
+            f"{_archery_install_msg}")
+        return
+
+    flake8_exclude = ['.venv*']
+
+    yield LintResult.from_cmd(
+        flake8("--extend-exclude=" + ','.join(flake8_exclude),
+               setup_py, src.pyarrow, os.path.join(src.python, "examples"),
+               src.dev, check=False))
+    config = os.path.join(src.python, ".flake8.cython")
+    yield LintResult.from_cmd(
+        flake8("--config=" + config, src.pyarrow, check=False))
+
+
+def python_numpydoc(symbols=None, allow_rules=None, disallow_rules=None):
+    """Run numpydoc linter on python.
+
+    Pyarrow must be available for import.
+    """
+    logger.info("Running Python docstring linters")
+    # by default try to run on all pyarrow package
+    symbols = symbols or {
+        'pyarrow',
+        'pyarrow.compute',
+        'pyarrow.csv',
+        'pyarrow.dataset',
+        'pyarrow.feather',
+        'pyarrow.flight',
+        'pyarrow.fs',
+        'pyarrow.gandiva',
+        'pyarrow.ipc',
+        'pyarrow.json',
+        'pyarrow.orc',
+        'pyarrow.parquet',
+        'pyarrow.plasma',
+        'pyarrow.types',
+    }
+    try:
+        numpydoc = NumpyDoc(symbols)
+    except RuntimeError as e:
+        logger.error(str(e))
+        yield LintResult(success=False)
+        return
+
+    results = numpydoc.validate(
+        # limit the validation scope to the pyarrow package
+        from_package='pyarrow',
+        allow_rules=allow_rules,
+        disallow_rules=disallow_rules
+    )
+
+    if len(results) == 0:
+        yield LintResult(success=True)
+        return
+
+    number_of_violations = 0
+    for obj, result in results:
+        errors = result['errors']
+
+        # inspect doesn't play nice with cython generated source code,
+        # to use a hacky way to represent a proper __qualname__
+        doc = getattr(obj, '__doc__', '')
+        name = getattr(obj, '__name__', '')
+        qualname = getattr(obj, '__qualname__', '')
+        module = getattr(obj, '__module__', '')
+        instance = getattr(obj, '__self__', '')
+        if instance:
+            klass = instance.__class__.__name__
+        else:
+            klass = ''
+
+        try:
+            cython_signature = doc.splitlines()[0]
+        except Exception:
+            cython_signature = ''
+
+        desc = '.'.join(filter(None, [module, klass, qualname or name]))
+
+        click.echo()
+        click.echo(click.style(desc, bold=True, fg='yellow'))
+        if cython_signature:
+            qualname_with_signature = '.'.join([module, cython_signature])
+            click.echo(
+                click.style(
+                    '-> {}'.format(qualname_with_signature),
+                    fg='yellow'
+                )
+            )
+
+        for error in errors:
+            number_of_violations += 1
+            click.echo('{}: {}'.format(*error))
+
+    msg = 'Total number of docstring violations: {}'.format(
+        number_of_violations
+    )
+    click.echo()
+    click.echo(click.style(msg, fg='red'))
+
+    yield LintResult(success=False)
+
+
+def rat_linter(src, root):
+    """Run apache-rat license linter."""
+    logger.info("Running apache-rat linter")
+
+    if src.git_dirty:
+        logger.warn("Due to the usage of git-archive, uncommitted files will"
+                    " not be checked for rat violations. ")
+
+    exclusion = exclusion_from_globs(
+        os.path.join(src.dev, "release", "rat_exclude_files.txt"))
+
+    # Creates a git-archive of ArrowSources, apache-rat expects a gzip
+    # compressed tar archive.
+    archive_path = os.path.join(root, "apache-arrow.tar.gz")
+    src.archive(archive_path, compressor=gzip.compress)
+    report = Rat().report(archive_path)
+
+    violations = list(report.validate(exclusion=exclusion))
+    for violation in violations:
+        print("apache-rat license violation: {}".format(violation))
+
+    yield LintResult(len(violations) == 0)
+
+
+def r_linter(src):
+    """Run R linter."""
+    logger.info("Running R linter")
+    r_lint_sh = os.path.join(src.r, "lint.sh")
+    yield LintResult.from_cmd(Bash().run(r_lint_sh, check=False))
+
+
+class Hadolint(Command):
+    def __init__(self, hadolint_bin=None):
+        self.bin = default_bin(hadolint_bin, "hadolint")
+
+
+def is_docker_image(path):
+    dirname = os.path.dirname(path)
+    filename = os.path.basename(path)
+
+    excluded = dirname.startswith(
+        "dev") or dirname.startswith("python/manylinux")
+
+    return filename.startswith("Dockerfile") and not excluded
+
+
+def docker_linter(src):
+    """Run Hadolint docker linter."""
+    logger.info("Running Docker linter")
+
+    hadolint = Hadolint()
+
+    if not hadolint.available:
+        logger.error(
+            "hadolint linter requested but hadolint binary not found.")
+        return
+
+    for path in git.ls_files(git_dir=src.path):
+        if is_docker_image(path):
+            yield LintResult.from_cmd(hadolint.run(path, check=False,
+                                                   cwd=src.path))
+
+
+def linter(src, fix=False, *, clang_format=False, cpplint=False,
+           clang_tidy=False, iwyu=False, iwyu_all=False,
+           python=False, numpydoc=False, cmake_format=False, rat=False,
+           r=False, docker=False):
+    """Run all linters."""
+    with tmpdir(prefix="arrow-lint-") as root:
+        build_dir = os.path.join(root, "cpp-build")
+
+        # Linters yield LintResult without raising exceptions on failure.
+        # This allows running all linters in one pass and exposing all
+        # errors to the user.
+        results = []
+
+        if clang_format or cpplint or clang_tidy or iwyu:
+            results.extend(cpp_linter(src, build_dir,
+                                      clang_format=clang_format,
+                                      cpplint=cpplint,
+                                      clang_tidy=clang_tidy,
+                                      iwyu=iwyu,
+                                      iwyu_all=iwyu_all,
+                                      fix=fix))
+
+        if python:
+            results.extend(python_linter(src, fix=fix))
+
+        if numpydoc:
+            results.extend(python_numpydoc())
+
+        if cmake_format:
+            results.extend(cmake_linter(src, fix=fix))
+
+        if rat:
+            results.extend(rat_linter(src, root))
+
+        if r:
+            results.extend(r_linter(src))
+
+        if docker:
+            results.extend(docker_linter(src))
+
+        # Raise error if one linter failed, ensuring calling code can exit with
+        # non-zero.
+        for result in results:
+            result.ok()
diff --git a/src/arrow/dev/archery/archery/utils/logger.py b/src/arrow/dev/archery/archery/utils/logger.py
new file mode 100644
index 000000000..9d0feda88
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/logger.py
@@ -0,0 +1,29 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import logging
+
+""" Global logger. """
+logger = logging.getLogger("archery")
+
+
+class LoggingContext:
+    def __init__(self, quiet=False):
+        self.quiet = quiet
+
+
+ctx = LoggingContext()
diff --git a/src/arrow/dev/archery/archery/utils/maven.py b/src/arrow/dev/archery/archery/utils/maven.py
new file mode 100644
index 000000000..96a3bf5bd
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/maven.py
@@ -0,0 +1,204 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+
+from .command import Command, default_bin
+
+
+class Maven(Command):
+    def __init__(self, maven_bin=None):
+        self.bin = default_bin(maven_bin, "mvn")
+
+
+maven = Maven()
+
+
+class MavenDefinition:
+    """ MavenDefinition captures the maven invocation arguments.
+
+    It allows creating build directories with the same definition, e.g.
+    ```
+    build_1 = maven_def.build("/tmp/build-1")
+    build_2 = maven_def.build("/tmp/build-2")
+
+    ...
+
+    build1.install()
+    build2.install()
+    """
+
+    def __init__(self, source, build_definitions=None,
+                 benchmark_definitions=None, env=None):
+        """ Initialize a MavenDefinition
+
+        Parameters
+        ----------
+        source : str
+                 Source directory where the top-level pom.xml is
+                 located. This is usually the root of the project.
+        build_definitions: list(str), optional
+        benchmark_definitions: list(str), optional
+        """
+        self.source = os.path.abspath(source)
+        self.build_definitions = build_definitions if build_definitions else []
+        self.benchmark_definitions =\
+            benchmark_definitions if benchmark_definitions else []
+        self.env = env
+
+    @property
+    def build_arguments(self):
+        """" Return the arguments to maven invocation for build. """
+        arguments = self.build_definitions + [
+            "-B", "-DskipTests", "-Drat.skip=true",
+            "-Dorg.slf4j.simpleLogger.log.org.apache.maven.cli.transfer."
+            "Slf4jMavenTransferListener=warn",
+            "-T", "2C", "install"
+        ]
+        return arguments
+
+    def build(self, build_dir, force=False, cmd_kwargs=None, **kwargs):
+        """ Invoke maven into a build directory.
+
+        Parameters
+        ----------
+        build_dir : str
+                    Directory in which the Maven build will be instantiated.
+        force : bool
+                not used now
+        """
+        if os.path.exists(build_dir):
+            # Extra safety to ensure we're deleting a build folder.
+            if not MavenBuild.is_build_dir(build_dir):
+                raise FileExistsError(
+                    "{} is not a maven build".format(build_dir)
+                )
+
+        cmd_kwargs = cmd_kwargs if cmd_kwargs else {}
+        assert MavenBuild.is_build_dir(build_dir)
+        maven(*self.build_arguments, cwd=build_dir, env=self.env, **cmd_kwargs)
+        return MavenBuild(build_dir, definition=self, **kwargs)
+
+    @property
+    def list_arguments(self):
+        """" Return the arguments to maven invocation for list """
+        arguments = [
+            "-Dskip.perf.benchmarks=false", "-Dbenchmark.list=-lp", "install"
+        ]
+        return arguments
+
+    @property
+    def benchmark_arguments(self):
+        """" Return the arguments to maven invocation for benchmark """
+        arguments = self.benchmark_definitions + [
+            "-Dskip.perf.benchmarks=false", "-Dbenchmark.fork=1",
+            "-Dbenchmark.jvmargs=\"-Darrow.enable_null_check_for_get=false "
+            "-Darrow.enable_unsafe_memory_access=true\"",
+            "install"
+        ]
+        return arguments
+
+    def __repr__(self):
+        return "MavenDefinition[source={}]".format(self.source)
+
+
+class MavenBuild(Maven):
+    """ MavenBuild represents a build directory initialized by maven.
+
+    The build instance can be used to build/test/install. It alleviates the
+    user to know which generator is used.
+    """
+
+    def __init__(self, build_dir, definition=None):
+        """ Initialize a MavenBuild.
+
+        The caller must ensure that maven was invoked in the build directory.
+
+        Parameters
+        ----------
+        definition : MavenDefinition
+                     The definition to build from.
+        build_dir : str
+                    The build directory to setup into.
+        """
+        assert MavenBuild.is_build_dir(build_dir)
+        super().__init__()
+        self.build_dir = os.path.abspath(build_dir)
+        self.definition = definition
+
+    @property
+    def binaries_dir(self):
+        return self.build_dir
+
+    def run(self, *argv, verbose=False, cwd=None, **kwargs):
+        extra = []
+        if verbose:
+            extra.append("-X")
+        if cwd is None:
+            cwd = self.build_dir
+        # Commands must be ran under the directory where pom.xml exists
+        return super().run(*extra, *argv, **kwargs, cwd=cwd)
+
+    def build(self, *argv, verbose=False, **kwargs):
+        definition_args = self.definition.build_arguments
+        cwd = self.binaries_dir
+        return self.run(*argv, *definition_args, verbose=verbose, cwd=cwd,
+                        env=self.definition.env, **kwargs)
+
+    def list(self, *argv, verbose=False, **kwargs):
+        definition_args = self.definition.list_arguments
+        cwd = self.binaries_dir + "/performance"
+        return self.run(*argv, *definition_args, verbose=verbose, cwd=cwd,
+                        env=self.definition.env, **kwargs)
+
+    def benchmark(self, *argv, verbose=False, **kwargs):
+        definition_args = self.definition.benchmark_arguments
+        cwd = self.binaries_dir + "/performance"
+        return self.run(*argv, *definition_args, verbose=verbose, cwd=cwd,
+                        env=self.definition.env, **kwargs)
+
+    @staticmethod
+    def is_build_dir(path):
+        """ Indicate if a path is Maven top directory.
+
+        This method only checks for the existence of paths and does not do any
+        validation whatsoever.
+        """
+        pom_xml = os.path.join(path, "pom.xml")
+        performance_dir = os.path.join(path, "performance")
+        return os.path.exists(pom_xml) and os.path.isdir(performance_dir)
+
+    @staticmethod
+    def from_path(path):
+        """ Instantiate a Maven from a path.
+
+        This is used to recover from an existing physical directory (created
+        with or without Maven).
+
+        Note that this method is not idempotent as the original definition will
+        be lost.
+        """
+        if not MavenBuild.is_build_dir(path):
+            raise ValueError("Not a valid MavenBuild path: {}".format(path))
+
+        return MavenBuild(path, definition=None)
+
+    def __repr__(self):
+        return ("MavenBuild["
+                "build = {},"
+                "definition = {}]".format(self.build_dir,
+                                          self.definition))
diff --git a/src/arrow/dev/archery/archery/utils/rat.py b/src/arrow/dev/archery/archery/utils/rat.py
new file mode 100644
index 000000000..e7fe19a7e
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/rat.py
@@ -0,0 +1,70 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import fnmatch
+import re
+from xml.etree import ElementTree
+
+from ..lang.java import Jar
+from .cache import Cache
+from .command import capture_stdout
+
+RAT_VERSION = 0.13
+RAT_JAR_FILENAME = "apache-rat-{}.jar".format(RAT_VERSION)
+RAT_URL_ = "https://repo1.maven.org/maven2/org/apache/rat/apache-rat"
+RAT_URL = "/".join([RAT_URL_, str(RAT_VERSION), RAT_JAR_FILENAME])
+
+
+class Rat(Jar):
+    def __init__(self):
+        jar = Cache().get_or_insert_from_url(RAT_JAR_FILENAME, RAT_URL)
+        Jar.__init__(self, jar)
+
+    @capture_stdout(strip=False)
+    def run_report(self, archive_path, **kwargs):
+        return self.run("--xml", archive_path, **kwargs)
+
+    def report(self, archive_path, **kwargs):
+        return RatReport(self.run_report(archive_path, **kwargs))
+
+
+def exclusion_from_globs(exclusions_path):
+    with open(exclusions_path, 'r') as exclusions_fd:
+        exclusions = [e.strip() for e in exclusions_fd]
+        return lambda path: any([fnmatch.fnmatch(path, e) for e in exclusions])
+
+
+class RatReport:
+    def __init__(self, xml):
+        self.xml = xml
+        self.tree = ElementTree.fromstring(xml)
+
+    def __repr__(self):
+        return "RatReport({})".format(self.xml)
+
+    def validate(self, exclusion=None):
+        for r in self.tree.findall('resource'):
+            approvals = r.findall('license-approval')
+            if not approvals or approvals[0].attrib['name'] == 'true':
+                continue
+
+            clean_name = re.sub('^[^/]+/', '', r.attrib['name'])
+
+            if exclusion and exclusion(clean_name):
+                continue
+
+            yield clean_name
diff --git a/src/arrow/dev/archery/archery/utils/report.py b/src/arrow/dev/archery/archery/utils/report.py
new file mode 100644
index 000000000..6c7587ddd
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/report.py
@@ -0,0 +1,64 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from abc import ABCMeta, abstractmethod
+import datetime
+
+import jinja2
+
+
+def markdown_escape(s):
+    for char in ('*', '#', '_', '~', '`', '>'):
+        s = s.replace(char, '\\' + char)
+    return s
+
+
+class Report(metaclass=ABCMeta):
+
+    def __init__(self, **kwargs):
+        for field in self.fields:
+            if field not in kwargs:
+                raise ValueError('Missing keyword argument {}'.format(field))
+        self._data = kwargs
+
+    def __getattr__(self, key):
+        return self._data[key]
+
+    @abstractmethod
+    def fields(self):
+        pass
+
+    @property
+    @abstractmethod
+    def templates(self):
+        pass
+
+
+class JinjaReport(Report):
+
+    def __init__(self, **kwargs):
+        self.env = jinja2.Environment(
+            loader=jinja2.PackageLoader('archery', 'templates')
+        )
+        self.env.filters['md'] = markdown_escape
+        self.env.globals['today'] = datetime.date.today
+        super().__init__(**kwargs)
+
+    def render(self, template_name):
+        template_path = self.templates[template_name]
+        template = self.env.get_template(template_path)
+        return template.render(**self._data)
diff --git a/src/arrow/dev/archery/archery/utils/source.py b/src/arrow/dev/archery/archery/utils/source.py
new file mode 100644
index 000000000..1080cb75d
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/source.py
@@ -0,0 +1,211 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+from pathlib import Path
+import subprocess
+
+from .git import git
+
+
+class InvalidArrowSource(Exception):
+    pass
+
+
+class ArrowSources:
+    """ ArrowSources is a companion class representing a directory containing
+    Apache Arrow's sources.
+    """
+    # Note that WORKSPACE is a reserved git revision name by this module to
+    # reference the current git workspace. In other words, this indicates to
+    # ArrowSources.at_revision that no cloning/checkout is required.
+    WORKSPACE = "WORKSPACE"
+
+    def __init__(self, path):
+        """ Initialize an ArrowSources
+
+        The caller must ensure that path is valid arrow source directory (can
+        be checked with ArrowSources.valid)
+
+        Parameters
+        ----------
+        path : src
+        """
+        path = Path(path)
+        # validate by checking a specific path in the arrow source tree
+        if not (path / 'cpp' / 'CMakeLists.txt').exists():
+            raise InvalidArrowSource(
+                "No Arrow C++ sources found in {}.".format(path)
+            )
+        self.path = path
+
+    @property
+    def archery(self):
+        """ Returns the archery directory of an Arrow sources. """
+        return self.dev / "archery"
+
+    @property
+    def cpp(self):
+        """ Returns the cpp directory of an Arrow sources. """
+        return self.path / "cpp"
+
+    @property
+    def dev(self):
+        """ Returns the dev directory of an Arrow sources. """
+        return self.path / "dev"
+
+    @property
+    def java(self):
+        """ Returns the java directory of an Arrow sources. """
+        return self.path / "java"
+
+    @property
+    def python(self):
+        """ Returns the python directory of an Arrow sources. """
+        return self.path / "python"
+
+    @property
+    def pyarrow(self):
+        """ Returns the python/pyarrow directory of an Arrow sources. """
+        return self.python / "pyarrow"
+
+    @property
+    def r(self):
+        """ Returns the r directory of an Arrow sources. """
+        return self.path / "r"
+
+    @property
+    def git_backed(self):
+        """ Indicate if the sources are backed by git. """
+        return (self.path / ".git").exists()
+
+    @property
+    def git_dirty(self):
+        """ Indicate if the sources is a dirty git directory. """
+        return self.git_backed and git.dirty(git_dir=self.path)
+
+    def archive(self, path, dereference=False, compressor=None, revision=None):
+        """ Saves a git archive at path. """
+        if not self.git_backed:
+            raise ValueError("{} is not backed by git".format(self))
+
+        rev = revision if revision else "HEAD"
+        archive = git.archive("--prefix=apache-arrow/", rev,
+                              git_dir=self.path)
+
+        # TODO(fsaintjacques): fix dereference for
+
+        if compressor:
+            archive = compressor(archive)
+
+        with open(path, "wb") as archive_fd:
+            archive_fd.write(archive)
+
+    def at_revision(self, revision, clone_dir):
+        """ Return a copy of the current sources for a specified git revision.
+
+        This method may return the current object if no checkout is required.
+        The caller is responsible to remove the cloned repository directory.
+
+        The user can use the special WORKSPACE token to mean the current git
+        workspace (no checkout performed).
+
+        The second value of the returned tuple indicates if a clone was
+        performed.
+
+        Parameters
+        ----------
+        revision : str
+                   Revision to checkout sources at.
+        clone_dir : str
+                    Path to checkout the local clone.
+        """
+        if not self.git_backed:
+            raise ValueError("{} is not backed by git".format(self))
+
+        if revision == ArrowSources.WORKSPACE:
+            return self, False
+
+        # A local clone is required to leave the current sources intact such
+        # that builds depending on said sources are not invalidated (or worse
+        # slightly affected when re-invoking the generator).
+        # "--local" only works when dest dir is on same volume of source dir.
+        # "--shared" works even if dest dir is on different volume.
+        git.clone("--shared", self.path, clone_dir)
+
+        # Revision can reference "origin/" (or any remotes) that are not found
+        # in the local clone. Thus, revisions are dereferenced in the source
+        # repository.
+        original_revision = git.rev_parse(revision)
+
+        git.checkout(original_revision, git_dir=clone_dir)
+
+        return ArrowSources(clone_dir), True
+
+    @staticmethod
+    def find(path=None):
+        """ Infer Arrow sources directory from various method.
+
+        The following guesses are done in order until a valid match is found:
+
+        1. Checks the given optional parameter.
+
+        2. Checks if the environment variable `ARROW_SRC` is defined and use
+           this.
+
+        3. Checks if the current working directory (cwd) is an Arrow source
+           directory.
+
+        4. Checks if this file (cli.py) is still in the original source
+           repository. If so, returns the relative path to the source
+           directory.
+        """
+
+        # Explicit via environment
+        env = os.environ.get("ARROW_SRC")
+
+        # Implicit via cwd
+        cwd = Path.cwd()
+
+        # Implicit via current file
+        try:
+            this = Path(__file__).parents[4]
+        except IndexError:
+            this = None
+
+        # Implicit via git repository (if archery is installed system wide)
+        try:
+            repo = git.repository_root(git_dir=cwd)
+        except subprocess.CalledProcessError:
+            # We're not inside a git repository.
+            repo = None
+
+        paths = list(filter(None, [path, env, cwd, this, repo]))
+        for p in paths:
+            try:
+                return ArrowSources(p)
+            except InvalidArrowSource:
+                pass
+
+        searched_paths = "\n".join([" - {}".format(p) for p in paths])
+        raise InvalidArrowSource(
+            "Unable to locate Arrow's source directory. "
+            "Searched paths are:\n{}".format(searched_paths)
+        )
+
+    def __repr__(self):
+        return self.path
diff --git a/src/arrow/dev/archery/archery/utils/tmpdir.py b/src/arrow/dev/archery/archery/utils/tmpdir.py
new file mode 100644
index 000000000..07d7355c8
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/tmpdir.py
@@ -0,0 +1,28 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from contextlib import contextmanager
+from tempfile import mkdtemp, TemporaryDirectory
+
+
+@contextmanager
+def tmpdir(preserve=False, prefix="arrow-archery-"):
+    if preserve:
+        yield mkdtemp(prefix=prefix)
+    else:
+        with TemporaryDirectory(prefix=prefix) as tmp:
+            yield tmp
diff --git a/src/arrow/dev/archery/conftest.py b/src/arrow/dev/archery/conftest.py
new file mode 100644
index 000000000..06a643bea
--- /dev/null
+++ b/src/arrow/dev/archery/conftest.py
@@ -0,0 +1,70 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import pathlib
+
+import pytest
+
+
+def pytest_addoption(parser):
+    parser.addoption(
+        "--enable-integration",
+        action="store_true",
+        default=False,
+        help="run slow tests"
+    )
+
+
+def pytest_configure(config):
+    config.addinivalue_line(
+        "markers",
+        (
+            "integration: mark test as integration tests involving more "
+            "extensive setup (only used for crossbow at the moment)"
+        )
+    )
+
+
+def pytest_collection_modifyitems(config, items):
+    if config.getoption("--enable-integration"):
+        return
+    marker = pytest.mark.skip(reason="need --enable-integration option to run")
+    for item in items:
+        if "integration" in item.keywords:
+            item.add_marker(marker)
+
+
+@pytest.fixture
+def load_fixture(request):
+    current_test_directory = pathlib.Path(request.node.fspath).parent
+
+    def decoder(path):
+        with path.open('r') as fp:
+            if path.suffix == '.json':
+                import json
+                return json.load(fp)
+            elif path.suffix == '.yaml':
+                import yaml
+                return yaml.load(fp)
+            else:
+                return fp.read()
+
+    def loader(name, decoder=decoder):
+        path = current_test_directory / 'fixtures' / name
+        return decoder(path)
+
+    return loader
diff --git a/src/arrow/dev/archery/generate_files_for_endian_test.sh b/src/arrow/dev/archery/generate_files_for_endian_test.sh
new file mode 100755
index 000000000..ba3ce9f16
--- /dev/null
+++ b/src/arrow/dev/archery/generate_files_for_endian_test.sh
@@ -0,0 +1,43 @@
+#!/usr/bin/env bash
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+# This script generates json and arrow files of each type (e.g. primitive) for integration endian test
+# Usage: generate_files_for_endian_test.sh
+#        ARROW_CPP_EXE_PATH : where Arrow C++ binaries can be found
+#        TMP_DIR            : where files will be generated
+
+set -e
+
+: ${ARROW_CPP_EXE_PATH:=/arrow/cpp/build/debug/}
+: ${TMP_DIR:=/tmp/arrow}
+
+json_dir=$TMP_DIR/arrow.$$
+mkdir -p $json_dir
+
+archery integration --stop-on-error --with-cpp=1 --tempdir=$json_dir
+
+for f in $json_dir/*.json ; do
+    $ARROW_CPP_EXE_PATH/arrow-json-integration-test -mode JSON_TO_ARROW -json $f -arrow ${f%.*}.arrow_file -integration true ;
+done
+for f in $json_dir/*.arrow_file ; do
+    $ARROW_CPP_EXE_PATH/arrow-file-to-stream $f > ${f%.*}.stream;
+done
+for f in $json_dir/*.json ; do
+    gzip $f ;
+done
+echo "The files are under $json_dir"
diff --git a/src/arrow/dev/archery/requirements.txt b/src/arrow/dev/archery/requirements.txt
new file mode 100644
index 000000000..0e1258adb
--- /dev/null
+++ b/src/arrow/dev/archery/requirements.txt
@@ -0,0 +1,4 @@
+click
+pygithub
+python-dotenv
+ruamel.yaml
diff --git a/src/arrow/dev/archery/setup.py b/src/arrow/dev/archery/setup.py
new file mode 100755
index 000000000..664807375
--- /dev/null
+++ b/src/arrow/dev/archery/setup.py
@@ -0,0 +1,59 @@
+#!/usr/bin/env python
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import functools
+import operator
+import sys
+from setuptools import setup, find_packages
+
+if sys.version_info < (3, 6):
+    sys.exit('Python < 3.6 is not supported')
+
+# For pathlib.Path compatibility
+jinja_req = 'jinja2>=2.11'
+
+extras = {
+    'lint': ['numpydoc==1.1.0', 'autopep8', 'flake8', 'cmake_format==0.6.13'],
+    'benchmark': ['pandas'],
+    'docker': ['ruamel.yaml', 'python-dotenv'],
+    'release': [jinja_req, 'jira', 'semver', 'gitpython'],
+    'crossbow': ['github3.py', jinja_req, 'pygit2>=1.6.0', 'ruamel.yaml',
+                 'setuptools_scm'],
+    'crossbow-upload': ['github3.py', jinja_req, 'ruamel.yaml',
+                        'setuptools_scm'],
+}
+extras['bot'] = extras['crossbow'] + ['pygithub', 'jira']
+extras['all'] = list(set(functools.reduce(operator.add, extras.values())))
+
+setup(
+    name='archery',
+    version="0.1.0",
+    description='Apache Arrow Developers Tools',
+    url='http://github.com/apache/arrow',
+    maintainer='Arrow Developers',
+    maintainer_email='dev@arrow.apache.org',
+    packages=find_packages(),
+    include_package_data=True,
+    install_requires=['click>=7'],
+    tests_require=['pytest', 'responses'],
+    extras_require=extras,
+    entry_points='''
+        [console_scripts]
+        archery=archery.cli:archery
+    '''
+)