Adding upstream version 18.2.2.upstream/18.2.2

Signed-off-by: Daniel Baumann <daniel.baumann@progress-linux.org>

386 files changed, 41634 insertions, 0 deletions

diff --git a/src/arrow/dev/.gitignore b/src/arrow/dev/.gitignore
new file mode 100644
index 000000000..b0792939f
--- /dev/null
+++ b/src/arrow/dev/.gitignore
@@ -0,0 +1,20 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+# Python virtual environments for dev tools
+.venv*/
+
diff --git a/src/arrow/dev/README.md b/src/arrow/dev/README.md
new file mode 100644
index 000000000..258792b80
--- /dev/null
+++ b/src/arrow/dev/README.md
@@ -0,0 +1,189 @@
+<!--
+  ~ Licensed to the Apache Software Foundation (ASF) under one
+  ~ or more contributor license agreements.  See the NOTICE file
+  ~ distributed with this work for additional information
+  ~ regarding copyright ownership.  The ASF licenses this file
+  ~ to you under the Apache License, Version 2.0 (the
+  ~ "License"); you may not use this file except in compliance
+  ~ with the License.  You may obtain a copy of the License at
+  ~
+  ~   http://www.apache.org/licenses/LICENSE-2.0
+  ~
+  ~ Unless required by applicable law or agreed to in writing,
+  ~ software distributed under the License is distributed on an
+  ~ "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  ~ KIND, either express or implied.  See the License for the
+  ~ specific language governing permissions and limitations
+  ~ under the License.
+  -->
+
+# Arrow Developer Scripts
+
+This directory contains scripts useful to developers when packaging,
+testing, or committing to Arrow.
+
+Merging a pull request requires being a committer on the project. In addition
+you need to have linked your GitHub and ASF accounts on
+https://gitbox.apache.org/setup/ to be able to push to GitHub as the main
+remote.
+
+NOTE: It may take some time (a few hours) between when you complete
+the setup at GitBox, and when your GitHub account will be added as a
+committer.
+
+## How to merge a Pull request
+
+Please don't merge PRs using the Github Web interface.  Instead, set up
+your git clone such as to have a remote named ``apache`` pointing to the
+official Arrow repository:
+```
+git remote add apache git@github.com:apache/arrow.git
+```
+
+and then run the following command:
+```
+./dev/merge_arrow_pr.sh
+```
+
+This creates a new Python virtual environment under `dev/.venv[PY_VERSION]`
+and installs all the necessary dependencies to run the Arrow merge script.
+After installed, it runs the merge script.
+
+(we don't provide a wrapper script for Windows yet, so under Windows you'll
+have to install Python dependencies yourself and then run `dev/merge_arrow_pr.py`
+directly)
+
+The merge script uses the GitHub REST API; if you encounter rate limit issues,
+you may set a `ARROW_GITHUB_API_TOKEN` environment variable to use a Personal
+Access Token.
+
+You can specify the username and the password of your JIRA account in
+`APACHE_JIRA_USERNAME` and `APACHE_JIRA_PASSWORD` environment variables.
+If these aren't supplied, the script will ask you the values of them.
+
+Note that the directory name of your Arrow git clone must be called `arrow`.
+
+example output:
+```
+Which pull request would you like to merge? (e.g. 34):
+```
+Type the pull request number (from https://github.com/apache/arrow/pulls) and hit enter.
+```
+=== Pull Request #X ===
+title	Blah Blah Blah
+source	repo/branch
+target	master
+url	https://api.github.com/repos/apache/arrow/pulls/X
+
+Proceed with merging pull request #3? (y/n):
+```
+If this looks good, type y and hit enter.
+```
+From git-wip-us.apache.org:/repos/asf/arrow.git
+ * [new branch]      master     -> PR_TOOL_MERGE_PR_3_MASTER
+Switched to branch 'PR_TOOL_MERGE_PR_3_MASTER'
+
+Merge complete (local ref PR_TOOL_MERGE_PR_3_MASTER). Push to apache? (y/n):
+```
+A local branch with the merge has been created.
+type y and hit enter to push it to apache master
+```
+Counting objects: 67, done.
+Delta compression using up to 4 threads.
+Compressing objects: 100% (26/26), done.
+Writing objects: 100% (36/36), 5.32 KiB, done.
+Total 36 (delta 17), reused 0 (delta 0)
+To git-wip-us.apache.org:/repos/arrow-mr.git
+   b767ac4..485658a  PR_TOOL_MERGE_PR_X_MASTER -> master
+Restoring head pointer to b767ac4e
+Note: checking out 'b767ac4e'.
+
+You are in 'detached HEAD' state. You can look around, make experimental
+changes and commit them, and you can discard any commits you make in this
+state without impacting any branches by performing another checkout.
+
+If you want to create a new branch to retain commits you create, you may
+do so (now or later) by using -b with the checkout command again. Example:
+
+  git checkout -b new_branch_name
+
+HEAD is now at b767ac4... Update README.md
+Deleting local branch PR_TOOL_MERGE_PR_X
+Deleting local branch PR_TOOL_MERGE_PR_X_MASTER
+Pull request #X merged!
+Merge hash: 485658a5
+
+Would you like to pick 485658a5 into another branch? (y/n):
+```
+For now just say n as we have 1 branch
+
+## Verifying Release Candidates
+
+We have provided a script to assist with verifying release candidates:
+
+```shell
+bash dev/release/verify-release-candidate.sh 0.7.0 0
+```
+
+Currently this only works on Linux (patches to expand to macOS welcome!). Read
+the script for information about system dependencies.
+
+On Windows, we have a script that verifies C++ and Python (requires Visual
+Studio 2015):
+
+```
+dev/release/verify-release-candidate.bat apache-arrow-0.7.0.tar.gz
+```
+
+### Verifying the JavaScript release
+
+For JavaScript-specific releases, use a different verification script:
+
+```shell
+bash dev/release/js-verify-release-candidate.sh 0.7.0 0
+```
+
+# Integration testing
+
+Build the following base image used by multiple tests:
+
+```shell
+docker build -t arrow_integration_xenial_base -f docker_common/Dockerfile.xenial.base .
+```
+
+## HDFS C++ / Python support
+
+```shell
+docker-compose build conda-cpp
+docker-compose build conda-python
+docker-compose build conda-python-hdfs
+docker-compose run --rm conda-python-hdfs
+```
+
+## Apache Spark Integration Tests
+
+Tests can be run to ensure that the current snapshot of Java and Python Arrow
+works with Spark. This will run a docker image to build Arrow C++
+and Python in a Conda environment, build and install Arrow Java to the local
+Maven repository, build Spark with the new Arrow artifact, and run Arrow
+related unit tests in Spark for Java and Python. Any errors will exit with a
+non-zero value. To run, use the following command:
+
+```shell
+docker-compose build conda-cpp
+docker-compose build conda-python
+docker-compose build conda-python-spark
+docker-compose run --rm conda-python-spark
+```
+
+If you already are building Spark, these commands will map your local Maven
+repo to the image and save time by not having to download all dependencies.
+Be aware, that docker write files as root, which can cause problems for maven
+on the host.
+
+```shell
+docker-compose run --rm -v $HOME/.m2:/root/.m2 conda-python-spark
+```
+
+NOTE: If the Java API has breaking changes, a patched version of Spark might
+need to be used to successfully build.
diff --git a/src/arrow/dev/archery/MANIFEST.in b/src/arrow/dev/archery/MANIFEST.in
new file mode 100644
index 000000000..90fe034c2
--- /dev/null
+++ b/src/arrow/dev/archery/MANIFEST.in
@@ -0,0 +1,4 @@
+include ../../LICENSE.txt
+include ../../NOTICE.txt
+
+include archery/reports/*
diff --git a/src/arrow/dev/archery/README.md b/src/arrow/dev/archery/README.md
new file mode 100644
index 000000000..eff654416
--- /dev/null
+++ b/src/arrow/dev/archery/README.md
@@ -0,0 +1,49 @@
+<!--
+  ~ Licensed to the Apache Software Foundation (ASF) under one
+  ~ or more contributor license agreements.  See the NOTICE file
+  ~ distributed with this work for additional information
+  ~ regarding copyright ownership.  The ASF licenses this file
+  ~ to you under the Apache License, Version 2.0 (the
+  ~ "License"); you may not use this file except in compliance
+  ~ with the License.  You may obtain a copy of the License at
+  ~
+  ~   http://www.apache.org/licenses/LICENSE-2.0
+  ~
+  ~ Unless required by applicable law or agreed to in writing,
+  ~ software distributed under the License is distributed on an
+  ~ "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  ~ KIND, either express or implied.  See the License for the
+  ~ specific language governing permissions and limitations
+  ~ under the License.
+  -->
+
+# Developing with Archery
+
+Archery is documented on the Arrow website:
+
+* [Daily development using Archery](https://arrow.apache.org/docs/developers/archery.html)
+* [Using Archery and Crossbow](https://arrow.apache.org/docs/developers/crossbow.html)
+* [Using Archer and Docker](https://arrow.apache.org/docs/developers/docker.html)
+
+# Installing Archery
+
+See the pages linked aboved for more details. As a general overview, Archery
+comes in a number of subpackages, each needing to be installed if you want
+to use the functionality of it:
+
+* lint – lint (and in some cases auto-format) code in the Arrow repo
+  To install: `pip install -e "arrow/dev/archery[lint]"`
+* benchmark – to run Arrow benchmarks using Archery
+  To install: `pip install -e "arrow/dev/archery[benchmark]"`
+* docker – to run docker-compose based tasks more easily
+  To install: `pip install -e "arrow/dev/archery[docker]"`
+* release – release related helpers
+  To install: `pip install -e "arrow/dev/archery[release]"`
+* crossbow – to trigger + interact with the crossbow build system
+  To install: `pip install -e "arrow/dev/archery[crossbow]"`
+* crossbow-upload
+  To install: `pip install -e "arrow/dev/archery[crossbow-upload]"`
+
+Additionally, if you would prefer to install everything at once,
+`pip install -e "arrow/dev/archery[all]"` is an alias for all of
+the above subpackages.
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/__init__.py b/src/arrow/dev/archery/archery/__init__.py
new file mode 100644
index 000000000..13a83393a
--- /dev/null
+++ b/src/arrow/dev/archery/archery/__init__.py
@@ -0,0 +1,16 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
diff --git a/src/arrow/dev/archery/archery/benchmark/__init__.py b/src/arrow/dev/archery/archery/benchmark/__init__.py
new file mode 100644
index 000000000..13a83393a
--- /dev/null
+++ b/src/arrow/dev/archery/archery/benchmark/__init__.py
@@ -0,0 +1,16 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
diff --git a/src/arrow/dev/archery/archery/benchmark/codec.py b/src/arrow/dev/archery/archery/benchmark/codec.py
new file mode 100644
index 000000000..4157890d1
--- /dev/null
+++ b/src/arrow/dev/archery/archery/benchmark/codec.py
@@ -0,0 +1,97 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+
+import json
+
+from ..benchmark.core import Benchmark, BenchmarkSuite
+from ..benchmark.runner import BenchmarkRunner, StaticBenchmarkRunner
+from ..benchmark.compare import BenchmarkComparator
+
+
+class JsonEncoder(json.JSONEncoder):
+    def default(self, o):
+        if isinstance(o, Benchmark):
+            return BenchmarkCodec.encode(o)
+
+        if isinstance(o, BenchmarkSuite):
+            return BenchmarkSuiteCodec.encode(o)
+
+        if isinstance(o, BenchmarkRunner):
+            return BenchmarkRunnerCodec.encode(o)
+
+        if isinstance(o, BenchmarkComparator):
+            return BenchmarkComparatorCodec.encode(o)
+
+        return json.JSONEncoder.default(self, o)
+
+
+class BenchmarkCodec:
+    @staticmethod
+    def encode(b):
+        return {
+            "name": b.name,
+            "unit": b.unit,
+            "less_is_better": b.less_is_better,
+            "values": b.values,
+            "time_unit": b.time_unit,
+            "times": b.times,
+            "counters": b.counters,
+        }
+
+    @staticmethod
+    def decode(dct, **kwargs):
+        return Benchmark(**dct, **kwargs)
+
+
+class BenchmarkSuiteCodec:
+    @staticmethod
+    def encode(bs):
+        return {
+            "name": bs.name,
+            "benchmarks": [BenchmarkCodec.encode(b) for b in bs.benchmarks]
+        }
+
+    @staticmethod
+    def decode(dct, **kwargs):
+        benchmarks = [BenchmarkCodec.decode(b)
+                      for b in dct.pop("benchmarks", [])]
+        return BenchmarkSuite(benchmarks=benchmarks, **dct, **kwargs)
+
+
+class BenchmarkRunnerCodec:
+    @staticmethod
+    def encode(br):
+        return {"suites": [BenchmarkSuiteCodec.encode(s) for s in br.suites]}
+
+    @staticmethod
+    def decode(dct, **kwargs):
+        suites = [BenchmarkSuiteCodec.decode(s)
+                  for s in dct.pop("suites", [])]
+        return StaticBenchmarkRunner(suites=suites, **dct, **kwargs)
+
+
+class BenchmarkComparatorCodec:
+    @staticmethod
+    def encode(bc):
+        comparator = bc.formatted
+
+        suite_name = bc.suite_name
+        if suite_name:
+            comparator["suite"] = suite_name
+
+        return comparator
diff --git a/src/arrow/dev/archery/archery/benchmark/compare.py b/src/arrow/dev/archery/archery/benchmark/compare.py
new file mode 100644
index 000000000..622b80179
--- /dev/null
+++ b/src/arrow/dev/archery/archery/benchmark/compare.py
@@ -0,0 +1,173 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+
+# Define a global regression threshold as 5%. This is purely subjective and
+# flawed. This does not track cumulative regression.
+DEFAULT_THRESHOLD = 0.05
+
+
+def items_per_seconds_fmt(value):
+    if value < 1000:
+        return "{} items/sec".format(value)
+    if value < 1000**2:
+        return "{:.3f}K items/sec".format(value / 1000)
+    if value < 1000**3:
+        return "{:.3f}M items/sec".format(value / 1000**2)
+    else:
+        return "{:.3f}G items/sec".format(value / 1000**3)
+
+
+def bytes_per_seconds_fmt(value):
+    if value < 1024:
+        return "{} bytes/sec".format(value)
+    if value < 1024**2:
+        return "{:.3f} KiB/sec".format(value / 1024)
+    if value < 1024**3:
+        return "{:.3f} MiB/sec".format(value / 1024**2)
+    if value < 1024**4:
+        return "{:.3f} GiB/sec".format(value / 1024**3)
+    else:
+        return "{:.3f} TiB/sec".format(value / 1024**4)
+
+
+def change_fmt(value):
+    return "{:.3%}".format(value)
+
+
+def formatter_for_unit(unit):
+    if unit == "bytes_per_second":
+        return bytes_per_seconds_fmt
+    elif unit == "items_per_second":
+        return items_per_seconds_fmt
+    else:
+        return lambda x: x
+
+
+class BenchmarkComparator:
+    """ Compares two benchmarks.
+
+    Encodes the logic of comparing two benchmarks and taking a decision on
+    if it induce a regression.
+    """
+
+    def __init__(self, contender, baseline, threshold=DEFAULT_THRESHOLD,
+                 suite_name=None):
+        self.contender = contender
+        self.baseline = baseline
+        self.threshold = threshold
+        self.suite_name = suite_name
+
+    @property
+    def name(self):
+        return self.baseline.name
+
+    @property
+    def less_is_better(self):
+        return self.baseline.less_is_better
+
+    @property
+    def unit(self):
+        return self.baseline.unit
+
+    @property
+    def change(self):
+        new = self.contender.value
+        old = self.baseline.value
+
+        if old == 0 and new == 0:
+            return 0.0
+        if old == 0:
+            return 0.0
+
+        return float(new - old) / abs(old)
+
+    @property
+    def confidence(self):
+        """ Indicate if a comparison of benchmarks should be trusted. """
+        return True
+
+    @property
+    def regression(self):
+        change = self.change
+        adjusted_change = change if self.less_is_better else -change
+        return (self.confidence and adjusted_change > self.threshold)
+
+    @property
+    def formatted(self):
+        fmt = formatter_for_unit(self.unit)
+        return {
+            "benchmark": self.name,
+            "change": change_fmt(self.change),
+            "regression": self.regression,
+            "baseline": fmt(self.baseline.value),
+            "contender": fmt(self.contender.value),
+            "unit": self.unit,
+            "less_is_better": self.less_is_better,
+            "counters": str(self.baseline.counters)
+        }
+
+    def compare(self, comparator=None):
+        return {
+            "benchmark": self.name,
+            "change": self.change,
+            "regression": self.regression,
+            "baseline": self.baseline.value,
+            "contender": self.contender.value,
+            "unit": self.unit,
+            "less_is_better": self.less_is_better,
+            "counters": self.baseline.counters
+        }
+
+    def __call__(self, **kwargs):
+        return self.compare(**kwargs)
+
+
+def pairwise_compare(contender, baseline):
+    dict_contender = {e.name: e for e in contender}
+    dict_baseline = {e.name: e for e in baseline}
+
+    for name in (dict_contender.keys() & dict_baseline.keys()):
+        yield name, (dict_contender[name], dict_baseline[name])
+
+
+class RunnerComparator:
+    """ Compares suites/benchmarks from runners.
+
+    It is up to the caller that ensure that runners are compatible (both from
+    the same language implementation).
+    """
+
+    def __init__(self, contender, baseline, threshold=DEFAULT_THRESHOLD):
+        self.contender = contender
+        self.baseline = baseline
+        self.threshold = threshold
+
+    @property
+    def comparisons(self):
+        contender = self.contender.suites
+        baseline = self.baseline.suites
+        suites = pairwise_compare(contender, baseline)
+
+        for suite_name, (suite_cont, suite_base) in suites:
+            benchmarks = pairwise_compare(
+                suite_cont.benchmarks, suite_base.benchmarks)
+
+            for _, (bench_cont, bench_base) in benchmarks:
+                yield BenchmarkComparator(bench_cont, bench_base,
+                                          threshold=self.threshold,
+                                          suite_name=suite_name)
diff --git a/src/arrow/dev/archery/archery/benchmark/core.py b/src/arrow/dev/archery/archery/benchmark/core.py
new file mode 100644
index 000000000..5a92271a3
--- /dev/null
+++ b/src/arrow/dev/archery/archery/benchmark/core.py
@@ -0,0 +1,57 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+
+def median(values):
+    n = len(values)
+    if n == 0:
+        raise ValueError("median requires at least one value")
+    elif n % 2 == 0:
+        return (values[(n // 2) - 1] + values[n // 2]) / 2
+    else:
+        return values[n // 2]
+
+
+class Benchmark:
+    def __init__(self, name, unit, less_is_better, values, time_unit,
+                 times, counters=None):
+        self.name = name
+        self.unit = unit
+        self.less_is_better = less_is_better
+        self.values = sorted(values)
+        self.time_unit = time_unit
+        self.times = sorted(times)
+        self.median = median(self.values)
+        self.counters = counters or {}
+
+    @property
+    def value(self):
+        return self.median
+
+    def __repr__(self):
+        return "Benchmark[name={},value={}]".format(self.name, self.value)
+
+
+class BenchmarkSuite:
+    def __init__(self, name, benchmarks):
+        self.name = name
+        self.benchmarks = benchmarks
+
+    def __repr__(self):
+        return "BenchmarkSuite[name={}, benchmarks={}]".format(
+            self.name, self.benchmarks
+        )
diff --git a/src/arrow/dev/archery/archery/benchmark/google.py b/src/arrow/dev/archery/archery/benchmark/google.py
new file mode 100644
index 000000000..ebcc52636
--- /dev/null
+++ b/src/arrow/dev/archery/archery/benchmark/google.py
@@ -0,0 +1,174 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from itertools import filterfalse, groupby, tee
+import json
+import subprocess
+from tempfile import NamedTemporaryFile
+
+from .core import Benchmark
+from ..utils.command import Command
+
+
+def partition(pred, iterable):
+    # adapted from python's examples
+    t1, t2 = tee(iterable)
+    return list(filter(pred, t1)), list(filterfalse(pred, t2))
+
+
+class GoogleBenchmarkCommand(Command):
+    """ Run a google benchmark binary.
+
+    This assumes the binary supports the standard command line options,
+    notably `--benchmark_filter`, `--benchmark_format`, etc...
+    """
+
+    def __init__(self, benchmark_bin, benchmark_filter=None):
+        self.bin = benchmark_bin
+        self.benchmark_filter = benchmark_filter
+
+    def list_benchmarks(self):
+        argv = ["--benchmark_list_tests"]
+        if self.benchmark_filter:
+            argv.append("--benchmark_filter={}".format(self.benchmark_filter))
+        result = self.run(*argv, stdout=subprocess.PIPE,
+                          stderr=subprocess.PIPE)
+        return str.splitlines(result.stdout.decode("utf-8"))
+
+    def results(self, repetitions=1):
+        with NamedTemporaryFile() as out:
+            argv = ["--benchmark_repetitions={}".format(repetitions),
+                    "--benchmark_out={}".format(out.name),
+                    "--benchmark_out_format=json"]
+
+            if self.benchmark_filter:
+                argv.append(
+                    "--benchmark_filter={}".format(self.benchmark_filter)
+                )
+
+            self.run(*argv, check=True)
+            return json.load(out)
+
+
+class GoogleBenchmarkObservation:
+    """ Represents one run of a single (google c++) benchmark.
+
+    Aggregates are reported by Google Benchmark executables alongside
+    other observations whenever repetitions are specified (with
+    `--benchmark_repetitions` on the bare benchmark, or with the
+    archery option `--repetitions`). Aggregate observations are not
+    included in `GoogleBenchmark.runs`.
+
+    RegressionSumKernel/32768/0                 1 us          1 us  25.8077GB/s
+    RegressionSumKernel/32768/0                 1 us          1 us  25.7066GB/s
+    RegressionSumKernel/32768/0                 1 us          1 us  25.1481GB/s
+    RegressionSumKernel/32768/0                 1 us          1 us  25.846GB/s
+    RegressionSumKernel/32768/0                 1 us          1 us  25.6453GB/s
+    RegressionSumKernel/32768/0_mean            1 us          1 us  25.6307GB/s
+    RegressionSumKernel/32768/0_median          1 us          1 us  25.7066GB/s
+    RegressionSumKernel/32768/0_stddev          0 us          0 us  288.046MB/s
+    """
+
+    def __init__(self, name, real_time, cpu_time, time_unit, run_type,
+                 size=None, bytes_per_second=None, items_per_second=None,
+                 **counters):
+        self._name = name
+        self.real_time = real_time
+        self.cpu_time = cpu_time
+        self.time_unit = time_unit
+        self.run_type = run_type
+        self.size = size
+        self.bytes_per_second = bytes_per_second
+        self.items_per_second = items_per_second
+        self.counters = counters
+
+    @property
+    def is_aggregate(self):
+        """ Indicate if the observation is a run or an aggregate. """
+        return self.run_type == "aggregate"
+
+    @property
+    def is_realtime(self):
+        """ Indicate if the preferred value is realtime instead of cputime. """
+        return self.name.find("/real_time") != -1
+
+    @property
+    def name(self):
+        name = self._name
+        return name.rsplit("_", maxsplit=1)[0] if self.is_aggregate else name
+
+    @property
+    def time(self):
+        return self.real_time if self.is_realtime else self.cpu_time
+
+    @property
+    def value(self):
+        """ Return the benchmark value."""
+        return self.bytes_per_second or self.items_per_second or self.time
+
+    @property
+    def unit(self):
+        if self.bytes_per_second:
+            return "bytes_per_second"
+        elif self.items_per_second:
+            return "items_per_second"
+        else:
+            return self.time_unit
+
+    def __repr__(self):
+        return str(self.value)
+
+
+class GoogleBenchmark(Benchmark):
+    """ A set of GoogleBenchmarkObservations. """
+
+    def __init__(self, name, runs):
+        """ Initialize a GoogleBenchmark.
+
+        Parameters
+        ----------
+        name: str
+              Name of the benchmark
+        runs: list(GoogleBenchmarkObservation)
+              Repetitions of GoogleBenchmarkObservation run.
+
+        """
+        self.name = name
+        # exclude google benchmark aggregate artifacts
+        _, runs = partition(lambda b: b.is_aggregate, runs)
+        self.runs = sorted(runs, key=lambda b: b.value)
+        unit = self.runs[0].unit
+        time_unit = self.runs[0].time_unit
+        less_is_better = not unit.endswith("per_second")
+        values = [b.value for b in self.runs]
+        times = [b.real_time for b in self.runs]
+        # Slight kludge to extract the UserCounters for each benchmark
+        counters = self.runs[0].counters
+        super().__init__(name, unit, less_is_better, values, time_unit, times,
+                         counters)
+
+    def __repr__(self):
+        return "GoogleBenchmark[name={},runs={}]".format(self.names, self.runs)
+
+    @classmethod
+    def from_json(cls, payload):
+        def group_key(x):
+            return x.name
+
+        benchmarks = map(lambda x: GoogleBenchmarkObservation(**x), payload)
+        groups = groupby(sorted(benchmarks, key=group_key), group_key)
+        return [cls(k, list(bs)) for k, bs in groups]
diff --git a/src/arrow/dev/archery/archery/benchmark/jmh.py b/src/arrow/dev/archery/archery/benchmark/jmh.py
new file mode 100644
index 000000000..f531b6de1
--- /dev/null
+++ b/src/arrow/dev/archery/archery/benchmark/jmh.py
@@ -0,0 +1,201 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from itertools import filterfalse, groupby, tee
+import json
+import subprocess
+from tempfile import NamedTemporaryFile
+
+from .core import Benchmark
+from ..utils.command import Command
+from ..utils.maven import Maven
+
+
+def partition(pred, iterable):
+    # adapted from python's examples
+    t1, t2 = tee(iterable)
+    return list(filter(pred, t1)), list(filterfalse(pred, t2))
+
+
+class JavaMicrobenchmarkHarnessCommand(Command):
+    """ Run a Java Micro Benchmark Harness
+
+    This assumes the binary supports the standard command line options,
+    notably `-Dbenchmark_filter`
+    """
+
+    def __init__(self, build, benchmark_filter=None):
+        self.benchmark_filter = benchmark_filter
+        self.build = build
+        self.maven = Maven()
+
+    """ Extract benchmark names from output between "Benchmarks:" and "[INFO]".
+    Assume the following output:
+      ...
+      Benchmarks:
+      org.apache.arrow.vector.IntBenchmarks.setIntDirectly
+      ...
+      org.apache.arrow.vector.IntBenchmarks.setWithValueHolder
+      org.apache.arrow.vector.IntBenchmarks.setWithWriter
+      ...
+      [INFO]
+    """
+
+    def list_benchmarks(self):
+        argv = []
+        if self.benchmark_filter:
+            argv.append("-Dbenchmark.filter={}".format(self.benchmark_filter))
+        result = self.build.list(
+            *argv, stdout=subprocess.PIPE, stderr=subprocess.PIPE)
+
+        lists = []
+        benchmarks = False
+        for line in str.splitlines(result.stdout.decode("utf-8")):
+            if not benchmarks:
+                if line.startswith("Benchmarks:"):
+                    benchmarks = True
+            else:
+                if line.startswith("org.apache.arrow"):
+                    lists.append(line)
+                if line.startswith("[INFO]"):
+                    break
+        return lists
+
+    def results(self, repetitions):
+        with NamedTemporaryFile(suffix=".json") as out:
+            argv = ["-Dbenchmark.runs={}".format(repetitions),
+                    "-Dbenchmark.resultfile={}".format(out.name),
+                    "-Dbenchmark.resultformat=json"]
+            if self.benchmark_filter:
+                argv.append(
+                    "-Dbenchmark.filter={}".format(self.benchmark_filter)
+                )
+
+            self.build.benchmark(*argv, check=True)
+            return json.load(out)
+
+
+class JavaMicrobenchmarkHarnessObservation:
+    """ Represents one run of a single Java Microbenchmark Harness
+    """
+
+    def __init__(self, benchmark, primaryMetric,
+                 forks, warmupIterations, measurementIterations, **counters):
+        self.name = benchmark
+        self.primaryMetric = primaryMetric
+        self.score = primaryMetric["score"]
+        self.score_unit = primaryMetric["scoreUnit"]
+        self.forks = forks
+        self.warmups = warmupIterations
+        self.runs = measurementIterations
+        self.counters = {
+            "mode": counters["mode"],
+            "threads": counters["threads"],
+            "warmups": warmupIterations,
+            "warmupTime": counters["warmupTime"],
+            "measurements": measurementIterations,
+            "measurementTime": counters["measurementTime"],
+            "jvmArgs": counters["jvmArgs"]
+        }
+        self.reciprocal_value = True if self.score_unit.endswith(
+            "/op") else False
+        if self.score_unit.startswith("ops/"):
+            idx = self.score_unit.find("/")
+            self.normalizePerSec(self.score_unit[idx+1:])
+        elif self.score_unit.endswith("/op"):
+            idx = self.score_unit.find("/")
+            self.normalizePerSec(self.score_unit[:idx])
+        else:
+            self.normalizeFactor = 1
+
+    @property
+    def value(self):
+        """ Return the benchmark value."""
+        val = 1 / self.score if self.reciprocal_value else self.score
+        return val * self.normalizeFactor
+
+    def normalizePerSec(self, unit):
+        if unit == "ns":
+            self.normalizeFactor = 1000 * 1000 * 1000
+        elif unit == "us":
+            self.normalizeFactor = 1000 * 1000
+        elif unit == "ms":
+            self.normalizeFactor = 1000
+        elif unit == "min":
+            self.normalizeFactor = 1 / 60
+        elif unit == "hr":
+            self.normalizeFactor = 1 / (60 * 60)
+        elif unit == "day":
+            self.normalizeFactor = 1 / (60 * 60 * 24)
+        else:
+            self.normalizeFactor = 1
+
+    @property
+    def unit(self):
+        if self.score_unit.startswith("ops/"):
+            return "items_per_second"
+        elif self.score_unit.endswith("/op"):
+            return "items_per_second"
+        else:
+            return "?"
+
+    def __repr__(self):
+        return str(self.value)
+
+
+class JavaMicrobenchmarkHarness(Benchmark):
+    """ A set of JavaMicrobenchmarkHarnessObservations. """
+
+    def __init__(self, name, runs):
+        """ Initialize a JavaMicrobenchmarkHarness.
+
+        Parameters
+        ----------
+        name: str
+              Name of the benchmark
+        forks: int
+        warmups: int
+        runs: int
+        runs: list(JavaMicrobenchmarkHarnessObservation)
+              Repetitions of JavaMicrobenchmarkHarnessObservation run.
+
+        """
+        self.name = name
+        self.runs = sorted(runs, key=lambda b: b.value)
+        unit = self.runs[0].unit
+        time_unit = "N/A"
+        less_is_better = not unit.endswith("per_second")
+        values = [b.value for b in self.runs]
+        times = []
+        # Slight kludge to extract the UserCounters for each benchmark
+        counters = self.runs[0].counters
+        super().__init__(name, unit, less_is_better, values, time_unit, times,
+                         counters)
+
+    def __repr__(self):
+        return "JavaMicrobenchmark[name={},runs={}]".format(
+            self.name, self.runs)
+
+    @classmethod
+    def from_json(cls, payload):
+        def group_key(x):
+            return x.name
+
+        benchmarks = map(
+            lambda x: JavaMicrobenchmarkHarnessObservation(**x), payload)
+        groups = groupby(sorted(benchmarks, key=group_key), group_key)
+        return [cls(k, list(bs)) for k, bs in groups]
diff --git a/src/arrow/dev/archery/archery/benchmark/runner.py b/src/arrow/dev/archery/archery/benchmark/runner.py
new file mode 100644
index 000000000..fc6d354b1
--- /dev/null
+++ b/src/arrow/dev/archery/archery/benchmark/runner.py
@@ -0,0 +1,313 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import glob
+import json
+import os
+import re
+
+from .core import BenchmarkSuite
+from .google import GoogleBenchmarkCommand, GoogleBenchmark
+from .jmh import JavaMicrobenchmarkHarnessCommand, JavaMicrobenchmarkHarness
+from ..lang.cpp import CppCMakeDefinition, CppConfiguration
+from ..lang.java import JavaMavenDefinition, JavaConfiguration
+from ..utils.cmake import CMakeBuild
+from ..utils.maven import MavenBuild
+from ..utils.logger import logger
+
+
+def regex_filter(re_expr):
+    if re_expr is None:
+        return lambda s: True
+    re_comp = re.compile(re_expr)
+    return lambda s: re_comp.search(s)
+
+
+DEFAULT_REPETITIONS = 1
+
+
+class BenchmarkRunner:
+    def __init__(self, suite_filter=None, benchmark_filter=None,
+                 repetitions=DEFAULT_REPETITIONS):
+        self.suite_filter = suite_filter
+        self.benchmark_filter = benchmark_filter
+        self.repetitions = repetitions
+
+    @property
+    def suites(self):
+        raise NotImplementedError("BenchmarkRunner must implement suites")
+
+    @staticmethod
+    def from_rev_or_path(src, root, rev_or_path, cmake_conf, **kwargs):
+        raise NotImplementedError(
+            "BenchmarkRunner must implement from_rev_or_path")
+
+
+class StaticBenchmarkRunner(BenchmarkRunner):
+    """ Run suites from a (static) set of suites. """
+
+    def __init__(self, suites, **kwargs):
+        self._suites = suites
+        super().__init__(**kwargs)
+
+    @property
+    def list_benchmarks(self):
+        for suite in self._suites:
+            for benchmark in suite.benchmarks:
+                yield "{}.{}".format(suite.name, benchmark.name)
+
+    @property
+    def suites(self):
+        suite_fn = regex_filter(self.suite_filter)
+        benchmark_fn = regex_filter(self.benchmark_filter)
+
+        for suite in (s for s in self._suites if suite_fn(s.name)):
+            benchmarks = [b for b in suite.benchmarks if benchmark_fn(b.name)]
+            yield BenchmarkSuite(suite.name, benchmarks)
+
+    @classmethod
+    def is_json_result(cls, path_or_str):
+        builder = None
+        try:
+            builder = cls.from_json(path_or_str)
+        except BaseException:
+            pass
+
+        return builder is not None
+
+    @staticmethod
+    def from_json(path_or_str, **kwargs):
+        # .codec imported here to break recursive imports
+        from .codec import BenchmarkRunnerCodec
+        if os.path.isfile(path_or_str):
+            with open(path_or_str) as f:
+                loaded = json.load(f)
+        else:
+            loaded = json.loads(path_or_str)
+        return BenchmarkRunnerCodec.decode(loaded, **kwargs)
+
+    def __repr__(self):
+        return "BenchmarkRunner[suites={}]".format(list(self.suites))
+
+
+class CppBenchmarkRunner(BenchmarkRunner):
+    """ Run suites from a CMakeBuild. """
+
+    def __init__(self, build, **kwargs):
+        """ Initialize a CppBenchmarkRunner. """
+        self.build = build
+        super().__init__(**kwargs)
+
+    @staticmethod
+    def default_configuration(**kwargs):
+        """ Returns the default benchmark configuration. """
+        return CppConfiguration(
+            build_type="release", with_tests=False, with_benchmarks=True,
+            with_compute=True,
+            with_csv=True,
+            with_dataset=True,
+            with_json=True,
+            with_parquet=True,
+            with_python=False,
+            with_brotli=True,
+            with_bz2=True,
+            with_lz4=True,
+            with_snappy=True,
+            with_zlib=True,
+            with_zstd=True,
+            **kwargs)
+
+    @property
+    def suites_binaries(self):
+        """ Returns a list of benchmark binaries for this build. """
+        # Ensure build is up-to-date to run benchmarks
+        self.build()
+        # Not the best method, but works for now
+        glob_expr = os.path.join(self.build.binaries_dir, "*-benchmark")
+        return {os.path.basename(b): b for b in glob.glob(glob_expr)}
+
+    def suite(self, name, suite_bin):
+        """ Returns the resulting benchmarks for a given suite. """
+        suite_cmd = GoogleBenchmarkCommand(suite_bin, self.benchmark_filter)
+
+        # Ensure there will be data
+        benchmark_names = suite_cmd.list_benchmarks()
+        if not benchmark_names:
+            return None
+
+        results = suite_cmd.results(repetitions=self.repetitions)
+        benchmarks = GoogleBenchmark.from_json(results.get("benchmarks"))
+        return BenchmarkSuite(name, benchmarks)
+
+    @property
+    def list_benchmarks(self):
+        for suite_name, suite_bin in self.suites_binaries.items():
+            suite_cmd = GoogleBenchmarkCommand(suite_bin)
+            for benchmark_name in suite_cmd.list_benchmarks():
+                yield "{}.{}".format(suite_name, benchmark_name)
+
+    @property
+    def suites(self):
+        """ Returns all suite for a runner. """
+        suite_matcher = regex_filter(self.suite_filter)
+
+        suite_and_binaries = self.suites_binaries
+        for suite_name in suite_and_binaries:
+            if not suite_matcher(suite_name):
+                logger.debug("Ignoring suite {}".format(suite_name))
+                continue
+
+            suite_bin = suite_and_binaries[suite_name]
+            suite = self.suite(suite_name, suite_bin)
+
+            # Filter may exclude all benchmarks
+            if not suite:
+                logger.debug("Suite {} executed but no results"
+                             .format(suite_name))
+                continue
+
+            yield suite
+
+    @staticmethod
+    def from_rev_or_path(src, root, rev_or_path, cmake_conf, **kwargs):
+        """ Returns a BenchmarkRunner from a path or a git revision.
+
+        First, it checks if `rev_or_path` is a valid path (or string) of a json
+        object that can deserialize to a BenchmarkRunner. If so, it initialize
+        a StaticBenchmarkRunner from it. This allows memoizing the result of a
+        run in a file or a string.
+
+        Second, it checks if `rev_or_path` points to a valid CMake build
+        directory.  If so, it creates a CppBenchmarkRunner with this existing
+        CMakeBuild.
+
+        Otherwise, it assumes `rev_or_path` is a revision and clone/checkout
+        the given revision and create a fresh CMakeBuild.
+        """
+        build = None
+        if StaticBenchmarkRunner.is_json_result(rev_or_path):
+            return StaticBenchmarkRunner.from_json(rev_or_path, **kwargs)
+        elif CMakeBuild.is_build_dir(rev_or_path):
+            build = CMakeBuild.from_path(rev_or_path)
+            return CppBenchmarkRunner(build, **kwargs)
+        else:
+            # Revisions can references remote via the `/` character, ensure
+            # that the revision is path friendly
+            path_rev = rev_or_path.replace("/", "_")
+            root_rev = os.path.join(root, path_rev)
+            os.mkdir(root_rev)
+
+            clone_dir = os.path.join(root_rev, "arrow")
+            # Possibly checkout the sources at given revision, no need to
+            # perform cleanup on cloned repository as root_rev is reclaimed.
+            src_rev, _ = src.at_revision(rev_or_path, clone_dir)
+            cmake_def = CppCMakeDefinition(src_rev.cpp, cmake_conf)
+            build_dir = os.path.join(root_rev, "build")
+            return CppBenchmarkRunner(cmake_def.build(build_dir), **kwargs)
+
+
+class JavaBenchmarkRunner(BenchmarkRunner):
+    """ Run suites for Java. """
+
+    # default repetitions is 5 for Java microbenchmark harness
+    def __init__(self, build, **kwargs):
+        """ Initialize a JavaBenchmarkRunner. """
+        self.build = build
+        super().__init__(**kwargs)
+
+    @staticmethod
+    def default_configuration(**kwargs):
+        """ Returns the default benchmark configuration. """
+        return JavaConfiguration(**kwargs)
+
+    def suite(self, name):
+        """ Returns the resulting benchmarks for a given suite. """
+        # update .m2 directory, which installs target jars
+        self.build.build()
+
+        suite_cmd = JavaMicrobenchmarkHarnessCommand(
+            self.build, self.benchmark_filter)
+
+        # Ensure there will be data
+        benchmark_names = suite_cmd.list_benchmarks()
+        if not benchmark_names:
+            return None
+
+        results = suite_cmd.results(repetitions=self.repetitions)
+        benchmarks = JavaMicrobenchmarkHarness.from_json(results)
+        return BenchmarkSuite(name, benchmarks)
+
+    @property
+    def list_benchmarks(self):
+        """ Returns all suite names """
+        # Ensure build is up-to-date to run benchmarks
+        self.build.build()
+
+        suite_cmd = JavaMicrobenchmarkHarnessCommand(self.build)
+        benchmark_names = suite_cmd.list_benchmarks()
+        for benchmark_name in benchmark_names:
+            yield "{}".format(benchmark_name)
+
+    @property
+    def suites(self):
+        """ Returns all suite for a runner. """
+        suite_name = "JavaBenchmark"
+        suite = self.suite(suite_name)
+
+        # Filter may exclude all benchmarks
+        if not suite:
+            logger.debug("Suite {} executed but no results"
+                         .format(suite_name))
+            return
+
+        yield suite
+
+    @staticmethod
+    def from_rev_or_path(src, root, rev_or_path, maven_conf, **kwargs):
+        """ Returns a BenchmarkRunner from a path or a git revision.
+
+        First, it checks if `rev_or_path` is a valid path (or string) of a json
+        object that can deserialize to a BenchmarkRunner. If so, it initialize
+        a StaticBenchmarkRunner from it. This allows memoizing the result of a
+        run in a file or a string.
+
+        Second, it checks if `rev_or_path` points to a valid Maven build
+        directory.  If so, it creates a JavaBenchmarkRunner with this existing
+        MavenBuild.
+
+        Otherwise, it assumes `rev_or_path` is a revision and clone/checkout
+        the given revision and create a fresh MavenBuild.
+        """
+        if StaticBenchmarkRunner.is_json_result(rev_or_path):
+            return StaticBenchmarkRunner.from_json(rev_or_path, **kwargs)
+        elif MavenBuild.is_build_dir(rev_or_path):
+            maven_def = JavaMavenDefinition(rev_or_path, maven_conf)
+            return JavaBenchmarkRunner(maven_def.build(rev_or_path), **kwargs)
+        else:
+            # Revisions can references remote via the `/` character, ensure
+            # that the revision is path friendly
+            path_rev = rev_or_path.replace("/", "_")
+            root_rev = os.path.join(root, path_rev)
+            os.mkdir(root_rev)
+
+            clone_dir = os.path.join(root_rev, "arrow")
+            # Possibly checkout the sources at given revision, no need to
+            # perform cleanup on cloned repository as root_rev is reclaimed.
+            src_rev, _ = src.at_revision(rev_or_path, clone_dir)
+            maven_def = JavaMavenDefinition(src_rev.java, maven_conf)
+            build_dir = os.path.join(root_rev, "arrow/java")
+            return JavaBenchmarkRunner(maven_def.build(build_dir), **kwargs)
diff --git a/src/arrow/dev/archery/archery/bot.py b/src/arrow/dev/archery/archery/bot.py
new file mode 100644
index 000000000..e8fbbdd04
--- /dev/null
+++ b/src/arrow/dev/archery/archery/bot.py
@@ -0,0 +1,267 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+import shlex
+from pathlib import Path
+from functools import partial
+import tempfile
+
+import click
+import github
+
+from .utils.git import git
+from .utils.logger import logger
+from .crossbow import Repo, Queue, Config, Target, Job, CommentReport
+
+
+class EventError(Exception):
+    pass
+
+
+class CommandError(Exception):
+
+    def __init__(self, message):
+        self.message = message
+
+
+class _CommandMixin:
+
+    def get_help_option(self, ctx):
+        def show_help(ctx, param, value):
+            if value and not ctx.resilient_parsing:
+                raise click.UsageError(ctx.get_help())
+        option = super().get_help_option(ctx)
+        option.callback = show_help
+        return option
+
+    def __call__(self, message, **kwargs):
+        args = shlex.split(message)
+        try:
+            with self.make_context(self.name, args=args, obj=kwargs) as ctx:
+                return self.invoke(ctx)
+        except click.ClickException as e:
+            raise CommandError(e.format_message())
+
+
+class Command(_CommandMixin, click.Command):
+    pass
+
+
+class Group(_CommandMixin, click.Group):
+
+    def command(self, *args, **kwargs):
+        kwargs.setdefault('cls', Command)
+        return super().command(*args, **kwargs)
+
+    def group(self, *args, **kwargs):
+        kwargs.setdefault('cls', Group)
+        return super().group(*args, **kwargs)
+
+    def parse_args(self, ctx, args):
+        if not args and self.no_args_is_help and not ctx.resilient_parsing:
+            raise click.UsageError(ctx.get_help())
+        return super().parse_args(ctx, args)
+
+
+command = partial(click.command, cls=Command)
+group = partial(click.group, cls=Group)
+
+
+class CommentBot:
+
+    def __init__(self, name, handler, token=None):
+        # TODO(kszucs): validate
+        assert isinstance(name, str)
+        assert callable(handler)
+        self.name = name
+        self.handler = handler
+        self.github = github.Github(token)
+
+    def parse_command(self, payload):
+        # only allow users of apache org to submit commands, for more see
+        # https://developer.github.com/v4/enum/commentauthorassociation/
+        allowed_roles = {'OWNER', 'MEMBER', 'CONTRIBUTOR'}
+        mention = '@{}'.format(self.name)
+        comment = payload['comment']
+
+        if payload['sender']['login'] == self.name:
+            raise EventError("Don't respond to itself")
+        elif payload['action'] not in {'created', 'edited'}:
+            raise EventError("Don't respond to comment deletion")
+        elif comment['author_association'] not in allowed_roles:
+            raise EventError(
+                "Don't respond to comments from non-authorized users"
+            )
+        elif not comment['body'].lstrip().startswith(mention):
+            raise EventError("The bot is not mentioned")
+
+        # Parse the comment, removing the bot mentioned (and everything
+        # before it)
+        command = payload['comment']['body'].split(mention)[-1]
+
+        # then split on newlines and keep only the first line
+        # (ignoring all other lines)
+        return command.split("\n")[0].strip()
+
+    def handle(self, event, payload):
+        try:
+            command = self.parse_command(payload)
+        except EventError as e:
+            logger.error(e)
+            # see the possible reasons in the validate method
+            return
+
+        if event == 'issue_comment':
+            return self.handle_issue_comment(command, payload)
+        elif event == 'pull_request_review_comment':
+            return self.handle_review_comment(command, payload)
+        else:
+            raise ValueError("Unexpected event type {}".format(event))
+
+    def handle_issue_comment(self, command, payload):
+        repo = self.github.get_repo(payload['repository']['id'], lazy=True)
+        issue = repo.get_issue(payload['issue']['number'])
+
+        try:
+            pull = issue.as_pull_request()
+        except github.GithubException:
+            return issue.create_comment(
+                "The comment bot only listens to pull request comments!"
+            )
+
+        comment = pull.get_issue_comment(payload['comment']['id'])
+        try:
+            self.handler(command, issue=issue, pull_request=pull,
+                         comment=comment)
+        except CommandError as e:
+            logger.error(e)
+            pull.create_issue_comment("```\n{}\n```".format(e.message))
+        except Exception as e:
+            logger.exception(e)
+            comment.create_reaction('-1')
+        else:
+            comment.create_reaction('+1')
+
+    def handle_review_comment(self, payload):
+        raise NotImplementedError()
+
+
+@group(name='@github-actions')
+@click.pass_context
+def actions(ctx):
+    """Ursabot"""
+    ctx.ensure_object(dict)
+
+
+@actions.group()
+@click.option('--crossbow', '-c', default='ursacomputing/crossbow',
+              help='Crossbow repository on github to use')
+@click.pass_obj
+def crossbow(obj, crossbow):
+    """
+    Trigger crossbow builds for this pull request
+    """
+    obj['crossbow_repo'] = crossbow
+
+
+def _clone_arrow_and_crossbow(dest, crossbow_repo, pull_request):
+    """
+    Clone the repositories and initialize crossbow objects.
+
+    Parameters
+    ----------
+    dest : Path
+        Filesystem path to clone the repositories to.
+    crossbow_repo : str
+        Github repository name, like kszucs/crossbow.
+    pull_request : pygithub.PullRequest
+        Object containing information about the pull request the comment bot
+        was triggered from.
+    """
+    arrow_path = dest / 'arrow'
+    queue_path = dest / 'crossbow'
+
+    # clone arrow and checkout the pull request's branch
+    pull_request_ref = 'pull/{}/head:{}'.format(
+        pull_request.number, pull_request.head.ref
+    )
+    git.clone(pull_request.base.repo.clone_url, str(arrow_path))
+    git.fetch('origin', pull_request_ref, git_dir=arrow_path)
+    git.checkout(pull_request.head.ref, git_dir=arrow_path)
+
+    # clone crossbow repository
+    crossbow_url = 'https://github.com/{}'.format(crossbow_repo)
+    git.clone(crossbow_url, str(queue_path))
+
+    # initialize crossbow objects
+    github_token = os.environ['CROSSBOW_GITHUB_TOKEN']
+    arrow = Repo(arrow_path)
+    queue = Queue(queue_path, github_token=github_token, require_https=True)
+
+    return (arrow, queue)
+
+
+@crossbow.command()
+@click.argument('tasks', nargs=-1, required=False)
+@click.option('--group', '-g', 'groups', multiple=True,
+              help='Submit task groups as defined in tests.yml')
+@click.option('--param', '-p', 'params', multiple=True,
+              help='Additional task parameters for rendering the CI templates')
+@click.option('--arrow-version', '-v', default=None,
+              help='Set target version explicitly.')
+@click.pass_obj
+def submit(obj, tasks, groups, params, arrow_version):
+    """
+    Submit crossbow testing tasks.
+
+    See groups defined in arrow/dev/tasks/tasks.yml
+    """
+    crossbow_repo = obj['crossbow_repo']
+    pull_request = obj['pull_request']
+    with tempfile.TemporaryDirectory() as tmpdir:
+        tmpdir = Path(tmpdir)
+        arrow, queue = _clone_arrow_and_crossbow(
+            dest=Path(tmpdir),
+            crossbow_repo=crossbow_repo,
+            pull_request=pull_request,
+        )
+        # load available tasks configuration and groups from yaml
+        config = Config.load_yaml(arrow.path / "dev" / "tasks" / "tasks.yml")
+        config.validate()
+
+        # initialize the crossbow build's target repository
+        target = Target.from_repo(arrow, version=arrow_version,
+                                  remote=pull_request.head.repo.clone_url,
+                                  branch=pull_request.head.ref)
+
+        # parse additional job parameters
+        params = dict([p.split("=") for p in params])
+
+        # instantiate the job object
+        job = Job.from_config(config=config, target=target, tasks=tasks,
+                              groups=groups, params=params)
+
+        # add the job to the crossbow queue and push to the remote repository
+        queue.put(job, prefix="actions")
+        queue.push()
+
+        # render the response comment's content
+        report = CommentReport(job, crossbow_repo=crossbow_repo)
+
+        # send the response
+        pull_request.create_issue_comment(report.show())
diff --git a/src/arrow/dev/archery/archery/cli.py b/src/arrow/dev/archery/archery/cli.py
new file mode 100644
index 000000000..d408be3cc
--- /dev/null
+++ b/src/arrow/dev/archery/archery/cli.py
@@ -0,0 +1,943 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from collections import namedtuple
+from io import StringIO
+import click
+import errno
+import json
+import logging
+import os
+import pathlib
+import sys
+
+from .benchmark.codec import JsonEncoder
+from .benchmark.compare import RunnerComparator, DEFAULT_THRESHOLD
+from .benchmark.runner import CppBenchmarkRunner, JavaBenchmarkRunner
+from .compat import _import_pandas
+from .lang.cpp import CppCMakeDefinition, CppConfiguration
+from .utils.cli import ArrowBool, validate_arrow_sources, add_optional_command
+from .utils.lint import linter, python_numpydoc, LintValidationException
+from .utils.logger import logger, ctx as log_ctx
+from .utils.source import ArrowSources
+from .utils.tmpdir import tmpdir
+
+# Set default logging to INFO in command line.
+logging.basicConfig(level=logging.INFO)
+
+
+BOOL = ArrowBool()
+
+
+@click.group()
+@click.option("--debug", type=BOOL, is_flag=True, default=False,
+              help="Increase logging with debugging output.")
+@click.option("--pdb", type=BOOL, is_flag=True, default=False,
+              help="Invoke pdb on uncaught exception.")
+@click.option("-q", "--quiet", type=BOOL, is_flag=True, default=False,
+              help="Silence executed commands.")
+@click.pass_context
+def archery(ctx, debug, pdb, quiet):
+    """ Apache Arrow developer utilities.
+
+    See sub-commands help with `archery <cmd> --help`.
+
+    """
+    # Ensure ctx.obj exists
+    ctx.ensure_object(dict)
+
+    log_ctx.quiet = quiet
+    if debug:
+        logger.setLevel(logging.DEBUG)
+
+    ctx.debug = debug
+
+    if pdb:
+        import pdb
+        sys.excepthook = lambda t, v, e: pdb.pm()
+
+
+build_dir_type = click.Path(dir_okay=True, file_okay=False, resolve_path=True)
+# Supported build types
+build_type = click.Choice(["debug", "relwithdebinfo", "release"],
+                          case_sensitive=False)
+# Supported warn levels
+warn_level_type = click.Choice(["everything", "checkin", "production"],
+                               case_sensitive=False)
+
+simd_level = click.Choice(["NONE", "SSE4_2", "AVX2", "AVX512"],
+                          case_sensitive=True)
+
+
+def cpp_toolchain_options(cmd):
+    options = [
+        click.option("--cc", metavar="<compiler>", help="C compiler."),
+        click.option("--cxx", metavar="<compiler>", help="C++ compiler."),
+        click.option("--cxx-flags", help="C++ compiler flags."),
+        click.option("--cpp-package-prefix",
+                     help=("Value to pass for ARROW_PACKAGE_PREFIX and "
+                           "use ARROW_DEPENDENCY_SOURCE=SYSTEM"))
+    ]
+    return _apply_options(cmd, options)
+
+
+def java_toolchain_options(cmd):
+    options = [
+        click.option("--java-home", metavar="<java_home>",
+                     help="Path to Java Developers Kit."),
+        click.option("--java-options", help="java compiler options."),
+    ]
+    return _apply_options(cmd, options)
+
+
+def _apply_options(cmd, options):
+    for option in options:
+        cmd = option(cmd)
+    return cmd
+
+
+@archery.command(short_help="Initialize an Arrow C++ build")
+@click.option("--src", metavar="<arrow_src>", default=None,
+              callback=validate_arrow_sources,
+              help="Specify Arrow source directory")
+# toolchain
+@cpp_toolchain_options
+@click.option("--build-type", default=None, type=build_type,
+              help="CMake's CMAKE_BUILD_TYPE")
+@click.option("--warn-level", default="production", type=warn_level_type,
+              help="Controls compiler warnings -W(no-)error.")
+@click.option("--use-gold-linker", default=True, type=BOOL,
+              help="Toggles ARROW_USE_LD_GOLD option.")
+@click.option("--simd-level", default="SSE4_2", type=simd_level,
+              help="Toggles ARROW_SIMD_LEVEL option.")
+# Tests and benchmarks
+@click.option("--with-tests", default=True, type=BOOL,
+              help="Build with tests.")
+@click.option("--with-benchmarks", default=None, type=BOOL,
+              help="Build with benchmarks.")
+@click.option("--with-examples", default=None, type=BOOL,
+              help="Build with examples.")
+@click.option("--with-integration", default=None, type=BOOL,
+              help="Build with integration test executables.")
+# Static checks
+@click.option("--use-asan", default=None, type=BOOL,
+              help="Toggle ARROW_USE_ASAN sanitizer.")
+@click.option("--use-tsan", default=None, type=BOOL,
+              help="Toggle ARROW_USE_TSAN sanitizer.")
+@click.option("--use-ubsan", default=None, type=BOOL,
+              help="Toggle ARROW_USE_UBSAN sanitizer.")
+@click.option("--with-fuzzing", default=None, type=BOOL,
+              help="Toggle ARROW_FUZZING.")
+# Components
+@click.option("--with-compute", default=None, type=BOOL,
+              help="Build the Arrow compute module.")
+@click.option("--with-csv", default=None, type=BOOL,
+              help="Build the Arrow CSV parser module.")
+@click.option("--with-cuda", default=None, type=BOOL,
+              help="Build the Arrow CUDA extensions.")
+@click.option("--with-dataset", default=None, type=BOOL,
+              help="Build the Arrow dataset module.")
+@click.option("--with-filesystem", default=None, type=BOOL,
+              help="Build the Arrow filesystem layer.")
+@click.option("--with-flight", default=None, type=BOOL,
+              help="Build with Flight rpc support.")
+@click.option("--with-gandiva", default=None, type=BOOL,
+              help="Build with Gandiva expression compiler support.")
+@click.option("--with-hdfs", default=None, type=BOOL,
+              help="Build the Arrow HDFS bridge.")
+@click.option("--with-hiveserver2", default=None, type=BOOL,
+              help="Build the HiveServer2 client and arrow adapater.")
+@click.option("--with-ipc", default=None, type=BOOL,
+              help="Build the Arrow IPC extensions.")
+@click.option("--with-json", default=None, type=BOOL,
+              help="Build the Arrow JSON parser module.")
+@click.option("--with-jni", default=None, type=BOOL,
+              help="Build the Arrow JNI lib.")
+@click.option("--with-mimalloc", default=None, type=BOOL,
+              help="Build the Arrow mimalloc based allocator.")
+@click.option("--with-parquet", default=None, type=BOOL,
+              help="Build with Parquet file support.")
+@click.option("--with-plasma", default=None, type=BOOL,
+              help="Build with Plasma object store support.")
+@click.option("--with-python", default=None, type=BOOL,
+              help="Build the Arrow CPython extesions.")
+@click.option("--with-r", default=None, type=BOOL,
+              help="Build the Arrow R extensions. This is not a CMake option, "
+              "it will toggle required options")
+@click.option("--with-s3", default=None, type=BOOL,
+              help="Build Arrow with S3 support.")
+# Compressions
+@click.option("--with-brotli", default=None, type=BOOL,
+              help="Build Arrow with brotli compression.")
+@click.option("--with-bz2", default=None, type=BOOL,
+              help="Build Arrow with bz2 compression.")
+@click.option("--with-lz4", default=None, type=BOOL,
+              help="Build Arrow with lz4 compression.")
+@click.option("--with-snappy", default=None, type=BOOL,
+              help="Build Arrow with snappy compression.")
+@click.option("--with-zlib", default=None, type=BOOL,
+              help="Build Arrow with zlib compression.")
+@click.option("--with-zstd", default=None, type=BOOL,
+              help="Build Arrow with zstd compression.")
+# CMake extra feature
+@click.option("--cmake-extras", type=str, multiple=True,
+              help="Extra flags/options to pass to cmake invocation. "
+              "Can be stacked")
+@click.option("--install-prefix", type=str,
+              help="Destination directory where files are installed. Expand to"
+              "CMAKE_INSTALL_PREFIX. Defaults to to $CONDA_PREFIX if the"
+              "variable exists.")
+# misc
+@click.option("-f", "--force", type=BOOL, is_flag=True, default=False,
+              help="Delete existing build directory if found.")
+@click.option("--targets", type=str, multiple=True,
+              help="Generator targets to run. Can be stacked.")
+@click.argument("build_dir", type=build_dir_type)
+@click.pass_context
+def build(ctx, src, build_dir, force, targets, **kwargs):
+    """ Initialize a C++ build directory.
+
+    The build command creates a directory initialized with Arrow's cpp source
+    cmake and configuration. It can also optionally invoke the generator to
+    test the build (and used in scripts).
+
+    Note that archery will carry the caller environment. It will also not touch
+    an existing directory, one must use the `--force` option to remove the
+    existing directory.
+
+    Examples:
+
+    \b
+    # Initialize build with clang8 and avx2 support in directory `clang8-build`
+    \b
+    archery build --cc=clang-8 --cxx=clang++-8 --cxx-flags=-mavx2 clang8-build
+
+    \b
+    # Builds and run test
+    archery build --targets=all --targets=test build
+    """
+    # Arrow's cpp cmake configuration
+    conf = CppConfiguration(**kwargs)
+    # This is a closure around cmake invocation, e.g. calling `def.build()`
+    # yields a directory ready to be run with the generator
+    cmake_def = CppCMakeDefinition(src.cpp, conf)
+    # Create build directory
+    build = cmake_def.build(build_dir, force=force)
+
+    for target in targets:
+        build.run(target)
+
+
+LintCheck = namedtuple('LintCheck', ('option_name', 'help'))
+
+lint_checks = [
+    LintCheck('clang-format', "Format C++ files with clang-format."),
+    LintCheck('clang-tidy', "Lint C++ files with clang-tidy."),
+    LintCheck('cpplint', "Lint C++ files with cpplint."),
+    LintCheck('iwyu', "Lint changed C++ files with Include-What-You-Use."),
+    LintCheck('python',
+              "Format and lint Python files with autopep8 and flake8."),
+    LintCheck('numpydoc', "Lint Python files with numpydoc."),
+    LintCheck('cmake-format', "Format CMake files with cmake-format.py."),
+    LintCheck('rat',
+              "Check all sources files for license texts via Apache RAT."),
+    LintCheck('r', "Lint R files."),
+    LintCheck('docker', "Lint Dockerfiles with hadolint."),
+]
+
+
+def decorate_lint_command(cmd):
+    """
+    Decorate the lint() command function to add individual per-check options.
+    """
+    for check in lint_checks:
+        option = click.option("--{0}/--no-{0}".format(check.option_name),
+                              default=None, help=check.help)
+        cmd = option(cmd)
+    return cmd
+
+
+@archery.command(short_help="Check Arrow source tree for errors")
+@click.option("--src", metavar="<arrow_src>", default=None,
+              callback=validate_arrow_sources,
+              help="Specify Arrow source directory")
+@click.option("--fix", is_flag=True, type=BOOL, default=False,
+              help="Toggle fixing the lint errors if the linter supports it.")
+@click.option("--iwyu_all", is_flag=True, type=BOOL, default=False,
+              help="Run IWYU on all C++ files if enabled")
+@click.option("-a", "--all", is_flag=True, default=False,
+              help="Enable all checks.")
+@decorate_lint_command
+@click.pass_context
+def lint(ctx, src, fix, iwyu_all, **checks):
+    if checks.pop('all'):
+        # "--all" is given => enable all non-selected checks
+        for k, v in checks.items():
+            if v is None:
+                checks[k] = True
+    if not any(checks.values()):
+        raise click.UsageError(
+            "Need to enable at least one lint check (try --help)")
+    try:
+        linter(src, fix, iwyu_all=iwyu_all, **checks)
+    except LintValidationException:
+        sys.exit(1)
+
+
+@archery.command(short_help="Lint python docstring with NumpyDoc")
+@click.argument('symbols', nargs=-1)
+@click.option("--src", metavar="<arrow_src>", default=None,
+              callback=validate_arrow_sources,
+              help="Specify Arrow source directory")
+@click.option("--allow-rule", "-a", multiple=True,
+              help="Allow only these rules")
+@click.option("--disallow-rule", "-d", multiple=True,
+              help="Disallow these rules")
+def numpydoc(src, symbols, allow_rule, disallow_rule):
+    """
+    Pass list of modules or symbols as arguments to restrict the validation.
+
+    By default all modules of pyarrow are tried to be validated.
+
+    Examples
+    --------
+    archery numpydoc pyarrow.dataset
+    archery numpydoc pyarrow.csv pyarrow.json pyarrow.parquet
+    archery numpydoc pyarrow.array
+    """
+    disallow_rule = disallow_rule or {'GL01', 'SA01', 'EX01', 'ES01'}
+    try:
+        results = python_numpydoc(symbols, allow_rules=allow_rule,
+                                  disallow_rules=disallow_rule)
+        for result in results:
+            result.ok()
+    except LintValidationException:
+        sys.exit(1)
+
+
+@archery.group()
+@click.pass_context
+def benchmark(ctx):
+    """ Arrow benchmarking.
+
+    Use the diff sub-command to benchmark revisions, and/or build directories.
+    """
+    pass
+
+
+def benchmark_common_options(cmd):
+    def check_language(ctx, param, value):
+        if value not in {"cpp", "java"}:
+            raise click.BadParameter("cpp or java is supported now")
+        return value
+
+    options = [
+        click.option("--src", metavar="<arrow_src>", show_default=True,
+                     default=None, callback=validate_arrow_sources,
+                     help="Specify Arrow source directory"),
+        click.option("--preserve", type=BOOL, default=False, show_default=True,
+                     is_flag=True,
+                     help="Preserve workspace for investigation."),
+        click.option("--output", metavar="<output>",
+                     type=click.File("w", encoding="utf8"), default="-",
+                     help="Capture output result into file."),
+        click.option("--language", metavar="<lang>", type=str, default="cpp",
+                     show_default=True, callback=check_language,
+                     help="Specify target language for the benchmark"),
+        click.option("--build-extras", type=str, multiple=True,
+                     help="Extra flags/options to pass to mvn build. "
+                     "Can be stacked. For language=java"),
+        click.option("--benchmark-extras", type=str, multiple=True,
+                     help="Extra flags/options to pass to mvn benchmark. "
+                     "Can be stacked. For language=java"),
+        click.option("--cmake-extras", type=str, multiple=True,
+                     help="Extra flags/options to pass to cmake invocation. "
+                     "Can be stacked. For language=cpp")
+    ]
+
+    cmd = java_toolchain_options(cmd)
+    cmd = cpp_toolchain_options(cmd)
+    return _apply_options(cmd, options)
+
+
+def benchmark_filter_options(cmd):
+    options = [
+        click.option("--suite-filter", metavar="<regex>", show_default=True,
+                     type=str, default=None,
+                     help="Regex filtering benchmark suites."),
+        click.option("--benchmark-filter", metavar="<regex>",
+                     show_default=True, type=str, default=None,
+                     help="Regex filtering benchmarks.")
+    ]
+    return _apply_options(cmd, options)
+
+
+@benchmark.command(name="list", short_help="List benchmark suite")
+@click.argument("rev_or_path", metavar="[<rev_or_path>]",
+                default="WORKSPACE", required=False)
+@benchmark_common_options
+@click.pass_context
+def benchmark_list(ctx, rev_or_path, src, preserve, output, cmake_extras,
+                   java_home, java_options, build_extras, benchmark_extras,
+                   language, **kwargs):
+    """ List benchmark suite.
+    """
+    with tmpdir(preserve=preserve) as root:
+        logger.debug("Running benchmark {}".format(rev_or_path))
+
+        if language == "cpp":
+            conf = CppBenchmarkRunner.default_configuration(
+                cmake_extras=cmake_extras, **kwargs)
+
+            runner_base = CppBenchmarkRunner.from_rev_or_path(
+                src, root, rev_or_path, conf)
+
+        elif language == "java":
+            for key in {'cpp_package_prefix', 'cxx_flags', 'cxx', 'cc'}:
+                del kwargs[key]
+            conf = JavaBenchmarkRunner.default_configuration(
+                java_home=java_home, java_options=java_options,
+                build_extras=build_extras, benchmark_extras=benchmark_extras,
+                **kwargs)
+
+            runner_base = JavaBenchmarkRunner.from_rev_or_path(
+                src, root, rev_or_path, conf)
+
+        for b in runner_base.list_benchmarks:
+            click.echo(b, file=output)
+
+
+@benchmark.command(name="run", short_help="Run benchmark suite")
+@click.argument("rev_or_path", metavar="[<rev_or_path>]",
+                default="WORKSPACE", required=False)
+@benchmark_common_options
+@benchmark_filter_options
+@click.option("--repetitions", type=int, default=-1,
+              help=("Number of repetitions of each benchmark. Increasing "
+                    "may improve result precision. "
+                    "[default: 1 for cpp, 5 for java"))
+@click.pass_context
+def benchmark_run(ctx, rev_or_path, src, preserve, output, cmake_extras,
+                  java_home, java_options, build_extras, benchmark_extras,
+                  language, suite_filter, benchmark_filter, repetitions,
+                  **kwargs):
+    """ Run benchmark suite.
+
+    This command will run the benchmark suite for a single build. This is
+    used to capture (and/or publish) the results.
+
+    The caller can optionally specify a target which is either a git revision
+    (commit, tag, special values like HEAD) or a cmake build directory.
+
+    When a commit is referenced, a local clone of the arrow sources (specified
+    via --src) is performed and the proper branch is created. This is done in
+    a temporary directory which can be left intact with the `--preserve` flag.
+
+    The special token "WORKSPACE" is reserved to specify the current git
+    workspace. This imply that no clone will be performed.
+
+    Examples:
+
+    \b
+    # Run the benchmarks on current git workspace
+    \b
+    archery benchmark run
+
+    \b
+    # Run the benchmarks on current previous commit
+    \b
+    archery benchmark run HEAD~1
+
+    \b
+    # Run the benchmarks on current previous commit
+    \b
+    archery benchmark run --output=run.json
+    """
+    with tmpdir(preserve=preserve) as root:
+        logger.debug("Running benchmark {}".format(rev_or_path))
+
+        if language == "cpp":
+            conf = CppBenchmarkRunner.default_configuration(
+                cmake_extras=cmake_extras, **kwargs)
+
+            repetitions = repetitions if repetitions != -1 else 1
+            runner_base = CppBenchmarkRunner.from_rev_or_path(
+                src, root, rev_or_path, conf,
+                repetitions=repetitions,
+                suite_filter=suite_filter, benchmark_filter=benchmark_filter)
+
+        elif language == "java":
+            for key in {'cpp_package_prefix', 'cxx_flags', 'cxx', 'cc'}:
+                del kwargs[key]
+            conf = JavaBenchmarkRunner.default_configuration(
+                java_home=java_home, java_options=java_options,
+                build_extras=build_extras, benchmark_extras=benchmark_extras,
+                **kwargs)
+
+            repetitions = repetitions if repetitions != -1 else 5
+            runner_base = JavaBenchmarkRunner.from_rev_or_path(
+                src, root, rev_or_path, conf,
+                repetitions=repetitions,
+                benchmark_filter=benchmark_filter)
+
+        json.dump(runner_base, output, cls=JsonEncoder)
+
+
+@benchmark.command(name="diff", short_help="Compare benchmark suites")
+@benchmark_common_options
+@benchmark_filter_options
+@click.option("--threshold", type=float, default=DEFAULT_THRESHOLD,
+              show_default=True,
+              help="Regression failure threshold in percentage.")
+@click.option("--repetitions", type=int, default=1, show_default=True,
+              help=("Number of repetitions of each benchmark. Increasing "
+                    "may improve result precision. "
+                    "[default: 1 for cpp, 5 for java"))
+@click.option("--no-counters", type=BOOL, default=False, is_flag=True,
+              help="Hide counters field in diff report.")
+@click.argument("contender", metavar="[<contender>",
+                default=ArrowSources.WORKSPACE, required=False)
+@click.argument("baseline", metavar="[<baseline>]]", default="origin/master",
+                required=False)
+@click.pass_context
+def benchmark_diff(ctx, src, preserve, output, language, cmake_extras,
+                   suite_filter, benchmark_filter, repetitions, no_counters,
+                   java_home, java_options, build_extras, benchmark_extras,
+                   threshold, contender, baseline, **kwargs):
+    """Compare (diff) benchmark runs.
+
+    This command acts like git-diff but for benchmark results.
+
+    The caller can optionally specify both the contender and the baseline. If
+    unspecified, the contender will default to the current workspace (like git)
+    and the baseline will default to master.
+
+    Each target (contender or baseline) can either be a git revision
+    (commit, tag, special values like HEAD) or a cmake build directory. This
+    allow comparing git commits, and/or different compilers and/or compiler
+    flags.
+
+    When a commit is referenced, a local clone of the arrow sources (specified
+    via --src) is performed and the proper branch is created. This is done in
+    a temporary directory which can be left intact with the `--preserve` flag.
+
+    The special token "WORKSPACE" is reserved to specify the current git
+    workspace. This imply that no clone will be performed.
+
+    Examples:
+
+    \b
+    # Compare workspace (contender) with master (baseline)
+    \b
+    archery benchmark diff
+
+    \b
+    # Compare master (contender) with latest version (baseline)
+    \b
+    export LAST=$(git tag -l "apache-arrow-[0-9]*" | sort -rV | head -1)
+    \b
+    archery benchmark diff master "$LAST"
+
+    \b
+    # Compare g++7 (contender) with clang++-8 (baseline) builds
+    \b
+    archery build --with-benchmarks=true \\
+            --cxx-flags=-ftree-vectorize \\
+            --cc=gcc-7 --cxx=g++-7 gcc7-build
+    \b
+    archery build --with-benchmarks=true \\
+            --cxx-flags=-flax-vector-conversions \\
+            --cc=clang-8 --cxx=clang++-8 clang8-build
+    \b
+    archery benchmark diff gcc7-build clang8-build
+
+    \b
+    # Compare default targets but scoped to the suites matching
+    # `^arrow-compute-aggregate` and benchmarks matching `(Sum|Mean)Kernel`.
+    \b
+    archery benchmark diff --suite-filter="^arrow-compute-aggregate" \\
+            --benchmark-filter="(Sum|Mean)Kernel"
+
+    \b
+    # Capture result in file `result.json`
+    \b
+    archery benchmark diff --output=result.json
+    \b
+    # Equivalently with no stdout clutter.
+    archery --quiet benchmark diff > result.json
+
+    \b
+    # Comparing with a cached results from `archery benchmark run`
+    \b
+    archery benchmark run --output=run.json HEAD~1
+    \b
+    # This should not recompute the benchmark from run.json
+    archery --quiet benchmark diff WORKSPACE run.json > result.json
+    """
+    with tmpdir(preserve=preserve) as root:
+        logger.debug("Comparing {} (contender) with {} (baseline)"
+                     .format(contender, baseline))
+
+        if language == "cpp":
+            conf = CppBenchmarkRunner.default_configuration(
+                cmake_extras=cmake_extras, **kwargs)
+
+            repetitions = repetitions if repetitions != -1 else 1
+            runner_cont = CppBenchmarkRunner.from_rev_or_path(
+                src, root, contender, conf,
+                repetitions=repetitions,
+                suite_filter=suite_filter,
+                benchmark_filter=benchmark_filter)
+            runner_base = CppBenchmarkRunner.from_rev_or_path(
+                src, root, baseline, conf,
+                repetitions=repetitions,
+                suite_filter=suite_filter,
+                benchmark_filter=benchmark_filter)
+
+        elif language == "java":
+            for key in {'cpp_package_prefix', 'cxx_flags', 'cxx', 'cc'}:
+                del kwargs[key]
+            conf = JavaBenchmarkRunner.default_configuration(
+                java_home=java_home, java_options=java_options,
+                build_extras=build_extras, benchmark_extras=benchmark_extras,
+                **kwargs)
+
+            repetitions = repetitions if repetitions != -1 else 5
+            runner_cont = JavaBenchmarkRunner.from_rev_or_path(
+                src, root, contender, conf,
+                repetitions=repetitions,
+                benchmark_filter=benchmark_filter)
+            runner_base = JavaBenchmarkRunner.from_rev_or_path(
+                src, root, baseline, conf,
+                repetitions=repetitions,
+                benchmark_filter=benchmark_filter)
+
+        runner_comp = RunnerComparator(runner_cont, runner_base, threshold)
+
+        # TODO(kszucs): test that the output is properly formatted jsonlines
+        comparisons_json = _get_comparisons_as_json(runner_comp.comparisons)
+        ren_counters = language == "java"
+        formatted = _format_comparisons_with_pandas(comparisons_json,
+                                                    no_counters, ren_counters)
+        output.write(formatted)
+        output.write('\n')
+
+
+def _get_comparisons_as_json(comparisons):
+    buf = StringIO()
+    for comparator in comparisons:
+        json.dump(comparator, buf, cls=JsonEncoder)
+        buf.write("\n")
+
+    return buf.getvalue()
+
+
+def _format_comparisons_with_pandas(comparisons_json, no_counters,
+                                    ren_counters):
+    pd = _import_pandas()
+    df = pd.read_json(StringIO(comparisons_json), lines=True)
+    # parse change % so we can sort by it
+    df['change %'] = df.pop('change').str[:-1].map(float)
+    first_regression = len(df) - df['regression'].sum()
+
+    fields = ['benchmark', 'baseline', 'contender', 'change %']
+    if not no_counters:
+        fields += ['counters']
+
+    df = df[fields]
+    if ren_counters:
+        df = df.rename(columns={'counters': 'configurations'})
+    df = df.sort_values(by='change %', ascending=False)
+
+    def labelled(title, df):
+        if len(df) == 0:
+            return ''
+        title += ': ({})'.format(len(df))
+        df_str = df.to_string(index=False)
+        bar = '-' * df_str.index('\n')
+        return '\n'.join([bar, title, bar, df_str])
+
+    return '\n\n'.join([labelled('Non-regressions', df[:first_regression]),
+                        labelled('Regressions', df[first_regression:])])
+
+
+# ----------------------------------------------------------------------
+# Integration testing
+
+def _set_default(opt, default):
+    if opt is None:
+        return default
+    return opt
+
+
+@archery.command(short_help="Execute protocol and Flight integration tests")
+@click.option('--with-all', is_flag=True, default=False,
+              help=('Include all known languages by default '
+                    'in integration tests'))
+@click.option('--random-seed', type=int, default=12345,
+              help="Seed for PRNG when generating test data")
+@click.option('--with-cpp', type=bool, default=False,
+              help='Include C++ in integration tests')
+@click.option('--with-csharp', type=bool, default=False,
+              help='Include C# in integration tests')
+@click.option('--with-java', type=bool, default=False,
+              help='Include Java in integration tests')
+@click.option('--with-js', type=bool, default=False,
+              help='Include JavaScript in integration tests')
+@click.option('--with-go', type=bool, default=False,
+              help='Include Go in integration tests')
+@click.option('--with-rust', type=bool, default=False,
+              help='Include Rust in integration tests',
+              envvar="ARCHERY_INTEGRATION_WITH_RUST")
+@click.option('--write_generated_json', default=False,
+              help='Generate test JSON to indicated path')
+@click.option('--run-flight', is_flag=True, default=False,
+              help='Run Flight integration tests')
+@click.option('--debug', is_flag=True, default=False,
+              help='Run executables in debug mode as relevant')
+@click.option('--serial', is_flag=True, default=False,
+              help='Run tests serially, rather than in parallel')
+@click.option('--tempdir', default=None,
+              help=('Directory to use for writing '
+                    'integration test temporary files'))
+@click.option('stop_on_error', '-x', '--stop-on-error',
+              is_flag=True, default=False,
+              help='Stop on first error')
+@click.option('--gold-dirs', multiple=True,
+              help="gold integration test file paths")
+@click.option('-k', '--match',
+              help=("Substring for test names to include in run, "
+                    "e.g. -k primitive"))
+def integration(with_all=False, random_seed=12345, **args):
+    from .integration.runner import write_js_test_json, run_all_tests
+    import numpy as np
+
+    # FIXME(bkietz) Include help strings for individual testers.
+    # For example, CPPTester's ARROW_CPP_EXE_PATH environment variable.
+
+    # Make runs involving data generation deterministic
+    np.random.seed(random_seed)
+
+    gen_path = args['write_generated_json']
+
+    languages = ['cpp', 'csharp', 'java', 'js', 'go', 'rust']
+
+    enabled_languages = 0
+    for lang in languages:
+        param = 'with_{}'.format(lang)
+        if with_all:
+            args[param] = with_all
+
+        if args[param]:
+            enabled_languages += 1
+
+    if gen_path:
+        try:
+            os.makedirs(gen_path)
+        except OSError as e:
+            if e.errno != errno.EEXIST:
+                raise
+        write_js_test_json(gen_path)
+    else:
+        if enabled_languages == 0:
+            raise Exception("Must enable at least 1 language to test")
+        run_all_tests(**args)
+
+
+@archery.command()
+@click.option('--event-name', '-n', required=True)
+@click.option('--event-payload', '-p', type=click.File('r', encoding='utf8'),
+              default='-', required=True)
+@click.option('--arrow-token', envvar='ARROW_GITHUB_TOKEN',
+              help='OAuth token for responding comment in the arrow repo')
+def trigger_bot(event_name, event_payload, arrow_token):
+    from .bot import CommentBot, actions
+
+    event_payload = json.loads(event_payload.read())
+
+    bot = CommentBot(name='github-actions', handler=actions, token=arrow_token)
+    bot.handle(event_name, event_payload)
+
+
+@archery.group('release')
+@click.option("--src", metavar="<arrow_src>", default=None,
+              callback=validate_arrow_sources,
+              help="Specify Arrow source directory.")
+@click.option("--jira-cache", type=click.Path(), default=None,
+              help="File path to cache queried JIRA issues per version.")
+@click.pass_obj
+def release(obj, src, jira_cache):
+    """Release releated commands."""
+    from .release import Jira, CachedJira
+
+    jira = Jira()
+    if jira_cache is not None:
+        jira = CachedJira(jira_cache, jira=jira)
+
+    obj['jira'] = jira
+    obj['repo'] = src.path
+
+
+@release.command('curate')
+@click.argument('version')
+@click.pass_obj
+def release_curate(obj, version):
+    """Release curation."""
+    from .release import Release
+
+    release = Release.from_jira(version, jira=obj['jira'], repo=obj['repo'])
+    curation = release.curate()
+
+    click.echo(curation.render('console'))
+
+
+@release.group('changelog')
+def release_changelog():
+    """Release changelog."""
+    pass
+
+
+@release_changelog.command('add')
+@click.argument('version')
+@click.pass_obj
+def release_changelog_add(obj, version):
+    """Prepend the changelog with the current release"""
+    from .release import Release
+
+    jira, repo = obj['jira'], obj['repo']
+
+    # just handle the current version
+    release = Release.from_jira(version, jira=jira, repo=repo)
+    if release.is_released:
+        raise ValueError('This version has been already released!')
+
+    changelog = release.changelog()
+    changelog_path = pathlib.Path(repo) / 'CHANGELOG.md'
+
+    current_content = changelog_path.read_text()
+    new_content = changelog.render('markdown') + current_content
+
+    changelog_path.write_text(new_content)
+    click.echo("CHANGELOG.md is updated!")
+
+
+@release_changelog.command('generate')
+@click.argument('version')
+@click.argument('output', type=click.File('w', encoding='utf8'), default='-')
+@click.pass_obj
+def release_changelog_generate(obj, version, output):
+    """Generate the changelog of a specific release."""
+    from .release import Release
+
+    jira, repo = obj['jira'], obj['repo']
+
+    # just handle the current version
+    release = Release.from_jira(version, jira=jira, repo=repo)
+
+    changelog = release.changelog()
+    output.write(changelog.render('markdown'))
+
+
+@release_changelog.command('regenerate')
+@click.pass_obj
+def release_changelog_regenerate(obj):
+    """Regeneretate the whole CHANGELOG.md file"""
+    from .release import Release
+
+    jira, repo = obj['jira'], obj['repo']
+    changelogs = []
+
+    for version in jira.project_versions('ARROW'):
+        if not version.released:
+            continue
+        release = Release.from_jira(version, jira=jira, repo=repo)
+        click.echo('Querying changelog for version: {}'.format(version))
+        changelogs.append(release.changelog())
+
+    click.echo('Rendering new CHANGELOG.md file...')
+    changelog_path = pathlib.Path(repo) / 'CHANGELOG.md'
+    with changelog_path.open('w') as fp:
+        for cl in changelogs:
+            fp.write(cl.render('markdown'))
+
+
+@release.command('cherry-pick')
+@click.argument('version')
+@click.option('--dry-run/--execute', default=True,
+              help="Display the git commands instead of executing them.")
+@click.option('--recreate/--continue', default=True,
+              help="Recreate the maintenance branch or only apply unapplied "
+                   "patches.")
+@click.pass_obj
+def release_cherry_pick(obj, version, dry_run, recreate):
+    """
+    Cherry pick commits.
+    """
+    from .release import Release, MinorRelease, PatchRelease
+
+    release = Release.from_jira(version, jira=obj['jira'], repo=obj['repo'])
+    if not isinstance(release, (MinorRelease, PatchRelease)):
+        raise click.UsageError('Cherry-pick command only supported for minor '
+                               'and patch releases')
+
+    if not dry_run:
+        release.cherry_pick_commits(recreate_branch=recreate)
+        click.echo('Executed the following commands:\n')
+
+    click.echo(
+        'git checkout {} -b {}'.format(release.previous.tag, release.branch)
+    )
+    for commit in release.commits_to_pick():
+        click.echo('git cherry-pick {}'.format(commit.hexsha))
+
+
+@archery.group("linking")
+@click.pass_obj
+def linking(obj):
+    """
+    Quick and dirty utilities for checking library linkage.
+    """
+    pass
+
+
+@linking.command("check-dependencies")
+@click.argument("paths", nargs=-1)
+@click.option("--allow", "-a", "allowed", multiple=True,
+              help="Name of the allowed libraries")
+@click.option("--disallow", "-d", "disallowed", multiple=True,
+              help="Name of the disallowed libraries")
+@click.pass_obj
+def linking_check_dependencies(obj, allowed, disallowed, paths):
+    from .linking import check_dynamic_library_dependencies, DependencyError
+
+    allowed, disallowed = set(allowed), set(disallowed)
+    try:
+        for path in map(pathlib.Path, paths):
+            check_dynamic_library_dependencies(path, allowed=allowed,
+                                               disallowed=disallowed)
+    except DependencyError as e:
+        raise click.ClickException(str(e))
+
+
+add_optional_command("docker", module=".docker.cli", function="docker",
+                     parent=archery)
+add_optional_command("crossbow", module=".crossbow.cli", function="crossbow",
+                     parent=archery)
+
+
+if __name__ == "__main__":
+    archery(obj={})
diff --git a/src/arrow/dev/archery/archery/compat.py b/src/arrow/dev/archery/archery/compat.py
new file mode 100644
index 000000000..bb0b15428
--- /dev/null
+++ b/src/arrow/dev/archery/archery/compat.py
@@ -0,0 +1,59 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import pathlib
+import sys
+
+
+def _is_path_like(path):
+    # PEP519 filesystem path protocol is available from python 3.6, so pathlib
+    # doesn't implement __fspath__ for earlier versions
+    return (isinstance(path, str) or
+            hasattr(path, '__fspath__') or
+            isinstance(path, pathlib.Path))
+
+
+def _ensure_path(path):
+    if isinstance(path, pathlib.Path):
+        return path
+    else:
+        return pathlib.Path(_stringify_path(path))
+
+
+def _stringify_path(path):
+    """
+    Convert *path* to a string or unicode path if possible.
+    """
+    if isinstance(path, str):
+        return path
+
+    # checking whether path implements the filesystem protocol
+    try:
+        return path.__fspath__()  # new in python 3.6
+    except AttributeError:
+        # fallback pathlib ckeck for earlier python versions than 3.6
+        if isinstance(path, pathlib.Path):
+            return str(path)
+
+    raise TypeError("not a path-like object")
+
+
+def _import_pandas():
+    # ARROW-13425: avoid importing PyArrow from Pandas
+    sys.modules['pyarrow'] = None
+    import pandas as pd
+    return pd
diff --git a/src/arrow/dev/archery/archery/crossbow/__init__.py b/src/arrow/dev/archery/archery/crossbow/__init__.py
new file mode 100644
index 000000000..bc72e81f0
--- /dev/null
+++ b/src/arrow/dev/archery/archery/crossbow/__init__.py
@@ -0,0 +1,19 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from .core import Config, Repo, Queue, Target, Job  # noqa
+from .reports import CommentReport, ConsoleReport, EmailReport  # noqa
diff --git a/src/arrow/dev/archery/archery/crossbow/cli.py b/src/arrow/dev/archery/archery/crossbow/cli.py
new file mode 100644
index 000000000..1d0610343
--- /dev/null
+++ b/src/arrow/dev/archery/archery/crossbow/cli.py
@@ -0,0 +1,365 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from pathlib import Path
+
+import click
+
+from .core import Config, Repo, Queue, Target, Job, CrossbowError
+from .reports import EmailReport, ConsoleReport
+from ..utils.source import ArrowSources
+
+
+_default_arrow_path = ArrowSources.find().path
+_default_queue_path = _default_arrow_path.parent / "crossbow"
+_default_config_path = _default_arrow_path / "dev" / "tasks" / "tasks.yml"
+
+
+@click.group()
+@click.option('--github-token', '-t', default=None,
+              envvar="CROSSBOW_GITHUB_TOKEN",
+              help='OAuth token for GitHub authentication')
+@click.option('--arrow-path', '-a',
+              type=click.Path(), default=_default_arrow_path,
+              help='Arrow\'s repository path. Defaults to the repository of '
+                   'this script')
+@click.option('--queue-path', '-q',
+              type=click.Path(), default=_default_queue_path,
+              help='The repository path used for scheduling the tasks. '
+                   'Defaults to crossbow directory placed next to arrow')
+@click.option('--queue-remote', '-qr', default=None,
+              help='Force to use this remote URL for the Queue repository')
+@click.option('--output-file', metavar='<output>',
+              type=click.File('w', encoding='utf8'), default='-',
+              help='Capture output result into file.')
+@click.pass_context
+def crossbow(ctx, github_token, arrow_path, queue_path, queue_remote,
+             output_file):
+    """
+    Schedule packaging tasks or nightly builds on CI services.
+    """
+    ctx.ensure_object(dict)
+    ctx.obj['output'] = output_file
+    ctx.obj['arrow'] = Repo(arrow_path)
+    ctx.obj['queue'] = Queue(queue_path, remote_url=queue_remote,
+                             github_token=github_token, require_https=True)
+
+
+@crossbow.command()
+@click.option('--config-path', '-c',
+              type=click.Path(exists=True), default=_default_config_path,
+              help='Task configuration yml. Defaults to tasks.yml')
+@click.pass_obj
+def check_config(obj, config_path):
+    # load available tasks configuration and groups from yaml
+    config = Config.load_yaml(config_path)
+    config.validate()
+
+    output = obj['output']
+    config.show(output)
+
+
+@crossbow.command()
+@click.argument('tasks', nargs=-1, required=False)
+@click.option('--group', '-g', 'groups', multiple=True,
+              help='Submit task groups as defined in task.yml')
+@click.option('--param', '-p', 'params', multiple=True,
+              help='Additional task parameters for rendering the CI templates')
+@click.option('--job-prefix', default='build',
+              help='Arbitrary prefix for branch names, e.g. nightly')
+@click.option('--config-path', '-c',
+              type=click.Path(exists=True), default=_default_config_path,
+              help='Task configuration yml. Defaults to tasks.yml')
+@click.option('--arrow-version', '-v', default=None,
+              help='Set target version explicitly.')
+@click.option('--arrow-remote', '-r', default=None,
+              help='Set GitHub remote explicitly, which is going to be cloned '
+                   'on the CI services. Note, that no validation happens '
+                   'locally. Examples: https://github.com/apache/arrow or '
+                   'https://github.com/kszucs/arrow.')
+@click.option('--arrow-branch', '-b', default=None,
+              help='Give the branch name explicitly, e.g. master, ARROW-1949.')
+@click.option('--arrow-sha', '-t', default=None,
+              help='Set commit SHA or Tag name explicitly, e.g. f67a515, '
+                   'apache-arrow-0.11.1.')
+@click.option('--fetch/--no-fetch', default=True,
+              help='Fetch references (branches and tags) from the remote')
+@click.option('--dry-run/--commit', default=False,
+              help='Just display the rendered CI configurations without '
+                   'committing them')
+@click.option('--no-push/--push', default=False,
+              help='Don\'t push the changes')
+@click.pass_obj
+def submit(obj, tasks, groups, params, job_prefix, config_path, arrow_version,
+           arrow_remote, arrow_branch, arrow_sha, fetch, dry_run, no_push):
+    output = obj['output']
+    queue, arrow = obj['queue'], obj['arrow']
+
+    # load available tasks configuration and groups from yaml
+    config = Config.load_yaml(config_path)
+    try:
+        config.validate()
+    except CrossbowError as e:
+        raise click.ClickException(str(e))
+
+    # Override the detected repo url / remote, branch and sha - this aims to
+    # make release procedure a bit simpler.
+    # Note, that the target resivion's crossbow templates must be
+    # compatible with the locally checked out version of crossbow (which is
+    # in case of the release procedure), because the templates still
+    # contain some business logic (dependency installation, deployments)
+    # which will be reduced to a single command in the future.
+    target = Target.from_repo(arrow, remote=arrow_remote, branch=arrow_branch,
+                              head=arrow_sha, version=arrow_version)
+
+    # parse additional job parameters
+    params = dict([p.split("=") for p in params])
+
+    # instantiate the job object
+    try:
+        job = Job.from_config(config=config, target=target, tasks=tasks,
+                              groups=groups, params=params)
+    except CrossbowError as e:
+        raise click.ClickException(str(e))
+
+    job.show(output)
+    if dry_run:
+        return
+
+    if fetch:
+        queue.fetch()
+    queue.put(job, prefix=job_prefix)
+
+    if no_push:
+        click.echo('Branches and commits created but not pushed: `{}`'
+                   .format(job.branch))
+    else:
+        queue.push()
+        click.echo('Pushed job identifier is: `{}`'.format(job.branch))
+
+
+@crossbow.command()
+@click.argument('task', required=True)
+@click.option('--config-path', '-c',
+              type=click.Path(exists=True), default=_default_config_path,
+              help='Task configuration yml. Defaults to tasks.yml')
+@click.option('--arrow-version', '-v', default=None,
+              help='Set target version explicitly.')
+@click.option('--arrow-remote', '-r', default=None,
+              help='Set GitHub remote explicitly, which is going to be cloned '
+                   'on the CI services. Note, that no validation happens '
+                   'locally. Examples: https://github.com/apache/arrow or '
+                   'https://github.com/kszucs/arrow.')
+@click.option('--arrow-branch', '-b', default=None,
+              help='Give the branch name explicitly, e.g. master, ARROW-1949.')
+@click.option('--arrow-sha', '-t', default=None,
+              help='Set commit SHA or Tag name explicitly, e.g. f67a515, '
+                   'apache-arrow-0.11.1.')
+@click.option('--param', '-p', 'params', multiple=True,
+              help='Additional task parameters for rendering the CI templates')
+@click.pass_obj
+def render(obj, task, config_path, arrow_version, arrow_remote, arrow_branch,
+           arrow_sha, params):
+    """
+    Utility command to check the rendered CI templates.
+    """
+    from .core import _flatten
+
+    def highlight(code):
+        try:
+            from pygments import highlight
+            from pygments.lexers import YamlLexer
+            from pygments.formatters import TerminalFormatter
+            return highlight(code, YamlLexer(), TerminalFormatter())
+        except ImportError:
+            return code
+
+    arrow = obj['arrow']
+
+    target = Target.from_repo(arrow, remote=arrow_remote, branch=arrow_branch,
+                              head=arrow_sha, version=arrow_version)
+    config = Config.load_yaml(config_path)
+    params = dict([p.split("=") for p in params])
+    params["queue_remote_url"] = "https://github.com/org/crossbow"
+    job = Job.from_config(config=config, target=target, tasks=[task],
+                          params=params)
+
+    for task_name, rendered_files in job.render_tasks().items():
+        for path, content in _flatten(rendered_files).items():
+            click.echo('#' * 80)
+            click.echo('### {:^72} ###'.format("/".join(path)))
+            click.echo('#' * 80)
+            click.echo(highlight(content))
+
+
+@crossbow.command()
+@click.argument('job-name', required=True)
+@click.option('--fetch/--no-fetch', default=True,
+              help='Fetch references (branches and tags) from the remote')
+@click.option('--task-filter', '-f', 'task_filters', multiple=True,
+              help='Glob pattern for filtering relevant tasks')
+@click.pass_obj
+def status(obj, job_name, fetch, task_filters):
+    output = obj['output']
+    queue = obj['queue']
+    if fetch:
+        queue.fetch()
+    job = queue.get(job_name)
+
+    report = ConsoleReport(job, task_filters=task_filters)
+    report.show(output)
+
+
+@crossbow.command()
+@click.argument('prefix', required=True)
+@click.option('--fetch/--no-fetch', default=True,
+              help='Fetch references (branches and tags) from the remote')
+@click.pass_obj
+def latest_prefix(obj, prefix, fetch):
+    queue = obj['queue']
+    if fetch:
+        queue.fetch()
+    latest = queue.latest_for_prefix(prefix)
+    click.echo(latest.branch)
+
+
+@crossbow.command()
+@click.argument('job-name', required=True)
+@click.option('--sender-name', '-n',
+              help='Name to use for report e-mail.')
+@click.option('--sender-email', '-e',
+              help='E-mail to use for report e-mail.')
+@click.option('--recipient-email', '-r',
+              help='Where to send the e-mail report')
+@click.option('--smtp-user', '-u',
+              help='E-mail address to use for SMTP login')
+@click.option('--smtp-password', '-P',
+              help='SMTP password to use for report e-mail.')
+@click.option('--smtp-server', '-s', default='smtp.gmail.com',
+              help='SMTP server to use for report e-mail.')
+@click.option('--smtp-port', '-p', default=465,
+              help='SMTP port to use for report e-mail.')
+@click.option('--poll/--no-poll', default=False,
+              help='Wait for completion if there are tasks pending')
+@click.option('--poll-max-minutes', default=180,
+              help='Maximum amount of time waiting for job completion')
+@click.option('--poll-interval-minutes', default=10,
+              help='Number of minutes to wait to check job status again')
+@click.option('--send/--dry-run', default=False,
+              help='Just display the report, don\'t send it')
+@click.option('--fetch/--no-fetch', default=True,
+              help='Fetch references (branches and tags) from the remote')
+@click.pass_obj
+def report(obj, job_name, sender_name, sender_email, recipient_email,
+           smtp_user, smtp_password, smtp_server, smtp_port, poll,
+           poll_max_minutes, poll_interval_minutes, send, fetch):
+    """
+    Send an e-mail report showing success/failure of tasks in a Crossbow run
+    """
+    output = obj['output']
+    queue = obj['queue']
+    if fetch:
+        queue.fetch()
+
+    job = queue.get(job_name)
+    report = EmailReport(
+        job=job,
+        sender_name=sender_name,
+        sender_email=sender_email,
+        recipient_email=recipient_email
+    )
+
+    if poll:
+        job.wait_until_finished(
+            poll_max_minutes=poll_max_minutes,
+            poll_interval_minutes=poll_interval_minutes
+        )
+
+    if send:
+        report.send(
+            smtp_user=smtp_user,
+            smtp_password=smtp_password,
+            smtp_server=smtp_server,
+            smtp_port=smtp_port
+        )
+    else:
+        report.show(output)
+
+
+@crossbow.command()
+@click.argument('job-name', required=True)
+@click.option('-t', '--target-dir',
+              default=_default_arrow_path / 'packages',
+              type=click.Path(file_okay=False, dir_okay=True),
+              help='Directory to download the build artifacts')
+@click.option('--dry-run/--execute', default=False,
+              help='Just display process, don\'t download anything')
+@click.option('--fetch/--no-fetch', default=True,
+              help='Fetch references (branches and tags) from the remote')
+@click.option('--task-filter', '-f', 'task_filters', multiple=True,
+              help='Glob pattern for filtering relevant tasks')
+@click.option('--validate-patterns/--skip-pattern-validation', default=True,
+              help='Whether to validate artifact name patterns or not')
+@click.pass_obj
+def download_artifacts(obj, job_name, target_dir, dry_run, fetch,
+                       validate_patterns, task_filters):
+    """Download build artifacts from GitHub releases"""
+    output = obj['output']
+
+    # fetch the queue repository
+    queue = obj['queue']
+    if fetch:
+        queue.fetch()
+
+    # query the job's artifacts
+    job = queue.get(job_name)
+
+    # create directory to download the assets to
+    target_dir = Path(target_dir).absolute() / job_name
+    target_dir.mkdir(parents=True, exist_ok=True)
+
+    # download the assets while showing the job status
+    def asset_callback(task_name, task, asset):
+        if asset is not None:
+            path = target_dir / task_name / asset.name
+            path.parent.mkdir(exist_ok=True)
+            if not dry_run:
+                asset.download(path)
+
+    click.echo('Downloading {}\'s artifacts.'.format(job_name))
+    click.echo('Destination directory is {}'.format(target_dir))
+    click.echo()
+
+    report = ConsoleReport(job, task_filters=task_filters)
+    report.show(
+        output,
+        asset_callback=asset_callback,
+        validate_patterns=validate_patterns
+    )
+
+
+@crossbow.command()
+@click.argument('patterns', nargs=-1, required=True)
+@click.option('--sha', required=True, help='Target committish')
+@click.option('--tag', required=True, help='Target tag')
+@click.option('--method', default='curl', help='Use cURL to upload')
+@click.pass_obj
+def upload_artifacts(obj, tag, sha, patterns, method):
+    queue = obj['queue']
+    queue.github_overwrite_release_assets(
+        tag_name=tag, target_commitish=sha, method=method, patterns=patterns
+    )
diff --git a/src/arrow/dev/archery/archery/crossbow/core.py b/src/arrow/dev/archery/archery/crossbow/core.py
new file mode 100644
index 000000000..0f2309e47
--- /dev/null
+++ b/src/arrow/dev/archery/archery/crossbow/core.py
@@ -0,0 +1,1172 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+import re
+import fnmatch
+import glob
+import time
+import logging
+import mimetypes
+import subprocess
+import textwrap
+from io import StringIO
+from pathlib import Path
+from datetime import date
+
+import jinja2
+from ruamel.yaml import YAML
+
+try:
+    import github3
+    _have_github3 = True
+except ImportError:
+    github3 = object
+    _have_github3 = False
+
+try:
+    import pygit2
+except ImportError:
+    PygitRemoteCallbacks = object
+else:
+    PygitRemoteCallbacks = pygit2.RemoteCallbacks
+
+from ..utils.source import ArrowSources
+
+
+for pkg in ["requests", "urllib3", "github3"]:
+    logging.getLogger(pkg).setLevel(logging.WARNING)
+
+logger = logging.getLogger("crossbow")
+
+
+class CrossbowError(Exception):
+    pass
+
+
+def _flatten(mapping):
+    """Converts a hierarchical mapping to a flat dictionary"""
+    result = {}
+    for k, v in mapping.items():
+        if isinstance(v, dict):
+            for ik, iv in _flatten(v).items():
+                ik = ik if isinstance(ik, tuple) else (ik,)
+                result[(k,) + ik] = iv
+        elif isinstance(v, list):
+            for ik, iv in enumerate(_flatten(v)):
+                ik = ik if isinstance(ik, tuple) else (ik,)
+                result[(k,) + ik] = iv
+        else:
+            result[(k,)] = v
+    return result
+
+
+def _unflatten(mapping):
+    """Converts a flat tuple => object mapping to hierarchical one"""
+    result = {}
+    for path, value in mapping.items():
+        parents, leaf = path[:-1], path[-1]
+        # create the hierarchy until we reach the leaf value
+        temp = result
+        for parent in parents:
+            temp.setdefault(parent, {})
+            temp = temp[parent]
+        # set the leaf value
+        temp[leaf] = value
+
+    return result
+
+
+def _unflatten_tree(files):
+    """Converts a flat path => object mapping to a hierarchical directories
+
+    Input:
+        {
+            'path/to/file.a': a_content,
+            'path/to/file.b': b_content,
+            'path/file.c': c_content
+        }
+    Output:
+        {
+            'path': {
+                'to': {
+                    'file.a': a_content,
+                    'file.b': b_content
+                },
+                'file.c': c_content
+            }
+        }
+    """
+    files = {tuple(k.split('/')): v for k, v in files.items()}
+    return _unflatten(files)
+
+
+def _render_jinja_template(searchpath, template, params):
+    def format_all(items, pattern):
+        return [pattern.format(item) for item in items]
+
+    loader = jinja2.FileSystemLoader(searchpath)
+    env = jinja2.Environment(loader=loader, trim_blocks=True,
+                             lstrip_blocks=True,
+                             undefined=jinja2.StrictUndefined)
+    env.filters['format_all'] = format_all
+    template = env.get_template(template)
+    return template.render(**params)
+
+
+# configurations for setting up branch skipping
+# - appveyor has a feature to skip builds without an appveyor.yml
+# - travis reads from the master branch and applies the rules
+# - circle requires the configuration to be present on all branch, even ones
+#   that are configured to be skipped
+# - azure skips branches without azure-pipelines.yml by default
+# - github skips branches without .github/workflows/ by default
+
+_default_travis_yml = """
+branches:
+  only:
+    - master
+    - /.*-travis-.*/
+
+os: linux
+dist: trusty
+language: generic
+"""
+
+_default_circle_yml = """
+version: 2
+
+jobs:
+  build:
+    machine: true
+
+workflows:
+  version: 2
+  build:
+    jobs:
+      - build:
+          filters:
+            branches:
+              only:
+                - /.*-circle-.*/
+"""
+
+_default_tree = {
+    '.travis.yml': _default_travis_yml,
+    '.circleci/config.yml': _default_circle_yml
+}
+
+
+class GitRemoteCallbacks(PygitRemoteCallbacks):
+
+    def __init__(self, token):
+        self.token = token
+        self.attempts = 0
+        super().__init__()
+
+    def push_update_reference(self, refname, message):
+        pass
+
+    def update_tips(self, refname, old, new):
+        pass
+
+    def credentials(self, url, username_from_url, allowed_types):
+        # its a libgit2 bug, that it infinitely retries the authentication
+        self.attempts += 1
+
+        if self.attempts >= 5:
+            # pygit2 doesn't propagate the exception properly
+            msg = 'Wrong oauth personal access token'
+            print(msg)
+            raise CrossbowError(msg)
+
+        if (allowed_types &
+                pygit2.credentials.GIT_CREDENTIAL_USERPASS_PLAINTEXT):
+            return pygit2.UserPass(self.token, 'x-oauth-basic')
+        else:
+            return None
+
+
+def _git_ssh_to_https(url):
+    return url.replace('git@github.com:', 'https://github.com/')
+
+
+class Repo:
+    """
+    Base class for interaction with local git repositories
+
+    A high level wrapper used for both reading revision information from
+    arrow's repository and pushing continuous integration tasks to the queue
+    repository.
+
+    Parameters
+    ----------
+    require_https : boolean, default False
+        Raise exception for SSH origin URLs
+    """
+
+    def __init__(self, path, github_token=None, remote_url=None,
+                 require_https=False):
+        self.path = Path(path)
+        self.github_token = github_token
+        self.require_https = require_https
+        self._remote_url = remote_url
+        self._pygit_repo = None
+        self._github_repo = None  # set by as_github_repo()
+        self._updated_refs = []
+
+    def __str__(self):
+        tpl = textwrap.dedent('''
+            Repo: {remote}@{branch}
+            Commit: {head}
+        ''')
+        return tpl.format(
+            remote=self.remote_url,
+            branch=self.branch.branch_name,
+            head=self.head
+        )
+
+    @property
+    def repo(self):
+        if self._pygit_repo is None:
+            self._pygit_repo = pygit2.Repository(str(self.path))
+        return self._pygit_repo
+
+    @property
+    def origin(self):
+        remote = self.repo.remotes['origin']
+        if self.require_https and remote.url.startswith('git@github.com'):
+            raise CrossbowError("Change SSH origin URL to HTTPS to use "
+                                "Crossbow: {}".format(remote.url))
+        return remote
+
+    def fetch(self):
+        refspec = '+refs/heads/*:refs/remotes/origin/*'
+        self.origin.fetch([refspec])
+
+    def push(self, refs=None, github_token=None):
+        github_token = github_token or self.github_token
+        if github_token is None:
+            raise RuntimeError(
+                'Could not determine GitHub token. Please set the '
+                'CROSSBOW_GITHUB_TOKEN environment variable to a '
+                'valid GitHub access token or pass one to --github-token.'
+            )
+        callbacks = GitRemoteCallbacks(github_token)
+        refs = refs or []
+        try:
+            self.origin.push(refs + self._updated_refs, callbacks=callbacks)
+        except pygit2.GitError:
+            raise RuntimeError('Failed to push updated references, '
+                               'potentially because of credential issues: {}'
+                               .format(self._updated_refs))
+        else:
+            self.updated_refs = []
+
+    @property
+    def head(self):
+        """Currently checked out commit's sha"""
+        return self.repo.head
+
+    @property
+    def branch(self):
+        """Currently checked out branch"""
+        try:
+            return self.repo.branches[self.repo.head.shorthand]
+        except KeyError:
+            return None  # detached
+
+    @property
+    def remote(self):
+        """Currently checked out branch's remote counterpart"""
+        try:
+            return self.repo.remotes[self.branch.upstream.remote_name]
+        except (AttributeError, KeyError):
+            return None  # cannot detect
+
+    @property
+    def remote_url(self):
+        """Currently checked out branch's remote counterpart URL
+
+        If an SSH github url is set, it will be replaced by the https
+        equivalent usable with GitHub OAuth token.
+        """
+        try:
+            return self._remote_url or _git_ssh_to_https(self.remote.url)
+        except AttributeError:
+            return None
+
+    @property
+    def user_name(self):
+        try:
+            return next(self.repo.config.get_multivar('user.name'))
+        except StopIteration:
+            return os.environ.get('GIT_COMMITTER_NAME', 'unknown')
+
+    @property
+    def user_email(self):
+        try:
+            return next(self.repo.config.get_multivar('user.email'))
+        except StopIteration:
+            return os.environ.get('GIT_COMMITTER_EMAIL', 'unknown')
+
+    @property
+    def signature(self):
+        return pygit2.Signature(self.user_name, self.user_email,
+                                int(time.time()))
+
+    def create_tree(self, files):
+        builder = self.repo.TreeBuilder()
+
+        for filename, content in files.items():
+            if isinstance(content, dict):
+                # create a subtree
+                tree_id = self.create_tree(content)
+                builder.insert(filename, tree_id, pygit2.GIT_FILEMODE_TREE)
+            else:
+                # create a file
+                blob_id = self.repo.create_blob(content)
+                builder.insert(filename, blob_id, pygit2.GIT_FILEMODE_BLOB)
+
+        tree_id = builder.write()
+        return tree_id
+
+    def create_commit(self, files, parents=None, message='',
+                      reference_name=None):
+        if parents is None:
+            # by default use the main branch as the base of the new branch
+            # required to reuse github actions cache across crossbow tasks
+            commit, _ = self.repo.resolve_refish("master")
+            parents = [commit.id]
+        tree_id = self.create_tree(files)
+
+        author = committer = self.signature
+        commit_id = self.repo.create_commit(reference_name, author, committer,
+                                            message, tree_id, parents)
+        return self.repo[commit_id]
+
+    def create_branch(self, branch_name, files, parents=None, message='',
+                      signature=None):
+        # create commit with the passed tree
+        commit = self.create_commit(files, parents=parents, message=message)
+
+        # create branch pointing to the previously created commit
+        branch = self.repo.create_branch(branch_name, commit)
+
+        # append to the pushable references
+        self._updated_refs.append('refs/heads/{}'.format(branch_name))
+
+        return branch
+
+    def create_tag(self, tag_name, commit_id, message=''):
+        tag_id = self.repo.create_tag(tag_name, commit_id,
+                                      pygit2.GIT_OBJ_COMMIT, self.signature,
+                                      message)
+
+        # append to the pushable references
+        self._updated_refs.append('refs/tags/{}'.format(tag_name))
+
+        return self.repo[tag_id]
+
+    def file_contents(self, commit_id, file):
+        commit = self.repo[commit_id]
+        entry = commit.tree[file]
+        blob = self.repo[entry.id]
+        return blob.data
+
+    def _parse_github_user_repo(self):
+        m = re.match(r'.*\/([^\/]+)\/([^\/\.]+)(\.git)?$', self.remote_url)
+        if m is None:
+            raise CrossbowError(
+                "Unable to parse the github owner and repository from the "
+                "repository's remote url '{}'".format(self.remote_url)
+            )
+        user, repo = m.group(1), m.group(2)
+        return user, repo
+
+    def as_github_repo(self, github_token=None):
+        """Converts it to a repository object which wraps the GitHub API"""
+        if self._github_repo is None:
+            if not _have_github3:
+                raise ImportError('Must install github3.py')
+            github_token = github_token or self.github_token
+            username, reponame = self._parse_github_user_repo()
+            session = github3.session.GitHubSession(
+                default_connect_timeout=10,
+                default_read_timeout=30
+            )
+            github = github3.GitHub(session=session)
+            github.login(token=github_token)
+            self._github_repo = github.repository(username, reponame)
+        return self._github_repo
+
+    def github_commit(self, sha):
+        repo = self.as_github_repo()
+        return repo.commit(sha)
+
+    def github_release(self, tag):
+        repo = self.as_github_repo()
+        try:
+            return repo.release_from_tag(tag)
+        except github3.exceptions.NotFoundError:
+            return None
+
+    def github_upload_asset_requests(self, release, path, name, mime,
+                                     max_retries=None, retry_backoff=None):
+        if max_retries is None:
+            max_retries = int(os.environ.get('CROSSBOW_MAX_RETRIES', 8))
+        if retry_backoff is None:
+            retry_backoff = int(os.environ.get('CROSSBOW_RETRY_BACKOFF', 5))
+
+        for i in range(max_retries):
+            try:
+                with open(path, 'rb') as fp:
+                    result = release.upload_asset(name=name, asset=fp,
+                                                  content_type=mime)
+            except github3.exceptions.ResponseError as e:
+                logger.error('Attempt {} has failed with message: {}.'
+                             .format(i + 1, str(e)))
+                logger.error('Error message {}'.format(e.msg))
+                logger.error('List of errors provided by Github:')
+                for err in e.errors:
+                    logger.error(' - {}'.format(err))
+
+                if e.code == 422:
+                    # 422 Validation Failed, probably raised because
+                    # ReleaseAsset already exists, so try to remove it before
+                    # reattempting the asset upload
+                    for asset in release.assets():
+                        if asset.name == name:
+                            logger.info('Release asset {} already exists, '
+                                        'removing it...'.format(name))
+                            asset.delete()
+                            logger.info('Asset {} removed.'.format(name))
+                            break
+            except github3.exceptions.ConnectionError as e:
+                logger.error('Attempt {} has failed with message: {}.'
+                             .format(i + 1, str(e)))
+            else:
+                logger.info('Attempt {} has finished.'.format(i + 1))
+                return result
+
+            time.sleep(retry_backoff)
+
+        raise RuntimeError('Github asset uploading has failed!')
+
+    def github_upload_asset_curl(self, release, path, name, mime):
+        upload_url, _ = release.upload_url.split('{?')
+        upload_url += '?name={}'.format(name)
+
+        command = [
+            'curl',
+            '--fail',
+            '-H', "Authorization: token {}".format(self.github_token),
+            '-H', "Content-Type: {}".format(mime),
+            '--data-binary', '@{}'.format(path),
+            upload_url
+        ]
+        return subprocess.run(command, shell=False, check=True)
+
+    def github_overwrite_release_assets(self, tag_name, target_commitish,
+                                        patterns, method='requests'):
+        # Since github has changed something the asset uploading via requests
+        # got instable, so prefer the cURL alternative.
+        # Potential cause:
+        #    sigmavirus24/github3.py/issues/779#issuecomment-379470626
+        repo = self.as_github_repo()
+        if not tag_name:
+            raise CrossbowError('Empty tag name')
+        if not target_commitish:
+            raise CrossbowError('Empty target commit for the release tag')
+
+        # remove the whole release if it already exists
+        try:
+            release = repo.release_from_tag(tag_name)
+        except github3.exceptions.NotFoundError:
+            pass
+        else:
+            release.delete()
+
+        release = repo.create_release(tag_name, target_commitish)
+        for pattern in patterns:
+            for path in glob.glob(pattern, recursive=True):
+                name = os.path.basename(path)
+                size = os.path.getsize(path)
+                mime = mimetypes.guess_type(name)[0] or 'application/zip'
+
+                logger.info(
+                    'Uploading asset `{}` with mimetype {} and size {}...'
+                    .format(name, mime, size)
+                )
+
+                if method == 'requests':
+                    self.github_upload_asset_requests(release, path, name=name,
+                                                      mime=mime)
+                elif method == 'curl':
+                    self.github_upload_asset_curl(release, path, name=name,
+                                                  mime=mime)
+                else:
+                    raise CrossbowError(
+                        'Unsupported upload method {}'.format(method)
+                    )
+
+
+class Queue(Repo):
+
+    def _latest_prefix_id(self, prefix):
+        pattern = re.compile(r'[\w\/-]*{}-(\d+)'.format(prefix))
+        matches = list(filter(None, map(pattern.match, self.repo.branches)))
+        if matches:
+            latest = max(int(m.group(1)) for m in matches)
+        else:
+            latest = -1
+        return latest
+
+    def _next_job_id(self, prefix):
+        """Auto increments the branch's identifier based on the prefix"""
+        latest_id = self._latest_prefix_id(prefix)
+        return '{}-{}'.format(prefix, latest_id + 1)
+
+    def latest_for_prefix(self, prefix):
+        latest_id = self._latest_prefix_id(prefix)
+        if latest_id < 0:
+            raise RuntimeError(
+                'No job has been submitted with prefix {} yet'.format(prefix)
+            )
+        job_name = '{}-{}'.format(prefix, latest_id)
+        return self.get(job_name)
+
+    def date_of(self, job):
+        # it'd be better to bound to the queue repository on deserialization
+        # and reorganize these methods to Job
+        branch_name = 'origin/{}'.format(job.branch)
+        branch = self.repo.branches[branch_name]
+        commit = self.repo[branch.target]
+        return date.fromtimestamp(commit.commit_time)
+
+    def jobs(self, pattern):
+        """Return jobs sorted by its identifier in reverse order"""
+        job_names = []
+        for name in self.repo.branches.remote:
+            origin, name = name.split('/', 1)
+            result = re.match(pattern, name)
+            if result:
+                job_names.append(name)
+
+        for name in sorted(job_names, reverse=True):
+            yield self.get(name)
+
+    def get(self, job_name):
+        branch_name = 'origin/{}'.format(job_name)
+        branch = self.repo.branches[branch_name]
+        try:
+            content = self.file_contents(branch.target, 'job.yml')
+        except KeyError:
+            raise CrossbowError(
+                'No job is found with name: {}'.format(job_name)
+            )
+
+        buffer = StringIO(content.decode('utf-8'))
+        job = yaml.load(buffer)
+        job.queue = self
+        return job
+
+    def put(self, job, prefix='build'):
+        if not isinstance(job, Job):
+            raise CrossbowError('`job` must be an instance of Job')
+        if job.branch is not None:
+            raise CrossbowError('`job.branch` is automatically generated, '
+                                'thus it must be blank')
+
+        if job.target.remote is None:
+            raise CrossbowError(
+                'Cannot determine git remote for the Arrow repository to '
+                'clone or push to, try to push the `{}` branch first to have '
+                'a remote tracking counterpart.'.format(job.target.branch)
+            )
+        if job.target.branch is None:
+            raise CrossbowError(
+                'Cannot determine the current branch of the Arrow repository '
+                'to clone or push to, perhaps it is in detached HEAD state. '
+                'Please checkout a branch.'
+            )
+
+        # auto increment and set next job id, e.g. build-85
+        job._queue = self
+        job.branch = self._next_job_id(prefix)
+
+        # create tasks' branches
+        for task_name, task in job.tasks.items():
+            # adding CI's name to the end of the branch in order to use skip
+            # patterns on travis and circleci
+            task.branch = '{}-{}-{}'.format(job.branch, task.ci, task_name)
+            params = {
+                **job.params,
+                "arrow": job.target,
+                "queue_remote_url": self.remote_url
+            }
+            files = task.render_files(job.template_searchpath, params=params)
+            branch = self.create_branch(task.branch, files=files)
+            self.create_tag(task.tag, branch.target)
+            task.commit = str(branch.target)
+
+        # create job's branch with its description
+        return self.create_branch(job.branch, files=job.render_files())
+
+
+def get_version(root, **kwargs):
+    """
+    Parse function for setuptools_scm that ignores tags for non-C++
+    subprojects, e.g. apache-arrow-js-XXX tags.
+    """
+    from setuptools_scm.git import parse as parse_git_version
+
+    # query the calculated version based on the git tags
+    kwargs['describe_command'] = (
+        'git describe --dirty --tags --long --match "apache-arrow-[0-9].*"'
+    )
+    version = parse_git_version(root, **kwargs)
+    tag = str(version.tag)
+
+    # We may get a development tag for the next version, such as "5.0.0.dev0",
+    # or the tag of an already released version, such as "4.0.0".
+    # In the latter case, we need to increment the version so that the computed
+    # version comes after any patch release (the next feature version after
+    # 4.0.0 is 5.0.0).
+    pattern = r"^(\d+)\.(\d+)\.(\d+)"
+    match = re.match(pattern, tag)
+    major, minor, patch = map(int, match.groups())
+    if 'dev' not in tag:
+        major += 1
+
+    return "{}.{}.{}.dev{}".format(major, minor, patch, version.distance)
+
+
+class Serializable:
+
+    @classmethod
+    def to_yaml(cls, representer, data):
+        tag = '!{}'.format(cls.__name__)
+        dct = {k: v for k, v in data.__dict__.items() if not k.startswith('_')}
+        return representer.represent_mapping(tag, dct)
+
+
+class Target(Serializable):
+    """
+    Describes target repository and revision the builds run against
+
+    This serializable data container holding information about arrow's
+    git remote, branch, sha and version number as well as some metadata
+    (currently only an email address where the notification should be sent).
+    """
+
+    def __init__(self, head, branch, remote, version, email=None):
+        self.head = head
+        self.email = email
+        self.branch = branch
+        self.remote = remote
+        self.version = version
+        self.no_rc_version = re.sub(r'-rc\d+\Z', '', version)
+        # Semantic Versioning 1.0.0: https://semver.org/spec/v1.0.0.html
+        #
+        # > A pre-release version number MAY be denoted by appending an
+        # > arbitrary string immediately following the patch version and a
+        # > dash. The string MUST be comprised of only alphanumerics plus
+        # > dash [0-9A-Za-z-].
+        #
+        # Example:
+        #
+        #   '0.16.1.dev10' ->
+        #   '0.16.1-dev10'
+        self.no_rc_semver_version = \
+            re.sub(r'\.(dev\d+)\Z', r'-\1', self.no_rc_version)
+
+    @classmethod
+    def from_repo(cls, repo, head=None, branch=None, remote=None, version=None,
+                  email=None):
+        """Initialize from a repository
+
+        Optionally override detected remote, branch, head, and/or version.
+        """
+        assert isinstance(repo, Repo)
+
+        if head is None:
+            head = str(repo.head.target)
+        if branch is None:
+            branch = repo.branch.branch_name
+        if remote is None:
+            remote = repo.remote_url
+        if version is None:
+            version = get_version(repo.path)
+        if email is None:
+            email = repo.user_email
+
+        return cls(head=head, email=email, branch=branch, remote=remote,
+                   version=version)
+
+
+class Task(Serializable):
+    """
+    Describes a build task and metadata required to render CI templates
+
+    A task is represented as a single git commit and branch containing jinja2
+    rendered files (currently appveyor.yml or .travis.yml configurations).
+
+    A task can't be directly submitted to a queue, must belong to a job.
+    Each task's unique identifier is its branch name, which is generated after
+    submitting the job to a queue.
+    """
+
+    def __init__(self, ci, template, artifacts=None, params=None):
+        assert ci in {
+            'circle',
+            'travis',
+            'appveyor',
+            'azure',
+            'github',
+            'drone',
+        }
+        self.ci = ci
+        self.template = template
+        self.artifacts = artifacts or []
+        self.params = params or {}
+        self.branch = None  # filled after adding to a queue
+        self.commit = None  # filled after adding to a queue
+        self._queue = None  # set by the queue object after put or get
+        self._status = None  # status cache
+        self._assets = None  # assets cache
+
+    def render_files(self, searchpath, params=None):
+        params = {**self.params, **(params or {}), "task": self}
+        try:
+            rendered = _render_jinja_template(searchpath, self.template,
+                                              params=params)
+        except jinja2.TemplateError as e:
+            raise RuntimeError(
+                'Failed to render template `{}` with {}: {}'.format(
+                    self.template, e.__class__.__name__, str(e)
+                )
+            )
+
+        tree = {**_default_tree, self.filename: rendered}
+        return _unflatten_tree(tree)
+
+    @property
+    def tag(self):
+        return self.branch
+
+    @property
+    def filename(self):
+        config_files = {
+            'circle': '.circleci/config.yml',
+            'travis': '.travis.yml',
+            'appveyor': 'appveyor.yml',
+            'azure': 'azure-pipelines.yml',
+            'github': '.github/workflows/crossbow.yml',
+            'drone': '.drone.yml',
+        }
+        return config_files[self.ci]
+
+    def status(self, force_query=False):
+        _status = getattr(self, '_status', None)
+        if force_query or _status is None:
+            github_commit = self._queue.github_commit(self.commit)
+            self._status = TaskStatus(github_commit)
+        return self._status
+
+    def assets(self, force_query=False, validate_patterns=True):
+        _assets = getattr(self, '_assets', None)
+        if force_query or _assets is None:
+            github_release = self._queue.github_release(self.tag)
+            self._assets = TaskAssets(github_release,
+                                      artifact_patterns=self.artifacts,
+                                      validate_patterns=validate_patterns)
+        return self._assets
+
+
+class TaskStatus:
+    """
+    Combine the results from status and checks API to a single state.
+
+    Azure pipelines uses checks API which doesn't provide a combined
+    interface like status API does, so we need to manually combine
+    both the commit statuses and the commit checks coming from
+    different API endpoint
+
+    Status.state: error, failure, pending or success, default pending
+    CheckRun.status: queued, in_progress or completed, default: queued
+    CheckRun.conclusion: success, failure, neutral, cancelled, timed_out
+                            or action_required, only set if
+                            CheckRun.status == 'completed'
+
+    1. Convert CheckRun's status and conclusion to one of Status.state
+    2. Merge the states based on the following rules:
+        - failure if any of the contexts report as error or failure
+        - pending if there are no statuses or a context is pending
+        - success if the latest status for all contexts is success
+        error otherwise.
+
+    Parameters
+    ----------
+    commit : github3.Commit
+        Commit to query the combined status for.
+
+    Returns
+    -------
+    TaskStatus(
+        combined_state='error|failure|pending|success',
+        github_status='original github status object',
+        github_check_runs='github checks associated with the commit',
+        total_count='number of statuses and checks'
+    )
+    """
+
+    def __init__(self, commit):
+        status = commit.status()
+        check_runs = list(commit.check_runs())
+        states = [s.state for s in status.statuses]
+
+        for check in check_runs:
+            if check.status == 'completed':
+                if check.conclusion in {'success', 'failure'}:
+                    states.append(check.conclusion)
+                elif check.conclusion in {'cancelled', 'timed_out',
+                                          'action_required'}:
+                    states.append('error')
+                # omit `neutral` conclusion
+            else:
+                states.append('pending')
+
+        # it could be more effective, but the following is more descriptive
+        combined_state = 'error'
+        if len(states):
+            if any(state in {'error', 'failure'} for state in states):
+                combined_state = 'failure'
+            elif any(state == 'pending' for state in states):
+                combined_state = 'pending'
+            elif all(state == 'success' for state in states):
+                combined_state = 'success'
+
+        # show link to the actual build, some of the CI providers implement
+        # the statuses API others implement the checks API, so display both
+        build_links = [s.target_url for s in status.statuses]
+        build_links += [c.html_url for c in check_runs]
+
+        self.combined_state = combined_state
+        self.github_status = status
+        self.github_check_runs = check_runs
+        self.total_count = len(states)
+        self.build_links = build_links
+
+
+class TaskAssets(dict):
+
+    def __init__(self, github_release, artifact_patterns,
+                 validate_patterns=True):
+        # HACK(kszucs): don't expect uploaded assets of no atifacts were
+        # defiened for the tasks in order to spare a bit of github rate limit
+        if not artifact_patterns:
+            return
+
+        if github_release is None:
+            github_assets = {}  # no assets have been uploaded for the task
+        else:
+            github_assets = {a.name: a for a in github_release.assets()}
+
+        if not validate_patterns:
+            # shortcut to avoid pattern validation and just set all artifacts
+            return self.update(github_assets)
+
+        for pattern in artifact_patterns:
+            # artifact can be a regex pattern
+            compiled = re.compile(f"^{pattern}$")
+            matches = list(
+                filter(None, map(compiled.match, github_assets.keys()))
+            )
+            num_matches = len(matches)
+
+            # validate artifact pattern matches single asset
+            if num_matches == 0:
+                self[pattern] = None
+            elif num_matches == 1:
+                self[pattern] = github_assets[matches[0].group(0)]
+            else:
+                raise CrossbowError(
+                    'Only a single asset should match pattern `{}`, there are '
+                    'multiple ones: {}'.format(pattern, ', '.join(matches))
+                )
+
+    def missing_patterns(self):
+        return [pattern for pattern, asset in self.items() if asset is None]
+
+    def uploaded_assets(self):
+        return [asset for asset in self.values() if asset is not None]
+
+
+class Job(Serializable):
+    """Describes multiple tasks against a single target repository"""
+
+    def __init__(self, target, tasks, params=None, template_searchpath=None):
+        if not tasks:
+            raise ValueError('no tasks were provided for the job')
+        if not all(isinstance(task, Task) for task in tasks.values()):
+            raise ValueError('each `tasks` mus be an instance of Task')
+        if not isinstance(target, Target):
+            raise ValueError('`target` must be an instance of Target')
+        if not isinstance(target, Target):
+            raise ValueError('`target` must be an instance of Target')
+        if not isinstance(params, dict):
+            raise ValueError('`params` must be an instance of dict')
+
+        self.target = target
+        self.tasks = tasks
+        self.params = params or {}  # additional parameters for the tasks
+        self.branch = None  # filled after adding to a queue
+        self._queue = None  # set by the queue object after put or get
+        if template_searchpath is None:
+            self._template_searchpath = ArrowSources.find().path
+        else:
+            self._template_searchpath = template_searchpath
+
+    def render_files(self):
+        with StringIO() as buf:
+            yaml.dump(self, buf)
+            content = buf.getvalue()
+        tree = {**_default_tree, "job.yml": content}
+        return _unflatten_tree(tree)
+
+    def render_tasks(self, params=None):
+        result = {}
+        params = {
+            **self.params,
+            "arrow": self.target,
+            **(params or {})
+        }
+        for task_name, task in self.tasks.items():
+            files = task.render_files(self._template_searchpath, params)
+            result[task_name] = files
+        return result
+
+    @property
+    def template_searchpath(self):
+        return self._template_searchpath
+
+    @property
+    def queue(self):
+        assert isinstance(self._queue, Queue)
+        return self._queue
+
+    @queue.setter
+    def queue(self, queue):
+        assert isinstance(queue, Queue)
+        self._queue = queue
+        for task in self.tasks.values():
+            task._queue = queue
+
+    @property
+    def email(self):
+        return os.environ.get('CROSSBOW_EMAIL', self.target.email)
+
+    @property
+    def date(self):
+        return self.queue.date_of(self)
+
+    def show(self, stream=None):
+        return yaml.dump(self, stream=stream)
+
+    @classmethod
+    def from_config(cls, config, target, tasks=None, groups=None, params=None):
+        """
+        Intantiate a job from based on a config.
+
+        Parameters
+        ----------
+        config : dict
+            Deserialized content of tasks.yml
+        target : Target
+            Describes target repository and revision the builds run against.
+        tasks : Optional[List[str]], default None
+            List of glob patterns for matching task names.
+        groups : Optional[List[str]], default None
+            List of exact group names matching predefined task sets in the
+            config.
+        params : Optional[Dict[str, str]], default None
+            Additional rendering parameters for the task templates.
+
+        Returns
+        -------
+        Job
+
+        Raises
+        ------
+        Exception:
+            If invalid groups or tasks has been passed.
+        """
+        task_definitions = config.select(tasks, groups=groups)
+
+        # instantiate the tasks
+        tasks = {}
+        versions = {'version': target.version,
+                    'no_rc_version': target.no_rc_version,
+                    'no_rc_semver_version': target.no_rc_semver_version}
+        for task_name, task in task_definitions.items():
+            artifacts = task.pop('artifacts', None) or []  # because of yaml
+            artifacts = [fn.format(**versions) for fn in artifacts]
+            tasks[task_name] = Task(artifacts=artifacts, **task)
+
+        return cls(target=target, tasks=tasks, params=params,
+                   template_searchpath=config.template_searchpath)
+
+    def is_finished(self):
+        for task in self.tasks.values():
+            status = task.status(force_query=True)
+            if status.combined_state == 'pending':
+                return False
+        return True
+
+    def wait_until_finished(self, poll_max_minutes=120,
+                            poll_interval_minutes=10):
+        started_at = time.time()
+        while True:
+            if self.is_finished():
+                break
+
+            waited_for_minutes = (time.time() - started_at) / 60
+            if waited_for_minutes > poll_max_minutes:
+                msg = ('Exceeded the maximum amount of time waiting for job '
+                       'to finish, waited for {} minutes.')
+                raise RuntimeError(msg.format(waited_for_minutes))
+
+            logger.info('Waiting {} minutes and then checking again'
+                        .format(poll_interval_minutes))
+            time.sleep(poll_interval_minutes * 60)
+
+
+class Config(dict):
+
+    def __init__(self, tasks, template_searchpath):
+        super().__init__(tasks)
+        self.template_searchpath = template_searchpath
+
+    @classmethod
+    def load_yaml(cls, path):
+        path = Path(path)
+        searchpath = path.parent
+        rendered = _render_jinja_template(searchpath, template=path.name,
+                                          params={})
+        config = yaml.load(rendered)
+        return cls(config, template_searchpath=searchpath)
+
+    def show(self, stream=None):
+        return yaml.dump(dict(self), stream=stream)
+
+    def select(self, tasks=None, groups=None):
+        config_groups = dict(self['groups'])
+        config_tasks = dict(self['tasks'])
+        valid_groups = set(config_groups.keys())
+        valid_tasks = set(config_tasks.keys())
+        group_whitelist = list(groups or [])
+        task_whitelist = list(tasks or [])
+
+        # validate that the passed groups are defined in the config
+        requested_groups = set(group_whitelist)
+        invalid_groups = requested_groups - valid_groups
+        if invalid_groups:
+            msg = 'Invalid group(s) {!r}. Must be one of {!r}'.format(
+                invalid_groups, valid_groups
+            )
+            raise CrossbowError(msg)
+
+        # merge the tasks defined in the selected groups
+        task_patterns = [list(config_groups[name]) for name in group_whitelist]
+        task_patterns = set(sum(task_patterns, task_whitelist))
+
+        # treat the task names as glob patterns to select tasks more easily
+        requested_tasks = set()
+        for pattern in task_patterns:
+            matches = fnmatch.filter(valid_tasks, pattern)
+            if len(matches):
+                requested_tasks.update(matches)
+            else:
+                raise CrossbowError(
+                    "Unable to match any tasks for `{}`".format(pattern)
+                )
+
+        # validate that the passed and matched tasks are defined in the config
+        invalid_tasks = requested_tasks - valid_tasks
+        if invalid_tasks:
+            msg = 'Invalid task(s) {!r}. Must be one of {!r}'.format(
+                invalid_tasks, valid_tasks
+            )
+            raise CrossbowError(msg)
+
+        return {
+            task_name: config_tasks[task_name] for task_name in requested_tasks
+        }
+
+    def validate(self):
+        # validate that the task groups are properly referening the tasks
+        for group_name, group in self['groups'].items():
+            for pattern in group:
+                tasks = self.select(tasks=[pattern])
+                if not tasks:
+                    raise CrossbowError(
+                        "The pattern `{}` defined for task group `{}` is not "
+                        "matching any of the tasks defined in the "
+                        "configuration file.".format(pattern, group_name)
+                    )
+
+        # validate that the tasks are constructible
+        for task_name, task in self['tasks'].items():
+            try:
+                Task(**task)
+            except Exception as e:
+                raise CrossbowError(
+                    'Unable to construct a task object from the '
+                    'definition  of task `{}`. The original error message '
+                    'is: `{}`'.format(task_name, str(e))
+                )
+
+        # validate that the defined tasks are renderable, in order to to that
+        # define the required object with dummy data
+        target = Target(
+            head='e279a7e06e61c14868ca7d71dea795420aea6539',
+            branch='master',
+            remote='https://github.com/apache/arrow',
+            version='1.0.0dev123',
+            email='dummy@example.ltd'
+        )
+
+        for task_name, task in self['tasks'].items():
+            task = Task(**task)
+            files = task.render_files(
+                self.template_searchpath,
+                params=dict(
+                    arrow=target,
+                    queue_remote_url='https://github.com/org/crossbow'
+                )
+            )
+            if not files:
+                raise CrossbowError('No files have been rendered for task `{}`'
+                                    .format(task_name))
+
+
+# configure yaml serializer
+yaml = YAML()
+yaml.register_class(Job)
+yaml.register_class(Task)
+yaml.register_class(Target)
diff --git a/src/arrow/dev/archery/archery/crossbow/reports.py b/src/arrow/dev/archery/archery/crossbow/reports.py
new file mode 100644
index 000000000..f86a67a74
--- /dev/null
+++ b/src/arrow/dev/archery/archery/crossbow/reports.py
@@ -0,0 +1,315 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import click
+import collections
+import operator
+import fnmatch
+import functools
+from io import StringIO
+import textwrap
+
+
+# TODO(kszucs): use archery.report.JinjaReport instead
+class Report:
+
+    def __init__(self, job, task_filters=None):
+        self.job = job
+
+        tasks = sorted(job.tasks.items())
+        if task_filters:
+            filtered = set()
+            for pattern in task_filters:
+                filtered |= set(fnmatch.filter(job.tasks.keys(), pattern))
+
+            tasks = [(name, task) for name, task in tasks if name in filtered]
+
+        self._tasks = dict(tasks)
+
+    @property
+    def tasks(self):
+        return self._tasks
+
+    def show(self):
+        raise NotImplementedError()
+
+
+class ConsoleReport(Report):
+    """Report the status of a Job to the console using click"""
+
+    # output table's header template
+    HEADER = '[{state:>7}] {branch:<52} {content:>16}'
+    DETAILS = ' └ {url}'
+
+    # output table's row template for assets
+    ARTIFACT_NAME = '{artifact:>69} '
+    ARTIFACT_STATE = '[{state:>7}]'
+
+    # state color mapping to highlight console output
+    COLORS = {
+        # from CombinedStatus
+        'error': 'red',
+        'failure': 'red',
+        'pending': 'yellow',
+        'success': 'green',
+        # custom state messages
+        'ok': 'green',
+        'missing': 'red'
+    }
+
+    def lead(self, state, branch, n_uploaded, n_expected):
+        line = self.HEADER.format(
+            state=state.upper(),
+            branch=branch,
+            content='uploaded {} / {}'.format(n_uploaded, n_expected)
+        )
+        return click.style(line, fg=self.COLORS[state.lower()])
+
+    def header(self):
+        header = self.HEADER.format(
+            state='state',
+            branch='Task / Branch',
+            content='Artifacts'
+        )
+        delimiter = '-' * len(header)
+        return '{}\n{}'.format(header, delimiter)
+
+    def artifact(self, state, pattern, asset):
+        if asset is None:
+            artifact = pattern
+            state = 'pending' if state == 'pending' else 'missing'
+        else:
+            artifact = asset.name
+            state = 'ok'
+
+        name_ = self.ARTIFACT_NAME.format(artifact=artifact)
+        state_ = click.style(
+            self.ARTIFACT_STATE.format(state=state.upper()),
+            self.COLORS[state]
+        )
+        return name_ + state_
+
+    def show(self, outstream, asset_callback=None, validate_patterns=True):
+        echo = functools.partial(click.echo, file=outstream)
+
+        # write table's header
+        echo(self.header())
+
+        # write table's body
+        for task_name, task in self.tasks.items():
+            # write summary of the uploaded vs total assets
+            status = task.status()
+            assets = task.assets(validate_patterns=validate_patterns)
+
+            # mapping of artifact pattern to asset or None of not uploaded
+            n_expected = len(task.artifacts)
+            n_uploaded = len(assets.uploaded_assets())
+            echo(self.lead(status.combined_state, task_name, n_uploaded,
+                           n_expected))
+
+            # show link to the actual build, some of the CI providers implement
+            # the statuses API others implement the checks API, so display both
+            for link in status.build_links:
+                echo(self.DETAILS.format(url=link))
+
+            # write per asset status
+            for artifact_pattern, asset in assets.items():
+                if asset_callback is not None:
+                    asset_callback(task_name, task, asset)
+                echo(self.artifact(status.combined_state, artifact_pattern,
+                                   asset))
+
+
+class EmailReport(Report):
+
+    HEADER = textwrap.dedent("""
+        Arrow Build Report for Job {job_name}
+
+        All tasks: {all_tasks_url}
+    """)
+
+    TASK = textwrap.dedent("""
+          - {name}:
+            URL: {url}
+    """).strip()
+
+    EMAIL = textwrap.dedent("""
+        From: {sender_name} <{sender_email}>
+        To: {recipient_email}
+        Subject: {subject}
+
+        {body}
+    """).strip()
+
+    STATUS_HEADERS = {
+        # from CombinedStatus
+        'error': 'Errored Tasks:',
+        'failure': 'Failed Tasks:',
+        'pending': 'Pending Tasks:',
+        'success': 'Succeeded Tasks:',
+    }
+
+    def __init__(self, job, sender_name, sender_email, recipient_email):
+        self.sender_name = sender_name
+        self.sender_email = sender_email
+        self.recipient_email = recipient_email
+        super().__init__(job)
+
+    def url(self, query):
+        repo_url = self.job.queue.remote_url.strip('.git')
+        return '{}/branches/all?query={}'.format(repo_url, query)
+
+    def listing(self, tasks):
+        return '\n'.join(
+            sorted(
+                self.TASK.format(name=task_name, url=self.url(task.branch))
+                for task_name, task in tasks.items()
+            )
+        )
+
+    def header(self):
+        url = self.url(self.job.branch)
+        return self.HEADER.format(job_name=self.job.branch, all_tasks_url=url)
+
+    def subject(self):
+        return (
+            "[NIGHTLY] Arrow Build Report for Job {}".format(self.job.branch)
+        )
+
+    def body(self):
+        buffer = StringIO()
+        buffer.write(self.header())
+
+        tasks_by_state = collections.defaultdict(dict)
+        for task_name, task in self.job.tasks.items():
+            state = task.status().combined_state
+            tasks_by_state[state][task_name] = task
+
+        for state in ('failure', 'error', 'pending', 'success'):
+            if state in tasks_by_state:
+                tasks = tasks_by_state[state]
+                buffer.write('\n')
+                buffer.write(self.STATUS_HEADERS[state])
+                buffer.write('\n')
+                buffer.write(self.listing(tasks))
+                buffer.write('\n')
+
+        return buffer.getvalue()
+
+    def email(self):
+        return self.EMAIL.format(
+            sender_name=self.sender_name,
+            sender_email=self.sender_email,
+            recipient_email=self.recipient_email,
+            subject=self.subject(),
+            body=self.body()
+        )
+
+    def show(self, outstream):
+        outstream.write(self.email())
+
+    def send(self, smtp_user, smtp_password, smtp_server, smtp_port):
+        import smtplib
+
+        email = self.email()
+
+        server = smtplib.SMTP_SSL(smtp_server, smtp_port)
+        server.ehlo()
+        server.login(smtp_user, smtp_password)
+        server.sendmail(smtp_user, self.recipient_email, email)
+        server.close()
+
+
+class CommentReport(Report):
+
+    _markdown_badge = '[![{title}]({badge})]({url})'
+
+    badges = {
+        'github': _markdown_badge.format(
+            title='Github Actions',
+            url='https://github.com/{repo}/actions?query=branch:{branch}',
+            badge=(
+                'https://github.com/{repo}/workflows/Crossbow/'
+                'badge.svg?branch={branch}'
+            ),
+        ),
+        'azure': _markdown_badge.format(
+            title='Azure',
+            url=(
+                'https://dev.azure.com/{repo}/_build/latest'
+                '?definitionId=1&branchName={branch}'
+            ),
+            badge=(
+                'https://dev.azure.com/{repo}/_apis/build/status/'
+                '{repo_dotted}?branchName={branch}'
+            )
+        ),
+        'travis': _markdown_badge.format(
+            title='TravisCI',
+            url='https://travis-ci.com/{repo}/branches',
+            badge='https://img.shields.io/travis/{repo}/{branch}.svg'
+        ),
+        'circle': _markdown_badge.format(
+            title='CircleCI',
+            url='https://circleci.com/gh/{repo}/tree/{branch}',
+            badge=(
+                'https://img.shields.io/circleci/build/github'
+                '/{repo}/{branch}.svg'
+            )
+        ),
+        'appveyor': _markdown_badge.format(
+            title='Appveyor',
+            url='https://ci.appveyor.com/project/{repo}/history',
+            badge='https://img.shields.io/appveyor/ci/{repo}/{branch}.svg'
+        ),
+        'drone': _markdown_badge.format(
+            title='Drone',
+            url='https://cloud.drone.io/{repo}',
+            badge='https://img.shields.io/drone/build/{repo}/{branch}.svg'
+        ),
+    }
+
+    def __init__(self, job, crossbow_repo):
+        self.crossbow_repo = crossbow_repo
+        super().__init__(job)
+
+    def show(self):
+        url = 'https://github.com/{repo}/branches/all?query={branch}'
+        sha = self.job.target.head
+
+        msg = 'Revision: {}\n\n'.format(sha)
+        msg += 'Submitted crossbow builds: [{repo} @ {branch}]'
+        msg += '({})\n'.format(url)
+        msg += '\n|Task|Status|\n|----|------|'
+
+        tasks = sorted(self.job.tasks.items(), key=operator.itemgetter(0))
+        for key, task in tasks:
+            branch = task.branch
+
+            try:
+                template = self.badges[task.ci]
+                badge = template.format(
+                    repo=self.crossbow_repo,
+                    repo_dotted=self.crossbow_repo.replace('/', '.'),
+                    branch=branch
+                )
+            except KeyError:
+                badge = 'unsupported CI service `{}`'.format(task.ci)
+
+            msg += '\n|{}|{}|'.format(key, badge)
+
+        return msg.format(repo=self.crossbow_repo, branch=self.job.branch)
diff --git a/src/arrow/dev/archery/archery/crossbow/tests/fixtures/crossbow-job.yaml b/src/arrow/dev/archery/archery/crossbow/tests/fixtures/crossbow-job.yaml
new file mode 100644
index 000000000..c37c7b553
--- /dev/null
+++ b/src/arrow/dev/archery/archery/crossbow/tests/fixtures/crossbow-job.yaml
@@ -0,0 +1,51 @@
+!Job
+target: !Target
+  head: f766a1d615dd1b7ee706d05102e579195951a61c
+  email: unkown
+  branch: refs/pull/4435/merge
+  remote: https://github.com/apache/arrow
+  version: 0.13.0.dev306
+  no_rc_version: 0.13.0.dev306
+tasks:
+  docker-cpp-cmake32: !Task
+    ci: circle
+    platform: linux
+    template: docker-tests/circle.linux.yml
+    artifacts: []
+    params:
+      commands:
+      - docker-compose build cpp-cmake32
+      - docker-compose run cpp-cmake32
+    branch: ursabot-1-circle-docker-cpp-cmake32
+    commit: a56b077c8d1b891a7935048e5672bf6fc07599ec
+  wheel-osx-cp37m: !Task
+    ci: travis
+    platform: osx
+    template: python-wheels/travis.osx.yml
+    artifacts:
+    - pyarrow-0.13.0.dev306-cp37-cp37m-macosx_10_6_intel.whl
+    params:
+      python_version: 3.7
+    branch: ursabot-1-travis-wheel-osx-cp37m
+    commit: a56b077c8d1b891a7935048e5672bf6fc07599ec
+  wheel-osx-cp36m: !Task
+    ci: travis
+    platform: osx
+    template: python-wheels/travis.osx.yml
+    artifacts:
+    - pyarrow-0.13.0.dev306-cp36-cp36m-macosx_10_6_intel.whl
+    params:
+      python_version: 3.6
+    branch: ursabot-1-travis-wheel-osx-cp36m
+    commit: a56b077c8d1b891a7935048e5672bf6fc07599ec
+  wheel-win-cp36m: !Task
+    ci: appveyor
+    platform: win
+    template: python-wheels/appveyor.yml
+    artifacts:
+    - pyarrow-0.13.0.dev306-cp36-cp36m-win_amd64.whl
+    params:
+      python_version: 3.6
+    branch: ursabot-1-appveyor-wheel-win-cp36m
+    commit: a56b077c8d1b891a7935048e5672bf6fc07599ec
+branch: ursabot-1
diff --git a/src/arrow/dev/archery/archery/crossbow/tests/fixtures/crossbow-success-message.md b/src/arrow/dev/archery/archery/crossbow/tests/fixtures/crossbow-success-message.md
new file mode 100644
index 000000000..15825218c
--- /dev/null
+++ b/src/arrow/dev/archery/archery/crossbow/tests/fixtures/crossbow-success-message.md
@@ -0,0 +1,10 @@
+Revision: {revision}
+
+Submitted crossbow builds: [{repo} @ {branch}](https://github.com/{repo}/branches/all?query={branch})
+
+|Task|Status|
+|----|------|
+|docker-cpp-cmake32|[![CircleCI](https://img.shields.io/circleci/build/github/{repo}/{branch}-circle-docker-cpp-cmake32.svg)](https://circleci.com/gh/{repo}/tree/{branch}-circle-docker-cpp-cmake32)|
+|wheel-osx-cp36m|[![TravisCI](https://img.shields.io/travis/{repo}/{branch}-travis-wheel-osx-cp36m.svg)](https://travis-ci.com/{repo}/branches)|
+|wheel-osx-cp37m|[![TravisCI](https://img.shields.io/travis/{repo}/{branch}-travis-wheel-osx-cp37m.svg)](https://travis-ci.com/{repo}/branches)|
+|wheel-win-cp36m|[![Appveyor](https://img.shields.io/appveyor/ci/{repo}/{branch}-appveyor-wheel-win-cp36m.svg)](https://ci.appveyor.com/project/{repo}/history)|
diff --git a/src/arrow/dev/archery/archery/crossbow/tests/test_core.py b/src/arrow/dev/archery/archery/crossbow/tests/test_core.py
new file mode 100644
index 000000000..518474236
--- /dev/null
+++ b/src/arrow/dev/archery/archery/crossbow/tests/test_core.py
@@ -0,0 +1,25 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from archery.utils.source import ArrowSources
+from archery.crossbow import Config
+
+
+def test_config():
+    src = ArrowSources.find()
+    conf = Config.load_yaml(src.dev / "tasks" / "tasks.yml")
+    conf.validate()
diff --git a/src/arrow/dev/archery/archery/crossbow/tests/test_crossbow_cli.py b/src/arrow/dev/archery/archery/crossbow/tests/test_crossbow_cli.py
new file mode 100644
index 000000000..ee9ba1ee2
--- /dev/null
+++ b/src/arrow/dev/archery/archery/crossbow/tests/test_crossbow_cli.py
@@ -0,0 +1,43 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from click.testing import CliRunner
+import pytest
+
+from archery.crossbow.cli import crossbow
+from archery.utils.git import git
+
+
+@pytest.mark.integration
+def test_crossbow_submit(tmp_path):
+    runner = CliRunner()
+
+    def invoke(*args):
+        return runner.invoke(crossbow, ['--queue-path', str(tmp_path), *args])
+
+    # initialize an empty crossbow repository
+    git.run_cmd("init", str(tmp_path))
+    git.run_cmd("-C", str(tmp_path), "remote", "add", "origin",
+                "https://github.com/dummy/repo")
+    git.run_cmd("-C", str(tmp_path), "commit", "-m", "initial",
+                "--allow-empty")
+
+    result = invoke('check-config')
+    assert result.exit_code == 0
+
+    result = invoke('submit', '--no-fetch', '--no-push', '-g', 'wheel')
+    assert result.exit_code == 0
diff --git a/src/arrow/dev/archery/archery/crossbow/tests/test_reports.py b/src/arrow/dev/archery/archery/crossbow/tests/test_reports.py
new file mode 100644
index 000000000..0df292bb5
--- /dev/null
+++ b/src/arrow/dev/archery/archery/crossbow/tests/test_reports.py
@@ -0,0 +1,35 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import textwrap
+
+from archery.crossbow.core import yaml
+from archery.crossbow.reports import CommentReport
+
+
+def test_crossbow_comment_formatter(load_fixture):
+    msg = load_fixture('crossbow-success-message.md')
+    job = load_fixture('crossbow-job.yaml', decoder=yaml.load)
+
+    report = CommentReport(job, crossbow_repo='ursa-labs/crossbow')
+    expected = msg.format(
+        repo='ursa-labs/crossbow',
+        branch='ursabot-1',
+        revision='f766a1d615dd1b7ee706d05102e579195951a61c',
+        status='has been succeeded.'
+    )
+    assert report.show() == textwrap.dedent(expected).strip()
diff --git a/src/arrow/dev/archery/archery/docker.py b/src/arrow/dev/archery/archery/docker.py
new file mode 100644
index 000000000..17d4c713a
--- /dev/null
+++ b/src/arrow/dev/archery/archery/docker.py
@@ -0,0 +1,402 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+import re
+import subprocess
+from io import StringIO
+
+from dotenv import dotenv_values
+from ruamel.yaml import YAML
+
+from .utils.command import Command, default_bin
+from .compat import _ensure_path
+
+
+def flatten(node, parents=None):
+    parents = list(parents or [])
+    if isinstance(node, str):
+        yield (node, parents)
+    elif isinstance(node, list):
+        for value in node:
+            yield from flatten(value, parents=parents)
+    elif isinstance(node, dict):
+        for key, value in node.items():
+            yield (key, parents)
+            yield from flatten(value, parents=parents + [key])
+    else:
+        raise TypeError(node)
+
+
+def _sanitize_command(cmd):
+    if isinstance(cmd, list):
+        cmd = " ".join(cmd)
+    return re.sub(r"\s+", " ", cmd)
+
+
+class UndefinedImage(Exception):
+    pass
+
+
+class ComposeConfig:
+
+    def __init__(self, config_path, dotenv_path, compose_bin, params=None):
+        config_path = _ensure_path(config_path)
+        if dotenv_path:
+            dotenv_path = _ensure_path(dotenv_path)
+        else:
+            dotenv_path = config_path.parent / '.env'
+        self._read_env(dotenv_path, params)
+        self._read_config(config_path, compose_bin)
+
+    def _read_env(self, dotenv_path, params):
+        """
+        Read .env and merge it with explicitly passed parameters.
+        """
+        self.dotenv = dotenv_values(str(dotenv_path))
+        if params is None:
+            self.params = {}
+        else:
+            self.params = {k: v for k, v in params.items() if k in self.dotenv}
+
+        # forward the process' environment variables
+        self.env = os.environ.copy()
+        # set the defaults from the dotenv files
+        self.env.update(self.dotenv)
+        # override the defaults passed as parameters
+        self.env.update(self.params)
+
+        # translate docker's architecture notation to a more widely used one
+        arch = self.env.get('ARCH', 'amd64')
+        arch_aliases = {
+            'amd64': 'x86_64',
+            'arm64v8': 'aarch64',
+            's390x': 's390x'
+        }
+        arch_short_aliases = {
+            'amd64': 'x64',
+            'arm64v8': 'arm64',
+            's390x': 's390x'
+        }
+        self.env['ARCH_ALIAS'] = arch_aliases.get(arch, arch)
+        self.env['ARCH_SHORT_ALIAS'] = arch_short_aliases.get(arch, arch)
+
+    def _read_config(self, config_path, compose_bin):
+        """
+        Validate and read the docker-compose.yml
+        """
+        yaml = YAML()
+        with config_path.open() as fp:
+            config = yaml.load(fp)
+
+        services = config['services'].keys()
+        self.hierarchy = dict(flatten(config.get('x-hierarchy', {})))
+        self.with_gpus = config.get('x-with-gpus', [])
+        nodes = self.hierarchy.keys()
+        errors = []
+
+        for name in self.with_gpus:
+            if name not in services:
+                errors.append(
+                    'Service `{}` defined in `x-with-gpus` bot not in '
+                    '`services`'.format(name)
+                )
+        for name in nodes - services:
+            errors.append(
+                'Service `{}` is defined in `x-hierarchy` bot not in '
+                '`services`'.format(name)
+            )
+        for name in services - nodes:
+            errors.append(
+                'Service `{}` is defined in `services` but not in '
+                '`x-hierarchy`'.format(name)
+            )
+
+        # trigger docker-compose's own validation
+        compose = Command('docker-compose')
+        args = ['--file', str(config_path), 'config']
+        result = compose.run(*args, env=self.env, check=False,
+                             stderr=subprocess.PIPE, stdout=subprocess.PIPE)
+
+        if result.returncode != 0:
+            # strip the intro line of docker-compose errors
+            errors += result.stderr.decode().splitlines()
+
+        if errors:
+            msg = '\n'.join([' - {}'.format(msg) for msg in errors])
+            raise ValueError(
+                'Found errors with docker-compose:\n{}'.format(msg)
+            )
+
+        rendered_config = StringIO(result.stdout.decode())
+        self.path = config_path
+        self.config = yaml.load(rendered_config)
+
+    def get(self, service_name):
+        try:
+            service = self.config['services'][service_name]
+        except KeyError:
+            raise UndefinedImage(service_name)
+        service['name'] = service_name
+        service['need_gpu'] = service_name in self.with_gpus
+        service['ancestors'] = self.hierarchy[service_name]
+        return service
+
+    def __getitem__(self, service_name):
+        return self.get(service_name)
+
+
+class Docker(Command):
+
+    def __init__(self, docker_bin=None):
+        self.bin = default_bin(docker_bin, "docker")
+
+
+class DockerCompose(Command):
+
+    def __init__(self, config_path, dotenv_path=None, compose_bin=None,
+                 params=None):
+        compose_bin = default_bin(compose_bin, 'docker-compose')
+        self.config = ComposeConfig(config_path, dotenv_path, compose_bin,
+                                    params)
+        self.bin = compose_bin
+        self.pull_memory = set()
+
+    def clear_pull_memory(self):
+        self.pull_memory = set()
+
+    def _execute_compose(self, *args, **kwargs):
+        # execute as a docker compose command
+        try:
+            result = super().run('--file', str(self.config.path), *args,
+                                 env=self.config.env, **kwargs)
+            result.check_returncode()
+        except subprocess.CalledProcessError as e:
+            def formatdict(d, template):
+                return '\n'.join(
+                    template.format(k, v) for k, v in sorted(d.items())
+                )
+            msg = (
+                "`{cmd}` exited with a non-zero exit code {code}, see the "
+                "process log above.\n\nThe docker-compose command was "
+                "invoked with the following parameters:\n\nDefaults defined "
+                "in .env:\n{dotenv}\n\nArchery was called with:\n{params}"
+            )
+            raise RuntimeError(
+                msg.format(
+                    cmd=' '.join(e.cmd),
+                    code=e.returncode,
+                    dotenv=formatdict(self.config.dotenv, template='  {}: {}'),
+                    params=formatdict(
+                        self.config.params, template='  export {}={}'
+                    )
+                )
+            )
+
+    def _execute_docker(self, *args, **kwargs):
+        # execute as a plain docker cli command
+        try:
+            result = Docker().run(*args, **kwargs)
+            result.check_returncode()
+        except subprocess.CalledProcessError as e:
+            raise RuntimeError(
+                "{} exited with non-zero exit code {}".format(
+                    ' '.join(e.cmd), e.returncode
+                )
+            )
+
+    def pull(self, service_name, pull_leaf=True, using_docker=False):
+        def _pull(service):
+            args = ['pull']
+            if service['image'] in self.pull_memory:
+                return
+
+            if using_docker:
+                try:
+                    self._execute_docker(*args, service['image'])
+                except Exception as e:
+                    # better --ignore-pull-failures handling
+                    print(e)
+            else:
+                args.append('--ignore-pull-failures')
+                self._execute_compose(*args, service['name'])
+
+            self.pull_memory.add(service['image'])
+
+        service = self.config.get(service_name)
+        for ancestor in service['ancestors']:
+            _pull(self.config.get(ancestor))
+        if pull_leaf:
+            _pull(service)
+
+    def build(self, service_name, use_cache=True, use_leaf_cache=True,
+              using_docker=False, using_buildx=False):
+        def _build(service, use_cache):
+            if 'build' not in service:
+                # nothing to do
+                return
+
+            args = []
+            cache_from = list(service.get('build', {}).get('cache_from', []))
+            if use_cache:
+                for image in cache_from:
+                    if image not in self.pull_memory:
+                        try:
+                            self._execute_docker('pull', image)
+                        except Exception as e:
+                            print(e)
+                        finally:
+                            self.pull_memory.add(image)
+            else:
+                args.append('--no-cache')
+
+            # turn on inline build cache, this is a docker buildx feature
+            # used to bundle the image build cache to the pushed image manifest
+            # so the build cache can be reused across hosts, documented at
+            # https://github.com/docker/buildx#--cache-tonametypetypekeyvalue
+            if self.config.env.get('BUILDKIT_INLINE_CACHE') == '1':
+                args.extend(['--build-arg', 'BUILDKIT_INLINE_CACHE=1'])
+
+            if using_buildx:
+                for k, v in service['build'].get('args', {}).items():
+                    args.extend(['--build-arg', '{}={}'.format(k, v)])
+
+                if use_cache:
+                    cache_ref = '{}-cache'.format(service['image'])
+                    cache_from = 'type=registry,ref={}'.format(cache_ref)
+                    cache_to = (
+                        'type=registry,ref={},mode=max'.format(cache_ref)
+                    )
+                    args.extend([
+                        '--cache-from', cache_from,
+                        '--cache-to', cache_to,
+                    ])
+
+                args.extend([
+                    '--output', 'type=docker',
+                    '-f', service['build']['dockerfile'],
+                    '-t', service['image'],
+                    service['build'].get('context', '.')
+                ])
+                self._execute_docker("buildx", "build", *args)
+            elif using_docker:
+                # better for caching
+                for k, v in service['build'].get('args', {}).items():
+                    args.extend(['--build-arg', '{}={}'.format(k, v)])
+                for img in cache_from:
+                    args.append('--cache-from="{}"'.format(img))
+                args.extend([
+                    '-f', service['build']['dockerfile'],
+                    '-t', service['image'],
+                    service['build'].get('context', '.')
+                ])
+                self._execute_docker("build", *args)
+            else:
+                self._execute_compose("build", *args, service['name'])
+
+        service = self.config.get(service_name)
+        # build ancestor services
+        for ancestor in service['ancestors']:
+            _build(self.config.get(ancestor), use_cache=use_cache)
+        # build the leaf/target service
+        _build(service, use_cache=use_cache and use_leaf_cache)
+
+    def run(self, service_name, command=None, *, env=None, volumes=None,
+            user=None, using_docker=False):
+        service = self.config.get(service_name)
+
+        args = []
+        if user is not None:
+            args.extend(['-u', user])
+
+        if env is not None:
+            for k, v in env.items():
+                args.extend(['-e', '{}={}'.format(k, v)])
+
+        if volumes is not None:
+            for volume in volumes:
+                args.extend(['--volume', volume])
+
+        if using_docker or service['need_gpu']:
+            # use gpus, requires docker>=19.03
+            if service['need_gpu']:
+                args.extend(['--gpus', 'all'])
+
+            if service.get('shm_size'):
+                args.extend(['--shm-size', service['shm_size']])
+
+            # append env variables from the compose conf
+            for k, v in service.get('environment', {}).items():
+                args.extend(['-e', '{}={}'.format(k, v)])
+
+            # append volumes from the compose conf
+            for v in service.get('volumes', []):
+                if not isinstance(v, str):
+                    # if not the compact string volume definition
+                    v = "{}:{}".format(v['source'], v['target'])
+                args.extend(['-v', v])
+
+            # infer whether an interactive shell is desired or not
+            if command in ['cmd.exe', 'bash', 'sh', 'powershell']:
+                args.append('-it')
+
+            # get the actual docker image name instead of the compose service
+            # name which we refer as image in general
+            args.append(service['image'])
+
+            # add command from compose if it wasn't overridden
+            if command is not None:
+                args.append(command)
+            else:
+                # replace whitespaces from the preformatted compose command
+                cmd = _sanitize_command(service.get('command', ''))
+                if cmd:
+                    args.append(cmd)
+
+            # execute as a plain docker cli command
+            self._execute_docker('run', '--rm', *args)
+        else:
+            # execute as a docker-compose command
+            args.append(service_name)
+            if command is not None:
+                args.append(command)
+            self._execute_compose('run', '--rm', *args)
+
+    def push(self, service_name, user=None, password=None, using_docker=False):
+        def _push(service):
+            if using_docker:
+                return self._execute_docker('push', service['image'])
+            else:
+                return self._execute_compose('push', service['name'])
+
+        if user is not None:
+            try:
+                # TODO(kszucs): have an option for a prompt
+                self._execute_docker('login', '-u', user, '-p', password)
+            except subprocess.CalledProcessError:
+                # hide credentials
+                msg = ('Failed to push `{}`, check the passed credentials'
+                       .format(service_name))
+                raise RuntimeError(msg) from None
+
+        service = self.config.get(service_name)
+        for ancestor in service['ancestors']:
+            _push(self.config.get(ancestor))
+        _push(service)
+
+    def images(self):
+        return sorted(self.config.hierarchy.keys())
diff --git a/src/arrow/dev/archery/archery/docker/__init__.py b/src/arrow/dev/archery/archery/docker/__init__.py
new file mode 100644
index 000000000..6be29c916
--- /dev/null
+++ b/src/arrow/dev/archery/archery/docker/__init__.py
@@ -0,0 +1,18 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from .core import DockerCompose, UndefinedImage  # noqa
diff --git a/src/arrow/dev/archery/archery/docker/cli.py b/src/arrow/dev/archery/archery/docker/cli.py
new file mode 100644
index 000000000..c6b4a6473
--- /dev/null
+++ b/src/arrow/dev/archery/archery/docker/cli.py
@@ -0,0 +1,261 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+
+import click
+
+from ..utils.cli import validate_arrow_sources
+from .core import DockerCompose, UndefinedImage
+
+
+def _mock_compose_calls(compose):
+    from types import MethodType
+    from subprocess import CompletedProcess
+
+    def _mock(compose, executable):
+        def _execute(self, *args, **kwargs):
+            params = ['{}={}'.format(k, v)
+                      for k, v in self.config.params.items()]
+            command = ' '.join(params + [executable] + list(args))
+            click.echo(command)
+            return CompletedProcess([], 0)
+        return MethodType(_execute, compose)
+
+    compose._execute_docker = _mock(compose, executable='docker')
+    compose._execute_compose = _mock(compose, executable='docker-compose')
+
+
+@click.group()
+@click.option("--src", metavar="<arrow_src>", default=None,
+              callback=validate_arrow_sources,
+              help="Specify Arrow source directory.")
+@click.option('--dry-run/--execute', default=False,
+              help="Display the docker-compose commands instead of executing "
+                   "them.")
+@click.pass_context
+def docker(ctx, src, dry_run):
+    """
+    Interact with docker-compose based builds.
+    """
+    ctx.ensure_object(dict)
+
+    config_path = src.path / 'docker-compose.yml'
+    if not config_path.exists():
+        raise click.ClickException(
+            "Docker compose configuration cannot be found in directory {}, "
+            "try to pass the arrow source directory explicitly.".format(src)
+        )
+
+    # take the docker-compose parameters like PYTHON, PANDAS, UBUNTU from the
+    # environment variables to keep the usage similar to docker-compose
+    compose = DockerCompose(config_path, params=os.environ)
+    if dry_run:
+        _mock_compose_calls(compose)
+    ctx.obj['compose'] = compose
+
+
+@docker.command("check-config")
+@click.pass_obj
+def check_config(obj):
+    """
+    Validate docker-compose configuration.
+    """
+    # executes the body of the docker function above which does the validation
+    # during the configuration loading
+
+
+@docker.command('build')
+@click.argument('image')
+@click.option('--force-pull/--no-pull', default=True,
+              help="Whether to force pull the image and its ancestor images")
+@click.option('--using-docker-cli', default=False, is_flag=True,
+              envvar='ARCHERY_USE_DOCKER_CLI',
+              help="Use docker CLI directly for building instead of calling "
+                   "docker-compose. This may help to reuse cached layers.")
+@click.option('--using-docker-buildx', default=False, is_flag=True,
+              envvar='ARCHERY_USE_DOCKER_BUILDX',
+              help="Use buildx with docker CLI directly for building instead "
+                   "of calling docker-compose or the plain docker build "
+                   "command. This option makes the build cache reusable "
+                   "across hosts.")
+@click.option('--use-cache/--no-cache', default=True,
+              help="Whether to use cache when building the image and its "
+                   "ancestor images")
+@click.option('--use-leaf-cache/--no-leaf-cache', default=True,
+              help="Whether to use cache when building only the (leaf) image "
+                   "passed as the argument. To disable caching for both the "
+                   "image and its ancestors use --no-cache option.")
+@click.pass_obj
+def docker_build(obj, image, *, force_pull, using_docker_cli,
+                 using_docker_buildx, use_cache, use_leaf_cache):
+    """
+    Execute docker-compose builds.
+    """
+    compose = obj['compose']
+
+    using_docker_cli |= using_docker_buildx
+    try:
+        if force_pull:
+            compose.pull(image, pull_leaf=use_leaf_cache,
+                         using_docker=using_docker_cli)
+        compose.build(image, use_cache=use_cache,
+                      use_leaf_cache=use_leaf_cache,
+                      using_docker=using_docker_cli,
+                      using_buildx=using_docker_buildx,
+                      pull_parents=force_pull)
+    except UndefinedImage as e:
+        raise click.ClickException(
+            "There is no service/image defined in docker-compose.yml with "
+            "name: {}".format(str(e))
+        )
+    except RuntimeError as e:
+        raise click.ClickException(str(e))
+
+
+@docker.command('run')
+@click.argument('image')
+@click.argument('command', required=False, default=None)
+@click.option('--env', '-e', multiple=True,
+              help="Set environment variable within the container")
+@click.option('--user', '-u', default=None,
+              help="Username or UID to run the container with")
+@click.option('--force-pull/--no-pull', default=True,
+              help="Whether to force pull the image and its ancestor images")
+@click.option('--force-build/--no-build', default=True,
+              help="Whether to force build the image and its ancestor images")
+@click.option('--build-only', default=False, is_flag=True,
+              help="Pull and/or build the image, but do not run it")
+@click.option('--using-docker-cli', default=False, is_flag=True,
+              envvar='ARCHERY_USE_DOCKER_CLI',
+              help="Use docker CLI directly for building instead of calling "
+                   "docker-compose. This may help to reuse cached layers.")
+@click.option('--using-docker-buildx', default=False, is_flag=True,
+              envvar='ARCHERY_USE_DOCKER_BUILDX',
+              help="Use buildx with docker CLI directly for building instead "
+                   "of calling docker-compose or the plain docker build "
+                   "command. This option makes the build cache reusable "
+                   "across hosts.")
+@click.option('--use-cache/--no-cache', default=True,
+              help="Whether to use cache when building the image and its "
+                   "ancestor images")
+@click.option('--use-leaf-cache/--no-leaf-cache', default=True,
+              help="Whether to use cache when building only the (leaf) image "
+                   "passed as the argument. To disable caching for both the "
+                   "image and its ancestors use --no-cache option.")
+@click.option('--resource-limit', default=None,
+              help="A CPU/memory limit preset to mimic CI environments like "
+                   "GitHub Actions. Implies --using-docker-cli. Note that "
+                   "exporting ARCHERY_DOCKER_BIN=\"sudo docker\" is likely "
+                   "required, unless Docker is configured with cgroups v2 "
+                   "(else Docker will silently ignore the limits).")
+@click.option('--volume', '-v', multiple=True,
+              help="Set volume within the container")
+@click.pass_obj
+def docker_run(obj, image, command, *, env, user, force_pull, force_build,
+               build_only, using_docker_cli, using_docker_buildx, use_cache,
+               use_leaf_cache, resource_limit, volume):
+    """
+    Execute docker-compose builds.
+
+    To see the available builds run `archery docker images`.
+
+    Examples:
+
+    # execute a single build
+    archery docker run conda-python
+
+    # execute the builds but disable the image pulling
+    archery docker run --no-cache conda-python
+
+    # pass a docker-compose parameter, like the python version
+    PYTHON=3.8 archery docker run conda-python
+
+    # disable the cache only for the leaf image
+    PANDAS=master archery docker run --no-leaf-cache conda-python-pandas
+
+    # entirely skip building the image
+    archery docker run --no-pull --no-build conda-python
+
+    # pass runtime parameters via docker environment variables
+    archery docker run -e CMAKE_BUILD_TYPE=release ubuntu-cpp
+
+    # set a volume
+    archery docker run -v $PWD/build:/build ubuntu-cpp
+
+    # starting an interactive bash session for debugging
+    archery docker run ubuntu-cpp bash
+    """
+    compose = obj['compose']
+    using_docker_cli |= using_docker_buildx
+
+    env = dict(kv.split('=', 1) for kv in env)
+    try:
+        if force_pull:
+            compose.pull(image, pull_leaf=use_leaf_cache,
+                         using_docker=using_docker_cli)
+        if force_build:
+            compose.build(image, use_cache=use_cache,
+                          use_leaf_cache=use_leaf_cache,
+                          using_docker=using_docker_cli,
+                          using_buildx=using_docker_buildx)
+        if build_only:
+            return
+        compose.run(
+            image,
+            command=command,
+            env=env,
+            user=user,
+            using_docker=using_docker_cli,
+            resource_limit=resource_limit,
+            volumes=volume
+        )
+    except UndefinedImage as e:
+        raise click.ClickException(
+            "There is no service/image defined in docker-compose.yml with "
+            "name: {}".format(str(e))
+        )
+    except RuntimeError as e:
+        raise click.ClickException(str(e))
+
+
+@docker.command('push')
+@click.argument('image')
+@click.option('--user', '-u', required=False, envvar='ARCHERY_DOCKER_USER',
+              help='Docker repository username')
+@click.option('--password', '-p', required=False,
+              envvar='ARCHERY_DOCKER_PASSWORD',
+              help='Docker repository password')
+@click.option('--using-docker-cli', default=False, is_flag=True,
+              help="Use docker CLI directly for building instead of calling "
+                   "docker-compose. This may help to reuse cached layers.")
+@click.pass_obj
+def docker_compose_push(obj, image, user, password, using_docker_cli):
+    """Push the generated docker-compose image."""
+    compose = obj['compose']
+    compose.push(image, user=user, password=password,
+                 using_docker=using_docker_cli)
+
+
+@docker.command('images')
+@click.pass_obj
+def docker_compose_images(obj):
+    """List the available docker-compose images."""
+    compose = obj['compose']
+    click.echo('Available images:')
+    for image in compose.images():
+        click.echo(f' - {image}')
diff --git a/src/arrow/dev/archery/archery/docker/core.py b/src/arrow/dev/archery/archery/docker/core.py
new file mode 100644
index 000000000..aaf16bdfa
--- /dev/null
+++ b/src/arrow/dev/archery/archery/docker/core.py
@@ -0,0 +1,417 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+import re
+import subprocess
+from io import StringIO
+
+from dotenv import dotenv_values
+from ruamel.yaml import YAML
+
+from ..utils.command import Command, default_bin
+from ..compat import _ensure_path
+
+
+def flatten(node, parents=None):
+    parents = list(parents or [])
+    if isinstance(node, str):
+        yield (node, parents)
+    elif isinstance(node, list):
+        for value in node:
+            yield from flatten(value, parents=parents)
+    elif isinstance(node, dict):
+        for key, value in node.items():
+            yield (key, parents)
+            yield from flatten(value, parents=parents + [key])
+    else:
+        raise TypeError(node)
+
+
+def _sanitize_command(cmd):
+    if isinstance(cmd, list):
+        cmd = " ".join(cmd)
+    return re.sub(r"\s+", " ", cmd)
+
+
+class UndefinedImage(Exception):
+    pass
+
+
+class ComposeConfig:
+
+    def __init__(self, config_path, dotenv_path, compose_bin, params=None):
+        config_path = _ensure_path(config_path)
+        if dotenv_path:
+            dotenv_path = _ensure_path(dotenv_path)
+        else:
+            dotenv_path = config_path.parent / '.env'
+        self._read_env(dotenv_path, params)
+        self._read_config(config_path, compose_bin)
+
+    def _read_env(self, dotenv_path, params):
+        """
+        Read .env and merge it with explicitly passed parameters.
+        """
+        self.dotenv = dotenv_values(str(dotenv_path))
+        if params is None:
+            self.params = {}
+        else:
+            self.params = {k: v for k, v in params.items() if k in self.dotenv}
+
+        # forward the process' environment variables
+        self.env = os.environ.copy()
+        # set the defaults from the dotenv files
+        self.env.update(self.dotenv)
+        # override the defaults passed as parameters
+        self.env.update(self.params)
+
+        # translate docker's architecture notation to a more widely used one
+        arch = self.env.get('ARCH', 'amd64')
+        arch_aliases = {
+            'amd64': 'x86_64',
+            'arm64v8': 'aarch64',
+            's390x': 's390x'
+        }
+        arch_short_aliases = {
+            'amd64': 'x64',
+            'arm64v8': 'arm64',
+            's390x': 's390x'
+        }
+        self.env['ARCH_ALIAS'] = arch_aliases.get(arch, arch)
+        self.env['ARCH_SHORT_ALIAS'] = arch_short_aliases.get(arch, arch)
+
+    def _read_config(self, config_path, compose_bin):
+        """
+        Validate and read the docker-compose.yml
+        """
+        yaml = YAML()
+        with config_path.open() as fp:
+            config = yaml.load(fp)
+
+        services = config['services'].keys()
+        self.hierarchy = dict(flatten(config.get('x-hierarchy', {})))
+        self.limit_presets = config.get('x-limit-presets', {})
+        self.with_gpus = config.get('x-with-gpus', [])
+        nodes = self.hierarchy.keys()
+        errors = []
+
+        for name in self.with_gpus:
+            if name not in services:
+                errors.append(
+                    'Service `{}` defined in `x-with-gpus` bot not in '
+                    '`services`'.format(name)
+                )
+        for name in nodes - services:
+            errors.append(
+                'Service `{}` is defined in `x-hierarchy` bot not in '
+                '`services`'.format(name)
+            )
+        for name in services - nodes:
+            errors.append(
+                'Service `{}` is defined in `services` but not in '
+                '`x-hierarchy`'.format(name)
+            )
+
+        # trigger docker-compose's own validation
+        compose = Command('docker-compose')
+        args = ['--file', str(config_path), 'config']
+        result = compose.run(*args, env=self.env, check=False,
+                             stderr=subprocess.PIPE, stdout=subprocess.PIPE)
+
+        if result.returncode != 0:
+            # strip the intro line of docker-compose errors
+            errors += result.stderr.decode().splitlines()
+
+        if errors:
+            msg = '\n'.join([' - {}'.format(msg) for msg in errors])
+            raise ValueError(
+                'Found errors with docker-compose:\n{}'.format(msg)
+            )
+
+        rendered_config = StringIO(result.stdout.decode())
+        self.path = config_path
+        self.config = yaml.load(rendered_config)
+
+    def get(self, service_name):
+        try:
+            service = self.config['services'][service_name]
+        except KeyError:
+            raise UndefinedImage(service_name)
+        service['name'] = service_name
+        service['need_gpu'] = service_name in self.with_gpus
+        service['ancestors'] = self.hierarchy[service_name]
+        return service
+
+    def __getitem__(self, service_name):
+        return self.get(service_name)
+
+
+class Docker(Command):
+
+    def __init__(self, docker_bin=None):
+        self.bin = default_bin(docker_bin, "docker")
+
+
+class DockerCompose(Command):
+
+    def __init__(self, config_path, dotenv_path=None, compose_bin=None,
+                 params=None):
+        compose_bin = default_bin(compose_bin, 'docker-compose')
+        self.config = ComposeConfig(config_path, dotenv_path, compose_bin,
+                                    params)
+        self.bin = compose_bin
+        self.pull_memory = set()
+
+    def clear_pull_memory(self):
+        self.pull_memory = set()
+
+    def _execute_compose(self, *args, **kwargs):
+        # execute as a docker compose command
+        try:
+            result = super().run('--file', str(self.config.path), *args,
+                                 env=self.config.env, **kwargs)
+            result.check_returncode()
+        except subprocess.CalledProcessError as e:
+            def formatdict(d, template):
+                return '\n'.join(
+                    template.format(k, v) for k, v in sorted(d.items())
+                )
+            msg = (
+                "`{cmd}` exited with a non-zero exit code {code}, see the "
+                "process log above.\n\nThe docker-compose command was "
+                "invoked with the following parameters:\n\nDefaults defined "
+                "in .env:\n{dotenv}\n\nArchery was called with:\n{params}"
+            )
+            raise RuntimeError(
+                msg.format(
+                    cmd=' '.join(e.cmd),
+                    code=e.returncode,
+                    dotenv=formatdict(self.config.dotenv, template='  {}: {}'),
+                    params=formatdict(
+                        self.config.params, template='  export {}={}'
+                    )
+                )
+            )
+
+    def _execute_docker(self, *args, **kwargs):
+        # execute as a plain docker cli command
+        try:
+            result = Docker().run(*args, **kwargs)
+            result.check_returncode()
+        except subprocess.CalledProcessError as e:
+            raise RuntimeError(
+                "{} exited with non-zero exit code {}".format(
+                    ' '.join(e.cmd), e.returncode
+                )
+            )
+
+    def pull(self, service_name, pull_leaf=True, using_docker=False):
+        def _pull(service):
+            args = ['pull']
+            if service['image'] in self.pull_memory:
+                return
+
+            if using_docker:
+                try:
+                    self._execute_docker(*args, service['image'])
+                except Exception as e:
+                    # better --ignore-pull-failures handling
+                    print(e)
+            else:
+                args.append('--ignore-pull-failures')
+                self._execute_compose(*args, service['name'])
+
+            self.pull_memory.add(service['image'])
+
+        service = self.config.get(service_name)
+        for ancestor in service['ancestors']:
+            _pull(self.config.get(ancestor))
+        if pull_leaf:
+            _pull(service)
+
+    def build(self, service_name, use_cache=True, use_leaf_cache=True,
+              using_docker=False, using_buildx=False, pull_parents=True):
+        def _build(service, use_cache):
+            if 'build' not in service:
+                # nothing to do
+                return
+
+            args = []
+            cache_from = list(service.get('build', {}).get('cache_from', []))
+            if pull_parents:
+                for image in cache_from:
+                    if image not in self.pull_memory:
+                        try:
+                            self._execute_docker('pull', image)
+                        except Exception as e:
+                            print(e)
+                        finally:
+                            self.pull_memory.add(image)
+
+            if not use_cache:
+                args.append('--no-cache')
+
+            # turn on inline build cache, this is a docker buildx feature
+            # used to bundle the image build cache to the pushed image manifest
+            # so the build cache can be reused across hosts, documented at
+            # https://github.com/docker/buildx#--cache-tonametypetypekeyvalue
+            if self.config.env.get('BUILDKIT_INLINE_CACHE') == '1':
+                args.extend(['--build-arg', 'BUILDKIT_INLINE_CACHE=1'])
+
+            if using_buildx:
+                for k, v in service['build'].get('args', {}).items():
+                    args.extend(['--build-arg', '{}={}'.format(k, v)])
+
+                if use_cache:
+                    cache_ref = '{}-cache'.format(service['image'])
+                    cache_from = 'type=registry,ref={}'.format(cache_ref)
+                    cache_to = (
+                        'type=registry,ref={},mode=max'.format(cache_ref)
+                    )
+                    args.extend([
+                        '--cache-from', cache_from,
+                        '--cache-to', cache_to,
+                    ])
+
+                args.extend([
+                    '--output', 'type=docker',
+                    '-f', service['build']['dockerfile'],
+                    '-t', service['image'],
+                    service['build'].get('context', '.')
+                ])
+                self._execute_docker("buildx", "build", *args)
+            elif using_docker:
+                # better for caching
+                for k, v in service['build'].get('args', {}).items():
+                    args.extend(['--build-arg', '{}={}'.format(k, v)])
+                for img in cache_from:
+                    args.append('--cache-from="{}"'.format(img))
+                args.extend([
+                    '-f', service['build']['dockerfile'],
+                    '-t', service['image'],
+                    service['build'].get('context', '.')
+                ])
+                self._execute_docker("build", *args)
+            else:
+                self._execute_compose("build", *args, service['name'])
+
+        service = self.config.get(service_name)
+        # build ancestor services
+        for ancestor in service['ancestors']:
+            _build(self.config.get(ancestor), use_cache=use_cache)
+        # build the leaf/target service
+        _build(service, use_cache=use_cache and use_leaf_cache)
+
+    def run(self, service_name, command=None, *, env=None, volumes=None,
+            user=None, using_docker=False, resource_limit=None):
+        service = self.config.get(service_name)
+
+        args = []
+        if user is not None:
+            args.extend(['-u', user])
+
+        if env is not None:
+            for k, v in env.items():
+                args.extend(['-e', '{}={}'.format(k, v)])
+
+        if volumes is not None:
+            for volume in volumes:
+                args.extend(['--volume', volume])
+
+        if using_docker or service['need_gpu'] or resource_limit:
+            # use gpus, requires docker>=19.03
+            if service['need_gpu']:
+                args.extend(['--gpus', 'all'])
+
+            if service.get('shm_size'):
+                args.extend(['--shm-size', service['shm_size']])
+
+            # append env variables from the compose conf
+            for k, v in service.get('environment', {}).items():
+                args.extend(['-e', '{}={}'.format(k, v)])
+
+            # append volumes from the compose conf
+            for v in service.get('volumes', []):
+                if not isinstance(v, str):
+                    # if not the compact string volume definition
+                    v = "{}:{}".format(v['source'], v['target'])
+                args.extend(['-v', v])
+
+            # infer whether an interactive shell is desired or not
+            if command in ['cmd.exe', 'bash', 'sh', 'powershell']:
+                args.append('-it')
+
+            if resource_limit:
+                limits = self.config.limit_presets.get(resource_limit)
+                if not limits:
+                    raise ValueError(
+                        f"Unknown resource limit preset '{resource_limit}'")
+                cpuset = limits.get('cpuset_cpus', [])
+                if cpuset:
+                    args.append(f'--cpuset-cpus={",".join(map(str, cpuset))}')
+                memory = limits.get('memory')
+                if memory:
+                    args.append(f'--memory={memory}')
+                    args.append(f'--memory-swap={memory}')
+
+            # get the actual docker image name instead of the compose service
+            # name which we refer as image in general
+            args.append(service['image'])
+
+            # add command from compose if it wasn't overridden
+            if command is not None:
+                args.append(command)
+            else:
+                # replace whitespaces from the preformatted compose command
+                cmd = _sanitize_command(service.get('command', ''))
+                if cmd:
+                    args.append(cmd)
+
+            # execute as a plain docker cli command
+            self._execute_docker('run', '--rm', *args)
+        else:
+            # execute as a docker-compose command
+            args.append(service_name)
+            if command is not None:
+                args.append(command)
+            self._execute_compose('run', '--rm', *args)
+
+    def push(self, service_name, user=None, password=None, using_docker=False):
+        def _push(service):
+            if using_docker:
+                return self._execute_docker('push', service['image'])
+            else:
+                return self._execute_compose('push', service['name'])
+
+        if user is not None:
+            try:
+                # TODO(kszucs): have an option for a prompt
+                self._execute_docker('login', '-u', user, '-p', password)
+            except subprocess.CalledProcessError:
+                # hide credentials
+                msg = ('Failed to push `{}`, check the passed credentials'
+                       .format(service_name))
+                raise RuntimeError(msg) from None
+
+        service = self.config.get(service_name)
+        for ancestor in service['ancestors']:
+            _push(self.config.get(ancestor))
+        _push(service)
+
+    def images(self):
+        return sorted(self.config.hierarchy.keys())
diff --git a/src/arrow/dev/archery/archery/docker/tests/test_docker.py b/src/arrow/dev/archery/archery/docker/tests/test_docker.py
new file mode 100644
index 000000000..982f3bfc1
--- /dev/null
+++ b/src/arrow/dev/archery/archery/docker/tests/test_docker.py
@@ -0,0 +1,531 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import collections
+import os
+import re
+import subprocess
+from unittest import mock
+
+import pytest
+
+from archery.docker import DockerCompose
+from archery.testing import assert_subprocess_calls, override_env, PartialEnv
+
+
+missing_service_compose_yml = """
+version: '3.5'
+
+x-hierarchy:
+  - foo:
+    - sub-foo:
+      - sub-sub-foo
+      - another-sub-sub-foo
+  - bar:
+    - sub-bar
+  - baz
+
+services:
+  foo:
+    image: org/foo
+  sub-sub-foo:
+    image: org/sub-sub-foo
+  another-sub-sub-foo:
+    image: org/another-sub-sub-foo
+  bar:
+    image: org/bar
+  sub-bar:
+    image: org/sub-bar
+  baz:
+    image: org/baz
+"""
+
+missing_node_compose_yml = """
+version: '3.5'
+
+x-hierarchy:
+  - foo:
+    - sub-foo:
+      - sub-sub-foo
+      - another-sub-sub-foo
+  - bar
+  - baz
+
+services:
+  foo:
+    image: org/foo
+  sub-foo:
+    image: org/sub-foo
+  sub-sub-foo:
+    image: org/sub-foo-foo
+  another-sub-sub-foo:
+    image: org/another-sub-sub-foo
+  bar:
+    image: org/bar
+  sub-bar:
+    image: org/sub-bar
+  baz:
+    image: org/baz
+"""
+
+ok_compose_yml = """
+version: '3.5'
+
+x-hierarchy:
+  - foo:
+    - sub-foo:
+      - sub-sub-foo
+      - another-sub-sub-foo
+  - bar:
+    - sub-bar
+  - baz
+
+services:
+  foo:
+    image: org/foo
+  sub-foo:
+    image: org/sub-foo
+  sub-sub-foo:
+    image: org/sub-sub-foo
+  another-sub-sub-foo:
+    image: org/another-sub-sub-foo
+  bar:
+    image: org/bar
+  sub-bar:
+    image: org/sub-bar
+  baz:
+    image: org/baz
+"""
+
+arrow_compose_yml = """
+version: '3.5'
+
+x-with-gpus:
+  - ubuntu-cuda
+
+x-hierarchy:
+  - conda-cpp:
+    - conda-python:
+      - conda-python-pandas
+      - conda-python-dask
+  - ubuntu-cpp:
+    - ubuntu-cpp-cmake32
+    - ubuntu-c-glib:
+      - ubuntu-ruby
+  - ubuntu-cuda
+
+x-limit-presets:
+  github:
+    cpuset_cpus: [0, 1]
+    memory: 7g
+
+services:
+  conda-cpp:
+    image: org/conda-cpp
+    build:
+      context: .
+      dockerfile: ci/docker/conda-cpp.dockerfile
+  conda-python:
+    image: org/conda-python
+    build:
+      context: .
+      dockerfile: ci/docker/conda-cpp.dockerfile
+      args:
+        python: 3.6
+  conda-python-pandas:
+    image: org/conda-python-pandas
+    build:
+      context: .
+      dockerfile: ci/docker/conda-python-pandas.dockerfile
+  conda-python-dask:
+    image: org/conda-python-dask
+  ubuntu-cpp:
+    image: org/ubuntu-cpp
+    build:
+      context: .
+      dockerfile: ci/docker/ubuntu-${UBUNTU}-cpp.dockerfile
+  ubuntu-cpp-cmake32:
+    image: org/ubuntu-cpp-cmake32
+  ubuntu-c-glib:
+    image: org/ubuntu-c-glib
+  ubuntu-ruby:
+    image: org/ubuntu-ruby
+  ubuntu-cuda:
+    image: org/ubuntu-cuda
+    environment:
+      CUDA_ENV: 1
+      OTHER_ENV: 2
+    volumes:
+     - /host:/container
+    command: /bin/bash -c "echo 1 > /tmp/dummy && cat /tmp/dummy"
+"""
+
+arrow_compose_env = {
+    'UBUNTU': '20.04',  # overridden below
+    'PYTHON': '3.6',
+    'PANDAS': 'latest',
+    'DASK': 'latest',  # overridden below
+}
+
+
+def create_config(directory, yml_content, env_content=None):
+    env_path = directory / '.env'
+    config_path = directory / 'docker-compose.yml'
+
+    with config_path.open('w') as fp:
+        fp.write(yml_content)
+
+    if env_content is not None:
+        with env_path.open('w') as fp:
+            for k, v in env_content.items():
+                fp.write("{}={}\n".format(k, v))
+
+    return config_path
+
+
+def format_run(args):
+    cmd = ["run", "--rm"]
+    if isinstance(args, str):
+        return " ".join(cmd + [args])
+    else:
+        return cmd + args
+
+
+@pytest.fixture
+def arrow_compose_path(tmpdir):
+    return create_config(tmpdir, arrow_compose_yml, arrow_compose_env)
+
+
+def test_config_validation(tmpdir):
+    config_path = create_config(tmpdir, missing_service_compose_yml)
+    msg = "`sub-foo` is defined in `x-hierarchy` bot not in `services`"
+    with pytest.raises(ValueError, match=msg):
+        DockerCompose(config_path)
+
+    config_path = create_config(tmpdir, missing_node_compose_yml)
+    msg = "`sub-bar` is defined in `services` but not in `x-hierarchy`"
+    with pytest.raises(ValueError, match=msg):
+        DockerCompose(config_path)
+
+    config_path = create_config(tmpdir, ok_compose_yml)
+    DockerCompose(config_path)  # no issue
+
+
+def assert_docker_calls(compose, expected_args):
+    base_command = ['docker']
+    expected_commands = []
+    for args in expected_args:
+        if isinstance(args, str):
+            args = re.split(r"\s", args)
+        expected_commands.append(base_command + args)
+    return assert_subprocess_calls(expected_commands, check=True)
+
+
+def assert_compose_calls(compose, expected_args, env=mock.ANY):
+    base_command = ['docker-compose', '--file', str(compose.config.path)]
+    expected_commands = []
+    for args in expected_args:
+        if isinstance(args, str):
+            args = re.split(r"\s", args)
+        expected_commands.append(base_command + args)
+    return assert_subprocess_calls(expected_commands, check=True, env=env)
+
+
+def test_arrow_example_validation_passes(arrow_compose_path):
+    DockerCompose(arrow_compose_path)
+
+
+def test_compose_default_params_and_env(arrow_compose_path):
+    compose = DockerCompose(arrow_compose_path, params=dict(
+        UBUNTU='18.04',
+        DASK='master'
+    ))
+    assert compose.config.dotenv == arrow_compose_env
+    assert compose.config.params == {
+        'UBUNTU': '18.04',
+        'DASK': 'master',
+    }
+
+
+def test_forwarding_env_variables(arrow_compose_path):
+    expected_calls = [
+        "pull --ignore-pull-failures conda-cpp",
+        "build conda-cpp",
+    ]
+    expected_env = PartialEnv(
+        MY_CUSTOM_VAR_A='a',
+        MY_CUSTOM_VAR_B='b'
+    )
+    with override_env({'MY_CUSTOM_VAR_A': 'a', 'MY_CUSTOM_VAR_B': 'b'}):
+        compose = DockerCompose(arrow_compose_path)
+        with assert_compose_calls(compose, expected_calls, env=expected_env):
+            assert os.environ['MY_CUSTOM_VAR_A'] == 'a'
+            assert os.environ['MY_CUSTOM_VAR_B'] == 'b'
+            compose.pull('conda-cpp')
+            compose.build('conda-cpp')
+
+
+def test_compose_pull(arrow_compose_path):
+    compose = DockerCompose(arrow_compose_path)
+
+    expected_calls = [
+        "pull --ignore-pull-failures conda-cpp",
+    ]
+    with assert_compose_calls(compose, expected_calls):
+        compose.clear_pull_memory()
+        compose.pull('conda-cpp')
+
+    expected_calls = [
+        "pull --ignore-pull-failures conda-cpp",
+        "pull --ignore-pull-failures conda-python",
+        "pull --ignore-pull-failures conda-python-pandas"
+    ]
+    with assert_compose_calls(compose, expected_calls):
+        compose.clear_pull_memory()
+        compose.pull('conda-python-pandas')
+
+    expected_calls = [
+        "pull --ignore-pull-failures conda-cpp",
+        "pull --ignore-pull-failures conda-python",
+    ]
+    with assert_compose_calls(compose, expected_calls):
+        compose.clear_pull_memory()
+        compose.pull('conda-python-pandas', pull_leaf=False)
+
+
+def test_compose_pull_params(arrow_compose_path):
+    expected_calls = [
+        "pull --ignore-pull-failures conda-cpp",
+        "pull --ignore-pull-failures conda-python",
+    ]
+    compose = DockerCompose(arrow_compose_path, params=dict(UBUNTU='18.04'))
+    expected_env = PartialEnv(PYTHON='3.6', PANDAS='latest')
+    with assert_compose_calls(compose, expected_calls, env=expected_env):
+        compose.clear_pull_memory()
+        compose.pull('conda-python-pandas', pull_leaf=False)
+
+
+def test_compose_build(arrow_compose_path):
+    compose = DockerCompose(arrow_compose_path)
+
+    expected_calls = [
+        "build conda-cpp",
+    ]
+    with assert_compose_calls(compose, expected_calls):
+        compose.build('conda-cpp')
+
+    expected_calls = [
+        "build --no-cache conda-cpp"
+    ]
+    with assert_compose_calls(compose, expected_calls):
+        compose.build('conda-cpp', use_cache=False)
+
+    expected_calls = [
+        "build conda-cpp",
+        "build conda-python",
+        "build conda-python-pandas"
+    ]
+    with assert_compose_calls(compose, expected_calls):
+        compose.build('conda-python-pandas')
+
+    expected_calls = [
+        "build --no-cache conda-cpp",
+        "build --no-cache conda-python",
+        "build --no-cache conda-python-pandas",
+    ]
+    with assert_compose_calls(compose, expected_calls):
+        compose.build('conda-python-pandas', use_cache=False)
+
+    expected_calls = [
+        "build conda-cpp",
+        "build conda-python",
+        "build --no-cache conda-python-pandas",
+    ]
+    with assert_compose_calls(compose, expected_calls):
+        compose.build('conda-python-pandas', use_cache=True,
+                      use_leaf_cache=False)
+
+
+@mock.patch.dict(os.environ, {"BUILDKIT_INLINE_CACHE": "1"})
+def test_compose_buildkit_inline_cache(arrow_compose_path):
+    compose = DockerCompose(arrow_compose_path)
+
+    expected_calls = [
+        "build --build-arg BUILDKIT_INLINE_CACHE=1 conda-cpp",
+    ]
+    with assert_compose_calls(compose, expected_calls):
+        compose.build('conda-cpp')
+
+
+def test_compose_build_params(arrow_compose_path):
+    expected_calls = [
+        "build ubuntu-cpp",
+    ]
+
+    compose = DockerCompose(arrow_compose_path, params=dict(UBUNTU='18.04'))
+    expected_env = PartialEnv(UBUNTU="18.04")
+    with assert_compose_calls(compose, expected_calls, env=expected_env):
+        compose.build('ubuntu-cpp')
+
+    compose = DockerCompose(arrow_compose_path, params=dict(UBUNTU='16.04'))
+    expected_env = PartialEnv(UBUNTU="16.04")
+    with assert_compose_calls(compose, expected_calls, env=expected_env):
+        compose.build('ubuntu-cpp')
+
+    expected_calls = [
+        "build --no-cache conda-cpp",
+        "build --no-cache conda-python",
+        "build --no-cache conda-python-pandas",
+    ]
+    compose = DockerCompose(arrow_compose_path, params=dict(UBUNTU='18.04'))
+    expected_env = PartialEnv(PYTHON='3.6', PANDAS='latest')
+    with assert_compose_calls(compose, expected_calls, env=expected_env):
+        compose.build('conda-python-pandas', use_cache=False)
+
+
+def test_compose_run(arrow_compose_path):
+    expected_calls = [
+        format_run("conda-cpp"),
+    ]
+    compose = DockerCompose(arrow_compose_path)
+    with assert_compose_calls(compose, expected_calls):
+        compose.run('conda-cpp')
+
+    expected_calls = [
+        format_run("conda-python")
+    ]
+    expected_env = PartialEnv(PYTHON='3.6')
+    with assert_compose_calls(compose, expected_calls, env=expected_env):
+        compose.run('conda-python')
+
+    compose = DockerCompose(arrow_compose_path, params=dict(PYTHON='3.8'))
+    expected_env = PartialEnv(PYTHON='3.8')
+    with assert_compose_calls(compose, expected_calls, env=expected_env):
+        compose.run('conda-python')
+
+    compose = DockerCompose(arrow_compose_path, params=dict(PYTHON='3.8'))
+    for command in ["bash", "echo 1"]:
+        expected_calls = [
+            format_run(["conda-python", command]),
+        ]
+        expected_env = PartialEnv(PYTHON='3.8')
+        with assert_compose_calls(compose, expected_calls, env=expected_env):
+            compose.run('conda-python', command)
+
+    expected_calls = [
+        (
+            format_run("-e CONTAINER_ENV_VAR_A=a -e CONTAINER_ENV_VAR_B=b "
+                       "conda-python")
+        )
+    ]
+    compose = DockerCompose(arrow_compose_path)
+    expected_env = PartialEnv(PYTHON='3.6')
+    with assert_compose_calls(compose, expected_calls, env=expected_env):
+        env = collections.OrderedDict([
+            ("CONTAINER_ENV_VAR_A", "a"),
+            ("CONTAINER_ENV_VAR_B", "b")
+        ])
+        compose.run('conda-python', env=env)
+
+    expected_calls = [
+        (
+            format_run("--volume /host/build:/build --volume "
+                       "/host/ccache:/ccache:delegated conda-python")
+        )
+    ]
+    compose = DockerCompose(arrow_compose_path)
+    with assert_compose_calls(compose, expected_calls):
+        volumes = ("/host/build:/build", "/host/ccache:/ccache:delegated")
+        compose.run('conda-python', volumes=volumes)
+
+
+def test_compose_run_with_resource_limits(arrow_compose_path):
+    expected_calls = [
+        format_run([
+            "--cpuset-cpus=0,1",
+            "--memory=7g",
+            "--memory-swap=7g",
+            "org/conda-cpp"
+        ]),
+    ]
+    compose = DockerCompose(arrow_compose_path)
+    with assert_docker_calls(compose, expected_calls):
+        compose.run('conda-cpp', resource_limit="github")
+
+
+def test_compose_push(arrow_compose_path):
+    compose = DockerCompose(arrow_compose_path, params=dict(PYTHON='3.8'))
+    expected_env = PartialEnv(PYTHON="3.8")
+    expected_calls = [
+        mock.call(["docker", "login", "-u", "user", "-p", "pass"], check=True),
+    ]
+    for image in ["conda-cpp", "conda-python", "conda-python-pandas"]:
+        expected_calls.append(
+            mock.call(["docker-compose", "--file", str(compose.config.path),
+                       "push", image], check=True, env=expected_env)
+        )
+    with assert_subprocess_calls(expected_calls):
+        compose.push('conda-python-pandas', user='user', password='pass')
+
+
+def test_compose_error(arrow_compose_path):
+    compose = DockerCompose(arrow_compose_path, params=dict(
+        PYTHON='3.8',
+        PANDAS='master'
+    ))
+
+    error = subprocess.CalledProcessError(99, [])
+    with mock.patch('subprocess.run', side_effect=error):
+        with pytest.raises(RuntimeError) as exc:
+            compose.run('conda-cpp')
+
+    exception_message = str(exc.value)
+    assert "exited with a non-zero exit code 99" in exception_message
+    assert "PANDAS: latest" in exception_message
+    assert "export PANDAS=master" in exception_message
+
+
+def test_image_with_gpu(arrow_compose_path):
+    compose = DockerCompose(arrow_compose_path)
+
+    expected_calls = [
+        [
+            "run", "--rm", "--gpus", "all",
+            "-e", "CUDA_ENV=1",
+            "-e", "OTHER_ENV=2",
+            "-v", "/host:/container:rw",
+            "org/ubuntu-cuda",
+            '/bin/bash -c "echo 1 > /tmp/dummy && cat /tmp/dummy"'
+        ]
+    ]
+    with assert_docker_calls(compose, expected_calls):
+        compose.run('ubuntu-cuda')
+
+
+def test_listing_images(arrow_compose_path):
+    compose = DockerCompose(arrow_compose_path)
+    assert sorted(compose.images()) == [
+        'conda-cpp',
+        'conda-python',
+        'conda-python-dask',
+        'conda-python-pandas',
+        'ubuntu-c-glib',
+        'ubuntu-cpp',
+        'ubuntu-cpp-cmake32',
+        'ubuntu-cuda',
+        'ubuntu-ruby',
+    ]
diff --git a/src/arrow/dev/archery/archery/docker/tests/test_docker_cli.py b/src/arrow/dev/archery/archery/docker/tests/test_docker_cli.py
new file mode 100644
index 000000000..ab39c7b9d
--- /dev/null
+++ b/src/arrow/dev/archery/archery/docker/tests/test_docker_cli.py
@@ -0,0 +1,201 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from unittest.mock import patch
+
+from click.testing import CliRunner
+
+from archery.docker import DockerCompose
+from archery.docker.cli import docker
+
+
+@patch.object(DockerCompose, "pull")
+@patch.object(DockerCompose, "build")
+@patch.object(DockerCompose, "run")
+def test_docker_run_with_custom_command(run, build, pull):
+    # with custom command
+    args = ["run", "ubuntu-cpp", "bash"]
+    result = CliRunner().invoke(docker, args)
+
+    assert result.exit_code == 0
+    pull.assert_called_once_with(
+        "ubuntu-cpp", pull_leaf=True, using_docker=False
+    )
+    build.assert_called_once_with(
+        "ubuntu-cpp",
+        use_cache=True,
+        use_leaf_cache=True,
+        using_docker=False,
+        using_buildx=False
+    )
+    run.assert_called_once_with(
+        "ubuntu-cpp",
+        command="bash",
+        env={},
+        resource_limit=None,
+        user=None,
+        using_docker=False,
+        volumes=(),
+    )
+
+
+@patch.object(DockerCompose, "pull")
+@patch.object(DockerCompose, "build")
+@patch.object(DockerCompose, "run")
+def test_docker_run_options(run, build, pull):
+    # environment variables and volumes
+    args = [
+        "run",
+        "-e",
+        "ARROW_GANDIVA=OFF",
+        "-e",
+        "ARROW_FLIGHT=ON",
+        "--volume",
+        "./build:/build",
+        "-v",
+        "./ccache:/ccache:delegated",
+        "-u",
+        "root",
+        "ubuntu-cpp",
+    ]
+    result = CliRunner().invoke(docker, args)
+    assert result.exit_code == 0
+    pull.assert_called_once_with(
+        "ubuntu-cpp", pull_leaf=True, using_docker=False
+    )
+    build.assert_called_once_with(
+        "ubuntu-cpp",
+        use_cache=True,
+        use_leaf_cache=True,
+        using_docker=False,
+        using_buildx=False
+    )
+    run.assert_called_once_with(
+        "ubuntu-cpp",
+        command=None,
+        env={"ARROW_GANDIVA": "OFF", "ARROW_FLIGHT": "ON"},
+        resource_limit=None,
+        user="root",
+        using_docker=False,
+        volumes=(
+            "./build:/build",
+            "./ccache:/ccache:delegated",
+        ),
+    )
+
+
+@patch.object(DockerCompose, "run")
+def test_docker_limit_options(run):
+    # environment variables and volumes
+    args = [
+        "run",
+        "-e",
+        "ARROW_GANDIVA=OFF",
+        "-e",
+        "ARROW_FLIGHT=ON",
+        "--volume",
+        "./build:/build",
+        "-v",
+        "./ccache:/ccache:delegated",
+        "-u",
+        "root",
+        "--resource-limit=github",
+        "--no-build",
+        "--no-pull",
+        "ubuntu-cpp",
+    ]
+    result = CliRunner().invoke(docker, args)
+    assert result.exit_code == 0
+    run.assert_called_once_with(
+        "ubuntu-cpp",
+        command=None,
+        env={"ARROW_GANDIVA": "OFF", "ARROW_FLIGHT": "ON"},
+        resource_limit="github",
+        user="root",
+        using_docker=False,
+        volumes=(
+            "./build:/build",
+            "./ccache:/ccache:delegated",
+        ),
+    )
+
+
+@patch.object(DockerCompose, "run")
+def test_docker_run_without_pulling_or_building(run):
+    args = ["run", "--no-pull", "--no-build", "ubuntu-cpp"]
+    result = CliRunner().invoke(docker, args)
+    assert result.exit_code == 0
+    run.assert_called_once_with(
+        "ubuntu-cpp",
+        command=None,
+        env={},
+        resource_limit=None,
+        user=None,
+        using_docker=False,
+        volumes=(),
+    )
+
+
+@patch.object(DockerCompose, "pull")
+@patch.object(DockerCompose, "build")
+def test_docker_run_only_pulling_and_building(build, pull):
+    args = ["run", "ubuntu-cpp", "--build-only"]
+    result = CliRunner().invoke(docker, args)
+    assert result.exit_code == 0
+    pull.assert_called_once_with(
+        "ubuntu-cpp", pull_leaf=True, using_docker=False
+    )
+    build.assert_called_once_with(
+        "ubuntu-cpp",
+        use_cache=True,
+        use_leaf_cache=True,
+        using_docker=False,
+        using_buildx=False
+    )
+
+
+@patch.object(DockerCompose, "build")
+@patch.object(DockerCompose, "run")
+def test_docker_run_without_build_cache(run, build):
+    args = [
+        "run",
+        "--no-pull",
+        "--force-build",
+        "--user",
+        "me",
+        "--no-cache",
+        "--no-leaf-cache",
+        "ubuntu-cpp",
+    ]
+    result = CliRunner().invoke(docker, args)
+    assert result.exit_code == 0
+    build.assert_called_once_with(
+        "ubuntu-cpp",
+        use_cache=False,
+        use_leaf_cache=False,
+        using_docker=False,
+        using_buildx=False
+    )
+    run.assert_called_once_with(
+        "ubuntu-cpp",
+        command=None,
+        env={},
+        resource_limit=None,
+        user="me",
+        using_docker=False,
+        volumes=(),
+    )
diff --git a/src/arrow/dev/archery/archery/integration/__init__.py b/src/arrow/dev/archery/archery/integration/__init__.py
new file mode 100644
index 000000000..13a83393a
--- /dev/null
+++ b/src/arrow/dev/archery/archery/integration/__init__.py
@@ -0,0 +1,16 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
diff --git a/src/arrow/dev/archery/archery/integration/datagen.py b/src/arrow/dev/archery/archery/integration/datagen.py
new file mode 100644
index 000000000..b764982bd
--- /dev/null
+++ b/src/arrow/dev/archery/archery/integration/datagen.py
@@ -0,0 +1,1662 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from collections import namedtuple, OrderedDict
+import binascii
+import json
+import os
+import random
+import tempfile
+
+import numpy as np
+
+from .util import frombytes, tobytes, random_bytes, random_utf8
+
+
+def metadata_key_values(pairs):
+    return [{'key': k, 'value': v} for k, v in pairs]
+
+
+class Field(object):
+
+    def __init__(self, name, *, nullable=True, metadata=None):
+        self.name = name
+        self.nullable = nullable
+        self.metadata = metadata or []
+
+    def get_json(self):
+        entries = [
+            ('name', self.name),
+            ('type', self._get_type()),
+            ('nullable', self.nullable),
+            ('children', self._get_children()),
+        ]
+
+        dct = self._get_dictionary()
+        if dct:
+            entries.append(('dictionary', dct))
+
+        if self.metadata is not None and len(self.metadata) > 0:
+            entries.append(('metadata', metadata_key_values(self.metadata)))
+
+        return OrderedDict(entries)
+
+    def _get_dictionary(self):
+        return None
+
+    def _make_is_valid(self, size, null_probability=0.4):
+        if self.nullable:
+            return (np.random.random_sample(size) > null_probability
+                    ).astype(np.int8)
+        else:
+            return np.ones(size, dtype=np.int8)
+
+
+class Column(object):
+
+    def __init__(self, name, count):
+        self.name = name
+        self.count = count
+
+    def __len__(self):
+        return self.count
+
+    def _get_children(self):
+        return []
+
+    def _get_buffers(self):
+        return []
+
+    def get_json(self):
+        entries = [
+            ('name', self.name),
+            ('count', self.count)
+        ]
+
+        buffers = self._get_buffers()
+        entries.extend(buffers)
+
+        children = self._get_children()
+        if len(children) > 0:
+            entries.append(('children', children))
+
+        return OrderedDict(entries)
+
+
+class PrimitiveField(Field):
+
+    def _get_children(self):
+        return []
+
+
+class PrimitiveColumn(Column):
+
+    def __init__(self, name, count, is_valid, values):
+        super().__init__(name, count)
+        self.is_valid = is_valid
+        self.values = values
+
+    def _encode_value(self, x):
+        return x
+
+    def _get_buffers(self):
+        return [
+            ('VALIDITY', [int(v) for v in self.is_valid]),
+            ('DATA', list([self._encode_value(x) for x in self.values]))
+        ]
+
+
+class NullColumn(Column):
+    # This subclass is for readability only
+    pass
+
+
+class NullField(PrimitiveField):
+
+    def __init__(self, name, metadata=None):
+        super().__init__(name, nullable=True,
+                         metadata=metadata)
+
+    def _get_type(self):
+        return OrderedDict([('name', 'null')])
+
+    def generate_column(self, size, name=None):
+        return NullColumn(name or self.name, size)
+
+
+TEST_INT_MAX = 2 ** 31 - 1
+TEST_INT_MIN = ~TEST_INT_MAX
+
+
+class IntegerField(PrimitiveField):
+
+    def __init__(self, name, is_signed, bit_width, *, nullable=True,
+                 metadata=None,
+                 min_value=TEST_INT_MIN,
+                 max_value=TEST_INT_MAX):
+        super().__init__(name, nullable=nullable,
+                         metadata=metadata)
+        self.is_signed = is_signed
+        self.bit_width = bit_width
+        self.min_value = min_value
+        self.max_value = max_value
+
+    def _get_generated_data_bounds(self):
+        if self.is_signed:
+            signed_iinfo = np.iinfo('int' + str(self.bit_width))
+            min_value, max_value = signed_iinfo.min, signed_iinfo.max
+        else:
+            unsigned_iinfo = np.iinfo('uint' + str(self.bit_width))
+            min_value, max_value = 0, unsigned_iinfo.max
+
+        lower_bound = max(min_value, self.min_value)
+        upper_bound = min(max_value, self.max_value)
+        return lower_bound, upper_bound
+
+    def _get_type(self):
+        return OrderedDict([
+            ('name', 'int'),
+            ('isSigned', self.is_signed),
+            ('bitWidth', self.bit_width)
+        ])
+
+    def generate_column(self, size, name=None):
+        lower_bound, upper_bound = self._get_generated_data_bounds()
+        return self.generate_range(size, lower_bound, upper_bound,
+                                   name=name, include_extremes=True)
+
+    def generate_range(self, size, lower, upper, name=None,
+                       include_extremes=False):
+        values = np.random.randint(lower, upper, size=size, dtype=np.int64)
+        if include_extremes and size >= 2:
+            values[:2] = [lower, upper]
+        values = list(map(int if self.bit_width < 64 else str, values))
+
+        is_valid = self._make_is_valid(size)
+
+        if name is None:
+            name = self.name
+        return PrimitiveColumn(name, size, is_valid, values)
+
+
+class DateField(IntegerField):
+
+    DAY = 0
+    MILLISECOND = 1
+
+    # 1/1/1 to 12/31/9999
+    _ranges = {
+        DAY: [-719162, 2932896],
+        MILLISECOND: [-62135596800000, 253402214400000]
+    }
+
+    def __init__(self, name, unit, *, nullable=True, metadata=None):
+        bit_width = 32 if unit == self.DAY else 64
+
+        min_value, max_value = self._ranges[unit]
+        super().__init__(
+            name, True, bit_width,
+            nullable=nullable, metadata=metadata,
+            min_value=min_value, max_value=max_value
+        )
+        self.unit = unit
+
+    def _get_type(self):
+        return OrderedDict([
+            ('name', 'date'),
+            ('unit', 'DAY' if self.unit == self.DAY else 'MILLISECOND')
+        ])
+
+
+TIMEUNIT_NAMES = {
+    's': 'SECOND',
+    'ms': 'MILLISECOND',
+    'us': 'MICROSECOND',
+    'ns': 'NANOSECOND'
+}
+
+
+class TimeField(IntegerField):
+
+    BIT_WIDTHS = {
+        's': 32,
+        'ms': 32,
+        'us': 64,
+        'ns': 64
+    }
+
+    _ranges = {
+        's': [0, 86400],
+        'ms': [0, 86400000],
+        'us': [0, 86400000000],
+        'ns': [0, 86400000000000]
+    }
+
+    def __init__(self, name, unit='s', *, nullable=True,
+                 metadata=None):
+        min_val, max_val = self._ranges[unit]
+        super().__init__(name, True, self.BIT_WIDTHS[unit],
+                         nullable=nullable, metadata=metadata,
+                         min_value=min_val, max_value=max_val)
+        self.unit = unit
+
+    def _get_type(self):
+        return OrderedDict([
+            ('name', 'time'),
+            ('unit', TIMEUNIT_NAMES[self.unit]),
+            ('bitWidth', self.bit_width)
+        ])
+
+
+class TimestampField(IntegerField):
+
+    # 1/1/1 to 12/31/9999
+    _ranges = {
+        's': [-62135596800, 253402214400],
+        'ms': [-62135596800000, 253402214400000],
+        'us': [-62135596800000000, 253402214400000000],
+
+        # Physical range for int64, ~584 years and change
+        'ns': [np.iinfo('int64').min, np.iinfo('int64').max]
+    }
+
+    def __init__(self, name, unit='s', tz=None, *, nullable=True,
+                 metadata=None):
+        min_val, max_val = self._ranges[unit]
+        super().__init__(name, True, 64,
+                         nullable=nullable,
+                         metadata=metadata,
+                         min_value=min_val,
+                         max_value=max_val)
+        self.unit = unit
+        self.tz = tz
+
+    def _get_type(self):
+        fields = [
+            ('name', 'timestamp'),
+            ('unit', TIMEUNIT_NAMES[self.unit])
+        ]
+
+        if self.tz is not None:
+            fields.append(('timezone', self.tz))
+
+        return OrderedDict(fields)
+
+
+class DurationIntervalField(IntegerField):
+
+    def __init__(self, name, unit='s', *, nullable=True,
+                 metadata=None):
+        min_val, max_val = np.iinfo('int64').min, np.iinfo('int64').max,
+        super().__init__(
+            name, True, 64,
+            nullable=nullable, metadata=metadata,
+            min_value=min_val, max_value=max_val)
+        self.unit = unit
+
+    def _get_type(self):
+        fields = [
+            ('name', 'duration'),
+            ('unit', TIMEUNIT_NAMES[self.unit])
+        ]
+
+        return OrderedDict(fields)
+
+
+class YearMonthIntervalField(IntegerField):
+    def __init__(self, name, *, nullable=True, metadata=None):
+        min_val, max_val = [-10000*12, 10000*12]  # +/- 10000 years.
+        super().__init__(
+            name, True, 32,
+            nullable=nullable, metadata=metadata,
+            min_value=min_val, max_value=max_val)
+
+    def _get_type(self):
+        fields = [
+            ('name', 'interval'),
+            ('unit', 'YEAR_MONTH'),
+        ]
+
+        return OrderedDict(fields)
+
+
+class DayTimeIntervalField(PrimitiveField):
+    def __init__(self, name, *, nullable=True, metadata=None):
+        super().__init__(name,
+                         nullable=True,
+                         metadata=metadata)
+
+    @property
+    def numpy_type(self):
+        return object
+
+    def _get_type(self):
+
+        return OrderedDict([
+            ('name', 'interval'),
+            ('unit', 'DAY_TIME'),
+        ])
+
+    def generate_column(self, size, name=None):
+        min_day_value, max_day_value = -10000*366, 10000*366
+        values = [{'days': random.randint(min_day_value, max_day_value),
+                   'milliseconds': random.randint(-86400000, +86400000)}
+                  for _ in range(size)]
+
+        is_valid = self._make_is_valid(size)
+        if name is None:
+            name = self.name
+        return PrimitiveColumn(name, size, is_valid, values)
+
+
+class MonthDayNanoIntervalField(PrimitiveField):
+    def __init__(self, name, *, nullable=True, metadata=None):
+        super().__init__(name,
+                         nullable=True,
+                         metadata=metadata)
+
+    @property
+    def numpy_type(self):
+        return object
+
+    def _get_type(self):
+
+        return OrderedDict([
+            ('name', 'interval'),
+            ('unit', 'MONTH_DAY_NANO'),
+        ])
+
+    def generate_column(self, size, name=None):
+        I32 = 'int32'
+        min_int_value, max_int_value = np.iinfo(I32).min, np.iinfo(I32).max
+        I64 = 'int64'
+        min_nano_val, max_nano_val = np.iinfo(I64).min, np.iinfo(I64).max,
+        values = [{'months': random.randint(min_int_value, max_int_value),
+                   'days': random.randint(min_int_value, max_int_value),
+                   'nanoseconds': random.randint(min_nano_val, max_nano_val)}
+                  for _ in range(size)]
+
+        is_valid = self._make_is_valid(size)
+        if name is None:
+            name = self.name
+        return PrimitiveColumn(name, size, is_valid, values)
+
+
+class FloatingPointField(PrimitiveField):
+
+    def __init__(self, name, bit_width, *, nullable=True,
+                 metadata=None):
+        super().__init__(name,
+                         nullable=nullable,
+                         metadata=metadata)
+
+        self.bit_width = bit_width
+        self.precision = {
+            16: 'HALF',
+            32: 'SINGLE',
+            64: 'DOUBLE'
+        }[self.bit_width]
+
+    @property
+    def numpy_type(self):
+        return 'float' + str(self.bit_width)
+
+    def _get_type(self):
+        return OrderedDict([
+            ('name', 'floatingpoint'),
+            ('precision', self.precision)
+        ])
+
+    def generate_column(self, size, name=None):
+        values = np.random.randn(size) * 1000
+        values = np.round(values, 3)
+
+        is_valid = self._make_is_valid(size)
+        if name is None:
+            name = self.name
+        return PrimitiveColumn(name, size, is_valid, values)
+
+
+DECIMAL_PRECISION_TO_VALUE = {
+    key: (1 << (8 * i - 1)) - 1 for i, key in enumerate(
+        [1, 3, 5, 7, 10, 12, 15, 17, 19, 22, 24, 27, 29, 32, 34, 36,
+         40, 42, 44, 50, 60, 70],
+        start=1,
+    )
+}
+
+
+def decimal_range_from_precision(precision):
+    assert 1 <= precision <= 76
+    try:
+        max_value = DECIMAL_PRECISION_TO_VALUE[precision]
+    except KeyError:
+        return decimal_range_from_precision(precision - 1)
+    else:
+        return ~max_value, max_value
+
+
+class DecimalField(PrimitiveField):
+    def __init__(self, name, precision, scale, bit_width, *,
+                 nullable=True, metadata=None):
+        super().__init__(name, nullable=True,
+                         metadata=metadata)
+        self.precision = precision
+        self.scale = scale
+        self.bit_width = bit_width
+
+    @property
+    def numpy_type(self):
+        return object
+
+    def _get_type(self):
+        return OrderedDict([
+            ('name', 'decimal'),
+            ('precision', self.precision),
+            ('scale', self.scale),
+            ('bitWidth', self.bit_width),
+        ])
+
+    def generate_column(self, size, name=None):
+        min_value, max_value = decimal_range_from_precision(self.precision)
+        values = [random.randint(min_value, max_value) for _ in range(size)]
+
+        is_valid = self._make_is_valid(size)
+        if name is None:
+            name = self.name
+        return DecimalColumn(name, size, is_valid, values, self.bit_width)
+
+
+class DecimalColumn(PrimitiveColumn):
+
+    def __init__(self, name, count, is_valid, values, bit_width):
+        super().__init__(name, count, is_valid, values)
+        self.bit_width = bit_width
+
+    def _encode_value(self, x):
+        return str(x)
+
+
+class BooleanField(PrimitiveField):
+    bit_width = 1
+
+    def _get_type(self):
+        return OrderedDict([('name', 'bool')])
+
+    @property
+    def numpy_type(self):
+        return 'bool'
+
+    def generate_column(self, size, name=None):
+        values = list(map(bool, np.random.randint(0, 2, size=size)))
+        is_valid = self._make_is_valid(size)
+        if name is None:
+            name = self.name
+        return PrimitiveColumn(name, size, is_valid, values)
+
+
+class FixedSizeBinaryField(PrimitiveField):
+
+    def __init__(self, name, byte_width, *, nullable=True,
+                 metadata=None):
+        super().__init__(name, nullable=nullable,
+                         metadata=metadata)
+        self.byte_width = byte_width
+
+    @property
+    def numpy_type(self):
+        return object
+
+    @property
+    def column_class(self):
+        return FixedSizeBinaryColumn
+
+    def _get_type(self):
+        return OrderedDict([('name', 'fixedsizebinary'),
+                            ('byteWidth', self.byte_width)])
+
+    def generate_column(self, size, name=None):
+        is_valid = self._make_is_valid(size)
+        values = []
+
+        for i in range(size):
+            values.append(random_bytes(self.byte_width))
+
+        if name is None:
+            name = self.name
+        return self.column_class(name, size, is_valid, values)
+
+
+class BinaryField(PrimitiveField):
+
+    @property
+    def numpy_type(self):
+        return object
+
+    @property
+    def column_class(self):
+        return BinaryColumn
+
+    def _get_type(self):
+        return OrderedDict([('name', 'binary')])
+
+    def _random_sizes(self, size):
+        return np.random.exponential(scale=4, size=size).astype(np.int32)
+
+    def generate_column(self, size, name=None):
+        is_valid = self._make_is_valid(size)
+        values = []
+
+        sizes = self._random_sizes(size)
+
+        for i, nbytes in enumerate(sizes):
+            if is_valid[i]:
+                values.append(random_bytes(nbytes))
+            else:
+                values.append(b"")
+
+        if name is None:
+            name = self.name
+        return self.column_class(name, size, is_valid, values)
+
+
+class StringField(BinaryField):
+
+    @property
+    def column_class(self):
+        return StringColumn
+
+    def _get_type(self):
+        return OrderedDict([('name', 'utf8')])
+
+    def generate_column(self, size, name=None):
+        K = 7
+        is_valid = self._make_is_valid(size)
+        values = []
+
+        for i in range(size):
+            if is_valid[i]:
+                values.append(tobytes(random_utf8(K)))
+            else:
+                values.append(b"")
+
+        if name is None:
+            name = self.name
+        return self.column_class(name, size, is_valid, values)
+
+
+class LargeBinaryField(BinaryField):
+
+    @property
+    def column_class(self):
+        return LargeBinaryColumn
+
+    def _get_type(self):
+        return OrderedDict([('name', 'largebinary')])
+
+
+class LargeStringField(StringField):
+
+    @property
+    def column_class(self):
+        return LargeStringColumn
+
+    def _get_type(self):
+        return OrderedDict([('name', 'largeutf8')])
+
+
+class Schema(object):
+
+    def __init__(self, fields, metadata=None):
+        self.fields = fields
+        self.metadata = metadata
+
+    def get_json(self):
+        entries = [
+            ('fields', [field.get_json() for field in self.fields])
+        ]
+
+        if self.metadata is not None and len(self.metadata) > 0:
+            entries.append(('metadata', metadata_key_values(self.metadata)))
+
+        return OrderedDict(entries)
+
+
+class _NarrowOffsetsMixin:
+
+    def _encode_offsets(self, offsets):
+        return list(map(int, offsets))
+
+
+class _LargeOffsetsMixin:
+
+    def _encode_offsets(self, offsets):
+        # 64-bit offsets have to be represented as strings to roundtrip
+        # through JSON.
+        return list(map(str, offsets))
+
+
+class _BaseBinaryColumn(PrimitiveColumn):
+
+    def _encode_value(self, x):
+        return frombytes(binascii.hexlify(x).upper())
+
+    def _get_buffers(self):
+        offset = 0
+        offsets = [0]
+
+        data = []
+        for i, v in enumerate(self.values):
+            if self.is_valid[i]:
+                offset += len(v)
+            else:
+                v = b""
+
+            offsets.append(offset)
+            data.append(self._encode_value(v))
+
+        return [
+            ('VALIDITY', [int(x) for x in self.is_valid]),
+            ('OFFSET', self._encode_offsets(offsets)),
+            ('DATA', data)
+        ]
+
+
+class _BaseStringColumn(_BaseBinaryColumn):
+
+    def _encode_value(self, x):
+        return frombytes(x)
+
+
+class BinaryColumn(_BaseBinaryColumn, _NarrowOffsetsMixin):
+    pass
+
+
+class StringColumn(_BaseStringColumn, _NarrowOffsetsMixin):
+    pass
+
+
+class LargeBinaryColumn(_BaseBinaryColumn, _LargeOffsetsMixin):
+    pass
+
+
+class LargeStringColumn(_BaseStringColumn, _LargeOffsetsMixin):
+    pass
+
+
+class FixedSizeBinaryColumn(PrimitiveColumn):
+
+    def _encode_value(self, x):
+        return frombytes(binascii.hexlify(x).upper())
+
+    def _get_buffers(self):
+        data = []
+        for i, v in enumerate(self.values):
+            data.append(self._encode_value(v))
+
+        return [
+            ('VALIDITY', [int(x) for x in self.is_valid]),
+            ('DATA', data)
+        ]
+
+
+class ListField(Field):
+
+    def __init__(self, name, value_field, *, nullable=True,
+                 metadata=None):
+        super().__init__(name, nullable=nullable,
+                         metadata=metadata)
+        self.value_field = value_field
+
+    @property
+    def column_class(self):
+        return ListColumn
+
+    def _get_type(self):
+        return OrderedDict([
+            ('name', 'list')
+        ])
+
+    def _get_children(self):
+        return [self.value_field.get_json()]
+
+    def generate_column(self, size, name=None):
+        MAX_LIST_SIZE = 4
+
+        is_valid = self._make_is_valid(size)
+        list_sizes = np.random.randint(0, MAX_LIST_SIZE + 1, size=size)
+        offsets = [0]
+
+        offset = 0
+        for i in range(size):
+            if is_valid[i]:
+                offset += int(list_sizes[i])
+            offsets.append(offset)
+
+        # The offset now is the total number of elements in the child array
+        values = self.value_field.generate_column(offset)
+
+        if name is None:
+            name = self.name
+        return self.column_class(name, size, is_valid, offsets, values)
+
+
+class LargeListField(ListField):
+
+    @property
+    def column_class(self):
+        return LargeListColumn
+
+    def _get_type(self):
+        return OrderedDict([
+            ('name', 'largelist')
+        ])
+
+
+class _BaseListColumn(Column):
+
+    def __init__(self, name, count, is_valid, offsets, values):
+        super().__init__(name, count)
+        self.is_valid = is_valid
+        self.offsets = offsets
+        self.values = values
+
+    def _get_buffers(self):
+        return [
+            ('VALIDITY', [int(v) for v in self.is_valid]),
+            ('OFFSET', self._encode_offsets(self.offsets))
+        ]
+
+    def _get_children(self):
+        return [self.values.get_json()]
+
+
+class ListColumn(_BaseListColumn, _NarrowOffsetsMixin):
+    pass
+
+
+class LargeListColumn(_BaseListColumn, _LargeOffsetsMixin):
+    pass
+
+
+class MapField(Field):
+
+    def __init__(self, name, key_field, item_field, *, nullable=True,
+                 metadata=None, keys_sorted=False, entries_name='entries'):
+        super().__init__(name, nullable=nullable,
+                         metadata=metadata)
+
+        assert not key_field.nullable
+        self.key_field = key_field
+        self.item_field = item_field
+        self.pair_field = StructField(entries_name, [key_field, item_field],
+                                      nullable=False)
+        self.keys_sorted = keys_sorted
+
+    def _get_type(self):
+        return OrderedDict([
+            ('name', 'map'),
+            ('keysSorted', self.keys_sorted)
+        ])
+
+    def _get_children(self):
+        return [self.pair_field.get_json()]
+
+    def generate_column(self, size, name=None):
+        MAX_MAP_SIZE = 4
+
+        is_valid = self._make_is_valid(size)
+        map_sizes = np.random.randint(0, MAX_MAP_SIZE + 1, size=size)
+        offsets = [0]
+
+        offset = 0
+        for i in range(size):
+            if is_valid[i]:
+                offset += int(map_sizes[i])
+            offsets.append(offset)
+
+        # The offset now is the total number of elements in the child array
+        pairs = self.pair_field.generate_column(offset)
+        if name is None:
+            name = self.name
+
+        return MapColumn(name, size, is_valid, offsets, pairs)
+
+
+class MapColumn(Column):
+
+    def __init__(self, name, count, is_valid, offsets, pairs):
+        super().__init__(name, count)
+        self.is_valid = is_valid
+        self.offsets = offsets
+        self.pairs = pairs
+
+    def _get_buffers(self):
+        return [
+            ('VALIDITY', [int(v) for v in self.is_valid]),
+            ('OFFSET', list(self.offsets))
+        ]
+
+    def _get_children(self):
+        return [self.pairs.get_json()]
+
+
+class FixedSizeListField(Field):
+
+    def __init__(self, name, value_field, list_size, *, nullable=True,
+                 metadata=None):
+        super().__init__(name, nullable=nullable,
+                         metadata=metadata)
+        self.value_field = value_field
+        self.list_size = list_size
+
+    def _get_type(self):
+        return OrderedDict([
+            ('name', 'fixedsizelist'),
+            ('listSize', self.list_size)
+        ])
+
+    def _get_children(self):
+        return [self.value_field.get_json()]
+
+    def generate_column(self, size, name=None):
+        is_valid = self._make_is_valid(size)
+        values = self.value_field.generate_column(size * self.list_size)
+
+        if name is None:
+            name = self.name
+        return FixedSizeListColumn(name, size, is_valid, values)
+
+
+class FixedSizeListColumn(Column):
+
+    def __init__(self, name, count, is_valid, values):
+        super().__init__(name, count)
+        self.is_valid = is_valid
+        self.values = values
+
+    def _get_buffers(self):
+        return [
+            ('VALIDITY', [int(v) for v in self.is_valid])
+        ]
+
+    def _get_children(self):
+        return [self.values.get_json()]
+
+
+class StructField(Field):
+
+    def __init__(self, name, fields, *, nullable=True,
+                 metadata=None):
+        super().__init__(name, nullable=nullable,
+                         metadata=metadata)
+        self.fields = fields
+
+    def _get_type(self):
+        return OrderedDict([
+            ('name', 'struct')
+        ])
+
+    def _get_children(self):
+        return [field.get_json() for field in self.fields]
+
+    def generate_column(self, size, name=None):
+        is_valid = self._make_is_valid(size)
+
+        field_values = [field.generate_column(size) for field in self.fields]
+        if name is None:
+            name = self.name
+        return StructColumn(name, size, is_valid, field_values)
+
+
+class _BaseUnionField(Field):
+
+    def __init__(self, name, fields, type_ids=None, *, nullable=True,
+                 metadata=None):
+        super().__init__(name, nullable=nullable, metadata=metadata)
+        if type_ids is None:
+            type_ids = list(range(fields))
+        else:
+            assert len(fields) == len(type_ids)
+        self.fields = fields
+        self.type_ids = type_ids
+        assert all(x >= 0 for x in self.type_ids)
+
+    def _get_type(self):
+        return OrderedDict([
+            ('name', 'union'),
+            ('mode', self.mode),
+            ('typeIds', self.type_ids),
+        ])
+
+    def _get_children(self):
+        return [field.get_json() for field in self.fields]
+
+    def _make_type_ids(self, size):
+        return np.random.choice(self.type_ids, size)
+
+
+class SparseUnionField(_BaseUnionField):
+    mode = 'SPARSE'
+
+    def generate_column(self, size, name=None):
+        array_type_ids = self._make_type_ids(size)
+        field_values = [field.generate_column(size) for field in self.fields]
+
+        if name is None:
+            name = self.name
+        return SparseUnionColumn(name, size, array_type_ids, field_values)
+
+
+class DenseUnionField(_BaseUnionField):
+    mode = 'DENSE'
+
+    def generate_column(self, size, name=None):
+        # Reverse mapping {logical type id => physical child id}
+        child_ids = [None] * (max(self.type_ids) + 1)
+        for i, type_id in enumerate(self.type_ids):
+            child_ids[type_id] = i
+
+        array_type_ids = self._make_type_ids(size)
+        offsets = []
+        child_sizes = [0] * len(self.fields)
+
+        for i in range(size):
+            child_id = child_ids[array_type_ids[i]]
+            offset = child_sizes[child_id]
+            offsets.append(offset)
+            child_sizes[child_id] = offset + 1
+
+        field_values = [
+            field.generate_column(child_size)
+            for field, child_size in zip(self.fields, child_sizes)]
+
+        if name is None:
+            name = self.name
+        return DenseUnionColumn(name, size, array_type_ids, offsets,
+                                field_values)
+
+
+class Dictionary(object):
+
+    def __init__(self, id_, field, size, name=None, ordered=False):
+        self.id_ = id_
+        self.field = field
+        self.values = field.generate_column(size=size, name=name)
+        self.ordered = ordered
+
+    def __len__(self):
+        return len(self.values)
+
+    def get_json(self):
+        dummy_batch = RecordBatch(len(self.values), [self.values])
+        return OrderedDict([
+            ('id', self.id_),
+            ('data', dummy_batch.get_json())
+        ])
+
+
+class DictionaryField(Field):
+
+    def __init__(self, name, index_field, dictionary, *, nullable=True,
+                 metadata=None):
+        super().__init__(name, nullable=nullable,
+                         metadata=metadata)
+        assert index_field.name == ''
+        assert isinstance(index_field, IntegerField)
+        assert isinstance(dictionary, Dictionary)
+
+        self.index_field = index_field
+        self.dictionary = dictionary
+
+    def _get_type(self):
+        return self.dictionary.field._get_type()
+
+    def _get_children(self):
+        return self.dictionary.field._get_children()
+
+    def _get_dictionary(self):
+        return OrderedDict([
+            ('id', self.dictionary.id_),
+            ('indexType', self.index_field._get_type()),
+            ('isOrdered', self.dictionary.ordered)
+        ])
+
+    def generate_column(self, size, name=None):
+        if name is None:
+            name = self.name
+        return self.index_field.generate_range(size, 0, len(self.dictionary),
+                                               name=name)
+
+
+ExtensionType = namedtuple(
+    'ExtensionType', ['extension_name', 'serialized', 'storage_field'])
+
+
+class ExtensionField(Field):
+
+    def __init__(self, name, extension_type, *, nullable=True, metadata=None):
+        metadata = (metadata or []) + [
+            ('ARROW:extension:name', extension_type.extension_name),
+            ('ARROW:extension:metadata', extension_type.serialized),
+        ]
+        super().__init__(name, nullable=nullable, metadata=metadata)
+        self.extension_type = extension_type
+
+    def _get_type(self):
+        return self.extension_type.storage_field._get_type()
+
+    def _get_children(self):
+        return self.extension_type.storage_field._get_children()
+
+    def _get_dictionary(self):
+        return self.extension_type.storage_field._get_dictionary()
+
+    def generate_column(self, size, name=None):
+        if name is None:
+            name = self.name
+        return self.extension_type.storage_field.generate_column(size, name)
+
+
+class StructColumn(Column):
+
+    def __init__(self, name, count, is_valid, field_values):
+        super().__init__(name, count)
+        self.is_valid = is_valid
+        self.field_values = field_values
+
+    def _get_buffers(self):
+        return [
+            ('VALIDITY', [int(v) for v in self.is_valid])
+        ]
+
+    def _get_children(self):
+        return [field.get_json() for field in self.field_values]
+
+
+class SparseUnionColumn(Column):
+
+    def __init__(self, name, count, type_ids, field_values):
+        super().__init__(name, count)
+        self.type_ids = type_ids
+        self.field_values = field_values
+
+    def _get_buffers(self):
+        return [
+            ('TYPE_ID', [int(v) for v in self.type_ids])
+        ]
+
+    def _get_children(self):
+        return [field.get_json() for field in self.field_values]
+
+
+class DenseUnionColumn(Column):
+
+    def __init__(self, name, count, type_ids, offsets, field_values):
+        super().__init__(name, count)
+        self.type_ids = type_ids
+        self.offsets = offsets
+        self.field_values = field_values
+
+    def _get_buffers(self):
+        return [
+            ('TYPE_ID', [int(v) for v in self.type_ids]),
+            ('OFFSET', [int(v) for v in self.offsets]),
+        ]
+
+    def _get_children(self):
+        return [field.get_json() for field in self.field_values]
+
+
+class RecordBatch(object):
+
+    def __init__(self, count, columns):
+        self.count = count
+        self.columns = columns
+
+    def get_json(self):
+        return OrderedDict([
+            ('count', self.count),
+            ('columns', [col.get_json() for col in self.columns])
+        ])
+
+
+class File(object):
+
+    def __init__(self, name, schema, batches, dictionaries=None,
+                 skip=None, path=None):
+        self.name = name
+        self.schema = schema
+        self.dictionaries = dictionaries or []
+        self.batches = batches
+        self.skip = set()
+        self.path = path
+        if skip:
+            self.skip.update(skip)
+
+    def get_json(self):
+        entries = [
+            ('schema', self.schema.get_json())
+        ]
+
+        if len(self.dictionaries) > 0:
+            entries.append(('dictionaries',
+                            [dictionary.get_json()
+                             for dictionary in self.dictionaries]))
+
+        entries.append(('batches', [batch.get_json()
+                                    for batch in self.batches]))
+        return OrderedDict(entries)
+
+    def write(self, path):
+        with open(path, 'wb') as f:
+            f.write(json.dumps(self.get_json(), indent=2).encode('utf-8'))
+        self.path = path
+
+    def skip_category(self, category):
+        """Skip this test for the given category.
+
+        Category should be SKIP_ARROW or SKIP_FLIGHT.
+        """
+        self.skip.add(category)
+        return self
+
+
+def get_field(name, type_, **kwargs):
+    if type_ == 'binary':
+        return BinaryField(name, **kwargs)
+    elif type_ == 'utf8':
+        return StringField(name, **kwargs)
+    elif type_ == 'largebinary':
+        return LargeBinaryField(name, **kwargs)
+    elif type_ == 'largeutf8':
+        return LargeStringField(name, **kwargs)
+    elif type_.startswith('fixedsizebinary_'):
+        byte_width = int(type_.split('_')[1])
+        return FixedSizeBinaryField(name, byte_width=byte_width, **kwargs)
+
+    dtype = np.dtype(type_)
+
+    if dtype.kind in ('i', 'u'):
+        signed = dtype.kind == 'i'
+        bit_width = dtype.itemsize * 8
+        return IntegerField(name, signed, bit_width, **kwargs)
+    elif dtype.kind == 'f':
+        bit_width = dtype.itemsize * 8
+        return FloatingPointField(name, bit_width, **kwargs)
+    elif dtype.kind == 'b':
+        return BooleanField(name, **kwargs)
+    else:
+        raise TypeError(dtype)
+
+
+def _generate_file(name, fields, batch_sizes, dictionaries=None, skip=None,
+                   metadata=None):
+    schema = Schema(fields, metadata=metadata)
+    batches = []
+    for size in batch_sizes:
+        columns = []
+        for field in fields:
+            col = field.generate_column(size)
+            columns.append(col)
+
+        batches.append(RecordBatch(size, columns))
+
+    return File(name, schema, batches, dictionaries, skip=skip)
+
+
+def generate_custom_metadata_case():
+    def meta(items):
+        # Generate a simple block of metadata where each value is '{}'.
+        # Keys are delimited by whitespace in `items`.
+        return [(k, '{}') for k in items.split()]
+
+    fields = [
+        get_field('sort_of_pandas', 'int8', metadata=meta('pandas')),
+
+        get_field('lots_of_meta', 'int8', metadata=meta('a b c d .. w x y z')),
+
+        get_field(
+            'unregistered_extension', 'int8',
+            metadata=[
+                ('ARROW:extension:name', '!nonexistent'),
+                ('ARROW:extension:metadata', ''),
+                ('ARROW:integration:allow_unregistered_extension', 'true'),
+            ]),
+
+        ListField('list_with_odd_values',
+                  get_field('item', 'int32', metadata=meta('odd_values'))),
+    ]
+
+    batch_sizes = [1]
+    return _generate_file('custom_metadata', fields, batch_sizes,
+                          metadata=meta('schema_custom_0 schema_custom_1'))
+
+
+def generate_duplicate_fieldnames_case():
+    fields = [
+        get_field('ints', 'int8'),
+        get_field('ints', 'int32'),
+
+        StructField('struct', [get_field('', 'int32'), get_field('', 'utf8')]),
+    ]
+
+    batch_sizes = [1]
+    return _generate_file('duplicate_fieldnames', fields, batch_sizes)
+
+
+def generate_primitive_case(batch_sizes, name='primitive'):
+    types = ['bool', 'int8', 'int16', 'int32', 'int64',
+             'uint8', 'uint16', 'uint32', 'uint64',
+             'float32', 'float64', 'binary', 'utf8',
+             'fixedsizebinary_19', 'fixedsizebinary_120']
+
+    fields = []
+
+    for type_ in types:
+        fields.append(get_field(type_ + "_nullable", type_, nullable=True))
+        fields.append(get_field(type_ + "_nonnullable", type_, nullable=False))
+
+    return _generate_file(name, fields, batch_sizes)
+
+
+def generate_primitive_large_offsets_case(batch_sizes):
+    types = ['largebinary', 'largeutf8']
+
+    fields = []
+
+    for type_ in types:
+        fields.append(get_field(type_ + "_nullable", type_, nullable=True))
+        fields.append(get_field(type_ + "_nonnullable", type_, nullable=False))
+
+    return _generate_file('primitive_large_offsets', fields, batch_sizes)
+
+
+def generate_null_case(batch_sizes):
+    # Interleave null with non-null types to ensure the appropriate number of
+    # buffers (0) is read and written
+    fields = [
+        NullField(name='f0'),
+        get_field('f1', 'int32'),
+        NullField(name='f2'),
+        get_field('f3', 'float64'),
+        NullField(name='f4')
+    ]
+    return _generate_file('null', fields, batch_sizes)
+
+
+def generate_null_trivial_case(batch_sizes):
+    # Generate a case with no buffers
+    fields = [
+        NullField(name='f0'),
+    ]
+    return _generate_file('null_trivial', fields, batch_sizes)
+
+
+def generate_decimal128_case():
+    fields = [
+        DecimalField(name='f{}'.format(i), precision=precision, scale=2,
+                     bit_width=128)
+        for i, precision in enumerate(range(3, 39))
+    ]
+
+    possible_batch_sizes = 7, 10
+    batch_sizes = [possible_batch_sizes[i % 2] for i in range(len(fields))]
+    # 'decimal' is the original name for the test, and it must match
+    # provide "gold" files that test backwards compatibility, so they
+    # can be appropriately skipped.
+    return _generate_file('decimal', fields, batch_sizes)
+
+
+def generate_decimal256_case():
+    fields = [
+        DecimalField(name='f{}'.format(i), precision=precision, scale=5,
+                     bit_width=256)
+        for i, precision in enumerate(range(37, 70))
+    ]
+
+    possible_batch_sizes = 7, 10
+    batch_sizes = [possible_batch_sizes[i % 2] for i in range(len(fields))]
+    return _generate_file('decimal256', fields, batch_sizes)
+
+
+def generate_datetime_case():
+    fields = [
+        DateField('f0', DateField.DAY),
+        DateField('f1', DateField.MILLISECOND),
+        TimeField('f2', 's'),
+        TimeField('f3', 'ms'),
+        TimeField('f4', 'us'),
+        TimeField('f5', 'ns'),
+        TimestampField('f6', 's'),
+        TimestampField('f7', 'ms'),
+        TimestampField('f8', 'us'),
+        TimestampField('f9', 'ns'),
+        TimestampField('f10', 'ms', tz=None),
+        TimestampField('f11', 's', tz='UTC'),
+        TimestampField('f12', 'ms', tz='US/Eastern'),
+        TimestampField('f13', 'us', tz='Europe/Paris'),
+        TimestampField('f14', 'ns', tz='US/Pacific'),
+    ]
+
+    batch_sizes = [7, 10]
+    return _generate_file("datetime", fields, batch_sizes)
+
+
+def generate_interval_case():
+    fields = [
+        DurationIntervalField('f1', 's'),
+        DurationIntervalField('f2', 'ms'),
+        DurationIntervalField('f3', 'us'),
+        DurationIntervalField('f4', 'ns'),
+        YearMonthIntervalField('f5'),
+        DayTimeIntervalField('f6'),
+    ]
+
+    batch_sizes = [7, 10]
+    return _generate_file("interval", fields, batch_sizes)
+
+
+def generate_month_day_nano_interval_case():
+    fields = [
+        MonthDayNanoIntervalField('f1'),
+    ]
+
+    batch_sizes = [7, 10]
+    return _generate_file("interval_mdn", fields, batch_sizes)
+
+
+def generate_map_case():
+    fields = [
+        MapField('map_nullable', get_field('key', 'utf8', nullable=False),
+                 get_field('value', 'int32')),
+    ]
+
+    batch_sizes = [7, 10]
+    return _generate_file("map", fields, batch_sizes)
+
+
+def generate_non_canonical_map_case():
+    fields = [
+        MapField('map_other_names',
+                 get_field('some_key', 'utf8', nullable=False),
+                 get_field('some_value', 'int32'),
+                 entries_name='some_entries'),
+    ]
+
+    batch_sizes = [7]
+    return _generate_file("map_non_canonical", fields, batch_sizes)
+
+
+def generate_nested_case():
+    fields = [
+        ListField('list_nullable', get_field('item', 'int32')),
+        FixedSizeListField('fixedsizelist_nullable',
+                           get_field('item', 'int32'), 4),
+        StructField('struct_nullable', [get_field('f1', 'int32'),
+                                        get_field('f2', 'utf8')]),
+        # Fails on Go (ARROW-8452)
+        # ListField('list_nonnullable', get_field('item', 'int32'),
+        #           nullable=False),
+    ]
+
+    batch_sizes = [7, 10]
+    return _generate_file("nested", fields, batch_sizes)
+
+
+def generate_recursive_nested_case():
+    fields = [
+        ListField('lists_list',
+                  ListField('inner_list', get_field('item', 'int16'))),
+        ListField('structs_list',
+                  StructField('inner_struct',
+                              [get_field('f1', 'int32'),
+                               get_field('f2', 'utf8')])),
+    ]
+
+    batch_sizes = [7, 10]
+    return _generate_file("recursive_nested", fields, batch_sizes)
+
+
+def generate_nested_large_offsets_case():
+    fields = [
+        LargeListField('large_list_nullable', get_field('item', 'int32')),
+        LargeListField('large_list_nonnullable',
+                       get_field('item', 'int32'), nullable=False),
+        LargeListField('large_list_nested',
+                       ListField('inner_list', get_field('item', 'int16'))),
+    ]
+
+    batch_sizes = [0, 13]
+    return _generate_file("nested_large_offsets", fields, batch_sizes)
+
+
+def generate_unions_case():
+    fields = [
+        SparseUnionField('sparse', [get_field('f1', 'int32'),
+                                    get_field('f2', 'utf8')],
+                         type_ids=[5, 7]),
+        DenseUnionField('dense', [get_field('f1', 'int16'),
+                                  get_field('f2', 'binary')],
+                        type_ids=[10, 20]),
+        SparseUnionField('sparse', [get_field('f1', 'float32', nullable=False),
+                                    get_field('f2', 'bool')],
+                         type_ids=[5, 7], nullable=False),
+        DenseUnionField('dense', [get_field('f1', 'uint8', nullable=False),
+                                  get_field('f2', 'uint16'),
+                                  NullField('f3')],
+                        type_ids=[42, 43, 44], nullable=False),
+    ]
+
+    batch_sizes = [0, 11]
+    return _generate_file("union", fields, batch_sizes)
+
+
+def generate_dictionary_case():
+    dict0 = Dictionary(0, StringField('dictionary1'), size=10, name='DICT0')
+    dict1 = Dictionary(1, StringField('dictionary1'), size=5, name='DICT1')
+    dict2 = Dictionary(2, get_field('dictionary2', 'int64'),
+                       size=50, name='DICT2')
+
+    fields = [
+        DictionaryField('dict0', get_field('', 'int8'), dict0),
+        DictionaryField('dict1', get_field('', 'int32'), dict1),
+        DictionaryField('dict2', get_field('', 'int16'), dict2)
+    ]
+    batch_sizes = [7, 10]
+    return _generate_file("dictionary", fields, batch_sizes,
+                          dictionaries=[dict0, dict1, dict2])
+
+
+def generate_dictionary_unsigned_case():
+    dict0 = Dictionary(0, StringField('dictionary0'), size=5, name='DICT0')
+    dict1 = Dictionary(1, StringField('dictionary1'), size=5, name='DICT1')
+    dict2 = Dictionary(2, StringField('dictionary2'), size=5, name='DICT2')
+
+    # TODO: JavaScript does not support uint64 dictionary indices, so disabled
+    # for now
+
+    # dict3 = Dictionary(3, StringField('dictionary3'), size=5, name='DICT3')
+    fields = [
+        DictionaryField('f0', get_field('', 'uint8'), dict0),
+        DictionaryField('f1', get_field('', 'uint16'), dict1),
+        DictionaryField('f2', get_field('', 'uint32'), dict2),
+        # DictionaryField('f3', get_field('', 'uint64'), dict3)
+    ]
+    batch_sizes = [7, 10]
+    return _generate_file("dictionary_unsigned", fields, batch_sizes,
+                          dictionaries=[dict0, dict1, dict2])
+
+
+def generate_nested_dictionary_case():
+    dict0 = Dictionary(0, StringField('str'), size=10, name='DICT0')
+
+    list_of_dict = ListField(
+        'list',
+        DictionaryField('str_dict', get_field('', 'int8'), dict0))
+    dict1 = Dictionary(1, list_of_dict, size=30, name='DICT1')
+
+    struct_of_dict = StructField('struct', [
+        DictionaryField('str_dict_a', get_field('', 'int8'), dict0),
+        DictionaryField('str_dict_b', get_field('', 'int8'), dict0)
+    ])
+    dict2 = Dictionary(2, struct_of_dict, size=30, name='DICT2')
+
+    fields = [
+        DictionaryField('list_dict', get_field('', 'int8'), dict1),
+        DictionaryField('struct_dict', get_field('', 'int8'), dict2)
+    ]
+
+    batch_sizes = [10, 13]
+    return _generate_file("nested_dictionary", fields, batch_sizes,
+                          dictionaries=[dict0, dict1, dict2])
+
+
+def generate_extension_case():
+    dict0 = Dictionary(0, StringField('dictionary0'), size=5, name='DICT0')
+
+    uuid_type = ExtensionType('uuid', 'uuid-serialized',
+                              FixedSizeBinaryField('', 16))
+    dict_ext_type = ExtensionType(
+        'dict-extension', 'dict-extension-serialized',
+        DictionaryField('str_dict', get_field('', 'int8'), dict0))
+
+    fields = [
+        ExtensionField('uuids', uuid_type),
+        ExtensionField('dict_exts', dict_ext_type),
+    ]
+
+    batch_sizes = [0, 13]
+    return _generate_file("extension", fields, batch_sizes,
+                          dictionaries=[dict0])
+
+
+def get_generated_json_files(tempdir=None):
+    tempdir = tempdir or tempfile.mkdtemp(prefix='arrow-integration-')
+
+    def _temp_path():
+        return
+
+    file_objs = [
+        generate_primitive_case([], name='primitive_no_batches'),
+        generate_primitive_case([17, 20], name='primitive'),
+        generate_primitive_case([0, 0, 0], name='primitive_zerolength'),
+
+        generate_primitive_large_offsets_case([17, 20])
+        .skip_category('C#')
+        .skip_category('Go')
+        .skip_category('JS'),
+
+        generate_null_case([10, 0])
+        .skip_category('C#')
+        .skip_category('JS'),   # TODO(ARROW-7900)
+
+        generate_null_trivial_case([0, 0])
+        .skip_category('C#')
+        .skip_category('JS'),   # TODO(ARROW-7900)
+
+        generate_decimal128_case()
+        .skip_category('Rust'),
+
+        generate_decimal256_case()
+        .skip_category('Go')  # TODO(ARROW-7948): Decimal + Go
+        .skip_category('JS')
+        .skip_category('Rust'),
+
+        generate_datetime_case()
+        .skip_category('C#'),
+
+        generate_interval_case()
+        .skip_category('C#')
+        .skip_category('JS')  # TODO(ARROW-5239): Intervals + JS
+        .skip_category('Rust'),
+
+        generate_month_day_nano_interval_case()
+        .skip_category('C#')
+        .skip_category('JS')
+        .skip_category('Rust'),
+
+
+        generate_map_case()
+        .skip_category('C#')
+        .skip_category('Rust'),
+
+        generate_non_canonical_map_case()
+        .skip_category('C#')
+        .skip_category('Java')   # TODO(ARROW-8715)
+        .skip_category('JS')     # TODO(ARROW-8716)
+        .skip_category('Rust'),
+
+        generate_nested_case()
+        .skip_category('C#'),
+
+        generate_recursive_nested_case()
+        .skip_category('C#'),
+
+        generate_nested_large_offsets_case()
+        .skip_category('C#')
+        .skip_category('Go')
+        .skip_category('JS')
+        .skip_category('Rust'),
+
+        generate_unions_case()
+        .skip_category('C#')
+        .skip_category('Go')
+        .skip_category('JS')
+        .skip_category('Rust'),
+
+        generate_custom_metadata_case()
+        .skip_category('C#')
+        .skip_category('JS'),
+
+        generate_duplicate_fieldnames_case()
+        .skip_category('C#')
+        .skip_category('Go')
+        .skip_category('JS'),
+
+        # TODO(ARROW-3039, ARROW-5267): Dictionaries in GO
+        generate_dictionary_case()
+        .skip_category('C#')
+        .skip_category('Go'),
+
+        generate_dictionary_unsigned_case()
+        .skip_category('C#')
+        .skip_category('Go')     # TODO(ARROW-9378)
+        .skip_category('Java'),  # TODO(ARROW-9377)
+
+        generate_nested_dictionary_case()
+        .skip_category('C#')
+        .skip_category('Go')
+        .skip_category('Java')  # TODO(ARROW-7779)
+        .skip_category('JS')
+        .skip_category('Rust'),
+
+        generate_extension_case()
+        .skip_category('C#')
+        .skip_category('Go')  # TODO(ARROW-3039): requires dictionaries
+        .skip_category('JS')
+        .skip_category('Rust'),
+    ]
+
+    generated_paths = []
+    for file_obj in file_objs:
+        out_path = os.path.join(tempdir, 'generated_' +
+                                file_obj.name + '.json')
+        file_obj.write(out_path)
+        generated_paths.append(file_obj)
+
+    return generated_paths
diff --git a/src/arrow/dev/archery/archery/integration/runner.py b/src/arrow/dev/archery/archery/integration/runner.py
new file mode 100644
index 000000000..463917b81
--- /dev/null
+++ b/src/arrow/dev/archery/archery/integration/runner.py
@@ -0,0 +1,429 @@
+# licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from collections import namedtuple
+from concurrent.futures import ThreadPoolExecutor
+from functools import partial
+import glob
+import gzip
+import itertools
+import os
+import sys
+import tempfile
+import traceback
+
+from .scenario import Scenario
+from .tester_cpp import CPPTester
+from .tester_go import GoTester
+from .tester_rust import RustTester
+from .tester_java import JavaTester
+from .tester_js import JSTester
+from .tester_csharp import CSharpTester
+from .util import (ARROW_ROOT_DEFAULT, guid, SKIP_ARROW, SKIP_FLIGHT,
+                   printer)
+from . import datagen
+
+
+Failure = namedtuple('Failure',
+                     ('test_case', 'producer', 'consumer', 'exc_info'))
+
+log = printer.print
+
+
+class Outcome:
+    def __init__(self):
+        self.failure = None
+        self.skipped = False
+
+
+class IntegrationRunner(object):
+
+    def __init__(self, json_files, flight_scenarios, testers, tempdir=None,
+                 debug=False, stop_on_error=True, gold_dirs=None,
+                 serial=False, match=None, **unused_kwargs):
+        self.json_files = json_files
+        self.flight_scenarios = flight_scenarios
+        self.testers = testers
+        self.temp_dir = tempdir or tempfile.mkdtemp()
+        self.debug = debug
+        self.stop_on_error = stop_on_error
+        self.serial = serial
+        self.gold_dirs = gold_dirs
+        self.failures = []
+        self.match = match
+
+        if self.match is not None:
+            print("-- Only running tests with {} in their name"
+                  .format(self.match))
+            self.json_files = [json_file for json_file in self.json_files
+                               if self.match in json_file.name]
+
+    def run(self):
+        """
+        Run Arrow IPC integration tests for the matrix of enabled
+        implementations.
+        """
+        for producer, consumer in itertools.product(
+                filter(lambda t: t.PRODUCER, self.testers),
+                filter(lambda t: t.CONSUMER, self.testers)):
+            self._compare_implementations(
+                producer, consumer, self._produce_consume,
+                self.json_files)
+        if self.gold_dirs:
+            for gold_dir, consumer in itertools.product(
+                    self.gold_dirs,
+                    filter(lambda t: t.CONSUMER, self.testers)):
+                log('\n\n\n\n')
+                log('******************************************************')
+                log('Tests against golden files in {}'.format(gold_dir))
+                log('******************************************************')
+
+                def run_gold(producer, consumer, outcome, test_case):
+                    self._run_gold(gold_dir, producer, consumer, outcome,
+                                   test_case)
+                self._compare_implementations(
+                    consumer, consumer, run_gold,
+                    self._gold_tests(gold_dir))
+
+    def run_flight(self):
+        """
+        Run Arrow Flight integration tests for the matrix of enabled
+        implementations.
+        """
+        servers = filter(lambda t: t.FLIGHT_SERVER, self.testers)
+        clients = filter(lambda t: (t.FLIGHT_CLIENT and t.CONSUMER),
+                         self.testers)
+        for server, client in itertools.product(servers, clients):
+            self._compare_flight_implementations(server, client)
+
+    def _gold_tests(self, gold_dir):
+        prefix = os.path.basename(os.path.normpath(gold_dir))
+        SUFFIX = ".json.gz"
+        golds = [jf for jf in os.listdir(gold_dir) if jf.endswith(SUFFIX)]
+        for json_path in golds:
+            name = json_path[json_path.index('_')+1: -len(SUFFIX)]
+            base_name = prefix + "_" + name + ".gold.json"
+            out_path = os.path.join(self.temp_dir, base_name)
+            with gzip.open(os.path.join(gold_dir, json_path)) as i:
+                with open(out_path, "wb") as out:
+                    out.write(i.read())
+
+            try:
+                skip = next(f for f in self.json_files
+                            if f.name == name).skip
+            except StopIteration:
+                skip = set()
+            if name == 'union' and prefix == '0.17.1':
+                skip.add("Java")
+            if prefix == '1.0.0-bigendian' or prefix == '1.0.0-littleendian':
+                skip.add("C#")
+                skip.add("Go")
+                skip.add("Java")
+                skip.add("JS")
+                skip.add("Rust")
+            if prefix == '2.0.0-compression':
+                skip.add("C#")
+                skip.add("JS")
+                skip.add("Rust")
+
+            # See https://github.com/apache/arrow/pull/9822 for how to
+            # disable specific compression type tests.
+
+            if prefix == '4.0.0-shareddict':
+                skip.add("C#")
+                skip.add("Go")
+
+            yield datagen.File(name, None, None, skip=skip, path=out_path)
+
+    def _run_test_cases(self, producer, consumer, case_runner,
+                        test_cases):
+        def case_wrapper(test_case):
+            with printer.cork():
+                return case_runner(test_case)
+
+        if self.failures and self.stop_on_error:
+            return
+
+        if self.serial:
+            for outcome in map(case_wrapper, test_cases):
+                if outcome.failure is not None:
+                    self.failures.append(outcome.failure)
+                    if self.stop_on_error:
+                        break
+
+        else:
+            with ThreadPoolExecutor() as executor:
+                for outcome in executor.map(case_wrapper, test_cases):
+                    if outcome.failure is not None:
+                        self.failures.append(outcome.failure)
+                        if self.stop_on_error:
+                            break
+
+    def _compare_implementations(
+            self, producer, consumer, run_binaries, test_cases):
+        """
+        Compare Arrow IPC for two implementations (one producer, one consumer).
+        """
+        log('##########################################################')
+        log('IPC: {0} producing, {1} consuming'
+            .format(producer.name, consumer.name))
+        log('##########################################################')
+
+        case_runner = partial(self._run_ipc_test_case,
+                              producer, consumer, run_binaries)
+        self._run_test_cases(producer, consumer, case_runner, test_cases)
+
+    def _run_ipc_test_case(self, producer, consumer, run_binaries, test_case):
+        """
+        Run one IPC test case.
+        """
+        outcome = Outcome()
+
+        json_path = test_case.path
+        log('==========================================================')
+        log('Testing file {0}'.format(json_path))
+        log('==========================================================')
+
+        if producer.name in test_case.skip:
+            log('-- Skipping test because producer {0} does '
+                'not support'.format(producer.name))
+            outcome.skipped = True
+
+        elif consumer.name in test_case.skip:
+            log('-- Skipping test because consumer {0} does '
+                'not support'.format(consumer.name))
+            outcome.skipped = True
+
+        elif SKIP_ARROW in test_case.skip:
+            log('-- Skipping test')
+            outcome.skipped = True
+
+        else:
+            try:
+                run_binaries(producer, consumer, outcome, test_case)
+            except Exception:
+                traceback.print_exc(file=printer.stdout)
+                outcome.failure = Failure(test_case, producer, consumer,
+                                          sys.exc_info())
+
+        return outcome
+
+    def _produce_consume(self, producer, consumer, outcome, test_case):
+        # Make the random access file
+        json_path = test_case.path
+        file_id = guid()[:8]
+        name = os.path.splitext(os.path.basename(json_path))[0]
+
+        producer_file_path = os.path.join(self.temp_dir, file_id + '_' +
+                                          name + '.json_as_file')
+        producer_stream_path = os.path.join(self.temp_dir, file_id + '_' +
+                                            name + '.producer_file_as_stream')
+        consumer_file_path = os.path.join(self.temp_dir, file_id + '_' +
+                                          name + '.consumer_stream_as_file')
+
+        log('-- Creating binary inputs')
+        producer.json_to_file(json_path, producer_file_path)
+
+        # Validate the file
+        log('-- Validating file')
+        consumer.validate(json_path, producer_file_path)
+
+        log('-- Validating stream')
+        producer.file_to_stream(producer_file_path, producer_stream_path)
+        consumer.stream_to_file(producer_stream_path, consumer_file_path)
+        consumer.validate(json_path, consumer_file_path)
+
+    def _run_gold(self, gold_dir, producer, consumer, outcome, test_case):
+        json_path = test_case.path
+
+        # Validate the file
+        log('-- Validating file')
+        producer_file_path = os.path.join(
+            gold_dir, "generated_" + test_case.name + ".arrow_file")
+        consumer.validate(json_path, producer_file_path)
+
+        log('-- Validating stream')
+        consumer_stream_path = os.path.join(
+            gold_dir, "generated_" + test_case.name + ".stream")
+        file_id = guid()[:8]
+        name = os.path.splitext(os.path.basename(json_path))[0]
+
+        consumer_file_path = os.path.join(self.temp_dir, file_id + '_' +
+                                          name + '.consumer_stream_as_file')
+
+        consumer.stream_to_file(consumer_stream_path, consumer_file_path)
+        consumer.validate(json_path, consumer_file_path)
+
+    def _compare_flight_implementations(self, producer, consumer):
+        log('##########################################################')
+        log('Flight: {0} serving, {1} requesting'
+            .format(producer.name, consumer.name))
+        log('##########################################################')
+
+        case_runner = partial(self._run_flight_test_case, producer, consumer)
+        self._run_test_cases(producer, consumer, case_runner,
+                             self.json_files + self.flight_scenarios)
+
+    def _run_flight_test_case(self, producer, consumer, test_case):
+        """
+        Run one Flight test case.
+        """
+        outcome = Outcome()
+
+        log('=' * 58)
+        log('Testing file {0}'.format(test_case.name))
+        log('=' * 58)
+
+        if producer.name in test_case.skip:
+            log('-- Skipping test because producer {0} does '
+                'not support'.format(producer.name))
+            outcome.skipped = True
+
+        elif consumer.name in test_case.skip:
+            log('-- Skipping test because consumer {0} does '
+                'not support'.format(consumer.name))
+            outcome.skipped = True
+
+        elif SKIP_FLIGHT in test_case.skip:
+            log('-- Skipping test')
+            outcome.skipped = True
+
+        else:
+            try:
+                if isinstance(test_case, Scenario):
+                    server = producer.flight_server(test_case.name)
+                    client_args = {'scenario_name': test_case.name}
+                else:
+                    server = producer.flight_server()
+                    client_args = {'json_path': test_case.path}
+
+                with server as port:
+                    # Have the client upload the file, then download and
+                    # compare
+                    consumer.flight_request(port, **client_args)
+            except Exception:
+                traceback.print_exc(file=printer.stdout)
+                outcome.failure = Failure(test_case, producer, consumer,
+                                          sys.exc_info())
+
+        return outcome
+
+
+def get_static_json_files():
+    glob_pattern = os.path.join(ARROW_ROOT_DEFAULT,
+                                'integration', 'data', '*.json')
+    return [
+        datagen.File(name=os.path.basename(p), path=p, skip=set(),
+                     schema=None, batches=None)
+        for p in glob.glob(glob_pattern)
+    ]
+
+
+def run_all_tests(with_cpp=True, with_java=True, with_js=True,
+                  with_csharp=True, with_go=True, with_rust=False,
+                  run_flight=False, tempdir=None, **kwargs):
+    tempdir = tempdir or tempfile.mkdtemp(prefix='arrow-integration-')
+
+    testers = []
+
+    if with_cpp:
+        testers.append(CPPTester(**kwargs))
+
+    if with_java:
+        testers.append(JavaTester(**kwargs))
+
+    if with_js:
+        testers.append(JSTester(**kwargs))
+
+    if with_csharp:
+        testers.append(CSharpTester(**kwargs))
+
+    if with_go:
+        testers.append(GoTester(**kwargs))
+
+    if with_rust:
+        testers.append(RustTester(**kwargs))
+
+    static_json_files = get_static_json_files()
+    generated_json_files = datagen.get_generated_json_files(tempdir=tempdir)
+    json_files = static_json_files + generated_json_files
+
+    # Additional integration test cases for Arrow Flight.
+    flight_scenarios = [
+        Scenario(
+            "auth:basic_proto",
+            description="Authenticate using the BasicAuth protobuf."),
+        Scenario(
+            "middleware",
+            description="Ensure headers are propagated via middleware.",
+            skip={"Rust"}   # TODO(ARROW-10961): tonic upgrade needed
+        ),
+    ]
+
+    runner = IntegrationRunner(json_files, flight_scenarios, testers, **kwargs)
+    runner.run()
+    if run_flight:
+        runner.run_flight()
+
+    fail_count = 0
+    if runner.failures:
+        log("################# FAILURES #################")
+        for test_case, producer, consumer, exc_info in runner.failures:
+            fail_count += 1
+            log("FAILED TEST:", end=" ")
+            log(test_case.name, producer.name, "producing, ",
+                consumer.name, "consuming")
+            if exc_info:
+                traceback.print_exception(*exc_info)
+            log()
+
+    log(fail_count, "failures")
+    if fail_count > 0:
+        sys.exit(1)
+
+
+def write_js_test_json(directory):
+    datagen.generate_map_case().write(
+        os.path.join(directory, 'map.json')
+    )
+    datagen.generate_nested_case().write(
+        os.path.join(directory, 'nested.json')
+    )
+    datagen.generate_decimal128_case().write(
+        os.path.join(directory, 'decimal.json')
+    )
+    datagen.generate_decimal256_case().write(
+        os.path.join(directory, 'decimal256.json')
+    )
+    datagen.generate_datetime_case().write(
+        os.path.join(directory, 'datetime.json')
+    )
+    datagen.generate_dictionary_case().write(
+        os.path.join(directory, 'dictionary.json')
+    )
+    datagen.generate_dictionary_unsigned_case().write(
+        os.path.join(directory, 'dictionary_unsigned.json')
+    )
+    datagen.generate_primitive_case([]).write(
+        os.path.join(directory, 'primitive_no_batches.json')
+    )
+    datagen.generate_primitive_case([7, 10]).write(
+        os.path.join(directory, 'primitive.json')
+    )
+    datagen.generate_primitive_case([0, 0, 0]).write(
+        os.path.join(directory, 'primitive-empty.json')
+    )
diff --git a/src/arrow/dev/archery/archery/integration/scenario.py b/src/arrow/dev/archery/archery/integration/scenario.py
new file mode 100644
index 000000000..1fcbca64e
--- /dev/null
+++ b/src/arrow/dev/archery/archery/integration/scenario.py
@@ -0,0 +1,29 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+
+class Scenario:
+    """
+    An integration test scenario for Arrow Flight.
+
+    Does not correspond to a particular IPC JSON file.
+    """
+
+    def __init__(self, name, description, skip=None):
+        self.name = name
+        self.description = description
+        self.skip = skip or set()
diff --git a/src/arrow/dev/archery/archery/integration/tester.py b/src/arrow/dev/archery/archery/integration/tester.py
new file mode 100644
index 000000000..122e4f2e4
--- /dev/null
+++ b/src/arrow/dev/archery/archery/integration/tester.py
@@ -0,0 +1,62 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+# Base class for language-specific integration test harnesses
+
+import subprocess
+
+from .util import log
+
+
+class Tester(object):
+    PRODUCER = False
+    CONSUMER = False
+    FLIGHT_SERVER = False
+    FLIGHT_CLIENT = False
+
+    def __init__(self, debug=False, **args):
+        self.args = args
+        self.debug = debug
+
+    def run_shell_command(self, cmd):
+        cmd = ' '.join(cmd)
+        if self.debug:
+            log(cmd)
+        subprocess.check_call(cmd, shell=True)
+
+    def json_to_file(self, json_path, arrow_path):
+        raise NotImplementedError
+
+    def stream_to_file(self, stream_path, file_path):
+        raise NotImplementedError
+
+    def file_to_stream(self, file_path, stream_path):
+        raise NotImplementedError
+
+    def validate(self, json_path, arrow_path):
+        raise NotImplementedError
+
+    def flight_server(self, scenario_name=None):
+        """Start the Flight server on a free port.
+
+        This should be a context manager that returns the port as the
+        managed object, and cleans up the server on exit.
+        """
+        raise NotImplementedError
+
+    def flight_request(self, port, json_path=None, scenario_name=None):
+        raise NotImplementedError
diff --git a/src/arrow/dev/archery/archery/integration/tester_cpp.py b/src/arrow/dev/archery/archery/integration/tester_cpp.py
new file mode 100644
index 000000000..d35c9550e
--- /dev/null
+++ b/src/arrow/dev/archery/archery/integration/tester_cpp.py
@@ -0,0 +1,116 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import contextlib
+import os
+import subprocess
+
+from .tester import Tester
+from .util import run_cmd, ARROW_ROOT_DEFAULT, log
+
+
+class CPPTester(Tester):
+    PRODUCER = True
+    CONSUMER = True
+    FLIGHT_SERVER = True
+    FLIGHT_CLIENT = True
+
+    EXE_PATH = os.environ.get(
+        'ARROW_CPP_EXE_PATH',
+        os.path.join(ARROW_ROOT_DEFAULT, 'cpp/build/debug'))
+
+    CPP_INTEGRATION_EXE = os.path.join(EXE_PATH, 'arrow-json-integration-test')
+    STREAM_TO_FILE = os.path.join(EXE_PATH, 'arrow-stream-to-file')
+    FILE_TO_STREAM = os.path.join(EXE_PATH, 'arrow-file-to-stream')
+
+    FLIGHT_SERVER_CMD = [
+        os.path.join(EXE_PATH, 'flight-test-integration-server')]
+    FLIGHT_CLIENT_CMD = [
+        os.path.join(EXE_PATH, 'flight-test-integration-client'),
+        "-host", "localhost"]
+
+    name = 'C++'
+
+    def _run(self, arrow_path=None, json_path=None, command='VALIDATE'):
+        cmd = [self.CPP_INTEGRATION_EXE, '--integration']
+
+        if arrow_path is not None:
+            cmd.append('--arrow=' + arrow_path)
+
+        if json_path is not None:
+            cmd.append('--json=' + json_path)
+
+        cmd.append('--mode=' + command)
+
+        if self.debug:
+            log(' '.join(cmd))
+
+        run_cmd(cmd)
+
+    def validate(self, json_path, arrow_path):
+        return self._run(arrow_path, json_path, 'VALIDATE')
+
+    def json_to_file(self, json_path, arrow_path):
+        return self._run(arrow_path, json_path, 'JSON_TO_ARROW')
+
+    def stream_to_file(self, stream_path, file_path):
+        cmd = [self.STREAM_TO_FILE, '<', stream_path, '>', file_path]
+        self.run_shell_command(cmd)
+
+    def file_to_stream(self, file_path, stream_path):
+        cmd = [self.FILE_TO_STREAM, file_path, '>', stream_path]
+        self.run_shell_command(cmd)
+
+    @contextlib.contextmanager
+    def flight_server(self, scenario_name=None):
+        cmd = self.FLIGHT_SERVER_CMD + ['-port=0']
+        if scenario_name:
+            cmd = cmd + ["-scenario", scenario_name]
+        if self.debug:
+            log(' '.join(cmd))
+        server = subprocess.Popen(cmd,
+                                  stdout=subprocess.PIPE,
+                                  stderr=subprocess.PIPE)
+        try:
+            output = server.stdout.readline().decode()
+            if not output.startswith("Server listening on localhost:"):
+                server.kill()
+                out, err = server.communicate()
+                raise RuntimeError(
+                    "Flight-C++ server did not start properly, "
+                    "stdout:\n{}\n\nstderr:\n{}\n"
+                    .format(output + out.decode(), err.decode()))
+            port = int(output.split(":")[1])
+            yield port
+        finally:
+            server.kill()
+            server.wait(5)
+
+    def flight_request(self, port, json_path=None, scenario_name=None):
+        cmd = self.FLIGHT_CLIENT_CMD + [
+            '-port=' + str(port),
+        ]
+        if json_path:
+            cmd.extend(('-path', json_path))
+        elif scenario_name:
+            cmd.extend(('-scenario', scenario_name))
+        else:
+            raise TypeError("Must provide one of json_path or scenario_name")
+
+        if self.debug:
+            log(' '.join(cmd))
+        run_cmd(cmd)
diff --git a/src/arrow/dev/archery/archery/integration/tester_csharp.py b/src/arrow/dev/archery/archery/integration/tester_csharp.py
new file mode 100644
index 000000000..130c49cfe
--- /dev/null
+++ b/src/arrow/dev/archery/archery/integration/tester_csharp.py
@@ -0,0 +1,67 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+
+from .tester import Tester
+from .util import run_cmd, ARROW_ROOT_DEFAULT, log
+
+
+class CSharpTester(Tester):
+    PRODUCER = True
+    CONSUMER = True
+
+    EXE_PATH = os.path.join(
+        ARROW_ROOT_DEFAULT,
+        'csharp/artifacts/Apache.Arrow.IntegrationTest',
+        'Debug/netcoreapp3.1/Apache.Arrow.IntegrationTest')
+
+    name = 'C#'
+
+    def _run(self, json_path=None, arrow_path=None, command='validate'):
+        cmd = [self.EXE_PATH]
+
+        cmd.extend(['--mode', command])
+
+        if json_path is not None:
+            cmd.extend(['-j', json_path])
+
+        if arrow_path is not None:
+            cmd.extend(['-a', arrow_path])
+
+        if self.debug:
+            log(' '.join(cmd))
+
+        run_cmd(cmd)
+
+    def validate(self, json_path, arrow_path):
+        return self._run(json_path, arrow_path, 'validate')
+
+    def json_to_file(self, json_path, arrow_path):
+        return self._run(json_path, arrow_path, 'json-to-arrow')
+
+    def stream_to_file(self, stream_path, file_path):
+        cmd = [self.EXE_PATH]
+        cmd.extend(['--mode', 'stream-to-file', '-a', file_path])
+        cmd.extend(['<', stream_path])
+        self.run_shell_command(cmd)
+
+    def file_to_stream(self, file_path, stream_path):
+        cmd = [self.EXE_PATH]
+        cmd.extend(['--mode', 'file-to-stream'])
+        cmd.extend(['-a', file_path, '>', stream_path])
+        self.run_shell_command(cmd)
diff --git a/src/arrow/dev/archery/archery/integration/tester_go.py b/src/arrow/dev/archery/archery/integration/tester_go.py
new file mode 100644
index 000000000..eeba38fe5
--- /dev/null
+++ b/src/arrow/dev/archery/archery/integration/tester_go.py
@@ -0,0 +1,119 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import contextlib
+import os
+import subprocess
+
+from .tester import Tester
+from .util import run_cmd, log
+
+
+class GoTester(Tester):
+    PRODUCER = True
+    CONSUMER = True
+    FLIGHT_SERVER = True
+    FLIGHT_CLIENT = True
+
+    # FIXME(sbinet): revisit for Go modules
+    HOME = os.getenv('HOME', '~')
+    GOPATH = os.getenv('GOPATH', os.path.join(HOME, 'go'))
+    GOBIN = os.environ.get('GOBIN', os.path.join(GOPATH, 'bin'))
+
+    GO_INTEGRATION_EXE = os.path.join(GOBIN, 'arrow-json-integration-test')
+    STREAM_TO_FILE = os.path.join(GOBIN, 'arrow-stream-to-file')
+    FILE_TO_STREAM = os.path.join(GOBIN, 'arrow-file-to-stream')
+
+    FLIGHT_SERVER_CMD = [
+        os.path.join(GOBIN, 'arrow-flight-integration-server')]
+    FLIGHT_CLIENT_CMD = [
+        os.path.join(GOBIN, 'arrow-flight-integration-client'),
+        '-host', 'localhost']
+
+    name = 'Go'
+
+    def _run(self, arrow_path=None, json_path=None, command='VALIDATE'):
+        cmd = [self.GO_INTEGRATION_EXE]
+
+        if arrow_path is not None:
+            cmd.extend(['-arrow', arrow_path])
+
+        if json_path is not None:
+            cmd.extend(['-json', json_path])
+
+        cmd.extend(['-mode', command])
+
+        if self.debug:
+            log(' '.join(cmd))
+
+        run_cmd(cmd)
+
+    def validate(self, json_path, arrow_path):
+        return self._run(arrow_path, json_path, 'VALIDATE')
+
+    def json_to_file(self, json_path, arrow_path):
+        return self._run(arrow_path, json_path, 'JSON_TO_ARROW')
+
+    def stream_to_file(self, stream_path, file_path):
+        cmd = [self.STREAM_TO_FILE, '<', stream_path, '>', file_path]
+        self.run_shell_command(cmd)
+
+    def file_to_stream(self, file_path, stream_path):
+        cmd = [self.FILE_TO_STREAM, file_path, '>', stream_path]
+        self.run_shell_command(cmd)
+
+    @contextlib.contextmanager
+    def flight_server(self, scenario_name=None):
+        cmd = self.FLIGHT_SERVER_CMD + ['-port=0']
+        if scenario_name:
+            cmd = cmd + ['-scenario', scenario_name]
+        if self.debug:
+            log(' '.join(cmd))
+        server = subprocess.Popen(cmd,
+                                  stdout=subprocess.PIPE,
+                                  stderr=subprocess.PIPE)
+
+        try:
+            output = server.stdout.readline().decode()
+            if not output.startswith("Server listening on localhost:"):
+                server.kill()
+                out, err = server.communicate()
+                raise RuntimeError(
+                    "Flight-Go server did not start properly, "
+                    "stdout: \n{}\n\nstderr:\n{}\n"
+                    .format(output + out.decode(), err.decode())
+                )
+            port = int(output.split(":")[1])
+            yield port
+        finally:
+            server.kill()
+            server.wait(5)
+
+    def flight_request(self, port, json_path=None, scenario_name=None):
+        cmd = self.FLIGHT_CLIENT_CMD + [
+            '-port=' + str(port),
+        ]
+        if json_path:
+            cmd.extend(('-path', json_path))
+        elif scenario_name:
+            cmd.extend(('-scenario', scenario_name))
+        else:
+            raise TypeError("Must provide one of json_path or scenario_name")
+
+        if self.debug:
+            log(' '.join(cmd))
+        run_cmd(cmd)
diff --git a/src/arrow/dev/archery/archery/integration/tester_java.py b/src/arrow/dev/archery/archery/integration/tester_java.py
new file mode 100644
index 000000000..f283f6cd2
--- /dev/null
+++ b/src/arrow/dev/archery/archery/integration/tester_java.py
@@ -0,0 +1,140 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import contextlib
+import os
+import subprocess
+
+from .tester import Tester
+from .util import run_cmd, ARROW_ROOT_DEFAULT, log
+
+
+def load_version_from_pom():
+    import xml.etree.ElementTree as ET
+    tree = ET.parse(os.path.join(ARROW_ROOT_DEFAULT, 'java', 'pom.xml'))
+    tag_pattern = '{http://maven.apache.org/POM/4.0.0}version'
+    version_tag = list(tree.getroot().findall(tag_pattern))[0]
+    return version_tag.text
+
+
+class JavaTester(Tester):
+    PRODUCER = True
+    CONSUMER = True
+    FLIGHT_SERVER = True
+    FLIGHT_CLIENT = True
+
+    JAVA_OPTS = ['-Dio.netty.tryReflectionSetAccessible=true',
+                 '-Darrow.struct.conflict.policy=CONFLICT_APPEND']
+
+    _arrow_version = load_version_from_pom()
+    ARROW_TOOLS_JAR = os.environ.get(
+        'ARROW_JAVA_INTEGRATION_JAR',
+        os.path.join(ARROW_ROOT_DEFAULT,
+                     'java/tools/target/arrow-tools-{}-'
+                     'jar-with-dependencies.jar'.format(_arrow_version)))
+    ARROW_FLIGHT_JAR = os.environ.get(
+        'ARROW_FLIGHT_JAVA_INTEGRATION_JAR',
+        os.path.join(ARROW_ROOT_DEFAULT,
+                     'java/flight/flight-core/target/flight-core-{}-'
+                     'jar-with-dependencies.jar'.format(_arrow_version)))
+    ARROW_FLIGHT_SERVER = ('org.apache.arrow.flight.example.integration.'
+                           'IntegrationTestServer')
+    ARROW_FLIGHT_CLIENT = ('org.apache.arrow.flight.example.integration.'
+                           'IntegrationTestClient')
+
+    name = 'Java'
+
+    def _run(self, arrow_path=None, json_path=None, command='VALIDATE'):
+        cmd = ['java'] + self.JAVA_OPTS + \
+            ['-cp', self.ARROW_TOOLS_JAR, 'org.apache.arrow.tools.Integration']
+
+        if arrow_path is not None:
+            cmd.extend(['-a', arrow_path])
+
+        if json_path is not None:
+            cmd.extend(['-j', json_path])
+
+        cmd.extend(['-c', command])
+
+        if self.debug:
+            log(' '.join(cmd))
+
+        run_cmd(cmd)
+
+    def validate(self, json_path, arrow_path):
+        return self._run(arrow_path, json_path, 'VALIDATE')
+
+    def json_to_file(self, json_path, arrow_path):
+        return self._run(arrow_path, json_path, 'JSON_TO_ARROW')
+
+    def stream_to_file(self, stream_path, file_path):
+        cmd = ['java'] + self.JAVA_OPTS + \
+            ['-cp', self.ARROW_TOOLS_JAR,
+             'org.apache.arrow.tools.StreamToFile', stream_path, file_path]
+        if self.debug:
+            log(' '.join(cmd))
+        run_cmd(cmd)
+
+    def file_to_stream(self, file_path, stream_path):
+        cmd = ['java'] + self.JAVA_OPTS + \
+            ['-cp', self.ARROW_TOOLS_JAR,
+             'org.apache.arrow.tools.FileToStream', file_path, stream_path]
+        if self.debug:
+            log(' '.join(cmd))
+        run_cmd(cmd)
+
+    def flight_request(self, port, json_path=None, scenario_name=None):
+        cmd = ['java'] + self.JAVA_OPTS + \
+            ['-cp', self.ARROW_FLIGHT_JAR, self.ARROW_FLIGHT_CLIENT,
+             '-port', str(port)]
+
+        if json_path:
+            cmd.extend(('-j', json_path))
+        elif scenario_name:
+            cmd.extend(('-scenario', scenario_name))
+        else:
+            raise TypeError("Must provide one of json_path or scenario_name")
+
+        if self.debug:
+            log(' '.join(cmd))
+        run_cmd(cmd)
+
+    @contextlib.contextmanager
+    def flight_server(self, scenario_name=None):
+        cmd = ['java'] + self.JAVA_OPTS + \
+            ['-cp', self.ARROW_FLIGHT_JAR, self.ARROW_FLIGHT_SERVER,
+             '-port', '0']
+        if scenario_name:
+            cmd.extend(('-scenario', scenario_name))
+        if self.debug:
+            log(' '.join(cmd))
+        server = subprocess.Popen(cmd, stdout=subprocess.PIPE,
+                                  stderr=subprocess.PIPE)
+        try:
+            output = server.stdout.readline().decode()
+            if not output.startswith("Server listening on localhost:"):
+                server.kill()
+                out, err = server.communicate()
+                raise RuntimeError(
+                    "Flight-Java server did not start properly, "
+                    "stdout:\n{}\n\nstderr:\n{}\n"
+                    .format(output + out.decode(), err.decode()))
+            port = int(output.split(":")[1])
+            yield port
+        finally:
+            server.kill()
+            server.wait(5)
diff --git a/src/arrow/dev/archery/archery/integration/tester_js.py b/src/arrow/dev/archery/archery/integration/tester_js.py
new file mode 100644
index 000000000..e24eec0ca
--- /dev/null
+++ b/src/arrow/dev/archery/archery/integration/tester_js.py
@@ -0,0 +1,73 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+
+from .tester import Tester
+from .util import run_cmd, ARROW_ROOT_DEFAULT, log
+
+
+class JSTester(Tester):
+    PRODUCER = True
+    CONSUMER = True
+
+    EXE_PATH = os.path.join(ARROW_ROOT_DEFAULT, 'js/bin')
+    VALIDATE = os.path.join(EXE_PATH, 'integration.js')
+    JSON_TO_ARROW = os.path.join(EXE_PATH, 'json-to-arrow.js')
+    STREAM_TO_FILE = os.path.join(EXE_PATH, 'stream-to-file.js')
+    FILE_TO_STREAM = os.path.join(EXE_PATH, 'file-to-stream.js')
+
+    name = 'JS'
+
+    def _run(self, exe_cmd, arrow_path=None, json_path=None,
+             command='VALIDATE'):
+        cmd = [exe_cmd]
+
+        if arrow_path is not None:
+            cmd.extend(['-a', arrow_path])
+
+        if json_path is not None:
+            cmd.extend(['-j', json_path])
+
+        cmd.extend(['--mode', command])
+
+        if self.debug:
+            log(' '.join(cmd))
+
+        run_cmd(cmd)
+
+    def validate(self, json_path, arrow_path):
+        return self._run(self.VALIDATE, arrow_path, json_path, 'VALIDATE')
+
+    def json_to_file(self, json_path, arrow_path):
+        cmd = ['node',
+               '--no-warnings', self.JSON_TO_ARROW,
+               '-a', arrow_path,
+               '-j', json_path]
+        self.run_shell_command(cmd)
+
+    def stream_to_file(self, stream_path, file_path):
+        cmd = ['node', '--no-warnings', self.STREAM_TO_FILE,
+               '<', stream_path,
+               '>', file_path]
+        self.run_shell_command(cmd)
+
+    def file_to_stream(self, file_path, stream_path):
+        cmd = ['node', '--no-warnings', self.FILE_TO_STREAM,
+               '<', file_path,
+               '>', stream_path]
+        self.run_shell_command(cmd)
diff --git a/src/arrow/dev/archery/archery/integration/tester_rust.py b/src/arrow/dev/archery/archery/integration/tester_rust.py
new file mode 100644
index 000000000..bca80ebae
--- /dev/null
+++ b/src/arrow/dev/archery/archery/integration/tester_rust.py
@@ -0,0 +1,115 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import contextlib
+import os
+import subprocess
+
+from .tester import Tester
+from .util import run_cmd, ARROW_ROOT_DEFAULT, log
+
+
+class RustTester(Tester):
+    PRODUCER = True
+    CONSUMER = True
+    FLIGHT_SERVER = True
+    FLIGHT_CLIENT = True
+
+    EXE_PATH = os.path.join(ARROW_ROOT_DEFAULT, 'rust/target/debug')
+
+    RUST_INTEGRATION_EXE = os.path.join(EXE_PATH,
+                                        'arrow-json-integration-test')
+    STREAM_TO_FILE = os.path.join(EXE_PATH, 'arrow-stream-to-file')
+    FILE_TO_STREAM = os.path.join(EXE_PATH, 'arrow-file-to-stream')
+
+    FLIGHT_SERVER_CMD = [
+        os.path.join(EXE_PATH, 'flight-test-integration-server')]
+    FLIGHT_CLIENT_CMD = [
+        os.path.join(EXE_PATH, 'flight-test-integration-client'),
+        "--host", "localhost"]
+
+    name = 'Rust'
+
+    def _run(self, arrow_path=None, json_path=None, command='VALIDATE'):
+        cmd = [self.RUST_INTEGRATION_EXE, '--integration']
+
+        if arrow_path is not None:
+            cmd.append('--arrow=' + arrow_path)
+
+        if json_path is not None:
+            cmd.append('--json=' + json_path)
+
+        cmd.append('--mode=' + command)
+
+        if self.debug:
+            log(' '.join(cmd))
+
+        run_cmd(cmd)
+
+    def validate(self, json_path, arrow_path):
+        return self._run(arrow_path, json_path, 'VALIDATE')
+
+    def json_to_file(self, json_path, arrow_path):
+        return self._run(arrow_path, json_path, 'JSON_TO_ARROW')
+
+    def stream_to_file(self, stream_path, file_path):
+        cmd = [self.STREAM_TO_FILE, '<', stream_path, '>', file_path]
+        self.run_shell_command(cmd)
+
+    def file_to_stream(self, file_path, stream_path):
+        cmd = [self.FILE_TO_STREAM, file_path, '>', stream_path]
+        self.run_shell_command(cmd)
+
+    @contextlib.contextmanager
+    def flight_server(self, scenario_name=None):
+        cmd = self.FLIGHT_SERVER_CMD + ['--port=0']
+        if scenario_name:
+            cmd = cmd + ["--scenario", scenario_name]
+        if self.debug:
+            log(' '.join(cmd))
+        server = subprocess.Popen(cmd,
+                                  stdout=subprocess.PIPE,
+                                  stderr=subprocess.PIPE)
+        try:
+            output = server.stdout.readline().decode()
+            if not output.startswith("Server listening on localhost:"):
+                server.kill()
+                out, err = server.communicate()
+                raise RuntimeError(
+                    "Flight-Rust server did not start properly, "
+                    "stdout:\n{}\n\nstderr:\n{}\n"
+                    .format(output + out.decode(), err.decode()))
+            port = int(output.split(":")[1])
+            yield port
+        finally:
+            server.kill()
+            server.wait(5)
+
+    def flight_request(self, port, json_path=None, scenario_name=None):
+        cmd = self.FLIGHT_CLIENT_CMD + [
+            '--port=' + str(port),
+        ]
+        if json_path:
+            cmd.extend(('--path', json_path))
+        elif scenario_name:
+            cmd.extend(('--scenario', scenario_name))
+        else:
+            raise TypeError("Must provide one of json_path or scenario_name")
+
+        if self.debug:
+            log(' '.join(cmd))
+        run_cmd(cmd)
diff --git a/src/arrow/dev/archery/archery/integration/util.py b/src/arrow/dev/archery/archery/integration/util.py
new file mode 100644
index 000000000..a4c4982ec
--- /dev/null
+++ b/src/arrow/dev/archery/archery/integration/util.py
@@ -0,0 +1,166 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import contextlib
+import io
+import os
+import random
+import socket
+import subprocess
+import sys
+import threading
+import uuid
+
+import numpy as np
+
+
+def guid():
+    return uuid.uuid4().hex
+
+
+# SKIP categories
+SKIP_ARROW = 'arrow'
+SKIP_FLIGHT = 'flight'
+
+ARROW_ROOT_DEFAULT = os.environ.get(
+    'ARROW_ROOT',
+    os.path.abspath(__file__).rsplit("/", 5)[0]
+)
+
+
+class _Printer:
+    """
+    A print()-providing object that can override the stream output on
+    a per-thread basis.
+    """
+
+    def __init__(self):
+        self._tls = threading.local()
+
+    def _get_stdout(self):
+        try:
+            return self._tls.stdout
+        except AttributeError:
+            self._tls.stdout = sys.stdout
+            self._tls.corked = False
+            return self._tls.stdout
+
+    def print(self, *args, **kwargs):
+        """
+        A variant of print() that writes to a thread-local stream.
+        """
+        print(*args, file=self._get_stdout(), **kwargs)
+
+    @property
+    def stdout(self):
+        """
+        A thread-local stdout wrapper that may be temporarily buffered
+        using `cork()`.
+        """
+        return self._get_stdout()
+
+    @contextlib.contextmanager
+    def cork(self):
+        """
+        Temporarily buffer this thread's stream and write out its contents
+        at the end of the context manager.  Useful to avoid interleaved
+        output when multiple threads output progress information.
+        """
+        outer_stdout = self._get_stdout()
+        assert not self._tls.corked, "reentrant call"
+        inner_stdout = self._tls.stdout = io.StringIO()
+        self._tls.corked = True
+        try:
+            yield
+        finally:
+            self._tls.stdout = outer_stdout
+            self._tls.corked = False
+            outer_stdout.write(inner_stdout.getvalue())
+            outer_stdout.flush()
+
+
+printer = _Printer()
+log = printer.print
+
+
+_RAND_CHARS = np.array(list("abcdefghijklmnop123456Ârrôwµ£°€矢"), dtype="U")
+
+
+def random_utf8(nchars):
+    """
+    Generate one random UTF8 string.
+    """
+    return ''.join(np.random.choice(_RAND_CHARS, nchars))
+
+
+def random_bytes(nbytes):
+    """
+    Generate one random binary string.
+    """
+    # NOTE getrandbits(0) fails
+    if nbytes > 0:
+        return random.getrandbits(nbytes * 8).to_bytes(nbytes,
+                                                       byteorder='little')
+    else:
+        return b""
+
+
+def tobytes(o):
+    if isinstance(o, str):
+        return o.encode('utf8')
+    return o
+
+
+def frombytes(o):
+    if isinstance(o, bytes):
+        return o.decode('utf8')
+    return o
+
+
+def run_cmd(cmd):
+    if isinstance(cmd, str):
+        cmd = cmd.split(' ')
+
+    try:
+        output = subprocess.check_output(cmd, stderr=subprocess.STDOUT)
+    except subprocess.CalledProcessError as e:
+        # this avoids hiding the stdout / stderr of failed processes
+        sio = io.StringIO()
+        print('Command failed:', " ".join(cmd), file=sio)
+        print('With output:', file=sio)
+        print('--------------', file=sio)
+        print(frombytes(e.output), file=sio)
+        print('--------------', file=sio)
+        raise RuntimeError(sio.getvalue())
+
+    return frombytes(output)
+
+
+# Adapted from CPython
+def find_unused_port(family=socket.AF_INET, socktype=socket.SOCK_STREAM):
+    """Returns an unused port that should be suitable for binding.  This is
+    achieved by creating a temporary socket with the same family and type as
+    the 'sock' parameter (default is AF_INET, SOCK_STREAM), and binding it to
+    the specified host address (defaults to 0.0.0.0) with the port set to 0,
+    eliciting an unused ephemeral port from the OS.  The temporary socket is
+    then closed and deleted, and the ephemeral port is returned.
+    """
+    with socket.socket(family, socktype) as tempsock:
+        tempsock.bind(('', 0))
+        port = tempsock.getsockname()[1]
+    del tempsock
+    return port
diff --git a/src/arrow/dev/archery/archery/lang/__init__.py b/src/arrow/dev/archery/archery/lang/__init__.py
new file mode 100644
index 000000000..13a83393a
--- /dev/null
+++ b/src/arrow/dev/archery/archery/lang/__init__.py
@@ -0,0 +1,16 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
diff --git a/src/arrow/dev/archery/archery/lang/cpp.py b/src/arrow/dev/archery/archery/lang/cpp.py
new file mode 100644
index 000000000..c2b1ca680
--- /dev/null
+++ b/src/arrow/dev/archery/archery/lang/cpp.py
@@ -0,0 +1,296 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+
+from ..utils.cmake import CMakeDefinition
+
+
+def truthifier(value):
+    return "ON" if value else "OFF"
+
+
+def or_else(value, default):
+    return value if value else default
+
+
+def coalesce(value, fallback):
+    return fallback if value is None else value
+
+
+LLVM_VERSION = 7
+
+
+class CppConfiguration:
+    def __init__(self,
+
+                 # toolchain
+                 cc=None, cxx=None, cxx_flags=None,
+                 build_type=None, warn_level=None,
+                 cpp_package_prefix=None, install_prefix=None, use_conda=None,
+                 build_static=False, build_shared=True, build_unity=True,
+                 # tests & examples
+                 with_tests=None, with_benchmarks=None, with_examples=None,
+                 with_integration=None,
+                 # static checks
+                 use_asan=None, use_tsan=None, use_ubsan=None,
+                 with_fuzzing=None,
+                 # Components
+                 with_compute=None, with_csv=None, with_cuda=None,
+                 with_dataset=None, with_filesystem=None, with_flight=None,
+                 with_gandiva=None, with_hdfs=None, with_hiveserver2=None,
+                 with_ipc=True, with_json=None, with_jni=None,
+                 with_mimalloc=None,
+                 with_parquet=None, with_plasma=None, with_python=True,
+                 with_r=None, with_s3=None,
+                 # Compressions
+                 with_brotli=None, with_bz2=None, with_lz4=None,
+                 with_snappy=None, with_zlib=None, with_zstd=None,
+                 # extras
+                 with_lint_only=False,
+                 use_gold_linker=True,
+                 simd_level="SSE4_2",
+                 cmake_extras=None):
+        self._cc = cc
+        self._cxx = cxx
+        self.cxx_flags = cxx_flags
+
+        self._build_type = build_type
+        self.warn_level = warn_level
+        self._install_prefix = install_prefix
+        self._package_prefix = cpp_package_prefix
+        self._use_conda = use_conda
+        self.build_static = build_static
+        self.build_shared = build_shared
+        self.build_unity = build_unity
+
+        self.with_tests = with_tests
+        self.with_benchmarks = with_benchmarks
+        self.with_examples = with_examples
+        self.with_integration = with_integration
+
+        self.use_asan = use_asan
+        self.use_tsan = use_tsan
+        self.use_ubsan = use_ubsan
+        self.with_fuzzing = with_fuzzing
+
+        self.with_compute = with_compute
+        self.with_csv = with_csv
+        self.with_cuda = with_cuda
+        self.with_dataset = with_dataset
+        self.with_filesystem = with_filesystem
+        self.with_flight = with_flight
+        self.with_gandiva = with_gandiva
+        self.with_hdfs = with_hdfs
+        self.with_hiveserver2 = with_hiveserver2
+        self.with_ipc = with_ipc
+        self.with_json = with_json
+        self.with_jni = with_jni
+        self.with_mimalloc = with_mimalloc
+        self.with_parquet = with_parquet
+        self.with_plasma = with_plasma
+        self.with_python = with_python
+        self.with_r = with_r
+        self.with_s3 = with_s3
+
+        self.with_brotli = with_brotli
+        self.with_bz2 = with_bz2
+        self.with_lz4 = with_lz4
+        self.with_snappy = with_snappy
+        self.with_zlib = with_zlib
+        self.with_zstd = with_zstd
+
+        self.with_lint_only = with_lint_only
+        self.use_gold_linker = use_gold_linker
+        self.simd_level = simd_level
+
+        self.cmake_extras = cmake_extras
+
+        # Fixup required dependencies by providing sane defaults if the caller
+        # didn't specify the option.
+        if self.with_r:
+            self.with_csv = coalesce(with_csv, True)
+            self.with_dataset = coalesce(with_dataset, True)
+            self.with_filesystem = coalesce(with_filesystem, True)
+            self.with_ipc = coalesce(with_ipc, True)
+            self.with_json = coalesce(with_json, True)
+            self.with_parquet = coalesce(with_parquet, True)
+
+        if self.with_python:
+            self.with_zlib = coalesce(with_zlib, True)
+            self.with_lz4 = coalesce(with_lz4, True)
+
+        if self.with_dataset:
+            self.with_filesystem = coalesce(with_filesystem, True)
+            self.with_parquet = coalesce(with_parquet, True)
+
+        if self.with_parquet:
+            self.with_snappy = coalesce(with_snappy, True)
+
+    @property
+    def build_type(self):
+        if self._build_type:
+            return self._build_type
+
+        if self.with_fuzzing:
+            return "relwithdebinfo"
+
+        return "release"
+
+    @property
+    def cc(self):
+        if self._cc:
+            return self._cc
+
+        if self.with_fuzzing:
+            return "clang-{}".format(LLVM_VERSION)
+
+        return None
+
+    @property
+    def cxx(self):
+        if self._cxx:
+            return self._cxx
+
+        if self.with_fuzzing:
+            return "clang++-{}".format(LLVM_VERSION)
+
+        return None
+
+    def _gen_defs(self):
+        if self.cxx_flags:
+            yield ("ARROW_CXXFLAGS", self.cxx_flags)
+
+        yield ("CMAKE_EXPORT_COMPILE_COMMANDS", truthifier(True))
+        yield ("CMAKE_BUILD_TYPE", self.build_type)
+
+        if not self.with_lint_only:
+            yield ("BUILD_WARNING_LEVEL",
+                   or_else(self.warn_level, "production"))
+
+        # if not ctx.quiet:
+        #   yield ("ARROW_VERBOSE_THIRDPARTY_BUILD", "ON")
+
+        maybe_prefix = self.install_prefix
+        if maybe_prefix:
+            yield ("CMAKE_INSTALL_PREFIX", maybe_prefix)
+
+        if self._package_prefix is not None:
+            yield ("ARROW_DEPENDENCY_SOURCE", "SYSTEM")
+            yield ("ARROW_PACKAGE_PREFIX", self._package_prefix)
+
+        yield ("ARROW_BUILD_STATIC", truthifier(self.build_static))
+        yield ("ARROW_BUILD_SHARED", truthifier(self.build_shared))
+        yield ("CMAKE_UNITY_BUILD", truthifier(self.build_unity))
+
+        # Tests and benchmarks
+        yield ("ARROW_BUILD_TESTS", truthifier(self.with_tests))
+        yield ("ARROW_BUILD_BENCHMARKS", truthifier(self.with_benchmarks))
+        yield ("ARROW_BUILD_EXAMPLES", truthifier(self.with_examples))
+        yield ("ARROW_BUILD_INTEGRATION", truthifier(self.with_integration))
+
+        # Static checks
+        yield ("ARROW_USE_ASAN", truthifier(self.use_asan))
+        yield ("ARROW_USE_TSAN", truthifier(self.use_tsan))
+        yield ("ARROW_USE_UBSAN", truthifier(self.use_ubsan))
+        yield ("ARROW_FUZZING", truthifier(self.with_fuzzing))
+
+        # Components
+        yield ("ARROW_COMPUTE", truthifier(self.with_compute))
+        yield ("ARROW_CSV", truthifier(self.with_csv))
+        yield ("ARROW_CUDA", truthifier(self.with_cuda))
+        yield ("ARROW_DATASET", truthifier(self.with_dataset))
+        yield ("ARROW_FILESYSTEM", truthifier(self.with_filesystem))
+        yield ("ARROW_FLIGHT", truthifier(self.with_flight))
+        yield ("ARROW_GANDIVA", truthifier(self.with_gandiva))
+        yield ("ARROW_PARQUET", truthifier(self.with_parquet))
+        yield ("ARROW_HDFS", truthifier(self.with_hdfs))
+        yield ("ARROW_HIVESERVER2", truthifier(self.with_hiveserver2))
+        yield ("ARROW_IPC", truthifier(self.with_ipc))
+        yield ("ARROW_JSON", truthifier(self.with_json))
+        yield ("ARROW_JNI", truthifier(self.with_jni))
+        yield ("ARROW_MIMALLOC", truthifier(self.with_mimalloc))
+        yield ("ARROW_PLASMA", truthifier(self.with_plasma))
+        yield ("ARROW_PYTHON", truthifier(self.with_python))
+        yield ("ARROW_S3", truthifier(self.with_s3))
+
+        # Compressions
+        yield ("ARROW_WITH_BROTLI", truthifier(self.with_brotli))
+        yield ("ARROW_WITH_BZ2", truthifier(self.with_bz2))
+        yield ("ARROW_WITH_LZ4", truthifier(self.with_lz4))
+        yield ("ARROW_WITH_SNAPPY", truthifier(self.with_snappy))
+        yield ("ARROW_WITH_ZLIB", truthifier(self.with_zlib))
+        yield ("ARROW_WITH_ZSTD", truthifier(self.with_zstd))
+
+        yield ("ARROW_LINT_ONLY", truthifier(self.with_lint_only))
+
+        # Some configurations don't like gnu gold linker.
+        broken_with_gold_ld = [self.with_fuzzing, self.with_gandiva]
+        if self.use_gold_linker and not any(broken_with_gold_ld):
+            yield ("ARROW_USE_LD_GOLD", truthifier(self.use_gold_linker))
+        yield ("ARROW_SIMD_LEVEL", or_else(self.simd_level, "SSE4_2"))
+
+        # Detect custom conda toolchain
+        if self.use_conda:
+            for d, v in [('CMAKE_AR', 'AR'), ('CMAKE_RANLIB', 'RANLIB')]:
+                v = os.environ.get(v)
+                if v:
+                    yield (d, v)
+
+    @property
+    def install_prefix(self):
+        if self._install_prefix:
+            return self._install_prefix
+
+        if self.use_conda:
+            return os.environ.get("CONDA_PREFIX")
+
+        return None
+
+    @property
+    def use_conda(self):
+        # If the user didn't specify a preference, guess via environment
+        if self._use_conda is None:
+            return os.environ.get("CONDA_PREFIX") is not None
+
+        return self._use_conda
+
+    @property
+    def definitions(self):
+        extras = list(self.cmake_extras) if self.cmake_extras else []
+        definitions = ["-D{}={}".format(d[0], d[1]) for d in self._gen_defs()]
+        return definitions + extras
+
+    @property
+    def environment(self):
+        env = os.environ.copy()
+
+        if self.cc:
+            env["CC"] = self.cc
+
+        if self.cxx:
+            env["CXX"] = self.cxx
+
+        return env
+
+
+class CppCMakeDefinition(CMakeDefinition):
+    def __init__(self, source, conf, **kwargs):
+        self.configuration = conf
+        super().__init__(source, **kwargs,
+                         definitions=conf.definitions, env=conf.environment,
+                         build_type=conf.build_type)
diff --git a/src/arrow/dev/archery/archery/lang/java.py b/src/arrow/dev/archery/archery/lang/java.py
new file mode 100644
index 000000000..bc169adf6
--- /dev/null
+++ b/src/arrow/dev/archery/archery/lang/java.py
@@ -0,0 +1,77 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+
+from ..utils.command import Command, CommandStackMixin, default_bin
+from ..utils.maven import MavenDefinition
+
+
+class Java(Command):
+    def __init__(self, java_bin=None):
+        self.bin = default_bin(java_bin, "java")
+
+
+class Jar(CommandStackMixin, Java):
+    def __init__(self, jar, *args, **kwargs):
+        self.jar = jar
+        self.argv = ("-jar", jar)
+        Java.__init__(self, *args, **kwargs)
+
+
+class JavaConfiguration:
+    def __init__(self,
+
+                 # toolchain
+                 java_home=None, java_options=None,
+                 # build & benchmark
+                 build_extras=None, benchmark_extras=None):
+        self.java_home = java_home
+        self.java_options = java_options
+
+        self.build_extras = list(build_extras) if build_extras else []
+        self.benchmark_extras = list(
+            benchmark_extras) if benchmark_extras else []
+
+    @property
+    def build_definitions(self):
+        return self.build_extras
+
+    @property
+    def benchmark_definitions(self):
+        return self.benchmark_extras
+
+    @property
+    def environment(self):
+        env = os.environ.copy()
+
+        if self.java_home:
+            env["JAVA_HOME"] = self.java_home
+
+        if self.java_options:
+            env["JAVA_OPTIONS"] = self.java_options
+
+        return env
+
+
+class JavaMavenDefinition(MavenDefinition):
+    def __init__(self, source, conf, **kwargs):
+        self.configuration = conf
+        super().__init__(source, **kwargs,
+                         build_definitions=conf.build_definitions,
+                         benchmark_definitions=conf.benchmark_definitions,
+                         env=conf.environment)
diff --git a/src/arrow/dev/archery/archery/lang/python.py b/src/arrow/dev/archery/archery/lang/python.py
new file mode 100644
index 000000000..c6ebbe650
--- /dev/null
+++ b/src/arrow/dev/archery/archery/lang/python.py
@@ -0,0 +1,223 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import inspect
+import tokenize
+from contextlib import contextmanager
+
+try:
+    from numpydoc.validate import Docstring, validate
+except ImportError:
+    have_numpydoc = False
+else:
+    have_numpydoc = True
+
+from ..utils.logger import logger
+from ..utils.command import Command, capture_stdout, default_bin
+
+
+class Flake8(Command):
+    def __init__(self, flake8_bin=None):
+        self.bin = default_bin(flake8_bin, "flake8")
+
+
+class Autopep8(Command):
+    def __init__(self, autopep8_bin=None):
+        self.bin = default_bin(autopep8_bin, "autopep8")
+
+    @capture_stdout()
+    def run_captured(self, *args, **kwargs):
+        return self.run(*args, **kwargs)
+
+
+def _tokenize_signature(s):
+    lines = s.encode('ascii').splitlines()
+    generator = iter(lines).__next__
+    return tokenize.tokenize(generator)
+
+
+def _convert_typehint(tokens):
+    names = []
+    opening_bracket_reached = False
+    for token in tokens:
+        # omit the tokens before the opening bracket
+        if not opening_bracket_reached:
+            if token.string == '(':
+                opening_bracket_reached = True
+            else:
+                continue
+
+        if token.type == 1:  # type 1 means NAME token
+            names.append(token)
+        else:
+            if len(names) == 1:
+                yield (names[0].type, names[0].string)
+            elif len(names) == 2:
+                # two "NAME" tokens follow each other which means a cython
+                # typehint like `bool argument`, so remove the typehint
+                # note that we could convert it to python typehints, but hints
+                # are not supported by _signature_fromstr
+                yield (names[1].type, names[1].string)
+            elif len(names) > 2:
+                raise ValueError('More than two NAME tokens follow each other')
+            names = []
+            yield (token.type, token.string)
+
+
+def inspect_signature(obj):
+    """
+    Custom signature inspection primarily for cython generated callables.
+
+    Cython puts the signatures to the first line of the docstrings, which we
+    can reuse to parse the python signature from, but some gymnastics are
+    required, like removing the cython typehints.
+
+    It converts the cython signature:
+        array(obj, type=None, mask=None, size=None, from_pandas=None,
+              bool safe=True, MemoryPool memory_pool=None)
+    To:
+        <Signature (obj, type=None, mask=None, size=None, from_pandas=None,
+                    safe=True, memory_pool=None)>
+    """
+    cython_signature = obj.__doc__.splitlines()[0]
+    cython_tokens = _tokenize_signature(cython_signature)
+    python_tokens = _convert_typehint(cython_tokens)
+    python_signature = tokenize.untokenize(python_tokens)
+    return inspect._signature_fromstr(inspect.Signature, obj, python_signature)
+
+
+class NumpyDoc:
+
+    def __init__(self, symbols=None):
+        if not have_numpydoc:
+            raise RuntimeError(
+                'Numpydoc is not available, install the development version '
+                'with command: pip install numpydoc==1.1.0'
+            )
+        self.symbols = set(symbols or {'pyarrow'})
+
+    def traverse(self, fn, obj, from_package):
+        """Apply a function on publicly exposed API components.
+
+        Recursively iterates over the members of the passed object. It omits
+        any '_' prefixed and thirdparty (non pyarrow) symbols.
+
+        Parameters
+        ----------
+        obj : Any
+        from_package : string, default 'pyarrow'
+            Predicate to only consider objects from this package.
+        """
+        todo = [obj]
+        seen = set()
+
+        while todo:
+            obj = todo.pop()
+            if obj in seen:
+                continue
+            else:
+                seen.add(obj)
+
+            fn(obj)
+
+            for name in dir(obj):
+                if name.startswith('_'):
+                    continue
+
+                member = getattr(obj, name)
+                module = getattr(member, '__module__', None)
+                if not (module and module.startswith(from_package)):
+                    continue
+
+                todo.append(member)
+
+    @contextmanager
+    def _apply_patches(self):
+        """
+        Patch Docstring class to bypass loading already loaded python objects.
+        """
+        orig_load_obj = Docstring._load_obj
+        orig_signature = inspect.signature
+
+        @staticmethod
+        def _load_obj(obj):
+            # By default it expects a qualname and import the object, but we
+            # have already loaded object after the API traversal.
+            if isinstance(obj, str):
+                return orig_load_obj(obj)
+            else:
+                return obj
+
+        def signature(obj):
+            # inspect.signature tries to parse __text_signature__ if other
+            # properties like __signature__ doesn't exists, but cython
+            # doesn't set that property despite that embedsignature cython
+            # directive is set. The only way to inspect a cython compiled
+            # callable's signature to parse it from __doc__ while
+            # embedsignature directive is set during the build phase.
+            # So path inspect.signature function to attempt to parse the first
+            # line of callable.__doc__ as a signature.
+            try:
+                return orig_signature(obj)
+            except Exception as orig_error:
+                try:
+                    return inspect_signature(obj)
+                except Exception:
+                    raise orig_error
+
+        try:
+            Docstring._load_obj = _load_obj
+            inspect.signature = signature
+            yield
+        finally:
+            Docstring._load_obj = orig_load_obj
+            inspect.signature = orig_signature
+
+    def validate(self, from_package='', allow_rules=None,
+                 disallow_rules=None):
+        results = []
+
+        def callback(obj):
+            try:
+                result = validate(obj)
+            except OSError as e:
+                symbol = f"{obj.__module__}.{obj.__name__}"
+                logger.warning(f"Unable to validate `{symbol}` due to `{e}`")
+                return
+
+            errors = []
+            for errcode, errmsg in result.get('errors', []):
+                if allow_rules and errcode not in allow_rules:
+                    continue
+                if disallow_rules and errcode in disallow_rules:
+                    continue
+                errors.append((errcode, errmsg))
+
+            if len(errors):
+                result['errors'] = errors
+                results.append((obj, result))
+
+        with self._apply_patches():
+            for symbol in self.symbols:
+                try:
+                    obj = Docstring._load_obj(symbol)
+                except (ImportError, AttributeError):
+                    print('{} is not available for import'.format(symbol))
+                else:
+                    self.traverse(callback, obj, from_package=from_package)
+
+        return results
diff --git a/src/arrow/dev/archery/archery/linking.py b/src/arrow/dev/archery/archery/linking.py
new file mode 100644
index 000000000..c2e6f1772
--- /dev/null
+++ b/src/arrow/dev/archery/archery/linking.py
@@ -0,0 +1,75 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import platform
+import subprocess
+
+from .utils.command import Command
+
+
+_ldd = Command("ldd")
+_otool = Command("otool")
+
+
+class DependencyError(Exception):
+    pass
+
+
+class DynamicLibrary:
+
+    def __init__(self, path):
+        self.path = path
+
+    def list_dependencies(self):
+        """
+        List the full name of the library dependencies.
+        """
+        system = platform.system()
+        if system == "Linux":
+            result = _ldd.run(self.path, stdout=subprocess.PIPE)
+            lines = result.stdout.splitlines()
+            return [ll.split(None, 1)[0].decode() for ll in lines]
+        elif system == "Darwin":
+            result = _otool.run("-L", self.path, stdout=subprocess.PIPE)
+            lines = result.stdout.splitlines()
+            return [dl.split(None, 1)[0].decode() for dl in lines]
+        else:
+            raise ValueError(f"{platform} is not supported")
+
+    def list_dependency_names(self):
+        """
+        List the truncated names of the dynamic library dependencies.
+        """
+        names = []
+        for dependency in self.list_dependencies():
+            *_, library = dependency.rsplit("/", 1)
+            name, *_ = library.split(".", 1)
+            names.append(name)
+        return names
+
+
+def check_dynamic_library_dependencies(path, allowed, disallowed):
+    dylib = DynamicLibrary(path)
+    for dep in dylib.list_dependency_names():
+        if allowed and dep not in allowed:
+            raise DependencyError(
+                f"Unexpected shared dependency found in {dylib.path}: `{dep}`"
+            )
+        if disallowed and dep in disallowed:
+            raise DependencyError(
+                f"Disallowed shared dependency found in {dylib.path}: `{dep}`"
+            )
diff --git a/src/arrow/dev/archery/archery/release.py b/src/arrow/dev/archery/archery/release.py
new file mode 100644
index 000000000..6baeabc9d
--- /dev/null
+++ b/src/arrow/dev/archery/archery/release.py
@@ -0,0 +1,535 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from collections import defaultdict
+import functools
+import os
+import re
+import pathlib
+import shelve
+import warnings
+
+from git import Repo
+from jira import JIRA
+from semver import VersionInfo as SemVer
+
+from .utils.source import ArrowSources
+from .utils.report import JinjaReport
+
+
+def cached_property(fn):
+    return property(functools.lru_cache(maxsize=1)(fn))
+
+
+class Version(SemVer):
+
+    __slots__ = ('released', 'release_date')
+
+    def __init__(self, released=False, release_date=None, **kwargs):
+        super().__init__(**kwargs)
+        self.released = released
+        self.release_date = release_date
+
+    @classmethod
+    def parse(cls, version, **kwargs):
+        return cls(**SemVer.parse(version).to_dict(), **kwargs)
+
+    @classmethod
+    def from_jira(cls, jira_version):
+        return cls.parse(
+            jira_version.name,
+            released=jira_version.released,
+            release_date=getattr(jira_version, 'releaseDate', None)
+        )
+
+
+class Issue:
+
+    def __init__(self, key, type, summary):
+        self.key = key
+        self.type = type
+        self.summary = summary
+
+    @classmethod
+    def from_jira(cls, jira_issue):
+        return cls(
+            key=jira_issue.key,
+            type=jira_issue.fields.issuetype.name,
+            summary=jira_issue.fields.summary
+        )
+
+    @property
+    def project(self):
+        return self.key.split('-')[0]
+
+    @property
+    def number(self):
+        return int(self.key.split('-')[1])
+
+
+class Jira(JIRA):
+
+    def __init__(self, user=None, password=None,
+                 url='https://issues.apache.org/jira'):
+        user = user or os.environ.get('APACHE_JIRA_USER')
+        password = password or os.environ.get('APACHE_JIRA_PASSWORD')
+        super().__init__(url, basic_auth=(user, password))
+
+    def project_version(self, version_string, project='ARROW'):
+        # query version from jira to populated with additional metadata
+        versions = {str(v): v for v in self.project_versions(project)}
+        return versions[version_string]
+
+    def project_versions(self, project):
+        versions = []
+        for v in super().project_versions(project):
+            try:
+                versions.append(Version.from_jira(v))
+            except ValueError:
+                # ignore invalid semantic versions like JS-0.4.0
+                continue
+        return sorted(versions, reverse=True)
+
+    def issue(self, key):
+        return Issue.from_jira(super().issue(key))
+
+    def project_issues(self, version, project='ARROW'):
+        query = "project={} AND fixVersion={}".format(project, version)
+        issues = super().search_issues(query, maxResults=False)
+        return list(map(Issue.from_jira, issues))
+
+
+class CachedJira:
+
+    def __init__(self, cache_path, jira=None):
+        self.jira = jira or Jira()
+        self.cache_path = cache_path
+
+    def __getattr__(self, name):
+        attr = getattr(self.jira, name)
+        return self._cached(name, attr) if callable(attr) else attr
+
+    def _cached(self, name, method):
+        def wrapper(*args, **kwargs):
+            key = str((name, args, kwargs))
+            with shelve.open(self.cache_path) as cache:
+                try:
+                    result = cache[key]
+                except KeyError:
+                    cache[key] = result = method(*args, **kwargs)
+            return result
+        return wrapper
+
+
+_TITLE_REGEX = re.compile(
+    r"(?P<issue>(?P<project>(ARROW|PARQUET))\-\d+)?\s*:?\s*"
+    r"(?P<components>\[.*\])?\s*(?P<summary>.*)"
+)
+_COMPONENT_REGEX = re.compile(r"\[([^\[\]]+)\]")
+
+
+class CommitTitle:
+
+    def __init__(self, summary, project=None, issue=None, components=None):
+        self.project = project
+        self.issue = issue
+        self.components = components or []
+        self.summary = summary
+
+    def __str__(self):
+        out = ""
+        if self.issue:
+            out += "{}: ".format(self.issue)
+        if self.components:
+            for component in self.components:
+                out += "[{}]".format(component)
+            out += " "
+        out += self.summary
+        return out
+
+    def __eq__(self, other):
+        return (
+            self.summary == other.summary and
+            self.project == other.project and
+            self.issue == other.issue and
+            self.components == other.components
+        )
+
+    def __hash__(self):
+        return hash(
+            (self.summary, self.project, self.issue, tuple(self.components))
+        )
+
+    @classmethod
+    def parse(cls, headline):
+        matches = _TITLE_REGEX.match(headline)
+        if matches is None:
+            warnings.warn(
+                "Unable to parse commit message `{}`".format(headline)
+            )
+            return CommitTitle(headline)
+
+        values = matches.groupdict()
+        components = values.get('components') or ''
+        components = _COMPONENT_REGEX.findall(components)
+
+        return CommitTitle(
+            values['summary'],
+            project=values.get('project'),
+            issue=values.get('issue'),
+            components=components
+        )
+
+
+class Commit:
+
+    def __init__(self, wrapped):
+        self._title = CommitTitle.parse(wrapped.summary)
+        self._wrapped = wrapped
+
+    def __getattr__(self, attr):
+        if hasattr(self._title, attr):
+            return getattr(self._title, attr)
+        else:
+            return getattr(self._wrapped, attr)
+
+    def __repr__(self):
+        template = '<Commit sha={!r} issue={!r} components={!r} summary={!r}>'
+        return template.format(self.hexsha, self.issue, self.components,
+                               self.summary)
+
+    @property
+    def url(self):
+        return 'https://github.com/apache/arrow/commit/{}'.format(self.hexsha)
+
+    @property
+    def title(self):
+        return self._title
+
+
+class ReleaseCuration(JinjaReport):
+    templates = {
+        'console': 'release_curation.txt.j2'
+    }
+    fields = [
+        'release',
+        'within',
+        'outside',
+        'nojira',
+        'parquet',
+        'nopatch'
+    ]
+
+
+class JiraChangelog(JinjaReport):
+    templates = {
+        'markdown': 'release_changelog.md.j2',
+        'html': 'release_changelog.html.j2'
+    }
+    fields = [
+        'release',
+        'categories'
+    ]
+
+
+class Release:
+
+    def __init__(self):
+        raise TypeError("Do not initialize Release class directly, use "
+                        "Release.from_jira(version) instead.")
+
+    def __repr__(self):
+        if self.version.released:
+            status = "released_at={!r}".format(self.version.release_date)
+        else:
+            status = "pending"
+        return "<{} {!r} {}>".format(self.__class__.__name__,
+                                     str(self.version), status)
+
+    @staticmethod
+    def from_jira(version, jira=None, repo=None):
+        if jira is None:
+            jira = Jira()
+        elif isinstance(jira, str):
+            jira = Jira(jira)
+        elif not isinstance(jira, (Jira, CachedJira)):
+            raise TypeError("`jira` argument must be a server url or a valid "
+                            "Jira instance")
+
+        if repo is None:
+            arrow = ArrowSources.find()
+            repo = Repo(arrow.path)
+        elif isinstance(repo, (str, pathlib.Path)):
+            repo = Repo(repo)
+        elif not isinstance(repo, Repo):
+            raise TypeError("`repo` argument must be a path or a valid Repo "
+                            "instance")
+
+        if isinstance(version, str):
+            version = jira.project_version(version, project='ARROW')
+        elif not isinstance(version, Version):
+            raise TypeError(version)
+
+        # decide the type of the release based on the version number
+        if version.patch == 0:
+            if version.minor == 0:
+                klass = MajorRelease
+            elif version.major == 0:
+                # handle minor releases before 1.0 as major releases
+                klass = MajorRelease
+            else:
+                klass = MinorRelease
+        else:
+            klass = PatchRelease
+
+        # prevent instantiating release object directly
+        obj = klass.__new__(klass)
+        obj.version = version
+        obj.jira = jira
+        obj.repo = repo
+
+        return obj
+
+    @property
+    def is_released(self):
+        return self.version.released
+
+    @property
+    def tag(self):
+        return "apache-arrow-{}".format(str(self.version))
+
+    @property
+    def branch(self):
+        raise NotImplementedError()
+
+    @property
+    def siblings(self):
+        """
+        Releases to consider when calculating previous and next releases.
+        """
+        raise NotImplementedError()
+
+    @cached_property
+    def previous(self):
+        # select all non-patch releases
+        position = self.siblings.index(self.version)
+        try:
+            previous = self.siblings[position + 1]
+        except IndexError:
+            # first release doesn't have a previous one
+            return None
+        else:
+            return Release.from_jira(previous, jira=self.jira, repo=self.repo)
+
+    @cached_property
+    def next(self):
+        # select all non-patch releases
+        position = self.siblings.index(self.version)
+        if position <= 0:
+            raise ValueError("There is no upcoming release set in JIRA after "
+                             "version {}".format(self.version))
+        upcoming = self.siblings[position - 1]
+        return Release.from_jira(upcoming, jira=self.jira, repo=self.repo)
+
+    @cached_property
+    def issues(self):
+        issues = self.jira.project_issues(self.version, project='ARROW')
+        return {i.key: i for i in issues}
+
+    @cached_property
+    def commits(self):
+        """
+        All commits applied between two versions.
+        """
+        if self.previous is None:
+            # first release
+            lower = ''
+        else:
+            lower = self.repo.tags[self.previous.tag]
+
+        if self.version.released:
+            upper = self.repo.tags[self.tag]
+        else:
+            try:
+                upper = self.repo.branches[self.branch]
+            except IndexError:
+                warnings.warn("Release branch `{}` doesn't exist."
+                              .format(self.branch))
+                return []
+
+        commit_range = "{}..{}".format(lower, upper)
+        return list(map(Commit, self.repo.iter_commits(commit_range)))
+
+    def curate(self):
+        # handle commits with parquet issue key specially and query them from
+        # jira and add it to the issues
+        release_issues = self.issues
+
+        within, outside, nojira, parquet = [], [], [], []
+        for c in self.commits:
+            if c.issue is None:
+                nojira.append(c)
+            elif c.issue in release_issues:
+                within.append((release_issues[c.issue], c))
+            elif c.project == 'PARQUET':
+                parquet.append((self.jira.issue(c.issue), c))
+            else:
+                outside.append((self.jira.issue(c.issue), c))
+
+        # remaining jira tickets
+        within_keys = {i.key for i, c in within}
+        nopatch = [issue for key, issue in release_issues.items()
+                   if key not in within_keys]
+
+        return ReleaseCuration(release=self, within=within, outside=outside,
+                               nojira=nojira, parquet=parquet, nopatch=nopatch)
+
+    def changelog(self):
+        release_issues = []
+
+        # get organized report for the release
+        curation = self.curate()
+
+        # jira tickets having patches in the release
+        for issue, _ in curation.within:
+            release_issues.append(issue)
+
+        # jira tickets without patches
+        for issue in curation.nopatch:
+            release_issues.append(issue)
+
+        # parquet patches in the release
+        for issue, _ in curation.parquet:
+            release_issues.append(issue)
+
+        # organize issues into categories
+        issue_types = {
+            'Bug': 'Bug Fixes',
+            'Improvement': 'New Features and Improvements',
+            'New Feature': 'New Features and Improvements',
+            'Sub-task': 'New Features and Improvements',
+            'Task': 'New Features and Improvements',
+            'Test': 'Bug Fixes',
+            'Wish': 'New Features and Improvements',
+        }
+        categories = defaultdict(list)
+        for issue in release_issues:
+            categories[issue_types[issue.type]].append(issue)
+
+        # sort issues by the issue key in ascending order
+        for name, issues in categories.items():
+            issues.sort(key=lambda issue: (issue.project, issue.number))
+
+        return JiraChangelog(release=self, categories=categories)
+
+
+class MaintenanceMixin:
+    """
+    Utility methods for cherry-picking commits from the main branch.
+    """
+
+    def commits_to_pick(self, exclude_already_applied=True):
+        # collect commits applied on the main branch since the root of the
+        # maintenance branch (the previous major release)
+        if self.version.major == 0:
+            # treat minor releases as major releases preceeding 1.0.0 release
+            commit_range = "apache-arrow-0.{}.0..master".format(
+                self.version.minor
+            )
+        else:
+            commit_range = "apache-arrow-{}.0.0..master".format(
+                self.version.major
+            )
+
+        # keeping the original order of the commits helps to minimize the merge
+        # conflicts during cherry-picks
+        commits = map(Commit, self.repo.iter_commits(commit_range))
+
+        # exclude patches that have been already applied to the maintenance
+        # branch, we cannot identify patches based on sha because it changes
+        # after the cherry pick so use commit title instead
+        if exclude_already_applied:
+            already_applied = {c.title for c in self.commits}
+        else:
+            already_applied = set()
+
+        # iterate over the commits applied on the main branch and filter out
+        # the ones that are included in the jira release
+        patches_to_pick = [c for c in commits if
+                           c.issue in self.issues and
+                           c.title not in already_applied]
+
+        return reversed(patches_to_pick)
+
+    def cherry_pick_commits(self, recreate_branch=True):
+        if recreate_branch:
+            # delete, create and checkout the maintenance branch based off of
+            # the previous tag
+            if self.branch in self.repo.branches:
+                self.repo.git.branch('-D', self.branch)
+            self.repo.git.checkout(self.previous.tag, b=self.branch)
+        else:
+            # just checkout the already existing maintenance branch
+            self.repo.git.checkout(self.branch)
+
+        # cherry pick the commits based on the jira tickets
+        for commit in self.commits_to_pick():
+            self.repo.git.cherry_pick(commit.hexsha)
+
+
+class MajorRelease(Release):
+
+    @property
+    def branch(self):
+        return "master"
+
+    @cached_property
+    def siblings(self):
+        """
+        Filter only the major releases.
+        """
+        # handle minor releases before 1.0 as major releases
+        return [v for v in self.jira.project_versions('ARROW')
+                if v.patch == 0 and (v.major == 0 or v.minor == 0)]
+
+
+class MinorRelease(Release, MaintenanceMixin):
+
+    @property
+    def branch(self):
+        return "maint-{}.x.x".format(self.version.major)
+
+    @cached_property
+    def siblings(self):
+        """
+        Filter the major and minor releases.
+        """
+        return [v for v in self.jira.project_versions('ARROW') if v.patch == 0]
+
+
+class PatchRelease(Release, MaintenanceMixin):
+
+    @property
+    def branch(self):
+        return "maint-{}.{}.x".format(self.version.major, self.version.minor)
+
+    @cached_property
+    def siblings(self):
+        """
+        No filtering, consider all releases.
+        """
+        return self.jira.project_versions('ARROW')
diff --git a/src/arrow/dev/archery/archery/templates/release_changelog.md.j2 b/src/arrow/dev/archery/archery/templates/release_changelog.md.j2
new file mode 100644
index 000000000..c0406ddf4
--- /dev/null
+++ b/src/arrow/dev/archery/archery/templates/release_changelog.md.j2
@@ -0,0 +1,29 @@
+{#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#}
+# Apache Arrow {{ release.version }} ({{ release.version.release_date or today() }})
+
+{% for category, issues in categories.items() -%}
+
+## {{ category }}
+
+{% for issue in issues -%}
+* [{{ issue.key }}](https://issues.apache.org/jira/browse/{{ issue.key }}) - {{ issue.summary | md }}
+{% endfor %}
+
+{% endfor %}
diff --git a/src/arrow/dev/archery/archery/templates/release_curation.txt.j2 b/src/arrow/dev/archery/archery/templates/release_curation.txt.j2
new file mode 100644
index 000000000..a5d11e9d4
--- /dev/null
+++ b/src/arrow/dev/archery/archery/templates/release_curation.txt.j2
@@ -0,0 +1,41 @@
+{#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#}
+Total number of JIRA tickets assigned to version {{ release.version }}: {{ release.issues|length }}
+
+Total number of applied patches since version {{ release.previous.version }}: {{ release.commits|length }}
+
+Patches with assigned issue in version {{ release.version }}:
+{% for issue, commit in within -%}
+ - {{ commit.url }} {{ commit.title }}
+{% endfor %}
+
+Patches with assigned issue outside of version {{ release.version }}:
+{% for issue, commit in outside -%}
+ - {{ commit.url }} {{ commit.title }}
+{% endfor %}
+
+Patches in version {{ release.version }} without a linked issue:
+{% for commit in nojira -%}
+ - {{ commit.url }} {{ commit.title }}
+{% endfor %}
+
+JIRA issues in version {{ release.version }} without a linked patch:
+{% for issue in nopatch -%}
+ - https://issues.apache.org/jira/browse/{{ issue.key }}
+{% endfor %}
diff --git a/src/arrow/dev/archery/archery/testing.py b/src/arrow/dev/archery/archery/testing.py
new file mode 100644
index 000000000..471a54d4c
--- /dev/null
+++ b/src/arrow/dev/archery/archery/testing.py
@@ -0,0 +1,83 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from contextlib import contextmanager
+import os
+from unittest import mock
+import re
+
+
+class DotDict(dict):
+
+    def __getattr__(self, key):
+        try:
+            item = self[key]
+        except KeyError:
+            raise AttributeError(key)
+        if isinstance(item, dict):
+            return DotDict(item)
+        else:
+            return item
+
+
+class PartialEnv(dict):
+
+    def __eq__(self, other):
+        return self.items() <= other.items()
+
+
+_mock_call_type = type(mock.call())
+
+
+def _ensure_mock_call_object(obj, **kwargs):
+    if isinstance(obj, _mock_call_type):
+        return obj
+    elif isinstance(obj, str):
+        cmd = re.split(r"\s+", obj)
+        return mock.call(cmd, **kwargs)
+    elif isinstance(obj, list):
+        return mock.call(obj, **kwargs)
+    else:
+        raise TypeError(obj)
+
+
+class SuccessfulSubprocessResult:
+
+    def check_returncode(self):
+        return
+
+
+@contextmanager
+def assert_subprocess_calls(expected_commands_or_calls, **kwargs):
+    calls = [
+        _ensure_mock_call_object(obj, **kwargs)
+        for obj in expected_commands_or_calls
+    ]
+    with mock.patch('subprocess.run', autospec=True) as run:
+        run.return_value = SuccessfulSubprocessResult()
+        yield run
+        run.assert_has_calls(calls)
+
+
+@contextmanager
+def override_env(mapping):
+    original = os.environ
+    try:
+        os.environ = dict(os.environ, **mapping)
+        yield os.environ
+    finally:
+        os.environ = original
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/archery-benchmark-diff-empty-lines.jsonl b/src/arrow/dev/archery/archery/tests/fixtures/archery-benchmark-diff-empty-lines.jsonl
new file mode 100644
index 000000000..5854eb75c
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/archery-benchmark-diff-empty-lines.jsonl
@@ -0,0 +1,6 @@
+{"benchmark": "RegressionSumKernel/32768/10", "change": 0.0046756468886368545, "regression": false, "baseline": 13265442258.099466, "contender": 13327466781.91994, "unit": "bytes_per_second", "less_is_better": false, "suite": "arrow-compute-aggregate-benchmark"}
+{"benchmark": "RegressionSumKernel/32768/1", "change": 0.0025108399115900733, "regression": false, "baseline": 15181891659.539782, "contender": 15220010959.05199, "unit": "bytes_per_second", "less_is_better": false, "suite": "arrow-compute-aggregate-benchmark"}
+
+{"benchmark": "RegressionSumKernel/32768/50", "change": 0.00346735806287155, "regression": false, "baseline": 11471825667.817123, "contender": 11511602595.042286, "unit": "bytes_per_second", "less_is_better": false, "suite": "arrow-compute-aggregate-benchmark"}
+
+{"benchmark": "RegressionSumKernel/32768/0", "change": 0.010140954727954987, "regression": false, "baseline": 18316987019.994465, "contender": 18502738756.116768, "unit": "bytes_per_second", "less_is_better": false, "suite": "arrow-compute-aggregate-benchmark"}
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/archery-benchmark-diff.jsonl b/src/arrow/dev/archery/archery/tests/fixtures/archery-benchmark-diff.jsonl
new file mode 100644
index 000000000..1e25810d7
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/archery-benchmark-diff.jsonl
@@ -0,0 +1,4 @@
+{"benchmark":"RegressionSumKernel/32768/50","change":-0.001550846227215492,"regression":false,"baseline":19241207435.428757,"contender":19211367281.47045,"unit":"bytes_per_second","less_is_better":false,"suite":"arrow-compute-aggregate-benchmark"}
+{"benchmark":"RegressionSumKernel/32768/1","change":0.0020681767923465765,"regression":true,"baseline":24823170673.777943,"contender":24771831968.277977,"unit":"bytes_per_second","less_is_better":false,"suite":"arrow-compute-aggregate-benchmark"}
+{"benchmark":"RegressionSumKernel/32768/10","change":0.0033323376378746905,"regression":false,"baseline":21902707565.968014,"contender":21975694782.76145,"unit":"bytes_per_second","less_is_better":false,"suite":"arrow-compute-aggregate-benchmark"}
+{"benchmark":"RegressionSumKernel/32768/0","change":-0.004918126090954414,"regression":true,"baseline":27685006611.446762,"contender":27821164964.790764,"unit":"bytes_per_second","less_is_better":false,"suite":"arrow-compute-aggregate-benchmark"}
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-build-command.json b/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-build-command.json
new file mode 100644
index 000000000..d591105f0
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-build-command.json
@@ -0,0 +1,212 @@
+{
+    "action": "created",
+    "comment": {
+        "author_association": "MEMBER",
+        "body": "@ursabot build",
+        "created_at": "2019-04-05T11:55:43Z",
+        "html_url": "https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480248726",
+        "id": 480248726,
+        "issue_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+        "node_id": "MDEyOklzc3VlQ29tbWVudDQ4MDI0ODcyNg==",
+        "updated_at": "2019-04-05T11:55:43Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480248726",
+        "user": {
+            "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+            "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/kszucs/followers",
+            "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/kszucs",
+            "id": 961747,
+            "login": "kszucs",
+            "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+            "organizations_url": "https://api.github.com/users/kszucs/orgs",
+            "received_events_url": "https://api.github.com/users/kszucs/received_events",
+            "repos_url": "https://api.github.com/users/kszucs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+            "type": "User",
+            "url": "https://api.github.com/users/kszucs"
+        }
+    },
+    "issue": {
+        "assignee": null,
+        "assignees": [],
+        "author_association": "MEMBER",
+        "body": "",
+        "closed_at": null,
+        "comments": 3,
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments",
+        "created_at": "2019-04-05T11:22:15Z",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/events",
+        "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+        "id": 429706959,
+        "labels": [],
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}",
+        "locked": false,
+        "milestone": null,
+        "node_id": "MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy",
+        "number": 26,
+        "pull_request": {
+            "diff_url": "https://github.com/ursa-labs/ursabot/pull/26.diff",
+            "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+            "patch_url": "https://github.com/ursa-labs/ursabot/pull/26.patch",
+            "url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26"
+        },
+        "repository_url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "state": "open",
+        "title": "Unittests for GithubHook",
+        "updated_at": "2019-04-05T11:55:43Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+        "user": {
+            "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+            "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/kszucs/followers",
+            "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/kszucs",
+            "id": 961747,
+            "login": "kszucs",
+            "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+            "organizations_url": "https://api.github.com/users/kszucs/orgs",
+            "received_events_url": "https://api.github.com/users/kszucs/received_events",
+            "repos_url": "https://api.github.com/users/kszucs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+            "type": "User",
+            "url": "https://api.github.com/users/kszucs"
+        }
+    },
+    "organization": {
+        "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+        "description": "Innovation lab for open source data science tools, powered by Apache Arrow",
+        "events_url": "https://api.github.com/orgs/ursa-labs/events",
+        "hooks_url": "https://api.github.com/orgs/ursa-labs/hooks",
+        "id": 46514972,
+        "issues_url": "https://api.github.com/orgs/ursa-labs/issues",
+        "login": "ursa-labs",
+        "members_url": "https://api.github.com/orgs/ursa-labs/members{/member}",
+        "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+        "public_members_url": "https://api.github.com/orgs/ursa-labs/public_members{/member}",
+        "repos_url": "https://api.github.com/orgs/ursa-labs/repos",
+        "url": "https://api.github.com/orgs/ursa-labs"
+    },
+    "repository": {
+        "archive_url": "https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}",
+        "archived": false,
+        "assignees_url": "https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}",
+        "blobs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}",
+        "branches_url": "https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}",
+        "clone_url": "https://github.com/ursa-labs/ursabot.git",
+        "collaborators_url": "https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}",
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/comments{/number}",
+        "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}",
+        "compare_url": "https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}",
+        "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}",
+        "contributors_url": "https://api.github.com/repos/ursa-labs/ursabot/contributors",
+        "created_at": "2019-02-04T15:40:31Z",
+        "default_branch": "master",
+        "deployments_url": "https://api.github.com/repos/ursa-labs/ursabot/deployments",
+        "description": null,
+        "disabled": false,
+        "downloads_url": "https://api.github.com/repos/ursa-labs/ursabot/downloads",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/events",
+        "fork": false,
+        "forks": 0,
+        "forks_count": 0,
+        "forks_url": "https://api.github.com/repos/ursa-labs/ursabot/forks",
+        "full_name": "ursa-labs/ursabot",
+        "git_commits_url": "https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}",
+        "git_refs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}",
+        "git_tags_url": "https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}",
+        "git_url": "git://github.com/ursa-labs/ursabot.git",
+        "has_downloads": true,
+        "has_issues": true,
+        "has_pages": false,
+        "has_projects": true,
+        "has_wiki": true,
+        "homepage": null,
+        "hooks_url": "https://api.github.com/repos/ursa-labs/ursabot/hooks",
+        "html_url": "https://github.com/ursa-labs/ursabot",
+        "id": 169101701,
+        "issue_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}",
+        "issue_events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}",
+        "issues_url": "https://api.github.com/repos/ursa-labs/ursabot/issues{/number}",
+        "keys_url": "https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}",
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/labels{/name}",
+        "language": "Jupyter Notebook",
+        "languages_url": "https://api.github.com/repos/ursa-labs/ursabot/languages",
+        "license": null,
+        "merges_url": "https://api.github.com/repos/ursa-labs/ursabot/merges",
+        "milestones_url": "https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}",
+        "mirror_url": null,
+        "name": "ursabot",
+        "node_id": "MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=",
+        "notifications_url": "https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}",
+        "open_issues": 19,
+        "open_issues_count": 19,
+        "owner": {
+            "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+            "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/ursa-labs/followers",
+            "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/ursa-labs",
+            "id": 46514972,
+            "login": "ursa-labs",
+            "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+            "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+            "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+            "repos_url": "https://api.github.com/users/ursa-labs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+            "type": "Organization",
+            "url": "https://api.github.com/users/ursa-labs"
+        },
+        "private": false,
+        "pulls_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}",
+        "pushed_at": "2019-04-05T11:22:16Z",
+        "releases_url": "https://api.github.com/repos/ursa-labs/ursabot/releases{/id}",
+        "size": 892,
+        "ssh_url": "git@github.com:ursa-labs/ursabot.git",
+        "stargazers_count": 1,
+        "stargazers_url": "https://api.github.com/repos/ursa-labs/ursabot/stargazers",
+        "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}",
+        "subscribers_url": "https://api.github.com/repos/ursa-labs/ursabot/subscribers",
+        "subscription_url": "https://api.github.com/repos/ursa-labs/ursabot/subscription",
+        "svn_url": "https://github.com/ursa-labs/ursabot",
+        "tags_url": "https://api.github.com/repos/ursa-labs/ursabot/tags",
+        "teams_url": "https://api.github.com/repos/ursa-labs/ursabot/teams",
+        "trees_url": "https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}",
+        "updated_at": "2019-04-04T17:49:10Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "watchers": 1,
+        "watchers_count": 1
+    },
+    "sender": {
+        "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+        "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+        "followers_url": "https://api.github.com/users/kszucs/followers",
+        "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+        "gravatar_id": "",
+        "html_url": "https://github.com/kszucs",
+        "id": 961747,
+        "login": "kszucs",
+        "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+        "organizations_url": "https://api.github.com/users/kszucs/orgs",
+        "received_events_url": "https://api.github.com/users/kszucs/received_events",
+        "repos_url": "https://api.github.com/users/kszucs/repos",
+        "site_admin": false,
+        "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+        "type": "User",
+        "url": "https://api.github.com/users/kszucs"
+    }
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-by-non-authorized-user.json b/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-by-non-authorized-user.json
new file mode 100644
index 000000000..5a8f3461c
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-by-non-authorized-user.json
@@ -0,0 +1,212 @@
+{
+    "action": "created",
+    "comment": {
+        "author_association": "NONE",
+        "body": "Unknown command \"\"",
+        "created_at": "2019-04-05T11:35:47Z",
+        "html_url": "https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480243815",
+        "id": 480243815,
+        "issue_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+        "node_id": "MDEyOklzc3VlQ29tbWVudDQ4MDI0MzgxNQ==",
+        "updated_at": "2019-04-05T11:35:47Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480243815",
+        "user": {
+            "avatar_url": "https://avatars2.githubusercontent.com/u/49275095?v=4",
+            "events_url": "https://api.github.com/users/ursabot/events{/privacy}",
+            "followers_url": "https://api.github.com/users/ursabot/followers",
+            "following_url": "https://api.github.com/users/ursabot/following{/other_user}",
+            "gists_url": "https://api.github.com/users/ursabot/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/ursabot",
+            "id": 49275095,
+            "login": "someone",
+            "node_id": "MDQ6VXNlcjQ5Mjc1MDk1",
+            "organizations_url": "https://api.github.com/users/ursabot/orgs",
+            "received_events_url": "https://api.github.com/users/ursabot/received_events",
+            "repos_url": "https://api.github.com/users/ursabot/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/ursabot/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/ursabot/subscriptions",
+            "type": "User",
+            "url": "https://api.github.com/users/ursabot"
+        }
+    },
+    "issue": {
+        "assignee": null,
+        "assignees": [],
+        "author_association": "NONE",
+        "body": "",
+        "closed_at": null,
+        "comments": 2,
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments",
+        "created_at": "2019-04-05T11:22:15Z",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/events",
+        "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+        "id": 429706959,
+        "labels": [],
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}",
+        "locked": false,
+        "milestone": null,
+        "node_id": "MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy",
+        "number": 26,
+        "pull_request": {
+            "diff_url": "https://github.com/ursa-labs/ursabot/pull/26.diff",
+            "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+            "patch_url": "https://github.com/ursa-labs/ursabot/pull/26.patch",
+            "url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26"
+        },
+        "repository_url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "state": "open",
+        "title": "Unittests for GithubHook",
+        "updated_at": "2019-04-05T11:35:47Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+        "user": {
+            "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+            "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/kszucs/followers",
+            "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/kszucs",
+            "id": 961747,
+            "login": "kszucs",
+            "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+            "organizations_url": "https://api.github.com/users/kszucs/orgs",
+            "received_events_url": "https://api.github.com/users/kszucs/received_events",
+            "repos_url": "https://api.github.com/users/kszucs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+            "type": "User",
+            "url": "https://api.github.com/users/kszucs"
+        }
+    },
+    "organization": {
+        "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+        "description": "Innovation lab for open source data science tools, powered by Apache Arrow",
+        "events_url": "https://api.github.com/orgs/ursa-labs/events",
+        "hooks_url": "https://api.github.com/orgs/ursa-labs/hooks",
+        "id": 46514972,
+        "issues_url": "https://api.github.com/orgs/ursa-labs/issues",
+        "login": "ursa-labs",
+        "members_url": "https://api.github.com/orgs/ursa-labs/members{/member}",
+        "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+        "public_members_url": "https://api.github.com/orgs/ursa-labs/public_members{/member}",
+        "repos_url": "https://api.github.com/orgs/ursa-labs/repos",
+        "url": "https://api.github.com/orgs/ursa-labs"
+    },
+    "repository": {
+        "archive_url": "https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}",
+        "archived": false,
+        "assignees_url": "https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}",
+        "blobs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}",
+        "branches_url": "https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}",
+        "clone_url": "https://github.com/ursa-labs/ursabot.git",
+        "collaborators_url": "https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}",
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/comments{/number}",
+        "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}",
+        "compare_url": "https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}",
+        "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}",
+        "contributors_url": "https://api.github.com/repos/ursa-labs/ursabot/contributors",
+        "created_at": "2019-02-04T15:40:31Z",
+        "default_branch": "master",
+        "deployments_url": "https://api.github.com/repos/ursa-labs/ursabot/deployments",
+        "description": null,
+        "disabled": false,
+        "downloads_url": "https://api.github.com/repos/ursa-labs/ursabot/downloads",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/events",
+        "fork": false,
+        "forks": 0,
+        "forks_count": 0,
+        "forks_url": "https://api.github.com/repos/ursa-labs/ursabot/forks",
+        "full_name": "ursa-labs/ursabot",
+        "git_commits_url": "https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}",
+        "git_refs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}",
+        "git_tags_url": "https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}",
+        "git_url": "git://github.com/ursa-labs/ursabot.git",
+        "has_downloads": true,
+        "has_issues": true,
+        "has_pages": false,
+        "has_projects": true,
+        "has_wiki": true,
+        "homepage": null,
+        "hooks_url": "https://api.github.com/repos/ursa-labs/ursabot/hooks",
+        "html_url": "https://github.com/ursa-labs/ursabot",
+        "id": 169101701,
+        "issue_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}",
+        "issue_events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}",
+        "issues_url": "https://api.github.com/repos/ursa-labs/ursabot/issues{/number}",
+        "keys_url": "https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}",
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/labels{/name}",
+        "language": "Jupyter Notebook",
+        "languages_url": "https://api.github.com/repos/ursa-labs/ursabot/languages",
+        "license": null,
+        "merges_url": "https://api.github.com/repos/ursa-labs/ursabot/merges",
+        "milestones_url": "https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}",
+        "mirror_url": null,
+        "name": "someone",
+        "node_id": "MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=",
+        "notifications_url": "https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}",
+        "open_issues": 19,
+        "open_issues_count": 19,
+        "owner": {
+            "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+            "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/ursa-labs/followers",
+            "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/ursa-labs",
+            "id": 46514972,
+            "login": "ursa-labs",
+            "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+            "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+            "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+            "repos_url": "https://api.github.com/users/ursa-labs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+            "type": "Organization",
+            "url": "https://api.github.com/users/ursa-labs"
+        },
+        "private": false,
+        "pulls_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}",
+        "pushed_at": "2019-04-05T11:22:16Z",
+        "releases_url": "https://api.github.com/repos/ursa-labs/ursabot/releases{/id}",
+        "size": 892,
+        "ssh_url": "git@github.com:ursa-labs/ursabot.git",
+        "stargazers_count": 1,
+        "stargazers_url": "https://api.github.com/repos/ursa-labs/ursabot/stargazers",
+        "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}",
+        "subscribers_url": "https://api.github.com/repos/ursa-labs/ursabot/subscribers",
+        "subscription_url": "https://api.github.com/repos/ursa-labs/ursabot/subscription",
+        "svn_url": "https://github.com/ursa-labs/ursabot",
+        "tags_url": "https://api.github.com/repos/ursa-labs/ursabot/tags",
+        "teams_url": "https://api.github.com/repos/ursa-labs/ursabot/teams",
+        "trees_url": "https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}",
+        "updated_at": "2019-04-04T17:49:10Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "watchers": 1,
+        "watchers_count": 1
+    },
+    "sender": {
+        "avatar_url": "https://avatars2.githubusercontent.com/u/49275095?v=4",
+        "events_url": "https://api.github.com/users/ursabot/events{/privacy}",
+        "followers_url": "https://api.github.com/users/ursabot/followers",
+        "following_url": "https://api.github.com/users/ursabot/following{/other_user}",
+        "gists_url": "https://api.github.com/users/ursabot/gists{/gist_id}",
+        "gravatar_id": "",
+        "html_url": "https://github.com/ursabot",
+        "id": 49275095,
+        "login": "someone",
+        "node_id": "MDQ6VXNlcjQ5Mjc1MDk1",
+        "organizations_url": "https://api.github.com/users/ursabot/orgs",
+        "received_events_url": "https://api.github.com/users/ursabot/received_events",
+        "repos_url": "https://api.github.com/users/ursabot/repos",
+        "site_admin": false,
+        "starred_url": "https://api.github.com/users/ursabot/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/ursabot/subscriptions",
+        "type": "User",
+        "url": "https://api.github.com/users/ursabot"
+    }
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-by-ursabot.json b/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-by-ursabot.json
new file mode 100644
index 000000000..bfb7210df
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-by-ursabot.json
@@ -0,0 +1,212 @@
+{
+    "action": "created",
+    "comment": {
+        "author_association": "NONE",
+        "body": "Unknown command \"\"",
+        "created_at": "2019-04-05T11:35:47Z",
+        "html_url": "https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480243815",
+        "id": 480243815,
+        "issue_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+        "node_id": "MDEyOklzc3VlQ29tbWVudDQ4MDI0MzgxNQ==",
+        "updated_at": "2019-04-05T11:35:47Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480243815",
+        "user": {
+            "avatar_url": "https://avatars2.githubusercontent.com/u/49275095?v=4",
+            "events_url": "https://api.github.com/users/ursabot/events{/privacy}",
+            "followers_url": "https://api.github.com/users/ursabot/followers",
+            "following_url": "https://api.github.com/users/ursabot/following{/other_user}",
+            "gists_url": "https://api.github.com/users/ursabot/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/ursabot",
+            "id": 49275095,
+            "login": "ursabot",
+            "node_id": "MDQ6VXNlcjQ5Mjc1MDk1",
+            "organizations_url": "https://api.github.com/users/ursabot/orgs",
+            "received_events_url": "https://api.github.com/users/ursabot/received_events",
+            "repos_url": "https://api.github.com/users/ursabot/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/ursabot/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/ursabot/subscriptions",
+            "type": "User",
+            "url": "https://api.github.com/users/ursabot"
+        }
+    },
+    "issue": {
+        "assignee": null,
+        "assignees": [],
+        "author_association": "MEMBER",
+        "body": "",
+        "closed_at": null,
+        "comments": 2,
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments",
+        "created_at": "2019-04-05T11:22:15Z",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/events",
+        "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+        "id": 429706959,
+        "labels": [],
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}",
+        "locked": false,
+        "milestone": null,
+        "node_id": "MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy",
+        "number": 26,
+        "pull_request": {
+            "diff_url": "https://github.com/ursa-labs/ursabot/pull/26.diff",
+            "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+            "patch_url": "https://github.com/ursa-labs/ursabot/pull/26.patch",
+            "url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26"
+        },
+        "repository_url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "state": "open",
+        "title": "Unittests for GithubHook",
+        "updated_at": "2019-04-05T11:35:47Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+        "user": {
+            "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+            "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/kszucs/followers",
+            "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/kszucs",
+            "id": 961747,
+            "login": "kszucs",
+            "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+            "organizations_url": "https://api.github.com/users/kszucs/orgs",
+            "received_events_url": "https://api.github.com/users/kszucs/received_events",
+            "repos_url": "https://api.github.com/users/kszucs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+            "type": "User",
+            "url": "https://api.github.com/users/kszucs"
+        }
+    },
+    "organization": {
+        "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+        "description": "Innovation lab for open source data science tools, powered by Apache Arrow",
+        "events_url": "https://api.github.com/orgs/ursa-labs/events",
+        "hooks_url": "https://api.github.com/orgs/ursa-labs/hooks",
+        "id": 46514972,
+        "issues_url": "https://api.github.com/orgs/ursa-labs/issues",
+        "login": "ursa-labs",
+        "members_url": "https://api.github.com/orgs/ursa-labs/members{/member}",
+        "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+        "public_members_url": "https://api.github.com/orgs/ursa-labs/public_members{/member}",
+        "repos_url": "https://api.github.com/orgs/ursa-labs/repos",
+        "url": "https://api.github.com/orgs/ursa-labs"
+    },
+    "repository": {
+        "archive_url": "https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}",
+        "archived": false,
+        "assignees_url": "https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}",
+        "blobs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}",
+        "branches_url": "https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}",
+        "clone_url": "https://github.com/ursa-labs/ursabot.git",
+        "collaborators_url": "https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}",
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/comments{/number}",
+        "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}",
+        "compare_url": "https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}",
+        "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}",
+        "contributors_url": "https://api.github.com/repos/ursa-labs/ursabot/contributors",
+        "created_at": "2019-02-04T15:40:31Z",
+        "default_branch": "master",
+        "deployments_url": "https://api.github.com/repos/ursa-labs/ursabot/deployments",
+        "description": null,
+        "disabled": false,
+        "downloads_url": "https://api.github.com/repos/ursa-labs/ursabot/downloads",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/events",
+        "fork": false,
+        "forks": 0,
+        "forks_count": 0,
+        "forks_url": "https://api.github.com/repos/ursa-labs/ursabot/forks",
+        "full_name": "ursa-labs/ursabot",
+        "git_commits_url": "https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}",
+        "git_refs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}",
+        "git_tags_url": "https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}",
+        "git_url": "git://github.com/ursa-labs/ursabot.git",
+        "has_downloads": true,
+        "has_issues": true,
+        "has_pages": false,
+        "has_projects": true,
+        "has_wiki": true,
+        "homepage": null,
+        "hooks_url": "https://api.github.com/repos/ursa-labs/ursabot/hooks",
+        "html_url": "https://github.com/ursa-labs/ursabot",
+        "id": 169101701,
+        "issue_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}",
+        "issue_events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}",
+        "issues_url": "https://api.github.com/repos/ursa-labs/ursabot/issues{/number}",
+        "keys_url": "https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}",
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/labels{/name}",
+        "language": "Jupyter Notebook",
+        "languages_url": "https://api.github.com/repos/ursa-labs/ursabot/languages",
+        "license": null,
+        "merges_url": "https://api.github.com/repos/ursa-labs/ursabot/merges",
+        "milestones_url": "https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}",
+        "mirror_url": null,
+        "name": "ursabot",
+        "node_id": "MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=",
+        "notifications_url": "https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}",
+        "open_issues": 19,
+        "open_issues_count": 19,
+        "owner": {
+            "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+            "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/ursa-labs/followers",
+            "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/ursa-labs",
+            "id": 46514972,
+            "login": "ursa-labs",
+            "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+            "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+            "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+            "repos_url": "https://api.github.com/users/ursa-labs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+            "type": "Organization",
+            "url": "https://api.github.com/users/ursa-labs"
+        },
+        "private": false,
+        "pulls_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}",
+        "pushed_at": "2019-04-05T11:22:16Z",
+        "releases_url": "https://api.github.com/repos/ursa-labs/ursabot/releases{/id}",
+        "size": 892,
+        "ssh_url": "git@github.com:ursa-labs/ursabot.git",
+        "stargazers_count": 1,
+        "stargazers_url": "https://api.github.com/repos/ursa-labs/ursabot/stargazers",
+        "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}",
+        "subscribers_url": "https://api.github.com/repos/ursa-labs/ursabot/subscribers",
+        "subscription_url": "https://api.github.com/repos/ursa-labs/ursabot/subscription",
+        "svn_url": "https://github.com/ursa-labs/ursabot",
+        "tags_url": "https://api.github.com/repos/ursa-labs/ursabot/tags",
+        "teams_url": "https://api.github.com/repos/ursa-labs/ursabot/teams",
+        "trees_url": "https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}",
+        "updated_at": "2019-04-04T17:49:10Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "watchers": 1,
+        "watchers_count": 1
+    },
+    "sender": {
+        "avatar_url": "https://avatars2.githubusercontent.com/u/49275095?v=4",
+        "events_url": "https://api.github.com/users/ursabot/events{/privacy}",
+        "followers_url": "https://api.github.com/users/ursabot/followers",
+        "following_url": "https://api.github.com/users/ursabot/following{/other_user}",
+        "gists_url": "https://api.github.com/users/ursabot/gists{/gist_id}",
+        "gravatar_id": "",
+        "html_url": "https://github.com/ursabot",
+        "id": 49275095,
+        "login": "ursabot",
+        "node_id": "MDQ6VXNlcjQ5Mjc1MDk1",
+        "organizations_url": "https://api.github.com/users/ursabot/orgs",
+        "received_events_url": "https://api.github.com/users/ursabot/received_events",
+        "repos_url": "https://api.github.com/users/ursabot/repos",
+        "site_admin": false,
+        "starred_url": "https://api.github.com/users/ursabot/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/ursabot/subscriptions",
+        "type": "User",
+        "url": "https://api.github.com/users/ursabot"
+    }
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-not-mentioning-ursabot.json b/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-not-mentioning-ursabot.json
new file mode 100644
index 000000000..a3d450078
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-not-mentioning-ursabot.json
@@ -0,0 +1,212 @@
+{
+    "action": "created",
+    "comment": {
+        "author_association": "MEMBER",
+        "body": "bear is no game",
+        "created_at": "2019-04-05T11:26:56Z",
+        "html_url": "https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480241727",
+        "id": 480241727,
+        "issue_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+        "node_id": "MDEyOklzc3VlQ29tbWVudDQ4MDI0MTcyNw==",
+        "updated_at": "2019-04-05T11:26:56Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480241727",
+        "user": {
+            "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+            "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/kszucs/followers",
+            "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/kszucs",
+            "id": 961747,
+            "login": "kszucs",
+            "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+            "organizations_url": "https://api.github.com/users/kszucs/orgs",
+            "received_events_url": "https://api.github.com/users/kszucs/received_events",
+            "repos_url": "https://api.github.com/users/kszucs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+            "type": "User",
+            "url": "https://api.github.com/users/kszucs"
+        }
+    },
+    "issue": {
+        "assignee": null,
+        "assignees": [],
+        "author_association": "MEMBER",
+        "body": "",
+        "closed_at": null,
+        "comments": 0,
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments",
+        "created_at": "2019-04-05T11:22:15Z",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/events",
+        "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+        "id": 429706959,
+        "labels": [],
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}",
+        "locked": false,
+        "milestone": null,
+        "node_id": "MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy",
+        "number": 26,
+        "pull_request": {
+            "diff_url": "https://github.com/ursa-labs/ursabot/pull/26.diff",
+            "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+            "patch_url": "https://github.com/ursa-labs/ursabot/pull/26.patch",
+            "url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26"
+        },
+        "repository_url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "state": "open",
+        "title": "Unittests for GithubHook",
+        "updated_at": "2019-04-05T11:26:56Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+        "user": {
+            "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+            "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/kszucs/followers",
+            "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/kszucs",
+            "id": 961747,
+            "login": "kszucs",
+            "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+            "organizations_url": "https://api.github.com/users/kszucs/orgs",
+            "received_events_url": "https://api.github.com/users/kszucs/received_events",
+            "repos_url": "https://api.github.com/users/kszucs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+            "type": "User",
+            "url": "https://api.github.com/users/kszucs"
+        }
+    },
+    "organization": {
+        "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+        "description": "Innovation lab for open source data science tools, powered by Apache Arrow",
+        "events_url": "https://api.github.com/orgs/ursa-labs/events",
+        "hooks_url": "https://api.github.com/orgs/ursa-labs/hooks",
+        "id": 46514972,
+        "issues_url": "https://api.github.com/orgs/ursa-labs/issues",
+        "login": "ursa-labs",
+        "members_url": "https://api.github.com/orgs/ursa-labs/members{/member}",
+        "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+        "public_members_url": "https://api.github.com/orgs/ursa-labs/public_members{/member}",
+        "repos_url": "https://api.github.com/orgs/ursa-labs/repos",
+        "url": "https://api.github.com/orgs/ursa-labs"
+    },
+    "repository": {
+        "archive_url": "https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}",
+        "archived": false,
+        "assignees_url": "https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}",
+        "blobs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}",
+        "branches_url": "https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}",
+        "clone_url": "https://github.com/ursa-labs/ursabot.git",
+        "collaborators_url": "https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}",
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/comments{/number}",
+        "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}",
+        "compare_url": "https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}",
+        "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}",
+        "contributors_url": "https://api.github.com/repos/ursa-labs/ursabot/contributors",
+        "created_at": "2019-02-04T15:40:31Z",
+        "default_branch": "master",
+        "deployments_url": "https://api.github.com/repos/ursa-labs/ursabot/deployments",
+        "description": null,
+        "disabled": false,
+        "downloads_url": "https://api.github.com/repos/ursa-labs/ursabot/downloads",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/events",
+        "fork": false,
+        "forks": 0,
+        "forks_count": 0,
+        "forks_url": "https://api.github.com/repos/ursa-labs/ursabot/forks",
+        "full_name": "ursa-labs/ursabot",
+        "git_commits_url": "https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}",
+        "git_refs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}",
+        "git_tags_url": "https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}",
+        "git_url": "git://github.com/ursa-labs/ursabot.git",
+        "has_downloads": true,
+        "has_issues": true,
+        "has_pages": false,
+        "has_projects": true,
+        "has_wiki": true,
+        "homepage": null,
+        "hooks_url": "https://api.github.com/repos/ursa-labs/ursabot/hooks",
+        "html_url": "https://github.com/ursa-labs/ursabot",
+        "id": 169101701,
+        "issue_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}",
+        "issue_events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}",
+        "issues_url": "https://api.github.com/repos/ursa-labs/ursabot/issues{/number}",
+        "keys_url": "https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}",
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/labels{/name}",
+        "language": "Jupyter Notebook",
+        "languages_url": "https://api.github.com/repos/ursa-labs/ursabot/languages",
+        "license": null,
+        "merges_url": "https://api.github.com/repos/ursa-labs/ursabot/merges",
+        "milestones_url": "https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}",
+        "mirror_url": null,
+        "name": "ursabot",
+        "node_id": "MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=",
+        "notifications_url": "https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}",
+        "open_issues": 19,
+        "open_issues_count": 19,
+        "owner": {
+            "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+            "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/ursa-labs/followers",
+            "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/ursa-labs",
+            "id": 46514972,
+            "login": "ursa-labs",
+            "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+            "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+            "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+            "repos_url": "https://api.github.com/users/ursa-labs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+            "type": "Organization",
+            "url": "https://api.github.com/users/ursa-labs"
+        },
+        "private": false,
+        "pulls_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}",
+        "pushed_at": "2019-04-05T11:22:16Z",
+        "releases_url": "https://api.github.com/repos/ursa-labs/ursabot/releases{/id}",
+        "size": 892,
+        "ssh_url": "git@github.com:ursa-labs/ursabot.git",
+        "stargazers_count": 1,
+        "stargazers_url": "https://api.github.com/repos/ursa-labs/ursabot/stargazers",
+        "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}",
+        "subscribers_url": "https://api.github.com/repos/ursa-labs/ursabot/subscribers",
+        "subscription_url": "https://api.github.com/repos/ursa-labs/ursabot/subscription",
+        "svn_url": "https://github.com/ursa-labs/ursabot",
+        "tags_url": "https://api.github.com/repos/ursa-labs/ursabot/tags",
+        "teams_url": "https://api.github.com/repos/ursa-labs/ursabot/teams",
+        "trees_url": "https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}",
+        "updated_at": "2019-04-04T17:49:10Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "watchers": 1,
+        "watchers_count": 1
+    },
+    "sender": {
+        "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+        "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+        "followers_url": "https://api.github.com/users/kszucs/followers",
+        "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+        "gravatar_id": "",
+        "html_url": "https://github.com/kszucs",
+        "id": 961747,
+        "login": "kszucs",
+        "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+        "organizations_url": "https://api.github.com/users/kszucs/orgs",
+        "received_events_url": "https://api.github.com/users/kszucs/received_events",
+        "repos_url": "https://api.github.com/users/kszucs/repos",
+        "site_admin": false,
+        "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+        "type": "User",
+        "url": "https://api.github.com/users/kszucs"
+    }
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-with-empty-command.json b/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-with-empty-command.json
new file mode 100644
index 000000000..c88197c8e
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-with-empty-command.json
@@ -0,0 +1,217 @@
+{
+    "action": "created",
+    "comment": {
+        "author_association": "MEMBER",
+        "body": "@ursabot ",
+        "body_html": "",
+        "body_text": "",
+        "created_at": "2019-04-05T11:35:46Z",
+        "html_url": "https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480243811",
+        "id": 480243811,
+        "issue_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+        "node_id": "MDEyOklzc3VlQ29tbWVudDQ4MDI0MzgxMQ==",
+        "updated_at": "2019-04-05T11:35:46Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480243811",
+        "user": {
+            "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+            "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/kszucs/followers",
+            "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/kszucs",
+            "id": 961747,
+            "login": "kszucs",
+            "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+            "organizations_url": "https://api.github.com/users/kszucs/orgs",
+            "received_events_url": "https://api.github.com/users/kszucs/received_events",
+            "repos_url": "https://api.github.com/users/kszucs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+            "type": "User",
+            "url": "https://api.github.com/users/kszucs"
+        }
+    },
+    "issue": {
+        "assignee": null,
+        "assignees": [],
+        "author_association": "MEMBER",
+        "body": "",
+        "body_html": "",
+        "body_text": "",
+        "closed_at": null,
+        "closed_by": null,
+        "comments": 1,
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments",
+        "created_at": "2019-04-05T11:22:15Z",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/events",
+        "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+        "id": 429706959,
+        "labels": [],
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}",
+        "locked": false,
+        "milestone": null,
+        "node_id": "MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy",
+        "number": 26,
+        "pull_request": {
+            "diff_url": "https://github.com/ursa-labs/ursabot/pull/26.diff",
+            "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+            "patch_url": "https://github.com/ursa-labs/ursabot/pull/26.patch",
+            "url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26"
+        },
+        "repository_url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "state": "open",
+        "title": "Unittests for GithubHook",
+        "updated_at": "2019-04-05T11:35:46Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+        "user": {
+            "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+            "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/kszucs/followers",
+            "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/kszucs",
+            "id": 961747,
+            "login": "kszucs",
+            "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+            "organizations_url": "https://api.github.com/users/kszucs/orgs",
+            "received_events_url": "https://api.github.com/users/kszucs/received_events",
+            "repos_url": "https://api.github.com/users/kszucs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+            "type": "User",
+            "url": "https://api.github.com/users/kszucs"
+        }
+    },
+    "organization": {
+        "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+        "description": "Innovation lab for open source data science tools, powered by Apache Arrow",
+        "events_url": "https://api.github.com/orgs/ursa-labs/events",
+        "hooks_url": "https://api.github.com/orgs/ursa-labs/hooks",
+        "id": 46514972,
+        "issues_url": "https://api.github.com/orgs/ursa-labs/issues",
+        "login": "ursa-labs",
+        "members_url": "https://api.github.com/orgs/ursa-labs/members{/member}",
+        "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+        "public_members_url": "https://api.github.com/orgs/ursa-labs/public_members{/member}",
+        "repos_url": "https://api.github.com/orgs/ursa-labs/repos",
+        "url": "https://api.github.com/orgs/ursa-labs"
+    },
+    "repository": {
+        "archive_url": "https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}",
+        "archived": false,
+        "assignees_url": "https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}",
+        "blobs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}",
+        "branches_url": "https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}",
+        "clone_url": "https://github.com/ursa-labs/ursabot.git",
+        "collaborators_url": "https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}",
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/comments{/number}",
+        "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}",
+        "compare_url": "https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}",
+        "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}",
+        "contributors_url": "https://api.github.com/repos/ursa-labs/ursabot/contributors",
+        "created_at": "2019-02-04T15:40:31Z",
+        "default_branch": "master",
+        "deployments_url": "https://api.github.com/repos/ursa-labs/ursabot/deployments",
+        "description": null,
+        "disabled": false,
+        "downloads_url": "https://api.github.com/repos/ursa-labs/ursabot/downloads",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/events",
+        "fork": false,
+        "forks": 0,
+        "forks_count": 0,
+        "forks_url": "https://api.github.com/repos/ursa-labs/ursabot/forks",
+        "full_name": "ursa-labs/ursabot",
+        "git_commits_url": "https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}",
+        "git_refs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}",
+        "git_tags_url": "https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}",
+        "git_url": "git://github.com/ursa-labs/ursabot.git",
+        "has_downloads": true,
+        "has_issues": true,
+        "has_pages": false,
+        "has_projects": true,
+        "has_wiki": true,
+        "homepage": null,
+        "hooks_url": "https://api.github.com/repos/ursa-labs/ursabot/hooks",
+        "html_url": "https://github.com/ursa-labs/ursabot",
+        "id": 169101701,
+        "issue_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}",
+        "issue_events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}",
+        "issues_url": "https://api.github.com/repos/ursa-labs/ursabot/issues{/number}",
+        "keys_url": "https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}",
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/labels{/name}",
+        "language": "Jupyter Notebook",
+        "languages_url": "https://api.github.com/repos/ursa-labs/ursabot/languages",
+        "license": null,
+        "merges_url": "https://api.github.com/repos/ursa-labs/ursabot/merges",
+        "milestones_url": "https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}",
+        "mirror_url": null,
+        "name": "ursabot",
+        "node_id": "MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=",
+        "notifications_url": "https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}",
+        "open_issues": 19,
+        "open_issues_count": 19,
+        "owner": {
+            "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+            "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/ursa-labs/followers",
+            "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/ursa-labs",
+            "id": 46514972,
+            "login": "ursa-labs",
+            "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+            "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+            "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+            "repos_url": "https://api.github.com/users/ursa-labs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+            "type": "Organization",
+            "url": "https://api.github.com/users/ursa-labs"
+        },
+        "private": false,
+        "pulls_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}",
+        "pushed_at": "2019-04-05T11:22:16Z",
+        "releases_url": "https://api.github.com/repos/ursa-labs/ursabot/releases{/id}",
+        "size": 892,
+        "ssh_url": "git@github.com:ursa-labs/ursabot.git",
+        "stargazers_count": 1,
+        "stargazers_url": "https://api.github.com/repos/ursa-labs/ursabot/stargazers",
+        "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}",
+        "subscribers_url": "https://api.github.com/repos/ursa-labs/ursabot/subscribers",
+        "subscription_url": "https://api.github.com/repos/ursa-labs/ursabot/subscription",
+        "svn_url": "https://github.com/ursa-labs/ursabot",
+        "tags_url": "https://api.github.com/repos/ursa-labs/ursabot/tags",
+        "teams_url": "https://api.github.com/repos/ursa-labs/ursabot/teams",
+        "trees_url": "https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}",
+        "updated_at": "2019-04-04T17:49:10Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "watchers": 1,
+        "watchers_count": 1
+    },
+    "sender": {
+        "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+        "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+        "followers_url": "https://api.github.com/users/kszucs/followers",
+        "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+        "gravatar_id": "",
+        "html_url": "https://github.com/kszucs",
+        "id": 961747,
+        "login": "kszucs",
+        "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+        "organizations_url": "https://api.github.com/users/kszucs/orgs",
+        "received_events_url": "https://api.github.com/users/kszucs/received_events",
+        "repos_url": "https://api.github.com/users/kszucs/repos",
+        "site_admin": false,
+        "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+        "type": "User",
+        "url": "https://api.github.com/users/kszucs"
+    }
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-without-pull-request.json b/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-without-pull-request.json
new file mode 100644
index 000000000..9e362fc0e
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/event-issue-comment-without-pull-request.json
@@ -0,0 +1,206 @@
+{
+    "action": "created",
+    "comment": {
+        "author_association": "MEMBER",
+        "body": "@ursabot build",
+        "created_at": "2019-04-05T13:07:57Z",
+        "html_url": "https://github.com/ursa-labs/ursabot/issues/19#issuecomment-480268708",
+        "id": 480268708,
+        "issue_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/19",
+        "node_id": "MDEyOklzc3VlQ29tbWVudDQ4MDI2ODcwOA==",
+        "updated_at": "2019-04-05T13:07:57Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480268708",
+        "user": {
+            "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+            "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/kszucs/followers",
+            "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/kszucs",
+            "id": 961747,
+            "login": "kszucs",
+            "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+            "organizations_url": "https://api.github.com/users/kszucs/orgs",
+            "received_events_url": "https://api.github.com/users/kszucs/received_events",
+            "repos_url": "https://api.github.com/users/kszucs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+            "type": "User",
+            "url": "https://api.github.com/users/kszucs"
+        }
+    },
+    "issue": {
+        "assignee": null,
+        "assignees": [],
+        "author_association": "MEMBER",
+        "body": "",
+        "closed_at": null,
+        "comments": 5,
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/19/comments",
+        "created_at": "2019-04-02T09:56:41Z",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/19/events",
+        "html_url": "https://github.com/ursa-labs/ursabot/issues/19",
+        "id": 428131685,
+        "labels": [],
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/19/labels{/name}",
+        "locked": false,
+        "milestone": null,
+        "node_id": "MDU6SXNzdWU0MjgxMzE2ODU=",
+        "number": 19,
+        "repository_url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "state": "open",
+        "title": "Build ursabot itself via ursabot",
+        "updated_at": "2019-04-05T13:07:57Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/19",
+        "user": {
+            "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+            "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/kszucs/followers",
+            "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/kszucs",
+            "id": 961747,
+            "login": "kszucs",
+            "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+            "organizations_url": "https://api.github.com/users/kszucs/orgs",
+            "received_events_url": "https://api.github.com/users/kszucs/received_events",
+            "repos_url": "https://api.github.com/users/kszucs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+            "type": "User",
+            "url": "https://api.github.com/users/kszucs"
+        }
+    },
+    "organization": {
+        "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+        "description": "Innovation lab for open source data science tools, powered by Apache Arrow",
+        "events_url": "https://api.github.com/orgs/ursa-labs/events",
+        "hooks_url": "https://api.github.com/orgs/ursa-labs/hooks",
+        "id": 46514972,
+        "issues_url": "https://api.github.com/orgs/ursa-labs/issues",
+        "login": "ursa-labs",
+        "members_url": "https://api.github.com/orgs/ursa-labs/members{/member}",
+        "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+        "public_members_url": "https://api.github.com/orgs/ursa-labs/public_members{/member}",
+        "repos_url": "https://api.github.com/orgs/ursa-labs/repos",
+        "url": "https://api.github.com/orgs/ursa-labs"
+    },
+    "repository": {
+        "archive_url": "https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}",
+        "archived": false,
+        "assignees_url": "https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}",
+        "blobs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}",
+        "branches_url": "https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}",
+        "clone_url": "https://github.com/ursa-labs/ursabot.git",
+        "collaborators_url": "https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}",
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/comments{/number}",
+        "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}",
+        "compare_url": "https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}",
+        "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}",
+        "contributors_url": "https://api.github.com/repos/ursa-labs/ursabot/contributors",
+        "created_at": "2019-02-04T15:40:31Z",
+        "default_branch": "master",
+        "deployments_url": "https://api.github.com/repos/ursa-labs/ursabot/deployments",
+        "description": null,
+        "disabled": false,
+        "downloads_url": "https://api.github.com/repos/ursa-labs/ursabot/downloads",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/events",
+        "fork": false,
+        "forks": 0,
+        "forks_count": 0,
+        "forks_url": "https://api.github.com/repos/ursa-labs/ursabot/forks",
+        "full_name": "ursa-labs/ursabot",
+        "git_commits_url": "https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}",
+        "git_refs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}",
+        "git_tags_url": "https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}",
+        "git_url": "git://github.com/ursa-labs/ursabot.git",
+        "has_downloads": true,
+        "has_issues": true,
+        "has_pages": false,
+        "has_projects": true,
+        "has_wiki": true,
+        "homepage": null,
+        "hooks_url": "https://api.github.com/repos/ursa-labs/ursabot/hooks",
+        "html_url": "https://github.com/ursa-labs/ursabot",
+        "id": 169101701,
+        "issue_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}",
+        "issue_events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}",
+        "issues_url": "https://api.github.com/repos/ursa-labs/ursabot/issues{/number}",
+        "keys_url": "https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}",
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/labels{/name}",
+        "language": "Jupyter Notebook",
+        "languages_url": "https://api.github.com/repos/ursa-labs/ursabot/languages",
+        "license": null,
+        "merges_url": "https://api.github.com/repos/ursa-labs/ursabot/merges",
+        "milestones_url": "https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}",
+        "mirror_url": null,
+        "name": "ursabot",
+        "node_id": "MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=",
+        "notifications_url": "https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}",
+        "open_issues": 19,
+        "open_issues_count": 19,
+        "owner": {
+            "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+            "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+            "followers_url": "https://api.github.com/users/ursa-labs/followers",
+            "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+            "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+            "gravatar_id": "",
+            "html_url": "https://github.com/ursa-labs",
+            "id": 46514972,
+            "login": "ursa-labs",
+            "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+            "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+            "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+            "repos_url": "https://api.github.com/users/ursa-labs/repos",
+            "site_admin": false,
+            "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+            "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+            "type": "Organization",
+            "url": "https://api.github.com/users/ursa-labs"
+        },
+        "private": false,
+        "pulls_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}",
+        "pushed_at": "2019-04-05T12:01:40Z",
+        "releases_url": "https://api.github.com/repos/ursa-labs/ursabot/releases{/id}",
+        "size": 898,
+        "ssh_url": "git@github.com:ursa-labs/ursabot.git",
+        "stargazers_count": 1,
+        "stargazers_url": "https://api.github.com/repos/ursa-labs/ursabot/stargazers",
+        "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}",
+        "subscribers_url": "https://api.github.com/repos/ursa-labs/ursabot/subscribers",
+        "subscription_url": "https://api.github.com/repos/ursa-labs/ursabot/subscription",
+        "svn_url": "https://github.com/ursa-labs/ursabot",
+        "tags_url": "https://api.github.com/repos/ursa-labs/ursabot/tags",
+        "teams_url": "https://api.github.com/repos/ursa-labs/ursabot/teams",
+        "trees_url": "https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}",
+        "updated_at": "2019-04-04T17:49:10Z",
+        "url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "watchers": 1,
+        "watchers_count": 1
+    },
+    "sender": {
+        "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+        "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+        "followers_url": "https://api.github.com/users/kszucs/followers",
+        "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+        "gravatar_id": "",
+        "html_url": "https://github.com/kszucs",
+        "id": 961747,
+        "login": "kszucs",
+        "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+        "organizations_url": "https://api.github.com/users/kszucs/orgs",
+        "received_events_url": "https://api.github.com/users/kszucs/received_events",
+        "repos_url": "https://api.github.com/users/kszucs/repos",
+        "site_admin": false,
+        "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+        "type": "User",
+        "url": "https://api.github.com/users/kszucs"
+    }
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/event-pull-request-opened.json b/src/arrow/dev/archery/archery/tests/fixtures/event-pull-request-opened.json
new file mode 100644
index 000000000..9cf5c0dda
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/event-pull-request-opened.json
@@ -0,0 +1,445 @@
+{
+  "action": "opened",
+  "number": 26,
+  "pull_request": {
+    "url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26",
+    "id": 267785552,
+    "node_id": "MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy",
+    "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+    "diff_url": "https://github.com/ursa-labs/ursabot/pull/26.diff",
+    "patch_url": "https://github.com/ursa-labs/ursabot/pull/26.patch",
+    "issue_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+    "number": 26,
+    "state": "open",
+    "locked": false,
+    "title": "Unittests for GithubHook",
+    "user": {
+      "login": "kszucs",
+      "id": 961747,
+      "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+      "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+      "gravatar_id": "",
+      "url": "https://api.github.com/users/kszucs",
+      "html_url": "https://github.com/kszucs",
+      "followers_url": "https://api.github.com/users/kszucs/followers",
+      "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+      "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+      "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+      "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+      "organizations_url": "https://api.github.com/users/kszucs/orgs",
+      "repos_url": "https://api.github.com/users/kszucs/repos",
+      "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+      "received_events_url": "https://api.github.com/users/kszucs/received_events",
+      "type": "User",
+      "site_admin": false
+    },
+    "body": "",
+    "created_at": "2019-04-05T11:22:15Z",
+    "updated_at": "2019-04-05T12:01:40Z",
+    "closed_at": null,
+    "merged_at": null,
+    "merge_commit_sha": "cc5dc3606988b3824be54df779ed2028776113cb",
+    "assignee": null,
+    "assignees": [],
+    "requested_reviewers": [],
+    "requested_teams": [],
+    "labels": [],
+    "milestone": null,
+    "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26/commits",
+    "review_comments_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26/comments",
+    "review_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/comments{/number}",
+    "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments",
+    "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/2705da2b616b98fa6010a25813c5a7a27456f71d",
+    "head": {
+      "label": "ursa-labs:test-hook",
+      "ref": "test-hook",
+      "sha": "2705da2b616b98fa6010a25813c5a7a27456f71d",
+      "user": {
+        "login": "ursa-labs",
+        "id": 46514972,
+        "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+        "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+        "gravatar_id": "",
+        "url": "https://api.github.com/users/ursa-labs",
+        "html_url": "https://github.com/ursa-labs",
+        "followers_url": "https://api.github.com/users/ursa-labs/followers",
+        "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+        "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+        "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+        "repos_url": "https://api.github.com/users/ursa-labs/repos",
+        "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+        "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+        "type": "Organization",
+        "site_admin": false
+      },
+      "repo": {
+        "id": 169101701,
+        "node_id": "MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=",
+        "name": "ursabot",
+        "full_name": "ursa-labs/ursabot",
+        "private": false,
+        "owner": {
+          "login": "ursa-labs",
+          "id": 46514972,
+          "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+          "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+          "gravatar_id": "",
+          "url": "https://api.github.com/users/ursa-labs",
+          "html_url": "https://github.com/ursa-labs",
+          "followers_url": "https://api.github.com/users/ursa-labs/followers",
+          "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+          "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+          "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+          "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+          "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+          "repos_url": "https://api.github.com/users/ursa-labs/repos",
+          "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+          "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+          "type": "Organization",
+          "site_admin": false
+        },
+        "html_url": "https://github.com/ursa-labs/ursabot",
+        "description": null,
+        "fork": false,
+        "url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "forks_url": "https://api.github.com/repos/ursa-labs/ursabot/forks",
+        "keys_url": "https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}",
+        "collaborators_url": "https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}",
+        "teams_url": "https://api.github.com/repos/ursa-labs/ursabot/teams",
+        "hooks_url": "https://api.github.com/repos/ursa-labs/ursabot/hooks",
+        "issue_events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/events",
+        "assignees_url": "https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}",
+        "branches_url": "https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}",
+        "tags_url": "https://api.github.com/repos/ursa-labs/ursabot/tags",
+        "blobs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}",
+        "git_tags_url": "https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}",
+        "git_refs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}",
+        "trees_url": "https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}",
+        "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}",
+        "languages_url": "https://api.github.com/repos/ursa-labs/ursabot/languages",
+        "stargazers_url": "https://api.github.com/repos/ursa-labs/ursabot/stargazers",
+        "contributors_url": "https://api.github.com/repos/ursa-labs/ursabot/contributors",
+        "subscribers_url": "https://api.github.com/repos/ursa-labs/ursabot/subscribers",
+        "subscription_url": "https://api.github.com/repos/ursa-labs/ursabot/subscription",
+        "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}",
+        "git_commits_url": "https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}",
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/comments{/number}",
+        "issue_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}",
+        "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}",
+        "compare_url": "https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}",
+        "merges_url": "https://api.github.com/repos/ursa-labs/ursabot/merges",
+        "archive_url": "https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}",
+        "downloads_url": "https://api.github.com/repos/ursa-labs/ursabot/downloads",
+        "issues_url": "https://api.github.com/repos/ursa-labs/ursabot/issues{/number}",
+        "pulls_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}",
+        "milestones_url": "https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}",
+        "notifications_url": "https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}",
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/labels{/name}",
+        "releases_url": "https://api.github.com/repos/ursa-labs/ursabot/releases{/id}",
+        "deployments_url": "https://api.github.com/repos/ursa-labs/ursabot/deployments",
+        "created_at": "2019-02-04T15:40:31Z",
+        "updated_at": "2019-04-04T17:49:10Z",
+        "pushed_at": "2019-04-05T12:01:40Z",
+        "git_url": "git://github.com/ursa-labs/ursabot.git",
+        "ssh_url": "git@github.com:ursa-labs/ursabot.git",
+        "clone_url": "https://github.com/ursa-labs/ursabot.git",
+        "svn_url": "https://github.com/ursa-labs/ursabot",
+        "homepage": null,
+        "size": 898,
+        "stargazers_count": 1,
+        "watchers_count": 1,
+        "language": "Jupyter Notebook",
+        "has_issues": true,
+        "has_projects": true,
+        "has_downloads": true,
+        "has_wiki": true,
+        "has_pages": false,
+        "forks_count": 0,
+        "mirror_url": null,
+        "archived": false,
+        "disabled": false,
+        "open_issues_count": 19,
+        "license": null,
+        "forks": 0,
+        "open_issues": 19,
+        "watchers": 1,
+        "default_branch": "master"
+      }
+    },
+    "base": {
+      "label": "ursa-labs:master",
+      "ref": "master",
+      "sha": "a162ad254b589b924db47e057791191b39613fd5",
+      "user": {
+        "login": "ursa-labs",
+        "id": 46514972,
+        "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+        "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+        "gravatar_id": "",
+        "url": "https://api.github.com/users/ursa-labs",
+        "html_url": "https://github.com/ursa-labs",
+        "followers_url": "https://api.github.com/users/ursa-labs/followers",
+        "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+        "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+        "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+        "repos_url": "https://api.github.com/users/ursa-labs/repos",
+        "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+        "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+        "type": "Organization",
+        "site_admin": false
+      },
+      "repo": {
+        "id": 169101701,
+        "node_id": "MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=",
+        "name": "ursabot",
+        "full_name": "ursa-labs/ursabot",
+        "private": false,
+        "owner": {
+          "login": "ursa-labs",
+          "id": 46514972,
+          "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+          "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+          "gravatar_id": "",
+          "url": "https://api.github.com/users/ursa-labs",
+          "html_url": "https://github.com/ursa-labs",
+          "followers_url": "https://api.github.com/users/ursa-labs/followers",
+          "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+          "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+          "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+          "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+          "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+          "repos_url": "https://api.github.com/users/ursa-labs/repos",
+          "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+          "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+          "type": "Organization",
+          "site_admin": false
+        },
+        "html_url": "https://github.com/ursa-labs/ursabot",
+        "description": null,
+        "fork": false,
+        "url": "https://api.github.com/repos/ursa-labs/ursabot",
+        "forks_url": "https://api.github.com/repos/ursa-labs/ursabot/forks",
+        "keys_url": "https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}",
+        "collaborators_url": "https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}",
+        "teams_url": "https://api.github.com/repos/ursa-labs/ursabot/teams",
+        "hooks_url": "https://api.github.com/repos/ursa-labs/ursabot/hooks",
+        "issue_events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}",
+        "events_url": "https://api.github.com/repos/ursa-labs/ursabot/events",
+        "assignees_url": "https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}",
+        "branches_url": "https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}",
+        "tags_url": "https://api.github.com/repos/ursa-labs/ursabot/tags",
+        "blobs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}",
+        "git_tags_url": "https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}",
+        "git_refs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}",
+        "trees_url": "https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}",
+        "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}",
+        "languages_url": "https://api.github.com/repos/ursa-labs/ursabot/languages",
+        "stargazers_url": "https://api.github.com/repos/ursa-labs/ursabot/stargazers",
+        "contributors_url": "https://api.github.com/repos/ursa-labs/ursabot/contributors",
+        "subscribers_url": "https://api.github.com/repos/ursa-labs/ursabot/subscribers",
+        "subscription_url": "https://api.github.com/repos/ursa-labs/ursabot/subscription",
+        "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}",
+        "git_commits_url": "https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}",
+        "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/comments{/number}",
+        "issue_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}",
+        "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}",
+        "compare_url": "https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}",
+        "merges_url": "https://api.github.com/repos/ursa-labs/ursabot/merges",
+        "archive_url": "https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}",
+        "downloads_url": "https://api.github.com/repos/ursa-labs/ursabot/downloads",
+        "issues_url": "https://api.github.com/repos/ursa-labs/ursabot/issues{/number}",
+        "pulls_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}",
+        "milestones_url": "https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}",
+        "notifications_url": "https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}",
+        "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/labels{/name}",
+        "releases_url": "https://api.github.com/repos/ursa-labs/ursabot/releases{/id}",
+        "deployments_url": "https://api.github.com/repos/ursa-labs/ursabot/deployments",
+        "created_at": "2019-02-04T15:40:31Z",
+        "updated_at": "2019-04-04T17:49:10Z",
+        "pushed_at": "2019-04-05T12:01:40Z",
+        "git_url": "git://github.com/ursa-labs/ursabot.git",
+        "ssh_url": "git@github.com:ursa-labs/ursabot.git",
+        "clone_url": "https://github.com/ursa-labs/ursabot.git",
+        "svn_url": "https://github.com/ursa-labs/ursabot",
+        "homepage": null,
+        "size": 898,
+        "stargazers_count": 1,
+        "watchers_count": 1,
+        "language": "Jupyter Notebook",
+        "has_issues": true,
+        "has_projects": true,
+        "has_downloads": true,
+        "has_wiki": true,
+        "has_pages": false,
+        "forks_count": 0,
+        "mirror_url": null,
+        "archived": false,
+        "disabled": false,
+        "open_issues_count": 19,
+        "license": null,
+        "forks": 0,
+        "open_issues": 19,
+        "watchers": 1,
+        "default_branch": "master"
+      }
+    },
+    "_links": {
+      "self": {
+        "href": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26"
+      },
+      "html": {
+        "href": "https://github.com/ursa-labs/ursabot/pull/26"
+      },
+      "issue": {
+        "href": "https://api.github.com/repos/ursa-labs/ursabot/issues/26"
+      },
+      "comments": {
+        "href": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments"
+      },
+      "review_comments": {
+        "href": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26/comments"
+      },
+      "review_comment": {
+        "href": "https://api.github.com/repos/ursa-labs/ursabot/pulls/comments{/number}"
+      },
+      "commits": {
+        "href": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26/commits"
+      },
+      "statuses": {
+        "href": "https://api.github.com/repos/ursa-labs/ursabot/statuses/2705da2b616b98fa6010a25813c5a7a27456f71d"
+      }
+    },
+    "author_association": "MEMBER",
+    "merged": false,
+    "mergeable": true,
+    "rebaseable": true,
+    "mergeable_state": "unstable",
+    "merged_by": null,
+    "comments": 5,
+    "review_comments": 0,
+    "maintainer_can_modify": false,
+    "commits": 2,
+    "additions": 1124,
+    "deletions": 0,
+    "changed_files": 7
+  },
+  "repository": {
+    "archive_url": "https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}",
+    "archived": false,
+    "assignees_url": "https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}",
+    "blobs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}",
+    "branches_url": "https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}",
+    "clone_url": "https://github.com/ursa-labs/ursabot.git",
+    "collaborators_url": "https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}",
+    "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/comments{/number}",
+    "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}",
+    "compare_url": "https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}",
+    "contributors_url": "https://api.github.com/repos/ursa-labs/ursabot/contributors",
+    "created_at": "2019-02-04T15:40:31Z",
+    "default_branch": "master",
+    "deployments_url": "https://api.github.com/repos/ursa-labs/ursabot/deployments",
+    "description": null,
+    "disabled": false,
+    "downloads_url": "https://api.github.com/repos/ursa-labs/ursabot/downloads",
+    "events_url": "https://api.github.com/repos/ursa-labs/ursabot/events",
+    "fork": false,
+    "forks": 0,
+    "forks_count": 0,
+    "forks_url": "https://api.github.com/repos/ursa-labs/ursabot/forks",
+    "full_name": "ursa-labs/ursabot",
+    "git_commits_url": "https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}",
+    "git_refs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}",
+    "git_tags_url": "https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}",
+    "git_url": "git://github.com/ursa-labs/ursabot.git",
+    "has_downloads": true,
+    "has_issues": true,
+    "has_pages": false,
+    "has_projects": true,
+    "has_wiki": true,
+    "homepage": null,
+    "hooks_url": "https://api.github.com/repos/ursa-labs/ursabot/hooks",
+    "html_url": "https://github.com/ursa-labs/ursabot",
+    "id": 169101701,
+    "issue_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}",
+    "issue_events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}",
+    "issues_url": "https://api.github.com/repos/ursa-labs/ursabot/issues{/number}",
+    "keys_url": "https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}",
+    "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/labels{/name}",
+    "language": "Jupyter Notebook",
+    "languages_url": "https://api.github.com/repos/ursa-labs/ursabot/languages",
+    "license": null,
+    "merges_url": "https://api.github.com/repos/ursa-labs/ursabot/merges",
+    "milestones_url": "https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}",
+    "mirror_url": null,
+    "name": "ursabot",
+    "node_id": "MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=",
+    "notifications_url": "https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}",
+    "open_issues": 19,
+    "open_issues_count": 19,
+    "owner": {
+      "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+      "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+      "followers_url": "https://api.github.com/users/ursa-labs/followers",
+      "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+      "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+      "gravatar_id": "",
+      "html_url": "https://github.com/ursa-labs",
+      "id": 46514972,
+      "login": "ursa-labs",
+      "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+      "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+      "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+      "repos_url": "https://api.github.com/users/ursa-labs/repos",
+      "site_admin": false,
+      "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+      "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+      "type": "Organization",
+      "url": "https://api.github.com/users/ursa-labs"
+    },
+    "private": false,
+    "pulls_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}",
+    "pushed_at": "2019-04-05T11:22:16Z",
+    "releases_url": "https://api.github.com/repos/ursa-labs/ursabot/releases{/id}",
+    "size": 892,
+    "ssh_url": "git@github.com:ursa-labs/ursabot.git",
+    "stargazers_count": 1,
+    "stargazers_url": "https://api.github.com/repos/ursa-labs/ursabot/stargazers",
+    "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}",
+    "subscribers_url": "https://api.github.com/repos/ursa-labs/ursabot/subscribers",
+    "subscription_url": "https://api.github.com/repos/ursa-labs/ursabot/subscription",
+    "svn_url": "https://github.com/ursa-labs/ursabot",
+    "tags_url": "https://api.github.com/repos/ursa-labs/ursabot/tags",
+    "teams_url": "https://api.github.com/repos/ursa-labs/ursabot/teams",
+    "trees_url": "https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}",
+    "updated_at": "2019-04-04T17:49:10Z",
+    "url": "https://api.github.com/repos/ursa-labs/ursabot",
+    "watchers": 1,
+    "watchers_count": 1
+  },
+  "sender": {
+    "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+    "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+    "followers_url": "https://api.github.com/users/kszucs/followers",
+    "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+    "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+    "gravatar_id": "",
+    "html_url": "https://github.com/kszucs",
+    "id": 961747,
+    "login": "kszucs",
+    "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+    "organizations_url": "https://api.github.com/users/kszucs/orgs",
+    "received_events_url": "https://api.github.com/users/kszucs/received_events",
+    "repos_url": "https://api.github.com/users/kszucs/repos",
+    "site_admin": false,
+    "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+    "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+    "type": "User",
+    "url": "https://api.github.com/users/kszucs"
+  }
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/issue-19.json b/src/arrow/dev/archery/archery/tests/fixtures/issue-19.json
new file mode 100644
index 000000000..1e4939776
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/issue-19.json
@@ -0,0 +1,64 @@
+{
+    "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/19",
+    "repository_url": "https://api.github.com/repos/ursa-labs/ursabot",
+    "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/19/labels{/name}",
+    "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/19/comments",
+    "events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/19/events",
+    "html_url": "https://github.com/ursa-labs/ursabot/issues/19",
+    "id": 428131685,
+    "node_id": "MDU6SXNzdWU0MjgxMzE2ODU=",
+    "number": 19,
+    "title": "Build ursabot itself via ursabot",
+    "user": {
+        "login": "kszucs",
+        "id": 961747,
+        "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+        "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+        "gravatar_id": "",
+        "url": "https://api.github.com/users/kszucs",
+        "html_url": "https://github.com/kszucs",
+        "followers_url": "https://api.github.com/users/kszucs/followers",
+        "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+        "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+        "organizations_url": "https://api.github.com/users/kszucs/orgs",
+        "repos_url": "https://api.github.com/users/kszucs/repos",
+        "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+        "received_events_url": "https://api.github.com/users/kszucs/received_events",
+        "type": "User",
+        "site_admin": false
+    },
+    "labels": [],
+    "state": "closed",
+    "locked": false,
+    "assignee": null,
+    "assignees": [],
+    "milestone": null,
+    "comments": 8,
+    "created_at": "2019-04-02T09:56:41Z",
+    "updated_at": "2019-04-05T13:30:49Z",
+    "closed_at": "2019-04-05T13:30:49Z",
+    "author_association": "MEMBER",
+    "body": "",
+    "closed_by": {
+        "login": "kszucs",
+        "id": 961747,
+        "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+        "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+        "gravatar_id": "",
+        "url": "https://api.github.com/users/kszucs",
+        "html_url": "https://github.com/kszucs",
+        "followers_url": "https://api.github.com/users/kszucs/followers",
+        "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+        "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+        "organizations_url": "https://api.github.com/users/kszucs/orgs",
+        "repos_url": "https://api.github.com/users/kszucs/repos",
+        "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+        "received_events_url": "https://api.github.com/users/kszucs/received_events",
+        "type": "User",
+        "site_admin": false
+    }
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/issue-26.json b/src/arrow/dev/archery/archery/tests/fixtures/issue-26.json
new file mode 100644
index 000000000..44c4d3bed
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/issue-26.json
@@ -0,0 +1,70 @@
+{
+    "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+    "repository_url": "https://api.github.com/repos/ursa-labs/ursabot",
+    "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}",
+    "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments",
+    "events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/events",
+    "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+    "id": 429706959,
+    "node_id": "MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy",
+    "number": 26,
+    "title": "Unittests for GithubHook + native asyncio syntax",
+    "user": {
+        "login": "kszucs",
+        "id": 961747,
+        "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+        "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+        "gravatar_id": "",
+        "url": "https://api.github.com/users/kszucs",
+        "html_url": "https://github.com/kszucs",
+        "followers_url": "https://api.github.com/users/kszucs/followers",
+        "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+        "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+        "organizations_url": "https://api.github.com/users/kszucs/orgs",
+        "repos_url": "https://api.github.com/users/kszucs/repos",
+        "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+        "received_events_url": "https://api.github.com/users/kszucs/received_events",
+        "type": "User",
+        "site_admin": false
+    },
+    "labels": [],
+    "state": "closed",
+    "locked": false,
+    "assignee": null,
+    "assignees": [],
+    "milestone": null,
+    "comments": 9,
+    "created_at": "2019-04-05T11:22:15Z",
+    "updated_at": "2019-08-28T00:34:19Z",
+    "closed_at": "2019-04-05T13:54:34Z",
+    "author_association": "MEMBER",
+    "pull_request": {
+        "url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26",
+        "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+        "diff_url": "https://github.com/ursa-labs/ursabot/pull/26.diff",
+        "patch_url": "https://github.com/ursa-labs/ursabot/pull/26.patch"
+    },
+    "body": "Resolves:\r\n- #26 Unittests for GithubHook + native asyncio syntax\r\n- #27 Use native async/await keywords instead of @inlineCallbacks and yield\r\n",
+    "closed_by": {
+        "login": "kszucs",
+        "id": 961747,
+        "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+        "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+        "gravatar_id": "",
+        "url": "https://api.github.com/users/kszucs",
+        "html_url": "https://github.com/kszucs",
+        "followers_url": "https://api.github.com/users/kszucs/followers",
+        "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+        "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+        "organizations_url": "https://api.github.com/users/kszucs/orgs",
+        "repos_url": "https://api.github.com/users/kszucs/repos",
+        "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+        "received_events_url": "https://api.github.com/users/kszucs/received_events",
+        "type": "User",
+        "site_admin": false
+    }
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/issue-comment-480243811.json b/src/arrow/dev/archery/archery/tests/fixtures/issue-comment-480243811.json
new file mode 100644
index 000000000..93ee4b13c
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/issue-comment-480243811.json
@@ -0,0 +1,31 @@
+{
+    "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments/479081273",
+    "html_url": "https://github.com/ursa-labs/ursabot/pull/21#issuecomment-479081273",
+    "issue_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/21",
+    "id": 480243811,
+    "node_id": "MDEyOklzc3VlQ29tbWVudDQ3OTA4MTI3Mw==",
+    "user": {
+        "login": "kszucs",
+        "id": 961747,
+        "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+        "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+        "gravatar_id": "",
+        "url": "https://api.github.com/users/kszucs",
+        "html_url": "https://github.com/kszucs",
+        "followers_url": "https://api.github.com/users/kszucs/followers",
+        "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+        "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+        "organizations_url": "https://api.github.com/users/kszucs/orgs",
+        "repos_url": "https://api.github.com/users/kszucs/repos",
+        "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+        "received_events_url": "https://api.github.com/users/kszucs/received_events",
+        "type": "User",
+        "site_admin": false
+    },
+    "created_at": "2019-04-02T16:29:46Z",
+    "updated_at": "2019-04-02T16:29:46Z",
+    "author_association": "MEMBER",
+    "body": "@ursabot"
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/issue-comment-480248726.json b/src/arrow/dev/archery/archery/tests/fixtures/issue-comment-480248726.json
new file mode 100644
index 000000000..f3cd34083
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/issue-comment-480248726.json
@@ -0,0 +1,31 @@
+{
+    "url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480248726",
+    "html_url": "https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480248726",
+    "issue_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+    "id": 480248726,
+    "node_id": "MDEyOklzc3VlQ29tbWVudDQ4MDI0ODcyNg==",
+    "user": {
+        "login": "kszucs",
+        "id": 961747,
+        "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+        "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+        "gravatar_id": "",
+        "url": "https://api.github.com/users/kszucs",
+        "html_url": "https://github.com/kszucs",
+        "followers_url": "https://api.github.com/users/kszucs/followers",
+        "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+        "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+        "organizations_url": "https://api.github.com/users/kszucs/orgs",
+        "repos_url": "https://api.github.com/users/kszucs/repos",
+        "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+        "received_events_url": "https://api.github.com/users/kszucs/received_events",
+        "type": "User",
+        "site_admin": false
+    },
+    "created_at": "2019-04-05T11:55:43Z",
+    "updated_at": "2019-04-05T11:55:43Z",
+    "author_association": "MEMBER",
+    "body": "@ursabot build"
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/pull-request-26-commit.json b/src/arrow/dev/archery/archery/tests/fixtures/pull-request-26-commit.json
new file mode 100644
index 000000000..ffc48943a
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/pull-request-26-commit.json
@@ -0,0 +1,158 @@
+{
+  "sha": "2705da2b616b98fa6010a25813c5a7a27456f71d",
+  "node_id": "MDY6Q29tbWl0MTY5MTAxNzAxOjI3MDVkYTJiNjE2Yjk4ZmE2MDEwYTI1ODEzYzVhN2EyNzQ1NmY3MWQ=",
+  "commit": {
+    "author": {
+      "name": "Krisztián Szűcs",
+      "email": "szucs.krisztian@gmail.com",
+      "date": "2019-04-05T12:01:31Z"
+    },
+    "committer": {
+      "name": "Krisztián Szűcs",
+      "email": "szucs.krisztian@gmail.com",
+      "date": "2019-04-05T12:01:31Z"
+    },
+    "message": "add recorded event requests",
+    "tree": {
+      "sha": "16a7bb186833a67e9c2d84a58393503b85500ceb",
+      "url": "https://api.github.com/repos/ursa-labs/ursabot/git/trees/16a7bb186833a67e9c2d84a58393503b85500ceb"
+    },
+    "url": "https://api.github.com/repos/ursa-labs/ursabot/git/commits/2705da2b616b98fa6010a25813c5a7a27456f71d",
+    "comment_count": 0,
+    "verification": {
+      "verified": true,
+      "reason": "valid",
+      "signature": "-----BEGIN PGP SIGNATURE-----\n\niQFOBAABCAA4FiEEOOW2r8dr6sA77zHlgjqBKYe1QKUFAlynQ58aHHN6dWNzLmty\naXN6dGlhbkBnbWFpbC5jb20ACgkQgjqBKYe1QKUYKwf6AiXDMaLqNLNSjRY7lIXX\nudioewz0hSb4bgIXBv30nswu9CoOA0+mHCokEVtZhYbXzXDsZ1KJrilSC4j+Ws4q\nkRGA6iEmrne2HcSKNZXzcVnwV9zpwKxlVh2QCTNb1PuOYFBLH0kwE704uWIWMGDN\nbo8cjQPwegePCRguCvPh/5wa5J3uiq5gmJLG6bC/d1XYE+FJVtlnyzqzLMIryGKe\ntIciw+wwkF413Q/YVbZ49vLUeCX9H8PHC4mZYGDWuvjFW1WTfkjK5bAH+oaTVM6h\n350I5ZFloHmMA/QeRge5qFxXoEBMDGiXHHktzYZDXnliFOQNxzqwirA5lQQ6LRSS\naQ==\n=7rqi\n-----END PGP SIGNATURE-----",
+      "payload": "tree 16a7bb186833a67e9c2d84a58393503b85500ceb\nparent 446ae69b9385e8d0f40aa9595f723d34383af2f7\nauthor Krisztián Szűcs <szucs.krisztian@gmail.com> 1554465691 +0200\ncommitter Krisztián Szűcs <szucs.krisztian@gmail.com> 1554465691 +0200\n\nadd recorded event requests\n"
+    }
+  },
+  "url": "https://api.github.com/repos/ursa-labs/ursabot/commits/2705da2b616b98fa6010a25813c5a7a27456f71d",
+  "html_url": "https://github.com/ursa-labs/ursabot/commit/2705da2b616b98fa6010a25813c5a7a27456f71d",
+  "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/commits/2705da2b616b98fa6010a25813c5a7a27456f71d/comments",
+  "author": {
+    "login": "kszucs",
+    "id": 961747,
+    "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+    "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+    "gravatar_id": "",
+    "url": "https://api.github.com/users/kszucs",
+    "html_url": "https://github.com/kszucs",
+    "followers_url": "https://api.github.com/users/kszucs/followers",
+    "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+    "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+    "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+    "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+    "organizations_url": "https://api.github.com/users/kszucs/orgs",
+    "repos_url": "https://api.github.com/users/kszucs/repos",
+    "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+    "received_events_url": "https://api.github.com/users/kszucs/received_events",
+    "type": "User",
+    "site_admin": false
+  },
+  "committer": {
+    "login": "kszucs",
+    "id": 961747,
+    "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+    "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+    "gravatar_id": "",
+    "url": "https://api.github.com/users/kszucs",
+    "html_url": "https://github.com/kszucs",
+    "followers_url": "https://api.github.com/users/kszucs/followers",
+    "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+    "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+    "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+    "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+    "organizations_url": "https://api.github.com/users/kszucs/orgs",
+    "repos_url": "https://api.github.com/users/kszucs/repos",
+    "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+    "received_events_url": "https://api.github.com/users/kszucs/received_events",
+    "type": "User",
+    "site_admin": false
+  },
+  "parents": [
+    {
+      "sha": "446ae69b9385e8d0f40aa9595f723d34383af2f7",
+      "url": "https://api.github.com/repos/ursa-labs/ursabot/commits/446ae69b9385e8d0f40aa9595f723d34383af2f7",
+      "html_url": "https://github.com/ursa-labs/ursabot/commit/446ae69b9385e8d0f40aa9595f723d34383af2f7"
+    }
+  ],
+  "stats": {
+    "total": 1062,
+    "additions": 1058,
+    "deletions": 4
+  },
+  "files": [
+    {
+      "sha": "dfae6eeaef384ae6180c6302a58b49e39982dc33",
+      "filename": "ursabot/tests/fixtures/issue-comment-build-command.json",
+      "status": "added",
+      "additions": 212,
+      "deletions": 0,
+      "changes": 212,
+      "blob_url": "https://github.com/ursa-labs/ursabot/blob/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-build-command.json",
+      "raw_url": "https://github.com/ursa-labs/ursabot/raw/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-build-command.json",
+      "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-build-command.json?ref=2705da2b616b98fa6010a25813c5a7a27456f71d",
+      "patch": "@@ -0,0 +1,212 @@\n+{\n+    \"action\": \"created\",\n+    \"comment\": {\n+        \"author_association\": \"NONE\",\n+        \"body\": \"I've successfully started builds for this PR\",\n+        \"created_at\": \"2019-04-05T11:55:44Z\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480248730\",\n+        \"id\": 480248730,\n+        \"issue_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"node_id\": \"MDEyOklzc3VlQ29tbWVudDQ4MDI0ODczMA==\",\n+        \"updated_at\": \"2019-04-05T11:55:44Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480248730\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/49275095?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursabot/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursabot/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursabot/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursabot/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursabot\",\n+            \"id\": 49275095,\n+            \"login\": \"ursabot\",\n+            \"node_id\": \"MDQ6VXNlcjQ5Mjc1MDk1\",\n+            \"organizations_url\": \"https://api.github.com/users/ursabot/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursabot/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursabot/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursabot/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursabot/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/ursabot\"\n+        }\n+    },\n+    \"issue\": {\n+        \"assignee\": null,\n+        \"assignees\": [],\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"\",\n+        \"closed_at\": null,\n+        \"comments\": 4,\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\",\n+        \"created_at\": \"2019-04-05T11:22:15Z\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/events\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+        \"id\": 429706959,\n+        \"labels\": [],\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}\",\n+        \"locked\": false,\n+        \"milestone\": null,\n+        \"node_id\": \"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\",\n+        \"number\": 26,\n+        \"pull_request\": {\n+            \"diff_url\": \"https://github.com/ursa-labs/ursabot/pull/26.diff\",\n+            \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+            \"patch_url\": \"https://github.com/ursa-labs/ursabot/pull/26.patch\",\n+            \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\"\n+        },\n+        \"repository_url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"state\": \"open\",\n+        \"title\": \"Unittests for GithubHook\",\n+        \"updated_at\": \"2019-04-05T11:55:44Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"organization\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+        \"description\": \"Innovation lab for open source data science tools, powered by Apache Arrow\",\n+        \"events_url\": \"https://api.github.com/orgs/ursa-labs/events\",\n+        \"hooks_url\": \"https://api.github.com/orgs/ursa-labs/hooks\",\n+        \"id\": 46514972,\n+        \"issues_url\": \"https://api.github.com/orgs/ursa-labs/issues\",\n+        \"login\": \"ursa-labs\",\n+        \"members_url\": \"https://api.github.com/orgs/ursa-labs/members{/member}\",\n+        \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+        \"public_members_url\": \"https://api.github.com/orgs/ursa-labs/public_members{/member}\",\n+        \"repos_url\": \"https://api.github.com/orgs/ursa-labs/repos\",\n+        \"url\": \"https://api.github.com/orgs/ursa-labs\"\n+    },\n+    \"repository\": {\n+        \"archive_url\": \"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\",\n+        \"archived\": false,\n+        \"assignees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\",\n+        \"blobs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\",\n+        \"branches_url\": \"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\",\n+        \"clone_url\": \"https://github.com/ursa-labs/ursabot.git\",\n+        \"collaborators_url\": \"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\",\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\",\n+        \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\",\n+        \"compare_url\": \"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\",\n+        \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\",\n+        \"contributors_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contributors\",\n+        \"created_at\": \"2019-02-04T15:40:31Z\",\n+        \"default_branch\": \"master\",\n+        \"deployments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/deployments\",\n+        \"description\": null,\n+        \"disabled\": false,\n+        \"downloads_url\": \"https://api.github.com/repos/ursa-labs/ursabot/downloads\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/events\",\n+        \"fork\": false,\n+        \"forks\": 0,\n+        \"forks_count\": 0,\n+        \"forks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/forks\",\n+        \"full_name\": \"ursa-labs/ursabot\",\n+        \"git_commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\",\n+        \"git_refs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\",\n+        \"git_tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\",\n+        \"git_url\": \"git://github.com/ursa-labs/ursabot.git\",\n+        \"has_downloads\": true,\n+        \"has_issues\": true,\n+        \"has_pages\": false,\n+        \"has_projects\": true,\n+        \"has_wiki\": true,\n+        \"homepage\": null,\n+        \"hooks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/hooks\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"id\": 169101701,\n+        \"issue_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\",\n+        \"issue_events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\",\n+        \"issues_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\",\n+        \"keys_url\": \"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\",\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\",\n+        \"language\": \"Jupyter Notebook\",\n+        \"languages_url\": \"https://api.github.com/repos/ursa-labs/ursabot/languages\",\n+        \"license\": null,\n+        \"merges_url\": \"https://api.github.com/repos/ursa-labs/ursabot/merges\",\n+        \"milestones_url\": \"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\",\n+        \"mirror_url\": null,\n+        \"name\": \"ursabot\",\n+        \"node_id\": \"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\",\n+        \"notifications_url\": \"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\",\n+        \"open_issues\": 19,\n+        \"open_issues_count\": 19,\n+        \"owner\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursa-labs\",\n+            \"id\": 46514972,\n+            \"login\": \"ursa-labs\",\n+            \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+            \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+            \"type\": \"Organization\",\n+            \"url\": \"https://api.github.com/users/ursa-labs\"\n+        },\n+        \"private\": false,\n+        \"pulls_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\",\n+        \"pushed_at\": \"2019-04-05T11:22:16Z\",\n+        \"releases_url\": \"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\",\n+        \"size\": 892,\n+        \"ssh_url\": \"git@github.com:ursa-labs/ursabot.git\",\n+        \"stargazers_count\": 1,\n+        \"stargazers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/stargazers\",\n+        \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\",\n+        \"subscribers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscribers\",\n+        \"subscription_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscription\",\n+        \"svn_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/tags\",\n+        \"teams_url\": \"https://api.github.com/repos/ursa-labs/ursabot/teams\",\n+        \"trees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\",\n+        \"updated_at\": \"2019-04-04T17:49:10Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"watchers\": 1,\n+        \"watchers_count\": 1\n+    },\n+    \"sender\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/49275095?v=4\",\n+        \"events_url\": \"https://api.github.com/users/ursabot/events{/privacy}\",\n+        \"followers_url\": \"https://api.github.com/users/ursabot/followers\",\n+        \"following_url\": \"https://api.github.com/users/ursabot/following{/other_user}\",\n+        \"gists_url\": \"https://api.github.com/users/ursabot/gists{/gist_id}\",\n+        \"gravatar_id\": \"\",\n+        \"html_url\": \"https://github.com/ursabot\",\n+        \"id\": 49275095,\n+        \"login\": \"ursabot\",\n+        \"node_id\": \"MDQ6VXNlcjQ5Mjc1MDk1\",\n+        \"organizations_url\": \"https://api.github.com/users/ursabot/orgs\",\n+        \"received_events_url\": \"https://api.github.com/users/ursabot/received_events\",\n+        \"repos_url\": \"https://api.github.com/users/ursabot/repos\",\n+        \"site_admin\": false,\n+        \"starred_url\": \"https://api.github.com/users/ursabot/starred{/owner}{/repo}\",\n+        \"subscriptions_url\": \"https://api.github.com/users/ursabot/subscriptions\",\n+        \"type\": \"User\",\n+        \"url\": \"https://api.github.com/users/ursabot\"\n+    }\n+}"
+    },
+    {
+      "sha": "7ef554e333327f0e62aa1fd76b4b17844a39adeb",
+      "filename": "ursabot/tests/fixtures/issue-comment-by-ursabot.json",
+      "status": "added",
+      "additions": 212,
+      "deletions": 0,
+      "changes": 212,
+      "blob_url": "https://github.com/ursa-labs/ursabot/blob/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-by-ursabot.json",
+      "raw_url": "https://github.com/ursa-labs/ursabot/raw/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-by-ursabot.json",
+      "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-by-ursabot.json?ref=2705da2b616b98fa6010a25813c5a7a27456f71d",
+      "patch": "@@ -0,0 +1,212 @@\n+{\n+    \"action\": \"created\",\n+    \"comment\": {\n+        \"author_association\": \"NONE\",\n+        \"body\": \"Unknown command \\\"\\\"\",\n+        \"created_at\": \"2019-04-05T11:35:47Z\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480243815\",\n+        \"id\": 480243815,\n+        \"issue_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"node_id\": \"MDEyOklzc3VlQ29tbWVudDQ4MDI0MzgxNQ==\",\n+        \"updated_at\": \"2019-04-05T11:35:47Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480243815\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/49275095?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursabot/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursabot/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursabot/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursabot/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursabot\",\n+            \"id\": 49275095,\n+            \"login\": \"ursabot\",\n+            \"node_id\": \"MDQ6VXNlcjQ5Mjc1MDk1\",\n+            \"organizations_url\": \"https://api.github.com/users/ursabot/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursabot/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursabot/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursabot/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursabot/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/ursabot\"\n+        }\n+    },\n+    \"issue\": {\n+        \"assignee\": null,\n+        \"assignees\": [],\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"\",\n+        \"closed_at\": null,\n+        \"comments\": 2,\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\",\n+        \"created_at\": \"2019-04-05T11:22:15Z\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/events\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+        \"id\": 429706959,\n+        \"labels\": [],\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}\",\n+        \"locked\": false,\n+        \"milestone\": null,\n+        \"node_id\": \"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\",\n+        \"number\": 26,\n+        \"pull_request\": {\n+            \"diff_url\": \"https://github.com/ursa-labs/ursabot/pull/26.diff\",\n+            \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+            \"patch_url\": \"https://github.com/ursa-labs/ursabot/pull/26.patch\",\n+            \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\"\n+        },\n+        \"repository_url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"state\": \"open\",\n+        \"title\": \"Unittests for GithubHook\",\n+        \"updated_at\": \"2019-04-05T11:35:47Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"organization\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+        \"description\": \"Innovation lab for open source data science tools, powered by Apache Arrow\",\n+        \"events_url\": \"https://api.github.com/orgs/ursa-labs/events\",\n+        \"hooks_url\": \"https://api.github.com/orgs/ursa-labs/hooks\",\n+        \"id\": 46514972,\n+        \"issues_url\": \"https://api.github.com/orgs/ursa-labs/issues\",\n+        \"login\": \"ursa-labs\",\n+        \"members_url\": \"https://api.github.com/orgs/ursa-labs/members{/member}\",\n+        \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+        \"public_members_url\": \"https://api.github.com/orgs/ursa-labs/public_members{/member}\",\n+        \"repos_url\": \"https://api.github.com/orgs/ursa-labs/repos\",\n+        \"url\": \"https://api.github.com/orgs/ursa-labs\"\n+    },\n+    \"repository\": {\n+        \"archive_url\": \"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\",\n+        \"archived\": false,\n+        \"assignees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\",\n+        \"blobs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\",\n+        \"branches_url\": \"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\",\n+        \"clone_url\": \"https://github.com/ursa-labs/ursabot.git\",\n+        \"collaborators_url\": \"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\",\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\",\n+        \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\",\n+        \"compare_url\": \"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\",\n+        \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\",\n+        \"contributors_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contributors\",\n+        \"created_at\": \"2019-02-04T15:40:31Z\",\n+        \"default_branch\": \"master\",\n+        \"deployments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/deployments\",\n+        \"description\": null,\n+        \"disabled\": false,\n+        \"downloads_url\": \"https://api.github.com/repos/ursa-labs/ursabot/downloads\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/events\",\n+        \"fork\": false,\n+        \"forks\": 0,\n+        \"forks_count\": 0,\n+        \"forks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/forks\",\n+        \"full_name\": \"ursa-labs/ursabot\",\n+        \"git_commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\",\n+        \"git_refs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\",\n+        \"git_tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\",\n+        \"git_url\": \"git://github.com/ursa-labs/ursabot.git\",\n+        \"has_downloads\": true,\n+        \"has_issues\": true,\n+        \"has_pages\": false,\n+        \"has_projects\": true,\n+        \"has_wiki\": true,\n+        \"homepage\": null,\n+        \"hooks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/hooks\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"id\": 169101701,\n+        \"issue_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\",\n+        \"issue_events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\",\n+        \"issues_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\",\n+        \"keys_url\": \"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\",\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\",\n+        \"language\": \"Jupyter Notebook\",\n+        \"languages_url\": \"https://api.github.com/repos/ursa-labs/ursabot/languages\",\n+        \"license\": null,\n+        \"merges_url\": \"https://api.github.com/repos/ursa-labs/ursabot/merges\",\n+        \"milestones_url\": \"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\",\n+        \"mirror_url\": null,\n+        \"name\": \"ursabot\",\n+        \"node_id\": \"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\",\n+        \"notifications_url\": \"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\",\n+        \"open_issues\": 19,\n+        \"open_issues_count\": 19,\n+        \"owner\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursa-labs\",\n+            \"id\": 46514972,\n+            \"login\": \"ursa-labs\",\n+            \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+            \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+            \"type\": \"Organization\",\n+            \"url\": \"https://api.github.com/users/ursa-labs\"\n+        },\n+        \"private\": false,\n+        \"pulls_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\",\n+        \"pushed_at\": \"2019-04-05T11:22:16Z\",\n+        \"releases_url\": \"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\",\n+        \"size\": 892,\n+        \"ssh_url\": \"git@github.com:ursa-labs/ursabot.git\",\n+        \"stargazers_count\": 1,\n+        \"stargazers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/stargazers\",\n+        \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\",\n+        \"subscribers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscribers\",\n+        \"subscription_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscription\",\n+        \"svn_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/tags\",\n+        \"teams_url\": \"https://api.github.com/repos/ursa-labs/ursabot/teams\",\n+        \"trees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\",\n+        \"updated_at\": \"2019-04-04T17:49:10Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"watchers\": 1,\n+        \"watchers_count\": 1\n+    },\n+    \"sender\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/49275095?v=4\",\n+        \"events_url\": \"https://api.github.com/users/ursabot/events{/privacy}\",\n+        \"followers_url\": \"https://api.github.com/users/ursabot/followers\",\n+        \"following_url\": \"https://api.github.com/users/ursabot/following{/other_user}\",\n+        \"gists_url\": \"https://api.github.com/users/ursabot/gists{/gist_id}\",\n+        \"gravatar_id\": \"\",\n+        \"html_url\": \"https://github.com/ursabot\",\n+        \"id\": 49275095,\n+        \"login\": \"ursabot\",\n+        \"node_id\": \"MDQ6VXNlcjQ5Mjc1MDk1\",\n+        \"organizations_url\": \"https://api.github.com/users/ursabot/orgs\",\n+        \"received_events_url\": \"https://api.github.com/users/ursabot/received_events\",\n+        \"repos_url\": \"https://api.github.com/users/ursabot/repos\",\n+        \"site_admin\": false,\n+        \"starred_url\": \"https://api.github.com/users/ursabot/starred{/owner}{/repo}\",\n+        \"subscriptions_url\": \"https://api.github.com/users/ursabot/subscriptions\",\n+        \"type\": \"User\",\n+        \"url\": \"https://api.github.com/users/ursabot\"\n+    }\n+}"
+    },
+    {
+      "sha": "a8082dbc91fdfe815b795e49ec10e49000771ef5",
+      "filename": "ursabot/tests/fixtures/issue-comment-not-mentioning-ursabot.json",
+      "status": "added",
+      "additions": 212,
+      "deletions": 0,
+      "changes": 212,
+      "blob_url": "https://github.com/ursa-labs/ursabot/blob/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-not-mentioning-ursabot.json",
+      "raw_url": "https://github.com/ursa-labs/ursabot/raw/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-not-mentioning-ursabot.json",
+      "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-not-mentioning-ursabot.json?ref=2705da2b616b98fa6010a25813c5a7a27456f71d",
+      "patch": "@@ -0,0 +1,212 @@\n+{\n+    \"action\": \"created\",\n+    \"comment\": {\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"bear is no game\",\n+        \"created_at\": \"2019-04-05T11:26:56Z\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480241727\",\n+        \"id\": 480241727,\n+        \"issue_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"node_id\": \"MDEyOklzc3VlQ29tbWVudDQ4MDI0MTcyNw==\",\n+        \"updated_at\": \"2019-04-05T11:26:56Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480241727\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"issue\": {\n+        \"assignee\": null,\n+        \"assignees\": [],\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"\",\n+        \"closed_at\": null,\n+        \"comments\": 0,\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\",\n+        \"created_at\": \"2019-04-05T11:22:15Z\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/events\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+        \"id\": 429706959,\n+        \"labels\": [],\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}\",\n+        \"locked\": false,\n+        \"milestone\": null,\n+        \"node_id\": \"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\",\n+        \"number\": 26,\n+        \"pull_request\": {\n+            \"diff_url\": \"https://github.com/ursa-labs/ursabot/pull/26.diff\",\n+            \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+            \"patch_url\": \"https://github.com/ursa-labs/ursabot/pull/26.patch\",\n+            \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\"\n+        },\n+        \"repository_url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"state\": \"open\",\n+        \"title\": \"Unittests for GithubHook\",\n+        \"updated_at\": \"2019-04-05T11:26:56Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"organization\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+        \"description\": \"Innovation lab for open source data science tools, powered by Apache Arrow\",\n+        \"events_url\": \"https://api.github.com/orgs/ursa-labs/events\",\n+        \"hooks_url\": \"https://api.github.com/orgs/ursa-labs/hooks\",\n+        \"id\": 46514972,\n+        \"issues_url\": \"https://api.github.com/orgs/ursa-labs/issues\",\n+        \"login\": \"ursa-labs\",\n+        \"members_url\": \"https://api.github.com/orgs/ursa-labs/members{/member}\",\n+        \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+        \"public_members_url\": \"https://api.github.com/orgs/ursa-labs/public_members{/member}\",\n+        \"repos_url\": \"https://api.github.com/orgs/ursa-labs/repos\",\n+        \"url\": \"https://api.github.com/orgs/ursa-labs\"\n+    },\n+    \"repository\": {\n+        \"archive_url\": \"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\",\n+        \"archived\": false,\n+        \"assignees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\",\n+        \"blobs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\",\n+        \"branches_url\": \"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\",\n+        \"clone_url\": \"https://github.com/ursa-labs/ursabot.git\",\n+        \"collaborators_url\": \"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\",\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\",\n+        \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\",\n+        \"compare_url\": \"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\",\n+        \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\",\n+        \"contributors_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contributors\",\n+        \"created_at\": \"2019-02-04T15:40:31Z\",\n+        \"default_branch\": \"master\",\n+        \"deployments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/deployments\",\n+        \"description\": null,\n+        \"disabled\": false,\n+        \"downloads_url\": \"https://api.github.com/repos/ursa-labs/ursabot/downloads\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/events\",\n+        \"fork\": false,\n+        \"forks\": 0,\n+        \"forks_count\": 0,\n+        \"forks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/forks\",\n+        \"full_name\": \"ursa-labs/ursabot\",\n+        \"git_commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\",\n+        \"git_refs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\",\n+        \"git_tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\",\n+        \"git_url\": \"git://github.com/ursa-labs/ursabot.git\",\n+        \"has_downloads\": true,\n+        \"has_issues\": true,\n+        \"has_pages\": false,\n+        \"has_projects\": true,\n+        \"has_wiki\": true,\n+        \"homepage\": null,\n+        \"hooks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/hooks\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"id\": 169101701,\n+        \"issue_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\",\n+        \"issue_events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\",\n+        \"issues_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\",\n+        \"keys_url\": \"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\",\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\",\n+        \"language\": \"Jupyter Notebook\",\n+        \"languages_url\": \"https://api.github.com/repos/ursa-labs/ursabot/languages\",\n+        \"license\": null,\n+        \"merges_url\": \"https://api.github.com/repos/ursa-labs/ursabot/merges\",\n+        \"milestones_url\": \"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\",\n+        \"mirror_url\": null,\n+        \"name\": \"ursabot\",\n+        \"node_id\": \"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\",\n+        \"notifications_url\": \"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\",\n+        \"open_issues\": 19,\n+        \"open_issues_count\": 19,\n+        \"owner\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursa-labs\",\n+            \"id\": 46514972,\n+            \"login\": \"ursa-labs\",\n+            \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+            \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+            \"type\": \"Organization\",\n+            \"url\": \"https://api.github.com/users/ursa-labs\"\n+        },\n+        \"private\": false,\n+        \"pulls_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\",\n+        \"pushed_at\": \"2019-04-05T11:22:16Z\",\n+        \"releases_url\": \"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\",\n+        \"size\": 892,\n+        \"ssh_url\": \"git@github.com:ursa-labs/ursabot.git\",\n+        \"stargazers_count\": 1,\n+        \"stargazers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/stargazers\",\n+        \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\",\n+        \"subscribers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscribers\",\n+        \"subscription_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscription\",\n+        \"svn_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/tags\",\n+        \"teams_url\": \"https://api.github.com/repos/ursa-labs/ursabot/teams\",\n+        \"trees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\",\n+        \"updated_at\": \"2019-04-04T17:49:10Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"watchers\": 1,\n+        \"watchers_count\": 1\n+    },\n+    \"sender\": {\n+        \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+        \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+        \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+        \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+        \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+        \"gravatar_id\": \"\",\n+        \"html_url\": \"https://github.com/kszucs\",\n+        \"id\": 961747,\n+        \"login\": \"kszucs\",\n+        \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+        \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+        \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+        \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+        \"site_admin\": false,\n+        \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+        \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+        \"type\": \"User\",\n+        \"url\": \"https://api.github.com/users/kszucs\"\n+    }\n+}"
+    },
+    {
+      "sha": "2770e29ba9086394455315e590c0b433d08e437e",
+      "filename": "ursabot/tests/fixtures/issue-comment-with-empty-command.json",
+      "status": "added",
+      "additions": 212,
+      "deletions": 0,
+      "changes": 212,
+      "blob_url": "https://github.com/ursa-labs/ursabot/blob/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-with-empty-command.json",
+      "raw_url": "https://github.com/ursa-labs/ursabot/raw/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-with-empty-command.json",
+      "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-with-empty-command.json?ref=2705da2b616b98fa6010a25813c5a7a27456f71d",
+      "patch": "@@ -0,0 +1,212 @@\n+{\n+    \"action\": \"created\",\n+    \"comment\": {\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"@ursabot \",\n+        \"created_at\": \"2019-04-05T11:35:46Z\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480243811\",\n+        \"id\": 480243811,\n+        \"issue_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"node_id\": \"MDEyOklzc3VlQ29tbWVudDQ4MDI0MzgxMQ==\",\n+        \"updated_at\": \"2019-04-05T11:35:46Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480243811\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"issue\": {\n+        \"assignee\": null,\n+        \"assignees\": [],\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"\",\n+        \"closed_at\": null,\n+        \"comments\": 1,\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\",\n+        \"created_at\": \"2019-04-05T11:22:15Z\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/events\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+        \"id\": 429706959,\n+        \"labels\": [],\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}\",\n+        \"locked\": false,\n+        \"milestone\": null,\n+        \"node_id\": \"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\",\n+        \"number\": 26,\n+        \"pull_request\": {\n+            \"diff_url\": \"https://github.com/ursa-labs/ursabot/pull/26.diff\",\n+            \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+            \"patch_url\": \"https://github.com/ursa-labs/ursabot/pull/26.patch\",\n+            \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\"\n+        },\n+        \"repository_url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"state\": \"open\",\n+        \"title\": \"Unittests for GithubHook\",\n+        \"updated_at\": \"2019-04-05T11:35:46Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"organization\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+        \"description\": \"Innovation lab for open source data science tools, powered by Apache Arrow\",\n+        \"events_url\": \"https://api.github.com/orgs/ursa-labs/events\",\n+        \"hooks_url\": \"https://api.github.com/orgs/ursa-labs/hooks\",\n+        \"id\": 46514972,\n+        \"issues_url\": \"https://api.github.com/orgs/ursa-labs/issues\",\n+        \"login\": \"ursa-labs\",\n+        \"members_url\": \"https://api.github.com/orgs/ursa-labs/members{/member}\",\n+        \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+        \"public_members_url\": \"https://api.github.com/orgs/ursa-labs/public_members{/member}\",\n+        \"repos_url\": \"https://api.github.com/orgs/ursa-labs/repos\",\n+        \"url\": \"https://api.github.com/orgs/ursa-labs\"\n+    },\n+    \"repository\": {\n+        \"archive_url\": \"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\",\n+        \"archived\": false,\n+        \"assignees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\",\n+        \"blobs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\",\n+        \"branches_url\": \"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\",\n+        \"clone_url\": \"https://github.com/ursa-labs/ursabot.git\",\n+        \"collaborators_url\": \"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\",\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\",\n+        \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\",\n+        \"compare_url\": \"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\",\n+        \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\",\n+        \"contributors_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contributors\",\n+        \"created_at\": \"2019-02-04T15:40:31Z\",\n+        \"default_branch\": \"master\",\n+        \"deployments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/deployments\",\n+        \"description\": null,\n+        \"disabled\": false,\n+        \"downloads_url\": \"https://api.github.com/repos/ursa-labs/ursabot/downloads\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/events\",\n+        \"fork\": false,\n+        \"forks\": 0,\n+        \"forks_count\": 0,\n+        \"forks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/forks\",\n+        \"full_name\": \"ursa-labs/ursabot\",\n+        \"git_commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\",\n+        \"git_refs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\",\n+        \"git_tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\",\n+        \"git_url\": \"git://github.com/ursa-labs/ursabot.git\",\n+        \"has_downloads\": true,\n+        \"has_issues\": true,\n+        \"has_pages\": false,\n+        \"has_projects\": true,\n+        \"has_wiki\": true,\n+        \"homepage\": null,\n+        \"hooks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/hooks\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"id\": 169101701,\n+        \"issue_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\",\n+        \"issue_events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\",\n+        \"issues_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\",\n+        \"keys_url\": \"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\",\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\",\n+        \"language\": \"Jupyter Notebook\",\n+        \"languages_url\": \"https://api.github.com/repos/ursa-labs/ursabot/languages\",\n+        \"license\": null,\n+        \"merges_url\": \"https://api.github.com/repos/ursa-labs/ursabot/merges\",\n+        \"milestones_url\": \"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\",\n+        \"mirror_url\": null,\n+        \"name\": \"ursabot\",\n+        \"node_id\": \"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\",\n+        \"notifications_url\": \"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\",\n+        \"open_issues\": 19,\n+        \"open_issues_count\": 19,\n+        \"owner\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursa-labs\",\n+            \"id\": 46514972,\n+            \"login\": \"ursa-labs\",\n+            \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+            \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+            \"type\": \"Organization\",\n+            \"url\": \"https://api.github.com/users/ursa-labs\"\n+        },\n+        \"private\": false,\n+        \"pulls_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\",\n+        \"pushed_at\": \"2019-04-05T11:22:16Z\",\n+        \"releases_url\": \"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\",\n+        \"size\": 892,\n+        \"ssh_url\": \"git@github.com:ursa-labs/ursabot.git\",\n+        \"stargazers_count\": 1,\n+        \"stargazers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/stargazers\",\n+        \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\",\n+        \"subscribers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscribers\",\n+        \"subscription_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscription\",\n+        \"svn_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/tags\",\n+        \"teams_url\": \"https://api.github.com/repos/ursa-labs/ursabot/teams\",\n+        \"trees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\",\n+        \"updated_at\": \"2019-04-04T17:49:10Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"watchers\": 1,\n+        \"watchers_count\": 1\n+    },\n+    \"sender\": {\n+        \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+        \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+        \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+        \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+        \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+        \"gravatar_id\": \"\",\n+        \"html_url\": \"https://github.com/kszucs\",\n+        \"id\": 961747,\n+        \"login\": \"kszucs\",\n+        \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+        \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+        \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+        \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+        \"site_admin\": false,\n+        \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+        \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+        \"type\": \"User\",\n+        \"url\": \"https://api.github.com/users/kszucs\"\n+    }\n+}"
+    },
+    {
+      "sha": "80ff46510a2f39ae60f7c3a98e5fdaef8e688784",
+      "filename": "ursabot/tests/fixtures/issue-comment-without-pull-request.json",
+      "status": "added",
+      "additions": 206,
+      "deletions": 0,
+      "changes": 206,
+      "blob_url": "https://github.com/ursa-labs/ursabot/blob/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-without-pull-request.json",
+      "raw_url": "https://github.com/ursa-labs/ursabot/raw/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-without-pull-request.json",
+      "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-without-pull-request.json?ref=2705da2b616b98fa6010a25813c5a7a27456f71d",
+      "patch": "@@ -0,0 +1,206 @@\n+{\n+    \"action\": \"created\",\n+    \"comment\": {\n+        \"author_association\": \"NONE\",\n+        \"body\": \"Ursabot only listens to pull request comments!\",\n+        \"created_at\": \"2019-04-05T11:53:43Z\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/issues/19#issuecomment-480248217\",\n+        \"id\": 480248217,\n+        \"issue_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/19\",\n+        \"node_id\": \"MDEyOklzc3VlQ29tbWVudDQ4MDI0ODIxNw==\",\n+        \"updated_at\": \"2019-04-05T11:53:43Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480248217\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/49275095?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursabot/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursabot/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursabot/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursabot/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursabot\",\n+            \"id\": 49275095,\n+            \"login\": \"ursabot\",\n+            \"node_id\": \"MDQ6VXNlcjQ5Mjc1MDk1\",\n+            \"organizations_url\": \"https://api.github.com/users/ursabot/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursabot/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursabot/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursabot/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursabot/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/ursabot\"\n+        }\n+    },\n+    \"issue\": {\n+        \"assignee\": null,\n+        \"assignees\": [],\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"\",\n+        \"closed_at\": null,\n+        \"comments\": 4,\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/19/comments\",\n+        \"created_at\": \"2019-04-02T09:56:41Z\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/19/events\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/issues/19\",\n+        \"id\": 428131685,\n+        \"labels\": [],\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/19/labels{/name}\",\n+        \"locked\": false,\n+        \"milestone\": null,\n+        \"node_id\": \"MDU6SXNzdWU0MjgxMzE2ODU=\",\n+        \"number\": 19,\n+        \"repository_url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"state\": \"open\",\n+        \"title\": \"Build ursabot itself via ursabot\",\n+        \"updated_at\": \"2019-04-05T11:53:43Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/19\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"organization\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+        \"description\": \"Innovation lab for open source data science tools, powered by Apache Arrow\",\n+        \"events_url\": \"https://api.github.com/orgs/ursa-labs/events\",\n+        \"hooks_url\": \"https://api.github.com/orgs/ursa-labs/hooks\",\n+        \"id\": 46514972,\n+        \"issues_url\": \"https://api.github.com/orgs/ursa-labs/issues\",\n+        \"login\": \"ursa-labs\",\n+        \"members_url\": \"https://api.github.com/orgs/ursa-labs/members{/member}\",\n+        \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+        \"public_members_url\": \"https://api.github.com/orgs/ursa-labs/public_members{/member}\",\n+        \"repos_url\": \"https://api.github.com/orgs/ursa-labs/repos\",\n+        \"url\": \"https://api.github.com/orgs/ursa-labs\"\n+    },\n+    \"repository\": {\n+        \"archive_url\": \"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\",\n+        \"archived\": false,\n+        \"assignees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\",\n+        \"blobs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\",\n+        \"branches_url\": \"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\",\n+        \"clone_url\": \"https://github.com/ursa-labs/ursabot.git\",\n+        \"collaborators_url\": \"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\",\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\",\n+        \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\",\n+        \"compare_url\": \"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\",\n+        \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\",\n+        \"contributors_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contributors\",\n+        \"created_at\": \"2019-02-04T15:40:31Z\",\n+        \"default_branch\": \"master\",\n+        \"deployments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/deployments\",\n+        \"description\": null,\n+        \"disabled\": false,\n+        \"downloads_url\": \"https://api.github.com/repos/ursa-labs/ursabot/downloads\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/events\",\n+        \"fork\": false,\n+        \"forks\": 0,\n+        \"forks_count\": 0,\n+        \"forks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/forks\",\n+        \"full_name\": \"ursa-labs/ursabot\",\n+        \"git_commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\",\n+        \"git_refs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\",\n+        \"git_tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\",\n+        \"git_url\": \"git://github.com/ursa-labs/ursabot.git\",\n+        \"has_downloads\": true,\n+        \"has_issues\": true,\n+        \"has_pages\": false,\n+        \"has_projects\": true,\n+        \"has_wiki\": true,\n+        \"homepage\": null,\n+        \"hooks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/hooks\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"id\": 169101701,\n+        \"issue_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\",\n+        \"issue_events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\",\n+        \"issues_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\",\n+        \"keys_url\": \"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\",\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\",\n+        \"language\": \"Jupyter Notebook\",\n+        \"languages_url\": \"https://api.github.com/repos/ursa-labs/ursabot/languages\",\n+        \"license\": null,\n+        \"merges_url\": \"https://api.github.com/repos/ursa-labs/ursabot/merges\",\n+        \"milestones_url\": \"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\",\n+        \"mirror_url\": null,\n+        \"name\": \"ursabot\",\n+        \"node_id\": \"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\",\n+        \"notifications_url\": \"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\",\n+        \"open_issues\": 19,\n+        \"open_issues_count\": 19,\n+        \"owner\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursa-labs\",\n+            \"id\": 46514972,\n+            \"login\": \"ursa-labs\",\n+            \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+            \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+            \"type\": \"Organization\",\n+            \"url\": \"https://api.github.com/users/ursa-labs\"\n+        },\n+        \"private\": false,\n+        \"pulls_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\",\n+        \"pushed_at\": \"2019-04-05T11:22:16Z\",\n+        \"releases_url\": \"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\",\n+        \"size\": 892,\n+        \"ssh_url\": \"git@github.com:ursa-labs/ursabot.git\",\n+        \"stargazers_count\": 1,\n+        \"stargazers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/stargazers\",\n+        \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\",\n+        \"subscribers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscribers\",\n+        \"subscription_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscription\",\n+        \"svn_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/tags\",\n+        \"teams_url\": \"https://api.github.com/repos/ursa-labs/ursabot/teams\",\n+        \"trees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\",\n+        \"updated_at\": \"2019-04-04T17:49:10Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"watchers\": 1,\n+        \"watchers_count\": 1\n+    },\n+    \"sender\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/49275095?v=4\",\n+        \"events_url\": \"https://api.github.com/users/ursabot/events{/privacy}\",\n+        \"followers_url\": \"https://api.github.com/users/ursabot/followers\",\n+        \"following_url\": \"https://api.github.com/users/ursabot/following{/other_user}\",\n+        \"gists_url\": \"https://api.github.com/users/ursabot/gists{/gist_id}\",\n+        \"gravatar_id\": \"\",\n+        \"html_url\": \"https://github.com/ursabot\",\n+        \"id\": 49275095,\n+        \"login\": \"ursabot\",\n+        \"node_id\": \"MDQ6VXNlcjQ5Mjc1MDk1\",\n+        \"organizations_url\": \"https://api.github.com/users/ursabot/orgs\",\n+        \"received_events_url\": \"https://api.github.com/users/ursabot/received_events\",\n+        \"repos_url\": \"https://api.github.com/users/ursabot/repos\",\n+        \"site_admin\": false,\n+        \"starred_url\": \"https://api.github.com/users/ursabot/starred{/owner}{/repo}\",\n+        \"subscriptions_url\": \"https://api.github.com/users/ursabot/subscriptions\",\n+        \"type\": \"User\",\n+        \"url\": \"https://api.github.com/users/ursabot\"\n+    }\n+}"
+    },
+    {
+      "sha": "c738bb0eb54c87ba0f23e97e827d77c2be74d0b6",
+      "filename": "ursabot/tests/test_hooks.py",
+      "status": "modified",
+      "additions": 4,
+      "deletions": 4,
+      "changes": 8,
+      "blob_url": "https://github.com/ursa-labs/ursabot/blob/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/test_hooks.py",
+      "raw_url": "https://github.com/ursa-labs/ursabot/raw/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/test_hooks.py",
+      "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/test_hooks.py?ref=2705da2b616b98fa6010a25813c5a7a27456f71d",
+      "patch": "@@ -54,7 +54,7 @@ class TestGithubHook(ChangeHookTestCase):\n         await self.request('ping', {})\n         assert len(self.hook.master.data.updates.changesAdded) == 0\n \n-    @ensure_deferred\n-    async def test_issue_comment(self):\n-        payload = {}\n-        await self.request('issue_comment', payload)\n+    # @ensure_deferred\n+    # async def test_issue_comment(self):\n+    #     payload = {}\n+    #     await self.request('issue_comment', payload)"
+    }
+  ]
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/pull-request-26-files.json b/src/arrow/dev/archery/archery/tests/fixtures/pull-request-26-files.json
new file mode 100644
index 000000000..b039b3d10
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/pull-request-26-files.json
@@ -0,0 +1,170 @@
+[
+  {
+    "sha": "ebfe3f6c5e98723f9751c99ce8ce798f1ba529c5",
+    "filename": ".travis.yml",
+    "status": "modified",
+    "additions": 4,
+    "deletions": 1,
+    "changes": 5,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/.travis.yml",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/.travis.yml",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/.travis.yml?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -4,7 +4,10 @@ services:\n python:\n   - 3.6\n script:\n-  - pip install \"pytest>=3.9\" flake8 -e .\n+  # --no-binary buildbot is required because buildbot doesn't bundle its tests\n+  # to binary wheels, but ursabot's test suite depends on buildbot's so install\n+  # it from source\n+  - pip install --no-binary buildbot \"pytest>=3.9\" mock flake8 -e .\n \n   # run linter\n   - flake8 ursabot"
+  },
+  {
+    "sha": "86ad809d3f74c175b92ac58c6c645b0fbf5fa2c5",
+    "filename": "setup.py",
+    "status": "modified",
+    "additions": 6,
+    "deletions": 1,
+    "changes": 7,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/setup.py",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/setup.py",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/setup.py?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -1,8 +1,13 @@\n #!/usr/bin/env python\n \n+import sys\n from setuptools import setup\n \n \n+if sys.version_info < (3, 6):\n+    sys.exit('Python < 3.6 is not supported due to missing asyncio support')\n+\n+\n # TODO(kszucs): add package data, change maintainer\n setup(\n     name='ursabot',\n@@ -15,7 +20,7 @@\n     setup_requires=['setuptools_scm'],\n     install_requires=['click', 'dask', 'docker', 'docker-map', 'toolz',\n                       'buildbot', 'treq'],\n-    tests_require=['pytest>=3.9'],\n+    tests_require=['pytest>=3.9', 'mock'],\n     entry_points='''\n         [console_scripts]\n         ursabot=ursabot.cli:ursabot"
+  },
+  {
+    "sha": "c884f3f85bba499d77d9ad28bcd0ff5edf80f957",
+    "filename": "ursabot/factories.py",
+    "status": "modified",
+    "additions": 6,
+    "deletions": 2,
+    "changes": 8,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/factories.py",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/factories.py",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/factories.py?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -79,8 +79,12 @@ def prepend_step(self, step):\n                repourl='https://github.com/ursa-labs/ursabot',\n                mode='full'),\n     ShellCommand(command=['ls', '-lah']),\n-    ShellCommand(command=['pip', 'install', 'pytest', 'flake8']),\n-    ShellCommand(command=['pip', 'install', '-e', '.']),\n+    ShellCommand(command=['pip', 'install', 'pytest', 'flake8', 'mock']),\n+    # --no-binary buildbot is required because buildbot doesn't bundle its\n+    # tests to binary wheels, but ursabot's test suite depends on buildbot's\n+    # so install it from source\n+    ShellCommand(command=['pip', 'install', '--no-binary', 'buildbot',\n+                          '-e', '.']),\n     ShellCommand(command=['flake8']),\n     ShellCommand(command=['pytest', '-v', '-m', 'not docker', 'ursabot']),\n     ShellCommand(command=['buildbot', 'checkconfig', '.'])"
+  },
+  {
+    "sha": "0265cfbd9c2882f492469882a7bf513a1c1b5af4",
+    "filename": "ursabot/hooks.py",
+    "status": "modified",
+    "additions": 17,
+    "deletions": 19,
+    "changes": 36,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/hooks.py",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/hooks.py",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/hooks.py?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -1,11 +1,11 @@\n from urllib.parse import urlparse\n \n from twisted.python import log\n-from twisted.internet import defer\n \n from buildbot.www.hooks.github import GitHubEventHandler\n from buildbot.util.httpclientservice import HTTPClientService\n \n+from .utils import ensure_deferred\n \n BOTNAME = 'ursabot'\n \n@@ -22,20 +22,18 @@ def _client(self):\n             self.master, self.github_api_endpoint, headers=headers,\n             debug=self.debug, verify=self.verify)\n \n-    @defer.inlineCallbacks\n-    def _get(self, url):\n+    async def _get(self, url):\n         url = urlparse(url)\n-        client = yield self._client()\n-        response = yield client.get(url.path)\n-        result = yield response.json()\n+        client = await self._client()\n+        response = await client.get(url.path)\n+        result = await response.json()\n         return result\n \n-    @defer.inlineCallbacks\n-    def _post(self, url, data):\n+    async def _post(self, url, data):\n         url = urlparse(url)\n-        client = yield self._client()\n-        response = yield client.post(url.path, json=data)\n-        result = yield response.json()\n+        client = await self._client()\n+        response = await client.post(url.path, json=data)\n+        result = await response.json()\n         log.msg(f'POST to {url} with the following result: {result}')\n         return result\n \n@@ -46,8 +44,8 @@ def _parse_command(self, message):\n             return message.split(mention)[-1].lower().strip()\n         return None\n \n-    @defer.inlineCallbacks\n-    def handle_issue_comment(self, payload, event):\n+    @ensure_deferred\n+    async def handle_issue_comment(self, payload, event):\n         issue = payload['issue']\n         comments_url = issue['comments_url']\n         command = self._parse_command(payload['comment']['body'])\n@@ -64,16 +62,16 @@ def handle_issue_comment(self, payload, event):\n         elif command == 'build':\n             if 'pull_request' not in issue:\n                 message = 'Ursabot only listens to pull request comments!'\n-                yield self._post(comments_url, {'body': message})\n+                await self._post(comments_url, {'body': message})\n                 return [], 'git'\n         else:\n             message = f'Unknown command \"{command}\"'\n-            yield self._post(comments_url, {'body': message})\n+            await self._post(comments_url, {'body': message})\n             return [], 'git'\n \n         try:\n-            pull_request = yield self._get(issue['pull_request']['url'])\n-            changes, _ = yield self.handle_pull_request({\n+            pull_request = await self._get(issue['pull_request']['url'])\n+            changes, _ = await self.handle_pull_request({\n                 'action': 'synchronize',\n                 'sender': payload['sender'],\n                 'repository': payload['repository'],\n@@ -82,11 +80,11 @@ def handle_issue_comment(self, payload, event):\n             }, event)\n         except Exception as e:\n             message = \"I've failed to start builds for this PR\"\n-            yield self._post(comments_url, {'body': message})\n+            await self._post(comments_url, {'body': message})\n             raise e\n         else:\n             message = \"I've successfully started builds for this PR\"\n-            yield self._post(comments_url, {'body': message})\n+            await self._post(comments_url, {'body': message})\n             return changes, 'git'\n \n     # TODO(kszucs):"
+  },
+  {
+    "sha": "1e1ecf2ce47da929dbf1b93632640e7e6ae1cfe0",
+    "filename": "ursabot/steps.py",
+    "status": "modified",
+    "additions": 13,
+    "deletions": 13,
+    "changes": 26,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/steps.py",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/steps.py",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/steps.py?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -1,9 +1,9 @@\n-from twisted.internet import defer\n-\n from buildbot.plugins import steps, util\n from buildbot.process import buildstep\n from buildbot.process.results import SUCCESS\n \n+from .utils import ensure_deferred\n+\n \n class ShellMixin(buildstep.ShellMixin):\n     \"\"\"Run command in a login bash shell\n@@ -49,10 +49,10 @@ def __init__(self, **kwargs):\n         kwargs = self.setupShellMixin(kwargs)\n         super().__init__(**kwargs)\n \n-    @defer.inlineCallbacks\n-    def run(self):\n-        cmd = yield self.makeRemoteShellCommand(command=self.command)\n-        yield self.runCommand(cmd)\n+    @ensure_deferred\n+    async def run(self):\n+        cmd = await self.makeRemoteShellCommand(command=self.command)\n+        await self.runCommand(cmd)\n         return cmd.results()\n \n \n@@ -71,8 +71,8 @@ class CMake(ShellMixin, steps.CMake):\n \n     name = 'CMake'\n \n-    @defer.inlineCallbacks\n-    def run(self):\n+    @ensure_deferred\n+    async def run(self):\n         \"\"\"Create and run CMake command\n \n         Copied from the original CMake implementation to handle None values as\n@@ -94,8 +94,8 @@ def run(self):\n         if self.options is not None:\n             command.extend(self.options)\n \n-        cmd = yield self.makeRemoteShellCommand(command=command)\n-        yield self.runCommand(cmd)\n+        cmd = await self.makeRemoteShellCommand(command=command)\n+        await self.runCommand(cmd)\n \n         return cmd.results()\n \n@@ -117,8 +117,8 @@ def __init__(self, variables, source='WorkerEnvironment', **kwargs):\n         self.source = source\n         super().__init__(**kwargs)\n \n-    @defer.inlineCallbacks\n-    def run(self):\n+    @ensure_deferred\n+    async def run(self):\n         # on Windows, environment variables are case-insensitive, but we have\n         # a case-sensitive dictionary in worker_environ.  Fortunately, that\n         # dictionary is also folded to uppercase, so we can simply fold the\n@@ -139,7 +139,7 @@ def run(self):\n                 # TODO(kszucs) try with self.setProperty similarly like in\n                 # SetProperties\n                 properties.setProperty(prop, value, self.source, runtime=True)\n-                yield self.addCompleteLog('set-prop', f'{prop}: {value}')\n+                await self.addCompleteLog('set-prop', f'{prop}: {value}')\n \n         return SUCCESS\n "
+  },
+  {
+    "sha": "6a7d5308be6608f542a810d410f9240157a1340f",
+    "filename": "ursabot/tests/fixtures/issue-comment-build-command.json",
+    "status": "added",
+    "additions": 212,
+    "deletions": 0,
+    "changes": 212,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/issue-comment-build-command.json",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/issue-comment-build-command.json",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-build-command.json?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -0,0 +1,212 @@\n+{\n+    \"action\": \"created\",\n+    \"comment\": {\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"@ursabot build\",\n+        \"created_at\": \"2019-04-05T11:55:43Z\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480248726\",\n+        \"id\": 480248726,\n+        \"issue_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"node_id\": \"MDEyOklzc3VlQ29tbWVudDQ4MDI0ODcyNg==\",\n+        \"updated_at\": \"2019-04-05T11:55:43Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480248726\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"issue\": {\n+        \"assignee\": null,\n+        \"assignees\": [],\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"\",\n+        \"closed_at\": null,\n+        \"comments\": 3,\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\",\n+        \"created_at\": \"2019-04-05T11:22:15Z\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/events\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+        \"id\": 429706959,\n+        \"labels\": [],\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}\",\n+        \"locked\": false,\n+        \"milestone\": null,\n+        \"node_id\": \"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\",\n+        \"number\": 26,\n+        \"pull_request\": {\n+            \"diff_url\": \"https://github.com/ursa-labs/ursabot/pull/26.diff\",\n+            \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+            \"patch_url\": \"https://github.com/ursa-labs/ursabot/pull/26.patch\",\n+            \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\"\n+        },\n+        \"repository_url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"state\": \"open\",\n+        \"title\": \"Unittests for GithubHook\",\n+        \"updated_at\": \"2019-04-05T11:55:43Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"organization\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+        \"description\": \"Innovation lab for open source data science tools, powered by Apache Arrow\",\n+        \"events_url\": \"https://api.github.com/orgs/ursa-labs/events\",\n+        \"hooks_url\": \"https://api.github.com/orgs/ursa-labs/hooks\",\n+        \"id\": 46514972,\n+        \"issues_url\": \"https://api.github.com/orgs/ursa-labs/issues\",\n+        \"login\": \"ursa-labs\",\n+        \"members_url\": \"https://api.github.com/orgs/ursa-labs/members{/member}\",\n+        \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+        \"public_members_url\": \"https://api.github.com/orgs/ursa-labs/public_members{/member}\",\n+        \"repos_url\": \"https://api.github.com/orgs/ursa-labs/repos\",\n+        \"url\": \"https://api.github.com/orgs/ursa-labs\"\n+    },\n+    \"repository\": {\n+        \"archive_url\": \"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\",\n+        \"archived\": false,\n+        \"assignees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\",\n+        \"blobs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\",\n+        \"branches_url\": \"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\",\n+        \"clone_url\": \"https://github.com/ursa-labs/ursabot.git\",\n+        \"collaborators_url\": \"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\",\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\",\n+        \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\",\n+        \"compare_url\": \"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\",\n+        \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\",\n+        \"contributors_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contributors\",\n+        \"created_at\": \"2019-02-04T15:40:31Z\",\n+        \"default_branch\": \"master\",\n+        \"deployments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/deployments\",\n+        \"description\": null,\n+        \"disabled\": false,\n+        \"downloads_url\": \"https://api.github.com/repos/ursa-labs/ursabot/downloads\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/events\",\n+        \"fork\": false,\n+        \"forks\": 0,\n+        \"forks_count\": 0,\n+        \"forks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/forks\",\n+        \"full_name\": \"ursa-labs/ursabot\",\n+        \"git_commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\",\n+        \"git_refs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\",\n+        \"git_tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\",\n+        \"git_url\": \"git://github.com/ursa-labs/ursabot.git\",\n+        \"has_downloads\": true,\n+        \"has_issues\": true,\n+        \"has_pages\": false,\n+        \"has_projects\": true,\n+        \"has_wiki\": true,\n+        \"homepage\": null,\n+        \"hooks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/hooks\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"id\": 169101701,\n+        \"issue_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\",\n+        \"issue_events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\",\n+        \"issues_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\",\n+        \"keys_url\": \"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\",\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\",\n+        \"language\": \"Jupyter Notebook\",\n+        \"languages_url\": \"https://api.github.com/repos/ursa-labs/ursabot/languages\",\n+        \"license\": null,\n+        \"merges_url\": \"https://api.github.com/repos/ursa-labs/ursabot/merges\",\n+        \"milestones_url\": \"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\",\n+        \"mirror_url\": null,\n+        \"name\": \"ursabot\",\n+        \"node_id\": \"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\",\n+        \"notifications_url\": \"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\",\n+        \"open_issues\": 19,\n+        \"open_issues_count\": 19,\n+        \"owner\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursa-labs\",\n+            \"id\": 46514972,\n+            \"login\": \"ursa-labs\",\n+            \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+            \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+            \"type\": \"Organization\",\n+            \"url\": \"https://api.github.com/users/ursa-labs\"\n+        },\n+        \"private\": false,\n+        \"pulls_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\",\n+        \"pushed_at\": \"2019-04-05T11:22:16Z\",\n+        \"releases_url\": \"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\",\n+        \"size\": 892,\n+        \"ssh_url\": \"git@github.com:ursa-labs/ursabot.git\",\n+        \"stargazers_count\": 1,\n+        \"stargazers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/stargazers\",\n+        \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\",\n+        \"subscribers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscribers\",\n+        \"subscription_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscription\",\n+        \"svn_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/tags\",\n+        \"teams_url\": \"https://api.github.com/repos/ursa-labs/ursabot/teams\",\n+        \"trees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\",\n+        \"updated_at\": \"2019-04-04T17:49:10Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"watchers\": 1,\n+        \"watchers_count\": 1\n+    },\n+    \"sender\": {\n+        \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+        \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+        \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+        \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+        \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+        \"gravatar_id\": \"\",\n+        \"html_url\": \"https://github.com/kszucs\",\n+        \"id\": 961747,\n+        \"login\": \"kszucs\",\n+        \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+        \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+        \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+        \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+        \"site_admin\": false,\n+        \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+        \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+        \"type\": \"User\",\n+        \"url\": \"https://api.github.com/users/kszucs\"\n+    }\n+}"
+  },
+  {
+    "sha": "7ef554e333327f0e62aa1fd76b4b17844a39adeb",
+    "filename": "ursabot/tests/fixtures/issue-comment-by-ursabot.json",
+    "status": "added",
+    "additions": 212,
+    "deletions": 0,
+    "changes": 212,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/issue-comment-by-ursabot.json",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/issue-comment-by-ursabot.json",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-by-ursabot.json?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -0,0 +1,212 @@\n+{\n+    \"action\": \"created\",\n+    \"comment\": {\n+        \"author_association\": \"NONE\",\n+        \"body\": \"Unknown command \\\"\\\"\",\n+        \"created_at\": \"2019-04-05T11:35:47Z\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480243815\",\n+        \"id\": 480243815,\n+        \"issue_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"node_id\": \"MDEyOklzc3VlQ29tbWVudDQ4MDI0MzgxNQ==\",\n+        \"updated_at\": \"2019-04-05T11:35:47Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480243815\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/49275095?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursabot/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursabot/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursabot/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursabot/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursabot\",\n+            \"id\": 49275095,\n+            \"login\": \"ursabot\",\n+            \"node_id\": \"MDQ6VXNlcjQ5Mjc1MDk1\",\n+            \"organizations_url\": \"https://api.github.com/users/ursabot/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursabot/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursabot/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursabot/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursabot/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/ursabot\"\n+        }\n+    },\n+    \"issue\": {\n+        \"assignee\": null,\n+        \"assignees\": [],\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"\",\n+        \"closed_at\": null,\n+        \"comments\": 2,\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\",\n+        \"created_at\": \"2019-04-05T11:22:15Z\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/events\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+        \"id\": 429706959,\n+        \"labels\": [],\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}\",\n+        \"locked\": false,\n+        \"milestone\": null,\n+        \"node_id\": \"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\",\n+        \"number\": 26,\n+        \"pull_request\": {\n+            \"diff_url\": \"https://github.com/ursa-labs/ursabot/pull/26.diff\",\n+            \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+            \"patch_url\": \"https://github.com/ursa-labs/ursabot/pull/26.patch\",\n+            \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\"\n+        },\n+        \"repository_url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"state\": \"open\",\n+        \"title\": \"Unittests for GithubHook\",\n+        \"updated_at\": \"2019-04-05T11:35:47Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"organization\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+        \"description\": \"Innovation lab for open source data science tools, powered by Apache Arrow\",\n+        \"events_url\": \"https://api.github.com/orgs/ursa-labs/events\",\n+        \"hooks_url\": \"https://api.github.com/orgs/ursa-labs/hooks\",\n+        \"id\": 46514972,\n+        \"issues_url\": \"https://api.github.com/orgs/ursa-labs/issues\",\n+        \"login\": \"ursa-labs\",\n+        \"members_url\": \"https://api.github.com/orgs/ursa-labs/members{/member}\",\n+        \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+        \"public_members_url\": \"https://api.github.com/orgs/ursa-labs/public_members{/member}\",\n+        \"repos_url\": \"https://api.github.com/orgs/ursa-labs/repos\",\n+        \"url\": \"https://api.github.com/orgs/ursa-labs\"\n+    },\n+    \"repository\": {\n+        \"archive_url\": \"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\",\n+        \"archived\": false,\n+        \"assignees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\",\n+        \"blobs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\",\n+        \"branches_url\": \"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\",\n+        \"clone_url\": \"https://github.com/ursa-labs/ursabot.git\",\n+        \"collaborators_url\": \"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\",\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\",\n+        \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\",\n+        \"compare_url\": \"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\",\n+        \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\",\n+        \"contributors_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contributors\",\n+        \"created_at\": \"2019-02-04T15:40:31Z\",\n+        \"default_branch\": \"master\",\n+        \"deployments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/deployments\",\n+        \"description\": null,\n+        \"disabled\": false,\n+        \"downloads_url\": \"https://api.github.com/repos/ursa-labs/ursabot/downloads\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/events\",\n+        \"fork\": false,\n+        \"forks\": 0,\n+        \"forks_count\": 0,\n+        \"forks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/forks\",\n+        \"full_name\": \"ursa-labs/ursabot\",\n+        \"git_commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\",\n+        \"git_refs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\",\n+        \"git_tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\",\n+        \"git_url\": \"git://github.com/ursa-labs/ursabot.git\",\n+        \"has_downloads\": true,\n+        \"has_issues\": true,\n+        \"has_pages\": false,\n+        \"has_projects\": true,\n+        \"has_wiki\": true,\n+        \"homepage\": null,\n+        \"hooks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/hooks\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"id\": 169101701,\n+        \"issue_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\",\n+        \"issue_events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\",\n+        \"issues_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\",\n+        \"keys_url\": \"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\",\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\",\n+        \"language\": \"Jupyter Notebook\",\n+        \"languages_url\": \"https://api.github.com/repos/ursa-labs/ursabot/languages\",\n+        \"license\": null,\n+        \"merges_url\": \"https://api.github.com/repos/ursa-labs/ursabot/merges\",\n+        \"milestones_url\": \"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\",\n+        \"mirror_url\": null,\n+        \"name\": \"ursabot\",\n+        \"node_id\": \"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\",\n+        \"notifications_url\": \"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\",\n+        \"open_issues\": 19,\n+        \"open_issues_count\": 19,\n+        \"owner\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursa-labs\",\n+            \"id\": 46514972,\n+            \"login\": \"ursa-labs\",\n+            \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+            \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+            \"type\": \"Organization\",\n+            \"url\": \"https://api.github.com/users/ursa-labs\"\n+        },\n+        \"private\": false,\n+        \"pulls_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\",\n+        \"pushed_at\": \"2019-04-05T11:22:16Z\",\n+        \"releases_url\": \"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\",\n+        \"size\": 892,\n+        \"ssh_url\": \"git@github.com:ursa-labs/ursabot.git\",\n+        \"stargazers_count\": 1,\n+        \"stargazers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/stargazers\",\n+        \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\",\n+        \"subscribers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscribers\",\n+        \"subscription_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscription\",\n+        \"svn_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/tags\",\n+        \"teams_url\": \"https://api.github.com/repos/ursa-labs/ursabot/teams\",\n+        \"trees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\",\n+        \"updated_at\": \"2019-04-04T17:49:10Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"watchers\": 1,\n+        \"watchers_count\": 1\n+    },\n+    \"sender\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/49275095?v=4\",\n+        \"events_url\": \"https://api.github.com/users/ursabot/events{/privacy}\",\n+        \"followers_url\": \"https://api.github.com/users/ursabot/followers\",\n+        \"following_url\": \"https://api.github.com/users/ursabot/following{/other_user}\",\n+        \"gists_url\": \"https://api.github.com/users/ursabot/gists{/gist_id}\",\n+        \"gravatar_id\": \"\",\n+        \"html_url\": \"https://github.com/ursabot\",\n+        \"id\": 49275095,\n+        \"login\": \"ursabot\",\n+        \"node_id\": \"MDQ6VXNlcjQ5Mjc1MDk1\",\n+        \"organizations_url\": \"https://api.github.com/users/ursabot/orgs\",\n+        \"received_events_url\": \"https://api.github.com/users/ursabot/received_events\",\n+        \"repos_url\": \"https://api.github.com/users/ursabot/repos\",\n+        \"site_admin\": false,\n+        \"starred_url\": \"https://api.github.com/users/ursabot/starred{/owner}{/repo}\",\n+        \"subscriptions_url\": \"https://api.github.com/users/ursabot/subscriptions\",\n+        \"type\": \"User\",\n+        \"url\": \"https://api.github.com/users/ursabot\"\n+    }\n+}"
+  },
+  {
+    "sha": "a8082dbc91fdfe815b795e49ec10e49000771ef5",
+    "filename": "ursabot/tests/fixtures/issue-comment-not-mentioning-ursabot.json",
+    "status": "added",
+    "additions": 212,
+    "deletions": 0,
+    "changes": 212,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/issue-comment-not-mentioning-ursabot.json",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/issue-comment-not-mentioning-ursabot.json",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-not-mentioning-ursabot.json?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -0,0 +1,212 @@\n+{\n+    \"action\": \"created\",\n+    \"comment\": {\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"bear is no game\",\n+        \"created_at\": \"2019-04-05T11:26:56Z\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480241727\",\n+        \"id\": 480241727,\n+        \"issue_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"node_id\": \"MDEyOklzc3VlQ29tbWVudDQ4MDI0MTcyNw==\",\n+        \"updated_at\": \"2019-04-05T11:26:56Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480241727\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"issue\": {\n+        \"assignee\": null,\n+        \"assignees\": [],\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"\",\n+        \"closed_at\": null,\n+        \"comments\": 0,\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\",\n+        \"created_at\": \"2019-04-05T11:22:15Z\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/events\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+        \"id\": 429706959,\n+        \"labels\": [],\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}\",\n+        \"locked\": false,\n+        \"milestone\": null,\n+        \"node_id\": \"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\",\n+        \"number\": 26,\n+        \"pull_request\": {\n+            \"diff_url\": \"https://github.com/ursa-labs/ursabot/pull/26.diff\",\n+            \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+            \"patch_url\": \"https://github.com/ursa-labs/ursabot/pull/26.patch\",\n+            \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\"\n+        },\n+        \"repository_url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"state\": \"open\",\n+        \"title\": \"Unittests for GithubHook\",\n+        \"updated_at\": \"2019-04-05T11:26:56Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"organization\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+        \"description\": \"Innovation lab for open source data science tools, powered by Apache Arrow\",\n+        \"events_url\": \"https://api.github.com/orgs/ursa-labs/events\",\n+        \"hooks_url\": \"https://api.github.com/orgs/ursa-labs/hooks\",\n+        \"id\": 46514972,\n+        \"issues_url\": \"https://api.github.com/orgs/ursa-labs/issues\",\n+        \"login\": \"ursa-labs\",\n+        \"members_url\": \"https://api.github.com/orgs/ursa-labs/members{/member}\",\n+        \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+        \"public_members_url\": \"https://api.github.com/orgs/ursa-labs/public_members{/member}\",\n+        \"repos_url\": \"https://api.github.com/orgs/ursa-labs/repos\",\n+        \"url\": \"https://api.github.com/orgs/ursa-labs\"\n+    },\n+    \"repository\": {\n+        \"archive_url\": \"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\",\n+        \"archived\": false,\n+        \"assignees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\",\n+        \"blobs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\",\n+        \"branches_url\": \"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\",\n+        \"clone_url\": \"https://github.com/ursa-labs/ursabot.git\",\n+        \"collaborators_url\": \"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\",\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\",\n+        \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\",\n+        \"compare_url\": \"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\",\n+        \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\",\n+        \"contributors_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contributors\",\n+        \"created_at\": \"2019-02-04T15:40:31Z\",\n+        \"default_branch\": \"master\",\n+        \"deployments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/deployments\",\n+        \"description\": null,\n+        \"disabled\": false,\n+        \"downloads_url\": \"https://api.github.com/repos/ursa-labs/ursabot/downloads\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/events\",\n+        \"fork\": false,\n+        \"forks\": 0,\n+        \"forks_count\": 0,\n+        \"forks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/forks\",\n+        \"full_name\": \"ursa-labs/ursabot\",\n+        \"git_commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\",\n+        \"git_refs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\",\n+        \"git_tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\",\n+        \"git_url\": \"git://github.com/ursa-labs/ursabot.git\",\n+        \"has_downloads\": true,\n+        \"has_issues\": true,\n+        \"has_pages\": false,\n+        \"has_projects\": true,\n+        \"has_wiki\": true,\n+        \"homepage\": null,\n+        \"hooks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/hooks\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"id\": 169101701,\n+        \"issue_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\",\n+        \"issue_events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\",\n+        \"issues_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\",\n+        \"keys_url\": \"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\",\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\",\n+        \"language\": \"Jupyter Notebook\",\n+        \"languages_url\": \"https://api.github.com/repos/ursa-labs/ursabot/languages\",\n+        \"license\": null,\n+        \"merges_url\": \"https://api.github.com/repos/ursa-labs/ursabot/merges\",\n+        \"milestones_url\": \"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\",\n+        \"mirror_url\": null,\n+        \"name\": \"ursabot\",\n+        \"node_id\": \"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\",\n+        \"notifications_url\": \"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\",\n+        \"open_issues\": 19,\n+        \"open_issues_count\": 19,\n+        \"owner\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursa-labs\",\n+            \"id\": 46514972,\n+            \"login\": \"ursa-labs\",\n+            \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+            \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+            \"type\": \"Organization\",\n+            \"url\": \"https://api.github.com/users/ursa-labs\"\n+        },\n+        \"private\": false,\n+        \"pulls_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\",\n+        \"pushed_at\": \"2019-04-05T11:22:16Z\",\n+        \"releases_url\": \"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\",\n+        \"size\": 892,\n+        \"ssh_url\": \"git@github.com:ursa-labs/ursabot.git\",\n+        \"stargazers_count\": 1,\n+        \"stargazers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/stargazers\",\n+        \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\",\n+        \"subscribers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscribers\",\n+        \"subscription_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscription\",\n+        \"svn_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/tags\",\n+        \"teams_url\": \"https://api.github.com/repos/ursa-labs/ursabot/teams\",\n+        \"trees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\",\n+        \"updated_at\": \"2019-04-04T17:49:10Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"watchers\": 1,\n+        \"watchers_count\": 1\n+    },\n+    \"sender\": {\n+        \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+        \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+        \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+        \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+        \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+        \"gravatar_id\": \"\",\n+        \"html_url\": \"https://github.com/kszucs\",\n+        \"id\": 961747,\n+        \"login\": \"kszucs\",\n+        \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+        \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+        \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+        \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+        \"site_admin\": false,\n+        \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+        \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+        \"type\": \"User\",\n+        \"url\": \"https://api.github.com/users/kszucs\"\n+    }\n+}"
+  },
+  {
+    "sha": "2770e29ba9086394455315e590c0b433d08e437e",
+    "filename": "ursabot/tests/fixtures/issue-comment-with-empty-command.json",
+    "status": "added",
+    "additions": 212,
+    "deletions": 0,
+    "changes": 212,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/issue-comment-with-empty-command.json",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/issue-comment-with-empty-command.json",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-with-empty-command.json?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -0,0 +1,212 @@\n+{\n+    \"action\": \"created\",\n+    \"comment\": {\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"@ursabot \",\n+        \"created_at\": \"2019-04-05T11:35:46Z\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480243811\",\n+        \"id\": 480243811,\n+        \"issue_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"node_id\": \"MDEyOklzc3VlQ29tbWVudDQ4MDI0MzgxMQ==\",\n+        \"updated_at\": \"2019-04-05T11:35:46Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480243811\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"issue\": {\n+        \"assignee\": null,\n+        \"assignees\": [],\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"\",\n+        \"closed_at\": null,\n+        \"comments\": 1,\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\",\n+        \"created_at\": \"2019-04-05T11:22:15Z\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/events\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+        \"id\": 429706959,\n+        \"labels\": [],\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}\",\n+        \"locked\": false,\n+        \"milestone\": null,\n+        \"node_id\": \"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\",\n+        \"number\": 26,\n+        \"pull_request\": {\n+            \"diff_url\": \"https://github.com/ursa-labs/ursabot/pull/26.diff\",\n+            \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+            \"patch_url\": \"https://github.com/ursa-labs/ursabot/pull/26.patch\",\n+            \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\"\n+        },\n+        \"repository_url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"state\": \"open\",\n+        \"title\": \"Unittests for GithubHook\",\n+        \"updated_at\": \"2019-04-05T11:35:46Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"organization\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+        \"description\": \"Innovation lab for open source data science tools, powered by Apache Arrow\",\n+        \"events_url\": \"https://api.github.com/orgs/ursa-labs/events\",\n+        \"hooks_url\": \"https://api.github.com/orgs/ursa-labs/hooks\",\n+        \"id\": 46514972,\n+        \"issues_url\": \"https://api.github.com/orgs/ursa-labs/issues\",\n+        \"login\": \"ursa-labs\",\n+        \"members_url\": \"https://api.github.com/orgs/ursa-labs/members{/member}\",\n+        \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+        \"public_members_url\": \"https://api.github.com/orgs/ursa-labs/public_members{/member}\",\n+        \"repos_url\": \"https://api.github.com/orgs/ursa-labs/repos\",\n+        \"url\": \"https://api.github.com/orgs/ursa-labs\"\n+    },\n+    \"repository\": {\n+        \"archive_url\": \"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\",\n+        \"archived\": false,\n+        \"assignees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\",\n+        \"blobs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\",\n+        \"branches_url\": \"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\",\n+        \"clone_url\": \"https://github.com/ursa-labs/ursabot.git\",\n+        \"collaborators_url\": \"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\",\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\",\n+        \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\",\n+        \"compare_url\": \"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\",\n+        \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\",\n+        \"contributors_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contributors\",\n+        \"created_at\": \"2019-02-04T15:40:31Z\",\n+        \"default_branch\": \"master\",\n+        \"deployments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/deployments\",\n+        \"description\": null,\n+        \"disabled\": false,\n+        \"downloads_url\": \"https://api.github.com/repos/ursa-labs/ursabot/downloads\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/events\",\n+        \"fork\": false,\n+        \"forks\": 0,\n+        \"forks_count\": 0,\n+        \"forks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/forks\",\n+        \"full_name\": \"ursa-labs/ursabot\",\n+        \"git_commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\",\n+        \"git_refs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\",\n+        \"git_tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\",\n+        \"git_url\": \"git://github.com/ursa-labs/ursabot.git\",\n+        \"has_downloads\": true,\n+        \"has_issues\": true,\n+        \"has_pages\": false,\n+        \"has_projects\": true,\n+        \"has_wiki\": true,\n+        \"homepage\": null,\n+        \"hooks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/hooks\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"id\": 169101701,\n+        \"issue_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\",\n+        \"issue_events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\",\n+        \"issues_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\",\n+        \"keys_url\": \"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\",\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\",\n+        \"language\": \"Jupyter Notebook\",\n+        \"languages_url\": \"https://api.github.com/repos/ursa-labs/ursabot/languages\",\n+        \"license\": null,\n+        \"merges_url\": \"https://api.github.com/repos/ursa-labs/ursabot/merges\",\n+        \"milestones_url\": \"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\",\n+        \"mirror_url\": null,\n+        \"name\": \"ursabot\",\n+        \"node_id\": \"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\",\n+        \"notifications_url\": \"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\",\n+        \"open_issues\": 19,\n+        \"open_issues_count\": 19,\n+        \"owner\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursa-labs\",\n+            \"id\": 46514972,\n+            \"login\": \"ursa-labs\",\n+            \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+            \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+            \"type\": \"Organization\",\n+            \"url\": \"https://api.github.com/users/ursa-labs\"\n+        },\n+        \"private\": false,\n+        \"pulls_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\",\n+        \"pushed_at\": \"2019-04-05T11:22:16Z\",\n+        \"releases_url\": \"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\",\n+        \"size\": 892,\n+        \"ssh_url\": \"git@github.com:ursa-labs/ursabot.git\",\n+        \"stargazers_count\": 1,\n+        \"stargazers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/stargazers\",\n+        \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\",\n+        \"subscribers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscribers\",\n+        \"subscription_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscription\",\n+        \"svn_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/tags\",\n+        \"teams_url\": \"https://api.github.com/repos/ursa-labs/ursabot/teams\",\n+        \"trees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\",\n+        \"updated_at\": \"2019-04-04T17:49:10Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"watchers\": 1,\n+        \"watchers_count\": 1\n+    },\n+    \"sender\": {\n+        \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+        \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+        \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+        \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+        \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+        \"gravatar_id\": \"\",\n+        \"html_url\": \"https://github.com/kszucs\",\n+        \"id\": 961747,\n+        \"login\": \"kszucs\",\n+        \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+        \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+        \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+        \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+        \"site_admin\": false,\n+        \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+        \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+        \"type\": \"User\",\n+        \"url\": \"https://api.github.com/users/kszucs\"\n+    }\n+}"
+  },
+  {
+    "sha": "b7de8d838332944101812ee2a46c08dd0144efe3",
+    "filename": "ursabot/tests/fixtures/issue-comment-without-pull-request.json",
+    "status": "added",
+    "additions": 206,
+    "deletions": 0,
+    "changes": 206,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/issue-comment-without-pull-request.json",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/issue-comment-without-pull-request.json",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-without-pull-request.json?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -0,0 +1,206 @@\n+{\n+    \"action\": \"created\",\n+    \"comment\": {\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"@ursabot build\",\n+        \"created_at\": \"2019-04-05T13:07:57Z\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/issues/19#issuecomment-480268708\",\n+        \"id\": 480268708,\n+        \"issue_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/19\",\n+        \"node_id\": \"MDEyOklzc3VlQ29tbWVudDQ4MDI2ODcwOA==\",\n+        \"updated_at\": \"2019-04-05T13:07:57Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480268708\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"issue\": {\n+        \"assignee\": null,\n+        \"assignees\": [],\n+        \"author_association\": \"MEMBER\",\n+        \"body\": \"\",\n+        \"closed_at\": null,\n+        \"comments\": 5,\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/19/comments\",\n+        \"created_at\": \"2019-04-02T09:56:41Z\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/19/events\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot/issues/19\",\n+        \"id\": 428131685,\n+        \"labels\": [],\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/19/labels{/name}\",\n+        \"locked\": false,\n+        \"milestone\": null,\n+        \"node_id\": \"MDU6SXNzdWU0MjgxMzE2ODU=\",\n+        \"number\": 19,\n+        \"repository_url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"state\": \"open\",\n+        \"title\": \"Build ursabot itself via ursabot\",\n+        \"updated_at\": \"2019-04-05T13:07:57Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/19\",\n+        \"user\": {\n+            \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+            \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+            \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/kszucs\",\n+            \"id\": 961747,\n+            \"login\": \"kszucs\",\n+            \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+            \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+            \"type\": \"User\",\n+            \"url\": \"https://api.github.com/users/kszucs\"\n+        }\n+    },\n+    \"organization\": {\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+        \"description\": \"Innovation lab for open source data science tools, powered by Apache Arrow\",\n+        \"events_url\": \"https://api.github.com/orgs/ursa-labs/events\",\n+        \"hooks_url\": \"https://api.github.com/orgs/ursa-labs/hooks\",\n+        \"id\": 46514972,\n+        \"issues_url\": \"https://api.github.com/orgs/ursa-labs/issues\",\n+        \"login\": \"ursa-labs\",\n+        \"members_url\": \"https://api.github.com/orgs/ursa-labs/members{/member}\",\n+        \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+        \"public_members_url\": \"https://api.github.com/orgs/ursa-labs/public_members{/member}\",\n+        \"repos_url\": \"https://api.github.com/orgs/ursa-labs/repos\",\n+        \"url\": \"https://api.github.com/orgs/ursa-labs\"\n+    },\n+    \"repository\": {\n+        \"archive_url\": \"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\",\n+        \"archived\": false,\n+        \"assignees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\",\n+        \"blobs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\",\n+        \"branches_url\": \"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\",\n+        \"clone_url\": \"https://github.com/ursa-labs/ursabot.git\",\n+        \"collaborators_url\": \"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\",\n+        \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\",\n+        \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\",\n+        \"compare_url\": \"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\",\n+        \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\",\n+        \"contributors_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contributors\",\n+        \"created_at\": \"2019-02-04T15:40:31Z\",\n+        \"default_branch\": \"master\",\n+        \"deployments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/deployments\",\n+        \"description\": null,\n+        \"disabled\": false,\n+        \"downloads_url\": \"https://api.github.com/repos/ursa-labs/ursabot/downloads\",\n+        \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/events\",\n+        \"fork\": false,\n+        \"forks\": 0,\n+        \"forks_count\": 0,\n+        \"forks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/forks\",\n+        \"full_name\": \"ursa-labs/ursabot\",\n+        \"git_commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\",\n+        \"git_refs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\",\n+        \"git_tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\",\n+        \"git_url\": \"git://github.com/ursa-labs/ursabot.git\",\n+        \"has_downloads\": true,\n+        \"has_issues\": true,\n+        \"has_pages\": false,\n+        \"has_projects\": true,\n+        \"has_wiki\": true,\n+        \"homepage\": null,\n+        \"hooks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/hooks\",\n+        \"html_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"id\": 169101701,\n+        \"issue_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\",\n+        \"issue_events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\",\n+        \"issues_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\",\n+        \"keys_url\": \"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\",\n+        \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\",\n+        \"language\": \"Jupyter Notebook\",\n+        \"languages_url\": \"https://api.github.com/repos/ursa-labs/ursabot/languages\",\n+        \"license\": null,\n+        \"merges_url\": \"https://api.github.com/repos/ursa-labs/ursabot/merges\",\n+        \"milestones_url\": \"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\",\n+        \"mirror_url\": null,\n+        \"name\": \"ursabot\",\n+        \"node_id\": \"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\",\n+        \"notifications_url\": \"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\",\n+        \"open_issues\": 19,\n+        \"open_issues_count\": 19,\n+        \"owner\": {\n+            \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+            \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+            \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+            \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+            \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+            \"gravatar_id\": \"\",\n+            \"html_url\": \"https://github.com/ursa-labs\",\n+            \"id\": 46514972,\n+            \"login\": \"ursa-labs\",\n+            \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+            \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+            \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+            \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+            \"site_admin\": false,\n+            \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+            \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+            \"type\": \"Organization\",\n+            \"url\": \"https://api.github.com/users/ursa-labs\"\n+        },\n+        \"private\": false,\n+        \"pulls_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\",\n+        \"pushed_at\": \"2019-04-05T12:01:40Z\",\n+        \"releases_url\": \"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\",\n+        \"size\": 898,\n+        \"ssh_url\": \"git@github.com:ursa-labs/ursabot.git\",\n+        \"stargazers_count\": 1,\n+        \"stargazers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/stargazers\",\n+        \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\",\n+        \"subscribers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscribers\",\n+        \"subscription_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscription\",\n+        \"svn_url\": \"https://github.com/ursa-labs/ursabot\",\n+        \"tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/tags\",\n+        \"teams_url\": \"https://api.github.com/repos/ursa-labs/ursabot/teams\",\n+        \"trees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\",\n+        \"updated_at\": \"2019-04-04T17:49:10Z\",\n+        \"url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+        \"watchers\": 1,\n+        \"watchers_count\": 1\n+    },\n+    \"sender\": {\n+        \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+        \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+        \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+        \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+        \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+        \"gravatar_id\": \"\",\n+        \"html_url\": \"https://github.com/kszucs\",\n+        \"id\": 961747,\n+        \"login\": \"kszucs\",\n+        \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+        \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+        \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+        \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+        \"site_admin\": false,\n+        \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+        \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+        \"type\": \"User\",\n+        \"url\": \"https://api.github.com/users/kszucs\"\n+    }\n+}"
+  },
+  {
+    "sha": "33e051455e866fb4774a16ae02ad40dcf9e6a7fd",
+    "filename": "ursabot/tests/fixtures/pull-request-26-commit.json",
+    "status": "added",
+    "additions": 158,
+    "deletions": 0,
+    "changes": 158,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/pull-request-26-commit.json",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/pull-request-26-commit.json",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/pull-request-26-commit.json?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -0,0 +1,158 @@\n+{\n+  \"sha\": \"2705da2b616b98fa6010a25813c5a7a27456f71d\",\n+  \"node_id\": \"MDY6Q29tbWl0MTY5MTAxNzAxOjI3MDVkYTJiNjE2Yjk4ZmE2MDEwYTI1ODEzYzVhN2EyNzQ1NmY3MWQ=\",\n+  \"commit\": {\n+    \"author\": {\n+      \"name\": \"Krisztián Szűcs\",\n+      \"email\": \"szucs.krisztian@gmail.com\",\n+      \"date\": \"2019-04-05T12:01:31Z\"\n+    },\n+    \"committer\": {\n+      \"name\": \"Krisztián Szűcs\",\n+      \"email\": \"szucs.krisztian@gmail.com\",\n+      \"date\": \"2019-04-05T12:01:31Z\"\n+    },\n+    \"message\": \"add recorded event requests\",\n+    \"tree\": {\n+      \"sha\": \"16a7bb186833a67e9c2d84a58393503b85500ceb\",\n+      \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees/16a7bb186833a67e9c2d84a58393503b85500ceb\"\n+    },\n+    \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits/2705da2b616b98fa6010a25813c5a7a27456f71d\",\n+    \"comment_count\": 0,\n+    \"verification\": {\n+      \"verified\": true,\n+      \"reason\": \"valid\",\n+      \"signature\": \"-----BEGIN PGP SIGNATURE-----\\n\\niQFOBAABCAA4FiEEOOW2r8dr6sA77zHlgjqBKYe1QKUFAlynQ58aHHN6dWNzLmty\\naXN6dGlhbkBnbWFpbC5jb20ACgkQgjqBKYe1QKUYKwf6AiXDMaLqNLNSjRY7lIXX\\nudioewz0hSb4bgIXBv30nswu9CoOA0+mHCokEVtZhYbXzXDsZ1KJrilSC4j+Ws4q\\nkRGA6iEmrne2HcSKNZXzcVnwV9zpwKxlVh2QCTNb1PuOYFBLH0kwE704uWIWMGDN\\nbo8cjQPwegePCRguCvPh/5wa5J3uiq5gmJLG6bC/d1XYE+FJVtlnyzqzLMIryGKe\\ntIciw+wwkF413Q/YVbZ49vLUeCX9H8PHC4mZYGDWuvjFW1WTfkjK5bAH+oaTVM6h\\n350I5ZFloHmMA/QeRge5qFxXoEBMDGiXHHktzYZDXnliFOQNxzqwirA5lQQ6LRSS\\naQ==\\n=7rqi\\n-----END PGP SIGNATURE-----\",\n+      \"payload\": \"tree 16a7bb186833a67e9c2d84a58393503b85500ceb\\nparent 446ae69b9385e8d0f40aa9595f723d34383af2f7\\nauthor Krisztián Szűcs <szucs.krisztian@gmail.com> 1554465691 +0200\\ncommitter Krisztián Szűcs <szucs.krisztian@gmail.com> 1554465691 +0200\\n\\nadd recorded event requests\\n\"\n+    }\n+  },\n+  \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits/2705da2b616b98fa6010a25813c5a7a27456f71d\",\n+  \"html_url\": \"https://github.com/ursa-labs/ursabot/commit/2705da2b616b98fa6010a25813c5a7a27456f71d\",\n+  \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits/2705da2b616b98fa6010a25813c5a7a27456f71d/comments\",\n+  \"author\": {\n+    \"login\": \"kszucs\",\n+    \"id\": 961747,\n+    \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+    \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+    \"gravatar_id\": \"\",\n+    \"url\": \"https://api.github.com/users/kszucs\",\n+    \"html_url\": \"https://github.com/kszucs\",\n+    \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+    \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+    \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+    \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+    \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+    \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+    \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+    \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+    \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+    \"type\": \"User\",\n+    \"site_admin\": false\n+  },\n+  \"committer\": {\n+    \"login\": \"kszucs\",\n+    \"id\": 961747,\n+    \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+    \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+    \"gravatar_id\": \"\",\n+    \"url\": \"https://api.github.com/users/kszucs\",\n+    \"html_url\": \"https://github.com/kszucs\",\n+    \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+    \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+    \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+    \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+    \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+    \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+    \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+    \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+    \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+    \"type\": \"User\",\n+    \"site_admin\": false\n+  },\n+  \"parents\": [\n+    {\n+      \"sha\": \"446ae69b9385e8d0f40aa9595f723d34383af2f7\",\n+      \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits/446ae69b9385e8d0f40aa9595f723d34383af2f7\",\n+      \"html_url\": \"https://github.com/ursa-labs/ursabot/commit/446ae69b9385e8d0f40aa9595f723d34383af2f7\"\n+    }\n+  ],\n+  \"stats\": {\n+    \"total\": 1062,\n+    \"additions\": 1058,\n+    \"deletions\": 4\n+  },\n+  \"files\": [\n+    {\n+      \"sha\": \"dfae6eeaef384ae6180c6302a58b49e39982dc33\",\n+      \"filename\": \"ursabot/tests/fixtures/issue-comment-build-command.json\",\n+      \"status\": \"added\",\n+      \"additions\": 212,\n+      \"deletions\": 0,\n+      \"changes\": 212,\n+      \"blob_url\": \"https://github.com/ursa-labs/ursabot/blob/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-build-command.json\",\n+      \"raw_url\": \"https://github.com/ursa-labs/ursabot/raw/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-build-command.json\",\n+      \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-build-command.json?ref=2705da2b616b98fa6010a25813c5a7a27456f71d\",\n+      \"patch\": \"@@ -0,0 +1,212 @@\\n+{\\n+    \\\"action\\\": \\\"created\\\",\\n+    \\\"comment\\\": {\\n+        \\\"author_association\\\": \\\"NONE\\\",\\n+        \\\"body\\\": \\\"I've successfully started builds for this PR\\\",\\n+        \\\"created_at\\\": \\\"2019-04-05T11:55:44Z\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480248730\\\",\\n+        \\\"id\\\": 480248730,\\n+        \\\"issue_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26\\\",\\n+        \\\"node_id\\\": \\\"MDEyOklzc3VlQ29tbWVudDQ4MDI0ODczMA==\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-05T11:55:44Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480248730\\\",\\n+        \\\"user\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/49275095?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/ursabot/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/ursabot/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/ursabot/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/ursabot/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/ursabot\\\",\\n+            \\\"id\\\": 49275095,\\n+            \\\"login\\\": \\\"ursabot\\\",\\n+            \\\"node_id\\\": \\\"MDQ6VXNlcjQ5Mjc1MDk1\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/ursabot/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/ursabot/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/ursabot/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/ursabot/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/ursabot/subscriptions\\\",\\n+            \\\"type\\\": \\\"User\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/ursabot\\\"\\n+        }\\n+    },\\n+    \\\"issue\\\": {\\n+        \\\"assignee\\\": null,\\n+        \\\"assignees\\\": [],\\n+        \\\"author_association\\\": \\\"MEMBER\\\",\\n+        \\\"body\\\": \\\"\\\",\\n+        \\\"closed_at\\\": null,\\n+        \\\"comments\\\": 4,\\n+        \\\"comments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\\\",\\n+        \\\"created_at\\\": \\\"2019-04-05T11:22:15Z\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26/events\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26\\\",\\n+        \\\"id\\\": 429706959,\\n+        \\\"labels\\\": [],\\n+        \\\"labels_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}\\\",\\n+        \\\"locked\\\": false,\\n+        \\\"milestone\\\": null,\\n+        \\\"node_id\\\": \\\"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\\\",\\n+        \\\"number\\\": 26,\\n+        \\\"pull_request\\\": {\\n+            \\\"diff_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26.diff\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26\\\",\\n+            \\\"patch_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26.patch\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\\\"\\n+        },\\n+        \\\"repository_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot\\\",\\n+        \\\"state\\\": \\\"open\\\",\\n+        \\\"title\\\": \\\"Unittests for GithubHook\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-05T11:55:44Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26\\\",\\n+        \\\"user\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars1.githubusercontent.com/u/961747?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/kszucs/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/kszucs/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/kszucs/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/kszucs/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/kszucs\\\",\\n+            \\\"id\\\": 961747,\\n+            \\\"login\\\": \\\"kszucs\\\",\\n+            \\\"node_id\\\": \\\"MDQ6VXNlcjk2MTc0Nw==\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/kszucs/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/kszucs/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/kszucs/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/kszucs/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/kszucs/subscriptions\\\",\\n+            \\\"type\\\": \\\"User\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/kszucs\\\"\\n+        }\\n+    },\\n+    \\\"organization\\\": {\\n+        \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/46514972?v=4\\\",\\n+        \\\"description\\\": \\\"Innovation lab for open source data science tools, powered by Apache Arrow\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/orgs/ursa-labs/events\\\",\\n+        \\\"hooks_url\\\": \\\"https://api.github.com/orgs/ursa-labs/hooks\\\",\\n+        \\\"id\\\": 46514972,\\n+        \\\"issues_url\\\": \\\"https://api.github.com/orgs/ursa-labs/issues\\\",\\n+        \\\"login\\\": \\\"ursa-labs\\\",\\n+        \\\"members_url\\\": \\\"https://api.github.com/orgs/ursa-labs/members{/member}\\\",\\n+        \\\"node_id\\\": \\\"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\\\",\\n+        \\\"public_members_url\\\": \\\"https://api.github.com/orgs/ursa-labs/public_members{/member}\\\",\\n+        \\\"repos_url\\\": \\\"https://api.github.com/orgs/ursa-labs/repos\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/orgs/ursa-labs\\\"\\n+    },\\n+    \\\"repository\\\": {\\n+        \\\"archive_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\\\",\\n+        \\\"archived\\\": false,\\n+        \\\"assignees_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\\\",\\n+        \\\"blobs_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\\\",\\n+        \\\"branches_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\\\",\\n+        \\\"clone_url\\\": \\\"https://github.com/ursa-labs/ursabot.git\\\",\\n+        \\\"collaborators_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\\\",\\n+        \\\"comments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\\\",\\n+        \\\"commits_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\\\",\\n+        \\\"compare_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\\\",\\n+        \\\"contents_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\\\",\\n+        \\\"contributors_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/contributors\\\",\\n+        \\\"created_at\\\": \\\"2019-02-04T15:40:31Z\\\",\\n+        \\\"default_branch\\\": \\\"master\\\",\\n+        \\\"deployments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/deployments\\\",\\n+        \\\"description\\\": null,\\n+        \\\"disabled\\\": false,\\n+        \\\"downloads_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/downloads\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/events\\\",\\n+        \\\"fork\\\": false,\\n+        \\\"forks\\\": 0,\\n+        \\\"forks_count\\\": 0,\\n+        \\\"forks_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/forks\\\",\\n+        \\\"full_name\\\": \\\"ursa-labs/ursabot\\\",\\n+        \\\"git_commits_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\\\",\\n+        \\\"git_refs_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\\\",\\n+        \\\"git_tags_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\\\",\\n+        \\\"git_url\\\": \\\"git://github.com/ursa-labs/ursabot.git\\\",\\n+        \\\"has_downloads\\\": true,\\n+        \\\"has_issues\\\": true,\\n+        \\\"has_pages\\\": false,\\n+        \\\"has_projects\\\": true,\\n+        \\\"has_wiki\\\": true,\\n+        \\\"homepage\\\": null,\\n+        \\\"hooks_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/hooks\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot\\\",\\n+        \\\"id\\\": 169101701,\\n+        \\\"issue_comment_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\\\",\\n+        \\\"issue_events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\\\",\\n+        \\\"issues_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\\\",\\n+        \\\"keys_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\\\",\\n+        \\\"labels_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\\\",\\n+        \\\"language\\\": \\\"Jupyter Notebook\\\",\\n+        \\\"languages_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/languages\\\",\\n+        \\\"license\\\": null,\\n+        \\\"merges_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/merges\\\",\\n+        \\\"milestones_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\\\",\\n+        \\\"mirror_url\\\": null,\\n+        \\\"name\\\": \\\"ursabot\\\",\\n+        \\\"node_id\\\": \\\"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\\\",\\n+        \\\"notifications_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\\\",\\n+        \\\"open_issues\\\": 19,\\n+        \\\"open_issues_count\\\": 19,\\n+        \\\"owner\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/46514972?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/ursa-labs/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/ursa-labs/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/ursa-labs/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/ursa-labs/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/ursa-labs\\\",\\n+            \\\"id\\\": 46514972,\\n+            \\\"login\\\": \\\"ursa-labs\\\",\\n+            \\\"node_id\\\": \\\"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/ursa-labs/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/ursa-labs/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/ursa-labs/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/ursa-labs/subscriptions\\\",\\n+            \\\"type\\\": \\\"Organization\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/ursa-labs\\\"\\n+        },\\n+        \\\"private\\\": false,\\n+        \\\"pulls_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\\\",\\n+        \\\"pushed_at\\\": \\\"2019-04-05T11:22:16Z\\\",\\n+        \\\"releases_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\\\",\\n+        \\\"size\\\": 892,\\n+        \\\"ssh_url\\\": \\\"git@github.com:ursa-labs/ursabot.git\\\",\\n+        \\\"stargazers_count\\\": 1,\\n+        \\\"stargazers_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/stargazers\\\",\\n+        \\\"statuses_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\\\",\\n+        \\\"subscribers_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/subscribers\\\",\\n+        \\\"subscription_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/subscription\\\",\\n+        \\\"svn_url\\\": \\\"https://github.com/ursa-labs/ursabot\\\",\\n+        \\\"tags_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/tags\\\",\\n+        \\\"teams_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/teams\\\",\\n+        \\\"trees_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-04T17:49:10Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot\\\",\\n+        \\\"watchers\\\": 1,\\n+        \\\"watchers_count\\\": 1\\n+    },\\n+    \\\"sender\\\": {\\n+        \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/49275095?v=4\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/users/ursabot/events{/privacy}\\\",\\n+        \\\"followers_url\\\": \\\"https://api.github.com/users/ursabot/followers\\\",\\n+        \\\"following_url\\\": \\\"https://api.github.com/users/ursabot/following{/other_user}\\\",\\n+        \\\"gists_url\\\": \\\"https://api.github.com/users/ursabot/gists{/gist_id}\\\",\\n+        \\\"gravatar_id\\\": \\\"\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursabot\\\",\\n+        \\\"id\\\": 49275095,\\n+        \\\"login\\\": \\\"ursabot\\\",\\n+        \\\"node_id\\\": \\\"MDQ6VXNlcjQ5Mjc1MDk1\\\",\\n+        \\\"organizations_url\\\": \\\"https://api.github.com/users/ursabot/orgs\\\",\\n+        \\\"received_events_url\\\": \\\"https://api.github.com/users/ursabot/received_events\\\",\\n+        \\\"repos_url\\\": \\\"https://api.github.com/users/ursabot/repos\\\",\\n+        \\\"site_admin\\\": false,\\n+        \\\"starred_url\\\": \\\"https://api.github.com/users/ursabot/starred{/owner}{/repo}\\\",\\n+        \\\"subscriptions_url\\\": \\\"https://api.github.com/users/ursabot/subscriptions\\\",\\n+        \\\"type\\\": \\\"User\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/users/ursabot\\\"\\n+    }\\n+}\"\n+    },\n+    {\n+      \"sha\": \"7ef554e333327f0e62aa1fd76b4b17844a39adeb\",\n+      \"filename\": \"ursabot/tests/fixtures/issue-comment-by-ursabot.json\",\n+      \"status\": \"added\",\n+      \"additions\": 212,\n+      \"deletions\": 0,\n+      \"changes\": 212,\n+      \"blob_url\": \"https://github.com/ursa-labs/ursabot/blob/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-by-ursabot.json\",\n+      \"raw_url\": \"https://github.com/ursa-labs/ursabot/raw/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-by-ursabot.json\",\n+      \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-by-ursabot.json?ref=2705da2b616b98fa6010a25813c5a7a27456f71d\",\n+      \"patch\": \"@@ -0,0 +1,212 @@\\n+{\\n+    \\\"action\\\": \\\"created\\\",\\n+    \\\"comment\\\": {\\n+        \\\"author_association\\\": \\\"NONE\\\",\\n+        \\\"body\\\": \\\"Unknown command \\\\\\\"\\\\\\\"\\\",\\n+        \\\"created_at\\\": \\\"2019-04-05T11:35:47Z\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480243815\\\",\\n+        \\\"id\\\": 480243815,\\n+        \\\"issue_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26\\\",\\n+        \\\"node_id\\\": \\\"MDEyOklzc3VlQ29tbWVudDQ4MDI0MzgxNQ==\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-05T11:35:47Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480243815\\\",\\n+        \\\"user\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/49275095?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/ursabot/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/ursabot/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/ursabot/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/ursabot/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/ursabot\\\",\\n+            \\\"id\\\": 49275095,\\n+            \\\"login\\\": \\\"ursabot\\\",\\n+            \\\"node_id\\\": \\\"MDQ6VXNlcjQ5Mjc1MDk1\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/ursabot/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/ursabot/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/ursabot/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/ursabot/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/ursabot/subscriptions\\\",\\n+            \\\"type\\\": \\\"User\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/ursabot\\\"\\n+        }\\n+    },\\n+    \\\"issue\\\": {\\n+        \\\"assignee\\\": null,\\n+        \\\"assignees\\\": [],\\n+        \\\"author_association\\\": \\\"MEMBER\\\",\\n+        \\\"body\\\": \\\"\\\",\\n+        \\\"closed_at\\\": null,\\n+        \\\"comments\\\": 2,\\n+        \\\"comments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\\\",\\n+        \\\"created_at\\\": \\\"2019-04-05T11:22:15Z\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26/events\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26\\\",\\n+        \\\"id\\\": 429706959,\\n+        \\\"labels\\\": [],\\n+        \\\"labels_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}\\\",\\n+        \\\"locked\\\": false,\\n+        \\\"milestone\\\": null,\\n+        \\\"node_id\\\": \\\"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\\\",\\n+        \\\"number\\\": 26,\\n+        \\\"pull_request\\\": {\\n+            \\\"diff_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26.diff\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26\\\",\\n+            \\\"patch_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26.patch\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\\\"\\n+        },\\n+        \\\"repository_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot\\\",\\n+        \\\"state\\\": \\\"open\\\",\\n+        \\\"title\\\": \\\"Unittests for GithubHook\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-05T11:35:47Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26\\\",\\n+        \\\"user\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars1.githubusercontent.com/u/961747?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/kszucs/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/kszucs/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/kszucs/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/kszucs/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/kszucs\\\",\\n+            \\\"id\\\": 961747,\\n+            \\\"login\\\": \\\"kszucs\\\",\\n+            \\\"node_id\\\": \\\"MDQ6VXNlcjk2MTc0Nw==\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/kszucs/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/kszucs/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/kszucs/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/kszucs/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/kszucs/subscriptions\\\",\\n+            \\\"type\\\": \\\"User\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/kszucs\\\"\\n+        }\\n+    },\\n+    \\\"organization\\\": {\\n+        \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/46514972?v=4\\\",\\n+        \\\"description\\\": \\\"Innovation lab for open source data science tools, powered by Apache Arrow\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/orgs/ursa-labs/events\\\",\\n+        \\\"hooks_url\\\": \\\"https://api.github.com/orgs/ursa-labs/hooks\\\",\\n+        \\\"id\\\": 46514972,\\n+        \\\"issues_url\\\": \\\"https://api.github.com/orgs/ursa-labs/issues\\\",\\n+        \\\"login\\\": \\\"ursa-labs\\\",\\n+        \\\"members_url\\\": \\\"https://api.github.com/orgs/ursa-labs/members{/member}\\\",\\n+        \\\"node_id\\\": \\\"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\\\",\\n+        \\\"public_members_url\\\": \\\"https://api.github.com/orgs/ursa-labs/public_members{/member}\\\",\\n+        \\\"repos_url\\\": \\\"https://api.github.com/orgs/ursa-labs/repos\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/orgs/ursa-labs\\\"\\n+    },\\n+    \\\"repository\\\": {\\n+        \\\"archive_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\\\",\\n+        \\\"archived\\\": false,\\n+        \\\"assignees_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\\\",\\n+        \\\"blobs_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\\\",\\n+        \\\"branches_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\\\",\\n+        \\\"clone_url\\\": \\\"https://github.com/ursa-labs/ursabot.git\\\",\\n+        \\\"collaborators_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\\\",\\n+        \\\"comments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\\\",\\n+        \\\"commits_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\\\",\\n+        \\\"compare_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\\\",\\n+        \\\"contents_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\\\",\\n+        \\\"contributors_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/contributors\\\",\\n+        \\\"created_at\\\": \\\"2019-02-04T15:40:31Z\\\",\\n+        \\\"default_branch\\\": \\\"master\\\",\\n+        \\\"deployments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/deployments\\\",\\n+        \\\"description\\\": null,\\n+        \\\"disabled\\\": false,\\n+        \\\"downloads_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/downloads\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/events\\\",\\n+        \\\"fork\\\": false,\\n+        \\\"forks\\\": 0,\\n+        \\\"forks_count\\\": 0,\\n+        \\\"forks_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/forks\\\",\\n+        \\\"full_name\\\": \\\"ursa-labs/ursabot\\\",\\n+        \\\"git_commits_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\\\",\\n+        \\\"git_refs_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\\\",\\n+        \\\"git_tags_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\\\",\\n+        \\\"git_url\\\": \\\"git://github.com/ursa-labs/ursabot.git\\\",\\n+        \\\"has_downloads\\\": true,\\n+        \\\"has_issues\\\": true,\\n+        \\\"has_pages\\\": false,\\n+        \\\"has_projects\\\": true,\\n+        \\\"has_wiki\\\": true,\\n+        \\\"homepage\\\": null,\\n+        \\\"hooks_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/hooks\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot\\\",\\n+        \\\"id\\\": 169101701,\\n+        \\\"issue_comment_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\\\",\\n+        \\\"issue_events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\\\",\\n+        \\\"issues_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\\\",\\n+        \\\"keys_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\\\",\\n+        \\\"labels_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\\\",\\n+        \\\"language\\\": \\\"Jupyter Notebook\\\",\\n+        \\\"languages_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/languages\\\",\\n+        \\\"license\\\": null,\\n+        \\\"merges_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/merges\\\",\\n+        \\\"milestones_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\\\",\\n+        \\\"mirror_url\\\": null,\\n+        \\\"name\\\": \\\"ursabot\\\",\\n+        \\\"node_id\\\": \\\"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\\\",\\n+        \\\"notifications_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\\\",\\n+        \\\"open_issues\\\": 19,\\n+        \\\"open_issues_count\\\": 19,\\n+        \\\"owner\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/46514972?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/ursa-labs/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/ursa-labs/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/ursa-labs/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/ursa-labs/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/ursa-labs\\\",\\n+            \\\"id\\\": 46514972,\\n+            \\\"login\\\": \\\"ursa-labs\\\",\\n+            \\\"node_id\\\": \\\"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/ursa-labs/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/ursa-labs/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/ursa-labs/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/ursa-labs/subscriptions\\\",\\n+            \\\"type\\\": \\\"Organization\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/ursa-labs\\\"\\n+        },\\n+        \\\"private\\\": false,\\n+        \\\"pulls_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\\\",\\n+        \\\"pushed_at\\\": \\\"2019-04-05T11:22:16Z\\\",\\n+        \\\"releases_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\\\",\\n+        \\\"size\\\": 892,\\n+        \\\"ssh_url\\\": \\\"git@github.com:ursa-labs/ursabot.git\\\",\\n+        \\\"stargazers_count\\\": 1,\\n+        \\\"stargazers_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/stargazers\\\",\\n+        \\\"statuses_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\\\",\\n+        \\\"subscribers_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/subscribers\\\",\\n+        \\\"subscription_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/subscription\\\",\\n+        \\\"svn_url\\\": \\\"https://github.com/ursa-labs/ursabot\\\",\\n+        \\\"tags_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/tags\\\",\\n+        \\\"teams_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/teams\\\",\\n+        \\\"trees_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-04T17:49:10Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot\\\",\\n+        \\\"watchers\\\": 1,\\n+        \\\"watchers_count\\\": 1\\n+    },\\n+    \\\"sender\\\": {\\n+        \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/49275095?v=4\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/users/ursabot/events{/privacy}\\\",\\n+        \\\"followers_url\\\": \\\"https://api.github.com/users/ursabot/followers\\\",\\n+        \\\"following_url\\\": \\\"https://api.github.com/users/ursabot/following{/other_user}\\\",\\n+        \\\"gists_url\\\": \\\"https://api.github.com/users/ursabot/gists{/gist_id}\\\",\\n+        \\\"gravatar_id\\\": \\\"\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursabot\\\",\\n+        \\\"id\\\": 49275095,\\n+        \\\"login\\\": \\\"ursabot\\\",\\n+        \\\"node_id\\\": \\\"MDQ6VXNlcjQ5Mjc1MDk1\\\",\\n+        \\\"organizations_url\\\": \\\"https://api.github.com/users/ursabot/orgs\\\",\\n+        \\\"received_events_url\\\": \\\"https://api.github.com/users/ursabot/received_events\\\",\\n+        \\\"repos_url\\\": \\\"https://api.github.com/users/ursabot/repos\\\",\\n+        \\\"site_admin\\\": false,\\n+        \\\"starred_url\\\": \\\"https://api.github.com/users/ursabot/starred{/owner}{/repo}\\\",\\n+        \\\"subscriptions_url\\\": \\\"https://api.github.com/users/ursabot/subscriptions\\\",\\n+        \\\"type\\\": \\\"User\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/users/ursabot\\\"\\n+    }\\n+}\"\n+    },\n+    {\n+      \"sha\": \"a8082dbc91fdfe815b795e49ec10e49000771ef5\",\n+      \"filename\": \"ursabot/tests/fixtures/issue-comment-not-mentioning-ursabot.json\",\n+      \"status\": \"added\",\n+      \"additions\": 212,\n+      \"deletions\": 0,\n+      \"changes\": 212,\n+      \"blob_url\": \"https://github.com/ursa-labs/ursabot/blob/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-not-mentioning-ursabot.json\",\n+      \"raw_url\": \"https://github.com/ursa-labs/ursabot/raw/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-not-mentioning-ursabot.json\",\n+      \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-not-mentioning-ursabot.json?ref=2705da2b616b98fa6010a25813c5a7a27456f71d\",\n+      \"patch\": \"@@ -0,0 +1,212 @@\\n+{\\n+    \\\"action\\\": \\\"created\\\",\\n+    \\\"comment\\\": {\\n+        \\\"author_association\\\": \\\"MEMBER\\\",\\n+        \\\"body\\\": \\\"bear is no game\\\",\\n+        \\\"created_at\\\": \\\"2019-04-05T11:26:56Z\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480241727\\\",\\n+        \\\"id\\\": 480241727,\\n+        \\\"issue_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26\\\",\\n+        \\\"node_id\\\": \\\"MDEyOklzc3VlQ29tbWVudDQ4MDI0MTcyNw==\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-05T11:26:56Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480241727\\\",\\n+        \\\"user\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars1.githubusercontent.com/u/961747?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/kszucs/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/kszucs/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/kszucs/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/kszucs/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/kszucs\\\",\\n+            \\\"id\\\": 961747,\\n+            \\\"login\\\": \\\"kszucs\\\",\\n+            \\\"node_id\\\": \\\"MDQ6VXNlcjk2MTc0Nw==\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/kszucs/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/kszucs/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/kszucs/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/kszucs/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/kszucs/subscriptions\\\",\\n+            \\\"type\\\": \\\"User\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/kszucs\\\"\\n+        }\\n+    },\\n+    \\\"issue\\\": {\\n+        \\\"assignee\\\": null,\\n+        \\\"assignees\\\": [],\\n+        \\\"author_association\\\": \\\"MEMBER\\\",\\n+        \\\"body\\\": \\\"\\\",\\n+        \\\"closed_at\\\": null,\\n+        \\\"comments\\\": 0,\\n+        \\\"comments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\\\",\\n+        \\\"created_at\\\": \\\"2019-04-05T11:22:15Z\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26/events\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26\\\",\\n+        \\\"id\\\": 429706959,\\n+        \\\"labels\\\": [],\\n+        \\\"labels_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}\\\",\\n+        \\\"locked\\\": false,\\n+        \\\"milestone\\\": null,\\n+        \\\"node_id\\\": \\\"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\\\",\\n+        \\\"number\\\": 26,\\n+        \\\"pull_request\\\": {\\n+            \\\"diff_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26.diff\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26\\\",\\n+            \\\"patch_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26.patch\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\\\"\\n+        },\\n+        \\\"repository_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot\\\",\\n+        \\\"state\\\": \\\"open\\\",\\n+        \\\"title\\\": \\\"Unittests for GithubHook\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-05T11:26:56Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26\\\",\\n+        \\\"user\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars1.githubusercontent.com/u/961747?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/kszucs/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/kszucs/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/kszucs/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/kszucs/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/kszucs\\\",\\n+            \\\"id\\\": 961747,\\n+            \\\"login\\\": \\\"kszucs\\\",\\n+            \\\"node_id\\\": \\\"MDQ6VXNlcjk2MTc0Nw==\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/kszucs/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/kszucs/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/kszucs/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/kszucs/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/kszucs/subscriptions\\\",\\n+            \\\"type\\\": \\\"User\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/kszucs\\\"\\n+        }\\n+    },\\n+    \\\"organization\\\": {\\n+        \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/46514972?v=4\\\",\\n+        \\\"description\\\": \\\"Innovation lab for open source data science tools, powered by Apache Arrow\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/orgs/ursa-labs/events\\\",\\n+        \\\"hooks_url\\\": \\\"https://api.github.com/orgs/ursa-labs/hooks\\\",\\n+        \\\"id\\\": 46514972,\\n+        \\\"issues_url\\\": \\\"https://api.github.com/orgs/ursa-labs/issues\\\",\\n+        \\\"login\\\": \\\"ursa-labs\\\",\\n+        \\\"members_url\\\": \\\"https://api.github.com/orgs/ursa-labs/members{/member}\\\",\\n+        \\\"node_id\\\": \\\"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\\\",\\n+        \\\"public_members_url\\\": \\\"https://api.github.com/orgs/ursa-labs/public_members{/member}\\\",\\n+        \\\"repos_url\\\": \\\"https://api.github.com/orgs/ursa-labs/repos\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/orgs/ursa-labs\\\"\\n+    },\\n+    \\\"repository\\\": {\\n+        \\\"archive_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\\\",\\n+        \\\"archived\\\": false,\\n+        \\\"assignees_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\\\",\\n+        \\\"blobs_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\\\",\\n+        \\\"branches_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\\\",\\n+        \\\"clone_url\\\": \\\"https://github.com/ursa-labs/ursabot.git\\\",\\n+        \\\"collaborators_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\\\",\\n+        \\\"comments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\\\",\\n+        \\\"commits_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\\\",\\n+        \\\"compare_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\\\",\\n+        \\\"contents_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\\\",\\n+        \\\"contributors_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/contributors\\\",\\n+        \\\"created_at\\\": \\\"2019-02-04T15:40:31Z\\\",\\n+        \\\"default_branch\\\": \\\"master\\\",\\n+        \\\"deployments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/deployments\\\",\\n+        \\\"description\\\": null,\\n+        \\\"disabled\\\": false,\\n+        \\\"downloads_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/downloads\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/events\\\",\\n+        \\\"fork\\\": false,\\n+        \\\"forks\\\": 0,\\n+        \\\"forks_count\\\": 0,\\n+        \\\"forks_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/forks\\\",\\n+        \\\"full_name\\\": \\\"ursa-labs/ursabot\\\",\\n+        \\\"git_commits_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\\\",\\n+        \\\"git_refs_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\\\",\\n+        \\\"git_tags_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\\\",\\n+        \\\"git_url\\\": \\\"git://github.com/ursa-labs/ursabot.git\\\",\\n+        \\\"has_downloads\\\": true,\\n+        \\\"has_issues\\\": true,\\n+        \\\"has_pages\\\": false,\\n+        \\\"has_projects\\\": true,\\n+        \\\"has_wiki\\\": true,\\n+        \\\"homepage\\\": null,\\n+        \\\"hooks_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/hooks\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot\\\",\\n+        \\\"id\\\": 169101701,\\n+        \\\"issue_comment_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\\\",\\n+        \\\"issue_events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\\\",\\n+        \\\"issues_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\\\",\\n+        \\\"keys_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\\\",\\n+        \\\"labels_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\\\",\\n+        \\\"language\\\": \\\"Jupyter Notebook\\\",\\n+        \\\"languages_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/languages\\\",\\n+        \\\"license\\\": null,\\n+        \\\"merges_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/merges\\\",\\n+        \\\"milestones_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\\\",\\n+        \\\"mirror_url\\\": null,\\n+        \\\"name\\\": \\\"ursabot\\\",\\n+        \\\"node_id\\\": \\\"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\\\",\\n+        \\\"notifications_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\\\",\\n+        \\\"open_issues\\\": 19,\\n+        \\\"open_issues_count\\\": 19,\\n+        \\\"owner\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/46514972?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/ursa-labs/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/ursa-labs/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/ursa-labs/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/ursa-labs/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/ursa-labs\\\",\\n+            \\\"id\\\": 46514972,\\n+            \\\"login\\\": \\\"ursa-labs\\\",\\n+            \\\"node_id\\\": \\\"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/ursa-labs/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/ursa-labs/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/ursa-labs/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/ursa-labs/subscriptions\\\",\\n+            \\\"type\\\": \\\"Organization\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/ursa-labs\\\"\\n+        },\\n+        \\\"private\\\": false,\\n+        \\\"pulls_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\\\",\\n+        \\\"pushed_at\\\": \\\"2019-04-05T11:22:16Z\\\",\\n+        \\\"releases_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\\\",\\n+        \\\"size\\\": 892,\\n+        \\\"ssh_url\\\": \\\"git@github.com:ursa-labs/ursabot.git\\\",\\n+        \\\"stargazers_count\\\": 1,\\n+        \\\"stargazers_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/stargazers\\\",\\n+        \\\"statuses_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\\\",\\n+        \\\"subscribers_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/subscribers\\\",\\n+        \\\"subscription_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/subscription\\\",\\n+        \\\"svn_url\\\": \\\"https://github.com/ursa-labs/ursabot\\\",\\n+        \\\"tags_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/tags\\\",\\n+        \\\"teams_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/teams\\\",\\n+        \\\"trees_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-04T17:49:10Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot\\\",\\n+        \\\"watchers\\\": 1,\\n+        \\\"watchers_count\\\": 1\\n+    },\\n+    \\\"sender\\\": {\\n+        \\\"avatar_url\\\": \\\"https://avatars1.githubusercontent.com/u/961747?v=4\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/users/kszucs/events{/privacy}\\\",\\n+        \\\"followers_url\\\": \\\"https://api.github.com/users/kszucs/followers\\\",\\n+        \\\"following_url\\\": \\\"https://api.github.com/users/kszucs/following{/other_user}\\\",\\n+        \\\"gists_url\\\": \\\"https://api.github.com/users/kszucs/gists{/gist_id}\\\",\\n+        \\\"gravatar_id\\\": \\\"\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/kszucs\\\",\\n+        \\\"id\\\": 961747,\\n+        \\\"login\\\": \\\"kszucs\\\",\\n+        \\\"node_id\\\": \\\"MDQ6VXNlcjk2MTc0Nw==\\\",\\n+        \\\"organizations_url\\\": \\\"https://api.github.com/users/kszucs/orgs\\\",\\n+        \\\"received_events_url\\\": \\\"https://api.github.com/users/kszucs/received_events\\\",\\n+        \\\"repos_url\\\": \\\"https://api.github.com/users/kszucs/repos\\\",\\n+        \\\"site_admin\\\": false,\\n+        \\\"starred_url\\\": \\\"https://api.github.com/users/kszucs/starred{/owner}{/repo}\\\",\\n+        \\\"subscriptions_url\\\": \\\"https://api.github.com/users/kszucs/subscriptions\\\",\\n+        \\\"type\\\": \\\"User\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/users/kszucs\\\"\\n+    }\\n+}\"\n+    },\n+    {\n+      \"sha\": \"2770e29ba9086394455315e590c0b433d08e437e\",\n+      \"filename\": \"ursabot/tests/fixtures/issue-comment-with-empty-command.json\",\n+      \"status\": \"added\",\n+      \"additions\": 212,\n+      \"deletions\": 0,\n+      \"changes\": 212,\n+      \"blob_url\": \"https://github.com/ursa-labs/ursabot/blob/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-with-empty-command.json\",\n+      \"raw_url\": \"https://github.com/ursa-labs/ursabot/raw/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-with-empty-command.json\",\n+      \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-with-empty-command.json?ref=2705da2b616b98fa6010a25813c5a7a27456f71d\",\n+      \"patch\": \"@@ -0,0 +1,212 @@\\n+{\\n+    \\\"action\\\": \\\"created\\\",\\n+    \\\"comment\\\": {\\n+        \\\"author_association\\\": \\\"MEMBER\\\",\\n+        \\\"body\\\": \\\"@ursabot \\\",\\n+        \\\"created_at\\\": \\\"2019-04-05T11:35:46Z\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26#issuecomment-480243811\\\",\\n+        \\\"id\\\": 480243811,\\n+        \\\"issue_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26\\\",\\n+        \\\"node_id\\\": \\\"MDEyOklzc3VlQ29tbWVudDQ4MDI0MzgxMQ==\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-05T11:35:46Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480243811\\\",\\n+        \\\"user\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars1.githubusercontent.com/u/961747?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/kszucs/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/kszucs/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/kszucs/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/kszucs/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/kszucs\\\",\\n+            \\\"id\\\": 961747,\\n+            \\\"login\\\": \\\"kszucs\\\",\\n+            \\\"node_id\\\": \\\"MDQ6VXNlcjk2MTc0Nw==\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/kszucs/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/kszucs/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/kszucs/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/kszucs/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/kszucs/subscriptions\\\",\\n+            \\\"type\\\": \\\"User\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/kszucs\\\"\\n+        }\\n+    },\\n+    \\\"issue\\\": {\\n+        \\\"assignee\\\": null,\\n+        \\\"assignees\\\": [],\\n+        \\\"author_association\\\": \\\"MEMBER\\\",\\n+        \\\"body\\\": \\\"\\\",\\n+        \\\"closed_at\\\": null,\\n+        \\\"comments\\\": 1,\\n+        \\\"comments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\\\",\\n+        \\\"created_at\\\": \\\"2019-04-05T11:22:15Z\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26/events\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26\\\",\\n+        \\\"id\\\": 429706959,\\n+        \\\"labels\\\": [],\\n+        \\\"labels_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26/labels{/name}\\\",\\n+        \\\"locked\\\": false,\\n+        \\\"milestone\\\": null,\\n+        \\\"node_id\\\": \\\"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\\\",\\n+        \\\"number\\\": 26,\\n+        \\\"pull_request\\\": {\\n+            \\\"diff_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26.diff\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26\\\",\\n+            \\\"patch_url\\\": \\\"https://github.com/ursa-labs/ursabot/pull/26.patch\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\\\"\\n+        },\\n+        \\\"repository_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot\\\",\\n+        \\\"state\\\": \\\"open\\\",\\n+        \\\"title\\\": \\\"Unittests for GithubHook\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-05T11:35:46Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/26\\\",\\n+        \\\"user\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars1.githubusercontent.com/u/961747?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/kszucs/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/kszucs/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/kszucs/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/kszucs/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/kszucs\\\",\\n+            \\\"id\\\": 961747,\\n+            \\\"login\\\": \\\"kszucs\\\",\\n+            \\\"node_id\\\": \\\"MDQ6VXNlcjk2MTc0Nw==\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/kszucs/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/kszucs/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/kszucs/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/kszucs/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/kszucs/subscriptions\\\",\\n+            \\\"type\\\": \\\"User\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/kszucs\\\"\\n+        }\\n+    },\\n+    \\\"organization\\\": {\\n+        \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/46514972?v=4\\\",\\n+        \\\"description\\\": \\\"Innovation lab for open source data science tools, powered by Apache Arrow\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/orgs/ursa-labs/events\\\",\\n+        \\\"hooks_url\\\": \\\"https://api.github.com/orgs/ursa-labs/hooks\\\",\\n+        \\\"id\\\": 46514972,\\n+        \\\"issues_url\\\": \\\"https://api.github.com/orgs/ursa-labs/issues\\\",\\n+        \\\"login\\\": \\\"ursa-labs\\\",\\n+        \\\"members_url\\\": \\\"https://api.github.com/orgs/ursa-labs/members{/member}\\\",\\n+        \\\"node_id\\\": \\\"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\\\",\\n+        \\\"public_members_url\\\": \\\"https://api.github.com/orgs/ursa-labs/public_members{/member}\\\",\\n+        \\\"repos_url\\\": \\\"https://api.github.com/orgs/ursa-labs/repos\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/orgs/ursa-labs\\\"\\n+    },\\n+    \\\"repository\\\": {\\n+        \\\"archive_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\\\",\\n+        \\\"archived\\\": false,\\n+        \\\"assignees_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\\\",\\n+        \\\"blobs_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\\\",\\n+        \\\"branches_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\\\",\\n+        \\\"clone_url\\\": \\\"https://github.com/ursa-labs/ursabot.git\\\",\\n+        \\\"collaborators_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\\\",\\n+        \\\"comments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\\\",\\n+        \\\"commits_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\\\",\\n+        \\\"compare_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\\\",\\n+        \\\"contents_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\\\",\\n+        \\\"contributors_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/contributors\\\",\\n+        \\\"created_at\\\": \\\"2019-02-04T15:40:31Z\\\",\\n+        \\\"default_branch\\\": \\\"master\\\",\\n+        \\\"deployments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/deployments\\\",\\n+        \\\"description\\\": null,\\n+        \\\"disabled\\\": false,\\n+        \\\"downloads_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/downloads\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/events\\\",\\n+        \\\"fork\\\": false,\\n+        \\\"forks\\\": 0,\\n+        \\\"forks_count\\\": 0,\\n+        \\\"forks_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/forks\\\",\\n+        \\\"full_name\\\": \\\"ursa-labs/ursabot\\\",\\n+        \\\"git_commits_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\\\",\\n+        \\\"git_refs_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\\\",\\n+        \\\"git_tags_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\\\",\\n+        \\\"git_url\\\": \\\"git://github.com/ursa-labs/ursabot.git\\\",\\n+        \\\"has_downloads\\\": true,\\n+        \\\"has_issues\\\": true,\\n+        \\\"has_pages\\\": false,\\n+        \\\"has_projects\\\": true,\\n+        \\\"has_wiki\\\": true,\\n+        \\\"homepage\\\": null,\\n+        \\\"hooks_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/hooks\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot\\\",\\n+        \\\"id\\\": 169101701,\\n+        \\\"issue_comment_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\\\",\\n+        \\\"issue_events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\\\",\\n+        \\\"issues_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\\\",\\n+        \\\"keys_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\\\",\\n+        \\\"labels_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\\\",\\n+        \\\"language\\\": \\\"Jupyter Notebook\\\",\\n+        \\\"languages_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/languages\\\",\\n+        \\\"license\\\": null,\\n+        \\\"merges_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/merges\\\",\\n+        \\\"milestones_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\\\",\\n+        \\\"mirror_url\\\": null,\\n+        \\\"name\\\": \\\"ursabot\\\",\\n+        \\\"node_id\\\": \\\"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\\\",\\n+        \\\"notifications_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\\\",\\n+        \\\"open_issues\\\": 19,\\n+        \\\"open_issues_count\\\": 19,\\n+        \\\"owner\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/46514972?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/ursa-labs/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/ursa-labs/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/ursa-labs/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/ursa-labs/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/ursa-labs\\\",\\n+            \\\"id\\\": 46514972,\\n+            \\\"login\\\": \\\"ursa-labs\\\",\\n+            \\\"node_id\\\": \\\"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/ursa-labs/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/ursa-labs/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/ursa-labs/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/ursa-labs/subscriptions\\\",\\n+            \\\"type\\\": \\\"Organization\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/ursa-labs\\\"\\n+        },\\n+        \\\"private\\\": false,\\n+        \\\"pulls_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\\\",\\n+        \\\"pushed_at\\\": \\\"2019-04-05T11:22:16Z\\\",\\n+        \\\"releases_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\\\",\\n+        \\\"size\\\": 892,\\n+        \\\"ssh_url\\\": \\\"git@github.com:ursa-labs/ursabot.git\\\",\\n+        \\\"stargazers_count\\\": 1,\\n+        \\\"stargazers_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/stargazers\\\",\\n+        \\\"statuses_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\\\",\\n+        \\\"subscribers_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/subscribers\\\",\\n+        \\\"subscription_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/subscription\\\",\\n+        \\\"svn_url\\\": \\\"https://github.com/ursa-labs/ursabot\\\",\\n+        \\\"tags_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/tags\\\",\\n+        \\\"teams_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/teams\\\",\\n+        \\\"trees_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-04T17:49:10Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot\\\",\\n+        \\\"watchers\\\": 1,\\n+        \\\"watchers_count\\\": 1\\n+    },\\n+    \\\"sender\\\": {\\n+        \\\"avatar_url\\\": \\\"https://avatars1.githubusercontent.com/u/961747?v=4\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/users/kszucs/events{/privacy}\\\",\\n+        \\\"followers_url\\\": \\\"https://api.github.com/users/kszucs/followers\\\",\\n+        \\\"following_url\\\": \\\"https://api.github.com/users/kszucs/following{/other_user}\\\",\\n+        \\\"gists_url\\\": \\\"https://api.github.com/users/kszucs/gists{/gist_id}\\\",\\n+        \\\"gravatar_id\\\": \\\"\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/kszucs\\\",\\n+        \\\"id\\\": 961747,\\n+        \\\"login\\\": \\\"kszucs\\\",\\n+        \\\"node_id\\\": \\\"MDQ6VXNlcjk2MTc0Nw==\\\",\\n+        \\\"organizations_url\\\": \\\"https://api.github.com/users/kszucs/orgs\\\",\\n+        \\\"received_events_url\\\": \\\"https://api.github.com/users/kszucs/received_events\\\",\\n+        \\\"repos_url\\\": \\\"https://api.github.com/users/kszucs/repos\\\",\\n+        \\\"site_admin\\\": false,\\n+        \\\"starred_url\\\": \\\"https://api.github.com/users/kszucs/starred{/owner}{/repo}\\\",\\n+        \\\"subscriptions_url\\\": \\\"https://api.github.com/users/kszucs/subscriptions\\\",\\n+        \\\"type\\\": \\\"User\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/users/kszucs\\\"\\n+    }\\n+}\"\n+    },\n+    {\n+      \"sha\": \"80ff46510a2f39ae60f7c3a98e5fdaef8e688784\",\n+      \"filename\": \"ursabot/tests/fixtures/issue-comment-without-pull-request.json\",\n+      \"status\": \"added\",\n+      \"additions\": 206,\n+      \"deletions\": 0,\n+      \"changes\": 206,\n+      \"blob_url\": \"https://github.com/ursa-labs/ursabot/blob/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-without-pull-request.json\",\n+      \"raw_url\": \"https://github.com/ursa-labs/ursabot/raw/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/fixtures/issue-comment-without-pull-request.json\",\n+      \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/issue-comment-without-pull-request.json?ref=2705da2b616b98fa6010a25813c5a7a27456f71d\",\n+      \"patch\": \"@@ -0,0 +1,206 @@\\n+{\\n+    \\\"action\\\": \\\"created\\\",\\n+    \\\"comment\\\": {\\n+        \\\"author_association\\\": \\\"NONE\\\",\\n+        \\\"body\\\": \\\"Ursabot only listens to pull request comments!\\\",\\n+        \\\"created_at\\\": \\\"2019-04-05T11:53:43Z\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/issues/19#issuecomment-480248217\\\",\\n+        \\\"id\\\": 480248217,\\n+        \\\"issue_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/19\\\",\\n+        \\\"node_id\\\": \\\"MDEyOklzc3VlQ29tbWVudDQ4MDI0ODIxNw==\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-05T11:53:43Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/comments/480248217\\\",\\n+        \\\"user\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/49275095?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/ursabot/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/ursabot/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/ursabot/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/ursabot/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/ursabot\\\",\\n+            \\\"id\\\": 49275095,\\n+            \\\"login\\\": \\\"ursabot\\\",\\n+            \\\"node_id\\\": \\\"MDQ6VXNlcjQ5Mjc1MDk1\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/ursabot/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/ursabot/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/ursabot/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/ursabot/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/ursabot/subscriptions\\\",\\n+            \\\"type\\\": \\\"User\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/ursabot\\\"\\n+        }\\n+    },\\n+    \\\"issue\\\": {\\n+        \\\"assignee\\\": null,\\n+        \\\"assignees\\\": [],\\n+        \\\"author_association\\\": \\\"MEMBER\\\",\\n+        \\\"body\\\": \\\"\\\",\\n+        \\\"closed_at\\\": null,\\n+        \\\"comments\\\": 4,\\n+        \\\"comments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/19/comments\\\",\\n+        \\\"created_at\\\": \\\"2019-04-02T09:56:41Z\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/19/events\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot/issues/19\\\",\\n+        \\\"id\\\": 428131685,\\n+        \\\"labels\\\": [],\\n+        \\\"labels_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/19/labels{/name}\\\",\\n+        \\\"locked\\\": false,\\n+        \\\"milestone\\\": null,\\n+        \\\"node_id\\\": \\\"MDU6SXNzdWU0MjgxMzE2ODU=\\\",\\n+        \\\"number\\\": 19,\\n+        \\\"repository_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot\\\",\\n+        \\\"state\\\": \\\"open\\\",\\n+        \\\"title\\\": \\\"Build ursabot itself via ursabot\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-05T11:53:43Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/19\\\",\\n+        \\\"user\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars1.githubusercontent.com/u/961747?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/kszucs/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/kszucs/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/kszucs/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/kszucs/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/kszucs\\\",\\n+            \\\"id\\\": 961747,\\n+            \\\"login\\\": \\\"kszucs\\\",\\n+            \\\"node_id\\\": \\\"MDQ6VXNlcjk2MTc0Nw==\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/kszucs/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/kszucs/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/kszucs/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/kszucs/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/kszucs/subscriptions\\\",\\n+            \\\"type\\\": \\\"User\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/kszucs\\\"\\n+        }\\n+    },\\n+    \\\"organization\\\": {\\n+        \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/46514972?v=4\\\",\\n+        \\\"description\\\": \\\"Innovation lab for open source data science tools, powered by Apache Arrow\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/orgs/ursa-labs/events\\\",\\n+        \\\"hooks_url\\\": \\\"https://api.github.com/orgs/ursa-labs/hooks\\\",\\n+        \\\"id\\\": 46514972,\\n+        \\\"issues_url\\\": \\\"https://api.github.com/orgs/ursa-labs/issues\\\",\\n+        \\\"login\\\": \\\"ursa-labs\\\",\\n+        \\\"members_url\\\": \\\"https://api.github.com/orgs/ursa-labs/members{/member}\\\",\\n+        \\\"node_id\\\": \\\"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\\\",\\n+        \\\"public_members_url\\\": \\\"https://api.github.com/orgs/ursa-labs/public_members{/member}\\\",\\n+        \\\"repos_url\\\": \\\"https://api.github.com/orgs/ursa-labs/repos\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/orgs/ursa-labs\\\"\\n+    },\\n+    \\\"repository\\\": {\\n+        \\\"archive_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\\\",\\n+        \\\"archived\\\": false,\\n+        \\\"assignees_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\\\",\\n+        \\\"blobs_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\\\",\\n+        \\\"branches_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\\\",\\n+        \\\"clone_url\\\": \\\"https://github.com/ursa-labs/ursabot.git\\\",\\n+        \\\"collaborators_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\\\",\\n+        \\\"comments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\\\",\\n+        \\\"commits_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\\\",\\n+        \\\"compare_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\\\",\\n+        \\\"contents_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\\\",\\n+        \\\"contributors_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/contributors\\\",\\n+        \\\"created_at\\\": \\\"2019-02-04T15:40:31Z\\\",\\n+        \\\"default_branch\\\": \\\"master\\\",\\n+        \\\"deployments_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/deployments\\\",\\n+        \\\"description\\\": null,\\n+        \\\"disabled\\\": false,\\n+        \\\"downloads_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/downloads\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/events\\\",\\n+        \\\"fork\\\": false,\\n+        \\\"forks\\\": 0,\\n+        \\\"forks_count\\\": 0,\\n+        \\\"forks_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/forks\\\",\\n+        \\\"full_name\\\": \\\"ursa-labs/ursabot\\\",\\n+        \\\"git_commits_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\\\",\\n+        \\\"git_refs_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\\\",\\n+        \\\"git_tags_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\\\",\\n+        \\\"git_url\\\": \\\"git://github.com/ursa-labs/ursabot.git\\\",\\n+        \\\"has_downloads\\\": true,\\n+        \\\"has_issues\\\": true,\\n+        \\\"has_pages\\\": false,\\n+        \\\"has_projects\\\": true,\\n+        \\\"has_wiki\\\": true,\\n+        \\\"homepage\\\": null,\\n+        \\\"hooks_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/hooks\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursa-labs/ursabot\\\",\\n+        \\\"id\\\": 169101701,\\n+        \\\"issue_comment_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\\\",\\n+        \\\"issue_events_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\\\",\\n+        \\\"issues_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\\\",\\n+        \\\"keys_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\\\",\\n+        \\\"labels_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\\\",\\n+        \\\"language\\\": \\\"Jupyter Notebook\\\",\\n+        \\\"languages_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/languages\\\",\\n+        \\\"license\\\": null,\\n+        \\\"merges_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/merges\\\",\\n+        \\\"milestones_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\\\",\\n+        \\\"mirror_url\\\": null,\\n+        \\\"name\\\": \\\"ursabot\\\",\\n+        \\\"node_id\\\": \\\"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\\\",\\n+        \\\"notifications_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\\\",\\n+        \\\"open_issues\\\": 19,\\n+        \\\"open_issues_count\\\": 19,\\n+        \\\"owner\\\": {\\n+            \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/46514972?v=4\\\",\\n+            \\\"events_url\\\": \\\"https://api.github.com/users/ursa-labs/events{/privacy}\\\",\\n+            \\\"followers_url\\\": \\\"https://api.github.com/users/ursa-labs/followers\\\",\\n+            \\\"following_url\\\": \\\"https://api.github.com/users/ursa-labs/following{/other_user}\\\",\\n+            \\\"gists_url\\\": \\\"https://api.github.com/users/ursa-labs/gists{/gist_id}\\\",\\n+            \\\"gravatar_id\\\": \\\"\\\",\\n+            \\\"html_url\\\": \\\"https://github.com/ursa-labs\\\",\\n+            \\\"id\\\": 46514972,\\n+            \\\"login\\\": \\\"ursa-labs\\\",\\n+            \\\"node_id\\\": \\\"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\\\",\\n+            \\\"organizations_url\\\": \\\"https://api.github.com/users/ursa-labs/orgs\\\",\\n+            \\\"received_events_url\\\": \\\"https://api.github.com/users/ursa-labs/received_events\\\",\\n+            \\\"repos_url\\\": \\\"https://api.github.com/users/ursa-labs/repos\\\",\\n+            \\\"site_admin\\\": false,\\n+            \\\"starred_url\\\": \\\"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\\\",\\n+            \\\"subscriptions_url\\\": \\\"https://api.github.com/users/ursa-labs/subscriptions\\\",\\n+            \\\"type\\\": \\\"Organization\\\",\\n+            \\\"url\\\": \\\"https://api.github.com/users/ursa-labs\\\"\\n+        },\\n+        \\\"private\\\": false,\\n+        \\\"pulls_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\\\",\\n+        \\\"pushed_at\\\": \\\"2019-04-05T11:22:16Z\\\",\\n+        \\\"releases_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\\\",\\n+        \\\"size\\\": 892,\\n+        \\\"ssh_url\\\": \\\"git@github.com:ursa-labs/ursabot.git\\\",\\n+        \\\"stargazers_count\\\": 1,\\n+        \\\"stargazers_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/stargazers\\\",\\n+        \\\"statuses_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\\\",\\n+        \\\"subscribers_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/subscribers\\\",\\n+        \\\"subscription_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/subscription\\\",\\n+        \\\"svn_url\\\": \\\"https://github.com/ursa-labs/ursabot\\\",\\n+        \\\"tags_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/tags\\\",\\n+        \\\"teams_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/teams\\\",\\n+        \\\"trees_url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\\\",\\n+        \\\"updated_at\\\": \\\"2019-04-04T17:49:10Z\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/repos/ursa-labs/ursabot\\\",\\n+        \\\"watchers\\\": 1,\\n+        \\\"watchers_count\\\": 1\\n+    },\\n+    \\\"sender\\\": {\\n+        \\\"avatar_url\\\": \\\"https://avatars2.githubusercontent.com/u/49275095?v=4\\\",\\n+        \\\"events_url\\\": \\\"https://api.github.com/users/ursabot/events{/privacy}\\\",\\n+        \\\"followers_url\\\": \\\"https://api.github.com/users/ursabot/followers\\\",\\n+        \\\"following_url\\\": \\\"https://api.github.com/users/ursabot/following{/other_user}\\\",\\n+        \\\"gists_url\\\": \\\"https://api.github.com/users/ursabot/gists{/gist_id}\\\",\\n+        \\\"gravatar_id\\\": \\\"\\\",\\n+        \\\"html_url\\\": \\\"https://github.com/ursabot\\\",\\n+        \\\"id\\\": 49275095,\\n+        \\\"login\\\": \\\"ursabot\\\",\\n+        \\\"node_id\\\": \\\"MDQ6VXNlcjQ5Mjc1MDk1\\\",\\n+        \\\"organizations_url\\\": \\\"https://api.github.com/users/ursabot/orgs\\\",\\n+        \\\"received_events_url\\\": \\\"https://api.github.com/users/ursabot/received_events\\\",\\n+        \\\"repos_url\\\": \\\"https://api.github.com/users/ursabot/repos\\\",\\n+        \\\"site_admin\\\": false,\\n+        \\\"starred_url\\\": \\\"https://api.github.com/users/ursabot/starred{/owner}{/repo}\\\",\\n+        \\\"subscriptions_url\\\": \\\"https://api.github.com/users/ursabot/subscriptions\\\",\\n+        \\\"type\\\": \\\"User\\\",\\n+        \\\"url\\\": \\\"https://api.github.com/users/ursabot\\\"\\n+    }\\n+}\"\n+    },\n+    {\n+      \"sha\": \"c738bb0eb54c87ba0f23e97e827d77c2be74d0b6\",\n+      \"filename\": \"ursabot/tests/test_hooks.py\",\n+      \"status\": \"modified\",\n+      \"additions\": 4,\n+      \"deletions\": 4,\n+      \"changes\": 8,\n+      \"blob_url\": \"https://github.com/ursa-labs/ursabot/blob/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/test_hooks.py\",\n+      \"raw_url\": \"https://github.com/ursa-labs/ursabot/raw/2705da2b616b98fa6010a25813c5a7a27456f71d/ursabot/tests/test_hooks.py\",\n+      \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/test_hooks.py?ref=2705da2b616b98fa6010a25813c5a7a27456f71d\",\n+      \"patch\": \"@@ -54,7 +54,7 @@ class TestGithubHook(ChangeHookTestCase):\\n         await self.request('ping', {})\\n         assert len(self.hook.master.data.updates.changesAdded) == 0\\n \\n-    @ensure_deferred\\n-    async def test_issue_comment(self):\\n-        payload = {}\\n-        await self.request('issue_comment', payload)\\n+    # @ensure_deferred\\n+    # async def test_issue_comment(self):\\n+    #     payload = {}\\n+    #     await self.request('issue_comment', payload)\"\n+    }\n+  ]\n+}"
+  },
+  {
+    "sha": "ad061d7244b917e6ea3853698dc3bc2a8c9c6857",
+    "filename": "ursabot/tests/fixtures/pull-request-26.json",
+    "status": "added",
+    "additions": 335,
+    "deletions": 0,
+    "changes": 335,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/pull-request-26.json",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/fixtures/pull-request-26.json",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/fixtures/pull-request-26.json?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -0,0 +1,335 @@\n+{\n+  \"url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\",\n+  \"id\": 267785552,\n+  \"node_id\": \"MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy\",\n+  \"html_url\": \"https://github.com/ursa-labs/ursabot/pull/26\",\n+  \"diff_url\": \"https://github.com/ursa-labs/ursabot/pull/26.diff\",\n+  \"patch_url\": \"https://github.com/ursa-labs/ursabot/pull/26.patch\",\n+  \"issue_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\",\n+  \"number\": 26,\n+  \"state\": \"open\",\n+  \"locked\": false,\n+  \"title\": \"Unittests for GithubHook\",\n+  \"user\": {\n+    \"login\": \"kszucs\",\n+    \"id\": 961747,\n+    \"node_id\": \"MDQ6VXNlcjk2MTc0Nw==\",\n+    \"avatar_url\": \"https://avatars1.githubusercontent.com/u/961747?v=4\",\n+    \"gravatar_id\": \"\",\n+    \"url\": \"https://api.github.com/users/kszucs\",\n+    \"html_url\": \"https://github.com/kszucs\",\n+    \"followers_url\": \"https://api.github.com/users/kszucs/followers\",\n+    \"following_url\": \"https://api.github.com/users/kszucs/following{/other_user}\",\n+    \"gists_url\": \"https://api.github.com/users/kszucs/gists{/gist_id}\",\n+    \"starred_url\": \"https://api.github.com/users/kszucs/starred{/owner}{/repo}\",\n+    \"subscriptions_url\": \"https://api.github.com/users/kszucs/subscriptions\",\n+    \"organizations_url\": \"https://api.github.com/users/kszucs/orgs\",\n+    \"repos_url\": \"https://api.github.com/users/kszucs/repos\",\n+    \"events_url\": \"https://api.github.com/users/kszucs/events{/privacy}\",\n+    \"received_events_url\": \"https://api.github.com/users/kszucs/received_events\",\n+    \"type\": \"User\",\n+    \"site_admin\": false\n+  },\n+  \"body\": \"\",\n+  \"created_at\": \"2019-04-05T11:22:15Z\",\n+  \"updated_at\": \"2019-04-05T12:01:40Z\",\n+  \"closed_at\": null,\n+  \"merged_at\": null,\n+  \"merge_commit_sha\": \"cc5dc3606988b3824be54df779ed2028776113cb\",\n+  \"assignee\": null,\n+  \"assignees\": [\n+\n+  ],\n+  \"requested_reviewers\": [\n+\n+  ],\n+  \"requested_teams\": [\n+\n+  ],\n+  \"labels\": [\n+\n+  ],\n+  \"milestone\": null,\n+  \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26/commits\",\n+  \"review_comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26/comments\",\n+  \"review_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/comments{/number}\",\n+  \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\",\n+  \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/2705da2b616b98fa6010a25813c5a7a27456f71d\",\n+  \"head\": {\n+    \"label\": \"ursa-labs:test-hook\",\n+    \"ref\": \"test-hook\",\n+    \"sha\": \"2705da2b616b98fa6010a25813c5a7a27456f71d\",\n+    \"user\": {\n+      \"login\": \"ursa-labs\",\n+      \"id\": 46514972,\n+      \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+      \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+      \"gravatar_id\": \"\",\n+      \"url\": \"https://api.github.com/users/ursa-labs\",\n+      \"html_url\": \"https://github.com/ursa-labs\",\n+      \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+      \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+      \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+      \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+      \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+      \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+      \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+      \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+      \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+      \"type\": \"Organization\",\n+      \"site_admin\": false\n+    },\n+    \"repo\": {\n+      \"id\": 169101701,\n+      \"node_id\": \"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\",\n+      \"name\": \"ursabot\",\n+      \"full_name\": \"ursa-labs/ursabot\",\n+      \"private\": false,\n+      \"owner\": {\n+        \"login\": \"ursa-labs\",\n+        \"id\": 46514972,\n+        \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+        \"gravatar_id\": \"\",\n+        \"url\": \"https://api.github.com/users/ursa-labs\",\n+        \"html_url\": \"https://github.com/ursa-labs\",\n+        \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+        \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+        \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+        \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+        \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+        \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+        \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+        \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+        \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+        \"type\": \"Organization\",\n+        \"site_admin\": false\n+      },\n+      \"html_url\": \"https://github.com/ursa-labs/ursabot\",\n+      \"description\": null,\n+      \"fork\": false,\n+      \"url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+      \"forks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/forks\",\n+      \"keys_url\": \"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\",\n+      \"collaborators_url\": \"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\",\n+      \"teams_url\": \"https://api.github.com/repos/ursa-labs/ursabot/teams\",\n+      \"hooks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/hooks\",\n+      \"issue_events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\",\n+      \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/events\",\n+      \"assignees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\",\n+      \"branches_url\": \"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\",\n+      \"tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/tags\",\n+      \"blobs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\",\n+      \"git_tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\",\n+      \"git_refs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\",\n+      \"trees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\",\n+      \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\",\n+      \"languages_url\": \"https://api.github.com/repos/ursa-labs/ursabot/languages\",\n+      \"stargazers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/stargazers\",\n+      \"contributors_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contributors\",\n+      \"subscribers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscribers\",\n+      \"subscription_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscription\",\n+      \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\",\n+      \"git_commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\",\n+      \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\",\n+      \"issue_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\",\n+      \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\",\n+      \"compare_url\": \"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\",\n+      \"merges_url\": \"https://api.github.com/repos/ursa-labs/ursabot/merges\",\n+      \"archive_url\": \"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\",\n+      \"downloads_url\": \"https://api.github.com/repos/ursa-labs/ursabot/downloads\",\n+      \"issues_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\",\n+      \"pulls_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\",\n+      \"milestones_url\": \"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\",\n+      \"notifications_url\": \"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\",\n+      \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\",\n+      \"releases_url\": \"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\",\n+      \"deployments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/deployments\",\n+      \"created_at\": \"2019-02-04T15:40:31Z\",\n+      \"updated_at\": \"2019-04-04T17:49:10Z\",\n+      \"pushed_at\": \"2019-04-05T12:01:40Z\",\n+      \"git_url\": \"git://github.com/ursa-labs/ursabot.git\",\n+      \"ssh_url\": \"git@github.com:ursa-labs/ursabot.git\",\n+      \"clone_url\": \"https://github.com/ursa-labs/ursabot.git\",\n+      \"svn_url\": \"https://github.com/ursa-labs/ursabot\",\n+      \"homepage\": null,\n+      \"size\": 898,\n+      \"stargazers_count\": 1,\n+      \"watchers_count\": 1,\n+      \"language\": \"Jupyter Notebook\",\n+      \"has_issues\": true,\n+      \"has_projects\": true,\n+      \"has_downloads\": true,\n+      \"has_wiki\": true,\n+      \"has_pages\": false,\n+      \"forks_count\": 0,\n+      \"mirror_url\": null,\n+      \"archived\": false,\n+      \"disabled\": false,\n+      \"open_issues_count\": 19,\n+      \"license\": null,\n+      \"forks\": 0,\n+      \"open_issues\": 19,\n+      \"watchers\": 1,\n+      \"default_branch\": \"master\"\n+    }\n+  },\n+  \"base\": {\n+    \"label\": \"ursa-labs:master\",\n+    \"ref\": \"master\",\n+    \"sha\": \"a162ad254b589b924db47e057791191b39613fd5\",\n+    \"user\": {\n+      \"login\": \"ursa-labs\",\n+      \"id\": 46514972,\n+      \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+      \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+      \"gravatar_id\": \"\",\n+      \"url\": \"https://api.github.com/users/ursa-labs\",\n+      \"html_url\": \"https://github.com/ursa-labs\",\n+      \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+      \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+      \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+      \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+      \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+      \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+      \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+      \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+      \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+      \"type\": \"Organization\",\n+      \"site_admin\": false\n+    },\n+    \"repo\": {\n+      \"id\": 169101701,\n+      \"node_id\": \"MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=\",\n+      \"name\": \"ursabot\",\n+      \"full_name\": \"ursa-labs/ursabot\",\n+      \"private\": false,\n+      \"owner\": {\n+        \"login\": \"ursa-labs\",\n+        \"id\": 46514972,\n+        \"node_id\": \"MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy\",\n+        \"avatar_url\": \"https://avatars2.githubusercontent.com/u/46514972?v=4\",\n+        \"gravatar_id\": \"\",\n+        \"url\": \"https://api.github.com/users/ursa-labs\",\n+        \"html_url\": \"https://github.com/ursa-labs\",\n+        \"followers_url\": \"https://api.github.com/users/ursa-labs/followers\",\n+        \"following_url\": \"https://api.github.com/users/ursa-labs/following{/other_user}\",\n+        \"gists_url\": \"https://api.github.com/users/ursa-labs/gists{/gist_id}\",\n+        \"starred_url\": \"https://api.github.com/users/ursa-labs/starred{/owner}{/repo}\",\n+        \"subscriptions_url\": \"https://api.github.com/users/ursa-labs/subscriptions\",\n+        \"organizations_url\": \"https://api.github.com/users/ursa-labs/orgs\",\n+        \"repos_url\": \"https://api.github.com/users/ursa-labs/repos\",\n+        \"events_url\": \"https://api.github.com/users/ursa-labs/events{/privacy}\",\n+        \"received_events_url\": \"https://api.github.com/users/ursa-labs/received_events\",\n+        \"type\": \"Organization\",\n+        \"site_admin\": false\n+      },\n+      \"html_url\": \"https://github.com/ursa-labs/ursabot\",\n+      \"description\": null,\n+      \"fork\": false,\n+      \"url\": \"https://api.github.com/repos/ursa-labs/ursabot\",\n+      \"forks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/forks\",\n+      \"keys_url\": \"https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}\",\n+      \"collaborators_url\": \"https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}\",\n+      \"teams_url\": \"https://api.github.com/repos/ursa-labs/ursabot/teams\",\n+      \"hooks_url\": \"https://api.github.com/repos/ursa-labs/ursabot/hooks\",\n+      \"issue_events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}\",\n+      \"events_url\": \"https://api.github.com/repos/ursa-labs/ursabot/events\",\n+      \"assignees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}\",\n+      \"branches_url\": \"https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}\",\n+      \"tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/tags\",\n+      \"blobs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}\",\n+      \"git_tags_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}\",\n+      \"git_refs_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}\",\n+      \"trees_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}\",\n+      \"statuses_url\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}\",\n+      \"languages_url\": \"https://api.github.com/repos/ursa-labs/ursabot/languages\",\n+      \"stargazers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/stargazers\",\n+      \"contributors_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contributors\",\n+      \"subscribers_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscribers\",\n+      \"subscription_url\": \"https://api.github.com/repos/ursa-labs/ursabot/subscription\",\n+      \"commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}\",\n+      \"git_commits_url\": \"https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}\",\n+      \"comments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/comments{/number}\",\n+      \"issue_comment_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}\",\n+      \"contents_url\": \"https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}\",\n+      \"compare_url\": \"https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}\",\n+      \"merges_url\": \"https://api.github.com/repos/ursa-labs/ursabot/merges\",\n+      \"archive_url\": \"https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}\",\n+      \"downloads_url\": \"https://api.github.com/repos/ursa-labs/ursabot/downloads\",\n+      \"issues_url\": \"https://api.github.com/repos/ursa-labs/ursabot/issues{/number}\",\n+      \"pulls_url\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}\",\n+      \"milestones_url\": \"https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}\",\n+      \"notifications_url\": \"https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}\",\n+      \"labels_url\": \"https://api.github.com/repos/ursa-labs/ursabot/labels{/name}\",\n+      \"releases_url\": \"https://api.github.com/repos/ursa-labs/ursabot/releases{/id}\",\n+      \"deployments_url\": \"https://api.github.com/repos/ursa-labs/ursabot/deployments\",\n+      \"created_at\": \"2019-02-04T15:40:31Z\",\n+      \"updated_at\": \"2019-04-04T17:49:10Z\",\n+      \"pushed_at\": \"2019-04-05T12:01:40Z\",\n+      \"git_url\": \"git://github.com/ursa-labs/ursabot.git\",\n+      \"ssh_url\": \"git@github.com:ursa-labs/ursabot.git\",\n+      \"clone_url\": \"https://github.com/ursa-labs/ursabot.git\",\n+      \"svn_url\": \"https://github.com/ursa-labs/ursabot\",\n+      \"homepage\": null,\n+      \"size\": 898,\n+      \"stargazers_count\": 1,\n+      \"watchers_count\": 1,\n+      \"language\": \"Jupyter Notebook\",\n+      \"has_issues\": true,\n+      \"has_projects\": true,\n+      \"has_downloads\": true,\n+      \"has_wiki\": true,\n+      \"has_pages\": false,\n+      \"forks_count\": 0,\n+      \"mirror_url\": null,\n+      \"archived\": false,\n+      \"disabled\": false,\n+      \"open_issues_count\": 19,\n+      \"license\": null,\n+      \"forks\": 0,\n+      \"open_issues\": 19,\n+      \"watchers\": 1,\n+      \"default_branch\": \"master\"\n+    }\n+  },\n+  \"_links\": {\n+    \"self\": {\n+      \"href\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26\"\n+    },\n+    \"html\": {\n+      \"href\": \"https://github.com/ursa-labs/ursabot/pull/26\"\n+    },\n+    \"issue\": {\n+      \"href\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26\"\n+    },\n+    \"comments\": {\n+      \"href\": \"https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments\"\n+    },\n+    \"review_comments\": {\n+      \"href\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26/comments\"\n+    },\n+    \"review_comment\": {\n+      \"href\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/comments{/number}\"\n+    },\n+    \"commits\": {\n+      \"href\": \"https://api.github.com/repos/ursa-labs/ursabot/pulls/26/commits\"\n+    },\n+    \"statuses\": {\n+      \"href\": \"https://api.github.com/repos/ursa-labs/ursabot/statuses/2705da2b616b98fa6010a25813c5a7a27456f71d\"\n+    }\n+  },\n+  \"author_association\": \"MEMBER\",\n+  \"merged\": false,\n+  \"mergeable\": true,\n+  \"rebaseable\": true,\n+  \"mergeable_state\": \"unstable\",\n+  \"merged_by\": null,\n+  \"comments\": 5,\n+  \"review_comments\": 0,\n+  \"maintainer_can_modify\": false,\n+  \"commits\": 2,\n+  \"additions\": 1124,\n+  \"deletions\": 0,\n+  \"changed_files\": 7\n+}"
+  },
+  {
+    "sha": "e87b27d2d7b4956d15f7468488b96cf6a06686f4",
+    "filename": "ursabot/tests/test_hooks.py",
+    "status": "added",
+    "additions": 116,
+    "deletions": 0,
+    "changes": 116,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/test_hooks.py",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/tests/test_hooks.py",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/tests/test_hooks.py?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -0,0 +1,116 @@\n+import json\n+from pathlib import Path\n+from twisted.trial import unittest\n+\n+from buildbot.test.util.misc import TestReactorMixin\n+from buildbot.test.fake.httpclientservice import \\\n+    HTTPClientService as FakeHTTPClientService\n+from buildbot.test.unit.test_www_hooks_github import (\n+    _prepare_request, _prepare_github_change_hook)\n+\n+from ursabot.utils import ensure_deferred\n+from ursabot.hooks import GithubHook\n+\n+\n+class ChangeHookTestCase(unittest.TestCase, TestReactorMixin):\n+\n+    klass = None\n+\n+    @ensure_deferred\n+    async def setUp(self):\n+        self.setUpTestReactor()\n+\n+        assert self.klass is not None\n+        self.hook = _prepare_github_change_hook(self, **{'class': self.klass})\n+        self.master = self.hook.master\n+        self.http = await FakeHTTPClientService.getFakeService(\n+            self.master, self, 'https://api.github.com',\n+            headers={'User-Agent': 'Buildbot'}, debug=False, verify=False)\n+\n+        await self.master.startService()\n+\n+    @ensure_deferred\n+    async def tearDown(self):\n+        await self.master.stopService()\n+\n+    async def trigger(self, event, payload, headers=None, _secret=None):\n+        payload = json.dumps(payload).encode()\n+        request = _prepare_request(event, payload, _secret=_secret,\n+                                   headers=headers)\n+        await request.test_render(self.hook)\n+        return request\n+\n+    def load_fixture(self, name):\n+        path = Path(__file__).parent / 'fixtures' / f'{name}.json'\n+        with path.open('r') as fp:\n+            return json.load(fp)\n+\n+\n+class TestGithubHook(ChangeHookTestCase):\n+\n+    klass = GithubHook\n+\n+    @ensure_deferred\n+    async def test_ping(self):\n+        await self.trigger('ping', {})\n+        assert len(self.hook.master.data.updates.changesAdded) == 0\n+\n+    @ensure_deferred\n+    async def test_issue_comment_not_mentioning_ursabot(self):\n+        payload = self.load_fixture('issue-comment-not-mentioning-ursabot')\n+        await self.trigger('issue_comment', payload=payload)\n+        assert len(self.hook.master.data.updates.changesAdded) == 0\n+\n+    @ensure_deferred\n+    async def test_issue_comment_by_ursabot(self):\n+        payload = self.load_fixture('issue-comment-by-ursabot')\n+        await self.trigger('issue_comment', payload=payload)\n+        assert len(self.hook.master.data.updates.changesAdded) == 0\n+\n+    @ensure_deferred\n+    async def test_issue_comment_with_empty_command(self):\n+        # responds to the comment\n+        request_json = {'body': 'Unknown command \"\"'}\n+        response_json = ''\n+        self.http.expect('post', '/repos/ursa-labs/ursabot/issues/26/comments',\n+                         json=request_json, content_json=response_json)\n+\n+        payload = self.load_fixture('issue-comment-with-empty-command')\n+        await self.trigger('issue_comment', payload=payload)\n+        assert len(self.hook.master.data.updates.changesAdded) == 0\n+\n+    @ensure_deferred\n+    async def test_issue_comment_without_pull_request(self):\n+        # responds to the comment\n+        request_json = {\n+            'body': 'Ursabot only listens to pull request comments!'\n+        }\n+        response_json = ''\n+        self.http.expect('post', '/repos/ursa-labs/ursabot/issues/19/comments',\n+                         json=request_json, content_json=response_json)\n+\n+        payload = self.load_fixture('issue-comment-without-pull-request')\n+        await self.trigger('issue_comment', payload=payload)\n+        assert len(self.hook.master.data.updates.changesAdded) == 0\n+\n+    @ensure_deferred\n+    async def test_issue_comment_build_command(self):\n+        # handle_issue_comment queries the pull request\n+        request_json = self.load_fixture('pull-request-26')\n+        self.http.expect('get', '/repos/ursa-labs/ursabot/pulls/26',\n+                         content_json=request_json)\n+        # tigger handle_pull_request which fetches the commit\n+        request_json = self.load_fixture('pull-request-26-commit')\n+        commit = '2705da2b616b98fa6010a25813c5a7a27456f71d'\n+        self.http.expect('get', f'/repos/ursa-labs/ursabot/commits/{commit}',\n+                         content_json=request_json)\n+\n+        # then responds to the comment\n+        request_json = {'body': \"I've successfully started builds for this PR\"}\n+        response_json = ''\n+        self.http.expect('post', '/repos/ursa-labs/ursabot/issues/26/comments',\n+                         json=request_json, content_json=response_json)\n+\n+        payload = self.load_fixture('issue-comment-build-command')\n+        await self.trigger('issue_comment', payload=payload)\n+        assert len(self.hook.master.data.updates.changesAdded) == 1"
+  },
+  {
+    "sha": "3ff0e88660cf186420e8bc672735e4d446963192",
+    "filename": "ursabot/utils.py",
+    "status": "added",
+    "additions": 10,
+    "deletions": 0,
+    "changes": 10,
+    "blob_url": "https://github.com/ursa-labs/ursabot/blob/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/utils.py",
+    "raw_url": "https://github.com/ursa-labs/ursabot/raw/70267dee34884e4b972388e1b30d57f6248c58d0/ursabot/utils.py",
+    "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/ursabot/utils.py?ref=70267dee34884e4b972388e1b30d57f6248c58d0",
+    "patch": "@@ -0,0 +1,10 @@\n+import functools\n+from twisted.internet import defer\n+\n+\n+def ensure_deferred(f):\n+    @functools.wraps(f)\n+    def wrapper(*args, **kwargs):\n+        result = f(*args, **kwargs)\n+        return defer.ensureDeferred(result)\n+    return wrapper"
+  }
+]
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/fixtures/pull-request-26.json b/src/arrow/dev/archery/archery/tests/fixtures/pull-request-26.json
new file mode 100644
index 000000000..d295afb39
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/fixtures/pull-request-26.json
@@ -0,0 +1,329 @@
+{
+  "url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26",
+  "id": 267785552,
+  "node_id": "MDExOlB1bGxSZXF1ZXN0MjY3Nzg1NTUy",
+  "html_url": "https://github.com/ursa-labs/ursabot/pull/26",
+  "diff_url": "https://github.com/ursa-labs/ursabot/pull/26.diff",
+  "patch_url": "https://github.com/ursa-labs/ursabot/pull/26.patch",
+  "issue_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26",
+  "number": 26,
+  "state": "open",
+  "locked": false,
+  "title": "Unittests for GithubHook",
+  "user": {
+    "login": "kszucs",
+    "id": 961747,
+    "node_id": "MDQ6VXNlcjk2MTc0Nw==",
+    "avatar_url": "https://avatars1.githubusercontent.com/u/961747?v=4",
+    "gravatar_id": "",
+    "url": "https://api.github.com/users/kszucs",
+    "html_url": "https://github.com/kszucs",
+    "followers_url": "https://api.github.com/users/kszucs/followers",
+    "following_url": "https://api.github.com/users/kszucs/following{/other_user}",
+    "gists_url": "https://api.github.com/users/kszucs/gists{/gist_id}",
+    "starred_url": "https://api.github.com/users/kszucs/starred{/owner}{/repo}",
+    "subscriptions_url": "https://api.github.com/users/kszucs/subscriptions",
+    "organizations_url": "https://api.github.com/users/kszucs/orgs",
+    "repos_url": "https://api.github.com/users/kszucs/repos",
+    "events_url": "https://api.github.com/users/kszucs/events{/privacy}",
+    "received_events_url": "https://api.github.com/users/kszucs/received_events",
+    "type": "User",
+    "site_admin": false
+  },
+  "body": "",
+  "body_html": "",
+  "body_text": "",
+  "created_at": "2019-04-05T11:22:15Z",
+  "updated_at": "2019-04-05T12:01:40Z",
+  "closed_at": null,
+  "merged_at": null,
+  "merge_commit_sha": "cc5dc3606988b3824be54df779ed2028776113cb",
+  "assignee": null,
+  "assignees": [],
+  "requested_reviewers": [],
+  "requested_teams": [],
+  "labels": [],
+  "milestone": null,
+  "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26/commits",
+  "review_comments_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26/comments",
+  "review_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls/comments{/number}",
+  "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments",
+  "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/2705da2b616b98fa6010a25813c5a7a27456f71d",
+  "head": {
+    "label": "ursa-labs:test-hook",
+    "ref": "test-hook",
+    "sha": "2705da2b616b98fa6010a25813c5a7a27456f71d",
+    "user": {
+      "login": "ursa-labs",
+      "id": 46514972,
+      "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+      "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+      "gravatar_id": "",
+      "url": "https://api.github.com/users/ursa-labs",
+      "html_url": "https://github.com/ursa-labs",
+      "followers_url": "https://api.github.com/users/ursa-labs/followers",
+      "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+      "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+      "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+      "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+      "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+      "repos_url": "https://api.github.com/users/ursa-labs/repos",
+      "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+      "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+      "type": "Organization",
+      "site_admin": false
+    },
+    "repo": {
+      "id": 169101701,
+      "node_id": "MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=",
+      "name": "ursabot",
+      "full_name": "ursa-labs/ursabot",
+      "private": false,
+      "owner": {
+        "login": "ursa-labs",
+        "id": 46514972,
+        "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+        "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+        "gravatar_id": "",
+        "url": "https://api.github.com/users/ursa-labs",
+        "html_url": "https://github.com/ursa-labs",
+        "followers_url": "https://api.github.com/users/ursa-labs/followers",
+        "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+        "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+        "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+        "repos_url": "https://api.github.com/users/ursa-labs/repos",
+        "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+        "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+        "type": "Organization",
+        "site_admin": false
+      },
+      "html_url": "https://github.com/ursa-labs/ursabot",
+      "description": null,
+      "fork": false,
+      "url": "https://api.github.com/repos/ursa-labs/ursabot",
+      "forks_url": "https://api.github.com/repos/ursa-labs/ursabot/forks",
+      "keys_url": "https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}",
+      "collaborators_url": "https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}",
+      "teams_url": "https://api.github.com/repos/ursa-labs/ursabot/teams",
+      "hooks_url": "https://api.github.com/repos/ursa-labs/ursabot/hooks",
+      "issue_events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}",
+      "events_url": "https://api.github.com/repos/ursa-labs/ursabot/events",
+      "assignees_url": "https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}",
+      "branches_url": "https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}",
+      "tags_url": "https://api.github.com/repos/ursa-labs/ursabot/tags",
+      "blobs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}",
+      "git_tags_url": "https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}",
+      "git_refs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}",
+      "trees_url": "https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}",
+      "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}",
+      "languages_url": "https://api.github.com/repos/ursa-labs/ursabot/languages",
+      "stargazers_url": "https://api.github.com/repos/ursa-labs/ursabot/stargazers",
+      "contributors_url": "https://api.github.com/repos/ursa-labs/ursabot/contributors",
+      "subscribers_url": "https://api.github.com/repos/ursa-labs/ursabot/subscribers",
+      "subscription_url": "https://api.github.com/repos/ursa-labs/ursabot/subscription",
+      "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}",
+      "git_commits_url": "https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}",
+      "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/comments{/number}",
+      "issue_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}",
+      "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}",
+      "compare_url": "https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}",
+      "merges_url": "https://api.github.com/repos/ursa-labs/ursabot/merges",
+      "archive_url": "https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}",
+      "downloads_url": "https://api.github.com/repos/ursa-labs/ursabot/downloads",
+      "issues_url": "https://api.github.com/repos/ursa-labs/ursabot/issues{/number}",
+      "pulls_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}",
+      "milestones_url": "https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}",
+      "notifications_url": "https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}",
+      "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/labels{/name}",
+      "releases_url": "https://api.github.com/repos/ursa-labs/ursabot/releases{/id}",
+      "deployments_url": "https://api.github.com/repos/ursa-labs/ursabot/deployments",
+      "created_at": "2019-02-04T15:40:31Z",
+      "updated_at": "2019-04-04T17:49:10Z",
+      "pushed_at": "2019-04-05T12:01:40Z",
+      "git_url": "git://github.com/ursa-labs/ursabot.git",
+      "ssh_url": "git@github.com:ursa-labs/ursabot.git",
+      "clone_url": "https://github.com/ursa-labs/ursabot.git",
+      "svn_url": "https://github.com/ursa-labs/ursabot",
+      "homepage": null,
+      "size": 898,
+      "stargazers_count": 1,
+      "watchers_count": 1,
+      "language": "Jupyter Notebook",
+      "has_issues": true,
+      "has_projects": true,
+      "has_downloads": true,
+      "has_wiki": true,
+      "has_pages": false,
+      "forks_count": 0,
+      "mirror_url": null,
+      "archived": false,
+      "disabled": false,
+      "open_issues_count": 19,
+      "license": null,
+      "forks": 0,
+      "open_issues": 19,
+      "watchers": 1,
+      "default_branch": "master"
+    }
+  },
+  "base": {
+    "label": "ursa-labs:master",
+    "ref": "master",
+    "sha": "a162ad254b589b924db47e057791191b39613fd5",
+    "user": {
+      "login": "ursa-labs",
+      "id": 46514972,
+      "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+      "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+      "gravatar_id": "",
+      "url": "https://api.github.com/users/ursa-labs",
+      "html_url": "https://github.com/ursa-labs",
+      "followers_url": "https://api.github.com/users/ursa-labs/followers",
+      "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+      "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+      "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+      "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+      "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+      "repos_url": "https://api.github.com/users/ursa-labs/repos",
+      "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+      "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+      "type": "Organization",
+      "site_admin": false
+    },
+    "repo": {
+      "id": 169101701,
+      "node_id": "MDEwOlJlcG9zaXRvcnkxNjkxMDE3MDE=",
+      "name": "ursabot",
+      "full_name": "ursa-labs/ursabot",
+      "private": false,
+      "owner": {
+        "login": "ursa-labs",
+        "id": 46514972,
+        "node_id": "MDEyOk9yZ2FuaXphdGlvbjQ2NTE0OTcy",
+        "avatar_url": "https://avatars2.githubusercontent.com/u/46514972?v=4",
+        "gravatar_id": "",
+        "url": "https://api.github.com/users/ursa-labs",
+        "html_url": "https://github.com/ursa-labs",
+        "followers_url": "https://api.github.com/users/ursa-labs/followers",
+        "following_url": "https://api.github.com/users/ursa-labs/following{/other_user}",
+        "gists_url": "https://api.github.com/users/ursa-labs/gists{/gist_id}",
+        "starred_url": "https://api.github.com/users/ursa-labs/starred{/owner}{/repo}",
+        "subscriptions_url": "https://api.github.com/users/ursa-labs/subscriptions",
+        "organizations_url": "https://api.github.com/users/ursa-labs/orgs",
+        "repos_url": "https://api.github.com/users/ursa-labs/repos",
+        "events_url": "https://api.github.com/users/ursa-labs/events{/privacy}",
+        "received_events_url": "https://api.github.com/users/ursa-labs/received_events",
+        "type": "Organization",
+        "site_admin": false
+      },
+      "html_url": "https://github.com/ursa-labs/ursabot",
+      "description": null,
+      "fork": false,
+      "url": "https://api.github.com/repos/ursa-labs/ursabot",
+      "forks_url": "https://api.github.com/repos/ursa-labs/ursabot/forks",
+      "keys_url": "https://api.github.com/repos/ursa-labs/ursabot/keys{/key_id}",
+      "collaborators_url": "https://api.github.com/repos/ursa-labs/ursabot/collaborators{/collaborator}",
+      "teams_url": "https://api.github.com/repos/ursa-labs/ursabot/teams",
+      "hooks_url": "https://api.github.com/repos/ursa-labs/ursabot/hooks",
+      "issue_events_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/events{/number}",
+      "events_url": "https://api.github.com/repos/ursa-labs/ursabot/events",
+      "assignees_url": "https://api.github.com/repos/ursa-labs/ursabot/assignees{/user}",
+      "branches_url": "https://api.github.com/repos/ursa-labs/ursabot/branches{/branch}",
+      "tags_url": "https://api.github.com/repos/ursa-labs/ursabot/tags",
+      "blobs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/blobs{/sha}",
+      "git_tags_url": "https://api.github.com/repos/ursa-labs/ursabot/git/tags{/sha}",
+      "git_refs_url": "https://api.github.com/repos/ursa-labs/ursabot/git/refs{/sha}",
+      "trees_url": "https://api.github.com/repos/ursa-labs/ursabot/git/trees{/sha}",
+      "statuses_url": "https://api.github.com/repos/ursa-labs/ursabot/statuses/{sha}",
+      "languages_url": "https://api.github.com/repos/ursa-labs/ursabot/languages",
+      "stargazers_url": "https://api.github.com/repos/ursa-labs/ursabot/stargazers",
+      "contributors_url": "https://api.github.com/repos/ursa-labs/ursabot/contributors",
+      "subscribers_url": "https://api.github.com/repos/ursa-labs/ursabot/subscribers",
+      "subscription_url": "https://api.github.com/repos/ursa-labs/ursabot/subscription",
+      "commits_url": "https://api.github.com/repos/ursa-labs/ursabot/commits{/sha}",
+      "git_commits_url": "https://api.github.com/repos/ursa-labs/ursabot/git/commits{/sha}",
+      "comments_url": "https://api.github.com/repos/ursa-labs/ursabot/comments{/number}",
+      "issue_comment_url": "https://api.github.com/repos/ursa-labs/ursabot/issues/comments{/number}",
+      "contents_url": "https://api.github.com/repos/ursa-labs/ursabot/contents/{+path}",
+      "compare_url": "https://api.github.com/repos/ursa-labs/ursabot/compare/{base}...{head}",
+      "merges_url": "https://api.github.com/repos/ursa-labs/ursabot/merges",
+      "archive_url": "https://api.github.com/repos/ursa-labs/ursabot/{archive_format}{/ref}",
+      "downloads_url": "https://api.github.com/repos/ursa-labs/ursabot/downloads",
+      "issues_url": "https://api.github.com/repos/ursa-labs/ursabot/issues{/number}",
+      "pulls_url": "https://api.github.com/repos/ursa-labs/ursabot/pulls{/number}",
+      "milestones_url": "https://api.github.com/repos/ursa-labs/ursabot/milestones{/number}",
+      "notifications_url": "https://api.github.com/repos/ursa-labs/ursabot/notifications{?since,all,participating}",
+      "labels_url": "https://api.github.com/repos/ursa-labs/ursabot/labels{/name}",
+      "releases_url": "https://api.github.com/repos/ursa-labs/ursabot/releases{/id}",
+      "deployments_url": "https://api.github.com/repos/ursa-labs/ursabot/deployments",
+      "created_at": "2019-02-04T15:40:31Z",
+      "updated_at": "2019-04-04T17:49:10Z",
+      "pushed_at": "2019-04-05T12:01:40Z",
+      "git_url": "git://github.com/ursa-labs/ursabot.git",
+      "ssh_url": "git@github.com:ursa-labs/ursabot.git",
+      "clone_url": "https://github.com/ursa-labs/ursabot.git",
+      "svn_url": "https://github.com/ursa-labs/ursabot",
+      "homepage": null,
+      "size": 898,
+      "stargazers_count": 1,
+      "watchers_count": 1,
+      "language": "Jupyter Notebook",
+      "has_issues": true,
+      "has_projects": true,
+      "has_downloads": true,
+      "has_wiki": true,
+      "has_pages": false,
+      "forks_count": 0,
+      "mirror_url": null,
+      "archived": false,
+      "disabled": false,
+      "open_issues_count": 19,
+      "license": null,
+      "forks": 0,
+      "open_issues": 19,
+      "watchers": 1,
+      "default_branch": "master"
+    }
+  },
+  "_links": {
+    "self": {
+      "href": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26"
+    },
+    "html": {
+      "href": "https://github.com/ursa-labs/ursabot/pull/26"
+    },
+    "issue": {
+      "href": "https://api.github.com/repos/ursa-labs/ursabot/issues/26"
+    },
+    "comments": {
+      "href": "https://api.github.com/repos/ursa-labs/ursabot/issues/26/comments"
+    },
+    "review_comments": {
+      "href": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26/comments"
+    },
+    "review_comment": {
+      "href": "https://api.github.com/repos/ursa-labs/ursabot/pulls/comments{/number}"
+    },
+    "commits": {
+      "href": "https://api.github.com/repos/ursa-labs/ursabot/pulls/26/commits"
+    },
+    "statuses": {
+      "href": "https://api.github.com/repos/ursa-labs/ursabot/statuses/2705da2b616b98fa6010a25813c5a7a27456f71d"
+    }
+  },
+  "author_association": "MEMBER",
+  "merged": false,
+  "mergeable": true,
+  "rebaseable": true,
+  "mergeable_state": "unstable",
+  "merged_by": null,
+  "comments": 5,
+  "review_comments": 0,
+  "maintainer_can_modify": false,
+  "commits": 2,
+  "additions": 1124,
+  "deletions": 0,
+  "changed_files": 7
+}
\ No newline at end of file
diff --git a/src/arrow/dev/archery/archery/tests/test_benchmarks.py b/src/arrow/dev/archery/archery/tests/test_benchmarks.py
new file mode 100644
index 000000000..fab1e8d44
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/test_benchmarks.py
@@ -0,0 +1,383 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import json
+
+from archery.benchmark.codec import JsonEncoder
+from archery.benchmark.core import Benchmark, median
+from archery.benchmark.compare import (
+    BenchmarkComparator, RunnerComparator
+)
+from archery.benchmark.google import (
+    GoogleBenchmark, GoogleBenchmarkObservation
+)
+from archery.benchmark.runner import StaticBenchmarkRunner
+
+
+def test_benchmark_comparator():
+    unit = "micros"
+
+    assert not BenchmarkComparator(
+        Benchmark("contender", unit, True, [10], unit, [1]),
+        Benchmark("baseline", unit, True, [20], unit, [1]),
+    ).regression
+
+    assert BenchmarkComparator(
+        Benchmark("contender", unit, False, [10], unit, [1]),
+        Benchmark("baseline", unit, False, [20], unit, [1]),
+    ).regression
+
+    assert BenchmarkComparator(
+        Benchmark("contender", unit, True, [20], unit, [1]),
+        Benchmark("baseline", unit, True, [10], unit, [1]),
+    ).regression
+
+    assert not BenchmarkComparator(
+        Benchmark("contender", unit, False, [20], unit, [1]),
+        Benchmark("baseline", unit, False, [10], unit, [1]),
+    ).regression
+
+
+def test_static_runner_from_json_not_a_regression():
+    archery_result = {
+        "suites": [
+            {
+                "name": "arrow-value-parsing-benchmark",
+                "benchmarks": [
+                    {
+                        "name": "FloatParsing<DoubleType>",
+                        "unit": "items_per_second",
+                        "less_is_better": False,
+                        "values": [
+                            109941112.87296811
+                        ],
+                        "time_unit": "ns",
+                        "times": [
+                            9095.800104330105
+                        ]
+                    },
+                ]
+            }
+        ]
+    }
+
+    contender = StaticBenchmarkRunner.from_json(json.dumps(archery_result))
+    baseline = StaticBenchmarkRunner.from_json(json.dumps(archery_result))
+    [comparison] = RunnerComparator(contender, baseline).comparisons
+    assert not comparison.regression
+
+
+def test_static_runner_from_json_regression():
+    archery_result = {
+        "suites": [
+            {
+                "name": "arrow-value-parsing-benchmark",
+                "benchmarks": [
+                    {
+                        "name": "FloatParsing<DoubleType>",
+                        "unit": "items_per_second",
+                        "less_is_better": False,
+                        "values": [
+                            109941112.87296811
+                        ],
+                        "time_unit": "ns",
+                        "times": [
+                            9095.800104330105
+                        ]
+                    },
+                ]
+            }
+        ]
+    }
+
+    contender = StaticBenchmarkRunner.from_json(json.dumps(archery_result))
+
+    # introduce artificial regression
+    archery_result['suites'][0]['benchmarks'][0]['values'][0] *= 2
+    baseline = StaticBenchmarkRunner.from_json(json.dumps(archery_result))
+
+    [comparison] = RunnerComparator(contender, baseline).comparisons
+    assert comparison.regression
+
+
+def test_benchmark_median():
+    assert median([10]) == 10
+    assert median([1, 2, 3]) == 2
+    assert median([1, 2]) == 1.5
+    assert median([1, 2, 3, 4]) == 2.5
+    assert median([1, 1, 1, 1]) == 1
+    try:
+        median([])
+        assert False
+    except ValueError:
+        pass
+
+
+def assert_benchmark(name, google_result, archery_result):
+    observation = GoogleBenchmarkObservation(**google_result)
+    benchmark = GoogleBenchmark(name, [observation])
+    result = json.dumps(benchmark, cls=JsonEncoder)
+    assert json.loads(result) == archery_result
+
+
+def test_items_per_second():
+    name = "ArrayArrayKernel<AddChecked, UInt8Type>/32768/0"
+    google_result = {
+        "cpu_time": 116292.58886653671,
+        "items_per_second": 281772039.9844759,
+        "iterations": 5964,
+        "name": name,
+        "null_percent": 0.0,
+        "real_time": 119811.77313729875,
+        "repetition_index": 0,
+        "repetitions": 0,
+        "run_name": name,
+        "run_type": "iteration",
+        "size": 32768.0,
+        "threads": 1,
+        "time_unit": "ns",
+    }
+    archery_result = {
+        "counters": {"iterations": 5964,
+                     "null_percent": 0.0,
+                     "repetition_index": 0,
+                     "repetitions": 0,
+                     "run_name": name,
+                     "threads": 1},
+        "name": name,
+        "unit": "items_per_second",
+        "less_is_better": False,
+        "values": [281772039.9844759],
+        "time_unit": "ns",
+        "times": [119811.77313729875],
+    }
+    assert "items_per_second" in google_result
+    assert "bytes_per_second" not in google_result
+    assert_benchmark(name, google_result, archery_result)
+
+
+def test_bytes_per_second():
+    name = "BufferOutputStreamLargeWrites/real_time"
+    google_result = {
+        "bytes_per_second": 1890209037.3405428,
+        "cpu_time": 17018127.659574457,
+        "iterations": 47,
+        "name": name,
+        "real_time": 17458386.53190963,
+        "repetition_index": 1,
+        "repetitions": 0,
+        "run_name": name,
+        "run_type": "iteration",
+        "threads": 1,
+        "time_unit": "ns",
+    }
+    archery_result = {
+        "counters": {"iterations": 47,
+                     "repetition_index": 1,
+                     "repetitions": 0,
+                     "run_name": name,
+                     "threads": 1},
+        "name": name,
+        "unit": "bytes_per_second",
+        "less_is_better": False,
+        "values": [1890209037.3405428],
+        "time_unit": "ns",
+        "times": [17458386.53190963],
+    }
+    assert "items_per_second" not in google_result
+    assert "bytes_per_second" in google_result
+    assert_benchmark(name, google_result, archery_result)
+
+
+def test_both_items_and_bytes_per_second():
+    name = "ArrayArrayKernel<AddChecked, UInt8Type>/32768/0"
+    google_result = {
+        "bytes_per_second": 281772039.9844759,
+        "cpu_time": 116292.58886653671,
+        "items_per_second": 281772039.9844759,
+        "iterations": 5964,
+        "name": name,
+        "null_percent": 0.0,
+        "real_time": 119811.77313729875,
+        "repetition_index": 0,
+        "repetitions": 0,
+        "run_name": name,
+        "run_type": "iteration",
+        "size": 32768.0,
+        "threads": 1,
+        "time_unit": "ns",
+    }
+    # Note that bytes_per_second trumps items_per_second
+    archery_result = {
+        "counters": {"iterations": 5964,
+                     "null_percent": 0.0,
+                     "repetition_index": 0,
+                     "repetitions": 0,
+                     "run_name": name,
+                     "threads": 1},
+        "name": name,
+        "unit": "bytes_per_second",
+        "less_is_better": False,
+        "values": [281772039.9844759],
+        "time_unit": "ns",
+        "times": [119811.77313729875],
+    }
+    assert "items_per_second" in google_result
+    assert "bytes_per_second" in google_result
+    assert_benchmark(name, google_result, archery_result)
+
+
+def test_neither_items_nor_bytes_per_second():
+    name = "AllocateDeallocate<Jemalloc>/size:1048576/real_time"
+    google_result = {
+        "cpu_time": 1778.6004847419827,
+        "iterations": 352765,
+        "name": name,
+        "real_time": 1835.3137357788837,
+        "repetition_index": 0,
+        "repetitions": 0,
+        "run_name": name,
+        "run_type": "iteration",
+        "threads": 1,
+        "time_unit": "ns",
+    }
+    archery_result = {
+        "counters": {"iterations": 352765,
+                     "repetition_index": 0,
+                     "repetitions": 0,
+                     "run_name": name,
+                     "threads": 1},
+        "name": name,
+        "unit": "ns",
+        "less_is_better": True,
+        "values": [1835.3137357788837],
+        "time_unit": "ns",
+        "times": [1835.3137357788837],
+    }
+    assert "items_per_second" not in google_result
+    assert "bytes_per_second" not in google_result
+    assert_benchmark(name, google_result, archery_result)
+
+
+def test_prefer_real_time():
+    name = "AllocateDeallocate<Jemalloc>/size:1048576/real_time"
+    google_result = {
+        "cpu_time": 1778.6004847419827,
+        "iterations": 352765,
+        "name": name,
+        "real_time": 1835.3137357788837,
+        "repetition_index": 0,
+        "repetitions": 0,
+        "run_name": name,
+        "run_type": "iteration",
+        "threads": 1,
+        "time_unit": "ns",
+    }
+    archery_result = {
+        "counters": {"iterations": 352765,
+                     "repetition_index": 0,
+                     "repetitions": 0,
+                     "run_name": name,
+                     "threads": 1},
+        "name": name,
+        "unit": "ns",
+        "less_is_better": True,
+        "values": [1835.3137357788837],
+        "time_unit": "ns",
+        "times": [1835.3137357788837],
+    }
+    assert name.endswith("/real_time")
+    assert_benchmark(name, google_result, archery_result)
+
+
+def test_prefer_cpu_time():
+    name = "AllocateDeallocate<Jemalloc>/size:1048576"
+    google_result = {
+        "cpu_time": 1778.6004847419827,
+        "iterations": 352765,
+        "name": name,
+        "real_time": 1835.3137357788837,
+        "repetition_index": 0,
+        "repetitions": 0,
+        "run_name": name,
+        "run_type": "iteration",
+        "threads": 1,
+        "time_unit": "ns",
+    }
+    archery_result = {
+        "counters": {"iterations": 352765,
+                     "repetition_index": 0,
+                     "repetitions": 0,
+                     "run_name": name,
+                     "threads": 1},
+        "name": name,
+        "unit": "ns",
+        "less_is_better": True,
+        "values": [1778.6004847419827],
+        "time_unit": "ns",
+        "times": [1835.3137357788837],
+    }
+    assert not name.endswith("/real_time")
+    assert_benchmark(name, google_result, archery_result)
+
+
+def test_omits_aggregates():
+    name = "AllocateDeallocate<Jemalloc>/size:1048576/real_time"
+    google_aggregate = {
+        "aggregate_name": "mean",
+        "cpu_time": 1757.428694267678,
+        "iterations": 3,
+        "name": "AllocateDeallocate<Jemalloc>/size:1048576/real_time_mean",
+        "real_time": 1849.3869337041162,
+        "repetitions": 0,
+        "run_name": name,
+        "run_type": "aggregate",
+        "threads": 1,
+        "time_unit": "ns",
+    }
+    google_result = {
+        "cpu_time": 1778.6004847419827,
+        "iterations": 352765,
+        "name": name,
+        "real_time": 1835.3137357788837,
+        "repetition_index": 0,
+        "repetitions": 0,
+        "run_name": name,
+        "run_type": "iteration",
+        "threads": 1,
+        "time_unit": "ns",
+    }
+    archery_result = {
+        "counters": {"iterations": 352765,
+                     "repetition_index": 0,
+                     "repetitions": 0,
+                     "run_name": name,
+                     "threads": 1},
+        "name": name,
+        "unit": "ns",
+        "less_is_better": True,
+        "values": [1835.3137357788837],
+        "time_unit": "ns",
+        "times": [1835.3137357788837],
+    }
+    assert google_aggregate["run_type"] == "aggregate"
+    assert google_result["run_type"] == "iteration"
+    observation1 = GoogleBenchmarkObservation(**google_aggregate)
+    observation2 = GoogleBenchmarkObservation(**google_result)
+    benchmark = GoogleBenchmark(name, [observation1, observation2])
+    result = json.dumps(benchmark, cls=JsonEncoder)
+    assert json.loads(result) == archery_result
diff --git a/src/arrow/dev/archery/archery/tests/test_bot.py b/src/arrow/dev/archery/archery/tests/test_bot.py
new file mode 100644
index 000000000..e84fb7e27
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/test_bot.py
@@ -0,0 +1,215 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import json
+from unittest.mock import Mock
+
+import click
+import pytest
+import responses as rsps
+
+from archery.bot import CommentBot, CommandError, group
+
+
+@pytest.fixture
+def responses():
+    with rsps.RequestsMock() as mock:
+        yield mock
+
+
+def github_url(path):
+    return 'https://api.github.com:443/{}'.format(path.strip('/'))
+
+
+@group()
+def custom_handler():
+    pass
+
+
+@custom_handler.command()
+@click.pass_obj
+def extra(obj):
+    return obj
+
+
+@custom_handler.command()
+@click.option('--force', '-f', is_flag=True)
+def build(force):
+    return force
+
+
+@custom_handler.command()
+@click.option('--name', required=True)
+def benchmark(name):
+    return name
+
+
+def test_click_based_commands():
+    assert custom_handler('build') is False
+    assert custom_handler('build -f') is True
+
+    assert custom_handler('benchmark --name strings') == 'strings'
+    with pytest.raises(CommandError):
+        assert custom_handler('benchmark')
+
+    assert custom_handler('extra', extra='data') == {'extra': 'data'}
+
+
+@pytest.mark.parametrize('fixture_name', [
+    # the bot is not mentioned, nothing to do
+    'event-issue-comment-not-mentioning-ursabot.json',
+    # don't respond to itself, it prevents recursive comment storms!
+    'event-issue-comment-by-ursabot.json',
+    # non-authorized user sent the comment, do not respond
+    'event-issue-comment-by-non-authorized-user.json',
+])
+def test_noop_events(load_fixture, fixture_name):
+    payload = load_fixture(fixture_name)
+
+    handler = Mock()
+    bot = CommentBot(name='ursabot', token='', handler=handler)
+    bot.handle('issue_comment', payload)
+
+    handler.assert_not_called()
+
+
+def test_issue_comment_without_pull_request(load_fixture, responses):
+    responses.add(
+        responses.GET,
+        github_url('/repositories/169101701/issues/19'),
+        json=load_fixture('issue-19.json'),
+        status=200
+    )
+    responses.add(
+        responses.GET,
+        github_url('repos/ursa-labs/ursabot/pulls/19'),
+        json={},
+        status=404
+    )
+    responses.add(
+        responses.POST,
+        github_url('/repos/ursa-labs/ursabot/issues/19/comments'),
+        json={}
+    )
+
+    def handler(command, **kwargs):
+        pass
+
+    payload = load_fixture('event-issue-comment-without-pull-request.json')
+    bot = CommentBot(name='ursabot', token='', handler=handler)
+    bot.handle('issue_comment', payload)
+
+    post = responses.calls[2]
+    assert json.loads(post.request.body) == {
+        'body': "The comment bot only listens to pull request comments!"
+    }
+
+
+def test_respond_with_usage(load_fixture, responses):
+    responses.add(
+        responses.GET,
+        github_url('/repositories/169101701/issues/26'),
+        json=load_fixture('issue-26.json'),
+        status=200
+    )
+    responses.add(
+        responses.GET,
+        github_url('/repos/ursa-labs/ursabot/pulls/26'),
+        json=load_fixture('pull-request-26.json'),
+        status=200
+    )
+    responses.add(
+        responses.GET,
+        github_url('/repos/ursa-labs/ursabot/issues/comments/480243811'),
+        json=load_fixture('issue-comment-480243811.json')
+    )
+    responses.add(
+        responses.POST,
+        github_url('/repos/ursa-labs/ursabot/issues/26/comments'),
+        json={}
+    )
+
+    def handler(command, **kwargs):
+        raise CommandError('test-usage')
+
+    payload = load_fixture('event-issue-comment-with-empty-command.json')
+    bot = CommentBot(name='ursabot', token='', handler=handler)
+    bot.handle('issue_comment', payload)
+
+    post = responses.calls[3]
+    assert json.loads(post.request.body) == {'body': '```\ntest-usage\n```'}
+
+
+@pytest.mark.parametrize(('command', 'reaction'), [
+    ('@ursabot build', '+1'),
+    ('@ursabot build\nwith a comment', '+1'),
+    ('@ursabot listen', '-1'),
+])
+def test_issue_comment_with_commands(load_fixture, responses, command,
+                                     reaction):
+    responses.add(
+        responses.GET,
+        github_url('/repositories/169101701/issues/26'),
+        json=load_fixture('issue-26.json'),
+        status=200
+    )
+    responses.add(
+        responses.GET,
+        github_url('/repos/ursa-labs/ursabot/pulls/26'),
+        json=load_fixture('pull-request-26.json'),
+        status=200
+    )
+    responses.add(
+        responses.GET,
+        github_url('/repos/ursa-labs/ursabot/issues/comments/480248726'),
+        json=load_fixture('issue-comment-480248726.json')
+    )
+    responses.add(
+        responses.POST,
+        github_url(
+            '/repos/ursa-labs/ursabot/issues/comments/480248726/reactions'
+        ),
+        json={}
+    )
+
+    def handler(command, **kwargs):
+        if command == 'build':
+            return True
+        else:
+            raise ValueError('Only `build` command is supported.')
+
+    payload = load_fixture('event-issue-comment-build-command.json')
+    payload["comment"]["body"] = command
+
+    bot = CommentBot(name='ursabot', token='', handler=handler)
+    bot.handle('issue_comment', payload)
+
+    post = responses.calls[3]
+    assert json.loads(post.request.body) == {'content': reaction}
+
+
+def test_issue_comment_with_commands_bot_not_first(load_fixture, responses):
+    # when the @-mention is not first, this is a no-op
+    handler = Mock()
+
+    payload = load_fixture('event-issue-comment-build-command.json')
+    payload["comment"]["body"] = 'with a comment\n@ursabot build'
+
+    bot = CommentBot(name='ursabot', token='', handler=handler)
+    bot.handle('issue_comment', payload)
+
+    handler.assert_not_called()
diff --git a/src/arrow/dev/archery/archery/tests/test_cli.py b/src/arrow/dev/archery/archery/tests/test_cli.py
new file mode 100644
index 000000000..3891a2c28
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/test_cli.py
@@ -0,0 +1,39 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from pathlib import Path
+from unittest.mock import patch
+
+from click.testing import CliRunner
+
+from archery.cli import archery
+
+
+@patch("archery.linking.check_dynamic_library_dependencies")
+def test_linking_check_dependencies(fn):
+    args = [
+        "linking",
+        "check-dependencies",
+        "-a", "libarrow",
+        "-d", "libcurl",
+        "somelib.so"
+    ]
+    result = CliRunner().invoke(archery, args)
+    assert result.exit_code == 0
+    fn.assert_called_once_with(
+        Path('somelib.so'), allowed={'libarrow'}, disallowed={'libcurl'}
+    )
diff --git a/src/arrow/dev/archery/archery/tests/test_release.py b/src/arrow/dev/archery/archery/tests/test_release.py
new file mode 100644
index 000000000..75aac8921
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/test_release.py
@@ -0,0 +1,333 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import pytest
+
+from archery.release import (
+    Release, MajorRelease, MinorRelease, PatchRelease,
+    Jira, Version, Issue, CommitTitle, Commit
+)
+from archery.testing import DotDict
+
+
+# subset of issues per revision
+_issues = {
+    "1.0.1": [
+        Issue("ARROW-9684", type="Bug", summary="[C++] Title"),
+        Issue("ARROW-9667", type="New Feature", summary="[Crossbow] Title"),
+        Issue("ARROW-9659", type="Bug", summary="[C++] Title"),
+        Issue("ARROW-9644", type="Bug", summary="[C++][Dataset] Title"),
+        Issue("ARROW-9643", type="Bug", summary="[C++] Title"),
+        Issue("ARROW-9609", type="Bug", summary="[C++] Title"),
+        Issue("ARROW-9606", type="Bug", summary="[C++][Dataset] Title")
+    ],
+    "1.0.0": [
+        Issue("ARROW-300", type="New Feature", summary="[Format] Title"),
+        Issue("ARROW-4427", type="Task", summary="[Doc] Title"),
+        Issue("ARROW-5035", type="Improvement", summary="[C#] Title"),
+        Issue("ARROW-8473", type="Bug", summary="[Rust] Title"),
+        Issue("ARROW-8472", type="Bug", summary="[Go][Integration] Title"),
+        Issue("ARROW-8471", type="Bug", summary="[C++][Integration] Title"),
+        Issue("ARROW-8974", type="Improvement", summary="[C++] Title"),
+        Issue("ARROW-8973", type="New Feature", summary="[Java] Title")
+    ],
+    "0.17.1": [
+        Issue("ARROW-8684", type="Bug", summary="[Python] Title"),
+        Issue("ARROW-8657", type="Bug", summary="[C++][Parquet] Title"),
+        Issue("ARROW-8641", type="Bug", summary="[Python] Title"),
+        Issue("ARROW-8609", type="Bug", summary="[C++] Title"),
+    ],
+    "0.17.0": [
+        Issue("ARROW-2882", type="New Feature", summary="[C++][Python] Title"),
+        Issue("ARROW-2587", type="Bug", summary="[Python] Title"),
+        Issue("ARROW-2447", type="Improvement", summary="[C++] Title"),
+        Issue("ARROW-2255", type="Bug", summary="[Integration] Title"),
+        Issue("ARROW-1907", type="Bug", summary="[C++/Python] Title"),
+        Issue("ARROW-1636", type="New Feature", summary="[Format] Title")
+    ]
+}
+
+
+class FakeJira(Jira):
+
+    def __init__(self):
+        pass
+
+    def project_versions(self, project='ARROW'):
+        return [
+            Version.parse("3.0.0", released=False),
+            Version.parse("2.0.0", released=False),
+            Version.parse("1.1.0", released=False),
+            Version.parse("1.0.1", released=False),
+            Version.parse("1.0.0", released=True),
+            Version.parse("0.17.1", released=True),
+            Version.parse("0.17.0", released=True),
+            Version.parse("0.16.0", released=True),
+            Version.parse("0.15.2", released=True),
+            Version.parse("0.15.1", released=True),
+            Version.parse("0.15.0", released=True),
+        ]
+
+    def project_issues(self, version, project='ARROW'):
+        return _issues[str(version)]
+
+
+@pytest.fixture
+def fake_jira():
+    return FakeJira()
+
+
+def test_version(fake_jira):
+    v = Version.parse("1.2.5")
+    assert str(v) == "1.2.5"
+    assert v.major == 1
+    assert v.minor == 2
+    assert v.patch == 5
+    assert v.released is False
+    assert v.release_date is None
+
+    v = Version.parse("1.0.0", released=True, release_date="2020-01-01")
+    assert str(v) == "1.0.0"
+    assert v.major == 1
+    assert v.minor == 0
+    assert v.patch == 0
+    assert v.released is True
+    assert v.release_date == "2020-01-01"
+
+
+def test_issue(fake_jira):
+    i = Issue("ARROW-1234", type='Bug', summary="title")
+    assert i.key == "ARROW-1234"
+    assert i.type == "Bug"
+    assert i.summary == "title"
+    assert i.project == "ARROW"
+    assert i.number == 1234
+
+    i = Issue("PARQUET-1111", type='Improvement', summary="another title")
+    assert i.key == "PARQUET-1111"
+    assert i.type == "Improvement"
+    assert i.summary == "another title"
+    assert i.project == "PARQUET"
+    assert i.number == 1111
+
+    fake_jira_issue = DotDict({
+        'key': 'ARROW-2222',
+        'fields': {
+            'issuetype': {
+                'name': 'Feature'
+            },
+            'summary': 'Issue title'
+        }
+    })
+    i = Issue.from_jira(fake_jira_issue)
+    assert i.key == "ARROW-2222"
+    assert i.type == "Feature"
+    assert i.summary == "Issue title"
+    assert i.project == "ARROW"
+    assert i.number == 2222
+
+
+def test_commit_title():
+    t = CommitTitle.parse(
+        "ARROW-9598: [C++][Parquet] Fix writing nullable structs"
+    )
+    assert t.project == "ARROW"
+    assert t.issue == "ARROW-9598"
+    assert t.components == ["C++", "Parquet"]
+    assert t.summary == "Fix writing nullable structs"
+
+    t = CommitTitle.parse(
+        "ARROW-8002: [C++][Dataset][R] Support partitioned dataset writing"
+    )
+    assert t.project == "ARROW"
+    assert t.issue == "ARROW-8002"
+    assert t.components == ["C++", "Dataset", "R"]
+    assert t.summary == "Support partitioned dataset writing"
+
+    t = CommitTitle.parse(
+        "ARROW-9600: [Rust][Arrow] pin older version of proc-macro2 during "
+        "build"
+    )
+    assert t.project == "ARROW"
+    assert t.issue == "ARROW-9600"
+    assert t.components == ["Rust", "Arrow"]
+    assert t.summary == "pin older version of proc-macro2 during build"
+
+    t = CommitTitle.parse("[Release] Update versions for 1.0.0")
+    assert t.project is None
+    assert t.issue is None
+    assert t.components == ["Release"]
+    assert t.summary == "Update versions for 1.0.0"
+
+    t = CommitTitle.parse("[Python][Doc] Fix rst role dataset.rst (#7725)")
+    assert t.project is None
+    assert t.issue is None
+    assert t.components == ["Python", "Doc"]
+    assert t.summary == "Fix rst role dataset.rst (#7725)"
+
+    t = CommitTitle.parse(
+        "PARQUET-1882: [C++] Buffered Reads should allow for 0 length"
+    )
+    assert t.project == 'PARQUET'
+    assert t.issue == 'PARQUET-1882'
+    assert t.components == ["C++"]
+    assert t.summary == "Buffered Reads should allow for 0 length"
+
+    t = CommitTitle.parse(
+        "ARROW-9340 [R] Use CRAN version of decor package "
+        "\nsomething else\n"
+        "\nwhich should be truncated"
+    )
+    assert t.project == 'ARROW'
+    assert t.issue == 'ARROW-9340'
+    assert t.components == ["R"]
+    assert t.summary == "Use CRAN version of decor package "
+
+
+def test_release_basics(fake_jira):
+    r = Release.from_jira("1.0.0", jira=fake_jira)
+    assert isinstance(r, MajorRelease)
+    assert r.is_released is True
+    assert r.branch == 'master'
+    assert r.tag == 'apache-arrow-1.0.0'
+
+    r = Release.from_jira("1.1.0", jira=fake_jira)
+    assert isinstance(r, MinorRelease)
+    assert r.is_released is False
+    assert r.branch == 'maint-1.x.x'
+    assert r.tag == 'apache-arrow-1.1.0'
+
+    # minor releases before 1.0 are treated as major releases
+    r = Release.from_jira("0.17.0", jira=fake_jira)
+    assert isinstance(r, MajorRelease)
+    assert r.is_released is True
+    assert r.branch == 'master'
+    assert r.tag == 'apache-arrow-0.17.0'
+
+    r = Release.from_jira("0.17.1", jira=fake_jira)
+    assert isinstance(r, PatchRelease)
+    assert r.is_released is True
+    assert r.branch == 'maint-0.17.x'
+    assert r.tag == 'apache-arrow-0.17.1'
+
+
+def test_previous_and_next_release(fake_jira):
+    r = Release.from_jira("3.0.0", jira=fake_jira)
+    assert isinstance(r.previous, MajorRelease)
+    assert r.previous.version == Version.parse("2.0.0")
+    with pytest.raises(ValueError, match="There is no upcoming release set"):
+        assert r.next
+
+    r = Release.from_jira("2.0.0", jira=fake_jira)
+    assert isinstance(r.previous, MajorRelease)
+    assert isinstance(r.next, MajorRelease)
+    assert r.previous.version == Version.parse("1.0.0")
+    assert r.next.version == Version.parse("3.0.0")
+
+    r = Release.from_jira("1.1.0", jira=fake_jira)
+    assert isinstance(r.previous, MajorRelease)
+    assert isinstance(r.next, MajorRelease)
+    assert r.previous.version == Version.parse("1.0.0")
+    assert r.next.version == Version.parse("2.0.0")
+
+    r = Release.from_jira("1.0.0", jira=fake_jira)
+    assert isinstance(r.next, MajorRelease)
+    assert isinstance(r.previous, MajorRelease)
+    assert r.previous.version == Version.parse("0.17.0")
+    assert r.next.version == Version.parse("2.0.0")
+
+    r = Release.from_jira("0.17.0", jira=fake_jira)
+    assert isinstance(r.previous, MajorRelease)
+    assert r.previous.version == Version.parse("0.16.0")
+
+    r = Release.from_jira("0.15.2", jira=fake_jira)
+    assert isinstance(r.previous, PatchRelease)
+    assert isinstance(r.next, MajorRelease)
+    assert r.previous.version == Version.parse("0.15.1")
+    assert r.next.version == Version.parse("0.16.0")
+
+    r = Release.from_jira("0.15.1", jira=fake_jira)
+    assert isinstance(r.previous, MajorRelease)
+    assert isinstance(r.next, PatchRelease)
+    assert r.previous.version == Version.parse("0.15.0")
+    assert r.next.version == Version.parse("0.15.2")
+
+
+def test_release_issues(fake_jira):
+    # major release issues
+    r = Release.from_jira("1.0.0", jira=fake_jira)
+    assert r.issues.keys() == set([
+        "ARROW-300",
+        "ARROW-4427",
+        "ARROW-5035",
+        "ARROW-8473",
+        "ARROW-8472",
+        "ARROW-8471",
+        "ARROW-8974",
+        "ARROW-8973"
+    ])
+    # minor release issues
+    r = Release.from_jira("0.17.0", jira=fake_jira)
+    assert r.issues.keys() == set([
+        "ARROW-2882",
+        "ARROW-2587",
+        "ARROW-2447",
+        "ARROW-2255",
+        "ARROW-1907",
+        "ARROW-1636",
+    ])
+    # patch release issues
+    r = Release.from_jira("1.0.1", jira=fake_jira)
+    assert r.issues.keys() == set([
+        "ARROW-9684",
+        "ARROW-9667",
+        "ARROW-9659",
+        "ARROW-9644",
+        "ARROW-9643",
+        "ARROW-9609",
+        "ARROW-9606"
+    ])
+
+
+@pytest.mark.parametrize(('version', 'ncommits'), [
+    ("1.0.0", 771),
+    ("0.17.1", 27),
+    ("0.17.0", 569),
+    ("0.15.1", 41)
+])
+def test_release_commits(fake_jira, version, ncommits):
+    r = Release.from_jira(version, jira=fake_jira)
+    assert len(r.commits) == ncommits
+    for c in r.commits:
+        assert isinstance(c, Commit)
+        assert isinstance(c.title, CommitTitle)
+        assert c.url.endswith(c.hexsha)
+
+
+def test_maintenance_patch_selection(fake_jira):
+    r = Release.from_jira("0.17.1", jira=fake_jira)
+
+    shas_to_pick = [
+        c.hexsha for c in r.commits_to_pick(exclude_already_applied=False)
+    ]
+    expected = [
+        '8939b4bd446ee406d5225c79d563a27d30fd7d6d',
+        'bcef6c95a324417e85e0140f9745d342cd8784b3',
+        '6002ec388840de5622e39af85abdc57a2cccc9b2',
+        '9123dadfd123bca7af4eaa9455f5b0d1ca8b929d',
+    ]
+    assert shas_to_pick == expected
diff --git a/src/arrow/dev/archery/archery/tests/test_testing.py b/src/arrow/dev/archery/archery/tests/test_testing.py
new file mode 100644
index 000000000..117b9288d
--- /dev/null
+++ b/src/arrow/dev/archery/archery/tests/test_testing.py
@@ -0,0 +1,62 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import subprocess
+
+import pytest
+
+from archery.testing import PartialEnv, assert_subprocess_calls
+
+
+def test_partial_env():
+    assert PartialEnv(a=1, b=2) == {'a': 1, 'b': 2, 'c': 3}
+    assert PartialEnv(a=1) == {'a': 1, 'b': 2, 'c': 3}
+    assert PartialEnv(a=1, b=2) == {'a': 1, 'b': 2}
+    assert PartialEnv(a=1, b=2) != {'b': 2, 'c': 3}
+    assert PartialEnv(a=1, b=2) != {'a': 1, 'c': 3}
+
+
+def test_assert_subprocess_calls():
+    expected_calls = [
+        "echo Hello",
+        ["echo", "World"]
+    ]
+    with assert_subprocess_calls(expected_calls):
+        subprocess.run(['echo', 'Hello'])
+        subprocess.run(['echo', 'World'])
+
+    expected_env = PartialEnv(
+        CUSTOM_ENV_A='a',
+        CUSTOM_ENV_C='c'
+    )
+    with assert_subprocess_calls(expected_calls, env=expected_env):
+        env = {
+            'CUSTOM_ENV_A': 'a',
+            'CUSTOM_ENV_B': 'b',
+            'CUSTOM_ENV_C': 'c'
+        }
+        subprocess.run(['echo', 'Hello'], env=env)
+        subprocess.run(['echo', 'World'], env=env)
+
+    with pytest.raises(AssertionError):
+        with assert_subprocess_calls(expected_calls, env=expected_env):
+            env = {
+                'CUSTOM_ENV_B': 'b',
+                'CUSTOM_ENV_C': 'c'
+            }
+            subprocess.run(['echo', 'Hello'], env=env)
+            subprocess.run(['echo', 'World'], env=env)
diff --git a/src/arrow/dev/archery/archery/utils/__init__.py b/src/arrow/dev/archery/archery/utils/__init__.py
new file mode 100644
index 000000000..13a83393a
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/__init__.py
@@ -0,0 +1,16 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
diff --git a/src/arrow/dev/archery/archery/utils/cache.py b/src/arrow/dev/archery/archery/utils/cache.py
new file mode 100644
index 000000000..d92c5f32e
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/cache.py
@@ -0,0 +1,80 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from pathlib import Path
+import os
+from urllib.request import urlopen
+
+from .logger import logger
+
+ARCHERY_CACHE_DIR = Path.home() / ".cache" / "archery"
+
+
+class Cache:
+    """ Cache stores downloaded objects, notably apache-rat.jar. """
+
+    def __init__(self, path=ARCHERY_CACHE_DIR):
+        self.root = path
+
+        if not path.exists():
+            os.makedirs(path)
+
+    def key_path(self, key):
+        """ Return the full path of a key. """
+        return self.root/key
+
+    def get(self, key):
+        """ Return the full path of a key if cached, None otherwise. """
+        path = self.key_path(key)
+        return path if path.exists() else None
+
+    def delete(self, key):
+        """ Remove a key (and the file) from the cache. """
+        path = self.get(key)
+        if path:
+            path.unlink()
+
+    def get_or_insert(self, key, create):
+        """
+        Get or Insert a key from the cache. If the key is not found, the
+        `create` closure will be evaluated.
+
+        The `create` closure takes a single parameter, the path where the
+        object should be store. The file should only be created upon success.
+        """
+        path = self.key_path(key)
+
+        if not path.exists():
+            create(path)
+
+        return path
+
+    def get_or_insert_from_url(self, key, url):
+        """
+        Get or Insert a key from the cache. If the key is not found, the file
+        is downloaded from `url`.
+        """
+        def download(path):
+            """ Tiny wrapper that download a file and save as key. """
+            logger.debug("Downloading {} as {}".format(url, path))
+            conn = urlopen(url)
+            # Ensure the download is completed before writing to disks.
+            content = conn.read()
+            with open(path, "wb") as path_fd:
+                path_fd.write(content)
+
+        return self.get_or_insert(key, download)
diff --git a/src/arrow/dev/archery/archery/utils/cli.py b/src/arrow/dev/archery/archery/utils/cli.py
new file mode 100644
index 000000000..701abe925
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/cli.py
@@ -0,0 +1,73 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import importlib
+
+import click
+
+from .source import ArrowSources, InvalidArrowSource
+
+
+class ArrowBool(click.types.BoolParamType):
+    """
+    ArrowBool supports the 'ON' and 'OFF' values on top of the values
+    supported by BoolParamType. This is convenient to port script which exports
+    CMake options variables.
+    """
+    name = "boolean"
+
+    def convert(self, value, param, ctx):
+        if isinstance(value, str):
+            lowered = value.lower()
+            if lowered == "on":
+                return True
+            elif lowered == "off":
+                return False
+
+        return super().convert(value, param, ctx)
+
+
+def validate_arrow_sources(ctx, param, src):
+    """
+    Ensure a directory contains Arrow cpp sources.
+    """
+    try:
+        return ArrowSources.find(src)
+    except InvalidArrowSource as e:
+        raise click.BadParameter(str(e))
+
+
+def add_optional_command(name, module, function, parent):
+    try:
+        module = importlib.import_module(module, package="archery")
+        command = getattr(module, function)
+    except ImportError as exc:
+        error_message = exc.name
+
+        @parent.command(
+            name,
+            context_settings={
+                "allow_extra_args": True,
+                "ignore_unknown_options": True,
+            }
+        )
+        def command():
+            raise click.ClickException(
+                f"Couldn't import command `{name}` due to {error_message}"
+            )
+    else:
+        parent.add_command(command)
diff --git a/src/arrow/dev/archery/archery/utils/cmake.py b/src/arrow/dev/archery/archery/utils/cmake.py
new file mode 100644
index 000000000..f93895b1a
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/cmake.py
@@ -0,0 +1,215 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+import re
+from shutil import rmtree, which
+
+from .command import Command, default_bin
+
+
+class CMake(Command):
+    def __init__(self, cmake_bin=None):
+        self.bin = default_bin(cmake_bin, "cmake")
+
+    @staticmethod
+    def default_generator():
+        """ Infer default generator.
+
+        Gives precedence to ninja if there exists an executable named `ninja`
+        in the search path.
+        """
+        found_ninja = which("ninja")
+        return "Ninja" if found_ninja else "Unix Makefiles"
+
+
+cmake = CMake()
+
+
+class CMakeDefinition:
+    """ CMakeDefinition captures the cmake invocation arguments.
+
+    It allows creating build directories with the same definition, e.g.
+    ```
+    build_1 = cmake_def.build("/tmp/build-1")
+    build_2 = cmake_def.build("/tmp/build-2")
+
+    ...
+
+    build1.all()
+    build2.all()
+    """
+
+    def __init__(self, source, build_type="release", generator=None,
+                 definitions=None, env=None):
+        """ Initialize a CMakeDefinition
+
+        Parameters
+        ----------
+        source : str
+                 Source directory where the top-level CMakeLists.txt is
+                 located. This is usually the root of the project.
+        generator : str, optional
+        definitions: list(str), optional
+        env : dict(str,str), optional
+              Environment to use when invoking cmake. This can be required to
+              work around cmake deficiencies, e.g. CC and CXX.
+        """
+        self.source = os.path.abspath(source)
+        self.build_type = build_type
+        self.generator = generator if generator else cmake.default_generator()
+        self.definitions = definitions if definitions else []
+        self.env = env
+
+    @property
+    def arguments(self):
+        """" Return the arguments to cmake invocation. """
+        arguments = [
+            "-G{}".format(self.generator),
+        ] + self.definitions + [
+            self.source
+        ]
+        return arguments
+
+    def build(self, build_dir, force=False, cmd_kwargs=None, **kwargs):
+        """ Invoke cmake into a build directory.
+
+        Parameters
+        ----------
+        build_dir : str
+                    Directory in which the CMake build will be instantiated.
+        force : bool
+                If the build folder exists, delete it before. Otherwise if it's
+                present, an error will be returned.
+        """
+        if os.path.exists(build_dir):
+            # Extra safety to ensure we're deleting a build folder.
+            if not CMakeBuild.is_build_dir(build_dir):
+                raise FileExistsError(
+                    "{} is not a cmake build".format(build_dir)
+                )
+            if not force:
+                raise FileExistsError(
+                    "{} exists use force=True".format(build_dir)
+                )
+            rmtree(build_dir)
+
+        os.mkdir(build_dir)
+
+        cmd_kwargs = cmd_kwargs if cmd_kwargs else {}
+        cmake(*self.arguments, cwd=build_dir, env=self.env, **cmd_kwargs)
+        return CMakeBuild(build_dir, self.build_type, definition=self,
+                          **kwargs)
+
+    def __repr__(self):
+        return "CMakeDefinition[source={}]".format(self.source)
+
+
+CMAKE_BUILD_TYPE_RE = re.compile("CMAKE_BUILD_TYPE:STRING=([a-zA-Z]+)")
+
+
+class CMakeBuild(CMake):
+    """ CMakeBuild represents a build directory initialized by cmake.
+
+    The build instance can be used to build/test/install. It alleviates the
+    user to know which generator is used.
+    """
+
+    def __init__(self, build_dir, build_type, definition=None):
+        """ Initialize a CMakeBuild.
+
+        The caller must ensure that cmake was invoked in the build directory.
+
+        Parameters
+        ----------
+        definition : CMakeDefinition
+                     The definition to build from.
+        build_dir : str
+                    The build directory to setup into.
+        """
+        assert CMakeBuild.is_build_dir(build_dir)
+        super().__init__()
+        self.build_dir = os.path.abspath(build_dir)
+        self.build_type = build_type
+        self.definition = definition
+
+    @property
+    def binaries_dir(self):
+        return os.path.join(self.build_dir, self.build_type)
+
+    def run(self, *argv, verbose=False, **kwargs):
+        cmake_args = ["--build", self.build_dir, "--"]
+        extra = []
+        if verbose:
+            extra.append("-v" if self.bin.endswith("ninja") else "VERBOSE=1")
+        # Commands must be ran under the build directory
+        return super().run(*cmake_args, *extra,
+                           *argv, **kwargs, cwd=self.build_dir)
+
+    def all(self):
+        return self.run("all")
+
+    def clean(self):
+        return self.run("clean")
+
+    def install(self):
+        return self.run("install")
+
+    def test(self):
+        return self.run("test")
+
+    @staticmethod
+    def is_build_dir(path):
+        """ Indicate if a path is CMake build directory.
+
+        This method only checks for the existence of paths and does not do any
+        validation whatsoever.
+        """
+        cmake_cache = os.path.join(path, "CMakeCache.txt")
+        cmake_files = os.path.join(path, "CMakeFiles")
+        return os.path.exists(cmake_cache) and os.path.exists(cmake_files)
+
+    @staticmethod
+    def from_path(path):
+        """ Instantiate a CMakeBuild from a path.
+
+        This is used to recover from an existing physical directory (created
+        with or without CMakeBuild).
+
+        Note that this method is not idempotent as the original definition will
+        be lost. Only build_type is recovered.
+        """
+        if not CMakeBuild.is_build_dir(path):
+            raise ValueError("Not a valid CMakeBuild path: {}".format(path))
+
+        build_type = None
+        # Infer build_type by looking at CMakeCache.txt and looking for a magic
+        # definition
+        cmake_cache_path = os.path.join(path, "CMakeCache.txt")
+        with open(cmake_cache_path, "r") as cmake_cache:
+            candidates = CMAKE_BUILD_TYPE_RE.findall(cmake_cache.read())
+            build_type = candidates[0].lower() if candidates else "release"
+
+        return CMakeBuild(path, build_type)
+
+    def __repr__(self):
+        return ("CMakeBuild["
+                "build = {},"
+                "build_type = {},"
+                "definition = {}]".format(self.build_dir,
+                                          self.build_type,
+                                          self.definition))
diff --git a/src/arrow/dev/archery/archery/utils/command.py b/src/arrow/dev/archery/archery/utils/command.py
new file mode 100644
index 000000000..f655e2ef2
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/command.py
@@ -0,0 +1,100 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+import shlex
+import shutil
+import subprocess
+
+from .logger import logger, ctx
+
+
+def default_bin(name, default):
+    assert(default)
+    env_name = "ARCHERY_{0}_BIN".format(default.upper())
+    return name if name else os.environ.get(env_name, default)
+
+
+# Decorator running a command and returning stdout
+class capture_stdout:
+    def __init__(self, strip=False, listify=False):
+        self.strip = strip
+        self.listify = listify
+
+    def __call__(self, f):
+        def strip_it(x):
+            return x.strip() if self.strip else x
+
+        def list_it(x):
+            return x.decode('utf-8').splitlines() if self.listify else x
+
+        def wrapper(*argv, **kwargs):
+            # Ensure stdout is captured
+            kwargs["stdout"] = subprocess.PIPE
+            return list_it(strip_it(f(*argv, **kwargs).stdout))
+        return wrapper
+
+
+class Command:
+    """
+    A runnable command.
+
+    Class inheriting from the Command class must provide the bin
+    property/attribute.
+    """
+
+    def __init__(self, bin):
+        self.bin = bin
+
+    def run(self, *argv, **kwargs):
+        assert hasattr(self, "bin")
+        invocation = shlex.split(self.bin)
+        invocation.extend(argv)
+
+        for key in ["stdout", "stderr"]:
+            # Preserve caller intention, otherwise silence
+            if key not in kwargs and ctx.quiet:
+                kwargs[key] = subprocess.PIPE
+
+        # Prefer safe by default
+        if "check" not in kwargs:
+            kwargs["check"] = True
+
+        logger.debug("Executing `{}`".format(invocation))
+        return subprocess.run(invocation, **kwargs)
+
+    @property
+    def available(self):
+        """
+        Indicate if the command binary is found in PATH.
+        """
+        binary = shlex.split(self.bin)[0]
+        return shutil.which(binary) is not None
+
+    def __call__(self, *argv, **kwargs):
+        return self.run(*argv, **kwargs)
+
+
+class CommandStackMixin:
+    def run(self, *argv, **kwargs):
+        stacked_args = self.argv + argv
+        return super(CommandStackMixin, self).run(*stacked_args, **kwargs)
+
+
+class Bash(Command):
+    def __init__(self, bash_bin=None):
+        self.bin = default_bin(bash_bin, "bash")
diff --git a/src/arrow/dev/archery/archery/utils/git.py b/src/arrow/dev/archery/archery/utils/git.py
new file mode 100644
index 000000000..798bc5d70
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/git.py
@@ -0,0 +1,100 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from .command import Command, capture_stdout, default_bin
+from ..compat import _stringify_path
+
+
+# Decorator prepending argv with the git sub-command found with the method
+# name.
+def git_cmd(fn):
+    # function name is the subcommand
+    sub_cmd = fn.__name__.replace("_", "-")
+
+    def wrapper(self, *argv, **kwargs):
+        return fn(self, sub_cmd, *argv, **kwargs)
+    return wrapper
+
+
+class Git(Command):
+    def __init__(self, git_bin=None):
+        self.bin = default_bin(git_bin, "git")
+
+    def run_cmd(self, cmd, *argv, git_dir=None, **kwargs):
+        """ Inject flags before sub-command in argv. """
+        opts = []
+        if git_dir is not None:
+            opts.extend(["-C", _stringify_path(git_dir)])
+
+        return self.run(*opts, cmd, *argv, **kwargs)
+
+    @capture_stdout(strip=False)
+    @git_cmd
+    def archive(self, *argv, **kwargs):
+        return self.run_cmd(*argv, **kwargs)
+
+    @git_cmd
+    def clone(self, *argv, **kwargs):
+        return self.run_cmd(*argv, **kwargs)
+
+    @git_cmd
+    def fetch(self, *argv, **kwargs):
+        return self.run_cmd(*argv, **kwargs)
+
+    @git_cmd
+    def checkout(self, *argv, **kwargs):
+        return self.run_cmd(*argv, **kwargs)
+
+    def dirty(self, **kwargs):
+        return len(self.status("--short", **kwargs)) > 0
+
+    @git_cmd
+    def log(self, *argv, **kwargs):
+        return self.run_cmd(*argv, **kwargs)
+
+    @capture_stdout(strip=True, listify=True)
+    @git_cmd
+    def ls_files(self, *argv, listify=False, **kwargs):
+        stdout = self.run_cmd(*argv, **kwargs)
+        return stdout
+
+    @capture_stdout(strip=True)
+    @git_cmd
+    def rev_parse(self, *argv, **kwargs):
+        return self.run_cmd(*argv, **kwargs)
+
+    @capture_stdout(strip=True)
+    @git_cmd
+    def status(self, *argv, **kwargs):
+        return self.run_cmd(*argv, **kwargs)
+
+    @capture_stdout(strip=True)
+    def head(self, **kwargs):
+        """ Return commit pointed by HEAD. """
+        return self.rev_parse("HEAD", **kwargs)
+
+    @capture_stdout(strip=True)
+    def current_branch(self, **kwargs):
+        return self.rev_parse("--abbrev-ref", "HEAD", **kwargs)
+
+    def repository_root(self, git_dir=None, **kwargs):
+        """ Locates the repository's root path from a subdirectory. """
+        stdout = self.rev_parse("--show-toplevel", git_dir=git_dir, **kwargs)
+        return stdout.decode('utf-8')
+
+
+git = Git()
diff --git a/src/arrow/dev/archery/archery/utils/lint.py b/src/arrow/dev/archery/archery/utils/lint.py
new file mode 100644
index 000000000..d95bfeea3
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/lint.py
@@ -0,0 +1,429 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import fnmatch
+import gzip
+import os
+from pathlib import Path
+
+import click
+
+from .command import Bash, Command, default_bin
+from .cmake import CMake
+from .git import git
+from .logger import logger
+from ..lang.cpp import CppCMakeDefinition, CppConfiguration
+from ..lang.python import Autopep8, Flake8, NumpyDoc
+from .rat import Rat, exclusion_from_globs
+from .tmpdir import tmpdir
+
+
+_archery_install_msg = (
+    "Please install archery using: `pip install -e dev/archery[lint]`. "
+)
+
+
+class LintValidationException(Exception):
+    pass
+
+
+class LintResult:
+    def __init__(self, success, reason=None):
+        self.success = success
+
+    def ok(self):
+        if not self.success:
+            raise LintValidationException
+
+    @staticmethod
+    def from_cmd(command_result):
+        return LintResult(command_result.returncode == 0)
+
+
+def cpp_linter(src, build_dir, clang_format=True, cpplint=True,
+               clang_tidy=False, iwyu=False, iwyu_all=False,
+               fix=False):
+    """ Run clang-format, cpplint and clang-tidy on cpp/ codebase. """
+    logger.info("Running C++ linters")
+
+    cmake = CMake()
+    if not cmake.available:
+        logger.error("cpp linter requested but cmake binary not found.")
+        return
+
+    # A cmake build directory is required to populate `compile_commands.json`
+    # which in turn is required by clang-tidy. It also provides a convenient
+    # way to hide clang-format/clang-tidy invocation via the Generate
+    # (ninja/make) targets.
+
+    # ARROW_LINT_ONLY exits early but ignore building compile_command.json
+    lint_only = not (iwyu or clang_tidy)
+    cmake_args = {"with_python": False, "with_lint_only": lint_only}
+    cmake_def = CppCMakeDefinition(src.cpp, CppConfiguration(**cmake_args))
+
+    build = cmake_def.build(build_dir)
+    if clang_format:
+        target = "format" if fix else "check-format"
+        yield LintResult.from_cmd(build.run(target, check=False))
+
+    if cpplint:
+        yield LintResult.from_cmd(build.run("lint", check=False))
+        yield LintResult.from_cmd(build.run("lint_cpp_cli", check=False))
+
+    if clang_tidy:
+        yield LintResult.from_cmd(build.run("check-clang-tidy", check=False))
+
+    if iwyu:
+        if iwyu_all:
+            iwyu_cmd = "iwyu-all"
+        else:
+            iwyu_cmd = "iwyu"
+        yield LintResult.from_cmd(build.run(iwyu_cmd, check=False))
+
+
+class CMakeFormat(Command):
+
+    def __init__(self, paths, cmake_format_bin=None):
+        self.check_version()
+        self.bin = default_bin(cmake_format_bin, "cmake-format")
+        self.paths = paths
+
+    @classmethod
+    def from_patterns(cls, base_path, include_patterns, exclude_patterns):
+        paths = {
+            str(path.as_posix())
+            for pattern in include_patterns
+            for path in base_path.glob(pattern)
+        }
+        for pattern in exclude_patterns:
+            pattern = (base_path / pattern).as_posix()
+            paths -= set(fnmatch.filter(paths, str(pattern)))
+        return cls(paths)
+
+    @staticmethod
+    def check_version():
+        try:
+            # cmake_format is part of the cmakelang package
+            import cmakelang
+        except ImportError:
+            raise ImportError(
+
+            )
+        # pin a specific version of cmake_format, must be updated in setup.py
+        if cmakelang.__version__ != "0.6.13":
+            raise LintValidationException(
+                f"Wrong version of cmake_format is detected. "
+                f"{_archery_install_msg}"
+            )
+
+    def check(self):
+        return self.run("-l", "error", "--check", *self.paths, check=False)
+
+    def fix(self):
+        return self.run("--in-place", *self.paths, check=False)
+
+
+def cmake_linter(src, fix=False):
+    """
+    Run cmake-format on all CMakeFiles.txt
+    """
+    logger.info("Running cmake-format linters")
+
+    cmake_format = CMakeFormat.from_patterns(
+        src.path,
+        include_patterns=[
+            'ci/**/*.cmake',
+            'cpp/CMakeLists.txt',
+            'cpp/src/**/CMakeLists.txt',
+            'cpp/cmake_modules/*.cmake',
+            'go/**/CMakeLists.txt',
+            'java/**/CMakeLists.txt',
+            'matlab/**/CMakeLists.txt',
+            'python/CMakeLists.txt',
+        ],
+        exclude_patterns=[
+            'cpp/cmake_modules/FindNumPy.cmake',
+            'cpp/cmake_modules/FindPythonLibsNew.cmake',
+            'cpp/cmake_modules/UseCython.cmake',
+            'cpp/src/arrow/util/config.h.cmake',
+        ]
+    )
+    method = cmake_format.fix if fix else cmake_format.check
+
+    yield LintResult.from_cmd(method())
+
+
+def python_linter(src, fix=False):
+    """Run Python linters on python/pyarrow, python/examples, setup.py
+    and dev/. """
+    setup_py = os.path.join(src.python, "setup.py")
+    setup_cfg = os.path.join(src.python, "setup.cfg")
+
+    logger.info("Running Python formatter (autopep8)")
+
+    autopep8 = Autopep8()
+    if not autopep8.available:
+        logger.error(
+            "Python formatter requested but autopep8 binary not found. "
+            f"{_archery_install_msg}")
+        return
+
+    # Gather files for autopep8
+    patterns = ["python/pyarrow/**/*.py",
+                "python/pyarrow/**/*.pyx",
+                "python/pyarrow/**/*.pxd",
+                "python/pyarrow/**/*.pxi",
+                "python/examples/**/*.py",
+                "dev/archery/**/*.py"]
+    files = [setup_py]
+    for pattern in patterns:
+        files += list(map(str, Path(src.path).glob(pattern)))
+
+    args = ['--global-config', setup_cfg, '--ignore-local-config']
+    if fix:
+        args += ['-j0', '--in-place']
+        args += sorted(files)
+        yield LintResult.from_cmd(autopep8(*args))
+    else:
+        # XXX `-j0` doesn't work well with `--exit-code`, so instead
+        # we capture the diff and check whether it's empty
+        # (https://github.com/hhatto/autopep8/issues/543)
+        args += ['-j0', '--diff']
+        args += sorted(files)
+        diff = autopep8.run_captured(*args)
+        if diff:
+            print(diff.decode('utf8'))
+            yield LintResult(success=False)
+        else:
+            yield LintResult(success=True)
+
+    # Run flake8 after autopep8 (the latter may have modified some files)
+    logger.info("Running Python linter (flake8)")
+
+    flake8 = Flake8()
+    if not flake8.available:
+        logger.error(
+            "Python linter requested but flake8 binary not found. "
+            f"{_archery_install_msg}")
+        return
+
+    flake8_exclude = ['.venv*']
+
+    yield LintResult.from_cmd(
+        flake8("--extend-exclude=" + ','.join(flake8_exclude),
+               setup_py, src.pyarrow, os.path.join(src.python, "examples"),
+               src.dev, check=False))
+    config = os.path.join(src.python, ".flake8.cython")
+    yield LintResult.from_cmd(
+        flake8("--config=" + config, src.pyarrow, check=False))
+
+
+def python_numpydoc(symbols=None, allow_rules=None, disallow_rules=None):
+    """Run numpydoc linter on python.
+
+    Pyarrow must be available for import.
+    """
+    logger.info("Running Python docstring linters")
+    # by default try to run on all pyarrow package
+    symbols = symbols or {
+        'pyarrow',
+        'pyarrow.compute',
+        'pyarrow.csv',
+        'pyarrow.dataset',
+        'pyarrow.feather',
+        'pyarrow.flight',
+        'pyarrow.fs',
+        'pyarrow.gandiva',
+        'pyarrow.ipc',
+        'pyarrow.json',
+        'pyarrow.orc',
+        'pyarrow.parquet',
+        'pyarrow.plasma',
+        'pyarrow.types',
+    }
+    try:
+        numpydoc = NumpyDoc(symbols)
+    except RuntimeError as e:
+        logger.error(str(e))
+        yield LintResult(success=False)
+        return
+
+    results = numpydoc.validate(
+        # limit the validation scope to the pyarrow package
+        from_package='pyarrow',
+        allow_rules=allow_rules,
+        disallow_rules=disallow_rules
+    )
+
+    if len(results) == 0:
+        yield LintResult(success=True)
+        return
+
+    number_of_violations = 0
+    for obj, result in results:
+        errors = result['errors']
+
+        # inspect doesn't play nice with cython generated source code,
+        # to use a hacky way to represent a proper __qualname__
+        doc = getattr(obj, '__doc__', '')
+        name = getattr(obj, '__name__', '')
+        qualname = getattr(obj, '__qualname__', '')
+        module = getattr(obj, '__module__', '')
+        instance = getattr(obj, '__self__', '')
+        if instance:
+            klass = instance.__class__.__name__
+        else:
+            klass = ''
+
+        try:
+            cython_signature = doc.splitlines()[0]
+        except Exception:
+            cython_signature = ''
+
+        desc = '.'.join(filter(None, [module, klass, qualname or name]))
+
+        click.echo()
+        click.echo(click.style(desc, bold=True, fg='yellow'))
+        if cython_signature:
+            qualname_with_signature = '.'.join([module, cython_signature])
+            click.echo(
+                click.style(
+                    '-> {}'.format(qualname_with_signature),
+                    fg='yellow'
+                )
+            )
+
+        for error in errors:
+            number_of_violations += 1
+            click.echo('{}: {}'.format(*error))
+
+    msg = 'Total number of docstring violations: {}'.format(
+        number_of_violations
+    )
+    click.echo()
+    click.echo(click.style(msg, fg='red'))
+
+    yield LintResult(success=False)
+
+
+def rat_linter(src, root):
+    """Run apache-rat license linter."""
+    logger.info("Running apache-rat linter")
+
+    if src.git_dirty:
+        logger.warn("Due to the usage of git-archive, uncommitted files will"
+                    " not be checked for rat violations. ")
+
+    exclusion = exclusion_from_globs(
+        os.path.join(src.dev, "release", "rat_exclude_files.txt"))
+
+    # Creates a git-archive of ArrowSources, apache-rat expects a gzip
+    # compressed tar archive.
+    archive_path = os.path.join(root, "apache-arrow.tar.gz")
+    src.archive(archive_path, compressor=gzip.compress)
+    report = Rat().report(archive_path)
+
+    violations = list(report.validate(exclusion=exclusion))
+    for violation in violations:
+        print("apache-rat license violation: {}".format(violation))
+
+    yield LintResult(len(violations) == 0)
+
+
+def r_linter(src):
+    """Run R linter."""
+    logger.info("Running R linter")
+    r_lint_sh = os.path.join(src.r, "lint.sh")
+    yield LintResult.from_cmd(Bash().run(r_lint_sh, check=False))
+
+
+class Hadolint(Command):
+    def __init__(self, hadolint_bin=None):
+        self.bin = default_bin(hadolint_bin, "hadolint")
+
+
+def is_docker_image(path):
+    dirname = os.path.dirname(path)
+    filename = os.path.basename(path)
+
+    excluded = dirname.startswith(
+        "dev") or dirname.startswith("python/manylinux")
+
+    return filename.startswith("Dockerfile") and not excluded
+
+
+def docker_linter(src):
+    """Run Hadolint docker linter."""
+    logger.info("Running Docker linter")
+
+    hadolint = Hadolint()
+
+    if not hadolint.available:
+        logger.error(
+            "hadolint linter requested but hadolint binary not found.")
+        return
+
+    for path in git.ls_files(git_dir=src.path):
+        if is_docker_image(path):
+            yield LintResult.from_cmd(hadolint.run(path, check=False,
+                                                   cwd=src.path))
+
+
+def linter(src, fix=False, *, clang_format=False, cpplint=False,
+           clang_tidy=False, iwyu=False, iwyu_all=False,
+           python=False, numpydoc=False, cmake_format=False, rat=False,
+           r=False, docker=False):
+    """Run all linters."""
+    with tmpdir(prefix="arrow-lint-") as root:
+        build_dir = os.path.join(root, "cpp-build")
+
+        # Linters yield LintResult without raising exceptions on failure.
+        # This allows running all linters in one pass and exposing all
+        # errors to the user.
+        results = []
+
+        if clang_format or cpplint or clang_tidy or iwyu:
+            results.extend(cpp_linter(src, build_dir,
+                                      clang_format=clang_format,
+                                      cpplint=cpplint,
+                                      clang_tidy=clang_tidy,
+                                      iwyu=iwyu,
+                                      iwyu_all=iwyu_all,
+                                      fix=fix))
+
+        if python:
+            results.extend(python_linter(src, fix=fix))
+
+        if numpydoc:
+            results.extend(python_numpydoc())
+
+        if cmake_format:
+            results.extend(cmake_linter(src, fix=fix))
+
+        if rat:
+            results.extend(rat_linter(src, root))
+
+        if r:
+            results.extend(r_linter(src))
+
+        if docker:
+            results.extend(docker_linter(src))
+
+        # Raise error if one linter failed, ensuring calling code can exit with
+        # non-zero.
+        for result in results:
+            result.ok()
diff --git a/src/arrow/dev/archery/archery/utils/logger.py b/src/arrow/dev/archery/archery/utils/logger.py
new file mode 100644
index 000000000..9d0feda88
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/logger.py
@@ -0,0 +1,29 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import logging
+
+""" Global logger. """
+logger = logging.getLogger("archery")
+
+
+class LoggingContext:
+    def __init__(self, quiet=False):
+        self.quiet = quiet
+
+
+ctx = LoggingContext()
diff --git a/src/arrow/dev/archery/archery/utils/maven.py b/src/arrow/dev/archery/archery/utils/maven.py
new file mode 100644
index 000000000..96a3bf5bd
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/maven.py
@@ -0,0 +1,204 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+
+from .command import Command, default_bin
+
+
+class Maven(Command):
+    def __init__(self, maven_bin=None):
+        self.bin = default_bin(maven_bin, "mvn")
+
+
+maven = Maven()
+
+
+class MavenDefinition:
+    """ MavenDefinition captures the maven invocation arguments.
+
+    It allows creating build directories with the same definition, e.g.
+    ```
+    build_1 = maven_def.build("/tmp/build-1")
+    build_2 = maven_def.build("/tmp/build-2")
+
+    ...
+
+    build1.install()
+    build2.install()
+    """
+
+    def __init__(self, source, build_definitions=None,
+                 benchmark_definitions=None, env=None):
+        """ Initialize a MavenDefinition
+
+        Parameters
+        ----------
+        source : str
+                 Source directory where the top-level pom.xml is
+                 located. This is usually the root of the project.
+        build_definitions: list(str), optional
+        benchmark_definitions: list(str), optional
+        """
+        self.source = os.path.abspath(source)
+        self.build_definitions = build_definitions if build_definitions else []
+        self.benchmark_definitions =\
+            benchmark_definitions if benchmark_definitions else []
+        self.env = env
+
+    @property
+    def build_arguments(self):
+        """" Return the arguments to maven invocation for build. """
+        arguments = self.build_definitions + [
+            "-B", "-DskipTests", "-Drat.skip=true",
+            "-Dorg.slf4j.simpleLogger.log.org.apache.maven.cli.transfer."
+            "Slf4jMavenTransferListener=warn",
+            "-T", "2C", "install"
+        ]
+        return arguments
+
+    def build(self, build_dir, force=False, cmd_kwargs=None, **kwargs):
+        """ Invoke maven into a build directory.
+
+        Parameters
+        ----------
+        build_dir : str
+                    Directory in which the Maven build will be instantiated.
+        force : bool
+                not used now
+        """
+        if os.path.exists(build_dir):
+            # Extra safety to ensure we're deleting a build folder.
+            if not MavenBuild.is_build_dir(build_dir):
+                raise FileExistsError(
+                    "{} is not a maven build".format(build_dir)
+                )
+
+        cmd_kwargs = cmd_kwargs if cmd_kwargs else {}
+        assert MavenBuild.is_build_dir(build_dir)
+        maven(*self.build_arguments, cwd=build_dir, env=self.env, **cmd_kwargs)
+        return MavenBuild(build_dir, definition=self, **kwargs)
+
+    @property
+    def list_arguments(self):
+        """" Return the arguments to maven invocation for list """
+        arguments = [
+            "-Dskip.perf.benchmarks=false", "-Dbenchmark.list=-lp", "install"
+        ]
+        return arguments
+
+    @property
+    def benchmark_arguments(self):
+        """" Return the arguments to maven invocation for benchmark """
+        arguments = self.benchmark_definitions + [
+            "-Dskip.perf.benchmarks=false", "-Dbenchmark.fork=1",
+            "-Dbenchmark.jvmargs=\"-Darrow.enable_null_check_for_get=false "
+            "-Darrow.enable_unsafe_memory_access=true\"",
+            "install"
+        ]
+        return arguments
+
+    def __repr__(self):
+        return "MavenDefinition[source={}]".format(self.source)
+
+
+class MavenBuild(Maven):
+    """ MavenBuild represents a build directory initialized by maven.
+
+    The build instance can be used to build/test/install. It alleviates the
+    user to know which generator is used.
+    """
+
+    def __init__(self, build_dir, definition=None):
+        """ Initialize a MavenBuild.
+
+        The caller must ensure that maven was invoked in the build directory.
+
+        Parameters
+        ----------
+        definition : MavenDefinition
+                     The definition to build from.
+        build_dir : str
+                    The build directory to setup into.
+        """
+        assert MavenBuild.is_build_dir(build_dir)
+        super().__init__()
+        self.build_dir = os.path.abspath(build_dir)
+        self.definition = definition
+
+    @property
+    def binaries_dir(self):
+        return self.build_dir
+
+    def run(self, *argv, verbose=False, cwd=None, **kwargs):
+        extra = []
+        if verbose:
+            extra.append("-X")
+        if cwd is None:
+            cwd = self.build_dir
+        # Commands must be ran under the directory where pom.xml exists
+        return super().run(*extra, *argv, **kwargs, cwd=cwd)
+
+    def build(self, *argv, verbose=False, **kwargs):
+        definition_args = self.definition.build_arguments
+        cwd = self.binaries_dir
+        return self.run(*argv, *definition_args, verbose=verbose, cwd=cwd,
+                        env=self.definition.env, **kwargs)
+
+    def list(self, *argv, verbose=False, **kwargs):
+        definition_args = self.definition.list_arguments
+        cwd = self.binaries_dir + "/performance"
+        return self.run(*argv, *definition_args, verbose=verbose, cwd=cwd,
+                        env=self.definition.env, **kwargs)
+
+    def benchmark(self, *argv, verbose=False, **kwargs):
+        definition_args = self.definition.benchmark_arguments
+        cwd = self.binaries_dir + "/performance"
+        return self.run(*argv, *definition_args, verbose=verbose, cwd=cwd,
+                        env=self.definition.env, **kwargs)
+
+    @staticmethod
+    def is_build_dir(path):
+        """ Indicate if a path is Maven top directory.
+
+        This method only checks for the existence of paths and does not do any
+        validation whatsoever.
+        """
+        pom_xml = os.path.join(path, "pom.xml")
+        performance_dir = os.path.join(path, "performance")
+        return os.path.exists(pom_xml) and os.path.isdir(performance_dir)
+
+    @staticmethod
+    def from_path(path):
+        """ Instantiate a Maven from a path.
+
+        This is used to recover from an existing physical directory (created
+        with or without Maven).
+
+        Note that this method is not idempotent as the original definition will
+        be lost.
+        """
+        if not MavenBuild.is_build_dir(path):
+            raise ValueError("Not a valid MavenBuild path: {}".format(path))
+
+        return MavenBuild(path, definition=None)
+
+    def __repr__(self):
+        return ("MavenBuild["
+                "build = {},"
+                "definition = {}]".format(self.build_dir,
+                                          self.definition))
diff --git a/src/arrow/dev/archery/archery/utils/rat.py b/src/arrow/dev/archery/archery/utils/rat.py
new file mode 100644
index 000000000..e7fe19a7e
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/rat.py
@@ -0,0 +1,70 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import fnmatch
+import re
+from xml.etree import ElementTree
+
+from ..lang.java import Jar
+from .cache import Cache
+from .command import capture_stdout
+
+RAT_VERSION = 0.13
+RAT_JAR_FILENAME = "apache-rat-{}.jar".format(RAT_VERSION)
+RAT_URL_ = "https://repo1.maven.org/maven2/org/apache/rat/apache-rat"
+RAT_URL = "/".join([RAT_URL_, str(RAT_VERSION), RAT_JAR_FILENAME])
+
+
+class Rat(Jar):
+    def __init__(self):
+        jar = Cache().get_or_insert_from_url(RAT_JAR_FILENAME, RAT_URL)
+        Jar.__init__(self, jar)
+
+    @capture_stdout(strip=False)
+    def run_report(self, archive_path, **kwargs):
+        return self.run("--xml", archive_path, **kwargs)
+
+    def report(self, archive_path, **kwargs):
+        return RatReport(self.run_report(archive_path, **kwargs))
+
+
+def exclusion_from_globs(exclusions_path):
+    with open(exclusions_path, 'r') as exclusions_fd:
+        exclusions = [e.strip() for e in exclusions_fd]
+        return lambda path: any([fnmatch.fnmatch(path, e) for e in exclusions])
+
+
+class RatReport:
+    def __init__(self, xml):
+        self.xml = xml
+        self.tree = ElementTree.fromstring(xml)
+
+    def __repr__(self):
+        return "RatReport({})".format(self.xml)
+
+    def validate(self, exclusion=None):
+        for r in self.tree.findall('resource'):
+            approvals = r.findall('license-approval')
+            if not approvals or approvals[0].attrib['name'] == 'true':
+                continue
+
+            clean_name = re.sub('^[^/]+/', '', r.attrib['name'])
+
+            if exclusion and exclusion(clean_name):
+                continue
+
+            yield clean_name
diff --git a/src/arrow/dev/archery/archery/utils/report.py b/src/arrow/dev/archery/archery/utils/report.py
new file mode 100644
index 000000000..6c7587ddd
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/report.py
@@ -0,0 +1,64 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from abc import ABCMeta, abstractmethod
+import datetime
+
+import jinja2
+
+
+def markdown_escape(s):
+    for char in ('*', '#', '_', '~', '`', '>'):
+        s = s.replace(char, '\\' + char)
+    return s
+
+
+class Report(metaclass=ABCMeta):
+
+    def __init__(self, **kwargs):
+        for field in self.fields:
+            if field not in kwargs:
+                raise ValueError('Missing keyword argument {}'.format(field))
+        self._data = kwargs
+
+    def __getattr__(self, key):
+        return self._data[key]
+
+    @abstractmethod
+    def fields(self):
+        pass
+
+    @property
+    @abstractmethod
+    def templates(self):
+        pass
+
+
+class JinjaReport(Report):
+
+    def __init__(self, **kwargs):
+        self.env = jinja2.Environment(
+            loader=jinja2.PackageLoader('archery', 'templates')
+        )
+        self.env.filters['md'] = markdown_escape
+        self.env.globals['today'] = datetime.date.today
+        super().__init__(**kwargs)
+
+    def render(self, template_name):
+        template_path = self.templates[template_name]
+        template = self.env.get_template(template_path)
+        return template.render(**self._data)
diff --git a/src/arrow/dev/archery/archery/utils/source.py b/src/arrow/dev/archery/archery/utils/source.py
new file mode 100644
index 000000000..1080cb75d
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/source.py
@@ -0,0 +1,211 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import os
+from pathlib import Path
+import subprocess
+
+from .git import git
+
+
+class InvalidArrowSource(Exception):
+    pass
+
+
+class ArrowSources:
+    """ ArrowSources is a companion class representing a directory containing
+    Apache Arrow's sources.
+    """
+    # Note that WORKSPACE is a reserved git revision name by this module to
+    # reference the current git workspace. In other words, this indicates to
+    # ArrowSources.at_revision that no cloning/checkout is required.
+    WORKSPACE = "WORKSPACE"
+
+    def __init__(self, path):
+        """ Initialize an ArrowSources
+
+        The caller must ensure that path is valid arrow source directory (can
+        be checked with ArrowSources.valid)
+
+        Parameters
+        ----------
+        path : src
+        """
+        path = Path(path)
+        # validate by checking a specific path in the arrow source tree
+        if not (path / 'cpp' / 'CMakeLists.txt').exists():
+            raise InvalidArrowSource(
+                "No Arrow C++ sources found in {}.".format(path)
+            )
+        self.path = path
+
+    @property
+    def archery(self):
+        """ Returns the archery directory of an Arrow sources. """
+        return self.dev / "archery"
+
+    @property
+    def cpp(self):
+        """ Returns the cpp directory of an Arrow sources. """
+        return self.path / "cpp"
+
+    @property
+    def dev(self):
+        """ Returns the dev directory of an Arrow sources. """
+        return self.path / "dev"
+
+    @property
+    def java(self):
+        """ Returns the java directory of an Arrow sources. """
+        return self.path / "java"
+
+    @property
+    def python(self):
+        """ Returns the python directory of an Arrow sources. """
+        return self.path / "python"
+
+    @property
+    def pyarrow(self):
+        """ Returns the python/pyarrow directory of an Arrow sources. """
+        return self.python / "pyarrow"
+
+    @property
+    def r(self):
+        """ Returns the r directory of an Arrow sources. """
+        return self.path / "r"
+
+    @property
+    def git_backed(self):
+        """ Indicate if the sources are backed by git. """
+        return (self.path / ".git").exists()
+
+    @property
+    def git_dirty(self):
+        """ Indicate if the sources is a dirty git directory. """
+        return self.git_backed and git.dirty(git_dir=self.path)
+
+    def archive(self, path, dereference=False, compressor=None, revision=None):
+        """ Saves a git archive at path. """
+        if not self.git_backed:
+            raise ValueError("{} is not backed by git".format(self))
+
+        rev = revision if revision else "HEAD"
+        archive = git.archive("--prefix=apache-arrow/", rev,
+                              git_dir=self.path)
+
+        # TODO(fsaintjacques): fix dereference for
+
+        if compressor:
+            archive = compressor(archive)
+
+        with open(path, "wb") as archive_fd:
+            archive_fd.write(archive)
+
+    def at_revision(self, revision, clone_dir):
+        """ Return a copy of the current sources for a specified git revision.
+
+        This method may return the current object if no checkout is required.
+        The caller is responsible to remove the cloned repository directory.
+
+        The user can use the special WORKSPACE token to mean the current git
+        workspace (no checkout performed).
+
+        The second value of the returned tuple indicates if a clone was
+        performed.
+
+        Parameters
+        ----------
+        revision : str
+                   Revision to checkout sources at.
+        clone_dir : str
+                    Path to checkout the local clone.
+        """
+        if not self.git_backed:
+            raise ValueError("{} is not backed by git".format(self))
+
+        if revision == ArrowSources.WORKSPACE:
+            return self, False
+
+        # A local clone is required to leave the current sources intact such
+        # that builds depending on said sources are not invalidated (or worse
+        # slightly affected when re-invoking the generator).
+        # "--local" only works when dest dir is on same volume of source dir.
+        # "--shared" works even if dest dir is on different volume.
+        git.clone("--shared", self.path, clone_dir)
+
+        # Revision can reference "origin/" (or any remotes) that are not found
+        # in the local clone. Thus, revisions are dereferenced in the source
+        # repository.
+        original_revision = git.rev_parse(revision)
+
+        git.checkout(original_revision, git_dir=clone_dir)
+
+        return ArrowSources(clone_dir), True
+
+    @staticmethod
+    def find(path=None):
+        """ Infer Arrow sources directory from various method.
+
+        The following guesses are done in order until a valid match is found:
+
+        1. Checks the given optional parameter.
+
+        2. Checks if the environment variable `ARROW_SRC` is defined and use
+           this.
+
+        3. Checks if the current working directory (cwd) is an Arrow source
+           directory.
+
+        4. Checks if this file (cli.py) is still in the original source
+           repository. If so, returns the relative path to the source
+           directory.
+        """
+
+        # Explicit via environment
+        env = os.environ.get("ARROW_SRC")
+
+        # Implicit via cwd
+        cwd = Path.cwd()
+
+        # Implicit via current file
+        try:
+            this = Path(__file__).parents[4]
+        except IndexError:
+            this = None
+
+        # Implicit via git repository (if archery is installed system wide)
+        try:
+            repo = git.repository_root(git_dir=cwd)
+        except subprocess.CalledProcessError:
+            # We're not inside a git repository.
+            repo = None
+
+        paths = list(filter(None, [path, env, cwd, this, repo]))
+        for p in paths:
+            try:
+                return ArrowSources(p)
+            except InvalidArrowSource:
+                pass
+
+        searched_paths = "\n".join([" - {}".format(p) for p in paths])
+        raise InvalidArrowSource(
+            "Unable to locate Arrow's source directory. "
+            "Searched paths are:\n{}".format(searched_paths)
+        )
+
+    def __repr__(self):
+        return self.path
diff --git a/src/arrow/dev/archery/archery/utils/tmpdir.py b/src/arrow/dev/archery/archery/utils/tmpdir.py
new file mode 100644
index 000000000..07d7355c8
--- /dev/null
+++ b/src/arrow/dev/archery/archery/utils/tmpdir.py
@@ -0,0 +1,28 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+from contextlib import contextmanager
+from tempfile import mkdtemp, TemporaryDirectory
+
+
+@contextmanager
+def tmpdir(preserve=False, prefix="arrow-archery-"):
+    if preserve:
+        yield mkdtemp(prefix=prefix)
+    else:
+        with TemporaryDirectory(prefix=prefix) as tmp:
+            yield tmp
diff --git a/src/arrow/dev/archery/conftest.py b/src/arrow/dev/archery/conftest.py
new file mode 100644
index 000000000..06a643bea
--- /dev/null
+++ b/src/arrow/dev/archery/conftest.py
@@ -0,0 +1,70 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import pathlib
+
+import pytest
+
+
+def pytest_addoption(parser):
+    parser.addoption(
+        "--enable-integration",
+        action="store_true",
+        default=False,
+        help="run slow tests"
+    )
+
+
+def pytest_configure(config):
+    config.addinivalue_line(
+        "markers",
+        (
+            "integration: mark test as integration tests involving more "
+            "extensive setup (only used for crossbow at the moment)"
+        )
+    )
+
+
+def pytest_collection_modifyitems(config, items):
+    if config.getoption("--enable-integration"):
+        return
+    marker = pytest.mark.skip(reason="need --enable-integration option to run")
+    for item in items:
+        if "integration" in item.keywords:
+            item.add_marker(marker)
+
+
+@pytest.fixture
+def load_fixture(request):
+    current_test_directory = pathlib.Path(request.node.fspath).parent
+
+    def decoder(path):
+        with path.open('r') as fp:
+            if path.suffix == '.json':
+                import json
+                return json.load(fp)
+            elif path.suffix == '.yaml':
+                import yaml
+                return yaml.load(fp)
+            else:
+                return fp.read()
+
+    def loader(name, decoder=decoder):
+        path = current_test_directory / 'fixtures' / name
+        return decoder(path)
+
+    return loader
diff --git a/src/arrow/dev/archery/generate_files_for_endian_test.sh b/src/arrow/dev/archery/generate_files_for_endian_test.sh
new file mode 100755
index 000000000..ba3ce9f16
--- /dev/null
+++ b/src/arrow/dev/archery/generate_files_for_endian_test.sh
@@ -0,0 +1,43 @@
+#!/usr/bin/env bash
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+# This script generates json and arrow files of each type (e.g. primitive) for integration endian test
+# Usage: generate_files_for_endian_test.sh
+#        ARROW_CPP_EXE_PATH : where Arrow C++ binaries can be found
+#        TMP_DIR            : where files will be generated
+
+set -e
+
+: ${ARROW_CPP_EXE_PATH:=/arrow/cpp/build/debug/}
+: ${TMP_DIR:=/tmp/arrow}
+
+json_dir=$TMP_DIR/arrow.$$
+mkdir -p $json_dir
+
+archery integration --stop-on-error --with-cpp=1 --tempdir=$json_dir
+
+for f in $json_dir/*.json ; do
+    $ARROW_CPP_EXE_PATH/arrow-json-integration-test -mode JSON_TO_ARROW -json $f -arrow ${f%.*}.arrow_file -integration true ;
+done
+for f in $json_dir/*.arrow_file ; do
+    $ARROW_CPP_EXE_PATH/arrow-file-to-stream $f > ${f%.*}.stream;
+done
+for f in $json_dir/*.json ; do
+    gzip $f ;
+done
+echo "The files are under $json_dir"
diff --git a/src/arrow/dev/archery/requirements.txt b/src/arrow/dev/archery/requirements.txt
new file mode 100644
index 000000000..0e1258adb
--- /dev/null
+++ b/src/arrow/dev/archery/requirements.txt
@@ -0,0 +1,4 @@
+click
+pygithub
+python-dotenv
+ruamel.yaml
diff --git a/src/arrow/dev/archery/setup.py b/src/arrow/dev/archery/setup.py
new file mode 100755
index 000000000..664807375
--- /dev/null
+++ b/src/arrow/dev/archery/setup.py
@@ -0,0 +1,59 @@
+#!/usr/bin/env python
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+import functools
+import operator
+import sys
+from setuptools import setup, find_packages
+
+if sys.version_info < (3, 6):
+    sys.exit('Python < 3.6 is not supported')
+
+# For pathlib.Path compatibility
+jinja_req = 'jinja2>=2.11'
+
+extras = {
+    'lint': ['numpydoc==1.1.0', 'autopep8', 'flake8', 'cmake_format==0.6.13'],
+    'benchmark': ['pandas'],
+    'docker': ['ruamel.yaml', 'python-dotenv'],
+    'release': [jinja_req, 'jira', 'semver', 'gitpython'],
+    'crossbow': ['github3.py', jinja_req, 'pygit2>=1.6.0', 'ruamel.yaml',
+                 'setuptools_scm'],
+    'crossbow-upload': ['github3.py', jinja_req, 'ruamel.yaml',
+                        'setuptools_scm'],
+}
+extras['bot'] = extras['crossbow'] + ['pygithub', 'jira']
+extras['all'] = list(set(functools.reduce(operator.add, extras.values())))
+
+setup(
+    name='archery',
+    version="0.1.0",
+    description='Apache Arrow Developers Tools',
+    url='http://github.com/apache/arrow',
+    maintainer='Arrow Developers',
+    maintainer_email='dev@arrow.apache.org',
+    packages=find_packages(),
+    include_package_data=True,
+    install_requires=['click>=7'],
+    tests_require=['pytest', 'responses'],
+    extras_require=extras,
+    entry_points='''
+        [console_scripts]
+        archery=archery.cli:archery
+    '''
+)
diff --git a/src/arrow/dev/benchmarking/.env b/src/arrow/dev/benchmarking/.env
new file mode 100644
index 000000000..7485f5866
--- /dev/null
+++ b/src/arrow/dev/benchmarking/.env
@@ -0,0 +1,18 @@
+# Licensed to the Apache Software Foundation (ASF) under one or more
+# contributor license agreements.  See the NOTICE file distributed with
+# this work for additional information regarding copyright ownership.
+# The ASF licenses this file to You under the Apache License, Version 2.0
+# (the "License"); you may not use this file except in compliance with
+# the License.  You may obtain a copy of the License at
+#
+#    http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+
+PG_USER=benchmark
+PG_PASS=benchmark
diff --git a/src/arrow/dev/benchmarking/.gitignore b/src/arrow/dev/benchmarking/.gitignore
new file mode 100644
index 000000000..cda00d658
--- /dev/null
+++ b/src/arrow/dev/benchmarking/.gitignore
@@ -0,0 +1 @@
+/machine.json
diff --git a/src/arrow/dev/benchmarking/Dockerfile b/src/arrow/dev/benchmarking/Dockerfile
new file mode 100644
index 000000000..f47033397
--- /dev/null
+++ b/src/arrow/dev/benchmarking/Dockerfile
@@ -0,0 +1,23 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+
+#   http://www.apache.org/licenses/LICENSE-2.0
+
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+FROM postgres:11-alpine
+
+# Any `.sh` and `.sql` files copied to the entrypoint directory
+# will be run during startup. See `docker-entrypoint.sh` in
+# https://github.com/docker-library/postgres/blob/master/11/alpine/
+COPY ddl/* /docker-entrypoint-initdb.d/
diff --git a/src/arrow/dev/benchmarking/README.md b/src/arrow/dev/benchmarking/README.md
new file mode 100644
index 000000000..c5ddd62e0
--- /dev/null
+++ b/src/arrow/dev/benchmarking/README.md
@@ -0,0 +1,255 @@
+<!--
+  ~ Licensed to the Apache Software Foundation (ASF) under one
+  ~ or more contributor license agreements.  See the NOTICE file
+  ~ distributed with this work for additional information
+  ~ regarding copyright ownership.  The ASF licenses this file
+  ~ to you under the Apache License, Version 2.0 (the
+  ~ "License"); you may not use this file except in compliance
+  ~ with the License.  You may obtain a copy of the License at
+  ~
+  ~   http://www.apache.org/licenses/LICENSE-2.0
+  ~
+  ~ Unless required by applicable law or agreed to in writing,
+  ~ software distributed under the License is distributed on an
+  ~ "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  ~ KIND, either express or implied.  See the License for the
+  ~ specific language governing permissions and limitations
+  ~ under the License.
+  -->
+
+
+> NOTE: For those deploying this database, Postgres does not by default use
+> UTF-8, however it is [required for the jsonb][pg-jsonb] format used in
+> some columns to always work. This [stackoverflow post][so-utf8] describes
+> how to do it for Amazon RDS. This [section of the docs][pg-charset]
+> states how to do it in general, i.e.: `initdb -E UTF8`.
+
+# Benchmark database
+
+This directory contains files related to the benchmark database.
+
+- 'ddl/\*.sql' contains the database definition.
+- 'examples/' contain code to test the database and demonstrate its use.
+- 'Dockerfile' and 'docker-compose.yml' are for developing benchmarks
+  against a testing database.
+- An auto-generated summary of views in the [Data model][./data_model.rst].
+
+## Setup
+
+To create a 'machine.json' file that will uniquely identify a computer for
+benchmark submission, run the provided shell script and fill in the prompts
+to identify the GPU.
+
+> NOTE: this does not work on VMs or Windows.
+
+```shell
+./make_machine_json.sh
+```
+
+Submit the machine details via http using the command
+
+> NOTE: This will only work if we have selected graphql as a client
+> and have it running in production or if during development
+> you have run `docker-compose up` to create and run both a
+> database Docker container and graphql client Docker container.
+
+```shell
+./graphql_submit.sh machine machine.json localhost:5000/graphql
+```
+
+or submit after starting up the psql client from this directory, using
+
+```
+\set content `cat machine.json`
+SELECT ingest_machine_view(:'content'::jsonb);
+```
+
+> NOTE: If you don't have a "machine.json" file generated,
+> use the example file "examples/machine.json" instead.
+
+## Local testing
+
+There is a file named "[.env][.env]" in this directory that is used by
+`docker-compose` to set up the postgres user and password for the
+local containers. Currently the name and password are both
+`benchmark`. This will be the password for the psql client as well.
+
+The Postgres Alpine image runs any added '\*.sql' and '\*.sh' scripts placed
+in '/docker-entrypoint-initdb.d/' during its startup script, so the local
+database will be set up automatically once the container is running.
+
+To start the containers, be sure to have [Docker installed][docker],
+and then run the following from this directory (arrow/dev/benchmarking).
+
+
+```
+docker-compose up
+```
+
+This will start a process that will show logs from both the running
+Postgres container and the running GraphQL container.
+To stop the running containers gracefully, background the process
+and run
+
+```
+docker-compose down
+fg  # To re-foreground the backgrounded process while it exits
+```
+
+You will still have the container images "benchmarking_pg",
+"graphile/postgraphile", and "postgres:11-alpine" on your
+computer. You should keep them if you want to run this again.
+If you don't, then remove them with the command:
+
+```
+docker rmi benchmarking_pg postgres:11-alpine graphile/postgraphile
+```
+
+### Postgres client
+
+The `psql` shell client is bundled with the PostgreSQL core distribution
+available from the [Postgres download page][postgres-downloads].
+Using the `PG_USER` defined in the `.env` file (currently "benchmark"),
+the command to connect to the container is:
+```shell
+psql -h localhost -p 5432 -U benchmark
+```
+There is an example script in [examples/example.sql](examples/example.sql) that
+runs some queries against the database. To run it in the psql client, type
+the following in the psql command-line interface:
+
+```
+\i examples/example.sql
+```
+
+#### Bulk ingestion using CSV
+
+An example CSV file for bulk ingestion is in
+[examples/benchmark_run_example.csv](examples/benchmark_run_example.csv).
+The columns are listed in the same order as they are defined, to avoid having
+to explicitly name every column in ingestion. The "id" column is left empty
+and will be automatically assigned on insert.
+
+To ingest the example CSV file from the command line,
+use the command below:
+
+```shell
+CSV='examples/benchmark_run_example.csv' && \
+psql -U benchmark -h localhost -p 5432 \
+ -c "\copy benchmark_run_view FROM '${CSV}' WITH (FORMAT csv, HEADER);"
+```
+
+#### Bulk ingestion using JSON
+
+To ingest the example JSON file using the psql client, use the command below.
+
+```
+\set content `cat examples/benchmark_example.json`
+SELECT ingest_benchmark_view(:'content'::jsonb);
+```
+
+### HTTP client
+
+This section requires an actual HTTP client to be up, either
+for the production database or via the testing setup.
+(See the [local testing section](#local-testing) for how to set it up).
+
+The 'graphile/postgraphile' container provides an HTTP interface
+to the database via two url routes:
+
+- A GraphiQL page ([localhost:5000/graphiql][graphiql])
+  to aid visual exploration of the data model.
+  (The `--watch` flag on the command line. Not recommended for production.)
+- An endpoint that receives POST requests only (localhost:5000/graphql).
+
+#### Ingestion
+
+The script [graphql_submit.sh](./graphql_submit.sh) simplifies submission
+to the database via curl. Examples:
+
+```shell
+./graphql_submit.sh benchmarks examples/benchmark_example.json 
+./graphql_submit.sh runs examples/benchmark_run_example.json
+```
+
+#### Querying
+
+The output of the query is a JSON object that is hard to read on the command line.
+Here is an example query in the shell:
+```shell
+curl -X POST \
+  -H "Content-Type: application/json"  \
+  --data '{"query": "{projectDetails{ projectName }}"}' \
+  localhost:5000/graphql
+```
+
+which (if you have previously run the "examples.sql" command) yields
+
+```
+{"data":{"projectDetails":{"projectName":"Apache Arrow"}}}
+```
+
+Here is an example query using Python:
+```python
+import json
+import requests
+
+uri = "http://localhost:5000/graphql"
+query = json.load(open("examples/graphql_query_environment_view.json"))
+response = requests.post(uri, json=query)
+message = "{benchmarkLanguage}: {languageImplementationVersion}, {dependencies}"
+
+for row in response.json()['data']['allEnvironmentViews']['edges']:
+    print(message.format(**row['node']))
+
+# result:
+#
+# Python: CPython 2.7, {"six":"","numpy":"1.14","other_lib":"1.0"}
+# Python: CPython 2.7, {"six":"","numpy":"1.15","other_lib":"1.0"}
+# Python: CPython 3.6, {"boost":"1.42","numpy":"1.15"}
+```
+
+## Deployment
+
+(work in progress).
+
+> NOTE: For those deploying this database, Postgres does not by default use
+> UTF-8, however it is [required for the jsonb][pg-jsonb] format used in
+> some columns to always work. This [stackoverflow post][so-utf8] describes
+> how to do it for Amazon RDS. This [section of the docs][pg-charset]
+> states how to do it in general, i.e.: `initdb -E UTF8`.
+
+
+## Quick reference
+
+- String variables `'have single quotes'`
+- Arrays `'{"have", "curly", "braces"}'::text[]` or `'{1, 2, 3}'::integer[]`
+- JSONb `'{"has":"this", "format":42}'::jsonb`
+- Elements inserted using JSON-formatted strings can use standard
+  JSON-formatted arrays (`[1, 2, 3]`) and do not have to use the above
+  string formats.
+- When comparing nullable values use `x IS NOT DISTINCT FROM y` rather than `x = y`
+- An auto-generated summary of the [Data model][./data_model.rst].
+
+## Data model documentation
+
+To recreate the data model documentation,
+(1) install the [psql client][postgres-downloads]
+(sorry you need to download the whole thing),
+(2) start the docker container using `docker-compose up`,
+(3) and then run these scripts:
+
+```
+./make_dotfile.sh
+./make_data_model_rst.sh
+```
+
+[pg-jsonb]: https://www.postgresql.org/docs/11/datatype-json.html#id-1.5.7.22.3
+[so-utf8]: https://stackoverflow.com/a/33557023
+[pg-charset]: https://www.postgresql.org/docs/9.3/multibyte.html#AEN34424
+[docker]: https://www.docker.com/get-started
+[citext-limitations]: https://www.postgresql.org/docs/11/citext.html#id-1.11.7.17.7
+[postgres-downloads]: https://www.postgresql.org/download/
+[graphiql]: http://localhost:5000/graphiql
+[postgraphile-lambda]: https://github.com/graphile/postgraphile-lambda-example
+[postgraphile-cli]: https://www.graphile.org/postgraphile/usage-cli/
diff --git a/src/arrow/dev/benchmarking/data_model.dot b/src/arrow/dev/benchmarking/data_model.dot
new file mode 100644
index 000000000..d311acd4e
--- /dev/null
+++ b/src/arrow/dev/benchmarking/data_model.dot
@@ -0,0 +1,219 @@
+/*
+ Licensed to the Apache Software Foundation (ASF) under one
+ or more contributor license agreements.See the NOTICE file
+ distributed with this work for additional information
+ regarding copyright ownership.The ASF licenses this file
+ to you under the Apache License, Version 2.0 (the
+ "License"); you may not use this file except in compliance
+ with the License.You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing,
+ software distributed under the License is distributed on an
+ "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+ KIND, either express or implied.See the License for the
+ specific language governing permissions and limitations
+ under the License.
+*/
+
+/*
+ WARNING
+   This is an auto-generated file. Please do not edit.
+
+   To reproduce, please run :code:`./make_data_model_rst.sh`.
+   (This requires you have the
+   `psql client <https://www.postgresql.org/download/>`_
+   and have started the docker containers using
+   :code:`docker-compose up`).
+*/
+digraph database {
+  concentrate = true;
+  rankdir = LR;
+  ratio = ".75";
+  node [shape = none, fontsize="11", fontname="Helvetica"];
+  edge [fontsize="8", fontname="Helvetica"];
+legend
+[fontsize = "14"
+label =
+<<table border="0" cellpadding="0">
+  <tr><td align="left"><font point-size="16">Legend</font></td></tr>
+  <tr><td align="left">pk = primary key</td></tr>
+  <tr><td align="left">fk = foreign key</td></tr>
+  <tr><td align="left">u = unique*</td></tr>
+  <tr><td align="left">o = optional</td></tr>
+  <tr><td align="left">* multiple uniques in the same table are a unique group</td></tr>
+</table>>
+];
+benchmark
+[label =
+  <<table border="0" cellborder="1" cellspacing="0" cellpadding="2">
+    <tr><td border="0"><font point-size="14">benchmark</font></td></tr>
+    <tr><td port="benchmark_id"><b>benchmark_id (pk)</b></td></tr>
+    <tr><td port="benchmark_language_id"><b>benchmark_language_id (pk)</b></td></tr>
+    <tr><td>benchmark_name (u)</td></tr>
+    <tr><td>parameter_names (o)</td></tr>
+    <tr><td>benchmark_description</td></tr>
+    <tr><td>benchmark_version (u)</td></tr>
+    <tr><td port="unit_id">unit_id (fk) </td></tr>
+  </table>>
+];
+benchmark_language
+[label =
+  <<table border="0" cellborder="1" cellspacing="0" cellpadding="2">
+    <tr><td border="0"><font point-size="14">benchmark_language</font></td></tr>
+    <tr><td port="benchmark_language_id"><b>benchmark_language_id (pk)</b></td></tr>
+    <tr><td>benchmark_language (u)</td></tr>
+  </table>>
+];
+benchmark_run
+[label =
+  <<table border="0" cellborder="1" cellspacing="0" cellpadding="2">
+    <tr><td border="0"><font point-size="14">benchmark_run</font></td></tr>
+    <tr><td port="benchmark_run_id"><b>benchmark_run_id (pk)</b></td></tr>
+    <tr><td>parameter_values (u)</td></tr>
+    <tr><td>value</td></tr>
+    <tr><td>git_commit_timestamp (u)</td></tr>
+    <tr><td>git_hash</td></tr>
+    <tr><td>val_min (o)</td></tr>
+    <tr><td>val_q1 (o)</td></tr>
+    <tr><td>val_q3 (o)</td></tr>
+    <tr><td>val_max (o)</td></tr>
+    <tr><td>std_dev</td></tr>
+    <tr><td>n_obs</td></tr>
+    <tr><td>run_timestamp (u)</td></tr>
+    <tr><td>run_metadata (o)</td></tr>
+    <tr><td>run_notes (o)</td></tr>
+    <tr><td port="machine_id">machine_id (u) (fk) </td></tr>
+    <tr><td port="environment_id">environment_id (u) (fk) </td></tr>
+    <tr><td port="language_implementation_version_id">language_implementation_version_id (fk) </td></tr>
+    <tr><td port="benchmark_language_id">benchmark_language_id (fk) </td></tr>
+    <tr><td port="benchmark_id">benchmark_id (u) (fk) </td></tr>
+  </table>>
+];
+benchmark_type
+[label =
+  <<table border="0" cellborder="1" cellspacing="0" cellpadding="2">
+    <tr><td border="0"><font point-size="14">benchmark_type</font></td></tr>
+    <tr><td port="benchmark_type_id"><b>benchmark_type_id (pk)</b></td></tr>
+    <tr><td>benchmark_type (u)</td></tr>
+    <tr><td>lessisbetter</td></tr>
+  </table>>
+];
+cpu
+[label =
+  <<table border="0" cellborder="1" cellspacing="0" cellpadding="2">
+    <tr><td border="0"><font point-size="14">cpu</font></td></tr>
+    <tr><td port="cpu_id"><b>cpu_id (pk)</b></td></tr>
+    <tr><td>cpu_model_name (u)</td></tr>
+    <tr><td>cpu_core_count</td></tr>
+    <tr><td>cpu_thread_count</td></tr>
+    <tr><td>cpu_frequency_max_hz</td></tr>
+    <tr><td>cpu_frequency_min_hz</td></tr>
+    <tr><td>cpu_l1d_cache_bytes</td></tr>
+    <tr><td>cpu_l1i_cache_bytes</td></tr>
+    <tr><td>cpu_l2_cache_bytes</td></tr>
+    <tr><td>cpu_l3_cache_bytes</td></tr>
+  </table>>
+];
+dependencies
+[label =
+  <<table border="0" cellborder="1" cellspacing="0" cellpadding="2">
+    <tr><td border="0"><font point-size="14">dependencies</font></td></tr>
+    <tr><td port="dependencies_id"><b>dependencies_id (pk)</b></td></tr>
+    <tr><td>dependencies (u)</td></tr>
+  </table>>
+];
+gpu
+[label =
+  <<table border="0" cellborder="1" cellspacing="0" cellpadding="2">
+    <tr><td border="0"><font point-size="14">gpu</font></td></tr>
+    <tr><td port="gpu_id"><b>gpu_id (pk)</b></td></tr>
+    <tr><td>gpu_information (u)</td></tr>
+    <tr><td>gpu_part_number</td></tr>
+    <tr><td>gpu_product_name</td></tr>
+  </table>>
+];
+language_implementation_version
+[label =
+  <<table border="0" cellborder="1" cellspacing="0" cellpadding="2">
+    <tr><td border="0"><font point-size="14">language_implementation_version</font></td></tr>
+    <tr><td port="language_implementation_version_id"><b>language_implementation_version_id (pk)</b></td></tr>
+    <tr><td port="benchmark_language_id"><b>benchmark_language_id (pk)</b></td></tr>
+    <tr><td>language_implementation_version (u)</td></tr>
+  </table>>
+];
+machine
+[label =
+  <<table border="0" cellborder="1" cellspacing="0" cellpadding="2">
+    <tr><td border="0"><font point-size="14">machine</font></td></tr>
+    <tr><td port="machine_id"><b>machine_id (pk)</b></td></tr>
+    <tr><td>machine_name</td></tr>
+    <tr><td>mac_address (u)</td></tr>
+    <tr><td>memory_bytes</td></tr>
+    <tr><td>cpu_actual_frequency_hz</td></tr>
+    <tr><td>machine_other_attributes (o)</td></tr>
+    <tr><td port="cpu_id">cpu_id (fk) </td></tr>
+    <tr><td port="gpu_id">gpu_id (fk) </td></tr>
+    <tr><td port="os_id">os_id (fk) </td></tr>
+  </table>>
+];
+os
+[label =
+  <<table border="0" cellborder="1" cellspacing="0" cellpadding="2">
+    <tr><td border="0"><font point-size="14">os</font></td></tr>
+    <tr><td port="os_id"><b>os_id (pk)</b></td></tr>
+    <tr><td>os_name (u)</td></tr>
+    <tr><td>architecture_name (u)</td></tr>
+    <tr><td>kernel_name (u)</td></tr>
+  </table>>
+];
+project
+[label =
+  <<table border="0" cellborder="1" cellspacing="0" cellpadding="2">
+    <tr><td border="0"><font point-size="14">project</font></td></tr>
+    <tr><td port="project_id"><b>project_id (pk)</b></td></tr>
+    <tr><td>project_name (u)</td></tr>
+    <tr><td>project_url (u)</td></tr>
+    <tr><td>repo_url (u)</td></tr>
+    <tr><td>last_changed</td></tr>
+  </table>>
+];
+unit
+[label =
+  <<table border="0" cellborder="1" cellspacing="0" cellpadding="2">
+    <tr><td border="0"><font point-size="14">unit</font></td></tr>
+    <tr><td port="unit_id"><b>unit_id (pk)</b></td></tr>
+    <tr><td>units (u)</td></tr>
+    <tr><td port="benchmark_type_id">benchmark_type_id (fk) </td></tr>
+  </table>>
+];
+environment
+[label =
+  <<table border="0" cellborder="1" cellspacing="0" cellpadding="2">
+    <tr><td border="0"><font point-size="14">environment</font></td></tr>
+    <tr><td port="environment_id"><b>environment_id (pk)</b></td></tr>
+    <tr><td port="language_implementation_version_id"><b>language_implementation_version_id (pk)</b></td></tr>
+    <tr><td port="benchmark_language_id"><b>benchmark_language_id (pk)</b></td></tr>
+    <tr><td port="dependencies_id">dependencies_id (u) (fk) </td></tr>
+  </table>>
+];
+machine:cpu_id -> cpu:cpu_id;
+machine:gpu_id -> gpu:gpu_id;
+machine:os_id -> os:os_id;
+benchmark:benchmark_language_id -> benchmark_language:benchmark_language_id;
+environment:benchmark_language_id -> benchmark_language:benchmark_language_id;
+language_implementation_version:benchmark_language_id -> benchmark_language:benchmark_language_id;
+environment:dependencies_id -> dependencies:dependencies_id;
+environment:benchmark_language_id -> language_implementation_version:benchmark_language_id;
+environment:language_implementation_version_id -> language_implementation_version:language_implementation_version_id;
+unit:benchmark_type_id -> benchmark_type:benchmark_type_id;
+benchmark_run:machine_id -> machine:machine_id;
+benchmark:unit_id -> unit:unit_id;
+benchmark_run:language_implementation_version_id -> environment:language_implementation_version_id;
+benchmark_run:benchmark_language_id -> environment:benchmark_language_id;
+benchmark_run:environment_id -> environment:environment_id;
+benchmark_run:benchmark_language_id -> benchmark:benchmark_language_id;
+benchmark_run:benchmark_id -> benchmark:benchmark_id;
+}
+
diff --git a/src/arrow/dev/benchmarking/data_model.rst b/src/arrow/dev/benchmarking/data_model.rst
new file mode 100644
index 000000000..d0f3dc7fc
--- /dev/null
+++ b/src/arrow/dev/benchmarking/data_model.rst
@@ -0,0 +1,373 @@
+.. Licensed to the Apache Software Foundation (ASF) under one
+.. or more contributor license agreements.  See the NOTICE file
+.. distributed with this work for additional information
+.. regarding copyright ownership.  The ASF licenses this file
+.. to you under the Apache License, Version 2.0 (the
+.. "License"); you may not use this file except in compliance
+.. with the License.  You may obtain a copy of the License at
+
+..   http://www.apache.org/licenses/LICENSE-2.0
+
+.. Unless required by applicable law or agreed to in writing,
+.. software distributed under the License is distributed on an
+.. "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+.. KIND, either express or implied.  See the License for the
+.. specific language governing permissions and limitations
+.. under the License.
+
+
+.. WARNING
+..   This is an auto-generated file. Please do not edit.
+
+..   To reproduce, please run :code:`./make_data_model_rst.sh`.
+..   (This requires you have the
+..   `psql client <https://www.postgresql.org/download/>`_
+..   and have started the docker containers using
+..   :code:`docker-compose up`).
+
+
+.. _benchmark-data-model:
+
+Benchmark data model
+====================
+
+
+.. graphviz:: data_model.dot
+
+
+.. _benchmark-ingestion:
+
+Benchmark ingestion helper functions
+====================================
+
+ingest_benchmark_run_view
+-------------------------
+
+:code:`ingest_benchmark_run_view(from_jsonb jsonb)`
+
+The argument is a JSON object. NOTE: key names must be entirely
+lowercase, or the insert will fail. Extra key-value pairs are ignored.
+Example::
+
+  [
+    {
+      "benchmark_name": "Benchmark 2",
+      "benchmark_version": "version 0",
+      "parameter_values": {"arg0": 100, "arg1": 5},
+      "value": 2.5,
+      "git_commit_timestamp": "2019-02-08 22:35:53 +0100",
+      "git_hash": "324d3cf198444a",
+      "val_min": 1,
+      "val_q1": 2,
+      "val_q3": 3,
+      "val_max": 4,
+      "std_dev": 1.41,
+      "n_obs": 8,
+      "run_timestamp": "2019-02-14 03:00:05 -0600",
+      "mac_address": "08:00:2b:01:02:03",
+      "benchmark_language": "Python",
+      "language_implementation_version": "CPython 2.7",
+      "dependencies": {"six": "", "numpy": "1.14", "other_lib": "1.0"}
+    },
+    {
+      "benchmark_name": "Benchmark 2",
+      "benchmark_version": "version 0",
+      "parameter_values": {"arg0": 1000, "arg1": 5},
+      "value": 5,
+      "git_commit_timestamp": "2019-02-08 22:35:53 +0100",
+      "git_hash": "324d3cf198444a",
+      "std_dev": 3.14,
+      "n_obs": 8,
+      "run_timestamp": "2019-02-14 03:00:10 -0600",
+      "mac_address": "08:00:2b:01:02:03",
+      "benchmark_language": "Python",
+      "language_implementation_version": "CPython 2.7",
+      "dependencies": {"six": "", "numpy": "1.14", "other_lib": "1.0"}
+    }
+  ]
+To identify which columns in "benchmark_run_view" are required,
+please see the view documentation in :ref:`benchmark-data-model`.
+
+
+
+back to `Benchmark data model <benchmark-data-model>`_
+
+
+ingest_benchmark_view
+---------------------
+
+:code:`ingest_benchmark_view(from_jsonb jsonb)`
+
+The argument is a JSON object. NOTE: key names must be entirely
+lowercase, or the insert will fail. Extra key-value pairs are ignored.
+Example::
+
+  [
+    {
+      "benchmark_name": "Benchmark 1",
+      "parameter_names": ["arg0", "arg1", "arg2"],
+      "benchmark_description": "First benchmark",
+      "benchmark_type": "Time",
+      "units": "miliseconds",
+      "lessisbetter": true,
+      "benchmark_version": "second version",
+      "benchmark_language": "Python"
+    },
+    {
+      "benchmark_name": "Benchmark 2",
+      "parameter_names": ["arg0", "arg1"],
+      "benchmark_description": "Description 2.",
+      "benchmark_type": "Time",
+      "units": "nanoseconds",
+      "lessisbetter": true,
+      "benchmark_version": "second version",
+      "benchmark_language": "Python"
+    }
+  ]
+
+To identify which columns in "benchmark_view" are required,
+please see the view documentation in :ref:`benchmark-data-model`.
+
+
+
+back to `Benchmark data model <benchmark-data-model>`_
+
+
+ingest_benchmark_runs_with_context
+----------------------------------
+
+:code:`ingest_benchmark_runs_with_context(from_jsonb jsonb)`
+
+The argument is a JSON object. NOTE: key names must be entirely
+lowercase, or the insert will fail. Extra key-value pairs are ignored.
+The object contains three key-value pairs::
+
+    {"context": {
+        "mac_address": "08:00:2b:01:02:03",
+        "benchmark_language": "Python",
+        "language_implementation_version": "CPython 3.6",
+        "dependencies": {"six": "", "numpy": "1.14", "other_lib": "1.0"},
+        "git_commit_timestamp": "2019-02-14 22:42:22 +0100",
+        "git_hash": "123456789abcde",
+        "run_timestamp": "2019-02-14 03:00:40 -0600",
+        "extra stuff": "does not hurt anything and will not be added."
+      },
+     "benchmark_version": {
+        "Benchmark Name 1": "Any string can be a version.",
+        "Benchmark Name 2": "A git hash can be a version.",
+        "An Unused Benchmark Name": "Will be ignored."
+      },
+     "benchmarks": [
+        {
+          "benchmark_name": "Benchmark Name 1",
+          "parameter_values": {"argument1": 1, "argument2": "value2"},
+          "value": 42,
+          "val_min": 41.2,
+          "val_q1":  41.5,
+          "val_q3":  42.5,
+          "val_max": 42.8,
+          "std_dev": 0.5,
+          "n_obs": 100,
+          "run_metadata": {"any": "key-value pairs"},
+          "run_notes": "Any relevant notes."
+        },
+        {
+          "benchmark_name": "Benchmark Name 2",
+          "parameter_values": {"not nullable": "Use {} if no params."},
+          "value": 8,
+          "std_dev": 1,
+          "n_obs": 2,
+        }
+      ]
+    }
+
+- The entry for "context" contains the machine, environment, and timestamp
+  information common to all of the runs
+- The entry for "benchmark_version" maps benchmark
+  names to their version strings. (Which can be a git hash,
+  the entire code string, a number, or any other string of your choice.)
+- The entry for "benchmarks" is a list of benchmark run data
+  for the given context and benchmark versions. The first example
+  benchmark run entry contains all possible values, even
+  nullable ones, and the second entry omits all nullable values.
+
+
+
+
+back to `Benchmark data model <benchmark-data-model>`_
+
+
+ingest_machine_view
+-------------------
+
+:code:`ingest_machine_view(from_jsonb jsonb)`
+
+The argument is a JSON object. NOTE: key names must be entirely
+lowercase, or the insert will fail. Extra key-value pairs are ignored.
+Example::
+
+  {
+    "mac_address": "0a:00:2d:01:02:03",
+    "machine_name": "Yet-Another-Machine-Name",
+    "memory_bytes": 8589934592,
+    "cpu_actual_frequency_hz": 2300000000,
+    "os_name": "OSX",
+    "architecture_name": "x86_64",
+    "kernel_name": "18.2.0",
+    "cpu_model_name": "Intel(R) Core(TM) i5-7360U CPU @ 2.30GHz",
+    "cpu_core_count": 2,
+    "cpu_thread_count": 4,
+    "cpu_frequency_max_hz": 2300000000,
+    "cpu_frequency_min_hz": 2300000000,
+    "cpu_l1d_cache_bytes": 32768,
+    "cpu_l1i_cache_bytes": 32768,
+    "cpu_l2_cache_bytes": 262144,
+    "cpu_l3_cache_bytes": 4194304,
+    "machine_other_attributes": {"just": "an example"},
+    "gpu_information": "",
+    "gpu_part_number": "",
+    "gpu_product_name": ""
+  }
+
+To identify which columns in "machine_view" are required,
+please see the view documentation in :ref:`benchmark-data-model`.
+
+
+
+back to `Benchmark data model <benchmark-data-model>`_
+
+
+
+.. _benchmark-views:
+
+Benchmark views
+===============
+
+
+benchmark_run_view
+------------------
+
+Each benchmark run.
+
+- Each entry is unique on the machine, environment, benchmark,
+  and git commit timestamp.
+
+===============================  ===========  ========  ===========  ===========
+Column                           Type         Nullable  Default      Description
+===============================  ===========  ========  ===========  ===========
+benchmark_run_id                 int8         not null  serial       primary key
+benchmark_name                   citext       not null               unique
+benchmark_version                citext       not null               unique
+parameter_values                 jsonb        not null  '{}'::jsonb  unique
+value                            numeric      not null
+git_commit_timestamp             timestamptz  not null               unique
+git_hash                         text         not null
+val_min                          numeric
+val_q1                           numeric
+val_q3                           numeric
+val_max                          numeric
+std_dev                          numeric      not null
+n_obs                            int4         not null
+run_timestamp                    timestamptz  not null               unique
+run_metadata                     jsonb
+run_notes                        text
+mac_address                      macaddr      not null               unique
+benchmark_language               citext       not null               unique
+language_implementation_version  citext       not null  ''::citext   unique
+dependencies                     jsonb        not null  '{}'::jsonb  unique
+===============================  ===========  ========  ===========  ===========
+
+back to `Benchmark data model <benchmark-data-model>`_
+
+benchmark_view
+--------------
+
+The details about a particular benchmark.
+
+- "benchmark_name" is unique for a given "benchmark_language"
+- Each entry is unique on
+  ("benchmark_language", "benchmark_name", "benchmark_version")
+
+=====================  ======  ========  =======  ===========
+Column                 Type    Nullable  Default  Description
+=====================  ======  ========  =======  ===========
+benchmark_id           int4    not null  serial   primary key
+benchmark_name         citext  not null           unique
+parameter_names        _text
+benchmark_description  text    not null
+benchmark_type         citext  not null           unique
+units                  citext  not null           unique
+lessisbetter           bool    not null
+benchmark_version      citext  not null           unique
+benchmark_language     citext  not null           unique
+=====================  ======  ========  =======  ===========
+
+back to `Benchmark data model <benchmark-data-model>`_
+
+environment_view
+----------------
+
+The build environment used for a reported benchmark run.
+(Will be inferred from each "benchmark_run" if not explicitly added).
+
+- Each entry is unique on
+  ("benchmark_language", "language_implementation_version", "dependencies")
+- "benchmark_language" is unique in the "benchmark_language" table
+- "benchmark_language" plus "language_implementation_version" is unique in
+  the "language_implementation_version" table
+- "dependencies" is unique in the "dependencies" table
+
+===============================  ======  ========  ===========  ===========
+Column                           Type    Nullable  Default      Description
+===============================  ======  ========  ===========  ===========
+environment_id                   int4    not null  serial       primary key
+benchmark_language               citext  not null               unique
+language_implementation_version  citext  not null  ''::citext   unique
+dependencies                     jsonb   not null  '{}'::jsonb  unique
+===============================  ======  ========  ===========  ===========
+
+back to `Benchmark data model <benchmark-data-model>`_
+
+machine_view
+------------
+
+The machine environment (CPU, GPU, OS) used for each benchmark run.
+
+- "mac_address" is unique in the "machine" table
+- "gpu_part_number" is unique in the "gpu" (graphics processing unit) table
+  Empty string (''), not null, is used for machines that won't use the GPU
+- "cpu_model_name" is unique in the "cpu" (central processing unit) table
+- "os_name", "os_architecture_name", and "os_kernel_name"
+  are unique in the "os" (operating system) table
+- "machine_other_attributes" is a key-value store for any other relevant
+  data, e.g. '{"hard_disk_type": "solid state"}'
+
+========================  =======  ========  ==========  ===========
+Column                    Type     Nullable  Default     Description
+========================  =======  ========  ==========  ===========
+machine_id                int4     not null  serial      primary key
+mac_address               macaddr  not null              unique
+machine_name              citext   not null
+memory_bytes              int8     not null
+cpu_actual_frequency_hz   int8     not null
+os_name                   citext   not null              unique
+architecture_name         citext   not null              unique
+kernel_name               citext   not null  ''::citext  unique
+cpu_model_name            citext   not null              unique
+cpu_core_count            int4     not null
+cpu_thread_count          int4     not null
+cpu_frequency_max_hz      int8     not null
+cpu_frequency_min_hz      int8     not null
+cpu_l1d_cache_bytes       int4     not null
+cpu_l1i_cache_bytes       int4     not null
+cpu_l2_cache_bytes        int4     not null
+cpu_l3_cache_bytes        int4     not null
+gpu_information           citext   not null  ''::citext  unique
+gpu_part_number           citext   not null  ''::citext
+gpu_product_name          citext   not null  ''::citext
+machine_other_attributes  jsonb
+========================  =======  ========  ==========  ===========
+
+back to `Benchmark data model <benchmark-data-model>`_
+
+
diff --git a/src/arrow/dev/benchmarking/ddl/0_setup.sql b/src/arrow/dev/benchmarking/ddl/0_setup.sql
new file mode 100644
index 000000000..ec1044641
--- /dev/null
+++ b/src/arrow/dev/benchmarking/ddl/0_setup.sql
@@ -0,0 +1,23 @@
+/*
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+*/
+
+CREATE EXTENSION IF NOT EXISTS "citext";  -- type for case-insensitive text
+
+-- For future fine-grained control over function execution by user group.
+ALTER DEFAULT PRIVILEGES REVOKE EXECUTE ON functions FROM public;
diff --git a/src/arrow/dev/benchmarking/ddl/1_00_table_public_project.sql b/src/arrow/dev/benchmarking/ddl/1_00_table_public_project.sql
new file mode 100644
index 000000000..c52d66cfd
--- /dev/null
+++ b/src/arrow/dev/benchmarking/ddl/1_00_table_public_project.sql
@@ -0,0 +1,45 @@
+/*
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+*/
+
+
+-- PROJECT
+CREATE TABLE IF NOT EXISTS public.project
+(
+  project_id SERIAL PRIMARY KEY
+  , project_name citext NOT NULL
+  , project_url text NOT NULL
+  , repo_url text NOT NULL
+  , last_changed timestamp (0) without time zone NOT NULL DEFAULT now()
+);
+COMMENT ON TABLE public.project
+  IS 'Project name and relevant URLs.';
+COMMENT ON COLUMN public.project.project_url
+  IS 'Homepage URL.';
+COMMENT ON COLUMN public.project.repo_url
+  IS 'Git repo URL to link stored commit hashes to code in a webpage.';
+COMMENT ON COLUMN public.project.last_changed
+  IS 'New project details are added with a new timestamp. '
+     'The project details with the newest timestamp will be used.';
+
+-- CONSTRAINTS
+CREATE UNIQUE INDEX project_unique_index_on_project_name_urls
+  ON public.project(project_name, project_url, repo_url);
+COMMENT ON INDEX
+  public.project_unique_index_on_project_name_urls
+  IS 'Enforce uniqueness of project name and urls.';
diff --git a/src/arrow/dev/benchmarking/ddl/1_01_table_public_cpu.sql b/src/arrow/dev/benchmarking/ddl/1_01_table_public_cpu.sql
new file mode 100644
index 000000000..df1a9e757
--- /dev/null
+++ b/src/arrow/dev/benchmarking/ddl/1_01_table_public_cpu.sql
@@ -0,0 +1,63 @@
+/*
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+*/
+
+
+-- CPU
+CREATE TABLE IF NOT EXISTS public.cpu
+(
+  cpu_id SERIAL PRIMARY KEY
+  , cpu_model_name citext NOT NULL UNIQUE
+  , cpu_core_count integer NOT NULL
+  , cpu_thread_count integer NOT NULL
+  , cpu_frequency_max_Hz bigint NOT NULL
+  , cpu_frequency_min_Hz bigint NOT NULL
+  , cpu_L1d_cache_bytes integer NOT NULL
+  , cpu_L1i_cache_bytes integer NOT NULL
+  , cpu_L2_cache_bytes integer NOT NULL
+  , cpu_L3_cache_bytes integer NOT NULL
+);
+COMMENT ON TABLE public.cpu
+  IS 'CPU model and its specifications.';
+COMMENT ON COLUMN public.cpu.cpu_id
+  IS 'The primary key for the CPU table. '
+     'NOTE: This is a synthetic primary key and not meant to represent a '
+     'processor instruction to read capabilities.';
+COMMENT ON COLUMN public.cpu.cpu_model_name
+  IS 'The output of `sysctl -n machdep.cpu.brand_stringp`.';
+COMMENT ON COLUMN public.cpu.cpu_core_count
+  IS 'The output of `sysctl -n hw.physicalcpu`.';
+COMMENT ON COLUMN public.cpu.cpu_thread_count
+  IS 'The output of `sysctl -n hw.logicalcpu`.';
+COMMENT ON COLUMN public.cpu.cpu_frequency_max_Hz
+  IS 'The output of `sysctl -n hw.cpufrequency_max`.';
+COMMENT ON COLUMN public.cpu.cpu_frequency_min_Hz
+  IS 'The output of `sysctl -n hw.cpufrequency_min`.';
+COMMENT ON COLUMN public.cpu.cpu_L1d_cache_bytes
+  IS 'The output of `sysctl -n hw.l1dcachesize`.';
+COMMENT ON COLUMN public.cpu.cpu_L1i_cache_bytes
+  IS 'The output of `sysctl -n hw.l1icachesize`.';
+COMMENT ON COLUMN public.cpu.cpu_L2_cache_bytes
+  IS 'The output of `sysctl -n hw.l2cachesize`.';
+COMMENT ON COLUMN public.cpu.cpu_L3_cache_bytes
+  IS 'The output of `sysctl -n hw.l3cachesize`.';
+
+-- CONSTRAINTS
+ALTER TABLE public.cpu
+  ADD CONSTRAINT cpu_check_cpu_model_name_length
+  CHECK (char_length(cpu_model_name) < 255);
diff --git a/src/arrow/dev/benchmarking/ddl/1_02_table_public_gpu.sql b/src/arrow/dev/benchmarking/ddl/1_02_table_public_gpu.sql
new file mode 100644
index 000000000..564af19de
--- /dev/null
+++ b/src/arrow/dev/benchmarking/ddl/1_02_table_public_gpu.sql
@@ -0,0 +1,43 @@
+/*
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+*/
+
+
+-- GPU
+CREATE TABLE IF NOT EXISTS public.gpu
+(
+  gpu_id SERIAL PRIMARY KEY
+  , gpu_information citext UNIQUE NOT NULL DEFAULT ''
+  , gpu_part_number citext NOT NULL DEFAULT ''
+  , gpu_product_name citext NOT NULL DEFAULT ''
+);
+COMMENT ON TABLE public.gpu IS 'GPU specifications.';
+COMMENT ON COLUMN public.gpu.gpu_information
+  IS 'The output of `nvidia-smi -q` (on Linux or Windows), or `cuda-smi` '
+     'or `kextstat | grep -i cuda` on OSX, or another command; anything '
+     'that gets a string to uniquely identify the GPU.';
+
+-- CONSTRAINTS
+CREATE INDEX gpu_index_on_part_number
+  ON public.gpu (gpu_part_number);
+
+CREATE INDEX gpu_index_on_product_name
+  ON public.gpu (gpu_product_name);
+
+CREATE INDEX gpu_index_on_product_name_and_part_number
+  ON public.gpu (gpu_product_name, gpu_part_number);
diff --git a/src/arrow/dev/benchmarking/ddl/1_03_table_public_os.sql b/src/arrow/dev/benchmarking/ddl/1_03_table_public_os.sql
new file mode 100644
index 000000000..7b03d82f4
--- /dev/null
+++ b/src/arrow/dev/benchmarking/ddl/1_03_table_public_os.sql
@@ -0,0 +1,57 @@
+/*
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+*/
+
+
+-- OS
+CREATE TABLE IF NOT EXISTS public.os
+(
+  os_id SERIAL PRIMARY KEY
+  , os_name citext NOT NULL
+  , architecture_name citext NOT NULL
+  , kernel_name citext NOT NULL DEFAULT ''
+);
+-- @name os. forces retention of an 's' in the Graphile GraphQL api.
+COMMENT ON TABLE public.os
+  IS E'@name os.\nOperating system name and kernel (version).';
+COMMENT ON COLUMN public.os.os_name
+  IS 'Operating system name. For example, OSX, Ubuntu, Windows`.';
+COMMENT ON COLUMN public.os.architecture_name
+  IS 'Operating system architecture; the output of `uname -m`.';
+COMMENT ON COLUMN public.os.kernel_name
+  IS 'Operating system kernel, or NULL. '
+     'On Linux/OSX, the output of `uname -r`. '
+     'On Windows, the output of `ver`.';
+
+-- CONSTRAINTS
+ALTER TABLE public.os
+  ADD CONSTRAINT os_check_os_name_length
+  CHECK (char_length(os_name) < 63);
+
+ALTER TABLE public.os
+  ADD CONSTRAINT os_check_architecture_name_length
+  CHECK (char_length(architecture_name) < 63);
+
+ALTER TABLE public.os
+  ADD CONSTRAINT os_check_kernel_name_length
+  CHECK (char_length(kernel_name) < 63);
+
+CREATE UNIQUE INDEX os_unique_index
+  ON public.os(os_name, architecture_name, kernel_name);
+COMMENT ON INDEX public.os_unique_index
+  IS 'Enforce uniqueness of os, architecture, and kernel names.';
diff --git a/src/arrow/dev/benchmarking/ddl/1_04_table_public_benchmark_language.sql b/src/arrow/dev/benchmarking/ddl/1_04_table_public_benchmark_language.sql
new file mode 100644
index 000000000..2e3553677
--- /dev/null
+++ b/src/arrow/dev/benchmarking/ddl/1_04_table_public_benchmark_language.sql
@@ -0,0 +1,35 @@
+/*
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+*/
+
+
+-- BENCHMARK_LANGUAGE
+CREATE TABLE IF NOT EXISTS public.benchmark_language
+(
+  benchmark_language_id SERIAL PRIMARY KEY
+  , benchmark_language citext NOT NULL UNIQUE
+);
+COMMENT ON TABLE public.benchmark_language
+  IS 'The language the benchmark was written in (and presumably for).';
+COMMENT ON COLUMN public.benchmark_language.benchmark_language
+  IS 'The benchmark language. For example: Python';
+
+-- CONSTRAINTS
+ALTER TABLE public.benchmark_language
+  ADD CONSTRAINT benchmark_language_check_language_length
+  CHECK (char_length(benchmark_language) < 63);
diff --git a/src/arrow/dev/benchmarking/ddl/1_05_table_public_dependencies.sql b/src/arrow/dev/benchmarking/ddl/1_05_table_public_dependencies.sql
new file mode 100644
index 000000000..3744a0c35
--- /dev/null
+++ b/src/arrow/dev/benchmarking/ddl/1_05_table_public_dependencies.sql
@@ -0,0 +1,31 @@
+/*
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+*/
+
+
+-- DEPENDENCIES
+CREATE TABLE IF NOT EXISTS public.dependencies
+(
+  dependencies_id SERIAL PRIMARY KEY
+  , dependencies jsonb UNIQUE NOT NULL DEFAULT '{}'::jsonb
+);
+COMMENT ON TABLE public.dependencies
+  IS E'@name dependencies.\n'
+      'A JSON object mapping dependencies to their versions.';
+COMMENT ON COLUMN public.dependencies.dependencies
+  IS 'For example: ''{"boost": "1.69", "conda": "", "numpy": "1.15"}''.';
diff --git a/src/arrow/dev/benchmarking/ddl/1_06_table_public_language_implementation_version.sql b/src/arrow/dev/benchmarking/ddl/1_06_table_public_language_implementation_version.sql
new file mode 100644
index 000000000..f7d26e4e2
--- /dev/null
+++ b/src/arrow/dev/benchmarking/ddl/1_06_table_public_language_implementation_version.sql
@@ -0,0 +1,46 @@
+/*
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+*/
+
+
+-- LANGUAGE_IMPLEMENTATION_VERSION
+CREATE TABLE IF NOT EXISTS public.language_implementation_version
+(
+  language_implementation_version_id SERIAL
+  , language_implementation_version citext NOT NULL DEFAULT ''
+  , benchmark_language_id integer NOT NULL
+  , PRIMARY KEY (language_implementation_version_id, benchmark_language_id)
+  , FOREIGN KEY (benchmark_language_id) REFERENCES public.benchmark_language
+);
+COMMENT ON TABLE public.language_implementation_version
+  IS 'The benchmark language implementation or compiler version, e.g. '
+     '''CPython 2.7'' or ''PyPy x.y'' or ''gcc 7.3.0'' or '
+     '''gcc (Ubuntu 7.3.0-27ubuntu1~18.04) 7.3.0''.';
+COMMENT ON COLUMN public.language_implementation_version.language_implementation_version
+  IS 'The version number used in the benchmark environment (e.g. ''2.7'').';
+
+-- CONSTRAINTS
+ALTER TABLE public.language_implementation_version
+  ADD CONSTRAINT language_implementation_version_check_version_length
+  CHECK (char_length(language_implementation_version) < 255);
+
+CREATE UNIQUE INDEX language_implementation_version_unique_index
+  ON public.language_implementation_version
+    (benchmark_language_id, language_implementation_version);
+COMMENT ON INDEX language_implementation_version_unique_index
+  IS 'Enforce unique implementation versions for the languages.';
diff --git a/src/arrow/dev/benchmarking/ddl/1_07_table_public_benchmark_type.sql b/src/arrow/dev/benchmarking/ddl/1_07_table_public_benchmark_type.sql
new file mode 100644
index 000000000..1143cdb00
--- /dev/null
+++ b/src/arrow/dev/benchmarking/ddl/1_07_table_public_benchmark_type.sql
@@ -0,0 +1,39 @@
+/*
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+*/
+
+
+-- BENCHMARK_TYPE
+CREATE TABLE IF NOT EXISTS public.benchmark_type
+(
+  benchmark_type_id SERIAL PRIMARY KEY
+  , benchmark_type citext NOT NULL UNIQUE
+  , lessisbetter boolean NOT NULL
+);
+COMMENT ON TABLE public.benchmark_type
+  IS 'The type of benchmark. For example "time", "mem", "peakmem", "track"';
+COMMENT ON COLUMN public.benchmark_type.benchmark_type
+  IS 'The type of units, so ''time'' for seconds, miliseconds, or '
+     '''mem'' for kilobytes, megabytes.';
+COMMENT ON COLUMN public.benchmark_type.lessisbetter
+  IS 'True if a smaller benchmark value is better.';
+
+-- CONSTRAINTS
+ALTER TABLE public.benchmark_type
+  ADD CONSTRAINT benchmark_type_check_benchmark_type_char_length
+  CHECK (char_length(benchmark_type) < 63);
diff --git a/src/arrow/dev/benchmarking/ddl/1_08_table_public_machine.sql b/src/arrow/dev/benchmarking/ddl/1_08_table_public_machine.sql
new file mode 100644
index 000000000..8f219d3e0
--- /dev/null
+++ b/src/arrow/dev/benchmarking/ddl/1_08_table_public_machine.sql
@@ -0,0 +1,69 @@
+/*
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+*/
+
+
+-- MACHINE
+CREATE TABLE IF NOT EXISTS public.machine
+(
+  machine_id SERIAL PRIMARY KEY
+  , machine_name citext NOT NULL
+  , mac_address macaddr NOT NULL
+  , memory_bytes bigint NOT NULL
+  , cpu_actual_frequency_Hz bigint NOT NULL
+  , machine_other_attributes jsonb
+  , cpu_id integer NOT NULL
+  , gpu_id integer NOT NULL
+  , os_id integer NOT NULL
+  , FOREIGN KEY (cpu_id) REFERENCES public.cpu
+  , FOREIGN KEY (gpu_id) REFERENCES public.gpu
+  , FOREIGN KEY (os_id) REFERENCES public.os
+);
+COMMENT ON TABLE public.machine
+  IS 'Unique identifiers for a machine.';
+COMMENT ON COLUMN public.machine.machine_name
+  IS 'A machine name of your choice.';
+COMMENT ON COLUMN public.machine.mac_address
+  IS 'The mac_address of a physical network interface to uniquely '
+     'identify a computer. Postgres accepts standard formats, including '
+     '''08:00:2b:01:02:03'', ''08-00-2b-01-02-03'', ''08002b:010203''';
+COMMENT ON COLUMN public.machine.memory_bytes
+  IS 'The output of `sysctl -n hw.memsize`.';
+COMMENT ON COLUMN public.machine.cpu_actual_frequency_Hz
+  IS 'The output of `sysctl -n hw.cpufrequency`.';
+COMMENT ON COLUMN public.machine.machine_other_attributes
+  IS 'Additional attributes of interest, as a JSON object. '
+     'For example: ''{"hard_disk_type": "solid state"}''::jsonb.';
+
+-- CONSTRAINTS
+CREATE UNIQUE INDEX machine_index_on_mac_address
+  ON public.machine(mac_address);
+COMMENT ON INDEX machine_index_on_mac_address
+  IS 'Enforce unique mac address';
+
+CREATE INDEX machine_index_on_cpu_id
+  ON public.machine(cpu_id);
+
+CREATE INDEX machine_index_on_gpu_id
+  ON public.machine(gpu_id);
+
+CREATE INDEX machine_index_on_os_id
+  ON public.machine(os_id);
+
+CREATE INDEX machine_index_on_cpu_gpu_os_id
+  ON public.machine(cpu_id, gpu_id, os_id);
diff --git a/src/arrow/dev/benchmarking/ddl/1_09_table_public_unit.sql b/src/arrow/dev/benchmarking/ddl/1_09_table_public_unit.sql
new file mode 100644
index 000000000..a8cf57669
--- /dev/null
+++ b/src/arrow/dev/benchmarking/ddl/1_09_table_public_unit.sql
@@ -0,0 +1,37 @@
+/*
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+*/
+
+
+-- UNIT
+CREATE TABLE IF NOT EXISTS public.unit
+(
+  unit_id SERIAL PRIMARY KEY
+  , units citext NOT NULL UNIQUE
+  , benchmark_type_id integer NOT NULL
+  , FOREIGN KEY (benchmark_type_id)
+    REFERENCES public.benchmark_type(benchmark_type_id)
+);
+COMMENT ON TABLE public.unit IS 'The actual units for a reported benchmark.';
+COMMENT ON COLUMN public.unit.units
+  IS 'For example: nanoseconds, microseconds, bytes, megabytes.';
+
+-- CONSTRAINTS
+ALTER TABLE public.unit
+  ADD CONSTRAINT unit_check_units_string_length
+  CHECK (char_length(units) < 63);
diff --git a/src/arrow/dev/benchmarking/ddl/1_10_table_public_environment.sql b/src/arrow/dev/benchmarking/ddl/1_10_table_public_environment.sql
new file mode 100644
index 000000000..e3a6d2395
--- /dev/null
+++ b/src/arrow/dev/benchmarking/ddl/1_10_table_public_environment.sql
@@ -0,0 +1,51 @@
+/*
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+*/
+
+
+-- ENVIRONMENT
+CREATE TABLE IF NOT EXISTS public.environment
+(
+  environment_id SERIAL
+  , language_implementation_version_id integer NOT NULL
+  , benchmark_language_id integer NOT NULL
+  , dependencies_id integer NOT NULL
+  , PRIMARY KEY
+      (environment_id, benchmark_language_id, language_implementation_version_id)
+  , FOREIGN KEY
+      (benchmark_language_id)
+      REFERENCES public.benchmark_language
+  , FOREIGN KEY
+      (language_implementation_version_id, benchmark_language_id)
+      REFERENCES public.language_implementation_version(
+        language_implementation_version_id
+        , benchmark_language_id
+      )
+  , FOREIGN KEY
+      (dependencies_id)
+      REFERENCES public.dependencies
+);
+COMMENT ON TABLE public.environment
+  IS 'Identifies a build environment for a specific suite of benchmarks.';
+
+-- CONSTRAINTS
+CREATE UNIQUE INDEX environment_unique_index
+  ON public.environment
+    (benchmark_language_id, language_implementation_version_id, dependencies_id);
+COMMENT ON INDEX environment_unique_index
+  IS 'Enforce unique combinations of language version and dependencies.';
diff --git a/src/arrow/dev/benchmarking/ddl/1_11_table_public_benchmark.sql b/src/arrow/dev/benchmarking/ddl/1_11_table_public_benchmark.sql
new file mode 100644
index 000000000..18895823d
--- /dev/null
+++ b/src/arrow/dev/benchmarking/ddl/1_11_table_public_benchmark.sql
@@ -0,0 +1,54 @@
+/*
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+*/
+
+
+-- BENCHMARK
+CREATE TABLE IF NOT EXISTS public.benchmark
+(
+  benchmark_id SERIAL
+  , benchmark_name citext NOT NULL
+  , parameter_names text[]
+  , benchmark_description text NOT NULL
+  , benchmark_version citext NOT NULL
+  , unit_id integer NOT NULL
+  , benchmark_language_id integer NOT NULL
+  , PRIMARY KEY (benchmark_id, benchmark_language_id)
+  , FOREIGN KEY (benchmark_language_id) REFERENCES public.benchmark_language
+  , FOREIGN KEY (unit_id) REFERENCES public.unit
+);
+COMMENT ON TABLE public.benchmark
+  IS 'Identifies an individual benchmark.';
+COMMENT ON COLUMN public.benchmark.parameter_names
+  IS 'A list of strings identifying the parameter names in the benchmark.';
+COMMENT ON COLUMN public.benchmark.benchmark_version
+  IS 'Can be any string. In Airspeed Velocity, the version is '
+     'by default the hash of the entire code string for the benchmark.';
+
+-- CONSTRAINTS
+CREATE INDEX benchmark_index_on_benchmark_language_id
+  ON public.benchmark(benchmark_language_id);
+
+CREATE INDEX benchmark_index_on_unit_id
+  ON public.benchmark(unit_id);
+
+CREATE UNIQUE INDEX benchmark_unique_index_on_language_benchmark_version
+  ON public.benchmark
+    (benchmark_language_id, benchmark_name, benchmark_version);
+COMMENT ON INDEX public.benchmark_unique_index_on_language_benchmark_version
+  IS 'Enforce uniqueness of benchmark name and version for a given language.';
diff --git a/src/arrow/dev/benchmarking/ddl/1_12_table_public_benchmark_run.sql b/src/arrow/dev/benchmarking/ddl/1_12_table_public_benchmark_run.sql
new file mode 100644
index 000000000..20b9ef0bb
--- /dev/null
+++ b/src/arrow/dev/benchmarking/ddl/1_12_table_public_benchmark_run.sql
@@ -0,0 +1,112 @@
+/*
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+*/
+
+
+-- BENCHMARK_RUN
+CREATE TABLE IF NOT EXISTS public.benchmark_run
+(
+  benchmark_run_id BIGSERIAL PRIMARY KEY
+  , parameter_values jsonb NOT NULL DEFAULT '{}'::jsonb
+  , value numeric NOT NULL
+  , git_commit_timestamp timestamp (0) with time zone NOT NULL
+  , git_hash text NOT NULL
+  , val_min numeric
+  , val_q1 numeric
+  , val_q3 numeric
+  , val_max numeric
+  , std_dev numeric NOT NULL
+  , n_obs integer NOT NULL
+  , run_timestamp timestamp (0) with time zone NOT NULL
+  , run_metadata jsonb
+  , run_notes text
+  , machine_id integer NOT NULL
+  , environment_id integer NOT NULL
+  , language_implementation_version_id integer NOT NULL
+  , benchmark_language_id integer NOT NULL
+  , benchmark_id integer NOT NULL
+  , FOREIGN KEY (machine_id) REFERENCES public.machine
+  , FOREIGN KEY
+      (environment_id, benchmark_language_id, language_implementation_version_id)
+      REFERENCES public.environment
+  , FOREIGN KEY (benchmark_id, benchmark_language_id)
+      REFERENCES public.benchmark(benchmark_id, benchmark_language_id)
+);
+COMMENT ON TABLE public.benchmark_run
+  IS 'One run per benchmark run.';
+COMMENT ON COLUMN public.benchmark_run.parameter_values
+  IS 'A JSON object mapping the parameter names from '
+     '"benchmark.parameter_names" to values.';
+COMMENT ON COLUMN public.benchmark_run.value
+  IS 'The average value from the benchmark run.';
+COMMENT ON COLUMN public.benchmark_run.git_commit_timestamp
+  IS 'Get this using `git show -s --date=local --format="%ci" <hash>`. '
+     'ISO 8601 is recommended, e.g. ''2019-01-30 03:12 -0600''.';
+COMMENT ON COLUMN public.benchmark_run.git_hash
+  IS 'The commit has of the codebase currently being benchmarked.';
+COMMENT ON COLUMN public.benchmark_run.val_min
+  IS 'The smallest benchmark run value for this run.';
+COMMENT ON COLUMN public.benchmark_run.val_q1
+  IS 'The first quartile of the benchmark run values for this run.';
+COMMENT ON COLUMN public.benchmark_run.val_q3
+  IS 'The third quartile of the benchmark run values for this run.';
+COMMENT ON COLUMN public.benchmark_run.val_max
+  IS 'The largest benchmark run value for this run.';
+COMMENT ON COLUMN public.benchmark_run.std_dev
+  IS 'The standard deviation of the run values for this benchmark run.';
+COMMENT ON COLUMN public.benchmark_run.n_obs
+  IS 'The number of observations for this benchmark run.';
+COMMENT ON COLUMN public.benchmark_run.run_metadata
+  IS 'Additional metadata of interest, as a JSON object. '
+     'For example: ''{"ci_99": [2.7e-06, 3.1e-06]}''::jsonb.';
+COMMENT ON COLUMN public.benchmark_run.run_notes
+  IS 'Additional notes of interest, as a text string. ';
+
+-- CONSTRAINTS
+ALTER TABLE public.benchmark_run
+  ADD CONSTRAINT benchmark_run_check_std_dev_nonnegative
+  CHECK (std_dev >= 0);
+
+ALTER TABLE public.benchmark_run
+  ADD CONSTRAINT benchmark_run_check_n_obs_positive
+  CHECK (n_obs > 0);
+
+CREATE INDEX benchmark_run_index_on_environment_id
+  ON public.benchmark_run(environment_id);
+
+CREATE INDEX benchmark_run_index_on_machine_id
+  ON public.benchmark_run(machine_id);
+
+CREATE INDEX benchmark_run_index_on_benchmark_id
+  ON public.benchmark_run(benchmark_id, benchmark_language_id);
+
+CREATE INDEX benchmark_run_index_on_benchmark_environment_time
+  ON public.benchmark_run
+    (benchmark_id, environment_id, git_commit_timestamp);
+COMMENT ON INDEX
+  public.benchmark_run_index_on_benchmark_environment_time
+  IS 'Index to improve sorting by benchmark, environment, and timestamp.';
+
+CREATE UNIQUE INDEX
+  benchmark_run_unique_index_on_env_benchmark_timestamp_params
+  ON public.benchmark_run
+    (machine_id, environment_id, benchmark_id, git_commit_timestamp, parameter_values, run_timestamp);
+COMMENT ON INDEX
+  public.benchmark_run_unique_index_on_env_benchmark_timestamp_params
+  IS 'Enforce uniqueness of benchmark run for a given machine, '
+     'environment, benchmark, git commit timestamp, and parameter values.';
diff --git a/src/arrow/dev/benchmarking/ddl/2_00_views.sql b/src/arrow/dev/benchmarking/ddl/2_00_views.sql
new file mode 100644
index 000000000..cbd295e50
--- /dev/null
+++ b/src/arrow/dev/benchmarking/ddl/2_00_views.sql
@@ -0,0 +1,324 @@
+/*
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+*/
+
+-- NOTE:
+-- The function for documentation depends on view columns
+-- being named exactly the same as in the table view.
+
+-- MACHINE_VIEW
+CREATE OR REPLACE VIEW public.machine_view AS
+  SELECT
+    machine.machine_id
+    , mac_address
+    , machine_name
+    , memory_bytes
+    , cpu_actual_frequency_Hz
+    , os_name
+    , architecture_name
+    , kernel_name
+    , cpu_model_name
+    , cpu_core_count
+    , cpu_thread_count
+    , cpu_frequency_max_Hz
+    , cpu_frequency_min_Hz
+    , cpu_L1d_cache_bytes
+    , cpu_L1i_cache_bytes
+    , cpu_L2_cache_bytes
+    , cpu_L3_cache_bytes
+    , gpu_information
+    , gpu_part_number
+    , gpu_product_name
+    , machine_other_attributes
+  FROM public.machine AS machine
+    JOIN public.cpu AS cpu ON machine.cpu_id = cpu.cpu_id
+    JOIN public.gpu AS gpu ON machine.gpu_id = gpu.gpu_id
+    JOIN public.os AS os ON machine.os_id = os.os_id;
+COMMENT ON VIEW public.machine_view IS
+E'The machine environment (CPU, GPU, OS) used for each benchmark run.\n\n'
+ '- "mac_address" is unique in the "machine" table\n'
+ '- "gpu_part_number" is unique in the "gpu" (graphics processing unit) table\n'
+ '  Empty string (''''), not null, is used for machines that won''t use the GPU\n'
+ '- "cpu_model_name" is unique in the "cpu" (central processing unit) table\n'
+ '- "os_name", "os_architecture_name", and "os_kernel_name"\n'
+ '  are unique in the "os" (operating system) table\n'
+ '- "machine_other_attributes" is a key-value store for any other relevant\n'
+ '  data, e.g. ''{"hard_disk_type": "solid state"}''';
+
+
+-- LANGUAGE_IMPLEMENTATION_VERSION_VIEW
+CREATE OR REPLACE VIEW public.language_implementation_version_view AS
+  SELECT
+    lv.language_implementation_version_id
+    , bl.benchmark_language
+    , lv.language_implementation_version
+  FROM public.language_implementation_version AS lv
+    JOIN public.benchmark_language AS bl
+      ON lv.benchmark_language_id = bl.benchmark_language_id;
+
+-- ENVIRONMENT_VIEW
+CREATE OR REPLACE VIEW public.environment_view AS
+  SELECT
+    env.environment_id
+    , benchmark_language
+    , language_implementation_version
+    , dependencies
+  FROM public.environment AS env
+    JOIN public.benchmark_language AS language
+      ON env.benchmark_language_id = language.benchmark_language_id
+    JOIN public.language_implementation_version AS version
+      ON env.language_implementation_version_id = version.language_implementation_version_id
+    JOIN public.dependencies AS deps
+      ON env.dependencies_id = deps.dependencies_id;
+COMMENT ON VIEW public.environment_view IS
+E'The build environment used for a reported benchmark run.\n'
+ '(Will be inferred from each "benchmark_run" if not explicitly added).\n\n'
+ '- Each entry is unique on\n'
+ '  ("benchmark_language", "language_implementation_version", "dependencies")\n'
+ '- "benchmark_language" is unique in the "benchmark_language" table\n'
+ '- "benchmark_language" plus "language_implementation_version" is unique in\n'
+ '  the "language_implementation_version" table\n'
+ '- "dependencies" is unique in the "dependencies" table';
+
+-- UNIT_VIEW
+CREATE OR REPLACE VIEW public.unit_view AS
+  SELECT
+    unit.unit_id
+    , units
+    , benchmark_type
+    , lessisbetter
+  FROM public.unit AS unit
+    JOIN public.benchmark_type AS bt
+      ON unit.benchmark_type_id = bt.benchmark_type_id;
+
+-- BENCHMARK_VIEW
+CREATE OR REPLACE VIEW public.benchmark_view AS
+  SELECT
+    b.benchmark_id
+    , benchmark_name
+    , parameter_names
+    , benchmark_description
+    , benchmark_type
+    , units
+    , lessisbetter
+    , benchmark_version
+    , benchmark_language
+  FROM public.benchmark AS b
+    JOIN public.benchmark_language AS benchmark_language
+      ON b.benchmark_language_id = benchmark_language.benchmark_language_id
+    JOIN public.unit AS unit
+      ON b.unit_id = unit.unit_id
+    JOIN public.benchmark_type AS benchmark_type
+      ON unit.benchmark_type_id = benchmark_type.benchmark_type_id;
+COMMENT ON VIEW public.benchmark_view IS
+E'The details about a particular benchmark.\n\n'
+ '- "benchmark_name" is unique for a given "benchmark_language"\n'
+ '- Each entry is unique on\n'
+ '  ("benchmark_language", "benchmark_name", "benchmark_version")';
+
+-- BENCHMARK_RUN_VIEW
+CREATE OR REPLACE VIEW public.benchmark_run_view AS
+  SELECT
+    run.benchmark_run_id
+    -- benchmark_view (name, version, language only)
+    , benchmark_name
+    , benchmark_version
+    -- datum
+    , parameter_values
+    , value
+    , git_commit_timestamp
+    , git_hash
+    , val_min
+    , val_q1
+    , val_q3
+    , val_max
+    , std_dev
+    , n_obs
+    , run_timestamp
+    , run_metadata
+    , run_notes
+    -- machine_view (mac address only)
+    , mac_address
+    -- environment_view
+    , env.benchmark_language
+    , language_implementation_version
+    , dependencies
+  FROM public.benchmark_run AS run
+    JOIN public.benchmark_view AS benchmark
+      ON run.benchmark_id = benchmark.benchmark_id
+    JOIN public.machine_view AS machine
+      ON run.machine_id = machine.machine_id
+    JOIN public.environment_view AS env
+      ON run.environment_id = env.environment_id;
+COMMENT ON VIEW public.benchmark_run_view IS
+E'Each benchmark run.\n\n'
+ '- Each entry is unique on the machine, environment, benchmark,\n'
+ '  and git commit timestamp.';
+
+-- FULL_BENCHMARK_RUN_VIEW
+CREATE OR REPLACE VIEW public.full_benchmark_run_view AS
+  SELECT
+    run.benchmark_run_id
+    -- benchmark_view
+    , benchmark_name
+    , parameter_names
+    , benchmark_description
+    , benchmark_type
+    , units
+    , lessisbetter
+    , benchmark_version
+    -- datum
+    , parameter_values
+    , value
+    , git_commit_timestamp
+    , git_hash
+    , val_min
+    , val_q1
+    , val_q3
+    , val_max
+    , std_dev
+    , n_obs
+    , run_timestamp
+    , run_metadata
+    , run_notes
+    -- machine_view
+    , machine_name
+    , mac_address
+    , memory_bytes
+    , cpu_actual_frequency_Hz
+    , os_name
+    , architecture_name
+    , kernel_name
+    , cpu_model_name
+    , cpu_core_count
+    , cpu_thread_count
+    , cpu_frequency_max_Hz
+    , cpu_frequency_min_Hz
+    , cpu_L1d_cache_bytes
+    , cpu_L1i_cache_bytes
+    , cpu_L2_cache_bytes
+    , cpu_L3_cache_bytes
+    , gpu_information
+    , gpu_part_number
+    , gpu_product_name
+    , machine_other_attributes
+    -- environment_view
+    , env.benchmark_language
+    , env.language_implementation_version
+    , dependencies
+  FROM public.benchmark_run AS run
+    JOIN public.benchmark_view AS benchmark
+      ON run.benchmark_id = benchmark.benchmark_id
+    JOIN public.machine_view AS machine
+      ON run.machine_id = machine.machine_id
+    JOIN public.environment_view AS env
+      ON run.environment_id = env.environment_id;
+
+-- SUMMARIZED_TABLES_VIEW
+CREATE VIEW public.summarized_tables_view AS
+    WITH chosen AS (
+          SELECT
+            cls.oid AS id
+            , cls.relname as tbl_name
+          FROM pg_catalog.pg_class AS cls
+          JOIN pg_catalog.pg_namespace AS ns ON cls.relnamespace = ns.oid
+          WHERE
+            cls.relkind = 'r'
+            AND ns.nspname = 'public'
+        ), all_constraints AS (
+          SELECT
+            chosen.id AS tbl_id
+            , chosen.tbl_name
+            , unnest(conkey) AS col_id
+            , 'foreign key' AS col_constraint
+            FROM pg_catalog.pg_constraint
+            JOIN chosen ON chosen.id = conrelid
+            WHERE contype = 'f'
+
+          UNION
+
+          SELECT
+            chosen.id
+            , chosen.tbl_name
+            , unnest(indkey)
+            , 'unique'
+            FROM pg_catalog.pg_index i
+            JOIN chosen ON chosen.id = i.indrelid
+            WHERE i.indisunique AND NOT i.indisprimary
+
+          UNION
+
+          SELECT
+            chosen.id
+            , chosen.tbl_name
+            , unnest(indkey)
+            , 'primary key'
+            FROM pg_catalog.pg_index i
+            JOIN chosen on chosen.id = i.indrelid
+            WHERE i.indisprimary
+        ), gathered_constraints AS (
+          SELECT
+            tbl_id
+            , tbl_name
+            , col_id
+            , string_agg(col_constraint, ', ' ORDER BY col_constraint)
+              AS  col_constraint
+          FROM all_constraints
+          GROUP BY tbl_id, tbl_name, col_id
+    )
+    SELECT
+      chosen.tbl_name AS table_name
+      , columns.attnum AS column_number
+      , columns.attname AS column_name
+      , typ.typname AS type_name
+      , CASE
+          WHEN columns.attnotnull
+            THEN 'not null'
+          ELSE ''
+        END AS nullable
+      , CASE
+          WHEN defaults.adsrc like 'nextval%'
+            THEN 'serial'
+          ELSE defaults.adsrc
+        END AS default_value
+      , CASE
+          WHEN gc.col_constraint = '' OR gc.col_constraint IS NULL
+            THEN cnstrnt.consrc
+          WHEN cnstrnt.consrc IS NULL
+            THEN gc.col_constraint
+          ELSE gc.col_constraint || ', ' || cnstrnt.consrc
+        END AS description
+    FROM pg_catalog.pg_attribute AS columns
+      JOIN chosen ON columns.attrelid = chosen.id
+      JOIN pg_catalog.pg_type AS typ
+        ON typ.oid = columns.atttypid
+      LEFT JOIN gathered_constraints AS gc
+        ON gc.col_id = columns.attnum
+        AND gc.tbl_id = columns.attrelid
+      LEFT JOIN pg_attrdef AS defaults
+        ON defaults.adrelid = chosen.id
+        AND defaults.adnum = columns.attnum
+      LEFT JOIN pg_catalog.pg_constraint AS cnstrnt
+        ON cnstrnt.conrelid = columns.attrelid
+        AND columns.attrelid = ANY(cnstrnt.conkey)
+    WHERE
+      columns.attnum > 0
+    ORDER BY table_name, column_number;
+COMMENT ON VIEW public.summarized_tables_view
+  IS 'A summary of all columns from all tables in the public schema, '
+  ' identifying nullability, primary/foreign keys, and data type.';
diff --git a/src/arrow/dev/benchmarking/ddl/3_00_functions_helpers.sql b/src/arrow/dev/benchmarking/ddl/3_00_functions_helpers.sql
new file mode 100644
index 000000000..b10b69a4e
--- /dev/null
+++ b/src/arrow/dev/benchmarking/ddl/3_00_functions_helpers.sql
@@ -0,0 +1,643 @@
+/*
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+*/
+
+
+-- PROJECT_DETAILS
+CREATE TYPE public.type_project_details AS (
+  project_name text
+  , project_url text
+  , repo_url text
+);
+
+CREATE OR REPLACE FUNCTION public.project_details()
+RETURNS public.type_project_details AS
+$$
+  SELECT project_name, project_url, repo_url
+  FROM public.project
+  ORDER BY last_changed DESC
+  LIMIT 1
+$$
+LANGUAGE sql STABLE;
+COMMENT ON FUNCTION public.project_details()
+IS 'Get the current project name, url, and repo url.';
+
+
+-------------------------- GET-OR-SET FUNCTIONS --------------------------
+--  The following functions have the naming convention "get_<tablename>_id".
+--  All of them attempt to SELECT the desired row given the column
+--  values, and if it does not exist will INSERT it.
+--
+--  When functions are overloaded with fewer columns, it is to allow
+--  selection only, given columns that comprise a unique index.
+
+-- GET_CPU_ID
+CREATE OR REPLACE FUNCTION public.get_cpu_id(
+  cpu_model_name citext
+  , cpu_core_count integer
+  , cpu_thread_count integer
+  , cpu_frequency_max_Hz bigint
+  , cpu_frequency_min_Hz bigint
+  , cpu_L1d_cache_bytes integer
+  , cpu_L1i_cache_bytes integer
+  , cpu_L2_cache_bytes integer
+  , cpu_L3_cache_bytes integer
+)
+RETURNS integer AS
+$$
+  DECLARE
+    result integer;
+  BEGIN
+    SELECT cpu_id INTO result FROM public.cpu AS cpu
+    WHERE cpu.cpu_model_name = $1
+      AND cpu.cpu_core_count = $2
+      AND cpu.cpu_thread_count = $3
+      AND cpu.cpu_frequency_max_Hz = $4
+      AND cpu.cpu_frequency_min_Hz = $5
+      AND cpu.cpu_L1d_cache_bytes = $6
+      AND cpu.cpu_L1i_cache_bytes = $7
+      AND cpu.cpu_L2_cache_bytes = $8
+      AND cpu.cpu_L3_cache_bytes = $9;
+
+    IF result IS NULL THEN
+      INSERT INTO public.cpu(
+        cpu_model_name
+        , cpu_core_count
+        , cpu_thread_count
+        , cpu_frequency_max_Hz
+        , cpu_frequency_min_Hz
+        , cpu_L1d_cache_bytes
+        , cpu_L1i_cache_bytes
+        , cpu_L2_cache_bytes
+        , cpu_L3_cache_bytes
+      )
+      VALUES ($1, $2, $3, $4, $5, $6, $7, $8, $9)
+      RETURNING cpu_id INTO result;
+    END IF;
+
+    RETURN result;
+  END
+$$
+LANGUAGE plpgsql;
+COMMENT ON FUNCTION public.get_cpu_id(
+  citext
+  , integer
+  , integer
+  , bigint -- cpu_frequency_max_Hz
+  , bigint -- cpu_frequency_min_Hz
+  , integer
+  , integer
+  , integer
+  , integer
+)
+IS 'Insert or select CPU data, returning "cpu.cpu_id".';
+
+-- GET_GPU_ID
+CREATE OR REPLACE FUNCTION public.get_gpu_id(
+  gpu_information citext DEFAULT NULL
+  , gpu_part_number citext DEFAULT NULL
+  , gpu_product_name citext DEFAULT NULL
+)
+RETURNS integer AS
+$$
+  DECLARE
+    result integer;
+  BEGIN
+    SELECT gpu_id INTO result FROM public.gpu AS gpu
+    WHERE
+      gpu.gpu_information = COALESCE($1, '')
+      AND gpu.gpu_part_number = COALESCE($2, '')
+      AND gpu.gpu_product_name = COALESCE($3, '');
+
+    IF result IS NULL THEN
+      INSERT INTO public.gpu(
+        gpu_information
+        , gpu_part_number
+        , gpu_product_name
+      )
+      VALUES (COALESCE($1, ''), COALESCE($2, ''), COALESCE($3, ''))
+      RETURNING gpu_id INTO result;
+    END IF;
+
+    RETURN result;
+  END
+$$
+LANGUAGE plpgsql;
+COMMENT ON FUNCTION public.get_gpu_id(citext, citext, citext)
+IS 'Insert or select GPU data, returning "gpu.gpu_id".';
+
+-- GET_OS_ID
+CREATE OR REPLACE FUNCTION public.get_os_id(
+  os_name citext
+  , architecture_name citext
+  , kernel_name citext DEFAULT ''
+)
+RETURNS integer AS
+$$
+  DECLARE
+    result integer;
+  BEGIN
+    SELECT os_id INTO result FROM public.os AS os
+    WHERE os.os_name = $1
+      AND os.architecture_name = $2
+      AND os.kernel_name = COALESCE($3, '');
+
+    IF result is NULL THEN
+      INSERT INTO public.os(os_name, architecture_name, kernel_name)
+      VALUES ($1, $2, COALESCE($3, ''))
+      RETURNING os_id INTO result;
+    END IF;
+
+    RETURN result;
+  END
+$$
+LANGUAGE plpgsql;
+COMMENT ON FUNCTION public.get_os_id(citext, citext, citext)
+IS 'Insert or select OS data, returning "os.os_id".';
+
+-- GET_MACHINE_ID (full signature)
+CREATE OR REPLACE FUNCTION public.get_machine_id(
+  mac_address macaddr
+  , machine_name citext
+  , memory_bytes bigint
+  , cpu_actual_frequency_Hz bigint
+  -- os
+  , os_name citext
+  , architecture_name citext
+  , kernel_name citext
+  -- cpu
+  , cpu_model_name citext
+  , cpu_core_count integer
+  , cpu_thread_count integer
+  , cpu_frequency_max_Hz bigint
+  , cpu_frequency_min_Hz bigint
+  , L1d_cache_bytes integer
+  , L1i_cache_bytes integer
+  , L2_cache_bytes integer
+  , L3_cache_bytes integer
+  -- gpu
+  , gpu_information citext DEFAULT ''
+  , gpu_part_number citext DEFAULT NULL
+  , gpu_product_name citext DEFAULT NULL
+  -- nullable machine attributes
+  , machine_other_attributes jsonb DEFAULT NULL
+)
+RETURNS integer AS
+$$
+  DECLARE
+    found_cpu_id integer;
+    found_gpu_id integer;
+    found_os_id integer;
+    result integer;
+  BEGIN
+    -- Can't bypass looking up all the values because of unique constraint.
+    SELECT public.get_cpu_id(
+      cpu_model_name
+      , cpu_core_count
+      , cpu_thread_count
+      , cpu_frequency_max_Hz
+      , cpu_frequency_min_Hz
+      , L1d_cache_bytes
+      , L1i_cache_bytes
+      , L2_cache_bytes
+      , L3_cache_bytes
+    ) INTO found_cpu_id;
+
+    SELECT public.get_gpu_id(
+      gpu_information
+      , gpu_part_number
+      , gpu_product_name
+    ) INTO found_gpu_id;
+
+    SELECT public.get_os_id(
+      os_name
+      , architecture_name
+      , kernel_name
+    ) INTO found_os_id;
+
+    SELECT machine_id INTO result FROM public.machine AS m
+    WHERE m.os_id = found_os_id
+      AND m.cpu_id = found_cpu_id
+      AND m.gpu_id = found_gpu_id
+      AND m.mac_address = $1
+      AND m.machine_name = $2
+      AND m.memory_bytes = $3
+      AND m.cpu_actual_frequency_Hz = $4;
+
+    IF result IS NULL THEN
+      INSERT INTO public.machine(
+        os_id
+        , cpu_id
+        , gpu_id
+        , mac_address
+        , machine_name
+        , memory_bytes
+        , cpu_actual_frequency_Hz
+        , machine_other_attributes
+      )
+      VALUES (found_os_id, found_cpu_id, found_gpu_id, $1, $2, $3, $4, $20)
+      RETURNING machine_id INTO result;
+    END IF;
+
+    RETURN result;
+  END
+$$
+LANGUAGE plpgsql;
+COMMENT ON FUNCTION public.get_machine_id(
+  macaddr
+  , citext
+  , bigint  -- memory_bytes
+  , bigint  -- cpu_frequency_actual_Hz
+  -- os
+  , citext
+  , citext
+  , citext
+  -- cpu
+  , citext
+  , integer
+  , integer
+  , bigint  -- cpu_frequency_max_Hz
+  , bigint  -- cpu_frequency_min_Hz
+  , integer
+  , integer
+  , integer
+  , integer
+  -- gpu
+  , citext
+  , citext
+  , citext
+  -- nullable machine attributes
+  , jsonb
+)
+IS 'Insert or select machine data, returning "machine.machine_id".';
+
+-- GET_MACHINE_ID (given unique mac_address)
+CREATE OR REPLACE FUNCTION public.get_machine_id(mac_address macaddr)
+RETURNS integer AS
+$$
+  SELECT machine_id FROM public.machine AS m
+  WHERE m.mac_address = $1;
+$$
+LANGUAGE sql STABLE;
+COMMENT ON FUNCTION public.get_machine_id(macaddr)
+IS 'Select machine_id given its mac address, returning "machine.machine_id".';
+
+-- GET_BENCHMARK_LANGUAGE_ID
+CREATE OR REPLACE FUNCTION public.get_benchmark_language_id(language citext)
+RETURNS integer AS
+$$
+  DECLARE
+    result integer;
+  BEGIN
+    SELECT benchmark_language_id INTO result
+    FROM public.benchmark_language AS bl
+    WHERE bl.benchmark_language = language;
+
+    IF result IS NULL THEN
+      INSERT INTO public.benchmark_language(benchmark_language)
+      VALUES (language)
+      RETURNING benchmark_language_id INTO result;
+    END IF;
+
+    RETURN result;
+  END
+$$
+LANGUAGE plpgsql;
+COMMENT ON FUNCTION public.get_benchmark_language_id(citext)
+IS 'Insert or select benchmark_language returning '
+   '"benchmark_language.benchmark_language_id".';
+
+-- GET_LANGUAGE_IMPLEMENTATION_VERSION_ID
+CREATE OR REPLACE FUNCTION public.get_language_implementation_version_id(
+  language citext
+  , language_implementation_version citext DEFAULT ''
+)
+RETURNS integer AS
+$$
+  DECLARE
+    language_id integer;
+    result integer;
+  BEGIN
+    SELECT public.get_benchmark_language_id($1) INTO language_id;
+
+    SELECT language_implementation_version_id INTO result FROM public.language_implementation_version AS lv
+    WHERE lv.benchmark_language_id = language_id
+      AND lv.language_implementation_version = COALESCE($2, '');
+
+    IF result IS NULL THEN
+      INSERT INTO
+        public.language_implementation_version(benchmark_language_id, language_implementation_version)
+      VALUES (language_id, COALESCE($2, ''))
+      RETURNING language_implementation_version_id INTO result;
+    END IF;
+
+    RETURN result;
+  END
+$$
+LANGUAGE plpgsql;
+COMMENT ON FUNCTION public.get_language_implementation_version_id(citext, citext)
+IS 'Insert or select language and version data, '
+      'returning "language_implementation_version.language_implementation_version_id".';
+
+CREATE OR REPLACE FUNCTION public.get_language_implementation_version_id(
+  -- overload for when language_id is known
+  language_id integer
+  , language_implementation_version citext DEFAULT ''
+)
+RETURNS integer AS
+$$
+  DECLARE
+    result integer;
+  BEGIN
+    SELECT language_implementation_version_id INTO result FROM public.language_implementation_version AS lv
+    WHERE lv.benchmark_language_id = language_id
+      AND lv.language_implementation_version = COALESCE($2, '');
+
+    IF result IS NULL THEN
+      INSERT INTO
+        public.language_implementation_version(benchmark_language_id, language_implementation_version)
+      VALUES (language_id, COALESCE($2, ''))
+      RETURNING language_implementation_version_id INTO result;
+    END IF;
+
+    RETURN result;
+  END
+$$
+LANGUAGE plpgsql;
+
+-- GET_LANGUAGE_DEPENDENCY_LOOKUP_ID
+CREATE OR REPLACE FUNCTION public.get_dependencies_id(
+  dependencies jsonb DEFAULT '{}'::jsonb
+)
+RETURNS integer AS
+$$
+  DECLARE
+    result integer;
+  BEGIN
+    SELECT dependencies_id INTO result
+    FROM public.dependencies AS ldl
+    WHERE ldl.dependencies = COALESCE($1, '{}'::jsonb);
+
+    IF result IS NULL THEN
+      INSERT INTO
+        public.dependencies(dependencies)
+      VALUES (COALESCE($1, '{}'::jsonb))
+      RETURNING dependencies_id INTO result;
+    END IF;
+
+    RETURN result;
+  END
+$$
+LANGUAGE plpgsql;
+COMMENT ON FUNCTION public.get_dependencies_id(jsonb)
+IS 'Insert or select dependencies, returning "dependencies.dependencies_id".';
+
+-- GET_ENVIRONMENT_ID
+CREATE OR REPLACE FUNCTION public.get_environment_id(
+  language citext,
+  language_implementation_version citext DEFAULT '',
+  dependencies jsonb DEFAULT '{}'::jsonb
+)
+RETURNS integer AS
+$$
+  DECLARE
+    found_language_id integer;
+    found_version_id integer;
+    found_dependencies_id integer;
+    result integer;
+  BEGIN
+    SELECT public.get_benchmark_language_id($1) INTO found_language_id;
+    SELECT
+      public.get_language_implementation_version_id(found_language_id, $2)
+      INTO found_version_id;
+    SELECT
+      public.get_dependencies_id ($3)
+      INTO found_dependencies_id;
+
+    SELECT environment_id INTO result FROM public.environment AS e
+    WHERE e.benchmark_language_id = found_language_id
+      AND e.language_implementation_version_id = found_version_id
+      AND e.dependencies_id = found_dependencies_id;
+
+    IF result IS NULL THEN
+      INSERT INTO
+        public.environment(
+          benchmark_language_id
+          , language_implementation_version_id
+          , dependencies_id
+        )
+      VALUES (found_language_id, found_version_id, found_dependencies_id)
+      RETURNING environment_id INTO result;
+    END IF;
+
+    RETURN result;
+  END
+$$
+LANGUAGE plpgsql;
+COMMENT ON FUNCTION public.get_environment_id(citext, citext, jsonb)
+IS 'Insert or select language, language version, and dependencies, '
+      'returning "environment.environment_id".';
+
+-- GET_BENCHMARK_TYPE_ID (full signature)
+CREATE OR REPLACE FUNCTION public.get_benchmark_type_id(
+  benchmark_type citext
+  , lessisbetter boolean
+)
+RETURNS integer AS
+$$
+  DECLARE
+    result integer;
+  BEGIN
+    SELECT benchmark_type_id INTO result FROM public.benchmark_type AS bt
+    WHERE bt.benchmark_type = $1
+      AND bt.lessisbetter = $2;
+
+    IF result IS NULL THEN
+      INSERT INTO public.benchmark_type(benchmark_type, lessisbetter)
+      VALUES($1, $2)
+      RETURNING benchmark_type_id INTO result;
+    END IF;
+
+    RETURN result;
+  END
+$$
+LANGUAGE plpgsql;
+COMMENT ON FUNCTION public.get_benchmark_type_id(citext, boolean)
+IS 'Insert or select benchmark type and lessisbetter, '
+   'returning "benchmark_type.benchmark_type_id".';
+
+-- GET_BENCHMARK_TYPE_ID (given unique benchmark_type string only)
+CREATE OR REPLACE FUNCTION public.get_benchmark_type_id(
+  benchmark_type citext
+)
+RETURNS integer AS
+$$
+  DECLARE
+    result integer;
+  BEGIN
+    SELECT benchmark_type_id INTO result FROM public.benchmark_type AS bt
+    WHERE bt.benchmark_type = $1;
+
+    RETURN result;
+  END
+$$
+LANGUAGE plpgsql;
+COMMENT ON FUNCTION public.get_benchmark_type_id(citext)
+IS 'Select benchmark_type_id given benchmark type (e.g. ''time''), '
+   'returning "benchmark_type.benchmark_type_id".';
+
+-- GET_UNIT_ID (full signature)
+CREATE OR REPLACE FUNCTION public.get_unit_id(
+  benchmark_type citext
+  , units citext
+  , lessisbetter boolean DEFAULT NULL
+)
+RETURNS integer AS
+$$
+  DECLARE
+    found_benchmark_type_id integer;
+    result integer;
+  BEGIN
+  
+    IF ($3 IS NOT NULL)  -- if lessisbetter is not null
+    THEN
+      SELECT public.get_benchmark_type_id($1, $3)
+        INTO found_benchmark_type_id;
+    ELSE
+      SELECT public.get_benchmark_type_id($1)
+        INTO found_benchmark_type_id;
+    END IF;
+
+    SELECT unit_id INTO result FROM public.unit AS u
+    WHERE u.benchmark_type_id = found_benchmark_type_id
+      AND u.units = $2;
+
+    IF result IS NULL THEN
+      INSERT INTO public.unit(benchmark_type_id, units)
+      VALUES(found_benchmark_type_id, $2)
+      RETURNING unit_id INTO result;
+    END IF;
+
+    RETURN result;
+  END
+$$
+LANGUAGE plpgsql;
+COMMENT ON FUNCTION public.get_unit_id(citext, citext, boolean)
+IS 'Insert or select benchmark type (e.g. ''time''), '
+   'units string (e.g. ''miliseconds''), '
+   'and "lessisbetter" (true if smaller benchmark values are better), '
+   'returning "unit.unit_id".';
+
+-- GET_UNIT_ID (given unique units string only)
+CREATE OR REPLACE FUNCTION public.get_unit_id(units citext)
+RETURNS integer AS
+$$
+  SELECT unit_id FROM public.unit AS u
+  WHERE u.units = units;
+$$
+LANGUAGE sql STABLE;
+COMMENT ON FUNCTION public.get_unit_id(citext)
+IS 'Select unit_id given unit name, returning "unit.unit_id".';
+
+-- GET_BENCHMARK_ID (full signature)
+CREATE OR REPLACE FUNCTION public.get_benchmark_id(
+  benchmark_language citext
+  , benchmark_name citext
+  , parameter_names text[]
+  , benchmark_description text
+  , benchmark_version citext
+  , benchmark_type citext
+  , units citext
+  , lessisbetter boolean
+)
+RETURNS integer AS
+$$
+  DECLARE
+    found_benchmark_language_id integer;
+    found_unit_id integer;
+    result integer;
+  BEGIN
+    SELECT public.get_benchmark_language_id(
+      benchmark_language
+    ) INTO found_benchmark_language_id;
+
+    SELECT public.get_unit_id(
+      benchmark_type
+      , units
+      , lessisbetter
+    ) INTO found_unit_id;
+
+    SELECT benchmark_id INTO result FROM public.benchmark AS b
+    WHERE b.benchmark_language_id = found_benchmark_language_id
+      AND b.benchmark_name = $2
+      -- handle nullable "parameter_names"
+      AND b.parameter_names IS NOT DISTINCT FROM $3
+      AND b.benchmark_description = $4
+      AND b.benchmark_version = $5
+      AND b.unit_id = found_unit_id;
+
+    IF result IS NULL THEN
+      INSERT INTO public.benchmark(
+        benchmark_language_id
+        , benchmark_name
+        , parameter_names
+        , benchmark_description
+        , benchmark_version
+        , unit_id
+      )
+      VALUES (found_benchmark_language_id, $2, $3, $4, $5, found_unit_id)
+      RETURNING benchmark_id INTO result;
+    END IF;
+
+    RETURN result;
+  END
+$$
+LANGUAGE plpgsql;
+COMMENT ON FUNCTION public.get_benchmark_id(
+  citext
+  , citext
+  , text[]
+  , text
+  , citext
+  , citext
+  , citext
+  , boolean
+)
+IS 'Insert/select benchmark given data, returning "benchmark.benchmark_id".';
+
+-- GET_BENCHMARK_ID (by unique columns)
+CREATE OR REPLACE FUNCTION public.get_benchmark_id(
+  benchmark_language citext
+  , benchmark_name citext
+  , benchmark_version citext
+)
+RETURNS integer AS
+$$
+  WITH language AS (
+    SELECT public.get_benchmark_language_id(benchmark_language) AS id
+  )
+  SELECT b.benchmark_id
+  FROM public.benchmark AS b
+  JOIN language ON b.benchmark_language_id = language.id
+  WHERE b.benchmark_name = benchmark_name
+    AND benchmark_version = benchmark_version
+$$
+LANGUAGE sql STABLE;
+COMMENT ON FUNCTION public.get_benchmark_id(citext, citext, citext)
+IS 'Select existing benchmark given unique columns, '
+   'returning "benchmark.benchmark_id".';
diff --git a/src/arrow/dev/benchmarking/ddl/3_01_functions_triggers.sql b/src/arrow/dev/benchmarking/ddl/3_01_functions_triggers.sql
new file mode 100644
index 000000000..b6ce4741a
--- /dev/null
+++ b/src/arrow/dev/benchmarking/ddl/3_01_functions_triggers.sql
@@ -0,0 +1,574 @@
+/*
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+*/
+
+
+-------------------------- TRIGGER FUNCTIONS --------------------------
+-- Views that do not select from a single table or view are not
+-- automatically updatable. These trigger functions are intended
+-- to be run instead of INSERT into the complicated views.
+
+
+-- LANGUAGE_IMPLEMENTATION_VERSION_VIEW_INSERT_ROW
+CREATE OR REPLACE FUNCTION public.language_implementation_version_view_insert_row()
+RETURNS trigger AS
+$$
+  DECLARE
+    language_id integer;
+    result integer;
+  BEGIN
+    IF NEW.benchmark_language IS NULL THEN
+      RAISE EXCEPTION 'Column "benchmark_language" cannot be NULL.';
+    END IF;
+    IF NEW.language_implementation_version IS NULL THEN
+      RAISE EXCEPTION
+        'Column "language_implementation_version" cannot be NULL (use '''' instead).';
+    END IF;
+
+    SELECT public.get_benchmark_language_id(NEW.benchmark_language)
+      INTO language_id;
+
+    SELECT language_implementation_version_id INTO result FROM public.language_implementation_version AS lv
+    WHERE lv.benchmark_language_id = language_id
+      AND lv.language_implementation_version = NEW.language_implementation_version;
+
+    IF result IS NOT NULL THEN
+      -- row already exists
+      RETURN NULL;
+    ELSE
+      INSERT INTO
+        public.language_implementation_version(
+          benchmark_language_id
+          , language_implementation_version
+        )
+      VALUES (language_id, NEW.language_implementation_version)
+      RETURNING language_implementation_version_id INTO NEW.language_implementation_version_id;
+    END IF;
+
+    RETURN NEW;
+  END
+$$
+LANGUAGE plpgsql;
+
+-- ENVIRONMENT_VIEW_INSERT_ROW
+CREATE OR REPLACE FUNCTION public.environment_view_insert_row()
+RETURNS trigger AS
+$$
+  DECLARE
+    found_language_id integer;
+    found_version_id integer;
+    found_dependencies_id integer;
+    result integer;
+  BEGIN
+    IF NEW.benchmark_language IS NULL
+    THEN
+      RAISE EXCEPTION 'Column "benchmark_language" cannot be NULL.';
+    END IF;
+    IF NEW.language_implementation_version IS NULL THEN
+      RAISE EXCEPTION
+        'Column "language_implementation_version" cannot be NULL (use '''' instead).';
+    END IF;
+
+    SELECT public.get_benchmark_language_id(NEW.benchmark_language)
+      INTO found_language_id;
+
+    SELECT public.get_language_implementation_version_id(
+      found_language_id
+      , NEW.language_implementation_version
+    )
+    INTO found_version_id;
+
+    SELECT public.get_dependencies_id(NEW.dependencies)
+    INTO found_dependencies_id;
+
+    SELECT environment_id INTO result FROM public.environment AS e
+    WHERE e.benchmark_language_id = found_language_id
+      AND e.language_implementation_version_id = found_version_id
+      AND e.dependencies_id = found_dependencies_id;
+
+    IF result IS NOT NULL THEN
+      -- row already exists
+      RETURN NULL;
+    ELSE
+      INSERT INTO
+        public.environment(
+          benchmark_language_id
+          , language_implementation_version_id
+          , dependencies_id
+        )
+      VALUES (found_language_id, found_version_id, found_dependencies_id)
+      RETURNING environment_id INTO NEW.environment_id;
+    END IF;
+
+    RETURN NEW;
+  END
+$$
+LANGUAGE plpgsql;
+
+-- MACHINE_VIEW_INSERT_ROW
+CREATE OR REPLACE FUNCTION public.machine_view_insert_row()
+RETURNS trigger AS
+$$
+  DECLARE
+    found_cpu_id integer;
+    found_gpu_id integer;
+    found_os_id integer;
+    result integer;
+  BEGIN
+    IF (
+      NEW.machine_name IS NULL
+      OR NEW.memory_bytes IS NULL
+      OR NEW.cpu_model_name IS NULL
+      OR NEW.cpu_core_count IS NULL
+      OR NEW.cpu_thread_count IS NULL
+      OR NEW.cpu_frequency_max_Hz IS NULL
+      OR NEW.cpu_frequency_min_Hz IS NULL
+      OR NEW.cpu_L1d_cache_bytes IS NULL
+      OR NEW.cpu_L1i_cache_bytes IS NULL
+      OR NEW.cpu_L2_cache_bytes IS NULL
+      OR NEW.cpu_L3_cache_bytes IS NULL
+      OR NEW.os_name IS NULL
+      OR NEW.architecture_name IS NULL
+    )
+    THEN
+      RAISE EXCEPTION 'None of the columns in "machine_view" can be NULL. '
+        'all columns in table "gpu" will default to the empty string '''', '
+        'as will blank "os.kernel_name". This is to allow uniqueness '
+        'constraints to work. Thank you!.';
+    END IF;
+
+    SELECT public.get_cpu_id(
+      NEW.cpu_model_name
+      , NEW.cpu_core_count
+      , NEW.cpu_thread_count
+      , NEW.cpu_frequency_max_Hz
+      , NEW.cpu_frequency_min_Hz
+      , NEW.cpu_L1d_cache_bytes
+      , NEW.cpu_L1i_cache_bytes
+      , NEW.cpu_L2_cache_bytes
+      , NEW.cpu_L3_cache_bytes
+    ) INTO found_cpu_id;
+
+    SELECT public.get_gpu_id(
+      NEW.gpu_information
+      , NEW.gpu_part_number
+      , NEW.gpu_product_name
+    ) INTO found_gpu_id;
+
+    SELECT public.get_os_id(
+      NEW.os_name
+      , NEW.architecture_name
+      , NEW.kernel_name
+    ) INTO found_os_id;
+
+    SELECT machine_id INTO result FROM public.machine AS m
+    WHERE m.os_id = found_os_id
+      AND m.cpu_id = found_cpu_id
+      AND m.gpu_id = found_gpu_id
+      AND m.machine_name = NEW.machine_name
+      AND m.memory_bytes = NEW.memory_bytes
+      AND m.cpu_actual_frequency_Hz = NEW.cpu_actual_frequency_Hz;
+
+    IF result IS NOT NULL THEN
+      -- row already exists
+      RETURN NULL;
+    ELSE
+      INSERT INTO public.machine(
+        os_id
+        , cpu_id
+        , gpu_id
+        , machine_name
+        , mac_address
+        , memory_bytes
+        , cpu_actual_frequency_Hz
+        , machine_other_attributes
+      )
+      VALUES (
+        found_os_id
+        , found_cpu_id
+        , found_gpu_id
+        , NEW.machine_name
+        , NEW.mac_address
+        , NEW.memory_bytes
+        , NEW.cpu_actual_frequency_Hz
+        , NEW.machine_other_attributes
+      )
+      RETURNING machine_id INTO NEW.machine_id;
+    END IF;
+
+    RETURN NEW;
+  END
+$$
+LANGUAGE plpgsql;
+
+-- UNIT_VIEW_INSERT_ROW
+CREATE OR REPLACE FUNCTION public.unit_view_insert_row()
+RETURNS trigger AS
+$$
+  DECLARE
+    found_benchmark_type_id integer;
+    result integer;
+  BEGIN
+    IF (NEW.benchmark_type IS NULL OR NEW.units IS NULL)
+    THEN
+      RAISE EXCEPTION E'"benchmark_type" and "units" cannot be NULL.\n'
+        'Further, if the "benchmark_type" has never been defined, '
+        '"lessisbetter" must be defined or there will be an error.';
+    END IF;
+
+    -- It's OK for "lessisbetter" = NULL if "benchmark_type" already exists.
+    SELECT public.get_benchmark_type_id(NEW.benchmark_type, NEW.lessisbetter)
+      INTO found_benchmark_type_id;
+
+    SELECT unit_id INTO result FROM public.unit AS u
+    WHERE u.benchmark_type_id = found_benchmark_type_id
+      AND u.units = NEW.units;
+
+    IF result IS NOT NULL THEN
+      -- row already exists
+      RETURN NULL;
+    ELSE
+      INSERT INTO public.unit (
+        benchmark_type_id
+        , units
+      )
+      VALUES (
+        found_benchmark_type_id
+        , NEW.units
+      )
+      RETURNING unit_id INTO NEW.unit_id;
+    END IF;
+
+    RETURN NEW;
+  END
+$$
+LANGUAGE plpgsql;
+
+-- BENCHMARK_VIEW_INSERT_ROW
+CREATE OR REPLACE FUNCTION public.benchmark_view_insert_row()
+RETURNS trigger AS
+$$
+  DECLARE
+    found_benchmark_language_id integer;
+    found_units_id integer;
+    result integer;
+  BEGIN
+    IF (
+      NEW.benchmark_name IS NULL
+      OR NEW.benchmark_version IS NULL
+      OR NEW.benchmark_language IS NULL
+      OR NEW.benchmark_type IS NULL
+      OR NEW.benchmark_description IS NULL
+      OR NEW.units IS NULL
+    )
+    THEN
+      RAISE EXCEPTION 'The only nullable column in this view is '
+        '"benchmark.parameter_names".';
+    END IF;
+
+    SELECT public.get_benchmark_language_id(
+      NEW.benchmark_language
+    ) INTO found_benchmark_language_id;
+
+    SELECT public.get_unit_id(NEW.units) INTO found_units_id;
+
+    SELECT benchmark_id INTO result FROM public.benchmark AS b
+    WHERE b.benchmark_language_id = found_benchmark_language_id
+      AND b.benchmark_name = NEW.benchmark_name
+      -- handle nullable "parameter_names"
+      AND b.parameter_names IS NOT DISTINCT FROM NEW.parameter_names
+      AND b.benchmark_description = NEW.benchmark_description
+      AND b.benchmark_version = NEW.benchmark_version
+      AND b.unit_id = found_units_id;
+
+    IF result IS NOT NULL THEN
+      -- row already exists
+      RETURN NULL;
+    ELSE
+      INSERT INTO public.benchmark(
+        benchmark_language_id
+        , benchmark_name
+        , parameter_names
+        , benchmark_description
+        , benchmark_version
+        , unit_id
+      )
+      VALUES (
+        found_benchmark_language_id
+        , NEW.benchmark_name
+        , NEW.parameter_names
+        , NEW.benchmark_description
+        , NEW.benchmark_version
+        , found_units_id
+      )
+      RETURNING benchmark_id INTO NEW.benchmark_id;
+    END IF;
+
+    RETURN NEW;
+  END
+$$
+LANGUAGE plpgsql;
+
+-- BENCHMARK_RUN_VIEW_INSERT_ROW
+CREATE OR REPLACE FUNCTION public.benchmark_run_view_insert_row()
+RETURNS trigger AS
+$$
+  DECLARE
+    found_benchmark_id integer;
+    found_benchmark_language_id integer;
+    found_machine_id integer;
+    found_environment_id integer;
+    found_language_implementation_version_id integer;
+  BEGIN
+    IF (
+      NEW.benchmark_name IS NULL
+      OR NEW.benchmark_version IS NULL
+      OR NEW.benchmark_language IS NULL
+      OR NEW.value IS NULL
+      OR NEW.run_timestamp IS NULL
+      OR NEW.git_commit_timestamp IS NULL
+      OR NEW.git_hash IS NULL
+      OR NEW.language_implementation_version IS NULL
+      OR NEW.mac_address IS NULL
+    )
+    THEN
+      RAISE EXCEPTION 'Only the following columns can be NULL: '
+        '"parameter_names", "val_min", "val_q1", "val_q3", "val_max".';
+    END IF;
+
+    SELECT public.get_benchmark_id(
+      NEW.benchmark_language
+      , NEW.benchmark_name
+      , NEW.benchmark_version
+    ) INTO found_benchmark_id;
+
+    SELECT public.get_benchmark_language_id(
+      NEW.benchmark_language
+    ) INTO found_benchmark_language_id;
+
+    SELECT public.get_machine_id(
+      NEW.mac_address
+    ) INTO found_machine_id;
+
+    SELECT public.get_environment_id(
+      NEW.benchmark_language
+      , NEW.language_implementation_version
+      , NEW.dependencies
+    ) INTO found_environment_id;
+
+    SELECT public.get_language_implementation_version_id(
+      found_benchmark_language_id,
+      NEW.language_implementation_version
+    ) INTO found_language_implementation_version_id;
+
+    INSERT INTO public.benchmark_run (
+      parameter_values
+      , value
+      , git_commit_timestamp
+      , git_hash
+      , val_min
+      , val_q1
+      , val_q3
+      , val_max
+      , std_dev
+      , n_obs
+      , run_timestamp
+      , run_metadata
+      , run_notes
+      , machine_id
+      , benchmark_language_id
+      , language_implementation_version_id
+      , environment_id
+      , benchmark_id
+    )
+    VALUES (
+      COALESCE(NEW.parameter_values, '{}'::jsonb)
+      , NEW.value
+      , NEW.git_commit_timestamp
+      , NEW.git_hash
+      , NEW.val_min
+      , NEW.val_q1
+      , NEW.val_q3
+      , NEW.val_max
+      , NEW.std_dev
+      , NEW.n_obs
+      , NEW.run_timestamp
+      , NEW.run_metadata
+      , NEW.run_notes
+      , found_machine_id
+      , found_benchmark_language_id
+      , found_language_implementation_version_id
+      , found_environment_id
+      , found_benchmark_id
+    ) returning benchmark_run_id INTO NEW.benchmark_run_id;
+
+    RETURN NEW;
+  END
+$$
+LANGUAGE plpgsql;
+
+-- FULL_BENCHMARK_RUN_VIEW_INSERT_ROW
+CREATE OR REPLACE FUNCTION public.full_benchmark_run_view_insert_row()
+RETURNS trigger AS
+$$
+  DECLARE
+    found_benchmark_id integer;
+    found_benchmark_language_id integer;
+    found_machine_id integer;
+    found_environment_id integer;
+    found_language_implementation_version_id integer;
+  BEGIN
+    IF (
+      NEW.value IS NULL
+      OR NEW.git_hash IS NULL
+      OR NEW.git_commit_timestamp IS NULL
+      OR NEW.run_timestamp IS NULL
+      -- benchmark
+      OR NEW.benchmark_name IS NULL
+      OR NEW.benchmark_description IS NULL
+      OR NEW.benchmark_version IS NULL
+      OR NEW.benchmark_language IS NULL
+      -- unit
+      OR NEW.benchmark_type IS NULL
+      OR NEW.units IS NULL
+      OR NEW.lessisbetter IS NULL
+      -- machine
+      OR NEW.machine_name IS NULL
+      OR NEW.memory_bytes IS NULL
+      OR NEW.cpu_model_name IS NULL
+      OR NEW.cpu_core_count IS NULL
+      OR NEW.os_name IS NULL
+      OR NEW.architecture_name IS NULL
+      OR NEW.kernel_name IS NULL
+      OR NEW.cpu_model_name IS NULL
+      OR NEW.cpu_core_count IS NULL
+      OR NEW.cpu_thread_count IS NULL
+      OR NEW.cpu_frequency_max_Hz IS NULL
+      OR NEW.cpu_frequency_min_Hz IS NULL
+      OR NEW.cpu_L1d_cache_bytes IS NULL
+      OR NEW.cpu_L1i_cache_bytes IS NULL
+      OR NEW.cpu_L2_cache_bytes IS NULL
+      OR NEW.cpu_L3_cache_bytes IS NULL
+    )
+    THEN
+      RAISE EXCEPTION 'Only the following columns can be NULL: '
+        '"machine_other_attributes", "parameter_names", "val_min", '
+        '"val_q1", "val_q3", "val_max", "run_metadata", "run_notes". '
+        'If "gpu_information", "gpu_part_number", "gpu_product_name", or '
+        '"kernel_name" are null, they will be silently turned into an '
+        'empty string ('''').';
+    END IF;
+
+    SELECT public.get_benchmark_id(
+      NEW.benchmark_language
+      , NEW.benchmark_name
+      , NEW.parameter_names
+      , NEW.benchmark_description
+      , NEW.benchmark_version
+      , NEW.benchmark_type
+      , NEW.units
+      , NEW.lessisbetter
+    ) INTO found_benchmark_id;
+
+    SELECT public.get_benchmark_language_id(
+      NEW.benchmark_language
+    ) INTO found_benchmark_language_id;
+
+    SELECT public.get_machine_id(
+      NEW.mac_address
+      , NEW.machine_name
+      , NEW.memory_bytes
+      , NEW.cpu_actual_frequency_Hz
+      -- os
+      , NEW.os_name
+      , NEW.architecture_name
+      , NEW.kernel_name
+      -- cpu
+      , NEW.cpu_model_name
+      , NEW.cpu_core_count
+      , NEW.cpu_thread_count
+      , NEW.cpu_frequency_max_Hz
+      , NEW.cpu_frequency_min_Hz
+      , NEW.cpu_L1d_cache_bytes
+      , NEW.cpu_L1i_cache_bytes
+      , NEW.cpu_L2_cache_bytes
+      , NEW.cpu_L3_cache_bytes
+      -- gpu
+      , NEW.gpu_information
+      , NEW.gpu_part_number
+      , NEW.gpu_product_name
+      -- nullable machine attributes
+      , NEW.machine_other_attributes
+    ) INTO found_machine_id;
+
+    SELECT public.get_environment_id(
+      NEW.benchmark_language
+      , NEW.language_implementation_version
+      , NEW.dependencies
+    ) INTO found_environment_id;
+
+    SELECT public.get_language_implementation_version_id(
+      found_benchmark_language_id,
+      NEW.language_implementation_version
+    ) INTO found_language_implementation_version_id;
+
+    INSERT INTO public.benchmark_run (
+      parameter_values
+      , value
+      , git_commit_timestamp
+      , git_hash
+      , val_min
+      , val_q1
+      , val_q3
+      , val_max
+      , std_dev
+      , n_obs
+      , run_timestamp
+      , run_metadata
+      , run_notes
+      , machine_id
+      , benchmark_language_id
+      , language_implementation_version_id
+      , environment_id
+      , benchmark_id
+    )
+    VALUES (
+      NEW.parameter_values
+      , NEW.value
+      , NEW.git_commit_timestamp
+      , NEW.git_hash
+      , NEW.val_min
+      , NEW.val_q1
+      , NEW.val_q3
+      , NEW.val_max
+      , NEW.std_dev
+      , NEW.n_obs
+      , NEW.run_timestamp
+      , NEW.run_metadata
+      , NEW.run_notes
+      , found_machine_id
+      , found_benchmark_language_id
+      , found_language_implementation_version_id
+      , found_environment_id
+      , found_benchmark_id
+    ) returning benchmark_run_id INTO NEW.benchmark_run_id;
+
+    RETURN NEW;
+  END
+$$
+LANGUAGE plpgsql;
diff --git a/src/arrow/dev/benchmarking/ddl/3_02_functions_ingestion.sql b/src/arrow/dev/benchmarking/ddl/3_02_functions_ingestion.sql
new file mode 100644
index 000000000..000c61d00
--- /dev/null
+++ b/src/arrow/dev/benchmarking/ddl/3_02_functions_ingestion.sql
@@ -0,0 +1,323 @@
+/*
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+*/
+
+
+-------------------------- IMPORT HELPERS  --------------------------
+-- Load from JSON (from https://stackoverflow.com/a/48396608)
+-- How to use it in the psql client:
+--   \set content `cat /examples/machine.json`
+--   select ingest_machine(:'content'::jsonb);
+-- INGEST_MACHINE_VIEW
+CREATE OR REPLACE FUNCTION public.ingest_machine_view(from_jsonb jsonb)
+RETURNS integer AS
+$$
+  DECLARE
+    result integer;
+  BEGIN
+    INSERT INTO public.machine_view
+    SELECT * FROM jsonb_populate_record(null::public.machine_view, from_jsonb)
+    RETURNING machine_id INTO result;
+    RETURN result;
+  END
+$$
+LANGUAGE plpgsql;
+COMMENT ON FUNCTION public.ingest_machine_view(jsonb) IS
+  E'The argument is a JSON object. NOTE: key names must be entirely\n'
+  'lowercase, or the insert will fail. Extra key-value pairs are ignored.\n'
+  'Example::\n\n'
+  '  {\n'
+  '    "mac_address": "0a:00:2d:01:02:03",\n'
+  '    "machine_name": "Yet-Another-Machine-Name",\n'
+  '    "memory_bytes": 8589934592,\n'
+  '    "cpu_actual_frequency_hz": 2300000000,\n'
+  '    "os_name": "OSX",\n'
+  '    "architecture_name": "x86_64",\n'
+  '    "kernel_name": "18.2.0",\n'
+  '    "cpu_model_name": "Intel(R) Core(TM) i5-7360U CPU @ 2.30GHz",\n'
+  '    "cpu_core_count": 2,\n'
+  '    "cpu_thread_count": 4,\n'
+  '    "cpu_frequency_max_hz": 2300000000,\n'
+  '    "cpu_frequency_min_hz": 2300000000,\n'
+  '    "cpu_l1d_cache_bytes": 32768,\n'
+  '    "cpu_l1i_cache_bytes": 32768,\n'
+  '    "cpu_l2_cache_bytes": 262144,\n'
+  '    "cpu_l3_cache_bytes": 4194304,\n'
+  '    "machine_other_attributes": {"just": "an example"},\n'
+  '    "gpu_information": "",\n'
+  '    "gpu_part_number": "",\n'
+  '    "gpu_product_name": ""\n'
+  '  }\n\n'
+  'To identify which columns in "machine_view" are required,\n'
+  'please see the view documentation in :ref:`benchmark-data-model`.\n';
+
+-- INGEST_BENCHMARK_VIEW
+CREATE OR REPLACE FUNCTION public.ingest_benchmark_view(from_jsonb jsonb)
+RETURNS setof integer AS
+$$
+  BEGIN
+    RETURN QUERY
+    INSERT INTO public.benchmark_view
+    SELECT * FROM jsonb_populate_recordset(
+      null::public.benchmark_view
+      , from_jsonb
+    )
+    RETURNING benchmark_id;
+  END
+$$
+LANGUAGE plpgsql;
+COMMENT ON FUNCTION public.ingest_benchmark_view(jsonb) IS
+  E'The argument is a JSON object. NOTE: key names must be entirely\n'
+  'lowercase, or the insert will fail. Extra key-value pairs are ignored.\n'
+  'Example::\n\n'
+  '  [\n'
+  '    {\n'
+  '      "benchmark_name": "Benchmark 1",\n'
+  '      "parameter_names": ["arg0", "arg1", "arg2"],\n'
+  '      "benchmark_description": "First benchmark",\n'
+  '      "benchmark_type": "Time",\n'
+  '      "units": "miliseconds",\n'
+  '      "lessisbetter": true,\n'
+  '      "benchmark_version": "second version",\n'
+  '      "benchmark_language": "Python"\n'
+  '    },\n'
+  '    {\n'
+  '      "benchmark_name": "Benchmark 2",\n'
+  '      "parameter_names": ["arg0", "arg1"],\n'
+  '      "benchmark_description": "Description 2.",\n'
+  '      "benchmark_type": "Time",\n'
+  '      "units": "nanoseconds",\n'
+  '      "lessisbetter": true,\n'
+  '      "benchmark_version": "second version",\n'
+  '      "benchmark_language": "Python"\n'
+  '    }\n'
+  '  ]\n\n'
+  'To identify which columns in "benchmark_view" are required,\n'
+  'please see the view documentation in :ref:`benchmark-data-model`.\n';
+
+-- INGEST_BENCHMARK_RUN_VIEW
+CREATE OR REPLACE FUNCTION public.ingest_benchmark_run_view(from_jsonb jsonb)
+RETURNS setof bigint AS
+$$
+  BEGIN
+    RETURN QUERY
+    INSERT INTO public.benchmark_run_view
+    SELECT * FROM
+    jsonb_populate_recordset(null::public.benchmark_run_view, from_jsonb)
+    RETURNING benchmark_run_id;
+  END
+$$
+LANGUAGE plpgsql;
+COMMENT ON FUNCTION public.ingest_benchmark_run_view(jsonb) IS
+  E'The argument is a JSON object. NOTE: key names must be entirely\n'
+  'lowercase, or the insert will fail. Extra key-value pairs are ignored.\n'
+  'Example::\n\n'
+  '  [\n'
+  '    {\n'
+  '      "benchmark_name": "Benchmark 2",\n'
+  '      "benchmark_version": "version 0",\n'
+  '      "parameter_values": {"arg0": 100, "arg1": 5},\n'
+  '      "value": 2.5,\n'
+  '      "git_commit_timestamp": "2019-02-08 22:35:53 +0100",\n'
+  '      "git_hash": "324d3cf198444a",\n'
+  '      "val_min": 1,\n'
+  '      "val_q1": 2,\n'
+  '      "val_q3": 3,\n'
+  '      "val_max": 4,\n'
+  '      "std_dev": 1.41,\n'
+  '      "n_obs": 8,\n'
+  '      "run_timestamp": "2019-02-14 03:00:05 -0600",\n'
+  '      "mac_address": "08:00:2b:01:02:03",\n'
+  '      "benchmark_language": "Python",\n'
+  '      "language_implementation_version": "CPython 2.7",\n'
+  '      "dependencies": {"six": "", "numpy": "1.14", "other_lib": "1.0"}\n'
+  '    },\n'
+  '    {\n'
+  '      "benchmark_name": "Benchmark 2",\n'
+  '      "benchmark_version": "version 0",\n'
+  '      "parameter_values": {"arg0": 1000, "arg1": 5},\n'
+  '      "value": 5,\n'
+  '      "git_commit_timestamp": "2019-02-08 22:35:53 +0100",\n'
+  '      "git_hash": "324d3cf198444a",\n'
+  '      "std_dev": 3.14,\n'
+  '      "n_obs": 8,\n'
+  '      "run_timestamp": "2019-02-14 03:00:10 -0600",\n'
+  '      "mac_address": "08:00:2b:01:02:03",\n'
+  '      "benchmark_language": "Python",\n'
+  '      "language_implementation_version": "CPython 2.7",\n'
+  '      "dependencies": {"six": "", "numpy": "1.14", "other_lib": "1.0"}\n'
+  '    }\n'
+  '  ]\n'
+  'To identify which columns in "benchmark_run_view" are required,\n'
+  'please see the view documentation in :ref:`benchmark-data-model`.\n';
+
+-- INGEST_BENCHMARK_RUNS_WITH_CONTEXT
+CREATE OR REPLACE FUNCTION public.ingest_benchmark_runs_with_context(from_jsonb jsonb)
+RETURNS setof bigint AS
+$$
+  DECLARE
+    context_jsonb jsonb;
+    found_environment_id integer;
+    found_machine_id integer;
+  BEGIN
+    SELECT from_jsonb -> 'context' INTO context_jsonb;
+
+    SELECT public.get_machine_id((context_jsonb ->> 'mac_address')::macaddr)
+    INTO found_machine_id;
+
+    SELECT get_environment_id(
+      (context_jsonb ->> 'benchmark_language')::citext
+      , (context_jsonb ->> 'language_implementation_version')::citext
+      , context_jsonb -> 'dependencies'
+    ) INTO found_environment_id;
+
+    RETURN QUERY
+    WITH run_datum AS (
+      SELECT *
+      FROM jsonb_to_recordset(from_jsonb -> 'benchmarks')
+      AS x(
+        benchmark_name citext
+        , parameter_values jsonb
+        , value numeric
+        , val_min numeric
+        , val_q1 numeric
+        , val_q3 numeric
+        , val_max numeric
+        , std_dev numeric
+        , n_obs integer
+        , run_timestamp timestamp (0) with time zone
+        , run_metadata jsonb
+        , run_notes text
+      )
+    ), benchmark_name_and_id AS (
+      SELECT
+        key AS benchmark_name
+        , public.get_benchmark_id(
+            (context_jsonb ->> 'benchmark_language')::citext
+            , key::citext  -- benchmark_name
+            , value::citext  -- benchmark_version
+        ) AS benchmark_id
+      FROM jsonb_each_text(from_jsonb -> 'benchmark_version')
+    )
+    INSERT INTO public.benchmark_run (
+      benchmark_id
+      -- run_datum
+      , parameter_values
+      , value
+      , val_min
+      , val_q1
+      , val_q3
+      , val_max
+      , std_dev
+      , n_obs
+      , run_metadata
+      , run_notes
+      -- additional context information
+      , git_commit_timestamp
+      , git_hash
+      , run_timestamp
+      -- machine
+      , machine_id
+      -- environment
+      , environment_id
+      , language_implementation_version_id
+      , benchmark_language_id
+    )
+    SELECT
+      b.benchmark_id
+      -- run_datum
+      , run_datum.parameter_values
+      , run_datum.value
+      , run_datum.val_min
+      , run_datum.val_q1
+      , run_datum.val_q3
+      , run_datum.val_max
+      , run_datum.std_dev
+      , run_datum.n_obs
+      , run_datum.run_metadata
+      , run_datum.run_notes
+      -- additional context information
+      , (context_jsonb ->> 'git_commit_timestamp')::timestamp (0) with time zone
+      , context_jsonb ->> 'git_hash'
+      , (context_jsonb ->> 'run_timestamp')::timestamp (0) with time zone
+      -- machine
+      , found_machine_id
+      -- environment
+      , e.environment_id
+      , e.language_implementation_version_id
+      , e.benchmark_language_id
+    FROM run_datum
+    JOIN public.environment AS e
+      ON e.environment_id = found_environment_id
+    JOIN benchmark_name_and_id AS b
+      ON b.benchmark_name = run_datum.benchmark_name
+    RETURNING benchmark_run_id;
+  END
+$$
+LANGUAGE plpgsql;
+COMMENT ON FUNCTION public.ingest_benchmark_runs_with_context(jsonb) IS
+  E'The argument is a JSON object. NOTE: key names must be entirely\n'
+  'lowercase, or the insert will fail. Extra key-value pairs are ignored.\n'
+  'The object contains three key-value pairs::\n\n'
+  '    {"context": {\n'
+  '        "mac_address": "08:00:2b:01:02:03",\n'
+  '        "benchmark_language": "Python",\n'
+  '        "language_implementation_version": "CPython 3.6",\n'
+  '        "dependencies": {"six": "", "numpy": "1.14", "other_lib": "1.0"},\n'
+  '        "git_commit_timestamp": "2019-02-14 22:42:22 +0100",\n'
+  '        "git_hash": "123456789abcde",\n'
+  '        "run_timestamp": "2019-02-14 03:00:40 -0600",\n'
+  '        "extra stuff": "does not hurt anything and will not be added."\n'
+  '      },\n'
+  '     "benchmark_version": {\n'
+  '        "Benchmark Name 1": "Any string can be a version.",\n'
+  '        "Benchmark Name 2": "A git hash can be a version.",\n'
+  '        "An Unused Benchmark Name": "Will be ignored."\n'
+  '      },\n'
+  '     "benchmarks": [\n'
+  '        {\n'
+  '          "benchmark_name": "Benchmark Name 1",\n'
+  '          "parameter_values": {"argument1": 1, "argument2": "value2"},\n'
+  '          "value": 42,\n'
+  '          "val_min": 41.2,\n'
+  '          "val_q1":  41.5,\n'
+  '          "val_q3":  42.5,\n'
+  '          "val_max": 42.8,\n'
+  '          "std_dev": 0.5,\n'
+  '          "n_obs": 100,\n'
+  '          "run_metadata": {"any": "key-value pairs"},\n'
+  '          "run_notes": "Any relevant notes."\n'
+  '        },\n'
+  '        {\n'
+  '          "benchmark_name": "Benchmark Name 2",\n'
+  '          "parameter_values": {"not nullable": "Use {} if no params."},\n'
+  '          "value": 8,\n'
+  '          "std_dev": 1,\n'
+  '          "n_obs": 2,\n'
+  '        }\n'
+  '      ]\n'
+  '    }\n\n'
+  '- The entry for "context" contains the machine, environment, and timestamp\n'
+  '  information common to all of the runs\n'
+  '- The entry for "benchmark_version" maps benchmark\n'
+  '  names to their version strings. (Which can be a git hash,\n'
+  '  the entire code string, a number, or any other string of your choice.)\n'
+  '- The entry for "benchmarks" is a list of benchmark run data\n'
+  '  for the given context and benchmark versions. The first example\n'
+  '  benchmark run entry contains all possible values, even\n'
+  '  nullable ones, and the second entry omits all nullable values.\n\n';
diff --git a/src/arrow/dev/benchmarking/ddl/3_10_functions_documentation.sql b/src/arrow/dev/benchmarking/ddl/3_10_functions_documentation.sql
new file mode 100644
index 000000000..6b2a05790
--- /dev/null
+++ b/src/arrow/dev/benchmarking/ddl/3_10_functions_documentation.sql
@@ -0,0 +1,395 @@
+/*
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+*/
+
+
+-- _DOCUMENTATION_INGESTION
+CREATE OR REPLACE FUNCTION public._documentation_ingestion()
+RETURNS text AS
+$$
+  WITH ingestion_docs AS (
+    SELECT
+      proname || E'\n'
+      || rpad('', character_length(proname), '-')
+      || E'\n\n:code:`'
+      || proname || '('
+      || string_agg(a.argname || ' ' || typname , ', ')
+      || E')`\n\n'
+      || description
+      || E'\n\n\nback to `Benchmark data model <benchmark-data-model>`_\n'
+      AS docs
+    FROM pg_catalog.pg_proc
+    JOIN pg_catalog.pg_namespace
+      ON nspname='public'
+      AND pg_namespace.oid = pronamespace
+      AND proname LIKE '%ingest%'
+    JOIN pg_catalog.pg_description
+      ON pg_description.objoid=pg_proc.oid,
+    LATERAL unnest(proargnames, proargtypes) AS a(argname, argtype)
+      JOIN pg_catalog.pg_type
+        ON pg_type.oid = a.argtype
+    GROUP BY proname, description
+  )
+  SELECT
+    string_agg(docs, E'\n\n') AS docs
+  FROM ingestion_docs;
+$$
+LANGUAGE sql STABLE;
+
+-- _DOCUMENTATION_VIEW_DETAILS
+CREATE OR REPLACE FUNCTION public._documentation_view_details(view_name citext)
+RETURNS TABLE(
+    column_name name
+    , type_name name
+    , nullable text
+    , default_value text
+    , description text
+) AS
+$$
+    WITH view_columns AS (
+      SELECT
+        attname AS column_name
+        , attnum AS column_order
+      FROM pg_catalog.pg_attribute
+      WHERE attrelid=view_name::regclass
+    )
+    SELECT
+      t.column_name
+      , type_name
+      , coalesce(nullable, '')
+      , coalesce(default_value, '')
+      , coalesce(description, '')
+    FROM public.summarized_tables_view AS t
+    JOIN view_columns AS v ON v.column_name = t.column_name
+    WHERE t.table_name || '_view' = view_name OR t.column_name NOT LIKE '%_id'
+    ORDER BY column_order;
+$$
+LANGUAGE sql STABLE;
+
+
+-- _DOCUMENTATION_VIEW_PIECES
+CREATE OR REPLACE FUNCTION public._documentation_view_pieces(view_name citext)
+RETURNS TABLE (rst_formatted text)
+AS
+$$
+DECLARE
+  column_length integer;
+  type_length integer;
+  nullable_length integer;
+  default_length integer;
+  description_length integer;
+  sep text;
+  border text;
+BEGIN
+
+  -- All of the hard-coded constants here are the string length of the table
+  -- column headers: 'Column', 'Type', 'Nullable', 'Default', 'Description'
+  SELECT greatest(6, max(character_length(column_name)))
+  FROM public._documentation_view_details(view_name) INTO column_length;
+
+  SELECT greatest(4, max(character_length(type_name)))
+  FROM public._documentation_view_details(view_name) INTO type_length;
+
+  SELECT greatest(8, max(character_length(nullable)))
+  FROM public._documentation_view_details(view_name) INTO nullable_length;
+
+  SELECT greatest(7, max(character_length(default_value)))
+  FROM public._documentation_view_details(view_name) INTO default_length;
+
+  SELECT greatest(11, max(character_length(description)))
+  FROM public._documentation_view_details(view_name) INTO description_length;
+
+  SELECT '  ' INTO sep;
+
+  SELECT
+      concat_ws(sep
+        , rpad('', column_length, '=')
+        , rpad('', type_length, '=')
+        , rpad('', nullable_length, '=')
+        , rpad('', default_length, '=')
+        , rpad('', description_length, '=')
+      )
+    INTO border;
+
+  RETURN QUERY
+  SELECT
+    border
+  UNION ALL
+  SELECT
+      concat_ws(sep
+        , rpad('Column', column_length, ' ')
+        , rpad('Type', type_length, ' ')
+        , rpad('Nullable', nullable_length, ' ')
+        , rpad('Default', default_length, ' ')
+        , rpad('Description', description_length, ' ')
+      )
+  UNION ALL
+  SELECT border
+  UNION ALL
+  SELECT
+    concat_ws(sep
+      , rpad(v.column_name, column_length, ' ')
+      , rpad(v.type_name, type_length, ' ')
+      , rpad(v.nullable, nullable_length, ' ')
+      , rpad(v.default_value, default_length, ' ')
+      , rpad(v.description, description_length, ' ')
+    )
+  FROM public._documentation_view_details(view_name) AS v
+  UNION ALL
+  SELECT border;
+
+END
+$$
+LANGUAGE plpgsql STABLE;
+
+
+-- DOCUMENTATION_FOR
+CREATE OR REPLACE FUNCTION public.documentation_for(view_name citext)
+RETURNS text AS
+$$
+  DECLARE
+    view_description text;
+    view_table_markup text;
+  BEGIN
+    SELECT description FROM pg_catalog.pg_description
+    WHERE pg_description.objoid = view_name::regclass
+    INTO view_description;
+
+    SELECT
+      view_name || E'\n' || rpad('', length(view_name), '-') || E'\n\n' ||
+      view_description || E'\n\n' ||
+      string_agg(rst_formatted, E'\n')
+    INTO view_table_markup
+    FROM public._documentation_view_pieces(view_name);
+
+    RETURN view_table_markup;
+  END
+$$
+LANGUAGE plpgsql STABLE;
+COMMENT ON FUNCTION public.documentation_for(citext)
+IS E'Create an ".rst"-formatted table describing a specific view.\n'
+  'Example: SELECT public.documentation_for(''endpoint'');';
+
+
+-- DOCUMENTATION
+CREATE OR REPLACE FUNCTION public.documentation(dotfile_name text)
+RETURNS TABLE (full_text text) AS
+$$
+  WITH v AS (
+      SELECT
+        public.documentation_for(relname::citext)
+        || E'\n\nback to `Benchmark data model <benchmark-data-model>`_\n'
+        AS view_documentation
+      FROM pg_catalog.pg_trigger
+      JOIN pg_catalog.pg_class ON pg_trigger.tgrelid = pg_class.oid
+      WHERE NOT tgisinternal
+  )
+  SELECT
+    E'\n.. _benchmark-data-model:\n\n'
+    'Benchmark data model\n'
+    '====================\n\n\n'
+    '.. graphviz:: '
+    || dotfile_name
+    || E'\n\n\n.. _benchmark-ingestion:\n\n'
+      'Benchmark ingestion helper functions\n'
+      '====================================\n\n'
+    || public._documentation_ingestion()
+    || E'\n\n\n.. _benchmark-views:\n\n'
+      'Benchmark views\n'
+      '===============\n\n\n'
+    || string_agg(v.view_documentation, E'\n')
+  FROM v
+  GROUP BY True;
+$$
+LANGUAGE sql STABLE;
+COMMENT ON FUNCTION public.documentation(text)
+IS E'Create an ".rst"-formatted file that shows the columns in '
+  'every insertable view in the "public" schema.\n'
+  'The text argument is the name of the generated dotfile to be included.\n'
+  'Example: SELECT public.documentation(''data_model.dot'');';
+
+
+-- _DOCUMENTATION_DOTFILE_NODE_FOR
+CREATE OR REPLACE FUNCTION public._documentation_dotfile_node_for(tablename name)
+RETURNS text AS
+$$
+DECLARE
+  result text;
+BEGIN
+  WITH node AS (
+  SELECT
+    tablename::text AS lines
+  UNION ALL
+  SELECT
+    E'[label = \n'
+    '  <<table border="0" cellborder="1" cellspacing="0" cellpadding="2">'
+  UNION ALL
+  -- table name
+  SELECT
+    '    <tr><td border="0"><font point-size="14">'
+    || tablename
+    || '</font></td></tr>'
+  UNION ALL
+  -- primary keys
+  SELECT
+    '    <tr><td port="' || column_name || '"><b>'
+    || column_name
+    || ' (pk)</b></td></tr>'
+  FROM public.summarized_tables_view
+  WHERE table_name = tablename
+    AND description LIKE '%primary key%'
+  UNION ALL
+  -- columns
+  SELECT
+    '    <tr><td>'
+    || column_name
+    || CASE WHEN description LIKE '%unique' THEN ' (u)' ELSE '' END
+    || CASE WHEN nullable <> 'not null' THEN ' (o)' ELSE '' END
+    || '</td></tr>'
+  FROM public.summarized_tables_view
+  WHERE table_name = tablename
+    AND (description IS NULL OR description  not like '%key%')
+  UNION ALL
+  -- foreign keys
+  SELECT
+    '    <tr><td port="' || column_name || '">'
+    || column_name
+    || CASE WHEN description LIKE '%unique' THEN ' (u)' ELSE '' END
+    || ' (fk) </td></tr>'
+  FROM public.summarized_tables_view
+  WHERE table_name = tablename
+    AND description LIKE '%foreign key%'
+    AND description NOT LIKE '%primary key%'
+  UNION ALL
+  SELECT
+    E'  </table>>\n];'
+  )
+  SELECT
+    string_agg(lines, E'\n')
+  INTO result
+  FROM node;
+
+  RETURN result;
+END
+$$
+LANGUAGE plpgsql STABLE;
+
+
+-- _DOCUMENTATION_DOTFILE_EDGES
+CREATE OR REPLACE FUNCTION public._documentation_dotfile_edges()
+RETURNS text AS
+$$
+DECLARE
+  result text;
+BEGIN
+  WITH relationship AS (
+  SELECT
+    conrelid AS fk_table_id
+    , confrelid AS pk_table_id
+    , unnest(conkey) AS fk_colnum
+    , unnest(confkey) AS pk_colnum
+    FROM pg_catalog.pg_constraint
+    WHERE confkey IS NOT NULL
+    AND connamespace='public'::regnamespace
+  ), all_edges AS (
+  SELECT
+    fk_tbl.relname || ':' || fk_col.attname
+    || ' -> '
+    || pk_tbl.relname || ':' || pk_col.attname
+    || ';' AS lines
+  FROM relationship
+  -- foreign key table + column
+  JOIN pg_catalog.pg_attribute AS fk_col
+    ON fk_col.attrelid = relationship.fk_table_id
+    AND fk_col.attnum = relationship.fk_colnum
+  JOIN pg_catalog.pg_class AS fk_tbl
+    ON fk_tbl.oid = relationship.fk_table_id
+  -- primary key table + column
+  JOIN pg_catalog.pg_attribute AS pk_col
+    ON pk_col.attrelid = relationship.pk_table_id
+    AND pk_col.attnum = relationship.pk_colnum
+  JOIN pg_catalog.pg_class AS pk_tbl
+    ON pk_tbl.oid = relationship.pk_table_id
+  )
+  SELECT
+    string_agg(lines, E'\n')
+    INTO result
+    FROM all_edges;
+
+  RETURN result;
+END
+$$
+LANGUAGE plpgsql STABLE;
+
+
+-- DOCUMENTATION_DOTFILE
+CREATE OR REPLACE FUNCTION public.documentation_dotfile()
+RETURNS text AS
+$$
+DECLARE
+  schemaname name := 'public';
+  result text;
+BEGIN
+  WITH file_contents AS (
+    SELECT
+      E'digraph database {\n  concentrate = true;\n'
+      '  rankdir = LR;\n'
+      '  ratio = ".75";\n'
+      '  node [shape = none, fontsize="11", fontname="Helvetica"];\n'
+      '  edge [fontsize="8", fontname="Helvetica"];'
+      AS lines
+    UNION ALL
+    SELECT
+      E'legend\n[fontsize = "14"\nlabel =\n'
+      '<<table border="0" cellpadding="0">\n'
+      '  <tr><td align="left"><font point-size="16">Legend</font></td></tr>\n'
+      '  <tr><td align="left">pk = primary key</td></tr>\n'
+      '  <tr><td align="left">fk = foreign key</td></tr>\n'
+      '  <tr><td align="left">u = unique*</td></tr>\n'
+      '  <tr><td align="left">o = optional</td></tr>\n'
+      '  <tr><td align="left">'
+      '* multiple uniques in the same table are a unique group</td></tr>\n'
+      '</table>>\n];'
+    UNION ALL
+    SELECT
+      string_agg(
+        public._documentation_dotfile_node_for(relname),
+        E'\n'  -- Forcing the 'env' table to the end makes a better image
+        ORDER BY (CASE WHEN relname LIKE 'env%' THEN 'z' ELSE relname END)
+    )
+    FROM pg_catalog.pg_class
+      WHERE relkind='r' AND relnamespace = schemaname::regnamespace
+    UNION ALL
+    SELECT
+      public._documentation_dotfile_edges()
+    UNION ALL
+    SELECT
+      '}'
+  )
+  SELECT
+    string_agg(lines, E'\n') AS dotfile
+    INTO result
+  FROM file_contents;
+  RETURN result;
+END
+$$
+LANGUAGE plpgsql STABLE;
+COMMENT ON FUNCTION public.documentation_dotfile()
+IS E'Create a Graphviz dotfile of the data model: '
+  'every table in the "public" schema.\n'
+  'Example: SELECT public.documentation_dotfile();';
diff --git a/src/arrow/dev/benchmarking/ddl/4_00_triggers.sql b/src/arrow/dev/benchmarking/ddl/4_00_triggers.sql
new file mode 100644
index 000000000..5fb0e5018
--- /dev/null
+++ b/src/arrow/dev/benchmarking/ddl/4_00_triggers.sql
@@ -0,0 +1,61 @@
+/*
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+ 
+    http://www.apache.org/licenses/LICENSE-2.0
+ 
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+*/
+
+
+-- LANGUAGE_IMPLEMENTATION_VERSION_VIEW_TRIGGER_INSERT
+CREATE TRIGGER language_implementation_version_view_trigger_insert
+  INSTEAD OF INSERT ON public.language_implementation_version_view
+  FOR EACH ROW
+  EXECUTE FUNCTION public.language_implementation_version_view_insert_row();
+
+-- ENVIRONMENT_VIEW_TRIGGER_INSERT
+CREATE TRIGGER environment_view_trigger_insert
+  INSTEAD OF INSERT ON public.environment_view
+  FOR EACH ROW
+  EXECUTE FUNCTION public.environment_view_insert_row();
+
+-- MACHINE_VIEW_TRIGGER_INSERT
+CREATE TRIGGER machine_view_trigger_insert
+  INSTEAD OF INSERT ON public.machine_view
+  FOR EACH ROW
+  EXECUTE FUNCTION public.machine_view_insert_row();
+
+-- UNIT_VIEW_TRIGGER_INSERT
+CREATE TRIGGER unit_view_trigger_insert
+  INSTEAD OF INSERT ON public.unit_view
+  FOR EACH ROW
+  EXECUTE FUNCTION public.unit_view_insert_row();
+
+-- BENCHMARK_VIEW_TRIGGER_INSERT
+CREATE TRIGGER benchmark_view_trigger_insert
+  INSTEAD OF INSERT ON public.benchmark_view
+  FOR EACH ROW
+  EXECUTE FUNCTION public.benchmark_view_insert_row();
+
+-- BENCHMARK_RUN_VIEW_TRIGGER_INSERT
+CREATE TRIGGER benchmark_run_view_trigger_insert
+  INSTEAD OF INSERT ON public.benchmark_run_view
+  FOR EACH ROW
+  EXECUTE FUNCTION public.benchmark_run_view_insert_row();
+
+-- FULL_BENCHMARK_RUN_VIEW_TRIGGER_INSERT
+CREATE TRIGGER full_benchmark_run_view_trigger_insert
+  INSTEAD OF INSERT ON public.full_benchmark_run_view
+  FOR EACH ROW
+  EXECUTE FUNCTION public.full_benchmark_run_view_insert_row();
diff --git a/src/arrow/dev/benchmarking/ddl/5_00_permissions.sql b/src/arrow/dev/benchmarking/ddl/5_00_permissions.sql
new file mode 100644
index 000000000..dd72c40db
--- /dev/null
+++ b/src/arrow/dev/benchmarking/ddl/5_00_permissions.sql
@@ -0,0 +1,73 @@
+/*
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+*/
+---------------------------- ROLES ----------------------------
+-- ARROW_WEB
+CREATE ROLE arrow_web login password 'arrow';
+COMMENT ON ROLE arrow_web IS 'Anonymous login user.';
+
+-- ARROW_ADMIN
+CREATE ROLE arrow_admin;
+COMMENT ON ROLE arrow_admin
+  IS 'Can select, insert, update, and delete on all public tables.';
+
+-- ARROW_ANONYMOUS
+CREATE ROLE arrow_anonymous;
+COMMENT ON ROLE arrow_anonymous
+  IS 'Can insert and select on all public tables.';
+
+GRANT arrow_anonymous TO arrow_web;
+
+
+---------------------------- PRIVILEGES ----------------------------
+GRANT USAGE ON SCHEMA public TO arrow_anonymous, arrow_admin;
+
+-- ARROW_ADMIN
+GRANT EXECUTE ON ALL FUNCTIONS IN SCHEMA public TO arrow_admin;
+GRANT USAGE, SELECT ON ALL SEQUENCES IN SCHEMA public to arrow_admin;
+GRANT SELECT, UPDATE, INSERT, DELETE ON ALL TABLES IN SCHEMA public
+  TO arrow_admin;
+
+-- ARROW_ANONYMOUS
+GRANT EXECUTE ON ALL FUNCTIONS IN SCHEMA public TO arrow_anonymous;
+GRANT SELECT ON ALL TABLES IN SCHEMA public TO arrow_anonymous;
+GRANT USAGE, SELECT ON ALL SEQUENCES IN SCHEMA public to arrow_anonymous;
+GRANT INSERT ON
+  public.benchmark
+  , public.benchmark_language
+  , public.dependencies
+  , public.language_implementation_version
+  , public.benchmark_run
+  , public.benchmark_type
+  , public.cpu
+  , public.environment
+  , public.environment_view
+  , public.gpu
+  , public.machine
+  , public.machine_view
+  , public.os
+  , public.unit
+  --, public.project  -- The only disallowed table is `project`.
+  , public.benchmark_run_view
+  , public.benchmark_view
+  , public.environment_view
+  , public.full_benchmark_run_view
+  , public.language_implementation_version_view
+  , public.machine_view
+  , public.unit_view
+TO arrow_anonymous;
diff --git a/src/arrow/dev/benchmarking/docker-compose.yml b/src/arrow/dev/benchmarking/docker-compose.yml
new file mode 100644
index 000000000..ca60206bf
--- /dev/null
+++ b/src/arrow/dev/benchmarking/docker-compose.yml
@@ -0,0 +1,43 @@
+# Licensed to the Apache Software Foundation (ASF) under one or more
+# contributor license agreements.  See the NOTICE file distributed with
+# this work for additional information regarding copyright ownership.
+# The ASF licenses this file to You under the Apache License, Version 2.0
+# (the "License"); you may not use this file except in compliance with
+# the License.  You may obtain a copy of the License at
+#
+#    http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+
+version: '3'
+services:
+
+  pg:
+    build:
+      context: .
+      dockerfile: Dockerfile
+    restart: always
+    ports:
+      - '5432:5432'
+    environment:
+      - POSTGRES_PASSWORD=${PG_PASS}
+      - POSTGRES_USER=${PG_USER}
+
+  graphile:
+    image: graphile/postgraphile
+    restart: always
+    ports:
+      - 5000:5000
+    depends_on:
+      - pg
+    command:
+      - --connection
+      - postgres://${PG_USER}:${PG_PASS}@pg:5432/${PG_USER}
+      - --schema
+      - public
+      - --watch
diff --git a/src/arrow/dev/benchmarking/examples/benchmark_example.json b/src/arrow/dev/benchmarking/examples/benchmark_example.json
new file mode 100644
index 000000000..d6f58c286
--- /dev/null
+++ b/src/arrow/dev/benchmarking/examples/benchmark_example.json
@@ -0,0 +1,32 @@
+[
+  {
+    "benchmark_name": "Benchmark 1",
+    "parameter_names": ["arg0", "arg1", "arg2"],
+    "benchmark_description": "First benchmark",
+    "benchmark_type": "Time",
+    "units": "miliseconds",
+    "lessisbetter": true,
+    "benchmark_version": "second version",
+    "benchmark_language": "Python"
+  },
+  {
+    "benchmark_name": "Benchmark 2",
+    "parameter_names": ["arg0", "arg1"],
+    "benchmark_description": "Description 2.",
+    "benchmark_type": "Time",
+    "units": "nanoseconds",
+    "lessisbetter": true,
+    "benchmark_version": "second version",
+    "benchmark_language": "Python"
+  },
+  {
+    "benchmark_name": "Benchmark 3",
+    "parameter_names": ["arg0"],
+    "benchmark_description": "Third benchmark",
+    "benchmark_type": "Memory",
+    "units": "kilobytes",
+    "lessisbetter": true,
+    "benchmark_version": "1",
+    "benchmark_language": "Python"
+  }
+]
diff --git a/src/arrow/dev/benchmarking/examples/benchmark_run_example.csv b/src/arrow/dev/benchmarking/examples/benchmark_run_example.csv
new file mode 100644
index 000000000..eab208a1c
--- /dev/null
+++ b/src/arrow/dev/benchmarking/examples/benchmark_run_example.csv
@@ -0,0 +1,6 @@
+benchmark_run_id,benchmark_name,benchmark_version,parameter_values,value,git_commit_timestamp,git_hash,val_min,val_q1,val_q3,val_max,std_dev,n_obs,run_timestamp,run_metadata,run_notes,mac_address,benchmark_language,language_implementation_version,dependencies

+,Benchmark 2,version 0,"{""arg0"": 100, ""arg1"": 5}",2.5,2019-01-31 14:31:10 -0600,8136c46d5c60fb,1,2,3,4,1.41,8,2019-02-14 02:00:00 -0600,,,08:00:2b:01:02:03,Python,CPython 2.7,"{""six"": """", ""numpy"": ""1.14"", ""other_lib"": ""1.0""}"

+,Benchmark 2,version 0,"{""arg0"": 1000, ""arg1"": 5}",5,2019-01-31 14:31:10 -0600,8136c46d5c60fb,2,4,6,8,3.14,8,2019-02-14 02:01:00 -0600,,,08:00:2b:01:02:03,Python,CPython 2.7,"{""six"": """", ""numpy"": ""1.14"", ""other_lib"": ""1.0""}"

+,Benchmark 2,version 0,"{""arg0"": 100, ""arg1"": 5}",2.5,2019-01-31 14:31:10 -0600,8136c46d5c60fb,0.5,1,3,5,3,8,2019-02-14 02:02:00 -0600,,,08:00:2b:01:02:03,Python,CPython 3.6,"{""boost"": ""1.42"", ""numpy"": ""1.15""}"

+,Benchmark 2,version 0,"{""arg0"": 1000, ""arg1"": 5}",3,2019-01-31 14:31:10 -0600,8136c46d5c60fb,2,2.5,4,4.5,1.5,8,2019-02-14 02:03:00 -0600,,,08:00:2b:01:02:03,Python,CPython 3.6,"{""boost"": ""1.42"", ""numpy"": ""1.15""}"

+,Benchmark 2,version 0,"{""arg0"": 1000, ""arg1"": 10}",3,2019-01-31 14:31:10 -0600,8136c46d5c60fb,1,2,4,5,2,8,2019-02-14 02:03:30 -0600,,,08:00:2b:01:02:03,Python,CPython 2.7,"{""six"": """", ""numpy"": ""1.15"", ""other_lib"": ""1.0""}"

diff --git a/src/arrow/dev/benchmarking/examples/benchmark_run_example.json b/src/arrow/dev/benchmarking/examples/benchmark_run_example.json
new file mode 100644
index 000000000..2ded776c9
--- /dev/null
+++ b/src/arrow/dev/benchmarking/examples/benchmark_run_example.json
@@ -0,0 +1,97 @@
+[
+  {
+    "benchmark_name": "Benchmark 2",
+    "benchmark_version": "version 0",
+    "parameter_values": {"arg0": 100, "arg1": 5},
+    "value": 2.5,
+    "git_commit_timestamp": "2019-02-08 22:35:53 +0100",
+    "git_hash": "324d3cf198444a",
+    "val_min": 1,
+    "val_q1": 2,
+    "val_q3": 3,
+    "val_max": 4,
+    "std_dev": 1.41,
+    "n_obs": 8,
+    "run_timestamp": "2019-02-14 03:00:05 -0600",
+    "mac_address": "08:00:2b:01:02:03",
+    "benchmark_language": "Python",
+    "language_implementation_version": "CPython 2.7",
+    "dependencies": {"six": "", "numpy": "1.14", "other_lib": "1.0"}
+  },
+  {
+    "benchmark_name": "Benchmark 2",
+    "benchmark_version": "version 0",
+    "parameter_values": {"arg0": 1000, "arg1": 5},
+    "value": 5,
+    "git_commit_timestamp": "2019-02-08 22:35:53 +0100",
+    "git_hash": "324d3cf198444a",
+    "val_min": 2,
+    "val_q1": 4,
+    "val_q3": 6,
+    "val_max": 8,
+    "std_dev": 3.14,
+    "n_obs": 8,
+    "run_timestamp": "2019-02-14 03:00:10 -0600",
+    "mac_address": "08:00:2b:01:02:03",
+    "benchmark_language": "Python",
+    "language_implementation_version": "CPython 2.7",
+    "dependencies": {"six": "", "numpy": "1.14", "other_lib": "1.0"}
+  },
+  {
+    "benchmark_name": "Benchmark 2",
+    "benchmark_version": "version 0",
+    "parameter_values": {"arg0": 100, "arg1": 5},
+    "value": 2.5,
+    "git_commit_timestamp": "2019-02-08 22:35:53 +0100",
+    "git_hash": "324d3cf198444a",
+    "val_min": 0.5,
+    "val_q1": 1,
+    "val_q3": 3,
+    "val_max": 5,
+    "std_dev": 3,
+    "n_obs": 8,
+    "run_timestamp": "2019-02-14 03:00:20 -0600",
+    "mac_address": "08:00:2b:01:02:03",
+    "benchmark_language": "Python",
+    "language_implementation_version": "CPython 2.7",
+    "dependencies": {"boost": "1.42", "numpy": "1.15"}
+  },
+  {
+    "benchmark_name": "Benchmark 2",
+    "benchmark_version": "version 0",
+    "parameter_values": {"arg0": 1000, "arg1": 5},
+    "value": 3,
+    "git_commit_timestamp": "2019-02-08 22:35:53 +0100",
+    "git_hash": "324d3cf198444a",
+    "val_min": 2,
+    "val_q1": 2.5,
+    "val_q3": 4,
+    "val_max": 4.5,
+    "std_dev": 1.5,
+    "n_obs": 8,
+    "run_timestamp": "2019-02-14 03:00:30 -0600",
+    "mac_address": "08:00:2b:01:02:03",
+    "benchmark_language": "Python",
+    "language_implementation_version": "CPython 2.7",
+    "dependencies": {"boost": "1.42", "numpy": "1.15"}
+  },
+  {
+    "benchmark_name": "Benchmark 2",
+    "benchmark_version": "version 0",
+    "parameter_values": {"arg0": 1000, "arg1": 10},
+    "value": 3,
+    "git_commit_timestamp": "2019-02-08 22:35:53 +0100",
+    "git_hash": "324d3cf198444a",
+    "val_min": 1,
+    "val_q1": 2,
+    "val_q3": 4,
+    "val_max": 5,
+    "std_dev": 2,
+    "n_obs": 8,
+    "run_timestamp": "2019-02-14 03:00:40 -0600",
+    "mac_address": "08:00:2b:01:02:03",
+    "benchmark_language": "Python",
+    "language_implementation_version": "CPython 2.7",
+    "dependencies": {"six": "", "numpy": "1.15", "other_lib": "1.0"}
+  }
+]
diff --git a/src/arrow/dev/benchmarking/examples/benchmark_with_context_example.json b/src/arrow/dev/benchmarking/examples/benchmark_with_context_example.json
new file mode 100644
index 000000000..f9e6e3130
--- /dev/null
+++ b/src/arrow/dev/benchmarking/examples/benchmark_with_context_example.json
@@ -0,0 +1,73 @@
+{
+  "context": {
+      "mac_address": "08:00:2b:01:02:03",
+      "benchmark_language": "Python",
+      "language_implementation_version": "CPython 2.7",
+      "dependencies": {"six": "", "numpy": "1.14", "other_lib": "1.0"},
+      "git_commit_timestamp": "2019-02-14 22:42:22 +0100",
+      "git_hash": "123456789abcde",
+      "run_timestamp": "2019-02-25 03:00:40 -0600",
+      "Extra stuff": "does not hurt anything and won't be added.",
+      "However": "all of the entries above 'Extra stuff' are required."
+  },
+  "benchmark_version": {
+      "Benchmark 2": "version 0",
+      "Benchmark 3": "any string is a version. (Benchmark 3 not actually used)"
+  },
+  "benchmarks": [
+    {
+      "benchmark_name": "Benchmark 2",
+      "parameter_values": {"arg0": 1, "arg1": 5},
+      "value": 2.5,
+      "val_min": 1,
+      "val_q1": 2,
+      "val_q3": 3,
+      "val_max": 4,
+      "std_dev": 1.41,
+      "n_obs": 8,
+      "run_metadata": {"any": "json object is admissible"},
+      "run_notes": "This value is an arbitrary-length string."
+    },
+    {
+      "benchmark_name": "Benchmark 2",
+      "parameter_values": {"arg0": 2, "arg1": 5},
+      "value": 5,
+      "std_dev": 3.14,
+      "n_obs": 8
+    },
+    {
+      "benchmark_name": "Benchmark 2",
+      "parameter_values": {"arg0": 3, "arg1": 5},
+      "value": 2.5,
+      "val_min": 0.5,
+      "val_q1": 1,
+      "val_q3": 3,
+      "val_max": 5,
+      "std_dev": 3,
+      "n_obs": 8,
+      "run_notes": "The previous run in this list has the minimal set of keys."
+    },
+    {
+      "benchmark_name": "Benchmark 2",
+      "parameter_values": {"arg0": 4, "arg1": 5},
+      "value": 3,
+      "val_min": 2,
+      "val_q1": 2.5,
+      "val_q3": 4,
+      "val_max": 4.5,
+      "std_dev": 1.5,
+      "n_obs": 8
+    },
+    {
+      "benchmark_name": "Benchmark 2",
+      "parameter_values": {"arg0": 5, "arg1": 5},
+      "value": 3,
+      "val_min": 1,
+      "val_q1": 2,
+      "val_q3": 4,
+      "val_max": 5,
+      "std_dev": 2,
+      "n_obs": 8
+    }
+  ]
+}
diff --git a/src/arrow/dev/benchmarking/examples/example.sql b/src/arrow/dev/benchmarking/examples/example.sql
new file mode 100644
index 000000000..e93269af7
--- /dev/null
+++ b/src/arrow/dev/benchmarking/examples/example.sql
@@ -0,0 +1,232 @@
+/*
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+ 
+    http://www.apache.org/licenses/LICENSE-2.0
+ 
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+*/
+
+
+-- Example insert into each of the views:
+INSERT INTO public.project(project_name, project_url, repo_url)
+VALUES (
+  'Apache Arrow'
+  , 'https://arrow.apache.org/'
+  , 'https://github.com/apache/arrow');
+
+INSERT INTO public.environment_view
+  (benchmark_language, language_implementation_version, dependencies)
+VALUES
+  ('Python', 'CPython 2.7', '{"six": "", "numpy": "1.14", "other_lib": "1.0"}'),
+  ('Python', 'CPython 3.6', '{"boost": "1.42", "numpy": "1.15"}');
+
+INSERT INTO public.dependencies(dependencies)
+VALUES
+  ('{"boost": "1.68", "numpy": "1.14"}'),
+  ('{"boost": "1.42", "numpy": "1.16"}');
+
+INSERT INTO public.language_implementation_version_view
+  (benchmark_language, language_implementation_version)
+VALUES
+  ('Python', 'CPython 2.7'),
+  ('Python', 'CPython 3.6');
+
+INSERT INTO public.unit_view
+  (benchmark_type, units, lessisbetter)
+VALUES
+  ('Memory', 'gigabytes', True),
+  ('Memory', 'kilobytes', True);
+
+
+\echo 'use \\dv to list the views views';
+\dv
+
+
+SELECT * FROM environment_view;
+SELECT * FROM unit_view;
+
+
+INSERT INTO public.machine_view (
+  mac_address
+  , machine_name
+  , memory_bytes
+  , cpu_actual_frequency_hz
+  , os_name
+  , architecture_name
+  , kernel_name
+  , cpu_model_name
+  , cpu_core_count
+  , cpu_thread_count
+  , cpu_frequency_max_hz
+  , cpu_frequency_min_hz
+  , cpu_l1d_cache_bytes
+  , cpu_l1i_cache_bytes
+  , cpu_l2_cache_bytes
+  , cpu_l3_cache_bytes
+  , machine_other_attributes
+) VALUES (
+  '08:00:2b:01:02:03'  -- mac_address
+  , 'My-Machine-Name'  -- machine_name
+  , 8589934592  -- memory_bytes
+  -- All (?) standard mac address formats are allowable:
+  -- https://www.postgresql.org/docs/11/datatype-net-types.html
+  , 2300000000  -- cpu_actual_frequency_Hz
+  , 'OSX'  -- os_name
+  , 'x86_64'  -- architecture_name
+  , '18.2.0'  -- kernel
+  , 'Intel(R) Core(TM) i5-7360U CPU @ 2.30GHz'  -- cpu_model_name
+  , 2  -- cpu_core_count
+  , 4  -- cpu_thread_count
+  , 2300000000  -- cpu_frequency_max_Hz
+  , 2300000000  -- cpu_frequency_min_Hz
+  , 32768 -- cpu_l1d_cache_bytes
+  , 32768  -- cpu_l1i_cache_bytes
+  , 262144  -- cpu_l2_cache_bytes
+  , 4194304  -- cpu_l3_cache_bytes
+  , '{"example": "for machine_other_attributes"}'::jsonb
+);
+
+
+INSERT INTO public.full_benchmark_run_view (
+  benchmark_name
+  , parameter_names
+  , benchmark_description
+  , benchmark_type
+  , units
+  , lessisbetter
+  , benchmark_version
+  -- datum
+  , parameter_values
+  , value
+  , git_commit_timestamp
+  , git_hash
+  , val_min
+  , val_q1
+  , val_q3
+  , val_max
+  , std_dev
+  , n_obs
+  , run_timestamp
+  , run_metadata
+  , run_notes
+  -- machine_view
+  , machine_name
+  , mac_address
+  , memory_bytes
+  , cpu_actual_frequency_hz
+  , os_name
+  , architecture_name
+  , kernel_name
+  , cpu_model_name
+  , cpu_core_count
+  , cpu_thread_count
+  , cpu_frequency_max_hz
+  , cpu_frequency_min_hz
+  , cpu_l1d_cache_bytes
+  , cpu_l1i_cache_bytes
+  , cpu_l2_cache_bytes
+  , cpu_l3_cache_bytes
+  , machine_other_attributes
+  -- environment_view
+  , benchmark_language
+  , language_implementation_version
+  , dependencies
+) VALUES (
+  'Benchmark 3'
+  , '{"arg0"}'::text[]
+  , 'Third benchmark'
+  , 'Memory'
+  , 'kilobytes'
+  , TRUE
+  , '0'
+  -- datum
+  , '{"arg0": 10}'::jsonb
+  , 0.5
+  , '2019-01-31 14:31:10 -0600'
+  , '8136c46d5c60fb'
+  , 0.5
+  , 0.5
+  , 0.5
+  , 0.5
+  , 0
+  , 2
+  , '2019-02-14 14:00:00 -0600'
+  , '{"ci_99": [2.7e-06, 3.1e-06]}'::jsonb
+  , 'Additional run_notes.'
+  -- machine_view
+  , 'My-Machine-Name'
+  , '09-00-2c-01-02-03'
+  , 8589934592
+  , 2300000000
+  , 'OSX'
+  , 'x86_64'
+  , '18.2.0'
+  , 'Intel(R) Core(TM) i5-7360U CPU @ 2.30GHz'
+  , 2
+  , 4
+  , 2300000000
+  , 2300000000
+  , 32768
+  , 32768
+  , 262144
+  , 4194304
+  , '{"example": "for machine_other_attributes"}'::jsonb
+  -- environment_view
+  , 'Python'
+  , 'CPython 2.7'
+  , '{"six": "", "numpy": "1.15", "other_lib": "1.0"}'::jsonb
+);
+
+
+-- Bulk load from CSV. First column is empty; serial "benchmark_run_id" will be assigned.
+--\copy benchmark_run_view FROM 'examples/benchmark_run_example.csv' WITH (FORMAT csv, HEADER);
+
+-- Load from JSON
+--\set content `cat examples/benchmark_example.json`
+--SELECT ingest_benchmark_view(:'content'::jsonb);
+
+INSERT INTO public.benchmark_view (
+    benchmark_name
+    , parameter_names
+    , benchmark_description
+    , benchmark_type
+    , units
+    , lessisbetter
+    , benchmark_version
+    , benchmark_language
+  ) VALUES (
+    'Benchmark 1'
+    , '{"arg0", "arg1", "arg2"}'::text[]
+    , E'Description.\nNewlines are OK in a string escaped with leading "E".'
+    , 'Time'
+    , 'miliseconds'
+    , TRUE
+    , 'Hash of code or other way to identify distinct benchmark versions.'
+    , 'Python'
+  ), (
+    'Benchmark 2'
+    , '{"arg0", "arg1"}'::text[]
+    , 'Description 2.'
+    , 'Time'
+    , 'nanoseconds'
+    , TRUE
+    , 'version 0'
+    , 'Python'
+  );
+
+
+\x
+SELECT * from benchmark_run_view;
+
+\x
diff --git a/src/arrow/dev/benchmarking/examples/example_graphql_mutation.json b/src/arrow/dev/benchmarking/examples/example_graphql_mutation.json
new file mode 100644
index 000000000..fec5eed0a
--- /dev/null
+++ b/src/arrow/dev/benchmarking/examples/example_graphql_mutation.json
@@ -0,0 +1,12 @@
+{
+  "query": "mutation ($p: CreateProjectInput!){createProject(input:$p){project{id}}}",
+  "variables": {
+    "p": {
+      "project": {
+        "projectName": "Apache Arrow",
+        "projectUrl": "https://www.arrow.apache.org",
+        "repoUrl": "https://www.github.com/apache/arrow"
+      }
+    }
+  }
+}
diff --git a/src/arrow/dev/benchmarking/examples/graphql_query_environment_view.json b/src/arrow/dev/benchmarking/examples/graphql_query_environment_view.json
new file mode 100644
index 000000000..78804fa91
--- /dev/null
+++ b/src/arrow/dev/benchmarking/examples/graphql_query_environment_view.json
@@ -0,0 +1,3 @@
+{
+  "query": "{allEnvironmentViews(orderBy: [BENCHMARK_LANGUAGE_ASC, LANGUAGE_IMPLEMENTATION_VERSION_ASC, DEPENDENCIES_ASC]) {edges {node {environmentId, benchmarkLanguage, languageImplementationVersion, dependencies}}}}"
+}
diff --git a/src/arrow/dev/benchmarking/examples/machine.json b/src/arrow/dev/benchmarking/examples/machine.json
new file mode 100644
index 000000000..2485e2bc1
--- /dev/null
+++ b/src/arrow/dev/benchmarking/examples/machine.json
@@ -0,0 +1,22 @@
+{
+  "mac_address": "0a:00:2d:01:02:03",
+  "machine_name": "Yet-Another-Machine-Name",
+  "memory_bytes": 8589934592,
+  "cpu_actual_frequency_hz": 2300000000,
+  "os_name": "OSX",
+  "architecture_name": "x86_64",
+  "kernel_name": "18.2.0",
+  "cpu_model_name": "Intel(R) Core(TM) i5-7360U CPU @ 2.30GHz",
+  "cpu_core_count": 2,
+  "cpu_thread_count": 4,
+  "cpu_frequency_max_hz": 2300000000,
+  "cpu_frequency_min_hz": 2300000000,
+  "cpu_l1d_cache_bytes": 32768,
+  "cpu_l1i_cache_bytes": 32768,
+  "cpu_l2_cache_bytes": 262144,
+  "cpu_l3_cache_bytes": 4194304,
+  "machine_other_attributes": {"just": "an example"},
+  "gpu_information": "",
+  "gpu_part_number": "",
+  "gpu_product_name": ""
+}
diff --git a/src/arrow/dev/benchmarking/graphql_submit.sh b/src/arrow/dev/benchmarking/graphql_submit.sh
new file mode 100755
index 000000000..2eaab9cdf
--- /dev/null
+++ b/src/arrow/dev/benchmarking/graphql_submit.sh
@@ -0,0 +1,75 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one or more
+# contributor license agreements.  See the NOTICE file distributed with
+# this work for additional information regarding copyright ownership.
+# The ASF licenses this file to You under the Apache License, Version 2.0
+# (the "License"); you may not use this file except in compliance with
+# the License.  You may obtain a copy of the License at
+#
+#    http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+
+OPTIONS=("machine" "benchmarks" "runs")
+
+option=${1-help}
+datafile=${2-machine.json}
+uri=${3-localhost:5000/graphql}
+
+help() {
+  cat <<HELP
+  Submit data via GraphQL
+  
+  Usage:
+  ${0} [option] [JSON_file] [URI]
+
+  Arguments:
+    option    - $(echo ${OPTIONS[@]} | sed 's/ /|/g')
+    JSON_file - path to the submission file (default 'machine.json')
+    URI       - URI to submit to (default 'localhost:5000/graphql')
+HELP
+}
+
+escape_quote() {  sed 's/"/\\"/g'; }
+
+template() {
+  cat <<TEMPLATE
+  {
+    "query": "mutation (\$jsonb: JSON!){${1}(input:{fromJsonb:\$jsonb}){${2}}}",
+    "variables": {
+      "jsonb": "$(echo $(cat ${datafile}) | escape_quote )"
+    }
+  }
+TEMPLATE
+}
+
+submit () {
+  curl -X POST -H "Content-Type: application/json"  --data @<(template $1 $2) ${uri}
+}
+
+
+case "$1" in
+  machine)
+    submit ingestMachineView integer;;
+
+  benchmarks)
+    submit ingestBenchmarkView integers;;
+
+  runs)
+    if grep -q context <(head -n2 ${2})
+    then
+      submit ingestBenchmarkRunsWithContext bigInts
+    else
+      submit ingestBenchmarkRunView bigInts
+    fi;;
+
+  *)
+    help
+    exit 1
+esac
diff --git a/src/arrow/dev/benchmarking/make_data_model_rst.sh b/src/arrow/dev/benchmarking/make_data_model_rst.sh
new file mode 100755
index 000000000..6a4f5f5b6
--- /dev/null
+++ b/src/arrow/dev/benchmarking/make_data_model_rst.sh
@@ -0,0 +1,69 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one or more
+# contributor license agreements.  See the NOTICE file distributed with
+# this work for additional information regarding copyright ownership.
+# The ASF licenses this file to You under the Apache License, Version 2.0
+# (the "License"); you may not use this file except in compliance with
+# the License.  You may obtain a copy of the License at
+#
+#    http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+
+set -e
+DOTFILE=data_model.dot
+OUTFILE=data_model.rst
+
+license() {
+  cat <<'LICENSE' > ${1}
+.. Licensed to the Apache Software Foundation (ASF) under one
+.. or more contributor license agreements.  See the NOTICE file
+.. distributed with this work for additional information
+.. regarding copyright ownership.  The ASF licenses this file
+.. to you under the Apache License, Version 2.0 (the
+.. "License"); you may not use this file except in compliance
+.. with the License.  You may obtain a copy of the License at
+
+..   http://www.apache.org/licenses/LICENSE-2.0
+
+.. Unless required by applicable law or agreed to in writing,
+.. software distributed under the License is distributed on an
+.. "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+.. KIND, either express or implied.  See the License for the
+.. specific language governing permissions and limitations
+.. under the License.
+
+
+LICENSE
+}
+
+warning() {
+  cat <<'WARNING' >> ${1}
+.. WARNING
+..   This is an auto-generated file. Please do not edit.
+
+..   To reproduce, please run :code:`./make_data_model_rst.sh`.
+..   (This requires you have the
+..   `psql client <https://www.postgresql.org/download/>`_
+..   and have started the docker containers using
+..   :code:`docker-compose up`).
+
+WARNING
+}
+
+echo "Making ${OUTFILE}"
+
+license ${OUTFILE}
+warning ${OUTFILE}
+
+PGPASSWORD=arrow \
+  psql --tuples-only --username=arrow_web \
+  --dbname=benchmark --port=5432 --host=localhost \
+  --command="select public.documentation('${DOTFILE}');" \
+  | sed "s/ *+$//" | sed "s/^ //" >> ${OUTFILE}
diff --git a/src/arrow/dev/benchmarking/make_dotfile.sh b/src/arrow/dev/benchmarking/make_dotfile.sh
new file mode 100755
index 000000000..b86dc3eb3
--- /dev/null
+++ b/src/arrow/dev/benchmarking/make_dotfile.sh
@@ -0,0 +1,70 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one or more
+# contributor license agreements.  See the NOTICE file distributed with
+# this work for additional information regarding copyright ownership.
+# The ASF licenses this file to You under the Apache License, Version 2.0
+# (the "License"); you may not use this file except in compliance with
+# the License.  You may obtain a copy of the License at
+#
+#    http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+
+set -e
+OUTFILE=data_model.dot
+
+license() {
+  cat <<'LICENSE' > ${1}
+/*
+ Licensed to the Apache Software Foundation (ASF) under one
+ or more contributor license agreements.See the NOTICE file
+ distributed with this work for additional information
+ regarding copyright ownership.The ASF licenses this file
+ to you under the Apache License, Version 2.0 (the
+ "License"); you may not use this file except in compliance
+ with the License.You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing,
+ software distributed under the License is distributed on an
+ "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+ KIND, either express or implied.See the License for the
+ specific language governing permissions and limitations
+ under the License.
+*/
+
+LICENSE
+}
+
+warning() {
+  cat <<'WARNING' >> ${1}
+/*
+ WARNING
+   This is an auto-generated file. Please do not edit.
+
+   To reproduce, please run :code:`./make_data_model_rst.sh`.
+   (This requires you have the
+   `psql client <https://www.postgresql.org/download/>`_
+   and have started the docker containers using
+   :code:`docker-compose up`).
+*/
+WARNING
+}
+
+echo "Making ${OUTFILE}"
+
+license ${OUTFILE}
+warning ${OUTFILE}
+
+PGPASSWORD=arrow \
+  psql --tuples-only --username=arrow_web \
+  --dbname=benchmark --port=5432 --host=localhost \
+  --command="select public.documentation_dotfile();" \
+  | sed "s/ *+$//" | sed "s/^ //" >> ${OUTFILE}
diff --git a/src/arrow/dev/benchmarking/make_machine_json.sh b/src/arrow/dev/benchmarking/make_machine_json.sh
new file mode 100755
index 000000000..09bf0ea2d
--- /dev/null
+++ b/src/arrow/dev/benchmarking/make_machine_json.sh
@@ -0,0 +1,55 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one or more
+# contributor license agreements.  See the NOTICE file distributed with
+# this work for additional information regarding copyright ownership.
+# The ASF licenses this file to You under the Apache License, Version 2.0
+# (the "License"); you may not use this file except in compliance with
+# the License.  You may obtain a copy of the License at
+#
+#    http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+
+set -e
+OUTFILE=machine.json
+
+echo "Making ${OUTFILE}"
+echo "** NOTE: This command fails on everything but OSX right now.      **"
+echo "*  also, the intent is to make this script not suck, just not now. *"
+echo "Please type GPU details here (or manually modify ${OUTFILE} later)."
+read -p "GPU information string (or <enter>): " gpu_information
+read -p "GPU part number (or <enter>): " gpu_part_number
+read -p "GPU product name (or <enter>): " gpu_product_name
+
+
+cat <<MACHINE_JSON > ${OUTFILE}
+{
+  "mac_address": "$(ifconfig en1 | awk '/ether/{print $2}')",
+  "machine_name": "$(uname -n)",
+  "memory_bytes": $(sysctl -n hw.memsize),
+  "cpu_actual_frequency_hz": $(sysctl -n hw.cpufrequency),
+  "os_name": "$(uname -s)",
+  "architecture_name": "$(uname -m)",
+  "kernel_name": "$(uname -r)",
+  "cpu_model_name": "$(sysctl -n machdep.cpu.brand_string)",
+  "cpu_core_count": $(sysctl -n hw.physicalcpu),
+  "cpu_thread_count": $(sysctl -n hw.logicalcpu),
+  "cpu_frequency_max_hz": $(sysctl -n hw.cpufrequency_max),
+  "cpu_frequency_min_hz": $(sysctl -n hw.cpufrequency_min),
+  "cpu_l1d_cache_bytes": $(sysctl -n hw.l1dcachesize),
+  "cpu_l1i_cache_bytes": $(sysctl -n hw.l1icachesize),
+  "cpu_l2_cache_bytes": $(sysctl -n hw.l2cachesize),
+  "cpu_l3_cache_bytes": $(sysctl -n hw.l3cachesize),
+  "gpu_information": "${gpu_information}",
+  "gpu_part_number": "${gpu_part_number}",
+  "gpu_product_name": "${gpu_product_name}"
+}
+MACHINE_JSON
+
+echo "Machine details saved in ${OUTFILE}"
diff --git a/src/arrow/dev/conbench_envs/README.md b/src/arrow/dev/conbench_envs/README.md
new file mode 100644
index 000000000..5a4eb58b2
--- /dev/null
+++ b/src/arrow/dev/conbench_envs/README.md
@@ -0,0 +1,214 @@
+<!---
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+-->
+# Benchmark Builds Env and Hooks
+This directory contains: 
+- [benchmarks.env](benchmarks.env) - list of env vars used for building Arrow C++/Python/R/Java/JavaScript and running benchmarks using [conbench](https://ursalabs.org/blog/announcing-conbench/).
+- [hooks.sh](hooks.sh) - hooks used by <b>@ursabot</b> benchmark builds that are triggered by `@ursabot please benchmark` PR comments. 
+
+## How to add or update Arrow build and run env vars used by `@ursabot` benchmark builds
+1. Create `apache/arrow` PR
+2. Update or add env var value in [benchmarks.env](../../dev/conbench_envs/benchmarks.env)
+3. Add `@ursabot please benchmark` comment to PR
+4. Once benchmark builds are done, benchmark results can be viewed via compare/runs links in the PR comment where
+- baseline = PR base HEAD commit with unaltered `/dev/conbench_envs/benchmarks.env`
+- contender = PR branch HEAD commit with overridden `/dev/conbench_envs/benchmarks.env`
+
+## Why do`@ursabot` benchmark builds need `hooks.sh`?
+`@ursabot` benchmark builds are maintained in Ursa's private repo.
+Benchmark builds use `hooks.sh` functions as hooks to create conda env with Arrow dependencies and build Arrow C++/Python/R/Java/JavaScript from source for a specific Arrow repo's commit.
+
+Defining hooks in Arrow repo allows benchmark builds for a specific commit to be
+compatible with the files/scripts *in that commit* which are used for installing Arrow
+dependencies and building Arrow. This allows Arrow contributors to asses the perfomance
+implications of different build options, dependency versions, etc by updating
+`hooks.sh`.
+
+## Can other repos and services use `benchmarks.env` and `hooks.sh`?
+
+Yes, other repos and services are welcome to use `benchmarks.env` and `hooks.sh` as long as 
+- existing hooks are not removed or renamed.
+- function definitions for exiting hooks can only be updated in the Arrow commit where Arrow build scripts or files with dependencies have been renamed, moved or added.
+- benchmark builds are run using `@ursabot please benchmark` PR comment to confirm that function definition updates do not break benchmark builds.
+
+## How can other repos and services use `benchmarks.env` and `hooks.sh` to setup benchmark env?
+Here are steps how `@ursabot` benchmark builds use `benchmarks.env` and `hooks.sh` to setup benchmarking env on Ubuntu:
+
+### 1. Install Arrow dependencies
+    sudo su
+    apt-get update -y -q && \
+        apt-get install -y -q --no-install-recommends \
+            autoconf \
+            ca-certificates \
+            ccache \
+            cmake \
+            g++ \
+            gcc \
+            gdb \
+            git \
+            libbenchmark-dev \
+            libboost-filesystem-dev \
+            libboost-regex-dev \
+            libboost-system-dev \
+            libbrotli-dev \
+            libbz2-dev \
+            libgflags-dev \
+            libcurl4-openssl-dev \
+            libgoogle-glog-dev \
+            liblz4-dev \
+            libprotobuf-dev \
+            libprotoc-dev \
+            libre2-dev \
+            libsnappy-dev \
+            libssl-dev \
+            libthrift-dev \
+            libutf8proc-dev \
+            libzstd-dev \
+            make \
+            ninja-build \
+            pkg-config \
+            protobuf-compiler \
+            rapidjson-dev \
+            tzdata \
+            wget && \
+        apt-get clean && \
+        rm -rf /var/lib/apt/lists*
+
+    apt-get update -y -q && \
+        apt-get install -y -q \
+            python3 \
+            python3-pip \
+            python3-dev && \
+        apt-get clean && \
+        rm -rf /var/lib/apt/lists/*
+
+### 2. Install Arrow dependencies for Java
+    sudo su
+    apt-get install openjdk-8-jdk
+    apt-get install maven
+    
+Verify that you have at least these versions of `java`, `javac` and `maven`:
+    
+    # java -version
+    openjdk version "1.8.0_292"
+    ..
+    # javac -version
+    javac 1.8.0_292
+    ...
+    # mvn -version
+    Apache Maven 3.6.3
+    ...
+
+### 3. Install Arrow dependencies for Java Script
+    sudo apt update
+    sudo apt -y upgrade
+    sudo apt update
+    sudo apt -y install curl dirmngr apt-transport-https lsb-release ca-certificates
+    curl -fsSL https://deb.nodesource.com/setup_14.x | sudo -E bash -
+    sudo apt-get install -y nodejs
+    sudo apt -y install yarn
+    sudo apt -y install gcc g++ make
+
+Verify that you have at least these versions of `node` and `yarn`:
+
+    # node --version
+    v14.17.2
+    ...
+    # yarn --version
+    1.22.5
+    ...
+    
+### 4. Install Conda
+    sudo apt install curl
+    curl -LO https://repo.anaconda.com/miniconda/Miniconda3-latest-Linux-x86_64.sh
+    sudo bash Miniconda3-latest-Linux-x86_64.sh
+    
+### 5. Set env vars:
+    export ARROW_REPO=https://github.com/apache/arrow.git
+    export BENCHMARKABLE=e6e9e6ea52b7a8f2682ffc4160168c936ca1d3e6
+    export BENCHMARKABLE_TYPE=arrow-commit
+    export PYTHON_VERSION=3.8
+    export CONBENCH_EMAIL=...
+    export CONBENCH_URL="https://conbench.ursa.dev"
+    export CONBENCH_PASSWORD=...
+    export MACHINE=...
+
+### 6. Use `create_conda_env_with_arrow_python` hook to create conda env and build Arrow C++ and Arrow Python
+    git clone "${ARROW_REPO}"
+    pushd arrow
+    git fetch -v --prune -- origin "${BENCHMARKABLE}"
+    git checkout -f "${BENCHMARKABLE}"
+    source dev/conbench_envs/hooks.sh create_conda_env_with_arrow_python
+    popd
+    
+### 7. Install conbench
+    git clone https://github.com/ursacomputing/conbench.git
+    pushd conbench
+    pip install -r requirements-cli.txt
+    pip install -U PyYAML
+    python setup.py install
+    popd
+
+### 8. Setup benchmarks repo
+    git clone https://github.com/ursacomputing/benchmarks.git
+    pushd benchmarks
+    python setup.py develop
+    popd
+    
+### 9. Setup conbench credentials
+    pushd benchmarks
+    touch .conbench
+    echo "url: $CONBENCH_URL" >> .conbench
+    echo "email: $CONBENCH_EMAIL" >> .conbench
+    echo "password: $CONBENCH_PASSWORD" >> .conbench
+    echo "host_name: $MACHINE" >> .conbench
+    popd
+ 
+### 10. Run Python benchmarks
+    cd benchmarks
+    conbench file-read ALL --iterations=3 --all=true --drop-caches=true 
+
+### 11. Use `install_archery` hook to setup archery and run C++ benchmarks
+    pushd arrow
+    source dev/conbench_envs/hooks.sh install_archery
+    popd
+    cd benchmarks
+    conbench cpp-micro --iterations=1
+
+### 12. Use `build_arrow_r` hook to build Arrow R and run R benchmarks
+    pushd arrow
+    source dev/conbench_envs/hooks.sh build_arrow_r
+    popd
+    R -e "remotes::install_github('ursacomputing/arrowbench')"
+    cd benchmarks
+    conbench dataframe-to-table ALL --iterations=3 --drop-caches=true --language=R
+
+### 13. Use `build_arrow_java` and `install_archery` hooks to build Arrow Java and run Java benchmarks
+    pushd arrow
+    source dev/conbench_envs/hooks.sh build_arrow_java
+    source dev/conbench_envs/hooks.sh install_archery
+    popd
+    cd benchmarks
+    conbench java-micro --iterations=1
+
+### 14. Use `install_java_script_project_dependencies` hook to install Java Script dependencies and run Java Script benchmarks
+    pushd arrow
+    source dev/conbench_envs/hooks.sh install_java_script_project_dependencies
+    popd
+    cd benchmarks
+    conbench js-micro
diff --git a/src/arrow/dev/conbench_envs/benchmarks.env b/src/arrow/dev/conbench_envs/benchmarks.env
new file mode 100644
index 000000000..6c151aa7c
--- /dev/null
+++ b/src/arrow/dev/conbench_envs/benchmarks.env
@@ -0,0 +1,50 @@
+# Licensed to the Apache Software Foundation (ASF) under one or more
+# contributor license agreements.  See the NOTICE file distributed with
+# this work for additional information regarding copyright ownership.
+# The ASF licenses this file to You under the Apache License, Version 2.0
+# (the "License"); you may not use this file except in compliance with
+# the License.  You may obtain a copy of the License at
+#
+#    http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+
+ARROW_BUILD_TESTS=OFF
+ARROW_BUILD_TYPE=release
+ARROW_DEPENDENCY_SOURCE=AUTO
+ARROW_DATASET=ON
+ARROW_DEFAULT_MEMORY_POOL=mimalloc
+ARROW_ENABLE_UNSAFE_MEMORY_ACCESS=true
+ARROW_ENABLE_NULL_CHECK_FOR_GET=false
+ARROW_FLIGHT=OFF
+ARROW_GANDIVA=OFF
+ARROW_HDFS=ON
+ARROW_HOME=$CONDA_PREFIX
+ARROW_INSTALL_NAME_RPATH=OFF
+ARROW_MIMALLOC=ON
+ARROW_NO_DEPRECATED_API=ON
+ARROW_ORC=ON
+ARROW_PARQUET=ON
+ARROW_PLASMA=ON
+ARROW_PYTHON=ON
+ARROW_S3=ON
+ARROW_USE_ASAN=OFF
+ARROW_USE_CCACHE=ON
+ARROW_USE_UBSAN=OFF
+ARROW_WITH_BROTLI=ON
+ARROW_WITH_BZ2=ON
+ARROW_WITH_LZ4=ON
+ARROW_WITH_SNAPPY=ON
+ARROW_WITH_ZLIB=ON
+ARROW_WITH_ZSTD=ON
+GTest_SOURCE=BUNDLED
+ORC_SOURCE=BUNDLED
+PARQUET_BUILD_EXAMPLES=ON
+PARQUET_BUILD_EXECUTABLES=ON
+PYTHON=python
+LD_LIBRARY_PATH=$CONDA_PREFIX/lib:$LD_LIBRARY_PATH
\ No newline at end of file
diff --git a/src/arrow/dev/conbench_envs/hooks.sh b/src/arrow/dev/conbench_envs/hooks.sh
new file mode 100755
index 000000000..6bcfbe446
--- /dev/null
+++ b/src/arrow/dev/conbench_envs/hooks.sh
@@ -0,0 +1,91 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+
+## These hooks are used by benchmark builds
+# to create a conda env with Arrow dependencies and build Arrow C++, Python, etc
+create_conda_env_for_benchmark_build() {
+  conda create -y -n "${BENCHMARKABLE_TYPE}" -c conda-forge \
+  --file ci/conda_env_unix.txt \
+  --file ci/conda_env_cpp.txt \
+  --file ci/conda_env_python.txt \
+  --file ci/conda_env_gandiva.txt \
+  compilers \
+  python="${PYTHON_VERSION}" \
+  pandas \
+  aws-sdk-cpp \
+  r
+}
+
+activate_conda_env_for_benchmark_build() {
+  conda init bash
+  conda activate "${BENCHMARKABLE_TYPE}"
+}
+
+install_arrow_python_dependencies() {
+  pip install -r python/requirements-build.txt -r python/requirements-test.txt
+}
+
+set_arrow_build_and_run_env_vars() {
+  set -a
+  source dev/conbench_envs/benchmarks.env
+  set +a
+}
+
+build_arrow_cpp() {
+  # Ignore the error when a cache can't be created
+  if ! ci/scripts/cpp_build.sh $(pwd) $(pwd) 2> error.log; then
+      if ! grep -q -F "Can\'t create temporary cache file" error.log; then
+         cat error.log
+      fi
+  fi
+}
+
+build_arrow_python() {
+  ci/scripts/python_build.sh $(pwd) $(pwd)
+}
+
+build_arrow_r() {
+  cat ci/etc/rprofile >> $(R RHOME)/etc/Rprofile.site
+  ci/scripts/r_deps.sh $(pwd) $(pwd)
+  (cd r; R CMD INSTALL .;)
+}
+
+build_arrow_java() {
+  ci/scripts/java_build.sh $(pwd) $(pwd)
+}
+
+install_archery() {
+  pip install -e dev/archery
+}
+
+install_java_script_project_dependencies() {
+  (cd js; yarn;)
+}
+
+create_conda_env_with_arrow_python() {
+  create_conda_env_for_benchmark_build
+  activate_conda_env_for_benchmark_build
+  install_arrow_python_dependencies
+  set_arrow_build_and_run_env_vars
+  build_arrow_cpp
+  build_arrow_python
+}
+
+"$@"
diff --git a/src/arrow/dev/merge.conf.sample b/src/arrow/dev/merge.conf.sample
new file mode 100644
index 000000000..c71b21161
--- /dev/null
+++ b/src/arrow/dev/merge.conf.sample
@@ -0,0 +1,25 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+# Configuration for the merge_arrow_pr.py tool
+# Install a copy of this file at ~/.config/arrow/merge.conf
+
+[jira]
+# issues.apache.org JIRA credentials. Sadly, the jira instance doesn't offer
+# token credentials. Ensure that the file is properly protected.
+username=johnsmith
+password=123456
diff --git a/src/arrow/dev/merge_arrow_pr.py b/src/arrow/dev/merge_arrow_pr.py
new file mode 100755
index 000000000..a8ff0b0e2
--- /dev/null
+++ b/src/arrow/dev/merge_arrow_pr.py
@@ -0,0 +1,613 @@
+#!/usr/bin/env python3
+
+#
+# Licensed to the Apache Software Foundation (ASF) under one or more
+# contributor license agreements.  See the NOTICE file distributed with
+# this work for additional information regarding copyright ownership.
+# The ASF licenses this file to You under the Apache License, Version 2.0
+# (the "License"); you may not use this file except in compliance with
+# the License.  You may obtain a copy of the License at
+#
+#    http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+
+# Utility for creating well-formed pull request merges and pushing them to
+# Apache.
+#   usage: ./merge_arrow_pr.py    (see config env vars below)
+#
+# This utility assumes you already have a local Arrow git clone and that you
+# have added remotes corresponding to both (i) the GitHub Apache Arrow mirror
+# and (ii) the apache git repo.
+#
+# There are several pieces of authorization possibly needed via environment
+# variables
+#
+# APACHE_JIRA_USERNAME: your Apache JIRA id
+# APACHE_JIRA_PASSWORD: your Apache JIRA password
+# ARROW_GITHUB_API_TOKEN: a GitHub API token to use for API requests (to avoid
+# rate limiting)
+
+import configparser
+import os
+import pprint
+import re
+import subprocess
+import sys
+import requests
+import getpass
+
+from six.moves import input
+import six
+
+try:
+    import jira.client
+    import jira.exceptions
+except ImportError:
+    print("Could not find jira library. "
+          "Run 'sudo pip install jira' to install.")
+    print("Exiting without trying to close the associated JIRA.")
+    sys.exit(1)
+
+# Remote name which points to the GitHub site
+PR_REMOTE_NAME = os.environ.get("PR_REMOTE_NAME", "apache")
+
+# For testing to avoid accidentally pushing to apache
+DEBUG = bool(int(os.environ.get("DEBUG", 0)))
+
+
+if DEBUG:
+    print("**************** DEBUGGING ****************")
+
+
+# Prefix added to temporary branches
+BRANCH_PREFIX = "PR_TOOL"
+JIRA_API_BASE = "https://issues.apache.org/jira"
+
+
+def get_json(url, headers=None):
+    req = requests.get(url, headers=headers)
+    return req.json()
+
+
+def run_cmd(cmd):
+    if isinstance(cmd, six.string_types):
+        cmd = cmd.split(' ')
+
+    try:
+        output = subprocess.check_output(cmd)
+    except subprocess.CalledProcessError as e:
+        # this avoids hiding the stdout / stderr of failed processes
+        print('Command failed: %s' % cmd)
+        print('With output:')
+        print('--------------')
+        print(e.output)
+        print('--------------')
+        raise e
+
+    if isinstance(output, six.binary_type):
+        output = output.decode('utf-8')
+    return output
+
+
+original_head = run_cmd("git rev-parse HEAD")[:8]
+
+
+def clean_up():
+    print("Restoring head pointer to %s" % original_head)
+    run_cmd("git checkout %s" % original_head)
+
+    branches = run_cmd("git branch").replace(" ", "").split("\n")
+
+    for branch in [x for x in branches
+                   if x.startswith(BRANCH_PREFIX)]:
+        print("Deleting local branch %s" % branch)
+        run_cmd("git branch -D %s" % branch)
+
+
+_REGEX_CI_DIRECTIVE = re.compile(r'\[[^\]]*\]')
+
+
+def strip_ci_directives(commit_message):
+    # Remove things like '[force ci]', '[skip appveyor]' from the assembled
+    # commit message
+    return _REGEX_CI_DIRECTIVE.sub('', commit_message)
+
+
+def fix_version_from_branch(branch, versions):
+    # Note: Assumes this is a sorted (newest->oldest) list of un-released
+    # versions
+    if branch == "master":
+        return versions[-1]
+    else:
+        branch_ver = branch.replace("branch-", "")
+        return [x for x in versions if x.name.startswith(branch_ver)][-1]
+
+
+# We can merge both ARROW and PARQUET patchesa
+SUPPORTED_PROJECTS = ['ARROW', 'PARQUET']
+PR_TITLE_REGEXEN = [(project, re.compile(r'^(' + project + r'-[0-9]+)\b.*$'))
+                    for project in SUPPORTED_PROJECTS]
+
+
+class JiraIssue(object):
+
+    def __init__(self, jira_con, jira_id, project, cmd):
+        self.jira_con = jira_con
+        self.jira_id = jira_id
+        self.project = project
+        self.cmd = cmd
+
+        try:
+            self.issue = jira_con.issue(jira_id)
+        except Exception as e:
+            self.cmd.fail("ASF JIRA could not find %s\n%s" % (jira_id, e))
+
+    @property
+    def current_fix_versions(self):
+        return self.issue.fields.fixVersions
+
+    def get_candidate_fix_versions(self, merge_branches=('master',)):
+        # Only suggest versions starting with a number, like 0.x but not JS-0.x
+        all_versions = self.jira_con.project_versions(self.project)
+        unreleased_versions = [x for x in all_versions
+                               if not x.raw['released']]
+
+        unreleased_versions = sorted(unreleased_versions,
+                                     key=lambda x: x.name, reverse=True)
+
+        mainline_versions = self._filter_mainline_versions(unreleased_versions)
+
+        mainline_non_patch_versions = []
+        for v in mainline_versions:
+            (major, minor, patch) = v.name.split(".")
+            if patch == "0":
+                mainline_non_patch_versions.append(v)
+
+        if len(mainline_versions) > len(mainline_non_patch_versions):
+            # If there is a non-patch release, suggest that instead
+            mainline_versions = mainline_non_patch_versions
+
+        default_fix_versions = [
+            fix_version_from_branch(x, mainline_versions).name
+            for x in merge_branches]
+
+        return all_versions, default_fix_versions
+
+    def _filter_mainline_versions(self, versions):
+        if self.project == 'PARQUET':
+            mainline_regex = re.compile(r'cpp-\d.*')
+        else:
+            mainline_regex = re.compile(r'\d.*')
+
+        return [x for x in versions if mainline_regex.match(x.name)]
+
+    def resolve(self, fix_versions, comment):
+        fields = self.issue.fields
+        cur_status = fields.status.name
+
+        if cur_status == "Resolved" or cur_status == "Closed":
+            self.cmd.fail("JIRA issue %s already has status '%s'"
+                          % (self.jira_id, cur_status))
+
+        if DEBUG:
+            print("JIRA issue %s untouched" % (self.jira_id))
+            return
+
+        resolve = [x for x in self.jira_con.transitions(self.jira_id)
+                   if x['name'] == "Resolve Issue"][0]
+
+        # ARROW-6915: do not overwrite existing fix versions corresponding to
+        # point releases
+        fix_versions = list(fix_versions)
+        fix_version_names = set(x['name'] for x in fix_versions)
+        for version in self.current_fix_versions:
+            major, minor, patch = version.name.split('.')
+            if patch != '0' and version.name not in fix_version_names:
+                fix_versions.append(version.raw)
+
+        self.jira_con.transition_issue(self.jira_id, resolve["id"],
+                                       comment=comment,
+                                       fixVersions=fix_versions)
+
+        print("Successfully resolved %s!" % (self.jira_id))
+
+        self.issue = self.jira_con.issue(self.jira_id)
+        self.show()
+
+    def show(self):
+        fields = self.issue.fields
+        print(format_jira_output(self.jira_id, fields.status.name,
+                                 fields.summary, fields.assignee,
+                                 fields.components))
+
+
+def format_jira_output(jira_id, status, summary, assignee, components):
+    if assignee is None:
+        assignee = "NOT ASSIGNED!!!"
+    else:
+        assignee = assignee.displayName
+
+    if len(components) == 0:
+        components = 'NO COMPONENTS!!!'
+    else:
+        components = ', '.join((x.name for x in components))
+
+    return """=== JIRA {} ===
+Summary\t\t{}
+Assignee\t{}
+Components\t{}
+Status\t\t{}
+URL\t\t{}/{}""".format(jira_id, summary, assignee, components, status,
+                       '/'.join((JIRA_API_BASE, 'browse')), jira_id)
+
+
+class GitHubAPI(object):
+
+    def __init__(self, project_name):
+        self.github_api = ("https://api.github.com/repos/apache/{0}"
+                           .format(project_name))
+
+        token = os.environ.get('ARROW_GITHUB_API_TOKEN', None)
+        if token:
+            self.headers = {'Authorization': 'token {0}'.format(token)}
+        else:
+            self.headers = None
+
+    def get_pr_data(self, number):
+        return get_json("%s/pulls/%s" % (self.github_api, number),
+                        headers=self.headers)
+
+
+class CommandInput(object):
+    """
+    Interface to input(...) to enable unit test mocks to be created
+    """
+
+    def fail(self, msg):
+        clean_up()
+        raise Exception(msg)
+
+    def prompt(self, prompt):
+        return input(prompt)
+
+    def getpass(self, prompt):
+        return getpass.getpass(prompt)
+
+    def continue_maybe(self, prompt):
+        while True:
+            result = input("\n%s (y/n): " % prompt)
+            if result.lower() == "y":
+                return
+            elif result.lower() == "n":
+                self.fail("Okay, exiting")
+            else:
+                prompt = "Please input 'y' or 'n'"
+
+
+class PullRequest(object):
+
+    def __init__(self, cmd, github_api, git_remote, jira_con, number):
+        self.cmd = cmd
+        self.git_remote = git_remote
+        self.con = jira_con
+        self.number = number
+        self._pr_data = github_api.get_pr_data(number)
+        try:
+            self.url = self._pr_data["url"]
+            self.title = self._pr_data["title"]
+            self.body = self._pr_data["body"]
+            self.target_ref = self._pr_data["base"]["ref"]
+            self.user_login = self._pr_data["user"]["login"]
+            self.base_ref = self._pr_data["head"]["ref"]
+        except KeyError:
+            pprint.pprint(self._pr_data)
+            raise
+        self.description = "%s/%s" % (self.user_login, self.base_ref)
+
+        self.jira_issue = self._get_jira()
+
+    def show(self):
+        print("\n=== Pull Request #%s ===" % self.number)
+        print("title\t%s\nsource\t%s\ntarget\t%s\nurl\t%s"
+              % (self.title, self.description, self.target_ref, self.url))
+        if self.jira_issue is not None:
+            self.jira_issue.show()
+        else:
+            print("Minor PR.  Please ensure it meets guidelines for minor.\n")
+
+    @property
+    def is_merged(self):
+        return bool(self._pr_data["merged"])
+
+    @property
+    def is_mergeable(self):
+        return bool(self._pr_data["mergeable"])
+
+    def _get_jira(self):
+        if self.title.startswith("MINOR:"):
+            return None
+
+        jira_id = None
+        for project, regex in PR_TITLE_REGEXEN:
+            m = regex.search(self.title)
+            if m:
+                jira_id = m.group(1)
+                break
+
+        if jira_id is None:
+            options = ' or '.join('{0}-XXX'.format(project)
+                                  for project in SUPPORTED_PROJECTS)
+            self.cmd.fail("PR title should be prefixed by a jira id "
+                          "{0}, but found {1}".format(options, self.title))
+
+        return JiraIssue(self.con, jira_id, project, self.cmd)
+
+    def merge(self):
+        """
+        merge the requested PR and return the merge hash
+        """
+        pr_branch_name = "%s_MERGE_PR_%s" % (BRANCH_PREFIX, self.number)
+        target_branch_name = "%s_MERGE_PR_%s_%s" % (BRANCH_PREFIX,
+                                                    self.number,
+                                                    self.target_ref.upper())
+        run_cmd("git fetch %s pull/%s/head:%s" % (self.git_remote,
+                                                  self.number,
+                                                  pr_branch_name))
+        run_cmd("git fetch %s %s:%s" % (self.git_remote, self.target_ref,
+                                        target_branch_name))
+        run_cmd("git checkout %s" % target_branch_name)
+
+        had_conflicts = False
+        try:
+            run_cmd(['git', 'merge', pr_branch_name, '--ff', '--squash'])
+        except Exception as e:
+            msg = ("Error merging: %s\nWould you like to "
+                   "manually fix-up this merge?" % e)
+            self.cmd.continue_maybe(msg)
+            msg = ("Okay, please fix any conflicts and 'git add' "
+                   "conflicting files... Finished?")
+            self.cmd.continue_maybe(msg)
+            had_conflicts = True
+
+        commit_authors = run_cmd(['git', 'log', 'HEAD..%s' % pr_branch_name,
+                                 '--pretty=format:%an <%ae>']).split("\n")
+        distinct_authors = sorted(set(commit_authors),
+                                  key=lambda x: commit_authors.count(x),
+                                  reverse=True)
+
+        for i, author in enumerate(distinct_authors):
+            print("Author {}: {}".format(i + 1, author))
+
+        if len(distinct_authors) > 1:
+            primary_author, distinct_authors = get_primary_author(
+                self.cmd, distinct_authors)
+        else:
+            # If there is only one author, do not prompt for a lead author
+            primary_author = distinct_authors[0]
+
+        merge_message_flags = []
+
+        merge_message_flags += ["-m", self.title]
+        if self.body is not None:
+            merge_message_flags += ["-m", self.body]
+
+        committer_name = run_cmd("git config --get user.name").strip()
+        committer_email = run_cmd("git config --get user.email").strip()
+
+        authors = ("Authored-by:" if len(distinct_authors) == 1
+                   else "Lead-authored-by:")
+        authors += " %s" % (distinct_authors.pop(0))
+        if len(distinct_authors) > 0:
+            authors += "\n" + "\n".join(["Co-authored-by: %s" % a
+                                         for a in distinct_authors])
+        authors += "\n" + "Signed-off-by: %s <%s>" % (committer_name,
+                                                      committer_email)
+
+        if had_conflicts:
+            committer_name = run_cmd("git config --get user.name").strip()
+            committer_email = run_cmd("git config --get user.email").strip()
+            message = ("This patch had conflicts when merged, "
+                       "resolved by\nCommitter: %s <%s>" %
+                       (committer_name, committer_email))
+            merge_message_flags += ["-m", message]
+
+        # The string "Closes #%s" string is required for GitHub to correctly
+        # close the PR
+        merge_message_flags += [
+            "-m",
+            "Closes #%s from %s"
+            % (self.number, self.description)]
+        merge_message_flags += ["-m", authors]
+
+        if DEBUG:
+            print("\n".join(merge_message_flags))
+
+        run_cmd(['git', 'commit',
+                 '--no-verify',  # do not run commit hooks
+                 '--author="%s"' % primary_author] +
+                merge_message_flags)
+
+        self.cmd.continue_maybe("Merge complete (local ref %s). Push to %s?"
+                                % (target_branch_name, self.git_remote))
+
+        try:
+            push_cmd = ('git push %s %s:%s' % (self.git_remote,
+                                               target_branch_name,
+                                               self.target_ref))
+            if DEBUG:
+                print(push_cmd)
+            else:
+                run_cmd(push_cmd)
+        except Exception as e:
+            clean_up()
+            self.cmd.fail("Exception while pushing: %s" % e)
+
+        merge_hash = run_cmd("git rev-parse %s" % target_branch_name)[:8]
+        clean_up()
+        print("Pull request #%s merged!" % self.number)
+        print("Merge hash: %s" % merge_hash)
+        return merge_hash
+
+
+def get_primary_author(cmd, distinct_authors):
+    author_pat = re.compile(r'(.*) <(.*)>')
+
+    while True:
+        primary_author = cmd.prompt(
+            "Enter primary author in the format of "
+            "\"name <email>\" [%s]: " % distinct_authors[0])
+
+        if primary_author == "":
+            return distinct_authors[0], distinct_authors
+
+        if author_pat.match(primary_author):
+            break
+        print('Bad author "{}", please try again'.format(primary_author))
+
+    # When primary author is specified manually, de-dup it from
+    # author list and put it at the head of author list.
+    distinct_authors = [x for x in distinct_authors
+                        if x != primary_author]
+    distinct_authors = [primary_author] + distinct_authors
+    return primary_author, distinct_authors
+
+
+def prompt_for_fix_version(cmd, jira_issue):
+    (all_versions,
+     default_fix_versions) = jira_issue.get_candidate_fix_versions()
+
+    default_fix_versions = ",".join(default_fix_versions)
+
+    issue_fix_versions = cmd.prompt("Enter comma-separated "
+                                    "fix version(s) [%s]: "
+                                    % default_fix_versions)
+    if issue_fix_versions == "":
+        issue_fix_versions = default_fix_versions
+    issue_fix_versions = issue_fix_versions.replace(" ", "").split(",")
+
+    def get_version_json(version_str):
+        return [x for x in all_versions if x.name == version_str][0].raw
+
+    return [get_version_json(v) for v in issue_fix_versions]
+
+
+CONFIG_FILE = "~/.config/arrow/merge.conf"
+
+
+def load_configuration():
+    config = configparser.ConfigParser()
+    config.read(os.path.expanduser(CONFIG_FILE))
+    return config
+
+
+def get_credentials(cmd):
+    username, password = None, None
+
+    config = load_configuration()
+    if "jira" in config.sections():
+        username = config["jira"].get("username")
+        password = config["jira"].get("password")
+
+    # Fallback to environment variables
+    if not username:
+        username = os.environ.get("APACHE_JIRA_USERNAME")
+
+    if not password:
+        password = os.environ.get("APACHE_JIRA_PASSWORD")
+
+    # Fallback to user tty prompt
+    if not username:
+        username = cmd.prompt("Env APACHE_JIRA_USERNAME not set, "
+                              "please enter your JIRA username:")
+
+    if not password:
+        password = cmd.getpass("Env APACHE_JIRA_PASSWORD not set, "
+                               "please enter your JIRA password:")
+
+    return (username, password)
+
+
+def connect_jira(cmd):
+    try:
+        return jira.client.JIRA(options={'server': JIRA_API_BASE},
+                                basic_auth=get_credentials(cmd))
+    except jira.exceptions.JIRAError as e:
+        if "CAPTCHA_CHALLENGE" in e.text:
+            print("")
+            print("It looks like you need to answer a captcha challenge for "
+                  "this account (probably due to a login attempt with an "
+                  "incorrect password). Please log in at "
+                  "https://issues.apache.org/jira and complete the captcha "
+                  "before running this tool again.")
+            print("Exiting.")
+            sys.exit(1)
+        raise e
+
+
+def get_pr_num():
+    if len(sys.argv) == 2:
+        return sys.argv[1]
+
+    return input("Which pull request would you like to merge? (e.g. 34): ")
+
+
+def cli():
+    # Location of your Arrow git clone
+    ARROW_HOME = os.path.abspath(os.path.dirname(__file__))
+    PROJECT_NAME = os.environ.get('ARROW_PROJECT_NAME') or 'arrow'
+    print("ARROW_HOME = " + ARROW_HOME)
+    print("PROJECT_NAME = " + PROJECT_NAME)
+
+    cmd = CommandInput()
+
+    pr_num = get_pr_num()
+
+    os.chdir(ARROW_HOME)
+
+    github_api = GitHubAPI(PROJECT_NAME)
+
+    jira_con = connect_jira(cmd)
+    pr = PullRequest(cmd, github_api, PR_REMOTE_NAME, jira_con, pr_num)
+
+    if pr.is_merged:
+        print("Pull request %s has already been merged")
+        sys.exit(0)
+
+    if not pr.is_mergeable:
+        msg = ("Pull request %s is not mergeable in its current form.\n"
+               % pr_num + "Continue? (experts only!)")
+        cmd.continue_maybe(msg)
+
+    pr.show()
+
+    cmd.continue_maybe("Proceed with merging pull request #%s?" % pr_num)
+
+    # merged hash not used
+    pr.merge()
+
+    if pr.jira_issue is None:
+        print("Minor PR.  No JIRA issue to update.\n")
+        return
+
+    cmd.continue_maybe("Would you like to update the associated JIRA?")
+    jira_comment = (
+        "Issue resolved by pull request %s\n[%s/%s]"
+        % (pr_num,
+           "https://github.com/apache/" + PROJECT_NAME + "/pull",
+           pr_num))
+
+    fix_versions_json = prompt_for_fix_version(cmd, pr.jira_issue)
+    pr.jira_issue.resolve(fix_versions_json, jira_comment)
+
+
+if __name__ == '__main__':
+    try:
+        cli()
+    except Exception:
+        raise
diff --git a/src/arrow/dev/merge_arrow_pr.sh b/src/arrow/dev/merge_arrow_pr.sh
new file mode 100755
index 000000000..5b55780dc
--- /dev/null
+++ b/src/arrow/dev/merge_arrow_pr.sh
@@ -0,0 +1,56 @@
+#!/usr/bin/env sh
+
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+# Wrapper script that automatically creates a Python virtual environment
+# and runs merge_arrow_pr.py inside it.
+
+set -e
+
+PYTHON=$(which python3)
+PYVER=$($PYTHON -c "import sys; print('.'.join(map(str, sys.version_info[:2])))")
+
+GIT_ROOT=$(git rev-parse --show-toplevel)
+ENV_DIR=$GIT_ROOT/dev/.venv$PYVER
+
+ENV_PYTHON=$ENV_DIR/bin/python3
+ENV_PIP="$ENV_PYTHON -m pip --no-input"
+
+check_venv() {
+    [ -x $ENV_PYTHON ] || {
+        echo "Virtual environment broken: $ENV_PYTHON not an executable"
+        exit 1
+    }
+}
+
+create_venv() {
+    echo ""
+    echo "Creating Python virtual environment in $ENV_DIR ..."
+    echo ""
+    $PYTHON -m venv $ENV_DIR
+    $ENV_PIP install -q -r $GIT_ROOT/dev/requirements_merge_arrow_pr.txt || {
+        echo "Failed to setup virtual environment"
+        echo "Please delete directory '$ENV_DIR' and try again"
+        exit $?
+    }
+}
+
+[ -d $ENV_DIR ] || create_venv
+check_venv
+
+$ENV_PYTHON $GIT_ROOT/dev/merge_arrow_pr.py "$@"
diff --git a/src/arrow/dev/release/.env.example b/src/arrow/dev/release/.env.example
new file mode 100644
index 000000000..50c8ec8e6
--- /dev/null
+++ b/src/arrow/dev/release/.env.example
@@ -0,0 +1,32 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+# The GPG key ID to sign artifacts. The GPG key ID must be registered
+# to both of the followings:
+#
+#   * https://dist.apache.org/repos/dist/dev/arrow/KEYS
+#   * https://dist.apache.org/repos/dist/release/arrow/KEYS
+#
+# See these files how to import your GPG key ID to these files.
+#
+# You must set this.
+#GPG_KEY_ID=08D3564B7C6A9CAFBFF6A66791D18FCF079F8007
+
+# The Artifactory API key to upload artifacts to Artifactory.
+#
+# You must set this.
+#ARTIFACTORY_API_KEY=secret
diff --git a/src/arrow/dev/release/.gitignore b/src/arrow/dev/release/.gitignore
new file mode 100644
index 000000000..f3d708a6a
--- /dev/null
+++ b/src/arrow/dev/release/.gitignore
@@ -0,0 +1,21 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+/.env
+/binary/id_rsa
+/binary/id_rsa.pub
+/binary/tmp/
diff --git a/src/arrow/dev/release/01-prepare-test.rb b/src/arrow/dev/release/01-prepare-test.rb
new file mode 100644
index 000000000..51665ec02
--- /dev/null
+++ b/src/arrow/dev/release/01-prepare-test.rb
@@ -0,0 +1,586 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+class PrepareTest < Test::Unit::TestCase
+  include GitRunnable
+  include VersionDetectable
+
+  def setup
+    @current_commit = git_current_commit
+    detect_versions
+
+    top_dir = Pathname(__dir__).parent.parent
+    @original_git_repository = top_dir + ".git"
+    Dir.mktmpdir do |dir|
+      @test_git_repository = Pathname(dir) + "arrow"
+      git("clone", @original_git_repository.to_s, @test_git_repository.to_s)
+      Dir.chdir(@test_git_repository) do
+        @tag_name = "apache-arrow-#{@release_version}"
+        @release_branch = "testing-release-#{@release_version}-rc0"
+        git("checkout", "-b", @release_branch, @current_commit)
+        yield
+      end
+      FileUtils.rm_rf(@test_git_repository)
+    end
+  end
+
+  def omit_on_release_branch
+    omit("Not for release branch") if on_release_branch?
+  end
+
+  def prepare(*targets)
+    if targets.last.is_a?(Hash)
+      additional_env = targets.pop
+    else
+      additional_env = {}
+    end
+    env = { "PREPARE_DEFAULT" => "0" }
+    targets.each do |target|
+      env["PREPARE_#{target}"] = "1"
+    end
+    env = env.merge(additional_env)
+    sh(env, "dev/release/01-prepare.sh", @release_version, @next_version, "0")
+  end
+
+  def bump_versions(*targets)
+    env = { "BUMP_DEFAULT" => "0" }
+    targets.each do |target|
+      env["BUMP_#{target}"] = "1"
+    end
+    sh(env, "dev/release/post-12-bump-versions.sh", @release_version,
+       @next_version)
+  end
+
+  def parse_patch(patch)
+    diffs = []
+    in_hunk = false
+    patch.each_line do |line|
+      case line
+      when /\A--- a\//
+        path = $POSTMATCH.chomp
+        diffs << { path: path, hunks: [] }
+        in_hunk = false
+      when /\A@@/
+        in_hunk = true
+        diffs.last[:hunks] << []
+      when /\A[-+]/
+        next unless in_hunk
+        diffs.last[:hunks].last << line.chomp
+      end
+    end
+    diffs.sort_by do |diff|
+      diff[:path]
+    end
+  end
+
+  def test_linux_packages
+    user = "Arrow Developers"
+    email = "dev@arrow.apache.org"
+    prepare("LINUX_PACKAGES", "DEBFULLNAME" => user, "DEBEMAIL" => email)
+    changes = parse_patch(git("log", "-n", "1", "-p"))
+    sampled_changes = changes.collect do |change|
+      {
+        path: change[:path],
+        sampled_hunks: change[:hunks].collect(&:first),
+      }
+    end
+    base_dir = "dev/tasks/linux-packages"
+    today = Time.now.utc.strftime("%a %b %d %Y")
+    expected_changes = [
+      {
+        path: "#{base_dir}/apache-arrow-apt-source/debian/changelog",
+        sampled_hunks: [
+          "+apache-arrow-apt-source (#{@release_version}-1) " +
+          "unstable; urgency=low",
+        ],
+      },
+      {
+        path: "#{base_dir}/apache-arrow-release/yum/apache-arrow-release.spec.in",
+        sampled_hunks: [
+          "+* #{today} #{user} <#{email}> - #{@release_version}-1",
+        ],
+      },
+      {
+        path: "#{base_dir}/apache-arrow/debian/changelog",
+        sampled_hunks: [
+          "+apache-arrow (#{@release_version}-1) unstable; urgency=low",
+        ],
+      },
+      {
+        path: "#{base_dir}/apache-arrow/yum/arrow.spec.in",
+        sampled_hunks: [
+          "+* #{today} #{user} <#{email}> - #{@release_version}-1",
+        ],
+      },
+    ]
+    assert_equal(expected_changes, sampled_changes)
+  end
+
+  def test_version_pre_tag
+    omit_on_release_branch
+    prepare("VERSION_PRE_TAG")
+    assert_equal([
+                   {
+                     path: "c_glib/meson.build",
+                     hunks: [
+                       ["-version = '#{@snapshot_version}'",
+                        "+version = '#{@release_version}'"],
+                     ],
+                   },
+                   {
+                     path: "ci/scripts/PKGBUILD",
+                     hunks: [
+                       ["-pkgver=#{@previous_version}.9000",
+                        "+pkgver=#{@release_version}"],
+                     ],
+                   },
+                   {
+                     path: "cpp/CMakeLists.txt",
+                     hunks: [
+                       ["-set(ARROW_VERSION \"#{@snapshot_version}\")",
+                        "+set(ARROW_VERSION \"#{@release_version}\")"],
+                     ],
+                   },
+                   {
+                     path: "cpp/vcpkg.json",
+                     hunks: [
+                       ["-  \"version-string\": \"#{@snapshot_version}\",",
+                        "+  \"version-string\": \"#{@release_version}\","],
+                     ],
+                   },
+                   {
+                     path: "csharp/Directory.Build.props",
+                     hunks: [
+                       ["-    <Version>#{@snapshot_version}</Version>",
+                        "+    <Version>#{@release_version}</Version>"],
+                     ],
+                   },
+                   {
+                     path: "dev/tasks/homebrew-formulae/apache-arrow.rb",
+                     hunks: [
+                       ["-  url \"https://www.apache.org/dyn/closer.lua?path=arrow/arrow-#{@snapshot_version}/apache-arrow-#{@snapshot_version}.tar.gz\"",
+                        "+  url \"https://www.apache.org/dyn/closer.lua?path=arrow/arrow-#{@release_version}/apache-arrow-#{@release_version}.tar.gz\""],
+                     ],
+                   },
+                   {
+                     path: "dev/tasks/homebrew-formulae/autobrew/apache-arrow.rb",
+                     hunks: [
+                       ["-  url \"https://www.apache.org/dyn/closer.lua?path=arrow/arrow-#{@previous_version}.9000/apache-arrow-#{@previous_version}.9000.tar.gz\"",
+                        "+  url \"https://www.apache.org/dyn/closer.lua?path=arrow/arrow-#{@release_version}/apache-arrow-#{@release_version}.tar.gz\""],
+                     ],
+                   },
+                   {
+                     path: "java/adapter/avro/pom.xml",
+                     hunks: [
+                       ["-    <version>#{@snapshot_version}</version>",
+                        "+    <version>#{@release_version}</version>"],
+                     ],
+                   },
+                   {
+                     hunks: [
+                       ["-        <version>#{@snapshot_version}</version>",
+                        "+        <version>#{@release_version}</version>"],
+                     ],
+                     path: "java/adapter/jdbc/pom.xml",
+                   },
+                   {
+                     hunks: [
+                       ["-        <version>#{@snapshot_version}</version>",
+                        "+        <version>#{@release_version}</version>"],
+                     ],
+                     path: "java/adapter/orc/pom.xml",
+                   },
+                   { hunks: [["-    <version>#{@snapshot_version}</version>",
+                              "+    <version>#{@release_version}</version>"]],
+                     path: "java/algorithm/pom.xml" },
+                   { hunks: [["-        <version>#{@snapshot_version}</version>",
+                              "+        <version>#{@release_version}</version>"]],
+                     path: "java/c/pom.xml" },
+                   { hunks: [["-    <version>#{@snapshot_version}</version>",
+                              "+    <version>#{@release_version}</version>"]],
+                     path: "java/compression/pom.xml" },
+                   { hunks: [["-        <version>#{@snapshot_version}</version>",
+                              "+        <version>#{@release_version}</version>"]],
+                     path: "java/dataset/pom.xml" },
+                   { hunks: [["-    <version>#{@snapshot_version}</version>",
+                              "+    <version>#{@release_version}</version>"]],
+                     path: "java/flight/flight-core/pom.xml" },
+                   { hunks: [["-    <version>#{@snapshot_version}</version>",
+                              "+    <version>#{@release_version}</version>"]],
+                     path: "java/flight/flight-grpc/pom.xml" },
+                   { hunks: [["-  <version>#{@snapshot_version}</version>", "+  <version>#{@release_version}</version>"]],
+                     path: "java/format/pom.xml" },
+                   { hunks: [["-      <version>#{@snapshot_version}</version>",
+                              "+      <version>#{@release_version}</version>"]],
+                     path: "java/gandiva/pom.xml" },
+                   { hunks: [["-    <version>#{@snapshot_version}</version>",
+                              "+    <version>#{@release_version}</version>"]],
+                     path: "java/memory/memory-core/pom.xml" },
+                   { hunks: [["-    <version>#{@snapshot_version}</version>",
+                              "+    <version>#{@release_version}</version>"]],
+                     path: "java/memory/memory-netty/pom.xml" },
+                   { hunks: [["-    <version>#{@snapshot_version}</version>",
+                              "+    <version>#{@release_version}</version>"]],
+                     path: "java/memory/memory-unsafe/pom.xml" },
+                   { hunks: [["-    <version>#{@snapshot_version}</version>",
+                              "+    <version>#{@release_version}</version>"]],
+                     path: "java/memory/pom.xml" },
+                   { hunks: [["-        <version>#{@snapshot_version}</version>",
+                              "+        <version>#{@release_version}</version>"],
+                             ["-            <version>#{@snapshot_version}</version>",
+                              "+            <version>#{@release_version}</version>"]],
+                     path: "java/performance/pom.xml" },
+                   { hunks: [["-        <version>#{@snapshot_version}</version>",
+                              "+        <version>#{@release_version}</version>"]],
+                     path: "java/plasma/pom.xml" },
+                   { hunks: [["-  <version>#{@snapshot_version}</version>", "+  <version>#{@release_version}</version>"]],
+                     path: "java/pom.xml" },
+                   { hunks: [["-        <version>#{@snapshot_version}</version>",
+                              "+        <version>#{@release_version}</version>"]],
+                     path: "java/tools/pom.xml" },
+                   { hunks: [["-    <version>#{@snapshot_version}</version>",
+                              "+    <version>#{@release_version}</version>"]],
+                     path: "java/vector/pom.xml" },
+                   {
+                     path: "js/package.json",
+                     hunks: [
+                       ["-  \"version\": \"#{@snapshot_version}\"",
+                        "+  \"version\": \"#{@release_version}\""],
+                     ],
+                   },
+                   {
+                     path: "matlab/CMakeLists.txt",
+                     hunks: [
+                       ["-set(MLARROW_VERSION \"#{@snapshot_version}\")",
+                        "+set(MLARROW_VERSION \"#{@release_version}\")"],
+                     ],
+                   },
+                   {
+                     path: "python/setup.py",
+                     hunks: [
+                       ["-default_version = '#{@snapshot_version}'",
+                        "+default_version = '#{@release_version}'"],
+                     ],
+                   },
+                   {
+                     path: "r/DESCRIPTION",
+                     hunks: [
+                       ["-Version: #{@previous_version}.9000",
+                        "+Version: #{@release_version}"],
+                     ],
+                   },
+                   {
+                     path: "r/NEWS.md",
+                     hunks: [
+                       ["-\# arrow #{@previous_version}.9000",
+                        "+\# arrow #{@release_version}"],
+                     ],
+                   },
+                   {
+                     path: "ruby/red-arrow-cuda/lib/arrow-cuda/version.rb",
+                     hunks: [
+                       ["-  VERSION = \"#{@snapshot_version}\"",
+                        "+  VERSION = \"#{@release_version}\""],
+                     ],
+                   },
+                   {
+                     path: "ruby/red-arrow-dataset/lib/arrow-dataset/version.rb",
+                     hunks: [
+                       ["-  VERSION = \"#{@snapshot_version}\"",
+                        "+  VERSION = \"#{@release_version}\""],
+                     ],
+                   },
+                   {
+                     path: "ruby/red-arrow-flight/lib/arrow-flight/version.rb",
+                     hunks: [
+                       ["-  VERSION = \"#{@snapshot_version}\"",
+                        "+  VERSION = \"#{@release_version}\""],
+                     ],
+                   },
+                   {
+                     path: "ruby/red-arrow/lib/arrow/version.rb",
+                     hunks: [
+                       ["-  VERSION = \"#{@snapshot_version}\"",
+                        "+  VERSION = \"#{@release_version}\""],
+                     ],
+                   },
+                   {
+                     path: "ruby/red-gandiva/lib/gandiva/version.rb",
+                     hunks: [
+                       ["-  VERSION = \"#{@snapshot_version}\"",
+                        "+  VERSION = \"#{@release_version}\""],
+                     ],
+                   },
+                   {
+                     path: "ruby/red-parquet/lib/parquet/version.rb",
+                     hunks: [
+                       ["-  VERSION = \"#{@snapshot_version}\"",
+                        "+  VERSION = \"#{@release_version}\""],
+                     ],
+                   },
+                   {
+                     path: "ruby/red-plasma/lib/plasma/version.rb",
+                     hunks: [
+                       ["-  VERSION = \"#{@snapshot_version}\"",
+                        "+  VERSION = \"#{@release_version}\""],
+                     ],
+                   },
+                 ],
+                 parse_patch(git("log", "-n", "1", "-p")))
+  end
+
+  def test_version_post_tag
+    omit_on_release_branch
+    bump_versions("VERSION_POST_TAG")
+    assert_equal([
+                   {
+                     path: "c_glib/meson.build",
+                     hunks: [
+                       ["-version = '#{@snapshot_version}'",
+                        "+version = '#{@next_snapshot_version}'"],
+                     ],
+                   },
+                   {
+                     path: "ci/scripts/PKGBUILD",
+                     hunks: [
+                       ["-pkgver=#{@previous_version}.9000",
+                        "+pkgver=#{@release_version}.9000"],
+                     ],
+                   },
+                   {
+                     path: "cpp/CMakeLists.txt",
+                     hunks: [
+                       ["-set(ARROW_VERSION \"#{@snapshot_version}\")",
+                        "+set(ARROW_VERSION \"#{@next_snapshot_version}\")"],
+                     ],
+                   },
+                   {
+                     path: "cpp/vcpkg.json",
+                     hunks: [
+                       ["-  \"version-string\": \"#{@snapshot_version}\",",
+                        "+  \"version-string\": \"#{@next_snapshot_version}\","],
+                     ],
+                   },
+                   {
+                     path: "csharp/Directory.Build.props",
+                     hunks: [
+                       ["-    <Version>#{@snapshot_version}</Version>",
+                        "+    <Version>#{@next_snapshot_version}</Version>"],
+                     ],
+                   },
+                   {
+                     path: "dev/tasks/homebrew-formulae/apache-arrow.rb",
+                     hunks: [
+                       ["-  url \"https://www.apache.org/dyn/closer.lua?path=arrow/arrow-#{@snapshot_version}/apache-arrow-#{@snapshot_version}.tar.gz\"",
+                        "+  url \"https://www.apache.org/dyn/closer.lua?path=arrow/arrow-#{@next_snapshot_version}/apache-arrow-#{@next_snapshot_version}.tar.gz\""],
+                     ],
+                   },
+                   {
+                     path: "dev/tasks/homebrew-formulae/autobrew/apache-arrow.rb",
+                     hunks: [
+                       ["-  url \"https://www.apache.org/dyn/closer.lua?path=arrow/arrow-#{@previous_version}.9000/apache-arrow-#{@previous_version}.9000.tar.gz\"",
+                        "+  url \"https://www.apache.org/dyn/closer.lua?path=arrow/arrow-#{@release_version}.9000/apache-arrow-#{@release_version}.9000.tar.gz\""],
+                     ],
+                   },
+                   { path: "java/adapter/avro/pom.xml",
+                     hunks: [["-    <version>#{@snapshot_version}</version>",
+                             "+    <version>#{@next_snapshot_version}</version>"]] },
+                   { hunks: [["-        <version>#{@snapshot_version}</version>",
+                              "+        <version>#{@next_snapshot_version}</version>"]],
+                     path: "java/adapter/jdbc/pom.xml" },
+                   { hunks: [["-        <version>#{@snapshot_version}</version>",
+                              "+        <version>#{@next_snapshot_version}</version>"]],
+                     path: "java/adapter/orc/pom.xml" },
+                   { hunks: [["-    <version>#{@snapshot_version}</version>",
+                              "+    <version>#{@next_snapshot_version}</version>"]],
+                     path: "java/algorithm/pom.xml" },
+                   { hunks: [["-        <version>#{@snapshot_version}</version>",
+                              "+        <version>#{@next_snapshot_version}</version>"]],
+                     path: "java/c/pom.xml" },
+                   { hunks: [["-    <version>#{@snapshot_version}</version>",
+                              "+    <version>#{@next_snapshot_version}</version>"]],
+                     path: "java/compression/pom.xml" },
+                   { hunks: [["-        <version>#{@snapshot_version}</version>",
+                              "+        <version>#{@next_snapshot_version}</version>"]],
+                     path: "java/dataset/pom.xml" },
+                   { hunks: [["-    <version>#{@snapshot_version}</version>",
+                              "+    <version>#{@next_snapshot_version}</version>"]],
+                     path: "java/flight/flight-core/pom.xml" },
+                   { hunks: [["-    <version>#{@snapshot_version}</version>",
+                              "+    <version>#{@next_snapshot_version}</version>"]],
+                     path: "java/flight/flight-grpc/pom.xml" },
+                   { hunks: [["-  <version>#{@snapshot_version}</version>", "+  <version>#{@next_snapshot_version}</version>"]],
+                     path: "java/format/pom.xml" },
+                   { hunks: [["-      <version>#{@snapshot_version}</version>",
+                              "+      <version>#{@next_snapshot_version}</version>"]],
+                     path: "java/gandiva/pom.xml" },
+                   { hunks: [["-    <version>#{@snapshot_version}</version>",
+                              "+    <version>#{@next_snapshot_version}</version>"]],
+                     path: "java/memory/memory-core/pom.xml" },
+                   { hunks: [["-    <version>#{@snapshot_version}</version>",
+                              "+    <version>#{@next_snapshot_version}</version>"]],
+                     path: "java/memory/memory-netty/pom.xml" },
+                   { hunks: [["-    <version>#{@snapshot_version}</version>",
+                              "+    <version>#{@next_snapshot_version}</version>"]],
+                     path: "java/memory/memory-unsafe/pom.xml" },
+                   { hunks: [["-    <version>#{@snapshot_version}</version>",
+                              "+    <version>#{@next_snapshot_version}</version>"]],
+                     path: "java/memory/pom.xml" },
+                   { hunks: [["-        <version>#{@snapshot_version}</version>",
+                              "+        <version>#{@next_snapshot_version}</version>"],
+                             ["-            <version>#{@snapshot_version}</version>",
+                              "+            <version>#{@next_snapshot_version}</version>"]],
+                     path: "java/performance/pom.xml" },
+                   { hunks: [["-        <version>#{@snapshot_version}</version>",
+                              "+        <version>#{@next_snapshot_version}</version>"]],
+                     path: "java/plasma/pom.xml" },
+                   { hunks: [["-  <version>#{@snapshot_version}</version>", "+  <version>#{@next_snapshot_version}</version>"]],
+                     path: "java/pom.xml" },
+                   { hunks: [["-        <version>#{@snapshot_version}</version>",
+                              "+        <version>#{@next_snapshot_version}</version>"]],
+                     path: "java/tools/pom.xml" },
+                   { hunks: [["-    <version>#{@snapshot_version}</version>",
+                              "+    <version>#{@next_snapshot_version}</version>"]],
+                     path: "java/vector/pom.xml" },
+                   {
+                     path: "js/package.json",
+                     hunks: [
+                       ["-  \"version\": \"#{@snapshot_version}\"",
+                        "+  \"version\": \"#{@next_snapshot_version}\""],
+                     ],
+                   },
+                   {
+                     path: "matlab/CMakeLists.txt",
+                     hunks: [
+                       ["-set(MLARROW_VERSION \"#{@snapshot_version}\")",
+                        "+set(MLARROW_VERSION \"#{@next_snapshot_version}\")"],
+                     ],
+                   },
+                   {
+                     path: "python/setup.py",
+                     hunks: [
+                       ["-default_version = '#{@snapshot_version}'",
+                        "+default_version = '#{@next_snapshot_version}'"],
+                     ],
+                   },
+                   {
+                     path: "r/DESCRIPTION",
+                     hunks: [
+                       ["-Version: #{@previous_version}.9000",
+                        "+Version: #{@release_version}.9000"],
+                     ],
+                   },
+                   {
+                     path: "r/NEWS.md",
+                     hunks: [
+                       ["-# arrow #{@previous_version}.9000",
+                        "+# arrow #{@release_version}.9000",
+                        "+",
+                        "+# arrow #{@release_version}",],
+                     ],
+                   },
+                   {
+                     path: "ruby/red-arrow-cuda/lib/arrow-cuda/version.rb",
+                     hunks: [
+                       ["-  VERSION = \"#{@snapshot_version}\"",
+                        "+  VERSION = \"#{@next_snapshot_version}\""],
+                     ],
+                   },
+                   {
+                     path: "ruby/red-arrow-dataset/lib/arrow-dataset/version.rb",
+                     hunks: [
+                       ["-  VERSION = \"#{@snapshot_version}\"",
+                        "+  VERSION = \"#{@next_snapshot_version}\""],
+                     ],
+                   },
+                   {
+                     path: "ruby/red-arrow-flight/lib/arrow-flight/version.rb",
+                     hunks: [
+                       ["-  VERSION = \"#{@snapshot_version}\"",
+                        "+  VERSION = \"#{@next_snapshot_version}\""],
+                     ],
+                   },
+                   {
+                     path: "ruby/red-arrow/lib/arrow/version.rb",
+                     hunks: [
+                       ["-  VERSION = \"#{@snapshot_version}\"",
+                        "+  VERSION = \"#{@next_snapshot_version}\""],
+                     ],
+                   },
+                   {
+                     path: "ruby/red-gandiva/lib/gandiva/version.rb",
+                     hunks: [
+                       ["-  VERSION = \"#{@snapshot_version}\"",
+                        "+  VERSION = \"#{@next_snapshot_version}\""],
+                     ],
+                   },
+                   {
+                     path: "ruby/red-parquet/lib/parquet/version.rb",
+                     hunks: [
+                       ["-  VERSION = \"#{@snapshot_version}\"",
+                        "+  VERSION = \"#{@next_snapshot_version}\""],
+                     ],
+                   },
+                   {
+                     path: "ruby/red-plasma/lib/plasma/version.rb",
+                     hunks: [
+                       ["-  VERSION = \"#{@snapshot_version}\"",
+                        "+  VERSION = \"#{@next_snapshot_version}\""],
+                     ],
+                   },
+                 ],
+                 parse_patch(git("log", "-n", "1", "-p")))
+  end
+
+  def test_deb_package_names
+    bump_versions("DEB_PACKAGE_NAMES")
+    changes = parse_patch(git("log", "-n", "1", "-p"))
+    sampled_changes = changes.collect do |change|
+      first_hunk = change[:hunks][0]
+      first_removed_line = first_hunk.find { |line| line.start_with?("-") }
+      first_added_line = first_hunk.find { |line| line.start_with?("+") }
+      {
+        sampled_diff: [first_removed_line, first_added_line],
+        path: change[:path],
+      }
+    end
+    expected_changes = [
+      {
+        sampled_diff: [
+          "-dev/tasks/linux-packages/apache-arrow/debian/libarrow-glib#{@so_version}.install",
+          "+dev/tasks/linux-packages/apache-arrow/debian/libarrow-glib#{@next_so_version}.install",
+        ],
+        path: "dev/release/rat_exclude_files.txt",
+      },
+      {
+        sampled_diff: [
+          "-Package: libarrow#{@so_version}",
+          "+Package: libarrow#{@next_so_version}",
+        ],
+        path: "dev/tasks/linux-packages/apache-arrow/debian/control.in",
+      },
+      {
+        sampled_diff: [
+          "-      - libarrow-dataset-glib#{@so_version}-dbgsym_{no_rc_version}-1_[a-z0-9]+.d?deb",
+          "+      - libarrow-dataset-glib#{@next_so_version}-dbgsym_{no_rc_version}-1_[a-z0-9]+.d?deb",
+        ],
+        path: "dev/tasks/tasks.yml",
+      },
+    ]
+    assert_equal(expected_changes, sampled_changes)
+  end
+end
diff --git a/src/arrow/dev/release/01-prepare.sh b/src/arrow/dev/release/01-prepare.sh
new file mode 100755
index 000000000..b1e917390
--- /dev/null
+++ b/src/arrow/dev/release/01-prepare.sh
@@ -0,0 +1,103 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+set -ue
+
+SOURCE_DIR="$( cd "$( dirname "${BASH_SOURCE[0]}" )" && pwd )"
+
+if [ "$#" -ne 3 ]; then
+  echo "Usage: $0 <version> <next_version> <rc-num>"
+  exit 1
+fi
+
+. $SOURCE_DIR/utils-prepare.sh
+
+version=$1
+next_version=$2
+next_version_snapshot="${next_version}-SNAPSHOT"
+rc_number=$3
+
+release_tag="apache-arrow-${version}"
+release_branch="release-${version}"
+release_candidate_branch="release-${version}-rc${rc_number}"
+
+: ${PREPARE_DEFAULT:=1}
+: ${PREPARE_CHANGELOG:=${PREPARE_DEFAULT}}
+: ${PREPARE_LINUX_PACKAGES:=${PREPARE_DEFAULT}}
+: ${PREPARE_VERSION_PRE_TAG:=${PREPARE_DEFAULT}}
+: ${PREPARE_BRANCH:=${PREPARE_DEFAULT}}
+: ${PREPARE_TAG:=${PREPARE_DEFAULT}}
+
+if [ ${PREPARE_TAG} -gt 0 ]; then
+  if [ $(git tag -l "${release_tag}") ]; then
+    echo "Delete existing git tag $release_tag"
+    git tag -d "${release_tag}"
+  fi
+fi
+
+if [ ${PREPARE_BRANCH} -gt 0 ]; then
+  if [[ $(git branch -l "${release_candidate_branch}") ]]; then
+    next_rc_number=$(($rc_number+1))
+    echo "Branch ${release_candidate_branch} already exists, so create a new release candidate:"
+    echo "1. Checkout the master branch for major releases and maint-<version> for patch releases."
+    echo "2. Execute the script again with bumped RC number."
+    echo "Commands:"
+    echo "   git checkout master"
+    echo "   dev/release/01-prepare.sh ${version} ${next_version} ${next_rc_number}"
+    exit 1
+  fi
+
+  echo "Create local branch ${release_candidate_branch} for release candidate ${rc_number}"
+  git checkout -b ${release_candidate_branch}
+fi
+
+############################## Pre-Tag Commits ##############################
+
+if [ ${PREPARE_CHANGELOG} -gt 0 ]; then
+  echo "Updating changelog for $version"
+  # Update changelog
+  archery release changelog add $version
+  git add ${SOURCE_DIR}/../../CHANGELOG.md
+  git commit -m "[Release] Update CHANGELOG.md for $version"
+fi
+
+if [ ${PREPARE_LINUX_PACKAGES} -gt 0 ]; then
+  echo "Updating .deb/.rpm changelogs for $version"
+  cd $SOURCE_DIR/../tasks/linux-packages
+  rake \
+    version:update \
+    ARROW_RELEASE_TIME="$(date +%Y-%m-%dT%H:%M:%S%z)" \
+    ARROW_VERSION=${version}
+  git add */debian*/changelog */yum/*.spec.in
+  git commit -m "[Release] Update .deb/.rpm changelogs for $version"
+  cd -
+fi
+
+if [ ${PREPARE_VERSION_PRE_TAG} -gt 0 ]; then
+  echo "Prepare release ${version} on tag ${release_tag} then reset to version ${next_version_snapshot}"
+
+  update_versions "${version}" "${next_version}" "release"
+  git commit -m "[Release] Update versions for ${version}"
+fi
+
+############################## Tag the Release ##############################
+
+if [ ${PREPARE_TAG} -gt 0 ]; then
+  git tag -a "${release_tag}" -m "[Release] Apache Arrow Release ${version}"
+fi
diff --git a/src/arrow/dev/release/02-source-test.rb b/src/arrow/dev/release/02-source-test.rb
new file mode 100644
index 000000000..652d4c07f
--- /dev/null
+++ b/src/arrow/dev/release/02-source-test.rb
@@ -0,0 +1,148 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+class SourceTest < Test::Unit::TestCase
+  include GitRunnable
+  include VersionDetectable
+
+  def setup
+    @current_commit = git_current_commit
+    detect_versions
+    @tag_name = "apache-arrow-#{@release_version}"
+    @script = File.expand_path("dev/release/02-source.sh")
+
+    Dir.mktmpdir do |dir|
+      Dir.chdir(dir) do
+        yield
+      end
+    end
+  end
+
+  def source(*targets)
+    env = {
+      "SOURCE_DEFAULT" => "0",
+      "release_hash" => @current_commit,
+    }
+    targets.each do |target|
+      env["SOURCE_#{target}"] = "1"
+    end
+    output = sh(env, @script, @release_version, "0")
+    sh("tar", "xf", "#{@tag_name}.tar.gz")
+    output
+  end
+
+  def test_symbolic_links
+    source
+    Dir.chdir(@tag_name) do
+      assert_equal([],
+                   Find.find(".").find_all {|path| File.symlink?(path)})
+    end
+  end
+
+  def test_csharp_git_commit_information
+    source
+    Dir.chdir("#{@tag_name}/csharp") do
+      FileUtils.mv("dummy.git", "../.git")
+      sh("dotnet", "pack", "-c", "Release")
+      FileUtils.mv("../.git", "dummy.git")
+      Dir.chdir("artifacts/Apache.Arrow/Release") do
+        sh("unzip", "Apache.Arrow.#{@snapshot_version}.nupkg")
+        FileUtils.chmod(0400, "Apache.Arrow.nuspec")
+        nuspec = REXML::Document.new(File.read("Apache.Arrow.nuspec"))
+        nuspec_repository = nuspec.elements["package/metadata/repository"]
+        attributes = {}
+        nuspec_repository.attributes.each do |key, value|
+          attributes[key] = value
+        end
+        assert_equal({
+                       "type" => "git",
+                       "url" => "https://github.com/apache/arrow",
+                       "commit" => @current_commit,
+                     },
+                     attributes)
+      end
+    end
+  end
+
+  def test_python_version
+    source
+    Dir.chdir("#{@tag_name}/python") do
+      sh("python3", "setup.py", "sdist")
+      if on_release_branch?
+        pyarrow_source_archive = "dist/pyarrow-#{@release_version}.tar.gz"
+      else
+        pyarrow_source_archive = "dist/pyarrow-#{@release_version}a0.tar.gz"
+      end
+      assert_equal([pyarrow_source_archive],
+                   Dir.glob("dist/pyarrow-*.tar.gz"))
+    end
+  end
+
+  def test_vote
+    jira_url = "https://issues.apache.org/jira"
+    jql_conditions = [
+      "project = ARROW",
+      "status in (Resolved, Closed)",
+      "fixVersion = #{@release_version}",
+    ]
+    jql = jql_conditions.join(" AND ")
+    n_resolved_issues = nil
+    search_url = URI("#{jira_url}/rest/api/2/search?jql=#{CGI.escape(jql)}")
+    search_url.open do |response|
+      n_resolved_issues = JSON.parse(response.read)["total"]
+    end
+    output = source("VOTE")
+    assert_equal(<<-VOTE.strip, output[/^-+$(.+?)^-+$/m, 1].strip)
+To: dev@arrow.apache.org
+Subject: [VOTE] Release Apache Arrow #{@release_version} - RC0
+
+Hi,
+
+I would like to propose the following release candidate (RC0) of Apache
+Arrow version #{@release_version}. This is a release consisting of #{n_resolved_issues}
+resolved JIRA issues[1].
+
+This release candidate is based on commit:
+#{@current_commit} [2]
+
+The source release rc0 is hosted at [3].
+The binary artifacts are hosted at [4][5][6][7][8][9].
+The changelog is located at [10].
+
+Please download, verify checksums and signatures, run the unit tests,
+and vote on the release. See [11] for how to validate a release candidate.
+
+The vote will be open for at least 72 hours.
+
+[ ] +1 Release this as Apache Arrow #{@release_version}
+[ ] +0
+[ ] -1 Do not release this as Apache Arrow #{@release_version} because...
+
+[1]: https://issues.apache.org/jira/issues/?jql=project%20%3D%20ARROW%20AND%20status%20in%20%28Resolved%2C%20Closed%29%20AND%20fixVersion%20%3D%20#{@release_version}
+[2]: https://github.com/apache/arrow/tree/#{@current_commit}
+[3]: https://dist.apache.org/repos/dist/dev/arrow/apache-arrow-#{@release_version}-rc0
+[4]: https://apache.jfrog.io/artifactory/arrow/amazon-linux-rc/
+[5]: https://apache.jfrog.io/artifactory/arrow/centos-rc/
+[6]: https://apache.jfrog.io/artifactory/arrow/debian-rc/
+[7]: https://apache.jfrog.io/artifactory/arrow/nuget-rc/#{@release_version}-rc0
+[8]: https://apache.jfrog.io/artifactory/arrow/python-rc/#{@release_version}-rc0
+[9]: https://apache.jfrog.io/artifactory/arrow/ubuntu-rc/
+[10]: https://github.com/apache/arrow/blob/#{@current_commit}/CHANGELOG.md
+[11]: https://cwiki.apache.org/confluence/display/ARROW/How+to+Verify+Release+Candidates
+    VOTE
+  end
+end
diff --git a/src/arrow/dev/release/02-source.sh b/src/arrow/dev/release/02-source.sh
new file mode 100755
index 000000000..156eccc1b
--- /dev/null
+++ b/src/arrow/dev/release/02-source.sh
@@ -0,0 +1,164 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+set -e
+
+: ${SOURCE_DEFAULT:=1}
+: ${SOURCE_RAT:=${SOURCE_DEFAULT}}
+: ${SOURCE_UPLOAD:=${SOURCE_DEFAULT}}
+: ${SOURCE_VOTE:=${SOURCE_DEFAULT}}
+
+SOURCE_DIR="$(cd "$(dirname "${BASH_SOURCE[0]}")" && pwd)"
+SOURCE_TOP_DIR="$(cd "${SOURCE_DIR}/../../" && pwd)"
+
+if [ "$#" -ne 2 ]; then
+  echo "Usage: $0 <version> <rc-num>"
+  exit
+fi
+
+version=$1
+rc=$2
+
+tag=apache-arrow-${version}
+tagrc=${tag}-rc${rc}
+rc_url="https://dist.apache.org/repos/dist/dev/arrow/${tagrc}"
+
+echo "Preparing source for tag ${tag}"
+
+: ${release_hash:=$(cd "${SOURCE_TOP_DIR}" && git rev-list --max-count=1 ${tag})}
+
+if [ ${SOURCE_UPLOAD} -gt 0 ]; then
+  if [ -z "$release_hash" ]; then
+    echo "Cannot continue: unknown git tag: $tag"
+    exit
+  fi
+fi
+
+echo "Using commit $release_hash"
+
+tarball=${tag}.tar.gz
+
+rm -rf ${tag}
+# be conservative and use the release hash, even though git produces the same
+# archive (identical hashes) using the scm tag
+(cd "${SOURCE_TOP_DIR}" && \
+  git archive ${release_hash} --prefix ${tag}/) | \
+  tar xf -
+
+# Resolve all hard and symbolic links
+rm -rf ${tag}.tmp
+mv ${tag} ${tag}.tmp
+cp -R -L ${tag}.tmp ${tag}
+rm -rf ${tag}.tmp
+
+# Create a dummy .git/ directory to download the source files from GitHub with Source Link in C#.
+dummy_git=${tag}/csharp/dummy.git
+mkdir ${dummy_git}
+pushd ${dummy_git}
+echo ${release_hash} > HEAD
+echo '[remote "origin"] url = https://github.com/apache/arrow.git' >> config
+mkdir objects refs
+popd
+
+# Create new tarball from modified source directory
+tar czf ${tarball} ${tag}
+rm -rf ${tag}
+
+if [ ${SOURCE_RAT} -gt 0 ]; then
+  "${SOURCE_DIR}/run-rat.sh" ${tarball}
+fi
+
+if [ ${SOURCE_UPLOAD} -gt 0 ]; then
+  # sign the archive
+  gpg --armor --output ${tarball}.asc --detach-sig ${tarball}
+  shasum -a 256 $tarball > ${tarball}.sha256
+  shasum -a 512 $tarball > ${tarball}.sha512
+
+  # check out the arrow RC folder
+  svn co --depth=empty https://dist.apache.org/repos/dist/dev/arrow tmp
+
+  # add the release candidate for the tag
+  mkdir -p tmp/${tagrc}
+
+  # copy the rc tarball into the tmp dir
+  cp ${tarball}* tmp/${tagrc}
+
+  # commit to svn
+  svn add tmp/${tagrc}
+  svn ci -m "Apache Arrow ${version} RC${rc}" tmp/${tagrc}
+
+  # clean up
+  rm -rf tmp
+
+  echo "Success! The release candidate is available here:"
+  echo "  ${rc_url}"
+  echo ""
+  echo "Commit SHA1: ${release_hash}"
+  echo ""
+fi
+
+if [ ${SOURCE_VOTE} -gt 0 ]; then
+  echo "The following draft email has been created to send to the"
+  echo "dev@arrow.apache.org mailing list"
+  echo ""
+  echo "---------------------------------------------------------"
+  jira_url="https://issues.apache.org/jira"
+  jql="project%20%3D%20ARROW%20AND%20status%20in%20%28Resolved%2C%20Closed%29%20AND%20fixVersion%20%3D%20${version}"
+  n_resolved_issues=$(curl "${jira_url}/rest/api/2/search/?jql=${jql}" | jq ".total")
+  cat <<MAIL
+To: dev@arrow.apache.org
+Subject: [VOTE] Release Apache Arrow ${version} - RC${rc}
+
+Hi,
+
+I would like to propose the following release candidate (RC${rc}) of Apache
+Arrow version ${version}. This is a release consisting of ${n_resolved_issues}
+resolved JIRA issues[1].
+
+This release candidate is based on commit:
+${release_hash} [2]
+
+The source release rc${rc} is hosted at [3].
+The binary artifacts are hosted at [4][5][6][7][8][9].
+The changelog is located at [10].
+
+Please download, verify checksums and signatures, run the unit tests,
+and vote on the release. See [11] for how to validate a release candidate.
+
+The vote will be open for at least 72 hours.
+
+[ ] +1 Release this as Apache Arrow ${version}
+[ ] +0
+[ ] -1 Do not release this as Apache Arrow ${version} because...
+
+[1]: ${jira_url}/issues/?jql=${jql}
+[2]: https://github.com/apache/arrow/tree/${release_hash}
+[3]: ${rc_url}
+[4]: https://apache.jfrog.io/artifactory/arrow/amazon-linux-rc/
+[5]: https://apache.jfrog.io/artifactory/arrow/centos-rc/
+[6]: https://apache.jfrog.io/artifactory/arrow/debian-rc/
+[7]: https://apache.jfrog.io/artifactory/arrow/nuget-rc/${version}-rc${rc}
+[8]: https://apache.jfrog.io/artifactory/arrow/python-rc/${version}-rc${rc}
+[9]: https://apache.jfrog.io/artifactory/arrow/ubuntu-rc/
+[10]: https://github.com/apache/arrow/blob/${release_hash}/CHANGELOG.md
+[11]: https://cwiki.apache.org/confluence/display/ARROW/How+to+Verify+Release+Candidates
+MAIL
+  echo "---------------------------------------------------------"
+fi
diff --git a/src/arrow/dev/release/03-binary-submit.sh b/src/arrow/dev/release/03-binary-submit.sh
new file mode 100755
index 000000000..b22a54bfd
--- /dev/null
+++ b/src/arrow/dev/release/03-binary-submit.sh
@@ -0,0 +1,45 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+set -e
+
+if [ "$#" -ne 2 ]; then
+  echo "Usage: $0 <version> <rc-num>"
+  exit
+fi
+
+version=$1
+rc_number=$2
+version_with_rc="${version}-rc${rc_number}"
+crossbow_job_prefix="release-${version_with_rc}"
+release_tag="apache-arrow-${version}"
+
+: ${ARROW_REPOSITORY:="apache/arrow"}
+: ${ARROW_BRANCH:=$release_tag}
+
+# archery will submit a job with id: "${crossbow_job_prefix}-0" unless there
+# are jobs submitted with the same prefix (the integer at the end is auto
+# incremented)
+archery crossbow submit \
+    --no-fetch \
+    --job-prefix ${crossbow_job_prefix} \
+    --arrow-version ${version_with_rc} \
+    --arrow-remote "https://github.com/${ARROW_REPOSITORY}" \
+    --arrow-branch ${ARROW_BRANCH} \
+    --group packaging
diff --git a/src/arrow/dev/release/04-binary-download.sh b/src/arrow/dev/release/04-binary-download.sh
new file mode 100755
index 000000000..b433a3f9c
--- /dev/null
+++ b/src/arrow/dev/release/04-binary-download.sh
@@ -0,0 +1,39 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+set -e
+
+if [ "$#" -ne 2 ]; then
+  echo "Usage: $0 <version> <rc-num>"
+  exit
+fi
+
+version=$1
+rc_number=$2
+version_with_rc="${version}-rc${rc_number}"
+crossbow_job_prefix="release-${version_with_rc}"
+
+# archery will submit a job with id: "${crossbow_job_prefix}-0" unless there
+# are jobs submitted with the same prefix (the integer at the end is auto
+# incremented)
+: ${CROSSBOW_JOB_NUMBER:="0"}
+: ${CROSSBOW_JOB_ID:="${crossbow_job_prefix}-${CROSSBOW_JOB_NUMBER}"}
+
+archery crossbow download-artifacts ${CROSSBOW_JOB_ID} --no-fetch
diff --git a/src/arrow/dev/release/05-binary-upload.sh b/src/arrow/dev/release/05-binary-upload.sh
new file mode 100755
index 000000000..5a30fc8bd
--- /dev/null
+++ b/src/arrow/dev/release/05-binary-upload.sh
@@ -0,0 +1,122 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+set -e
+set -u
+set -o pipefail
+
+SOURCE_DIR="$(cd "$(dirname "${BASH_SOURCE[0]}")" && pwd)"
+
+if [ "$#" -ne 2 ]; then
+  echo "Usage: $0 <version> <rc-num>"
+  exit
+fi
+
+version=$1
+rc=$2
+
+version_with_rc="${version}-rc${rc}"
+crossbow_job_prefix="release-${version_with_rc}"
+crossbow_package_dir="${SOURCE_DIR}/../../packages"
+
+: ${CROSSBOW_JOB_NUMBER:="0"}
+: ${CROSSBOW_JOB_ID:="${crossbow_job_prefix}-${CROSSBOW_JOB_NUMBER}"}
+artifact_dir="${crossbow_package_dir}/${CROSSBOW_JOB_ID}"
+
+if [ ! -e "$artifact_dir" ]; then
+  echo "$artifact_dir does not exist"
+  exit 1
+fi
+
+if [ ! -d "$artifact_dir" ]; then
+  echo "$artifact_dir is not a directory"
+  exit 1
+fi
+
+cd "${SOURCE_DIR}"
+
+if [ ! -f .env ]; then
+  echo "You must create $(pwd)/.env"
+  echo "You can use $(pwd)/.env.example as template"
+  exit 1
+fi
+. .env
+
+. utils-binary.sh
+
+# By default upload all artifacts.
+# To deactivate one category, deactivate the category and all of its dependents.
+# To explicitly select one category, set UPLOAD_DEFAULT=0 UPLOAD_X=1.
+: ${UPLOAD_DEFAULT:=1}
+: ${UPLOAD_ALMALINUX:=${UPLOAD_DEFAULT}}
+: ${UPLOAD_AMAZON_LINUX:=${UPLOAD_DEFAULT}}
+: ${UPLOAD_CENTOS:=${UPLOAD_DEFAULT}}
+: ${UPLOAD_DEBIAN:=${UPLOAD_DEFAULT}}
+: ${UPLOAD_NUGET:=${UPLOAD_DEFAULT}}
+: ${UPLOAD_PYTHON:=${UPLOAD_DEFAULT}}
+: ${UPLOAD_UBUNTU:=${UPLOAD_DEFAULT}}
+
+rake_tasks=()
+apt_targets=()
+yum_targets=()
+if [ ${UPLOAD_ALMALINUX} -gt 0 ]; then
+  rake_tasks+=(yum:rc)
+  yum_targets+=(almalinux)
+fi
+if [ ${UPLOAD_AMAZON_LINUX} -gt 0 ]; then
+  rake_tasks+=(yum:rc)
+  yum_targets+=(amazon-linux)
+fi
+if [ ${UPLOAD_CENTOS} -gt 0 ]; then
+  rake_tasks+=(yum:rc)
+  yum_targets+=(centos)
+fi
+if [ ${UPLOAD_DEBIAN} -gt 0 ]; then
+  rake_tasks+=(apt:rc)
+  apt_targets+=(debian)
+fi
+if [ ${UPLOAD_NUGET} -gt 0 ]; then
+  rake_tasks+=(nuget:rc)
+fi
+if [ ${UPLOAD_PYTHON} -gt 0 ]; then
+  rake_tasks+=(python:rc)
+fi
+if [ ${UPLOAD_UBUNTU} -gt 0 ]; then
+  rake_tasks+=(apt:rc)
+  apt_targets+=(ubuntu)
+fi
+rake_tasks+=(summary:rc)
+
+tmp_dir=binary/tmp
+mkdir -p "${tmp_dir}"
+source_artifacts_dir="${tmp_dir}/artifacts"
+rm -rf "${source_artifacts_dir}"
+cp -a "${artifact_dir}" "${source_artifacts_dir}"
+
+docker_run \
+  ./runner.sh \
+  rake \
+    "${rake_tasks[@]}" \
+    APT_TARGETS=$(IFS=,; echo "${apt_targets[*]}") \
+    ARTIFACTORY_API_KEY="${ARTIFACTORY_API_KEY}" \
+    ARTIFACTS_DIR="${tmp_dir}/artifacts" \
+    RC=${rc} \
+    STAGING=${STAGING:-no} \
+    VERSION=${version} \
+    YUM_TARGETS=$(IFS=,; echo "${yum_targets[*]}")
diff --git a/src/arrow/dev/release/README.md b/src/arrow/dev/release/README.md
new file mode 100644
index 000000000..0a9cc3e04
--- /dev/null
+++ b/src/arrow/dev/release/README.md
@@ -0,0 +1,24 @@
+<!---
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+-->
+
+## Release management scripts
+
+To learn more, see the project wiki:
+
+https://cwiki.apache.org/confluence/display/ARROW/Release+Management+Guide
diff --git a/src/arrow/dev/release/Rakefile b/src/arrow/dev/release/Rakefile
new file mode 100644
index 000000000..ff57bad5e
--- /dev/null
+++ b/src/arrow/dev/release/Rakefile
@@ -0,0 +1,37 @@
+# -*- ruby -*-
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+require_relative "binary-task"
+
+if File.exist?(".env")
+  File.open(".env") do |env|
+    env.each_line do |line|
+      case line.strip
+      when /\A#/
+      when /\A([^=]+)=(.*)\z/
+        key = $1
+        value = $2
+        ENV[key] ||= value
+      end
+    end
+  end
+end
+
+binary_task = BinaryTask.new
+binary_task.define
diff --git a/src/arrow/dev/release/VERIFY.md b/src/arrow/dev/release/VERIFY.md
new file mode 100644
index 000000000..5b441ac13
--- /dev/null
+++ b/src/arrow/dev/release/VERIFY.md
@@ -0,0 +1,76 @@
+<!---
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+-->
+
+# Verifying Arrow releases
+
+## Windows
+
+We've provided a convenience script for verifying the C++ and Python builds on
+Windows. Read the comments in `verify-release-candidate.bat` for instructions.
+
+## Linux and macOS
+
+We've provided a convenience script for verifying the C++, Python, C
+GLib, Java and JavaScript builds on Linux and macOS. Read the comments in
+`verify-release-candidate.sh` for instructions.
+
+### C GLib
+
+You need the followings to verify C GLib build:
+
+  * GLib
+  * GObject Introspection
+  * Ruby (not EOL-ed version is required)
+  * gobject-introspection gem
+  * test-unit gem
+
+You can install them by the followings on Debian GNU/Linux and Ubuntu:
+
+```console
+% sudo apt install -y -V libgirepository1.0-dev ruby-dev
+% sudo gem install gobject-introspection test-unit
+```
+
+You can install them by the followings on CentOS:
+
+```console
+% sudo yum install -y gobject-introspection-devel
+% git clone https://github.com/sstephenson/rbenv.git ~/.rbenv
+% git clone https://github.com/sstephenson/ruby-build.git ~/.rbenv/plugins/ruby-build
+% echo 'export PATH="$HOME/.rbenv/bin:$PATH"' >> ~/.bash_profile
+% echo 'eval "$(rbenv init -)"' >> ~/.bash_profile
+% exec ${SHELL} --login
+% sudo yum install -y gcc make patch openssl-devel readline-devel zlib-devel
+% rbenv install 2.4.2
+% rbenv global 2.4.2
+% gem install gobject-introspection test-unit
+```
+
+You can install them by the followings on macOS:
+
+```console
+% brew install -y gobject-introspection
+% gem install gobject-introspection test-unit
+```
+
+You need to set `PKG_CONFIG_PATH` to find libffi on macOS:
+
+```console
+% export PKG_CONFIG_PATH=$(brew --prefix libffi)/lib/pkgconfig:$PKG_CONFIG_PATH
+```
diff --git a/src/arrow/dev/release/binary-task.rb b/src/arrow/dev/release/binary-task.rb
new file mode 100644
index 000000000..5f88e477e
--- /dev/null
+++ b/src/arrow/dev/release/binary-task.rb
@@ -0,0 +1,1910 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+require "cgi/util"
+require "digest/sha2"
+require "io/console"
+require "json"
+require "net/http"
+require "pathname"
+require "tempfile"
+require "thread"
+require "time"
+
+begin
+  require "apt-dists-merge"
+rescue LoadError
+  warn("apt-dists-merge is needed for apt:* tasks")
+end
+
+class BinaryTask
+  include Rake::DSL
+
+  class ThreadPool
+    def initialize(use_case, &worker)
+      @n_workers = choose_n_workers(use_case)
+      @worker = worker
+      @jobs = Thread::Queue.new
+      @workers = @n_workers.times.collect do
+        Thread.new do
+          loop do
+            job = @jobs.pop
+            break if job.nil?
+            @worker.call(job)
+          end
+        end
+      end
+    end
+
+    def <<(job)
+      @jobs << job
+    end
+
+    def join
+      @n_workers.times do
+        @jobs << nil
+      end
+      @workers.each(&:join)
+    end
+
+    private
+    def choose_n_workers(use_case)
+      case use_case
+      when :artifactory
+        # Too many workers cause Artifactory error.
+        6
+      when :gpg
+        # Too many workers cause gpg-agent error.
+        2
+      else
+        raise "Unknown use case: #{use_case}"
+      end
+    end
+  end
+
+  class ProgressReporter
+    def initialize(label, count_max=0)
+      @label = label
+      @count_max = count_max
+
+      @mutex = Thread::Mutex.new
+
+      @time_start = Time.now
+      @time_previous = Time.now
+      @count_current = 0
+      @count_previous = 0
+    end
+
+    def advance
+      @mutex.synchronize do
+        @count_current += 1
+
+        return if @count_max.zero?
+
+        time_current = Time.now
+        if time_current - @time_previous <= 1
+          return
+        end
+
+        show_progress(time_current)
+      end
+    end
+
+    def increment_max
+      @mutex.synchronize do
+        @count_max += 1
+        show_progress(Time.now) if @count_max == 1
+      end
+    end
+
+    def finish
+      @mutex.synchronize do
+        return if @count_max.zero?
+        show_progress(Time.now)
+        $stderr.puts
+      end
+    end
+
+    private
+    def show_progress(time_current)
+      n_finishes = @count_current - @count_previous
+      throughput = n_finishes.to_f / (time_current - @time_previous)
+      @time_previous = time_current
+      @count_previous = @count_current
+
+      message = build_message(time_current, throughput)
+      $stderr.print("\r#{message}") if message
+    end
+
+    def build_message(time_current, throughput)
+      percent = (@count_current / @count_max.to_f) * 100
+      formatted_count = "[%s/%s]" % [
+        format_count(@count_current),
+        format_count(@count_max),
+      ]
+      elapsed_second = time_current - @time_start
+      if throughput.zero?
+        rest_second = 0
+      else
+        rest_second = (@count_max - @count_current) / throughput
+      end
+      separator = " - "
+      progress = "%5.1f%% %s %s %s %s" % [
+        percent,
+        formatted_count,
+        format_time_interval(elapsed_second),
+        format_time_interval(rest_second),
+        format_throughput(throughput),
+      ]
+      label = @label
+
+      width = guess_terminal_width
+      return "#{label}#{separator}#{progress}" if width.nil?
+
+      return nil if progress.size > width
+
+      label_width = width - progress.size - separator.size
+      if label.size > label_width
+        ellipsis = "..."
+        shorten_label_width = label_width - ellipsis.size
+        if shorten_label_width < 1
+          return progress
+        else
+          label = label[0, shorten_label_width] + ellipsis
+        end
+      end
+      "#{label}#{separator}#{progress}"
+    end
+
+    def format_count(count)
+      "%d" % count
+    end
+
+    def format_time_interval(interval)
+      if interval < 60
+        "00:00:%02d" % interval
+      elsif interval < (60 * 60)
+        minute, second = interval.divmod(60)
+        "00:%02d:%02d" % [minute, second]
+      elsif interval < (60 * 60 * 24)
+        minute, second = interval.divmod(60)
+        hour, minute = minute.divmod(60)
+        "%02d:%02d:%02d" % [hour, minute, second]
+      else
+        minute, second = interval.divmod(60)
+        hour, minute = minute.divmod(60)
+        day, hour = hour.divmod(24)
+        "%dd %02d:%02d:%02d" % [day, hour, minute, second]
+      end
+    end
+
+    def format_throughput(throughput)
+      "%2d/s" % throughput
+    end
+
+    def guess_terminal_width
+      guess_terminal_width_from_io ||
+        guess_terminal_width_from_command ||
+        guess_terminal_width_from_env ||
+        80
+    end
+
+    def guess_terminal_width_from_io
+      if IO.respond_to?(:console) and IO.console
+        IO.console.winsize[1]
+      elsif $stderr.respond_to?(:winsize)
+        begin
+          $stderr.winsize[1]
+        rescue SystemCallError
+          nil
+        end
+      else
+        nil
+      end
+    end
+
+    def guess_terminal_width_from_command
+      IO.pipe do |input, output|
+        begin
+          pid = spawn("tput", "cols", {:out => output, :err => output})
+        rescue SystemCallError
+          return nil
+        end
+
+        output.close
+        _, status = Process.waitpid2(pid)
+        return nil unless status.success?
+
+        result = input.read.chomp
+        begin
+          Integer(result, 10)
+        rescue ArgumentError
+          nil
+        end
+      end
+    end
+
+    def guess_terminal_width_from_env
+      env = ENV["COLUMNS"] || ENV["TERM_WIDTH"]
+      return nil if env.nil?
+
+      begin
+        Integer(env, 10)
+      rescue ArgumentError
+        nil
+      end
+    end
+  end
+
+  class ArtifactoryClient
+    class Error < StandardError
+      attr_reader :request
+      attr_reader :response
+      def initialize(request, response, message)
+        @request = request
+        @response = response
+        super(message)
+      end
+    end
+
+    def initialize(prefix, api_key)
+      @prefix = prefix
+      @api_key = api_key
+      @http = nil
+      restart
+    end
+
+    def restart
+      close
+      @http = start_http(build_url(""))
+    end
+
+    private def start_http(url, &block)
+      http = Net::HTTP.new(url.host, url.port)
+      http.set_debug_output($stderr) if ENV["DEBUG"]
+      http.use_ssl = true
+      if block_given?
+        http.start(&block)
+      else
+        http
+      end
+    end
+
+    def close
+      return if @http.nil?
+      @http.finish if @http.started?
+      @http = nil
+    end
+
+    def request(method, headers, url, body: nil, &block)
+      request = build_request(method, url, headers, body: body)
+      if ENV["DRY_RUN"]
+        case request
+        when Net::HTTP::Get, Net::HTTP::Head
+        else
+          p [method, url]
+          return
+        end
+      end
+      request_internal(@http, request, &block)
+    end
+
+    private def request_internal(http, request, &block)
+      http.request(request) do |response|
+        case response
+        when Net::HTTPSuccess,
+             Net::HTTPNotModified
+          if block_given?
+            return yield(response)
+          else
+            response.read_body
+            return response
+          end
+        when Net::HTTPRedirection
+          redirected_url = URI(response["Location"])
+          redirected_request = Net::HTTP::Get.new(redirected_url, {})
+          start_http(redirected_url) do |redirected_http|
+            request_internal(redirected_http, redirected_request, &block)
+          end
+        else
+          message = "failed to request: "
+          message << "#{request.uri}: #{request.method}: "
+          message << "#{response.message} #{response.code}"
+          if response.body
+            message << "\n"
+            message << response.body
+          end
+          raise Error.new(request, response, message)
+        end
+      end
+    end
+
+    def files
+      _files = []
+      directories = [""]
+      until directories.empty?
+        directory = directories.shift
+        list(directory).each do |path|
+          resolved_path = "#{directory}#{path}"
+          case path
+          when "../"
+          when /\/\z/
+            directories << resolved_path
+          else
+            _files << resolved_path
+          end
+        end
+      end
+      _files
+    end
+
+    def list(path)
+      url = build_url(path)
+      with_retry(3, url) do
+        begin
+          request(:get, {}, url) do |response|
+            response.body.scan(/<a href="(.+?)"/).flatten
+          end
+        rescue Error => error
+          case error.response
+          when Net::HTTPNotFound
+            return []
+          else
+            raise
+          end
+        end
+      end
+    end
+
+    def head(path)
+      url = build_url(path)
+      with_retry(3, url) do
+        request(:head, {}, url)
+      end
+    end
+
+    def exist?(path)
+      begin
+        head(path)
+        true
+      rescue Error => error
+        case error.response
+        when Net::HTTPNotFound
+          false
+        else
+          raise
+        end
+      end
+    end
+
+    def upload(path, destination_path)
+      destination_url = build_url(destination_path)
+      with_retry(3, destination_url) do
+        sha1 = Digest::SHA1.file(path).hexdigest
+        sha256 = Digest::SHA256.file(path).hexdigest
+        headers = {
+          "X-Artifactory-Last-Modified" => File.mtime(path).rfc2822,
+          "X-Checksum-Deploy" => "false",
+          "X-Checksum-Sha1" => sha1,
+          "X-Checksum-Sha256" => sha256,
+          "Content-Length" => File.size(path).to_s,
+          "Content-Type" => "application/octet-stream",
+        }
+        File.open(path, "rb") do |input|
+          request(:put, headers, destination_url, body: input)
+        end
+      end
+    end
+
+    def download(path, output_path)
+      url = build_url(path)
+      with_retry(5, url) do
+        begin
+          begin
+            headers = {}
+            if File.exist?(output_path)
+              headers["If-Modified-Since"] = File.mtime(output_path).rfc2822
+            end
+            request(:get, headers, url) do |response|
+              case response
+              when Net::HTTPNotModified
+              else
+                File.open(output_path, "wb") do |output|
+                  response.read_body do |chunk|
+                    output.write(chunk)
+                  end
+                end
+                last_modified = response["Last-Modified"]
+                if last_modified
+                  FileUtils.touch(output_path,
+                                  mtime: Time.rfc2822(last_modified))
+                end
+              end
+            end
+          rescue Error => error
+            case error.response
+            when Net::HTTPNotFound
+              $stderr.puts(error.message)
+              return
+            else
+              raise
+            end
+          end
+        end
+      rescue
+        FileUtils.rm_f(output_path)
+        raise
+      end
+    end
+
+    def delete(path)
+      url = build_url(path)
+      with_retry(3, url) do
+        request(:delete, {}, url)
+      end
+    end
+
+    def copy(source, destination)
+      uri = build_api_url("copy/arrow/#{source}",
+                          "to" => "/arrow/#{destination}")
+      with_read_timeout(300) do
+        request(:post, {}, uri)
+      end
+    end
+
+    private
+    def build_url(path)
+      uri_string = "https://apache.jfrog.io/artifactory/arrow"
+      uri_string << "/#{@prefix}" unless @prefix.nil?
+      uri_string << "/#{path}"
+      URI(uri_string)
+    end
+
+    def build_api_url(path, parameters)
+      uri_string = "https://apache.jfrog.io/artifactory/api/#{path}"
+      unless parameters.empty?
+        uri_string << "?"
+        escaped_parameters = parameters.collect do |key, value|
+          "#{CGI.escape(key)}=#{CGI.escape(value)}"
+        end
+        uri_string << escaped_parameters.join("&")
+      end
+      URI(uri_string)
+    end
+
+    def build_request(method, url, headers, body: nil)
+      need_auth = false
+      case method
+      when :head
+        request = Net::HTTP::Head.new(url, headers)
+      when :get
+        request = Net::HTTP::Get.new(url, headers)
+      when :post
+        need_auth = true
+        request = Net::HTTP::Post.new(url, headers)
+      when :put
+        need_auth = true
+        request = Net::HTTP::Put.new(url, headers)
+      when :delete
+        need_auth = true
+        request = Net::HTTP::Delete.new(url, headers)
+      else
+        raise "unsupported HTTP method: #{method.inspect}"
+      end
+      request["Connection"] = "Keep-Alive"
+      request["X-JFrog-Art-Api"] = @api_key if need_auth
+      if body
+        if body.is_a?(String)
+          request.body = body
+        else
+          request.body_stream = body
+        end
+      end
+      request
+    end
+
+    def with_retry(max_n_retries, target)
+      n_retries = 0
+      begin
+        yield
+      rescue Net::OpenTimeout,
+             OpenSSL::OpenSSLError,
+             SocketError,
+             SystemCallError,
+             Timeout::Error => error
+        n_retries += 1
+        if n_retries <= max_n_retries
+          $stderr.puts
+          $stderr.puts("Retry #{n_retries}: #{target}: " +
+                       "#{error.class}: #{error.message}")
+          restart
+          retry
+        else
+          raise
+        end
+      end
+    end
+
+    def with_read_timeout(timeout)
+      current_timeout = @http.read_timeout
+      begin
+        @http.read_timeout = timeout
+        yield
+      ensure
+        @http.read_timeout = current_timeout
+      end
+    end
+  end
+
+  class ArtifactoryClientPool
+    class << self
+      def open(prefix, api_key)
+        pool = new(prefix, api_key)
+        begin
+          yield(pool)
+        ensure
+          pool.close
+        end
+      end
+    end
+
+    def initialize(prefix, api_key)
+      @prefix = prefix
+      @api_key = api_key
+      @mutex = Thread::Mutex.new
+      @clients = []
+    end
+
+    def pull
+      client = @mutex.synchronize do
+        if @clients.empty?
+          ArtifactoryClient.new(@prefix, @api_key)
+        else
+          @clients.pop
+        end
+      end
+      begin
+        yield(client)
+      ensure
+        release(client)
+      end
+    end
+
+    def release(client)
+      @mutex.synchronize do
+        @clients << client
+      end
+    end
+
+    def close
+      @clients.each(&:close)
+    end
+  end
+
+  module ArtifactoryPath
+    private
+    def base_path
+      path = @distribution
+      path += "-staging" if @staging
+      path += "-rc" if @rc
+      path
+    end
+  end
+
+  class ArtifactoryDownloader
+    include ArtifactoryPath
+
+    def initialize(api_key:,
+                   destination:,
+                   distribution:,
+                   list: nil,
+                   pattern: nil,
+                   prefix: nil,
+                   rc: nil,
+                   staging: false)
+      @api_key = api_key
+      @destination = destination
+      @distribution = distribution
+      @list = list
+      @pattern = pattern
+      @prefix = prefix
+      @rc = rc
+      @staging = staging
+    end
+
+    def download
+      progress_label = "Downloading: #{base_path}"
+      progress_reporter = ProgressReporter.new(progress_label)
+      prefix = [base_path, @prefix].compact.join("/")
+      ArtifactoryClientPool.open(prefix, @api_key) do |client_pool|
+        thread_pool = ThreadPool.new(:artifactory) do |path, output_path|
+          client_pool.pull do |client|
+            client.download(path, output_path)
+          end
+          progress_reporter.advance
+        end
+        files = client_pool.pull do |client|
+          if @list
+            list_output_path = "#{@destination}/#{@list}"
+            client.download(@list, list_output_path)
+            File.readlines(list_output_path, chomp: true)
+          else
+            client.files
+          end
+        end
+        files.each do |path|
+          output_path = "#{@destination}/#{path}"
+          if @pattern
+            next unless @pattern.match?(path)
+          end
+          yield(output_path)
+          output_dir = File.dirname(output_path)
+          FileUtils.mkdir_p(output_dir)
+          progress_reporter.increment_max
+          thread_pool << [path, output_path]
+        end
+        thread_pool.join
+      end
+      progress_reporter.finish
+    end
+  end
+
+  class ArtifactoryUploader
+    include ArtifactoryPath
+
+    def initialize(api_key:,
+                   destination_prefix: nil,
+                   distribution:,
+                   rc: nil,
+                   source:,
+                   staging: false,
+                   sync: false,
+                   sync_pattern: nil)
+      @api_key = api_key
+      @destination_prefix = destination_prefix
+      @distribution = distribution
+      @rc = rc
+      @source = source
+      @staging = staging
+      @sync = sync
+      @sync_pattern = sync_pattern
+    end
+
+    def upload
+      progress_label = "Uploading: #{base_path}"
+      progress_reporter = ProgressReporter.new(progress_label)
+      prefix = base_path
+      prefix += "/#{@destination_prefix}" if @destination_prefix
+      ArtifactoryClientPool.open(prefix, @api_key) do |client_pool|
+        if @sync
+          existing_files = client_pool.pull do |client|
+            client.files
+          end
+        else
+          existing_files = []
+        end
+
+        thread_pool = ThreadPool.new(:artifactory) do |path, relative_path|
+          client_pool.pull do |client|
+            client.upload(path, relative_path)
+          end
+          progress_reporter.advance
+        end
+
+        source = Pathname(@source)
+        source.glob("**/*") do |path|
+          next if path.directory?
+          destination_path = path.relative_path_from(source)
+          progress_reporter.increment_max
+          existing_files.delete(destination_path.to_s)
+          thread_pool << [path, destination_path]
+        end
+        thread_pool.join
+
+        if @sync
+          thread_pool = ThreadPool.new(:artifactory) do |path|
+            client_pool.pull do |client|
+              client.delete(path)
+            end
+            progress_reporter.advance
+          end
+          existing_files.each do |path|
+            if @sync_pattern
+              next unless @sync_pattern.match?(path)
+            end
+            progress_reporter.increment_max
+            thread_pool << path
+          end
+          thread_pool.join
+        end
+      end
+      progress_reporter.finish
+    end
+  end
+
+  def define
+    define_apt_tasks
+    define_yum_tasks
+    define_python_tasks
+    define_nuget_tasks
+    define_summary_tasks
+  end
+
+  private
+  def env_value(name)
+    value = ENV[name]
+    value = yield(name) if value.nil? and block_given?
+    raise "Specify #{name} environment variable" if value.nil?
+    value
+  end
+
+  def verbose?
+    ENV["VERBOSE"] == "yes"
+  end
+
+  def default_output
+    if verbose?
+      $stdout
+    else
+      IO::NULL
+    end
+  end
+
+  def gpg_key_id
+    env_value("GPG_KEY_ID")
+  end
+
+  def shorten_gpg_key_id(id)
+    id[-8..-1]
+  end
+
+  def rpm_gpg_key_package_name(id)
+    "gpg-pubkey-#{shorten_gpg_key_id(id).downcase}"
+  end
+
+  def artifactory_api_key
+    env_value("ARTIFACTORY_API_KEY")
+  end
+
+  def artifacts_dir
+    env_value("ARTIFACTS_DIR")
+  end
+
+  def version
+    env_value("VERSION")
+  end
+
+  def rc
+    env_value("RC")
+  end
+
+  def staging?
+    ENV["STAGING"] == "yes"
+  end
+
+  def full_version
+    "#{version}-rc#{rc}"
+  end
+
+  def valid_sign?(path, sign_path)
+    IO.pipe do |input, output|
+      begin
+        sh({"LANG" => "C"},
+           "gpg",
+           "--verify",
+           sign_path,
+           path,
+           out: default_output,
+           err: output,
+           verbose: false)
+      rescue
+        return false
+      end
+      output.close
+      /Good signature/ === input.read
+    end
+  end
+
+  def sign(source_path, destination_path)
+    if File.exist?(destination_path)
+      return if valid_sign?(source_path, destination_path)
+      rm(destination_path, verbose: false)
+    end
+    sh("gpg",
+       "--detach-sig",
+       "--local-user", gpg_key_id,
+       "--output", destination_path,
+       source_path,
+       out: default_output,
+       verbose: verbose?)
+  end
+
+  def sha512(source_path, destination_path)
+    if File.exist?(destination_path)
+      sha512 = File.read(destination_path).split[0]
+      return if Digest::SHA512.file(source_path).hexdigest == sha512
+    end
+    absolute_destination_path = File.expand_path(destination_path)
+    Dir.chdir(File.dirname(source_path)) do
+      sh("shasum",
+         "--algorithm", "512",
+         File.basename(source_path),
+         out: absolute_destination_path,
+         verbose: verbose?)
+    end
+  end
+
+  def sign_dir(label, dir)
+    progress_label = "Signing: #{label}"
+    progress_reporter = ProgressReporter.new(progress_label)
+
+    target_paths = []
+    Pathname(dir).glob("**/*") do |path|
+      next if path.directory?
+      case path.extname
+      when ".asc", ".sha512"
+        next
+      end
+      progress_reporter.increment_max
+      target_paths << path.to_s
+    end
+    target_paths.each do |path|
+      sign(path, "#{path}.asc")
+      sha512(path, "#{path}.sha512")
+      progress_reporter.advance
+    end
+    progress_reporter.finish
+  end
+
+  def download_distribution(distribution,
+                            destination,
+                            target,
+                            list: nil,
+                            pattern: nil,
+                            prefix: nil)
+    mkdir_p(destination, verbose: verbose?) unless File.exist?(destination)
+    existing_paths = {}
+    Pathname(destination).glob("**/*") do |path|
+      next if path.directory?
+      existing_paths[path.to_s] = true
+    end
+    options = {
+      api_key: artifactory_api_key,
+      destination: destination,
+      distribution: distribution,
+      list: list,
+      pattern: pattern,
+      prefix: prefix,
+      staging: staging?,
+    }
+    options[:rc] = rc if target == :rc
+    downloader = ArtifactoryDownloader.new(**options)
+    downloader.download do |output_path|
+      existing_paths.delete(output_path)
+    end
+    existing_paths.each_key do |path|
+      rm_f(path, verbose: verbose?)
+    end
+  end
+
+  def same_content?(path1, path2)
+    File.exist?(path1) and
+      File.exist?(path2) and
+      Digest::SHA256.file(path1) == Digest::SHA256.file(path2)
+  end
+
+  def copy_artifact(source_path,
+                    destination_path,
+                    progress_reporter)
+    return if same_content?(source_path, destination_path)
+    progress_reporter.increment_max
+    destination_dir = File.dirname(destination_path)
+    unless File.exist?(destination_dir)
+      mkdir_p(destination_dir, verbose: verbose?)
+    end
+    cp(source_path, destination_path, verbose: verbose?)
+    progress_reporter.advance
+  end
+
+  def prepare_staging(base_path)
+    client = ArtifactoryClient.new(nil, artifactory_api_key)
+    ["", "-rc"].each do |suffix|
+      path = "#{base_path}#{suffix}"
+      progress_reporter = ProgressReporter.new("Preparing staging for #{path}")
+      progress_reporter.increment_max
+      begin
+        staging_path = "#{base_path}-staging#{suffix}"
+        if client.exist?(staging_path)
+          client.delete(staging_path)
+        end
+        if client.exist?(path)
+          client.copy(path, staging_path)
+        end
+      ensure
+        progress_reporter.advance
+        progress_reporter.finish
+      end
+    end
+  end
+
+  def delete_staging(base_path)
+    client = ArtifactoryClient.new(nil, artifactory_api_key)
+    ["", "-rc"].each do |suffix|
+      path = "#{base_path}#{suffix}"
+      progress_reporter = ProgressReporter.new("Deleting staging for #{path}")
+      progress_reporter.increment_max
+      begin
+        staging_path = "#{base_path}-staging#{suffix}"
+        if client.exist?(staging_path)
+          client.delete(staging_path)
+        end
+      ensure
+        progress_reporter.advance
+        progress_reporter.finish
+      end
+    end
+  end
+
+  def uploaded_files_name
+    "uploaded-files.txt"
+  end
+
+  def write_uploaded_files(dir)
+    dir = Pathname(dir)
+    uploaded_files = []
+    dir.glob("**/*") do |path|
+      next if path.directory?
+      uploaded_files << path.relative_path_from(dir).to_s
+    end
+    File.open("#{dir}/#{uploaded_files_name}", "w") do |output|
+      output.puts(uploaded_files.sort)
+    end
+  end
+
+  def tmp_dir
+    "binary/tmp"
+  end
+
+  def rc_dir
+    "#{tmp_dir}/rc"
+  end
+
+  def release_dir
+    "#{tmp_dir}/release"
+  end
+
+  def apt_repository_label
+    "Apache Arrow"
+  end
+
+  def apt_repository_description
+    "Apache Arrow packages"
+  end
+
+  def apt_rc_repositories_dir
+    "#{rc_dir}/apt/repositories"
+  end
+
+  def apt_release_repositories_dir
+    "#{release_dir}/apt/repositories"
+  end
+
+  def available_apt_targets
+    [
+      ["debian", "buster", "main"],
+      ["debian", "bullseye", "main"],
+      ["debian", "bookworm", "main"],
+      ["ubuntu", "bionic", "main"],
+      ["ubuntu", "focal", "main"],
+      ["ubuntu", "hirsute", "main"],
+      ["ubuntu", "impish", "main"],
+    ]
+  end
+
+  def apt_targets
+    env_apt_targets = (ENV["APT_TARGETS"] || "").split(",")
+    if env_apt_targets.empty?
+      available_apt_targets
+    else
+      available_apt_targets.select do |distribution, code_name, component|
+        env_apt_targets.any? do |env_apt_target|
+          if env_apt_target.include?("-")
+            env_apt_target.start_with?("#{distribution}-#{code_name}")
+          else
+            env_apt_target == distribution
+          end
+        end
+      end
+    end
+  end
+
+  def apt_distributions
+    apt_targets.collect(&:first).uniq
+  end
+
+  def apt_architectures
+    [
+      "amd64",
+      "arm64",
+    ]
+  end
+
+  def generate_apt_release(dists_dir, code_name, component, architecture)
+    dir = "#{dists_dir}/#{component}/"
+    if architecture == "source"
+      dir << architecture
+    else
+      dir << "binary-#{architecture}"
+    end
+
+    mkdir_p(dir, verbose: verbose?)
+    File.open("#{dir}/Release", "w") do |release|
+      release.puts(<<-RELEASE)
+Archive: #{code_name}
+Component: #{component}
+Origin: #{apt_repository_label}
+Label: #{apt_repository_label}
+Architecture: #{architecture}
+      RELEASE
+    end
+  end
+
+  def generate_apt_ftp_archive_generate_conf(code_name, component)
+    conf = <<-CONF
+Dir::ArchiveDir ".";
+Dir::CacheDir ".";
+TreeDefault::Directory "pool/#{code_name}/#{component}";
+TreeDefault::SrcDirectory "pool/#{code_name}/#{component}";
+Default::Packages::Extensions ".deb";
+Default::Packages::Compress ". gzip xz";
+Default::Sources::Compress ". gzip xz";
+Default::Contents::Compress "gzip";
+    CONF
+
+    apt_architectures.each do |architecture|
+      conf << <<-CONF
+
+BinDirectory "dists/#{code_name}/#{component}/binary-#{architecture}" {
+  Packages "dists/#{code_name}/#{component}/binary-#{architecture}/Packages";
+  Contents "dists/#{code_name}/#{component}/Contents-#{architecture}";
+  SrcPackages "dists/#{code_name}/#{component}/source/Sources";
+};
+      CONF
+    end
+
+    conf << <<-CONF
+
+Tree "dists/#{code_name}" {
+  Sections "#{component}";
+  Architectures "#{apt_architectures.join(" ")} source";
+};
+    CONF
+
+    conf
+  end
+
+  def generate_apt_ftp_archive_release_conf(code_name, component)
+    <<-CONF
+APT::FTPArchive::Release::Origin "#{apt_repository_label}";
+APT::FTPArchive::Release::Label "#{apt_repository_label}";
+APT::FTPArchive::Release::Architectures "#{apt_architectures.join(" ")}";
+APT::FTPArchive::Release::Codename "#{code_name}";
+APT::FTPArchive::Release::Suite "#{code_name}";
+APT::FTPArchive::Release::Components "#{component}";
+APT::FTPArchive::Release::Description "#{apt_repository_description}";
+    CONF
+  end
+
+  def apt_update(base_dir, incoming_dir, merged_dir)
+    apt_targets.each do |distribution, code_name, component|
+      distribution_dir = "#{incoming_dir}/#{distribution}"
+      pool_dir = "#{distribution_dir}/pool/#{code_name}"
+      next unless File.exist?(pool_dir)
+      dists_dir = "#{distribution_dir}/dists/#{code_name}"
+      rm_rf(dists_dir, verbose: verbose?)
+      generate_apt_release(dists_dir, code_name, component, "source")
+      apt_architectures.each do |architecture|
+        generate_apt_release(dists_dir, code_name, component, architecture)
+      end
+
+      generate_conf_file = Tempfile.new("apt-ftparchive-generate.conf")
+      File.open(generate_conf_file.path, "w") do |conf|
+        conf.puts(generate_apt_ftp_archive_generate_conf(code_name,
+                                                         component))
+      end
+      cd(distribution_dir, verbose: verbose?) do
+        sh("apt-ftparchive",
+           "generate",
+           generate_conf_file.path,
+           out: default_output,
+           verbose: verbose?)
+      end
+
+      Dir.glob("#{dists_dir}/Release*") do |release|
+        rm_f(release, verbose: verbose?)
+      end
+      Dir.glob("#{distribution_dir}/*.db") do |db|
+        rm_f(db, verbose: verbose?)
+      end
+      release_conf_file = Tempfile.new("apt-ftparchive-release.conf")
+      File.open(release_conf_file.path, "w") do |conf|
+        conf.puts(generate_apt_ftp_archive_release_conf(code_name,
+                                                        component))
+      end
+      release_file = Tempfile.new("apt-ftparchive-release")
+      sh("apt-ftparchive",
+         "-c", release_conf_file.path,
+         "release",
+         dists_dir,
+         out: release_file.path,
+         verbose: verbose?)
+      mv(release_file.path, "#{dists_dir}/Release", verbose: verbose?)
+
+      base_dists_dir = "#{base_dir}/#{distribution}/dists/#{code_name}"
+      merged_dists_dir = "#{merged_dir}/#{distribution}/dists/#{code_name}"
+      rm_rf(merged_dists_dir)
+      merger = APTDistsMerge::Merger.new(base_dists_dir,
+                                         dists_dir,
+                                         merged_dists_dir)
+      merger.merge
+
+      in_release_path = "#{merged_dists_dir}/InRelease"
+      release_path = "#{merged_dists_dir}/Release"
+      signed_release_path = "#{release_path}.gpg"
+      sh("gpg",
+         "--sign",
+         "--detach-sign",
+         "--armor",
+         "--local-user", gpg_key_id,
+         "--output", signed_release_path,
+         release_path,
+         out: default_output,
+         verbose: verbose?)
+      sh("gpg",
+         "--clear-sign",
+         "--local-user", gpg_key_id,
+         "--output", in_release_path,
+         release_path,
+         out: default_output,
+         verbose: verbose?)
+    end
+  end
+
+  def define_apt_staging_tasks
+    namespace :apt do
+      namespace :staging do
+        desc "Prepare staging environment for APT repositories"
+        task :prepare do
+          apt_distributions.each do |distribution|
+            prepare_staging(distribution)
+          end
+        end
+
+        desc "Delete staging environment for APT repositories"
+        task :delete do
+          apt_distributions.each do |distribution|
+            delete_staging(distribution)
+          end
+        end
+      end
+    end
+  end
+
+  def define_apt_rc_tasks
+    namespace :apt do
+      namespace :rc do
+        base_dir = "#{apt_rc_repositories_dir}/base"
+        incoming_dir = "#{apt_rc_repositories_dir}/incoming"
+        merged_dir = "#{apt_rc_repositories_dir}/merged"
+        upload_dir = "#{apt_rc_repositories_dir}/upload"
+
+        desc "Copy .deb packages"
+        task :copy do
+          apt_targets.each do |distribution, code_name, component|
+            progress_label = "Copying: #{distribution} #{code_name}"
+            progress_reporter = ProgressReporter.new(progress_label)
+
+            distribution_dir = "#{incoming_dir}/#{distribution}"
+            pool_dir = "#{distribution_dir}/pool/#{code_name}"
+            rm_rf(pool_dir, verbose: verbose?)
+            mkdir_p(pool_dir, verbose: verbose?)
+            source_dir_prefix = "#{artifacts_dir}/#{distribution}-#{code_name}"
+            Dir.glob("#{source_dir_prefix}*/**/*") do |path|
+              next if File.directory?(path)
+              base_name = File.basename(path)
+              if base_name.start_with?("apache-arrow-apt-source")
+                package_name = "apache-arrow-apt-source"
+              else
+                package_name = "apache-arrow"
+              end
+              destination_path = [
+                pool_dir,
+                component,
+                package_name[0],
+                package_name,
+                base_name,
+              ].join("/")
+              copy_artifact(path,
+                            destination_path,
+                            progress_reporter)
+              case base_name
+              when /\A[^_]+-apt-source_.*\.deb\z/
+                latest_apt_source_package_path = [
+                  distribution_dir,
+                  "#{package_name}-latest-#{code_name}.deb"
+                ].join("/")
+                copy_artifact(path,
+                              latest_apt_source_package_path,
+                              progress_reporter)
+              end
+            end
+            progress_reporter.finish
+          end
+        end
+
+        desc "Download dists/ for RC APT repositories"
+        task :download do
+          apt_distributions.each do |distribution|
+            not_checksum_pattern = /.+(?<!\.asc|\.sha512)\z/
+            base_distribution_dir = "#{base_dir}/#{distribution}"
+            pattern = /\Adists\/#{not_checksum_pattern}/
+            download_distribution(distribution,
+                                  base_distribution_dir,
+                                  :base,
+                                  pattern: pattern)
+          end
+        end
+
+        desc "Sign .deb packages"
+        task :sign do
+          apt_distributions.each do |distribution|
+            distribution_dir = "#{incoming_dir}/#{distribution}"
+            Dir.glob("#{distribution_dir}/**/*.dsc") do |path|
+              begin
+                sh({"LANG" => "C"},
+                   "gpg",
+                   "--verify",
+                   path,
+                   out: IO::NULL,
+                   err: IO::NULL,
+                   verbose: false)
+              rescue
+                sh("debsign",
+                   "--no-re-sign",
+                   "-k#{gpg_key_id}",
+                   path,
+                   out: default_output,
+                   verbose: verbose?)
+              end
+            end
+            sign_dir(distribution, distribution_dir)
+          end
+        end
+
+        desc "Update RC APT repositories"
+        task :update do
+          apt_update(base_dir, incoming_dir, merged_dir)
+          apt_targets.each do |distribution, code_name, component|
+            dists_dir = "#{merged_dir}/#{distribution}/dists/#{code_name}"
+            next unless File.exist?(dists_dir)
+            sign_dir("#{distribution} #{code_name}",
+                     dists_dir)
+          end
+        end
+
+        desc "Upload .deb packages and RC APT repositories"
+        task :upload do
+          apt_distributions.each do |distribution|
+            upload_distribution_dir = "#{upload_dir}/#{distribution}"
+            incoming_distribution_dir = "#{incoming_dir}/#{distribution}"
+            merged_dists_dir = "#{merged_dir}/#{distribution}/dists"
+
+            rm_rf(upload_distribution_dir, verbose: verbose?)
+            mkdir_p(upload_distribution_dir, verbose: verbose?)
+            Dir.glob("#{incoming_distribution_dir}/*") do |path|
+              next if File.basename(path) == "dists"
+              cp_r(path,
+                   upload_distribution_dir,
+                   preserve: true,
+                   verbose: verbose?)
+            end
+            cp_r(merged_dists_dir,
+                 upload_distribution_dir,
+                 preserve: true,
+                 verbose: verbose?)
+            write_uploaded_files(upload_distribution_dir)
+            uploader = ArtifactoryUploader.new(api_key: artifactory_api_key,
+                                               distribution: distribution,
+                                               rc: rc,
+                                               source: upload_distribution_dir,
+                                               staging: staging?)
+            uploader.upload
+          end
+        end
+      end
+
+      desc "Release RC APT repositories"
+      apt_rc_tasks = [
+        "apt:rc:copy",
+        "apt:rc:download",
+        "apt:rc:sign",
+        "apt:rc:update",
+        "apt:rc:upload",
+      ]
+      apt_rc_tasks.unshift("apt:staging:prepare") if staging?
+      task :rc => apt_rc_tasks
+    end
+  end
+
+  def define_apt_release_tasks
+    directory apt_release_repositories_dir
+
+    namespace :apt do
+      namespace :release do
+        desc "Download RC APT repositories"
+        task :download => apt_release_repositories_dir do
+          apt_distributions.each do |distribution|
+            distribution_dir = "#{apt_release_repositories_dir}/#{distribution}"
+            download_distribution(distribution,
+                                  distribution_dir,
+                                  :rc,
+                                  list: uploaded_files_name)
+          end
+        end
+
+        desc "Upload release APT repositories"
+        task :upload => apt_release_repositories_dir do
+          apt_distributions.each do |distribution|
+            distribution_dir = "#{apt_release_repositories_dir}/#{distribution}"
+            uploader = ArtifactoryUploader.new(api_key: artifactory_api_key,
+                                               distribution: distribution,
+                                               source: distribution_dir,
+                                               staging: staging?)
+            uploader.upload
+          end
+        end
+      end
+
+      desc "Release APT repositories"
+      apt_release_tasks = [
+        "apt:release:download",
+        "apt:release:upload",
+      ]
+      task :release => apt_release_tasks
+    end
+  end
+
+  def define_apt_tasks
+    define_apt_staging_tasks
+    define_apt_rc_tasks
+    define_apt_release_tasks
+  end
+
+  def yum_rc_repositories_dir
+    "#{rc_dir}/yum/repositories"
+  end
+
+  def yum_release_repositories_dir
+    "#{release_dir}/yum/repositories"
+  end
+
+  def available_yum_targets
+    [
+      ["almalinux", "8"],
+      ["amazon-linux", "2"],
+      ["centos", "7"],
+      ["centos", "8"],
+    ]
+  end
+
+  def yum_targets
+    env_yum_targets = (ENV["YUM_TARGETS"] || "").split(",")
+    if env_yum_targets.empty?
+      available_yum_targets
+    else
+      available_yum_targets.select do |distribution, distribution_version|
+        env_yum_targets.any? do |env_yum_target|
+          if /\d/.match?(env_yum_target)
+            env_yum_target.start_with?("#{distribution}-#{distribution_version}")
+          else
+            env_yum_target == distribution
+          end
+        end
+      end
+    end
+  end
+
+  def yum_distributions
+    yum_targets.collect(&:first).uniq
+  end
+
+  def yum_architectures
+    [
+      "aarch64",
+      "x86_64",
+    ]
+  end
+
+  def signed_rpm?(rpm)
+    IO.pipe do |input, output|
+      system("rpm", "--checksig", rpm, out: output)
+      output.close
+      signature = input.gets.sub(/\A#{Regexp.escape(rpm)}: /, "")
+      signature.split.include?("signatures")
+    end
+  end
+
+  def sign_rpms(directory)
+    thread_pool = ThreadPool.new(:gpg) do |rpm|
+      unless signed_rpm?(rpm)
+        sh("rpm",
+           "-D", "_gpg_name #{gpg_key_id}",
+           "-D", "__gpg /usr/bin/gpg",
+           "-D", "__gpg_check_password_cmd /bin/true true",
+           "--resign",
+           rpm,
+           out: default_output,
+           verbose: verbose?)
+      end
+    end
+    Dir.glob("#{directory}/**/*.rpm") do |rpm|
+      thread_pool << rpm
+    end
+    thread_pool.join
+  end
+
+  def rpm_sign(directory)
+    unless system("rpm", "-q",
+                  rpm_gpg_key_package_name(gpg_key_id),
+                  out: IO::NULL)
+      gpg_key = Tempfile.new(["apache-arrow-binary", ".asc"])
+      sh("gpg",
+         "--armor",
+         "--export", gpg_key_id,
+         out: gpg_key.path,
+         verbose: verbose?)
+      sh("rpm",
+         "--import", gpg_key.path,
+         out: default_output,
+         verbose: verbose?)
+      gpg_key.close!
+    end
+
+    yum_targets.each do |distribution, distribution_version|
+      source_dir = [
+        directory,
+        distribution,
+        distribution_version,
+      ].join("/")
+      sign_rpms(source_dir)
+    end
+  end
+
+  def yum_update(base_dir, incoming_dir)
+    yum_targets.each do |distribution, distribution_version|
+      target_dir = "#{incoming_dir}/#{distribution}/#{distribution_version}"
+      target_dir = Pathname(target_dir)
+      next unless target_dir.directory?
+      Dir.glob("#{target_dir}/**/repodata") do |repodata|
+        rm_rf(repodata, verbose: verbose?)
+      end
+      target_dir.glob("*") do |arch_dir|
+        next unless arch_dir.directory?
+        base_repodata_dir = [
+          base_dir,
+          distribution,
+          distribution_version,
+          File.basename(arch_dir),
+          "repodata",
+        ].join("/")
+        if File.exist?(base_repodata_dir)
+          cp_r(base_repodata_dir,
+               arch_dir.to_s,
+               preserve: true,
+               verbose: verbose?)
+        end
+        packages = Tempfile.new("createrepo-c-packages")
+        Pathname.glob("#{arch_dir}/*/*.rpm") do |rpm|
+          relative_rpm = rpm.relative_path_from(arch_dir)
+          packages.puts(relative_rpm.to_s)
+        end
+        packages.close
+        sh("createrepo_c",
+           "--pkglist", packages.path,
+           "--recycle-pkglist",
+           "--retain-old-md-by-age=0",
+           "--skip-stat",
+           "--update",
+           arch_dir.to_s,
+           out: default_output,
+           verbose: verbose?)
+      end
+    end
+  end
+
+  def define_yum_staging_tasks
+    namespace :yum do
+      namespace :staging do
+        desc "Prepare staging environment for Yum repositories"
+        task :prepare do
+          yum_distributions.each do |distribution|
+            prepare_staging(distribution)
+          end
+        end
+
+        desc "Delete staging environment for Yum repositories"
+        task :delete do
+          yum_distributions.each do |distribution|
+            delete_staging(distribution)
+          end
+        end
+      end
+    end
+  end
+
+  def define_yum_rc_tasks
+    namespace :yum do
+      namespace :rc do
+        base_dir = "#{yum_rc_repositories_dir}/base"
+        incoming_dir = "#{yum_rc_repositories_dir}/incoming"
+        upload_dir = "#{yum_rc_repositories_dir}/upload"
+
+        desc "Copy RPM packages"
+        task :copy do
+          yum_targets.each do |distribution, distribution_version|
+            progress_label = "Copying: #{distribution} #{distribution_version}"
+            progress_reporter = ProgressReporter.new(progress_label)
+
+            destination_prefix = [
+              incoming_dir,
+              distribution,
+              distribution_version,
+            ].join("/")
+            rm_rf(destination_prefix, verbose: verbose?)
+            source_dir_prefix =
+              "#{artifacts_dir}/#{distribution}-#{distribution_version}"
+            Dir.glob("#{source_dir_prefix}*/**/*") do |path|
+              next if File.directory?(path)
+              base_name = File.basename(path)
+              type = base_name.split(".")[-2]
+              destination_paths = []
+              case type
+              when "src"
+                destination_paths << [
+                  destination_prefix,
+                  "Source",
+                  "SPackages",
+                  base_name,
+                ].join("/")
+              when "noarch"
+                yum_architectures.each do |architecture|
+                  destination_paths << [
+                    destination_prefix,
+                    architecture,
+                    "Packages",
+                    base_name,
+                  ].join("/")
+                end
+              else
+                destination_paths << [
+                  destination_prefix,
+                  type,
+                  "Packages",
+                  base_name,
+                ].join("/")
+              end
+              destination_paths.each do |destination_path|
+                copy_artifact(path,
+                              destination_path,
+                              progress_reporter)
+              end
+              case base_name
+              when /\A(apache-arrow-release)-.*\.noarch\.rpm\z/
+                package_name = $1
+                latest_release_package_path = [
+                  destination_prefix,
+                  "#{package_name}-latest.rpm"
+                ].join("/")
+                copy_artifact(path,
+                              latest_release_package_path,
+                              progress_reporter)
+              end
+            end
+
+            progress_reporter.finish
+          end
+        end
+
+        desc "Download repodata for RC Yum repositories"
+        task :download do
+          yum_distributions.each do |distribution|
+            distribution_dir = "#{base_dir}/#{distribution}"
+            download_distribution(distribution,
+                                  distribution_dir,
+                                  :base,
+                                  pattern: /\/repodata\//)
+          end
+        end
+
+        desc "Sign RPM packages"
+        task :sign do
+          rpm_sign(incoming_dir)
+          yum_targets.each do |distribution, distribution_version|
+            source_dir = [
+              incoming_dir,
+              distribution,
+              distribution_version,
+            ].join("/")
+            sign_dir("#{distribution}-#{distribution_version}",
+                     source_dir)
+          end
+        end
+
+        desc "Update RC Yum repositories"
+        task :update do
+          yum_update(base_dir, incoming_dir)
+          yum_targets.each do |distribution, distribution_version|
+            target_dir = [
+              incoming_dir,
+              distribution,
+              distribution_version,
+            ].join("/")
+            target_dir = Pathname(target_dir)
+            next unless target_dir.directory?
+            target_dir.glob("*") do |arch_dir|
+              next unless arch_dir.directory?
+              sign_label =
+                "#{distribution}-#{distribution_version} #{arch_dir.basename}"
+              sign_dir(sign_label,
+                       arch_dir.to_s)
+            end
+          end
+        end
+
+        desc "Upload RC Yum repositories"
+        task :upload => yum_rc_repositories_dir do
+          yum_distributions.each do |distribution|
+            incoming_target_dir = "#{incoming_dir}/#{distribution}"
+            upload_target_dir = "#{upload_dir}/#{distribution}"
+
+            rm_rf(upload_target_dir, verbose: verbose?)
+            mkdir_p(upload_target_dir, verbose: verbose?)
+            cp_r(Dir.glob("#{incoming_target_dir}/*"),
+                 upload_target_dir.to_s,
+                 preserve: true,
+                 verbose: verbose?)
+            write_uploaded_files(upload_target_dir)
+
+            uploader = ArtifactoryUploader.new(api_key: artifactory_api_key,
+                                               distribution: distribution,
+                                               rc: rc,
+                                               source: upload_target_dir,
+                                               staging: staging?,
+                                               sync: true,
+                                               sync_pattern: /\/repodata\//)
+            uploader.upload
+          end
+        end
+      end
+
+      desc "Release RC Yum packages"
+      yum_rc_tasks = [
+        "yum:rc:copy",
+        "yum:rc:download",
+        "yum:rc:sign",
+        "yum:rc:update",
+        "yum:rc:upload",
+      ]
+      yum_rc_tasks.unshift("yum:staging:prepare") if staging?
+      task :rc => yum_rc_tasks
+    end
+  end
+
+  def define_yum_release_tasks
+    directory yum_release_repositories_dir
+
+    namespace :yum do
+      namespace :release do
+        desc "Download RC Yum repositories"
+        task :download => yum_release_repositories_dir do
+          yum_distributions.each do |distribution|
+            distribution_dir = "#{yum_release_repositories_dir}/#{distribution}"
+            download_distribution(distribution,
+                                  distribution_dir,
+                                  :rc,
+                                  list: uploaded_files_name)
+          end
+        end
+
+        desc "Upload release Yum repositories"
+        task :upload => yum_release_repositories_dir do
+          yum_distributions.each do |distribution|
+            distribution_dir = "#{yum_release_repositories_dir}/#{distribution}"
+            uploader =
+              ArtifactoryUploader.new(api_key: artifactory_api_key,
+                                      distribution: distribution,
+                                      source: distribution_dir,
+                                      staging: staging?,
+                                      sync: true,
+                                      sync_pattern: /\/repodata\//)
+            uploader.upload
+          end
+        end
+      end
+
+      desc "Release Yum packages"
+      yum_release_tasks = [
+        "yum:release:download",
+        "yum:release:upload",
+      ]
+      task :release => yum_release_tasks
+    end
+  end
+
+  def define_yum_tasks
+    define_yum_staging_tasks
+    define_yum_rc_tasks
+    define_yum_release_tasks
+  end
+
+  def define_generic_data_rc_tasks(label,
+                                   id,
+                                   rc_dir,
+                                   target_files_glob)
+    directory rc_dir
+
+    namespace id do
+      namespace :rc do
+        desc "Copy #{label} packages"
+        task :copy => rc_dir do
+          progress_label = "Copying: #{label}"
+          progress_reporter = ProgressReporter.new(progress_label)
+
+          Pathname(artifacts_dir).glob(target_files_glob) do |path|
+            next if path.directory?
+            destination_path = [
+              rc_dir,
+              path.basename.to_s,
+            ].join("/")
+            copy_artifact(path, destination_path, progress_reporter)
+          end
+
+          progress_reporter.finish
+        end
+
+        desc "Sign #{label} packages"
+        task :sign => rc_dir do
+          sign_dir(label, rc_dir)
+        end
+
+        desc "Upload #{label} packages"
+        task :upload do
+          uploader =
+            ArtifactoryUploader.new(api_key: artifactory_api_key,
+                                    destination_prefix: full_version,
+                                    distribution: id.to_s,
+                                    rc: rc,
+                                    source: rc_dir,
+                                    staging: staging?)
+          uploader.upload
+        end
+      end
+
+      desc "Release RC #{label} packages"
+      rc_tasks = [
+        "#{id}:rc:copy",
+        "#{id}:rc:sign",
+        "#{id}:rc:upload",
+      ]
+      task :rc => rc_tasks
+    end
+  end
+
+  def define_generic_data_release_tasks(label, id, release_dir)
+    directory release_dir
+
+    namespace id do
+      namespace :release do
+        desc "Download RC #{label} packages"
+        task :download => release_dir do
+          download_distribution(id.to_s,
+                                release_dir,
+                                :rc,
+                                prefix: "#{full_version}")
+        end
+
+        desc "Upload release #{label} packages"
+        task :upload => release_dir do
+          uploader = ArtifactoryUploader.new(api_key: artifactory_api_key,
+                                             destination_prefix: version,
+                                             distribution: id.to_s,
+                                             source: release_dir,
+                                             staging: staging?)
+          uploader.upload
+        end
+      end
+
+      desc "Release #{label} packages"
+      release_tasks = [
+        "#{id}:release:download",
+        "#{id}:release:upload",
+      ]
+      task :release => release_tasks
+    end
+  end
+
+  def define_generic_data_tasks(label,
+                                id,
+                                rc_dir,
+                                release_dir,
+                                target_files_glob)
+    define_generic_data_rc_tasks(label, id, rc_dir, target_files_glob)
+    define_generic_data_release_tasks(label, id, release_dir)
+  end
+
+  def define_python_tasks
+    define_generic_data_tasks("Python",
+                              :python,
+                              "#{rc_dir}/python/#{full_version}",
+                              "#{release_dir}/python/#{full_version}",
+                              "{python-sdist,wheel-*}/**/*")
+  end
+
+  def define_nuget_tasks
+    define_generic_data_tasks("NuGet",
+                              :nuget,
+                              "#{rc_dir}/nuget/#{full_version}",
+                              "#{release_dir}/nuget/#{full_version}",
+                              "nuget/**/*")
+  end
+
+  def define_summary_tasks
+    namespace :summary do
+      desc "Show RC summary"
+      task :rc do
+        suffix = ""
+        suffix << "-staging" if staging?
+        puts(<<-SUMMARY)
+Success! The release candidate binaries are available here:
+  https://apache.jfrog.io/artifactory/arrow/almalinux#{suffix}-rc/
+  https://apache.jfrog.io/artifactory/arrow/amazon-linux#{suffix}-rc/
+  https://apache.jfrog.io/artifactory/arrow/centos#{suffix}-rc/
+  https://apache.jfrog.io/artifactory/arrow/debian#{suffix}-rc/
+  https://apache.jfrog.io/artifactory/arrow/nuget#{suffix}-rc/#{full_version}
+  https://apache.jfrog.io/artifactory/arrow/python#{suffix}-rc/#{full_version}
+  https://apache.jfrog.io/artifactory/arrow/ubuntu#{suffix}-rc/
+        SUMMARY
+      end
+
+      desc "Show release summary"
+      task :release do
+        suffix = ""
+        suffix << "-staging" if staging?
+        puts(<<-SUMMARY)
+Success! The release binaries are available here:
+  https://apache.jfrog.io/artifactory/arrow/almalinux#{suffix}/
+  https://apache.jfrog.io/artifactory/arrow/amazon-linux#{suffix}/
+  https://apache.jfrog.io/artifactory/arrow/centos#{suffix}/
+  https://apache.jfrog.io/artifactory/arrow/debian#{suffix}/
+  https://apache.jfrog.io/artifactory/arrow/nuget#{suffix}/#{version}
+  https://apache.jfrog.io/artifactory/arrow/python#{suffix}/#{version}
+  https://apache.jfrog.io/artifactory/arrow/ubuntu#{suffix}/
+        SUMMARY
+      end
+    end
+  end
+end
diff --git a/src/arrow/dev/release/binary/.dockerignore b/src/arrow/dev/release/binary/.dockerignore
new file mode 100644
index 000000000..f2c46d8ce
--- /dev/null
+++ b/src/arrow/dev/release/binary/.dockerignore
@@ -0,0 +1,18 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+/tmp/
diff --git a/src/arrow/dev/release/binary/Dockerfile b/src/arrow/dev/release/binary/Dockerfile
new file mode 100644
index 000000000..a21b32dd7
--- /dev/null
+++ b/src/arrow/dev/release/binary/Dockerfile
@@ -0,0 +1,70 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+FROM debian:bullseye
+
+ENV DEBIAN_FRONTEND noninteractive
+
+ARG DEBUG
+
+RUN \
+  quiet=$([ "${DEBUG}" = "yes" ] || echo "-qq") && \
+  apt update ${quiet} && \
+  apt install -y -V ${quiet} \
+    apt-utils \
+    createrepo-c \
+    devscripts \
+    gpg \
+    locales \
+    openssh-server \
+    rake \
+    rpm \
+    ruby \
+    sudo && \
+  apt clean && \
+  rm -rf /var/lib/apt/lists/*
+
+RUN gem install apt-dists-merge -v ">= 1.0.2"
+
+RUN locale-gen en_US.UTF-8
+
+RUN mkdir -p /run/sshd
+RUN echo "StreamLocalBindUnlink yes" >> /etc/ssh/sshd_config
+
+ENV ARROW_USER arrow
+ENV ARROW_UID 10000
+
+RUN \
+  groupadd --gid ${ARROW_UID} ${ARROW_USER} && \
+  useradd --uid ${ARROW_UID} --gid ${ARROW_UID} --create-home ${ARROW_USER} && \
+  mkdir -p /home/arrow/.gnupg /home/arrow/.ssh && \
+  chown -R arrow: /home/arrow/.gnupg /home/arrow/.ssh && \
+  chmod -R og-rwx /home/arrow/.gnupg /home/arrow/.ssh && \
+  echo "${ARROW_USER} ALL=(ALL:ALL) NOPASSWD:ALL" | \
+    EDITOR=tee visudo -f /etc/sudoers.d/arrow
+
+COPY id_rsa.pub /home/arrow/.ssh/authorized_keys
+RUN \
+  chown -R arrow: /home/arrow/.ssh && \
+  chmod -R og-rwx /home/arrow/.ssh
+
+COPY runner.sh /home/arrow/runner.sh
+RUN \
+  chown -R arrow: /home/arrow/runner.sh && \
+  chmod +x /home/arrow/runner.sh
+
+EXPOSE 22
diff --git a/src/arrow/dev/release/binary/runner.sh b/src/arrow/dev/release/binary/runner.sh
new file mode 100755
index 000000000..465d60d62
--- /dev/null
+++ b/src/arrow/dev/release/binary/runner.sh
@@ -0,0 +1,36 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+set -u
+
+export LANG=C
+
+target_dir=/host/binary/tmp
+original_owner=$(stat --format=%u ${target_dir})
+original_group=$(stat --format=%g ${target_dir})
+
+sudo -H chown -R ${USER}: ${target_dir}
+restore_owner() {
+  sudo -H chown -R ${original_owner}:${original_group} ${target_dir}
+}
+trap restore_owner EXIT
+
+cd /host
+
+"$@"
diff --git a/src/arrow/dev/release/check-rat-report.py b/src/arrow/dev/release/check-rat-report.py
new file mode 100644
index 000000000..a5718103a
--- /dev/null
+++ b/src/arrow/dev/release/check-rat-report.py
@@ -0,0 +1,59 @@
+#!/usr/bin/env python
+##############################################################################
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+##############################################################################
+import fnmatch
+import re
+import sys
+import xml.etree.ElementTree as ET
+
+if len(sys.argv) != 3:
+    sys.stderr.write("Usage: %s exclude_globs.lst rat_report.xml\n" %
+                     sys.argv[0])
+    sys.exit(1)
+
+exclude_globs_filename = sys.argv[1]
+xml_filename = sys.argv[2]
+
+globs = [line.strip() for line in open(exclude_globs_filename, "r")]
+
+tree = ET.parse(xml_filename)
+root = tree.getroot()
+resources = root.findall('resource')
+
+all_ok = True
+for r in resources:
+    approvals = r.findall('license-approval')
+    if not approvals or approvals[0].attrib['name'] == 'true':
+        continue
+    clean_name = re.sub('^[^/]+/', '', r.attrib['name'])
+    excluded = False
+    for g in globs:
+        if fnmatch.fnmatch(clean_name, g):
+            excluded = True
+            break
+    if not excluded:
+        sys.stdout.write("NOT APPROVED: %s (%s): %s\n" % (
+            clean_name, r.attrib['name'], approvals[0].attrib['name']))
+        all_ok = False
+
+if not all_ok:
+    sys.exit(1)
+
+print('OK')
+sys.exit(0)
diff --git a/src/arrow/dev/release/download_rc_binaries.py b/src/arrow/dev/release/download_rc_binaries.py
new file mode 100755
index 000000000..3e3d0f7d3
--- /dev/null
+++ b/src/arrow/dev/release/download_rc_binaries.py
@@ -0,0 +1,184 @@
+#!/usr/bin/env python
+#
+# Licensed to the Apache Software Foundation (ASF) under one or more
+# contributor license agreements.  See the NOTICE file distributed with
+# this work for additional information regarding copyright ownership.
+# The ASF licenses this file to You under the Apache License, Version 2.0
+# (the "License"); you may not use this file except in compliance with
+# the License.  You may obtain a copy of the License at
+#
+#    http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+import re
+
+import argparse
+import concurrent.futures as cf
+import functools
+import os
+import subprocess
+import urllib.request
+
+
+ARTIFACTORY_ROOT = "https://apache.jfrog.io/artifactory/arrow"
+DEFAULT_PARALLEL_DOWNLOADS = 8
+
+
+class Artifactory:
+
+    def get_file_list(self, prefix):
+        def traverse(directory, files, directories):
+            url = f'{ARTIFACTORY_ROOT}/{directory}'
+            response = urllib.request.urlopen(url).read().decode()
+            paths = re.findall('<a href="(.+?)"', response)
+            for path in paths:
+                if path == '../':
+                    continue
+                resolved_path = f'{directory}{path}'
+                if path.endswith('/'):
+                    directories.append(resolved_path)
+                else:
+                    files.append(resolved_path)
+        files = []
+        if not prefix.endswith('/'):
+            prefix += '/'
+        directories = [prefix]
+        while len(directories) > 0:
+            directory = directories.pop()
+            traverse(directory, files, directories)
+        return files
+
+    def download_files(self, files, dest=None, num_parallel=None,
+                       re_match=None):
+        """
+        Download files from Bintray in parallel. If file already exists, will
+        overwrite if the checksum does not match what Bintray says it should be
+
+        Parameters
+        ----------
+        files : List[Dict]
+            File listing from Bintray
+        dest : str, default None
+            Defaults to current working directory
+        num_parallel : int, default 8
+            Number of files to download in parallel. If set to None, uses
+            default
+        """
+        if dest is None:
+            dest = os.getcwd()
+        if num_parallel is None:
+            num_parallel = DEFAULT_PARALLEL_DOWNLOADS
+
+        if re_match is not None:
+            regex = re.compile(re_match)
+            files = [x for x in files if regex.match(x)]
+
+        if num_parallel == 1:
+            for path in files:
+                self._download_file(dest, path)
+        else:
+            parallel_map_terminate_early(
+                functools.partial(self._download_file, dest),
+                files,
+                num_parallel
+            )
+
+    def _download_file(self, dest, path):
+        base, filename = os.path.split(path)
+
+        dest_dir = os.path.join(dest, base)
+        os.makedirs(dest_dir, exist_ok=True)
+
+        dest_path = os.path.join(dest_dir, filename)
+
+        print("Downloading {} to {}".format(path, dest_path))
+
+        url = f'{ARTIFACTORY_ROOT}/{path}'
+
+        cmd = [
+            'curl', '--fail', '--location', '--retry', '5',
+            '--output', dest_path, url
+        ]
+        proc = subprocess.Popen(cmd, stdout=subprocess.PIPE,
+                                stderr=subprocess.PIPE)
+        stdout, stderr = proc.communicate()
+        if proc.returncode != 0:
+            raise Exception("Downloading {} failed\nstdout: {}\nstderr: {}"
+                            .format(path, stdout, stderr))
+
+
+def parallel_map_terminate_early(f, iterable, num_parallel):
+    tasks = []
+    with cf.ProcessPoolExecutor(num_parallel) as pool:
+        for v in iterable:
+            tasks.append(pool.submit(functools.partial(f, v)))
+
+        for task in cf.as_completed(tasks):
+            if task.exception() is not None:
+                e = task.exception()
+                for task in tasks:
+                    task.cancel()
+                raise e
+
+
+ARROW_REPOSITORY_PACKAGE_TYPES = ['centos', 'debian', 'ubuntu']
+ARROW_STANDALONE_PACKAGE_TYPES = ['nuget', 'python']
+ARROW_PACKAGE_TYPES = \
+    ARROW_REPOSITORY_PACKAGE_TYPES + \
+    ARROW_STANDALONE_PACKAGE_TYPES
+
+
+def download_rc_binaries(version, rc_number, re_match=None, dest=None,
+                         num_parallel=None, target_package_type=None):
+    artifactory = Artifactory()
+
+    version_string = '{}-rc{}'.format(version, rc_number)
+    if target_package_type:
+        package_types = [target_package_type]
+    else:
+        package_types = ARROW_PACKAGE_TYPES
+    for package_type in package_types:
+        if package_type in ARROW_REPOSITORY_PACKAGE_TYPES:
+            prefix = f'{package_type}-rc'
+        else:
+            prefix = f'{package_type}-rc/{version_string}'
+        files = artifactory.get_file_list(prefix)
+        if package_type in ARROW_REPOSITORY_PACKAGE_TYPES:
+            version_pattern = re.compile(r'\d+\.\d+\.\d+')
+
+            def is_old_release(path):
+                match = version_pattern.search(path)
+                if not match:
+                    return False
+                return match[0] != version
+            files = [x for x in files if not is_old_release(x)]
+        artifactory.download_files(files, re_match=re_match, dest=dest,
+                                   num_parallel=num_parallel)
+
+
+if __name__ == '__main__':
+    parser = argparse.ArgumentParser(
+        description='Download release candidate binaries'
+    )
+    parser.add_argument('version', type=str, help='The version number')
+    parser.add_argument('rc_number', type=int,
+                        help='The release candidate number, e.g. 0, 1, etc')
+    parser.add_argument('-e', '--regexp', type=str, default=None,
+                        help=('Regular expression to match on file names '
+                              'to only download certain files'))
+    parser.add_argument('--dest', type=str, default=os.getcwd(),
+                        help='The output folder for the downloaded files')
+    parser.add_argument('--num_parallel', type=int, default=8,
+                        help='The number of concurrent downloads to do')
+    parser.add_argument('--package_type', type=str, default=None,
+                        help='The package type to be downloaded')
+    args = parser.parse_args()
+
+    download_rc_binaries(args.version, args.rc_number, dest=args.dest,
+                         re_match=args.regexp, num_parallel=args.num_parallel,
+                         target_package_type=args.package_type)
diff --git a/src/arrow/dev/release/post-01-upload.sh b/src/arrow/dev/release/post-01-upload.sh
new file mode 100755
index 000000000..5671c3746
--- /dev/null
+++ b/src/arrow/dev/release/post-01-upload.sh
@@ -0,0 +1,71 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+set -e
+set -u
+
+if [ "$#" -ne 2 ]; then
+  echo "Usage: $0 <version> <rc-num>"
+  exit
+fi
+
+version=$1
+rc=$2
+
+tmp_dir=tmp-apache-arrow-dist
+
+echo "Recreate temporary directory: ${tmp_dir}"
+rm -rf ${tmp_dir}
+mkdir -p ${tmp_dir}
+
+echo "Clone dev dist repository"
+svn \
+  co \
+  https://dist.apache.org/repos/dist/dev/arrow/apache-arrow-${version}-rc${rc} \
+  ${tmp_dir}/dev
+
+echo "Clone release dist repository"
+svn co https://dist.apache.org/repos/dist/release/arrow ${tmp_dir}/release
+
+echo "Copy ${version}-rc${rc} to release working copy"
+release_version=arrow-${version}
+mkdir -p ${tmp_dir}/release/${release_version}
+cp -r ${tmp_dir}/dev/* ${tmp_dir}/release/${release_version}/
+svn add ${tmp_dir}/release/${release_version}
+
+echo "Keep only the three most recent versions"
+old_releases=$(
+  svn ls ${tmp_dir}/release/ | \
+  grep -E '^arrow-[0-9\.]+' | \
+  sort --version-sort --reverse | \
+  tail -n +4
+)
+for old_release_version in $old_releases; do
+  echo "Remove old release ${old_release_version}"
+  svn delete ${tmp_dir}/release/${old_release_version}
+done
+
+echo "Commit release"
+svn ci -m "Apache Arrow ${version}" ${tmp_dir}/release
+
+echo "Clean up"
+rm -rf ${tmp_dir}
+
+echo "Success! The release is available here:"
+echo "  https://dist.apache.org/repos/dist/release/arrow/${release_version}"
diff --git a/src/arrow/dev/release/post-02-binary.sh b/src/arrow/dev/release/post-02-binary.sh
new file mode 100755
index 000000000..b1b41f9fb
--- /dev/null
+++ b/src/arrow/dev/release/post-02-binary.sh
@@ -0,0 +1,101 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+set -e
+set -o pipefail
+
+SOURCE_DIR="$(cd "$(dirname "${BASH_SOURCE[0]}")" && pwd)"
+
+if [ "$#" -ne 2 ]; then
+  echo "Usage: $0 <version> <rc-num>"
+  exit
+fi
+
+version=$1
+rc=$2
+
+cd "${SOURCE_DIR}"
+
+if [ ! -f .env ]; then
+  echo "You must create $(pwd)/.env"
+  echo "You can use $(pwd)/.env.example as template"
+  exit 1
+fi
+. .env
+
+. utils-binary.sh
+
+# By default deploy all artifacts.
+# To deactivate one category, deactivate the category and all of its dependents.
+# To explicitly select one category, set DEPLOY_DEFAULT=0 DEPLOY_X=1.
+: ${DEPLOY_DEFAULT:=1}
+: ${DEPLOY_ALMALINUX:=${DEPLOY_DEFAULT}}
+: ${DEPLOY_AMAZON_LINUX:=${DEPLOY_DEFAULT}}
+: ${DEPLOY_CENTOS:=${DEPLOY_DEFAULT}}
+: ${DEPLOY_DEBIAN:=${DEPLOY_DEFAULT}}
+: ${DEPLOY_NUGET:=${DEPLOY_DEFAULT}}
+: ${DEPLOY_PYTHON:=${DEPLOY_DEFAULT}}
+: ${DEPLOY_UBUNTU:=${DEPLOY_DEFAULT}}
+
+rake_tasks=()
+apt_targets=()
+yum_targets=()
+if [ ${DEPLOY_ALMALINUX} -gt 0 ]; then
+  rake_tasks+=(yum:release)
+  yum_targets+=(almalinux)
+fi
+if [ ${DEPLOY_AMAZON_LINUX} -gt 0 ]; then
+  rake_tasks+=(yum:release)
+  yum_targets+=(amazon-linux)
+fi
+if [ ${DEPLOY_CENTOS} -gt 0 ]; then
+  rake_tasks+=(yum:release)
+  yum_targets+=(centos)
+fi
+if [ ${DEPLOY_DEBIAN} -gt 0 ]; then
+  rake_tasks+=(apt:release)
+  apt_targets+=(debian)
+fi
+if [ ${DEPLOY_NUGET} -gt 0 ]; then
+  rake_tasks+=(nuget:release)
+fi
+if [ ${DEPLOY_PYTHON} -gt 0 ]; then
+  rake_tasks+=(python:release)
+fi
+if [ ${DEPLOY_UBUNTU} -gt 0 ]; then
+  rake_tasks+=(apt:release)
+  apt_targets+=(ubuntu)
+fi
+rake_tasks+=(summary:release)
+
+tmp_dir=binary/tmp
+mkdir -p "${tmp_dir}"
+
+docker_run \
+  ./runner.sh \
+  rake \
+    --trace \
+    "${rake_tasks[@]}" \
+    APT_TARGETS=$(IFS=,; echo "${apt_targets[*]}") \
+    ARTIFACTORY_API_KEY="${ARTIFACTORY_API_KEY}" \
+    ARTIFACTS_DIR="${tmp_dir}/artifacts" \
+    RC=${rc} \
+    STAGING=${STAGING:-no} \
+    VERSION=${version} \
+    YUM_TARGETS=$(IFS=,; echo "${yum_targets[*]}")
diff --git a/src/arrow/dev/release/post-03-website.sh b/src/arrow/dev/release/post-03-website.sh
new file mode 100755
index 000000000..7aceeaf59
--- /dev/null
+++ b/src/arrow/dev/release/post-03-website.sh
@@ -0,0 +1,266 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+set -e
+set -u
+
+SOURCE_DIR="$(cd "$(dirname "${BASH_SOURCE[0]}")" && pwd)"
+ARROW_DIR="${SOURCE_DIR}/../.."
+ARROW_SITE_DIR="${ARROW_DIR}/../arrow-site"
+
+if [ "$#" -ne 2 ]; then
+  echo "Usage: $0 <previous-version> <version>"
+  exit 1
+fi
+
+previous_version=$1
+version=$2
+
+branch_name=release-note-${version}
+release_dir="${ARROW_SITE_DIR}/_release"
+announce_file="${release_dir}/${version}.md"
+versions_yml="${ARROW_SITE_DIR}/_data/versions.yml"
+
+pushd "${ARROW_SITE_DIR}"
+git checkout master
+git checkout -b ${branch_name}
+popd
+
+pushd "${ARROW_DIR}"
+
+release_date=$(LANG=C date "+%-d %B %Y")
+previous_tag_date=$(git log -n 1 --pretty=%aI apache-arrow-${previous_version})
+rough_previous_release_date=$(date --date "${previous_tag_date}" +%s)
+rough_release_date=$(date +%s)
+rough_n_development_months=$((
+  (${rough_release_date} - ${rough_previous_release_date}) / (60 * 60 * 24 * 30)
+))
+
+git_tag=apache-arrow-${version}
+git_range=apache-arrow-${previous_version}..${git_tag}
+
+committers_command_line="git shortlog -csn ${git_range}"
+contributors_command_line="git shortlog -sn ${git_range}"
+
+committers=$(${committers_command_line})
+contributors=$(${contributors_command_line})
+
+n_commits=$(git log --pretty=oneline ${git_range} | wc -l)
+n_contributors=$(${contributors_command_line} | wc -l)
+
+git_tag_hash=$(git log -n 1 --pretty=%H ${git_tag})
+
+popd
+
+pushd "${ARROW_SITE_DIR}"
+
+# Add announce for the current version
+cat <<ANNOUNCE > "${announce_file}"
+---
+layout: default
+title: Apache Arrow ${version} Release
+permalink: /release/${version}.html
+---
+<!--
+{% comment %}
+Licensed to the Apache Software Foundation (ASF) under one or more
+contributor license agreements.  See the NOTICE file distributed with
+this work for additional information regarding copyright ownership.
+The ASF licenses this file to you under the Apache License, Version 2.0
+(the "License"); you may not use this file except in compliance with
+the License.  You may obtain a copy of the License at
+
+http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+{% endcomment %}
+-->
+
+# Apache Arrow ${version} (${release_date})
+
+This is a major release covering more than ${rough_n_development_months} months of development.
+
+## Download
+
+* [**Source Artifacts**][1]
+* **Binary Artifacts**
+  * [For CentOS][2]
+  * [For Debian][3]
+  * [For Python][4]
+  * [For Ubuntu][5]
+* [Git tag][6]
+
+## Contributors
+
+This release includes ${n_commits} commits from ${n_contributors} distinct contributors.
+
+\`\`\`console
+$ ${contributors_command_line}
+ANNOUNCE
+
+echo "${contributors}" >> "${announce_file}"
+
+cat <<ANNOUNCE >> "${announce_file}"
+\`\`\`
+
+## Patch Committers
+
+The following Apache committers merged contributed patches to the repository.
+
+\`\`\`console
+$ ${committers_command_line}
+ANNOUNCE
+
+echo "${committers}" >> "${announce_file}"
+
+cat <<ANNOUNCE >> "${announce_file}"
+\`\`\`
+
+## Changelog
+
+ANNOUNCE
+
+archery release changelog generate ${version} | \
+  sed -e 's/^#/##/g' >> "${announce_file}"
+
+cat <<ANNOUNCE >> "${announce_file}"
+[1]: https://www.apache.org/dyn/closer.lua/arrow/arrow-${version}/
+[2]: https://apache.jfrog.io/artifactory/arrow/centos/
+[3]: https://apache.jfrog.io/artifactory/arrow/debian/
+[4]: https://apache.jfrog.io/artifactory/arrow/python/${version}/
+[5]: https://apache.jfrog.io/artifactory/arrow/ubuntu/
+[6]: https://github.com/apache/arrow/releases/tag/apache-arrow-${version}
+ANNOUNCE
+git add "${announce_file}"
+
+
+# Update index
+pushd "${release_dir}"
+
+index_file=index.md
+rm -f ${index_file}
+announce_files="$(ls | sort --version-sort --reverse)"
+cat <<INDEX > ${index_file}
+---
+layout: default
+title: Releases
+permalink: /release/index.html
+---
+<!--
+{% comment %}
+Licensed to the Apache Software Foundation (ASF) under one or more
+contributor license agreements.  See the NOTICE file distributed with
+this work for additional information regarding copyright ownership.
+The ASF licenses this file to you under the Apache License, Version 2.0
+(the "License"); you may not use this file except in compliance with
+the License.  You may obtain a copy of the License at
+
+http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+{% endcomment %}
+-->
+
+# Apache Arrow Releases
+
+Navigate to the release page for downloads and the changelog.
+
+INDEX
+
+i=0
+for md_file in ${announce_files}; do
+  i=$((i + 1))
+  title=$(grep '^# Apache Arrow' ${md_file} | sed -e 's/^# Apache Arrow //')
+  echo "* [${title}][${i}]" >> ${index_file}
+done
+echo >> ${index_file}
+
+i=0
+for md_file in ${announce_files}; do
+  i=$((i + 1))
+  html_file=$(echo ${md_file} | sed -e 's/md$/html/')
+  echo "[${i}]: {{ site.baseurl }}/release/${html_file}" >> ${index_file}
+done
+
+git add ${index_file}
+
+popd
+
+
+# Update versions.yml
+pinned_version=$(echo ${version} | sed -e 's/\.[^.]*$/.*/')
+
+apache_download_url=https://downloads.apache.org
+
+cat <<YAML > "${versions_yml}"
+# Licensed to the Apache Software Foundation (ASF) under one or more
+# contributor license agreements.  See the NOTICE file distributed with
+# this work for additional information regarding copyright ownership.
+# The ASF licenses this file to you under the Apache License, Version 2.0
+# (the "License"); you may not use this file except in compliance with
+# the License.  You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+# Database of the current version
+#
+current:
+  number: '${version}'
+  pinned_number: '${pinned_version}'
+  date: '${release_date}'
+  git-tag: '${git_tag_hash}'
+  github-tag-link: 'https://github.com/apache/arrow/releases/tag/${git_tag}'
+  release-notes: 'https://arrow.apache.org/release/${version}.html'
+  mirrors: 'https://www.apache.org/dyn/closer.lua/arrow/arrow-${version}/'
+  tarball-name: 'apache-arrow-${version}.tar.gz'
+  tarball-url: 'https://www.apache.org/dyn/closer.lua?action=download&filename=arrow/arrow-${version}/apache-arrow-${version}.tar.gz'
+  java-artifacts: 'http://search.maven.org/#search%7Cga%7C1%7Cg%3A%22org.apache.arrow%22%20AND%20v%3A%22${version}%22'
+  asc: '${apache_download_url}/arrow/arrow-${version}/apache-arrow-${version}.tar.gz.asc'
+  sha256: '${apache_download_url}/arrow/arrow-${version}/apache-arrow-${version}.tar.gz.sha256'
+  sha512: '${apache_download_url}/arrow/arrow-${version}/apache-arrow-${version}.tar.gz.sha512'
+YAML
+git add "${versions_yml}"
+
+git commit -m "[Website] Add release note for ${version}"
+git push -u origin ${branch_name}
+
+github_url=$(git remote get-url origin | \
+               sed \
+                 -e 's,^git@github.com:,https://github.com/,' \
+                 -e 's,\.git$,,')
+
+echo "Success!"
+echo "Create a pull request:"
+echo "  ${github_url}/pull/new/${branch_name}"
+
+popd
diff --git a/src/arrow/dev/release/post-04-ruby.sh b/src/arrow/dev/release/post-04-ruby.sh
new file mode 100755
index 000000000..edcb54c13
--- /dev/null
+++ b/src/arrow/dev/release/post-04-ruby.sh
@@ -0,0 +1,92 @@
+#!/usr/bin/env bash
+# -*- indent-tabs-mode: nil; sh-indentation: 2; sh-basic-offset: 2 -*-
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+set -e
+set -o pipefail
+
+SOURCE_DIR="$( cd "$( dirname "${BASH_SOURCE[0]}" )" && pwd )"
+
+if [ "$#" -ne 1 ]; then
+  echo "Usage: $0 <version>"
+  exit
+fi
+
+version=$1
+archive_name=apache-arrow-${version}
+tar_gz=${archive_name}.tar.gz
+
+echo "NOTE: We should release RubyGems after Homebrew and MSYS2 packages are updated!!!"
+
+echo "Checking Homebrew package..."
+homebrew_version=$(
+  curl \
+    --fail \
+    --no-progress-meter \
+    https://raw.githubusercontent.com/Homebrew/homebrew-core/master/Formula/apache-arrow-glib.rb | \
+    grep url | \
+    grep -o "[0-9]*\.[0-9]*\.[0-9]*" | \
+    head -n 1)
+echo "Homebrew package version: ${homebrew_version}"
+if [ "${version}" = "${homebrew_version}" ]; then
+  echo "OK!"
+else
+  echo "Different!"
+  exit 1
+fi
+
+
+echo "Checking MSYS2 package..."
+msys2_version=$(
+  curl \
+    --fail \
+    --no-progress-meter \
+    https://packages.msys2.org/base/mingw-w64-arrow | \
+    grep -A 1 ">Version:<" | \
+    grep -o "[0-9]*\.[0-9]*\.[0-9]*")
+echo "MSYS2 package version: ${msys2_version}"
+if [ "${version}" = "${msys2_version}" ]; then
+  echo "OK!"
+else
+  echo "Different!"
+  exit 1
+fi
+
+
+rm -f ${tar_gz}
+curl \
+  --remote-name \
+  --fail \
+  https://downloads.apache.org/arrow/arrow-${version}/${tar_gz}
+rm -rf ${archive_name}
+tar xf ${tar_gz}
+modules=()
+for module in ${archive_name}/ruby/red-*; do
+  pushd ${module}
+  rake release
+  modules+=($(basename ${module}))
+  popd
+done
+rm -rf ${archive_name}
+rm -f ${tar_gz}
+
+echo "Success! The released RubyGems are available here:"
+for module in ${modules[@]}; do
+  echo "  https://rubygems.org/gems/${module}/versions/${version}"
+done
diff --git a/src/arrow/dev/release/post-05-js.sh b/src/arrow/dev/release/post-05-js.sh
new file mode 100755
index 000000000..edc5fe20b
--- /dev/null
+++ b/src/arrow/dev/release/post-05-js.sh
@@ -0,0 +1,48 @@
+#!/usr/bin/env bash
+# -*- indent-tabs-mode: nil; sh-indentation: 2; sh-basic-offset: 2 -*-
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+set -e
+
+SOURCE_DIR="$( cd "$( dirname "${BASH_SOURCE[0]}" )" && pwd )"
+
+if [ "$#" -ne 1 ]; then
+  echo "Usage: $0 <version>"
+  exit
+fi
+
+version=$1
+archive_name=apache-arrow-${version}
+tar_gz=${archive_name}.tar.gz
+
+rm -f ${tar_gz}
+curl \
+  --remote-name \
+  --fail \
+  https://downloads.apache.org/arrow/arrow-${version}/${tar_gz}
+rm -rf ${archive_name}
+tar xf ${tar_gz}
+pushd ${archive_name}/js
+./npm-release.sh
+popd
+rm -rf ${archive_name}
+rm -f ${tar_gz}
+
+echo "Success! The released npm packages are available here:"
+echo "  https://www.npmjs.com/package/apache-arrow/v/${version}"
diff --git a/src/arrow/dev/release/post-06-csharp.sh b/src/arrow/dev/release/post-06-csharp.sh
new file mode 100755
index 000000000..d2968a5d5
--- /dev/null
+++ b/src/arrow/dev/release/post-06-csharp.sh
@@ -0,0 +1,60 @@
+#!/usr/bin/env bash
+# -*- indent-tabs-mode: nil; sh-indentation: 2; sh-basic-offset: 2 -*-
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+set -eux
+
+SOURCE_DIR="$(cd "$(dirname "${BASH_SOURCE[0]}")" && pwd)"
+
+if [ "$#" -ne 1 ]; then
+  echo "Usage: $0 <version>"
+  exit
+fi
+
+version=$1
+
+if [ -z "${NUGET_API_KEY}" ]; then
+  echo "NUGET_API_KEY is empty"
+  exit 1
+fi
+
+base_names=()
+base_names+=(Apache.Arrow.${version})
+base_names+=(Apache.Arrow.Flight.${version})
+base_names+=(Apache.Arrow.Flight.AspNetCore.${version})
+for base_name in ${base_names[@]}; do
+  for extension in nupkg snupkg; do
+    path=${base_name}.${extension}
+    rm -f ${path}
+    curl \
+      --fail \
+      --location \
+      --remote-name \
+      https://apache.jfrog.io/artifactory/arrow/nuget/${version}/${path}
+  done
+  dotnet nuget push \
+    ${base_name}.nupkg \
+    -k ${NUGET_API_KEY} \
+    -s https://api.nuget.org/v3/index.json
+  rm -f ${base_name}.{nupkg,snupkg}
+done
+
+echo "Success! The released NuGet package is available here:"
+echo "  https://www.nuget.org/packages/Apache.Arrow/${version}"
diff --git a/src/arrow/dev/release/post-08-remove-rc.sh b/src/arrow/dev/release/post-08-remove-rc.sh
new file mode 100755
index 000000000..8e02b7e95
--- /dev/null
+++ b/src/arrow/dev/release/post-08-remove-rc.sh
@@ -0,0 +1,50 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+set -e
+set -u
+set -o pipefail
+
+SOURCE_DIR="$(cd "$(dirname "${BASH_SOURCE[0]}")" && pwd)"
+
+if [ "$#" -ne 1 ]; then
+  echo "Usage: $0 <version>"
+  exit
+fi
+
+version=$1
+
+base_url=https://dist.apache.org/repos/dist/dev/arrow
+pattern="^apache-arrow-${version}-rc"
+paths=$()
+if svn ls ${base_url} | grep "${pattern}" > /dev/null 2>&1; then
+  rc_paths=$(svn ls ${base_url} | grep "${pattern}")
+  rc_urls=()
+  for rc_path in ${rc_paths}; do
+    rc_urls+=(${base_url}/${rc_path})
+  done
+  svn rm --message "Remove RC for ${version}" ${rc_urls[@]}
+  echo "Removed RC artifacts:"
+  for rc_url in ${rc_urls[@]}; do
+    echo "  ${rc_url}"
+  done
+else
+  echo "No RC artifacts at ${base_url}"
+fi
diff --git a/src/arrow/dev/release/post-09-docs.sh b/src/arrow/dev/release/post-09-docs.sh
new file mode 100755
index 000000000..9c0b77bb5
--- /dev/null
+++ b/src/arrow/dev/release/post-09-docs.sh
@@ -0,0 +1,67 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+set -e
+set -u
+
+SOURCE_DIR="$(cd "$(dirname "${BASH_SOURCE[0]}")" && pwd)"
+ARROW_DIR="${SOURCE_DIR}/../.."
+ARROW_SITE_DIR="${ARROW_DIR}/../arrow-site"
+
+if [ "$#" -ne 1 ]; then
+  echo "Usage: $0 <version>"
+  exit 1
+fi
+
+version=$1
+release_tag="apache-arrow-${version}"
+branch_name=release-docs-${version}
+
+pushd "${ARROW_SITE_DIR}"
+git checkout asf-site
+git checkout -b ${branch_name}
+rm -rf docs/*
+git checkout docs/c_glib/index.html
+popd
+
+pushd "${ARROW_DIR}"
+git checkout "${release_tag}"
+
+UBUNTU=20.10 archery docker run \
+  -v "${ARROW_SITE_DIR}/docs:/build/docs" \
+  -e ARROW_DOCS_VERSION="${version}" \
+  ubuntu-docs
+
+: ${PUSH:=1}
+
+if [ ${PUSH} -gt 0 ]; then
+  pushd "${ARROW_SITE_DIR}"
+  git add docs
+  git commit -m "[Website] Update documentations for ${version}"
+  git push -u origin ${branch_name}
+  github_url=$(git remote get-url origin | \
+                 sed \
+                   -e 's,^git@github.com:,https://github.com/,' \
+                   -e 's,\.git$,,')
+  popd
+
+  echo "Success!"
+  echo "Create a pull request:"
+  echo "  ${github_url}/pull/new/${branch_name}"
+fi
diff --git a/src/arrow/dev/release/post-10-python.sh b/src/arrow/dev/release/post-10-python.sh
new file mode 100755
index 000000000..a014239ea
--- /dev/null
+++ b/src/arrow/dev/release/post-10-python.sh
@@ -0,0 +1,52 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+set -ex
+set -o pipefail
+
+SOURCE_DIR="$(cd "$(dirname "${BASH_SOURCE[0]}")" && pwd)"
+: ${TEST_PYPI:=0}
+
+if [ "$#" -ne 2 ]; then
+  echo "Usage: $0 <version> <rc-num>"
+  exit
+fi
+
+version=$1
+rc=$2
+
+tmp=$(mktemp -d -t "arrow-post-python.XXXXX")
+${PYTHON:-python} \
+  "${SOURCE_DIR}/download_rc_binaries.py" \
+  ${version} \
+  ${rc} \
+  --dest="${tmp}" \
+  --package_type=python \
+  --regex=".*\.(whl|tar\.gz)$"
+
+if [ ${TEST_PYPI} -gt 0 ]; then
+  TWINE_ARGS="--repository-url https://test.pypi.org/legacy/"
+fi
+
+twine upload ${TWINE_ARGS} ${tmp}/python-rc/${version}-rc${rc}/*.{whl,tar.gz}
+
+rm -rf "${tmp}"
+
+echo "Success! The released PyPI packages are available here:"
+echo "  https://pypi.org/project/pyarrow/${version}"
diff --git a/src/arrow/dev/release/post-11-java.sh b/src/arrow/dev/release/post-11-java.sh
new file mode 100755
index 000000000..86e6e9b57
--- /dev/null
+++ b/src/arrow/dev/release/post-11-java.sh
@@ -0,0 +1,81 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+set -e
+set -o pipefail
+
+SOURCE_DIR="$( cd "$( dirname "${BASH_SOURCE[0]}" )" && pwd )"
+
+if [ "$#" -ne 1 ]; then
+  echo "Usage: $0 <version>"
+  exit
+fi
+
+version=$1
+archive_name=apache-arrow-${version}
+tar_gz=${archive_name}.tar.gz
+
+rm -f ${tar_gz}
+curl \
+  --remote-name \
+  --fail \
+  https://downloads.apache.org/arrow/arrow-${version}/${tar_gz}
+rm -rf ${archive_name}
+tar xf ${tar_gz}
+
+pushd ${archive_name}
+
+# clone the testing data to the appropiate directories
+git clone https://github.com/apache/arrow-testing.git testing
+git clone https://github.com/apache/parquet-testing.git cpp/submodules/parquet-testing
+
+# build the jni bindings similarly like the 01-perform.sh does
+mkdir -p cpp/java-build
+pushd cpp/java-build
+cmake \
+  -DARROW_DATASET=ON \
+  -DARROW_FILESYSTEM=ON \
+  -DARROW_GANDIVA_JAVA=ON \
+  -DARROW_GANDIVA=ON \
+  -DARROW_JNI=ON \
+  -DARROW_ORC=ON \
+  -DARROW_PARQUET=ON \
+  -DCMAKE_BUILD_TYPE=release \
+  -G Ninja \
+  ..
+ninja
+popd
+
+# go in the java subfolder
+pushd java
+# stage the artifacts using both the apache-release and arrow-jni profiles
+# Note: on ORC checkstyle failure use -Dcheckstyle.skip=true until https://issues.apache.org/jira/browse/ARROW-12552 gets resolved
+mvn -Papache-release,arrow-jni -Darrow.cpp.build.dir=$(realpath ../cpp/java-build/release) deploy
+popd
+
+popd
+
+echo "Success! The maven artifacts have been stated. Proceed with the following steps:"
+echo "1. Login to the apache repository: https://repository.apache.org/#stagingRepositories"
+echo "2. Select the arrow staging repository you just just created: orgapachearrow-100x"
+echo "3. Click the \"close\" button"
+echo "4. Once validation has passed, click the \"release\" button"
+echo ""
+echo "Note, that you must set up Maven to be able to publish to Apache's repositories."
+echo "Read more at https://www.apache.org/dev/publishing-maven-artifacts.html."
diff --git a/src/arrow/dev/release/post-12-bump-versions.sh b/src/arrow/dev/release/post-12-bump-versions.sh
new file mode 100755
index 000000000..8474f03d2
--- /dev/null
+++ b/src/arrow/dev/release/post-12-bump-versions.sh
@@ -0,0 +1,79 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+set -ue
+
+SOURCE_DIR="$( cd "$( dirname "${BASH_SOURCE[0]}" )" && pwd )"
+
+if [ "$#" -ne 2 ]; then
+  echo "Usage: $0 <version> <next_version>"
+  exit 1
+fi
+
+: ${BUMP_DEFAULT:=1}
+: ${BUMP_VERSION_POST_TAG:=${BUMP_DEFAULT}}
+: ${BUMP_DEB_PACKAGE_NAMES:=${BUMP_DEFAULT}}
+
+. $SOURCE_DIR/utils-prepare.sh
+
+version=$1
+next_version=$2
+next_version_snapshot="${next_version}-SNAPSHOT"
+
+if [ ${BUMP_VERSION_POST_TAG} -gt 0 ]; then
+  echo "Updating versions for ${next_version_snapshot}"
+  update_versions "${version}" "${next_version}" "snapshot"
+  git commit -m "[Release] Update versions for ${next_version_snapshot}"
+fi
+
+if [ ${BUMP_DEB_PACKAGE_NAMES} -gt 0 ]; then
+  echo "Updating .deb package names for ${next_version}"
+  so_version() {
+    local version=$1
+    local major_version=$(echo $version | sed -E -e 's/^([0-9]+)\.[0-9]+\.[0-9]+$/\1/')
+    local minor_version=$(echo $version | sed -E -e 's/^[0-9]+\.([0-9]+)\.[0-9]+$/\1/')
+    expr ${major_version} \* 100 + ${minor_version}
+  }
+  deb_lib_suffix=$(so_version $version)
+  next_deb_lib_suffix=$(so_version $next_version)
+  if [ "${deb_lib_suffix}" != "${next_deb_lib_suffix}" ]; then
+    cd $SOURCE_DIR/../tasks/linux-packages/apache-arrow
+    for target in debian*/lib*${deb_lib_suffix}.install; do
+      git mv \
+	${target} \
+	$(echo $target | sed -e "s/${deb_lib_suffix}/${next_deb_lib_suffix}/")
+    done
+    deb_lib_suffix_substitute_pattern="s/(lib(arrow|gandiva|parquet|plasma)[-a-z]*)${deb_lib_suffix}/\\1${next_deb_lib_suffix}/g"
+    sed -i.bak -E -e "${deb_lib_suffix_substitute_pattern}" debian*/control*
+    rm -f debian*/control*.bak
+    git add debian*/control*
+    cd -
+    cd $SOURCE_DIR/../tasks/
+    sed -i.bak -E -e "${deb_lib_suffix_substitute_pattern}" tasks.yml
+    rm -f tasks.yml.bak
+    git add tasks.yml
+    cd -
+    cd $SOURCE_DIR
+    sed -i.bak -E -e "${deb_lib_suffix_substitute_pattern}" rat_exclude_files.txt
+    rm -f rat_exclude_files.txt.bak
+    git add rat_exclude_files.txt
+    git commit -m "[Release] Update .deb package names for $next_version"
+    cd -
+  fi
+fi
diff --git a/src/arrow/dev/release/post-13-go.sh b/src/arrow/dev/release/post-13-go.sh
new file mode 100644
index 000000000..7c6034837
--- /dev/null
+++ b/src/arrow/dev/release/post-13-go.sh
@@ -0,0 +1,34 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+set -ue
+
+SOURCE_DIR="$( cd "$( dirname "${BASH_SOURCE[0]}" )" && pwd )"
+
+if [ "$#" -ne 1 ]; then
+    echo "Usage: $0 <version>"
+    exit
+fi
+
+version=$1
+version_tag="apache-arrow-${version}"
+go_arrow_tag="go/v${version}"
+
+git tag "${go_arrow_tag}" "${version_tag}"
+git push apache "${go_arrow_tag}"
diff --git a/src/arrow/dev/release/rat_exclude_files.txt b/src/arrow/dev/release/rat_exclude_files.txt
new file mode 100644
index 000000000..47fcf618f
--- /dev/null
+++ b/src/arrow/dev/release/rat_exclude_files.txt
@@ -0,0 +1,208 @@
+*.npmrc
+*.gitignore
+.gitmodules
+*_generated.h
+*_generated.js
+*_generated.ts
+*.csv
+*.json
+*.snap
+.github/ISSUE_TEMPLATE/question.md
+ci/etc/rprofile
+ci/etc/*.patch
+ci/vcpkg/*.patch
+CHANGELOG.md
+cpp/CHANGELOG_PARQUET.md
+cpp/src/arrow/io/mman.h
+cpp/src/arrow/util/random.h
+cpp/src/arrow/status.cc
+cpp/src/arrow/status.h
+cpp/src/arrow/vendored/*
+cpp/build-support/asan_symbolize.py
+cpp/build-support/cpplint.py
+cpp/build-support/lint_exclusions.txt
+cpp/build-support/iwyu/*
+cpp/cmake_modules/FindPythonLibsNew.cmake
+cpp/cmake_modules/SnappyCMakeLists.txt
+cpp/cmake_modules/SnappyConfig.h
+cpp/examples/parquet/parquet-arrow/cmake_modules/FindArrow.cmake
+cpp/src/parquet/.parquetcppversion
+cpp/src/generated/parquet_constants.cpp
+cpp/src/generated/parquet_constants.h
+cpp/src/generated/parquet_types.cpp
+cpp/src/generated/parquet_types.h
+cpp/src/plasma/thirdparty/ae/ae.c
+cpp/src/plasma/thirdparty/ae/ae.h
+cpp/src/plasma/thirdparty/ae/ae_epoll.c
+cpp/src/plasma/thirdparty/ae/ae_evport.c
+cpp/src/plasma/thirdparty/ae/ae_kqueue.c
+cpp/src/plasma/thirdparty/ae/ae_select.c
+cpp/src/plasma/thirdparty/ae/config.h
+cpp/src/plasma/thirdparty/ae/zmalloc.h
+cpp/src/plasma/thirdparty/dlmalloc.c
+cpp/thirdparty/flatbuffers/include/flatbuffers/base.h
+cpp/thirdparty/flatbuffers/include/flatbuffers/flatbuffers.h
+cpp/thirdparty/flatbuffers/include/flatbuffers/stl_emulation.h
+dev/requirements*.txt
+dev/archery/MANIFEST.in
+dev/archery/requirements*.txt
+dev/archery/archery/tests/fixtures/*
+dev/archery/archery/crossbow/tests/fixtures/*
+dev/release/rat_exclude_files.txt
+dev/tasks/homebrew-formulae/apache-arrow.rb
+dev/tasks/linux-packages/apache-arrow-apt-source/debian/apache-arrow-apt-source.install
+dev/tasks/linux-packages/apache-arrow-apt-source/debian/compat
+dev/tasks/linux-packages/apache-arrow-apt-source/debian/control
+dev/tasks/linux-packages/apache-arrow-apt-source/debian/rules
+dev/tasks/linux-packages/apache-arrow-apt-source/debian/source/format
+dev/tasks/linux-packages/apache-arrow/debian/compat
+dev/tasks/linux-packages/apache-arrow/debian/control.in
+dev/tasks/linux-packages/apache-arrow/debian/gir1.2-arrow-1.0.install
+dev/tasks/linux-packages/apache-arrow/debian/gir1.2-arrow-cuda-1.0.install
+dev/tasks/linux-packages/apache-arrow/debian/gir1.2-arrow-dataset-1.0.install
+dev/tasks/linux-packages/apache-arrow/debian/gir1.2-arrow-flight-1.0.install
+dev/tasks/linux-packages/apache-arrow/debian/gir1.2-gandiva-1.0.install
+dev/tasks/linux-packages/apache-arrow/debian/gir1.2-parquet-1.0.install
+dev/tasks/linux-packages/apache-arrow/debian/gir1.2-plasma-1.0.install
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-dev.install
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-glib-dev.install
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-glib-doc.doc-base
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-glib-doc.install
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-glib-doc.links
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-glib600.install
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-cuda-dev.install
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-cuda-glib-dev.install
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-cuda-glib600.install
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-cuda600.install
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset-dev.install
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset-glib-dev.install
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset-glib-doc.doc-base
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset-glib-doc.install
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset-glib-doc.links
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset-glib600.install
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset600.install
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight-dev.install
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight-glib-dev.install
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight-glib-doc.doc-base
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight-glib-doc.install
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight-glib-doc.links
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight-glib600.install
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight600.install
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-python-dev.install
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-python-flight-dev.install
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-python-flight600.install
+dev/tasks/linux-packages/apache-arrow/debian/libarrow-python600.install
+dev/tasks/linux-packages/apache-arrow/debian/libarrow600.install
+dev/tasks/linux-packages/apache-arrow/debian/libgandiva-dev.install
+dev/tasks/linux-packages/apache-arrow/debian/libgandiva-glib-dev.install
+dev/tasks/linux-packages/apache-arrow/debian/libgandiva-glib-doc.doc-base
+dev/tasks/linux-packages/apache-arrow/debian/libgandiva-glib-doc.install
+dev/tasks/linux-packages/apache-arrow/debian/libgandiva-glib-doc.links
+dev/tasks/linux-packages/apache-arrow/debian/libgandiva-glib600.install
+dev/tasks/linux-packages/apache-arrow/debian/libgandiva600.install
+dev/tasks/linux-packages/apache-arrow/debian/libparquet-dev.install
+dev/tasks/linux-packages/apache-arrow/debian/libparquet-glib-dev.install
+dev/tasks/linux-packages/apache-arrow/debian/libparquet-glib-doc.doc-base
+dev/tasks/linux-packages/apache-arrow/debian/libparquet-glib-doc.install
+dev/tasks/linux-packages/apache-arrow/debian/libparquet-glib-doc.links
+dev/tasks/linux-packages/apache-arrow/debian/libparquet-glib600.install
+dev/tasks/linux-packages/apache-arrow/debian/libparquet600.install
+dev/tasks/linux-packages/apache-arrow/debian/libplasma-dev.install
+dev/tasks/linux-packages/apache-arrow/debian/libplasma-glib-dev.install
+dev/tasks/linux-packages/apache-arrow/debian/libplasma-glib-doc.doc-base
+dev/tasks/linux-packages/apache-arrow/debian/libplasma-glib-doc.install
+dev/tasks/linux-packages/apache-arrow/debian/libplasma-glib-doc.links
+dev/tasks/linux-packages/apache-arrow/debian/libplasma-glib600.install
+dev/tasks/linux-packages/apache-arrow/debian/libplasma600.install
+dev/tasks/linux-packages/apache-arrow/debian/patches/series
+dev/tasks/linux-packages/apache-arrow/debian/plasma-store-server.install
+dev/tasks/linux-packages/apache-arrow/debian/rules
+dev/tasks/linux-packages/apache-arrow/debian/source/format
+dev/tasks/linux-packages/apache-arrow/debian/watch
+dev/tasks/requirements*.txt
+dev/tasks/conda-recipes/*
+docs/requirements.txt
+go/arrow/flight/Flight_grpc.pb.go
+go/go.sum
+go/arrow/Gopkg.lock
+go/arrow/flight/Flight.pb.go
+go/arrow/flight/Flight_grpc.pb.go
+go/arrow/internal/cpu/*
+go/arrow/type_string.go
+go/arrow/cdata/test/go.sum
+go/*.tmpldata
+go/*.s
+go/parquet/internal/gen-go/parquet/GoUnusedProtection__.go
+go/parquet/internal/gen-go/parquet/parquet-consts.go
+go/parquet/internal/gen-go/parquet/parquet.go
+js/.npmignore
+js/closure-compiler-scripts/*
+js/src/fb/*.ts
+js/yarn.lock
+js/.eslintignore
+python/cmake_modules
+python/cmake_modules/FindPythonLibsNew.cmake
+python/cmake_modules/SnappyCMakeLists.txt
+python/cmake_modules/SnappyConfig.h
+python/MANIFEST.in
+python/manylinux1/.dockerignore
+python/pyarrow/includes/__init__.pxd
+python/pyarrow/tests/__init__.py
+python/pyarrow/vendored/*
+python/requirements*.txt
+pax_global_header
+MANIFEST.in
+__init__.pxd
+__init__.py
+requirements.txt
+csharp/.gitattributes
+csharp/dummy.git/*
+csharp/src/Apache.Arrow/Flatbuf/*
+csharp/Apache.Arrow.sln
+csharp/examples/FluentBuilderExample/FluentBuilderExample.csproj
+csharp/examples/Examples.sln
+csharp/src/Apache.Arrow/Apache.Arrow.csproj
+csharp/src/Apache.Arrow/Properties/Resources.Designer.cs
+csharp/src/Apache.Arrow/Properties/Resources.resx
+csharp/src/Apache.Arrow.Flight/Apache.Arrow.Flight.csproj
+csharp/src/Apache.Arrow.Flight.AspNetCore/Apache.Arrow.Flight.AspNetCore.csproj
+csharp/test/Apache.Arrow.Benchmarks/Apache.Arrow.Benchmarks.csproj
+csharp/test/Apache.Arrow.Flight.Tests/Apache.Arrow.Flight.Tests.csproj
+csharp/test/Apache.Arrow.Flight.TestWeb/Apache.Arrow.Flight.TestWeb.csproj
+csharp/test/Apache.Arrow.IntegrationTest/Apache.Arrow.IntegrationTest.csproj
+csharp/test/Apache.Arrow.Tests/Apache.Arrow.Tests.csproj
+csharp/test/Apache.Arrow.Tests/app.config
+*.html
+*.sgml
+*.css
+*.png
+*.ico
+*.svg
+*.devhelp2
+*.scss
+r/R/arrowExports.R
+r/src/arrowExports.cpp
+r/DESCRIPTION
+r/LICENSE.md
+r/NAMESPACE
+r/.Rbuildignore
+r/arrow.Rproj
+r/README.md
+r/README.Rmd
+r/man/*.Rd
+r/cran-comments.md
+r/vignettes/*.Rmd
+r/tests/testthat/test-*.txt
+r/inst/include/cpp11.hpp
+r/inst/include/cpp11/*.hpp
+.gitattributes
+ruby/red-arrow/.yardopts
+julia/Arrow/Project.toml
+julia/Arrow/README.md
+julia/Arrow/docs/Manifest.toml
+julia/Arrow/docs/Project.toml
+julia/Arrow/docs/make.jl
+julia/Arrow/docs/mkdocs.yml
+julia/Arrow/docs/src/index.md
+julia/Arrow/docs/src/manual.md
+julia/Arrow/docs/src/reference.md
diff --git a/src/arrow/dev/release/run-rat.sh b/src/arrow/dev/release/run-rat.sh
new file mode 100755
index 000000000..2596a284c
--- /dev/null
+++ b/src/arrow/dev/release/run-rat.sh
@@ -0,0 +1,43 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+RAT_VERSION=0.13
+
+# download apache rat
+if [ ! -f apache-rat-${RAT_VERSION}.jar ]; then
+  curl -s https://repo1.maven.org/maven2/org/apache/rat/apache-rat/${RAT_VERSION}/apache-rat-${RAT_VERSION}.jar > apache-rat-${RAT_VERSION}.jar
+fi
+
+RAT="java -jar apache-rat-${RAT_VERSION}.jar -x "
+
+RELEASE_DIR=$(cd "$(dirname "$BASH_SOURCE")"; pwd)
+
+# generate the rat report
+$RAT $1 > rat.txt
+python $RELEASE_DIR/check-rat-report.py $RELEASE_DIR/rat_exclude_files.txt rat.txt > filtered_rat.txt
+cat filtered_rat.txt
+UNAPPROVED=`cat filtered_rat.txt  | grep "NOT APPROVED" | wc -l`
+
+if [ "0" -eq "${UNAPPROVED}" ]; then
+  echo "No unapproved licenses"
+else
+  echo "${UNAPPROVED} unapproved licences. Check rat report: rat.txt"
+  exit 1
+fi
diff --git a/src/arrow/dev/release/run-test.rb b/src/arrow/dev/release/run-test.rb
new file mode 100755
index 000000000..90df39b13
--- /dev/null
+++ b/src/arrow/dev/release/run-test.rb
@@ -0,0 +1,31 @@
+#!/usr/bin/env ruby
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+$VERBOSE = true
+
+require "pathname"
+
+test_dir = Pathname.new(__dir__)
+
+require "test-unit"
+require_relative "test-helper"
+
+ENV["TEST_UNIT_MAX_DIFF_TARGET_STRING_SIZE"] = "10000"
+
+exit(Test::Unit::AutoRunner.run(true, test_dir.to_s))
diff --git a/src/arrow/dev/release/setup-gpg-agent.sh b/src/arrow/dev/release/setup-gpg-agent.sh
new file mode 100644
index 000000000..9ff84f6f0
--- /dev/null
+++ b/src/arrow/dev/release/setup-gpg-agent.sh
@@ -0,0 +1,24 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+# source me
+eval $(gpg-agent --daemon --allow-preset-passphrase)
+gpg --use-agent -s LICENSE.txt
+rm -rf LICENSE.txt.gpg
diff --git a/src/arrow/dev/release/test-helper.rb b/src/arrow/dev/release/test-helper.rb
new file mode 100644
index 000000000..8a272ddfe
--- /dev/null
+++ b/src/arrow/dev/release/test-helper.rb
@@ -0,0 +1,96 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+require "English"
+require "cgi/util"
+require "fileutils"
+require "find"
+require "json"
+require "open-uri"
+require "rexml/document"
+require "tempfile"
+require "tmpdir"
+
+module CommandRunnable
+  class Error < StandardError
+  end
+
+  def sh(*command_line, check_result: true)
+    if command_line[0].is_a?(Hash)
+      env = command_line.shift
+    else
+      env = {}
+    end
+    stdout = Tempfile.new("command-stdout.log")
+    stderr = Tempfile.new("command-stderr.log")
+    success = system(env, *command_line, out: stdout.path, err: stderr.path)
+    if check_result
+      unless success
+        message = "Failed to run: #{command_line.join(" ")}\n"
+        message << "stdout:\n #{stdout.read}\n"
+        message << "stderr:\n #{stderr.read}"
+        raise Error, message
+      end
+    end
+    stdout.read
+  end
+end
+
+module GitRunnable
+  include CommandRunnable
+
+  def git(*args)
+    if args[0].is_a?(Hash)
+      env = args.shift
+    else
+      env = {}
+    end
+    sh(env, "git", *args)
+  end
+
+  def git_current_commit
+    git("rev-parse", "HEAD").chomp
+  end
+
+  def git_tags
+    git("tags").lines(chomp: true)
+  end
+end
+
+module VersionDetectable
+  def detect_versions
+    top_dir = Pathname(__dir__).parent.parent
+    cpp_cmake_lists = top_dir + "cpp" + "CMakeLists.txt"
+    @snapshot_version = cpp_cmake_lists.read[/ARROW_VERSION "(.+?)"/, 1]
+    @release_version = @snapshot_version.gsub(/-SNAPSHOT\z/, "")
+    @so_version = compute_so_version(@release_version)
+    @next_version = @release_version.gsub(/\A\d+/) {|major| major.succ}
+    @next_snapshot_version = "#{@next_version}-SNAPSHOT"
+    @next_so_version = compute_so_version(@next_version)
+    r_description = top_dir + "r" + "DESCRIPTION"
+    @previous_version = r_description.read[/^Version: (.+?)\.9000$/, 1]
+  end
+
+  def compute_so_version(version)
+    major, minor, _patch = version.split(".")
+    Integer(major, 10) * 100 + Integer(minor, 10)
+  end
+
+  def on_release_branch?
+    @snapshot_version == @release_version
+  end
+end
diff --git a/src/arrow/dev/release/utils-binary.sh b/src/arrow/dev/release/utils-binary.sh
new file mode 100644
index 000000000..31ebcd8e9
--- /dev/null
+++ b/src/arrow/dev/release/utils-binary.sh
@@ -0,0 +1,86 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+docker_image_name=apache-arrow/release-binary
+gpg_agent_extra_socket="$(gpgconf --list-dirs agent-extra-socket)"
+if [ $(uname) = "Darwin" ]; then
+  docker_uid=10000
+  docker_gid=10000
+else
+  docker_uid=$(id -u)
+  docker_gid=$(id -g)
+fi
+docker_ssh_key="${SOURCE_DIR}/binary/id_rsa"
+
+if [ ! -f "${docker_ssh_key}" ]; then
+  ssh-keygen -N "" -f "${docker_ssh_key}"
+fi
+
+docker_gpg_ssh() {
+  local ssh_port=$1
+  shift
+  local known_hosts_file=$(mktemp -t "arrow-binary-gpg-ssh-known-hosts.XXXXX")
+  local exit_code=
+  if ssh \
+      -o StrictHostKeyChecking=no \
+      -o UserKnownHostsFile=${known_hosts_file} \
+      -i "${docker_ssh_key}" \
+      -p ${ssh_port} \
+      -R "/home/arrow/.gnupg/S.gpg-agent:${gpg_agent_extra_socket}" \
+      arrow@127.0.0.1 \
+      "$@"; then
+    exit_code=$?;
+  else
+    exit_code=$?;
+  fi
+  rm -f ${known_hosts_file}
+  return ${exit_code}
+}
+
+docker_run() {
+  local container_id_dir=$(mktemp -d -t "arrow-binary-gpg-container.XXXXX")
+  local container_id_file=${container_id_dir}/id
+  docker \
+    run \
+    --cidfile ${container_id_file} \
+    --detach \
+    --publish-all \
+    --rm \
+    --volume "$PWD":/host \
+    ${docker_image_name} \
+    bash -c "
+if [ \$(id -u) -ne ${docker_uid} ]; then
+  usermod --uid ${docker_uid} arrow
+  chown -R arrow: ~arrow
+fi
+/usr/sbin/sshd -D
+"
+  local container_id=$(cat ${container_id_file})
+  local ssh_port=$(docker port ${container_id} | grep -E -o '[0-9]+$' | head -n 1)
+  # Wait for sshd available
+  while ! docker_gpg_ssh ${ssh_port} : > /dev/null 2>&1; do
+    sleep 0.1
+  done
+  gpg --export ${GPG_KEY_ID} | docker_gpg_ssh ${ssh_port} gpg --import
+  docker_gpg_ssh ${ssh_port} "$@"
+  docker kill ${container_id}
+  rm -rf ${container_id_dir}
+}
+
+docker build -t ${docker_image_name} "${SOURCE_DIR}/binary"
+
+chmod go-rwx "${docker_ssh_key}"
diff --git a/src/arrow/dev/release/utils-prepare.sh b/src/arrow/dev/release/utils-prepare.sh
new file mode 100644
index 000000000..7ba786a75
--- /dev/null
+++ b/src/arrow/dev/release/utils-prepare.sh
@@ -0,0 +1,145 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+ARROW_DIR="${SOURCE_DIR}/../.."
+
+update_versions() {
+  local base_version=$1
+  local next_version=$2
+  local type=$3
+
+  case ${type} in
+    release)
+      local version=${base_version}
+      local r_version=${base_version}
+      ;;
+    snapshot)
+      local version=${next_version}-SNAPSHOT
+      local r_version=${base_version}.9000
+      ;;
+  esac
+
+  pushd "${ARROW_DIR}/c_glib"
+  sed -i.bak -E -e \
+    "s/^version = '.+'/version = '${version}'/" \
+    meson.build
+  rm -f meson.build.bak
+  git add meson.build
+  popd
+
+  pushd "${ARROW_DIR}/ci/scripts"
+  sed -i.bak -E -e \
+    "s/^pkgver=.+/pkgver=${r_version}/" \
+    PKGBUILD
+  rm -f PKGBUILD.bak
+  git add PKGBUILD
+  popd
+
+  pushd "${ARROW_DIR}/cpp"
+  sed -i.bak -E -e \
+    "s/^set\(ARROW_VERSION \".+\"\)/set(ARROW_VERSION \"${version}\")/" \
+    CMakeLists.txt
+  rm -f CMakeLists.txt.bak
+  git add CMakeLists.txt
+
+  sed -i.bak -E -e \
+    "s/\"version-string\": \".+\"/\"version-string\": \"${version}\"/" \
+    vcpkg.json
+  rm -f vcpkg.json.bak
+  git add vcpkg.json
+  popd
+
+  pushd "${ARROW_DIR}/java"
+  mvn versions:set -DnewVersion=${version}
+  find . -type f -name pom.xml.versionsBackup -delete
+  git add "pom.xml"
+  git add "**/pom.xml"
+  popd
+
+  pushd "${ARROW_DIR}/csharp"
+  sed -i.bak -E -e \
+    "s/^    <Version>.+<\/Version>/    <Version>${version}<\/Version>/" \
+    Directory.Build.props
+  rm -f Directory.Build.props.bak
+  git add Directory.Build.props
+  popd
+
+  pushd "${ARROW_DIR}/dev/tasks/homebrew-formulae"
+  sed -i.bak -E -e \
+    "s/arrow-[0-9.]+[0-9]+/arrow-${r_version}/g" \
+    autobrew/apache-arrow.rb
+  rm -f autobrew/apache-arrow.rb.bak
+  git add autobrew/apache-arrow.rb
+  sed -i.bak -E -e \
+    "s/arrow-[0-9.\-]+[0-9SNAPHOT]+/arrow-${version}/g" \
+    apache-arrow.rb
+  rm -f apache-arrow.rb.bak
+  git add apache-arrow.rb
+  popd
+
+  pushd "${ARROW_DIR}/js"
+  sed -i.bak -E -e \
+    "s/^  \"version\": \".+\"/  \"version\": \"${version}\"/" \
+    package.json
+  rm -f package.json.bak
+  git add package.json
+  popd
+
+  pushd "${ARROW_DIR}/matlab"
+  sed -i.bak -E -e \
+    "s/^set\(MLARROW_VERSION \".+\"\)/set(MLARROW_VERSION \"${version}\")/" \
+    CMakeLists.txt
+  rm -f CMakeLists.txt.bak
+  git add CMakeLists.txt
+  popd
+
+  pushd "${ARROW_DIR}/python"
+  sed -i.bak -E -e \
+    "s/^default_version = '.+'/default_version = '${version}'/" \
+    setup.py
+  rm -f setup.py.bak
+  git add setup.py
+  popd
+
+  pushd "${ARROW_DIR}/r"
+  sed -i.bak -E -e \
+    "s/^Version: .+/Version: ${r_version}/" \
+    DESCRIPTION
+  rm -f DESCRIPTION.bak
+  git add DESCRIPTION
+  # Replace dev version with release version
+  sed -i.bak -E -e \
+    "0,/^# arrow /s/^# arrow .+/# arrow ${base_version}/" \
+    NEWS.md
+  if [ ${type} = "snapshot" ]; then
+    # Add a news entry for the new dev version
+    sed -i.bak -E -e \
+      "0,/^# arrow /s/^(# arrow .+)/# arrow ${r_version}\n\n\1/" \
+      NEWS.md
+  fi
+  rm -f NEWS.md.bak
+  git add NEWS.md
+  popd
+
+  pushd "${ARROW_DIR}/ruby"
+  sed -i.bak -E -e \
+    "s/^  VERSION = \".+\"/  VERSION = \"${version}\"/g" \
+    */*/*/version.rb
+  rm -f */*/*/version.rb.bak
+  git add */*/*/version.rb
+  popd
+}
diff --git a/src/arrow/dev/release/verify-apt.sh b/src/arrow/dev/release/verify-apt.sh
new file mode 100755
index 000000000..3773e27fa
--- /dev/null
+++ b/src/arrow/dev/release/verify-apt.sh
@@ -0,0 +1,194 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+set -exu
+
+if [ $# -lt 2 ]; then
+  echo "Usage: $0 VERSION rc"
+  echo "       $0 VERSION staging-rc"
+  echo "       $0 VERSION release"
+  echo "       $0 VERSION staging-release"
+  echo "       $0 VERSION local"
+  echo " e.g.: $0 0.13.0 rc                # Verify 0.13.0 RC"
+  echo " e.g.: $0 0.13.0 staging-rc        # Verify 0.13.0 RC on staging"
+  echo " e.g.: $0 0.13.0 release           # Verify 0.13.0"
+  echo " e.g.: $0 0.13.0 staging-release   # Verify 0.13.0 on staging"
+  echo " e.g.: $0 0.13.0-dev20210203 local # Verify 0.13.0-dev20210203 on local"
+  exit 1
+fi
+
+VERSION="$1"
+TYPE="$2"
+
+local_prefix="/arrow/dev/tasks/linux-packages"
+
+
+echo "::group::Prepare repository"
+
+export DEBIAN_FRONTEND=noninteractive
+
+APT_INSTALL="apt install -y -V --no-install-recommends"
+
+apt update
+${APT_INSTALL} \
+  ca-certificates \
+  curl \
+  lsb-release
+
+code_name="$(lsb_release --codename --short)"
+distribution="$(lsb_release --id --short | tr 'A-Z' 'a-z')"
+artifactory_base_url="https://apache.jfrog.io/artifactory/arrow/${distribution}"
+case "${TYPE}" in
+  rc|staging-rc|staging-release)
+    suffix=${TYPE%-release}
+    artifactory_base_url+="-${suffix}"
+    ;;
+esac
+
+have_flight=yes
+have_plasma=yes
+workaround_missing_packages=()
+case "${distribution}-${code_name}" in
+  debian-*)
+    sed \
+      -i"" \
+      -e "s/ main$/ main contrib non-free/g" \
+      /etc/apt/sources.list
+    ;;
+esac
+if [ "$(arch)" = "aarch64" ]; then
+  have_plasma=no
+fi
+
+if [ "${TYPE}" = "local" ]; then
+  case "${VERSION}" in
+    *-dev*)
+      package_version="$(echo "${VERSION}" | sed -e 's/-dev\(.*\)$/~dev\1/g')"
+      ;;
+    *-rc*)
+      package_version="$(echo "${VERSION}" | sed -e 's/-rc.*$//g')"
+      ;;
+    *)
+      package_version="${VERSION}"
+      ;;
+  esac
+  package_version+="-1"
+  apt_source_path="${local_prefix}/apt/repositories"
+  apt_source_path+="/${distribution}/pool/${code_name}/main"
+  apt_source_path+="/a/apache-arrow-apt-source"
+  apt_source_path+="/apache-arrow-apt-source_${package_version}_all.deb"
+  ${APT_INSTALL} "${apt_source_path}"
+else
+  package_version="${VERSION}-1"
+  apt_source_base_name="apache-arrow-apt-source-latest-${code_name}.deb"
+  curl \
+    --output "${apt_source_base_name}" \
+    "${artifactory_base_url}/${apt_source_base_name}"
+  ${APT_INSTALL} "./${apt_source_base_name}"
+fi
+
+if [ "${TYPE}" = "local" ]; then
+  sed \
+    -i"" \
+    -e "s,^URIs: .*$,URIs: file://${local_prefix}/apt/repositories/${distribution},g" \
+    /etc/apt/sources.list.d/apache-arrow.sources
+  keys="${local_prefix}/KEYS"
+  if [ -f "${keys}" ]; then
+    gpg \
+      --no-default-keyring \
+      --keyring /usr/share/keyrings/apache-arrow-apt-source.gpg \
+      --import "${keys}"
+  fi
+else
+  case "${TYPE}" in
+    rc|staging-rc|staging-release)
+      suffix=${TYPE%-release}
+      sed \
+        -i"" \
+        -e "s,^URIs: \\(.*\\)/,URIs: \\1-${suffix}/,g" \
+        /etc/apt/sources.list.d/apache-arrow.sources
+      ;;
+  esac
+fi
+
+apt update
+
+echo "::endgroup::"
+
+
+echo "::group::Test Apache Arrow C++"
+${APT_INSTALL} libarrow-dev=${package_version}
+required_packages=()
+required_packages+=(cmake)
+required_packages+=(g++)
+required_packages+=(git)
+required_packages+=(make)
+required_packages+=(pkg-config)
+required_packages+=(${workaround_missing_packages[@]})
+${APT_INSTALL} ${required_packages[@]}
+mkdir -p build
+cp -a /arrow/cpp/examples/minimal_build build
+pushd build/minimal_build
+cmake .
+make -j$(nproc)
+./arrow_example
+c++ -std=c++11 -o arrow_example example.cc $(pkg-config --cflags --libs arrow)
+./arrow_example
+popd
+echo "::endgroup::"
+
+
+echo "::group::Test Apache Arrow GLib"
+${APT_INSTALL} libarrow-glib-dev=${package_version}
+${APT_INSTALL} libarrow-glib-doc=${package_version}
+echo "::endgroup::"
+
+
+if [ "${have_flight}" = "yes" ]; then
+  echo "::group::Test Apache Arrow Flight"
+  ${APT_INSTALL} libarrow-flight-glib-dev=${package_version}
+  ${APT_INSTALL} libarrow-flight-glib-doc=${package_version}
+  echo "::endgroup::"
+fi
+
+
+echo "::group::Test libarrow-python"
+${APT_INSTALL} libarrow-python-dev=${package_version}
+echo "::endgroup::"
+
+
+if [ "${have_plasma}" = "yes" ]; then
+  echo "::group::Test Plasma"
+  ${APT_INSTALL} libplasma-glib-dev=${package_version}
+  ${APT_INSTALL} libplasma-glib-doc=${package_version}
+  ${APT_INSTALL} plasma-store-server=${package_version}
+  echo "::endgroup::"
+fi
+
+
+echo "::group::Test Gandiva"
+${APT_INSTALL} libgandiva-glib-dev=${package_version}
+${APT_INSTALL} libgandiva-glib-doc=${package_version}
+echo "::endgroup::"
+
+
+echo "::group::Test Parquet"
+${APT_INSTALL} libparquet-glib-dev=${package_version}
+${APT_INSTALL} libparquet-glib-doc=${package_version}
+echo "::endgroup::"
diff --git a/src/arrow/dev/release/verify-release-candidate-wheels.bat b/src/arrow/dev/release/verify-release-candidate-wheels.bat
new file mode 100644
index 000000000..5bcefe80d
--- /dev/null
+++ b/src/arrow/dev/release/verify-release-candidate-wheels.bat
@@ -0,0 +1,107 @@
+@rem Licensed to the Apache Software Foundation (ASF) under one
+@rem or more contributor license agreements.  See the NOTICE file
+@rem distributed with this work for additional information
+@rem regarding copyright ownership.  The ASF licenses this file
+@rem to you under the Apache License, Version 2.0 (the
+@rem "License"); you may not use this file except in compliance
+@rem with the License.  You may obtain a copy of the License at
+@rem
+@rem   http://www.apache.org/licenses/LICENSE-2.0
+@rem
+@rem Unless required by applicable law or agreed to in writing,
+@rem software distributed under the License is distributed on an
+@rem "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+@rem KIND, either express or implied.  See the License for the
+@rem specific language governing permissions and limitations
+@rem under the License.
+
+@rem This script downloads and installs all Windows wheels for a release
+@rem candidate into temporary conda environments and makes sure that imports
+@rem work
+
+@rem To run the script:
+@rem verify-release-candidate-wheels.bat VERSION RC_NUM
+
+@echo on
+
+set _CURRENT_DIR=%CD%
+set _VERIFICATION_DIR=C:\tmp\arrow-verify-release-wheels
+
+if not exist "C:\tmp\" mkdir C:\tmp
+if exist %_VERIFICATION_DIR% rd %_VERIFICATION_DIR% /s /q
+if not exist %_VERIFICATION_DIR% mkdir %_VERIFICATION_DIR%
+
+cd %_VERIFICATION_DIR%
+
+@rem clone Arrow repository to obtain test requirements
+set GIT_ENV_PATH=%_VERIFICATION_DIR%\_git
+call conda create -p %GIT_ENV_PATH% ^
+    --no-shortcuts -f -q -y git ^
+    || EXIT /B 1
+call activate %GIT_ENV_PATH%
+
+git clone https://github.com/apache/arrow.git || EXIT /B 1
+pushd arrow
+git submodule update --init
+popd
+
+set ARROW_VERSION=%1
+set RC_NUMBER=%2
+
+python arrow\dev\release\download_rc_binaries.py %ARROW_VERSION% %RC_NUMBER% ^
+    --package_type python ^
+    --regex=".*win_amd64.*" || EXIT /B 1
+
+call deactivate
+
+set ARROW_TEST_DATA=%cd%\arrow\testing\data
+
+CALL :verify_wheel 3.6 m
+if errorlevel 1 GOTO error
+
+CALL :verify_wheel 3.7 m
+if errorlevel 1 GOTO error
+
+CALL :verify_wheel 3.8
+if errorlevel 1 GOTO error
+
+:done
+cd %_CURRENT_DIR%
+
+EXIT /B %ERRORLEVEL%
+
+:error
+call deactivate
+cd %_CURRENT_DIR%
+
+EXIT /B 1
+
+@rem a batch function to verify a single wheel
+:verify_wheel
+
+set PY_VERSION=%1
+set ABI_TAG=%2
+set PY_VERSION_NO_PERIOD=%PY_VERSION:.=%
+
+set CONDA_ENV_PATH=%_VERIFICATION_DIR%\_verify-wheel-%PY_VERSION%
+call conda create -p %CONDA_ENV_PATH% ^
+    --no-shortcuts -f -q -y python=%PY_VERSION% ^
+    || EXIT /B 1
+call activate %CONDA_ENV_PATH%
+
+set WHEEL_FILENAME=pyarrow-%ARROW_VERSION%-cp%PY_VERSION_NO_PERIOD%-cp%PY_VERSION_NO_PERIOD%%ABI_TAG%-win_amd64.whl
+
+pip install python-rc\%ARROW_VERSION%-rc%RC_NUMBER%\%WHEEL_FILENAME% || EXIT /B 1
+python -c "import pyarrow" || EXIT /B 1
+python -c "import pyarrow.parquet" || EXIT /B 1
+python -c "import pyarrow.flight" || EXIT /B 1
+python -c "import pyarrow.dataset" || EXIT /B 1
+
+pip install -r arrow\python\requirements-test.txt || EXIT /B 1
+pytest %CONDA_ENV_PATH%\Lib\site-packages\pyarrow --pdb -v || EXIT /B 1
+
+:done
+
+call deactivate
+
+EXIT /B 0
diff --git a/src/arrow/dev/release/verify-release-candidate.bat b/src/arrow/dev/release/verify-release-candidate.bat
new file mode 100644
index 000000000..fee8c01bc
--- /dev/null
+++ b/src/arrow/dev/release/verify-release-candidate.bat
@@ -0,0 +1,130 @@
+@rem Licensed to the Apache Software Foundation (ASF) under one
+@rem or more contributor license agreements.  See the NOTICE file
+@rem distributed with this work for additional information
+@rem regarding copyright ownership.  The ASF licenses this file
+@rem to you under the Apache License, Version 2.0 (the
+@rem "License"); you may not use this file except in compliance
+@rem with the License.  You may obtain a copy of the License at
+@rem
+@rem   http://www.apache.org/licenses/LICENSE-2.0
+@rem
+@rem Unless required by applicable law or agreed to in writing,
+@rem software distributed under the License is distributed on an
+@rem "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+@rem KIND, either express or implied.  See the License for the
+@rem specific language governing permissions and limitations
+@rem under the License.
+
+@rem To run the script:
+@rem verify-release-candidate.bat VERSION RC_NUM
+
+@echo on
+
+if not exist "C:\tmp\" mkdir C:\tmp
+if exist "C:\tmp\arrow-verify-release" rd C:\tmp\arrow-verify-release /s /q
+if not exist "C:\tmp\arrow-verify-release" mkdir C:\tmp\arrow-verify-release
+
+set _VERIFICATION_DIR=C:\tmp\arrow-verify-release
+set _VERIFICATION_DIR_UNIX=C:/tmp/arrow-verify-release
+set _VERIFICATION_CONDA_ENV=%_VERIFICATION_DIR%\conda-env
+set _DIST_URL=https://dist.apache.org/repos/dist/dev/arrow
+set _TARBALL=apache-arrow-%1.tar.gz
+set ARROW_SOURCE=%_VERIFICATION_DIR%\apache-arrow-%1
+set INSTALL_DIR=%_VERIFICATION_DIR%\install
+
+@rem Requires GNU Wget for Windows
+wget --no-check-certificate -O %_TARBALL% %_DIST_URL%/apache-arrow-%1-rc%2/%_TARBALL% || exit /B 1
+
+tar xf %_TARBALL% -C %_VERIFICATION_DIR_UNIX%
+
+set PYTHON=3.6
+
+@rem Using call with conda.bat seems necessary to avoid terminating the batch
+@rem script execution
+call conda create --no-shortcuts -c conda-forge -f -q -y -p %_VERIFICATION_CONDA_ENV% ^
+    --file=ci\conda_env_cpp.txt ^
+    --file=ci\conda_env_python.txt ^
+    git ^
+    python=%PYTHON% ^
+    || exit /B 1
+
+call activate %_VERIFICATION_CONDA_ENV% || exit /B 1
+
+set GENERATOR=Visual Studio 15 2017 Win64
+set CONFIGURATION=release
+
+pushd %ARROW_SOURCE%
+
+set ARROW_HOME=%INSTALL_DIR%
+set PARQUET_HOME=%INSTALL_DIR%
+set PATH=%INSTALL_DIR%\bin;%PATH%
+
+@rem Build and test Arrow C++ libraries
+mkdir %ARROW_SOURCE%\cpp\build
+pushd %ARROW_SOURCE%\cpp\build
+
+@rem This is the path for Visual Studio Community 2017
+call "C:\Program Files (x86)\Microsoft Visual Studio\2017\Community\Common7\Tools\VsDevCmd.bat" -arch=amd64
+
+@rem NOTE(wesm): not using Ninja for now to be able to more easily control the
+@rem generator used
+
+cmake -G "%GENERATOR%" ^
+      -DARROW_BOOST_USE_SHARED=ON ^
+      -DARROW_BUILD_STATIC=OFF ^
+      -DARROW_BUILD_TESTS=ON ^
+      -DARROW_CXXFLAGS="/MP" ^
+      -DARROW_DATASET=ON ^
+      -DARROW_FLIGHT=ON ^
+      -DARROW_MIMALLOC=ON ^
+      -DARROW_PARQUET=ON ^
+      -DARROW_PYTHON=ON ^
+      -DARROW_WITH_BROTLI=ON ^
+      -DARROW_WITH_BZ2=ON ^
+      -DARROW_WITH_LZ4=ON ^
+      -DARROW_WITH_SNAPPY=ON ^
+      -DARROW_WITH_ZLIB=ON ^
+      -DARROW_WITH_ZSTD=ON ^
+      -DCMAKE_BUILD_TYPE=%CONFIGURATION% ^
+      -DCMAKE_INSTALL_PREFIX=%ARROW_HOME% ^
+      -DCMAKE_UNITY_BUILD=ON ^
+      -DGTest_SOURCE=BUNDLED ^
+      ..  || exit /B
+
+cmake --build . --target INSTALL --config Release || exit /B 1
+
+@rem NOTE(wesm): Building googletest is flaky for me with ninja. Building it
+@rem first fixes the problem
+
+@rem ninja googletest_ep || exit /B 1
+@rem ninja install || exit /B 1
+
+@rem Get testing datasets for Parquet unit tests
+git clone https://github.com/apache/parquet-testing.git %_VERIFICATION_DIR%\parquet-testing
+set PARQUET_TEST_DATA=%_VERIFICATION_DIR%\parquet-testing\data
+
+git clone https://github.com/apache/arrow-testing.git %_VERIFICATION_DIR%\arrow-testing
+set ARROW_TEST_DATA=%_VERIFICATION_DIR%\arrow-testing\data
+
+@rem Needed so python-test.exe works
+set PYTHONPATH_ORIGINAL=%PYTHONPATH%
+set PYTHONPATH=%CONDA_PREFIX%\Lib;%CONDA_PREFIX%\Lib\site-packages;%CONDA_PREFIX%\DLLs;%CONDA_PREFIX%;%PYTHONPATH%
+ctest -VV  || exit /B 1
+set PYTHONPATH=%PYTHONPATH_ORIGINAL%
+popd
+
+@rem Build and import pyarrow
+pushd %ARROW_SOURCE%\python
+
+pip install -r requirements-test.txt || exit /B 1
+
+set PYARROW_CMAKE_GENERATOR=%GENERATOR%
+set PYARROW_WITH_FLIGHT=1
+set PYARROW_WITH_PARQUET=1
+set PYARROW_WITH_DATASET=1
+python setup.py build_ext --inplace --bundle-arrow-cpp bdist_wheel || exit /B 1
+pytest pyarrow -v -s --enable-parquet || exit /B 1
+
+popd
+
+call deactivate
diff --git a/src/arrow/dev/release/verify-release-candidate.sh b/src/arrow/dev/release/verify-release-candidate.sh
new file mode 100755
index 000000000..3da89360c
--- /dev/null
+++ b/src/arrow/dev/release/verify-release-candidate.sh
@@ -0,0 +1,817 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+#
+
+# Requirements
+# - Ruby >= 2.3
+# - Maven >= 3.3.9
+# - JDK >=7
+# - gcc >= 4.8
+# - Node.js >= 11.12 (best way is to use nvm)
+# - Go >= 1.15
+#
+# If using a non-system Boost, set BOOST_ROOT and add Boost libraries to
+# LD_LIBRARY_PATH.
+#
+# To reuse build artifacts between runs set ARROW_TMPDIR environment variable to
+# a directory where the temporary files should be placed to, note that this
+# directory is not cleaned up automatically.
+
+case $# in
+  3) ARTIFACT="$1"
+     VERSION="$2"
+     RC_NUMBER="$3"
+     case $ARTIFACT in
+       source|binaries|wheels) ;;
+       *) echo "Invalid argument: '${ARTIFACT}', valid options are \
+'source', 'binaries', or 'wheels'"
+          exit 1
+          ;;
+     esac
+     ;;
+  *) echo "Usage: $0 source|binaries X.Y.Z RC_NUMBER"
+     exit 1
+     ;;
+esac
+
+set -e
+set -x
+set -o pipefail
+
+SOURCE_DIR="$(cd "$(dirname "${BASH_SOURCE[0]:-$0}")" && pwd)"
+ARROW_DIR="$(dirname $(dirname ${SOURCE_DIR}))"
+
+detect_cuda() {
+  if ! (which nvcc && which nvidia-smi) > /dev/null; then
+    return 1
+  fi
+
+  local n_gpus=$(nvidia-smi --list-gpus | wc -l)
+  return $((${n_gpus} < 1))
+}
+
+# Build options for the C++ library
+
+if [ -z "${ARROW_CUDA:-}" ] && detect_cuda; then
+  ARROW_CUDA=ON
+fi
+: ${ARROW_CUDA:=OFF}
+: ${ARROW_FLIGHT:=ON}
+: ${ARROW_GANDIVA:=ON}
+
+ARROW_DIST_URL='https://dist.apache.org/repos/dist/dev/arrow'
+
+download_dist_file() {
+  curl \
+    --silent \
+    --show-error \
+    --fail \
+    --location \
+    --remote-name $ARROW_DIST_URL/$1
+}
+
+download_rc_file() {
+  download_dist_file apache-arrow-${VERSION}-rc${RC_NUMBER}/$1
+}
+
+import_gpg_keys() {
+  download_dist_file KEYS
+  gpg --import KEYS
+}
+
+fetch_archive() {
+  local dist_name=$1
+  download_rc_file ${dist_name}.tar.gz
+  download_rc_file ${dist_name}.tar.gz.asc
+  download_rc_file ${dist_name}.tar.gz.sha256
+  download_rc_file ${dist_name}.tar.gz.sha512
+  gpg --verify ${dist_name}.tar.gz.asc ${dist_name}.tar.gz
+  shasum -a 256 -c ${dist_name}.tar.gz.sha256
+  shasum -a 512 -c ${dist_name}.tar.gz.sha512
+}
+
+verify_dir_artifact_signatures() {
+  # verify the signature and the checksums of each artifact
+  find $1 -name '*.asc' | while read sigfile; do
+    artifact=${sigfile/.asc/}
+    gpg --verify $sigfile $artifact || exit 1
+
+    # go into the directory because the checksum files contain only the
+    # basename of the artifact
+    pushd $(dirname $artifact)
+    base_artifact=$(basename $artifact)
+    if [ -f $base_artifact.sha256 ]; then
+      shasum -a 256 -c $base_artifact.sha256 || exit 1
+    fi
+    shasum -a 512 -c $base_artifact.sha512 || exit 1
+    popd
+  done
+}
+
+test_binary() {
+  local download_dir=binaries
+  mkdir -p ${download_dir}
+
+  ${PYTHON:-python} $SOURCE_DIR/download_rc_binaries.py $VERSION $RC_NUMBER \
+         --dest=${download_dir}
+
+  verify_dir_artifact_signatures ${download_dir}
+}
+
+test_apt() {
+  for target in "debian:buster" \
+                "arm64v8/debian:buster" \
+                "debian:bullseye" \
+                "arm64v8/debian:bullseye" \
+                "debian:bookworm" \
+                "arm64v8/debian:bookworm" \
+                "ubuntu:bionic" \
+                "arm64v8/ubuntu:bionic" \
+                "ubuntu:focal" \
+                "arm64v8/ubuntu:focal" \
+                "ubuntu:hirsute" \
+                "arm64v8/ubuntu:hirsute" \
+                "ubuntu:impish" \
+                "arm64v8/ubuntu:impish"; do \
+    case "${target}" in
+      arm64v8/*)
+        if [ "$(arch)" = "aarch64" -o -e /usr/bin/qemu-aarch64-static ]; then
+          case "${target}" in
+          arm64v8/debian:buster|arm64v8/ubuntu:bionic|arm64v8/ubuntu:focal)
+            ;; # OK
+          *)
+            # qemu-user-static in Ubuntu 20.04 has a crash bug:
+            #   https://bugs.launchpad.net/qemu/+bug/1749393
+            continue
+            ;;
+          esac
+        else
+          continue
+        fi
+        ;;
+    esac
+    if ! docker run --rm -v "${SOURCE_DIR}"/../..:/arrow:delegated \
+           "${target}" \
+           /arrow/dev/release/verify-apt.sh \
+           "${VERSION}" \
+           "rc"; then
+      echo "Failed to verify the APT repository for ${target}"
+      exit 1
+    fi
+  done
+}
+
+test_yum() {
+  for target in "almalinux:8" \
+                "arm64v8/almalinux:8" \
+                "amazonlinux:2" \
+                "centos:7" \
+                "centos:8" \
+                "arm64v8/centos:8"; do
+    case "${target}" in
+      arm64v8/*)
+        if [ "$(arch)" = "aarch64" -o -e /usr/bin/qemu-aarch64-static ]; then
+          : # OK
+        else
+          continue
+        fi
+        ;;
+    esac
+    if ! docker run --rm -v "${SOURCE_DIR}"/../..:/arrow:delegated \
+           "${target}" \
+           /arrow/dev/release/verify-yum.sh \
+           "${VERSION}" \
+           "rc"; then
+      echo "Failed to verify the Yum repository for ${target}"
+      exit 1
+    fi
+  done
+}
+
+
+setup_tempdir() {
+  cleanup() {
+    if [ "${TEST_SUCCESS}" = "yes" ]; then
+      rm -fr "${ARROW_TMPDIR}"
+    else
+      echo "Failed to verify release candidate. See ${ARROW_TMPDIR} for details."
+    fi
+  }
+
+  if [ -z "${ARROW_TMPDIR}" ]; then
+    # clean up automatically if ARROW_TMPDIR is not defined
+    ARROW_TMPDIR=$(mktemp -d -t "$1.XXXXX")
+    trap cleanup EXIT
+  else
+    # don't clean up automatically
+    mkdir -p "${ARROW_TMPDIR}"
+  fi
+}
+
+setup_miniconda() {
+  # Setup short-lived miniconda for Python and integration tests
+  OS="$(uname)"
+  if [ "${OS}" == "Darwin" ]; then
+    OS=MacOSX
+  fi
+  ARCH="$(uname -m)"
+  MINICONDA_URL="https://github.com/conda-forge/miniforge/releases/latest/download/Miniforge3-${OS}-${ARCH}.sh"
+
+  MINICONDA=$PWD/test-miniconda
+
+  if [ ! -d "${MINICONDA}" ]; then
+    # Setup miniconda only if the directory doesn't exist yet
+    wget -O miniconda.sh $MINICONDA_URL
+    bash miniconda.sh -b -p $MINICONDA
+    rm -f miniconda.sh
+  fi
+  echo "Installed miniconda at ${MINICONDA}"
+
+  . $MINICONDA/etc/profile.d/conda.sh
+
+  conda create -n arrow-test -y -q -c conda-forge \
+    python=3.8 \
+    nomkl \
+    numpy \
+    pandas \
+    cython
+  conda activate arrow-test
+  echo "Using conda environment ${CONDA_PREFIX}"
+}
+
+# Build and test Java (Requires newer Maven -- I used 3.3.9)
+
+test_package_java() {
+  pushd java
+
+  mvn test
+  mvn package
+
+  popd
+}
+
+# Build and test C++
+
+test_and_install_cpp() {
+  mkdir -p cpp/build
+  pushd cpp/build
+
+  ARROW_CMAKE_OPTIONS="
+${ARROW_CMAKE_OPTIONS:-}
+-DCMAKE_INSTALL_PREFIX=$ARROW_HOME
+-DCMAKE_INSTALL_LIBDIR=lib
+-DARROW_FLIGHT=${ARROW_FLIGHT}
+-DARROW_PLASMA=ON
+-DARROW_ORC=ON
+-DARROW_PYTHON=ON
+-DARROW_GANDIVA=${ARROW_GANDIVA}
+-DARROW_PARQUET=ON
+-DARROW_DATASET=ON
+-DPARQUET_REQUIRE_ENCRYPTION=ON
+-DARROW_VERBOSE_THIRDPARTY_BUILD=ON
+-DARROW_WITH_BZ2=ON
+-DARROW_WITH_ZLIB=ON
+-DARROW_WITH_ZSTD=ON
+-DARROW_WITH_LZ4=ON
+-DARROW_WITH_SNAPPY=ON
+-DARROW_WITH_BROTLI=ON
+-DARROW_BOOST_USE_SHARED=ON
+-DCMAKE_BUILD_TYPE=release
+-DARROW_BUILD_TESTS=ON
+-DARROW_BUILD_INTEGRATION=ON
+-DARROW_CUDA=${ARROW_CUDA}
+-DARROW_DEPENDENCY_SOURCE=AUTO
+"
+  cmake $ARROW_CMAKE_OPTIONS ..
+
+  make -j$NPROC install
+
+  # TODO: ARROW-5036: plasma-serialization_tests broken
+  # TODO: ARROW-5054: libgtest.so link failure in flight-server-test
+  LD_LIBRARY_PATH=$PWD/release:$LD_LIBRARY_PATH ctest \
+    --exclude-regex "plasma-serialization_tests" \
+    -j$NPROC \
+    --output-on-failure \
+    -L unittest
+  popd
+}
+
+test_csharp() {
+  pushd csharp
+
+  local csharp_bin=${PWD}/bin
+  mkdir -p ${csharp_bin}
+
+  if which dotnet > /dev/null 2>&1; then
+    if ! which sourcelink > /dev/null 2>&1; then
+      local dotnet_tools_dir=$HOME/.dotnet/tools
+      if [ -d "${dotnet_tools_dir}" ]; then
+        PATH="${dotnet_tools_dir}:$PATH"
+      fi
+    fi
+  else
+    local dotnet_version=3.1.405
+    local dotnet_platform=
+    case "$(uname)" in
+      Linux)
+        dotnet_platform=linux
+        ;;
+      Darwin)
+        dotnet_platform=macos
+        ;;
+    esac
+    local dotnet_download_thank_you_url=https://dotnet.microsoft.com/download/thank-you/dotnet-sdk-${dotnet_version}-${dotnet_platform}-x64-binaries
+    local dotnet_download_url=$( \
+      curl --location ${dotnet_download_thank_you_url} | \
+        grep 'window\.open' | \
+        grep -E -o '[^"]+' | \
+        sed -n 2p)
+    curl ${dotnet_download_url} | \
+      tar xzf - -C ${csharp_bin}
+    PATH=${csharp_bin}:${PATH}
+  fi
+
+  dotnet test
+  mv dummy.git ../.git
+  dotnet pack -c Release
+  mv ../.git dummy.git
+
+  if ! which sourcelink > /dev/null 2>&1; then
+    dotnet tool install --tool-path ${csharp_bin} sourcelink
+    PATH=${csharp_bin}:${PATH}
+    if ! sourcelink --help > /dev/null 2>&1; then
+      export DOTNET_ROOT=${csharp_bin}
+    fi
+  fi
+
+  sourcelink test artifacts/Apache.Arrow/Release/netstandard1.3/Apache.Arrow.pdb
+  sourcelink test artifacts/Apache.Arrow/Release/netcoreapp2.1/Apache.Arrow.pdb
+
+  popd
+}
+
+# Build and test Python
+
+test_python() {
+  pushd python
+
+  pip install -r requirements-build.txt -r requirements-test.txt
+
+  export PYARROW_WITH_DATASET=1
+  export PYARROW_WITH_PARQUET=1
+  export PYARROW_WITH_PLASMA=1
+  if [ "${ARROW_CUDA}" = "ON" ]; then
+    export PYARROW_WITH_CUDA=1
+  fi
+  if [ "${ARROW_FLIGHT}" = "ON" ]; then
+    export PYARROW_WITH_FLIGHT=1
+  fi
+  if [ "${ARROW_GANDIVA}" = "ON" ]; then
+    export PYARROW_WITH_GANDIVA=1
+  fi
+
+  python setup.py build_ext --inplace
+  pytest pyarrow -v --pdb
+
+  popd
+}
+
+test_glib() {
+  pushd c_glib
+
+  pip install meson
+
+  meson build --prefix=$ARROW_HOME --libdir=lib
+  ninja -C build
+  ninja -C build install
+
+  export GI_TYPELIB_PATH=$ARROW_HOME/lib/girepository-1.0:$GI_TYPELIB_PATH
+
+  if ! bundle --version; then
+    gem install --no-document bundler
+  fi
+
+  bundle install --path vendor/bundle
+  bundle exec ruby test/run-test.rb
+
+  popd
+}
+
+test_js() {
+  pushd js
+
+  if [ "${INSTALL_NODE}" -gt 0 ]; then
+    export NVM_DIR="`pwd`/.nvm"
+    mkdir -p $NVM_DIR
+    curl -o- https://raw.githubusercontent.com/nvm-sh/nvm/v0.35.3/install.sh | \
+      PROFILE=/dev/null bash
+    [ -s "$NVM_DIR/nvm.sh" ] && \. "$NVM_DIR/nvm.sh"
+
+    nvm install --lts
+    npm install -g yarn
+  fi
+
+  yarn --frozen-lockfile
+  yarn run-s clean:all lint build
+  yarn test
+  popd
+}
+
+test_ruby() {
+  pushd ruby
+
+  local modules="red-arrow red-arrow-dataset red-plasma red-parquet"
+  if [ "${ARROW_CUDA}" = "ON" ]; then
+    modules="${modules} red-arrow-cuda"
+  fi
+  if [ "${ARROW_FLIGHT}" = "ON" ]; then
+    modules="${modules} red-arrow-flight"
+  fi
+  if [ "${ARROW_GANDIVA}" = "ON" ]; then
+    modules="${modules} red-gandiva"
+  fi
+
+  for module in ${modules}; do
+    pushd ${module}
+    bundle install --path vendor/bundle
+    bundle exec ruby test/run-test.rb
+    popd
+  done
+
+  popd
+}
+
+test_go() {
+  local VERSION=1.15.14
+  local ARCH=amd64
+
+  if [ "$(uname)" == "Darwin" ]; then
+    local OS=darwin
+  else
+    local OS=linux
+  fi
+
+  local GO_ARCHIVE=go$VERSION.$OS-$ARCH.tar.gz
+  wget https://dl.google.com/go/$GO_ARCHIVE
+
+  mkdir -p local-go
+  tar -xzf $GO_ARCHIVE -C local-go
+  rm -f $GO_ARCHIVE
+
+  export GOROOT=`pwd`/local-go/go
+  export GOPATH=`pwd`/local-go/gopath
+  export PATH=$GOROOT/bin:$GOPATH/bin:$PATH
+
+  pushd go/arrow
+
+  go get -v ./...
+  go test ./...
+  go clean -modcache
+
+  popd
+}
+
+# Run integration tests
+test_integration() {
+  JAVA_DIR=$PWD/java
+  CPP_BUILD_DIR=$PWD/cpp/build
+
+  export ARROW_JAVA_INTEGRATION_JAR=$JAVA_DIR/tools/target/arrow-tools-$VERSION-jar-with-dependencies.jar
+  export ARROW_CPP_EXE_PATH=$CPP_BUILD_DIR/release
+
+  pip install -e dev/archery
+
+  INTEGRATION_TEST_ARGS=""
+
+  if [ "${ARROW_FLIGHT}" = "ON" ]; then
+    INTEGRATION_TEST_ARGS="${INTEGRATION_TEST_ARGS} --run-flight"
+  fi
+
+  # Flight integration test executable have runtime dependency on
+  # release/libgtest.so
+  LD_LIBRARY_PATH=$ARROW_CPP_EXE_PATH:$LD_LIBRARY_PATH \
+      archery integration \
+              --with-cpp=${TEST_INTEGRATION_CPP} \
+              --with-java=${TEST_INTEGRATION_JAVA} \
+              --with-js=${TEST_INTEGRATION_JS} \
+              --with-go=${TEST_INTEGRATION_GO} \
+              $INTEGRATION_TEST_ARGS
+}
+
+clone_testing_repositories() {
+  # Clone testing repositories if not cloned already
+  if [ ! -d "arrow-testing" ]; then
+    git clone https://github.com/apache/arrow-testing.git
+  fi
+  if [ ! -d "parquet-testing" ]; then
+    git clone https://github.com/apache/parquet-testing.git
+  fi
+  export ARROW_TEST_DATA=$PWD/arrow-testing/data
+  export PARQUET_TEST_DATA=$PWD/parquet-testing/data
+}
+
+test_source_distribution() {
+  export ARROW_HOME=$ARROW_TMPDIR/install
+  export PARQUET_HOME=$ARROW_TMPDIR/install
+  export LD_LIBRARY_PATH=$ARROW_HOME/lib:${LD_LIBRARY_PATH:-}
+  export PKG_CONFIG_PATH=$ARROW_HOME/lib/pkgconfig:${PKG_CONFIG_PATH:-}
+
+  if [ "$(uname)" == "Darwin" ]; then
+    NPROC=$(sysctl -n hw.ncpu)
+  else
+    NPROC=$(nproc)
+  fi
+
+  clone_testing_repositories
+
+  if [ ${TEST_JAVA} -gt 0 ]; then
+    test_package_java
+  fi
+  if [ ${TEST_CPP} -gt 0 ]; then
+    test_and_install_cpp
+  fi
+  if [ ${TEST_CSHARP} -gt 0 ]; then
+    test_csharp
+  fi
+  if [ ${TEST_PYTHON} -gt 0 ]; then
+    test_python
+  fi
+  if [ ${TEST_GLIB} -gt 0 ]; then
+    test_glib
+  fi
+  if [ ${TEST_RUBY} -gt 0 ]; then
+    test_ruby
+  fi
+  if [ ${TEST_JS} -gt 0 ]; then
+    test_js
+  fi
+  if [ ${TEST_GO} -gt 0 ]; then
+    test_go
+  fi
+  if [ ${TEST_INTEGRATION} -gt 0 ]; then
+    test_integration
+  fi
+}
+
+test_binary_distribution() {
+  if [ ${TEST_BINARY} -gt 0 ]; then
+    test_binary
+  fi
+  if [ ${TEST_APT} -gt 0 ]; then
+    test_apt
+  fi
+  if [ ${TEST_YUM} -gt 0 ]; then
+    test_yum
+  fi
+}
+
+test_linux_wheels() {
+  if [ "$(uname -m)" = "aarch64" ]; then
+    local arch="aarch64"
+  else
+    local arch="x86_64"
+  fi
+
+  local py_arches="3.6m 3.7m 3.8 3.9"
+  local platform_tags="manylinux_2_12_${arch}.manylinux2010_${arch} manylinux_2_17_${arch}.manylinux2014_${arch}"
+
+  for py_arch in ${py_arches}; do
+    local env=_verify_wheel-${py_arch}
+    conda create -yq -n ${env} python=${py_arch//[mu]/}
+    conda activate ${env}
+    pip install -U pip
+
+    for tag in ${platform_tags}; do
+      # check the mandatory and optional imports
+      pip install python-rc/${VERSION}-rc${RC_NUMBER}/pyarrow-${VERSION}-cp${py_arch//[mu.]/}-cp${py_arch//./}-${tag}.whl
+      INSTALL_PYARROW=OFF ${ARROW_DIR}/ci/scripts/python_wheel_unix_test.sh ${ARROW_DIR}
+    done
+
+    conda deactivate
+  done
+}
+
+test_macos_wheels() {
+  local py_arches="3.6m 3.7m 3.8 3.9"
+  local macos_version=$(sw_vers -productVersion)
+  local macos_short_version=${macos_version:0:5}
+
+  local check_s3=ON
+  local check_flight=ON
+
+  # macOS version <= 10.13
+  if [ $(echo "${macos_short_version}\n10.14" | sort -V | head -n1) == "${macos_short_version}" ]; then
+    local check_s3=OFF
+  fi
+  # apple silicon processor
+  if [ "$(uname -m)" = "arm64" ]; then
+    local py_arches="3.8 3.9"
+    local check_flight=OFF
+  fi
+
+  # verify arch-native wheels inside an arch-native conda environment
+  for py_arch in ${py_arches}; do
+    local env=_verify_wheel-${py_arch}
+    conda create -yq -n ${env} python=${py_arch//m/}
+    conda activate ${env}
+    pip install -U pip
+
+    # check the mandatory and optional imports
+    pip install --find-links python-rc/${VERSION}-rc${RC_NUMBER} pyarrow==${VERSION}
+    INSTALL_PYARROW=OFF ARROW_FLIGHT=${check_flight} ARROW_S3=${check_s3} \
+      ${ARROW_DIR}/ci/scripts/python_wheel_unix_test.sh ${ARROW_DIR}
+
+    conda deactivate
+  done
+
+  # verify arm64 and universal2 wheels using an universal2 python binary
+  # the interpreter should be installed from python.org:
+  #   https://www.python.org/ftp/python/3.9.6/python-3.9.6-macosx10.9.pkg
+  if [ "$(uname -m)" = "arm64" ]; then
+    for py_arch in "3.9"; do
+      local pyver=${py_arch//m/}
+      local python="/Library/Frameworks/Python.framework/Versions/${pyver}/bin/python${pyver}"
+
+      # create and activate a virtualenv for testing as arm64
+      for arch in "arm64" "x86_64"; do
+        local venv="${ARROW_TMPDIR}/test-${arch}-virtualenv"
+        $python -m virtualenv $venv
+        source $venv/bin/activate
+        pip install -U pip
+
+        # install pyarrow's universal2 wheel
+        pip install \
+            --find-links python-rc/${VERSION}-rc${RC_NUMBER} \
+            --target $(python -c 'import site; print(site.getsitepackages()[0])') \
+            --platform macosx_11_0_universal2 \
+            --only-binary=:all: \
+            pyarrow==${VERSION}
+        # check the imports and execute the unittests
+        INSTALL_PYARROW=OFF ARROW_FLIGHT=${check_flight} ARROW_S3=${check_s3} \
+          arch -${arch} ${ARROW_DIR}/ci/scripts/python_wheel_unix_test.sh ${ARROW_DIR}
+
+        deactivate
+      done
+    done
+  fi
+}
+
+test_wheels() {
+  clone_testing_repositories
+
+  local download_dir=binaries
+  mkdir -p ${download_dir}
+
+  if [ "$(uname)" == "Darwin" ]; then
+    local filter_regex=.*macosx.*
+  else
+    local filter_regex=.*manylinux.*
+  fi
+
+  python $SOURCE_DIR/download_rc_binaries.py $VERSION $RC_NUMBER \
+         --package_type python \
+         --regex=${filter_regex} \
+         --dest=${download_dir}
+
+  verify_dir_artifact_signatures ${download_dir}
+
+  pushd ${download_dir}
+
+  if [ "$(uname)" == "Darwin" ]; then
+    test_macos_wheels
+  else
+    test_linux_wheels
+  fi
+
+  popd
+}
+
+# By default test all functionalities.
+# To deactivate one test, deactivate the test and all of its dependents
+# To explicitly select one test, set TEST_DEFAULT=0 TEST_X=1
+
+# Install NodeJS locally for running the JavaScript tests rather than using the
+# system Node installation, which may be too old.
+: ${INSTALL_NODE:=1}
+
+if [ "${ARTIFACT}" == "source" ]; then
+  : ${TEST_SOURCE:=1}
+elif [ "${ARTIFACT}" == "wheels" ]; then
+  TEST_WHEELS=1
+else
+  TEST_BINARY_DISTRIBUTIONS=1
+fi
+: ${TEST_SOURCE:=0}
+: ${TEST_WHEELS:=0}
+: ${TEST_BINARY_DISTRIBUTIONS:=0}
+
+: ${TEST_DEFAULT:=1}
+: ${TEST_JAVA:=${TEST_DEFAULT}}
+: ${TEST_CPP:=${TEST_DEFAULT}}
+: ${TEST_CSHARP:=${TEST_DEFAULT}}
+: ${TEST_GLIB:=${TEST_DEFAULT}}
+: ${TEST_RUBY:=${TEST_DEFAULT}}
+: ${TEST_PYTHON:=${TEST_DEFAULT}}
+: ${TEST_JS:=${TEST_DEFAULT}}
+: ${TEST_GO:=${TEST_DEFAULT}}
+: ${TEST_INTEGRATION:=${TEST_DEFAULT}}
+if [ ${TEST_BINARY_DISTRIBUTIONS} -gt 0 ]; then
+  TEST_BINARY_DISTRIBUTIONS_DEFAULT=${TEST_DEFAULT}
+else
+  TEST_BINARY_DISTRIBUTIONS_DEFAULT=0
+fi
+: ${TEST_BINARY:=${TEST_BINARY_DISTRIBUTIONS_DEFAULT}}
+: ${TEST_APT:=${TEST_BINARY_DISTRIBUTIONS_DEFAULT}}
+: ${TEST_YUM:=${TEST_BINARY_DISTRIBUTIONS_DEFAULT}}
+
+# For selective Integration testing, set TEST_DEFAULT=0 TEST_INTEGRATION_X=1 TEST_INTEGRATION_Y=1
+: ${TEST_INTEGRATION_CPP:=${TEST_INTEGRATION}}
+: ${TEST_INTEGRATION_JAVA:=${TEST_INTEGRATION}}
+: ${TEST_INTEGRATION_JS:=${TEST_INTEGRATION}}
+: ${TEST_INTEGRATION_GO:=${TEST_INTEGRATION}}
+
+# Automatically test if its activated by a dependent
+TEST_GLIB=$((${TEST_GLIB} + ${TEST_RUBY}))
+TEST_CPP=$((${TEST_CPP} + ${TEST_GLIB} + ${TEST_PYTHON} + ${TEST_INTEGRATION_CPP}))
+TEST_JAVA=$((${TEST_JAVA} + ${TEST_INTEGRATION_JAVA}))
+TEST_JS=$((${TEST_JS} + ${TEST_INTEGRATION_JS}))
+TEST_GO=$((${TEST_GO} + ${TEST_INTEGRATION_GO}))
+TEST_INTEGRATION=$((${TEST_INTEGRATION} + ${TEST_INTEGRATION_CPP} + ${TEST_INTEGRATION_JAVA} + ${TEST_INTEGRATION_JS} + ${TEST_INTEGRATION_GO}))
+
+if [ "${ARTIFACT}" == "source" ]; then
+  NEED_MINICONDA=$((${TEST_CPP} + ${TEST_INTEGRATION}))
+elif [ "${ARTIFACT}" == "wheels" ]; then
+  NEED_MINICONDA=$((${TEST_WHEELS}))
+else
+  if [ -z "${PYTHON:-}" ]; then
+    NEED_MINICONDA=$((${TEST_BINARY}))
+  else
+    NEED_MINICONDA=0
+  fi
+fi
+
+: ${TEST_ARCHIVE:=apache-arrow-${VERSION}.tar.gz}
+case "${TEST_ARCHIVE}" in
+  /*)
+   ;;
+  *)
+   TEST_ARCHIVE=${PWD}/${TEST_ARCHIVE}
+   ;;
+esac
+
+TEST_SUCCESS=no
+
+setup_tempdir "arrow-${VERSION}"
+echo "Working in sandbox ${ARROW_TMPDIR}"
+cd ${ARROW_TMPDIR}
+
+if [ ${NEED_MINICONDA} -gt 0 ]; then
+  setup_miniconda
+fi
+
+if [ "${ARTIFACT}" == "source" ]; then
+  dist_name="apache-arrow-${VERSION}"
+  if [ ${TEST_SOURCE} -gt 0 ]; then
+    import_gpg_keys
+    if [ ! -d "${dist_name}" ]; then
+      fetch_archive ${dist_name}
+      tar xf ${dist_name}.tar.gz
+    fi
+  else
+    mkdir -p ${dist_name}
+    if [ ! -f ${TEST_ARCHIVE} ]; then
+      echo "${TEST_ARCHIVE} not found"
+      exit 1
+    fi
+    tar xf ${TEST_ARCHIVE} -C ${dist_name} --strip-components=1
+  fi
+  pushd ${dist_name}
+  test_source_distribution
+  popd
+elif [ "${ARTIFACT}" == "wheels" ]; then
+  import_gpg_keys
+  test_wheels
+else
+  import_gpg_keys
+  test_binary_distribution
+fi
+
+TEST_SUCCESS=yes
+echo 'Release candidate looks good!'
+exit 0
diff --git a/src/arrow/dev/release/verify-yum.sh b/src/arrow/dev/release/verify-yum.sh
new file mode 100755
index 000000000..a7f572a44
--- /dev/null
+++ b/src/arrow/dev/release/verify-yum.sh
@@ -0,0 +1,204 @@
+#!/usr/bin/env bash
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+set -exu
+
+if [ $# -lt 2 ]; then
+  echo "Usage: $0 VERSION rc"
+  echo "       $0 VERSION staging-rc"
+  echo "       $0 VERSION release"
+  echo "       $0 VERSION staging-release"
+  echo "       $0 VERSION local"
+  echo " e.g.: $0 0.13.0 rc                # Verify 0.13.0 RC"
+  echo " e.g.: $0 0.13.0 staging-rc        # Verify 0.13.0 RC on staging"
+  echo " e.g.: $0 0.13.0 release           # Verify 0.13.0"
+  echo " e.g.: $0 0.13.0 staging-release   # Verify 0.13.0 on staging"
+  echo " e.g.: $0 0.13.0-dev20210203 local # Verify 0.13.0-dev20210203 on local"
+  exit 1
+fi
+
+VERSION="$1"
+TYPE="$2"
+
+local_prefix="/arrow/dev/tasks/linux-packages"
+
+artifactory_base_url="https://apache.jfrog.io/artifactory/arrow"
+
+distribution=$(. /etc/os-release && echo "${ID}")
+distribution_version=$(. /etc/os-release && echo "${VERSION_ID}" | grep -o "^[0-9]*")
+distribution_prefix="centos"
+
+cmake_package=cmake
+cmake_command=cmake
+have_flight=yes
+have_gandiva=yes
+have_glib=yes
+have_parquet=yes
+have_python=yes
+install_command="dnf install -y --enablerepo=powertools"
+
+case "${distribution}-${distribution_version}" in
+  almalinux-*)
+    distribution_prefix="almalinux"
+    ;;
+  amzn-2)
+    cmake_package=cmake3
+    cmake_command=cmake3
+    have_flight=no
+    have_gandiva=no
+    have_python=no
+    install_command="yum install -y"
+    distribution_prefix="amazon-linux"
+    amazon-linux-extras install epel -y
+    ;;
+  centos-7)
+    cmake_package=cmake3
+    cmake_command=cmake3
+    have_flight=no
+    have_gandiva=no
+    install_command="yum install -y"
+    ;;
+esac
+if [ "$(arch)" = "aarch64" ]; then
+  have_gandiva=no
+fi
+
+if [ "${TYPE}" = "local" ]; then
+  case "${VERSION}" in
+    *-dev*)
+      package_version="$(echo "${VERSION}" | sed -e 's/-dev\(.*\)$/-0.dev\1/g')"
+      ;;
+    *-rc*)
+      package_version="$(echo "${VERSION}" | sed -e 's/-rc.*$//g')"
+      package_version+="-1"
+      ;;
+    *)
+      package_version="${VERSION}-1"
+      ;;
+  esac
+  release_path="${local_prefix}/yum/repositories"
+  case "${distribution}" in
+    almalinux)
+      package_version+=".el${distribution_version}"
+      release_path+="/almalinux"
+      ;;
+    amzn)
+      package_version+=".${distribution}${distribution_version}"
+      release_path+="/amazon-linux"
+      amazon-linux-extras install -y epel
+      ;;
+    *)
+      package_version+=".el${distribution_version}"
+      release_path+="/centos"
+      ;;
+  esac
+  release_path+="/${distribution_version}/$(arch)/Packages"
+  release_path+="/apache-arrow-release-${package_version}.noarch.rpm"
+  ${install_command} "${release_path}"
+else
+  package_version="${VERSION}"
+  case "${TYPE}" in
+    rc|staging-rc|staging-release)
+      suffix=${TYPE%-release}
+      distribution_prefix+="-${suffix}"
+      ;;
+  esac
+  ${install_command} \
+    ${artifactory_base_url}/${distribution_prefix}/${distribution_version}/apache-arrow-release-latest.rpm
+fi
+
+if [ "${TYPE}" = "local" ]; then
+  sed \
+    -i"" \
+    -e "s,baseurl=https://apache\.jfrog\.io/artifactory/arrow/,baseurl=file://${local_prefix}/yum/repositories/,g" \
+    /etc/yum.repos.d/Apache-Arrow.repo
+  keys="${local_prefix}/KEYS"
+  if [ -f "${keys}" ]; then
+    cp "${keys}" /etc/pki/rpm-gpg/RPM-GPG-KEY-Apache-Arrow
+  fi
+else
+  case "${TYPE}" in
+    rc|staging-rc|staging-release)
+      suffix=${TYPE%-release}
+      sed \
+        -i"" \
+        -e "s,/almalinux/,/almalinux-${suffix}/,g" \
+        -e "s,/centos/,/centos-${suffix}/,g" \
+        -e "s,/amazon-linux/,/amazon-linux-${suffix}/,g" \
+        /etc/yum.repos.d/Apache-Arrow.repo
+      ;;
+  esac
+fi
+
+${install_command} --enablerepo=epel arrow-devel-${package_version}
+${install_command} \
+  ${cmake_package} \
+  gcc-c++ \
+  git \
+  libarchive \
+  make \
+  pkg-config
+mkdir -p build
+cp -a /arrow/cpp/examples/minimal_build build
+pushd build/minimal_build
+${cmake_command} .
+make -j$(nproc)
+./arrow_example
+c++ -std=c++11 -o arrow_example example.cc $(pkg-config --cflags --libs arrow)
+./arrow_example
+popd
+
+if [ "${have_glib}" = "yes" ]; then
+  ${install_command} --enablerepo=epel arrow-glib-devel-${package_version}
+  ${install_command} --enablerepo=epel arrow-glib-doc-${package_version}
+fi
+
+if [ "${have_python}" = "yes" ]; then
+  ${install_command} --enablerepo=epel arrow-python-devel-${package_version}
+fi
+
+if [ "${have_glib}" = "yes" ]; then
+  ${install_command} --enablerepo=epel plasma-glib-devel-${package_version}
+  ${install_command} --enablerepo=epel plasma-glib-doc-${package_version}
+else
+  ${install_command} --enablerepo=epel plasma-devel-${package_version}
+fi
+
+if [ "${have_flight}" = "yes" ]; then
+  ${install_command} --enablerepo=epel arrow-flight-glib-devel-${package_version}
+  ${install_command} --enablerepo=epel arrow-flight-glib-doc-${package_version}
+fi
+
+if [ "${have_gandiva}" = "yes" ]; then
+  if [ "${have_glib}" = "yes" ]; then
+    ${install_command} --enablerepo=epel gandiva-glib-devel-${package_version}
+    ${install_command} --enablerepo=epel gandiva-glib-doc-${package_version}
+  else
+    ${install_command} --enablerepo=epel gandiva-devel-${package_version}
+  fi
+fi
+
+if [ "${have_parquet}" = "yes" ]; then
+  if [ "${have_glib}" = "yes" ]; then
+    ${install_command} --enablerepo=epel parquet-glib-devel-${package_version}
+    ${install_command} --enablerepo=epel parquet-glib-doc-${package_version}
+  else
+    ${install_command} --enablerepo=epel parquet-devel-${package_version}
+  fi
+fi
diff --git a/src/arrow/dev/requirements_merge_arrow_pr.txt b/src/arrow/dev/requirements_merge_arrow_pr.txt
new file mode 100644
index 000000000..7ac17dc1b
--- /dev/null
+++ b/src/arrow/dev/requirements_merge_arrow_pr.txt
@@ -0,0 +1,3 @@
+jira
+requests
+six
diff --git a/src/arrow/dev/tasks/README.md b/src/arrow/dev/tasks/README.md
new file mode 100644
index 000000000..1af9739db
--- /dev/null
+++ b/src/arrow/dev/tasks/README.md
@@ -0,0 +1,19 @@
+<!--
+Licensed to the Apache Software Foundation (ASF) under one
+or more contributor license agreements.  See the NOTICE file
+distributed with this work for additional information
+regarding copyright ownership.  The ASF licenses this file
+to you under the Apache License, Version 2.0 (the
+"License"); you may not use this file except in compliance
+with the License.  You may obtain a copy of the License at
+
+http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+-->
+
+See the usage guide under the [documentation page](../../docs/source/developers/crossbow.rst)
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_64_cuda_compiler_version10.2numpy1.17python3.6.____cpython.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_64_cuda_compiler_version10.2numpy1.17python3.6.____cpython.yaml
new file mode 100644
index 000000000..dfc87c80b
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_64_cuda_compiler_version10.2numpy1.17python3.6.____cpython.yaml
@@ -0,0 +1,70 @@
+aws_sdk_cpp:
+- 1.8.186
+bzip2:
+- '1'
+c_compiler:
+- gcc
+c_compiler_version:
+- '9'
+cdt_name:
+- cos6
+channel_sources:
+- conda-forge,defaults
+channel_targets:
+- conda-forge main
+cuda_compiler:
+- nvcc
+cuda_compiler_version:
+- '10.2'
+cxx_compiler:
+- gxx
+cxx_compiler_version:
+- '9'
+docker_image:
+- quay.io/condaforge/linux-anvil-cuda:10.2
+gflags:
+- '2.2'
+glog:
+- '0.5'
+grpc_cpp:
+- '1.38'
+libprotobuf:
+- '3.16'
+lz4_c:
+- 1.9.3
+numpy:
+- '1.17'
+orc:
+- 1.6.8
+pin_run_as_build:
+  bzip2:
+    max_pin: x
+  lz4-c:
+    max_pin: x.x.x
+  python:
+    min_pin: x.x
+    max_pin: x.x
+  zlib:
+    max_pin: x.x
+python:
+- 3.6.* *_cpython
+re2:
+- 2021.06.01
+snappy:
+- '1'
+target_platform:
+- linux-64
+thrift_cpp:
+- 0.14.2
+zip_keys:
+- - c_compiler_version
+  - cxx_compiler_version
+- - cuda_compiler_version
+  - cdt_name
+  - docker_image
+- - python
+  - numpy
+zlib:
+- '1.2'
+zstd:
+- '1.5'
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_64_cuda_compiler_version10.2numpy1.17python3.7.____cpython.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_64_cuda_compiler_version10.2numpy1.17python3.7.____cpython.yaml
new file mode 100644
index 000000000..3416b952c
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_64_cuda_compiler_version10.2numpy1.17python3.7.____cpython.yaml
@@ -0,0 +1,70 @@
+aws_sdk_cpp:
+- 1.8.186
+bzip2:
+- '1'
+c_compiler:
+- gcc
+c_compiler_version:
+- '9'
+cdt_name:
+- cos6
+channel_sources:
+- conda-forge,defaults
+channel_targets:
+- conda-forge main
+cuda_compiler:
+- nvcc
+cuda_compiler_version:
+- '10.2'
+cxx_compiler:
+- gxx
+cxx_compiler_version:
+- '9'
+docker_image:
+- quay.io/condaforge/linux-anvil-cuda:10.2
+gflags:
+- '2.2'
+glog:
+- '0.5'
+grpc_cpp:
+- '1.38'
+libprotobuf:
+- '3.16'
+lz4_c:
+- 1.9.3
+numpy:
+- '1.17'
+orc:
+- 1.6.8
+pin_run_as_build:
+  bzip2:
+    max_pin: x
+  lz4-c:
+    max_pin: x.x.x
+  python:
+    min_pin: x.x
+    max_pin: x.x
+  zlib:
+    max_pin: x.x
+python:
+- 3.7.* *_cpython
+re2:
+- 2021.06.01
+snappy:
+- '1'
+target_platform:
+- linux-64
+thrift_cpp:
+- 0.14.2
+zip_keys:
+- - c_compiler_version
+  - cxx_compiler_version
+- - cuda_compiler_version
+  - cdt_name
+  - docker_image
+- - python
+  - numpy
+zlib:
+- '1.2'
+zstd:
+- '1.5'
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_64_cuda_compiler_version10.2numpy1.17python3.8.____cpython.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_64_cuda_compiler_version10.2numpy1.17python3.8.____cpython.yaml
new file mode 100644
index 000000000..f819ba722
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_64_cuda_compiler_version10.2numpy1.17python3.8.____cpython.yaml
@@ -0,0 +1,70 @@
+aws_sdk_cpp:
+- 1.8.186
+bzip2:
+- '1'
+c_compiler:
+- gcc
+c_compiler_version:
+- '9'
+cdt_name:
+- cos6
+channel_sources:
+- conda-forge,defaults
+channel_targets:
+- conda-forge main
+cuda_compiler:
+- nvcc
+cuda_compiler_version:
+- '10.2'
+cxx_compiler:
+- gxx
+cxx_compiler_version:
+- '9'
+docker_image:
+- quay.io/condaforge/linux-anvil-cuda:10.2
+gflags:
+- '2.2'
+glog:
+- '0.5'
+grpc_cpp:
+- '1.38'
+libprotobuf:
+- '3.16'
+lz4_c:
+- 1.9.3
+numpy:
+- '1.17'
+orc:
+- 1.6.8
+pin_run_as_build:
+  bzip2:
+    max_pin: x
+  lz4-c:
+    max_pin: x.x.x
+  python:
+    min_pin: x.x
+    max_pin: x.x
+  zlib:
+    max_pin: x.x
+python:
+- 3.8.* *_cpython
+re2:
+- 2021.06.01
+snappy:
+- '1'
+target_platform:
+- linux-64
+thrift_cpp:
+- 0.14.2
+zip_keys:
+- - c_compiler_version
+  - cxx_compiler_version
+- - cuda_compiler_version
+  - cdt_name
+  - docker_image
+- - python
+  - numpy
+zlib:
+- '1.2'
+zstd:
+- '1.5'
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_64_cuda_compiler_version10.2numpy1.19python3.9.____cpython.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_64_cuda_compiler_version10.2numpy1.19python3.9.____cpython.yaml
new file mode 100644
index 000000000..3e2e0ef51
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_64_cuda_compiler_version10.2numpy1.19python3.9.____cpython.yaml
@@ -0,0 +1,70 @@
+aws_sdk_cpp:
+- 1.8.186
+bzip2:
+- '1'
+c_compiler:
+- gcc
+c_compiler_version:
+- '9'
+cdt_name:
+- cos6
+channel_sources:
+- conda-forge,defaults
+channel_targets:
+- conda-forge main
+cuda_compiler:
+- nvcc
+cuda_compiler_version:
+- '10.2'
+cxx_compiler:
+- gxx
+cxx_compiler_version:
+- '9'
+docker_image:
+- quay.io/condaforge/linux-anvil-cuda:10.2
+gflags:
+- '2.2'
+glog:
+- '0.5'
+grpc_cpp:
+- '1.38'
+libprotobuf:
+- '3.16'
+lz4_c:
+- 1.9.3
+numpy:
+- '1.19'
+orc:
+- 1.6.8
+pin_run_as_build:
+  bzip2:
+    max_pin: x
+  lz4-c:
+    max_pin: x.x.x
+  python:
+    min_pin: x.x
+    max_pin: x.x
+  zlib:
+    max_pin: x.x
+python:
+- 3.9.* *_cpython
+re2:
+- 2021.06.01
+snappy:
+- '1'
+target_platform:
+- linux-64
+thrift_cpp:
+- 0.14.2
+zip_keys:
+- - c_compiler_version
+  - cxx_compiler_version
+- - cuda_compiler_version
+  - cdt_name
+  - docker_image
+- - python
+  - numpy
+zlib:
+- '1.2'
+zstd:
+- '1.5'
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_64_cuda_compiler_versionNonenumpy1.17python3.6.____cpython.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_64_cuda_compiler_versionNonenumpy1.17python3.6.____cpython.yaml
new file mode 100644
index 000000000..3aba0f129
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_64_cuda_compiler_versionNonenumpy1.17python3.6.____cpython.yaml
@@ -0,0 +1,70 @@
+aws_sdk_cpp:
+- 1.8.186
+bzip2:
+- '1'
+c_compiler:
+- gcc
+c_compiler_version:
+- '9'
+cdt_name:
+- cos6
+channel_sources:
+- conda-forge,defaults
+channel_targets:
+- conda-forge main
+cuda_compiler:
+- nvcc
+cuda_compiler_version:
+- None
+cxx_compiler:
+- gxx
+cxx_compiler_version:
+- '9'
+docker_image:
+- quay.io/condaforge/linux-anvil-comp7
+gflags:
+- '2.2'
+glog:
+- '0.5'
+grpc_cpp:
+- '1.38'
+libprotobuf:
+- '3.16'
+lz4_c:
+- 1.9.3
+numpy:
+- '1.17'
+orc:
+- 1.6.8
+pin_run_as_build:
+  bzip2:
+    max_pin: x
+  lz4-c:
+    max_pin: x.x.x
+  python:
+    min_pin: x.x
+    max_pin: x.x
+  zlib:
+    max_pin: x.x
+python:
+- 3.6.* *_cpython
+re2:
+- 2021.06.01
+snappy:
+- '1'
+target_platform:
+- linux-64
+thrift_cpp:
+- 0.14.2
+zip_keys:
+- - c_compiler_version
+  - cxx_compiler_version
+- - cuda_compiler_version
+  - cdt_name
+  - docker_image
+- - python
+  - numpy
+zlib:
+- '1.2'
+zstd:
+- '1.5'
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_64_cuda_compiler_versionNonenumpy1.17python3.7.____cpython.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_64_cuda_compiler_versionNonenumpy1.17python3.7.____cpython.yaml
new file mode 100644
index 000000000..ff26bc521
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_64_cuda_compiler_versionNonenumpy1.17python3.7.____cpython.yaml
@@ -0,0 +1,70 @@
+aws_sdk_cpp:
+- 1.8.186
+bzip2:
+- '1'
+c_compiler:
+- gcc
+c_compiler_version:
+- '9'
+cdt_name:
+- cos6
+channel_sources:
+- conda-forge,defaults
+channel_targets:
+- conda-forge main
+cuda_compiler:
+- nvcc
+cuda_compiler_version:
+- None
+cxx_compiler:
+- gxx
+cxx_compiler_version:
+- '9'
+docker_image:
+- quay.io/condaforge/linux-anvil-comp7
+gflags:
+- '2.2'
+glog:
+- '0.5'
+grpc_cpp:
+- '1.38'
+libprotobuf:
+- '3.16'
+lz4_c:
+- 1.9.3
+numpy:
+- '1.17'
+orc:
+- 1.6.8
+pin_run_as_build:
+  bzip2:
+    max_pin: x
+  lz4-c:
+    max_pin: x.x.x
+  python:
+    min_pin: x.x
+    max_pin: x.x
+  zlib:
+    max_pin: x.x
+python:
+- 3.7.* *_cpython
+re2:
+- 2021.06.01
+snappy:
+- '1'
+target_platform:
+- linux-64
+thrift_cpp:
+- 0.14.2
+zip_keys:
+- - c_compiler_version
+  - cxx_compiler_version
+- - cuda_compiler_version
+  - cdt_name
+  - docker_image
+- - python
+  - numpy
+zlib:
+- '1.2'
+zstd:
+- '1.5'
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_64_cuda_compiler_versionNonenumpy1.17python3.8.____cpython.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_64_cuda_compiler_versionNonenumpy1.17python3.8.____cpython.yaml
new file mode 100644
index 000000000..5703aba68
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_64_cuda_compiler_versionNonenumpy1.17python3.8.____cpython.yaml
@@ -0,0 +1,70 @@
+aws_sdk_cpp:
+- 1.8.186
+bzip2:
+- '1'
+c_compiler:
+- gcc
+c_compiler_version:
+- '9'
+cdt_name:
+- cos6
+channel_sources:
+- conda-forge,defaults
+channel_targets:
+- conda-forge main
+cuda_compiler:
+- nvcc
+cuda_compiler_version:
+- None
+cxx_compiler:
+- gxx
+cxx_compiler_version:
+- '9'
+docker_image:
+- quay.io/condaforge/linux-anvil-comp7
+gflags:
+- '2.2'
+glog:
+- '0.5'
+grpc_cpp:
+- '1.38'
+libprotobuf:
+- '3.16'
+lz4_c:
+- 1.9.3
+numpy:
+- '1.17'
+orc:
+- 1.6.8
+pin_run_as_build:
+  bzip2:
+    max_pin: x
+  lz4-c:
+    max_pin: x.x.x
+  python:
+    min_pin: x.x
+    max_pin: x.x
+  zlib:
+    max_pin: x.x
+python:
+- 3.8.* *_cpython
+re2:
+- 2021.06.01
+snappy:
+- '1'
+target_platform:
+- linux-64
+thrift_cpp:
+- 0.14.2
+zip_keys:
+- - c_compiler_version
+  - cxx_compiler_version
+- - cuda_compiler_version
+  - cdt_name
+  - docker_image
+- - python
+  - numpy
+zlib:
+- '1.2'
+zstd:
+- '1.5'
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_64_cuda_compiler_versionNonenumpy1.19python3.9.____cpython.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_64_cuda_compiler_versionNonenumpy1.19python3.9.____cpython.yaml
new file mode 100644
index 000000000..8ff58d717
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_64_cuda_compiler_versionNonenumpy1.19python3.9.____cpython.yaml
@@ -0,0 +1,70 @@
+aws_sdk_cpp:
+- 1.8.186
+bzip2:
+- '1'
+c_compiler:
+- gcc
+c_compiler_version:
+- '9'
+cdt_name:
+- cos6
+channel_sources:
+- conda-forge,defaults
+channel_targets:
+- conda-forge main
+cuda_compiler:
+- nvcc
+cuda_compiler_version:
+- None
+cxx_compiler:
+- gxx
+cxx_compiler_version:
+- '9'
+docker_image:
+- quay.io/condaforge/linux-anvil-comp7
+gflags:
+- '2.2'
+glog:
+- '0.5'
+grpc_cpp:
+- '1.38'
+libprotobuf:
+- '3.16'
+lz4_c:
+- 1.9.3
+numpy:
+- '1.19'
+orc:
+- 1.6.8
+pin_run_as_build:
+  bzip2:
+    max_pin: x
+  lz4-c:
+    max_pin: x.x.x
+  python:
+    min_pin: x.x
+    max_pin: x.x
+  zlib:
+    max_pin: x.x
+python:
+- 3.9.* *_cpython
+re2:
+- 2021.06.01
+snappy:
+- '1'
+target_platform:
+- linux-64
+thrift_cpp:
+- 0.14.2
+zip_keys:
+- - c_compiler_version
+  - cxx_compiler_version
+- - cuda_compiler_version
+  - cdt_name
+  - docker_image
+- - python
+  - numpy
+zlib:
+- '1.2'
+zstd:
+- '1.5'
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_aarch64_numpy1.17python3.6.____cpython.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_aarch64_numpy1.17python3.6.____cpython.yaml
new file mode 100644
index 000000000..5bb4381fe
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_aarch64_numpy1.17python3.6.____cpython.yaml
@@ -0,0 +1,69 @@
+BUILD:
+- aarch64-conda_cos7-linux-gnu
+aws_sdk_cpp:
+- 1.8.186
+bzip2:
+- '1'
+c_compiler:
+- gcc
+c_compiler_version:
+- '9'
+cdt_arch:
+- aarch64
+cdt_name:
+- cos7
+channel_sources:
+- conda-forge
+channel_targets:
+- conda-forge main
+cuda_compiler_version:
+- None
+cxx_compiler:
+- gxx
+cxx_compiler_version:
+- '9'
+docker_image:
+- quay.io/condaforge/linux-anvil-comp7
+gflags:
+- '2.2'
+glog:
+- '0.5'
+grpc_cpp:
+- '1.38'
+libprotobuf:
+- '3.16'
+lz4_c:
+- 1.9.3
+numpy:
+- '1.17'
+orc:
+- 1.6.8
+pin_run_as_build:
+  bzip2:
+    max_pin: x
+  lz4-c:
+    max_pin: x.x.x
+  python:
+    min_pin: x.x
+    max_pin: x.x
+  zlib:
+    max_pin: x.x
+python:
+- 3.6.* *_cpython
+re2:
+- 2021.06.01
+snappy:
+- '1'
+target_platform:
+- linux-aarch64
+thrift_cpp:
+- 0.14.2
+zip_keys:
+- - c_compiler_version
+  - cxx_compiler_version
+- - python
+  - numpy
+zlib:
+- '1.2'
+zstd:
+- '1.5'
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_aarch64_numpy1.17python3.7.____cpython.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_aarch64_numpy1.17python3.7.____cpython.yaml
new file mode 100644
index 000000000..2b1715d58
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_aarch64_numpy1.17python3.7.____cpython.yaml
@@ -0,0 +1,69 @@
+BUILD:
+- aarch64-conda_cos7-linux-gnu
+aws_sdk_cpp:
+- 1.8.186
+bzip2:
+- '1'
+c_compiler:
+- gcc
+c_compiler_version:
+- '9'
+cdt_arch:
+- aarch64
+cdt_name:
+- cos7
+channel_sources:
+- conda-forge
+channel_targets:
+- conda-forge main
+cuda_compiler_version:
+- None
+cxx_compiler:
+- gxx
+cxx_compiler_version:
+- '9'
+docker_image:
+- quay.io/condaforge/linux-anvil-comp7
+gflags:
+- '2.2'
+glog:
+- '0.5'
+grpc_cpp:
+- '1.38'
+libprotobuf:
+- '3.16'
+lz4_c:
+- 1.9.3
+numpy:
+- '1.17'
+orc:
+- 1.6.8
+pin_run_as_build:
+  bzip2:
+    max_pin: x
+  lz4-c:
+    max_pin: x.x.x
+  python:
+    min_pin: x.x
+    max_pin: x.x
+  zlib:
+    max_pin: x.x
+python:
+- 3.7.* *_cpython
+re2:
+- 2021.06.01
+snappy:
+- '1'
+target_platform:
+- linux-aarch64
+thrift_cpp:
+- 0.14.2
+zip_keys:
+- - c_compiler_version
+  - cxx_compiler_version
+- - python
+  - numpy
+zlib:
+- '1.2'
+zstd:
+- '1.5'
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_aarch64_numpy1.17python3.8.____cpython.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_aarch64_numpy1.17python3.8.____cpython.yaml
new file mode 100644
index 000000000..5a0e7313e
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_aarch64_numpy1.17python3.8.____cpython.yaml
@@ -0,0 +1,69 @@
+BUILD:
+- aarch64-conda_cos7-linux-gnu
+aws_sdk_cpp:
+- 1.8.186
+bzip2:
+- '1'
+c_compiler:
+- gcc
+c_compiler_version:
+- '9'
+cdt_arch:
+- aarch64
+cdt_name:
+- cos7
+channel_sources:
+- conda-forge
+channel_targets:
+- conda-forge main
+cuda_compiler_version:
+- None
+cxx_compiler:
+- gxx
+cxx_compiler_version:
+- '9'
+docker_image:
+- quay.io/condaforge/linux-anvil-comp7
+gflags:
+- '2.2'
+glog:
+- '0.5'
+grpc_cpp:
+- '1.38'
+libprotobuf:
+- '3.16'
+lz4_c:
+- 1.9.3
+numpy:
+- '1.17'
+orc:
+- 1.6.8
+pin_run_as_build:
+  bzip2:
+    max_pin: x
+  lz4-c:
+    max_pin: x.x.x
+  python:
+    min_pin: x.x
+    max_pin: x.x
+  zlib:
+    max_pin: x.x
+python:
+- 3.8.* *_cpython
+re2:
+- 2021.06.01
+snappy:
+- '1'
+target_platform:
+- linux-aarch64
+thrift_cpp:
+- 0.14.2
+zip_keys:
+- - c_compiler_version
+  - cxx_compiler_version
+- - python
+  - numpy
+zlib:
+- '1.2'
+zstd:
+- '1.5'
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_aarch64_numpy1.19python3.9.____cpython.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_aarch64_numpy1.19python3.9.____cpython.yaml
new file mode 100644
index 000000000..16ace00bd
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/linux_aarch64_numpy1.19python3.9.____cpython.yaml
@@ -0,0 +1,69 @@
+BUILD:
+- aarch64-conda_cos7-linux-gnu
+aws_sdk_cpp:
+- 1.8.186
+bzip2:
+- '1'
+c_compiler:
+- gcc
+c_compiler_version:
+- '9'
+cdt_arch:
+- aarch64
+cdt_name:
+- cos7
+channel_sources:
+- conda-forge
+channel_targets:
+- conda-forge main
+cuda_compiler_version:
+- None
+cxx_compiler:
+- gxx
+cxx_compiler_version:
+- '9'
+docker_image:
+- quay.io/condaforge/linux-anvil-comp7
+gflags:
+- '2.2'
+glog:
+- '0.5'
+grpc_cpp:
+- '1.38'
+libprotobuf:
+- '3.16'
+lz4_c:
+- 1.9.3
+numpy:
+- '1.19'
+orc:
+- 1.6.8
+pin_run_as_build:
+  bzip2:
+    max_pin: x
+  lz4-c:
+    max_pin: x.x.x
+  python:
+    min_pin: x.x
+    max_pin: x.x
+  zlib:
+    max_pin: x.x
+python:
+- 3.9.* *_cpython
+re2:
+- 2021.06.01
+snappy:
+- '1'
+target_platform:
+- linux-aarch64
+thrift_cpp:
+- 0.14.2
+zip_keys:
+- - c_compiler_version
+  - cxx_compiler_version
+- - python
+  - numpy
+zlib:
+- '1.2'
+zstd:
+- '1.5'
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/osx_64_numpy1.17python3.6.____cpython.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/osx_64_numpy1.17python3.6.____cpython.yaml
new file mode 100644
index 000000000..0be59fe1a
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/osx_64_numpy1.17python3.6.____cpython.yaml
@@ -0,0 +1,65 @@
+MACOSX_DEPLOYMENT_TARGET:
+- '10.9'
+aws_sdk_cpp:
+- 1.8.186
+bzip2:
+- '1'
+c_compiler:
+- clang
+c_compiler_version:
+- '11'
+channel_sources:
+- conda-forge,defaults
+channel_targets:
+- conda-forge main
+cuda_compiler_version:
+- None
+cxx_compiler:
+- clangxx
+cxx_compiler_version:
+- '11'
+gflags:
+- '2.2'
+glog:
+- '0.5'
+grpc_cpp:
+- '1.38'
+libprotobuf:
+- '3.16'
+lz4_c:
+- 1.9.3
+macos_machine:
+- x86_64-apple-darwin13.4.0
+numpy:
+- '1.17'
+orc:
+- 1.6.8
+pin_run_as_build:
+  bzip2:
+    max_pin: x
+  lz4-c:
+    max_pin: x.x.x
+  python:
+    min_pin: x.x
+    max_pin: x.x
+  zlib:
+    max_pin: x.x
+python:
+- 3.6.* *_cpython
+re2:
+- 2021.06.01
+snappy:
+- '1'
+target_platform:
+- osx-64
+thrift_cpp:
+- 0.14.2
+zip_keys:
+- - c_compiler_version
+  - cxx_compiler_version
+- - python
+  - numpy
+zlib:
+- '1.2'
+zstd:
+- '1.5'
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/osx_64_numpy1.17python3.7.____cpython.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/osx_64_numpy1.17python3.7.____cpython.yaml
new file mode 100644
index 000000000..d2c046ab2
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/osx_64_numpy1.17python3.7.____cpython.yaml
@@ -0,0 +1,65 @@
+MACOSX_DEPLOYMENT_TARGET:
+- '10.9'
+aws_sdk_cpp:
+- 1.8.186
+bzip2:
+- '1'
+c_compiler:
+- clang
+c_compiler_version:
+- '11'
+channel_sources:
+- conda-forge,defaults
+channel_targets:
+- conda-forge main
+cuda_compiler_version:
+- None
+cxx_compiler:
+- clangxx
+cxx_compiler_version:
+- '11'
+gflags:
+- '2.2'
+glog:
+- '0.5'
+grpc_cpp:
+- '1.38'
+libprotobuf:
+- '3.16'
+lz4_c:
+- 1.9.3
+macos_machine:
+- x86_64-apple-darwin13.4.0
+numpy:
+- '1.17'
+orc:
+- 1.6.8
+pin_run_as_build:
+  bzip2:
+    max_pin: x
+  lz4-c:
+    max_pin: x.x.x
+  python:
+    min_pin: x.x
+    max_pin: x.x
+  zlib:
+    max_pin: x.x
+python:
+- 3.7.* *_cpython
+re2:
+- 2021.06.01
+snappy:
+- '1'
+target_platform:
+- osx-64
+thrift_cpp:
+- 0.14.2
+zip_keys:
+- - c_compiler_version
+  - cxx_compiler_version
+- - python
+  - numpy
+zlib:
+- '1.2'
+zstd:
+- '1.5'
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/osx_64_numpy1.17python3.8.____cpython.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/osx_64_numpy1.17python3.8.____cpython.yaml
new file mode 100644
index 000000000..43f634454
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/osx_64_numpy1.17python3.8.____cpython.yaml
@@ -0,0 +1,65 @@
+MACOSX_DEPLOYMENT_TARGET:
+- '10.9'
+aws_sdk_cpp:
+- 1.8.186
+bzip2:
+- '1'
+c_compiler:
+- clang
+c_compiler_version:
+- '11'
+channel_sources:
+- conda-forge,defaults
+channel_targets:
+- conda-forge main
+cuda_compiler_version:
+- None
+cxx_compiler:
+- clangxx
+cxx_compiler_version:
+- '11'
+gflags:
+- '2.2'
+glog:
+- '0.5'
+grpc_cpp:
+- '1.38'
+libprotobuf:
+- '3.16'
+lz4_c:
+- 1.9.3
+macos_machine:
+- x86_64-apple-darwin13.4.0
+numpy:
+- '1.17'
+orc:
+- 1.6.8
+pin_run_as_build:
+  bzip2:
+    max_pin: x
+  lz4-c:
+    max_pin: x.x.x
+  python:
+    min_pin: x.x
+    max_pin: x.x
+  zlib:
+    max_pin: x.x
+python:
+- 3.8.* *_cpython
+re2:
+- 2021.06.01
+snappy:
+- '1'
+target_platform:
+- osx-64
+thrift_cpp:
+- 0.14.2
+zip_keys:
+- - c_compiler_version
+  - cxx_compiler_version
+- - python
+  - numpy
+zlib:
+- '1.2'
+zstd:
+- '1.5'
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/osx_64_numpy1.19python3.9.____cpython.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/osx_64_numpy1.19python3.9.____cpython.yaml
new file mode 100644
index 000000000..7cc730f9b
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/osx_64_numpy1.19python3.9.____cpython.yaml
@@ -0,0 +1,65 @@
+MACOSX_DEPLOYMENT_TARGET:
+- '10.9'
+aws_sdk_cpp:
+- 1.8.186
+bzip2:
+- '1'
+c_compiler:
+- clang
+c_compiler_version:
+- '11'
+channel_sources:
+- conda-forge,defaults
+channel_targets:
+- conda-forge main
+cuda_compiler_version:
+- None
+cxx_compiler:
+- clangxx
+cxx_compiler_version:
+- '11'
+gflags:
+- '2.2'
+glog:
+- '0.5'
+grpc_cpp:
+- '1.38'
+libprotobuf:
+- '3.16'
+lz4_c:
+- 1.9.3
+macos_machine:
+- x86_64-apple-darwin13.4.0
+numpy:
+- '1.19'
+orc:
+- 1.6.8
+pin_run_as_build:
+  bzip2:
+    max_pin: x
+  lz4-c:
+    max_pin: x.x.x
+  python:
+    min_pin: x.x
+    max_pin: x.x
+  zlib:
+    max_pin: x.x
+python:
+- 3.9.* *_cpython
+re2:
+- 2021.06.01
+snappy:
+- '1'
+target_platform:
+- osx-64
+thrift_cpp:
+- 0.14.2
+zip_keys:
+- - c_compiler_version
+  - cxx_compiler_version
+- - python
+  - numpy
+zlib:
+- '1.2'
+zstd:
+- '1.5'
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/osx_arm64_python3.8.____cpython.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/osx_arm64_python3.8.____cpython.yaml
new file mode 100644
index 000000000..e5f8e2ba2
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/osx_arm64_python3.8.____cpython.yaml
@@ -0,0 +1,65 @@
+MACOSX_DEPLOYMENT_TARGET:
+- '11.0'
+aws_sdk_cpp:
+- 1.8.186
+bzip2:
+- '1'
+c_compiler:
+- clang
+c_compiler_version:
+- '11'
+channel_sources:
+- conda-forge/label/rust_dev,conda-forge
+channel_targets:
+- conda-forge main
+cuda_compiler_version:
+- None
+cxx_compiler:
+- clangxx
+cxx_compiler_version:
+- '11'
+gflags:
+- '2.2'
+glog:
+- '0.5'
+grpc_cpp:
+- '1.38'
+libprotobuf:
+- '3.16'
+lz4_c:
+- 1.9.3
+macos_machine:
+- arm64-apple-darwin20.0.0
+numpy:
+- '1.19'
+orc:
+- 1.6.8
+pin_run_as_build:
+  bzip2:
+    max_pin: x
+  lz4-c:
+    max_pin: x.x.x
+  python:
+    min_pin: x.x
+    max_pin: x.x
+  zlib:
+    max_pin: x.x
+python:
+- 3.8.* *_cpython
+re2:
+- 2021.06.01
+snappy:
+- '1'
+target_platform:
+- osx-arm64
+thrift_cpp:
+- 0.14.2
+zip_keys:
+- - c_compiler_version
+  - cxx_compiler_version
+- - python
+  - numpy
+zlib:
+- '1.2'
+zstd:
+- '1.5'
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/osx_arm64_python3.9.____cpython.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/osx_arm64_python3.9.____cpython.yaml
new file mode 100644
index 000000000..cd3eca6d2
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/osx_arm64_python3.9.____cpython.yaml
@@ -0,0 +1,65 @@
+MACOSX_DEPLOYMENT_TARGET:
+- '11.0'
+aws_sdk_cpp:
+- 1.8.186
+bzip2:
+- '1'
+c_compiler:
+- clang
+c_compiler_version:
+- '11'
+channel_sources:
+- conda-forge/label/rust_dev,conda-forge
+channel_targets:
+- conda-forge main
+cuda_compiler_version:
+- None
+cxx_compiler:
+- clangxx
+cxx_compiler_version:
+- '11'
+gflags:
+- '2.2'
+glog:
+- '0.5'
+grpc_cpp:
+- '1.38'
+libprotobuf:
+- '3.16'
+lz4_c:
+- 1.9.3
+macos_machine:
+- arm64-apple-darwin20.0.0
+numpy:
+- '1.19'
+orc:
+- 1.6.8
+pin_run_as_build:
+  bzip2:
+    max_pin: x
+  lz4-c:
+    max_pin: x.x.x
+  python:
+    min_pin: x.x
+    max_pin: x.x
+  zlib:
+    max_pin: x.x
+python:
+- 3.9.* *_cpython
+re2:
+- 2021.06.01
+snappy:
+- '1'
+target_platform:
+- osx-arm64
+thrift_cpp:
+- 0.14.2
+zip_keys:
+- - c_compiler_version
+  - cxx_compiler_version
+- - python
+  - numpy
+zlib:
+- '1.2'
+zstd:
+- '1.5'
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/r/linux_64_r_base4.0.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/r/linux_64_r_base4.0.yaml
new file mode 100644
index 000000000..dfdfae966
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/r/linux_64_r_base4.0.yaml
@@ -0,0 +1,29 @@
+c_compiler:
+- gcc
+c_compiler_version:
+- '9'
+cdt_name:
+- cos6
+channel_sources:
+- conda-forge,defaults
+channel_targets:
+- conda-forge main
+cxx_compiler:
+- gxx
+cxx_compiler_version:
+- '9'
+docker_image:
+- quay.io/condaforge/linux-anvil-comp7
+pin_run_as_build:
+  r-base:
+    min_pin: x.x
+    max_pin: x.x
+r_base:
+- '4.0'
+target_platform:
+- linux-64
+zip_keys:
+- - c_compiler_version
+  - cxx_compiler_version
+- - cdt_name
+  - docker_image
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/r/linux_64_r_base4.1.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/r/linux_64_r_base4.1.yaml
new file mode 100644
index 000000000..c5f455c19
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/r/linux_64_r_base4.1.yaml
@@ -0,0 +1,29 @@
+c_compiler:
+- gcc
+c_compiler_version:
+- '9'
+cdt_name:
+- cos6
+channel_sources:
+- conda-forge,defaults
+channel_targets:
+- conda-forge main
+cxx_compiler:
+- gxx
+cxx_compiler_version:
+- '9'
+docker_image:
+- quay.io/condaforge/linux-anvil-comp7
+pin_run_as_build:
+  r-base:
+    min_pin: x.x
+    max_pin: x.x
+r_base:
+- '4.1'
+target_platform:
+- linux-64
+zip_keys:
+- - c_compiler_version
+  - cxx_compiler_version
+- - cdt_name
+  - docker_image
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/r/osx_64_r_base4.0.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/r/osx_64_r_base4.0.yaml
new file mode 100644
index 000000000..08bb81d08
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/r/osx_64_r_base4.0.yaml
@@ -0,0 +1,27 @@
+MACOSX_DEPLOYMENT_TARGET:
+- '10.9'
+c_compiler:
+- clang
+c_compiler_version:
+- '11'
+channel_sources:
+- conda-forge,defaults
+channel_targets:
+- conda-forge main
+cxx_compiler:
+- clangxx
+cxx_compiler_version:
+- '11'
+macos_machine:
+- x86_64-apple-darwin13.4.0
+pin_run_as_build:
+  r-base:
+    min_pin: x.x
+    max_pin: x.x
+r_base:
+- '4.0'
+target_platform:
+- osx-64
+zip_keys:
+- - c_compiler_version
+  - cxx_compiler_version
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/r/osx_64_r_base4.1.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/r/osx_64_r_base4.1.yaml
new file mode 100644
index 000000000..9974c6638
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/r/osx_64_r_base4.1.yaml
@@ -0,0 +1,27 @@
+MACOSX_DEPLOYMENT_TARGET:
+- '10.9'
+c_compiler:
+- clang
+c_compiler_version:
+- '11'
+channel_sources:
+- conda-forge,defaults
+channel_targets:
+- conda-forge main
+cxx_compiler:
+- clangxx
+cxx_compiler_version:
+- '11'
+macos_machine:
+- x86_64-apple-darwin13.4.0
+pin_run_as_build:
+  r-base:
+    min_pin: x.x
+    max_pin: x.x
+r_base:
+- '4.1'
+target_platform:
+- osx-64
+zip_keys:
+- - c_compiler_version
+  - cxx_compiler_version
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/r/win_64_r_base4.0.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/r/win_64_r_base4.0.yaml
new file mode 100644
index 000000000..02c2a7075
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/r/win_64_r_base4.0.yaml
@@ -0,0 +1,12 @@
+channel_sources:
+- conda-forge,defaults
+channel_targets:
+- conda-forge main
+pin_run_as_build:
+  r-base:
+    min_pin: x.x
+    max_pin: x.x
+r_base:
+- '4.0'
+target_platform:
+- win-64
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/r/win_64_r_base4.1.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/r/win_64_r_base4.1.yaml
new file mode 100644
index 000000000..2fe9ad314
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/r/win_64_r_base4.1.yaml
@@ -0,0 +1,12 @@
+channel_sources:
+- conda-forge,defaults
+channel_targets:
+- conda-forge main
+pin_run_as_build:
+  r-base:
+    min_pin: x.x
+    max_pin: x.x
+r_base:
+- '4.1'
+target_platform:
+- win-64
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/win_64_cuda_compiler_versionNonenumpy1.17python3.6.____cpython.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/win_64_cuda_compiler_versionNonenumpy1.17python3.6.____cpython.yaml
new file mode 100644
index 000000000..8d4e25167
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/win_64_cuda_compiler_versionNonenumpy1.17python3.6.____cpython.yaml
@@ -0,0 +1,55 @@
+aws_sdk_cpp:
+- 1.8.186
+bzip2:
+- '1'
+c_compiler:
+- vs2017
+channel_sources:
+- conda-forge,defaults
+channel_targets:
+- conda-forge main
+cuda_compiler:
+- nvcc
+cuda_compiler_version:
+- None
+cxx_compiler:
+- vs2017
+gflags:
+- '2.2'
+glog:
+- '0.5'
+grpc_cpp:
+- '1.38'
+libprotobuf:
+- '3.16'
+lz4_c:
+- 1.9.3
+numpy:
+- '1.17'
+pin_run_as_build:
+  bzip2:
+    max_pin: x
+  lz4-c:
+    max_pin: x.x.x
+  python:
+    min_pin: x.x
+    max_pin: x.x
+  zlib:
+    max_pin: x.x
+python:
+- 3.6.* *_cpython
+re2:
+- 2021.06.01
+snappy:
+- '1'
+target_platform:
+- win-64
+thrift_cpp:
+- 0.14.2
+zip_keys:
+- - numpy
+  - python
+zlib:
+- '1.2'
+zstd:
+- '1.5'
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/win_64_cuda_compiler_versionNonenumpy1.17python3.7.____cpython.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/win_64_cuda_compiler_versionNonenumpy1.17python3.7.____cpython.yaml
new file mode 100644
index 000000000..8da4a8380
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/win_64_cuda_compiler_versionNonenumpy1.17python3.7.____cpython.yaml
@@ -0,0 +1,55 @@
+aws_sdk_cpp:
+- 1.8.186
+bzip2:
+- '1'
+c_compiler:
+- vs2017
+channel_sources:
+- conda-forge,defaults
+channel_targets:
+- conda-forge main
+cuda_compiler:
+- nvcc
+cuda_compiler_version:
+- None
+cxx_compiler:
+- vs2017
+gflags:
+- '2.2'
+glog:
+- '0.5'
+grpc_cpp:
+- '1.38'
+libprotobuf:
+- '3.16'
+lz4_c:
+- 1.9.3
+numpy:
+- '1.17'
+pin_run_as_build:
+  bzip2:
+    max_pin: x
+  lz4-c:
+    max_pin: x.x.x
+  python:
+    min_pin: x.x
+    max_pin: x.x
+  zlib:
+    max_pin: x.x
+python:
+- 3.7.* *_cpython
+re2:
+- 2021.06.01
+snappy:
+- '1'
+target_platform:
+- win-64
+thrift_cpp:
+- 0.14.2
+zip_keys:
+- - numpy
+  - python
+zlib:
+- '1.2'
+zstd:
+- '1.5'
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/win_64_cuda_compiler_versionNonenumpy1.17python3.8.____cpython.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/win_64_cuda_compiler_versionNonenumpy1.17python3.8.____cpython.yaml
new file mode 100644
index 000000000..1980e1be3
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/win_64_cuda_compiler_versionNonenumpy1.17python3.8.____cpython.yaml
@@ -0,0 +1,55 @@
+aws_sdk_cpp:
+- 1.8.186
+bzip2:
+- '1'
+c_compiler:
+- vs2017
+channel_sources:
+- conda-forge,defaults
+channel_targets:
+- conda-forge main
+cuda_compiler:
+- nvcc
+cuda_compiler_version:
+- None
+cxx_compiler:
+- vs2017
+gflags:
+- '2.2'
+glog:
+- '0.5'
+grpc_cpp:
+- '1.38'
+libprotobuf:
+- '3.16'
+lz4_c:
+- 1.9.3
+numpy:
+- '1.17'
+pin_run_as_build:
+  bzip2:
+    max_pin: x
+  lz4-c:
+    max_pin: x.x.x
+  python:
+    min_pin: x.x
+    max_pin: x.x
+  zlib:
+    max_pin: x.x
+python:
+- 3.8.* *_cpython
+re2:
+- 2021.06.01
+snappy:
+- '1'
+target_platform:
+- win-64
+thrift_cpp:
+- 0.14.2
+zip_keys:
+- - numpy
+  - python
+zlib:
+- '1.2'
+zstd:
+- '1.5'
diff --git a/src/arrow/dev/tasks/conda-recipes/.ci_support/win_64_cuda_compiler_versionNonenumpy1.19python3.9.____cpython.yaml b/src/arrow/dev/tasks/conda-recipes/.ci_support/win_64_cuda_compiler_versionNonenumpy1.19python3.9.____cpython.yaml
new file mode 100644
index 000000000..1106037d3
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.ci_support/win_64_cuda_compiler_versionNonenumpy1.19python3.9.____cpython.yaml
@@ -0,0 +1,55 @@
+aws_sdk_cpp:
+- 1.8.186
+bzip2:
+- '1'
+c_compiler:
+- vs2017
+channel_sources:
+- conda-forge,defaults
+channel_targets:
+- conda-forge main
+cuda_compiler:
+- nvcc
+cuda_compiler_version:
+- None
+cxx_compiler:
+- vs2017
+gflags:
+- '2.2'
+glog:
+- '0.5'
+grpc_cpp:
+- '1.38'
+libprotobuf:
+- '3.16'
+lz4_c:
+- 1.9.3
+numpy:
+- '1.19'
+pin_run_as_build:
+  bzip2:
+    max_pin: x
+  lz4-c:
+    max_pin: x.x.x
+  python:
+    min_pin: x.x
+    max_pin: x.x
+  zlib:
+    max_pin: x.x
+python:
+- 3.9.* *_cpython
+re2:
+- 2021.06.01
+snappy:
+- '1'
+target_platform:
+- win-64
+thrift_cpp:
+- 0.14.2
+zip_keys:
+- - numpy
+  - python
+zlib:
+- '1.2'
+zstd:
+- '1.5'
diff --git a/src/arrow/dev/tasks/conda-recipes/.scripts/logging_utils.sh b/src/arrow/dev/tasks/conda-recipes/.scripts/logging_utils.sh
new file mode 100644
index 000000000..a53ef3f2c
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/.scripts/logging_utils.sh
@@ -0,0 +1,30 @@
+#!/bin/bash
+
+# Provide a unified interface for the different logging
+# utilities CI providers offer. If unavailable, provide
+# a compatible fallback (e.g. bare `echo xxxxxx`).
+
+function startgroup {
+    # Start a foldable group of log lines
+    # Pass a single argument, quoted
+    case ${CI:-} in
+        azure )
+            echo "##[group]$1";;
+        travis )
+            echo "$1"
+            echo -en 'travis_fold:start:'"${1// /}"'\\r';;
+        * )
+            echo "$1";;
+    esac
+}
+
+function endgroup {
+    # End a foldable group of log lines
+    # Pass a single argument, quoted
+    case ${CI:-} in
+        azure )
+            echo "##[endgroup]";;
+        travis )
+            echo -en 'travis_fold:end:'"${1// /}"'\\r';;
+    esac
+}
diff --git a/src/arrow/dev/tasks/conda-recipes/README.md b/src/arrow/dev/tasks/conda-recipes/README.md
new file mode 100644
index 000000000..39f82f1b0
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/README.md
@@ -0,0 +1,67 @@
+<!---
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+-->
+
+# Conda Forge recipes
+
+This directory must be migrated periodically with the upstrem updates of
+[arrow-cpp-feedstock][arrow-cpp-feedstock],
+[parquet-cpp-feedstock][parquet-cpp-feedstock].
+conda-forge repositories because of multiple vendored files.
+
+## Keeping the recipes synchronized
+
+The recipes here are tested on nightly basis, so they follow the development
+versions of arrow instead of the upstream recipes, which are suitable for the
+latest releases.
+
+### Backporting from the upstream feedstocks
+
+In most of the cases these recipes are more accurate, then the upstream
+feedstocks. Although the upstream feedstocks regularly receive automatic updates
+by the conda-forge team so we need to backport those changes to the crossbow
+recipes. Most of these updates are touching the version pinning files
+(under `.ci_support`) and other CI related configuration files.
+
+Because all three recipes must be built in the same continuous integration
+job prefer porting from the [arrpw-cpp feedstock][arrow-cpp-feedstock].
+
+#### Updating the variants:
+
+Copy the configuration files from `arrow-cpp-feedstock/.ci_support` to the
+`.ci_support` folder.
+
+#### Updating the CI configurations:
+
+The `.azure-pipelines/azure-pipelines-[linux|osx|win].yml` should be ported
+to the local counterparts under `.azure-pipelines` with keeping the crossbow
+related parts (the cloning of arrow and the jinja templated variables) and
+moving the matrix definitions like [this][matrix-definition] to the crossbow
+[tasks.yml][../tasks.yml] config file.
+
+
+### Porting recipes from crossbow to the upstream feedstocks
+
+Theoretically these recipes should be up to date with the actual version of
+Arrow, so during the release procedure the content of these recipes should be
+copied to the upstream feedstocks.
+
+
+[arrow-cpp-feedstock]: https://github.com/conda-forge/arrow-cpp-feedstock
+[parquet-cpp-feedstock]: https://github.com/conda-forge/parquet-cpp-feedstock
+[matrix-definition]: https://github.com/conda-forge/arrow-cpp-feedstock/blob/master/.azure-pipelines/azure-pipelines-linux.yml#L12
diff --git a/src/arrow/dev/tasks/conda-recipes/arrow-cpp/LLVM_LICENSE.txt b/src/arrow/dev/tasks/conda-recipes/arrow-cpp/LLVM_LICENSE.txt
new file mode 100644
index 000000000..461398bab
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/arrow-cpp/LLVM_LICENSE.txt
@@ -0,0 +1,68 @@
+==============================================================================
+LLVM Release License
+==============================================================================
+University of Illinois/NCSA
+Open Source License
+
+Copyright (c) 2003-2018 University of Illinois at Urbana-Champaign.
+All rights reserved.
+
+Developed by:
+
+    LLVM Team
+
+    University of Illinois at Urbana-Champaign
+
+    http://llvm.org
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal with
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
+of the Software, and to permit persons to whom the Software is furnished to do
+so, subject to the following conditions:
+
+    * Redistributions of source code must retain the above copyright notice,
+      this list of conditions and the following disclaimers.
+
+    * Redistributions in binary form must reproduce the above copyright notice,
+      this list of conditions and the following disclaimers in the
+      documentation and/or other materials provided with the distribution.
+
+    * Neither the names of the LLVM Team, University of Illinois at
+      Urbana-Champaign, nor the names of its contributors may be used to
+      endorse or promote products derived from this Software without specific
+      prior written permission.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS
+FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.  IN NO EVENT SHALL THE
+CONTRIBUTORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS WITH THE
+SOFTWARE.
+
+==============================================================================
+Copyrights and Licenses for Third Party Software Distributed with LLVM:
+==============================================================================
+The LLVM software contains code written by third parties.  Such software will
+have its own individual LICENSE.TXT file in the directory in which it appears.
+This file will describe the copyrights, license, and restrictions which apply
+to that code.
+
+The disclaimer of warranty in the University of Illinois Open Source License
+applies to all code in the LLVM Distribution, and nothing in any of the
+other licenses gives permission to use the names of the LLVM Team or the
+University of Illinois to endorse or promote products derived from this
+Software.
+
+The following pieces of software have additional or alternate copyrights,
+licenses, and/or restrictions:
+
+Program             Directory
+-------             ---------
+Google Test         llvm/utils/unittest/googletest
+OpenBSD regex       llvm/lib/Support/{reg*, COPYRIGHT.regex}
+pyyaml tests        llvm/test/YAMLParser/{*.data, LICENSE.TXT}
+ARM contributions   llvm/lib/Target/ARM/LICENSE.TXT
+md5 contributions   llvm/lib/Support/MD5.cpp llvm/include/llvm/Support/MD5.h
diff --git a/src/arrow/dev/tasks/conda-recipes/arrow-cpp/bld-arrow.bat b/src/arrow/dev/tasks/conda-recipes/arrow-cpp/bld-arrow.bat
new file mode 100644
index 000000000..0527356f7
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/arrow-cpp/bld-arrow.bat
@@ -0,0 +1,55 @@
+@echo on
+
+mkdir "%SRC_DIR%"\cpp\build
+pushd "%SRC_DIR%"\cpp\build
+
+:: Enable CUDA support
+if "%cuda_compiler_version%"=="None" (
+    set "EXTRA_CMAKE_ARGS=-DARROW_CUDA=OFF"
+) else (
+    REM this should move to nvcc-feedstock
+    set "CUDA_PATH=%CUDA_PATH:\=/%"
+    set "CUDA_HOME=%CUDA_HOME:\=/%"
+
+    set "EXTRA_CMAKE_ARGS=-DARROW_CUDA=ON"
+)
+
+cmake -G "Ninja" ^
+      -DBUILD_SHARED_LIBS=ON ^
+      -DCMAKE_INSTALL_PREFIX="%LIBRARY_PREFIX%" ^
+      -DARROW_DEPENDENCY_SOURCE=SYSTEM ^
+      -DARROW_PACKAGE_PREFIX="%LIBRARY_PREFIX%" ^
+      -DLLVM_TOOLS_BINARY_DIR="%LIBRARY_BIN%" ^
+      -DPython3_EXECUTABLE="%PYTHON%" ^
+      -DARROW_WITH_BZ2:BOOL=ON ^
+      -DARROW_WITH_ZLIB:BOOL=ON ^
+      -DARROW_WITH_ZSTD:BOOL=ON ^
+      -DARROW_WITH_LZ4:BOOL=ON ^
+      -DARROW_WITH_SNAPPY:BOOL=ON ^
+      -DARROW_WITH_BROTLI:BOOL=ON ^
+      -DARROW_BOOST_USE_SHARED:BOOL=ON ^
+      -DARROW_BUILD_TESTS:BOOL=OFF ^
+      -DARROW_BUILD_UTILITIES:BOOL=OFF ^
+      -DARROW_BUILD_STATIC:BOOL=OFF ^
+      -DCMAKE_BUILD_TYPE=release ^
+      -DARROW_SSE42:BOOL=OFF ^
+      -DARROW_PYTHON:BOOL=ON ^
+      -DARROW_MIMALLOC:BOOL=ON ^
+      -DARROW_DATASET:BOOL=ON ^
+      -DARROW_FLIGHT:BOOL=ON ^
+      -DARROW_FLIGHT_REQUIRE_TLSCREDENTIALSOPTIONS:BOOL=ON ^
+      -DARROW_HDFS:BOOL=ON ^
+      -DARROW_PARQUET:BOOL=ON ^
+      -DARROW_GANDIVA:BOOL=ON ^
+      -DARROW_ORC:BOOL=ON ^
+      -DARROW_S3:BOOL=ON ^
+      -DBoost_NO_BOOST_CMAKE=ON ^
+      -DCMAKE_UNITY_BUILD=ON ^
+      %EXTRA_CMAKE_ARGS% ^
+      ..
+if errorlevel 1 exit 1
+
+cmake --build . --target install --config Release
+if errorlevel 1 exit 1
+
+popd
diff --git a/src/arrow/dev/tasks/conda-recipes/arrow-cpp/bld-pyarrow.bat b/src/arrow/dev/tasks/conda-recipes/arrow-cpp/bld-pyarrow.bat
new file mode 100644
index 000000000..89cec3710
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/arrow-cpp/bld-pyarrow.bat
@@ -0,0 +1,44 @@
+@echo on
+pushd "%SRC_DIR%"\python
+
+@rem the symlinks for cmake modules don't work here
+@rem NOTE: In contrast to conda-forge, they work here as we clone from git.
+@rem del cmake_modules\BuildUtils.cmake
+@rem del cmake_modules\SetupCxxFlags.cmake
+@rem del cmake_modules\CompilerInfo.cmake
+@rem del cmake_modules\FindNumPy.cmake
+@rem del cmake_modules\FindPythonLibsNew.cmake
+@rem copy /Y "%SRC_DIR%\cpp\cmake_modules\BuildUtils.cmake" cmake_modules\
+@rem copy /Y "%SRC_DIR%\cpp\cmake_modules\SetupCxxFlags.cmake" cmake_modules\
+@rem copy /Y "%SRC_DIR%\cpp\cmake_modules\CompilerInfo.cmake" cmake_modules\
+@rem copy /Y "%SRC_DIR%\cpp\cmake_modules\FindNumPy.cmake" cmake_modules\
+@rem copy /Y "%SRC_DIR%\cpp\cmake_modules\FindPythonLibsNew.cmake" cmake_modules\
+
+SET ARROW_HOME=%LIBRARY_PREFIX%
+SET SETUPTOOLS_SCM_PRETEND_VERSION=%PKG_VERSION%
+SET PYARROW_BUILD_TYPE=release
+SET PYARROW_WITH_S3=1
+SET PYARROW_WITH_HDFS=1
+SET PYARROW_WITH_DATASET=1
+SET PYARROW_WITH_FLIGHT=1
+SET PYARROW_WITH_GANDIVA=1
+SET PYARROW_WITH_PARQUET=1
+SET PYARROW_CMAKE_GENERATOR=Ninja
+
+:: Enable CUDA support
+if "%cuda_compiler_version%"=="None" (
+    set "PYARROW_WITH_CUDA=0"
+) else (
+    set "PYARROW_WITH_CUDA=1"
+)
+
+%PYTHON%   setup.py ^
+           build_ext ^
+           install --single-version-externally-managed ^
+                   --record=record.txt
+if errorlevel 1 exit 1
+popd
+
+if [%PKG_NAME%] == [pyarrow] (
+    rd /s /q %SP_DIR%\pyarrow\tests
+)
diff --git a/src/arrow/dev/tasks/conda-recipes/arrow-cpp/build-arrow.sh b/src/arrow/dev/tasks/conda-recipes/arrow-cpp/build-arrow.sh
new file mode 100644
index 000000000..9e4c02c5c
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/arrow-cpp/build-arrow.sh
@@ -0,0 +1,99 @@
+#!/usr/bin/env bash
+
+set -e
+set -x
+
+mkdir cpp/build
+pushd cpp/build
+
+EXTRA_CMAKE_ARGS=""
+
+# Include g++'s system headers
+if [ "$(uname)" == "Linux" ]; then
+  SYSTEM_INCLUDES=$(echo | ${CXX} -E -Wp,-v -xc++ - 2>&1 | grep '^ ' | awk '{print "-isystem;" substr($1, 1)}' | tr '\n' ';')
+  EXTRA_CMAKE_ARGS=" -DARROW_GANDIVA_PC_CXX_FLAGS=${SYSTEM_INCLUDES}"
+fi
+
+# Enable CUDA support
+if [[ ! -z "${cuda_compiler_version+x}" && "${cuda_compiler_version}" != "None" ]]
+then
+    if [[ -z "${CUDA_HOME+x}" ]]
+    then
+        echo "cuda_compiler_version=${cuda_compiler_version} CUDA_HOME=$CUDA_HOME"
+        CUDA_GDB_EXECUTABLE=$(which cuda-gdb || exit 0)
+        if [[ -n "$CUDA_GDB_EXECUTABLE" ]]
+        then
+            CUDA_HOME=$(dirname $(dirname $CUDA_GDB_EXECUTABLE))
+        else
+            echo "Cannot determine CUDA_HOME: cuda-gdb not in PATH"
+            return 1
+        fi
+    fi
+    EXTRA_CMAKE_ARGS=" ${EXTRA_CMAKE_ARGS} -DARROW_CUDA=ON -DCUDA_TOOLKIT_ROOT_DIR=${CUDA_HOME} -DCMAKE_LIBRARY_PATH=${CUDA_HOME}/lib64/stubs"
+else
+    EXTRA_CMAKE_ARGS=" ${EXTRA_CMAKE_ARGS} -DARROW_CUDA=OFF"
+fi
+
+if [[ "${target_platform}" == "osx-arm64" ]]; then
+    # We need llvm 11+ support in Arrow for this
+    # Tell jemalloc to support 16K page size on apple arm64 silicon
+    EXTRA_CMAKE_ARGS=" ${EXTRA_CMAKE_ARGS} -DARROW_GANDIVA=OFF -DARROW_JEMALLOC_LG_PAGE=14"
+    sed -ie "s;protoc-gen-grpc.*$;protoc-gen-grpc=${BUILD_PREFIX}/bin/grpc_cpp_plugin\";g" ../src/arrow/flight/CMakeLists.txt
+elif [[ "${target_platform}" == "linux-aarch64" ]]; then
+    # Tell jemalloc to support both 4k and 64k page arm64 systems
+    # See https://github.com/apache/arrow/pull/10940
+    EXTRA_CMAKE_ARGS=" ${EXTRA_CMAKE_ARGS} -DARROW_GANDIVA=ON -DARROW_JEMALLOC_LG_PAGE=16"
+else
+    EXTRA_CMAKE_ARGS=" ${EXTRA_CMAKE_ARGS} -DARROW_GANDIVA=ON"
+fi
+
+cmake \
+    -DARROW_BOOST_USE_SHARED=ON \
+    -DARROW_BUILD_BENCHMARKS=OFF \
+    -DARROW_BUILD_STATIC=OFF \
+    -DARROW_BUILD_TESTS=OFF \
+    -DARROW_BUILD_UTILITIES=OFF \
+    -DBUILD_SHARED_LIBS=ON \
+    -DARROW_DATASET=ON \
+    -DARROW_DEPENDENCY_SOURCE=SYSTEM \
+    -DARROW_FLIGHT=ON \
+    -DARROW_FLIGHT_REQUIRE_TLSCREDENTIALSOPTIONS=ON \
+    -DARROW_HDFS=ON \
+    -DARROW_JEMALLOC=ON \
+    -DARROW_MIMALLOC=ON \
+    -DARROW_ORC=ON \
+    -DARROW_PACKAGE_PREFIX=$PREFIX \
+    -DARROW_PARQUET=ON \
+    -DARROW_PLASMA=ON \
+    -DARROW_PYTHON=ON \
+    -DARROW_S3=ON \
+    -DARROW_SIMD_LEVEL=NONE \
+    -DARROW_USE_LD_GOLD=ON \
+    -DARROW_WITH_BROTLI=ON \
+    -DARROW_WITH_BZ2=ON \
+    -DARROW_WITH_LZ4=ON \
+    -DARROW_WITH_SNAPPY=ON \
+    -DARROW_WITH_ZLIB=ON \
+    -DARROW_WITH_ZSTD=ON \
+    -DCMAKE_BUILD_TYPE=release \
+    -DCMAKE_INSTALL_LIBDIR=lib \
+    -DCMAKE_INSTALL_PREFIX=$PREFIX \
+    -DLLVM_TOOLS_BINARY_DIR=$PREFIX/bin \
+    -DPython3_EXECUTABLE=${PYTHON} \
+    -DProtobuf_PROTOC_EXECUTABLE=$BUILD_PREFIX/bin/protoc \
+    -GNinja \
+    ${EXTRA_CMAKE_ARGS} \
+    ..
+
+# Commented out until jemalloc and mimalloc are fixed upstream
+if [[ "${target_platform}" == "osx-arm64" ]]; then
+     ninja jemalloc_ep-prefix/src/jemalloc_ep-stamp/jemalloc_ep-patch mimalloc_ep-prefix/src/mimalloc_ep-stamp/mimalloc_ep-patch
+     cp $BUILD_PREFIX/share/gnuconfig/config.* jemalloc_ep-prefix/src/jemalloc_ep/build-aux/
+     sed -ie 's/list(APPEND mi_cflags -march=native)//g' mimalloc_ep-prefix/src/mimalloc_ep/CMakeLists.txt
+     # Use the correct register for thread-local storage
+     sed -ie 's/tpidr_el0/tpidrro_el0/g' mimalloc_ep-prefix/src/mimalloc_ep/include/mimalloc-internal.h
+fi
+
+ninja install
+
+popd
diff --git a/src/arrow/dev/tasks/conda-recipes/arrow-cpp/build-pyarrow.sh b/src/arrow/dev/tasks/conda-recipes/arrow-cpp/build-pyarrow.sh
new file mode 100644
index 000000000..f0cf9ceb4
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/arrow-cpp/build-pyarrow.sh
@@ -0,0 +1,49 @@
+#!/usr/bin/env sh
+
+set -e
+set -x
+
+# Build dependencies
+export ARROW_HOME=$PREFIX
+export PARQUET_HOME=$PREFIX
+export SETUPTOOLS_SCM_PRETEND_VERSION=$PKG_VERSION
+export PYARROW_BUILD_TYPE=release
+export PYARROW_BUNDLE_ARROW_CPP_HEADERS=0
+export PYARROW_WITH_DATASET=1
+export PYARROW_WITH_FLIGHT=1
+if [[ "${target_platform}" == "osx-arm64" ]]; then
+    # We need llvm 11+ support in Arrow for this
+    export PYARROW_WITH_GANDIVA=0
+else
+    export PYARROW_WITH_GANDIVA=1
+fi
+export PYARROW_WITH_HDFS=1
+export PYARROW_WITH_ORC=1
+export PYARROW_WITH_PARQUET=1
+export PYARROW_WITH_PLASMA=1
+export PYARROW_WITH_S3=1
+export PYARROW_CMAKE_GENERATOR=Ninja
+BUILD_EXT_FLAGS=""
+
+# Enable CUDA support
+if [[ ! -z "${cuda_compiler_version+x}" && "${cuda_compiler_version}" != "None" ]]; then
+    export PYARROW_WITH_CUDA=1
+else
+    export PYARROW_WITH_CUDA=0
+fi
+
+# Resolve: Make Error at cmake_modules/SetupCxxFlags.cmake:338 (message): Unsupported arch flag: -march=.
+if [[ "${target_platform}" == "linux-aarch64" ]]; then
+    export PYARROW_CMAKE_OPTIONS="-DARROW_ARMV8_ARCH=armv8-a"
+fi
+
+cd python
+
+$PYTHON setup.py \
+        build_ext \
+        install --single-version-externally-managed \
+                --record=record.txt
+
+if [[ "$PKG_NAME" == "pyarrow" ]]; then
+    rm -r ${SP_DIR}/pyarrow/tests
+fi
diff --git a/src/arrow/dev/tasks/conda-recipes/arrow-cpp/meta.yaml b/src/arrow/dev/tasks/conda-recipes/arrow-cpp/meta.yaml
new file mode 100644
index 000000000..48a862986
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/arrow-cpp/meta.yaml
@@ -0,0 +1,302 @@
+# NOTE: In constrast to the conda-forge recipe, ARROW_VERSION is a templated variable here.
+{% set version = ARROW_VERSION %}
+{% set cuda_enabled = cuda_compiler_version != "None" %}
+{% set build_ext_version = ARROW_VERSION %}
+{% set build_ext = "cuda" if cuda_enabled else "cpu" %}
+{% set proc_build_number = "0" %}
+
+package:
+  name: arrow-cpp-ext
+  version: {{ version }}
+
+source:
+  path: ../../../../
+
+build:
+  number: 0
+  # for cuda on win/linux, building with 9.2 is enough to be compatible with all later versions,
+  # since arrow is only using libcuda, and not libcudart.
+  skip: true  # [(win or linux) and cuda_compiler_version not in ("None", "10.2")]
+  skip: true  # [osx and cuda_compiler_version != "None"]
+  run_exports:
+    - {{ pin_subpackage("arrow-cpp", max_pin="x.x.x") }}
+
+outputs:
+  - name: arrow-cpp-proc
+    version: {{ build_ext_version }}
+    build:
+      number: {{ proc_build_number }}
+      string: "{{ build_ext }}"
+    test:
+      commands:
+        - exit 0
+    about:
+      home: http://github.com/apache/arrow
+      license: Apache-2.0
+      license_file:
+        - LICENSE.txt
+      summary: 'A meta-package to select Arrow build variant'
+
+  - name: arrow-cpp
+    script: build-arrow.sh  # [not win]
+    script: bld-arrow.bat   # [win]
+    version: {{ version }}
+    build:
+      string: py{{ CONDA_PY }}h{{ PKG_HASH }}_{{ PKG_BUILDNUM }}_{{ build_ext }}
+      run_exports:
+        - {{ pin_subpackage("arrow-cpp", max_pin="x.x.x") }}
+      ignore_run_exports:
+        - cudatoolkit
+      track_features:
+        {{ "- arrow-cuda" if cuda_enabled else "" }}
+    requirements:
+      build:
+        - python                                 # [build_platform != target_platform]
+        - cross-python_{{ target_platform }}     # [build_platform != target_platform]
+        - cython                                 # [build_platform != target_platform]
+        - numpy                                  # [build_platform != target_platform]
+        - gnuconfig                              # [osx and arm64]
+        - libprotobuf
+        - grpc-cpp
+        - cmake
+        - autoconf  # [unix]
+        - ninja
+        - make  # [unix]
+        - {{ compiler('c') }}
+        - {{ compiler('cxx') }}
+        - {{ compiler("cuda") }}  # [cuda_compiler_version != "None"]
+      host:
+        - aws-sdk-cpp
+        - boost-cpp >=1.70
+        - brotli
+        - bzip2
+        - c-ares
+        - gflags
+        - glog
+        - grpc-cpp
+        - libprotobuf
+        - clangdev 10  # [not (osx and arm64)]
+        - llvmdev 10   # [not (osx and arm64)]
+        - libutf8proc
+        - lz4-c
+        - numpy
+        - orc  # [unix]
+        - python
+        - rapidjson
+        - re2
+        - snappy
+        - thrift-cpp
+        - zlib
+        - zstd
+      run:
+        - {{ pin_compatible('numpy', lower_bound='1.16') }}
+        - python
+      run_constrained:
+        - arrow-cpp-proc * {{ build_ext }}
+        - cudatoolkit >=9.2  # [cuda_compiler_version != "None"]
+
+    about:
+      home: http://github.com/apache/arrow
+      license: Apache-2.0
+      license_file:
+        - LICENSE.txt
+      summary: C++ libraries for Apache Arrow
+
+    test:
+      commands:
+        # headers
+        - test -f $PREFIX/include/arrow/api.h              # [unix]
+        - test -f $PREFIX/include/arrow/flight/types.h     # [unix]
+        - test -f $PREFIX/include/plasma/client.h          # [unix]
+        - test -f $PREFIX/include/gandiva/engine.h         # [unix and not (osx and arm64)]
+        - test -f $PREFIX/include/parquet/api/reader.h     # [unix]
+        - if not exist %LIBRARY_INC%\\arrow\\api.h exit 1            # [win]
+        - if not exist %LIBRARY_INC%\\gandiva\\engine.h exit 1       # [win]
+        - if not exist %LIBRARY_INC%\\parquet\\api\\reader.h exit 1  # [win]
+
+        # shared
+        - test -f $PREFIX/lib/libarrow.so            # [linux]
+        - test -f $PREFIX/lib/libarrow_dataset.so    # [linux]
+        - test -f $PREFIX/lib/libarrow_flight.so     # [linux]
+        - test -f $PREFIX/lib/libarrow_python.so     # [linux]
+        - test -f $PREFIX/lib/libparquet.so          # [linux]
+        - test -f $PREFIX/lib/libgandiva.so          # [linux]
+        - test -f $PREFIX/lib/libplasma.so           # [linux]
+        - test -f $PREFIX/lib/libarrow_cuda${SHLIB_EXT}               # [(cuda_compiler_version != "None") and unix]
+        - test ! -f $PREFIX/lib/libarrow_cuda${SHLIB_EXT}             # [(cuda_compiler_version == "None") and unix]
+        - if not exist %PREFIX%\\Library\\bin\\arrow_cuda.dll exit 1  # [(cuda_compiler_version != "None") and win]
+        - if exist %PREFIX%\\Library\\bin\\arrow_cuda.dll exit 1      # [(cuda_compiler_version == "None") and win]
+        - test -f $PREFIX/lib/libarrow.dylib          # [osx]
+        - test -f $PREFIX/lib/libarrow_dataset.dylib  # [osx]
+        - test -f $PREFIX/lib/libarrow_python.dylib   # [osx]
+        - test -f $PREFIX/lib/libgandiva.dylib        # [osx and not arm64]
+        - test -f $PREFIX/lib/libparquet.dylib        # [osx]
+        - test -f $PREFIX/lib/libplasma.dylib         # [osx]
+        - if not exist %PREFIX%\\Library\\bin\\arrow.dll exit 1          # [win]
+        - if not exist %PREFIX%\\Library\\bin\\arrow_dataset.dll exit 1  # [win]
+        - if not exist %PREFIX%\\Library\\bin\\arrow_flight.dll exit 1   # [win]
+        - if not exist %PREFIX%\\Library\\bin\\arrow_python.dll exit 1   # [win]
+        - if not exist %PREFIX%\\Library\\bin\\parquet.dll exit 1        # [win]
+        - if not exist %PREFIX%\\Library\\bin\\gandiva.dll exit 1        # [win]
+
+        # absence of static libraries
+        - test ! -f $PREFIX/lib/libarrow.a          # [unix]
+        - test ! -f $PREFIX/lib/libarrow_dataset.a  # [unix]
+        - test ! -f $PREFIX/lib/libarrow_flight.a   # [unix]
+        - test ! -f $PREFIX/lib/libarrow_python.a   # [unix]
+        - test ! -f $PREFIX/lib/libplasma.a         # [unix]
+        - test ! -f $PREFIX/lib/libparquet.a        # [unix]
+        - test ! -f $PREFIX/lib/libgandiva.a        # [unix]
+        - if exist %PREFIX%\\Library\\lib\\arrow_static.lib exit 1          # [win]
+        - if exist %PREFIX%\\Library\\lib\\arrow_dataset_static.lib exit 1  # [win]
+        - if exist %PREFIX%\\Library\\lib\\arrow_flight_static.lib exit 1   # [win]
+        - if exist %PREFIX%\\Library\\lib\\arrow_python_static.lib exit 1   # [win]
+        - if exist %PREFIX%\\Library\\lib\\parquet_static.lib exit 1        # [win]
+        - if exist %PREFIX%\\Library\\lib\\gandiva_static.lib exit 1        # [win]
+
+  - name: pyarrow
+    script: build-pyarrow.sh  # [not win]
+    script: bld-pyarrow.bat   # [win]
+    version: {{ version }}
+    build:
+      string: py{{ CONDA_PY }}h{{ PKG_HASH }}_{{ PKG_BUILDNUM }}_{{ build_ext }}
+      ignore_run_exports:
+        - cudatoolkit
+      track_features:
+        {{ "- arrow-cuda" if cuda_enabled else "" }}
+    requirements:
+      build:
+        - python                                 # [build_platform != target_platform]
+        - cross-python_{{ target_platform }}     # [build_platform != target_platform]
+        - cython                                 # [build_platform != target_platform]
+        - numpy                                  # [build_platform != target_platform]
+        - cmake
+        - ninja
+        - make  # [unix]
+        - {{ compiler('c') }}
+        - {{ compiler('cxx') }}
+        # pyarrow does not require nvcc but it needs to link against libraries in arrow-cpp=*=*cuda
+        - {{ compiler("cuda") }}  # [cuda_compiler_version != "None"]
+      host:
+        - {{ pin_subpackage('arrow-cpp', exact=True) }}
+        - cython
+        - numpy
+        - python
+        - setuptools
+        - setuptools_scm
+        - six
+      run:
+        - {{ pin_subpackage('arrow-cpp', exact=True) }}
+        - {{ pin_compatible('numpy', lower_bound='1.16') }}
+        # empty parquet-cpp metapackage, force old versions to be uninstalled
+        - parquet-cpp 1.5.1.*
+        - python
+      run_constrained:
+        - arrow-cpp-proc * {{ build_ext }}
+        - cudatoolkit >=9.2  # [cuda_compiler_version != "None"]
+
+    about:
+      home: http://github.com/apache/arrow
+      license: Apache-2.0
+      license_file:
+        - LICENSE.txt
+      summary: Python libraries for Apache Arrow
+
+    test:
+      imports:
+        - pyarrow
+        - pyarrow.dataset
+        - pyarrow.flight
+        - pyarrow.gandiva  # [not (osx and arm64)]
+        - pyarrow.orc      # [unix]
+        - pyarrow.parquet
+        - pyarrow.plasma   # [unix]
+        - pyarrow.fs
+        - pyarrow._s3fs
+        - pyarrow._hdfs
+        # We can only test importing cuda package but cannot run when a
+        # CUDA device is not available, for instance, when building from CI.
+        # On Windows, we cannot even do that due to `nvcuda.dll` not being found, see
+        # https://conda-forge.org/docs/maintainer/knowledge_base.html#nvcuda-dll-cannot-be-found-on-windows
+        # However, we check below for (at least) the presence of a correctly-compiled module
+        - pyarrow.cuda     # [cuda_compiler_version != "None" and not win]
+      commands:
+        - test ! -f ${SP_DIR}/pyarrow/tests/test_array.py                         # [unix]
+        - if exist %SP_DIR%/pyarrow/tests/test_array.py exit 1                    # [win]
+        # Need to remove dot from PY_VER; %MYVAR:x=y% replaces "x" in %MYVAR% with "y"
+        - if not exist %SP_DIR%/pyarrow/_cuda.cp%PY_VER:.=%-win_amd64.pyd exit 1  # [win and cuda_compiler_version != "None"]
+
+  - name: pyarrow-tests
+    script: build-pyarrow.sh  # [not win]
+    script: bld-pyarrow.bat   # [win]
+    version: {{ version }}
+    build:
+      string: py{{ CONDA_PY }}h{{ PKG_HASH }}_{{ PKG_BUILDNUM }}_{{ build_ext }}
+      ignore_run_exports:
+        - cudatoolkit
+      track_features:
+        {{ "- arrow-cuda" if cuda_enabled else "" }}
+    requirements:
+      build:
+        - python                                 # [build_platform != target_platform]
+        - cross-python_{{ target_platform }}     # [build_platform != target_platform]
+        - cython                                 # [build_platform != target_platform]
+        - numpy                                  # [build_platform != target_platform]
+        - cmake
+        - ninja
+        - make  # [unix]
+        - {{ compiler('c') }}
+        - {{ compiler('cxx') }}
+        # pyarrow does not require nvcc but it needs to link against libraries in arrow-cpp=*=*cuda
+        - {{ compiler("cuda") }}  # [cuda_compiler_version != "None"]
+      host:
+        - {{ pin_subpackage('arrow-cpp', exact=True) }}
+        - {{ pin_subpackage('pyarrow', exact=True) }}
+        - cython
+        - numpy
+        - python
+        - setuptools
+        - setuptools_scm
+        - six
+      run:
+        - {{ pin_subpackage('pyarrow', exact=True) }}
+        - python
+      run_constrained:
+        - arrow-cpp-proc * {{ build_ext }}
+        - cudatoolkit >=9.2  # [cuda_compiler_version != "None"]
+
+    about:
+      home: http://github.com/apache/arrow
+      license: Apache-2.0
+      license_file:
+        - LICENSE.txt
+      summary: Python test files for Apache Arrow
+
+    test:
+      commands:
+        - test -f ${SP_DIR}/pyarrow/tests/test_array.py             # [unix]
+        - if not exist %SP_DIR%/pyarrow/tests/test_array.py exit 1  # [win]
+
+about:
+  home: http://github.com/apache/arrow
+  license: Apache-2.0
+  license_file:
+    - LICENSE.txt
+  summary: C++ and Python libraries for Apache Arrow
+
+extra:
+  recipe-maintainers:
+    - wesm
+    - xhochy
+    - leifwalsh
+    - jreback
+    - cpcloud
+    - pcmoritz
+    - robertnishihara
+    - siddharthteotia
+    - kou
+    - kszucs
+    - pitrou
+    - pearu
+    - nealrichardson
+    - jakirkham
diff --git a/src/arrow/dev/tasks/conda-recipes/azure.clean.yml b/src/arrow/dev/tasks/conda-recipes/azure.clean.yml
new file mode 100644
index 000000000..84f167812
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/azure.clean.yml
@@ -0,0 +1,28 @@
+jobs:
+- job: linux
+  pool:
+    vmImage: ubuntu-latest
+  timeoutInMinutes: 360
+
+  steps:
+  - script: |
+      git clone --no-checkout {{ arrow.remote }} arrow
+      git -C arrow fetch -t {{ arrow.remote }} {{ arrow.branch }}
+      git -C arrow checkout FETCH_HEAD
+      git -C arrow submodule update --init --recursive
+    displayName: Clone arrow
+
+  - script: |
+      conda install -y -c conda-forge pandas anaconda-client packaging
+    displayName: Install requirements
+
+  - script: |
+      {% if arrow.branch == 'master' %}
+      mkdir -p $HOME/.continuum/anaconda-client/tokens/
+      echo $(CROSSBOW_ANACONDA_TOKEN) > $HOME/.continuum/anaconda-client/tokens/https%3A%2F%2Fapi.anaconda.org.token
+      {% endif %}
+      eval "$(conda shell.bash hook)"
+      conda activate base
+      python3 arrow/dev/tasks/conda-recipes/clean.py {% if arrow.branch == 'master' %}FORCE{% endif %}
+    displayName: Delete outdated packages
+
diff --git a/src/arrow/dev/tasks/conda-recipes/azure.linux.yml b/src/arrow/dev/tasks/conda-recipes/azure.linux.yml
new file mode 100755
index 000000000..c05d284d2
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/azure.linux.yml
@@ -0,0 +1,38 @@
+{% import 'macros.jinja' as macros with context %}
+
+jobs:
+- job: linux
+  pool:
+    vmImage: ubuntu-latest
+  timeoutInMinutes: 360
+
+  variables:
+    CONFIG: {{ config }}
+    R_CONFIG: {{ r_config|default("") }}
+    ARROW_VERSION: {{ arrow.no_rc_version }}
+    UPLOAD_PACKAGES: False
+
+  steps:
+  # configure qemu binfmt-misc running.  This allows us to run docker containers
+  # embedded qemu-static
+  - script: |
+      docker run --rm --privileged multiarch/qemu-user-static:register --reset --credential yes
+      ls /proc/sys/fs/binfmt_misc/
+    displayName: Configure binfmt_misc
+    condition: not(startsWith(variables['CONFIG'], 'linux_64'))
+
+  {{ macros.azure_checkout_arrow() }}
+
+  - task: CondaEnvironment@1
+    inputs:
+      packageSpecs: 'anaconda-client shyaml'
+      installOptions: '-c conda-forge'
+      updateConda: false
+
+  - script: |
+      mkdir build_artifacts
+      CI=azure arrow/dev/tasks/conda-recipes/run_docker_build.sh $(pwd)/build_artifacts
+    displayName: Run docker build
+
+  {{ macros.azure_upload_releases("build_artifacts/*/*.tar.bz2") }}
+  {{ macros.azure_upload_anaconda("build_artifacts/*/*.tar.bz2") }}
diff --git a/src/arrow/dev/tasks/conda-recipes/azure.osx.yml b/src/arrow/dev/tasks/conda-recipes/azure.osx.yml
new file mode 100755
index 000000000..99bb76ba5
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/azure.osx.yml
@@ -0,0 +1,83 @@
+{% import 'macros.jinja' as macros with context %}
+
+jobs:
+- job: osx
+  pool:
+    vmImage: macOS-10.14
+  timeoutInMinutes: 360
+  variables:
+    CONFIG: {{ config }}
+    R_CONFIG: {{ r_config|default("") }}
+    ARROW_VERSION: {{ arrow.no_rc_version }}
+    UPLOAD_PACKAGES: False
+  steps:
+  - bash: |
+      echo "##vso[task.prependpath]$CONDA/bin"
+      sudo chown -R $USER $CONDA
+    displayName: Add conda to PATH
+
+  - script: |
+      source activate base
+      conda config --set channel_priority strict
+      conda install -n base -c conda-forge --quiet --yes conda-forge-ci-setup=3 conda-build
+    displayName: 'Add conda-forge-ci-setup=3'
+
+  - script: |
+      echo "Removing homebrew from Azure to avoid conflicts."
+      /usr/bin/sudo mangle_homebrew
+      /usr/bin/sudo -k
+    displayName: Mangle homebrew
+
+  {{ macros.azure_checkout_arrow() }}
+
+  - script: |
+      source activate base
+      echo "Configuring conda."
+
+      setup_conda_rc ./ ./ ./.ci_support/${CONFIG}.yaml
+      export CI=azure
+      source run_conda_forge_build_setup
+      conda update --yes --quiet --override-channels -c conda-forge --all
+    displayName: Configure conda and conda-build
+    workingDirectory: arrow/dev/tasks/conda-recipes
+    env:
+      OSX_FORCE_SDK_DOWNLOAD: "1"
+
+  - script: |
+      source activate base
+      mangle_compiler ./ ./ ./.ci_support/${CONFIG}.yaml
+    workingDirectory: arrow/dev/tasks/conda-recipes
+    displayName: Mangle compiler
+
+  - script: |
+      source activate base
+      make_build_number ./ ./ ./.ci_support/${CONFIG}.yaml
+    workingDirectory: arrow/dev/tasks/conda-recipes
+    displayName: Generate build number clobber file
+
+  - script: |
+      source activate base
+      set +x
+      if [[ "${CONFIG}" == osx_arm* ]]; then
+        EXTRA_CB_OPTIONS="${EXTRA_CB_OPTIONS:-} --no-test"
+      fi
+      conda build arrow-cpp \
+        -m ./.ci_support/${CONFIG}.yaml \
+        --clobber-file ./.ci_support/clobber_${CONFIG}.yaml \
+        ${EXTRA_CB_OPTIONS:-} \
+        --output-folder ./build_artifacts
+
+      if [ ! -z "${R_CONFIG}" ]; then
+        conda build r-arrow \
+          -m ./.ci_support/r/${R_CONFIG}.yaml \
+          --output-folder ./build_artifacts
+      fi
+    workingDirectory: arrow/dev/tasks/conda-recipes
+    displayName: Build recipes
+
+  - script: |
+     sudo mv /usr/local/conda_mangled/* /usr/local/
+    displayName: Unmangle homebrew
+
+  {{ macros.azure_upload_releases("arrow/dev/tasks/conda-recipes/build_artifacts/osx-*/*.tar.bz2") }}
+  {{ macros.azure_upload_anaconda("arrow/dev/tasks/conda-recipes/build_artifacts/osx-*/*.tar.bz2") }}
diff --git a/src/arrow/dev/tasks/conda-recipes/azure.win.yml b/src/arrow/dev/tasks/conda-recipes/azure.win.yml
new file mode 100755
index 000000000..422e2f0e9
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/azure.win.yml
@@ -0,0 +1,77 @@
+{% import 'macros.jinja' as macros with context %}
+
+jobs:
+- job: win
+  pool:
+    vmImage: vs2017-win2016
+  timeoutInMinutes: 360
+  variables:
+    CONFIG: {{ config }}
+    R_CONFIG: {{ r_config|default("") }}
+    ARROW_VERSION: {{ arrow.no_rc_version }}
+    CONDA_BLD_PATH: D:\\bld\\
+    UPLOAD_PACKAGES: False
+
+  steps:
+    - script: |
+        choco install vcpython27 -fdv -y --debug
+      condition: contains(variables['CONFIG'], 'vs2008')
+      displayName: Install vcpython27.msi (if needed)
+
+    - powershell: |
+        Set-PSDebug -Trace 1
+        $batchcontent = @"
+        ECHO ON
+        SET vcpython=C:\Program Files (x86)\Common Files\Microsoft\Visual C++ for Python\9.0
+        DIR "%vcpython%"
+        CALL "%vcpython%\vcvarsall.bat" %*
+        "@
+        $batchDir = "C:\Program Files (x86)\Common Files\Microsoft\Visual C++ for Python\9.0\VC"
+        $batchPath = "$batchDir" + "\vcvarsall.bat"
+        New-Item -Path $batchPath -ItemType "file" -Force
+        Set-Content -Value $batchcontent -Path $batchPath
+        Get-ChildItem -Path $batchDir
+        Get-ChildItem -Path ($batchDir + '\..')
+      condition: contains(variables['CONFIG'], 'vs2008')
+      displayName: Patch vs2008 (if needed)
+
+    - task: CondaEnvironment@1
+      inputs:
+        packageSpecs: 'python=3.6 conda-build conda conda-forge::conda-forge-ci-setup=3 pip' # Optional
+        installOptions: "-c conda-forge"
+        updateConda: true
+      displayName: Install conda-build and activate environment
+    - script: set PYTHONUNBUFFERED=1
+
+    {{ macros.azure_checkout_arrow()|indent(2) }}
+
+    # Configure the VM
+    - script: setup_conda_rc .\ .\ .\.ci_support\%CONFIG%.yaml
+      workingDirectory: arrow\dev\tasks\conda-recipes
+
+    # Configure the VM.
+    - script: |
+        set "CI=azure"
+        call activate base
+        run_conda_forge_build_setup
+      displayName: conda-forge build setup
+      workingDirectory: arrow\dev\tasks\conda-recipes
+
+    - script: |
+        conda.exe build arrow-cpp parquet-cpp -m .ci_support\%CONFIG%.yaml
+      displayName: Build recipe
+      workingDirectory: arrow\dev\tasks\conda-recipes
+      env:
+        PYTHONUNBUFFERED: 1
+      condition: not(contains(variables['CONFIG'], 'vs2008'))
+
+    - script: |
+        conda.exe build r-arrow -m .ci_support\r\%R_CONFIG%.yaml
+      displayName: Build recipe
+      workingDirectory: arrow\dev\tasks\conda-recipes
+      env:
+        PYTHONUNBUFFERED: 1
+      condition: contains(variables['R_CONFIG'], 'win')
+
+    {{ macros.azure_upload_releases("D:\\bld\\win-64\\*.tar.bz2")|indent(2) }}
+    {{ macros.azure_upload_anaconda("D:\\bld\\win-64\\*.tar.bz2")|indent(2) }}
diff --git a/src/arrow/dev/tasks/conda-recipes/azure.yml b/src/arrow/dev/tasks/conda-recipes/azure.yml
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/azure.yml
diff --git a/src/arrow/dev/tasks/conda-recipes/build_steps.sh b/src/arrow/dev/tasks/conda-recipes/build_steps.sh
new file mode 100755
index 000000000..25864c08a
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/build_steps.sh
@@ -0,0 +1,55 @@
+#!/usr/bin/env bash
+
+# NOTE: This script has been slightly adopted to suite the Apache Arrow / crossbow CI
+# 	setup. The next time this is updated to the current version on conda-forge,
+#       you will also make this additions afterwards.
+
+# PLEASE NOTE: This script has been automatically generated by conda-smithy. Any changes here
+# will be lost next time ``conda smithy rerender`` is run. If you would like to make permanent
+# changes to this script, consider a proposal to conda-smithy so that other feedstocks can also
+# benefit from the improvement.
+
+set -xeuo pipefail
+
+output_dir=${1}
+
+export PYTHONUNBUFFERED=1
+export FEEDSTOCK_ROOT="${FEEDSTOCK_ROOT:-/home/conda/feedstock_root}"
+export CI_SUPPORT="${FEEDSTOCK_ROOT}/.ci_support"
+export CONFIG_FILE="${CI_SUPPORT}/${CONFIG}.yaml"
+
+cat >~/.condarc <<CONDARC
+
+conda-build:
+ root-dir: ${output_dir}
+
+CONDARC
+
+conda install --yes --quiet conda-forge-ci-setup=3 conda-build pip -c conda-forge
+
+# set up the condarc
+setup_conda_rc "${FEEDSTOCK_ROOT}" "${FEEDSTOCK_ROOT}" "${CONFIG_FILE}"
+
+source run_conda_forge_build_setup
+
+# make the build number clobber
+make_build_number "${FEEDSTOCK_ROOT}" "${FEEDSTOCK_ROOT}" "${CONFIG_FILE}"
+
+export CONDA_BLD_PATH="${output_dir}"
+
+conda build \
+    "${FEEDSTOCK_ROOT}/arrow-cpp" \
+    "${FEEDSTOCK_ROOT}/parquet-cpp" \
+    -m "${CI_SUPPORT}/${CONFIG}.yaml" \
+    --clobber-file "${CI_SUPPORT}/clobber_${CONFIG}.yaml" \
+    --output-folder "${output_dir}"
+
+if [ ! -z "${R_CONFIG:-}" ]; then
+  conda build \
+      "${FEEDSTOCK_ROOT}/r-arrow" \
+      -m "${CI_SUPPORT}/r/${R_CONFIG}.yaml" \
+      --output-folder "${output_dir}"
+fi
+
+
+touch "${output_dir}/conda-forge-build-done-${CONFIG}"
diff --git a/src/arrow/dev/tasks/conda-recipes/clean.py b/src/arrow/dev/tasks/conda-recipes/clean.py
new file mode 100644
index 000000000..bd31c875d
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/clean.py
@@ -0,0 +1,80 @@
+from subprocess import check_output, check_call
+from typing import List
+
+import json
+import os
+import pandas as pd
+import sys
+
+from packaging.version import Version
+
+
+VERSIONS_TO_KEEP = 5
+PACKAGES = [
+    "arrow-cpp",
+    "arrow-cpp-proc",
+    "parquet-cpp",
+    "pyarrow",
+    "pyarrow-tests",
+    "r-arrow",
+]
+PLATFORMS = [
+    "linux-64",
+    "linux-aarch64",
+    "osx-64",
+    "win-64",
+]
+EXCLUDED_PATTERNS = [
+    ["r-arrow", "linux-aarch64"],
+]
+
+
+def packages_to_delete(package_name: str, platform: str) -> List[str]:
+    env = os.environ.copy()
+    env["CONDA_SUBDIR"] = platform
+    pkgs_json = check_output(
+        [
+            "conda",
+            "search",
+            "--json",
+            "-c",
+            "arrow-nightlies",
+            "--override-channels",
+            package_name,
+        ],
+        env=env,
+    )
+    pkgs = pd.DataFrame(json.loads(pkgs_json)[package_name])
+    pkgs["version"] = pkgs["version"].map(Version)
+    pkgs["py_version"] = pkgs["build"].str.slice(0, 4)
+
+    to_delete = []
+
+    for (subdir, python), group in pkgs.groupby(["subdir", "py_version"]):
+        group = group.sort_values(by="version", ascending=False)
+
+        if len(group) > VERSIONS_TO_KEEP:
+            del_candidates = group[VERSIONS_TO_KEEP:]
+            to_delete += (
+                f"arrow-nightlies/{package_name}/"
+                + del_candidates["version"].astype(str)
+                + del_candidates["url"].str.replace(
+                    "https://conda.anaconda.org/arrow-nightlies", ""
+                )
+            ).to_list()
+
+    return to_delete
+
+
+if __name__ == "__main__":
+    to_delete = []
+    for package in PACKAGES:
+        for platform in PLATFORMS:
+            if [package, platform] in EXCLUDED_PATTERNS:
+                continue
+            to_delete += packages_to_delete(package, platform)
+
+    for name in to_delete:
+        print(f"Deleting {name} …")
+        if "FORCE" in sys.argv:
+            check_call(["anaconda", "remove", "-f", name])
diff --git a/src/arrow/dev/tasks/conda-recipes/conda-forge.yml b/src/arrow/dev/tasks/conda-recipes/conda-forge.yml
new file mode 100644
index 000000000..4c07b5dd3
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/conda-forge.yml
@@ -0,0 +1 @@
+channel_priority: strict
diff --git a/src/arrow/dev/tasks/conda-recipes/parquet-cpp/meta.yaml b/src/arrow/dev/tasks/conda-recipes/parquet-cpp/meta.yaml
new file mode 100644
index 000000000..5de06c32b
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/parquet-cpp/meta.yaml
@@ -0,0 +1,51 @@
+# ARROW-3229: this is a meta-package to prevent conflicts in the future
+
+{% set parquet_version = "1.5.1" %}
+
+package:
+  name: parquet-cpp
+  version: {{ parquet_version }}
+
+build:
+  number: 0
+  skip: true  # [win32]
+  skip: true  # [win and py<35]
+
+requirements:
+  host:
+    # NOTE: in the upstream feedstock use >= instead of =
+    - arrow-cpp ={{ ARROW_VERSION }}
+  run:
+    - arrow-cpp ={{ ARROW_VERSION }}
+
+test:
+  commands:
+    # headers
+    - test -f $PREFIX/include/parquet/api/reader.h               # [unix]
+    - if not exist %LIBRARY_INC%\\parquet\\api\\reader.h exit 1  # [win]
+
+    # shared
+    - test -f $PREFIX/lib/libparquet.so                        # [linux]
+    - test -f $PREFIX/lib/libparquet.dylib                     # [osx]
+    - if not exist %PREFIX%\\Library\\bin\\parquet.dll exit 1  # [win]
+
+    # absence of static libraries
+    - test ! -f $PREFIX/lib/libparquet.a                          # [unix]
+    - if exist %PREFIX%\\Library\\lib\\parquet_static.lib exit 1  # [win]
+
+about:
+  home: http://github.com/apache/arrow
+  license: Apache 2.0
+  summary: 'C++ libraries for the Apache Parquet file format'
+
+extra:
+  recipe-maintainers:
+    - wesm
+    - xhochy
+    - leifwalsh
+    - jreback
+    - cpcloud
+    - siddharthteotia
+    - kou
+    - kszucs
+    - pitrou
diff --git a/src/arrow/dev/tasks/conda-recipes/r-arrow/bld.bat b/src/arrow/dev/tasks/conda-recipes/r-arrow/bld.bat
new file mode 100644
index 000000000..a193ddc0a
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/r-arrow/bld.bat
@@ -0,0 +1,9 @@
+bash %RECIPE_DIR%/build_win.sh

+IF %ERRORLEVEL% NEQ 0 exit 1

+cp %RECIPE_DIR%/configure.win r

+IF %ERRORLEVEL% NEQ 0 exit 1

+cp %RECIPE_DIR%/install.libs.R r/src

+IF %ERRORLEVEL% NEQ 0 exit 1

+set "MAKEFLAGS=-j%CPU_COUNT%"

+"%R%" CMD INSTALL --build r

+IF %ERRORLEVEL% NEQ 0 exit 1

diff --git a/src/arrow/dev/tasks/conda-recipes/r-arrow/build.sh b/src/arrow/dev/tasks/conda-recipes/r-arrow/build.sh
new file mode 100644
index 000000000..e868189a2
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/r-arrow/build.sh
@@ -0,0 +1,3 @@
+#!/usr/bin/env bash
+export DISABLE_AUTOBREW=1
+$R CMD INSTALL --build r/.
diff --git a/src/arrow/dev/tasks/conda-recipes/r-arrow/build_win.sh b/src/arrow/dev/tasks/conda-recipes/r-arrow/build_win.sh
new file mode 100755
index 000000000..22c07d6e0
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/r-arrow/build_win.sh
@@ -0,0 +1,8 @@
+#!/usr/bin/env bash
+
+set -exuo pipefail
+
+
+# Rename arrow.dll to lib_arrow.dll to avoid conflicts with the arrow-cpp arrow.dll
+sed -i -e 's/void R_init_arrow/__declspec(dllexport) void R_init_lib_arrow/g' r/src/arrowExports.cpp
+sed -i -e 's/useDynLib(arrow/useDynLib(lib_arrow/g' r/NAMESPACE
diff --git a/src/arrow/dev/tasks/conda-recipes/r-arrow/configure.win b/src/arrow/dev/tasks/conda-recipes/r-arrow/configure.win
new file mode 100755
index 000000000..0b11d1335
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/r-arrow/configure.win
@@ -0,0 +1,9 @@
+#!/usr/bin/env bash
+
+set -euxo pipefail
+
+# Remove the -I../inst/include/ when unvendoring cpp11 in ARROW-13610
+echo "PKG_CPPFLAGS=-DNDEBUG -I\"${LIBRARY_PREFIX}/include\" -I\"${PREFIX}/include\" -DARROW_R_WITH_ARROW -DARROW_R_WITH_PARQUET -DARROW_R_WITH_DATASET -DARROW_R_WITH_S3 -DARROW_R_WITH_JSON -I../inst/include/" > src/Makevars.win
+echo "PKG_CXXFLAGS=\$(CXX_VISIBILITY)" >> src/Makevars.win
+echo 'CXX_STD=CXX11' >> src/Makevars.win
+echo "PKG_LIBS=-L\"${LIBRARY_PREFIX}/lib\" -larrow_dataset -lparquet -larrow" >> src/Makevars.win
diff --git a/src/arrow/dev/tasks/conda-recipes/r-arrow/install.libs.R b/src/arrow/dev/tasks/conda-recipes/r-arrow/install.libs.R
new file mode 100644
index 000000000..005bbe16b
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/r-arrow/install.libs.R
@@ -0,0 +1,5 @@
+src_dir <- file.path(R_PACKAGE_SOURCE, "src", fsep = "/")
+dest_dir <- file.path(R_PACKAGE_DIR, paste0("libs", R_ARCH), fsep="/")
+
+dir.create(file.path(R_PACKAGE_DIR, paste0("libs", R_ARCH), fsep="/"), recursive = TRUE, showWarnings = FALSE)
+file.copy(file.path(src_dir, "arrow.dll", fsep = "/"), file.path(dest_dir, "lib_arrow.dll", fsep = "/"))
diff --git a/src/arrow/dev/tasks/conda-recipes/r-arrow/meta.yaml b/src/arrow/dev/tasks/conda-recipes/r-arrow/meta.yaml
new file mode 100644
index 000000000..5f0643bef
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/r-arrow/meta.yaml
@@ -0,0 +1,66 @@
+{% set version = ARROW_VERSION %}
+{% set posix = 'm2-' if win else '' %}
+{% set native = 'm2w64-' if win else '' %}
+
+package:
+  name: r-arrow
+  version: {{ version|replace("-", "_") }}
+
+source:
+  path: ../../../../
+
+build:
+  merge_build_host: true  # [win]
+  number: 0
+  rpaths:
+    - lib/R/lib/
+    - lib/
+
+requirements:
+  build:
+    - {{ compiler('c') }}        # [not win]
+    - {{ compiler('cxx') }}      # [not win]
+    - {{ compiler('r_clang') }}  # [win]
+    - pkg-config                 # [not win]
+    - {{ posix }}make
+    - {{ posix }}sed         # [win]
+    - {{ posix }}coreutils   # [win]
+    - {{ posix }}filesystem  # [win]
+    - {{ posix }}zip         # [win]
+  host:
+    # Needs to be here, otherwise merge_build_host runs into issues
+    - pkg-config  # [win]
+    - r-base
+    - arrow-cpp {{ version }}
+    - r-cpp11
+    - r-r6
+    - r-assertthat
+    - r-bit64
+    - r-purrr
+    - r-rlang
+    - r-tidyselect
+  run:
+    - r-base
+    - r-r6
+    - r-assertthat
+    - r-bit64
+    - r-purrr
+    - r-rlang
+    - r-tidyselect
+
+test:
+  commands:
+    - $R -e "library('arrow')"           # [not win]
+    - "\"%R%\" -e \"library('arrow'); data(mtcars); write_parquet(mtcars, 'test.parquet')\""  # [win]
+
+about:
+  home: https://github.com/apache/arrow
+  license: Apache-2.0
+  license_file: LICENSE.txt
+  summary: R Integration to 'Apache' 'Arrow'.
+  license_family: APACHE
+
+extra:
+  recipe-maintainers:
+    - conda-forge/r
+    - conda-forge/arrow-cpp
diff --git a/src/arrow/dev/tasks/conda-recipes/run_docker_build.sh b/src/arrow/dev/tasks/conda-recipes/run_docker_build.sh
new file mode 100755
index 000000000..7645c43e2
--- /dev/null
+++ b/src/arrow/dev/tasks/conda-recipes/run_docker_build.sh
@@ -0,0 +1,77 @@
+#!/usr/bin/env bash
+
+# NOTE: This script has been slightly adopted to suite the Apache Arrow / crossbow CI
+# 	setup. The next time this is updated to the current version on conda-forge,
+#       you will also make this additions afterwards.
+
+# PLEASE NOTE: This script has been automatically generated by conda-smithy. Any changes here
+# will be lost next time ``conda smithy rerender`` is run. If you would like to make permanent
+# changes to this script, consider a proposal to conda-smithy so that other feedstocks can also
+# benefit from the improvement.
+
+set -xeo pipefail
+
+build_dir=${1}
+
+THISDIR="$( cd "$( dirname "$0" )" >/dev/null && pwd )"
+ARROW_ROOT=$(cd "$THISDIR/../../.."; pwd;)
+FEEDSTOCK_ROOT=$THISDIR
+
+docker info
+
+# In order for the conda-build process in the container to write to the mounted
+# volumes, we need to run with the same id as the host machine, which is
+# normally the owner of the mounted volumes, or at least has write permission
+export HOST_USER_ID=$(id -u)
+# Check if docker-machine is being used (normally on OSX) and get the uid from
+# the VM
+if hash docker-machine 2> /dev/null && docker-machine active > /dev/null; then
+    export HOST_USER_ID=$(docker-machine ssh $(docker-machine active) id -u)
+fi
+
+if [ -z "$CONFIG" ]; then
+    set +x
+    FILES=`ls .ci_support/linux_*`
+    CONFIGS=""
+    for file in $FILES; do
+        CONFIGS="${CONFIGS}'${file:12:-5}' or ";
+    done
+    echo "Need to set CONFIG env variable. Value can be one of ${CONFIGS:0:-4}"
+    exit 1
+fi
+
+if [ -z "${DOCKER_IMAGE}" ]; then
+    SHYAML_INSTALLED="$(shyaml -h || echo NO)"
+    if [ "${SHYAML_INSTALLED}" == "NO" ]; then
+        echo "WARNING: DOCKER_IMAGE variable not set and shyaml not installed. Falling back to condaforge/linux-anvil-comp7"
+        DOCKER_IMAGE="condaforge/linux-anvil-comp7"
+    else
+        DOCKER_IMAGE="$(cat "${FEEDSTOCK_ROOT}/.ci_support/${CONFIG}.yaml" | shyaml get-value docker_image.0 condaforge/linux-anvil-comp7 )"
+    fi
+fi
+
+mkdir -p "${build_dir}"
+DONE_CANARY="${build_dir}/conda-forge-build-done-${CONFIG}"
+rm -f "$DONE_CANARY"
+
+if [ -z "${CI}" ]; then
+    DOCKER_RUN_ARGS="-it "
+fi
+
+export UPLOAD_PACKAGES="${UPLOAD_PACKAGES:-True}"
+docker run ${DOCKER_RUN_ARGS} \
+           --shm-size=2G \
+           -v "${ARROW_ROOT}":/arrow:rw,z \
+           -v "${build_dir}":/build:rw \
+           -e FEEDSTOCK_ROOT="/arrow/dev/tasks/conda-recipes" \
+           -e CONFIG \
+           -e R_CONFIG \
+           -e HOST_USER_ID \
+           -e UPLOAD_PACKAGES \
+           -e ARROW_VERSION \
+           -e CI \
+           $DOCKER_IMAGE \
+           bash /arrow/dev/tasks/conda-recipes/build_steps.sh /build
+
+# verify that the end of the script was reached
+test -f "$DONE_CANARY"
diff --git a/src/arrow/dev/tasks/cpp-examples/github.linux.yml b/src/arrow/dev/tasks/cpp-examples/github.linux.yml
new file mode 100644
index 000000000..717d3c443
--- /dev/null
+++ b/src/arrow/dev/tasks/cpp-examples/github.linux.yml
@@ -0,0 +1,46 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+# NOTE: must set "Crossbow" as name to have the badge links working in the
+# github comment reports!
+name: Crossbow
+
+on:
+  push:
+    branches:
+      - "*-github-*"
+
+jobs:
+  test:
+    name: C++ Example
+    runs-on: ubuntu-latest
+    steps:
+      - name: Checkout Arrow
+        shell: bash
+        run: |
+          git clone --no-checkout {{ arrow.remote }} arrow
+          git -C arrow fetch -t {{ arrow.remote }} {{ arrow.branch }}
+          git -C arrow checkout FETCH_HEAD
+          git -C arrow submodule update --init --recursive
+      - name: Free Up Disk Space
+        shell: bash
+        run: arrow/ci/scripts/util_cleanup.sh
+      - name: Run
+        shell: bash
+        run: |
+          cd arrow/cpp/examples/{{ type }}
+          docker-compose run --rm {{ run }}
diff --git a/src/arrow/dev/tasks/docker-tests/azure.linux.yml b/src/arrow/dev/tasks/docker-tests/azure.linux.yml
new file mode 100644
index 000000000..b8f1151f7
--- /dev/null
+++ b/src/arrow/dev/tasks/docker-tests/azure.linux.yml
@@ -0,0 +1,52 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+jobs:
+- job: linux
+  pool:
+    vmImage: ubuntu-latest
+  timeoutInMinutes: 360
+  {% if env is defined %}
+  variables:
+  {% for key, value in env.items() %}
+    {{ key }}: {{ value }}
+  {% endfor %}
+  {% endif %}
+
+  steps:
+  - task: DockerInstaller@0
+    displayName: Docker Installer
+    inputs:
+      dockerVersion: 17.09.0-ce
+      releaseType: stable
+
+  - task: UsePythonVersion@0
+    inputs:
+      versionSpec: '3.6'
+
+  - script: |
+      git clone --no-checkout {{ arrow.remote }} arrow
+      git -C arrow fetch -t {{ arrow.remote }} {{ arrow.branch }}
+      git -C arrow checkout FETCH_HEAD
+      git -C arrow submodule update --init --recursive
+    displayName: Clone arrow
+
+  - script: pip install -e arrow/dev/archery[docker]
+    displayName: Setup Archery
+
+  - script: archery docker run -e SETUPTOOLS_SCM_PRETEND_VERSION="{{ arrow.no_rc_version }}" {{ run }}
+    displayName: Execute Docker Build
diff --git a/src/arrow/dev/tasks/docker-tests/circle.linux.yml b/src/arrow/dev/tasks/docker-tests/circle.linux.yml
new file mode 100644
index 000000000..3ddb93dc9
--- /dev/null
+++ b/src/arrow/dev/tasks/docker-tests/circle.linux.yml
@@ -0,0 +1,51 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+version: 2
+jobs:
+  build:
+    machine:
+      image: ubuntu-1604:202004-01
+    {%- if env is defined %}
+    environment:
+    {%- for key, value in env.items() %}
+      {{ key }}: {{ value }}
+    {%- endfor %}
+    {%- endif %}
+    steps:
+      - run: |
+          docker -v
+          docker-compose -v
+      - run: |
+          git clone --no-checkout {{ arrow.remote }} arrow
+          git -C arrow fetch -t {{ arrow.remote }} {{ arrow.branch }}
+          git -C arrow checkout FETCH_HEAD
+          git -C arrow submodule update --init --recursive
+      - run:
+          name: Execute Docker Build
+          command: |
+            pyenv versions
+            pyenv global 3.6.10
+            pip install -e arrow/dev/archery[docker]
+            archery docker run -e SETUPTOOLS_SCM_PRETEND_VERSION="{{ arrow.no_rc_version }}" {{ run }}
+          no_output_timeout: "1h"
+
+workflows:
+  version: 2
+  build:
+    jobs:
+      - build
diff --git a/src/arrow/dev/tasks/docker-tests/github.linux.yml b/src/arrow/dev/tasks/docker-tests/github.linux.yml
new file mode 100644
index 000000000..1faf482cb
--- /dev/null
+++ b/src/arrow/dev/tasks/docker-tests/github.linux.yml
@@ -0,0 +1,56 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+{% import 'macros.jinja' as macros with context %}
+
+{{ macros.github_header() }}
+
+jobs:
+  test:
+    name: Docker Test
+    runs-on: ubuntu-latest
+  {% if env is defined %}
+    env:
+    {% for key, value in env.items() %}
+      {{ key }}: "{{ value }}"
+    {% endfor %}
+  {% endif %}
+    steps:
+      {{ macros.github_checkout_arrow()|indent }}
+      {{ macros.github_install_archery()|indent }}
+
+      - name: Free Up Disk Space
+        shell: bash
+        run: arrow/ci/scripts/util_cleanup.sh
+
+      - name: Execute Docker Build
+        shell: bash
+        run: archery docker run -e SETUPTOOLS_SCM_PRETEND_VERSION="{{ arrow.no_rc_version }}" {{ flags|default("") }} {{ image }} {{ command|default("") }}
+
+    {% if '-r' in image %}
+      - name: Dump R install logs
+        run: cat arrow/r/check/arrow.Rcheck/00install.out
+        continue-on-error: true
+        if: always()
+    {% endif %}
+
+    {% if arrow.branch == 'master' %}
+      {{ macros.github_login_dockerhub()|indent }}
+      - name: Push Docker Image
+        shell: bash
+        run: archery docker push {{ image }}
+    {% endif %}
diff --git a/src/arrow/dev/tasks/homebrew-formulae/apache-arrow.rb b/src/arrow/dev/tasks/homebrew-formulae/apache-arrow.rb
new file mode 100644
index 000000000..5f39666bd
--- /dev/null
+++ b/src/arrow/dev/tasks/homebrew-formulae/apache-arrow.rb
@@ -0,0 +1,69 @@
+class ApacheArrow < Formula
+  desc "Columnar in-memory analytics layer designed to accelerate big data"
+  homepage "https://arrow.apache.org/"
+  url "https://www.apache.org/dyn/closer.lua?path=arrow/arrow-6.0.1/apache-arrow-6.0.1.tar.gz"
+  sha256 "9948ddb6d4798b51552d0dca3252dd6e3a7d0f9702714fc6f5a1b59397ce1d28"
+  license "Apache-2.0"
+  head "https://github.com/apache/arrow.git"
+
+  depends_on "boost" => :build
+  depends_on "cmake" => :build
+  depends_on "llvm" => :build
+  depends_on "brotli"
+  depends_on "glog"
+  depends_on "grpc"
+  depends_on "lz4"
+  depends_on "numpy"
+  depends_on "openssl@1.1"
+  depends_on "protobuf"
+  depends_on "python@3.9"
+  depends_on "rapidjson"
+  depends_on "snappy"
+  depends_on "thrift"
+  depends_on "zstd"
+
+  def install
+    ENV.cxx11
+    # link against system libc++ instead of llvm provided libc++
+    ENV.remove "HOMEBREW_LIBRARY_PATHS", Formula["llvm"].opt_lib
+    args = %W[
+      -DARROW_FLIGHT=ON
+      -DARROW_GANDIVA=ON
+      -DARROW_JEMALLOC=ON
+      -DARROW_MIMALLOC=ON
+      -DARROW_ORC=ON
+      -DARROW_PARQUET=ON
+      -DARROW_PLASMA=ON
+      -DARROW_PROTOBUF_USE_SHARED=ON
+      -DARROW_PYTHON=ON
+      -DARROW_WITH_BZ2=ON
+      -DARROW_WITH_ZLIB=ON
+      -DARROW_WITH_ZSTD=ON
+      -DARROW_WITH_LZ4=ON
+      -DARROW_WITH_SNAPPY=ON
+      -DARROW_WITH_BROTLI=ON
+      -DARROW_INSTALL_NAME_RPATH=OFF
+      -DPython3_EXECUTABLE=#{Formula["python@3.9"].bin/"python3"}
+    ]
+    # Re-enable -DARROW_S3=ON and add back aws-sdk-cpp to depends_on in ARROW-6437
+
+    mkdir "build"
+    cd "build" do
+      system "cmake", "../cpp", *std_cmake_args, *args
+      system "make"
+      system "make", "install"
+    end
+  end
+
+  test do
+    (testpath/"test.cpp").write <<~EOS
+      #include "arrow/api.h"
+      int main(void) {
+        arrow::int64();
+        return 0;
+      }
+    EOS
+    system ENV.cxx, "test.cpp", "-std=c++11", "-I#{include}", "-L#{lib}", "-larrow", "-o", "test"
+    system "./test"
+  end
+end
diff --git a/src/arrow/dev/tasks/homebrew-formulae/autobrew/apache-arrow.rb b/src/arrow/dev/tasks/homebrew-formulae/autobrew/apache-arrow.rb
new file mode 100644
index 000000000..2a77b01fc
--- /dev/null
+++ b/src/arrow/dev/tasks/homebrew-formulae/autobrew/apache-arrow.rb
@@ -0,0 +1,88 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+# https://github.com/autobrew/homebrew-core/blob/master/Formula/apache-arrow.rb
+class ApacheArrow < Formula
+  desc "Columnar in-memory analytics layer designed to accelerate big data"
+  homepage "https://arrow.apache.org/"
+  url "https://www.apache.org/dyn/closer.lua?path=arrow/arrow-6.0.1/apache-arrow-6.0.1.tar.gz"
+  sha256 "9948ddb6d4798b51552d0dca3252dd6e3a7d0f9702714fc6f5a1b59397ce1d28"
+  head "https://github.com/apache/arrow.git"
+
+  bottle do
+    cellar :any
+    sha256 "a55211ba6f464681b7ca1b48defdad9cfbe1cf6fad8ff9ec875dc5a3c8f3c5ed" => :el_capitan_or_later
+    root_url "https://autobrew.github.io/bottles"
+  end
+
+  # NOTE: if you add something here, be sure to add to PKG_LIBS in r/tools/autobrew
+  depends_on "boost" => :build
+  depends_on "cmake" => :build
+  depends_on "aws-sdk-cpp"
+  depends_on "lz4"
+  depends_on "snappy"
+  depends_on "thrift"
+  depends_on "zstd"
+
+  def install
+    ENV.cxx11
+    args = %W[
+      -DARROW_BUILD_SHARED=OFF
+      -DARROW_BUILD_UTILITIES=ON
+      -DARROW_COMPUTE=ON
+      -DARROW_CSV=ON
+      -DARROW_DATASET=ON
+      -DARROW_FILESYSTEM=ON
+      -DARROW_HDFS=OFF
+      -DARROW_JEMALLOC=ON
+      -DARROW_JSON=ON
+      -DARROW_MIMALLOC=ON
+      -DARROW_PARQUET=ON
+      -DARROW_PYTHON=OFF
+      -DARROW_S3=ON
+      -DARROW_USE_GLOG=OFF
+      -DARROW_VERBOSE_THIRDPARTY_BUILD=ON
+      -DARROW_WITH_LZ4=ON
+      -DARROW_WITH_SNAPPY=ON
+      -DARROW_WITH_ZLIB=ON
+      -DARROW_WITH_ZSTD=ON
+      -DCMAKE_UNITY_BUILD=OFF
+      -DPARQUET_BUILD_EXECUTABLES=ON
+      -DLZ4_HOME=#{Formula["lz4"].prefix}
+      -DTHRIFT_HOME=#{Formula["thrift"].prefix}
+    ]
+
+    mkdir "build"
+    cd "build" do
+      system "cmake", "../cpp", *std_cmake_args, *args
+      system "make"
+      system "make", "install"
+    end
+  end
+
+  test do
+    (testpath/"test.cpp").write <<~EOS
+      #include "arrow/api.h"
+      int main(void) {
+        arrow::int64();
+        return 0;
+      }
+    EOS
+    system ENV.cxx, "test.cpp", "-std=c++11", "-I#{include}", "-L#{lib}", "-larrow", "-o", "test"
+    system "./test"
+  end
+end
diff --git a/src/arrow/dev/tasks/homebrew-formulae/github.macos.yml b/src/arrow/dev/tasks/homebrew-formulae/github.macos.yml
new file mode 100644
index 000000000..232cc38a9
--- /dev/null
+++ b/src/arrow/dev/tasks/homebrew-formulae/github.macos.yml
@@ -0,0 +1,56 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+# NOTE: must set "Crossbow" as name to have the badge links working in the
+# github comment reports!
+name: Crossbow
+
+on:
+  push:
+    branches:
+      - "*-github-*"
+
+jobs:
+  autobrew:
+    name: "Autobrew"
+    runs-on: macOS-latest
+    steps:
+      - name: Checkout Arrow
+        run: |
+          git clone --no-checkout {{ arrow.remote }} arrow
+          git -C arrow fetch -t {{ arrow.remote }} {{ arrow.branch }}
+          git -C arrow checkout FETCH_HEAD
+          git -C arrow submodule update --init --recursive
+      - name: Configure homebrew formula for testing
+        env:
+          ARROW_FORMULA: ./arrow/dev/tasks/homebrew-formulae/{{ formula }}
+        run: |
+          # Pin the current commit in the formula to test so that we're not always pulling from master
+          sed -i.bak -E -e 's@https://github.com/apache/arrow.git"$@{{ arrow.remote }}.git", revision: "{{ arrow.head }}"@' $ARROW_FORMULA && rm -f $ARROW_FORMULA.bak
+          # Sometimes crossbow gives a remote URL with .git and sometimes not. Make sure there's only one
+          sed -i.bak -E -e 's@.git.git@.git@' $ARROW_FORMULA && rm -f $ARROW_FORMULA.bak
+          brew update
+          brew --version
+          brew unlink python@2 || true
+          brew config
+          brew doctor || true
+          cp $ARROW_FORMULA $(brew --repository homebrew/core)/Formula/apache-arrow.rb
+      - name: Test formula
+        run: |
+          brew install -v --HEAD apache-arrow
+          brew test apache-arrow
+          brew audit --strict apache-arrow
diff --git a/src/arrow/dev/tasks/java-jars/README.md b/src/arrow/dev/tasks/java-jars/README.md
new file mode 100644
index 000000000..1d61662d4
--- /dev/null
+++ b/src/arrow/dev/tasks/java-jars/README.md
@@ -0,0 +1,29 @@
+<!--
+Licensed to the Apache Software Foundation (ASF) under one
+or more contributor license agreements.  See the NOTICE file
+distributed with this work for additional information
+regarding copyright ownership.  The ASF licenses this file
+to you under the Apache License, Version 2.0 (the
+"License"); you may not use this file except in compliance
+with the License.  You may obtain a copy of the License at
+
+http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+-->
+
+# Jars.
+
+This directory is responsible to generate the jar files for the Arrow components that depend on C++ shared libraries to execute.
+
+The Arrow C++ libraries are compiled both on MacOS and Linux distributions, with their dependencies linked statically, and they are added
+in the jars at the end, so the file can be used on both systems.
+
+## Linux Docker Image
+To compile the C++ libraries in Linux, a docker image is used. 
+It is created used the **ci/docker/java-bundled-jars.dockerfile** file. 
+If it is necessary to add any new dependency, you need to change that file.
\ No newline at end of file
diff --git a/src/arrow/dev/tasks/java-jars/github.yml b/src/arrow/dev/tasks/java-jars/github.yml
new file mode 100644
index 000000000..81d31dd4c
--- /dev/null
+++ b/src/arrow/dev/tasks/java-jars/github.yml
@@ -0,0 +1,115 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+{% import 'macros.jinja' as macros with context %}
+
+{{ macros.github_header() }}
+
+jobs:
+
+  build-cpp-ubuntu:
+    name: Build C++ Libs Ubuntu
+    runs-on: ubuntu-18.04
+    steps:
+      {{ macros.github_checkout_arrow()|indent }}
+      {{ macros.github_install_archery()|indent }}
+      - name: Build C++ Libs
+        run: archery docker run java-jni-manylinux-2014
+      - name: Compress into single artifact
+        run: tar -cvzf arrow-shared-libs-linux.tar.gz arrow/java-dist/
+      - name: Upload Artifacts
+        uses: actions/upload-artifact@v2
+        with:
+          name: ubuntu-shared-lib
+          path: arrow-shared-libs-linux.tar.gz
+    {% if arrow.branch == 'master' %}
+      {{ macros.github_login_dockerhub()|indent }}
+      - name: Push Docker Image
+        shell: bash
+        run: archery docker push java-jni-manylinux-2014
+    {% endif %}
+
+  build-cpp-macos:
+    name: Build C++ Libs MacOS
+    runs-on: macos-latest
+    env:
+      MACOSX_DEPLOYMENT_TARGET: "10.11"
+    steps:
+      {{ macros.github_checkout_arrow()|indent }}
+      {{ macros.github_install_archery()|indent }}
+      - name: Install Dependencies
+        run: brew bundle --file=arrow/cpp/Brewfile
+      - name: Build C Data Interface lib
+        run: |
+          set -e
+          arrow/ci/scripts/java_cdata_build.sh \
+            $GITHUB_WORKSPACE/arrow \
+            $GITHUB_WORKSPACE/arrow/java-native-build \
+            $GITHUB_WORKSPACE/arrow/java-dist
+      - name: Build C++ Libs
+        run: |
+          set -e
+          arrow/ci/scripts/java_jni_macos_build.sh \
+            $GITHUB_WORKSPACE/arrow \
+            $GITHUB_WORKSPACE/arrow/cpp-build \
+            $GITHUB_WORKSPACE/arrow/java-dist
+      - name: Compress into single artifact
+        run: tar -cvzf arrow-shared-libs-macos.tar.gz arrow/java-dist/
+      - name: Upload Artifacts
+        uses: actions/upload-artifact@v2
+        with:
+          name: macos-shared-lib
+          path: arrow-shared-libs-macos.tar.gz
+
+  package-jars:
+    name: Build Jar Files
+    runs-on: macos-latest
+    needs: [build-cpp-macos, build-cpp-ubuntu]
+    steps:
+      {{ macros.github_checkout_arrow()|indent }}
+      - name: Download Linux C++ Libraries
+        uses: actions/download-artifact@v2
+        with:
+          name: ubuntu-shared-lib
+      - name: Download MacOS C++ Library
+        uses: actions/download-artifact@v2
+        with:
+          name: macos-shared-lib
+      - name: Descompress artifacts
+        run: |
+          tar -xvzf arrow-shared-libs-macos.tar.gz
+          tar -xvzf arrow-shared-libs-linux.tar.gz
+      - name: Test that Shared Libraries Exist
+        run: |
+          test -f arrow/java-dist/libarrow_cdata_jni.dylib
+          test -f arrow/java-dist/libarrow_dataset_jni.dylib
+          test -f arrow/java-dist/libgandiva_jni.dylib
+          test -f arrow/java-dist/libarrow_orc_jni.dylib
+          test -f arrow/java-dist/libarrow_cdata_jni.so
+          test -f arrow/java-dist/libarrow_dataset_jni.so
+          test -f arrow/java-dist/libarrow_orc_jni.so
+          test -f arrow/java-dist/libgandiva_jni.so
+      - name: Build Bundled Jar
+        run: |
+          set -e
+          pushd arrow/java
+          mvn versions:set -DnewVersion={{ arrow.no_rc_version }}
+          popd
+          arrow/ci/scripts/java_full_build.sh \
+            $GITHUB_WORKSPACE/arrow \
+            $GITHUB_WORKSPACE/arrow/java-dist
+      {{ macros.github_upload_releases(["arrow/java-dist/*.jar", "arrow/java-dist/*.pom"])|indent }}
diff --git a/src/arrow/dev/tasks/linux-packages/.gitignore b/src/arrow/dev/tasks/linux-packages/.gitignore
new file mode 100644
index 000000000..0e49a90c1
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/.gitignore
@@ -0,0 +1,28 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+/*/*.tar.gz
+/*/apt/repositories/
+/*/apt/tmp/
+/*/apt/build.sh
+/*/apt/env.sh
+/*/yum/repositories/
+/*/yum/tmp/
+/*/yum/build.sh
+/*/yum/env.sh
+/apt/repositories/
+/yum/repositories/
diff --git a/src/arrow/dev/tasks/linux-packages/README.md b/src/arrow/dev/tasks/linux-packages/README.md
new file mode 100644
index 000000000..cafcc04ed
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/README.md
@@ -0,0 +1,40 @@
+<!---
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing,
+  software distributed under the License is distributed on an
+  "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+  KIND, either express or implied.  See the License for the
+  specific language governing permissions and limitations
+  under the License.
+-->
+
+# Linux packages for Apache Arrow C++ and GLib
+
+## Requirements
+
+  * Ruby
+  * Docker
+  * Tools to build tar.gz for Apache Arrow C++ and GLib
+
+## How to build .deb packages
+
+```console
+% rake version:update
+% rake apt
+```
+
+## How to build .rpm packages
+
+```console
+% rake version:update
+% rake yum
+```
diff --git a/src/arrow/dev/tasks/linux-packages/Rakefile b/src/arrow/dev/tasks/linux-packages/Rakefile
new file mode 100644
index 000000000..58cd981fe
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/Rakefile
@@ -0,0 +1,249 @@
+# -*- ruby -*-
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+require "English"
+
+require_relative "../../release/binary-task"
+require_relative "helper"
+
+packages = [
+  "apache-arrow",
+  "apache-arrow-apt-source",
+  "apache-arrow-release",
+]
+
+
+namespace :apt do
+  desc "Build deb packages"
+  task :build do
+    packages.each do |package|
+      cd(package) do
+        ruby("-S", "rake", "apt:build")
+      end
+    end
+  end
+end
+
+namespace :yum do
+  desc "Build RPM packages"
+  task :build do
+    packages.each do |package|
+      cd(package) do
+        ruby("-S", "rake", "yum:build")
+      end
+    end
+  end
+end
+
+namespace :version do
+  desc "Update versions"
+  task :update do
+    packages.each do |package|
+      cd(package) do
+        ruby("-S", "rake", "version:update")
+      end
+    end
+  end
+end
+
+namespace :docker do
+  desc "Pull built images"
+  task :pull do
+    packages.each do |package|
+      cd(package) do
+        ruby("-S", "rake", "docker:pull")
+      end
+    end
+  end
+
+  desc "Push built images"
+  task :push do
+    packages.each do |package|
+      cd(package) do
+        ruby("-S", "rake", "docker:push")
+      end
+    end
+  end
+end
+
+
+class LocalBinaryTask < BinaryTask
+  include Helper::ApacheArrow
+
+  def initialize(packages)
+    @packages = packages
+    super()
+  end
+
+  def define
+    define_apt_test_task
+    define_yum_test_task
+  end
+
+  private
+  def latest_commit_time(git_directory)
+    cd(git_directory) do
+      return Time.iso8601(`git log -n 1 --format=%aI`.chomp).utc
+    end
+  end
+
+  def version
+    @version ||= detect_version(detect_release_time)
+  end
+
+  def resolve_docker_image(target)
+    image = ""
+    target = target.gsub(/\Aamazon-linux/, "amazonlinux")
+    case target
+    when /-(?:arm64|aarch64)\z/
+      target = $PREMATCH
+      image << "arm64v8/"
+    end
+    image << target.gsub(/-/, ":")
+  end
+
+  def verify(target)
+    verify_command_line = [
+      "docker",
+      "run",
+      "--rm",
+      "--log-driver", "none",
+      "--volume", "#{File.expand_path(arrow_source_dir)}:/arrow:delegated",
+    ]
+    if $stdin.tty?
+      verify_command_line << "--interactive"
+      verify_command_line << "--tty"
+    else
+      verify_command_line.concat(["--attach", "STDOUT"])
+      verify_command_line.concat(["--attach", "STDERR"])
+    end
+    verify_command_line << resolve_docker_image(target)
+    case target
+    when /\Adebian-/, /\Aubuntu-/
+      verify_command_line << "/arrow/dev/release/verify-apt.sh"
+    else
+      verify_command_line << "/arrow/dev/release/verify-yum.sh"
+    end
+    verify_command_line << version
+    verify_command_line << "local"
+    sh(*verify_command_line)
+  end
+
+  def apt_test_targets
+    targets = (ENV["APT_TARGETS"] || "").split(",")
+    targets = apt_test_targets_default if targets.empty?
+    targets
+  end
+
+  def apt_test_targets_default
+    # Disable arm64 targets by default for now
+    # because they require some setups on host.
+    [
+      "debian-buster",
+      # "debian-buster-arm64",
+      "debian-bullseye",
+      # "debian-bullseye-arm64",
+      "ubuntu-xenial",
+      # "ubuntu-xenial-arm64",
+      "ubuntu-bionic",
+      # "ubuntu-bionic-arm64",
+      "ubuntu-focal",
+      # "ubuntu-focal-arm64",
+      "ubuntu-hirsute",
+      # "ubuntu-hirsute-arm64",
+      "ubuntu-impish",
+      # "ubuntu-impish-arm64",
+    ]
+  end
+
+  def define_apt_test_task
+    namespace :apt do
+      desc "Test deb packages"
+      task :test do
+        repositories_dir = "apt/repositories"
+        rm_rf(repositories_dir)
+        @packages.each do |package|
+          package_repositories = "#{package}/apt/repositories"
+          next unless File.exist?(package_repositories)
+          sh("rsync", "-a", "#{package_repositories}/", repositories_dir)
+        end
+        Dir.glob("#{repositories_dir}/ubuntu/pool/*") do |code_name_dir|
+          universe_dir = "#{code_name_dir}/universe"
+          next unless File.exist?(universe_dir)
+          mv(universe_dir, "#{code_name_dir}/main")
+        end
+        base_dir = "nonexistent"
+        merged_dir = "apt/merged"
+        apt_update(base_dir, repositories_dir, merged_dir)
+        Dir.glob("#{merged_dir}/*/dists/*") do |dists_code_name_dir|
+          prefix = dists_code_name_dir.split("/")[-3..-1].join("/")
+          mv(Dir.glob("#{dists_code_name_dir}/*Release*"),
+             "#{repositories_dir}/#{prefix}")
+        end
+        apt_test_targets.each do |target|
+          verify(target)
+        end
+      end
+    end
+  end
+
+  def yum_test_targets
+    targets = (ENV["YUM_TARGETS"] || "").split(",")
+    targets = yum_test_targets_default if targets.empty?
+    targets
+  end
+
+  def yum_test_targets_default
+    # Disable aarch64 targets by default for now
+    # because they require some setups on host.
+    [
+      "almalinux-8",
+      # "almalinux-8-aarch64",
+      "amazon-linux-2",
+      # "amazon-linux-2-aarch64",
+      "centos-7",
+      "centos-8",
+      # "centos-8-aarch64",
+    ]
+  end
+
+  def define_yum_test_task
+    namespace :yum do
+      desc "Test RPM packages"
+      task :test do
+        repositories_dir = "yum/repositories"
+        rm_rf(repositories_dir)
+        @packages.each do |package|
+          package_repositories = "#{package}/yum/repositories"
+          next unless File.exist?(package_repositories)
+          sh("rsync", "-a", "#{package_repositories}/", repositories_dir)
+        end
+        rpm_sign(repositories_dir)
+        base_dir = "nonexistent"
+        yum_update(base_dir, repositories_dir)
+        yum_test_targets.each do |target|
+          verify(target)
+        end
+      end
+    end
+  end
+end
+
+local_binary_task = LocalBinaryTask.new(packages)
+local_binary_task.define
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/Rakefile b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/Rakefile
new file mode 100644
index 000000000..210fa951e
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/Rakefile
@@ -0,0 +1,64 @@
+# -*- ruby -*-
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+require_relative "../helper"
+require_relative "../package-task"
+
+class ApacheArrowAptSourcePackageTask < PackageTask
+  include Helper::ApacheArrow
+
+  def initialize
+    release_time = detect_release_time
+    super("apache-arrow-apt-source",
+          detect_version(release_time),
+          release_time,
+          :rc_build_type => :release)
+  end
+
+  private
+  def define_archive_task
+    file @archive_name do
+      rm_rf(@archive_base_name)
+      mkdir(@archive_base_name)
+      download("https://downloads.apache.org/arrow/KEYS",
+               "#{@archive_base_name}/KEYS")
+      sh("tar", "czf", @archive_name, @archive_base_name)
+      rm_rf(@archive_base_name)
+    end
+
+    if deb_archive_name != @archive_name
+      file deb_archive_name => @archive_name do
+        if @archive_base_name == deb_archive_base_name
+          cp(@archive_name, deb_archive_name)
+        else
+          sh("tar", "xf", @archive_name)
+          mv(@archive_base_name, deb_archive_base_name)
+          sh("tar", "czf", deb_archive_name, deb_archive_base_name)
+        end
+      end
+    end
+  end
+
+  def enable_yum?
+    false
+  end
+end
+
+task = ApacheArrowAptSourcePackageTask.new
+task.define
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/apt/debian-bookworm/Dockerfile b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/apt/debian-bookworm/Dockerfile
new file mode 100644
index 000000000..f9541efde
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/apt/debian-bookworm/Dockerfile
@@ -0,0 +1,40 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+FROM debian:bookworm
+
+RUN \
+  echo "debconf debconf/frontend select Noninteractive" | \
+    debconf-set-selections
+
+RUN \
+  echo 'APT::Install-Recommends "false";' > \
+    /etc/apt/apt.conf.d/disable-install-recommends
+
+ARG DEBUG
+
+RUN \
+  quiet=$([ "${DEBUG}" = "yes" ] || echo "-qq") && \
+  apt update ${quiet} && \
+  apt install -y -V ${quiet} \
+    build-essential \
+    debhelper \
+    devscripts \
+    fakeroot \
+    gnupg \
+    lsb-release && \
+  apt clean
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/apt/debian-bullseye/Dockerfile b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/apt/debian-bullseye/Dockerfile
new file mode 100644
index 000000000..b0842a0c0
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/apt/debian-bullseye/Dockerfile
@@ -0,0 +1,41 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+FROM debian:bullseye
+
+RUN \
+  echo "debconf debconf/frontend select Noninteractive" | \
+    debconf-set-selections
+
+RUN \
+  echo 'APT::Install-Recommends "false";' > \
+    /etc/apt/apt.conf.d/disable-install-recommends
+
+ARG DEBUG
+
+RUN \
+  quiet=$([ "${DEBUG}" = "yes" ] || echo "-qq") && \
+  apt update ${quiet} && \
+  apt install -y -V ${quiet} \
+    build-essential \
+    debhelper \
+    devscripts \
+    fakeroot \
+    gnupg \
+    lsb-release && \
+  apt clean && \
+  rm -rf /var/lib/apt/lists/*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/apt/debian-buster/Dockerfile b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/apt/debian-buster/Dockerfile
new file mode 100644
index 000000000..0d37f5dee
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/apt/debian-buster/Dockerfile
@@ -0,0 +1,41 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+FROM debian:buster
+
+RUN \
+  echo "debconf debconf/frontend select Noninteractive" | \
+    debconf-set-selections
+
+RUN \
+  echo 'APT::Install-Recommends "false";' > \
+    /etc/apt/apt.conf.d/disable-install-recommends
+
+ARG DEBUG
+
+RUN \
+  quiet=$([ "${DEBUG}" = "yes" ] || echo "-qq") && \
+  apt update ${quiet} && \
+  apt install -y -V ${quiet} \
+    build-essential \
+    debhelper \
+    devscripts \
+    fakeroot \
+    gnupg \
+    lsb-release && \
+  apt clean && \
+  rm -rf /var/lib/apt/lists/*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/apt/ubuntu-bionic/Dockerfile b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/apt/ubuntu-bionic/Dockerfile
new file mode 100644
index 000000000..53e11fb7e
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/apt/ubuntu-bionic/Dockerfile
@@ -0,0 +1,41 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+FROM ubuntu:bionic
+
+RUN \
+  echo "debconf debconf/frontend select Noninteractive" | \
+    debconf-set-selections
+
+RUN \
+  echo 'APT::Install-Recommends "false";' > \
+    /etc/apt/apt.conf.d/disable-install-recommends
+
+ARG DEBUG
+
+RUN \
+  quiet=$([ "${DEBUG}" = "yes" ] || echo "-qq") && \
+  apt update ${quiet} && \
+  apt install -y -V ${quiet} \
+    build-essential \
+    debhelper \
+    devscripts \
+    fakeroot \
+    gnupg \
+    lsb-release && \
+  apt clean && \
+  rm -rf /var/lib/apt/lists/*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/apt/ubuntu-focal/Dockerfile b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/apt/ubuntu-focal/Dockerfile
new file mode 100644
index 000000000..dc902d14d
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/apt/ubuntu-focal/Dockerfile
@@ -0,0 +1,41 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+FROM ubuntu:focal
+
+RUN \
+  echo "debconf debconf/frontend select Noninteractive" | \
+    debconf-set-selections
+
+RUN \
+  echo 'APT::Install-Recommends "false";' > \
+    /etc/apt/apt.conf.d/disable-install-recommends
+
+ARG DEBUG
+
+RUN \
+  quiet=$([ "${DEBUG}" = "yes" ] || echo "-qq") && \
+  apt update ${quiet} && \
+  apt install -y -V ${quiet} \
+    build-essential \
+    debhelper \
+    devscripts \
+    fakeroot \
+    gnupg \
+    lsb-release && \
+  apt clean && \
+  rm -rf /var/lib/apt/lists/*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/apt/ubuntu-hirsute/Dockerfile b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/apt/ubuntu-hirsute/Dockerfile
new file mode 100644
index 000000000..8b6fd7f0e
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/apt/ubuntu-hirsute/Dockerfile
@@ -0,0 +1,41 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+FROM ubuntu:hirsute
+
+RUN \
+  echo "debconf debconf/frontend select Noninteractive" | \
+    debconf-set-selections
+
+RUN \
+  echo 'APT::Install-Recommends "false";' > \
+    /etc/apt/apt.conf.d/disable-install-recommends
+
+ARG DEBUG
+
+RUN \
+  quiet=$([ "${DEBUG}" = "yes" ] || echo "-qq") && \
+  apt update ${quiet} && \
+  apt install -y -V ${quiet} \
+    build-essential \
+    debhelper \
+    devscripts \
+    fakeroot \
+    gnupg \
+    lsb-release && \
+  apt clean && \
+  rm -rf /var/lib/apt/lists/*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/apt/ubuntu-impish/Dockerfile b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/apt/ubuntu-impish/Dockerfile
new file mode 100644
index 000000000..640cd715d
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/apt/ubuntu-impish/Dockerfile
@@ -0,0 +1,41 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+FROM ubuntu:impish
+
+RUN \
+  echo "debconf debconf/frontend select Noninteractive" | \
+    debconf-set-selections
+
+RUN \
+  echo 'APT::Install-Recommends "false";' > \
+    /etc/apt/apt.conf.d/disable-install-recommends
+
+ARG DEBUG
+
+RUN \
+  quiet=$([ "${DEBUG}" = "yes" ] || echo "-qq") && \
+  apt update ${quiet} && \
+  apt install -y -V ${quiet} \
+    build-essential \
+    debhelper \
+    devscripts \
+    fakeroot \
+    gnupg \
+    lsb-release && \
+  apt clean && \
+  rm -rf /var/lib/apt/lists/*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/debian/apache-arrow-apt-source.install b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/debian/apache-arrow-apt-source.install
new file mode 100644
index 000000000..7bcb2ecc9
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/debian/apache-arrow-apt-source.install
@@ -0,0 +1,2 @@
+etc/apt/sources.list.d/*
+usr/share/keyrings/*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/debian/changelog b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/debian/changelog
new file mode 100644
index 000000000..27e14c802
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/debian/changelog
@@ -0,0 +1,11 @@
+apache-arrow-apt-source (6.0.1-1) unstable; urgency=low
+
+  * New upstream release.
+
+ -- Sutou Kouhei <kou@clear-code.com>  Wed, 10 Nov 2021 02:04:45 -0000
+
+apache-arrow-apt-source (6.0.0-1) unstable; urgency=low
+
+  * New upstream release.
+
+ -- Krisztián Szűcs <szucs.krisztian@gmail.com>  Thu, 21 Oct 2021 19:01:54 -0000
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/debian/compat b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/debian/compat
new file mode 100644
index 000000000..ec635144f
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/debian/compat
@@ -0,0 +1 @@
+9
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/debian/control b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/debian/control
new file mode 100644
index 000000000..f54d52f98
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/debian/control
@@ -0,0 +1,23 @@
+Source: apache-arrow-apt-source
+Section: misc
+Priority: important
+Maintainer: Apache Arrow Developers <dev@arrow.apache.org>
+Build-Depends:
+  debhelper (>= 9),
+  gnupg,
+  lsb-release
+Standards-Version: 3.9.7
+Homepage: https://arrow.apache.org/
+
+Package: apache-arrow-apt-source
+Section: misc
+Architecture: all
+Replaces: apache-arrow-archive-keyring
+Breaks: apache-arrow-archive-keyring
+Depends:
+  ${misc:Depends},
+  apt-transport-https,
+  gnupg
+Description: GnuPG archive key of the Apache Arrow archive
+ The Apache Arrow project digitally signs its Release files. This
+ package contains the archive key used for that.
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/debian/copyright b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/debian/copyright
new file mode 100644
index 000000000..274d64ca0
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/debian/copyright
@@ -0,0 +1,26 @@
+Format: http://www.debian.org/doc/packaging-manuals/copyright-format/1.0/
+Upstream-Name: Apache Arrow
+Upstream-Contact: Apache Arrow Developers <dev@arrow.apache.org>
+
+Files: *
+Copyright: 2016 The Apache Software Foundation
+License: Apache-2.0
+
+License: Apache-2.0
+ Licensed to the Apache Software Foundation (ASF) under one or more
+ contributor license agreements.  See the NOTICE file distributed with
+ this work for additional information regarding copyright ownership.
+ The ASF licenses this file to You under the Apache License, Version 2.0
+ (the "License"); you may not use this file except in compliance with
+ the License.  You may obtain a copy of the License at
+ .
+      http://www.apache.org/licenses/LICENSE-2.0
+ .
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ .
+ On Debian systems, the full text of the Apache Software License version 2 can
+ be found in the file `/usr/share/common-licenses/Apache-2.0'.
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/debian/rules b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/debian/rules
new file mode 100755
index 000000000..bf7a85c8c
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/debian/rules
@@ -0,0 +1,37 @@
+#!/usr/bin/make -f
+# -*- makefile-gmake -*-
+#
+# Uncomment this to turn on verbose mode.
+#export DH_VERBOSE=1
+# This has to be exported to make some magic below work.
+export DH_OPTIONS
+
+%:
+	dh $@
+
+override_dh_auto_build:
+	gpg \
+	  --no-default-keyring \
+	  --keyring ./apache-arrow-apt-source.gpg \
+	  --import KEYS
+
+	( \
+	  distribution=$$(lsb_release --id --short | tr 'A-Z' 'a-z'); \
+	  code_name=$$(lsb_release --codename --short); \
+	  echo "Types: deb deb-src"; \
+	  echo "URIs: https://apache.jfrog.io/artifactory/arrow/$${distribution}/"; \
+	  echo "Suites: $${code_name}"; \
+	  echo "Components: main"; \
+	  echo "Signed-By: /usr/share/keyrings/apache-arrow-apt-source.gpg"; \
+	) > apache-arrow.sources
+
+override_dh_install:
+	install -d debian/tmp/usr/share/keyrings/
+	install -m 0644 apache-arrow-apt-source.gpg \
+	  debian/tmp/usr/share/keyrings/
+
+	install -d debian/tmp/etc/apt/sources.list.d/
+	install -m 0644 apache-arrow.sources \
+	  debian/tmp/etc/apt/sources.list.d/
+
+	dh_install
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/debian/source/format b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/debian/source/format
new file mode 100644
index 000000000..163aaf8d8
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow-apt-source/debian/source/format
@@ -0,0 +1 @@
+3.0 (quilt)
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow-release/Rakefile b/src/arrow/dev/tasks/linux-packages/apache-arrow-release/Rakefile
new file mode 100644
index 000000000..4a341c6f1
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow-release/Rakefile
@@ -0,0 +1,66 @@
+# -*- ruby -*-
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+require_relative "../helper"
+require_relative "../package-task"
+
+class ApacheArrowReleasePackageTask < PackageTask
+  include Helper::ApacheArrow
+
+  def initialize
+    release_time = detect_release_time
+    super("apache-arrow-release",
+          detect_version(release_time),
+          release_time,
+          :rc_build_type => :release)
+  end
+
+  private
+  def repo_path
+    "#{yum_dir}/Apache-Arrow.repo"
+  end
+
+  def define_archive_task
+    file @archive_name => [repo_path] do
+      rm_rf(@archive_base_name)
+      mkdir(@archive_base_name)
+      download("https://downloads.apache.org/arrow/KEYS",
+               "#{@archive_base_name}/KEYS")
+      cp(repo_path, @archive_base_name)
+      sh("tar", "czf", @archive_name, @archive_base_name)
+      rm_rf(@archive_base_name)
+    end
+
+    if rpm_archive_name != @archive_name
+      file rpm_archive_name => @archive_name do
+        sh("tar", "xf", @archive_name)
+        rpm_archive_base_name = File.basename(rpm_archive_name, ".tar.gz")
+        mv(@archive_base_name, rpm_archive_base_name)
+        sh("tar", "czf", rpm_archive_name, rpm_archive_base_name)
+      end
+    end
+  end
+
+  def enable_apt?
+    false
+  end
+end
+
+task = ApacheArrowReleasePackageTask.new
+task.define
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow-release/yum/Apache-Arrow.repo b/src/arrow/dev/tasks/linux-packages/apache-arrow-release/yum/Apache-Arrow.repo
new file mode 100644
index 000000000..0d1666520
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow-release/yum/Apache-Arrow.repo
@@ -0,0 +1,44 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+[apache-arrow-almalinux]
+name=Apache Arrow for AlmaLinux $releasever - $basearch
+baseurl=https://apache.jfrog.io/artifactory/arrow/almalinux/$releasever/$basearch/
+gpgcheck=1
+enabled=0
+gpgkey=file:///etc/pki/rpm-gpg/RPM-GPG-KEY-Apache-Arrow
+
+[apache-arrow-amazon-linux]
+name=Apache Arrow for Amazon Linux $releasever - $basearch
+baseurl=https://apache.jfrog.io/artifactory/arrow/amazon-linux/$releasever/$basearch/
+gpgcheck=1
+enabled=0
+gpgkey=file:///etc/pki/rpm-gpg/RPM-GPG-KEY-Apache-Arrow
+
+[apache-arrow-centos]
+name=Apache Arrow for CentOS $releasever - $basearch
+baseurl=https://apache.jfrog.io/artifactory/arrow/centos/$releasever/$basearch/
+gpgcheck=1
+enabled=0
+gpgkey=file:///etc/pki/rpm-gpg/RPM-GPG-KEY-Apache-Arrow
+
+[apache-arrow-rhel]
+name=Apache Arrow for RHEL $releasever - $basearch
+baseurl=https://apache.jfrog.io/artifactory/arrow/centos/$releasever/$basearch/
+gpgcheck=1
+enabled=0
+gpgkey=file:///etc/pki/rpm-gpg/RPM-GPG-KEY-Apache-Arrow
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow-release/yum/almalinux-8/Dockerfile b/src/arrow/dev/tasks/linux-packages/apache-arrow-release/yum/almalinux-8/Dockerfile
new file mode 100644
index 000000000..5be1edc3d
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow-release/yum/almalinux-8/Dockerfile
@@ -0,0 +1,26 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+FROM almalinux:8
+
+ARG DEBUG
+
+RUN \
+  quiet=$([ "${DEBUG}" = "yes" ] || echo "--quiet") && \
+  dnf install --enablerepo=powertools -y ${quiet} \
+    rpmdevtools && \
+  dnf clean ${quiet} all
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow-release/yum/amazon-linux-2/Dockerfile b/src/arrow/dev/tasks/linux-packages/apache-arrow-release/yum/amazon-linux-2/Dockerfile
new file mode 100644
index 000000000..800df6c68
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow-release/yum/amazon-linux-2/Dockerfile
@@ -0,0 +1,26 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+FROM amazonlinux:2
+
+ARG DEBUG
+
+RUN \
+  quiet=$([ "${DEBUG}" = "yes" ] || echo "--quiet") && \
+  yum install -y ${quiet} \
+    rpmdevtools && \
+  yum clean ${quiet} all
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow-release/yum/apache-arrow-release.spec.in b/src/arrow/dev/tasks/linux-packages/apache-arrow-release/yum/apache-arrow-release.spec.in
new file mode 100644
index 000000000..594cda373
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow-release/yum/apache-arrow-release.spec.in
@@ -0,0 +1,113 @@
+# -*- sh-shell: rpm -*-
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+%define use_dnf (%{rhel} >= 8)
+%if %{use_dnf}
+%define yum_repository_enable() (dnf config-manager --set-enabled %1)
+%define yum_repository_disable() (dnf config-manager --set-disabled %1)
+%else
+%define yum_repository_enable() (yum-config-manager --enable %1)
+%define yum_repository_disable() (yum-config-manager --disable %1)
+%endif
+
+Name:		@PACKAGE@
+Version:	@VERSION@
+Release:	@RELEASE@%{?dist}
+Summary:	Apache Arrow release files
+
+License:	Apache-2.0
+URL:		https://arrow.apache.org/
+Source0:	@PACKAGE@-%{version}.tar.gz
+
+BuildArch:	noarch
+
+Requires:	epel-release
+%if %{use_dnf}
+Requires:	dnf-command(config-manager)
+%else
+Requires:	yum-utils
+%endif
+
+%description
+Apache Arrow release files.
+
+%prep
+%setup -q
+
+%build
+distribution=$(. /etc/os-release && echo "${ID}")
+if [ "${distribution}" = "rhel" ]; then
+  # We use distribution version explicitly for RHEL because we can't
+  # use symbolic link on Artifactory. CentOS uses 7 and 8 but RHEL uses
+  # 7Server and 8Server for $releasever. If we can use symbolic link
+  # on Artifactory we can use $releasever directly.
+  distribution_version=$(. /etc/os-release && echo "${VERSION_ID}")
+  sed -i'' -e "s/\\\$releasever/${distribution_version}/g" Apache-Arrow.repo
+fi
+
+%install
+rm -rf $RPM_BUILD_ROOT
+
+%{__install} -Dp -m0644 KEYS \
+   $RPM_BUILD_ROOT%{_sysconfdir}/pki/rpm-gpg/RPM-GPG-KEY-Apache-Arrow
+
+%{__install} -d $RPM_BUILD_ROOT%{_sysconfdir}/yum.repos.d/
+%{__install} -Dp -m0644 Apache-Arrow.repo \
+   $RPM_BUILD_ROOT%{_sysconfdir}/yum.repos.d/Apache-Arrow.repo
+
+%files
+%defattr(-, root, root, 0755)
+%doc
+%dir %{_sysconfdir}/yum.repos.d/
+%dir %{_sysconfdir}/pki/rpm-gpg/
+%{_sysconfdir}/pki/rpm-gpg/RPM-GPG-KEY-Apache-Arrow
+%config(noreplace) %{_sysconfdir}/yum.repos.d/Apache-Arrow.repo
+
+%post
+if grep -q 'Amazon Linux release 2' /etc/system-release 2>/dev/null; then
+  %{yum_repository_enable apache-arrow-amazon-linux}
+elif grep -q 'Red Hat Enterprise Linux' /etc/system-release 2>/dev/null; then
+  %{yum_repository_enable apache-arrow-rhel}
+elif grep -q 'AlmaLinux' /etc/system-release 2>/dev/null; then
+  %{yum_repository_enable apache-arrow-almalinux}
+else
+  %{yum_repository_enable apache-arrow-centos}
+fi
+
+%changelog
+* Wed Nov 10 2021 Sutou Kouhei <kou@clear-code.com> - 6.0.1-1
+- New upstream release.
+
+* Thu Oct 21 2021 Krisztián Szűcs <szucs.krisztian@gmail.com> - 6.0.0-1
+- New upstream release.
+
+* Mon Jan 18 2021 Krisztián Szűcs <szucs.krisztian@gmail.com> - 3.0.0-1
+- New upstream release.
+
+* Mon Oct 12 2020 Krisztián Szűcs <szucs.krisztian@gmail.com> - 2.0.0-1
+- New upstream release.
+
+* Mon Jul 20 2020 Krisztián Szűcs <szucs.krisztian@gmail.com> - 1.0.0-1
+- New upstream release.
+
+* Thu Apr 16 2020 Krisztián Szűcs <szucs.krisztian@gmail.com> - 0.17.0-1
+- New upstream release.
+
+* Thu Jan 30 2020 Krisztián Szűcs <szucs.krisztian@gmail.com> - 0.16.0-1
+- New upstream release.
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow-release/yum/centos-7/Dockerfile b/src/arrow/dev/tasks/linux-packages/apache-arrow-release/yum/centos-7/Dockerfile
new file mode 100644
index 000000000..236b0e297
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow-release/yum/centos-7/Dockerfile
@@ -0,0 +1,26 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+FROM centos:7
+
+ARG DEBUG
+
+RUN \
+  quiet=$([ "${DEBUG}" = "yes" ] || echo "--quiet") && \
+  yum install -y ${quiet} \
+    rpmdevtools && \
+  yum clean ${quiet} all
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow-release/yum/centos-8/Dockerfile b/src/arrow/dev/tasks/linux-packages/apache-arrow-release/yum/centos-8/Dockerfile
new file mode 100644
index 000000000..e36850630
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow-release/yum/centos-8/Dockerfile
@@ -0,0 +1,26 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+FROM centos:8
+
+ARG DEBUG
+
+RUN \
+  quiet=$([ "${DEBUG}" = "yes" ] || echo "--quiet") && \
+  dnf install --enablerepo=powertools -y ${quiet} \
+    rpmdevtools && \
+  dnf clean ${quiet} all
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/Rakefile b/src/arrow/dev/tasks/linux-packages/apache-arrow/Rakefile
new file mode 100644
index 000000000..9dfae955e
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/Rakefile
@@ -0,0 +1,162 @@
+# -*- ruby -*-
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+require_relative "../helper"
+require_relative "../package-task"
+
+class ApacheArrowPackageTask < PackageTask
+  include Helper::ApacheArrow
+
+  def initialize
+    release_time = detect_release_time
+    super("apache-arrow",
+          detect_version(release_time),
+          release_time,
+          :rc_build_type => :release)
+    @rpm_package = "arrow"
+  end
+
+  private
+  def define_archive_task
+    file @archive_name do
+      case @version
+      when /\A\d+\.\d+\.\d+-rc\d+\z/
+        download_rc_archive
+      when /\A\d+\.\d+\.\d+\z/
+        download_released_archive
+      else
+        build_archive
+      end
+    end
+
+    if deb_archive_name != @archive_name
+      file deb_archive_name => @archive_name do
+        cp(@archive_name, deb_archive_name)
+      end
+    end
+
+    if rpm_archive_name != @archive_name
+      file rpm_archive_name => @archive_name do
+        cp(@archive_name, rpm_archive_name)
+      end
+    end
+  end
+
+  def download_rc_archive
+    base_url = "https://dist.apache.org/repos/dist/dev/arrow"
+    archive_name_no_rc = @archive_name.gsub(/-rc\d+(\.tar\.gz)\z/, "\\1")
+    url = "#{base_url}/#{@package}-#{@version}/#{archive_name_no_rc}"
+    download(url, @archive_name)
+  end
+
+  def download_released_archive
+    mirror_base_url = "https://www.apache.org/dyn/closer.lua/arrow"
+    mirror_list_url = "#{mirror_base_url}/arrow-#{@version}/#{@archive_name}"
+    open(mirror_list_url) do |response|
+      if /href="(.+?\/#{Regexp.escape(@archive_name)})"/ =~ response.read
+        download($1, ".")
+      end
+    end
+  end
+
+  def build_archive
+    cd(arrow_source_dir) do
+      sh("git", "archive", "HEAD",
+         "--prefix", "#{@archive_base_name}/",
+         "--output", @full_archive_name)
+    end
+  end
+
+  def apt_arm64_cuda_available_target?(target)
+    false
+  end
+
+  def apt_prepare_debian_control_cuda_architecture(control, target)
+    if apt_arm64_cuda_available_target?(target)
+      cuda_architecture = "any"
+    else
+      cuda_architecture = "i386 amd64"
+    end
+    control.gsub(/@CUDA_ARCHITECTURE@/, cuda_architecture)
+  end
+
+  def apt_prepare_debian_control_c_ares(control, target)
+    case target
+    when /\Aubuntu-bionic/
+      use_system_c_ares = "#"
+    else
+      use_system_c_ares = ""
+    end
+    control.gsub(/@USE_SYSTEM_C_ARES@/, use_system_c_ares)
+  end
+
+  def apt_prepare_debian_control_grpc(control, target)
+    case target
+    when /\Adebian-buster/, /\Aubuntu-(?:bionic|focal)/
+      use_system_grpc = "#"
+    else
+      use_system_grpc = ""
+    end
+    control.gsub(/@USE_SYSTEM_GRPC@/, use_system_grpc)
+  end
+
+  def apt_prepare_debian_control_thrift(control, target)
+    case target
+    when /\Aubuntu-bionic/
+      use_system_thrift = "#"
+    else
+      use_system_thrift = ""
+    end
+    control.gsub(/@USE_SYSTEM_THRIFT@/, use_system_thrift)
+  end
+
+  def apt_prepare_debian_control_utf8proc(control, target)
+    case target
+    when /\Aubuntu-bionic/
+      use_system_utf8proc = "#"
+    else
+      use_system_utf8proc = ""
+    end
+    control.gsub(/@USE_SYSTEM_UTF8PROC@/, use_system_utf8proc)
+  end
+
+  def apt_prepare_debian_control_zstd(control, target)
+    case target
+    when /\Adebian-buster/, /\Aubuntu-bionic/
+      use_system_zstd = "#"
+    else
+      use_system_zstd = ""
+    end
+    control.gsub(/@USE_SYSTEM_ZSTD@/, use_system_zstd)
+  end
+
+  def apt_prepare_debian_control(control_in, target)
+    control = control_in.dup
+    control = apt_prepare_debian_control_cuda_architecture(control, target)
+    control = apt_prepare_debian_control_c_ares(control, target)
+    control = apt_prepare_debian_control_grpc(control, target)
+    control = apt_prepare_debian_control_thrift(control, target)
+    control = apt_prepare_debian_control_utf8proc(control, target)
+    control = apt_prepare_debian_control_zstd(control, target)
+    control
+  end
+end
+
+task = ApacheArrowPackageTask.new
+task.define
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/debian-bookworm-arm64/from b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/debian-bookworm-arm64/from
new file mode 100644
index 000000000..022eaf290
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/debian-bookworm-arm64/from
@@ -0,0 +1,18 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+arm64v8/debian:bookworm
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/debian-bookworm/Dockerfile b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/debian-bookworm/Dockerfile
new file mode 100644
index 000000000..e88ed53ff
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/debian-bookworm/Dockerfile
@@ -0,0 +1,81 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+ARG FROM=debian:bookworm
+FROM ${FROM}
+
+RUN \
+  echo "debconf debconf/frontend select Noninteractive" | \
+    debconf-set-selections
+
+RUN \
+  echo 'APT::Install-Recommends "false";' > \
+    /etc/apt/apt.conf.d/disable-install-recommends
+
+RUN sed -i'' -e 's/main$/main contrib non-free/g' /etc/apt/sources.list
+
+ARG DEBUG
+RUN \
+  quiet=$([ "${DEBUG}" = "yes" ] || echo "-qq") && \
+  apt update ${quiet} && \
+  apt install -y -V ${quiet} \
+    build-essential \
+    ccache \
+    clang \
+    cmake \
+    debhelper \
+    devscripts \
+    git \
+    gtk-doc-tools \
+    libboost-filesystem-dev \
+    libboost-system-dev \
+    libbrotli-dev \
+    libbz2-dev \
+    libc-ares-dev \
+    libcurl4-openssl-dev \
+    libgirepository1.0-dev \
+    libglib2.0-doc \
+    libgmock-dev \
+    libgoogle-glog-dev \
+    libgrpc++-dev \
+    libgtest-dev \
+    liblz4-dev \
+    libprotoc-dev \
+    libprotobuf-dev \
+    libre2-dev \
+    libsnappy-dev \
+    libssl-dev \
+    libthrift-dev \
+    libutf8proc-dev \
+    libzstd-dev \
+    llvm-dev \
+    lsb-release \
+    ninja-build \
+    pkg-config \
+    protobuf-compiler-grpc \
+    python3-dev \
+    python3-numpy \
+    python3-pip \
+    rapidjson-dev \
+    tzdata \
+    zlib1g-dev && \
+  if apt list | grep '^nvidia-cuda-toolkit/'; then \
+    apt install -y -V ${quiet} nvidia-cuda-toolkit; \
+  fi && \
+  pip3 install --upgrade meson && \
+  ln -s /usr/local/bin/meson /usr/bin/ && \
+  apt clean
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/debian-bullseye-arm64/from b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/debian-bullseye-arm64/from
new file mode 100644
index 000000000..34187b2af
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/debian-bullseye-arm64/from
@@ -0,0 +1,18 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+arm64v8/debian:bullseye
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/debian-bullseye/Dockerfile b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/debian-bullseye/Dockerfile
new file mode 100644
index 000000000..2a5b18f5b
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/debian-bullseye/Dockerfile
@@ -0,0 +1,82 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+ARG FROM=debian:bullseye
+FROM ${FROM}
+
+RUN \
+  echo "debconf debconf/frontend select Noninteractive" | \
+    debconf-set-selections
+
+RUN \
+  echo 'APT::Install-Recommends "false";' > \
+    /etc/apt/apt.conf.d/disable-install-recommends
+
+RUN sed -i'' -e 's/main$/main contrib non-free/g' /etc/apt/sources.list
+
+ARG DEBUG
+RUN \
+  quiet=$([ "${DEBUG}" = "yes" ] || echo "-qq") && \
+  apt update ${quiet} && \
+  apt install -y -V ${quiet} \
+    build-essential \
+    ccache \
+    clang \
+    cmake \
+    debhelper \
+    devscripts \
+    git \
+    gtk-doc-tools \
+    libboost-filesystem-dev \
+    libboost-system-dev \
+    libbrotli-dev \
+    libbz2-dev \
+    libc-ares-dev \
+    libcurl4-openssl-dev \
+    libgirepository1.0-dev \
+    libglib2.0-doc \
+    libgmock-dev \
+    libgoogle-glog-dev \
+    libgrpc++-dev \
+    libgtest-dev \
+    liblz4-dev \
+    libprotoc-dev \
+    libprotobuf-dev \
+    libre2-dev \
+    libsnappy-dev \
+    libssl-dev \
+    libthrift-dev \
+    libutf8proc-dev \
+    libzstd-dev \
+    llvm-dev \
+    lsb-release \
+    ninja-build \
+    pkg-config \
+    protobuf-compiler-grpc \
+    python3-dev \
+    python3-numpy \
+    python3-pip \
+    rapidjson-dev \
+    tzdata \
+    zlib1g-dev && \
+  if apt list | grep '^nvidia-cuda-toolkit/'; then \
+    apt install -y -V ${quiet} nvidia-cuda-toolkit; \
+  fi && \
+  pip3 install --upgrade meson && \
+  ln -s /usr/local/bin/meson /usr/bin/ && \
+  apt clean && \
+  rm -rf /var/lib/apt/lists/*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/debian-buster-arm64/from b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/debian-buster-arm64/from
new file mode 100644
index 000000000..8da222b86
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/debian-buster-arm64/from
@@ -0,0 +1,18 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+arm64v8/debian:buster
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/debian-buster/Dockerfile b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/debian-buster/Dockerfile
new file mode 100644
index 000000000..11a33a130
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/debian-buster/Dockerfile
@@ -0,0 +1,82 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+ARG FROM=debian:buster
+FROM ${FROM}
+
+RUN \
+  echo "debconf debconf/frontend select Noninteractive" | \
+    debconf-set-selections
+
+RUN \
+  echo 'APT::Install-Recommends "false";' > \
+    /etc/apt/apt.conf.d/disable-install-recommends
+
+RUN sed -i'' -e 's/main$/main contrib non-free/g' /etc/apt/sources.list
+
+RUN \
+  echo "deb http://deb.debian.org/debian buster-backports main" > \
+    /etc/apt/sources.list.d/backports.list
+
+ARG DEBUG
+RUN \
+  quiet=$([ "${DEBUG}" = "yes" ] || echo "-qq") && \
+  apt update ${quiet} && \
+  apt install -y -V ${quiet} \
+    build-essential \
+    ccache \
+    cmake \
+    debhelper \
+    devscripts \
+    git \
+    gtk-doc-tools \
+    libboost-filesystem-dev \
+    libboost-system-dev \
+    libbrotli-dev \
+    libbz2-dev \
+    libc-ares-dev \
+    libcurl4-openssl-dev \
+    libgirepository1.0-dev \
+    libglib2.0-doc \
+    libgmock-dev \
+    libgoogle-glog-dev \
+    libgtest-dev \
+    liblz4-dev \
+    libre2-dev \
+    libsnappy-dev \
+    libssl-dev \
+    libthrift-dev \
+    libutf8proc-dev \
+    lsb-release \
+    ninja-build \
+    pkg-config \
+    python3-dev \
+    python3-numpy \
+    python3-pip \
+    rapidjson-dev \
+    tzdata \
+    zlib1g-dev && \
+  apt install -y -V -t buster-backports ${quiet} \
+    clang-11 \
+    llvm-11-dev && \
+  if apt list | grep '^nvidia-cuda-toolkit/'; then \
+    apt install -y -V ${quiet} nvidia-cuda-toolkit; \
+  fi && \
+  pip3 install --upgrade meson && \
+  ln -s /usr/local/bin/meson /usr/bin/ && \
+  apt clean && \
+  rm -rf /var/lib/apt/lists/*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/ubuntu-bionic-arm64/from b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/ubuntu-bionic-arm64/from
new file mode 100644
index 000000000..c3ba00cf0
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/ubuntu-bionic-arm64/from
@@ -0,0 +1,18 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+arm64v8/ubuntu:bionic
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/ubuntu-bionic/Dockerfile b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/ubuntu-bionic/Dockerfile
new file mode 100644
index 000000000..ac0c6a58d
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/ubuntu-bionic/Dockerfile
@@ -0,0 +1,84 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+ARG FROM=ubuntu:bionic
+FROM ${FROM}
+
+RUN \
+  echo "debconf debconf/frontend select Noninteractive" | \
+    debconf-set-selections
+
+RUN \
+  echo 'APT::Install-Recommends "false";' > \
+    /etc/apt/apt.conf.d/disable-install-recommends
+
+ARG DEBUG
+RUN \
+  quiet=$([ "${DEBUG}" = "yes" ] || echo "-qq") && \
+  apt update ${quiet} && \
+  apt install -y -V ${quiet} \
+    build-essential \
+    ccache \
+    clang-10 \
+    cmake \
+    devscripts \
+    fakeroot \
+    git \
+    gtk-doc-tools \
+    libboost-filesystem-dev \
+    libboost-system-dev \
+    libbrotli-dev \
+    libbz2-dev \
+    libcurl4-openssl-dev \
+    libgirepository1.0-dev \
+    libglib2.0-doc \
+    libgoogle-glog-dev \
+    libgtest-dev \
+    liblz4-dev \
+    libre2-dev \
+    libsnappy-dev \
+    libssl-dev \
+    llvm-10-dev \
+    lsb-release \
+    ninja-build \
+    pkg-config \
+    python3-dev \
+    python3-numpy \
+    python3-pip \
+    python3-setuptools \
+    python3-wheel \
+    rapidjson-dev \
+    tzdata \
+    zlib1g-dev && \
+  (echo "includedir=/usr/include" && \
+   echo "libdir=/usr/lib/$(dpkg-architecture -qDEB_HOST_MULTIARCH)" && \
+   echo "" && \
+   echo "Name: re2" && \
+   echo "Description: RE2 is a fast, safe, thread-friendly regular expression engine." && \
+   echo "Version: 0.0.0" && \
+   echo "Cflags: -std=c++11 -pthread -I\${includedir}" && \
+   echo "Libs: -pthread -L\${libdir} -lre2") | \
+    tee "/usr/lib/$(dpkg-architecture -qDEB_HOST_MULTIARCH)/pkgconfig/re2.pc" && \
+  if apt list | grep '^nvidia-cuda-toolkit/'; then \
+    apt install -y -V ${quiet} nvidia-cuda-toolkit; \
+  fi && \
+  apt install -y -V -t bionic-backports ${quiet} \
+    debhelper && \
+  pip3 install --upgrade meson && \
+  ln -s /usr/local/bin/meson /usr/bin/ && \
+  apt clean && \
+  rm -rf /var/lib/apt/lists/*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/ubuntu-focal-arm64/from b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/ubuntu-focal-arm64/from
new file mode 100644
index 000000000..52ab48b66
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/ubuntu-focal-arm64/from
@@ -0,0 +1,18 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+arm64v8/ubuntu:focal
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/ubuntu-focal/Dockerfile b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/ubuntu-focal/Dockerfile
new file mode 100644
index 000000000..112cc1846
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/ubuntu-focal/Dockerfile
@@ -0,0 +1,77 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+ARG FROM=ubuntu:focal
+FROM ${FROM}
+
+RUN \
+  echo "debconf debconf/frontend select Noninteractive" | \
+    debconf-set-selections
+
+RUN \
+  echo 'APT::Install-Recommends "false";' > \
+    /etc/apt/apt.conf.d/disable-install-recommends
+
+ARG DEBUG
+RUN \
+  quiet=$([ "${DEBUG}" = "yes" ] || echo "-qq") && \
+  apt update ${quiet} && \
+  apt install -y -V ${quiet} \
+    build-essential \
+    ccache \
+    clang \
+    cmake \
+    debhelper \
+    devscripts \
+    git \
+    gtk-doc-tools \
+    libboost-filesystem-dev \
+    libboost-system-dev \
+    libbrotli-dev \
+    libbz2-dev \
+    libc-ares-dev \
+    libcurl4-openssl-dev \
+    libgirepository1.0-dev \
+    libglib2.0-doc \
+    libgmock-dev \
+    libgoogle-glog-dev \
+    libgtest-dev \
+    liblz4-dev \
+    libre2-dev \
+    libsnappy-dev \
+    libssl-dev \
+    libthrift-dev \
+    libutf8proc-dev \
+    libzstd-dev \
+    llvm-dev \
+    lsb-release \
+    ninja-build \
+    pkg-config \
+    python3-dev \
+    python3-numpy \
+    python3-pip \
+    python3-setuptools \
+    rapidjson-dev \
+    tzdata \
+    zlib1g-dev && \
+  if apt list | grep '^nvidia-cuda-toolkit/'; then \
+    apt install -y -V ${quiet} nvidia-cuda-toolkit; \
+  fi && \
+  apt clean && \
+  python3 -m pip install --no-use-pep517 meson && \
+  ln -s /usr/local/bin/meson /usr/bin/ && \
+  rm -rf /var/lib/apt/lists/*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/ubuntu-hirsute-arm64/from b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/ubuntu-hirsute-arm64/from
new file mode 100644
index 000000000..f19ea9022
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/ubuntu-hirsute-arm64/from
@@ -0,0 +1,18 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+arm64v8/ubuntu:hirsute
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/ubuntu-hirsute/Dockerfile b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/ubuntu-hirsute/Dockerfile
new file mode 100644
index 000000000..7e26d3eb2
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/ubuntu-hirsute/Dockerfile
@@ -0,0 +1,83 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+ARG FROM=ubuntu:hirsute
+FROM ${FROM}
+
+RUN \
+  echo "debconf debconf/frontend select Noninteractive" | \
+    debconf-set-selections
+
+RUN \
+  echo 'APT::Install-Recommends "false";' > \
+    /etc/apt/apt.conf.d/disable-install-recommends
+
+ARG DEBUG
+RUN \
+  quiet=$([ "${DEBUG}" = "yes" ] || echo "-qq") && \
+  apt update ${quiet} && \
+  apt install -y -V ${quiet} \
+    build-essential \
+    ccache \
+    clang \
+    cmake \
+    debhelper \
+    devscripts \
+    git \
+    gtk-doc-tools \
+    libboost-filesystem-dev \
+    libboost-system-dev \
+    libbrotli-dev \
+    libbz2-dev \
+    libc-ares-dev \
+    libcurl4-openssl-dev \
+    libgirepository1.0-dev \
+    libglib2.0-doc \
+    libgmock-dev \
+    libgoogle-glog-dev \
+    libgrpc++-dev \
+    libgtest-dev \
+    liblz4-dev \
+    libprotoc-dev \
+    libprotobuf-dev \
+    libre2-dev \
+    libsnappy-dev \
+    libssl-dev \
+    libthrift-dev \
+    libutf8proc-dev \
+    libzstd-dev \
+    llvm-dev \
+    lsb-release \
+    ninja-build \
+    pkg-config \
+    protobuf-compiler-grpc \
+    python3-dev \
+    python3-numpy \
+    python3-pip \
+    python3-setuptools \
+    rapidjson-dev \
+    tzdata \
+    zlib1g-dev && \
+  if apt list | grep -q '^libcuda1'; then \
+    apt install -y -V ${quiet} nvidia-cuda-toolkit; \
+  else \
+    :; \
+  fi && \
+  apt clean && \
+  python3 -m pip install --no-use-pep517 meson && \
+  ln -s /usr/local/bin/meson /usr/bin/ && \
+  rm -rf /var/lib/apt/lists/*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/ubuntu-impish-arm64/from b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/ubuntu-impish-arm64/from
new file mode 100644
index 000000000..0c8a1c7a1
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/ubuntu-impish-arm64/from
@@ -0,0 +1,18 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+arm64v8/ubuntu:impish
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/ubuntu-impish/Dockerfile b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/ubuntu-impish/Dockerfile
new file mode 100644
index 000000000..2e94dd9b6
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/apt/ubuntu-impish/Dockerfile
@@ -0,0 +1,83 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+ARG FROM=ubuntu:impish
+FROM ${FROM}
+
+RUN \
+  echo "debconf debconf/frontend select Noninteractive" | \
+    debconf-set-selections
+
+RUN \
+  echo 'APT::Install-Recommends "false";' > \
+    /etc/apt/apt.conf.d/disable-install-recommends
+
+ARG DEBUG
+RUN \
+  quiet=$([ "${DEBUG}" = "yes" ] || echo "-qq") && \
+  apt update ${quiet} && \
+  apt install -y -V ${quiet} \
+    build-essential \
+    ccache \
+    clang \
+    cmake \
+    debhelper \
+    devscripts \
+    git \
+    gtk-doc-tools \
+    libboost-filesystem-dev \
+    libboost-system-dev \
+    libbrotli-dev \
+    libbz2-dev \
+    libc-ares-dev \
+    libcurl4-openssl-dev \
+    libgirepository1.0-dev \
+    libglib2.0-doc \
+    libgmock-dev \
+    libgoogle-glog-dev \
+    libgrpc++-dev \
+    libgtest-dev \
+    liblz4-dev \
+    libprotoc-dev \
+    libprotobuf-dev \
+    libre2-dev \
+    libsnappy-dev \
+    libssl-dev \
+    libthrift-dev \
+    libutf8proc-dev \
+    libzstd-dev \
+    llvm-dev \
+    lsb-release \
+    ninja-build \
+    pkg-config \
+    protobuf-compiler-grpc \
+    python3-dev \
+    python3-numpy \
+    python3-pip \
+    python3-setuptools \
+    rapidjson-dev \
+    tzdata \
+    zlib1g-dev && \
+  if apt list | grep -q '^libcuda1'; then \
+    apt install -y -V ${quiet} nvidia-cuda-toolkit; \
+  else \
+    :; \
+  fi && \
+  apt clean && \
+  python3 -m pip install --no-use-pep517 meson && \
+  ln -s /usr/local/bin/meson /usr/bin/ && \
+  rm -rf /var/lib/apt/lists/*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/changelog b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/changelog
new file mode 100644
index 000000000..65948629e
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/changelog
@@ -0,0 +1,123 @@
+apache-arrow (6.0.1-1) unstable; urgency=low
+
+  * New upstream release.
+
+ -- Sutou Kouhei <kou@clear-code.com>  Wed, 10 Nov 2021 02:04:45 -0000
+
+apache-arrow (6.0.0-1) unstable; urgency=low
+
+  * New upstream release.
+
+ -- Krisztián Szűcs <szucs.krisztian@gmail.com>  Thu, 21 Oct 2021 19:01:54 -0000
+
+apache-arrow (3.0.0-1) unstable; urgency=low
+
+  * New upstream release.
+
+ -- Krisztián Szűcs <szucs.krisztian@gmail.com>  Mon, 18 Jan 2021 21:33:18 -0000
+
+apache-arrow (2.0.0-1) unstable; urgency=low
+
+  * New upstream release.
+
+ -- Krisztián Szűcs <szucs.krisztian@gmail.com>  Mon, 12 Oct 2020 23:38:01 -0000
+
+apache-arrow (1.0.0-1) unstable; urgency=low
+
+  * New upstream release.
+
+ -- Krisztián Szűcs <szucs.krisztian@gmail.com>  Mon, 20 Jul 2020 20:41:07 -0000
+
+apache-arrow (0.17.0-1) unstable; urgency=low
+
+  * New upstream release.
+
+ -- Krisztián Szűcs <szucs.krisztian@gmail.com>  Thu, 16 Apr 2020 12:05:43 -0000
+
+apache-arrow (0.16.0-1) unstable; urgency=low
+
+  * New upstream release.
+
+ -- Krisztián Szűcs <szucs.krisztian@gmail.com>  Thu, 30 Jan 2020 20:21:44 -0000
+
+apache-arrow (0.15.0-1) unstable; urgency=low
+
+  * New upstream release.
+
+ -- Krisztián Szűcs <szucs.krisztian@gmail.com>  Mon, 30 Sep 2019 17:19:02 -0000
+
+apache-arrow (0.14.0-1) unstable; urgency=low
+
+  * New upstream release.
+
+ -- Sutou Kouhei <kou@clear-code.com>  Fri, 28 Jun 2019 22:22:35 -0000
+
+apache-arrow (0.13.0-1) unstable; urgency=low
+
+  * New upstream release.
+
+ -- Kouhei Sutou <kou@clear-code.com>  Thu, 28 Mar 2019 02:24:58 -0000
+
+apache-arrow (0.12.0-1) unstable; urgency=low
+
+  * New upstream release.
+
+ -- Krisztián Szűcs <szucs.krisztian@gmail.com>  Wed, 16 Jan 2019 03:29:25 -0000
+
+apache-arrow (0.11.0-1) unstable; urgency=low
+
+  * New upstream release.
+
+ -- Kouhei Sutou <kou@clear-code.com>  Thu, 04 Oct 2018 00:33:42 -0000
+
+apache-arrow (0.10.0-1) unstable; urgency=low
+
+  * New upstream release.
+
+ -- Phillip Cloud <cpcloud@gmail.com>  Thu, 02 Aug 2018 23:58:23 -0000
+
+apache-arrow (0.9.0-1) unstable; urgency=low
+
+  * New upstream release.
+
+ -- Kouhei Sutou <kou@clear-code.com>  Fri, 16 Mar 2018 16:56:31 -0000
+
+apache-arrow (0.8.0-1) unstable; urgency=low
+
+  * New upstream release.
+
+  * Add libarrow-gpu-glib0, libarrow-gpu-glib-dev and gir1.2-arrow-gpu-1.0.
+
+ -- Uwe L. Korn <uwelk@xhochy.com>  Sun, 17 Dec 2017 20:24:44 -0000
+
+apache-arrow (0.7.1-2) unstable; urgency=low
+
+  * Add libarrow-gpu0 and libarrow-gpu-dev.
+
+  * Add libarrow-python-dev.
+
+ -- Kouhei Sutou <kou@clear-code.com>  Sun, 29 Oct 2017 21:59:13 +0900
+
+apache-arrow (0.7.1-1) unstable; urgency=low
+
+  * New upstream release.
+
+ -- Kouhei Sutou <kou@clear-code.com>  Wed, 27 Sep 2017 13:19:05 -0000
+
+apache-arrow (0.7.0-1) unstable; urgency=low
+
+  * New upstream release.
+
+ -- Wes McKinney <wes.mckinney@twosigma.com>  Tue, 12 Sep 2017 22:01:14 -0000
+
+apache-arrow (0.6.0-1) unstable; urgency=low
+
+  * New upstream release.
+
+ -- Kouhei Sutou <kou@clear-code.com>  Fri, 11 Aug 2017 21:27:51 -0000
+
+apache-arrow (0.6.0.20170802-1) unstable; urgency=low
+
+  * New upstream release.
+
+ -- Kouhei Sutou <kou@clear-code.com>  Wed, 02 Aug 2017 22:28:18 -0000
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/compat b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/compat
new file mode 100644
index 000000000..48082f72f
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/compat
@@ -0,0 +1 @@
+12
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/control.in b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/control.in
new file mode 100644
index 000000000..6b0332ed2
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/control.in
@@ -0,0 +1,640 @@
+Source: apache-arrow
+Section: devel
+Priority: optional
+Maintainer: Apache Arrow Developers <dev@arrow.apache.org>
+Build-Depends:
+  cmake,
+  debhelper (>= 12),
+  git,
+  gobject-introspection,
+  gtk-doc-tools,
+  libboost-filesystem-dev,
+  libboost-system-dev,
+  libbrotli-dev,
+  libbz2-dev,
+@USE_SYSTEM_C_ARES@  libc-ares-dev,
+  libcurl4-openssl-dev,
+  libgirepository1.0-dev,
+  libgoogle-glog-dev,
+@USE_SYSTEM_GRPC@  libgrpc++-dev,
+  libgtest-dev,
+  liblz4-dev,
+@USE_SYSTEM_GRPC@  libprotoc-dev,
+@USE_SYSTEM_GRPC@  libprotobuf-dev,
+  libre2-dev,
+  libsnappy-dev,
+  libssl-dev,
+@USE_SYSTEM_THRIFT@  libthrift-dev,
+@USE_SYSTEM_UTF8PROC@  libutf8proc-dev,
+@USE_SYSTEM_ZSTD@  libzstd-dev,
+  ninja-build,
+  nvidia-cuda-toolkit [!arm64],
+  pkg-config,
+@USE_SYSTEM_GRPC@  protobuf-compiler-grpc,
+  python3-dev,
+  python3-numpy,
+  tzdata,
+  zlib1g-dev
+Build-Depends-Indep: libglib2.0-doc
+Standards-Version: 3.9.8
+Homepage: https://arrow.apache.org/
+
+Package: libarrow600
+Section: libs
+Architecture: any
+Multi-Arch: same
+Pre-Depends: ${misc:Pre-Depends}
+Depends:
+  ${misc:Depends},
+  ${shlibs:Depends}
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides C++ library files.
+
+Package: libarrow-cuda600
+Section: libs
+Architecture: @CUDA_ARCHITECTURE@
+Multi-Arch: same
+Pre-Depends: ${misc:Pre-Depends}
+Depends:
+  ${misc:Depends},
+  ${shlibs:Depends},
+  libarrow600 (= ${binary:Version})
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides C++ library files for CUDA support.
+
+Package: libarrow-dataset600
+Section: libs
+Architecture: any
+Multi-Arch: same
+Pre-Depends: ${misc:Pre-Depends}
+Depends:
+  ${misc:Depends},
+  ${shlibs:Depends},
+  libarrow600 (= ${binary:Version}),
+  libparquet600 (= ${binary:Version})
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides C++ library files for Dataset module.
+
+Package: libarrow-flight600
+Section: libs
+Architecture: any
+Multi-Arch: same
+Pre-Depends: ${misc:Pre-Depends}
+Depends:
+  ${misc:Depends},
+  ${shlibs:Depends},
+  libarrow600 (= ${binary:Version})
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides C++ library files for Flight RPC system.
+
+Package: libarrow-python600
+Section: libs
+Architecture: any
+Multi-Arch: same
+Pre-Depends: ${misc:Pre-Depends}
+Depends:
+  ${misc:Depends},
+  ${shlibs:Depends},
+  libarrow600 (= ${binary:Version}),
+  python3,
+  python3-numpy
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides C++ library files for Python support.
+
+Package: libarrow-python-flight600
+Section: libs
+Architecture: any
+Multi-Arch: same
+Pre-Depends: ${misc:Pre-Depends}
+Depends:
+  ${misc:Depends},
+  ${shlibs:Depends},
+  libarrow-flight600 (= ${binary:Version}),
+  libarrow-python600 (= ${binary:Version})
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides C++ library files for Flight and Python support.
+
+Package: libarrow-dev
+Section: libdevel
+Architecture: any
+Multi-Arch: same
+Depends:
+  ${misc:Depends},
+  libarrow600 (= ${binary:Version}),
+  libbrotli-dev,
+  libbz2-dev,
+@USE_SYSTEM_C_ARES@  libc-ares-dev,
+@USE_SYSTEM_GRPC@  libgrpc++-dev,
+  liblz4-dev,
+  libre2-dev,
+  libsnappy-dev,
+  libssl-dev,
+@USE_SYSTEM_THRIFT@  libthrift-dev,
+@USE_SYSTEM_UTF8PROC@  libutf8proc-dev,
+@USE_SYSTEM_ZSTD@  libzstd-dev,
+@USE_SYSTEM_GRPC@  protobuf-compiler-grpc,
+  zlib1g-dev
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides C++ header files.
+
+Package: libarrow-cuda-dev
+Section: libdevel
+Architecture: @CUDA_ARCHITECTURE@
+Multi-Arch: same
+Depends:
+  ${misc:Depends},
+  libarrow-dev (= ${binary:Version}),
+  libarrow-cuda600 (= ${binary:Version})
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides C++ header files for CUDA support.
+
+Package: libarrow-dataset-dev
+Section: libdevel
+Architecture: any
+Multi-Arch: same
+Depends:
+  ${misc:Depends},
+  libarrow-dev (= ${binary:Version}),
+  libarrow-dataset600 (= ${binary:Version}),
+  libparquet-dev (= ${binary:Version})
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides C++ header files for dataset module.
+
+Package: libarrow-flight-dev
+Section: libdevel
+Architecture: any
+Multi-Arch: same
+Depends:
+  ${misc:Depends},
+  libarrow-dev (= ${binary:Version}),
+  libarrow-flight600 (= ${binary:Version})
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides C++ header files for Flight RPC system.
+
+Package: libarrow-python-dev
+Section: libdevel
+Architecture: any
+Multi-Arch: same
+Depends:
+  ${misc:Depends},
+  libarrow-dev (= ${binary:Version}),
+  libarrow-python600 (= ${binary:Version})
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides C++ header files for Python support.
+
+Package: libarrow-python-flight-dev
+Section: libdevel
+Architecture: any
+Multi-Arch: same
+Depends:
+  ${misc:Depends},
+  libarrow-flight-dev (= ${binary:Version}),
+  libarrow-python-dev (= ${binary:Version}),
+  libarrow-python-flight600 (= ${binary:Version})
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides C++ header files for Flight and Python support.
+
+Package: libgandiva600
+Section: libs
+Architecture: any
+Multi-Arch: same
+Pre-Depends: ${misc:Pre-Depends}
+Depends:
+  ${misc:Depends},
+  ${shlibs:Depends},
+  libarrow600 (= ${binary:Version})
+Description: Gandiva is a toolset for compiling and evaluating expressions
+ on Arrow Data.
+ .
+ This package provides C++ library files.
+
+Package: libgandiva-dev
+Section: libdevel
+Architecture: any
+Multi-Arch: same
+Depends:
+  ${misc:Depends},
+  libarrow-dev (= ${binary:Version}),
+  libgandiva600 (= ${binary:Version})
+Description: Gandiva is a toolset for compiling and evaluating expressions
+ on Arrow Data.
+ .
+ This package provides C++ header files.
+
+Package: libplasma600
+Section: libs
+Architecture: @CUDA_ARCHITECTURE@
+Multi-Arch: same
+Pre-Depends: ${misc:Pre-Depends}
+Depends:
+  ${misc:Depends},
+  ${shlibs:Depends},
+  libarrow-cuda600 (= ${binary:Version})
+Description: Plasma is an in-memory object store and cache for big data.
+ .
+ This package provides C++ library files to connect plasma-store-server.
+
+Package: plasma-store-server
+Section: utils
+Architecture: @CUDA_ARCHITECTURE@
+Pre-Depends: ${misc:Pre-Depends}
+Depends:
+  ${misc:Depends},
+  ${shlibs:Depends},
+  libplasma600 (= ${binary:Version})
+Description: Plasma is an in-memory object store and cache for big data.
+ .
+ This package provides plasma-store-server.
+
+Package: libplasma-dev
+Section: libdevel
+Architecture: @CUDA_ARCHITECTURE@
+Multi-Arch: same
+Depends:
+  ${misc:Depends},
+  libarrow-cuda-dev (= ${binary:Version}),
+  libplasma600 (= ${binary:Version})
+Description: Plasma is an in-memory object store and cache for big data.
+ .
+ This package provides C++ header files.
+
+Package: libparquet600
+Section: libs
+Architecture: any
+Multi-Arch: same
+Pre-Depends: ${misc:Pre-Depends}
+Depends:
+  ${misc:Depends},
+  ${shlibs:Depends}
+Description: Apache Parquet is a columnar storage format
+ .
+ This package provides C++ library files to process Apache Parquet format.
+
+Package: libparquet-dev
+Section: libdevel
+Architecture: any
+Multi-Arch: same
+Depends:
+  ${misc:Depends},
+  libarrow-dev (= ${binary:Version}),
+  libparquet600 (= ${binary:Version})
+Description: Apache Parquet is a columnar storage format
+ .
+ This package provides C++ header files.
+
+Package: libarrow-glib600
+Section: libs
+Architecture: any
+Multi-Arch: same
+Pre-Depends: ${misc:Pre-Depends}
+Depends:
+  ${misc:Depends},
+  ${shlibs:Depends},
+  libarrow600 (= ${binary:Version})
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides GLib based library files.
+
+Package: gir1.2-arrow-1.0
+Section: introspection
+Architecture: any
+Multi-Arch: same
+Depends:
+  ${gir:Depends},
+  ${misc:Depends}
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides GObject Introspection typelib files.
+
+Package: libarrow-glib-dev
+Section: libdevel
+Architecture: any
+Multi-Arch: same
+Depends:
+  ${misc:Depends},
+  libglib2.0-dev,
+  libarrow-dev (= ${binary:Version}),
+  libarrow-glib600 (= ${binary:Version}),
+  gir1.2-arrow-1.0 (= ${binary:Version})
+Suggests: libarrow-glib-doc
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides GLib based header files.
+
+Package: libarrow-glib-doc
+Section: doc
+Architecture: all
+Multi-Arch: foreign
+Depends:
+  ${misc:Depends}
+Recommends: libglib2.0-doc
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides documentations.
+
+Package: libarrow-cuda-glib600
+Section: libs
+Architecture: @CUDA_ARCHITECTURE@
+Multi-Arch: same
+Pre-Depends: ${misc:Pre-Depends}
+Depends:
+  ${misc:Depends},
+  ${shlibs:Depends},
+  libarrow-glib600 (= ${binary:Version}),
+  libarrow-cuda600 (= ${binary:Version})
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides GLib based library files for CUDA support.
+
+Package: gir1.2-arrow-cuda-1.0
+Section: introspection
+Architecture: @CUDA_ARCHITECTURE@
+Multi-Arch: same
+Depends:
+  ${gir:Depends},
+  ${misc:Depends}
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides GObject Introspection typelib files for CUDA support.
+
+Package: libarrow-cuda-glib-dev
+Section: libdevel
+Architecture: @CUDA_ARCHITECTURE@
+Multi-Arch: same
+Depends:
+  ${misc:Depends},
+  libarrow-cuda-dev (= ${binary:Version}),
+  libarrow-glib-dev (= ${binary:Version}),
+  libarrow-cuda-glib600 (= ${binary:Version}),
+  gir1.2-arrow-cuda-1.0 (= ${binary:Version})
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides GLib based header files for CUDA support.
+
+Package: libarrow-dataset-glib600
+Section: libs
+Architecture: any
+Multi-Arch: same
+Pre-Depends: ${misc:Pre-Depends}
+Depends:
+  ${misc:Depends},
+  ${shlibs:Depends},
+  libarrow-glib600 (= ${binary:Version}),
+  libarrow-dataset600 (= ${binary:Version})
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides GLib based library files for dataset module.
+
+Package: gir1.2-arrow-dataset-1.0
+Section: introspection
+Architecture: any
+Multi-Arch: same
+Depends:
+  ${gir:Depends},
+  ${misc:Depends}
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides GObject Introspection typelib files for dataset module.
+
+Package: libarrow-dataset-glib-dev
+Section: libdevel
+Architecture: any
+Multi-Arch: same
+Depends:
+  ${misc:Depends},
+  libarrow-dataset-dev (= ${binary:Version}),
+  libarrow-glib-dev (= ${binary:Version}),
+  libarrow-dataset-glib600 (= ${binary:Version}),
+  gir1.2-arrow-dataset-1.0 (= ${binary:Version})
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides GLib based header files for dataset module.
+
+Package: libarrow-dataset-glib-doc
+Section: doc
+Architecture: any
+Multi-Arch: foreign
+Depends:
+  ${misc:Depends}
+Recommends: libarrow-glib-doc
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides documentations for dataset module.
+
+Package: libarrow-flight-glib600
+Section: libs
+Architecture: any
+Multi-Arch: same
+Pre-Depends: ${misc:Pre-Depends}
+Depends:
+  ${misc:Depends},
+  ${shlibs:Depends},
+  libarrow-glib600 (= ${binary:Version}),
+  libarrow-flight600 (= ${binary:Version})
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides GLib based library files for Apache Arrow Flight.
+
+Package: gir1.2-arrow-flight-1.0
+Section: introspection
+Architecture: any
+Multi-Arch: same
+Depends:
+  ${gir:Depends},
+  ${misc:Depends}
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides GObject Introspection typelib files for Apache Arrow
+ Flight.
+
+Package: libarrow-flight-glib-dev
+Section: libdevel
+Architecture: any
+Multi-Arch: same
+Depends:
+  ${misc:Depends},
+  libarrow-flight-dev (= ${binary:Version}),
+  libarrow-glib-dev (= ${binary:Version}),
+  libarrow-flight-glib600 (= ${binary:Version}),
+  gir1.2-arrow-flight-1.0 (= ${binary:Version})
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides GLib based header files for Apache Arrow Flight.
+
+Package: libarrow-flight-glib-doc
+Section: doc
+Architecture: any
+Multi-Arch: foreign
+Depends:
+  ${misc:Depends}
+Recommends: libarrow-glib-doc
+Description: Apache Arrow is a data processing library for analysis
+ .
+ This package provides documentations for Apache Arrow Flight.
+
+Package: libgandiva-glib600
+Section: libs
+Architecture: any
+Multi-Arch: same
+Pre-Depends: ${misc:Pre-Depends}
+Depends:
+  ${misc:Depends},
+  ${shlibs:Depends},
+  libarrow-glib600 (= ${binary:Version}),
+  libgandiva600 (= ${binary:Version})
+Description: Gandiva is a toolset for compiling and evaluating expressions
+ on Arrow Data.
+ .
+ This package provides GLib based library files.
+
+Package: gir1.2-gandiva-1.0
+Section: introspection
+Architecture: any
+Multi-Arch: same
+Depends:
+  ${gir:Depends},
+  ${misc:Depends}
+Description: Gandiva is a toolset for compiling and evaluating expressions
+ on Arrow Data.
+ .
+ This package provides GObject Introspection typelib files.
+
+Package: libgandiva-glib-dev
+Section: libdevel
+Architecture: any
+Multi-Arch: same
+Depends:
+  ${misc:Depends},
+  libgandiva-dev (= ${binary:Version}),
+  libarrow-glib-dev (= ${binary:Version}),
+  libgandiva-glib600 (= ${binary:Version}),
+  gir1.2-gandiva-1.0 (= ${binary:Version})
+Description: Gandiva is a toolset for compiling and evaluating expressions
+ on Arrow Data.
+ .
+ This package provides GLib based header files.
+
+Package: libgandiva-glib-doc
+Section: doc
+Architecture: any
+Multi-Arch: foreign
+Depends:
+  ${misc:Depends}
+Recommends: libglib2.0-doc
+Description: Gandiva is a toolset for compiling and evaluating expressions
+ on Arrow Data.
+ .
+ This package provides documentations.
+
+Package: libplasma-glib600
+Section: libs
+Architecture: @CUDA_ARCHITECTURE@
+Multi-Arch: same
+Pre-Depends: ${misc:Pre-Depends}
+Depends:
+  ${misc:Depends},
+  ${shlibs:Depends},
+  libarrow-cuda-glib600 (= ${binary:Version}),
+  libplasma600 (= ${binary:Version})
+Description: Plasma is an in-memory object store and cache for big data.
+ .
+ This package provides GLib based library files to connect plasma-store-server.
+
+Package: gir1.2-plasma-1.0
+Section: introspection
+Architecture: @CUDA_ARCHITECTURE@
+Multi-Arch: same
+Depends:
+  ${gir:Depends},
+  ${misc:Depends}
+Description: Plasma is an in-memory object store and cache for big data.
+ .
+ This package provides GObject Introspection typelib files.
+
+Package: libplasma-glib-dev
+Section: libdevel
+Architecture: @CUDA_ARCHITECTURE@
+Multi-Arch: same
+Depends:
+  ${misc:Depends},
+  libplasma-dev (= ${binary:Version}),
+  libarrow-cuda-glib-dev (= ${binary:Version}),
+  libplasma-glib600 (= ${binary:Version}),
+  gir1.2-plasma-1.0 (= ${binary:Version})
+Description: Plasma is an in-memory object store and cache for big data.
+ .
+ This package provides GLib based header files.
+
+Package: libplasma-glib-doc
+Section: doc
+Architecture: @CUDA_ARCHITECTURE@
+Multi-Arch: foreign
+Depends:
+  ${misc:Depends}
+Recommends: libglib2.0-doc
+Description: Plasma is an in-memory object store and cache for big data.
+ .
+ This package provides documentations.
+
+Package: libparquet-glib600
+Section: libs
+Architecture: any
+Multi-Arch: same
+Pre-Depends: ${misc:Pre-Depends}
+Depends:
+  ${misc:Depends},
+  ${shlibs:Depends},
+  libarrow-glib600 (= ${binary:Version}),
+  libparquet600 (= ${binary:Version})
+Description: Apache Parquet is a columnar storage format
+ .
+ This package provides GLib based library files.
+
+Package: gir1.2-parquet-1.0
+Section: introspection
+Architecture: any
+Multi-Arch: same
+Depends:
+  ${gir:Depends},
+  ${misc:Depends}
+Description: Apache Parquet is a columnar storage format
+ .
+ This package provides GObject Introspection typelib files.
+
+Package: libparquet-glib-dev
+Section: libdevel
+Architecture: any
+Multi-Arch: same
+Depends:
+  ${misc:Depends},
+  libarrow-glib-dev (= ${binary:Version}),
+  libparquet-dev (= ${binary:Version}),
+  libparquet-glib600 (= ${binary:Version}),
+  gir1.2-parquet-1.0 (= ${binary:Version})
+Suggests: libparquet-glib-doc
+Description: Apache Parquet is a columnar storage format
+ .
+ This package provides GLib based header files.
+
+Package: libparquet-glib-doc
+Section: doc
+Architecture: all
+Multi-Arch: foreign
+Depends:
+  ${misc:Depends}
+Recommends: libglib2.0-doc
+Description: Apache Parquet is a columnar storage format
+ .
+ This package provides documentations.
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/copyright b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/copyright
new file mode 100644
index 000000000..9db0ea76f
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/copyright
@@ -0,0 +1,193 @@
+Format: http://www.debian.org/doc/packaging-manuals/copyright-format/1.0/
+Upstream-Name: Apache Arrow
+Upstream-Contact: <dev@arrow.apache.org>
+Source: https://dist.apache.org/repos/dist/release/arrow/
+
+Files: *
+Copyright: 2016 The Apache Software Foundation
+License: Apache-2.0
+
+Files: TODO for "This product includes software from the SFrame project"
+Copyright: 2015 Dato, Inc.
+           2009 Carnegie Mellon University.
+License: BSD-3-clause
+
+Files: TODO for "This product includes software from the Numpy project"
+Copyright: 1995, 1996, 1997 Jim Hugunin, hugunin@mit.edu
+           2005 Travis E. Oliphant oliphant@ee.byu.edu Brigham Young University
+License: BSD-3-clause
+
+Files: TODO for "This product includes software from the Feather project"
+Copyright: TODO
+License: Apache-2.0
+
+Files: TODO for "This product includes software from the DyND project"
+Copyright: TODO
+License: BSD-2-clause
+
+Files: TODO for "This product includes software from the LLVM project"
+Copyright: 2003-2007 University of Illinois at Urbana-Champaign.
+License: U-OF-I-BSD-LIKE
+
+Files: TODO for "This product includes software from the google-lint project"
+Copyright: 2009 Google Inc. All rights reserved.
+License: BSD-3-clause
+
+Files: TODO for "This product includes software from the mman-win32 project"
+Copyright: 2010 kutuzov.viktor.84
+License: MIT
+
+Files: TODO for "This product includes software from the LevelDB project"
+Copyright: 2011 The LevelDB Authors. All rights reserved.
+License: BSD-3-clause
+
+Files: TODO for "This product includes software from the CMake project"
+Copyright: 2001-2009 Kitware, Inc.
+           2012-2014 Continuum Analytics, Inc.
+License: BSD-3-clause
+
+Files: TODO for "This product includes software from https://github.com/matthew-brett/multibuild"
+Copyright: 2013-2016, Matt Terry and Matthew Brett; all rights reserved.
+License: BSD-2-clause
+
+Files: TODO for "This product includes software from the Ibis project"
+Copyright: 2015 Cloudera, Inc.
+License: Apache-2.0
+
+Files: TODO for "This product includes code from Apache Kudu"
+Copyright: 2016 The Apache Software Foundation
+License: Apache-2.0
+
+License: Apache-2.0
+ Licensed to the Apache Software Foundation (ASF) under one or more
+ contributor license agreements.  See the NOTICE file distributed with
+ this work for additional information regarding copyright ownership.
+ The ASF licenses this file to You under the Apache License, Version 2.0
+ (the "License"); you may not use this file except in compliance with
+ the License.  You may obtain a copy of the License at
+ .
+      http://www.apache.org/licenses/LICENSE-2.0
+ .
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ .
+ On Debian systems, the full text of the Apache Software License version 2 can
+ be found in the file `/usr/share/common-licenses/Apache-2.0'.
+
+License: BSD-3-clause
+ Redistribution and use in source and binary forms, with or without
+ modification, are permitted provided that the following conditions
+ are met:
+ .
+ 1. Redistributions of source code must retain the above copyright
+    notice, this list of conditions and the following disclaimer.
+ 2. Redistributions in binary form must reproduce the above copyright
+    notice, this list of conditions and the following disclaimer in the
+    documentation and/or other materials provided with the distribution.
+ 3. Neither the name of the University nor the names of its contributors
+    may be used to endorse or promote products derived from this software
+    without specific prior written permission.
+ .
+ THIS SOFTWARE IS PROVIDED BY THE REGENTS AND CONTRIBUTORS ``AS IS'' AND
+ ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
+ IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+ ARE DISCLAIMED.  IN NO EVENT SHALL THE REGENTS OR CONTRIBUTORS BE LIABLE
+ FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+ DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS
+ OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION)
+ HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT
+ LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY
+ OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF
+ SUCH DAMAGE.
+
+License: BSD-2-clause
+ Redistribution and use in source and binary forms, with or without
+ modification, are permitted provided that the following conditions
+ are met:
+ .
+ 1) Redistributions of source code must retain the above copyright
+ notice, this list of conditions and the following disclaimer.
+ .
+ 2) Redistributions in binary form must reproduce the above copyright
+ notice, this list of conditions and the following disclaimer in the
+ documentation and/or other materials provided with the distribution.
+ .
+ THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
+ "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
+ LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
+ A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT
+ HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT,
+ INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING,
+ BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS
+ OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT
+ LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY
+ WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE
+ POSSIBILITY OF SUCH DAMAGE.
+
+License: U-OF-I-BSD-LIKE
+ ==============================================================================
+ LLVM Release License
+ ==============================================================================
+ University of Illinois/NCSA
+ Open Source License
+ .
+ Copyright (c) 2003-2013 University of Illinois at Urbana-Champaign.
+ All rights reserved.
+ .
+ Developed by:
+ .
+     LLVM Team
+ .
+     University of Illinois at Urbana-Champaign
+ .
+     http://llvm.org
+ .
+ Permission is hereby granted, free of charge, to any person obtaining a copy of
+ this software and associated documentation files (the "Software"), to deal with
+ the Software without restriction, including without limitation the rights to
+ use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
+ of the Software, and to permit persons to whom the Software is furnished to do
+ so, subject to the following conditions:
+ .
+     * Redistributions of source code must retain the above copyright notice,
+       this list of conditions and the following disclaimers.
+ .
+     * Redistributions in binary form must reproduce the above copyright notice,
+       this list of conditions and the following disclaimers in the
+       documentation and/or other materials provided with the distribution.
+ .
+     * Neither the names of the LLVM Team, University of Illinois at
+       Urbana-Champaign, nor the names of its contributors may be used to
+       endorse or promote products derived from this Software without specific
+       prior written permission.
+ .
+ THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+ IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS
+ FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.  IN NO EVENT SHALL THE
+ CONTRIBUTORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+ LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+ OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS WITH THE
+ SOFTWARE.
+
+License: MIT
+ Permission is hereby granted, free of charge, to any person obtaining a copy
+ of this software and associated documentation files (the "Software"), to deal
+ in the Software without restriction, including without limitation the rights
+ to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+ copies of the Software, and to permit persons to whom the Software is
+ furnished to do so, subject to the following conditions:
+ .
+ The above copyright notice and this permission notice shall be included in
+ all copies or substantial portions of the Software.
+ .
+ THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+ IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+ FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+ AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+ LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+ OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+ THE SOFTWARE.
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/gir1.2-arrow-1.0.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/gir1.2-arrow-1.0.install
new file mode 100644
index 000000000..e0197fcd3
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/gir1.2-arrow-1.0.install
@@ -0,0 +1 @@
+usr/lib/*/girepository-1.0/Arrow-1.0.typelib
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/gir1.2-arrow-cuda-1.0.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/gir1.2-arrow-cuda-1.0.install
new file mode 100644
index 000000000..ef0d9f56f
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/gir1.2-arrow-cuda-1.0.install
@@ -0,0 +1 @@
+usr/lib/*/girepository-1.0/ArrowCUDA-1.0.typelib
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/gir1.2-arrow-dataset-1.0.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/gir1.2-arrow-dataset-1.0.install
new file mode 100644
index 000000000..27091dab3
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/gir1.2-arrow-dataset-1.0.install
@@ -0,0 +1 @@
+usr/lib/*/girepository-1.0/ArrowDataset-1.0.typelib
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/gir1.2-gandiva-1.0.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/gir1.2-gandiva-1.0.install
new file mode 100644
index 000000000..0433b367a
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/gir1.2-gandiva-1.0.install
@@ -0,0 +1 @@
+usr/lib/*/girepository-1.0/Gandiva-1.0.typelib
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/gir1.2-parquet-1.0.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/gir1.2-parquet-1.0.install
new file mode 100644
index 000000000..13fde6681
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/gir1.2-parquet-1.0.install
@@ -0,0 +1 @@
+usr/lib/*/girepository-1.0/Parquet-1.0.typelib
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/gir1.2-plasma-1.0.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/gir1.2-plasma-1.0.install
new file mode 100644
index 000000000..7b7ce2158
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/gir1.2-plasma-1.0.install
@@ -0,0 +1 @@
+usr/lib/*/girepository-1.0/Plasma-1.0.typelib
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-cuda-dev.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-cuda-dev.install
new file mode 100644
index 000000000..77e0b70f6
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-cuda-dev.install
@@ -0,0 +1,6 @@
+usr/lib/*/cmake/arrow/ArrowCUDAConfig*.cmake
+usr/lib/*/cmake/arrow/ArrowCUDATargets*.cmake
+usr/lib/*/cmake/arrow/FindArrowCUDA.cmake
+usr/lib/*/libarrow_cuda.a
+usr/lib/*/libarrow_cuda.so
+usr/lib/*/pkgconfig/arrow-cuda.pc
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-cuda-glib-dev.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-cuda-glib-dev.install
new file mode 100644
index 000000000..778ae5fd7
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-cuda-glib-dev.install
@@ -0,0 +1,4 @@
+usr/include/arrow-cuda-glib/
+usr/lib/*/libarrow-cuda-glib.so
+usr/lib/*/pkgconfig/arrow-cuda-glib.pc
+usr/share/gir-1.0/ArrowCUDA-1.0.gir
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-cuda-glib600.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-cuda-glib600.install
new file mode 100644
index 000000000..a6d637526
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-cuda-glib600.install
@@ -0,0 +1 @@
+usr/lib/*/libarrow-cuda-glib.so.*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-cuda600.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-cuda600.install
new file mode 100644
index 000000000..5ae464687
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-cuda600.install
@@ -0,0 +1 @@
+usr/lib/*/libarrow_cuda.so.*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset-dev.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset-dev.install
new file mode 100644
index 000000000..53e727ae0
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset-dev.install
@@ -0,0 +1,6 @@
+usr/lib/*/cmake/arrow/ArrowDatasetConfig*.cmake
+usr/lib/*/cmake/arrow/ArrowDatasetTargets*.cmake
+usr/lib/*/cmake/arrow/FindArrowDataset.cmake
+usr/lib/*/libarrow_dataset.a
+usr/lib/*/libarrow_dataset.so
+usr/lib/*/pkgconfig/arrow-dataset.pc
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset-glib-dev.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset-glib-dev.install
new file mode 100644
index 000000000..4c50bde97
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset-glib-dev.install
@@ -0,0 +1,4 @@
+usr/include/arrow-dataset-glib/
+usr/lib/*/libarrow-dataset-glib.so
+usr/lib/*/pkgconfig/arrow-dataset-glib.pc
+usr/share/gir-1.0/ArrowDataset-1.0.gir
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset-glib-doc.doc-base b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset-glib-doc.doc-base
new file mode 100644
index 000000000..5ec8156b0
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset-glib-doc.doc-base
@@ -0,0 +1,9 @@
+Document: arrow-dataset-glib
+Title: Apache Arrow Dataset GLib Reference Manual
+Author: The Apache Software Foundation
+Abstract: Apache Arrow Dataset GLib provides an API to read and write semantic datasets stored in different locations and formats that uses GLib.
+Section: Programming
+
+Format: HTML
+Index: /usr/share/gtk-doc/html/arrow-dataset-glib/index.html
+Files: /usr/share/gtk-doc/html/arrow-dataset-glib/*.html
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset-glib-doc.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset-glib-doc.install
new file mode 100644
index 000000000..523bc206e
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset-glib-doc.install
@@ -0,0 +1 @@
+usr/share/gtk-doc/html/arrow-dataset-glib
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset-glib-doc.links b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset-glib-doc.links
new file mode 100644
index 000000000..3d880362b
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset-glib-doc.links
@@ -0,0 +1,3 @@
+usr/share/gtk-doc/html/arrow-dataset-glib usr/share/doc/libarrow-dataset-glib-doc/arrow-dataset-glib 
+usr/share/doc/libglib2.0-doc/glib usr/share/doc/libarrow-dataset-glib-doc/glib
+usr/share/doc/libglib2.0-doc/gobject usr/share/doc/libarrow-dataset-glib-doc/gobject
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset-glib600.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset-glib600.install
new file mode 100644
index 000000000..10085f3a0
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset-glib600.install
@@ -0,0 +1 @@
+usr/lib/*/libarrow-dataset-glib.so.*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset600.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset600.install
new file mode 100644
index 000000000..014634165
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-dataset600.install
@@ -0,0 +1 @@
+usr/lib/*/libarrow_dataset.so.*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-dev.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-dev.install
new file mode 100644
index 000000000..ccd0c4e5b
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-dev.install
@@ -0,0 +1,19 @@
+usr/include/arrow/
+usr/lib/*/cmake/arrow/ArrowConfig*.cmake
+usr/lib/*/cmake/arrow/ArrowOptions.cmake
+usr/lib/*/cmake/arrow/ArrowTargets*.cmake
+usr/lib/*/cmake/arrow/Find*Alt.cmake
+usr/lib/*/cmake/arrow/FindArrow.cmake
+usr/lib/*/cmake/arrow/FindBrotli.cmake
+usr/lib/*/cmake/arrow/FindLz4.cmake
+usr/lib/*/cmake/arrow/Find[Suz]*.cmake
+usr/lib/*/cmake/arrow/arrow-config.cmake
+usr/lib/*/libarrow.a
+usr/lib/*/libarrow.so
+usr/lib/*/libarrow_bundled_dependencies.a
+usr/lib/*/pkgconfig/arrow-compute.pc
+usr/lib/*/pkgconfig/arrow-csv.pc
+usr/lib/*/pkgconfig/arrow-filesystem.pc
+usr/lib/*/pkgconfig/arrow-json.pc
+usr/lib/*/pkgconfig/arrow-orc.pc
+usr/lib/*/pkgconfig/arrow.pc
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight-dev.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight-dev.install
new file mode 100644
index 000000000..20ca33d84
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight-dev.install
@@ -0,0 +1,6 @@
+usr/lib/*/cmake/arrow/ArrowFlightConfig*.cmake
+usr/lib/*/cmake/arrow/ArrowFlightTargets*.cmake
+usr/lib/*/cmake/arrow/FindArrowFlight.cmake
+usr/lib/*/libarrow_flight.a
+usr/lib/*/libarrow_flight.so
+usr/lib/*/pkgconfig/arrow-flight.pc
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight-glib-dev.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight-glib-dev.install
new file mode 100644
index 000000000..8a8dee3ac
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight-glib-dev.install
@@ -0,0 +1,4 @@
+usr/include/arrow-flight-glib/
+usr/lib/*/libarrow-flight-glib.so
+usr/lib/*/pkgconfig/arrow-flight-glib.pc
+usr/share/gir-1.0/ArrowFlight-1.0.gir
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight-glib-doc.doc-base b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight-glib-doc.doc-base
new file mode 100644
index 000000000..94b17c11b
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight-glib-doc.doc-base
@@ -0,0 +1,9 @@
+Document: arrow-flight-glib
+Title: Apache Arrow Flight GLib Reference Manual
+Author: The Apache Software Foundation
+Abstract: Apache Arrow Flight GLib provides a general-purpose client-server framework to simplify high performance transport of large datasets over network interfaces.
+Section: Programming
+
+Format: HTML
+Index: /usr/share/gtk-doc/html/arrow-flight-glib/index.html
+Files: /usr/share/gtk-doc/html/arrow-flight-glib/*.html
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight-glib-doc.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight-glib-doc.install
new file mode 100644
index 000000000..3c95f17ed
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight-glib-doc.install
@@ -0,0 +1 @@
+usr/share/gtk-doc/html/arrow-flight-glib
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight-glib-doc.links b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight-glib-doc.links
new file mode 100644
index 000000000..d55c89a1b
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight-glib-doc.links
@@ -0,0 +1,3 @@
+usr/share/gtk-doc/html/arrow-flight-glib usr/share/doc/libarrow-flight-glib-doc/arrow-flight-glib 
+usr/share/doc/libglib2.0-doc/glib usr/share/doc/libarrow-flight-glib-doc/glib
+usr/share/doc/libglib2.0-doc/gobject usr/share/doc/libarrow-flight-glib-doc/gobject
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight-glib600.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight-glib600.install
new file mode 100644
index 000000000..a6156ed94
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight-glib600.install
@@ -0,0 +1 @@
+usr/lib/*/libarrow-flight-glib.so.*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight600.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight600.install
new file mode 100644
index 000000000..abdb96d4c
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-flight600.install
@@ -0,0 +1 @@
+usr/lib/*/libarrow_flight.so.*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-glib-dev.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-glib-dev.install
new file mode 100644
index 000000000..f6de7eedb
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-glib-dev.install
@@ -0,0 +1,6 @@
+usr/include/arrow-glib/
+usr/lib/*/libarrow-glib.so
+usr/lib/*/pkgconfig/arrow-glib.pc
+usr/lib/*/pkgconfig/arrow-orc-glib.pc
+usr/share/arrow-glib/example/
+usr/share/gir-1.0/Arrow-1.0.gir
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-glib-doc.doc-base b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-glib-doc.doc-base
new file mode 100644
index 000000000..8ae4ffb6d
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-glib-doc.doc-base
@@ -0,0 +1,9 @@
+Document: arrow-glib
+Title: Apache Arrow GLib Reference Manual
+Author: The Apache Software Foundation
+Abstract: Apache Arrow GLib is a data processing library for analysis that uses GLib.
+Section: Programming
+
+Format: HTML
+Index: /usr/share/gtk-doc/html/arrow-glib/index.html
+Files: /usr/share/gtk-doc/html/arrow-glib/*.html
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-glib-doc.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-glib-doc.install
new file mode 100644
index 000000000..912a29c58
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-glib-doc.install
@@ -0,0 +1,2 @@
+usr/share/doc/arrow-glib/
+usr/share/gtk-doc/html/arrow-glib
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-glib-doc.links b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-glib-doc.links
new file mode 100644
index 000000000..556987d0a
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-glib-doc.links
@@ -0,0 +1,3 @@
+usr/share/gtk-doc/html/arrow-glib usr/share/doc/libarrow-glib-doc/arrow-glib
+usr/share/doc/libglib2.0-doc/glib usr/share/doc/libarrow-glib-doc/glib
+usr/share/doc/libglib2.0-doc/gobject usr/share/doc/libarrow-glib-doc/gobject
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-glib600.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-glib600.install
new file mode 100644
index 000000000..ec369d153
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-glib600.install
@@ -0,0 +1 @@
+usr/lib/*/libarrow-glib.so.*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-python-dev.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-python-dev.install
new file mode 100644
index 000000000..807583f98
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-python-dev.install
@@ -0,0 +1,6 @@
+usr/lib/*/cmake/arrow/ArrowPythonConfig*.cmake
+usr/lib/*/cmake/arrow/ArrowPythonTargets*.cmake
+usr/lib/*/cmake/arrow/FindArrowPython.cmake
+usr/lib/*/libarrow_python.a
+usr/lib/*/libarrow_python.so
+usr/lib/*/pkgconfig/arrow-python.pc
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-python-flight-dev.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-python-flight-dev.install
new file mode 100644
index 000000000..6cf96e227
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-python-flight-dev.install
@@ -0,0 +1,6 @@
+usr/lib/*/cmake/arrow/ArrowPythonFlightConfig*.cmake
+usr/lib/*/cmake/arrow/ArrowPythonFlightTargets*.cmake
+usr/lib/*/cmake/arrow/FindArrowPythonFlight.cmake
+usr/lib/*/libarrow_python_flight.a
+usr/lib/*/libarrow_python_flight.so
+usr/lib/*/pkgconfig/arrow-python-flight.pc
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-python-flight600.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-python-flight600.install
new file mode 100644
index 000000000..b7cbfec1f
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-python-flight600.install
@@ -0,0 +1 @@
+usr/lib/*/libarrow_python_flight.so.*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-python600.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-python600.install
new file mode 100644
index 000000000..eef3e6648
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow-python600.install
@@ -0,0 +1 @@
+usr/lib/*/libarrow_python.so.*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow600.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow600.install
new file mode 100644
index 000000000..98ef2139c
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libarrow600.install
@@ -0,0 +1 @@
+usr/lib/*/libarrow.so.*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libgandiva-dev.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libgandiva-dev.install
new file mode 100644
index 000000000..26e7e76fb
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libgandiva-dev.install
@@ -0,0 +1,7 @@
+usr/include/gandiva/
+usr/lib/*/cmake/arrow/GandivaConfig*.cmake
+usr/lib/*/cmake/arrow/GandivaTargets*.cmake
+usr/lib/*/cmake/arrow/FindGandiva.cmake
+usr/lib/*/libgandiva.a
+usr/lib/*/libgandiva.so
+usr/lib/*/pkgconfig/gandiva.pc
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libgandiva-glib-dev.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libgandiva-glib-dev.install
new file mode 100644
index 000000000..fe7d8bb79
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libgandiva-glib-dev.install
@@ -0,0 +1,4 @@
+usr/include/gandiva-glib/
+usr/lib/*/libgandiva-glib.so
+usr/lib/*/pkgconfig/gandiva-glib.pc
+usr/share/gir-1.0/Gandiva-1.0.gir
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libgandiva-glib-doc.doc-base b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libgandiva-glib-doc.doc-base
new file mode 100644
index 000000000..2bf913062
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libgandiva-glib-doc.doc-base
@@ -0,0 +1,9 @@
+Document: gandiva-glib
+Title: Gandiva GLib Reference Manual
+Author: The Apache Software Foundation
+Abstract: Gandiva GLib is a toolset for compiling and evaluating expressions on Arrow Data that uses GLib.
+Section: Programming
+
+Format: HTML
+Index: /usr/share/gtk-doc/html/gandiva-glib/index.html
+Files: /usr/share/gtk-doc/html/gandiva-glib/*.html
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libgandiva-glib-doc.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libgandiva-glib-doc.install
new file mode 100644
index 000000000..358e4e5c7
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libgandiva-glib-doc.install
@@ -0,0 +1 @@
+usr/share/gtk-doc/html/gandiva-glib
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libgandiva-glib-doc.links b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libgandiva-glib-doc.links
new file mode 100644
index 000000000..234794e23
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libgandiva-glib-doc.links
@@ -0,0 +1,3 @@
+usr/share/gtk-doc/html/gandiva-glib usr/share/doc/libgandiva-glib-doc/gandiva-glib
+usr/share/doc/libglib2.0-doc/glib usr/share/doc/libgandiva-glib-doc/glib
+usr/share/doc/libglib2.0-doc/gobject usr/share/doc/libgandiva-glib-doc/gobject
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libgandiva-glib600.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libgandiva-glib600.install
new file mode 100644
index 000000000..6257fd438
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libgandiva-glib600.install
@@ -0,0 +1 @@
+usr/lib/*/libgandiva-glib.so.*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libgandiva600.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libgandiva600.install
new file mode 100644
index 000000000..1475f49cf
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libgandiva600.install
@@ -0,0 +1 @@
+usr/lib/*/libgandiva.so.*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libparquet-dev.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libparquet-dev.install
new file mode 100644
index 000000000..e163115f0
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libparquet-dev.install
@@ -0,0 +1,7 @@
+usr/include/parquet/
+usr/lib/*/cmake/arrow/ParquetConfig*.cmake
+usr/lib/*/cmake/arrow/ParquetTargets*.cmake
+usr/lib/*/cmake/arrow/FindParquet.cmake
+usr/lib/*/libparquet.a
+usr/lib/*/libparquet.so
+usr/lib/*/pkgconfig/parquet.pc
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libparquet-glib-dev.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libparquet-glib-dev.install
new file mode 100644
index 000000000..9cce737a7
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libparquet-glib-dev.install
@@ -0,0 +1,4 @@
+usr/include/parquet-glib/
+usr/lib/*/libparquet-glib.so
+usr/lib/*/pkgconfig/parquet-glib.pc
+usr/share/gir-1.0/Parquet-1.0.gir
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libparquet-glib-doc.doc-base b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libparquet-glib-doc.doc-base
new file mode 100644
index 000000000..cc68e2df6
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libparquet-glib-doc.doc-base
@@ -0,0 +1,9 @@
+Document: parquet-glib
+Title: Apache Parquet GLib Reference Manual
+Author: The Apache Software Foundation
+Abstract: Apache Parquet GLib is a columnar storage format processing library that uses GLib.
+Section: Programming
+
+Format: HTML
+Index: /usr/share/gtk-doc/html/parquet-glib/index.html
+Files: /usr/share/gtk-doc/html/parquet-glib/*.html
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libparquet-glib-doc.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libparquet-glib-doc.install
new file mode 100644
index 000000000..5843ea3da
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libparquet-glib-doc.install
@@ -0,0 +1 @@
+usr/share/gtk-doc/html/parquet-glib
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libparquet-glib-doc.links b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libparquet-glib-doc.links
new file mode 100644
index 000000000..c31f346b1
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libparquet-glib-doc.links
@@ -0,0 +1,3 @@
+usr/share/gtk-doc/html/parquet-glib usr/share/doc/libparquet-glib-doc/parquet-glib 
+usr/share/doc/libglib2.0-doc/glib usr/share/doc/libparquet-glib-doc/glib
+usr/share/doc/libglib2.0-doc/gobject usr/share/doc/libparquet-glib-doc/gobject
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libparquet-glib600.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libparquet-glib600.install
new file mode 100644
index 000000000..1c0e44199
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libparquet-glib600.install
@@ -0,0 +1 @@
+usr/lib/*/libparquet-glib.so.*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libparquet600.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libparquet600.install
new file mode 100644
index 000000000..540a91d5e
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libparquet600.install
@@ -0,0 +1 @@
+usr/lib/*/libparquet.so.*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libplasma-dev.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libplasma-dev.install
new file mode 100644
index 000000000..c315d4dfc
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libplasma-dev.install
@@ -0,0 +1,7 @@
+usr/include/plasma/
+usr/lib/*/cmake/arrow/PlasmaConfig*.cmake
+usr/lib/*/cmake/arrow/PlasmaTargets*.cmake
+usr/lib/*/cmake/arrow/FindPlasma.cmake
+usr/lib/*/libplasma.a
+usr/lib/*/libplasma.so
+usr/lib/*/pkgconfig/plasma.pc
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libplasma-glib-dev.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libplasma-glib-dev.install
new file mode 100644
index 000000000..7800681d2
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libplasma-glib-dev.install
@@ -0,0 +1,4 @@
+usr/include/plasma-glib/
+usr/lib/*/libplasma-glib.so
+usr/lib/*/pkgconfig/plasma-glib.pc
+usr/share/gir-1.0/Plasma-1.0.gir
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libplasma-glib-doc.doc-base b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libplasma-glib-doc.doc-base
new file mode 100644
index 000000000..a9d306d8b
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libplasma-glib-doc.doc-base
@@ -0,0 +1,9 @@
+Document: plasma-glib
+Title: Plasma GLib Reference Manual
+Author: The Apache Software Foundation
+Abstract: Plasma GLib is an in-memory object store and cache for big data that uses GLib.
+Section: Programming
+
+Format: HTML
+Index: /usr/share/gtk-doc/html/plasma-glib/index.html
+Files: /usr/share/gtk-doc/html/plasma-glib/*.html
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libplasma-glib-doc.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libplasma-glib-doc.install
new file mode 100644
index 000000000..ad13b94cd
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libplasma-glib-doc.install
@@ -0,0 +1 @@
+usr/share/gtk-doc/html/plasma-glib
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libplasma-glib-doc.links b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libplasma-glib-doc.links
new file mode 100644
index 000000000..193262f9b
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libplasma-glib-doc.links
@@ -0,0 +1,3 @@
+usr/share/gtk-doc/html/plasma-glib usr/share/doc/libplasma-glib-doc/plasma-glib
+usr/share/doc/libglib2.0-doc/glib usr/share/doc/libplasma-glib-doc/glib
+usr/share/doc/libglib2.0-doc/gobject usr/share/doc/libplasma-glib-doc/gobject
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libplasma-glib600.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libplasma-glib600.install
new file mode 100644
index 000000000..339bcca3e
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libplasma-glib600.install
@@ -0,0 +1 @@
+usr/lib/*/libplasma-glib.so.*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libplasma600.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libplasma600.install
new file mode 100644
index 000000000..f8a744b65
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/libplasma600.install
@@ -0,0 +1 @@
+usr/lib/*/libplasma.so.*
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/patches/series b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/patches/series
new file mode 100644
index 000000000..e69de29bb
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/patches/series
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/plasma-store-server.install b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/plasma-store-server.install
new file mode 100644
index 000000000..bd13b0e81
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/plasma-store-server.install
@@ -0,0 +1 @@
+usr/bin/plasma-store-server
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/rules b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/rules
new file mode 100755
index 000000000..2de533615
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/rules
@@ -0,0 +1,104 @@
+#!/usr/bin/make -f
+# -*- makefile-gmake -*-
+#
+# Uncomment this to turn on verbose mode.
+#export DH_VERBOSE=1
+# This has to be exported to make some magic below work.
+export DH_OPTIONS
+
+export DEB_BUILD_MAINT_OPTIONS=reproducible=-timeless
+
+BUILD_TYPE=release
+
+%:
+	dh $@ --with gir
+
+override_dh_auto_configure:
+	if dpkg -l nvidia-cuda-toolkit > /dev/null 2>&1; then	\
+	  ARROW_CUDA=ON;					\
+	  ARROW_PLASMA=ON;					\
+	else							\
+	  ARROW_CUDA=OFF;					\
+	  ARROW_PLASMA=OFF;					\
+	fi;							\
+	dh_auto_configure					\
+	  --sourcedirectory=cpp					\
+	  --builddirectory=cpp_build				\
+	  --buildsystem=cmake+ninja				\
+	  --							\
+	  -DARROW_CUDA=$${ARROW_CUDA}				\
+	  -DARROW_FLIGHT=ON					\
+	  -DARROW_GANDIVA=ON					\
+	  -DARROW_GANDIVA_JAVA=OFF				\
+	  -DARROW_MIMALLOC=ON					\
+	  -DARROW_ORC=ON					\
+	  -DARROW_PACKAGE_KIND=deb				\
+	  -DARROW_PARQUET=ON					\
+	  -DARROW_PLASMA=$${ARROW_PLASMA}			\
+	  -DARROW_PYTHON=ON					\
+	  -DARROW_S3=ON						\
+	  -DARROW_USE_CCACHE=OFF				\
+	  -DARROW_WITH_BROTLI=ON				\
+	  -DARROW_WITH_BZ2=ON					\
+	  -DARROW_WITH_LZ4=ON					\
+	  -DARROW_WITH_SNAPPY=ON				\
+	  -DARROW_WITH_ZLIB=ON					\
+	  -DARROW_WITH_ZSTD=ON					\
+	  -DCMAKE_BUILD_TYPE=$(BUILD_TYPE)			\
+	  -DCMAKE_UNITY_BUILD=ON				\
+	  -DPARQUET_REQUIRE_ENCRYPTION=ON			\
+	  -DPythonInterp_FIND_VERSION=ON			\
+	  -DPythonInterp_FIND_VERSION_MAJOR=3
+
+override_dh_auto_build:
+	dh_auto_build				\
+	  --sourcedirectory=cpp			\
+	  --builddirectory=cpp_build
+	dh_auto_configure				\
+	  --sourcedirectory=c_glib			\
+	  --builddirectory=c_glib_build			\
+	  --buildsystem=meson+ninja			\
+	  --						\
+	  -Darrow_cpp_build_type=$(BUILD_TYPE)		\
+	  -Darrow_cpp_build_dir=../cpp_build		\
+	  -Dgtk_doc=true
+	env							\
+	  LD_LIBRARY_PATH=$(CURDIR)/cpp_build/$(BUILD_TYPE)	\
+	    dh_auto_build					\
+	      --sourcedirectory=c_glib				\
+	      --builddirectory=c_glib_build			\
+	      --buildsystem=meson+ninja
+
+override_dh_auto_install:
+	dh_auto_install				\
+	  --sourcedirectory=c_glib		\
+	  --builddirectory=c_glib_build		\
+	  --buildsystem=meson+ninja
+	# Remove built files to reduce disk usage
+	dh_auto_clean				\
+	  --sourcedirectory=c_glib		\
+	  --builddirectory=c_glib_build		\
+	  --buildsystem=meson+ninja
+
+	dh_auto_install				\
+	  --sourcedirectory=cpp			\
+	  --builddirectory=cpp_build
+	# Remove built files to reduce disk usage
+	dh_auto_clean				\
+	  --sourcedirectory=cpp			\
+	  --builddirectory=cpp_build
+
+override_dh_auto_test:
+	# TODO: We need Boost 1.64 or later to build tests for
+	# Apache Arrow Flight.
+	# git clone --depth 1 https://github.com/apache/arrow-testing.git
+	# git clone --depth 1 https://github.com/apache/parquet-testing.git
+	# cd cpp_build &&								\
+	#   env									\
+	#     ARROW_TEST_DATA=$(CURDIR)/arrow-testing/data			\
+	#     PARQUET_TEST_DATA=$(CURDIR)/parquet-testing/data			\
+	#       ctest --exclude-regex 'arrow-cuda-test|plasma-client_tests'
+
+# skip file failing with "Unknown DWARF DW_OP_255" (see bug#949296)
+override_dh_dwz:
+	dh_dwz --exclude=libgandiva.so
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/source/format b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/source/format
new file mode 100644
index 000000000..163aaf8d8
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/source/format
@@ -0,0 +1 @@
+3.0 (quilt)
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/watch b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/watch
new file mode 100644
index 000000000..5cb3f0091
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/debian/watch
@@ -0,0 +1,2 @@
+version=3
+https://dist.apache.org/repos/dist/release/arrow/arrow-(.+)/apache-arrow-(.+).tar.gz
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/yum/almalinux-8-aarch64/from b/src/arrow/dev/tasks/linux-packages/apache-arrow/yum/almalinux-8-aarch64/from
new file mode 100644
index 000000000..b570587e0
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/yum/almalinux-8-aarch64/from
@@ -0,0 +1,18 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+arm64v8/almalinux:8
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/yum/almalinux-8/Dockerfile b/src/arrow/dev/tasks/linux-packages/apache-arrow/yum/almalinux-8/Dockerfile
new file mode 100644
index 000000000..003b26747
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/yum/almalinux-8/Dockerfile
@@ -0,0 +1,64 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+ARG FROM=almalinux:8
+FROM ${FROM}
+
+ARG DEBUG
+
+RUN \
+  quiet=$([ "${DEBUG}" = "yes" ] || echo "--quiet") && \
+  dnf install -y ${quiet} epel-release && \
+  dnf install --enablerepo=powertools -y ${quiet} \
+    bison \
+    boost-devel \
+    brotli-devel \
+    bzip2-devel \
+    c-ares-devel \
+    ccache \
+    clang \
+    cmake \
+    curl-devel \
+    flex \
+    gcc-c++ \
+    gflags-devel \
+    git \
+    glog-devel \
+    gobject-introspection-devel \
+    gtk-doc \
+    libarchive \
+    libzstd-devel \
+    llvm-devel \
+    llvm-static \
+    lz4-devel \
+    make \
+    ncurses-devel \
+    ninja-build \
+    openssl-devel \
+    pkg-config \
+    python3 \
+    python3-devel \
+    python3-numpy \
+    python3-pip \
+    re2-devel \
+    # rapidjson-devel \
+    rpmdevtools \
+    snappy-devel \
+    tar \
+    # utf8proc-devel \
+    zlib-devel && \
+  dnf clean ${quiet} all
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/yum/amazon-linux-2/Dockerfile b/src/arrow/dev/tasks/linux-packages/apache-arrow/yum/amazon-linux-2/Dockerfile
new file mode 100644
index 000000000..6ada89729
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/yum/amazon-linux-2/Dockerfile
@@ -0,0 +1,55 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+ARG FROM=amazonlinux:2
+FROM ${FROM}
+
+COPY qemu-* /usr/bin/
+
+ARG DEBUG
+
+RUN \
+  quiet=$([ "${DEBUG}" = "yes" ] || echo "--quiet") && \
+  yum update -y ${quiet} && \
+  amazon-linux-extras install -y epel && \
+  yum install -y ${quiet} \
+    bison \
+    brotli-devel \
+    bzip2-devel \
+    ccache \
+    cmake3 \
+    flex \
+    gcc-c++ \
+    git \
+    glog-devel \
+    gobject-introspection-devel \
+    gtk-doc \
+    lz4-devel \
+    make \
+    openssl-devel \
+    pkg-config \
+    rapidjson-devel \
+    rpmdevtools \
+    snappy-devel \
+    tar \
+    utf8proc-devel \
+    zlib-devel && \
+  # Install ninja-build dependencies in amzn2-core
+  yum install -y ${quiet} ninja-build && \
+  # Install ninja-build from EPEL because ninja-build in amzn2-core is old.
+  yum install -y ${quiet} --disablerepo=amzn2-core ninja-build && \
+  yum clean ${quiet} all
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/yum/amazon-linux-2/qemu-dummy-static b/src/arrow/dev/tasks/linux-packages/apache-arrow/yum/amazon-linux-2/qemu-dummy-static
new file mode 100755
index 000000000..279d89545
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/yum/amazon-linux-2/qemu-dummy-static
@@ -0,0 +1,33 @@
+#!/usr/bin/env sh
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+# Do nothing. This exists only for not requiring qemu-aarch64-static copy.
+# Recent Debian (buster or later) and Ubuntu (18.10 or later) on amd64 hosts or
+# arm64 host don't require qemu-aarch64-static in Docker image. But old Debian
+# and Ubuntu hosts on amd64 require qemu-aarch64-static in Docker image.
+#
+# We use "COPY qemu* /usr/bin/" in Dockerfile. If we don't put any "qemnu*",
+# the "COPY" is failed. It means that we always require "qemu*" even if we
+# use recent Debian/Ubuntu or arm64 host. If we have this dummy "qemu*" file,
+# the "COPY" isn't failed. It means that we can copy "qemu*" only when we
+# need.
+#
+# See also "script" in dev/tasks/linux-packages/azure.linux.arm64.yml.
+# Azure Pipelines uses old Ubuntu (18.04).
+# So we need to put "qemu-aarch64-static" into this directory.
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/yum/arrow.spec.in b/src/arrow/dev/tasks/linux-packages/apache-arrow/yum/arrow.spec.in
new file mode 100644
index 000000000..3a8f71ecc
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/yum/arrow.spec.in
@@ -0,0 +1,892 @@
+# -*- sh-shell: rpm -*-
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+%define _amzn %{?amzn:%{amzn}}%{!?amzn:0}
+%define is_amazon_linux (%{_amzn} != 0)
+
+%define boost_version %( \
+  if [ %{rhel} -eq 7 ]; then \
+    echo 169; \
+  fi)
+%define cmake_version %( \
+  if [ %{rhel} -lt 8 ]; then \
+    echo 3; \
+  fi)
+%define python_version %( \
+  if [ %{rhel} -eq 7 ]; then \
+    echo 36; \
+  else \
+    echo 3; \
+  fi)
+
+%define lz4_requirement %( \
+  if [ %{_amzn} -eq 0 ]; then \
+    echo ">= 1.8.0"; \
+  fi)
+
+%define use_boost (!%{is_amazon_linux})
+%define use_flight (%{rhel} >= 8)
+%define use_gandiva (%{rhel} >= 8 && %{_arch} != "aarch64")
+%define use_gflags (!%{is_amazon_linux})
+%define use_mimalloc (%{rhel} >= 8)
+%define use_python (!%{is_amazon_linux})
+# TODO: Enable this. This works on local but is fragile on GitHub Actions and
+# Travis CI.
+# %define use_s3 (%{rhel} >= 8)
+%define use_s3 0
+
+%define have_rapidjson (%{rhel} == 7)
+%define have_re2 (%{rhel} >= 8)
+# EPEL ships utf8proc but it's old.
+# %define have_utf8proc (%{rhel} == 7)
+%define have_utf8proc 0
+%define have_zstd (!%{is_amazon_linux})
+
+Name:		@PACKAGE@
+Version:	@VERSION@
+Release:	@RELEASE@%{?dist}
+Summary:	Apache Arrow is a data processing library for analysis
+
+License:	Apache-2.0
+URL:		https://arrow.apache.org/
+Source0:	https://dist.apache.org/repos/dist/release/@PACKAGE@/@PACKAGE@-%{version}/apache-@PACKAGE@-%{version}.tar.gz
+
+BuildRequires:	bison
+%if %{use_boost}
+BuildRequires:	boost%{boost_version}-devel
+%endif
+BuildRequires:	brotli-devel
+BuildRequires:	bzip2-devel
+%if %{use_flight}
+BuildRequires:	c-ares-devel
+%endif
+BuildRequires:	cmake%{cmake_version}
+%if %{use_s3}
+BuildRequires:	curl-devel
+%endif
+BuildRequires:	flex
+BuildRequires:	gcc-c++
+%if %{use_gflags}
+BuildRequires:	gflags-devel
+%endif
+BuildRequires:	git
+BuildRequires:	glog-devel
+%if %{have_zstd}
+BuildRequires:	libzstd-devel
+%endif
+BuildRequires:	lz4-devel %{lz4_requirement}
+BuildRequires:	ninja-build
+BuildRequires:	openssl-devel
+BuildRequires:	pkgconfig
+%if %{use_python}
+BuildRequires:	python%{python_version}-devel
+BuildRequires:	python%{python_version}-numpy
+%endif
+%if %{have_rapidjson}
+BuildRequires:	rapidjson-devel
+%endif
+%if %{have_re2}
+BuildRequires:	re2-devel
+%endif
+BuildRequires:	snappy-devel
+%if %{have_utf8proc}
+BuildRequires:	utf8proc-devel
+%endif
+BuildRequires:	zlib-devel
+
+%if %{use_gandiva}
+BuildRequires:	llvm-devel
+BuildRequires:	ncurses-devel
+%endif
+
+BuildRequires:	gobject-introspection-devel
+BuildRequires:	gtk-doc
+
+%description
+Apache Arrow is a data processing library for analysis.
+
+%prep
+%setup -q -n apache-@PACKAGE@-%{version}
+
+%build
+cpp_build_type=release
+mkdir cpp/build
+cd cpp/build
+%cmake3 .. \
+  -DARROW_CSV=ON \
+  -DARROW_DATASET=ON \
+%if %{use_flight}
+  -DARROW_FLIGHT=ON \
+%endif
+%if %{use_gandiva}
+  -DARROW_GANDIVA=ON \
+%endif
+  -DARROW_HDFS=ON \
+  -DARROW_JSON=ON \
+%if %{use_mimalloc}
+  -DARROW_MIMALLOC=ON \
+%endif
+  -DARROW_ORC=ON \
+  -DARROW_PACKAGE_KIND=rpm \
+  -DARROW_PARQUET=ON \
+  -DARROW_PLASMA=ON \
+%if %{use_python}
+  -DARROW_PYTHON=ON \
+%endif
+%if %{use_s3}
+  -DARROW_S3=ON \
+%endif
+  -DARROW_WITH_BROTLI=ON \
+  -DARROW_WITH_BZ2=ON \
+  -DARROW_WITH_LZ4=ON \
+  -DARROW_WITH_SNAPPY=ON \
+  -DARROW_WITH_ZLIB=ON \
+  -DARROW_WITH_ZSTD=ON \
+  -DCMAKE_BUILD_TYPE=$cpp_build_type \
+  -DARROW_USE_CCACHE=OFF \
+  -DPARQUET_REQUIRE_ENCRYPTION=ON \
+%if %{use_python}
+  -DPythonInterp_FIND_VERSION=ON \
+  -DPythonInterp_FIND_VERSION_MAJOR=3 \
+%endif
+  -GNinja
+
+ninja %{?_smp_mflags}
+cd -
+
+cd c_glib
+pip3 install meson
+meson setup build \
+  --default-library=both \
+  --libdir=%{_libdir} \
+  --prefix=%{_prefix} \
+  -Darrow_cpp_build_dir=../cpp/build \
+  -Darrow_cpp_build_type=$cpp_build_type \
+  -Dgtk_doc=true
+LD_LIBRARY_PATH=$PWD/../cpp/build/$cpp_build_type \
+  ninja -C build %{?_smp_mflags}
+cd -
+
+%install
+cpp_build_type=release
+
+cd c_glib
+DESTDIR=$RPM_BUILD_ROOT ninja -C build install
+ninja -C build clean
+cd -
+
+cd cpp/build
+DESTDIR=$RPM_BUILD_ROOT ninja install
+ninja clean
+cd -
+
+%package libs
+Summary:	Runtime libraries for Apache Arrow C++
+License:	Apache-2.0
+Requires:	brotli
+%if %{use_gflags}
+Requires:	gflags
+%endif
+Requires:	glog
+%if %{have_zstd}
+Requires:	libzstd
+%endif
+Requires:	lz4 %{lz4_requirement}
+%if %{have_re2}
+Requires:	re2
+%endif
+Requires:	snappy
+%if %{have_utf8proc}
+Requires:	utf8proc
+%endif
+Requires:	zlib
+
+%description libs
+This package contains the libraries for Apache Arrow C++.
+
+%files libs
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_docdir}/arrow/
+%{_libdir}/libarrow.so.*
+
+%package devel
+Summary:	Libraries and header files for Apache Arrow C++
+License:	Apache-2.0
+Requires:	%{name}-libs = %{version}-%{release}
+Requires:	brotli-devel
+Requires:	bzip2-devel
+%if %{use_flight}
+Requires:	c-ares-devel
+%endif
+%if %{have_zstd}
+Requires:	libzstd-devel
+%endif
+Requires:	lz4-devel %{lz4_requirement}
+Requires:	openssl-devel
+%if %{have_rapidjson}
+Requires:	rapidjson-devel
+%endif
+%if %{have_re2}
+Requires:	re2-devel
+%endif
+Requires:	snappy-devel
+%if %{have_utf8proc}
+Requires:	utf8proc-devel
+%endif
+Requires:	zlib-devel
+
+%description devel
+Libraries and header files for Apache Arrow C++.
+
+%files devel
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_includedir}/arrow/
+%exclude %{_includedir}/arrow/dataset/
+%if %{use_flight}
+%exclude %{_includedir}/arrow/flight/
+%endif
+%exclude %{_includedir}/arrow/python/
+%{_libdir}/cmake/arrow/ArrowConfig*.cmake
+%{_libdir}/cmake/arrow/ArrowOptions.cmake
+%{_libdir}/cmake/arrow/ArrowTargets*.cmake
+%{_libdir}/cmake/arrow/FindArrow.cmake
+%{_libdir}/cmake/arrow/FindBrotli.cmake
+%{_libdir}/cmake/arrow/FindLz4.cmake
+%{_libdir}/cmake/arrow/FindSnappy.cmake
+%if %{use_flight}
+%{_libdir}/cmake/arrow/Findc-aresAlt.cmake
+%endif
+%if %{have_re2}
+%{_libdir}/cmake/arrow/Findre2Alt.cmake
+%endif
+%if %{have_utf8proc}
+%{_libdir}/cmake/arrow/Findutf8proc.cmake
+%endif
+%if %{have_zstd}
+%{_libdir}/cmake/arrow/Findzstd.cmake
+%endif
+%{_libdir}/cmake/arrow/arrow-config.cmake
+%{_libdir}/libarrow.a
+%{_libdir}/libarrow.so
+%{_libdir}/libarrow_bundled_dependencies.a
+%{_libdir}/pkgconfig/arrow-compute.pc
+%{_libdir}/pkgconfig/arrow-csv.pc
+%{_libdir}/pkgconfig/arrow-filesystem.pc
+%{_libdir}/pkgconfig/arrow-json.pc
+%{_libdir}/pkgconfig/arrow-orc.pc
+%{_libdir}/pkgconfig/arrow.pc
+
+%package dataset-libs
+Summary:	C++ library to read and write semantic datasets stored in different locations and formats
+License:	Apache-2.0
+Requires:	%{name}-libs = %{version}-%{release}
+
+%description dataset-libs
+This package contains the libraries for Apache Arrow dataset.
+
+%files dataset-libs
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_libdir}/libarrow_dataset.so.*
+
+%package dataset-devel
+Summary:	Libraries and header files for Apache Arrow dataset.
+License:	Apache-2.0
+Requires:	%{name}-dataset-libs = %{version}-%{release}
+
+%description dataset-devel
+Libraries and header files for Apache Arrow dataset.
+
+%files dataset-devel
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_includedir}/arrow/dataset/
+%{_libdir}/cmake/arrow/ArrowDatasetConfig*.cmake
+%{_libdir}/cmake/arrow/ArrowDatasetTargets*.cmake
+%{_libdir}/cmake/arrow/FindArrowDataset.cmake
+%{_libdir}/libarrow_dataset.a
+%{_libdir}/libarrow_dataset.so
+%{_libdir}/pkgconfig/arrow-dataset.pc
+
+%if %{use_flight}
+%package flight-libs
+Summary:	C++ library for fast data transport.
+License:	Apache-2.0
+Requires:	%{name}-libs = %{version}-%{release}
+%if %{use_flight}
+Requires:	c-ares
+%endif
+Requires:	openssl
+
+%description flight-libs
+This package contains the libraries for Apache Arrow Flight.
+
+%files flight-libs
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_libdir}/libarrow_flight.so.*
+
+%package flight-devel
+Summary:	Libraries and header files for Apache Arrow Flight.
+License:	Apache-2.0
+Requires:	%{name}-flight-libs = %{version}-%{release}
+
+%description flight-devel
+Libraries and header files for Apache Arrow Flight.
+
+%files flight-devel
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_includedir}/arrow/flight/
+%{_libdir}/cmake/arrow/ArrowFlightConfig*.cmake
+%{_libdir}/cmake/arrow/ArrowFlightTargets*.cmake
+%{_libdir}/cmake/arrow/FindArrowFlight.cmake
+%{_libdir}/libarrow_flight.a
+%{_libdir}/libarrow_flight.so
+%{_libdir}/pkgconfig/arrow-flight.pc
+%endif
+
+%if %{use_gandiva}
+%package -n gandiva-libs
+Summary:	C++ library for compiling and evaluating expressions on Apache Arrow data.
+License:	Apache-2.0
+Requires:	%{name}-libs = %{version}-%{release}
+Requires:	ncurses-libs
+
+%description -n gandiva-libs
+This package contains the libraries for Gandiva.
+
+%files -n gandiva-libs
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_libdir}/libgandiva.so.*
+
+%package -n gandiva-devel
+Summary:	Libraries and header files for Gandiva.
+License:	Apache-2.0
+Requires:	gandiva-libs = %{version}-%{release}
+Requires:	llvm-devel
+
+%description -n gandiva-devel
+Libraries and header files for Gandiva.
+
+%files -n gandiva-devel
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_includedir}/gandiva/
+%{_libdir}/cmake/arrow/GandivaConfig*.cmake
+%{_libdir}/cmake/arrow/GandivaTargets*.cmake
+%{_libdir}/cmake/arrow/FindGandiva.cmake
+%{_libdir}/libgandiva.a
+%{_libdir}/libgandiva.so
+%{_libdir}/pkgconfig/gandiva.pc
+%endif
+
+%if %{use_python}
+%package python-libs
+Summary:	Python integration library for Apache Arrow
+License:	Apache-2.0
+Requires:	%{name}-libs = %{version}-%{release}
+Requires:	python%{python_version}-numpy
+
+%description python-libs
+This package contains the Python integration library for Apache Arrow.
+
+%files python-libs
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_libdir}/libarrow_python.so.*
+
+%package python-devel
+Summary:	Libraries and header files for Python integration library for Apache Arrow
+License:	Apache-2.0
+Requires:	%{name}-devel = %{version}-%{release}
+Requires:	%{name}-libs = %{version}-%{release}
+Requires:	python%{python_version}-devel
+
+%description python-devel
+Libraries and header files for Python integration library for Apache Arrow.
+
+%files python-devel
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_includedir}/arrow/python/
+%exclude %{_includedir}/arrow/python/flight.h
+%{_libdir}/cmake/arrow/ArrowPythonConfig*.cmake
+%{_libdir}/cmake/arrow/ArrowPythonTargets*.cmake
+%{_libdir}/cmake/arrow/FindArrowPython.cmake
+%{_libdir}/libarrow_python.a
+%{_libdir}/libarrow_python.so
+%{_libdir}/pkgconfig/arrow-python.pc
+
+%if %{use_flight}
+%package python-flight-libs
+Summary:	Python integration library for Apache Arrow Flight
+License:	Apache-2.0
+Requires:	%{name}-flight-libs = %{version}-%{release}
+Requires:	%{name}-python-libs = %{version}-%{release}
+
+%description python-flight-libs
+This package contains the Python integration library for Apache Arrow Flight.
+
+%files python-flight-libs
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_libdir}/libarrow_python_flight.so.*
+
+%package python-flight-devel
+Summary:	Libraries and header files for Python integration library for Apache Arrow Flight.
+License:	Apache-2.0
+Requires:	%{name}-flight-devel = %{version}-%{release}
+Requires:	%{name}-python-devel = %{version}-%{release}
+Requires:	%{name}-python-flight-libs = %{version}-%{release}
+
+%description python-flight-devel
+Libraries and header files for Python integration library for
+Apache Arrow Flight.
+
+%files python-flight-devel
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_includedir}/arrow/python/flight.h
+%{_libdir}/cmake/arrow/ArrowPythonFlightConfig*.cmake
+%{_libdir}/cmake/arrow/ArrowPythonFlightTargets*.cmake
+%{_libdir}/cmake/arrow/FindArrowPythonFlight.cmake
+%{_libdir}/libarrow_python_flight.a
+%{_libdir}/libarrow_python_flight.so
+%{_libdir}/pkgconfig/arrow-python-flight.pc
+%endif
+%endif
+
+%package -n plasma-libs
+Summary:	Runtime libraries for Plasma in-memory object store
+License:	Apache-2.0
+Requires:	%{name}-libs = %{version}-%{release}
+
+%description -n plasma-libs
+This package contains the libraries for Plasma in-memory object store.
+
+%files -n plasma-libs
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_libdir}/libplasma.so.*
+
+%package -n plasma-store-server
+Summary:	Server for Plasma in-memory object store
+License:	Apache-2.0
+Requires:	plasma-libs = %{version}-%{release}
+
+%description -n plasma-store-server
+This package contains the server for Plasma in-memory object store.
+
+%files -n plasma-store-server
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_bindir}/plasma-store-server
+
+%package -n plasma-devel
+Summary:	Libraries and header files for Plasma in-memory object store
+License:	Apache-2.0
+Requires:	plasma-libs = %{version}-%{release}
+
+%description -n plasma-devel
+Libraries and header files for Plasma in-memory object store.
+
+%files -n plasma-devel
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_includedir}/plasma/
+%{_libdir}/cmake/arrow/PlasmaConfig*.cmake
+%{_libdir}/cmake/arrow/PlasmaTargets*.cmake
+%{_libdir}/cmake/arrow/FindPlasma.cmake
+%{_libdir}/libplasma.a
+%{_libdir}/libplasma.so
+%{_libdir}/pkgconfig/plasma*.pc
+
+%package -n parquet-libs
+Summary:	Runtime libraries for Apache Parquet C++
+License:	Apache-2.0
+Requires:	%{name}-libs = %{version}-%{release}
+Requires:	openssl
+
+%description -n parquet-libs
+This package contains the libraries for Apache Parquet C++.
+
+%files -n parquet-libs
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_libdir}/libparquet.so.*
+
+%package -n parquet-devel
+Summary:	Libraries and header files for Apache Parquet C++
+License:	Apache-2.0
+Requires:	parquet-libs = %{version}-%{release}
+Requires:	zlib-devel
+
+%description -n parquet-devel
+Libraries and header files for Apache Parquet C++.
+
+%files -n parquet-devel
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_includedir}/parquet/
+%{_libdir}/cmake/arrow/ParquetConfig*.cmake
+%{_libdir}/cmake/arrow/ParquetTargets*.cmake
+%{_libdir}/cmake/arrow/FindParquet.cmake
+%{_libdir}/libparquet.a
+%{_libdir}/libparquet.so
+%{_libdir}/pkgconfig/parquet*.pc
+
+%package glib-libs
+Summary:	Runtime libraries for Apache Arrow GLib
+License:	Apache-2.0
+Requires:	%{name}-libs = %{version}-%{release}
+Requires:	glib2
+
+%description glib-libs
+This package contains the libraries for Apache Arrow GLib.
+
+%files glib-libs
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_libdir}/libarrow-glib.so.*
+%{_datadir}/gir-1.0/Arrow-1.0.gir
+
+%package glib-devel
+Summary:	Libraries and header files for Apache Arrow GLib
+License:	Apache-2.0
+Requires:	%{name}-devel = %{version}-%{release}
+Requires:	glib2-devel
+Requires:	gobject-introspection-devel
+
+%description glib-devel
+Libraries and header files for Apache Arrow GLib.
+
+%files glib-devel
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_includedir}/arrow-glib/
+%{_libdir}/libarrow-glib.a
+%{_libdir}/libarrow-glib.so
+%{_libdir}/pkgconfig/arrow-glib.pc
+%{_libdir}/pkgconfig/arrow-orc-glib.pc
+%{_libdir}/girepository-1.0/Arrow-1.0.typelib
+%{_datadir}/arrow-glib/example/
+
+%package glib-doc
+Summary:	Documentation for Apache Arrow GLib
+License:	Apache-2.0
+
+%description glib-doc
+Documentation for Apache Arrow GLib.
+
+%files glib-doc
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_docdir}/arrow-glib/
+%{_datadir}/gtk-doc/html/arrow-glib/
+
+%package dataset-glib-libs
+Summary:	Runtime libraries for Apache Arrow Dataset GLib
+License:	Apache-2.0
+Requires:	%{name}-dataset-libs = %{version}-%{release}
+Requires:	%{name}-glib-libs = %{version}-%{release}
+
+%description dataset-glib-libs
+This package contains the libraries for Apache Arrow Dataset GLib.
+
+%files dataset-glib-libs
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_libdir}/libarrow-dataset-glib.so.*
+%{_datadir}/gir-1.0/ArrowDataset-1.0.gir
+
+%package dataset-glib-devel
+Summary:	Libraries and header files for Apache Arrow Dataset GLib
+License:	Apache-2.0
+Requires:	%{name}-dataset-devel = %{version}-%{release}
+Requires:	%{name}-glib-devel = %{version}-%{release}
+
+%description dataset-glib-devel
+Libraries and header files for Apache Arrow Dataset GLib.
+
+%files dataset-glib-devel
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_includedir}/arrow-dataset-glib/
+%{_libdir}/libarrow-dataset-glib.a
+%{_libdir}/libarrow-dataset-glib.so
+%{_libdir}/pkgconfig/arrow-dataset-glib.pc
+%{_libdir}/girepository-1.0/ArrowDataset-1.0.typelib
+
+%package dataset-glib-doc
+Summary:	Documentation for Apache Arrow Dataset GLib
+License:	Apache-2.0
+
+%description dataset-glib-doc
+Documentation for Apache Arrow dataset GLib.
+
+%files dataset-glib-doc
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_datadir}/gtk-doc/html/arrow-dataset-glib/
+
+%if %{use_flight}
+%package flight-glib-libs
+Summary:	Runtime libraries for Apache Arrow Flight GLib
+License:	Apache-2.0
+Requires:	%{name}-flight-libs = %{version}-%{release}
+Requires:	%{name}-glib-libs = %{version}-%{release}
+
+%description flight-glib-libs
+This package contains the libraries for Apache Arrow Flight GLib.
+
+%files flight-glib-libs
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_libdir}/libarrow-flight-glib.so.*
+%{_datadir}/gir-1.0/ArrowFlight-1.0.gir
+
+%package flight-glib-devel
+Summary:	Libraries and header files for Apache Arrow Flight GLib
+License:	Apache-2.0
+Requires:	%{name}-flight-devel = %{version}-%{release}
+Requires:	%{name}-glib-devel = %{version}-%{release}
+
+%description flight-glib-devel
+Libraries and header files for Apache Arrow Flight GLib.
+
+%files flight-glib-devel
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_includedir}/arrow-flight-glib/
+%{_libdir}/libarrow-flight-glib.a
+%{_libdir}/libarrow-flight-glib.so
+%{_libdir}/pkgconfig/arrow-flight-glib.pc
+%{_libdir}/girepository-1.0/ArrowFlight-1.0.typelib
+
+%package flight-glib-doc
+Summary:	Documentation for Apache Arrow Flight GLib
+License:	Apache-2.0
+
+%description flight-glib-doc
+Documentation for Apache Arrow Flight GLib.
+
+%files flight-glib-doc
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_datadir}/gtk-doc/html/arrow-flight-glib/
+%endif
+
+%if %{use_gandiva}
+%package -n gandiva-glib-libs
+Summary:	Runtime libraries for Gandiva GLib
+License:	Apache-2.0
+Requires:	gandiva-libs = %{version}-%{release}
+Requires:	%{name}-glib-libs = %{version}-%{release}
+
+%description -n gandiva-glib-libs
+This package contains the libraries for Gandiva GLib.
+
+%files -n gandiva-glib-libs
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_libdir}/libgandiva-glib.so.*
+%{_datadir}/gir-1.0/Gandiva-1.0.gir
+
+%package -n gandiva-glib-devel
+Summary:	Libraries and header files for Gandiva GLib
+License:	Apache-2.0
+Requires:	gandiva-devel = %{version}-%{release}
+Requires:	%{name}-glib-devel = %{version}-%{release}
+
+%description -n gandiva-glib-devel
+Libraries and header files for Gandiva GLib.
+
+%files -n gandiva-glib-devel
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_includedir}/gandiva-glib/
+%{_libdir}/libgandiva-glib.a
+%{_libdir}/libgandiva-glib.so
+%{_libdir}/pkgconfig/gandiva-glib.pc
+%{_libdir}/girepository-1.0/Gandiva-1.0.typelib
+
+%package -n gandiva-glib-doc
+Summary:	Documentation for Gandiva GLib
+License:	Apache-2.0
+
+%description -n gandiva-glib-doc
+Documentation for Gandiva GLib.
+
+%files -n gandiva-glib-doc
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_datadir}/gtk-doc/html/gandiva-glib/
+%endif
+
+%package -n plasma-glib-libs
+Summary:	Runtime libraries for Plasma GLib
+License:	Apache-2.0
+Requires:	plasma-libs = %{version}-%{release}
+Requires:	%{name}-glib-libs = %{version}-%{release}
+
+%description -n plasma-glib-libs
+This package contains the libraries for Plasma GLib.
+
+%files -n plasma-glib-libs
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_libdir}/libplasma-glib.so.*
+%{_datadir}/gir-1.0/Plasma-1.0.gir
+
+%package -n plasma-glib-devel
+Summary:	Libraries and header files for Plasma GLib
+License:	Apache-2.0
+Requires:	plasma-devel = %{version}-%{release}
+Requires:	%{name}-glib-devel = %{version}-%{release}
+
+%description -n plasma-glib-devel
+Libraries and header files for Plasma GLib.
+
+%files -n plasma-glib-devel
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_includedir}/plasma-glib/
+%{_libdir}/libplasma-glib.a
+%{_libdir}/libplasma-glib.so
+%{_libdir}/pkgconfig/plasma-glib.pc
+%{_libdir}/girepository-1.0/Plasma-1.0.typelib
+
+%package -n plasma-glib-doc
+Summary:	Documentation for Plasma GLib
+License:	Apache-2.0
+
+%description -n plasma-glib-doc
+Documentation for Plasma GLib.
+
+%files -n plasma-glib-doc
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_datadir}/gtk-doc/html/plasma-glib/
+
+%package -n parquet-glib-libs
+Summary:	Runtime libraries for Apache Parquet GLib
+License:	Apache-2.0
+Requires:	parquet-libs = %{version}-%{release}
+Requires:	%{name}-glib-libs = %{version}-%{release}
+
+%description -n parquet-glib-libs
+This package contains the libraries for Apache Parquet GLib.
+
+%files -n parquet-glib-libs
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_libdir}/libparquet-glib.so.*
+%{_datadir}/gir-1.0/Parquet-1.0.gir
+
+%package -n parquet-glib-devel
+Summary:	Libraries and header files for Apache Parquet GLib
+License:	Apache-2.0
+Requires:	parquet-devel = %{version}-%{release}
+Requires:	%{name}-glib-devel = %{version}-%{release}
+
+%description -n parquet-glib-devel
+Libraries and header files for Apache Parquet GLib.
+
+%files -n parquet-glib-devel
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_includedir}/parquet-glib/
+%{_libdir}/libparquet-glib.a
+%{_libdir}/libparquet-glib.so
+%{_libdir}/pkgconfig/parquet-glib.pc
+%{_libdir}/girepository-1.0/Parquet-1.0.typelib
+
+%package -n parquet-glib-doc
+Summary:	Documentation for Apache Parquet GLib
+License:	Apache-2.0
+
+%description -n parquet-glib-doc
+Documentation for Apache Parquet GLib.
+
+%files -n parquet-glib-doc
+%defattr(-,root,root,-)
+%doc README.md LICENSE.txt NOTICE.txt
+%{_datadir}/gtk-doc/html/parquet-glib/
+
+%changelog
+* Wed Nov 10 2021 Sutou Kouhei <kou@clear-code.com> - 6.0.1-1
+- New upstream release.
+
+* Thu Oct 21 2021 Krisztián Szűcs <szucs.krisztian@gmail.com> - 6.0.0-1
+- New upstream release.
+
+* Mon Jan 18 2021 Krisztián Szűcs <szucs.krisztian@gmail.com> - 3.0.0-1
+- New upstream release.
+
+* Mon Oct 12 2020 Krisztián Szűcs <szucs.krisztian@gmail.com> - 2.0.0-1
+- New upstream release.
+
+* Mon Jul 20 2020 Krisztián Szűcs <szucs.krisztian@gmail.com> - 1.0.0-1
+- New upstream release.
+
+* Thu Apr 16 2020 Krisztián Szűcs <szucs.krisztian@gmail.com> - 0.17.0-1
+- New upstream release.
+
+* Thu Jan 30 2020 Krisztián Szűcs <szucs.krisztian@gmail.com> - 0.16.0-1
+- New upstream release.
+
+* Mon Sep 30 2019 Krisztián Szűcs <szucs.krisztian@gmail.com> - 0.15.0-1
+- New upstream release.
+
+* Fri Jun 28 2019 Sutou Kouhei <kou@clear-code.com> - 0.14.0-1
+- New upstream release.
+
+* Thu Mar 28 2019 Kouhei Sutou <kou@clear-code.com> - 0.13.0-1
+- New upstream release.
+
+* Wed Jan 16 2019 Krisztián Szűcs <szucs.krisztian@gmail.com> - 0.12.0-1
+- New upstream release.
+
+* Thu Oct 04 2018 Kouhei Sutou <kou@clear-code.com> - 0.11.0-1
+- New upstream release.
+
+* Thu Aug 02 2018 Phillip Cloud <cpcloud@gmail.com> - 0.10.0-1
+- New upstream release.
+
+* Fri Mar 16 2018 Kouhei Sutou <kou@clear-code.com> - 0.9.0-1
+- New upstream release.
+
+* Sun Dec 17 2017 Uwe Korn <uwelk@xhochy.com> - 0.8.0-1
+- New upstream release.
+
+* Wed Sep 27 2017 Kouhei Sutou <kou@clear-code.com> - 0.7.1-1
+- New upstream release.
+
+* Tue Sep 12 2017 Wes McKinney <wes.mckinney@twosigma.com> - 0.7.0-1
+- New upstream release.
+
+* Fri Aug 11 2017 Kouhei Sutou <kou@clear-code.com> - 0.6.0-1
+- New upstream release.
+
+* Wed Aug 02 2017 Kouhei Sutou <kou@clear-code.com> - 0.6.0.20170802-1
+- New upstream release.
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/yum/centos-7/Dockerfile b/src/arrow/dev/tasks/linux-packages/apache-arrow/yum/centos-7/Dockerfile
new file mode 100644
index 000000000..6856e3854
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/yum/centos-7/Dockerfile
@@ -0,0 +1,59 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+ARG FROM=centos:7
+FROM ${FROM}
+
+ARG DEBUG
+
+RUN \
+  quiet=$([ "${DEBUG}" = "yes" ] || echo "--quiet") && \
+  yum update -y ${quiet} && \
+  yum install -y ${quiet} epel-release && \
+  yum install -y ${quiet} \
+    bison \
+    boost169-devel \
+    brotli-devel \
+    bzip2-devel \
+    ccache \
+    cmake3 \
+    flex \
+    gcc-c++ \
+    gflags-devel \
+    git \
+    glog-devel \
+    gobject-introspection-devel \
+    gtk-doc \
+    libzstd-devel \
+    lz4-devel \
+    make \
+    ninja-build \
+    openssl-devel \
+    pkg-config \
+    python36 \
+    python36-devel \
+    python36-numpy \
+    rapidjson-devel \
+    rpmdevtools \
+    snappy-devel \
+    tar \
+    zlib-devel && \
+  yum clean ${quiet} all
+
+ENV \
+  BOOST_INCLUDEDIR=/usr/include/boost169 \
+  BOOST_LIBRARYDIR=/usr/lib64/boost169
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/yum/centos-8-aarch64/from b/src/arrow/dev/tasks/linux-packages/apache-arrow/yum/centos-8-aarch64/from
new file mode 100644
index 000000000..587ce9d4a
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/yum/centos-8-aarch64/from
@@ -0,0 +1,18 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+arm64v8/centos:8
diff --git a/src/arrow/dev/tasks/linux-packages/apache-arrow/yum/centos-8/Dockerfile b/src/arrow/dev/tasks/linux-packages/apache-arrow/yum/centos-8/Dockerfile
new file mode 100644
index 000000000..ad145c4ee
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apache-arrow/yum/centos-8/Dockerfile
@@ -0,0 +1,64 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+ARG FROM=centos:8
+FROM ${FROM}
+
+ARG DEBUG
+
+RUN \
+  quiet=$([ "${DEBUG}" = "yes" ] || echo "--quiet") && \
+  dnf install -y ${quiet} epel-release && \
+  dnf install --enablerepo=powertools -y ${quiet} \
+    bison \
+    boost-devel \
+    brotli-devel \
+    bzip2-devel \
+    c-ares-devel \
+    ccache \
+    clang \
+    cmake \
+    curl-devel \
+    flex \
+    gcc-c++ \
+    gflags-devel \
+    git \
+    glog-devel \
+    gobject-introspection-devel \
+    gtk-doc \
+    libarchive \
+    libzstd-devel \
+    llvm-devel \
+    llvm-static \
+    lz4-devel \
+    make \
+    ncurses-devel \
+    ninja-build \
+    openssl-devel \
+    pkg-config \
+    python3 \
+    python3-devel \
+    python3-numpy \
+    python3-pip \
+    re2-devel \
+    # rapidjson-devel \
+    rpmdevtools \
+    snappy-devel \
+    tar \
+    # utf8proc-devel \
+    zlib-devel && \
+  dnf clean ${quiet} all
diff --git a/src/arrow/dev/tasks/linux-packages/apt/build.sh b/src/arrow/dev/tasks/linux-packages/apt/build.sh
new file mode 100755
index 000000000..a54567a5c
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/apt/build.sh
@@ -0,0 +1,117 @@
+#!/usr/bin/env bash
+# -*- sh-indentation: 2; sh-basic-offset: 2 -*-
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+LANG=C
+
+set -u
+
+run()
+{
+  "$@"
+  if test $? -ne 0; then
+    echo "Failed $@"
+    exit 1
+  fi
+}
+
+. /host/env.sh
+
+distribution=$(lsb_release --id --short | tr 'A-Z' 'a-z')
+code_name=$(lsb_release --codename --short)
+case "${distribution}" in
+  debian)
+    component=main
+    ;;
+  ubuntu)
+    component=universe
+    ;;
+esac
+architecture=$(dpkg-architecture -q DEB_BUILD_ARCH)
+
+debuild_options=()
+dpkg_buildpackage_options=(-us -uc)
+
+run mkdir -p /build
+run cd /build
+find . -not -path ./ccache -a -not -path "./ccache/*" -delete
+if which ccache > /dev/null 2>&1; then
+  export CCACHE_COMPILERCHECK=content
+  export CCACHE_COMPRESS=1
+  export CCACHE_COMPRESSLEVEL=6
+  export CCACHE_DIR="${PWD}/ccache"
+  export CCACHE_MAXSIZE=500M
+  ccache --show-stats
+  debuild_options+=(-eCCACHE_COMPILERCHECK)
+  debuild_options+=(-eCCACHE_COMPRESS)
+  debuild_options+=(-eCCACHE_COMPRESSLEVEL)
+  debuild_options+=(-eCCACHE_DIR)
+  debuild_options+=(-eCCACHE_MAXSIZE)
+  if [ -d /usr/lib/ccache ] ;then
+    debuild_options+=(--prepend-path=/usr/lib/ccache)
+  fi
+fi
+run cp /host/tmp/${PACKAGE}-${VERSION}.tar.gz \
+  ${PACKAGE}_${VERSION}.orig.tar.gz
+run tar xfz ${PACKAGE}_${VERSION}.orig.tar.gz
+case "${VERSION}" in
+  *~dev*)
+    run mv ${PACKAGE}-$(echo $VERSION | sed -e 's/~dev/-dev/') \
+        ${PACKAGE}-${VERSION}
+    ;;
+  *~rc*)
+    run mv ${PACKAGE}-$(echo $VERSION | sed -r -e 's/~rc[0-9]+//') \
+        ${PACKAGE}-${VERSION}
+    ;;
+esac
+run cd ${PACKAGE}-${VERSION}/
+platform="${distribution}-${code_name}"
+if [ -d "/host/tmp/debian.${platform}-${architecture}" ]; then
+  run cp -rp "/host/tmp/debian.${platform}-${architecture}" debian
+elif [ -d "/host/tmp/debian.${platform}" ]; then
+  run cp -rp "/host/tmp/debian.${platform}" debian
+else
+  run cp -rp "/host/tmp/debian" debian
+fi
+: ${DEB_BUILD_OPTIONS:="parallel=$(nproc)"}
+# DEB_BUILD_OPTIONS="${DEB_BUILD_OPTIONS} noopt"
+export DEB_BUILD_OPTIONS
+if [ "${DEBUG:-no}" = "yes" ]; then
+  run debuild "${debuild_options[@]}" "${dpkg_buildpackage_options[@]}"
+else
+  run debuild "${debuild_options[@]}" "${dpkg_buildpackage_options[@]}" > /dev/null
+fi
+if which ccache > /dev/null 2>&1; then
+  ccache --show-stats
+fi
+run cd -
+
+repositories="/host/repositories"
+package_initial=$(echo "${PACKAGE}" | sed -e 's/\(.\).*/\1/')
+pool_dir="${repositories}/${distribution}/pool/${code_name}/${component}/${package_initial}/${PACKAGE}"
+run mkdir -p "${pool_dir}/"
+run \
+  find . \
+  -maxdepth 1 \
+  -type f \
+  -not -path '*.build' \
+  -not -path '*.buildinfo' \
+  -exec cp '{}' "${pool_dir}/" ';'
+
+run chown -R "$(stat --format "%u:%g" "${repositories}")" "${repositories}"
diff --git a/src/arrow/dev/tasks/linux-packages/github.linux.amd64.yml b/src/arrow/dev/tasks/linux-packages/github.linux.amd64.yml
new file mode 100644
index 000000000..557c4ab41
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/github.linux.amd64.yml
@@ -0,0 +1,138 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+{% import 'macros.jinja' as macros with context %}
+
+{{ macros.github_header() }}
+
+jobs:
+  package:
+    name: Package
+    runs-on: ubuntu-20.04
+    steps:
+      {{ macros.github_checkout_arrow()|indent }}
+      {{ macros.github_login_dockerhub()|indent }}
+
+      - name: Set up Ruby
+        uses: ruby/setup-ruby@v1
+        with:
+          ruby-version: '3.0'
+      - name: Free Up Disk Space
+        shell: bash
+        run: arrow/ci/scripts/util_cleanup.sh
+      - name: Cache ccache
+        uses: actions/cache@v2
+        with:
+          path: arrow/dev/tasks/linux-packages/apache-arrow/{{ task_namespace }}/build/{{ target }}/ccache
+          key: linux-{{ task_namespace }}-ccache-{{ target }}-{{ "${{ hashFiles('arrow/cpp/**') }}" }}
+          restore-keys: linux-{{ task_namespace }}-ccache-{{ target }}-
+      - name: Build
+        run: |
+          set -e
+          pushd arrow/dev/tasks/linux-packages
+          rake version:update
+          rake docker:pull || :
+          rake --trace {{ task_namespace }}:build BUILD_DIR=build
+          sudo rm -rf */*/build
+          popd
+        env:
+          APT_TARGETS: {{ target }}
+          ARROW_VERSION: {{ arrow.version }}
+          REPO: {{ '${{ secrets.REPO }}' }}
+          YUM_TARGETS: {{ target }}
+      - uses: actions/upload-artifact@v2
+        with:
+          name: packages
+          path: packages/*/{{ task_namespace }}/repositories/
+      - name: Docker Push
+        continue-on-error: true
+        shell: bash
+        run: |
+          pushd arrow/dev/tasks/linux-packages
+          rake docker:push
+          popd
+        env:
+          APT_TARGETS: {{ target }}
+          REPO: {{ '${{ secrets.REPO }}' }}
+          YUM_TARGETS: {{ target }}
+      - name: Set up test
+        run: |
+          set -e
+          sudo apt update
+          # We can install createrepo_c by package with Ubuntu 22.04.
+          #   createrepo_c \
+          sudo apt install -y \
+            apt-utils \
+            devscripts \
+            gpg \
+            rpm
+          gem install apt-dists-merge
+          (echo "Key-Type: RSA"; \
+           echo "Key-Length: 4096"; \
+           echo "Name-Real: Test"; \
+           echo "Name-Email: test@example.com"; \
+           echo "%no-protection") | \
+            gpg --full-generate-key --batch
+          GPG_KEY_ID=$(gpg --list-keys --with-colon test@example.com | grep fpr | cut -d: -f10)
+          echo "GPG_KEY_ID=${GPG_KEY_ID}" >> ${GITHUB_ENV}
+          gpg --export --armor test@example.com > arrow/dev/tasks/linux-packages/KEYS
+      # We can install createrepo_c by package with Ubuntu 22.04.
+      # This is workaround:
+      - name: Install createrepo_c
+        run: |
+          sudo apt install -y \
+            cmake \
+            libbz2-dev \
+            libcurl4-openssl-dev \
+            libglib2.0-dev \
+            liblzma-dev \
+            libmagic-dev \
+            librpm-dev \
+            libsqlite3-dev \
+            libssl-dev \
+            libxml2-dev \
+            libzstd-dev \
+            pkg-config \
+            zlib1g-dev
+          git clone --depth 1 https://github.com/rpm-software-management/createrepo_c.git
+          pushd createrepo_c
+          /usr/bin/cmake \
+            -DCMAKE_INSTALL_PREFIX=/usr \
+            -DENABLE_BASHCOMP=OFF \
+            -DENABLE_DRPM=OFF \
+            -DENABLE_PYTHON=OFF \
+            -DWITH_LIBMODULEMD=OFF \
+            -DWITH_ZCHUNK=OFF \
+            .
+          make -j$(nproc)
+          sudo make install
+          popd
+          rm -rf createrepo_c
+      - name: Test
+        run: |
+          set -e
+          pushd arrow/dev/tasks/linux-packages
+          rake --trace {{ task_namespace }}:test
+          rm -rf {{ task_namespace }}/repositories
+          popd
+        env:
+          APT_TARGETS: {{ target }}
+          ARROW_VERSION: {{ arrow.version }}
+          YUM_TARGETS: {{ target }}
+
+      {% set patterns = upload_extensions | format_all("arrow/dev/tasks/linux-packages/**/*{}") %}
+      {{ macros.github_upload_releases(patterns)|indent }}
diff --git a/src/arrow/dev/tasks/linux-packages/helper.rb b/src/arrow/dev/tasks/linux-packages/helper.rb
new file mode 100644
index 000000000..30ac3b898
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/helper.rb
@@ -0,0 +1,70 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+module Helper
+  module ApacheArrow
+    private
+    def detect_release_time
+      release_time_env = ENV["ARROW_RELEASE_TIME"]
+      if release_time_env
+        Time.parse(release_time_env).utc
+      else
+        latest_commit_time(arrow_source_dir) || Time.now.utc
+      end
+    end
+
+    def arrow_source_dir
+      File.join(__dir__, "..", "..", "..")
+    end
+
+    def detect_version(release_time)
+      version_env = ENV["ARROW_VERSION"]
+      return version_env if version_env
+
+      pom_xml_path = File.join(arrow_source_dir, "java", "pom.xml")
+      pom_xml_content = File.read(pom_xml_path)
+      version = pom_xml_content[/^  <version>(.+?)<\/version>/, 1]
+      formatted_release_time = release_time.strftime("%Y%m%d")
+      version.gsub(/-SNAPSHOT\z/) {"-dev#{formatted_release_time}"}
+    end
+
+    def detect_env(name)
+      value = ENV[name]
+      return value if value and not value.empty?
+
+      dot_env_path = File.join(arrow_source_dir, ".env")
+      File.open(dot_env_path) do |dot_env|
+        dot_env.each_line do |line|
+          case line.chomp
+          when /\A#{Regexp.escape(name)}=(.*)/
+            return $1
+          end
+        end
+      end
+      raise "Failed to detect #{name} environment variable"
+    end
+
+    def detect_repo
+      detect_env("REPO")
+    end
+
+    def docker_image(os, architecture)
+      architecture ||= "amd64"
+      "#{detect_repo}:#{architecture}-#{os}-package-#{@package}"
+    end
+  end
+end
diff --git a/src/arrow/dev/tasks/linux-packages/package-task.rb b/src/arrow/dev/tasks/linux-packages/package-task.rb
new file mode 100644
index 000000000..9dd1b2d93
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/package-task.rb
@@ -0,0 +1,645 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+require "English"
+require "open-uri"
+require "time"
+
+class PackageTask
+  include Rake::DSL
+
+  def initialize(package, version, release_time, options={})
+    @package = package
+    @version = version
+    @release_time = release_time
+
+    @archive_base_name = "#{@package}-#{@version}"
+    @archive_name = "#{@archive_base_name}.tar.gz"
+    @full_archive_name = File.expand_path(@archive_name)
+
+    @rpm_package = @package
+    case @version
+    when /-((dev|rc)\d+)\z/
+      base_version = $PREMATCH
+      sub_version = $1
+      type = $2
+      if type == "rc" and options[:rc_build_type] == :release
+        @deb_upstream_version = base_version
+        @deb_archive_base_name_version = base_version
+        @rpm_version = base_version
+        @rpm_release = "1"
+      else
+        @deb_upstream_version = "#{base_version}~#{sub_version}"
+        @deb_archive_base_name_version = @version
+        @rpm_version = base_version
+        @rpm_release = "0.#{sub_version}"
+      end
+    else
+      @deb_upstream_version = @version
+      @deb_archive_base_name_version = @version
+      @rpm_version = @version
+      @rpm_release = "1"
+    end
+    @deb_release = ENV["DEB_RELEASE"] || "1"
+  end
+
+  def define
+    define_dist_task
+    define_apt_task
+    define_yum_task
+    define_version_task
+    define_docker_tasks
+  end
+
+  private
+  def env_value(name)
+    value = ENV[name]
+    raise "Specify #{name} environment variable" if value.nil?
+    value
+  end
+
+  def debug_build?
+    ENV["DEBUG"] != "no"
+  end
+
+  def git_directory?(directory)
+    candidate_paths = [".git", "HEAD"]
+    candidate_paths.any? do |candidate_path|
+      File.exist?(File.join(directory, candidate_path))
+    end
+  end
+
+  def latest_commit_time(git_directory)
+    return nil unless git_directory?(git_directory)
+    cd(git_directory) do
+      return Time.iso8601(`git log -n 1 --format=%aI`.chomp).utc
+    end
+  end
+
+  def download(url, output_path)
+    if File.directory?(output_path)
+      base_name = url.split("/").last
+      output_path = File.join(output_path, base_name)
+    end
+    absolute_output_path = File.expand_path(output_path)
+
+    unless File.exist?(absolute_output_path)
+      mkdir_p(File.dirname(absolute_output_path))
+      rake_output_message "Downloading... #{url}"
+      open_url(url) do |downloaded_file|
+        File.open(absolute_output_path, "wb") do |output_file|
+          IO.copy_stream(downloaded_file, output_file)
+        end
+      end
+    end
+
+    absolute_output_path
+  end
+
+  def open_url(url, &block)
+    URI(url).open(&block)
+  end
+
+  def substitute_content(content)
+    content.gsub(/@(.+?)@/) do |matched|
+      yield($1, matched)
+    end
+  end
+
+  def docker_image(os, architecture)
+    image = "#{@package}-#{os}"
+    image << "-#{architecture}" if architecture
+    image
+  end
+
+  def docker_run(os, architecture, console: false)
+    id = os
+    id = "#{id}-#{architecture}" if architecture
+    image = docker_image(os, architecture)
+    build_command_line = [
+      "docker",
+      "build",
+      "--cache-from", image,
+      "--tag", image,
+    ]
+    run_command_line = [
+      "docker",
+      "run",
+      "--rm",
+      "--log-driver", "none",
+      "--volume", "#{Dir.pwd}:/host:rw",
+    ]
+    if $stdin.tty?
+      run_command_line << "--interactive"
+      run_command_line << "--tty"
+    else
+      run_command_line.concat(["--attach", "STDOUT"])
+      run_command_line.concat(["--attach", "STDERR"])
+    end
+    build_dir = ENV["BUILD_DIR"]
+    if build_dir
+      build_dir = "#{File.expand_path(build_dir)}/#{id}"
+      mkdir_p(build_dir)
+      run_command_line.concat(["--volume", "#{build_dir}:/build:rw"])
+    end
+    if debug_build?
+      build_command_line.concat(["--build-arg", "DEBUG=yes"])
+      run_command_line.concat(["--env", "DEBUG=yes"])
+    end
+    pass_through_env_names = [
+      "DEB_BUILD_OPTIONS",
+      "RPM_BUILD_NCPUS",
+    ]
+    pass_through_env_names.each do |name|
+      value = ENV[name]
+      next unless value
+      run_command_line.concat(["--env", "#{name}=#{value}"])
+    end
+    if File.exist?(File.join(id, "Dockerfile"))
+      docker_context = id
+    else
+      from = File.readlines(File.join(id, "from")).find do |line|
+        /^[a-z]/i =~ line
+      end
+      build_command_line.concat(["--build-arg", "FROM=#{from.chomp}"])
+      docker_context = os
+    end
+    build_command_line.concat(docker_build_options(os, architecture))
+    run_command_line.concat(docker_run_options(os, architecture))
+    build_command_line << docker_context
+    run_command_line << image
+    run_command_line << "/host/build.sh" unless console
+
+    sh(*build_command_line)
+    sh(*run_command_line)
+  end
+
+  def docker_build_options(os, architecture)
+    []
+  end
+
+  def docker_run_options(os, architecture)
+    []
+  end
+
+  def docker_pull(os, architecture)
+    image = docker_image(os, architecture)
+    command_line = [
+      "docker",
+      "pull",
+      image,
+    ]
+    command_line.concat(docker_pull_options(os, architecture))
+    sh(*command_line)
+  end
+
+  def docker_pull_options(os, architecture)
+    []
+  end
+
+  def docker_push(os, architecture)
+    image = docker_image(os, architecture)
+    command_line = [
+      "docker",
+      "push",
+      image,
+    ]
+    command_line.concat(docker_push_options(os, architecture))
+    sh(*command_line)
+  end
+
+  def docker_push_options(os, architecture)
+    []
+  end
+
+  def define_dist_task
+    define_archive_task
+    desc "Create release package"
+    task :dist => [@archive_name]
+  end
+
+  def split_target(target)
+    components = target.split("-")
+    if components[0, 2] == ["amazon", "linux"]
+      components[0, 2] = components[0, 2].join("-")
+    end
+    if components.size >= 3
+      components[2..-1] = components[2..-1].join("-")
+    end
+    components
+  end
+
+  def enable_apt?
+    true
+  end
+
+  def apt_targets
+    return [] unless enable_apt?
+
+    targets = (ENV["APT_TARGETS"] || "").split(",")
+    targets = apt_targets_default if targets.empty?
+
+    targets.find_all do |target|
+      Dir.exist?(File.join(apt_dir, target))
+    end
+  end
+
+  def apt_targets_default
+    # Disable arm64 targets by default for now
+    # because they require some setups on host.
+    [
+      "debian-buster",
+      # "debian-buster-arm64",
+      "debian-bullseye",
+      # "debian-bullseye-arm64",
+      "debian-bookworm",
+      # "debian-bookworm-arm64",
+      "ubuntu-bionic",
+      # "ubuntu-bionic-arm64",
+      "ubuntu-focal",
+      # "ubuntu-focal-arm64",
+      "ubuntu-hirsute",
+      # "ubuntu-hirsute-arm64",
+      "ubuntu-impish",
+      # "ubuntu-impish-arm64",
+    ]
+  end
+
+  def deb_archive_base_name
+    "#{@package}-#{@deb_archive_base_name_version}"
+  end
+
+  def deb_archive_name
+    "#{@package}-#{@deb_upstream_version}.tar.gz"
+  end
+
+  def apt_dir
+    "apt"
+  end
+
+  def apt_prepare_debian_dir(tmp_dir, target)
+    source_debian_dir = nil
+    specific_debian_dir = "debian.#{target}"
+    distribution, code_name, _architecture = split_target(target)
+    platform = [distribution, code_name].join("-")
+    platform_debian_dir = "debian.#{platform}"
+    if File.exist?(specific_debian_dir)
+      source_debian_dir = specific_debian_dir
+    elsif File.exist?(platform_debian_dir)
+      source_debian_dir = platform_debian_dir
+    else
+      source_debian_dir = "debian"
+    end
+
+    prepared_debian_dir = "#{tmp_dir}/debian.#{target}"
+    cp_r(source_debian_dir, prepared_debian_dir)
+    control_in_path = "#{prepared_debian_dir}/control.in"
+    if File.exist?(control_in_path)
+      control_in = File.read(control_in_path)
+      rm_f(control_in_path)
+      File.open("#{prepared_debian_dir}/control", "w") do |control|
+        prepared_control = apt_prepare_debian_control(control_in, target)
+        control.print(prepared_control)
+      end
+    end
+  end
+
+  def apt_prepare_debian_control(control_in, target)
+    message = "#{__method__} must be defined to use debian/control.in"
+    raise NotImplementedError, message
+  end
+
+  def apt_build(console: false)
+    tmp_dir = "#{apt_dir}/tmp"
+    rm_rf(tmp_dir)
+    mkdir_p(tmp_dir)
+    cp(deb_archive_name,
+       File.join(tmp_dir, deb_archive_name))
+    apt_targets.each do |target|
+      apt_prepare_debian_dir(tmp_dir, target)
+    end
+
+    env_sh = "#{apt_dir}/env.sh"
+    File.open(env_sh, "w") do |file|
+      file.puts(<<-ENV)
+PACKAGE=#{@package}
+VERSION=#{@deb_upstream_version}
+      ENV
+    end
+
+    apt_targets.each do |target|
+      cd(apt_dir) do
+        distribution, version, architecture = split_target(target)
+        os = "#{distribution}-#{version}"
+        docker_run(os, architecture, console: console)
+      end
+    end
+  end
+
+  def define_apt_task
+    namespace :apt do
+      source_build_sh = "#{__dir__}/apt/build.sh"
+      build_sh = "#{apt_dir}/build.sh"
+      repositories_dir = "#{apt_dir}/repositories"
+
+      file build_sh => source_build_sh do
+        cp(source_build_sh, build_sh)
+      end
+
+      directory repositories_dir
+
+      desc "Build deb packages"
+      if enable_apt?
+        build_dependencies = [
+          deb_archive_name,
+          build_sh,
+          repositories_dir,
+        ]
+      else
+        build_dependencies = []
+      end
+      task :build => build_dependencies do
+        apt_build if enable_apt?
+      end
+
+      namespace :build do
+        desc "Open console"
+        task :console => build_dependencies do
+          apt_build(console: true) if enable_apt?
+        end
+      end
+    end
+
+    desc "Release APT repositories"
+    apt_tasks = [
+      "apt:build",
+    ]
+    task :apt => apt_tasks
+  end
+
+  def enable_yum?
+    true
+  end
+
+  def yum_targets
+    return [] unless enable_yum?
+
+    targets = (ENV["YUM_TARGETS"] || "").split(",")
+    targets = yum_targets_default if targets.empty?
+
+    targets.find_all do |target|
+      Dir.exist?(File.join(yum_dir, target))
+    end
+  end
+
+  def yum_targets_default
+    # Disable aarch64 targets by default for now
+    # because they require some setups on host.
+    [
+      "almalinux-8",
+      # "almalinux-8-arch64",
+      "amazon-linux-2",
+      # "amazon-linux-2-arch64",
+      "centos-7",
+      # "centos-7-aarch64",
+      "centos-8",
+      # "centos-8-aarch64",
+    ]
+  end
+
+  def rpm_archive_base_name
+    "#{@package}-#{@rpm_version}"
+  end
+
+  def rpm_archive_name
+    "#{rpm_archive_base_name}.tar.gz"
+  end
+
+  def yum_dir
+    "yum"
+  end
+
+  def yum_build_sh
+    "#{yum_dir}/build.sh"
+  end
+
+  def yum_expand_variable(key)
+    case key
+    when "PACKAGE"
+      @rpm_package
+    when "VERSION"
+      @rpm_version
+    when "RELEASE"
+      @rpm_release
+    else
+      nil
+    end
+  end
+
+  def yum_spec_in_path
+    "#{yum_dir}/#{@rpm_package}.spec.in"
+  end
+
+  def yum_build(console: false)
+    tmp_dir = "#{yum_dir}/tmp"
+    rm_rf(tmp_dir)
+    mkdir_p(tmp_dir)
+    cp(rpm_archive_name,
+       File.join(tmp_dir, rpm_archive_name))
+
+    env_sh = "#{yum_dir}/env.sh"
+    File.open(env_sh, "w") do |file|
+      file.puts(<<-ENV)
+SOURCE_ARCHIVE=#{rpm_archive_name}
+PACKAGE=#{@rpm_package}
+VERSION=#{@rpm_version}
+RELEASE=#{@rpm_release}
+      ENV
+    end
+
+    spec = "#{tmp_dir}/#{@rpm_package}.spec"
+    spec_in_data = File.read(yum_spec_in_path)
+    spec_data = substitute_content(spec_in_data) do |key, matched|
+      yum_expand_variable(key) || matched
+    end
+    File.open(spec, "w") do |spec_file|
+      spec_file.print(spec_data)
+    end
+
+    yum_targets.each do |target|
+      cd(yum_dir) do
+        distribution, version, architecture = split_target(target)
+        os = "#{distribution}-#{version}"
+        docker_run(os, architecture, console: console)
+      end
+    end
+  end
+
+  def define_yum_task
+    namespace :yum do
+      source_build_sh = "#{__dir__}/yum/build.sh"
+      file yum_build_sh => source_build_sh do
+        cp(source_build_sh, yum_build_sh)
+      end
+
+      repositories_dir = "#{yum_dir}/repositories"
+      directory repositories_dir
+
+      desc "Build RPM packages"
+      if enable_yum?
+        build_dependencies = [
+          repositories_dir,
+          rpm_archive_name,
+          yum_build_sh,
+          yum_spec_in_path,
+        ]
+      else
+        build_dependencies = []
+      end
+      task :build => build_dependencies do
+        yum_build if enable_yum?
+      end
+
+      namespace :build do
+        desc "Open console"
+        task :console => build_dependencies do
+          yum_build(console: true) if enable_yum?
+        end
+      end
+    end
+
+    desc "Release Yum repositories"
+    yum_tasks = [
+      "yum:build",
+    ]
+    task :yum => yum_tasks
+  end
+
+  def define_version_task
+    namespace :version do
+      desc "Update versions"
+      task :update do
+        update_debian_changelog
+        update_spec
+      end
+    end
+  end
+
+  def package_changelog_message
+    "New upstream release."
+  end
+
+  def packager_name
+    ENV["DEBFULLNAME"] || ENV["NAME"] || guess_packager_name_from_git
+  end
+
+  def guess_packager_name_from_git
+    name = `git config --get user.name`.chomp
+    return name unless name.empty?
+    `git log -n 1 --format=%aN`.chomp
+  end
+
+  def packager_email
+    ENV["DEBEMAIL"] || ENV["EMAIL"] || guess_packager_email_from_git
+  end
+
+  def guess_packager_email_from_git
+    email = `git config --get user.email`.chomp
+    return email unless email.empty?
+    `git log -n 1 --format=%aE`.chomp
+  end
+
+  def update_content(path)
+    if File.exist?(path)
+      content = File.read(path)
+    else
+      content = ""
+    end
+    content = yield(content)
+    File.open(path, "w") do |file|
+      file.puts(content)
+    end
+  end
+
+  def update_debian_changelog
+    return unless enable_apt?
+
+    Dir.glob("debian*") do |debian_dir|
+      update_content("#{debian_dir}/changelog") do |content|
+        <<-CHANGELOG.rstrip
+#{@package} (#{@deb_upstream_version}-#{@deb_release}) unstable; urgency=low
+
+  * New upstream release.
+
+ -- #{packager_name} <#{packager_email}>  #{@release_time.rfc2822}
+
+#{content}
+        CHANGELOG
+      end
+    end
+  end
+
+  def update_spec
+    return unless enable_yum?
+
+    release_time = @release_time.strftime("%a %b %d %Y")
+    update_content(yum_spec_in_path) do |content|
+      content = content.sub(/^(%changelog\n)/, <<-CHANGELOG)
+%changelog
+* #{release_time} #{packager_name} <#{packager_email}> - #{@rpm_version}-#{@rpm_release}
+- #{package_changelog_message}
+
+      CHANGELOG
+      content = content.sub(/^(Release:\s+)\d+/, "\\11")
+      content.rstrip
+    end
+  end
+
+  def define_docker_tasks
+    namespace :docker do
+      pull_tasks = []
+      push_tasks = []
+
+      (apt_targets + yum_targets).each do |target|
+        distribution, version, architecture = split_target(target)
+        os = "#{distribution}-#{version}"
+
+        namespace :pull do
+          desc "Pull built image for #{target}"
+          task target do
+            docker_pull(os, architecture)
+          end
+          pull_tasks << "docker:pull:#{target}"
+        end
+
+        namespace :push do
+          desc "Push built image for #{target}"
+          task target do
+            docker_push(os, architecture)
+          end
+          push_tasks << "docker:push:#{target}"
+        end
+      end
+
+      desc "Pull built images"
+      task :pull => pull_tasks
+
+      desc "Push built images"
+      task :push => push_tasks
+    end
+  end
+end
diff --git a/src/arrow/dev/tasks/linux-packages/travis.linux.arm64.yml b/src/arrow/dev/tasks/linux-packages/travis.linux.arm64.yml
new file mode 100644
index 000000000..3703f4c46
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/travis.linux.arm64.yml
@@ -0,0 +1,155 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+{% import 'macros.jinja' as macros with context %}
+
+arch: arm64-graviton2
+virt: vm
+os: linux
+dist: focal
+group: edge
+language: minimal
+
+addons:
+  apt:
+    packages:
+      - apt-utils
+      # We need Ubuntu 20.10 or later
+      # - createrepo_c
+      - devscripts
+      - gpg
+      - libgit2-dev
+      - python3-pip
+      - rake
+      - rpm
+
+      # https://bugs.launchpad.net/ubuntu/+source/glibc/+bug/1916485
+      # We need to use runc 1.0.0~rc93 or later from focal-updated.
+      - runc
+
+      # To build createrepo_c from source.
+      # We can remove them when we can install createrepo_c package
+      - cmake
+      - libbz2-dev
+      - libcurl4-openssl-dev
+      - libglib2.0-dev
+      - liblzma-dev
+      - libmagic-dev
+      - librpm-dev
+      - libsqlite3-dev
+      - libssl-dev
+      - libxml2-dev
+      - libzstd-dev
+      - pkg-config
+      - zlib1g-dev
+    update: true
+
+services:
+  - docker
+
+# don't build twice
+if: tag IS blank
+
+env:
+  global:
+    - APT_TARGETS={{ target }}
+    - ARROW_VERSION={{ arrow.version }}
+    - BUILD_REF={{ arrow.head }}
+    - TRAVIS_TAG={{ task.tag }}
+    - YUM_TARGETS={{ target }}
+
+before_script:
+  - set -e
+  {{ macros.travis_checkout_arrow() }}
+  {{ macros.travis_docker_login() }}
+
+  # Build createrepo_c from source.
+  # We can remove them when we can install createrepo_c package
+  - git clone --depth 1 https://github.com/rpm-software-management/createrepo_c.git
+  - pushd createrepo_c
+  - |
+      /usr/bin/cmake \
+        -DCMAKE_INSTALL_PREFIX=/usr \
+        -DENABLE_BASHCOMP=OFF \
+        -DENABLE_DRPM=OFF \
+        -DENABLE_PYTHON=OFF \
+        -DWITH_LIBMODULEMD=OFF \
+        -DWITH_ZCHUNK=OFF \
+        .
+  - make -j$(nproc)
+  - sudo make install
+  - popd
+  - rm -rf createrepo_c
+
+script:
+  # Build packages
+  - pushd arrow/dev/tasks/linux-packages
+  - rake version:update
+  - |
+      rake docker:pull || :
+  - pushd apache-arrow-apt-source/apt
+  - |
+      for target in debian-* ubuntu-*; do
+        cp -a ${target} ${target}-arm64
+      done
+  - popd
+  - pushd apache-arrow-release/yum
+  - |
+      for target in almalinux-* centos-*; do
+        cp -a ${target} ${target}-aarch64
+      done
+  - popd
+  - |
+      rake \
+        --trace \
+        {{ task_namespace }}:build \
+        BUILD_DIR=build \
+        DEB_BUILD_OPTIONS=parallel=2 \
+        RPM_BUILD_NCPUS=2
+  - sudo rm -rf */*/build
+  - popd
+  # Push Docker image
+  - pushd arrow/dev/tasks/linux-packages
+  - |
+      docker login -u "${DOCKERHUB_USER}" \
+                   -p "${DOCKERHUB_TOKEN}" || :
+  - |
+      rake docker:push || :
+  - popd
+  # Test built packages
+  - sudo gem install apt-dists-merge
+  - |
+      (echo "Key-Type: RSA"; \
+       echo "Key-Length: 4096"; \
+       echo "Name-Real: Test"; \
+       echo "Name-Email: test@example.com"; \
+       echo "%no-protection") | \
+        gpg --full-generate-key --batch
+  - |
+      GPG_KEY_ID=$(gpg --list-keys --with-colon test@example.com | grep fpr | cut -d: -f10)
+  - gpg --export --armor test@example.com > arrow/dev/tasks/linux-packages/KEYS
+  - pushd arrow/dev/tasks/linux-packages
+  - |
+      rake --trace {{ task_namespace }}:test \
+        CREATEREPO=createrepo_c \
+        GPG_KEY_ID=${GPG_KEY_ID}
+  - rm -rf {{ task_namespace }}/repositories
+  - popd
+
+after_success:
+  {% set patterns = upload_extensions | format_all("arrow/dev/tasks/linux-packages/**/*{}") %}
+  {{ macros.travis_upload_releases(patterns) }}
diff --git a/src/arrow/dev/tasks/linux-packages/yum/build.sh b/src/arrow/dev/tasks/linux-packages/yum/build.sh
new file mode 100755
index 000000000..5224f23e9
--- /dev/null
+++ b/src/arrow/dev/tasks/linux-packages/yum/build.sh
@@ -0,0 +1,158 @@
+#!/usr/bin/env bash
+# -*- sh-indentation: 2; sh-basic-offset: 2 -*-
+#
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+set -u
+
+run()
+{
+  "$@"
+  if test $? -ne 0; then
+    echo "Failed $@"
+    exit 1
+  fi
+}
+
+rpmbuild_options=
+
+. /host/env.sh
+
+if grep -q amazon /etc/system-release-cpe; then
+  distribution=$(cut -d ":" -f 5 /etc/system-release-cpe | tr '_' '-')
+  distribution_version=$(cut -d ":" -f 6 /etc/system-release-cpe)
+else
+  distribution=$(cut -d ":" -f 4 /etc/system-release-cpe)
+  distribution_version=$(cut -d ":" -f 5 /etc/system-release-cpe)
+fi
+distribution_version=$(echo ${distribution_version} | sed -e 's/\..*$//g')
+
+architecture="$(arch)"
+lib_directory=/usr/lib64
+case "${architecture}" in
+  i*86)
+    architecture=i386
+    lib_directory=/usr/lib
+    ;;
+esac
+
+run mkdir -p /build
+run cd /build
+find . -not -path ./ccache -a -not -path "./ccache/*" -delete
+if which ccache > /dev/null 2>&1; then
+  export CCACHE_COMPILERCHECK=content
+  export CCACHE_COMPRESS=1
+  export CCACHE_COMPRESSLEVEL=6
+  export CCACHE_MAXSIZE=500M
+  export CCACHE_DIR="${PWD}/ccache"
+  ccache --show-stats
+  if [ -d "${lib_directory}/ccache" ]; then
+    PATH="${lib_directory}/ccache:$PATH"
+  fi
+fi
+
+run mkdir -p rpmbuild
+run cd
+rm -rf rpmbuild
+run ln -fs /build/rpmbuild ./
+if [ -x /usr/bin/rpmdev-setuptree ]; then
+  rm -rf .rpmmacros
+  run rpmdev-setuptree
+else
+  run cat <<RPMMACROS > ~/.rpmmacros
+%_topdir ${HOME}/rpmbuild
+RPMMACROS
+  run mkdir -p rpmbuild/SOURCES
+  run mkdir -p rpmbuild/SPECS
+  run mkdir -p rpmbuild/BUILD
+  run mkdir -p rpmbuild/RPMS
+  run mkdir -p rpmbuild/SRPMS
+fi
+
+repositories="/host/repositories"
+repository="${repositories}/${distribution}/${distribution_version}"
+rpm_dir="${repository}/${architecture}/Packages"
+srpm_dir="${repository}/source/SRPMS"
+run mkdir -p "${rpm_dir}" "${srpm_dir}"
+
+# for debug
+# rpmbuild_options="$rpmbuild_options --define 'optflags -O0 -g3'"
+
+if [ -n "${SOURCE_ARCHIVE}" ]; then
+  case "${RELEASE}" in
+    0.dev*)
+      source_archive_base_name=$( \
+        echo ${SOURCE_ARCHIVE} | sed -e 's/\.tar\.gz$//')
+      run tar xf /host/tmp/${SOURCE_ARCHIVE} \
+        --transform="s,^[^/]*,${PACKAGE},"
+      run mv \
+          ${PACKAGE} \
+          ${source_archive_base_name}
+      run tar czf \
+          rpmbuild/SOURCES/${SOURCE_ARCHIVE} \
+          ${source_archive_base_name}
+      run rm -rf ${source_archive_base_name}
+      ;;
+    *)
+      run cp /host/tmp/${SOURCE_ARCHIVE} rpmbuild/SOURCES/
+      ;;
+  esac
+else
+  run cp /host/tmp/${PACKAGE}-${VERSION}.* rpmbuild/SOURCES/
+fi
+run cp \
+    /host/tmp/${PACKAGE}.spec \
+    rpmbuild/SPECS/
+
+run cat <<BUILD > build.sh
+#!/usr/bin/env bash
+
+rpmbuild -ba ${rpmbuild_options} rpmbuild/SPECS/${PACKAGE}.spec
+BUILD
+run chmod +x build.sh
+if [ -n "${SCL:-}" ]; then
+  run cat <<WHICH_STRIP > which-strip.sh
+#!/usr/bin/env bash
+
+which strip
+WHICH_STRIP
+  run chmod +x which-strip.sh
+  run cat <<USE_SCL_STRIP >> ~/.rpmmacros
+%__strip $(run scl enable ${SCL} ./which-strip.sh)
+USE_SCL_STRIP
+  if [ "${DEBUG:-no}" = "yes" ]; then
+    run scl enable ${SCL} ./build.sh
+  else
+    run scl enable ${SCL} ./build.sh > /dev/null
+  fi
+else
+  if [ "${DEBUG:-no}" = "yes" ]; then
+    run ./build.sh
+  else
+    run ./build.sh > /dev/null
+  fi
+fi
+
+if which ccache > /dev/null 2>&1; then
+  ccache --show-stats
+fi
+
+run mv rpmbuild/RPMS/*/* "${rpm_dir}/"
+run mv rpmbuild/SRPMS/* "${srpm_dir}/"
+
+run chown -R "$(stat --format "%u:%g" "${repositories}")" "${repositories}"
diff --git a/src/arrow/dev/tasks/macros.jinja b/src/arrow/dev/tasks/macros.jinja
new file mode 100644
index 000000000..be265caa4
--- /dev/null
+++ b/src/arrow/dev/tasks/macros.jinja
@@ -0,0 +1,198 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+{%- macro github_header() -%}
+# NOTE: must set "Crossbow" as name to have the badge links working in the
+# github comment reports!
+name: Crossbow
+on:
+  push:
+    branches:
+      - "*-github-*"
+{% endmacro %}
+
+{%- macro github_checkout_arrow() -%}
+  - name: Checkout Arrow
+    run: |
+      git clone --no-checkout {{ arrow.remote }} arrow
+      git -C arrow config core.symlinks true
+      git -C arrow fetch -t {{ arrow.remote }} {{ arrow.branch }}
+      git -C arrow checkout FETCH_HEAD
+      git -C arrow submodule update --init --recursive
+  - name: Fetch Submodules and Tags
+    shell: bash
+    run: cd arrow && ci/scripts/util_checkout.sh
+{% endmacro %}
+
+{%- macro github_login_dockerhub() -%}
+  - name: Login to Dockerhub
+    uses: docker/login-action@v1
+    with:
+      username: {{ '${{ secrets.DOCKERHUB_USER }}' }}
+      password: {{ '${{ secrets.DOCKERHUB_TOKEN }}' }}
+{% endmacro %}
+
+{%- macro github_login_ghcr() -%}
+  - name: Login to GitHub Container Registry
+    shell: bash
+    run: docker login ghcr.io -u {{ '${{ github.repository_owner }}' }} -p {{ '${{ secrets.CROSSBOW_GHCR_TOKEN }}' }}
+{% endmacro %}
+
+{%- macro github_install_archery() -%}
+  - name: Set up Python
+    uses: actions/setup-python@v2
+    with:
+      python-version: 3.8
+  - name: Install Archery
+    shell: bash
+    run: pip install -e arrow/dev/archery[all]
+{% endmacro %}
+
+{%- macro github_upload_releases(pattern) -%}
+  - name: Set up Python
+    uses: actions/setup-python@v2
+    with:
+      python-version: 3.8
+  - name: Setup Crossbow
+    shell: bash
+    run: pip install -e arrow/dev/archery[crossbow-upload]
+  - name: Upload artifacts
+    shell: bash
+    run: |
+      archery crossbow \
+      --queue-path $(pwd) \
+      --queue-remote {{ queue_remote_url }} \
+      upload-artifacts \
+      --sha {{ task.branch }} \
+      --tag {{ task.tag }} \
+    {% if pattern is string %}
+      "{{ pattern }}"
+    {% elif pattern is iterable %}
+      {% for p in pattern %}
+      "{{ p }}" {{ "\\" if not loop.last else "" }}
+      {% endfor %}
+    {% endif %}
+    env:
+      CROSSBOW_GITHUB_TOKEN: {{ '${{ secrets.CROSSBOW_GITHUB_TOKEN || secrets.GITHUB_TOKEN }}' }}
+{% endmacro %}
+
+{%- macro github_upload_gemfury(pattern) -%}
+  {%- if arrow.branch == 'master' -%}
+  - name: Upload package to Gemfury
+    shell: bash
+    run: |
+      path=$(ls {{ pattern }})
+      curl -F "package=@${path}" https://${CROSSBOW_GEMFURY_TOKEN}@push.fury.io/${CROSSBOW_GEMFURY_ORG}/
+    env:
+      CROSSBOW_GEMFURY_TOKEN: {{ '${{ secrets.CROSSBOW_GEMFURY_TOKEN }}' }}
+      CROSSBOW_GEMFURY_ORG: {{ '${{ secrets.CROSSBOW_GEMFURY_ORG }}' }}
+  {% endif %}
+{% endmacro %}
+
+{%- macro azure_checkout_arrow() -%}
+  - script: |
+      git clone --no-checkout {{ arrow.remote }} arrow
+      git -C arrow fetch -t {{ arrow.remote }} {{ arrow.branch }}
+      git -C arrow checkout FETCH_HEAD
+      git -C arrow submodule update --init --recursive
+    displayName: Clone arrow
+{% endmacro %}
+
+{%- macro azure_upload_releases(pattern) -%}
+  - task: UsePythonVersion@0
+    inputs:
+      versionSpec: '3.8'
+  - script: pip install -e arrow/dev/archery[crossbow-upload]
+    displayName: Install Crossbow
+  - bash: |
+      archery crossbow \
+        --queue-path $(pwd) \
+        --queue-remote {{ queue_remote_url }} \
+        upload-artifacts \
+        --sha {{ task.branch }} \
+        --tag {{ task.tag }} \
+      {% if pattern is string %}
+        "{{ pattern }}"
+      {% elif pattern is iterable %}
+        {% for p in pattern %}
+        "{{ p }}" {{ "\\" if not loop.last else "" }}
+        {% endfor %}
+      {% endif %}
+    env:
+      CROSSBOW_GITHUB_TOKEN: $(CROSSBOW_GITHUB_TOKEN)
+    displayName: Upload packages as a GitHub release
+{% endmacro %}
+
+{%- macro azure_upload_anaconda(pattern) -%}
+  {%- if arrow.branch == 'master' -%}
+  - task: CondaEnvironment@1
+    inputs:
+      packageSpecs: 'anaconda-client'
+      installOptions: '-c conda-forge'
+      updateConda: no
+  - script: |
+      conda install -y anaconda-client
+      anaconda -t $(CROSSBOW_ANACONDA_TOKEN) upload --force {{ pattern }}
+    displayName: Upload packages to Anaconda
+  {% endif %}
+{% endmacro %}
+
+{%- macro travis_checkout_arrow() -%}
+  - git clone --no-checkout {{ arrow.remote }} arrow
+  - git -C arrow fetch -t {{ arrow.remote }} {{ arrow.branch }}
+  - git -C arrow checkout FETCH_HEAD
+  - git -C arrow submodule update --init --recursive
+{% endmacro %}
+
+{%- macro travis_install_archery() -%}
+  - sudo -H pip3 install --upgrade pip
+  - sudo -H pip3 install docker-compose
+  - sudo -H pip3 install -e arrow/dev/archery[docker]
+{% endmacro %}
+
+{%- macro travis_docker_login() -%}
+  - echo "${DOCKERHUB_TOKEN}" | docker login --username "${DOCKERHUB_USER}" --password-stdin
+{% endmacro %}
+
+{%- macro travis_upload_releases(pattern) -%}
+  - sudo -H pip3 install pygit2==1.0
+  - sudo -H pip3 install -e arrow/dev/archery[crossbow-upload]
+  - |
+    archery crossbow \
+      --queue-path $(pwd) \
+      --queue-remote {{ queue_remote_url }} \
+      upload-artifacts \
+      --sha {{ task.branch }} \
+      --tag {{ task.tag }} \
+    {% if pattern is string %}
+      "{{ pattern }}"
+    {% elif pattern is iterable %}
+      {% for p in pattern %}
+      "{{ p }}" {{ "\\" if not loop.last else "" }}
+      {% endfor %}
+    {% endif %}
+{% endmacro %}
+
+{%- macro travis_upload_gemfury(pattern) -%}
+  {%- if arrow.branch == 'master' -%}
+  - |
+    WHEEL_PATH=$(echo arrow/python/repaired_wheels/*.whl)
+    curl \
+      -F "package=@${WHEEL_PATH}" \
+      "https://${CROSSBOW_GEMFURY_TOKEN}@push.fury.io/${CROSSBOW_GEMFURY_ORG}/"
+  {% endif %}
+{% endmacro %}
diff --git a/src/arrow/dev/tasks/nightlies.sample.yml b/src/arrow/dev/tasks/nightlies.sample.yml
new file mode 100644
index 000000000..710f7c0ad
--- /dev/null
+++ b/src/arrow/dev/tasks/nightlies.sample.yml
@@ -0,0 +1,68 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+# this travis configuration can be used to submit cron scheduled tasks
+# 1. copy this file to one of crossbow's branch (master for example) with
+#    filename .travis.yml
+# 2. setup daily cron jobs for that particular branch, see travis'
+#    documentation https://docs.travis-ci.com/user/cron-jobs/
+
+branches:
+  # don't attempt to build branches intended for windows builds
+  except:
+    - /.*win.*/
+
+os: linux
+dist: trusty
+language: generic
+
+before_install:
+    # Install Miniconda.
+    - echo `pwd`
+    - |
+      echo ""
+      echo "Installing a fresh version of Miniconda."
+      MINICONDA_URL="https://repo.continuum.io/miniconda"
+      MINICONDA_FILE="Miniconda3-latest-Linux-x86_64.sh"
+      curl -L -O "${MINICONDA_URL}/${MINICONDA_FILE}"
+      bash $MINICONDA_FILE -b
+
+    # Configure conda.
+    - |
+      echo ""
+      echo "Configuring conda."
+      source /home/travis/miniconda3/bin/activate root
+      conda config --remove channels defaults
+      conda config --add channels defaults
+      conda config --add channels conda-forge
+      conda config --set show_channel_urls true
+
+install:
+  - pushd ..
+  # to build against a specific branch of a fork
+  # git clone -b <branch> https://github.com/<user>/arrow
+  - git clone https://github.com/apache/arrow
+  - pip install dev/archery[crossbow]
+
+script:
+  # submit packaging tasks
+  - |
+    if [ $TRAVIS_EVENT_TYPE = "cron" ]; then
+      archery crossbow submit -g conda -g wheel -g linux
+    else
+      archery crossbow submit --dry-run -g conda -g wheel -g linux
+    fi
diff --git a/src/arrow/dev/tasks/nuget-packages/github.linux.yml b/src/arrow/dev/tasks/nuget-packages/github.linux.yml
new file mode 100644
index 000000000..cd03a7bfe
--- /dev/null
+++ b/src/arrow/dev/tasks/nuget-packages/github.linux.yml
@@ -0,0 +1,43 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+{% import 'macros.jinja' as macros with context %}
+
+{{ macros.github_header() }}
+
+jobs:
+  package:
+    name: Package
+    runs-on: ubuntu-latest
+    steps:
+      {{ macros.github_checkout_arrow()|indent }}
+      {{ macros.github_install_archery()|indent }}
+
+      - name: Prepare version
+        run: |
+          sed -i'' -E -e \
+            "s/^    <Version>.+<\/Version>/    <Version>{{ arrow.no_rc_semver_version }}<\/Version>/" \
+            arrow/csharp/Directory.Build.props
+      - name: Build package
+        run: |
+          pushd arrow
+          archery docker run {{ run }}
+          popd
+
+      {% set patterns = ["arrow/csharp/artifacts/**/*.nupkg",
+                         "arrow/csharp/artifacts/**/*.snupkg"] %}
+      {{ macros.github_upload_releases(patterns)|indent }}
diff --git a/src/arrow/dev/tasks/python-sdist/github.yml b/src/arrow/dev/tasks/python-sdist/github.yml
new file mode 100644
index 000000000..68371876a
--- /dev/null
+++ b/src/arrow/dev/tasks/python-sdist/github.yml
@@ -0,0 +1,45 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+{% import 'macros.jinja' as macros with context %}
+
+{{ macros.github_header() }}
+
+jobs:
+  build:
+    name: "Build sdist"
+    runs-on: ubuntu-20.04
+    steps:
+      {{ macros.github_checkout_arrow()|indent }}
+      {{ macros.github_install_archery()|indent }}
+
+      - name: Build sdist
+        run: |
+          archery docker run python-sdist
+          {% if arrow.branch == 'master' %}
+          archery docker push python-sdist || :
+          {% endif %}
+        env:
+          PYARROW_VERSION: {{ arrow.no_rc_version }}
+
+      - name: Test sdist
+        run: archery docker run ubuntu-python-sdist-test
+        env:
+          PYARROW_VERSION: {{ arrow.no_rc_version }}
+
+      {{ macros.github_upload_releases("arrow/python/dist/*.tar.gz")|indent }}
+      {{ macros.github_upload_gemfury("arrow/python/dist/*.tar.gz")|indent }}
diff --git a/src/arrow/dev/tasks/python-wheels/github.linux.amd64.yml b/src/arrow/dev/tasks/python-wheels/github.linux.amd64.yml
new file mode 100644
index 000000000..dc2386482
--- /dev/null
+++ b/src/arrow/dev/tasks/python-wheels/github.linux.amd64.yml
@@ -0,0 +1,56 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+{% import 'macros.jinja' as macros with context %}
+
+{{ macros.github_header() }}
+
+jobs:
+  build:
+    name: "Build wheel for Manylinux {{ manylinux_version }}"
+    runs-on: ubuntu-latest
+    env:
+      # archery uses these environment variables
+      ARCH: amd64
+      PYTHON: "{{ python_version }}"
+
+    steps:
+      {{ macros.github_checkout_arrow()|indent }}
+      {{ macros.github_install_archery()|indent }}
+      {{ macros.github_login_dockerhub()|indent }}
+
+      - name: Build wheel
+        shell: bash
+        run: archery docker run -e SETUPTOOLS_SCM_PRETEND_VERSION={{ arrow.no_rc_version }} python-wheel-manylinux-{{ manylinux_version }}
+
+      # TODO(kszucs): auditwheel show
+      - name: Test wheel
+        shell: bash
+        run: |
+          archery docker run python-wheel-manylinux-test-imports
+          archery docker run python-wheel-manylinux-test-unittests
+
+      {{ macros.github_upload_releases("arrow/python/repaired_wheels/*.whl")|indent }}
+      {{ macros.github_upload_gemfury("arrow/python/repaired_wheels/*.whl")|indent }}
+
+      {% if arrow.branch == 'master' %}
+      - name: Push Docker Image
+        shell: bash
+        run: |
+          archery docker push python-wheel-manylinux-{{ manylinux_version }}
+          archery docker push python-wheel-manylinux-test-unittests
+      {% endif %}
diff --git a/src/arrow/dev/tasks/python-wheels/github.osx.amd64.yml b/src/arrow/dev/tasks/python-wheels/github.osx.amd64.yml
new file mode 100644
index 000000000..8078abfd5
--- /dev/null
+++ b/src/arrow/dev/tasks/python-wheels/github.osx.amd64.yml
@@ -0,0 +1,110 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+{% import 'macros.jinja' as macros with context %}
+
+{{ macros.github_header() }}
+
+env:
+  ARROW_S3: {{ arrow_s3 }}
+  CC: "clang"
+  CXX: "clang++"
+  MACOSX_DEPLOYMENT_TARGET: "{{ macos_deployment_target }}"
+  PYARROW_BUILD_VERBOSE: 1
+  PYARROW_VERSION: "{{ arrow.no_rc_version }}"
+  PYTHON_VERSION: "{{ python_version }}"
+  PYTHON: "/Library/Frameworks/Python.framework/Versions/{{ python_version }}/bin/python{{ python_version }}"
+  VCPKG_DEFAULT_TRIPLET: x64-osx-static-release
+  VCPKG_FEATURE_FLAGS: "-manifests"
+  VCPKG_OVERLAY_TRIPLETS: {{ "${{ github.workspace }}/arrow/ci/vcpkg" }}
+  VCPKG_ROOT: {{ "${{ github.workspace }}/vcpkg" }}
+  VCPKG_VERSION: "{{ vcpkg_version }}"
+
+jobs:
+  build:
+    name: Build wheel for OS X
+    runs-on: macos-10.15
+    steps:
+      {{ macros.github_checkout_arrow()|indent }}
+
+      - name: Install System Dependencies
+        run: brew install bash bison coreutils ninja cmake
+
+      - uses: actions/cache@v2
+        id: vcpkg-cache
+        with:
+          path: vcpkg
+          key: vcpkg-{{ macos_deployment_target }}-{{ vcpkg_version }}-{{ "${{ hashFiles('arrow/ci/vcpkg/*.patch', 'arrow/ci/vcpkg/*osx*.cmake') }}" }}
+
+      - name: Install Vcpkg
+        if: steps.vcpkg-cache.outputs.cache-hit != 'true'
+        shell: bash
+        env:
+          MACOSX_DEPLOYMENT_TARGET: "10.15"
+        run: arrow/ci/scripts/install_vcpkg.sh $VCPKG_VERSION $VCPKG_ROOT
+
+      - name: Install Packages
+        run: |
+          $VCPKG_ROOT/vcpkg install \
+            abseil \
+            boost-filesystem \
+            brotli \
+            bzip2 \
+            c-ares \
+            curl \
+            flatbuffers \
+            gflags \
+            glog \
+            grpc \
+            lz4 \
+            openssl \
+            orc \
+            protobuf \
+            rapidjson \
+            re2 \
+            snappy \
+            thrift \
+            utf8proc \
+            zlib \
+            zstd
+
+      {% if arrow_s3 == "ON" %}
+      - name: Install AWS SDK C++
+        run: $VCPKG_ROOT/vcpkg install aws-sdk-cpp[config,cognito-identity,core,identity-management,s3,sts,transfer]
+      {% endif %}
+
+      - name: Install Python {{ python_version }}
+        shell: bash
+        run: sudo arrow/ci/scripts/install_python.sh macos {{ python_version }}
+
+      - name: Build Wheel
+        shell: bash
+        run: |
+          $PYTHON -m virtualenv build-env
+          source build-env/bin/activate
+          pip install --upgrade pip wheel
+          arrow/ci/scripts/python_wheel_macos_build.sh x86_64 $(pwd)/arrow $(pwd)/build
+
+      - name: Test Wheel
+        shell: bash
+        run: |
+          $PYTHON -m virtualenv test-env
+          source test-env/bin/activate
+          pip install --upgrade pip wheel
+          arrow/ci/scripts/python_wheel_unix_test.sh $(pwd)/arrow
+
+      {{ macros.github_upload_releases("arrow/python/repaired_wheels/*.whl")|indent }}
+      {{ macros.github_upload_gemfury("arrow/python/repaired_wheels/*.whl")|indent }}
diff --git a/src/arrow/dev/tasks/python-wheels/github.osx.arm64.yml b/src/arrow/dev/tasks/python-wheels/github.osx.arm64.yml
new file mode 100644
index 000000000..e5456dbfc
--- /dev/null
+++ b/src/arrow/dev/tasks/python-wheels/github.osx.arm64.yml
@@ -0,0 +1,157 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Prerequisits on the host:
+# - brew install bash bison coreutils ninja cmake
+# - sudo arrow/ci/scripts/install_python.sh macos 3.9
+
+{% import 'macros.jinja' as macros with context %}
+
+{{ macros.github_header() }}
+
+env:
+  ARROW_FLIGHT: OFF
+  ARROW_JEMALLOC: OFF
+  ARROW_SIMD_LEVEL: "{{ arrow_simd_level }}"
+  CC: "clang"
+  CMAKE_BUILD_TYPE: release
+  CMAKE_CXX_COMPILER_LAUNCHER: "ccache"
+  CXX: "clang++"
+  MACOSX_DEPLOYMENT_TARGET: "{{ macos_deployment_target }}"
+  PYARROW_BUILD_VERBOSE: 1
+  PYARROW_VERSION: "{{ arrow.no_rc_version }}"
+  PYTHON_VERSION: "{{ python_version }}"
+  PYTHON: "/Library/Frameworks/Python.framework/Versions/{{ python_version }}/bin/python{{ python_version }}"
+  VCPKG_DEFAULT_TRIPLET: {{ arch }}-osx-static-release
+  VCPKG_FEATURE_FLAGS: "-manifests"
+  VCPKG_OVERLAY_TRIPLETS: {{ "${{ github.workspace }}/arrow/ci/vcpkg" }}
+  VCPKG_ROOT: {{ "${{ github.workspace }}/vcpkg" }}
+  VCPKG_VERSION: "{{ vcpkg_version }}"
+
+jobs:
+  build:
+    name: Build wheel for OS X
+    runs-on: self-hosted
+    steps:
+      - name: Cleanup
+        shell: bash
+        run: rm -rf arrow vcpkg build crossbow-env build-env test-*-env
+
+      {{ macros.github_checkout_arrow()|indent }}
+
+      - name: Add Brew's Bison to PATH
+        shell: bash
+        run: echo "/opt/homebrew/opt/bison/bin" >> $GITHUB_PATH
+
+      - name: Install Vcpkg
+        shell: bash
+        env:
+          MACOSX_DEPLOYMENT_TARGET: "11.0"
+        run: arch -arm64 arrow/ci/scripts/install_vcpkg.sh $VCPKG_VERSION $VCPKG_ROOT
+
+      - name: Install OpenSSL
+        shell: bash
+        run: arch -arm64 $VCPKG_ROOT/vcpkg install openssl
+
+      {% if arch == "universal2" %}
+      # OpenSSL doesn't provide an universal2 configuration yet, so vcpkg is
+      # unable to propagate the list of architectures from VCPKG_OSX_ARCHIETCTURES.
+      # In order to prevent link time warnings (which may turn out to be errors)
+      # we compile OpenSSL separately for the two architectures and merge the
+      # binaries into universal2 ones using `lipo`.
+      - name: Create universal binaries for OpenSSL
+        shell: bash
+        run: |
+          for arch in arm64 x64; do
+            VCPKG_DEFAULT_TRIPLET=${arch}-osx-static-release arch -arm64 $VCPKG_ROOT/vcpkg install openssl
+          done
+          for lib in libcrypto libssl; do
+            lipo -create $VCPKG_ROOT/installed/arm64-osx-static-release/lib/${lib}.a \
+                         $VCPKG_ROOT/installed/x64-osx-static-release/lib/${lib}.a \
+                 -output $VCPKG_ROOT/installed/universal2-osx-static-release/lib/${lib}.a
+          done
+      {% endif %}
+
+      - name: Install Packages
+        run: |
+          arch -arm64 $VCPKG_ROOT/vcpkg install \
+            aws-sdk-cpp[config,cognito-identity,core,identity-management,s3,sts,transfer] \
+            boost-filesystem \
+            brotli \
+            bzip2 \
+            c-ares \
+            curl \
+            flatbuffers \
+            gflags \
+            glog \
+            lz4 \
+            orc \
+            protobuf \
+            rapidjson \
+            re2 \
+            snappy \
+            thrift \
+            utf8proc \
+            zlib \
+            zstd
+
+      - name: Build Wheel
+        shell: bash
+        run: |
+          $PYTHON -m virtualenv build-env
+          source build-env/bin/activate
+          pip install --upgrade pip wheel
+          arch -arm64 arrow/ci/scripts/python_wheel_macos_build.sh {{ arch }} $(pwd)/arrow $(pwd)/build
+
+      - name: Test Wheel on ARM64
+        shell: bash
+        env:
+          PYTEST_ADDOPTS: "-k 'not test_cancellation'"
+        run: |
+          $PYTHON -m virtualenv test-arm64-env
+          source test-arm64-env/bin/activate
+          pip install --upgrade pip wheel
+          arch -arm64 arrow/ci/scripts/python_wheel_unix_test.sh $(pwd)/arrow
+
+      {% if arch == "universal2" %}
+      - name: Test Wheel on AMD64
+        shell: bash
+        env:
+          PYTEST_ADDOPTS: "-k 'not test_cancellation'"
+        run: |
+          $PYTHON -m virtualenv test-amd64-env
+          source test-amd64-env/bin/activate
+          pip install --upgrade pip wheel
+          arch -x86_64 arrow/ci/scripts/python_wheel_unix_test.sh $(pwd)/arrow
+      {% endif %}
+
+      - name: Upload artifacts
+        shell: bash
+        run: |
+          $PYTHON -m virtualenv crossbow-env
+          source crossbow-env/bin/activate
+          arch -x86_64 pip install -e arrow/dev/archery[crossbow-upload]
+          arch -x86_64 archery crossbow \
+          --queue-path $(pwd) \
+          --queue-remote {{ queue_remote_url }} \
+          upload-artifacts \
+          --sha {{ task.branch }} \
+          --tag {{ task.tag }} \
+          "arrow/python/repaired_wheels/*.whl"
+        env:
+          CROSSBOW_GITHUB_TOKEN: {{ "${{ secrets.CROSSBOW_GITHUB_TOKEN || secrets.GITHUB_TOKEN }}" }}
+
+      {{ macros.github_upload_gemfury("arrow/python/repaired_wheels/*.whl")|indent }}
diff --git a/src/arrow/dev/tasks/python-wheels/github.windows.yml b/src/arrow/dev/tasks/python-wheels/github.windows.yml
new file mode 100644
index 000000000..f9989aed0
--- /dev/null
+++ b/src/arrow/dev/tasks/python-wheels/github.windows.yml
@@ -0,0 +1,58 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+{% import 'macros.jinja' as macros with context %}
+
+{{ macros.github_header() }}
+
+jobs:
+  build:
+    name: "Build wheel for Windows"
+    runs-on: windows-2019
+    env:
+      # archery uses this environment variable
+      PYTHON: "{{ python_version }}"
+      # this is a private repository at the moment (mostly because of licensing
+      # consideration of windows images with visual studio), but anyone can
+      # recreate the image by manually building it via:
+      # `archery build python-wheel-windows-vs2017`
+      # note that we don't run docker build since there wouldn't be a cache hit
+      # and rebuilding the dependencies takes a fair amount of time
+      REPO: ghcr.io/ursacomputing/arrow
+      # prefer the docker cli over docker-compose
+      ARCHERY_USE_DOCKER_CLI: 1
+
+    steps:
+      {{ macros.github_checkout_arrow()|indent }}
+      {{ macros.github_login_ghcr()|indent }}
+      {{ macros.github_install_archery()|indent }}
+
+      - name: Build wheel
+        shell: cmd
+        run: archery docker run --no-build -e SETUPTOOLS_SCM_PRETEND_VERSION={{ arrow.no_rc_version }} python-wheel-windows-vs2017
+
+      # Two layers of the official python 3.6 windows image are not available for download.
+      # Docker pull returns with unexpected status resolving reader: 403 Forbidden.
+      # See https://issues.apache.org/jira/browse/ARROW-14424
+      {% if python_version != "3.6" %}
+      - name: Test wheel
+        shell: cmd
+        run: archery docker run python-wheel-windows-test
+      {% endif %}
+
+      {{ macros.github_upload_releases("arrow/python/dist/*.whl")|indent }}
+      {{ macros.github_upload_gemfury("arrow/python/dist/*.whl")|indent }}
diff --git a/src/arrow/dev/tasks/python-wheels/travis.linux.arm64.yml b/src/arrow/dev/tasks/python-wheels/travis.linux.arm64.yml
new file mode 100644
index 000000000..d32d89d83
--- /dev/null
+++ b/src/arrow/dev/tasks/python-wheels/travis.linux.arm64.yml
@@ -0,0 +1,73 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+{% import 'macros.jinja' as macros with context %}
+
+arch: arm64-graviton2
+virt: vm
+os: linux
+dist: focal
+group: edge
+language: minimal
+
+addons:
+  apt:
+    packages:
+      - libgit2-dev
+      - python3-pip
+
+services:
+  - docker
+
+# don't build twice
+if: tag IS blank
+
+env:
+  global:
+    - BUILD_REF={{ arrow.head }}
+    - TRAVIS_TAG={{ task.tag }}
+    # archery uses these environment variables
+    - ARCH=arm64v8
+    - PYTHON="{{ python_version }}"
+
+before_script:
+  - set -e
+  {{ macros.travis_checkout_arrow() }}
+  {{ macros.travis_docker_login() }}
+
+script:
+  # Install Archery and Crossbow dependencies
+  {{ macros.travis_install_archery() }}
+
+  # Build and Test packages
+  # output something every minutes to prevent travis from killing the build
+  - while sleep 1m; do echo "=====[ $SECONDS seconds still running ]====="; done &
+  - archery docker run -e SETUPTOOLS_SCM_PRETEND_VERSION={{ arrow.no_rc_version }} python-wheel-manylinux-{{ manylinux_version }}
+  - archery docker run python-wheel-manylinux-test-imports
+  - archery docker run python-wheel-manylinux-test-unittests
+  - kill %1
+
+after_success:
+  # Upload wheel as github artifact
+  {{ macros.travis_upload_releases("arrow/python/repaired_wheels/*.whl") }}
+  {{ macros.travis_upload_gemfury("arrow/python/repaired_wheels/*.whl") }}
+
+  {% if arrow.branch == 'master' %}
+  # Push the docker image to dockerhub
+  - archery docker push python-wheel-manylinux-{{ manylinux_version }}
+  - archery docker push python-wheel-manylinux-test-unittests
+  {% endif %}
diff --git a/src/arrow/dev/tasks/r/azure.linux.yml b/src/arrow/dev/tasks/r/azure.linux.yml
new file mode 100644
index 000000000..92e725f68
--- /dev/null
+++ b/src/arrow/dev/tasks/r/azure.linux.yml
@@ -0,0 +1,65 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+jobs:
+  - job: linux
+    pool:
+      vmImage: ubuntu-latest
+    timeoutInMinutes: 360
+    steps:
+      - script: |
+          set -ex
+          git clone --no-checkout {{ arrow.remote }} arrow
+          git -C arrow fetch -t {{ arrow.remote }} {{ arrow.branch }}
+          git -C arrow checkout FETCH_HEAD
+          git -C arrow submodule update --init --recursive
+        displayName: Clone arrow
+
+      - script: |
+          set -ex
+          docker -v
+          docker-compose -v
+          cd arrow
+          export R_ORG={{ r_org }}
+          export R_IMAGE={{ r_image }}
+          export R_TAG={{ r_tag }}
+          export DEVTOOLSET_VERSION={{ devtoolset_version|default("-1") }}
+          docker-compose pull --ignore-pull-failures r
+          docker-compose build r
+        displayName: Docker build
+
+      - script: |
+          set -ex
+          cd arrow
+          export R_ORG={{ r_org }}
+          export R_IMAGE={{ r_image }}
+          export R_TAG={{ r_tag }}
+          export ARROW_R_DEV={{ not_cran|default("TRUE") }}
+          # Note that by default, ci/scripts/r_test.sh sets NOT_CRAN=true
+          # if ARROW_R_DEV=TRUE. Pass `-e NOT_CRAN=false` to turn that off.
+          docker-compose run {{ flags|default("") }} r
+        displayName: Docker run
+
+      - script: |
+          set -ex
+          cat arrow/r/check/arrow.Rcheck/00install.out
+        displayName: Dump install logs
+        condition: succeededOrFailed()
+      - script: |
+          set -ex
+          cat arrow/r/check/arrow.Rcheck/tests/testthat.Rout*
+        displayName: Dump test logs
+        condition: succeededOrFailed()
diff --git a/src/arrow/dev/tasks/r/github.devdocs.yml b/src/arrow/dev/tasks/r/github.devdocs.yml
new file mode 100644
index 000000000..5591e6587
--- /dev/null
+++ b/src/arrow/dev/tasks/r/github.devdocs.yml
@@ -0,0 +1,78 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+{% import 'macros.jinja' as macros with context %}
+
+{{ macros.github_header() }}
+
+jobs:
+  devdocs:
+    name: 'R devdocs {{ "${{ matrix.os }}" }}'
+    runs-on: {{ "${{ matrix.os }}" }}
+    strategy:
+      fail-fast: false
+      matrix:
+        os: [macOS-latest, ubuntu-20.04]
+
+    steps:
+      {{ macros.github_checkout_arrow()|indent }}
+
+      - uses: r-lib/actions/setup-r@v1
+      - uses: r-lib/actions/setup-pandoc@v1
+      - name: Install knitr, rmarkdown
+        run: |
+          install.packages(c("rmarkdown", "knitr", "sessioninfo"))
+        shell: Rscript {0}
+      - name: Session info
+        run: |
+          options(width = 100)
+          pkgs <- installed.packages()[, "Package"]
+          sessioninfo::session_info(pkgs, include_base = TRUE)
+        shell: Rscript {0}
+      - name: Remove system gfortran so that brew can install gcc successfully
+        run: rm -f /usr/local/bin/gfortran
+      - name: Write the install script
+        env:
+          RUN_DEVDOCS: TRUE
+          DEVDOCS_MACOS: {{ "${{contains(matrix.os, 'macOS')}}" }}
+          DEVDOCS_UBUNTU: {{ "${{contains(matrix.os, 'ubuntu')}}" }}
+        run: |
+          # This isn't actually rendering the docs, but will save arrow/r/vignettes/script.sh
+          # which can be sourced to install arrow.
+          rmarkdown::render("arrow/r/vignettes/developing.Rmd")
+        shell: Rscript {0}
+      - name: Install from the devdocs
+        env:
+          LIBARROW_BINARY: FALSE
+          ARROW_R_DEV: TRUE
+        run: bash arrow/r/vignettes/script.sh
+        shell: bash
+      - name: Ensure that the Arrow package is loadable and we have the correct one
+        run: |
+          echo $LD_LIBRARY_PATH
+          R --no-save <<EOF
+          Sys.getenv("LD_LIBRARY_PATH")
+          library(arrow)
+          arrow_info()
+          EOF
+        shell: bash -l {0}
+      - name: Save the install script
+        uses: actions/upload-artifact@v2
+        with:
+          name: {{ "devdocs-script_os-${{ matrix.os }}_sysinstall-${{ matrix.system-install }}" }}
+          path: arrow/r/vignettes/script.sh
+        if: always()
diff --git a/src/arrow/dev/tasks/r/github.linux.arrow.version.back.compat.yml b/src/arrow/dev/tasks/r/github.linux.arrow.version.back.compat.yml
new file mode 100644
index 000000000..e48b67ac6
--- /dev/null
+++ b/src/arrow/dev/tasks/r/github.linux.arrow.version.back.compat.yml
@@ -0,0 +1,117 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+# NOTE: must set "Crossbow" as name to have the badge links working in the
+# github comment reports!
+name: Crossbow
+
+on:
+  push
+
+jobs:
+  write-files:
+    name: "Write files"
+    runs-on: ubuntu-20.04
+    strategy:
+      fail-fast: false
+    env:
+      ARROW_R_DEV: "TRUE"
+      RSPM: "https://packagemanager.rstudio.com/cran/__linux__/focal/latest"
+    steps:
+      - name: Checkout Arrow
+        run: |
+          git clone --no-checkout {{ arrow.remote }} arrow
+          git -C arrow fetch -t {{ arrow.remote }} {{ arrow.branch }}
+          git -C arrow checkout FETCH_HEAD
+          git -C arrow submodule update --init --recursive
+      - name: Free Up Disk Space
+        shell: bash
+        run: arrow/ci/scripts/util_cleanup.sh
+      - name: Fetch Submodules and Tags
+        shell: bash
+        run: cd arrow && ci/scripts/util_checkout.sh
+      - uses: r-lib/actions/setup-r@v1
+      - name: Install dependencies
+        run: |
+          install.packages(c("remotes", "glue", "sys"))
+          remotes::install_deps("arrow/r", dependencies = TRUE)
+        shell: Rscript {0}
+      - name: Install Arrow
+        run: |
+          cd arrow/r
+          R CMD INSTALL .
+        shell: bash
+      - name: Write files
+        run: |
+          cd arrow/r
+          R -f extra-tests/write-files.R
+        shell: bash
+
+      - name: Upload the parquet artifacts
+        uses: actions/upload-artifact@v2
+        with:
+          name: files
+          path: arrow/r/extra-tests/files
+
+  read-files:
+    name: "Read files with Arrow {{ '${{ matrix.config.old_arrow_version }}' }}"
+    needs: [write-files]
+    runs-on: ubuntu-20.04
+    strategy:
+      fail-fast: false
+      matrix:
+        config:
+        # We use the R version that was released at the time of the arrow release in order
+        # to make sure we can download binaries from RSPM.
+        - { old_arrow_version: '5.0.0', r: '4.1' }
+        - { old_arrow_version: '4.0.0', r: '4.0' }
+        - { old_arrow_version: '3.0.0', r: '4.0' }
+        - { old_arrow_version: '2.0.0', r: '4.0' }
+        - { old_arrow_version: '1.0.1', r: '4.0' }
+    env:
+      ARROW_R_DEV: "TRUE"
+      RSPM: "https://packagemanager.rstudio.com/cran/__linux__/focal/latest"
+      OLD_ARROW_VERSION: {{ '${{ matrix.config.old_arrow_version }}' }}
+    steps:
+      - name: Checkout Arrow
+        run: |
+          git clone --no-checkout {{ arrow.remote }} arrow
+          git -C arrow fetch -t {{ arrow.remote }} {{ arrow.branch }}
+          git -C arrow checkout FETCH_HEAD
+          git -C arrow submodule update --init --recursive
+      - uses: r-lib/actions/setup-r@v1
+        with:
+          r-version: {{ '${{ matrix.config.r }}' }}
+      - name: Install old Arrow
+        run: |
+          install.packages(c("remotes", "testthat"))
+          remotes::install_version("arrow",  "{{ '${{ matrix.config.old_arrow_version }}' }}")
+        shell: Rscript {0}
+      - name: Setup our testing directory, copy only the tests to it.
+        run: |
+          mkdir -p extra-tests/files
+          cp arrow/r/extra-tests/helper*.R extra-tests/
+          cp arrow/r/extra-tests/test-*.R extra-tests/
+      - name: Download artifacts
+        uses: actions/download-artifact@v2
+        with:
+          name: files
+          path: extra-tests/files
+      - name: Test reading
+        run: |
+          testthat::test_dir("extra-tests")
+        shell: Rscript {0}
diff --git a/src/arrow/dev/tasks/r/github.linux.cran.yml b/src/arrow/dev/tasks/r/github.linux.cran.yml
new file mode 100644
index 000000000..03d22dcbf
--- /dev/null
+++ b/src/arrow/dev/tasks/r/github.linux.cran.yml
@@ -0,0 +1,79 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+# NOTE: must set "Crossbow" as name to have the badge links working in the
+# github comment reports!
+name: Crossbow
+
+on:
+  push:
+    branches:
+      - "*-github-*"
+
+jobs:
+  as-cran:
+    name: "rhub/{{ MATRIX }}"
+    runs-on: ubuntu-latest
+    strategy:
+      fail-fast: false
+      matrix:
+        # See https://hub.docker.com/r/rhub
+        r_image:
+          - debian-gcc-devel
+          - debian-gcc-patched
+          - debian-gcc-release
+          - fedora-gcc-devel
+          - fedora-clang-devel
+    env:
+      R_ORG: "rhub"
+      R_IMAGE: {{ MATRIX }}
+      R_TAG: "latest"
+      ARROW_R_DEV: "FALSE"
+    steps:
+      - name: Checkout Arrow
+        run: |
+          git clone --no-checkout {{ arrow.remote }} arrow
+          git -C arrow fetch -t {{ arrow.remote }} {{ arrow.branch }}
+          git -C arrow checkout FETCH_HEAD
+          git -C arrow submodule update --init --recursive
+      - name: Free Up Disk Space
+        shell: bash
+        run: arrow/ci/scripts/util_cleanup.sh
+      - name: Fetch Submodules and Tags
+        shell: bash
+        run: cd arrow && ci/scripts/util_checkout.sh
+      - name: Docker Pull
+        shell: bash
+        run: cd arrow && docker-compose pull --ignore-pull-failures r
+      - name: Docker Build
+        shell: bash
+        run: cd arrow && docker-compose build r
+      - name: Docker Run
+        shell: bash
+        run: cd arrow && docker-compose run r
+      - name: Dump install logs
+        run: cat arrow/r/check/arrow.Rcheck/00install.out
+        if: always()
+      - name: Dump test logs
+        run: cat arrow/r/check/arrow.Rcheck/tests/testthat.Rout*
+        if: always()
+      - name: Save the test output
+        if: always()
+        uses: actions/upload-artifact@v2
+        with:
+          name: test-output
+          path: arrow/r/check/arrow.Rcheck/tests/testthat.Rout*
diff --git a/src/arrow/dev/tasks/r/github.linux.offline.build.yml b/src/arrow/dev/tasks/r/github.linux.offline.build.yml
new file mode 100644
index 000000000..60685b18c
--- /dev/null
+++ b/src/arrow/dev/tasks/r/github.linux.offline.build.yml
@@ -0,0 +1,117 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+# NOTE: must set "Crossbow" as name to have the badge links working in the
+# github comment reports!
+name: Crossbow
+
+on:
+  push:
+    branches:
+      - "*-github-*"
+
+jobs:
+  grab-dependencies:
+    name: "Download thirdparty dependencies"
+    runs-on: ubuntu-20.04
+    strategy:
+      fail-fast: false
+    env:
+      ARROW_R_DEV: "TRUE"
+      RSPM: "https://packagemanager.rstudio.com/cran/__linux__/focal/latest"
+    steps:
+      - name: Checkout Arrow
+        run: |
+          git clone --no-checkout {{ arrow.remote }} arrow
+          git -C arrow fetch -t {{ arrow.remote }} {{ arrow.branch }}
+          git -C arrow checkout FETCH_HEAD
+          git -C arrow submodule update --init --recursive
+      - name: Free Up Disk Space
+        shell: bash
+        run: arrow/ci/scripts/util_cleanup.sh
+      - name: Fetch Submodules and Tags
+        shell: bash
+        run: cd arrow && ci/scripts/util_checkout.sh
+      - uses: r-lib/actions/setup-r@v1
+      - name: Pull Arrow dependencies
+        run: |
+          cd arrow/r
+          # This is `make build`, but with no vignettes and not running `make doc`
+          cp ../NOTICE.txt inst/NOTICE.txt
+          rsync --archive --delete ../cpp tools/
+          cp -p ../.env tools/
+          cp -p ../NOTICE.txt tools/
+          cp -p ../LICENSE.txt tools/
+          R CMD build --no-build-vignettes --no-manual .
+          built_tar=$(ls -1 arrow*.tar.gz | head -n 1)
+          R -e "source('R/install-arrow.R'); create_package_with_all_dependencies(dest_file = 'arrow_with_deps.tar.gz', source_file = \"${built_tar}\")"
+        shell: bash
+      - name: Upload the third party dependency artifacts
+        uses: actions/upload-artifact@v2
+        with:
+          name: thirdparty_deps
+          path: arrow/r/arrow_with_deps.tar.gz
+
+  intall-offline:
+    name: "Install offline"
+    needs: [grab-dependencies]
+    runs-on: ubuntu-20.04
+    strategy:
+      fail-fast: false
+    env:
+      ARROW_R_DEV: TRUE
+      RSPM: "https://packagemanager.rstudio.com/cran/__linux__/focal/latest"
+    steps:
+      - name: Checkout Arrow
+        run: |
+          git clone --no-checkout {{ arrow.remote }} arrow
+          git -C arrow fetch -t {{ arrow.remote }} {{ arrow.branch }}
+          git -C arrow checkout FETCH_HEAD
+          git -C arrow submodule update --init --recursive
+      - uses: r-lib/actions/setup-r@v1
+      - name: Download artifacts
+        uses: actions/download-artifact@v2
+        with:
+          name: thirdparty_deps
+          path: arrow/r/
+      - name: Install system dependencies
+        run: |
+          sudo apt-get update
+          sudo apt install libcurl4-openssl-dev libssl-dev
+      - name: Install dependencies
+        run: |
+          install.packages(c("remotes", "glue", "sys"))
+          remotes::install_deps("arrow/r", dependencies = TRUE)
+        shell: Rscript {0}
+      - name: Install
+        env:
+          TEST_OFFLINE_BUILD: true
+          LIBARROW_MINIMAL: false
+        run: |
+          cd arrow/r
+          R CMD INSTALL --install-tests --no-test-load --no-docs --no-help --no-byte-compile arrow_with_deps.tar.gz
+      - name: Run the tests
+        run: R -e 'if(tools::testInstalledPackage("arrow") != 0L) stop("There was a test failure.")'
+      - name: Dump test logs
+        run: cat arrow-tests/testthat.Rout*
+        if: always()
+      - name: Save the test output
+        uses: actions/upload-artifact@v2
+        with:
+          name: test-output
+          path: arrow-tests/testthat.Rout*
+        if: always()
diff --git a/src/arrow/dev/tasks/r/github.linux.rchk.yml b/src/arrow/dev/tasks/r/github.linux.rchk.yml
new file mode 100644
index 000000000..72ff26969
--- /dev/null
+++ b/src/arrow/dev/tasks/r/github.linux.rchk.yml
@@ -0,0 +1,77 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+# NOTE: must set "Crossbow" as name to have the badge links working in the
+# github comment reports!
+name: Crossbow
+
+on:
+  push:
+    branches:
+      - "*-github-*"
+
+jobs:
+  as-cran:
+    name: "rchk"
+    runs-on: ubuntu-20.04
+    strategy:
+      fail-fast: false
+    env:
+      ARROW_R_DEV: "FALSE"
+      RSPM: "https://packagemanager.rstudio.com/cran/__linux__/focal/latest"
+    steps:
+      - name: Checkout Arrow
+        run: |
+          git clone --no-checkout {{ arrow.remote }} arrow
+          git -C arrow fetch -t {{ arrow.remote }} {{ arrow.branch }}
+          git -C arrow checkout FETCH_HEAD
+          git -C arrow submodule update --init --recursive
+      - name: Free Up Disk Space
+        shell: bash
+        run: arrow/ci/scripts/util_cleanup.sh
+      - uses: r-lib/actions/setup-r@v1
+      - uses: r-lib/actions/setup-pandoc@v1
+      - name: Install dependencies
+        run: |
+          install.packages("remotes")
+          remotes::install_deps("arrow/r", dependencies = TRUE)
+        shell: Rscript {0}
+      - name: Build arrow package
+        run: |
+          R CMD build --no-build-vignettes arrow/r
+          mkdir packages
+          mv arrow_*.tar.gz packages
+      - name: rchk
+        run: |
+          docker run -v `pwd`/packages:/rchk/packages kalibera/rchk:latest /rchk/packages/arrow_*.tar.gz |& tee rchk.out
+      - name: Confirm that rchk has no errors
+        # Suspicious call, [UP], and [PB] are all of the error types currently at
+        # https://github.com/kalibera/cran-checks/tree/master/rchk/results
+        # though this might not be exhaustive, there does not appear to be a way to have rchk return an error code
+        # CRAN also will remove some of the outputs (especially those related to Rcpp and strptime, e.g.
+        # ERROR: too many states (abstraction error?))
+        # https://github.com/kalibera/rchk
+        run: |
+          if [ $(grep -c "Suspicious call" rchk.out) -gt 0 ] || [ $(grep -c "\[UP\]" rchk.out) -gt 0 ] || [ $(grep -c "\[PB\]" rchk.out) -gt 0 ]; then
+            echo "Found rchk errors"
+            cat rchk.out
+            exit 1
+          fi
+        if: always()
+      - name: Dump rchk output logs
+        run: cat rchk.out
+        if: always()
diff --git a/src/arrow/dev/tasks/r/github.linux.revdepcheck.yml b/src/arrow/dev/tasks/r/github.linux.revdepcheck.yml
new file mode 100644
index 000000000..80071171b
--- /dev/null
+++ b/src/arrow/dev/tasks/r/github.linux.revdepcheck.yml
@@ -0,0 +1,77 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+# NOTE: must set "Crossbow" as name to have the badge links working in the
+# github comment reports!
+name: Crossbow
+
+on:
+  push:
+    branches:
+      - "*-github-*"
+
+jobs:
+  r-versions:
+    name: "rstudio/r-base:latest-focal"
+    runs-on: ubuntu-latest
+    strategy:
+      fail-fast: false
+    env:
+      R_ORG: "rstudio"
+      R_IMAGE: "r-base"
+      R_TAG: "latest-focal"
+      ARROW_R_DEV: "TRUE"
+    steps:
+      - name: Checkout Arrow
+        run: |
+          git clone --no-checkout {{ arrow.remote }} arrow
+          git -C arrow fetch -t {{ arrow.remote }} {{ arrow.branch }}
+          git -C arrow checkout FETCH_HEAD
+          git -C arrow submodule update --init --recursive
+      - name: Free Up Disk Space
+        shell: bash
+        run: arrow/ci/scripts/util_cleanup.sh
+      - name: Fetch Submodules and Tags
+        shell: bash
+        run: cd arrow && ci/scripts/util_checkout.sh
+      - name: Docker Pull
+        shell: bash
+        run: cd arrow && docker-compose pull --ignore-pull-failures r
+      - name: Docker Build
+        shell: bash
+        run: cd arrow && docker-compose build r-revdepcheck
+      - name: Docker Run
+        shell: bash
+        run: cd arrow && docker-compose run r-revdepcheck
+      - name: revdepcheck CRAN report
+        if: always()
+        shell: bash
+        run: cat arrow/r/revdep/cran.md
+      - name: revdepcheck failures
+        if: always()
+        shell: bash
+        run: cat arrow/r/revdep/failures.md
+      - name: revdepcheck problems
+        if: always()
+        shell: bash
+        run: cat arrow/r/revdep/problems.md
+      - name: Save the revdep output
+        if: always()
+        uses: actions/upload-artifact@v2
+        with:
+          name: revdepcheck-folder
+          path: arrow/r/revdep
diff --git a/src/arrow/dev/tasks/r/github.linux.versions.yml b/src/arrow/dev/tasks/r/github.linux.versions.yml
new file mode 100644
index 000000000..f383fe8d0
--- /dev/null
+++ b/src/arrow/dev/tasks/r/github.linux.versions.yml
@@ -0,0 +1,81 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+# NOTE: must set "Crossbow" as name to have the badge links working in the
+# github comment reports!
+name: Crossbow
+
+on:
+  push:
+    branches:
+      - "*-github-*"
+
+jobs:
+  r-versions:
+    name: "rstudio/r-base:{{ MATRIX }}-bionic"
+    runs-on: ubuntu-latest
+    strategy:
+      fail-fast: false
+      matrix:
+        # See https://hub.docker.com/r/rstudio/r-base
+        r_version:
+          # We test devel, release, and oldrel in regular CI.
+          # This is for older versions
+          # rlang and vctrs depend on R >= 3.3
+          - "3.3"
+          - "3.4"
+          - "3.5"
+          - "3.6"
+    env:
+      R_ORG: "rstudio"
+      R_IMAGE: "r-base"
+      R_TAG: "{{ MATRIX }}-bionic"
+      ARROW_R_DEV: "TRUE"
+    steps:
+      - name: Checkout Arrow
+        run: |
+          git clone --no-checkout {{ arrow.remote }} arrow
+          git -C arrow fetch -t {{ arrow.remote }} {{ arrow.branch }}
+          git -C arrow checkout FETCH_HEAD
+          git -C arrow submodule update --init --recursive
+      - name: Free Up Disk Space
+        shell: bash
+        run: arrow/ci/scripts/util_cleanup.sh
+      - name: Fetch Submodules and Tags
+        shell: bash
+        run: cd arrow && ci/scripts/util_checkout.sh
+      - name: Docker Pull
+        shell: bash
+        run: cd arrow && docker-compose pull --ignore-pull-failures r
+      - name: Docker Build
+        shell: bash
+        run: cd arrow && docker-compose build r
+      - name: Docker Run
+        shell: bash
+        run: cd arrow && docker-compose run r
+      - name: Dump install logs
+        run: cat arrow/r/check/arrow.Rcheck/00install.out
+        if: always()
+      - name: Dump test logs
+        run: cat arrow/r/check/arrow.Rcheck/tests/testthat.Rout*
+        if: always()
+      - name: Save the test output
+        if: always()
+        uses: actions/upload-artifact@v2
+        with:
+          name: test-output
+          path: arrow/r/check/arrow.Rcheck/tests/testthat.Rout*
diff --git a/src/arrow/dev/tasks/r/github.macos-linux.local.yml b/src/arrow/dev/tasks/r/github.macos-linux.local.yml
new file mode 100644
index 000000000..79e3332af
--- /dev/null
+++ b/src/arrow/dev/tasks/r/github.macos-linux.local.yml
@@ -0,0 +1,87 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+# NOTE: must set "Crossbow" as name to have the badge links working in the
+# github comment reports!
+name: Crossbow
+
+on:
+  push:
+    branches:
+      - "*-github-*"
+
+jobs:
+  autobrew:
+    name: "install from local source"
+    runs-on: {{ "${{ matrix.os }}" }}
+    strategy:
+      fail-fast: false
+      matrix:
+        os: [macOS-latest, ubuntu-20.04]
+
+    steps:
+      - name: Checkout Arrow
+        run: |
+          git clone --no-checkout {{ arrow.remote }} arrow
+          git -C arrow fetch -t {{ arrow.remote }} {{ arrow.branch }}
+          git -C arrow checkout FETCH_HEAD
+          git -C arrow submodule update --init --recursive
+      - name: Configure non-autobrew dependencies (macos)
+        run: |
+          cd arrow/r
+          brew install openssl
+        if: contains(matrix.os, 'macOS')
+      - name: Configure non-autobrew dependencies (linux)
+        run: |
+          cd arrow/r
+          sudo apt-get update
+          sudo apt install libcurl4-openssl-dev libssl-dev
+        if: contains(matrix.os, 'ubuntu')
+      - uses: r-lib/actions/setup-r@v1
+      - name: Install dependencies
+        run: |
+          install.packages("remotes")
+          remotes::install_deps("arrow/r", dependencies = TRUE)
+          remotes::install_cran(c("rcmdcheck", "sys", "sessioninfo"))
+        shell: Rscript {0}
+      - name: Session info
+        run: |
+          options(width = 100)
+          pkgs <- installed.packages()[, "Package"]
+          sessioninfo::session_info(pkgs, include_base = TRUE)
+        shell: Rscript {0}
+      - name: Install
+        env:
+          _R_CHECK_CRAN_INCOMING_: false
+          ARROW_USE_PKG_CONFIG: false
+          FORCE_BUNDLED_BUILD: true
+          LIBARROW_MINIMAL: false
+          ARROW_R_DEV: TRUE
+        run: |
+          cd arrow/r
+          R CMD INSTALL . --install-tests
+      - name: Run the tests
+        run: R -e 'if(tools::testInstalledPackage("arrow") != 0L) stop("There was a test failure.")'
+      - name: Dump test logs
+        run: cat arrow-tests/testthat.Rout*
+        if: failure()
+      - name: Save the test output
+        uses: actions/upload-artifact@v2
+        with:
+          name: test-output
+          path: arrow-tests/testthat.Rout*
+        if: always()
diff --git a/src/arrow/dev/tasks/r/github.macos.autobrew.yml b/src/arrow/dev/tasks/r/github.macos.autobrew.yml
new file mode 100644
index 000000000..1b8500f64
--- /dev/null
+++ b/src/arrow/dev/tasks/r/github.macos.autobrew.yml
@@ -0,0 +1,78 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+# NOTE: must set "Crossbow" as name to have the badge links working in the
+# github comment reports!
+name: Crossbow
+
+on:
+  push:
+    branches:
+      - "*-github-*"
+
+jobs:
+  autobrew:
+    name: "Autobrew"
+    runs-on: macOS-latest
+    steps:
+      - name: Checkout Arrow
+        run: |
+          git clone --no-checkout {{ arrow.remote }} arrow
+          git -C arrow fetch -t {{ arrow.remote }} {{ arrow.branch }}
+          git -C arrow checkout FETCH_HEAD
+          git -C arrow submodule update --init --recursive
+      - name: Configure autobrew script
+        run: |
+          cd arrow/r
+          # Put the formula inside r/ so that it's included in the package build
+          cp ../dev/tasks/homebrew-formulae/autobrew/apache-arrow.rb tools/apache-arrow.rb
+          # Pin the current commit in the formula to test so that we're not always pulling from master
+          sed -i.bak -E -e 's@https://github.com/apache/arrow.git"$@{{ arrow.remote }}.git", :revision => "{{ arrow.head }}"@' tools/apache-arrow.rb && rm -f tools/apache-arrow.rb.bak
+          # Sometimes crossbow gives a remote URL with .git and sometimes not. Make sure there's only one
+          sed -i.bak -E -e 's@.git.git@.git@' tools/apache-arrow.rb && rm -f tools/apache-arrow.rb.bak
+          # Get minio for S3 testing
+          brew install minio
+      - uses: r-lib/actions/setup-r@v1
+      - name: Install dependencies
+        run: |
+          install.packages("remotes")
+          remotes::install_deps("arrow/r", dependencies = TRUE)
+          remotes::install_cran(c("rcmdcheck", "sys", "sessioninfo"))
+        shell: Rscript {0}
+      - name: Session info
+        run: |
+          options(width = 100)
+          pkgs <- installed.packages()[, "Package"]
+          sessioninfo::session_info(pkgs, include_base = TRUE)
+        shell: Rscript {0}
+      - name: Check
+        env:
+          _R_CHECK_CRAN_INCOMING_: false
+          ARROW_USE_PKG_CONFIG: false
+        run: arrow/ci/scripts/r_test.sh arrow
+      - name: Dump install logs
+        run: cat arrow/r/check/arrow.Rcheck/00install.out
+        if: always()
+      - name: Dump test logs
+        run: cat arrow/r/check/arrow.Rcheck/tests/testthat.Rout*
+        if: always()
+      - name: Save the test output
+        if: always()
+        uses: actions/upload-artifact@v2
+        with:
+          name: test-output
+          path: arrow/r/check/arrow.Rcheck/tests/testthat.Rout*
diff --git a/src/arrow/dev/tasks/tasks.yml b/src/arrow/dev/tasks/tasks.yml
new file mode 100644
index 000000000..8e67d3116
--- /dev/null
+++ b/src/arrow/dev/tasks/tasks.yml
@@ -0,0 +1,1308 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+groups:
+  # these groups are just for convenience
+  # makes it easier to submit related tasks
+
+{############################# Packaging tasks ###############################}
+
+  conda:
+    - conda-*
+
+  wheel:
+    - wheel-*
+
+  linux:
+    - almalinux-*
+    - amazon-linux-*
+    - centos-*
+    - debian-*
+    - ubuntu-*
+
+  linux-amd64:
+    - almalinux-*-amd64
+    - amazon-linux-*-amd64
+    - centos-*-amd64
+    - debian-*-amd64
+    - ubuntu-*-amd64
+
+  linux-arm64:
+    - almalinux-*-arm64
+    - centos-*-arm64
+    - debian-*-arm64
+    - ubuntu-*-arm64
+
+  homebrew:
+    - homebrew-*
+
+  packaging:
+    - almalinux-*
+    - amazon-linux-*
+    - centos-*
+    - debian-*
+    - java-jars
+    - nuget
+    - python-sdist
+    - ubuntu-*
+    - wheel-*
+
+{############################# Testing tasks #################################}
+
+  test:
+    - test-*
+
+  cpp:
+    - test-*cpp*
+
+  c-glib:
+    - test-*c-glib*
+
+  python:
+    - test-*python*
+
+  r:
+    - test*-r-*
+    - homebrew-r-autobrew
+    # r-conda tasks
+    - conda-linux-gcc-py*-cpu-r*
+    - conda-osx-clang-py*-r*
+    - conda-win-vs2017-py*-r*
+
+  ruby:
+    - test-*ruby*
+
+  vcpkg:
+    - test-*vcpkg*
+
+  integration:
+    - test-*dask*
+    - test-*hdfs*
+    - test-*kartothek*
+    - test-*pandas*
+    - test-*spark*
+    # TEMP disable because those are failing due to needing upstream fix (ARROW-13594)
+    # - test-*turbodbc*
+
+  example:
+    - example-*
+
+  example-cpp:
+    - example-*cpp*
+
+  verify-rc:
+    - verify-rc-*
+
+  verify-rc-binaries:
+    - verify-rc-binaries-*
+
+  verify-rc-wheels:
+    - verify-rc-wheels-*
+
+  verify-rc-source:
+    - verify-rc-source-*
+
+  verify-rc-source-macos:
+    - verify-rc-source-*-macos-*
+
+  verify-rc-source-linux:
+    - verify-rc-source-*-linux-*
+
+{######################## Tasks to run regularly #############################}
+
+  nightly:
+    - almalinux-*
+    - amazon-linux-*
+    - debian-*
+    - ubuntu-*
+    - centos-*
+    - conda-*
+    - java-jars
+    # List the homebrews explicitly because we don't care about running homebrew-cpp-autobrew
+    - homebrew-cpp
+    - homebrew-r-autobrew
+    - nuget
+    - test-*
+    - example-*
+    - wheel-*
+    - python-sdist
+
+tasks:
+  # arbitrary_task_name:
+  #   template: path of jinja2 templated yml
+  #   params: optional extra parameters
+  #   artifacts: list of regex patterns, each needs to match a single github
+  #              release asset, version variable is replaced in the pattern
+  #              e.g.:
+  #     - pyarrow-{no_rc_version}-py36(h[a-z0-9]+)_0-linux-64.tar.bz2
+
+{############################## Conda Linux ##################################}
+
+  conda-clean:
+    ci: azure
+    template: conda-recipes/azure.clean.yml
+
+  # Important notes on the conda setup here:
+  #
+  # * On conda-forge the `pyarrow` and `arrow-cpp` packages are built in
+  #   the same feedstock as the dependency matrix is the same for them as
+  #   Python and the OS are the main dimension. The R package `r-arrow` is
+  #   an independent feedstock as it doesn't have the Python but the
+  #   R dimension. To limit the number of CI jobs, we are building `r-arrow`
+  #   for R 4.0 with the Python 3.6 jobs and for R 4.1 with the Python 3.7 jobs.
+  # * The files in `dev/tasks/conda-recipes/.ci_support/` are automatically
+  #   generated and to be synced regularly from the feedstock. We have no way
+  #   yet to generate them inside the arrow repository automatically.
+
+  conda-linux-gcc-py36-cpu-r40:
+    ci: azure
+    template: conda-recipes/azure.linux.yml
+    params:
+      config: linux_64_cuda_compiler_versionNonenumpy1.17python3.6.____cpython
+      r_config: linux_64_r_base4.0
+    artifacts:
+      - arrow-cpp-{no_rc_version}-py36(h[a-z0-9]+)_0_cpu.tar.bz2
+      - pyarrow-{no_rc_version}-py36(h[a-z0-9]+)_0_cpu.tar.bz2
+
+  conda-linux-gcc-py37-cpu-r41:
+    ci: azure
+    template: conda-recipes/azure.linux.yml
+    params:
+      config: linux_64_cuda_compiler_versionNonenumpy1.17python3.7.____cpython
+      r_config: linux_64_r_base4.1
+    artifacts:
+      - arrow-cpp-{no_rc_version}-py37(h[a-z0-9]+)_0_cpu.tar.bz2
+      - pyarrow-{no_rc_version}-py37(h[a-z0-9]+)_0_cpu.tar.bz2
+
+  conda-linux-gcc-py38-cpu:
+    ci: azure
+    template: conda-recipes/azure.linux.yml
+    params:
+      config: linux_64_cuda_compiler_versionNonenumpy1.17python3.8.____cpython
+    artifacts:
+      - arrow-cpp-{no_rc_version}-py38(h[a-z0-9]+)_0_cpu.tar.bz2
+      - pyarrow-{no_rc_version}-py38(h[a-z0-9]+)_0_cpu.tar.bz2
+
+  conda-linux-gcc-py39-cpu:
+    ci: azure
+    template: conda-recipes/azure.linux.yml
+    params:
+      config: linux_64_cuda_compiler_versionNonenumpy1.19python3.9.____cpython
+    artifacts:
+      - arrow-cpp-{no_rc_version}-py39(h[a-z0-9]+)_0_cpu.tar.bz2
+      - pyarrow-{no_rc_version}-py39(h[a-z0-9]+)_0_cpu.tar.bz2
+
+{% for python_version, numpy_version in [("3.6", "1.17"),
+                                         ("3.7", "1.17"),
+                                         ("3.8", "1.17"),
+                                         ("3.9", "1.19"),
+                                         ("3.10", "1.21")] %}
+  {% set pyver = python_version | replace(".", "") %}
+
+  conda-linux-gcc-py{{ pyver }}-cuda:
+    ci: azure
+    template: conda-recipes/azure.linux.yml
+    params:
+      config: linux_64_cuda_compiler_version10.2numpy{{ numpy_version }}python{{ python_version }}.____cpython
+    artifacts:
+      - arrow-cpp-{no_rc_version}-py{{ pyver }}(h[a-z0-9]+)_0_cuda.tar.bz2
+      - pyarrow-{no_rc_version}-py{{ pyver }}(h[a-z0-9]+)_0_cuda.tar.bz2
+
+  conda-linux-gcc-py{{ pyver }}-arm64:
+    ci: azure
+    template: conda-recipes/azure.linux.yml
+    params:
+      config: linux_aarch64_numpy{{ numpy_version }}python{{ python_version }}.____cpython
+    artifacts:
+      - arrow-cpp-{no_rc_version}-py{{ pyver }}(h[a-z0-9]+)_0_cpu.tar.bz2
+      - pyarrow-{no_rc_version}-py{{ pyver }}(h[a-z0-9]+)_0_cpu.tar.bz2
+
+{% endfor %}
+
+  ############################## Conda OSX ####################################
+
+  conda-osx-clang-py36-r40:
+    ci: azure
+    template: conda-recipes/azure.osx.yml
+    params:
+      config: osx_64_numpy1.17python3.6.____cpython
+      r_config: osx_64_r_base4.0
+    artifacts:
+      - arrow-cpp-{no_rc_version}-py36(h[a-z0-9]+)_0_cpu.tar.bz2
+      - pyarrow-{no_rc_version}-py36(h[a-z0-9]+)_0_cpu.tar.bz2
+
+  conda-osx-clang-py37-r41:
+    ci: azure
+    template: conda-recipes/azure.osx.yml
+    params:
+      config: osx_64_numpy1.17python3.7.____cpython
+      r_config: osx_64_r_base4.1
+    artifacts:
+      - arrow-cpp-{no_rc_version}-py37(h[a-z0-9]+)_0_cpu.tar.bz2
+      - pyarrow-{no_rc_version}-py37(h[a-z0-9]+)_0_cpu.tar.bz2
+
+  conda-osx-clang-py38:
+    ci: azure
+    template: conda-recipes/azure.osx.yml
+    params:
+      config: osx_64_numpy1.17python3.8.____cpython
+    artifacts:
+      - arrow-cpp-{no_rc_version}-py38(h[a-z0-9]+)_0_cpu.tar.bz2
+      - pyarrow-{no_rc_version}-py38(h[a-z0-9]+)_0_cpu.tar.bz2
+
+  conda-osx-clang-py39:
+    ci: azure
+    template: conda-recipes/azure.osx.yml
+    params:
+      config: osx_64_numpy1.19python3.9.____cpython
+    artifacts:
+      - arrow-cpp-{no_rc_version}-py39(h[a-z0-9]+)_0_cpu.tar.bz2
+      - pyarrow-{no_rc_version}-py39(h[a-z0-9]+)_0_cpu.tar.bz2
+
+  conda-osx-arm64-clang-py38:
+    ci: azure
+    template: conda-recipes/azure.osx.yml
+    params:
+      config: osx_arm64_python3.8.____cpython
+    artifacts:
+      - arrow-cpp-{no_rc_version}-py38(h[a-z0-9]+)_0_cpu.tar.bz2
+      - pyarrow-{no_rc_version}-py38(h[a-z0-9]+)_0_cpu.tar.bz2
+
+  conda-osx-arm64-clang-py39:
+    ci: azure
+    template: conda-recipes/azure.osx.yml
+    params:
+      config: osx_arm64_python3.9.____cpython
+    artifacts:
+      - arrow-cpp-{no_rc_version}-py39(h[a-z0-9]+)_0_cpu.tar.bz2
+      - pyarrow-{no_rc_version}-py39(h[a-z0-9]+)_0_cpu.tar.bz2
+
+  ############################## Conda Windows ################################
+
+  conda-win-vs2017-py36-r40:
+    ci: azure
+    template: conda-recipes/azure.win.yml
+    params:
+      config: win_64_cuda_compiler_versionNonenumpy1.17python3.6.____cpython
+      r_config: win_64_r_base4.0
+    artifacts:
+      - arrow-cpp-{no_rc_version}-py36(h[a-z0-9]+)_0_cpu.tar.bz2
+      - pyarrow-{no_rc_version}-py36(h[a-z0-9]+)_0_cpu.tar.bz2
+
+  conda-win-vs2017-py37-r41:
+    ci: azure
+    template: conda-recipes/azure.win.yml
+    params:
+      config: win_64_cuda_compiler_versionNonenumpy1.17python3.7.____cpython
+      r_config: win_64_r_base4.1
+    artifacts:
+      - arrow-cpp-{no_rc_version}-py37(h[a-z0-9]+)_0_cpu.tar.bz2
+      - pyarrow-{no_rc_version}-py37(h[a-z0-9]+)_0_cpu.tar.bz2
+
+  conda-win-vs2017-py38:
+    ci: azure
+    template: conda-recipes/azure.win.yml
+    params:
+      config: win_64_cuda_compiler_versionNonenumpy1.17python3.8.____cpython
+    artifacts:
+      - arrow-cpp-{no_rc_version}-py38(h[a-z0-9]+)_0_cpu.tar.bz2
+      - pyarrow-{no_rc_version}-py38(h[a-z0-9]+)_0_cpu.tar.bz2
+
+  conda-win-vs2017-py39:
+    ci: azure
+    template: conda-recipes/azure.win.yml
+    params:
+      config: win_64_cuda_compiler_versionNonenumpy1.19python3.9.____cpython
+    artifacts:
+      - arrow-cpp-{no_rc_version}-py38(h[a-z0-9]+)_0_cpu.tar.bz2
+      - pyarrow-{no_rc_version}-py38(h[a-z0-9]+)_0_cpu.tar.bz2
+
+
+{% for python_version, python_tag, abi_tag in [("3.6", "cp36", "cp36m"),
+                                               ("3.7", "cp37", "cp37m"),
+                                               ("3.8", "cp38", "cp38"),
+                                               ("3.9", "cp39", "cp39"),
+                                               ("3.10", "cp310", "cp310")] %}
+
+{############################## Wheel Linux ##################################}
+
+{% for ci, arch, arch_alias, x_y, manylinux in [("github", "amd64", "x86_64", "2_12", "2010"),
+                                                ("github", "amd64", "x86_64", "2_17", "2014"),
+                                                ("travis", "arm64", "aarch64", "2_17", "2014")] %}
+  wheel-manylinux{{ manylinux }}-{{ python_tag }}-{{ arch }}:
+    ci: {{ ci }}
+    template: python-wheels/{{ ci }}.linux.{{ arch }}.yml
+    params:
+      python_version: "{{ python_version }}"
+      manylinux_version: {{ manylinux }}
+    artifacts:
+      - pyarrow-{no_rc_version}-{{ python_tag }}-{{ abi_tag }}-manylinux_{{ x_y }}_{{ arch_alias }}.manylinux{{ manylinux }}_{{ arch_alias }}.whl
+{% endfor %}
+
+{############################## Wheel OSX ####################################}
+
+# enable S3 support from macOS 10.13 so we don't need to bundle curl, crypt and ssl
+{% for macos_version, macos_codename, arrow_s3 in [("10.9", "mavericks", "OFF"),
+                                                   ("10.13", "high-sierra", "ON")] %}
+  {% set platform_tag = "macosx_{}_x86_64".format(macos_version.replace('.', '_')) %}
+
+  wheel-macos-{{ macos_codename }}-{{ python_tag }}-amd64:
+    ci: github
+    template: python-wheels/github.osx.amd64.yml
+    params:
+      vcpkg_version: "2021.04.30"
+      python_version: "{{ python_version }}"
+      macos_deployment_target: {{ macos_version }}
+      arrow_s3: {{ arrow_s3 }}
+    artifacts:
+      - pyarrow-{no_rc_version}-{{ python_tag }}-{{ abi_tag }}-{{ platform_tag }}.whl
+
+{% endfor %}
+
+{############################## Wheel Windows ################################}
+
+  wheel-windows-{{ python_tag }}-amd64:
+    ci: github
+    template: python-wheels/github.windows.yml
+    params:
+      python_version: "{{ python_version }}"
+    artifacts:
+      - pyarrow-{no_rc_version}-{{ python_tag }}-{{ abi_tag }}-win_amd64.whl
+
+{% endfor %}
+
+{############################## Wheel OSX M1 #################################}
+
+  # The python 3.8 universal2 installer has been built with macos deployment
+  # target 11.0, so we cannot build binaries with earlier deployment target
+  # otherwise distutils will raise a deployment target version mismatch error.
+  wheel-macos-big-sur-cp38-arm64:
+    ci: github
+    template: python-wheels/github.osx.arm64.yml
+    params:
+      arch: arm64
+      arrow_simd_level: "DEFAULT"
+      vcpkg_version: "2021.04.30"
+      python_version: "3.8"
+      macos_deployment_target: "11.0"
+
+    artifacts:
+      - pyarrow-{no_rc_version}-cp38-cp38-macosx_11_0_arm64.whl
+
+{% for python_version, python_tag in [("3.9", "cp39"), ("3.10", "cp310")] %}
+  wheel-macos-big-sur-{{ python_tag }}-arm64:
+    ci: github
+    template: python-wheels/github.osx.arm64.yml
+    params:
+      arch: arm64
+      arrow_simd_level: "DEFAULT"
+      vcpkg_version: "2021.04.30"
+      python_version: "{{ python_version }}"
+      macos_deployment_target: "11.0"
+    artifacts:
+      - pyarrow-{no_rc_version}-{{ python_tag }}-{{ python_tag }}-macosx_11_0_arm64.whl
+
+  wheel-macos-big-sur-{{ python_tag }}-universal2:
+    ci: github
+    template: python-wheels/github.osx.arm64.yml
+    params:
+      arch: universal2
+      # Universal2 builds for both rosetta and native, but we currently can't
+      # configure SIMD for both architectures at the same time
+      arrow_simd_level: "NONE"
+      vcpkg_version: "2021.04.30"
+      python_version: "{{ python_version }}"
+      macos_deployment_target: "10.13"
+    artifacts:
+      - pyarrow-{no_rc_version}-{{ python_tag }}-{{ python_tag }}-macosx_10_13_universal2.whl
+{% endfor %}
+
+{############################ Python sdist ####################################}
+
+  python-sdist:
+    ci: github
+    template: python-sdist/github.yml
+    artifacts:
+      - pyarrow-{no_rc_version}.tar.gz
+
+{############################## Linux PKGS ####################################}
+
+{% for target in ["debian-buster",
+                  "debian-bullseye",
+                  "debian-bookworm",
+                  "ubuntu-bionic",
+                  "ubuntu-focal",
+                  "ubuntu-hirsute",
+                  "ubuntu-impish"] %}
+  {% for architecture in ["amd64", "arm64"] %}
+  {{ target }}-{{ architecture }}:
+    {% if architecture == "amd64" %}
+    ci: github
+    template: linux-packages/github.linux.amd64.yml
+    {% else %}
+    ci: travis
+    template: linux-packages/travis.linux.arm64.yml
+    {% endif %}
+    params:
+    {% if architecture == "amd64" %}
+      target: "{{ target }}"
+    {% else %}
+      target: "{{ target }}-arm64"
+    {% endif %}
+      task_namespace: "apt"
+      upload_extensions:
+        - .ddeb
+        - .deb
+        - .debian.tar.xz
+        - .dsc
+        - .orig.tar.gz
+    artifacts:
+    {% if architecture == "amd64" %}
+      - apache-arrow-apt-source_{no_rc_version}-1.debian.tar.xz
+      - apache-arrow-apt-source_{no_rc_version}-1.dsc
+      - apache-arrow-apt-source_{no_rc_version}-1_all.deb
+      - apache-arrow-apt-source_{no_rc_version}.orig.tar.gz
+      - apache-arrow_{no_rc_version}-1.debian.tar.xz
+      - apache-arrow_{no_rc_version}-1.dsc
+      - apache-arrow_{no_rc_version}.orig.tar.gz
+    {% endif %}
+      - gir1.2-arrow-1.0_{no_rc_version}-1_[a-z0-9]+.deb
+      - gir1.2-arrow-dataset-1.0_{no_rc_version}-1_[a-z0-9]+.deb
+      - gir1.2-arrow-flight-1.0_{no_rc_version}-1_[a-z0-9]+.deb
+      - gir1.2-gandiva-1.0_{no_rc_version}-1_[a-z0-9]+.deb
+      - gir1.2-parquet-1.0_{no_rc_version}-1_[a-z0-9]+.deb
+      - libarrow-dataset-dev_{no_rc_version}-1_[a-z0-9]+.deb
+      - libarrow-dataset-glib-dev_{no_rc_version}-1_[a-z0-9]+.deb
+      - libarrow-dataset-glib-doc_{no_rc_version}-1_[a-z0-9]+.deb
+      - libarrow-dataset-glib600-dbgsym_{no_rc_version}-1_[a-z0-9]+.d?deb
+      - libarrow-dataset-glib600_{no_rc_version}-1_[a-z0-9]+.deb
+      - libarrow-dataset600-dbgsym_{no_rc_version}-1_[a-z0-9]+.d?deb
+      - libarrow-dataset600_{no_rc_version}-1_[a-z0-9]+.deb
+      - libarrow-dev_{no_rc_version}-1_[a-z0-9]+.deb
+      - libarrow-flight-dev_{no_rc_version}-1_[a-z0-9]+.deb
+      - libarrow-flight-glib-dev_{no_rc_version}-1_[a-z0-9]+.deb
+      - libarrow-flight-glib-doc_{no_rc_version}-1_[a-z0-9]+.deb
+      - libarrow-flight-glib600-dbgsym_{no_rc_version}-1_[a-z0-9]+.d?deb
+      - libarrow-flight-glib600_{no_rc_version}-1_[a-z0-9]+.deb
+      - libarrow-flight600-dbgsym_{no_rc_version}-1_[a-z0-9]+.d?deb
+      - libarrow-flight600_{no_rc_version}-1_[a-z0-9]+.deb
+      - libarrow-glib-dev_{no_rc_version}-1_[a-z0-9]+.deb
+      - libarrow-glib-doc_{no_rc_version}-1_[a-z0-9]+.deb
+      - libarrow-glib600-dbgsym_{no_rc_version}-1_[a-z0-9]+.d?deb
+      - libarrow-glib600_{no_rc_version}-1_[a-z0-9]+.deb
+      - libarrow-python-dev_{no_rc_version}-1_[a-z0-9]+.deb
+      - libarrow-python-flight-dev_{no_rc_version}-1_[a-z0-9]+.deb
+      - libarrow-python-flight600-dbgsym_{no_rc_version}-1_[a-z0-9]+.d?deb
+      - libarrow-python-flight600_{no_rc_version}-1_[a-z0-9]+.deb
+      - libarrow-python600-dbgsym_{no_rc_version}-1_[a-z0-9]+.d?deb
+      - libarrow-python600_{no_rc_version}-1_[a-z0-9]+.deb
+      - libarrow600-dbgsym_{no_rc_version}-1_[a-z0-9]+.d?deb
+      - libarrow600_{no_rc_version}-1_[a-z0-9]+.deb
+      - libgandiva-dev_{no_rc_version}-1_[a-z0-9]+.deb
+      - libgandiva-glib-dev_{no_rc_version}-1_[a-z0-9]+.deb
+      - libgandiva-glib-doc_{no_rc_version}-1_[a-z0-9]+.deb
+      - libgandiva-glib600-dbgsym_{no_rc_version}-1_[a-z0-9]+.d?deb
+      - libgandiva-glib600_{no_rc_version}-1_[a-z0-9]+.deb
+      - libgandiva600-dbgsym_{no_rc_version}-1_[a-z0-9]+.d?deb
+      - libgandiva600_{no_rc_version}-1_[a-z0-9]+.deb
+      - libparquet-dev_{no_rc_version}-1_[a-z0-9]+.deb
+      - libparquet-glib-dev_{no_rc_version}-1_[a-z0-9]+.deb
+      - libparquet-glib-doc_{no_rc_version}-1_[a-z0-9]+.deb
+      - libparquet-glib600-dbgsym_{no_rc_version}-1_[a-z0-9]+.d?deb
+      - libparquet-glib600_{no_rc_version}-1_[a-z0-9]+.deb
+      - libparquet600-dbgsym_{no_rc_version}-1_[a-z0-9]+.d?deb
+      - libparquet600_{no_rc_version}-1_[a-z0-9]+.deb
+    {% if architecture == "amd64" %}
+      - gir1.2-arrow-cuda-1.0_{no_rc_version}-1_[a-z0-9]+.deb
+      - gir1.2-plasma-1.0_{no_rc_version}-1_[a-z0-9]+.deb
+      - libarrow-cuda-dev_{no_rc_version}-1_[a-z0-9]+.deb
+      - libarrow-cuda-glib-dev_{no_rc_version}-1_[a-z0-9]+.deb
+      - libarrow-cuda-glib600-dbgsym_{no_rc_version}-1_[a-z0-9]+.d?deb
+      - libarrow-cuda-glib600_{no_rc_version}-1_[a-z0-9]+.deb
+      - libarrow-cuda600-dbgsym_{no_rc_version}-1_[a-z0-9]+.d?deb
+      - libarrow-cuda600_{no_rc_version}-1_[a-z0-9]+.deb
+      - libplasma-dev_{no_rc_version}-1_[a-z0-9]+.deb
+      - libplasma-glib-dev_{no_rc_version}-1_[a-z0-9]+.deb
+      - libplasma-glib-doc_{no_rc_version}-1_[a-z0-9]+.deb
+      - libplasma-glib600-dbgsym_{no_rc_version}-1_[a-z0-9]+.d?deb
+      - libplasma-glib600_{no_rc_version}-1_[a-z0-9]+.deb
+      - libplasma600-dbgsym_{no_rc_version}-1_[a-z0-9]+.d?deb
+      - libplasma600_{no_rc_version}-1_[a-z0-9]+.deb
+      - plasma-store-server-dbgsym_{no_rc_version}-1_[a-z0-9]+.d?deb
+      - plasma-store-server_{no_rc_version}-1_[a-z0-9]+.deb
+    {% endif %}
+  {% endfor %}
+{% endfor %}
+
+{% for target in ["almalinux-8",
+                  "amazon-linux-2",
+                  "centos-7",
+                  "centos-8"] %}
+  {% set is_rhel8_based = (target == "almalinux-8" or target == "centos-8") %}
+  {% for architecture in ["amd64", "arm64"] %}
+    {% if not (target in ["amazon-linux-2", "centos-7"] and architecture == "arm64") %}
+  {{ target }}-{{ architecture }}:
+      {% if architecture == "amd64" %}
+    ci: github
+    template: linux-packages/github.linux.amd64.yml
+      {% else %}
+    ci: travis
+    template: linux-packages/travis.linux.arm64.yml
+      {% endif %}
+    params:
+      {% if architecture == "amd64" %}
+      target: "{{ target }}"
+      {% else %}
+      target: "{{ target }}-aarch64"
+      {% endif %}
+      task_namespace: "yum"
+      upload_extensions:
+        - .rpm
+    artifacts:
+      {% if architecture == "amd64" %}
+      - apache-arrow-release-{no_rc_version}-1.[a-z0-9]+.noarch.rpm
+      - apache-arrow-release-{no_rc_version}-1.[a-z0-9]+.src.rpm
+      {% endif %}
+      - arrow-dataset-devel-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      - arrow-dataset-glib-devel-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      - arrow-dataset-glib-doc-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% if is_rhel8_based %}
+      - arrow-dataset-glib-libs-debuginfo-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% endif %}
+      - arrow-dataset-glib-libs-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% if is_rhel8_based %}
+      - arrow-dataset-libs-debuginfo-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% endif %}
+      - arrow-dataset-libs-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      - arrow-debuginfo-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% if is_rhel8_based %}
+      - arrow-debugsource-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% endif %}
+      - arrow-devel-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% if is_rhel8_based %}
+      - arrow-flight-devel-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      - arrow-flight-glib-devel-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      - arrow-flight-glib-doc-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      - arrow-flight-glib-libs-debuginfo-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      - arrow-flight-glib-libs-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      - arrow-flight-libs-debuginfo-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      - arrow-flight-libs-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% endif %}
+      - arrow-glib-devel-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      - arrow-glib-doc-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% if is_rhel8_based %}
+      - arrow-glib-libs-debuginfo-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% endif %}
+      - arrow-glib-libs-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% if is_rhel8_based %}
+      - arrow-libs-debuginfo-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% endif %}
+      - arrow-libs-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% if target != "amazon-linux-2" %}
+      - arrow-python-devel-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+        {% if is_rhel8_based %}
+      - arrow-python-flight-devel-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      - arrow-python-flight-libs-debuginfo-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      - arrow-python-flight-libs-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      - arrow-python-libs-debuginfo-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+        {% endif %}
+      - arrow-python-libs-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% endif %}
+      {% if architecture == "amd64" %}
+      - arrow-{no_rc_version}-1.[a-z0-9]+.src.rpm
+      {% endif %}
+      {% if is_rhel8_based and architecture == "amd64" %}
+      - gandiva-devel-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      - gandiva-glib-devel-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      - gandiva-glib-doc-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      - gandiva-glib-libs-debuginfo-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      - gandiva-glib-libs-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      - gandiva-libs-debuginfo-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      - gandiva-libs-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% endif %}
+      - parquet-devel-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      - parquet-glib-devel-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      - parquet-glib-doc-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% if is_rhel8_based %}
+      - parquet-glib-libs-debuginfo-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% endif %}
+      - parquet-glib-libs-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% if is_rhel8_based %}
+      - parquet-libs-debuginfo-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% endif %}
+      - parquet-libs-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      - plasma-devel-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      - plasma-glib-devel-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      - plasma-glib-doc-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% if is_rhel8_based %}
+      - plasma-glib-libs-debuginfo-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% endif %}
+      - plasma-glib-libs-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% if is_rhel8_based %}
+      - plasma-libs-debuginfo-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% endif %}
+      - plasma-libs-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% if is_rhel8_based %}
+      - plasma-store-server-debuginfo-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+      {% endif %}
+      - plasma-store-server-{no_rc_version}-1.[a-z0-9]+.[a-z0-9_]+.rpm
+    {% endif %}
+  {% endfor %}
+{% endfor %}
+
+  ############################## Homebrew Tasks ################################
+
+  homebrew-cpp:
+    ci: github
+    template: homebrew-formulae/github.macos.yml
+    params:
+      formula: apache-arrow.rb
+
+  homebrew-cpp-autobrew:
+    ci: github
+    template: homebrew-formulae/github.macos.yml
+    params:
+      formula: autobrew/apache-arrow.rb
+
+  homebrew-r-autobrew:
+    # This tests that the autobrew formula + script work in practice
+    ci: github
+    template: r/github.macos.autobrew.yml
+
+  ############################## Arrow JAR's ##################################
+
+  java-jars:
+    # Build jar's that contains cpp libraries dependencies
+    ci: github
+    template: java-jars/github.yml
+    artifacts:
+      - arrow-algorithm-{no_rc_version}-tests.jar
+      - arrow-algorithm-{no_rc_version}.jar
+      - arrow-algorithm-{no_rc_version}.pom
+      - arrow-avro-{no_rc_version}-tests.jar
+      - arrow-avro-{no_rc_version}.jar
+      - arrow-avro-{no_rc_version}.pom
+      - arrow-c-data-{no_rc_version}-tests.jar
+      - arrow-c-data-{no_rc_version}.jar
+      - arrow-c-data-{no_rc_version}.pom
+      - arrow-compression-{no_rc_version}-tests.jar
+      - arrow-compression-{no_rc_version}.jar
+      - arrow-compression-{no_rc_version}.pom
+      - arrow-dataset-{no_rc_version}-tests.jar
+      - arrow-dataset-{no_rc_version}.jar
+      - arrow-dataset-{no_rc_version}.pom
+      - arrow-format-{no_rc_version}-tests.jar
+      - arrow-format-{no_rc_version}.jar
+      - arrow-format-{no_rc_version}.pom
+      - arrow-gandiva-{no_rc_version}-tests.jar
+      - arrow-gandiva-{no_rc_version}.jar
+      - arrow-gandiva-{no_rc_version}.pom
+      - arrow-java-root-{no_rc_version}.pom
+      - arrow-jdbc-{no_rc_version}-tests.jar
+      - arrow-jdbc-{no_rc_version}.jar
+      - arrow-jdbc-{no_rc_version}.pom
+      - arrow-memory-{no_rc_version}.pom
+      - arrow-memory-core-{no_rc_version}-tests.jar
+      - arrow-memory-core-{no_rc_version}.jar
+      - arrow-memory-core-{no_rc_version}.pom
+      - arrow-memory-netty-{no_rc_version}-tests.jar
+      - arrow-memory-netty-{no_rc_version}.jar
+      - arrow-memory-netty-{no_rc_version}.pom
+      - arrow-memory-unsafe-{no_rc_version}-tests.jar
+      - arrow-memory-unsafe-{no_rc_version}.jar
+      - arrow-memory-unsafe-{no_rc_version}.pom
+      - arrow-orc-{no_rc_version}-tests.jar
+      - arrow-orc-{no_rc_version}.jar
+      - arrow-orc-{no_rc_version}.pom
+      - arrow-performance-{no_rc_version}-tests.jar
+      - arrow-performance-{no_rc_version}.jar
+      - arrow-performance-{no_rc_version}.pom
+      - arrow-plasma-{no_rc_version}-tests.jar
+      - arrow-plasma-{no_rc_version}.jar
+      - arrow-plasma-{no_rc_version}.pom
+      - arrow-tools-{no_rc_version}-jar-with-dependencies.jar
+      - arrow-tools-{no_rc_version}-tests.jar
+      - arrow-tools-{no_rc_version}.jar
+      - arrow-tools-{no_rc_version}.pom
+      - arrow-vector-{no_rc_version}-shade-format-flatbuffers.jar
+      - arrow-vector-{no_rc_version}-tests.jar
+      - arrow-vector-{no_rc_version}.jar
+      - arrow-vector-{no_rc_version}.pom
+      - flight-core-{no_rc_version}-jar-with-dependencies.jar
+      - flight-core-{no_rc_version}-shaded-ext.jar
+      - flight-core-{no_rc_version}-shaded.jar
+      - flight-core-{no_rc_version}-tests.jar
+      - flight-core-{no_rc_version}.jar
+      - flight-core-{no_rc_version}.pom
+      - flight-grpc-{no_rc_version}-tests.jar
+      - flight-grpc-{no_rc_version}.jar
+      - flight-grpc-{no_rc_version}.pom
+
+  ############################## NuGet packages ###############################
+
+  nuget:
+    ci: github
+    template: nuget-packages/github.linux.yml
+    params:
+      run: ubuntu-csharp
+    artifacts:
+      - Apache.Arrow.Flight.AspNetCore.{no_rc_version}.nupkg
+      - Apache.Arrow.Flight.AspNetCore.{no_rc_version}.snupkg
+      - Apache.Arrow.Flight.{no_rc_version}.nupkg
+      - Apache.Arrow.Flight.{no_rc_version}.snupkg
+      - Apache.Arrow.{no_rc_version}.nupkg
+      - Apache.Arrow.{no_rc_version}.snupkg
+
+  ########################### Release verification ############################
+
+{% for target in ["binary", "yum", "apt"] %}
+  verify-rc-binaries-{{ target }}-amd64:
+    ci: github
+    template: verify-rc/github.linux.amd64.yml
+    params:
+      env:
+        TEST_DEFAULT: 0
+        TEST_{{ target|upper }}: 1
+      artifact: "binaries"
+{% endfor %}
+
+{% for platform, arch, runner in [("linux", "amd64", "ubuntu-20.04"),
+                                  ("macos", "amd64", "macos-10.15")] %}
+  {% for target in ["cpp",
+                    "csharp",
+                    "go",
+                    "integration",
+                    "java",
+                    "js",
+                    "python",
+                    "ruby"] %}
+
+  verify-rc-source-{{ target }}-{{ platform }}-{{ arch }}:
+    ci: github
+    template: verify-rc/github.{{ platform }}.{{ arch }}.yml
+    params:
+      env:
+        INSTALL_NODE: 0
+        TEST_DEFAULT: 0
+        TEST_{{ target|upper }}: 1
+      artifact: "source"
+      github_runner: {{ runner }}
+  {% endfor %}
+{% endfor %}
+
+{% for platform, arch, runner in [("macos", "arm64", "self-hosted")] %}
+  {% for target in ["cpp",
+                    "csharp",
+                    "go",
+                    "integration",
+                    "js",
+                    "python",
+                    "ruby"] %}
+
+  verify-rc-source-{{ target }}-{{ platform }}-{{ arch }}:
+    ci: github
+    template: verify-rc/github.{{ platform }}.{{ arch }}.yml
+    params:
+      env:
+        ARROW_FLIGHT: 0
+        ARROW_GANDIVA: 0
+        INSTALL_NODE: 0
+        TEST_DEFAULT: 0
+        TEST_INTEGRATION_JAVA: 0
+        TEST_{{ target|upper }}: 1
+      artifact: "source"
+      github_runner: {{ runner }}
+  {% endfor %}
+{% endfor %}
+
+  verify-rc-wheels-linux-amd64:
+    ci: github
+    template: verify-rc/github.linux.amd64.yml
+    params:
+      env:
+        TEST_DEFAULT: 0
+      artifact: "wheels"
+
+  verify-rc-wheels-macos-10.15-amd64:
+    ci: github
+    template: verify-rc/github.macos.amd64.yml
+    params:
+      github_runner: "macos-10.15"
+      env:
+        TEST_DEFAULT: 0
+      artifact: "wheels"
+
+  # The github hosted macos-11 runners are in preview only, but should be switched once they are generally available:
+  #   https://docs.github.com/en/actions/using-github-hosted-runners/about-github-hosted-runners#supported-runners-and-hardware-resources
+  verify-rc-wheels-macos-11-amd64:
+    ci: github
+    template: verify-rc/github.macos.arm64.yml
+    params:
+      github_runner: "self-hosted"
+      arch_emulation: "x86_64"
+      env:
+        TEST_DEFAULT: 0
+      artifact: "wheels"
+
+  verify-rc-wheels-macos-11-arm64:
+    ci: github
+    template: verify-rc/github.macos.arm64.yml
+    params:
+      github_runner: "self-hosted"
+      arch_emulation: "arm64"
+      env:
+        TEST_DEFAULT: 0
+      artifact: "wheels"
+
+  verify-rc-source-windows:
+    ci: github
+    template: verify-rc/github.win.yml
+    params:
+      script: "verify-release-candidate.bat"
+
+  verify-rc-wheels-windows:
+    ci: github
+    template: verify-rc/github.win.yml
+    params:
+      script: "verify-release-candidate-wheels.bat"
+
+{############################## Docker tests #################################}
+
+{% for image in ["conda-cpp",
+                 "debian-c-glib",
+                 "ubuntu-c-glib",
+                 "debian-ruby",
+                 "ubuntu-ruby"] %}
+  test-{{ image }}:
+    ci: github
+    template: docker-tests/github.linux.yml
+    params:
+      image: {{ image }}
+{% endfor %}
+
+  # Use azure to run valgrind tests to prevent OOM
+  test-conda-cpp-valgrind:
+    ci: azure
+    template: docker-tests/azure.linux.yml
+    params:
+      run: conda-cpp-valgrind
+
+{% for ubuntu_version in ["18.04", "20.04"] %}
+  test-ubuntu-{{ ubuntu_version }}-cpp:
+    ci: github
+    template: docker-tests/github.linux.yml
+    params:
+      env:
+        UBUNTU: {{ ubuntu_version }}
+      image: ubuntu-cpp
+{% endfor %}
+
+  test-ubuntu-20.04-cpp-bundled:
+    ci: github
+    template: docker-tests/github.linux.yml
+    params:
+      env:
+        UBUNTU: 20.04
+      image: ubuntu-cpp-bundled
+
+  test-debian-11-cpp:
+    ci: github
+    template: docker-tests/github.linux.yml
+    params:
+      env:
+        DEBIAN: 11
+      image: debian-cpp
+
+  test-fedora-33-cpp:
+    ci: github
+    template: docker-tests/github.linux.yml
+    params:
+      env:
+        FEDORA: 33
+      image: fedora-cpp
+
+  test-ubuntu-18.04-cpp-release:
+    ci: github
+    template: docker-tests/github.linux.yml
+    params:
+      env:
+        UBUNTU: 18.04
+      flags: "-e ARROW_BUILD_TYPE=release"
+      image: ubuntu-cpp
+
+  test-ubuntu-18.04-cpp-static:
+    ci: github
+    template: docker-tests/github.linux.yml
+    params:
+      env:
+        UBUNTU: 18.04
+      flags: "-e ARROW_BUILD_SHARED=OFF -e ARROW_BUILD_STATIC=ON -e ARROW_TEST_LINKAGE=static"
+      image: ubuntu-cpp
+
+{% for cpp_standard in [14, 17] %}
+  test-ubuntu-20.04-cpp-{{ cpp_standard }}:
+    ci: github
+    template: docker-tests/github.linux.yml
+    params:
+      env:
+        UBUNTU: 20.04
+      flags: "-e CMAKE_ARGS=-DCMAKE_CXX_STANDARD={{ cpp_standard }}"
+      image: ubuntu-cpp
+{% endfor %}
+
+  test-ubuntu-20.04-cpp-thread-sanitizer:
+    ci: github
+    template: docker-tests/github.linux.yml
+    params:
+      env:
+        # clang-tools and llvm version need to be synchronized so as
+        # to have the right llvm-symbolizer version
+        CLANG_TOOLS: 11
+        LLVM: 11
+        UBUNTU: 20.04
+      image: ubuntu-cpp-thread-sanitizer
+
+{% for python_version in ["3.6", "3.7", "3.8", "3.9", "3.10"] %}
+  test-conda-python-{{ python_version }}:
+    ci: github
+    template: docker-tests/github.linux.yml
+    params:
+      env:
+        PYTHON: "{{ python_version }}"
+      image: conda-python
+{% endfor %}
+
+  test-conda-python-3.8-hypothesis:
+    ci: github
+    template: docker-tests/github.linux.yml
+    params:
+      env:
+        HYPOTHESIS_PROFILE: ci
+        PYARROW_TEST_HYPOTHESIS: ON
+        PYTHON: 3.8
+        # limit to execute hypothesis tests only
+        PYTEST_ARGS: "-m hypothesis"
+      image: conda-python-pandas
+
+  test-debian-11-python-3:
+    ci: azure
+    template: docker-tests/azure.linux.yml
+    params:
+      env:
+        DEBIAN: 11
+      run: debian-python
+
+  test-ubuntu-18.04-python-3:
+    ci: azure
+    template: docker-tests/azure.linux.yml
+    params:
+      env:
+        UBUNTU: 18.04
+      run: ubuntu-python
+
+  test-fedora-33-python-3:
+    ci: azure
+    template: docker-tests/azure.linux.yml
+    params:
+      env:
+        FEDORA: 33
+      run: fedora-python
+
+  test-r-linux-valgrind:
+    ci: azure
+    template: docker-tests/azure.linux.yml
+    params:
+      env:
+        ARROW_R_DEV: "TRUE"
+        UBUNTU: 18.04
+      run: ubuntu-r-valgrind
+
+  test-r-linux-rchk:
+    ci: github
+    template: r/github.linux.rchk.yml
+
+  test-r-linux-as-cran:
+    ci: github
+    template: r/github.linux.cran.yml
+    params:
+      MATRIX: {{ "${{ matrix.r_image }}" }}
+
+  test-r-arrow-backwards-compatibility:
+    ci: github
+    template: r/github.linux.arrow.version.back.compat.yml
+
+  test-r-versions:
+    ci: github
+    template: r/github.linux.versions.yml
+    params:
+      MATRIX: {{ "${{ matrix.r_version }}" }}
+
+  test-r-install-local:
+    ci: github
+    template: r/github.macos-linux.local.yml
+
+  test-r-devdocs:
+    ci: github
+    template: r/github.devdocs.yml
+
+  test-r-depsource-auto:
+      ci: azure
+      template: r/azure.linux.yml
+      params:
+        r_org: rocker
+        r_image: r-base
+        r_tag: latest
+        flags: '-e ARROW_DEPENDENCY_SOURCE=AUTO'
+
+  test-r-depsource-system:
+    ci: github
+    template: docker-tests/github.linux.yml
+    params:
+      env:
+        UBUNTU: 21.04
+        CLANG_TOOLS: 9 # can remove this when >=9 is the default
+      flags: '-e ARROW_SOURCE_HOME="/arrow" -e FORCE_BUNDLED_BUILD=TRUE -e LIBARROW_BUILD=TRUE -e ARROW_DEPENDENCY_SOURCE=SYSTEM'
+      image: ubuntu-r-only-r
+
+  test-r-offline-minimal:
+      ci: azure
+      template: r/azure.linux.yml
+      params:
+        r_org: rocker
+        r_image: r-base
+        r_tag: latest
+        flags: '-e TEST_OFFLINE_BUILD=true'
+
+  test-r-offline-maximal:
+    ci: github
+    template: r/github.linux.offline.build.yml
+
+
+{% for r_org, r_image, r_tag in [("rhub", "ubuntu-gcc-release", "latest"),
+                                 ("rocker", "r-base", "latest"),
+                                 ("rstudio", "r-base", "3.6-bionic"),
+                                 ("rstudio", "r-base", "3.6-centos8"),
+                                 ("rstudio", "r-base", "3.6-opensuse15"),
+                                 ("rstudio", "r-base", "3.6-opensuse42")] %}
+  test-r-{{ r_org }}-{{ r_image }}-{{ r_tag }}:
+    ci: azure
+    template: r/azure.linux.yml
+    params:
+      r_org: {{ r_org }}
+      r_image: {{ r_image }}
+      r_tag: {{ r_tag }}
+{% endfor %}
+
+  # This is with R built with --enable-lto
+  # CRAN also does R CMD INSTALL --use-LTO
+  # which overrides the UseLTO field in r/DESCRIPTION
+  test-r-rhub-debian-gcc-devel-lto-latest:
+    ci: azure
+    template: r/azure.linux.yml
+    params:
+      r_org: rhub
+      r_image: debian-gcc-devel-lto
+      r_tag: latest
+      flags: '-e NOT_CRAN=false -e INSTALL_ARGS=--use-LTO'
+
+  # This one has -flto=auto
+  test-r-ubuntu-21.04:
+    ci: github
+    template: docker-tests/github.linux.yml
+    params:
+      env:
+        UBUNTU: 21.04
+        CLANG_TOOLS: 9 # can remove this when >=9 is the default
+      flags: '-e ARROW_SOURCE_HOME="/arrow" -e FORCE_BUNDLED_BUILD=TRUE -e LIBARROW_BUILD=TRUE'
+      image: ubuntu-r-only-r
+
+  # This also has -flto=auto
+  test-r-gcc-11:
+    ci: github
+    template: docker-tests/github.linux.yml
+    params:
+      env:
+        UBUNTU: 21.04
+        CLANG_TOOLS: 9 # can remove this when >=9 is the default
+        GCC_VERSION: 11
+      # S3 support is not buildable with gcc11 right now
+      flags: '-e ARROW_SOURCE_HOME="/arrow" -e FORCE_BUNDLED_BUILD=TRUE -e LIBARROW_BUILD=TRUE -e ARROW_S3=OFF'
+      image: ubuntu-r-only-r
+
+  test-r-rstudio-r-base-3.6-centos7-devtoolset-8:
+    ci: azure
+    template: r/azure.linux.yml
+    params:
+      r_org: rstudio
+      r_image: r-base
+      r_tag: 3.6-centos7
+      devtoolset_version: 8
+
+  test-r-minimal-build:
+    ci: azure
+    template: r/azure.linux.yml
+    params:
+      r_org: rocker
+      r_image: r-base
+      r_tag: latest
+      flags: "-e LIBARROW_MINIMAL=TRUE"
+
+  test-ubuntu-18.04-r-sanitizer:
+    ci: azure
+    template: docker-tests/azure.linux.yml
+    params:
+      env:
+        UBUNTU: 18.04
+      run: ubuntu-r-sanitizer
+
+  revdep-r-check:
+    ci: github
+    template: r/github.linux.revdepcheck.yml
+
+  test-debian-11-go-1.15:
+    ci: azure
+    template: docker-tests/azure.linux.yml
+    params:
+      env:
+        DEBIAN: 11
+        GO: 1.15
+      run: debian-go
+
+  test-ubuntu-20.10-docs:
+    ci: azure
+    template: docker-tests/azure.linux.yml
+    params:
+      env:
+        UBUNTU: "20.10"
+      run: ubuntu-docs
+
+  test-ubuntu-default-docs:
+    ci: azure
+    template: docker-tests/azure.linux.yml
+    params:
+      run: ubuntu-docs
+
+  ############################## vcpkg tests ##################################
+
+  test-build-vcpkg-win:
+    ci: github
+    template: vcpkg-tests/github.windows.yml
+
+  ############################## Integration tests ############################
+
+{% for python_version, pandas_version, numpy_version, cache_leaf in [("3.6", "0.23", "1.16", True),
+                                                                     ("3.7", "0.24", "1.19", True),
+                                                                     ("3.7", "latest", "latest", False),
+                                                                     ("3.8", "latest", "latest", False),
+                                                                     ("3.8", "nightly", "nightly", False),
+                                                                     ("3.9", "master", "nightly", False)] %}
+  test-conda-python-{{ python_version }}-pandas-{{ pandas_version }}:
+    ci: github
+    template: docker-tests/github.linux.yml
+    params:
+      env:
+        PYTHON: {{ python_version }}
+        PANDAS: {{ pandas_version }}
+        NUMPY: {{ numpy_version }}
+    {% if cache_leaf %}
+      # use the latest pandas release, so prevent reusing any cached layers
+      flags: --no-leaf-cache
+    {% endif %}
+      image: conda-python-pandas
+{% endfor %}
+
+{% for dask_version in ["latest", "master"] %}
+  test-conda-python-3.9-dask-{{ dask_version }}:
+    ci: github
+    template: docker-tests/github.linux.yml
+    params:
+      env:
+        PYTHON: 3.9
+        DASK: {{ dask_version }}
+      # use the latest dask release, so prevent reusing any cached layers
+      flags: --no-leaf-cache
+      image: conda-python-dask
+{% endfor %}
+
+# TEMP disable because those are failing due to needing upstream fix (ARROW-13594)
+# {% for turbodbc_version in ["latest", "master"] %}
+#   test-conda-python-3.7-turbodbc-{{ turbodbc_version }}:
+#     ci: github
+#     template: docker-tests/github.linux.yml
+#     params:
+#       env:
+#         PYTHON: 3.7
+#         TURBODBC: {{ turbodbc_version }}
+#       # use the latest turbodbc release, so prevent reusing any cached layers
+#       flags: --no-leaf-cache
+#       image: conda-python-turbodbc
+# {% endfor %}
+
+{% for kartothek_version in ["latest", "master"] %}
+  test-conda-python-3.7-kartothek-{{ kartothek_version }}:
+    ci: github
+    template: docker-tests/github.linux.yml
+    params:
+      env:
+        PYTHON: 3.7
+        KARTOTHEK: {{ kartothek_version }}
+      flags: --no-leaf-cache
+      image: conda-python-kartothek
+{% endfor %}
+
+{% for hdfs_version in ["2.9.2", "3.2.1"] %}
+  test-conda-python-3.7-hdfs-{{ hdfs_version }}:
+    ci: github
+    template: docker-tests/github.linux.yml
+    params:
+      env:
+        PYTHON: 3.7
+        HDFS: {{ hdfs_version }}
+      image: conda-python-hdfs
+{% endfor %}
+
+{% for python_version, spark_version, test_pyarrow_only in [("3.7", "v3.1.2", "false"),
+                                                            ("3.8", "v3.2.0", "false"),
+                                                            ("3.9", "master", "false")] %}
+  test-conda-python-{{ python_version }}-spark-{{ spark_version }}:
+    ci: github
+    template: docker-tests/github.linux.yml
+    params:
+      env:
+        PYTHON: {{ python_version }}
+        SPARK: {{ spark_version }}
+        TEST_PYARROW_ONLY: {{ test_pyarrow_only }}
+      # use the branch-3.0 of spark, so prevent reusing any layers
+      flags: --no-leaf-cache
+      image: conda-python-spark
+{% endfor %}
+
+  # Remove the "skipped-" prefix in ARROW-8475
+  skipped-test-conda-cpp-hiveserver2:
+    ci: github
+    template: docker-tests/github.linux.yml
+    params:
+      image: conda-cpp-hiveserver2
+
+{% for kind in ["static", "static-system-dependency"] %}
+  example-cpp-minimal-build-{{ kind }}:
+    ci: github
+    template: cpp-examples/github.linux.yml
+    params:
+      type: minimal_build
+      run: {{ kind }}
+{% endfor %}
diff --git a/src/arrow/dev/tasks/vcpkg-tests/cpp-build-vcpkg.bat b/src/arrow/dev/tasks/vcpkg-tests/cpp-build-vcpkg.bat
new file mode 100644
index 000000000..6423720c2
--- /dev/null
+++ b/src/arrow/dev/tasks/vcpkg-tests/cpp-build-vcpkg.bat
@@ -0,0 +1,86 @@
+@rem Licensed to the Apache Software Foundation (ASF) under one
+@rem or more contributor license agreements.  See the NOTICE file
+@rem distributed with this work for additional information
+@rem regarding copyright ownership.  The ASF licenses this file
+@rem to you under the Apache License, Version 2.0 (the
+@rem "License"); you may not use this file except in compliance
+@rem with the License.  You may obtain a copy of the License at
+@rem
+@rem   http://www.apache.org/licenses/LICENSE-2.0
+@rem
+@rem Unless required by applicable law or agreed to in writing,
+@rem software distributed under the License is distributed on an
+@rem "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+@rem KIND, either express or implied.  See the License for the
+@rem specific language governing permissions and limitations
+@rem under the License.
+
+@rem Run VsDevCmd.bat to set Visual Studio environment variables for building
+@rem on the command line. This is the path for Visual Studio Enterprise 2019
+
+call "C:\Program Files (x86)\Microsoft Visual Studio\2019\Enterprise\Common7\Tools\VsDevCmd.bat" -arch=amd64
+
+
+@rem Install build dependencies with vcpkg
+
+@rem TODO(ianmcook): change --x-manifest-root to --manifest-root after it
+@rem changes in vcpkg
+
+vcpkg install ^
+    --triplet x64-windows ^
+    --x-manifest-root cpp  ^
+    --feature-flags=versions ^
+    --clean-after-build ^
+    || exit /B 1
+
+
+@rem Set environment variables
+
+set ARROW_TEST_DATA=%cd%\testing\data
+set PARQUET_TEST_DATA=%cd%\cpp\submodules\parquet-testing\data
+
+
+@rem Build Arrow C++ library
+
+mkdir cpp\build
+pushd cpp\build
+
+@rem TODO(ianmcook): test using --parallel %NUMBER_OF_PROCESSORS% with
+@rem cmake --build instead of specifying -DARROW_CXXFLAGS="/MP" here
+@rem (see https://gitlab.kitware.com/cmake/cmake/-/issues/20564)
+
+@rem TODO(ianmcook): Add -DARROW_BUILD_BENCHMARKS=ON after the issue described
+@rem at https://github.com/google/benchmark/issues/1046 is resolved
+
+cmake -G "Visual Studio 16 2019" -A x64 ^
+      -DARROW_BOOST_USE_SHARED=ON ^
+      -DARROW_BUILD_SHARED=ON ^
+      -DARROW_BUILD_STATIC=OFF ^
+      -DARROW_BUILD_TESTS=ON ^
+      -DARROW_CXXFLAGS="/MP" ^
+      -DARROW_DATASET=ON ^
+      -DARROW_DEPENDENCY_SOURCE=VCPKG ^
+      -DARROW_FLIGHT=OFF ^
+      -DARROW_MIMALLOC=ON ^
+      -DARROW_PARQUET=ON ^
+      -DARROW_PYTHON=OFF ^
+      -DARROW_WITH_BROTLI=ON ^
+      -DARROW_WITH_BZ2=ON ^
+      -DARROW_WITH_LZ4=ON ^
+      -DARROW_WITH_SNAPPY=ON ^
+      -DARROW_WITH_ZLIB=ON ^
+      -DARROW_WITH_ZSTD=ON ^
+      -DCMAKE_BUILD_TYPE=release ^
+      -DCMAKE_UNITY_BUILD=ON ^
+      .. || exit /B 1
+
+cmake --build . --target INSTALL --config Release || exit /B 1
+
+
+@rem Test Arrow C++ library
+
+ctest --output-on-failure ^
+      --parallel %NUMBER_OF_PROCESSORS% ^
+      --timeout 300 || exit /B 1
+
+popd
diff --git a/src/arrow/dev/tasks/vcpkg-tests/github.windows.yml b/src/arrow/dev/tasks/vcpkg-tests/github.windows.yml
new file mode 100644
index 000000000..ad3e793a6
--- /dev/null
+++ b/src/arrow/dev/tasks/vcpkg-tests/github.windows.yml
@@ -0,0 +1,59 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+# NOTE: must set "Crossbow" as name to have the badge links working in the
+# github comment reports!
+name: Crossbow
+
+on:
+  push:
+    branches:
+      - "*-github-*"
+
+jobs:
+  test-vcpkg-win:
+    name: Install build deps with vcpkg and build Arrow C++
+    runs-on: windows-2019
+    steps:
+      - name: Checkout Arrow
+        run: |
+          git clone --no-checkout {{ arrow.remote }} arrow
+          git -C arrow fetch -t {{ arrow.remote }} {{ arrow.branch }}
+          git -C arrow checkout FETCH_HEAD
+          git -C arrow submodule update --init --recursive
+      - name: Remove and Reinstall vcpkg
+        # When running vcpkg in Github Actions on Windows, remove the
+        # preinstalled vcpkg and install the newest version from source.
+        # Versions of vcpkg rapidly stop working until updated, and
+        # the safest and most reliable way to update vcpkg is simply
+        # to remove and reinstall it.
+        shell: cmd
+        run: |
+          CALL vcpkg integrate remove 2>NUL
+          CALL C:
+          CALL cd \
+          CALL rmdir /s /q vcpkg 2>NUL
+          CALL git clone https://github.com/microsoft/vcpkg.git vcpkg
+          CALL cd vcpkg
+          CALL bootstrap-vcpkg.bat -win64 -disableMetrics
+          CALL vcpkg integrate install
+          CALL setx PATH "%PATH%;C:\vcpkg"
+      - name: Install Dependencies with vcpkg and Build Arrow C++
+        shell: cmd
+        run: |
+          CALL cd arrow
+          CALL dev\tasks\vcpkg-tests\cpp-build-vcpkg.bat
diff --git a/src/arrow/dev/tasks/verify-rc/github.linux.amd64.yml b/src/arrow/dev/tasks/verify-rc/github.linux.amd64.yml
new file mode 100644
index 000000000..8a4613a49
--- /dev/null
+++ b/src/arrow/dev/tasks/verify-rc/github.linux.amd64.yml
@@ -0,0 +1,77 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+{% import 'macros.jinja' as macros with context %}
+
+{{ macros.github_header() }}
+
+jobs:
+  verify:
+    name: "Verify release candidate Ubuntu {{ artifact }}"
+    runs-on: {{ github_runner|default("ubuntu-20.04") }}
+    {% if env is defined %}
+    env:
+    {% for key, value in env.items() %}
+      {{ key }}: {{ value }}
+    {% endfor %}
+    {% endif %}
+
+    steps:
+      {{ macros.github_checkout_arrow()|indent }}
+
+      - name: Install System Dependencies
+        run: |
+          # TODO: don't require removing newer llvms
+          sudo apt-get --purge remove -y llvm-9 clang-9
+          sudo apt-get update -y
+          sudo apt-get install -y \
+            autoconf-archive \
+            binfmt-support \
+            bison \
+            curl \
+            flex \
+            gtk-doc-tools \
+            jq \
+            libboost-all-dev \
+            libgirepository1.0-dev \
+            ninja-build \
+            qemu-user-static \
+            wget
+
+          if [ "$TEST_JAVA" = "1" ]; then
+            # Maven
+            MAVEN_VERSION=3.6.3
+            wget https://downloads.apache.org/maven/maven-3/$MAVEN_VERSION/binaries/apache-maven-$MAVEN_VERSION-bin.zip
+            unzip apache-maven-$MAVEN_VERSION-bin.zip
+            mkdir -p $HOME/java
+            mv apache-maven-$MAVEN_VERSION $HOME/java
+            export PATH=$HOME/java/apache-maven-$MAVEN_VERSION/bin:$PATH
+          fi
+
+          if [ "$TEST_RUBY" = "1" ]; then
+            ruby --version
+            sudo gem install bundler
+          fi
+      - uses: actions/setup-node@v2-beta
+        with:
+          node-version: '14'
+      - name: Run verification
+        shell: bash
+        run: |
+          arrow/dev/release/verify-release-candidate.sh \
+            {{ artifact }} \
+            {{ release|default("1.0.0") }} {{ rc|default("0") }}
diff --git a/src/arrow/dev/tasks/verify-rc/github.macos.amd64.yml b/src/arrow/dev/tasks/verify-rc/github.macos.amd64.yml
new file mode 100644
index 000000000..d39cda382
--- /dev/null
+++ b/src/arrow/dev/tasks/verify-rc/github.macos.amd64.yml
@@ -0,0 +1,50 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+{% import 'macros.jinja' as macros with context %}
+
+{{ macros.github_header() }}
+
+jobs:
+  verify:
+    name: "Verify release candidate macOS {{ artifact }}"
+    runs-on: {{ github_runner|default("macos-latest") }}
+    {% if env is defined %}
+    env:
+    {% for key, value in env.items() %}
+      {{ key }}: {{ value }}
+    {% endfor %}
+    {% endif %}
+
+    steps:
+      {{ macros.github_checkout_arrow()|indent }}
+
+      - name: Install System Dependencies
+        shell: bash
+        run: |
+          brew update
+          brew bundle --file=arrow/cpp/Brewfile
+          brew bundle --file=arrow/c_glib/Brewfile
+      - uses: actions/setup-node@v2-beta
+        with:
+          node-version: '14'
+      - name: Run verification
+        shell: bash
+        run: |
+          arrow/dev/release/verify-release-candidate.sh \
+            {{ artifact }} \
+            {{ release|default("1.0.0") }} {{ rc|default("0") }}
diff --git a/src/arrow/dev/tasks/verify-rc/github.macos.arm64.yml b/src/arrow/dev/tasks/verify-rc/github.macos.arm64.yml
new file mode 100644
index 000000000..26139ed60
--- /dev/null
+++ b/src/arrow/dev/tasks/verify-rc/github.macos.arm64.yml
@@ -0,0 +1,48 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+{% import 'macros.jinja' as macros with context %}
+
+{{ macros.github_header() }}
+
+jobs:
+  verify:
+    name: "Verify release candidate macOS {{ artifact }}"
+    runs-on: {{ github_runner }}
+    {% if env is defined %}
+    env:
+    {% for key, value in env.items() %}
+      {{ key }}: {{ value }}
+    {% endfor %}
+    {% endif %}
+
+    steps:
+      - name: Cleanup
+        shell: bash
+        run: rm -rf arrow
+
+      {{ macros.github_checkout_arrow()|indent }}
+
+      - name: Run verification
+        shell: bash
+        run: |
+          export PATH="$(brew --prefix node@14)/bin:$PATH"
+          export PATH="$(brew --prefix ruby)/bin:$PATH"
+          export PKG_CONFIG_PATH="$(brew --prefix ruby)/lib/pkgconfig"
+          arch -{{ arch_emulation|default("arm64") }} arrow/dev/release/verify-release-candidate.sh \
+            {{ artifact }} \
+            {{ release|default("1.0.0") }} {{ rc|default("0") }}
diff --git a/src/arrow/dev/tasks/verify-rc/github.win.yml b/src/arrow/dev/tasks/verify-rc/github.win.yml
new file mode 100644
index 000000000..5406327e8
--- /dev/null
+++ b/src/arrow/dev/tasks/verify-rc/github.win.yml
@@ -0,0 +1,45 @@
+# Licensed to the Apache Software Foundation (ASF) under one
+# or more contributor license agreements.  See the NOTICE file
+# distributed with this work for additional information
+# regarding copyright ownership.  The ASF licenses this file
+# to you under the Apache License, Version 2.0 (the
+# "License"); you may not use this file except in compliance
+# with the License.  You may obtain a copy of the License at
+#
+#   http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing,
+# software distributed under the License is distributed on an
+# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+# KIND, either express or implied.  See the License for the
+# specific language governing permissions and limitations
+# under the License.
+
+{% import 'macros.jinja' as macros with context %}
+
+{{ macros.github_header() }}
+
+jobs:
+  verify:
+    name: "Verify release candidate Windows source"
+    runs-on: windows-2016
+    {% if env is defined %}
+    env:
+    {% for key, value in env.items() %}
+      {{ key }}: {{ value }}
+    {% endfor %}
+    {% endif %}
+
+    steps:
+      {{ macros.github_checkout_arrow()|indent }}
+
+      - uses: conda-incubator/setup-miniconda@v2
+      - name: Install System Dependencies
+        run: |
+          choco install boost-msvc-14.1
+          choco install wget
+      - name: Run verification
+        shell: cmd
+        run: |
+          cd arrow
+          dev/release/{{ script }} {{ release|default("1.0.0") }} {{ rc|default("0") }}
diff --git a/src/arrow/dev/test_merge_arrow_pr.py b/src/arrow/dev/test_merge_arrow_pr.py
new file mode 100644
index 000000000..8fe188350
--- /dev/null
+++ b/src/arrow/dev/test_merge_arrow_pr.py
@@ -0,0 +1,317 @@
+#!/usr/bin/env python
+
+#
+# Licensed to the Apache Software Foundation (ASF) under one or more
+# contributor license agreements.  See the NOTICE file distributed with
+# this work for additional information regarding copyright ownership.
+# The ASF licenses this file to You under the Apache License, Version 2.0
+# (the "License"); you may not use this file except in compliance with
+# the License.  You may obtain a copy of the License at
+#
+#    http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+
+from collections import namedtuple
+
+import pytest
+
+import merge_arrow_pr
+
+
+FakeIssue = namedtuple('issue', ['fields'])
+FakeFields = namedtuple('fields', ['status', 'summary', 'assignee',
+                                   'components', 'fixVersions'])
+FakeAssignee = namedtuple('assignee', ['displayName'])
+FakeStatus = namedtuple('status', ['name'])
+FakeComponent = namedtuple('component', ['name'])
+FakeVersion = namedtuple('version', ['name', 'raw'])
+
+RAW_VERSION_JSON = [
+    {'name': 'JS-0.4.0', 'released': False},
+    {'name': '0.11.0', 'released': False},
+    {'name': '0.12.0', 'released': False},
+    {'name': '0.10.0', 'released': True},
+    {'name': '0.9.0', 'released': True}
+]
+
+
+SOURCE_VERSIONS = [FakeVersion(raw['name'], raw)
+                   for raw in RAW_VERSION_JSON]
+
+TRANSITIONS = [{'name': 'Resolve Issue', 'id': 1}]
+
+jira_id = 'ARROW-1234'
+status = FakeStatus('In Progress')
+fields = FakeFields(status, 'issue summary', FakeAssignee('groundhog'),
+                    [FakeComponent('C++'), FakeComponent('Format')],
+                    [])
+FAKE_ISSUE_1 = FakeIssue(fields)
+
+
+class FakeJIRA:
+
+    def __init__(self, issue=None, project_versions=None, transitions=None,
+                 current_fix_versions=None):
+        self._issue = issue
+        self._project_versions = project_versions
+        self._transitions = transitions
+
+    def issue(self, jira_id):
+        return self._issue
+
+    def transitions(self, jira_id):
+        return self._transitions
+
+    def transition_issue(self, jira_id, transition_id, comment=None,
+                         fixVersions=None):
+        self.captured_transition = {
+            'jira_id': jira_id,
+            'transition_id': transition_id,
+            'comment': comment,
+            'fixVersions': fixVersions
+        }
+
+    def get_candidate_fix_versions(self):
+        return SOURCE_VERSIONS, ['0.12.0']
+
+    def project_versions(self, project):
+        return self._project_versions
+
+
+class FakeCLI:
+
+    def __init__(self, responses=()):
+        self.responses = responses
+        self.position = 0
+
+    def prompt(self, prompt):
+        response = self.responses[self.position]
+        self.position += 1
+        return response
+
+    def fail(self, msg):
+        raise Exception(msg)
+
+
+def test_jira_fix_versions():
+    jira = FakeJIRA(project_versions=SOURCE_VERSIONS,
+                    transitions=TRANSITIONS)
+
+    issue = merge_arrow_pr.JiraIssue(jira, 'ARROW-1234', 'ARROW', FakeCLI())
+    all_versions, default_versions = issue.get_candidate_fix_versions()
+    assert all_versions == SOURCE_VERSIONS
+    assert default_versions == ['0.11.0']
+
+
+def test_jira_no_suggest_patch_release():
+    versions_json = [
+        {'name': '0.11.1', 'released': False},
+        {'name': '0.12.0', 'released': False},
+    ]
+
+    versions = [FakeVersion(raw['name'], raw) for raw in versions_json]
+
+    jira = FakeJIRA(project_versions=versions, transitions=TRANSITIONS)
+    issue = merge_arrow_pr.JiraIssue(jira, 'ARROW-1234', 'ARROW', FakeCLI())
+    all_versions, default_versions = issue.get_candidate_fix_versions()
+    assert all_versions == versions
+    assert default_versions == ['0.12.0']
+
+
+def test_jira_parquet_no_suggest_non_cpp():
+    # ARROW-7351
+    versions_json = [
+        {'name': 'cpp-1.5.0', 'released': True},
+        {'name': 'cpp-1.6.0', 'released': False},
+        {'name': 'cpp-1.7.0', 'released': False},
+        {'name': '1.11.0', 'released': False},
+        {'name': '1.12.0', 'released': False}
+    ]
+
+    versions = [FakeVersion(raw['name'], raw)
+                for raw in versions_json]
+
+    jira = FakeJIRA(project_versions=versions, transitions=TRANSITIONS)
+    issue = merge_arrow_pr.JiraIssue(jira, 'PARQUET-1713', 'PARQUET',
+                                     FakeCLI())
+    all_versions, default_versions = issue.get_candidate_fix_versions()
+    assert all_versions == versions
+    assert default_versions == ['cpp-1.6.0']
+
+
+def test_jira_invalid_issue():
+    class Mock:
+
+        def issue(self, jira_id):
+            raise Exception("not found")
+
+    with pytest.raises(Exception):
+        merge_arrow_pr.JiraIssue(Mock(), 'ARROW-1234', 'ARROW', FakeCLI())
+
+
+def test_jira_resolve():
+    jira = FakeJIRA(issue=FAKE_ISSUE_1,
+                    project_versions=SOURCE_VERSIONS,
+                    transitions=TRANSITIONS)
+
+    my_comment = 'my comment'
+    fix_versions = [SOURCE_VERSIONS[1].raw]
+
+    issue = merge_arrow_pr.JiraIssue(jira, 'ARROW-1234', 'ARROW', FakeCLI())
+    issue.resolve(fix_versions, my_comment)
+
+    assert jira.captured_transition == {
+        'jira_id': 'ARROW-1234',
+        'transition_id': 1,
+        'comment': my_comment,
+        'fixVersions': fix_versions
+    }
+
+
+def test_jira_resolve_non_mainline():
+    jira = FakeJIRA(issue=FAKE_ISSUE_1,
+                    project_versions=SOURCE_VERSIONS,
+                    transitions=TRANSITIONS)
+
+    my_comment = 'my comment'
+    fix_versions = [SOURCE_VERSIONS[0].raw]
+
+    issue = merge_arrow_pr.JiraIssue(jira, 'ARROW-1234', 'ARROW', FakeCLI())
+    issue.resolve(fix_versions, my_comment)
+
+    assert jira.captured_transition == {
+        'jira_id': 'ARROW-1234',
+        'transition_id': 1,
+        'comment': my_comment,
+        'fixVersions': fix_versions
+    }
+
+
+def test_jira_resolve_released_fix_version():
+    # ARROW-5083
+    jira = FakeJIRA(issue=FAKE_ISSUE_1,
+                    project_versions=SOURCE_VERSIONS,
+                    transitions=TRANSITIONS)
+
+    cmd = FakeCLI(responses=['0.9.0'])
+    fix_versions_json = merge_arrow_pr.prompt_for_fix_version(cmd, jira)
+    assert fix_versions_json == [RAW_VERSION_JSON[-1]]
+
+
+def test_multiple_authors_bad_input():
+    a0 = 'Jimbob Crawfish <jimbob.crawfish@gmail.com>'
+    a1 = 'Jarvis McCratchett <jarvis.mccratchett@hotmail.com>'
+    a2 = 'Hank Miller <hank.miller@protonmail.com>'
+    distinct_authors = [a0, a1]
+
+    cmd = FakeCLI(responses=[''])
+    primary_author, new_distinct_authors = merge_arrow_pr.get_primary_author(
+        cmd, distinct_authors)
+    assert primary_author == a0
+    assert new_distinct_authors == [a0, a1]
+
+    cmd = FakeCLI(responses=['oops', a1])
+    primary_author, new_distinct_authors = merge_arrow_pr.get_primary_author(
+        cmd, distinct_authors)
+    assert primary_author == a1
+    assert new_distinct_authors == [a1, a0]
+
+    cmd = FakeCLI(responses=[a2])
+    primary_author, new_distinct_authors = merge_arrow_pr.get_primary_author(
+        cmd, distinct_authors)
+    assert primary_author == a2
+    assert new_distinct_authors == [a2, a0, a1]
+
+
+def test_jira_already_resolved():
+    status = FakeStatus('Resolved')
+    fields = FakeFields(status, 'issue summary', FakeAssignee('groundhog'),
+                        [FakeComponent('Java')], [])
+    issue = FakeIssue(fields)
+
+    jira = FakeJIRA(issue=issue,
+                    project_versions=SOURCE_VERSIONS,
+                    transitions=TRANSITIONS)
+
+    fix_versions = [SOURCE_VERSIONS[0].raw]
+    issue = merge_arrow_pr.JiraIssue(jira, 'ARROW-1234', 'ARROW', FakeCLI())
+
+    with pytest.raises(Exception,
+                       match="ARROW-1234 already has status 'Resolved'"):
+        issue.resolve(fix_versions, "")
+
+
+def test_no_unset_point_release_fix_version():
+    # ARROW-6915: We have had the problem of issues marked with a point release
+    # having their fix versions overwritten by the merge tool. This verifies
+    # that existing patch release versions are carried over
+    status = FakeStatus('In Progress')
+
+    versions_json = {
+        '0.14.2': {'name': '0.14.2', 'id': 1},
+        '0.15.1': {'name': '0.15.1', 'id': 2},
+        '0.16.0': {'name': '0.16.0', 'id': 3},
+        '0.17.0': {'name': '0.17.0', 'id': 4}
+    }
+
+    fields = FakeFields(status, 'summary', FakeAssignee('someone'),
+                        [FakeComponent('Java')],
+                        [FakeVersion(v, versions_json[v])
+                         for v in ['0.17.0', '0.15.1', '0.14.2']])
+    issue = FakeIssue(fields)
+
+    jira = FakeJIRA(issue=issue, project_versions=SOURCE_VERSIONS,
+                    transitions=TRANSITIONS)
+
+    issue = merge_arrow_pr.JiraIssue(jira, 'ARROW-1234', 'ARROW', FakeCLI())
+    issue.resolve([versions_json['0.16.0']], "a comment")
+
+    assert jira.captured_transition == {
+        'jira_id': 'ARROW-1234',
+        'transition_id': 1,
+        'comment': 'a comment',
+        'fixVersions': [versions_json[v]
+                        for v in ['0.16.0', '0.15.1', '0.14.2']]
+    }
+
+    issue.resolve([versions_json['0.15.1']], "a comment")
+
+    assert jira.captured_transition == {
+        'jira_id': 'ARROW-1234',
+        'transition_id': 1,
+        'comment': 'a comment',
+        'fixVersions': [versions_json[v] for v in ['0.15.1', '0.14.2']]
+    }
+
+
+def test_jira_output_no_components():
+    # ARROW-5472
+    status = 'Interesting work'
+    components = []
+    output = merge_arrow_pr.format_jira_output(
+        'ARROW-1234', 'Resolved', status, FakeAssignee('Foo Bar'),
+        components)
+
+    assert output == """=== JIRA ARROW-1234 ===
+Summary\t\tInteresting work
+Assignee\tFoo Bar
+Components\tNO COMPONENTS!!!
+Status\t\tResolved
+URL\t\thttps://issues.apache.org/jira/browse/ARROW-1234"""
+
+    output = merge_arrow_pr.format_jira_output(
+        'ARROW-1234', 'Resolved', status, FakeAssignee('Foo Bar'),
+        [FakeComponent('C++'), FakeComponent('Python')])
+
+    assert output == """=== JIRA ARROW-1234 ===
+Summary\t\tInteresting work
+Assignee\tFoo Bar
+Components\tC++, Python
+Status\t\tResolved
+URL\t\thttps://issues.apache.org/jira/browse/ARROW-1234"""