summaryrefslogtreecommitdiffstats
path: root/src/osd/OSDMap.h
diff options
context:
space:
mode:
authorDaniel Baumann <daniel.baumann@progress-linux.org>2024-04-21 11:54:28 +0000
committerDaniel Baumann <daniel.baumann@progress-linux.org>2024-04-21 11:54:28 +0000
commite6918187568dbd01842d8d1d2c808ce16a894239 (patch)
tree64f88b554b444a49f656b6c656111a145cbbaa28 /src/osd/OSDMap.h
parentInitial commit. (diff)
downloadceph-e6918187568dbd01842d8d1d2c808ce16a894239.tar.xz
ceph-e6918187568dbd01842d8d1d2c808ce16a894239.zip
Adding upstream version 18.2.2.upstream/18.2.2
Signed-off-by: Daniel Baumann <daniel.baumann@progress-linux.org>
Diffstat (limited to 'src/osd/OSDMap.h')
-rw-r--r--src/osd/OSDMap.h1798
1 files changed, 1798 insertions, 0 deletions
diff --git a/src/osd/OSDMap.h b/src/osd/OSDMap.h
new file mode 100644
index 000000000..3a3e6155e
--- /dev/null
+++ b/src/osd/OSDMap.h
@@ -0,0 +1,1798 @@
+// -*- mode:C++; tab-width:8; c-basic-offset:2; indent-tabs-mode:t -*-
+// vim: ts=8 sw=2 smarttab
+/*
+ * Ceph - scalable distributed file system
+ *
+ * Copyright (C) 2004-2006 Sage Weil <sage@newdream.net>
+ * Copyright (C) 2013,2014 Cloudwatt <libre.licensing@cloudwatt.com>
+ *
+ * Author: Loic Dachary <loic@dachary.org>
+ *
+ * This is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU Lesser General Public
+ * License version 2.1, as published by the Free Software
+ * Foundation. See file COPYING.
+ *
+ */
+
+
+#ifndef CEPH_OSDMAP_H
+#define CEPH_OSDMAP_H
+
+/*
+ * describe properties of the OSD cluster.
+ * disks, disk groups, total # osds,
+ *
+ */
+#include <vector>
+#include <list>
+#include <set>
+#include <map>
+#include <memory>
+
+#include <boost/smart_ptr/local_shared_ptr.hpp>
+#include "include/btree_map.h"
+#include "include/common_fwd.h"
+#include "include/types.h"
+#include "common/ceph_releases.h"
+#include "osd_types.h"
+
+//#include "include/ceph_features.h"
+#include "crush/CrushWrapper.h"
+
+// forward declaration
+class CrushWrapper;
+class health_check_map_t;
+
+/*
+ * we track up to two intervals during which the osd was alive and
+ * healthy. the most recent is [up_from,up_thru), where up_thru is
+ * the last epoch the osd is known to have _started_. i.e., a lower
+ * bound on the actual osd death. down_at (if it is > up_from) is an
+ * upper bound on the actual osd death.
+ *
+ * the second is the last_clean interval [begin,end). in that case,
+ * the last interval is the last epoch known to have been either
+ * _finished_, or during which the osd cleanly shut down. when
+ * possible, we push this forward to the epoch the osd was eventually
+ * marked down.
+ *
+ * the lost_at is used to allow build_prior to proceed without waiting
+ * for an osd to recover. In certain cases, progress may be blocked
+ * because an osd is down that may contain updates (i.e., a pg may have
+ * gone rw during an interval). If the osd can't be brought online, we
+ * can force things to proceed knowing that we _might_ be losing some
+ * acked writes. If the osd comes back to life later, that's fine to,
+ * but those writes will still be lost (the divergent objects will be
+ * thrown out).
+ */
+struct osd_info_t {
+ epoch_t last_clean_begin; // last interval that ended with a clean osd shutdown
+ epoch_t last_clean_end;
+ epoch_t up_from; // epoch osd marked up
+ epoch_t up_thru; // lower bound on actual osd death (if > up_from)
+ epoch_t down_at; // upper bound on actual osd death (if > up_from)
+ epoch_t lost_at; // last epoch we decided data was "lost"
+
+ osd_info_t() : last_clean_begin(0), last_clean_end(0),
+ up_from(0), up_thru(0), down_at(0), lost_at(0) {}
+
+ void dump(ceph::Formatter *f) const;
+ void encode(ceph::buffer::list& bl) const;
+ void decode(ceph::buffer::list::const_iterator& bl);
+ static void generate_test_instances(std::list<osd_info_t*>& o);
+};
+WRITE_CLASS_ENCODER(osd_info_t)
+
+std::ostream& operator<<(std::ostream& out, const osd_info_t& info);
+
+struct osd_xinfo_t {
+ utime_t down_stamp; ///< timestamp when we were last marked down
+ float laggy_probability; ///< encoded as __u32: 0 = definitely not laggy, 0xffffffff definitely laggy
+ __u32 laggy_interval; ///< average interval between being marked laggy and recovering
+ uint64_t features; ///< features supported by this osd we should know about
+ __u32 old_weight; ///< weight prior to being auto marked out
+ utime_t last_purged_snaps_scrub; ///< last scrub of purged_snaps
+ epoch_t dead_epoch = 0; ///< last epoch we were confirmed dead (not just down)
+
+ osd_xinfo_t() : laggy_probability(0), laggy_interval(0),
+ features(0), old_weight(0) {}
+
+ void dump(ceph::Formatter *f) const;
+ void encode(ceph::buffer::list& bl, uint64_t features) const;
+ void decode(ceph::buffer::list::const_iterator& bl);
+ static void generate_test_instances(std::list<osd_xinfo_t*>& o);
+};
+WRITE_CLASS_ENCODER_FEATURES(osd_xinfo_t)
+
+std::ostream& operator<<(std::ostream& out, const osd_xinfo_t& xi);
+
+
+struct PGTempMap {
+#if 1
+ ceph::buffer::list data;
+ typedef btree::btree_map<pg_t,ceph_le32*> map_t;
+ map_t map;
+
+ void encode(ceph::buffer::list& bl) const {
+ using ceph::encode;
+ uint32_t n = map.size();
+ encode(n, bl);
+ for (auto &p : map) {
+ encode(p.first, bl);
+ bl.append((char*)p.second, (*p.second + 1) * sizeof(ceph_le32));
+ }
+ }
+ void decode(ceph::buffer::list::const_iterator& p) {
+ using ceph::decode;
+ data.clear();
+ map.clear();
+ uint32_t n;
+ decode(n, p);
+ if (!n)
+ return;
+ auto pstart = p;
+ size_t start_off = pstart.get_off();
+ std::vector<std::pair<pg_t,size_t>> offsets;
+ offsets.resize(n);
+ for (unsigned i=0; i<n; ++i) {
+ pg_t pgid;
+ decode(pgid, p);
+ offsets[i].first = pgid;
+ offsets[i].second = p.get_off() - start_off;
+ uint32_t vn;
+ decode(vn, p);
+ p += vn * sizeof(int32_t);
+ }
+ size_t len = p.get_off() - start_off;
+ pstart.copy(len, data);
+ if (data.get_num_buffers() > 1) {
+ data.rebuild();
+ }
+ //map.reserve(n);
+ char *start = data.c_str();
+ for (auto i : offsets) {
+ map.insert(map.end(), std::make_pair(i.first, (ceph_le32*)(start + i.second)));
+ }
+ }
+ void rebuild() {
+ ceph::buffer::list bl;
+ encode(bl);
+ auto p = std::cbegin(bl);
+ decode(p);
+ }
+ friend bool operator==(const PGTempMap& l, const PGTempMap& r) {
+ return
+ l.map.size() == r.map.size() &&
+ l.data.contents_equal(r.data);
+ }
+
+ class iterator {
+ map_t::const_iterator it;
+ map_t::const_iterator end;
+ std::pair<pg_t,std::vector<int32_t>> current;
+ void init_current() {
+ if (it != end) {
+ current.first = it->first;
+ ceph_assert(it->second);
+ current.second.resize(*it->second);
+ ceph_le32 *p = it->second + 1;
+ for (uint32_t n = 0; n < *it->second; ++n, ++p) {
+ current.second[n] = *p;
+ }
+ }
+ }
+ public:
+ iterator(map_t::const_iterator p,
+ map_t::const_iterator e)
+ : it(p), end(e) {
+ init_current();
+ }
+
+ const std::pair<pg_t,std::vector<int32_t>>& operator*() const {
+ return current;
+ }
+ const std::pair<pg_t,std::vector<int32_t>>* operator->() const {
+ return &current;
+ }
+ friend bool operator==(const iterator& l, const iterator& r) {
+ return l.it == r.it;
+ }
+ friend bool operator!=(const iterator& l, const iterator& r) {
+ return l.it != r.it;
+ }
+ iterator& operator++() {
+ ++it;
+ if (it != end)
+ init_current();
+ return *this;
+ }
+ iterator operator++(int) {
+ iterator r = *this;
+ ++it;
+ if (it != end)
+ init_current();
+ return r;
+ }
+ };
+ iterator begin() const {
+ return iterator(map.begin(), map.end());
+ }
+ iterator end() const {
+ return iterator(map.end(), map.end());
+ }
+ iterator find(pg_t pgid) const {
+ return iterator(map.find(pgid), map.end());
+ }
+ size_t size() const {
+ return map.size();
+ }
+ size_t count(pg_t pgid) const {
+ return map.count(pgid);
+ }
+ void erase(pg_t pgid) {
+ map.erase(pgid);
+ }
+ void clear() {
+ map.clear();
+ data.clear();
+ }
+ void set(pg_t pgid, const mempool::osdmap::vector<int32_t>& v) {
+ using ceph::encode;
+ size_t need = sizeof(ceph_le32) * (1 + v.size());
+ if (need < data.get_append_buffer_unused_tail_length()) {
+ ceph::buffer::ptr z(data.get_append_buffer_unused_tail_length());
+ z.zero();
+ data.append(z.c_str(), z.length());
+ }
+ encode(v, data);
+ map[pgid] = (ceph_le32*)(data.back().end_c_str()) - (1 + v.size());
+ }
+ mempool::osdmap::vector<int32_t> get(pg_t pgid) {
+ mempool::osdmap::vector<int32_t> v;
+ ceph_le32 *p = map[pgid];
+ size_t n = *p++;
+ v.resize(n);
+ for (size_t i = 0; i < n; ++i, ++p) {
+ v[i] = *p;
+ }
+ return v;
+ }
+#else
+ // trivial implementation
+ mempool::osdmap::map<pg_t,mempool::osdmap::vector<int32_t> > pg_temp;
+
+ void encode(ceph::buffer::list& bl) const {
+ encode(pg_temp, bl);
+ }
+ void decode(ceph::buffer::list::const_iterator& p) {
+ decode(pg_temp, p);
+ }
+ friend bool operator==(const PGTempMap& l, const PGTempMap& r) {
+ return
+ l.pg_temp.size() == r.pg_temp.size() &&
+ l.pg_temp == r.pg_temp;
+ }
+
+ class iterator {
+ mempool::osdmap::map<pg_t,mempool::osdmap::vector<int32_t> >::const_iterator it;
+ public:
+ iterator(mempool::osdmap::map<pg_t,
+ mempool::osdmap::vector<int32_t> >::const_iterator p)
+ : it(p) {}
+
+ std::pair<pg_t,const mempool::osdmap::vector<int32_t>&> operator*() const {
+ return *it;
+ }
+ const std::pair<const pg_t,mempool::osdmap::vector<int32_t>>* operator->() const {
+ return &*it;
+ }
+ friend bool operator==(const iterator& l, const iterator& r) {
+ return l.it == r.it;
+ }
+ friend bool operator!=(const iterator& l, const iterator& r) {
+ return l.it != r.it;
+ }
+ iterator& operator++() {
+ ++it;
+ return *this;
+ }
+ iterator operator++(int) {
+ iterator r = *this;
+ ++it;
+ return r;
+ }
+ };
+ iterator begin() const {
+ return iterator(pg_temp.cbegin());
+ }
+ iterator end() const {
+ return iterator(pg_temp.cend());
+ }
+ iterator find(pg_t pgid) const {
+ return iterator(pg_temp.find(pgid));
+ }
+ size_t size() const {
+ return pg_temp.size();
+ }
+ size_t count(pg_t pgid) const {
+ return pg_temp.count(pgid);
+ }
+ void erase(pg_t pgid) {
+ pg_temp.erase(pgid);
+ }
+ void clear() {
+ pg_temp.clear();
+ }
+ void set(pg_t pgid, const mempool::osdmap::vector<int32_t>& v) {
+ pg_temp[pgid] = v;
+ }
+ const mempool::osdmap::vector<int32_t>& get(pg_t pgid) {
+ return pg_temp.at(pgid);
+ }
+#endif
+ void dump(ceph::Formatter *f) const {
+ for (const auto &pg : *this) {
+ f->open_object_section("osds");
+ f->dump_stream("pgid") << pg.first;
+ f->open_array_section("osds");
+ for (const auto osd : pg.second)
+ f->dump_int("osd", osd);
+ f->close_section();
+ f->close_section();
+ }
+ }
+};
+WRITE_CLASS_ENCODER(PGTempMap)
+
+/** OSDMap
+ */
+class OSDMap {
+public:
+ MEMPOOL_CLASS_HELPERS();
+
+ class Incremental {
+ public:
+ MEMPOOL_CLASS_HELPERS();
+
+ /// feature bits we were encoded with. the subsequent OSDMap
+ /// encoding should match.
+ uint64_t encode_features;
+ uuid_d fsid;
+ epoch_t epoch; // new epoch; we are a diff from epoch-1 to epoch
+ utime_t modified;
+ int64_t new_pool_max; //incremented by the OSDMonitor on each pool create
+ int32_t new_flags;
+ ceph_release_t new_require_osd_release{0xff};
+ uint32_t new_stretch_bucket_count{0};
+ uint32_t new_degraded_stretch_mode{0};
+ uint32_t new_recovering_stretch_mode{0};
+ int32_t new_stretch_mode_bucket{0};
+ bool stretch_mode_enabled{false};
+ bool change_stretch_mode{false};
+
+ enum class mutate_allow_crimson_t : uint8_t {
+ NONE = 0,
+ SET = 1,
+ // Monitor won't allow CLEAR to be set currently, but we may allow it later
+ CLEAR = 2
+ } mutate_allow_crimson = mutate_allow_crimson_t::NONE;
+
+ // full (rare)
+ ceph::buffer::list fullmap; // in lieu of below.
+ ceph::buffer::list crush;
+
+ // incremental
+ int32_t new_max_osd;
+ mempool::osdmap::map<int64_t,pg_pool_t> new_pools;
+ mempool::osdmap::map<int64_t,std::string> new_pool_names;
+ mempool::osdmap::set<int64_t> old_pools;
+ mempool::osdmap::map<std::string,std::map<std::string,std::string> > new_erasure_code_profiles;
+ mempool::osdmap::vector<std::string> old_erasure_code_profiles;
+ mempool::osdmap::map<int32_t,entity_addrvec_t> new_up_client;
+ mempool::osdmap::map<int32_t,entity_addrvec_t> new_up_cluster;
+ mempool::osdmap::map<int32_t,uint32_t> new_state; // XORed onto previous state.
+ mempool::osdmap::map<int32_t,uint32_t> new_weight;
+ mempool::osdmap::map<pg_t,mempool::osdmap::vector<int32_t> > new_pg_temp; // [] to remove
+ mempool::osdmap::map<pg_t, int32_t> new_primary_temp; // [-1] to remove
+ mempool::osdmap::map<int32_t,uint32_t> new_primary_affinity;
+ mempool::osdmap::map<int32_t,epoch_t> new_up_thru;
+ mempool::osdmap::map<int32_t,std::pair<epoch_t,epoch_t> > new_last_clean_interval;
+ mempool::osdmap::map<int32_t,epoch_t> new_lost;
+ mempool::osdmap::map<int32_t,uuid_d> new_uuid;
+ mempool::osdmap::map<int32_t,osd_xinfo_t> new_xinfo;
+
+ mempool::osdmap::map<entity_addr_t,utime_t> new_blocklist;
+ mempool::osdmap::vector<entity_addr_t> old_blocklist;
+ mempool::osdmap::map<entity_addr_t,utime_t> new_range_blocklist;
+ mempool::osdmap::vector<entity_addr_t> old_range_blocklist;
+ mempool::osdmap::map<int32_t, entity_addrvec_t> new_hb_back_up;
+ mempool::osdmap::map<int32_t, entity_addrvec_t> new_hb_front_up;
+
+ mempool::osdmap::map<pg_t,mempool::osdmap::vector<int32_t>> new_pg_upmap;
+ mempool::osdmap::map<pg_t,mempool::osdmap::vector<std::pair<int32_t,int32_t>>> new_pg_upmap_items;
+ mempool::osdmap::map<pg_t, int32_t> new_pg_upmap_primary;
+ mempool::osdmap::set<pg_t> old_pg_upmap, old_pg_upmap_items, old_pg_upmap_primary;
+ mempool::osdmap::map<int64_t, snap_interval_set_t> new_removed_snaps;
+ mempool::osdmap::map<int64_t, snap_interval_set_t> new_purged_snaps;
+
+ mempool::osdmap::map<int32_t,uint32_t> new_crush_node_flags;
+ mempool::osdmap::map<int32_t,uint32_t> new_device_class_flags;
+
+ std::string cluster_snapshot;
+
+ float new_nearfull_ratio = -1;
+ float new_backfillfull_ratio = -1;
+ float new_full_ratio = -1;
+
+ ceph_release_t new_require_min_compat_client{0xff};
+
+ utime_t new_last_up_change, new_last_in_change;
+
+ mutable bool have_crc; ///< crc values are defined
+ uint32_t full_crc; ///< crc of the resulting OSDMap
+ mutable uint32_t inc_crc; ///< crc of this incremental
+
+ int get_net_marked_out(const OSDMap *previous) const;
+ int get_net_marked_down(const OSDMap *previous) const;
+ int identify_osd(uuid_d u) const;
+
+ void encode_client_old(ceph::buffer::list& bl) const;
+ void encode_classic(ceph::buffer::list& bl, uint64_t features) const;
+ void encode(ceph::buffer::list& bl, uint64_t features=CEPH_FEATURES_ALL) const;
+ void decode_classic(ceph::buffer::list::const_iterator &p);
+ void decode(ceph::buffer::list::const_iterator &bl);
+ void dump(ceph::Formatter *f) const;
+ static void generate_test_instances(std::list<Incremental*>& o);
+
+ explicit Incremental(epoch_t e=0) :
+ encode_features(0),
+ epoch(e), new_pool_max(-1), new_flags(-1), new_max_osd(-1),
+ have_crc(false), full_crc(0), inc_crc(0) {
+ }
+ explicit Incremental(ceph::buffer::list &bl) {
+ auto p = std::cbegin(bl);
+ decode(p);
+ }
+ explicit Incremental(ceph::buffer::list::const_iterator &p) {
+ decode(p);
+ }
+
+ pg_pool_t *get_new_pool(int64_t pool, const pg_pool_t *orig) {
+ if (new_pools.count(pool) == 0)
+ new_pools[pool] = *orig;
+ return &new_pools[pool];
+ }
+ bool has_erasure_code_profile(const std::string &name) const {
+ auto i = new_erasure_code_profiles.find(name);
+ return i != new_erasure_code_profiles.end();
+ }
+ void set_erasure_code_profile(const std::string &name,
+ const std::map<std::string,std::string>& profile) {
+ new_erasure_code_profiles[name] = profile;
+ }
+ mempool::osdmap::map<std::string,std::map<std::string,std::string>> get_erasure_code_profiles() const {
+ return new_erasure_code_profiles;
+ }
+
+ /// propagate update pools' (snap and other) metadata to any of their tiers
+ int propagate_base_properties_to_tiers(CephContext *cct, const OSDMap &base);
+
+ /// filter out osds with any pending state changing
+ size_t get_pending_state_osds(std::vector<int> *osds) {
+ ceph_assert(osds);
+ osds->clear();
+
+ for (auto &p : new_state) {
+ osds->push_back(p.first);
+ }
+
+ return osds->size();
+ }
+
+ bool pending_osd_has_state(int osd, unsigned state) {
+ return new_state.count(osd) && (new_state[osd] & state) != 0;
+ }
+
+ bool pending_osd_state_set(int osd, unsigned state) {
+ if (pending_osd_has_state(osd, state))
+ return false;
+ new_state[osd] |= state;
+ return true;
+ }
+
+ // cancel the specified pending osd state if there is any
+ // return ture on success, false otherwise.
+ bool pending_osd_state_clear(int osd, unsigned state) {
+ if (!pending_osd_has_state(osd, state)) {
+ // never has been set or already has been cancelled.
+ return false;
+ }
+
+ new_state[osd] &= ~state;
+ if (!new_state[osd]) {
+ // all flags cleared
+ new_state.erase(osd);
+ }
+ return true;
+ }
+
+ bool in_new_removed_snaps(int64_t pool, snapid_t snap) const {
+ auto p = new_removed_snaps.find(pool);
+ if (p == new_removed_snaps.end()) {
+ return false;
+ }
+ return p->second.contains(snap);
+ }
+
+ void set_allow_crimson() { mutate_allow_crimson = mutate_allow_crimson_t::SET; }
+ };
+
+private:
+ uuid_d fsid;
+ epoch_t epoch; // what epoch of the osd cluster descriptor is this
+ utime_t created, modified; // epoch start time
+ int32_t pool_max; // the largest pool num, ever
+
+ uint32_t flags;
+
+ int num_osd; // not saved; see calc_num_osds
+ int num_up_osd; // not saved; see calc_num_osds
+ int num_in_osd; // not saved; see calc_num_osds
+
+ int32_t max_osd;
+ std::vector<uint32_t> osd_state;
+
+ mempool::osdmap::map<int32_t,uint32_t> crush_node_flags; // crush node -> CEPH_OSD_* flags
+ mempool::osdmap::map<int32_t,uint32_t> device_class_flags; // device class -> CEPH_OSD_* flags
+
+ utime_t last_up_change, last_in_change;
+
+ // These features affect OSDMap[::Incremental] encoding, or the
+ // encoding of some type embedded therein (CrushWrapper, something
+ // from osd_types, etc.).
+ static constexpr uint64_t SIGNIFICANT_FEATURES =
+ CEPH_FEATUREMASK_PGID64 |
+ CEPH_FEATUREMASK_PGPOOL3 |
+ CEPH_FEATUREMASK_OSDENC |
+ CEPH_FEATUREMASK_OSDMAP_ENC |
+ CEPH_FEATUREMASK_OSD_POOLRESEND |
+ CEPH_FEATUREMASK_NEW_OSDOP_ENCODING |
+ CEPH_FEATUREMASK_MSG_ADDR2 |
+ CEPH_FEATUREMASK_CRUSH_TUNABLES5 |
+ CEPH_FEATUREMASK_CRUSH_CHOOSE_ARGS |
+ CEPH_FEATUREMASK_SERVER_LUMINOUS |
+ CEPH_FEATUREMASK_SERVER_MIMIC |
+ CEPH_FEATUREMASK_SERVER_NAUTILUS |
+ CEPH_FEATUREMASK_SERVER_OCTOPUS |
+ CEPH_FEATUREMASK_SERVER_REEF;
+
+ struct addrs_s {
+ mempool::osdmap::vector<std::shared_ptr<entity_addrvec_t> > client_addrs;
+ mempool::osdmap::vector<std::shared_ptr<entity_addrvec_t> > cluster_addrs;
+ mempool::osdmap::vector<std::shared_ptr<entity_addrvec_t> > hb_back_addrs;
+ mempool::osdmap::vector<std::shared_ptr<entity_addrvec_t> > hb_front_addrs;
+ };
+ std::shared_ptr<addrs_s> osd_addrs;
+
+ entity_addrvec_t _blank_addrvec;
+
+ mempool::osdmap::vector<__u32> osd_weight; // 16.16 fixed point, 0x10000 = "in", 0 = "out"
+ mempool::osdmap::vector<osd_info_t> osd_info;
+ std::shared_ptr<PGTempMap> pg_temp; // temp pg mapping (e.g. while we rebuild)
+ std::shared_ptr< mempool::osdmap::map<pg_t,int32_t > > primary_temp; // temp primary mapping (e.g. while we rebuild)
+ std::shared_ptr< mempool::osdmap::vector<__u32> > osd_primary_affinity; ///< 16.16 fixed point, 0x10000 = baseline
+
+ // remap (post-CRUSH, pre-up)
+ mempool::osdmap::map<pg_t,mempool::osdmap::vector<int32_t>> pg_upmap; ///< remap pg
+ mempool::osdmap::map<pg_t,mempool::osdmap::vector<std::pair<int32_t,int32_t>>> pg_upmap_items; ///< remap osds in up set
+ mempool::osdmap::map<pg_t, int32_t> pg_upmap_primaries; ///< remap primary of a pg
+
+ mempool::osdmap::map<int64_t,pg_pool_t> pools;
+ mempool::osdmap::map<int64_t,std::string> pool_name;
+ mempool::osdmap::map<std::string, std::map<std::string,std::string>> erasure_code_profiles;
+ mempool::osdmap::map<std::string,int64_t, std::less<>> name_pool;
+
+ std::shared_ptr< mempool::osdmap::vector<uuid_d> > osd_uuid;
+ mempool::osdmap::vector<osd_xinfo_t> osd_xinfo;
+
+ class range_bits {
+ struct ip6 {
+ uint64_t upper_64_bits, lower_64_bits;
+ uint64_t upper_mask, lower_mask;
+ };
+ struct ip4 {
+ uint32_t ip_32_bits;
+ uint32_t mask;
+ };
+ union {
+ ip6 ipv6;
+ ip4 ipv4;
+ } bits;
+ bool ipv6;
+ static void get_ipv6_bytes(unsigned const char *addr,
+ uint64_t *upper, uint64_t *lower);
+ public:
+ range_bits();
+ range_bits(const entity_addr_t& addr);
+ void parse(const entity_addr_t& addr);
+ bool matches(const entity_addr_t& addr) const;
+ };
+ mempool::osdmap::unordered_map<entity_addr_t,utime_t> blocklist;
+ mempool::osdmap::map<entity_addr_t,utime_t> range_blocklist;
+ mempool::osdmap::map<entity_addr_t,range_bits> calculated_ranges;
+
+ /// queue of snaps to remove
+ mempool::osdmap::map<int64_t, snap_interval_set_t> removed_snaps_queue;
+
+ /// removed_snaps additions this epoch
+ mempool::osdmap::map<int64_t, snap_interval_set_t> new_removed_snaps;
+
+ /// removed_snaps removals this epoch
+ mempool::osdmap::map<int64_t, snap_interval_set_t> new_purged_snaps;
+
+ epoch_t cluster_snapshot_epoch;
+ std::string cluster_snapshot;
+ bool new_blocklist_entries;
+
+ float full_ratio = 0, backfillfull_ratio = 0, nearfull_ratio = 0;
+
+ /// min compat client we want to support
+ ceph_release_t require_min_compat_client{ceph_release_t::unknown};
+
+public:
+ /// require osds to run at least this release
+ ceph_release_t require_osd_release{ceph_release_t::unknown};
+
+private:
+ mutable uint64_t cached_up_osd_features;
+
+ mutable bool crc_defined;
+ mutable uint32_t crc;
+
+ void _calc_up_osd_features();
+
+ public:
+ bool have_crc() const { return crc_defined; }
+ uint32_t get_crc() const { return crc; }
+
+ std::shared_ptr<CrushWrapper> crush; // hierarchical map
+ bool stretch_mode_enabled; // we are in stretch mode, requiring multiple sites
+ uint32_t stretch_bucket_count; // number of sites we expect to be in
+ uint32_t degraded_stretch_mode; // 0 if not degraded; else count of up sites
+ uint32_t recovering_stretch_mode; // 0 if not recovering; else 1
+ int32_t stretch_mode_bucket; // the bucket type we're stretched across
+ bool allow_crimson{false};
+private:
+ uint32_t crush_version = 1;
+
+ friend class OSDMonitor;
+
+ public:
+ OSDMap() : epoch(0),
+ pool_max(0),
+ flags(0),
+ num_osd(0), num_up_osd(0), num_in_osd(0),
+ max_osd(0),
+ osd_addrs(std::make_shared<addrs_s>()),
+ pg_temp(std::make_shared<PGTempMap>()),
+ primary_temp(std::make_shared<mempool::osdmap::map<pg_t,int32_t>>()),
+ osd_uuid(std::make_shared<mempool::osdmap::vector<uuid_d>>()),
+ cluster_snapshot_epoch(0),
+ new_blocklist_entries(false),
+ cached_up_osd_features(0),
+ crc_defined(false), crc(0),
+ crush(std::make_shared<CrushWrapper>()),
+ stretch_mode_enabled(false), stretch_bucket_count(0),
+ degraded_stretch_mode(0), recovering_stretch_mode(0), stretch_mode_bucket(0) {
+ }
+
+private:
+ OSDMap(const OSDMap& other) = default;
+ OSDMap& operator=(const OSDMap& other) = default;
+public:
+
+ /// return feature mask subset that is relevant to OSDMap encoding
+ static uint64_t get_significant_features(uint64_t features) {
+ return SIGNIFICANT_FEATURES & features;
+ }
+
+ uint64_t get_encoding_features() const;
+
+ void deepish_copy_from(const OSDMap& o) {
+ *this = o;
+ primary_temp.reset(new mempool::osdmap::map<pg_t,int32_t>(*o.primary_temp));
+ pg_temp.reset(new PGTempMap(*o.pg_temp));
+ osd_uuid.reset(new mempool::osdmap::vector<uuid_d>(*o.osd_uuid));
+
+ if (o.osd_primary_affinity)
+ osd_primary_affinity.reset(new mempool::osdmap::vector<__u32>(*o.osd_primary_affinity));
+
+ // NOTE: this still references shared entity_addrvec_t's.
+ osd_addrs.reset(new addrs_s(*o.osd_addrs));
+
+ // NOTE: we do not copy crush. note that apply_incremental will
+ // allocate a new CrushWrapper, though.
+ }
+
+ // map info
+ const uuid_d& get_fsid() const { return fsid; }
+ void set_fsid(uuid_d& f) { fsid = f; }
+
+ epoch_t get_epoch() const { return epoch; }
+ void inc_epoch() { epoch++; }
+
+ void set_epoch(epoch_t e);
+
+ uint32_t get_crush_version() const {
+ return crush_version;
+ }
+
+ /* stamps etc */
+ const utime_t& get_created() const { return created; }
+ const utime_t& get_modified() const { return modified; }
+
+ bool is_blocklisted(const entity_addr_t& a, CephContext *cct=nullptr) const;
+ bool is_blocklisted(const entity_addrvec_t& a, CephContext *cct=nullptr) const;
+ void get_blocklist(std::list<std::pair<entity_addr_t,utime_t > > *bl,
+ std::list<std::pair<entity_addr_t,utime_t> > *rl) const;
+ void get_blocklist(std::set<entity_addr_t> *bl,
+ std::set<entity_addr_t> *rl) const;
+
+ std::string get_cluster_snapshot() const {
+ if (cluster_snapshot_epoch == epoch)
+ return cluster_snapshot;
+ return std::string();
+ }
+
+ float get_full_ratio() const {
+ return full_ratio;
+ }
+ float get_backfillfull_ratio() const {
+ return backfillfull_ratio;
+ }
+ float get_nearfull_ratio() const {
+ return nearfull_ratio;
+ }
+ void get_full_pools(CephContext *cct,
+ std::set<int64_t> *full,
+ std::set<int64_t> *backfillfull,
+ std::set<int64_t> *nearfull) const;
+ void get_full_osd_counts(std::set<int> *full, std::set<int> *backfill,
+ std::set<int> *nearfull) const;
+
+
+ /***** cluster state *****/
+ /* osds */
+ int get_max_osd() const { return max_osd; }
+ void set_max_osd(int m);
+
+ unsigned get_num_osds() const {
+ return num_osd;
+ }
+ unsigned get_num_up_osds() const {
+ return num_up_osd;
+ }
+ unsigned get_num_in_osds() const {
+ return num_in_osd;
+ }
+ /// recalculate cached values for get_num{,_up,_in}_osds
+ int calc_num_osds();
+
+ void get_all_osds(std::set<int32_t>& ls) const;
+ void get_up_osds(std::set<int32_t>& ls) const;
+ void get_out_existing_osds(std::set<int32_t>& ls) const;
+ unsigned get_num_pg_temp() const {
+ return pg_temp->size();
+ }
+
+ int get_flags() const { return flags; }
+ bool test_flag(int f) const { return flags & f; }
+ void set_flag(int f) { flags |= f; }
+ void clear_flag(int f) { flags &= ~f; }
+
+ void get_flag_set(std::set<std::string> *flagset) const;
+
+ static void calc_state_set(int state, std::set<std::string>& st);
+
+ int get_state(int o) const {
+ ceph_assert(o < max_osd);
+ return osd_state[o];
+ }
+ int get_state(int o, std::set<std::string>& st) const {
+ ceph_assert(o < max_osd);
+ unsigned t = osd_state[o];
+ calc_state_set(t, st);
+ return osd_state[o];
+ }
+ void set_state(int o, unsigned s) {
+ ceph_assert(o < max_osd);
+ osd_state[o] = s;
+ }
+ void set_weight(int o, unsigned w) {
+ ceph_assert(o < max_osd);
+ osd_weight[o] = w;
+ if (w)
+ osd_state[o] |= CEPH_OSD_EXISTS;
+ }
+ unsigned get_weight(int o) const {
+ ceph_assert(o < max_osd);
+ return osd_weight[o];
+ }
+ float get_weightf(int o) const {
+ return (float)get_weight(o) / (float)CEPH_OSD_IN;
+ }
+ void adjust_osd_weights(const std::map<int,double>& weights, Incremental& inc) const;
+
+ void set_primary_affinity(int o, int w) {
+ ceph_assert(o < max_osd);
+ if (!osd_primary_affinity)
+ osd_primary_affinity.reset(
+ new mempool::osdmap::vector<__u32>(
+ max_osd, CEPH_OSD_DEFAULT_PRIMARY_AFFINITY));
+ (*osd_primary_affinity)[o] = w;
+ }
+ unsigned get_primary_affinity(int o) const {
+ ceph_assert(o < max_osd);
+ if (!osd_primary_affinity)
+ return CEPH_OSD_DEFAULT_PRIMARY_AFFINITY;
+ return (*osd_primary_affinity)[o];
+ }
+ float get_primary_affinityf(int o) const {
+ return (float)get_primary_affinity(o) / (float)CEPH_OSD_MAX_PRIMARY_AFFINITY;
+ }
+
+ bool has_erasure_code_profile(const std::string &name) const {
+ auto i = erasure_code_profiles.find(name);
+ return i != erasure_code_profiles.end();
+ }
+ int get_erasure_code_profile_default(CephContext *cct,
+ std::map<std::string,std::string> &profile_map,
+ std::ostream *ss);
+ void set_erasure_code_profile(const std::string &name,
+ const std::map<std::string,std::string>& profile) {
+ erasure_code_profiles[name] = profile;
+ }
+ const std::map<std::string,std::string> &get_erasure_code_profile(
+ const std::string &name) const {
+ static std::map<std::string,std::string> empty;
+ auto i = erasure_code_profiles.find(name);
+ if (i == erasure_code_profiles.end())
+ return empty;
+ else
+ return i->second;
+ }
+ const mempool::osdmap::map<std::string,std::map<std::string,std::string>> &get_erasure_code_profiles() const {
+ return erasure_code_profiles;
+ }
+
+ bool get_allow_crimson() const {
+ return allow_crimson;
+ }
+
+ bool exists(int osd) const {
+ //assert(osd >= 0);
+ return osd >= 0 && osd < max_osd && (osd_state[osd] & CEPH_OSD_EXISTS);
+ }
+
+ bool is_destroyed(int osd) const {
+ return exists(osd) && (osd_state[osd] & CEPH_OSD_DESTROYED);
+ }
+
+ bool is_up(int osd) const {
+ return exists(osd) && (osd_state[osd] & CEPH_OSD_UP);
+ }
+
+ bool has_been_up_since(int osd, epoch_t epoch) const {
+ return is_up(osd) && get_up_from(osd) <= epoch;
+ }
+
+ bool is_down(int osd) const {
+ return !is_up(osd);
+ }
+
+ bool is_stop(int osd) const {
+ return exists(osd) && is_down(osd) &&
+ (osd_state[osd] & CEPH_OSD_STOP);
+ }
+
+ bool is_out(int osd) const {
+ return !exists(osd) || get_weight(osd) == CEPH_OSD_OUT;
+ }
+
+ bool is_in(int osd) const {
+ return !is_out(osd);
+ }
+
+ bool is_dead(int osd) const {
+ if (!exists(osd)) {
+ return false; // unclear if they know they are removed from map
+ }
+ return get_xinfo(osd).dead_epoch > get_info(osd).up_from;
+ }
+
+ unsigned get_osd_crush_node_flags(int osd) const;
+ unsigned get_crush_node_flags(int id) const;
+ unsigned get_device_class_flags(int id) const;
+
+ bool is_noup_by_osd(int osd) const {
+ return exists(osd) && (osd_state[osd] & CEPH_OSD_NOUP);
+ }
+
+ bool is_nodown_by_osd(int osd) const {
+ return exists(osd) && (osd_state[osd] & CEPH_OSD_NODOWN);
+ }
+
+ bool is_noin_by_osd(int osd) const {
+ return exists(osd) && (osd_state[osd] & CEPH_OSD_NOIN);
+ }
+
+ bool is_noout_by_osd(int osd) const {
+ return exists(osd) && (osd_state[osd] & CEPH_OSD_NOOUT);
+ }
+
+ bool is_noup(int osd) const {
+ if (test_flag(CEPH_OSDMAP_NOUP)) // global?
+ return true;
+ if (is_noup_by_osd(osd)) // by osd?
+ return true;
+ if (get_osd_crush_node_flags(osd) & CEPH_OSD_NOUP) // by crush-node?
+ return true;
+ if (auto class_id = crush->get_item_class_id(osd); class_id >= 0 &&
+ get_device_class_flags(class_id) & CEPH_OSD_NOUP) // by device-class?
+ return true;
+ return false;
+ }
+
+ bool is_nodown(int osd) const {
+ if (test_flag(CEPH_OSDMAP_NODOWN))
+ return true;
+ if (is_nodown_by_osd(osd))
+ return true;
+ if (get_osd_crush_node_flags(osd) & CEPH_OSD_NODOWN)
+ return true;
+ if (auto class_id = crush->get_item_class_id(osd); class_id >= 0 &&
+ get_device_class_flags(class_id) & CEPH_OSD_NODOWN)
+ return true;
+ return false;
+ }
+
+ bool is_noin(int osd) const {
+ if (test_flag(CEPH_OSDMAP_NOIN))
+ return true;
+ if (is_noin_by_osd(osd))
+ return true;
+ if (get_osd_crush_node_flags(osd) & CEPH_OSD_NOIN)
+ return true;
+ if (auto class_id = crush->get_item_class_id(osd); class_id >= 0 &&
+ get_device_class_flags(class_id) & CEPH_OSD_NOIN)
+ return true;
+ return false;
+ }
+
+ bool is_noout(int osd) const {
+ if (test_flag(CEPH_OSDMAP_NOOUT))
+ return true;
+ if (is_noout_by_osd(osd))
+ return true;
+ if (get_osd_crush_node_flags(osd) & CEPH_OSD_NOOUT)
+ return true;
+ if (auto class_id = crush->get_item_class_id(osd); class_id >= 0 &&
+ get_device_class_flags(class_id) & CEPH_OSD_NOOUT)
+ return true;
+ return false;
+ }
+
+ /**
+ * check if an entire crush subtree is down
+ */
+ bool subtree_is_down(int id, std::set<int> *down_cache) const;
+ bool containing_subtree_is_down(CephContext *cct, int osd, int subtree_type, std::set<int> *down_cache) const;
+
+ bool subtree_type_is_down(CephContext *cct, int id, int subtree_type, std::set<int> *down_in_osds, std::set<int> *up_in_osds,
+ std::set<int> *subtree_up, std::unordered_map<int, std::set<int> > *subtree_type_down) const;
+
+ int identify_osd(const entity_addr_t& addr) const;
+ int identify_osd(const uuid_d& u) const;
+ int identify_osd_on_all_channels(const entity_addr_t& addr) const;
+
+ bool have_addr(const entity_addr_t& addr) const {
+ return identify_osd(addr) >= 0;
+ }
+ int find_osd_on_ip(const entity_addr_t& ip) const;
+
+ const entity_addrvec_t& get_addrs(int osd) const {
+ ceph_assert(exists(osd));
+ return osd_addrs->client_addrs[osd] ?
+ *osd_addrs->client_addrs[osd] : _blank_addrvec;
+ }
+ const entity_addrvec_t& get_most_recent_addrs(int osd) const {
+ return get_addrs(osd);
+ }
+ const entity_addrvec_t &get_cluster_addrs(int osd) const {
+ ceph_assert(exists(osd));
+ return osd_addrs->cluster_addrs[osd] ?
+ *osd_addrs->cluster_addrs[osd] : _blank_addrvec;
+ }
+ const entity_addrvec_t &get_hb_back_addrs(int osd) const {
+ ceph_assert(exists(osd));
+ return osd_addrs->hb_back_addrs[osd] ?
+ *osd_addrs->hb_back_addrs[osd] : _blank_addrvec;
+ }
+ const entity_addrvec_t &get_hb_front_addrs(int osd) const {
+ ceph_assert(exists(osd));
+ return osd_addrs->hb_front_addrs[osd] ?
+ *osd_addrs->hb_front_addrs[osd] : _blank_addrvec;
+ }
+
+ const uuid_d& get_uuid(int osd) const {
+ ceph_assert(exists(osd));
+ return (*osd_uuid)[osd];
+ }
+
+ const epoch_t& get_up_from(int osd) const {
+ ceph_assert(exists(osd));
+ return osd_info[osd].up_from;
+ }
+ const epoch_t& get_up_thru(int osd) const {
+ ceph_assert(exists(osd));
+ return osd_info[osd].up_thru;
+ }
+ const epoch_t& get_down_at(int osd) const {
+ ceph_assert(exists(osd));
+ return osd_info[osd].down_at;
+ }
+ const osd_info_t& get_info(int osd) const {
+ ceph_assert(osd < max_osd);
+ return osd_info[osd];
+ }
+
+ const osd_xinfo_t& get_xinfo(int osd) const {
+ ceph_assert(osd < max_osd);
+ return osd_xinfo[osd];
+ }
+
+ int get_next_up_osd_after(int n) const {
+ if (get_max_osd() == 0)
+ return -1;
+ for (int i = n + 1; i != n; ++i) {
+ if (i >= get_max_osd())
+ i = 0;
+ if (i == n)
+ break;
+ if (is_up(i))
+ return i;
+ }
+ return -1;
+ }
+
+ int get_previous_up_osd_before(int n) const {
+ if (get_max_osd() == 0)
+ return -1;
+ for (int i = n - 1; i != n; --i) {
+ if (i < 0)
+ i = get_max_osd() - 1;
+ if (i == n)
+ break;
+ if (is_up(i))
+ return i;
+ }
+ return -1;
+ }
+
+
+ void get_random_up_osds_by_subtree(int n, // whoami
+ std::string &subtree,
+ int limit, // how many
+ std::set<int> skip,
+ std::set<int> *want) const;
+
+ /**
+ * get feature bits required by the current structure
+ *
+ * @param entity_type [in] what entity type we are asking about
+ * @param mask [out] std::set of all possible map-related features we could std::set
+ * @return feature bits used by this map
+ */
+ uint64_t get_features(int entity_type, uint64_t *mask) const;
+
+ /**
+ * get oldest *client* version (firefly, hammer, etc.) that can connect given
+ * the feature bits required (according to get_features()).
+ */
+ ceph_release_t get_min_compat_client() const;
+
+ /**
+ * gets the required minimum *client* version that can connect to the cluster.
+ */
+ ceph_release_t get_require_min_compat_client() const;
+
+ /**
+ * get intersection of features supported by up osds
+ */
+ uint64_t get_up_osd_features() const;
+
+ void get_upmap_pgs(std::vector<pg_t> *upmap_pgs) const;
+ bool check_pg_upmaps(
+ CephContext *cct,
+ const std::vector<pg_t>& to_check,
+ std::vector<pg_t> *to_cancel,
+ std::map<pg_t, mempool::osdmap::vector<std::pair<int,int>>> *to_remap) const;
+ void clean_pg_upmaps(
+ CephContext *cct,
+ Incremental *pending_inc,
+ const std::vector<pg_t>& to_cancel,
+ const std::map<pg_t, mempool::osdmap::vector<std::pair<int,int>>>& to_remap) const;
+ bool clean_pg_upmaps(CephContext *cct, Incremental *pending_inc) const;
+
+ int apply_incremental(const Incremental &inc);
+
+ /// try to re-use/reference addrs in oldmap from newmap
+ static void dedup(const OSDMap *oldmap, OSDMap *newmap);
+
+ static void clean_temps(CephContext *cct,
+ const OSDMap& oldmap,
+ const OSDMap& nextmap,
+ Incremental *pending_inc);
+
+ // serialize, unserialize
+private:
+ void encode_client_old(ceph::buffer::list& bl) const;
+ void encode_classic(ceph::buffer::list& bl, uint64_t features) const;
+ void decode_classic(ceph::buffer::list::const_iterator& p);
+ void post_decode();
+public:
+ void encode(ceph::buffer::list& bl, uint64_t features=CEPH_FEATURES_ALL) const;
+ void decode(ceph::buffer::list& bl);
+ void decode(ceph::buffer::list::const_iterator& bl);
+
+
+ /**** mapping facilities ****/
+ int map_to_pg(
+ int64_t pool,
+ const std::string& name,
+ const std::string& key,
+ const std::string& nspace,
+ pg_t *pg) const;
+ int object_locator_to_pg(const object_t& oid, const object_locator_t& loc,
+ pg_t &pg) const;
+ pg_t object_locator_to_pg(const object_t& oid,
+ const object_locator_t& loc) const {
+ pg_t pg;
+ int ret = object_locator_to_pg(oid, loc, pg);
+ ceph_assert(ret == 0);
+ return pg;
+ }
+
+
+ static object_locator_t file_to_object_locator(const file_layout_t& layout) {
+ return object_locator_t(layout.pool_id, layout.pool_ns);
+ }
+
+ ceph_object_layout file_to_object_layout(object_t oid,
+ file_layout_t& layout) const {
+ return make_object_layout(oid, layout.pool_id, layout.pool_ns);
+ }
+
+ ceph_object_layout make_object_layout(object_t oid, int pg_pool,
+ std::string nspace) const;
+
+ int get_pg_num(int pg_pool) const
+ {
+ const pg_pool_t *pool = get_pg_pool(pg_pool);
+ ceph_assert(NULL != pool);
+ return pool->get_pg_num();
+ }
+
+ bool pg_exists(pg_t pgid) const {
+ const pg_pool_t *p = get_pg_pool(pgid.pool());
+ return p && pgid.ps() < p->get_pg_num();
+ }
+
+ int get_pg_pool_min_size(pg_t pgid) const {
+ if (!pg_exists(pgid)) {
+ return -ENOENT;
+ }
+ const pg_pool_t *p = get_pg_pool(pgid.pool());
+ ceph_assert(p);
+ return p->get_min_size();
+ }
+
+ int get_pg_pool_size(pg_t pgid) const {
+ if (!pg_exists(pgid)) {
+ return -ENOENT;
+ }
+ const pg_pool_t *p = get_pg_pool(pgid.pool());
+ ceph_assert(p);
+ return p->get_size();
+ }
+
+ int get_pg_pool_crush_rule(pg_t pgid) const {
+ if (!pg_exists(pgid)) {
+ return -ENOENT;
+ }
+ const pg_pool_t *p = get_pg_pool(pgid.pool());
+ ceph_assert(p);
+ return p->get_crush_rule();
+ }
+
+private:
+ /// pg -> (raw osd std::list)
+ void _pg_to_raw_osds(
+ const pg_pool_t& pool, pg_t pg,
+ std::vector<int> *osds,
+ ps_t *ppps) const;
+ int _pick_primary(const std::vector<int>& osds) const;
+ void _remove_nonexistent_osds(const pg_pool_t& pool, std::vector<int>& osds) const;
+
+ void _apply_primary_affinity(ps_t seed, const pg_pool_t& pool,
+ std::vector<int> *osds, int *primary) const;
+
+ /// apply pg_upmap[_items] mappings
+ void _apply_upmap(const pg_pool_t& pi, pg_t pg, std::vector<int> *raw) const;
+
+ /// pg -> (up osd std::list)
+ void _raw_to_up_osds(const pg_pool_t& pool, const std::vector<int>& raw,
+ std::vector<int> *up) const;
+
+
+ /**
+ * Get the pg and primary temp, if they are specified.
+ * @param temp_pg [out] Will be empty or contain the temp PG mapping on return
+ * @param temp_primary [out] Will be the value in primary_temp, or a value derived
+ * from the pg_temp (if specified), or -1 if you should use the calculated (up_)primary.
+ */
+ void _get_temp_osds(const pg_pool_t& pool, pg_t pg,
+ std::vector<int> *temp_pg, int *temp_primary) const;
+
+ /**
+ * map to up and acting. Fills in whatever fields are non-NULL.
+ */
+ void _pg_to_up_acting_osds(const pg_t& pg, std::vector<int> *up, int *up_primary,
+ std::vector<int> *acting, int *acting_primary,
+ bool raw_pg_to_pg = true) const;
+
+public:
+ /***
+ * This is suitable only for looking at raw CRUSH outputs. It skips
+ * applying the temp and up checks and should not be used
+ * by anybody for data mapping purposes.
+ * raw and primary must be non-NULL
+ */
+ void pg_to_raw_osds(pg_t pg, std::vector<int> *raw, int *primary) const;
+ void pg_to_raw_upmap(pg_t pg, std::vector<int> *raw,
+ std::vector<int> *raw_upmap) const;
+ /// map a pg to its acting set. @return acting set size
+ void pg_to_acting_osds(const pg_t& pg, std::vector<int> *acting,
+ int *acting_primary) const {
+ _pg_to_up_acting_osds(pg, NULL, NULL, acting, acting_primary);
+ }
+ void pg_to_acting_osds(pg_t pg, std::vector<int>& acting) const {
+ return pg_to_acting_osds(pg, &acting, NULL);
+ }
+ /**
+ * This does not apply temp overrides and should not be used
+ * by anybody for data mapping purposes. Specify both pointers.
+ */
+ void pg_to_raw_up(pg_t pg, std::vector<int> *up, int *primary) const;
+ /**
+ * map a pg to its acting set as well as its up set. You must use
+ * the acting set for data mapping purposes, but some users will
+ * also find the up set useful for things like deciding what to
+ * set as pg_temp.
+ * Each of these pointers must be non-NULL.
+ */
+ void pg_to_up_acting_osds(pg_t pg, std::vector<int> *up, int *up_primary,
+ std::vector<int> *acting, int *acting_primary) const {
+ _pg_to_up_acting_osds(pg, up, up_primary, acting, acting_primary);
+ }
+ void pg_to_up_acting_osds(pg_t pg, std::vector<int>& up, std::vector<int>& acting) const {
+ int up_primary, acting_primary;
+ pg_to_up_acting_osds(pg, &up, &up_primary, &acting, &acting_primary);
+ }
+ bool pg_is_ec(pg_t pg) const {
+ auto i = pools.find(pg.pool());
+ ceph_assert(i != pools.end());
+ return i->second.is_erasure();
+ }
+ bool get_primary_shard(const pg_t& pgid, spg_t *out) const {
+ auto i = get_pools().find(pgid.pool());
+ if (i == get_pools().end()) {
+ return false;
+ }
+ if (!i->second.is_erasure()) {
+ *out = spg_t(pgid);
+ return true;
+ }
+ int primary;
+ std::vector<int> acting;
+ pg_to_acting_osds(pgid, &acting, &primary);
+ for (uint8_t i = 0; i < acting.size(); ++i) {
+ if (acting[i] == primary) {
+ *out = spg_t(pgid, shard_id_t(i));
+ return true;
+ }
+ }
+ return false;
+ }
+ bool get_primary_shard(const pg_t& pgid, int *primary, spg_t *out) const {
+ auto i = get_pools().find(pgid.pool());
+ if (i == get_pools().end()) {
+ return false;
+ }
+ std::vector<int> acting;
+ pg_to_acting_osds(pgid, &acting, primary);
+ if (i->second.is_erasure()) {
+ for (uint8_t i = 0; i < acting.size(); ++i) {
+ if (acting[i] == *primary) {
+ *out = spg_t(pgid, shard_id_t(i));
+ return true;
+ }
+ }
+ } else {
+ *out = spg_t(pgid);
+ return true;
+ }
+ return false;
+ }
+
+ bool in_removed_snaps_queue(int64_t pool, snapid_t snap) const {
+ auto p = removed_snaps_queue.find(pool);
+ if (p == removed_snaps_queue.end()) {
+ return false;
+ }
+ return p->second.contains(snap);
+ }
+
+ const mempool::osdmap::map<int64_t,snap_interval_set_t>&
+ get_removed_snaps_queue() const {
+ return removed_snaps_queue;
+ }
+ const mempool::osdmap::map<int64_t,snap_interval_set_t>&
+ get_new_removed_snaps() const {
+ return new_removed_snaps;
+ }
+ const mempool::osdmap::map<int64_t,snap_interval_set_t>&
+ get_new_purged_snaps() const {
+ return new_purged_snaps;
+ }
+
+ int64_t lookup_pg_pool_name(std::string_view name) const {
+ auto p = name_pool.find(name);
+ if (p == name_pool.end())
+ return -ENOENT;
+ return p->second;
+ }
+
+ int64_t get_pool_max() const {
+ return pool_max;
+ }
+ const mempool::osdmap::map<int64_t,pg_pool_t>& get_pools() const {
+ return pools;
+ }
+ mempool::osdmap::map<int64_t,pg_pool_t>& get_pools() {
+ return pools;
+ }
+ void get_pool_ids_by_rule(int rule_id, std::set<int64_t> *pool_ids) const {
+ ceph_assert(pool_ids);
+ for (auto &p: pools) {
+ if (p.second.get_crush_rule() == rule_id) {
+ pool_ids->insert(p.first);
+ }
+ }
+ }
+ void get_pool_ids_by_osd(CephContext *cct,
+ int osd,
+ std::set<int64_t> *pool_ids) const;
+ const std::string& get_pool_name(int64_t p) const {
+ auto i = pool_name.find(p);
+ ceph_assert(i != pool_name.end());
+ return i->second;
+ }
+ const mempool::osdmap::map<int64_t,std::string>& get_pool_names() const {
+ return pool_name;
+ }
+ bool have_pg_pool(int64_t p) const {
+ return pools.count(p);
+ }
+ const pg_pool_t* get_pg_pool(int64_t p) const {
+ auto i = pools.find(p);
+ if (i != pools.end())
+ return &i->second;
+ return NULL;
+ }
+ unsigned get_pg_size(pg_t pg) const {
+ auto p = pools.find(pg.pool());
+ ceph_assert(p != pools.end());
+ return p->second.get_size();
+ }
+ int get_pg_type(pg_t pg) const {
+ auto p = pools.find(pg.pool());
+ ceph_assert(p != pools.end());
+ return p->second.get_type();
+ }
+ int get_pool_crush_rule(int64_t pool_id) const {
+ auto pool = get_pg_pool(pool_id);
+ if (!pool)
+ return -ENOENT;
+ return pool->get_crush_rule();
+ }
+
+
+ pg_t raw_pg_to_pg(pg_t pg) const {
+ auto p = pools.find(pg.pool());
+ ceph_assert(p != pools.end());
+ return p->second.raw_pg_to_pg(pg);
+ }
+
+ // pg -> acting primary osd
+ int get_pg_acting_primary(pg_t pg) const {
+ int primary = -1;
+ _pg_to_up_acting_osds(pg, nullptr, nullptr, nullptr, &primary);
+ return primary;
+ }
+
+ /*
+ * check whether an spg_t maps to a particular osd
+ */
+ bool is_up_acting_osd_shard(spg_t pg, int osd) const {
+ std::vector<int> up, acting;
+ _pg_to_up_acting_osds(pg.pgid, &up, NULL, &acting, NULL, false);
+ if (calc_pg_role(pg_shard_t(osd, pg.shard), acting) >= 0 ||
+ calc_pg_role(pg_shard_t(osd, pg.shard), up) >= 0) {
+ return true;
+ }
+ return false;
+ }
+
+
+ static int calc_pg_role_broken(int osd, const std::vector<int>& acting, int nrep=0);
+ static int calc_pg_role(pg_shard_t who, const std::vector<int>& acting);
+ static bool primary_changed_broken(
+ int oldprimary,
+ const std::vector<int> &oldacting,
+ int newprimary,
+ const std::vector<int> &newacting);
+
+ /* rank is -1 (stray), 0 (primary), 1,2,3,... (replica) */
+ int get_pg_acting_role(spg_t pg, int osd) const {
+ std::vector<int> group;
+ pg_to_acting_osds(pg.pgid, group);
+ return calc_pg_role(pg_shard_t(osd, pg.shard), group);
+ }
+
+ bool try_pg_upmap(
+ CephContext *cct,
+ pg_t pg, ///< pg to potentially remap
+ const std::set<int>& overfull, ///< osds we'd want to evacuate
+ const std::vector<int>& underfull, ///< osds to move to, in order of preference
+ const std::vector<int>& more_underfull, ///< less full osds to move to, in order of preference
+ std::vector<int> *orig,
+ std::vector<int> *out); ///< resulting alternative mapping
+
+ int balance_primaries(
+ CephContext *cct,
+ int64_t pid,
+ Incremental *pending_inc,
+ OSDMap& tmp_osd_map) const;
+
+ int calc_desired_primary_distribution(
+ CephContext *cct,
+ int64_t pid, // pool id
+ const std::vector<uint64_t> &osds,
+ std::map<uint64_t, float>& desired_primary_distribution) const; // vector of osd ids
+
+ int calc_pg_upmaps(
+ CephContext *cct,
+ uint32_t max_deviation, ///< max deviation from target (value >= 1)
+ int max_iterations, ///< max iterations to run
+ const std::set<int64_t>& pools, ///< [optional] restrict to pool
+ Incremental *pending_inc,
+ std::random_device::result_type *p_seed = nullptr ///< [optional] for regression tests
+ );
+
+ std::map<uint64_t,std::set<pg_t>> get_pgs_by_osd(
+ CephContext *cct,
+ int64_t pid,
+ std::map<uint64_t, std::set<pg_t>> *p_primaries_by_osd = nullptr,
+ std::map<uint64_t, std::set<pg_t>> *p_acting_primaries_by_osd = nullptr
+ ) const; // used in calc_desired_primary_distribution()
+
+private: // Bunch of internal functions used only by calc_pg_upmaps (result of code refactoring)
+
+ float get_osds_weight(
+ CephContext *cct,
+ const OSDMap& tmp_osd_map,
+ int64_t pid,
+ std::map<int,float>& osds_weight
+ ) const;
+
+ float build_pool_pgs_info (
+ CephContext *cct,
+ const std::set<int64_t>& pools, ///< [optional] restrict to pool
+ const OSDMap& tmp_osd_map,
+ int& total_pgs,
+ std::map<int, std::set<pg_t>>& pgs_by_osd,
+ std::map<int,float>& osds_weight
+ ); // return total weight of all OSDs
+
+ float calc_deviations (
+ CephContext *cct,
+ const std::map<int,std::set<pg_t>>& pgs_by_osd,
+ const std::map<int,float>& osd_weight,
+ float pgs_per_weight,
+ std::map<int,float>& osd_deviation,
+ std::multimap<float,int>& deviation_osd,
+ float& stddev
+ ); // return current max deviation
+
+ void fill_overfull_underfull (
+ CephContext *cct,
+ const std::multimap<float,int>& deviation_osd,
+ int max_deviation,
+ std::set<int>& overfull,
+ std::set<int>& more_overfull,
+ std::vector<int>& underfull,
+ std::vector<int>& more_underfull
+ );
+
+ int pack_upmap_results(
+ CephContext *cct,
+ const std::set<pg_t>& to_unmap,
+ const std::map<pg_t, mempool::osdmap::vector<std::pair<int, int>>>& to_upmap,
+ OSDMap& tmp_osd_map,
+ OSDMap::Incremental *pending_inc
+ );
+
+ std::default_random_engine get_random_engine(
+ CephContext *cct,
+ std::random_device::result_type *p_seed
+ );
+
+ bool try_drop_remap_overfull(
+ CephContext *cct,
+ const std::vector<pg_t>& pgs,
+ const OSDMap& tmp_osd_map,
+ int osd,
+ std::map<int,std::set<pg_t>>& temp_pgs_by_osd,
+ std::set<pg_t>& to_unmap,
+ std::map<pg_t, mempool::osdmap::vector<std::pair<int32_t,int32_t>>>& to_upmap
+ );
+
+typedef std::vector<std::pair<pg_t, mempool::osdmap::vector<std::pair<int, int>>>>
+ candidates_t;
+
+bool try_drop_remap_underfull(
+ CephContext *cct,
+ const candidates_t& candidates,
+ int osd,
+ std::map<int,std::set<pg_t>>& temp_pgs_by_osd,
+ std::set<pg_t>& to_unmap,
+ std::map<pg_t, mempool::osdmap::vector<std::pair<int32_t,int32_t>>>& to_upmap
+ );
+
+ void add_remap_pair(
+ CephContext *cct,
+ int orig,
+ int out,
+ pg_t pg,
+ size_t pg_pool_size,
+ int osd,
+ std::set<int>& existing,
+ std::map<int,std::set<pg_t>>& temp_pgs_by_osd,
+ mempool::osdmap::vector<std::pair<int32_t,int32_t>> new_upmap_items,
+ std::map<pg_t, mempool::osdmap::vector<std::pair<int32_t,int32_t>>>& to_upmap
+ );
+
+ int find_best_remap (
+ CephContext *cct,
+ const std::vector<int>& orig,
+ const std::vector<int>& out,
+ const std::set<int>& existing,
+ const std::map<int,float> osd_deviation
+ );
+
+ candidates_t build_candidates(
+ CephContext *cct,
+ const OSDMap& tmp_osd_map,
+ const std::set<pg_t> to_skip,
+ const std::set<int64_t>& only_pools,
+ bool aggressive,
+ std::random_device::result_type *p_seed
+ );
+
+public:
+ typedef struct {
+ float pa_avg;
+ float pa_weighted;
+ float pa_weighted_avg;
+ float raw_score;
+ float optimal_score; // based on primary_affinity values
+ float adjusted_score; // based on raw_score and pa_avg 1 is optimal
+ float acting_raw_score; // based on active_primaries (temporary)
+ float acting_adj_score; // based on raw_active_score and pa_avg 1 is optimal
+ std::string err_msg;
+ } read_balance_info_t;
+ //
+ // This function calculates scores about the cluster read balance state
+ // p_rb_info->acting_adj_score is the current read balance score (acting)
+ // p_rb_info->adjusted_score is the stable read balance score
+ // Return value of 0 is OK, negative means an error (may happen with
+ // some arifically generated osamap files)
+ //
+ int calc_read_balance_score(
+ CephContext *cct,
+ int64_t pool_id,
+ read_balance_info_t *p_rb_info) const;
+
+private:
+ float rbi_round(float f) const {
+ return (f > 0.0) ? floor(f * 100 + 0.5) / 100 : ceil(f * 100 - 0.5) / 100;
+ }
+
+ int64_t has_zero_pa_pgs(
+ CephContext *cct,
+ int64_t pool_id) const;
+
+ void zero_rbi(
+ read_balance_info_t &rbi
+ ) const;
+
+ int set_rbi(
+ CephContext *cct,
+ read_balance_info_t &rbi,
+ int64_t pool_id,
+ float total_w_pa,
+ float pa_sum,
+ int num_osds,
+ int osd_pa_count,
+ float total_osd_weight,
+ uint max_prims_per_osd,
+ uint max_acting_prims_per_osd,
+ float avg_prims_per_osd,
+ bool prim_on_zero_pa,
+ bool acting_on_zero_pa,
+ float max_osd_score) const;
+
+public:
+ int get_osds_by_bucket_name(const std::string &name, std::set<int> *osds) const;
+
+ bool have_pg_upmaps(pg_t pg) const {
+ return pg_upmap.count(pg) ||
+ pg_upmap_items.count(pg);
+ }
+
+ bool check_full(const std::set<pg_shard_t> &missing_on) const {
+ for (auto shard : missing_on) {
+ if (get_state(shard.osd) & CEPH_OSD_FULL)
+ return true;
+ }
+ return false;
+ }
+
+ /*
+ * handy helpers to build simple maps...
+ */
+ /**
+ * Build an OSD map suitable for basic usage. If **num_osd** is >= 0
+ * it will be initialized with the specified number of OSDs in a
+ * single host. If **num_osd** is < 0 the layout of the OSD map will
+ * be built by reading the content of the configuration file.
+ *
+ * @param cct [in] in core ceph context
+ * @param e [in] initial epoch
+ * @param fsid [in] id of the cluster
+ * @param num_osd [in] number of OSDs if >= 0 or read from conf if < 0
+ * @return **0** on success, negative errno on error.
+ */
+private:
+ int build_simple_optioned(CephContext *cct, epoch_t e, uuid_d &fsid,
+ int num_osd, int pg_bits, int pgp_bits,
+ bool default_pool);
+public:
+ int build_simple(CephContext *cct, epoch_t e, uuid_d &fsid,
+ int num_osd) {
+ return build_simple_optioned(cct, e, fsid, num_osd, 0, 0, false);
+ }
+ int build_simple_with_pool(CephContext *cct, epoch_t e, uuid_d &fsid,
+ int num_osd, int pg_bits, int pgp_bits) {
+ return build_simple_optioned(cct, e, fsid, num_osd,
+ pg_bits, pgp_bits, true);
+ }
+ static int _build_crush_types(CrushWrapper& crush);
+ static int build_simple_crush_map(CephContext *cct, CrushWrapper& crush,
+ int num_osd, std::ostream *ss);
+ static int build_simple_crush_map_from_conf(CephContext *cct,
+ CrushWrapper& crush,
+ std::ostream *ss);
+ static int build_simple_crush_rules(
+ CephContext *cct, CrushWrapper& crush,
+ const std::string& root,
+ std::ostream *ss);
+
+ bool crush_rule_in_use(int rule_id) const;
+
+ int validate_crush_rules(CrushWrapper *crush, std::ostream *ss) const;
+
+ void clear_temp() {
+ pg_temp->clear();
+ primary_temp->clear();
+ }
+
+private:
+ void print_osd_line(int cur, std::ostream *out, ceph::Formatter *f) const;
+public:
+ void print(CephContext *cct, std::ostream& out) const;
+ void print_osd(int id, std::ostream& out) const;
+ void print_osds(std::ostream& out) const;
+ void print_pools(CephContext *cct, std::ostream& out) const;
+ void print_summary(ceph::Formatter *f, std::ostream& out,
+ const std::string& prefix, bool extra=false) const;
+ void print_oneline_summary(std::ostream& out) const;
+
+ enum {
+ DUMP_IN = 1, // only 'in' osds
+ DUMP_OUT = 2, // only 'out' osds
+ DUMP_UP = 4, // only 'up' osds
+ DUMP_DOWN = 8, // only 'down' osds
+ DUMP_DESTROYED = 16, // only 'destroyed' osds
+ };
+ void print_tree(ceph::Formatter *f, std::ostream *out,
+ unsigned dump_flags=0, std::string bucket="") const;
+
+ int summarize_mapping_stats(
+ OSDMap *newmap,
+ const std::set<int64_t> *pools,
+ std::string *out,
+ ceph::Formatter *f) const;
+
+ std::string get_flag_string() const;
+ static std::string get_flag_string(unsigned flags);
+ static void dump_erasure_code_profiles(
+ const mempool::osdmap::map<std::string,std::map<std::string,std::string> > &profiles,
+ ceph::Formatter *f);
+ void dump(ceph::Formatter *f, CephContext *cct = nullptr) const;
+ void dump_osd(int id, ceph::Formatter *f) const;
+ void dump_osds(ceph::Formatter *f) const;
+ void dump_pool(CephContext *cct, int64_t pid, const pg_pool_t &pdata, ceph::Formatter *f) const;
+ void dump_read_balance_score(CephContext *cct, int64_t pid, const pg_pool_t &pdata, ceph::Formatter *f) const;
+ static void generate_test_instances(std::list<OSDMap*>& o);
+ bool check_new_blocklist_entries() const { return new_blocklist_entries; }
+
+ void check_health(CephContext *cct, health_check_map_t *checks) const;
+
+ int parse_osd_id_list(const std::vector<std::string>& ls,
+ std::set<int> *out,
+ std::ostream *ss) const;
+
+ float pool_raw_used_rate(int64_t poolid) const;
+ std::optional<std::string> pending_require_osd_release() const;
+
+};
+WRITE_CLASS_ENCODER_FEATURES(OSDMap)
+WRITE_CLASS_ENCODER_FEATURES(OSDMap::Incremental)
+
+#ifdef WITH_SEASTAR
+#include "crimson/common/local_shared_foreign_ptr.h"
+using LocalOSDMapRef = boost::local_shared_ptr<const OSDMap>;
+using OSDMapRef = crimson::local_shared_foreign_ptr<LocalOSDMapRef>;
+#else
+using OSDMapRef = std::shared_ptr<const OSDMap>;
+#endif
+
+
+inline std::ostream& operator<<(std::ostream& out, const OSDMap& m) {
+ m.print_oneline_summary(out);
+ return out;
+}
+
+class PGMap;
+
+void print_osd_utilization(const OSDMap& osdmap,
+ const PGMap& pgmap,
+ std::ostream& out,
+ ceph::Formatter *f,
+ bool tree,
+ const std::string& filter);
+
+#endif