From 5dced3d1b3deca80e01415a2e35dc7972dcbfae7 Mon Sep 17 00:00:00 2001
From: Daniel Baumann <daniel.baumann@progress-linux.org>
Date: Fri, 19 Apr 2024 11:25:10 +0200
Subject: Adding upstream version 1.47.0.

Signed-off-by: Daniel Baumann <daniel.baumann@progress-linux.org>
---
 lib/ext2fs/Android.bp                    |  129 +
 lib/ext2fs/Makefile.in                   | 1459 +++++++++++
 lib/ext2fs/alloc.c                       |  554 ++++
 lib/ext2fs/alloc_sb.c                    |   81 +
 lib/ext2fs/alloc_stats.c                 |  165 ++
 lib/ext2fs/alloc_tables.c                |  278 ++
 lib/ext2fs/atexit.c                      |  116 +
 lib/ext2fs/badblocks.c                   |  328 +++
 lib/ext2fs/bb_compat.c                   |   64 +
 lib/ext2fs/bb_inode.c                    |  270 ++
 lib/ext2fs/bitmaps.c                     |  320 +++
 lib/ext2fs/bitops.c                      |  148 ++
 lib/ext2fs/bitops.h                      |  606 +++++
 lib/ext2fs/blkmap64_ba.c                 |  492 ++++
 lib/ext2fs/blkmap64_rb.c                 |  998 +++++++
 lib/ext2fs/blknum.c                      |  606 +++++
 lib/ext2fs/block.c                       |  659 +++++
 lib/ext2fs/bmap.c                        |  499 ++++
 lib/ext2fs/bmap64.h                      |  106 +
 lib/ext2fs/bmove.c                       |  167 ++
 lib/ext2fs/brel.h                        |   86 +
 lib/ext2fs/brel_ma.c                     |  199 ++
 lib/ext2fs/check_desc.c                  |  104 +
 lib/ext2fs/closefs.c                     |  521 ++++
 lib/ext2fs/compiler.h                    |   26 +
 lib/ext2fs/crc16.c                       |   74 +
 lib/ext2fs/crc16.h                       |   26 +
 lib/ext2fs/crc32c.c                      |  938 +++++++
 lib/ext2fs/crc32c_defs.h                 |   59 +
 lib/ext2fs/csum.c                        | 1011 ++++++++
 lib/ext2fs/dblist.c                      |  403 +++
 lib/ext2fs/dblist_dir.c                  |   88 +
 lib/ext2fs/digest_encode.c               |  187 ++
 lib/ext2fs/dir_iterate.c                 |  315 +++
 lib/ext2fs/dirblock.c                    |  113 +
 lib/ext2fs/dirhash.c                     |  307 +++
 lib/ext2fs/dosio.c                       |  459 ++++
 lib/ext2fs/dosio.h                       |  157 ++
 lib/ext2fs/dupfs.c                       |  122 +
 lib/ext2fs/e2image.h                     |   37 +
 lib/ext2fs/expanddir.c                   |  143 +
 lib/ext2fs/ext2_err.et.in                |  560 ++++
 lib/ext2fs/ext2_ext_attr.h               |   84 +
 lib/ext2fs/ext2_fs.h                     | 1201 +++++++++
 lib/ext2fs/ext2_io.h                     |  179 ++
 lib/ext2fs/ext2_types.h.in               |  196 ++
 lib/ext2fs/ext2fs.h                      | 2224 ++++++++++++++++
 lib/ext2fs/ext2fs.pc.in                  |   11 +
 lib/ext2fs/ext2fsP.h                     |  210 ++
 lib/ext2fs/ext3_extents.h                |  127 +
 lib/ext2fs/ext4_acl.h                    |   62 +
 lib/ext2fs/ext_attr.c                    | 1784 +++++++++++++
 lib/ext2fs/extent.c                      | 1877 ++++++++++++++
 lib/ext2fs/fallocate.c                   |  873 +++++++
 lib/ext2fs/fast_commit.h                 |  190 ++
 lib/ext2fs/fiemap.h                      |   93 +
 lib/ext2fs/fileio.c                      |  666 +++++
 lib/ext2fs/finddev.c                     |  218 ++
 lib/ext2fs/flushb.c                      |   88 +
 lib/ext2fs/freefs.c                      |  108 +
 lib/ext2fs/gen_bitmap.c                  |  650 +++++
 lib/ext2fs/gen_bitmap64.c                |  981 +++++++
 lib/ext2fs/gen_crc32ctable.c             |  117 +
 lib/ext2fs/get_num_dirs.c                |   50 +
 lib/ext2fs/get_pathname.c                |  171 ++
 lib/ext2fs/getsectsize.c                 |  151 ++
 lib/ext2fs/getsize.c                     |  324 +++
 lib/ext2fs/hashmap.c                     |  109 +
 lib/ext2fs/hashmap.h                     |   42 +
 lib/ext2fs/i_block.c                     |   90 +
 lib/ext2fs/icount.c                      |  921 +++++++
 lib/ext2fs/imager.c                      |  470 ++++
 lib/ext2fs/ind_block.c                   |   67 +
 lib/ext2fs/initialize.c                  |  671 +++++
 lib/ext2fs/inline.c                      |  118 +
 lib/ext2fs/inline_data.c                 |  842 ++++++
 lib/ext2fs/inode.c                       | 1122 ++++++++
 lib/ext2fs/inode_io.c                    |  290 +++
 lib/ext2fs/io_manager.c                  |  152 ++
 lib/ext2fs/irel.h                        |  114 +
 lib/ext2fs/irel_ma.c                     |  377 +++
 lib/ext2fs/ismounted.c                   |  478 ++++
 lib/ext2fs/jfs_compat.h                  |  113 +
 lib/ext2fs/kernel-jbd.h                  |  456 ++++
 lib/ext2fs/kernel-list.h                 |  111 +
 lib/ext2fs/link.c                        |  646 +++++
 lib/ext2fs/llseek.c                      |  145 ++
 lib/ext2fs/lookup.c                      |   70 +
 lib/ext2fs/mkdir.c                       |  200 ++
 lib/ext2fs/mkjournal.c                   |  654 +++++
 lib/ext2fs/mmp.c                         |  488 ++++
 lib/ext2fs/namei.c                       |  227 ++
 lib/ext2fs/native.c                      |   28 +
 lib/ext2fs/newdir.c                      |  126 +
 lib/ext2fs/nls_utf8.c                    | 1000 +++++++
 lib/ext2fs/nt_io.c                       | 1494 +++++++++++
 lib/ext2fs/openfs.c                      |  590 +++++
 lib/ext2fs/orphan.c                      |  273 ++
 lib/ext2fs/progress.c                    |  103 +
 lib/ext2fs/punch.c                       |  513 ++++
 lib/ext2fs/qcow2.c                       |  272 ++
 lib/ext2fs/qcow2.h                       |  114 +
 lib/ext2fs/rbtree.c                      |  383 +++
 lib/ext2fs/rbtree.h                      |  183 ++
 lib/ext2fs/read_bb.c                     |  102 +
 lib/ext2fs/read_bb_file.c                |  109 +
 lib/ext2fs/res_gdt.c                     |  239 ++
 lib/ext2fs/rw_bitmaps.c                  |  682 +++++
 lib/ext2fs/sha256.c                      |  254 ++
 lib/ext2fs/sha512.c                      |  302 +++
 lib/ext2fs/sparse_io.c                   |  554 ++++
 lib/ext2fs/swapfs.c                      |  491 ++++
 lib/ext2fs/symlink.c                     |  212 ++
 lib/ext2fs/tdb.c                         | 4174 ++++++++++++++++++++++++++++++
 lib/ext2fs/tdb.h                         |  215 ++
 lib/ext2fs/tdb/build-tdb                 |   34 +
 lib/ext2fs/tdb/patches/copyright         |   20 +
 lib/ext2fs/tdb/patches/ext2tdb-rename    |   65 +
 lib/ext2fs/tdb/patches/replace-includes  |   92 +
 lib/ext2fs/tdb/patches/series            |    6 +
 lib/ext2fs/tdb/patches/static-functions  |   13 +
 lib/ext2fs/tdb/patches/static-prototypes |   72 +
 lib/ext2fs/tdb/patches/tdbtool-includes  |   30 +
 lib/ext2fs/tdbtool.c                     |  621 +++++
 lib/ext2fs/test_io.c                     |  557 ++++
 lib/ext2fs/tst_badblocks.c               |  369 +++
 lib/ext2fs/tst_bitmaps.c                 |  732 ++++++
 lib/ext2fs/tst_bitmaps_cmd.ct            |   51 +
 lib/ext2fs/tst_bitmaps_cmds              |  150 ++
 lib/ext2fs/tst_bitmaps_exp               |  313 +++
 lib/ext2fs/tst_bitops.c                  |  288 +++
 lib/ext2fs/tst_byteswap.c                |   93 +
 lib/ext2fs/tst_cmds.ct                   |    6 +
 lib/ext2fs/tst_fs_struct.c               |   81 +
 lib/ext2fs/tst_getsectsize.c             |   63 +
 lib/ext2fs/tst_getsize.c                 |   47 +
 lib/ext2fs/tst_inode_size.c              |   89 +
 lib/ext2fs/tst_iscan.c                   |  227 ++
 lib/ext2fs/tst_libext2fs.c               |   72 +
 lib/ext2fs/tst_super_size.c              |  161 ++
 lib/ext2fs/tst_types.c                   |   64 +
 lib/ext2fs/undo_io.c                     | 1108 ++++++++
 lib/ext2fs/unix_io.c                     | 1510 +++++++++++
 lib/ext2fs/unlink.c                      |  100 +
 lib/ext2fs/utf8data.h                    | 4109 +++++++++++++++++++++++++++++
 lib/ext2fs/utf8n.h                       |  120 +
 lib/ext2fs/valid_blk.c                   |   68 +
 lib/ext2fs/version.c                     |   57 +
 lib/ext2fs/windows_io.c                  | 1031 ++++++++
 lib/ext2fs/write_bb_file.c               |   35 +
 150 files changed, 60455 insertions(+)
 create mode 100644 lib/ext2fs/Android.bp
 create mode 100644 lib/ext2fs/Makefile.in
 create mode 100644 lib/ext2fs/alloc.c
 create mode 100644 lib/ext2fs/alloc_sb.c
 create mode 100644 lib/ext2fs/alloc_stats.c
 create mode 100644 lib/ext2fs/alloc_tables.c
 create mode 100644 lib/ext2fs/atexit.c
 create mode 100644 lib/ext2fs/badblocks.c
 create mode 100644 lib/ext2fs/bb_compat.c
 create mode 100644 lib/ext2fs/bb_inode.c
 create mode 100644 lib/ext2fs/bitmaps.c
 create mode 100644 lib/ext2fs/bitops.c
 create mode 100644 lib/ext2fs/bitops.h
 create mode 100644 lib/ext2fs/blkmap64_ba.c
 create mode 100644 lib/ext2fs/blkmap64_rb.c
 create mode 100644 lib/ext2fs/blknum.c
 create mode 100644 lib/ext2fs/block.c
 create mode 100644 lib/ext2fs/bmap.c
 create mode 100644 lib/ext2fs/bmap64.h
 create mode 100644 lib/ext2fs/bmove.c
 create mode 100644 lib/ext2fs/brel.h
 create mode 100644 lib/ext2fs/brel_ma.c
 create mode 100644 lib/ext2fs/check_desc.c
 create mode 100644 lib/ext2fs/closefs.c
 create mode 100644 lib/ext2fs/compiler.h
 create mode 100644 lib/ext2fs/crc16.c
 create mode 100644 lib/ext2fs/crc16.h
 create mode 100644 lib/ext2fs/crc32c.c
 create mode 100644 lib/ext2fs/crc32c_defs.h
 create mode 100644 lib/ext2fs/csum.c
 create mode 100644 lib/ext2fs/dblist.c
 create mode 100644 lib/ext2fs/dblist_dir.c
 create mode 100644 lib/ext2fs/digest_encode.c
 create mode 100644 lib/ext2fs/dir_iterate.c
 create mode 100644 lib/ext2fs/dirblock.c
 create mode 100644 lib/ext2fs/dirhash.c
 create mode 100644 lib/ext2fs/dosio.c
 create mode 100644 lib/ext2fs/dosio.h
 create mode 100644 lib/ext2fs/dupfs.c
 create mode 100644 lib/ext2fs/e2image.h
 create mode 100644 lib/ext2fs/expanddir.c
 create mode 100644 lib/ext2fs/ext2_err.et.in
 create mode 100644 lib/ext2fs/ext2_ext_attr.h
 create mode 100644 lib/ext2fs/ext2_fs.h
 create mode 100644 lib/ext2fs/ext2_io.h
 create mode 100644 lib/ext2fs/ext2_types.h.in
 create mode 100644 lib/ext2fs/ext2fs.h
 create mode 100644 lib/ext2fs/ext2fs.pc.in
 create mode 100644 lib/ext2fs/ext2fsP.h
 create mode 100644 lib/ext2fs/ext3_extents.h
 create mode 100644 lib/ext2fs/ext4_acl.h
 create mode 100644 lib/ext2fs/ext_attr.c
 create mode 100644 lib/ext2fs/extent.c
 create mode 100644 lib/ext2fs/fallocate.c
 create mode 100644 lib/ext2fs/fast_commit.h
 create mode 100644 lib/ext2fs/fiemap.h
 create mode 100644 lib/ext2fs/fileio.c
 create mode 100644 lib/ext2fs/finddev.c
 create mode 100644 lib/ext2fs/flushb.c
 create mode 100644 lib/ext2fs/freefs.c
 create mode 100644 lib/ext2fs/gen_bitmap.c
 create mode 100644 lib/ext2fs/gen_bitmap64.c
 create mode 100644 lib/ext2fs/gen_crc32ctable.c
 create mode 100644 lib/ext2fs/get_num_dirs.c
 create mode 100644 lib/ext2fs/get_pathname.c
 create mode 100644 lib/ext2fs/getsectsize.c
 create mode 100644 lib/ext2fs/getsize.c
 create mode 100644 lib/ext2fs/hashmap.c
 create mode 100644 lib/ext2fs/hashmap.h
 create mode 100644 lib/ext2fs/i_block.c
 create mode 100644 lib/ext2fs/icount.c
 create mode 100644 lib/ext2fs/imager.c
 create mode 100644 lib/ext2fs/ind_block.c
 create mode 100644 lib/ext2fs/initialize.c
 create mode 100644 lib/ext2fs/inline.c
 create mode 100644 lib/ext2fs/inline_data.c
 create mode 100644 lib/ext2fs/inode.c
 create mode 100644 lib/ext2fs/inode_io.c
 create mode 100644 lib/ext2fs/io_manager.c
 create mode 100644 lib/ext2fs/irel.h
 create mode 100644 lib/ext2fs/irel_ma.c
 create mode 100644 lib/ext2fs/ismounted.c
 create mode 100644 lib/ext2fs/jfs_compat.h
 create mode 100644 lib/ext2fs/kernel-jbd.h
 create mode 100644 lib/ext2fs/kernel-list.h
 create mode 100644 lib/ext2fs/link.c
 create mode 100644 lib/ext2fs/llseek.c
 create mode 100644 lib/ext2fs/lookup.c
 create mode 100644 lib/ext2fs/mkdir.c
 create mode 100644 lib/ext2fs/mkjournal.c
 create mode 100644 lib/ext2fs/mmp.c
 create mode 100644 lib/ext2fs/namei.c
 create mode 100644 lib/ext2fs/native.c
 create mode 100644 lib/ext2fs/newdir.c
 create mode 100644 lib/ext2fs/nls_utf8.c
 create mode 100644 lib/ext2fs/nt_io.c
 create mode 100644 lib/ext2fs/openfs.c
 create mode 100644 lib/ext2fs/orphan.c
 create mode 100644 lib/ext2fs/progress.c
 create mode 100644 lib/ext2fs/punch.c
 create mode 100644 lib/ext2fs/qcow2.c
 create mode 100644 lib/ext2fs/qcow2.h
 create mode 100644 lib/ext2fs/rbtree.c
 create mode 100644 lib/ext2fs/rbtree.h
 create mode 100644 lib/ext2fs/read_bb.c
 create mode 100644 lib/ext2fs/read_bb_file.c
 create mode 100644 lib/ext2fs/res_gdt.c
 create mode 100644 lib/ext2fs/rw_bitmaps.c
 create mode 100644 lib/ext2fs/sha256.c
 create mode 100644 lib/ext2fs/sha512.c
 create mode 100644 lib/ext2fs/sparse_io.c
 create mode 100644 lib/ext2fs/swapfs.c
 create mode 100644 lib/ext2fs/symlink.c
 create mode 100644 lib/ext2fs/tdb.c
 create mode 100644 lib/ext2fs/tdb.h
 create mode 100755 lib/ext2fs/tdb/build-tdb
 create mode 100644 lib/ext2fs/tdb/patches/copyright
 create mode 100644 lib/ext2fs/tdb/patches/ext2tdb-rename
 create mode 100644 lib/ext2fs/tdb/patches/replace-includes
 create mode 100644 lib/ext2fs/tdb/patches/series
 create mode 100644 lib/ext2fs/tdb/patches/static-functions
 create mode 100644 lib/ext2fs/tdb/patches/static-prototypes
 create mode 100644 lib/ext2fs/tdb/patches/tdbtool-includes
 create mode 100644 lib/ext2fs/tdbtool.c
 create mode 100644 lib/ext2fs/test_io.c
 create mode 100644 lib/ext2fs/tst_badblocks.c
 create mode 100644 lib/ext2fs/tst_bitmaps.c
 create mode 100644 lib/ext2fs/tst_bitmaps_cmd.ct
 create mode 100644 lib/ext2fs/tst_bitmaps_cmds
 create mode 100644 lib/ext2fs/tst_bitmaps_exp
 create mode 100644 lib/ext2fs/tst_bitops.c
 create mode 100644 lib/ext2fs/tst_byteswap.c
 create mode 100644 lib/ext2fs/tst_cmds.ct
 create mode 100644 lib/ext2fs/tst_fs_struct.c
 create mode 100644 lib/ext2fs/tst_getsectsize.c
 create mode 100644 lib/ext2fs/tst_getsize.c
 create mode 100644 lib/ext2fs/tst_inode_size.c
 create mode 100644 lib/ext2fs/tst_iscan.c
 create mode 100644 lib/ext2fs/tst_libext2fs.c
 create mode 100644 lib/ext2fs/tst_super_size.c
 create mode 100644 lib/ext2fs/tst_types.c
 create mode 100644 lib/ext2fs/undo_io.c
 create mode 100644 lib/ext2fs/unix_io.c
 create mode 100644 lib/ext2fs/unlink.c
 create mode 100644 lib/ext2fs/utf8data.h
 create mode 100644 lib/ext2fs/utf8n.h
 create mode 100644 lib/ext2fs/valid_blk.c
 create mode 100644 lib/ext2fs/version.c
 create mode 100644 lib/ext2fs/windows_io.c
 create mode 100644 lib/ext2fs/write_bb_file.c

(limited to 'lib/ext2fs')

diff --git a/lib/ext2fs/Android.bp b/lib/ext2fs/Android.bp
new file mode 100644
index 0000000..db8b3b7
--- /dev/null
+++ b/lib/ext2fs/Android.bp
@@ -0,0 +1,129 @@
+// Copyright 2017 The Android Open Source Project
+
+package {
+    // See: http://go/android-license-faq
+    // A large-scale-change added 'default_applicable_licenses' to import
+    // all of the 'license_kinds' from "external_e2fsprogs_license"
+    // to get the below license kinds:
+    //   SPDX-license-identifier-GPL
+    //   SPDX-license-identifier-GPL-2.0
+    //   SPDX-license-identifier-LGPL
+    //   SPDX-license-identifier-LGPL-2.1
+    //   SPDX-license-identifier-LGPL-3.0
+    //   legacy_unencumbered
+    default_applicable_licenses: ["external_e2fsprogs_license"],
+}
+
+cc_library {
+    name: "libext2fs",
+    host_supported: true,
+    ramdisk_available: true,
+    vendor_ramdisk_available: true,
+    recovery_available: true,
+    unique_host_soname: true,
+    defaults: ["e2fsprogs-defaults"],
+    srcs: [
+        "ext2_err.c",
+        "alloc.c",
+        "alloc_sb.c",
+        "alloc_stats.c",
+        "alloc_tables.c",
+        "atexit.c",
+        "badblocks.c",
+        "bb_inode.c",
+        "bitmaps.c",
+        "bitops.c",
+        "blkmap64_ba.c",
+        "blkmap64_rb.c",
+        "blknum.c",
+        "block.c",
+        "bmap.c",
+        "check_desc.c",
+        "crc16.c",
+        "crc32c.c",
+        "csum.c",
+        "closefs.c",
+        "dblist.c",
+        "dblist_dir.c",
+        "digest_encode.c",
+        "dirblock.c",
+        "dirhash.c",
+        "dir_iterate.c",
+        "dupfs.c",
+        "expanddir.c",
+        "ext_attr.c",
+        "extent.c",
+        "fallocate.c",
+        "fileio.c",
+        "finddev.c",
+        "flushb.c",
+        "freefs.c",
+        "gen_bitmap.c",
+        "gen_bitmap64.c",
+        "get_num_dirs.c",
+        "get_pathname.c",
+        "getsize.c",
+        "getsectsize.c",
+        "hashmap.c",
+        "i_block.c",
+        "icount.c",
+        "imager.c",
+        "ind_block.c",
+        "initialize.c",
+        "inline.c",
+        "inline_data.c",
+        "inode.c",
+        "io_manager.c",
+        "ismounted.c",
+        "link.c",
+        "llseek.c",
+        "lookup.c",
+        "mmp.c",
+        "mkdir.c",
+        "mkjournal.c",
+        "namei.c",
+        "native.c",
+        "newdir.c",
+        "nls_utf8.c",
+        "openfs.c",
+        "progress.c",
+        "punch.c",
+        "qcow2.c",
+        "rbtree.c",
+        "read_bb.c",
+        "read_bb_file.c",
+        "res_gdt.c",
+        "rw_bitmaps.c",
+        "sha256.c",
+        "sha512.c",
+        "swapfs.c",
+        "symlink.c",
+        "undo_io.c",
+        "unix_io.c",
+        "sparse_io.c",
+        "unlink.c",
+        "valid_blk.c",
+        "version.c",
+        // get rid of this?!
+        "test_io.c",
+    ],
+    shared_libs: [
+        "libext2_com_err",
+        "libsparse",
+        "libz",
+    ],
+    target: {
+        android: {
+            shared_libs: ["libext2_uuid"],
+        },
+        windows: {
+            enabled: true,
+            srcs: ["windows_io.c"],
+            exclude_srcs: ["unix_io.c"],
+        },
+    },
+
+    header_libs: ["libext2-headers"],
+    export_include_dirs: ["."],
+    export_header_lib_headers: ["libext2-headers"],
+}
diff --git a/lib/ext2fs/Makefile.in b/lib/ext2fs/Makefile.in
new file mode 100644
index 0000000..798ff60
--- /dev/null
+++ b/lib/ext2fs/Makefile.in
@@ -0,0 +1,1459 @@
+srcdir = @srcdir@
+top_srcdir = @top_srcdir@
+VPATH = @srcdir@
+top_builddir = ../..
+my_dir = lib/ext2fs
+INSTALL = @INSTALL@
+MKDIR_P = @MKDIR_P@
+DEPEND_CFLAGS = -I$(top_srcdir)/debugfs -I$(srcdir)/../../e2fsck -DDEBUGFS
+# This nastiness is needed because of jfs_user.h hackery; when we finally
+# clean up this mess, we should be able to drop it
+DEBUGFS_CFLAGS = -I$(srcdir)/../../e2fsck $(ALL_CFLAGS) -DDEBUGFS
+
+@MCONFIG@
+
+@DEBUGFS_CMT@DEBUGFS_LIB_OBJS = bb_compat.o inode_io.o write_bb_file.o
+
+MK_CMDS=	_SS_DIR_OVERRIDE=$(srcdir)/../ss ../ss/mk_cmds
+COMPILE_ET=	_ET_DIR_OVERRIDE=$(srcdir)/../et ../et/compile_et
+
+@RESIZER_CMT@RESIZE_LIB_OBJS = dupfs.o
+@TEST_IO_CMT@TEST_IO_LIB_OBJS = test_io.o
+@IMAGER_CMT@E2IMAGE_LIB_OBJS = imager.o
+
+DEBUG_OBJS= debug_cmds.o extent_cmds.o tst_cmds.o debugfs.o util.o \
+	ncheck.o icheck.o ls.o lsdel.o dump.o set_fields.o logdump.o \
+	htree.o unused.o e2freefrag.o filefrag.o extent_inode.o zap.o \
+	xattrs.o quota.o tst_libext2fs.o create_inode.o journal.o \
+	revoke.o recovery.o do_journal.o
+
+DEBUG_SRCS= debug_cmds.c extent_cmds.c tst_cmds.c \
+	$(top_srcdir)/debugfs/debugfs.c \
+	$(top_srcdir)/debugfs/util.c \
+	$(top_srcdir)/debugfs/ncheck.c \
+	$(top_srcdir)/debugfs/icheck.c \
+	$(top_srcdir)/debugfs/ls.c \
+	$(top_srcdir)/debugfs/lsdel.c \
+	$(top_srcdir)/debugfs/dump.c \
+	$(top_srcdir)/debugfs/set_fields.c \
+	$(top_srcdir)/debugfs/logdump.c \
+	$(top_srcdir)/debugfs/htree.c \
+	$(top_srcdir)/debugfs/unused.c \
+	$(top_srcdir)/debugfs/filefrag.c \
+	$(top_srcdir)/debugfs/extent_inode.c \
+	$(top_srcdir)/debugfs/zap.c \
+	$(top_srcdir)/debugfs/quota.c \
+	$(top_srcdir)/debugfs/xattrs.c \
+	$(top_srcdir)/misc/e2freefrag.c \
+	$(top_srcdir)/misc/create_inode.c \
+	$(top_srcdir)/debugfs/journal.c \
+	$(top_srcdir)/e2fsck/revoke.c \
+	$(top_srcdir)/e2fsck/recovery.c \
+	$(top_srcdir)/debugfs/do_journal.c
+
+@TDB_CMT@TDB_OBJ= tdb.o
+
+OBJS= $(DEBUGFS_LIB_OBJS) $(RESIZE_LIB_OBJS) $(E2IMAGE_LIB_OBJS) \
+	$(TEST_IO_LIB_OBJS) \
+	ext2_err.o \
+	alloc.o \
+	alloc_sb.o \
+	alloc_stats.o \
+	alloc_tables.o \
+	atexit.o \
+	badblocks.o \
+	bb_inode.o \
+	bitmaps.o \
+	bitops.o \
+	blkmap64_ba.o \
+	blkmap64_rb.o \
+	blknum.o \
+	block.o \
+	bmap.o \
+	check_desc.o \
+	closefs.o \
+	crc16.o \
+	crc32c.o \
+	csum.o \
+	dblist.o \
+	dblist_dir.o \
+	dirblock.o \
+	dirhash.o \
+	dir_iterate.o \
+	expanddir.o \
+	ext_attr.o \
+	extent.o \
+	fallocate.o \
+	fileio.o \
+	finddev.o \
+	flushb.o \
+	freefs.o \
+	gen_bitmap.o \
+	gen_bitmap64.o \
+	get_num_dirs.o \
+	get_pathname.o \
+	getsize.o \
+	getsectsize.o \
+	hashmap.o \
+	i_block.o \
+	icount.o \
+	ind_block.o \
+	initialize.o \
+	inline.o \
+	inline_data.o \
+	inode.o \
+	io_manager.o \
+	ismounted.o \
+	link.o \
+	llseek.o \
+	lookup.o \
+	mkdir.o \
+	mkjournal.o \
+	mmp.o \
+	namei.o \
+	native.o \
+	newdir.o \
+	nls_utf8.o \
+	openfs.o \
+	orphan.o \
+	progress.o \
+	punch.o \
+	qcow2.o \
+	read_bb.o \
+	read_bb_file.o \
+	res_gdt.o \
+	rw_bitmaps.o \
+	sha512.o \
+	swapfs.o \
+	symlink.o \
+	$(TDB_OBJ) \
+	undo_io.o \
+	@OS_IO_FILE@.o \
+	sparse_io.o \
+	unlink.o \
+	valid_blk.o \
+	version.o \
+	rbtree.o
+
+SRCS= ext2_err.c \
+	$(srcdir)/alloc.c \
+	$(srcdir)/alloc_sb.c \
+	$(srcdir)/alloc_stats.c \
+	$(srcdir)/alloc_tables.c \
+	$(srcdir)/atexit.c \
+	$(srcdir)/badblocks.c \
+	$(srcdir)/bb_compat.c \
+	$(srcdir)/bb_inode.c \
+	$(srcdir)/bitmaps.c \
+	$(srcdir)/bitops.c \
+	$(srcdir)/blkmap64_ba.c \
+	$(srcdir)/blkmap64_rb.c \
+	$(srcdir)/block.c \
+	$(srcdir)/bmap.c \
+	$(srcdir)/check_desc.c \
+	$(srcdir)/closefs.c \
+	$(srcdir)/crc16.c \
+	$(srcdir)/crc32c.c \
+	$(srcdir)/gen_crc32ctable.c \
+	$(srcdir)/csum.c \
+	$(srcdir)/dblist.c \
+	$(srcdir)/dblist_dir.c \
+	$(srcdir)/digest_encode.c \
+	$(srcdir)/dirblock.c \
+	$(srcdir)/dirhash.c \
+	$(srcdir)/dir_iterate.c \
+	$(srcdir)/dupfs.c \
+	$(srcdir)/expanddir.c \
+	$(srcdir)/ext_attr.c \
+	$(srcdir)/extent.c \
+	$(srcdir)/fileio.c \
+	$(srcdir)/finddev.c \
+	$(srcdir)/flushb.c \
+	$(srcdir)/freefs.c \
+	$(srcdir)/gen_bitmap.c \
+	$(srcdir)/gen_bitmap64.c \
+	$(srcdir)/get_num_dirs.c \
+	$(srcdir)/get_pathname.c \
+	$(srcdir)/getsize.c \
+	$(srcdir)/getsectsize.c \
+	$(srcdir)/hashmap.c \
+	$(srcdir)/i_block.c \
+	$(srcdir)/icount.c \
+	$(srcdir)/ind_block.c \
+	$(srcdir)/initialize.c \
+	$(srcdir)/inline.c \
+	$(srcdir)/inline_data.c	\
+	$(srcdir)/inode.c \
+	$(srcdir)/inode_io.c \
+	$(srcdir)/imager.c \
+	$(srcdir)/io_manager.c \
+	$(srcdir)/ismounted.c \
+	$(srcdir)/link.c \
+	$(srcdir)/llseek.c \
+	$(srcdir)/lookup.c \
+	$(srcdir)/mkdir.c \
+	$(srcdir)/mkjournal.c \
+	$(srcdir)/mmp.c	\
+	$(srcdir)/namei.c \
+	$(srcdir)/native.c \
+	$(srcdir)/newdir.c \
+	$(srcdir)/nls_utf8.c \
+	$(srcdir)/openfs.c \
+	$(srcdir)/orphan.c \
+	$(srcdir)/progress.c \
+	$(srcdir)/punch.c \
+	$(srcdir)/qcow2.c \
+	$(srcdir)/read_bb.c \
+	$(srcdir)/read_bb_file.c \
+	$(srcdir)/res_gdt.c \
+	$(srcdir)/rw_bitmaps.c \
+	$(srcdir)/sha256.c \
+	$(srcdir)/sha512.c \
+	$(srcdir)/swapfs.c \
+	$(srcdir)/symlink.c \
+	$(srcdir)/tdb.c \
+	$(srcdir)/test_io.c \
+	$(srcdir)/tst_badblocks.c \
+	$(srcdir)/tst_bitops.c \
+	$(srcdir)/tst_byteswap.c \
+	$(srcdir)/tst_getsize.c \
+	$(srcdir)/tst_iscan.c \
+	$(srcdir)/undo_io.c \
+	$(srcdir)/@OS_IO_FILE@.c \
+	$(srcdir)/sparse_io.c \
+	$(srcdir)/unlink.c \
+	$(srcdir)/valid_blk.c \
+	$(srcdir)/version.c \
+	$(srcdir)/write_bb_file.c \
+	$(srcdir)/rbtree.c \
+	$(srcdir)/tst_libext2fs.c \
+	$(DEBUG_SRCS)
+
+HFILES= bitops.h ext2fs.h ext2_io.h ext2_fs.h ext2_ext_attr.h ext3_extents.h \
+	tdb.h qcow2.h hashmap.h
+HFILES_IN=  ext2_err.h ext2_types.h
+
+LIBRARY= libext2fs
+LIBDIR= ext2fs
+
+ELF_VERSION = 2.4
+ELF_SO_VERSION = 2
+ELF_IMAGE = libext2fs
+ELF_MYDIR = ext2fs
+ELF_INSTALL_DIR = $(root_libdir)
+ELF_OTHER_LIBS = -lcom_err
+
+BSDLIB_VERSION = 2.1
+BSDLIB_IMAGE = libext2fs
+BSDLIB_MYDIR = ext2fs
+BSDLIB_INSTALL_DIR = $(root_libdir)
+
+@MAKEFILE_LIBRARY@
+@MAKEFILE_ELF@
+@MAKEFILE_BSDLIB@
+@MAKEFILE_PROFILE@
+
+all:: ext2fs.pc
+
+.c.o:
+	$(E) "	CC $<"
+	$(Q) $(CC) $(ALL_CFLAGS_STLIB) -c $< -o $@
+	$(Q) $(CHECK_CMD) $(ALL_CFLAGS) $<
+	$(Q) $(CPPCHECK_CMD) $(CPPFLAGS) $<
+@PROFILE_CMT@	$(Q) $(CC) $(ALL_CFLAGS_STLIB) -g -pg -o profiled/$*.o -c $<
+@ELF_CMT@	$(Q) $(CC) $(ALL_CFLAGS_SHLIB) -fPIC -shared -o elfshared/$*.o -c $<
+@BSDLIB_CMT@	$(Q) $(CC) $(ALL_CFLAGS_SHLIB) $(BSDLIB_PIC_FLAG) -o pic/$*.o -c $<
+
+DISTFILES= Makefile *.c *.h image
+
+ext2_err.et: $(DEP_SUBSTITUTE) $(srcdir)/ext2_err.et.in
+	$(E) "	SUBST $@"
+	$(Q) $(SUBSTITUTE) $(srcdir)/ext2_err.et.in ext2_err.et
+
+ext2_err.c ext2_err.h: ext2_err.et
+	$(E) "	COMPILE_ET ext2_err.et"
+	$(Q) $(COMPILE_ET) ext2_err.et
+
+ext2fs.pc: $(srcdir)/ext2fs.pc.in $(top_builddir)/config.status
+	$(E) "	CONFIG.STATUS $@"
+	$(Q) cd $(top_builddir); CONFIG_FILES=lib/ext2fs/ext2fs.pc ./config.status
+
+tst_badblocks: tst_badblocks.o $(STATIC_LIBEXT2FS) $(DEPSTATIC_LIBCOM_ERR)
+	$(E) "	LD $@"
+	$(Q) $(CC) -o tst_badblocks tst_badblocks.o $(ALL_LDFLAGS) \
+		$(STATIC_LIBEXT2FS) $(STATIC_LIBCOM_ERR) $(SYSLIBS)
+
+tst_digest_encode: $(srcdir)/digest_encode.c $(srcdir)/ext2_fs.h
+	$(E) "	CC $@"
+	$(Q) $(CC) $(ALL_LDFLAGS) $(ALL_CFLAGS) -o tst_digest_encode \
+		$(srcdir)/digest_encode.c -DUNITTEST $(SYSLIBS)
+
+tst_icount: $(srcdir)/icount.c $(STATIC_LIBEXT2FS) $(DEPSTATIC_LIBCOM_ERR)
+	$(E) "	LD $@"
+	$(Q) $(CC) -o tst_icount $(srcdir)/icount.c -DDEBUG \
+		$(ALL_CFLAGS) $(ALL_LDFLAGS) \
+		$(STATIC_LIBEXT2FS) $(STATIC_LIBCOM_ERR) $(SYSLIBS)
+
+tst_iscan: tst_iscan.o $(STATIC_LIBEXT2FS) $(DEPSTATIC_LIBCOM_ERR)
+	$(E) "	LD $@"
+	$(Q) $(CC) -o tst_iscan tst_iscan.o $(ALL_LDFLAGS) \
+		$(STATIC_LIBEXT2FS) $(STATIC_LIBCOM_ERR) $(SYSLIBS)
+
+tst_getsize: tst_getsize.o $(STATIC_LIBEXT2FS) $(DEPSTATIC_LIBCOM_ERR)
+	$(E) "	LD $@"
+	$(Q) $(CC) -o tst_getsize tst_getsize.o $(ALL_LDFLAGS) \
+		$(STATIC_LIBEXT2FS) $(STATIC_LIBCOM_ERR) $(SYSLIBS)
+
+tst_ismounted: $(srcdir)/ismounted.c $(STATIC_LIBEXT2FS) \
+		$(DEPSTATIC_LIBCOM_ERR)
+	$(E) "	LD $@"
+	$(Q) $(CC) -o tst_ismounted $(srcdir)/ismounted.c \
+		$(STATIC_LIBEXT2FS) -DDEBUG $(ALL_CFLAGS) $(ALL_LDFLAGS) \
+		$(STATIC_LIBCOM_ERR) $(SYSLIBS)
+
+tst_byteswap: tst_byteswap.o $(STATIC_LIBEXT2FS) $(DEPSTATIC_LIBCOM_ERR)
+	$(E) "	LD $@"
+	$(Q) $(CC) -o tst_byteswap tst_byteswap.o $(ALL_LDFLAGS) \
+		$(STATIC_LIBEXT2FS) $(STATIC_LIBCOM_ERR) $(SYSLIBS)
+
+tst_bitops: tst_bitops.o $(STATIC_LIBEXT2FS) $(DEPSTATIC_LIBCOM_ERR)
+	$(E) "	LD $@"
+	$(Q) $(CC) -o tst_bitops tst_bitops.o $(ALL_CFLAGS) $(ALL_LDFLAGS) \
+		$(STATIC_LIBEXT2FS) $(STATIC_LIBCOM_ERR) $(SYSLIBS)
+
+tst_getsectsize: tst_getsectsize.o getsectsize.o $(STATIC_LIBEXT2FS) \
+			$(DEPSTATIC_LIBCOM_ERR)
+	$(E) "	LD $@"
+	$(Q) $(CC) -o tst_getsectsize tst_getsectsize.o getsectsize.o \
+		$(ALL_LDFLAGS) $(STATIC_LIBEXT2FS) $(STATIC_LIBCOM_ERR) \
+		$(SYSLIBS)
+
+tst_types.o: $(srcdir)/tst_types.c ext2_types.h 
+
+tst_types: tst_types.o ext2_types.h 
+	$(E) "	LD $@"
+	$(Q) $(CC) -o tst_types tst_types.o $(ALL_LDFLAGS) $(SYSLIBS)
+
+tst_super_size.o: $(srcdir)/tst_super_size.c $(srcdir)/ext2_fs.h
+
+tst_super_size: tst_super_size.o
+	$(E) "	LD $@"
+	$(Q) $(CC) -o tst_super_size tst_super_size.o $(ALL_LDFLAGS) $(SYSLIBS)
+
+tst_fs_struct.o: $(srcdir)/tst_fs_struct.c $(srcdir)/ext2fs.h
+
+tst_fs_struct: tst_fs_struct.o
+	$(E) "	LD $@"
+	$(Q) $(CC) -o tst_fs_struct tst_fs_struct.o $(ALL_LDFLAGS) $(SYSLIBS)
+
+tst_inode_size.o: $(srcdir)/tst_inode_size.c $(srcdir)/ext2_fs.h
+
+tst_inode_size: tst_inode_size.o
+	$(E) "	LD $@"
+	$(Q) $(CC) -o tst_inode_size tst_inode_size.o $(ALL_LDFLAGS) $(SYSLIBS)
+
+tst_sha256: $(srcdir)/sha256.c $(srcdir)/ext2_fs.h
+	$(E) "	CC $@"
+	$(Q) $(CC) $(ALL_LDFLAGS) $(ALL_CFLAGS) -o tst_sha256 \
+		$(srcdir)/sha256.c -DUNITTEST $(SYSLIBS)
+
+tst_sha512: $(srcdir)/sha512.c $(srcdir)/ext2_fs.h
+	$(E) "	CC $@"
+	$(Q) $(CC) $(ALL_LDFLAGS) $(ALL_CFLAGS) -o tst_sha512 \
+		$(srcdir)/sha512.c -DUNITTEST $(SYSLIBS)
+
+ext2_tdbtool: tdbtool.o
+	$(E) "	LD $@"
+	$(Q) $(CC) -o ext2_tdbtool tdbtool.o tdb.o $(ALL_LDFLAGS) $(SYSLIBS)
+
+tst_cmds.c tst_cmds.h: tst_cmds.ct
+	$(E) "	MK_CMDS $@"
+	$(Q) $(MK_CMDS) $(srcdir)/tst_cmds.ct
+
+debug_cmds.c debug_cmds.h: $(top_srcdir)/debugfs/debug_cmds.ct
+	$(E) "	MK_CMDS $<"
+	$(Q) $(MK_CMDS) $(top_srcdir)/debugfs/debug_cmds.ct
+
+extent_cmds.c extent_cmds.h: $(top_srcdir)/debugfs/extent_cmds.ct
+	$(E) "	MK_CMDS $<"
+	$(Q) $(MK_CMDS) $(top_srcdir)/debugfs/extent_cmds.ct
+
+debugfs.o: $(top_srcdir)/debugfs/debugfs.c
+	$(E) "	CC $<"
+	$(Q) $(CC) $(DEBUGFS_CFLAGS) -DSKIP_GLOBDEFS -c $< -o $@
+
+extent_inode.o: $(top_srcdir)/debugfs/extent_inode.c
+	$(E) "	CC $<"
+	$(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@
+
+util.o: $(top_srcdir)/debugfs/util.c
+	$(E) "	CC $<"
+	$(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@
+
+ncheck.o: $(top_srcdir)/debugfs/ncheck.c
+	$(E) "	CC $<"
+	$(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@
+
+icheck.o: $(top_srcdir)/debugfs/icheck.c
+	$(E) "	CC $<"
+	$(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@
+
+ls.o: $(top_srcdir)/debugfs/ls.c
+	$(E) "	CC $<"
+	$(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@
+
+lsdel.o: $(top_srcdir)/debugfs/lsdel.c
+	$(E) "	CC $<"
+	$(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@
+
+dump.o: $(top_srcdir)/debugfs/dump.c
+	$(E) "	CC $<"
+	$(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@
+
+set_fields.o: $(top_srcdir)/debugfs/set_fields.c
+	$(E) "	CC $<"
+	$(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@
+
+logdump.o: $(top_srcdir)/debugfs/logdump.c
+	$(E) "	CC $<"
+	$(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@
+
+htree.o: $(top_srcdir)/debugfs/htree.c
+	$(E) "	CC $<"
+	$(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@
+
+unused.o: $(top_srcdir)/debugfs/unused.c
+	$(E) "	CC $<"
+	$(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@
+
+zap.o: $(top_srcdir)/debugfs/zap.c
+	$(E) "	CC $<"
+	$(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@
+
+quota.o: $(top_srcdir)/debugfs/quota.c
+	$(E) "	CC $<"
+	$(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@
+
+journal.o: $(top_srcdir)/debugfs/journal.c
+	$(E) "	CC $<"
+	$(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@
+
+revoke.o: $(top_srcdir)/e2fsck/revoke.c
+	$(E) "	CC $<"
+	$(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@
+
+recovery.o: $(top_srcdir)/e2fsck/recovery.c
+	$(E) "	CC $<"
+	$(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@
+
+do_journal.o: $(top_srcdir)/debugfs/do_journal.c
+	$(E) "	CC $<"
+	$(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@
+
+xattrs.o: $(top_srcdir)/debugfs/xattrs.c
+	$(E) "	CC $<"
+	$(Q) $(CC) $(DEBUGFS_CFLAGS) -c $< -o $@
+
+e2freefrag.o: $(top_srcdir)/misc/e2freefrag.c
+	$(E) "	CC $<"
+	$(Q) $(CC) $(ALL_CFLAGS) -DDEBUGFS -I$(top_srcdir)/debugfs -c $< -o $@
+
+create_inode.o: $(top_srcdir)/misc/create_inode.c
+	$(E) "	CC $<"
+	$(Q) $(CC) $(ALL_CFLAGS) -DDEBUGFS -c $< -o $@
+
+filefrag.o: $(top_srcdir)/debugfs/filefrag.c
+	$(E) "	CC $<"
+	$(Q) $(CC) $(ALL_CFLAGS) -c $< -o $@
+
+tst_libext2fs.o: $(srcdir)/tst_libext2fs.c
+	$(E) "	CC $<"
+	$(Q) $(CC) $(ALL_CFLAGS) $(ALL_LDFLAGS) $(DEPEND_CFLAGS) -c $< -o $@
+
+tst_bitmaps_cmd.c: tst_bitmaps_cmd.ct
+	$(E) "	MK_CMDS $@"
+	$(Q) DIR=$(srcdir) $(MK_CMDS) $(srcdir)/tst_bitmaps_cmd.ct
+
+tst_bitmaps: tst_bitmaps.o tst_bitmaps_cmd.o $(srcdir)/blkmap64_rb.c \
+		$(STATIC_LIBEXT2FS) $(DEPSTATIC_LIBSS) $(DEPSTATIC_LIBCOM_ERR)
+	$(E) "	LD $@"
+	$(Q) $(CC) -o $@ tst_bitmaps.o tst_bitmaps_cmd.o \
+		-DDEBUG_RB $(srcdir)/blkmap64_rb.c $(ALL_CFLAGS) \
+		$(ALL_LDFLAGS) $(STATIC_LIBEXT2FS) $(STATIC_LIBSS) \
+		$(STATIC_LIBCOM_ERR) $(SYSLIBS)
+
+tst_extents: $(srcdir)/extent.c $(DEBUG_OBJS) $(DEPSTATIC_LIBSS) libext2fs.a \
+	$(STATIC_LIBE2P) $(DEPLIBUUID) $(DEPLIBBLKID) $(DEPSTATIC_LIBCOM_ERR) \
+	$(DEPLIBSUPPORT)
+	$(E) "	LD $@"
+	$(Q) $(CC) -o tst_extents $(srcdir)/extent.c \
+		$(ALL_CFLAGS) $(ALL_LDFLAGS) -DDEBUG $(DEBUG_OBJS) \
+		$(STATIC_LIBSS) $(STATIC_LIBE2P) $(LIBSUPPORT) \
+		$(STATIC_LIBEXT2FS) $(LIBBLKID) $(LIBUUID) \
+		$(STATIC_LIBCOM_ERR) $(SYSLIBS) -I $(top_srcdir)/debugfs
+
+tst_libext2fs: $(DEBUG_OBJS) \
+	$(DEPSTATIC_LIBSS) $(STATIC_LIBE2P) $(DEPLIBUUID) libext2fs.a \
+	$(DEPLIBBLKID) $(DEPSTATIC_LIBCOM_ERR) $(DEPLIBSUPPORT)
+	$(E) "	LD $@"
+	$(Q) $(CC) -o tst_libext2fs $(ALL_LDFLAGS) -DDEBUG $(DEBUG_OBJS) \
+		$(STATIC_LIBSS) $(STATIC_LIBE2P) $(LIBSUPPORT) \
+		$(STATIC_LIBEXT2FS) $(LIBBLKID) $(LIBUUID) $(LIBMAGIC) \
+		$(STATIC_LIBCOM_ERR) $(SYSLIBS) -I $(top_srcdir)/debugfs
+
+tst_inline: $(srcdir)/inline.c $(STATIC_LIBEXT2FS) $(DEPSTATIC_LIBCOM_ERR)
+	$(E) "	LD $@"
+	$(Q) $(CC) -o tst_inline $(srcdir)/inline.c $(ALL_CFLAGS) \
+		$(ALL_LDFLAGS) -DDEBUG $(STATIC_LIBEXT2FS) \
+		$(STATIC_LIBCOM_ERR) $(SYSLIBS)
+
+tst_inline_data: inline_data.c $(STATIC_LIBEXT2FS) $(DEPSTATIC_LIBCOM_ERR)
+	$(E) "	LD $@"
+	$(Q) $(CC) -o tst_inline_data $(srcdir)/inline_data.c $(ALL_CFLAGS) \
+		$(ALL_LDFLAGS) -DDEBUG $(STATIC_LIBEXT2FS) \
+		$(STATIC_LIBCOM_ERR) $(SYSLIBS)
+
+tst_csum: csum.c $(STATIC_LIBEXT2FS) $(DEPSTATIC_LIBCOM_ERR) $(STATIC_LIBE2P) \
+		$(top_srcdir)/lib/e2p/e2p.h
+	$(E) "	LD $@"
+	$(Q) $(CC) -o tst_csum $(srcdir)/csum.c -DDEBUG \
+		$(ALL_CFLAGS) $(ALL_LDFLAGS) $(STATIC_LIBEXT2FS) \
+		$(STATIC_LIBCOM_ERR) $(STATIC_LIBE2P) $(SYSLIBS)
+
+tst_crc32c: $(srcdir)/crc32c.c $(STATIC_LIBEXT2FS) $(DEPSTATIC_LIBCOM_ERR)
+	$(Q) $(CC) $(ALL_LDFLAGS) $(ALL_CFLAGS) -o tst_crc32c $(srcdir)/crc32c.c \
+		-DUNITTEST $(STATIC_LIBEXT2FS) $(STATIC_LIBCOM_ERR) \
+		$(SYSLIBS)
+
+mkjournal: mkjournal.c $(STATIC_LIBEXT2FS) $(DEPLIBCOM_ERR)
+	$(E) "	LD $@"
+	$(Q) $(CC) -o mkjournal $(srcdir)/mkjournal.c -DDEBUG \
+		$(STATIC_LIBEXT2FS) $(LIBCOM_ERR) $(ALL_CFLAGS) $(SYSLIBS)
+
+fullcheck check:: tst_bitops tst_badblocks tst_iscan tst_types tst_icount \
+    tst_super_size tst_types tst_inode_size tst_csum tst_crc32c tst_bitmaps \
+    tst_inline tst_inline_data tst_libext2fs tst_sha256 tst_sha512 \
+    tst_digest_encode tst_getsize tst_getsectsize
+	$(TESTENV) ./tst_bitops
+	$(TESTENV) ./tst_badblocks
+	$(TESTENV) ./tst_iscan
+	$(TESTENV) ./tst_types
+	$(TESTENV) ./tst_icount
+	$(TESTENV) ./tst_super_size
+	$(TESTENV) ./tst_inode_size
+	$(TESTENV) ./tst_csum
+	$(TESTENV) ./tst_inline
+	$(TESTENV) ./tst_inline_data
+	$(TESTENV) ./tst_crc32c
+	$(TESTENV) ./tst_sha256
+	$(TESTENV) ./tst_sha512
+	$(TESTENV) ./tst_bitmaps -f $(srcdir)/tst_bitmaps_cmds > tst_bitmaps_out
+	diff $(srcdir)/tst_bitmaps_exp tst_bitmaps_out
+	$(TESTENV) ./tst_bitmaps -t 2 -f $(srcdir)/tst_bitmaps_cmds > tst_bitmaps_out
+	diff $(srcdir)/tst_bitmaps_exp tst_bitmaps_out
+	$(TESTENV) ./tst_bitmaps -t 3 -f $(srcdir)/tst_bitmaps_cmds > tst_bitmaps_out
+	diff $(srcdir)/tst_bitmaps_exp tst_bitmaps_out
+	$(TESTENV) ./tst_bitmaps -l -f $(srcdir)/tst_bitmaps_cmds > tst_bitmaps_out
+	diff $(srcdir)/tst_bitmaps_exp tst_bitmaps_out
+	$(TESTENV) ./tst_digest_encode
+
+installdirs::
+	$(E) "	MKDIR_P $(libdir) $(includedir)/ext2fs"
+	$(Q) $(MKDIR_P) $(DESTDIR)$(libdir) \
+		$(DESTDIR)$(includedir)/ext2fs $(DESTDIR)$(pkgconfigdir)
+
+install:: all $(HFILES) $(HFILES_IN) installdirs ext2fs.pc
+	$(E) "	INSTALL_DATA $(libdir)/libext2fs.a"
+	$(Q) $(INSTALL_DATA) libext2fs.a $(DESTDIR)$(libdir)/libext2fs.a
+	-$(Q) $(RANLIB) $(DESTDIR)$(libdir)/libext2fs.a
+	$(Q) $(CHMOD) $(LIBMODE) $(DESTDIR)$(libdir)/libext2fs.a
+	$(Q) for i in $(HFILES); do \
+		echo "	INSTALL_DATA $(includedir)/ext2fs/$$i"; \
+		$(INSTALL_DATA) $(srcdir)/$$i $(DESTDIR)$(includedir)/ext2fs/$$i; \
+	done
+	$(Q) for i in $(HFILES_IN); do \
+		echo "	INSTALL_DATA $(includedir)/ext2fs/$$i"; \
+		$(INSTALL_DATA) $$i $(DESTDIR)$(includedir)/ext2fs/$$i; \
+	done
+	$(E) "	INSTALL_DATA $(pkgconfigdir)/ext2fs.pc"
+	$(Q) $(INSTALL_DATA) ext2fs.pc $(DESTDIR)$(pkgconfigdir)/ext2fs.pc
+
+uninstall::
+	$(RM) -f $(DESTDIR)$(libdir)/libext2fs.a \
+		$(DESTDIR)$(pkgconfigdir)/ext2fs.pc
+	$(RM) -rf $(DESTDIR)$(includedir)/ext2fs 
+
+clean::
+	$(RM) -f \#* *.s *.o *.a *~ *.bak core profiled/* \
+		tst_badblocks tst_iscan ext2_err.et ext2_err.c ext2_err.h \
+		tst_byteswap tst_ismounted tst_getsize tst_getsectsize \
+		tst_bitops tst_types tst_icount tst_super_size tst_csum \
+		tst_bitmaps tst_bitmaps_out tst_extents tst_inline \
+		tst_inline_data tst_inode_size tst_bitmaps_cmd.c \
+		tst_digest_encode tst_sha256 tst_sha512 \
+		ext2_tdbtool mkjournal debug_cmds.c tst_cmds.c extent_cmds.c \
+		../libext2fs.a ../libext2fs_p.a ../libext2fs_chk.a \
+		crc32c_table.h gen_crc32ctable tst_crc32c tst_libext2fs \
+		ext2fs.pc ext2_types.h
+
+mostlyclean:: clean
+distclean:: clean
+	$(RM) -f .depend ext2_err.c ext2_err.h Makefile ext2fs.pc \
+		$(srcdir)/TAGS $(srcdir)/Makefile.in.old
+#
+# Hack to parallel makes recognize dependencies correctly.
+#
+$(top_builddir)/lib/ext2fs/ext2_err.h: ext2_err.h
+
+$(OBJS): subdirs
+
+gen_crc32ctable: $(srcdir)/gen_crc32ctable.c
+	$(E) "	CC $@"
+	$(Q) $(BUILD_CC) $(BUILD_CFLAGS) $(BUILD_LDFLAGS) -o gen_crc32ctable \
+		$(srcdir)/gen_crc32ctable.c
+
+crc32c_table.h: gen_crc32ctable
+	$(E) "	GEN32CTABLE $@"
+	$(Q) ./gen_crc32ctable > crc32c_table.h
+
+$(top_builddir)/$(my_dir)/ext2_types.h: $(srcdir)/ext2_types.h.in \
+		$(top_builddir)/config.status
+	cd $(top_builddir); CONFIG_FILES=$(my_dir)/ext2_types.h ./config.status
+
+$(srcdir)/utf8data.h:
+	$(Q) $(MAKE) $(MKUTF8DATA)
+	$(E) "MKUTF8DATA $@"
+	$(Q) $(MKUTF8DATA) -a $(top_srcdir)/util/ucd/DerivedAge-11.0.0.txt \
+		-c $(top_srcdir)/util/ucd/DerivedCombiningClass-11.0.0.txt \
+		-p $(top_srcdir)/util/ucd/DerivedCoreProperties-11.0.0.txt \
+		-d $(top_srcdir)/util/ucd/UnicodeData-11.0.0.txt \
+		-f $(top_srcdir)/util/ucd/CaseFolding-11.0.0.txt \
+		-n $(top_srcdir)/util/ucd/NormalizationCorrections-11.0.0.txt \
+		-t $(top_srcdir)/util/ucd/NormalizationTest-11.0.0.txt \
+		-o $@
+
+#
+# This needs to be manually maintained since "make depend" on a
+# Linux system is going to blow up due to the lack of windows.h
+# header file.  If someone on Windows tries to run "make depend",
+# they will need to comment this chunk below.
+#
+windows_io.o: $(srcdir)/windows_io.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/bitops.h $(srcdir)/ext2fsP.h
+
+# +++ Dependency line eater +++
+# 
+# Makefile dependencies follow.  This must be the last section in
+# the Makefile.in file
+#
+ext2_err.o: ext2_err.c
+alloc.o: $(srcdir)/alloc.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+alloc_sb.o: $(srcdir)/alloc_sb.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+alloc_stats.o: $(srcdir)/alloc_stats.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+alloc_tables.o: $(srcdir)/alloc_tables.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(srcdir)/ext2fsP.h
+atexit.o: $(srcdir)/atexit.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(srcdir)/ext2fsP.h
+badblocks.o: $(srcdir)/badblocks.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \
+ $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h
+bb_compat.o: $(srcdir)/bb_compat.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \
+ $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h
+bb_inode.o: $(srcdir)/bb_inode.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+bitmaps.o: $(srcdir)/bitmaps.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(srcdir)/ext2fsP.h $(srcdir)/bmap64.h
+bitops.o: $(srcdir)/bitops.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+blkmap64_ba.o: $(srcdir)/blkmap64_ba.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \
+ $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h $(srcdir)/bmap64.h
+blkmap64_rb.o: $(srcdir)/blkmap64_rb.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \
+ $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h $(srcdir)/bmap64.h $(srcdir)/rbtree.h \
+ $(srcdir)/compiler.h
+block.o: $(srcdir)/block.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+bmap.o: $(srcdir)/bmap.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \
+ $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h
+check_desc.o: $(srcdir)/check_desc.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+closefs.o: $(srcdir)/closefs.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \
+ $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h
+crc16.o: $(srcdir)/crc16.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(top_builddir)/lib/ext2fs/ext2_types.h \
+ $(srcdir)/crc16.h
+crc32c.o: $(srcdir)/crc32c.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/crc32c_defs.h $(srcdir)/ext2fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2_fs.h \
+ $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h crc32c_table.h
+gen_crc32ctable.o: $(srcdir)/gen_crc32ctable.c $(srcdir)/crc32c_defs.h
+csum.o: $(srcdir)/csum.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(srcdir)/crc16.h
+dblist.o: $(srcdir)/dblist.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \
+ $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h
+dblist_dir.o: $(srcdir)/dblist_dir.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \
+ $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h
+digest_encode.o: $(srcdir)/digest_encode.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2_fs.h \
+ $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h
+dirblock.o: $(srcdir)/dirblock.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+dirhash.o: $(srcdir)/dirhash.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(srcdir)/ext2fsP.h
+dir_iterate.o: $(srcdir)/dir_iterate.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \
+ $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h
+dupfs.o: $(srcdir)/dupfs.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \
+ $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h
+expanddir.o: $(srcdir)/expanddir.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(srcdir)/ext2fsP.h
+ext_attr.o: $(srcdir)/ext_attr.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/ext4_acl.h $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h \
+ $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h
+extent.o: $(srcdir)/extent.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \
+ $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h $(srcdir)/e2image.h
+fileio.o: $(srcdir)/fileio.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(srcdir)/ext2fsP.h
+finddev.o: $(srcdir)/finddev.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(srcdir)/ext2fsP.h
+flushb.o: $(srcdir)/flushb.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+freefs.o: $(srcdir)/freefs.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \
+ $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h
+gen_bitmap.o: $(srcdir)/gen_bitmap.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \
+ $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h
+gen_bitmap64.o: $(srcdir)/gen_bitmap64.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \
+ $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h $(srcdir)/bmap64.h
+get_num_dirs.o: $(srcdir)/get_num_dirs.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \
+ $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h
+get_pathname.o: $(srcdir)/get_pathname.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+getsize.o: $(srcdir)/getsize.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+getsectsize.o: $(srcdir)/getsectsize.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+hashmap.o: $(srcdir)/hashmap.c $(srcdir)/hashmap.h
+i_block.o: $(srcdir)/i_block.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+icount.o: $(srcdir)/icount.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(srcdir)/tdb.h
+ind_block.o: $(srcdir)/ind_block.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+initialize.o: $(srcdir)/initialize.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+inline.o: $(srcdir)/inline.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+inline_data.o: $(srcdir)/inline_data.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h $(srcdir)/ext2fsP.h
+inode.o: $(srcdir)/inode.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \
+ $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h $(srcdir)/e2image.h
+inode_io.o: $(srcdir)/inode_io.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+imager.o: $(srcdir)/imager.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+io_manager.o: $(srcdir)/io_manager.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+ismounted.o: $(srcdir)/ismounted.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(srcdir)/ext2fsP.h
+link.o: $(srcdir)/link.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(srcdir)/ext2fsP.h
+llseek.o: $(srcdir)/llseek.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_types.h
+lookup.o: $(srcdir)/lookup.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+mkdir.o: $(srcdir)/mkdir.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(srcdir)/ext2fsP.h
+mkjournal.o: $(srcdir)/mkjournal.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(top_srcdir)/lib/e2p/e2p.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext2fs.h $(srcdir)/ext3_extents.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h $(srcdir)/kernel-jbd.h \
+ $(srcdir)/jfs_compat.h $(srcdir)/kernel-list.h $(srcdir)/compiler.h
+mmp.o: $(srcdir)/mmp.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h
+namei.o: $(srcdir)/namei.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(srcdir)/ext2fsP.h
+native.o: $(srcdir)/native.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+newdir.o: $(srcdir)/newdir.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+nls_utf8.o: $(srcdir)/nls_utf8.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(srcdir)/ext2fsP.h $(srcdir)/utf8data.h
+openfs.o: $(srcdir)/openfs.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(srcdir)/e2image.h
+progress.o: $(srcdir)/progress.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2_fs.h \
+ $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h $(srcdir)/ext2fsP.h
+punch.o: $(srcdir)/punch.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(srcdir)/ext2fsP.h
+qcow2.o: $(srcdir)/qcow2.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2_fs.h \
+ $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h $(srcdir)/qcow2.h
+read_bb.o: $(srcdir)/read_bb.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+read_bb_file.o: $(srcdir)/read_bb_file.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+res_gdt.o: $(srcdir)/res_gdt.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+rw_bitmaps.o: $(srcdir)/rw_bitmaps.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(srcdir)/e2image.h
+sha256.o: $(srcdir)/sha256.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2_fs.h \
+ $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h
+sha512.o: $(srcdir)/sha512.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2_fs.h \
+ $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h
+swapfs.o: $(srcdir)/swapfs.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(srcdir)/ext2fsP.h
+symlink.o: $(srcdir)/symlink.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+tdb.o: $(srcdir)/tdb.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/tdb.h
+test_io.o: $(srcdir)/test_io.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+tst_badblocks.o: $(srcdir)/tst_badblocks.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+tst_bitops.o: $(srcdir)/tst_bitops.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+tst_byteswap.o: $(srcdir)/tst_byteswap.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+tst_getsize.o: $(srcdir)/tst_getsize.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+tst_iscan.o: $(srcdir)/tst_iscan.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+undo_io.o: $(srcdir)/undo_io.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(srcdir)/ext2fsP.h
+unix_io.o: $(srcdir)/unix_io.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(srcdir)/ext2fsP.h
+sparse_io.o: $(srcdir)/sparse_io.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+unlink.o: $(srcdir)/unlink.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+valid_blk.o: $(srcdir)/valid_blk.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+version.o: $(srcdir)/version.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(top_srcdir)/version.h
+write_bb_file.o: $(srcdir)/write_bb_file.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h
+rbtree.o: $(srcdir)/rbtree.c $(srcdir)/rbtree.h $(srcdir)/compiler.h
+tst_libext2fs.o: $(srcdir)/tst_libext2fs.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fsP.h \
+ $(srcdir)/ext2fs.h $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h $(top_srcdir)/lib/ss/ss.h \
+ $(top_builddir)/lib/ss/ss_err.h $(top_srcdir)/debugfs/debugfs.h \
+ $(srcdir)/ext2fs.h $(top_srcdir)/debugfs/../misc/create_inode.h \
+ $(top_srcdir)/lib/e2p/e2p.h $(top_srcdir)/lib/support/quotaio.h \
+ $(top_srcdir)/lib/support/dqblk_v2.h \
+ $(top_srcdir)/lib/support/quotaio_tree.h
+debug_cmds.o: debug_cmds.c $(top_srcdir)/lib/ss/ss.h \
+ $(top_builddir)/lib/ss/ss_err.h $(top_srcdir)/lib/et/com_err.h
+extent_cmds.o: extent_cmds.c $(top_srcdir)/lib/ss/ss.h \
+ $(top_builddir)/lib/ss/ss_err.h $(top_srcdir)/lib/et/com_err.h
+tst_cmds.o: tst_cmds.c $(top_srcdir)/lib/ss/ss.h \
+ $(top_builddir)/lib/ss/ss_err.h $(top_srcdir)/lib/et/com_err.h
+debugfs.o: $(top_srcdir)/debugfs/debugfs.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \
+ $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \
+ $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \
+ $(top_srcdir)/lib/support/quotaio_tree.h $(top_srcdir)/debugfs/../version.h \
+ $(srcdir)/../../e2fsck/jfs_user.h $(srcdir)/kernel-jbd.h \
+ $(srcdir)/jfs_compat.h $(srcdir)/kernel-list.h $(srcdir)/compiler.h \
+ $(top_srcdir)/lib/support/plausible.h
+util.o: $(top_srcdir)/debugfs/util.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(top_srcdir)/lib/ss/ss.h \
+ $(top_builddir)/lib/ss/ss_err.h $(top_srcdir)/lib/et/com_err.h \
+ $(top_srcdir)/debugfs/debugfs.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \
+ $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \
+ $(top_srcdir)/lib/support/quotaio_tree.h
+ncheck.o: $(top_srcdir)/debugfs/ncheck.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \
+ $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \
+ $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \
+ $(top_srcdir)/lib/support/quotaio_tree.h
+icheck.o: $(top_srcdir)/debugfs/icheck.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \
+ $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \
+ $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \
+ $(top_srcdir)/lib/support/quotaio_tree.h
+ls.o: $(top_srcdir)/debugfs/ls.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \
+ $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \
+ $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \
+ $(top_srcdir)/lib/support/quotaio_tree.h
+lsdel.o: $(top_srcdir)/debugfs/lsdel.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \
+ $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \
+ $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \
+ $(top_srcdir)/lib/support/quotaio_tree.h
+dump.o: $(top_srcdir)/debugfs/dump.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \
+ $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \
+ $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \
+ $(top_srcdir)/lib/support/quotaio_tree.h
+set_fields.o: $(top_srcdir)/debugfs/set_fields.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \
+ $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \
+ $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \
+ $(top_srcdir)/lib/support/quotaio_tree.h
+logdump.o: $(top_srcdir)/debugfs/logdump.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \
+ $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \
+ $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \
+ $(top_srcdir)/lib/support/quotaio_tree.h $(srcdir)/../../e2fsck/jfs_user.h \
+ $(srcdir)/kernel-jbd.h $(srcdir)/jfs_compat.h $(srcdir)/kernel-list.h \
+ $(srcdir)/compiler.h $(srcdir)/fast_commit.h
+htree.o: $(top_srcdir)/debugfs/htree.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \
+ $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \
+ $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \
+ $(top_srcdir)/lib/support/quotaio_tree.h
+unused.o: $(top_srcdir)/debugfs/unused.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \
+ $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \
+ $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \
+ $(top_srcdir)/lib/support/quotaio_tree.h
+filefrag.o: $(top_srcdir)/debugfs/filefrag.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \
+ $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \
+ $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \
+ $(top_srcdir)/lib/support/quotaio_tree.h
+extent_inode.o: $(top_srcdir)/debugfs/extent_inode.c \
+ $(top_builddir)/lib/config.h $(top_builddir)/lib/dirpaths.h \
+ $(top_srcdir)/debugfs/debugfs.h $(top_srcdir)/lib/ss/ss.h \
+ $(top_builddir)/lib/ss/ss_err.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_fs.h $(top_builddir)/lib/ext2fs/ext2_types.h \
+ $(srcdir)/ext2fs.h $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \
+ $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \
+ $(top_srcdir)/lib/support/quotaio_tree.h
+zap.o: $(top_srcdir)/debugfs/zap.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \
+ $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \
+ $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \
+ $(top_srcdir)/lib/support/quotaio_tree.h
+quota.o: $(top_srcdir)/debugfs/quota.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \
+ $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \
+ $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \
+ $(top_srcdir)/lib/support/quotaio_tree.h
+xattrs.o: $(top_srcdir)/debugfs/xattrs.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(top_srcdir)/lib/support/cstring.h \
+ $(top_srcdir)/debugfs/debugfs.h $(top_srcdir)/lib/ss/ss.h \
+ $(top_builddir)/lib/ss/ss_err.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_fs.h $(top_builddir)/lib/ext2fs/ext2_types.h \
+ $(srcdir)/ext2fs.h $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \
+ $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \
+ $(top_srcdir)/lib/support/quotaio_tree.h
+e2freefrag.o: $(top_srcdir)/misc/e2freefrag.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h $(top_srcdir)/misc/e2freefrag.h \
+ $(top_srcdir)/debugfs/debugfs.h $(top_srcdir)/lib/ss/ss.h \
+ $(top_builddir)/lib/ss/ss_err.h $(top_srcdir)/debugfs/../misc/create_inode.h \
+ $(top_srcdir)/lib/e2p/e2p.h $(top_srcdir)/lib/support/quotaio.h \
+ $(top_srcdir)/lib/support/dqblk_v2.h \
+ $(top_srcdir)/lib/support/quotaio_tree.h
+create_inode.o: $(top_srcdir)/misc/create_inode.c \
+ $(top_builddir)/lib/config.h $(top_builddir)/lib/dirpaths.h \
+ $(srcdir)/ext2fs.h $(top_builddir)/lib/ext2fs/ext2_types.h \
+ $(srcdir)/ext2_fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(srcdir)/fiemap.h $(top_srcdir)/misc/create_inode.h \
+ $(top_srcdir)/lib/e2p/e2p.h $(top_srcdir)/lib/support/nls-enable.h
+journal.o: $(top_srcdir)/debugfs/journal.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/journal.h \
+ $(srcdir)/../../e2fsck/jfs_user.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h $(srcdir)/kernel-jbd.h \
+ $(srcdir)/jfs_compat.h $(srcdir)/kernel-list.h $(srcdir)/compiler.h
+revoke.o: $(top_srcdir)/e2fsck/revoke.c $(top_srcdir)/e2fsck/jfs_user.h \
+ $(top_builddir)/lib/config.h $(top_builddir)/lib/dirpaths.h \
+ $(srcdir)/ext2_fs.h $(top_builddir)/lib/ext2fs/ext2_types.h \
+ $(srcdir)/ext2fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(srcdir)/kernel-jbd.h $(srcdir)/jfs_compat.h $(srcdir)/kernel-list.h \
+ $(srcdir)/compiler.h
+recovery.o: $(top_srcdir)/e2fsck/recovery.c $(top_srcdir)/e2fsck/jfs_user.h \
+ $(top_builddir)/lib/config.h $(top_builddir)/lib/dirpaths.h \
+ $(srcdir)/ext2_fs.h $(top_builddir)/lib/ext2fs/ext2_types.h \
+ $(srcdir)/ext2fs.h $(srcdir)/ext3_extents.h $(top_srcdir)/lib/et/com_err.h \
+ $(srcdir)/ext2_io.h $(top_builddir)/lib/ext2fs/ext2_err.h \
+ $(srcdir)/ext2_ext_attr.h $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(srcdir)/kernel-jbd.h $(srcdir)/jfs_compat.h $(srcdir)/kernel-list.h \
+ $(srcdir)/compiler.h
+do_journal.o: $(top_srcdir)/debugfs/do_journal.c $(top_builddir)/lib/config.h \
+ $(top_builddir)/lib/dirpaths.h $(top_srcdir)/debugfs/debugfs.h \
+ $(top_srcdir)/lib/ss/ss.h $(top_builddir)/lib/ss/ss_err.h \
+ $(top_srcdir)/lib/et/com_err.h $(srcdir)/ext2_fs.h \
+ $(top_builddir)/lib/ext2fs/ext2_types.h $(srcdir)/ext2fs.h \
+ $(srcdir)/ext3_extents.h $(srcdir)/ext2_io.h \
+ $(top_builddir)/lib/ext2fs/ext2_err.h $(srcdir)/ext2_ext_attr.h \
+ $(srcdir)/hashmap.h $(srcdir)/bitops.h \
+ $(top_srcdir)/debugfs/../misc/create_inode.h $(top_srcdir)/lib/e2p/e2p.h \
+ $(top_srcdir)/lib/support/quotaio.h $(top_srcdir)/lib/support/dqblk_v2.h \
+ $(top_srcdir)/lib/support/quotaio_tree.h $(srcdir)/kernel-jbd.h \
+ $(srcdir)/jfs_compat.h $(srcdir)/kernel-list.h $(srcdir)/compiler.h \
+ $(top_srcdir)/debugfs/journal.h $(srcdir)/../../e2fsck/jfs_user.h
diff --git a/lib/ext2fs/alloc.c b/lib/ext2fs/alloc.c
new file mode 100644
index 0000000..3fd9216
--- /dev/null
+++ b/lib/ext2fs/alloc.c
@@ -0,0 +1,554 @@
+/*
+ * alloc.c --- allocate new inodes, blocks for ext2fs
+ *
+ * Copyright (C) 1993, 1994, 1995, 1996 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <time.h>
+#include <string.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+#define min(a, b) ((a) < (b) ? (a) : (b))
+
+#undef DEBUG
+
+#ifdef DEBUG
+# define dbg_printf(f, a...)  do {printf(f, ## a); fflush(stdout); } while (0)
+#else
+# define dbg_printf(f, a...)
+#endif
+
+/*
+ * Clear the uninit block bitmap flag if necessary
+ */
+void ext2fs_clear_block_uninit(ext2_filsys fs, dgrp_t group)
+{
+	if (group >= fs->group_desc_count ||
+	    !ext2fs_has_group_desc_csum(fs) ||
+	    !(ext2fs_bg_flags_test(fs, group, EXT2_BG_BLOCK_UNINIT)))
+		return;
+
+	/* uninit block bitmaps are now initialized in read_bitmaps() */
+
+	ext2fs_bg_flags_clear(fs, group, EXT2_BG_BLOCK_UNINIT);
+	ext2fs_group_desc_csum_set(fs, group);
+	ext2fs_mark_super_dirty(fs);
+	ext2fs_mark_bb_dirty(fs);
+}
+
+/*
+ * Check for uninit inode bitmaps and deal with them appropriately
+ */
+static void check_inode_uninit(ext2_filsys fs, ext2fs_inode_bitmap map,
+			  dgrp_t group)
+{
+	ext2_ino_t	i, ino;
+
+	if (group >= fs->group_desc_count ||
+	    !ext2fs_has_group_desc_csum(fs) ||
+	    !(ext2fs_bg_flags_test(fs, group, EXT2_BG_INODE_UNINIT)))
+		return;
+
+	ino = (group * fs->super->s_inodes_per_group) + 1;
+	for (i=0; i < fs->super->s_inodes_per_group; i++, ino++)
+		ext2fs_fast_unmark_inode_bitmap2(map, ino);
+
+	ext2fs_bg_flags_clear(fs, group, EXT2_BG_INODE_UNINIT);
+	/* Mimics what the kernel does */
+	ext2fs_bg_flags_clear(fs, group, EXT2_BG_BLOCK_UNINIT);
+	ext2fs_group_desc_csum_set(fs, group);
+	ext2fs_mark_ib_dirty(fs);
+	ext2fs_mark_super_dirty(fs);
+}
+
+/*
+ * Right now, just search forward from the parent directory's block
+ * group to find the next free inode.
+ *
+ * Should have a special policy for directories.
+ */
+errcode_t ext2fs_new_inode(ext2_filsys fs, ext2_ino_t dir,
+			   int mode EXT2FS_ATTR((unused)),
+			   ext2fs_inode_bitmap map, ext2_ino_t *ret)
+{
+	ext2_ino_t	start_inode = 0;
+	ext2_ino_t	i, ino_in_group, upto, first_zero;
+	errcode_t	retval;
+	dgrp_t		group;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	if (!map)
+		map = fs->inode_map;
+	if (!map)
+		return EXT2_ET_NO_INODE_BITMAP;
+
+	if (dir > 0) {
+		group = (dir - 1) / EXT2_INODES_PER_GROUP(fs->super);
+		start_inode = (group * EXT2_INODES_PER_GROUP(fs->super)) + 1;
+	}
+	if (start_inode < EXT2_FIRST_INODE(fs->super))
+		start_inode = EXT2_FIRST_INODE(fs->super);
+	if (start_inode > fs->super->s_inodes_count)
+		return EXT2_ET_INODE_ALLOC_FAIL;
+	i = start_inode;
+	do {
+		ino_in_group = (i - 1) % EXT2_INODES_PER_GROUP(fs->super);
+		group = (i - 1) / EXT2_INODES_PER_GROUP(fs->super);
+
+		check_inode_uninit(fs, map, group);
+		upto = i + (EXT2_INODES_PER_GROUP(fs->super) - ino_in_group);
+		if (i < start_inode && upto >= start_inode)
+			upto = start_inode - 1;
+		if (upto > fs->super->s_inodes_count)
+			upto = fs->super->s_inodes_count;
+
+		retval = ext2fs_find_first_zero_inode_bitmap2(map, i, upto,
+							      &first_zero);
+		if (retval == 0) {
+			i = first_zero;
+			break;
+		}
+		if (retval != ENOENT)
+			return EXT2_ET_INODE_ALLOC_FAIL;
+		i = upto + 1;
+		if (i > fs->super->s_inodes_count)
+			i = EXT2_FIRST_INODE(fs->super);
+	} while (i != start_inode);
+
+	if (ext2fs_test_inode_bitmap2(map, i))
+		return EXT2_ET_INODE_ALLOC_FAIL;
+	*ret = i;
+	return 0;
+}
+
+/*
+ * Stupid algorithm --- we now just search forward starting from the
+ * goal.  Should put in a smarter one someday....
+ */
+errcode_t ext2fs_new_block3(ext2_filsys fs, blk64_t goal,
+			    ext2fs_block_bitmap map, blk64_t *ret,
+			    struct blk_alloc_ctx *ctx)
+{
+	errcode_t retval;
+	blk64_t	b = 0;
+	errcode_t (*gab)(ext2_filsys fs, blk64_t goal, blk64_t *ret);
+	errcode_t (*gab2)(ext2_filsys, blk64_t, blk64_t *,
+			  struct blk_alloc_ctx *);
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	if (!map) {
+		/*
+		 * In case there are clients out there whose get_alloc_block
+		 * handlers call ext2fs_new_block2 with a NULL block map,
+		 * temporarily swap out the function pointer so that we don't
+		 * end up in an infinite loop.
+		 */
+		if (fs->get_alloc_block2) {
+			gab2 = fs->get_alloc_block2;
+			fs->get_alloc_block2 = NULL;
+			retval = gab2(fs, goal, &b, ctx);
+			fs->get_alloc_block2 = gab2;
+			goto allocated;
+		} else if (fs->get_alloc_block) {
+			gab = fs->get_alloc_block;
+			fs->get_alloc_block = NULL;
+			retval = gab(fs, goal, &b);
+			fs->get_alloc_block = gab;
+			goto allocated;
+		}
+	}
+	if (!map)
+		map = fs->block_map;
+	if (!map)
+		return EXT2_ET_NO_BLOCK_BITMAP;
+	if (!goal || (goal >= ext2fs_blocks_count(fs->super)))
+		goal = fs->super->s_first_data_block;
+	goal &= ~EXT2FS_CLUSTER_MASK(fs);
+
+	retval = ext2fs_find_first_zero_block_bitmap2(map,
+			goal, ext2fs_blocks_count(fs->super) - 1, &b);
+	if ((retval == ENOENT) && (goal != fs->super->s_first_data_block))
+		retval = ext2fs_find_first_zero_block_bitmap2(map,
+			fs->super->s_first_data_block, goal - 1, &b);
+allocated:
+	if (retval == ENOENT)
+		return EXT2_ET_BLOCK_ALLOC_FAIL;
+	if (retval)
+		return retval;
+
+	ext2fs_clear_block_uninit(fs, ext2fs_group_of_blk2(fs, b));
+	*ret = b;
+	return 0;
+}
+
+errcode_t ext2fs_new_block2(ext2_filsys fs, blk64_t goal,
+			   ext2fs_block_bitmap map, blk64_t *ret)
+{
+	return ext2fs_new_block3(fs, goal, map, ret, NULL);
+}
+
+errcode_t ext2fs_new_block(ext2_filsys fs, blk_t goal,
+			   ext2fs_block_bitmap map, blk_t *ret)
+{
+	errcode_t retval;
+	blk64_t val;
+	retval = ext2fs_new_block2(fs, goal, map, &val);
+	if (!retval)
+		*ret = (blk_t) val;
+	return retval;
+}
+
+/*
+ * This function zeros out the allocated block, and updates all of the
+ * appropriate filesystem records.
+ */
+errcode_t ext2fs_alloc_block3(ext2_filsys fs, blk64_t goal, char *block_buf,
+			      blk64_t *ret, struct blk_alloc_ctx *ctx)
+{
+	errcode_t	retval;
+	blk64_t		block;
+
+	if (fs->get_alloc_block2) {
+		retval = (fs->get_alloc_block2)(fs, goal, &block, ctx);
+		if (retval)
+			goto fail;
+	} else if (fs->get_alloc_block) {
+		retval = (fs->get_alloc_block)(fs, goal, &block);
+		if (retval)
+			goto fail;
+	} else {
+		if (!fs->block_map) {
+			retval = ext2fs_read_block_bitmap(fs);
+			if (retval)
+				goto fail;
+		}
+
+		retval = ext2fs_new_block3(fs, goal, 0, &block, ctx);
+		if (retval)
+			goto fail;
+	}
+
+	if (block_buf) {
+		memset(block_buf, 0, fs->blocksize);
+		retval = io_channel_write_blk64(fs->io, block, 1, block_buf);
+	} else
+		retval = ext2fs_zero_blocks2(fs, block, 1, NULL, NULL);
+	if (retval)
+		goto fail;
+
+	ext2fs_block_alloc_stats2(fs, block, +1);
+	*ret = block;
+
+fail:
+	return retval;
+}
+
+errcode_t ext2fs_alloc_block2(ext2_filsys fs, blk64_t goal,
+			     char *block_buf, blk64_t *ret)
+{
+	return ext2fs_alloc_block3(fs, goal, block_buf, ret, NULL);
+}
+
+errcode_t ext2fs_alloc_block(ext2_filsys fs, blk_t goal,
+			     char *block_buf, blk_t *ret)
+{
+	errcode_t retval;
+	blk64_t ret64, goal64 = goal;
+	retval = ext2fs_alloc_block3(fs, goal64, block_buf, &ret64, NULL);
+	if (!retval)
+		*ret = (blk_t)ret64;
+        return retval;
+}
+
+errcode_t ext2fs_get_free_blocks2(ext2_filsys fs, blk64_t start, blk64_t finish,
+				 int num, ext2fs_block_bitmap map, blk64_t *ret)
+{
+	blk64_t	b = start;
+	int	c_ratio;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	if (!map)
+		map = fs->block_map;
+	if (!map)
+		return EXT2_ET_NO_BLOCK_BITMAP;
+	if (!b)
+		b = fs->super->s_first_data_block;
+	if (!finish)
+		finish = start;
+	if (!num)
+		num = 1;
+	c_ratio = 1 << ext2fs_get_bitmap_granularity(map);
+	b &= ~(c_ratio - 1);
+	finish &= ~(c_ratio -1);
+	do {
+		if (b + num - 1 >= ext2fs_blocks_count(fs->super)) {
+			if (finish > start)
+				return EXT2_ET_BLOCK_ALLOC_FAIL;
+			b = fs->super->s_first_data_block;
+		}
+		if (ext2fs_fast_test_block_bitmap_range2(map, b, num)) {
+			*ret = b;
+			return 0;
+		}
+		b += c_ratio;
+	} while (b != finish);
+	return EXT2_ET_BLOCK_ALLOC_FAIL;
+}
+
+errcode_t ext2fs_get_free_blocks(ext2_filsys fs, blk_t start, blk_t finish,
+				 int num, ext2fs_block_bitmap map, blk_t *ret)
+{
+	errcode_t retval;
+	blk64_t val;
+	retval = ext2fs_get_free_blocks2(fs, start, finish, num, map, &val);
+	if(!retval)
+		*ret = (blk_t) val;
+	return retval;
+}
+
+void ext2fs_set_alloc_block_callback(ext2_filsys fs,
+				     errcode_t (*func)(ext2_filsys fs,
+						       blk64_t goal,
+						       blk64_t *ret),
+				     errcode_t (**old)(ext2_filsys fs,
+						       blk64_t goal,
+						       blk64_t *ret))
+{
+	if (!fs || fs->magic != EXT2_ET_MAGIC_EXT2FS_FILSYS)
+		return;
+
+	if (old)
+		*old = fs->get_alloc_block;
+
+	fs->get_alloc_block = func;
+}
+
+blk64_t ext2fs_find_inode_goal(ext2_filsys fs, ext2_ino_t ino,
+			       struct ext2_inode *inode, blk64_t lblk)
+{
+	dgrp_t			group;
+	__u8			log_flex;
+	struct ext2fs_extent	extent;
+	ext2_extent_handle_t	handle = NULL;
+	errcode_t		err;
+
+	/* Make sure data stored in inode->i_block is neither fast symlink nor
+	 * inline data.
+	 */
+	if (inode == NULL || ext2fs_is_fast_symlink(inode) ||
+	    inode->i_flags & EXT4_INLINE_DATA_FL)
+		goto no_blocks;
+
+	if (inode->i_flags & EXT4_EXTENTS_FL) {
+		err = ext2fs_extent_open2(fs, ino, inode, &handle);
+		if (err)
+			goto no_blocks;
+		err = ext2fs_extent_goto2(handle, 0, lblk);
+		if (err)
+			goto no_blocks;
+		err = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT, &extent);
+		if (err)
+			goto no_blocks;
+		ext2fs_extent_free(handle);
+		return extent.e_pblk + (lblk - extent.e_lblk);
+	}
+
+	/* block mapped file; see if block zero is mapped? */
+	if (inode->i_block[0])
+		return inode->i_block[0];
+
+no_blocks:
+	ext2fs_extent_free(handle);
+	log_flex = fs->super->s_log_groups_per_flex;
+	group = ext2fs_group_of_ino(fs, ino);
+	if (log_flex)
+		group = group & ~((1 << (log_flex)) - 1);
+	return ext2fs_group_first_block2(fs, group);
+}
+
+/*
+ * Starting at _goal_, scan around the filesystem to find a run of free blocks
+ * that's at least _len_ blocks long.  Possible flags:
+ * - EXT2_NEWRANGE_EXACT_GOAL: The range of blocks must start at _goal_.
+ * - EXT2_NEWRANGE_MIN_LENGTH: do not return a allocation shorter than _len_.
+ * - EXT2_NEWRANGE_ZERO_BLOCKS: Zero blocks pblk to pblk+plen before returning.
+ *
+ * The starting block is returned in _pblk_ and the length is returned via
+ * _plen_.  The blocks are not marked in the bitmap; the caller must mark
+ * however much of the returned run they actually use, hopefully via
+ * ext2fs_block_alloc_stats_range().
+ *
+ * This function can return a range that is longer than what was requested.
+ */
+errcode_t ext2fs_new_range(ext2_filsys fs, int flags, blk64_t goal,
+			   blk64_t len, ext2fs_block_bitmap map, blk64_t *pblk,
+			   blk64_t *plen)
+{
+	errcode_t retval;
+	blk64_t start, end, b;
+	int looped = 0;
+	blk64_t max_blocks = ext2fs_blocks_count(fs->super);
+	errcode_t (*nrf)(ext2_filsys fs, int flags, blk64_t goal,
+			 blk64_t len, blk64_t *pblk, blk64_t *plen);
+
+	dbg_printf("%s: flags=0x%x goal=%llu len=%llu\n", __func__, flags,
+		   goal, len);
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+	if (len == 0 || (flags & ~EXT2_NEWRANGE_ALL_FLAGS))
+		return EXT2_ET_INVALID_ARGUMENT;
+
+	if (!map && fs->new_range) {
+		/*
+		 * In case there are clients out there whose new_range
+		 * handlers call ext2fs_new_range with a NULL block map,
+		 * temporarily swap out the function pointer so that we don't
+		 * end up in an infinite loop.
+		 */
+		nrf = fs->new_range;
+		fs->new_range = NULL;
+		retval = nrf(fs, flags, goal, len, pblk, plen);
+		fs->new_range = nrf;
+		if (retval)
+			return retval;
+		start = *pblk;
+		end = *pblk + *plen;
+		goto allocated;
+	}
+	if (!map)
+		map = fs->block_map;
+	if (!map)
+		return EXT2_ET_NO_BLOCK_BITMAP;
+	if (!goal || goal >= ext2fs_blocks_count(fs->super))
+		goal = fs->super->s_first_data_block;
+
+	start = goal;
+	while (!looped || start <= goal) {
+		retval = ext2fs_find_first_zero_block_bitmap2(map, start,
+							      max_blocks - 1,
+							      &start);
+		if (retval == ENOENT) {
+			/*
+			 * If there are no free blocks beyond the starting
+			 * point, try scanning the whole filesystem, unless the
+			 * user told us only to allocate from _goal_, or if
+			 * we're already scanning the whole filesystem.
+			 */
+			if (flags & EXT2_NEWRANGE_FIXED_GOAL ||
+			    start == fs->super->s_first_data_block)
+				goto fail;
+			start = fs->super->s_first_data_block;
+			continue;
+		} else if (retval)
+			goto errout;
+
+		if (flags & EXT2_NEWRANGE_FIXED_GOAL && start != goal)
+			goto fail;
+
+		b = min(start + len - 1, max_blocks - 1);
+		retval =  ext2fs_find_first_set_block_bitmap2(map, start, b,
+							      &end);
+		if (retval == ENOENT)
+			end = b + 1;
+		else if (retval)
+			goto errout;
+
+		if (!(flags & EXT2_NEWRANGE_MIN_LENGTH) ||
+		    (end - start) >= len) {
+			/* Success! */
+			*pblk = start;
+			*plen = end - start;
+			dbg_printf("%s: new_range goal=%llu--%llu "
+				   "blk=%llu--%llu %llu\n",
+				   __func__, goal, goal + len - 1,
+				   *pblk, *pblk + *plen - 1, *plen);
+allocated:
+			for (b = start; b < end;
+			     b += fs->super->s_blocks_per_group)
+				ext2fs_clear_block_uninit(fs,
+						ext2fs_group_of_blk2(fs, b));
+			return 0;
+		}
+
+		if (flags & EXT2_NEWRANGE_FIXED_GOAL)
+			goto fail;
+		start = end;
+		if (start >= max_blocks) {
+			if (looped)
+				goto fail;
+			looped = 1;
+			start = fs->super->s_first_data_block;
+		}
+	}
+
+fail:
+	retval = EXT2_ET_BLOCK_ALLOC_FAIL;
+errout:
+	return retval;
+}
+
+void ext2fs_set_new_range_callback(ext2_filsys fs,
+	errcode_t (*func)(ext2_filsys fs, int flags, blk64_t goal,
+			       blk64_t len, blk64_t *pblk, blk64_t *plen),
+	errcode_t (**old)(ext2_filsys fs, int flags, blk64_t goal,
+			       blk64_t len, blk64_t *pblk, blk64_t *plen))
+{
+	if (!fs || fs->magic != EXT2_ET_MAGIC_EXT2FS_FILSYS)
+		return;
+
+	if (old)
+		*old = fs->new_range;
+
+	fs->new_range = func;
+}
+
+errcode_t ext2fs_alloc_range(ext2_filsys fs, int flags, blk64_t goal,
+			     blk_t len, blk64_t *ret)
+{
+	int newr_flags = EXT2_NEWRANGE_MIN_LENGTH;
+	errcode_t retval;
+	blk64_t plen;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+	if (len == 0 || (flags & ~EXT2_ALLOCRANGE_ALL_FLAGS))
+		return EXT2_ET_INVALID_ARGUMENT;
+
+	if (flags & EXT2_ALLOCRANGE_FIXED_GOAL)
+		newr_flags |= EXT2_NEWRANGE_FIXED_GOAL;
+
+	retval = ext2fs_new_range(fs, newr_flags, goal, len, NULL, ret, &plen);
+	if (retval)
+		return retval;
+
+	if (plen < len)
+		return EXT2_ET_BLOCK_ALLOC_FAIL;
+
+	if (flags & EXT2_ALLOCRANGE_ZERO_BLOCKS) {
+		retval = ext2fs_zero_blocks2(fs, *ret, len, NULL, NULL);
+		if (retval)
+			return retval;
+	}
+
+	ext2fs_block_alloc_stats_range(fs, *ret, len, +1);
+	return retval;
+}
diff --git a/lib/ext2fs/alloc_sb.c b/lib/ext2fs/alloc_sb.c
new file mode 100644
index 0000000..8530b40
--- /dev/null
+++ b/lib/ext2fs/alloc_sb.c
@@ -0,0 +1,81 @@
+/*
+ * alloc_sb.c --- Allocate the superblock and block group descriptors for a
+ * newly initialized filesystem.  Used by mke2fs when initializing a filesystem
+ *
+ * Copyright (C) 1994, 1995, 1996, 2003 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+/*
+ * This function reserves the superblock and block group descriptors
+ * for a given block group.  It currently returns the number of free
+ * blocks assuming that inode table and allocation bitmaps will be in
+ * the group.  This is not necessarily the case when the flex_bg
+ * feature is enabled, so callers should take care!  It was only
+ * really intended for use by mke2fs, and even there it's not that
+ * useful.  In the future, when we redo this function for 64-bit block
+ * numbers, we should probably return the number of blocks used by the
+ * super block and group descriptors instead.
+ *
+ * See also the comment for ext2fs_super_and_bgd_loc()
+ */
+int ext2fs_reserve_super_and_bgd(ext2_filsys fs,
+				 dgrp_t group,
+				 ext2fs_block_bitmap bmap)
+{
+	blk64_t	super_blk, old_desc_blk, new_desc_blk;
+	blk_t	used_blks;
+	int	old_desc_blocks, num_blocks;
+
+	ext2fs_super_and_bgd_loc2(fs, group, &super_blk,
+				  &old_desc_blk, &new_desc_blk, &used_blks);
+
+	if (ext2fs_has_feature_meta_bg(fs->super))
+		old_desc_blocks = fs->super->s_first_meta_bg;
+	else
+		old_desc_blocks =
+			fs->desc_blocks + fs->super->s_reserved_gdt_blocks;
+
+	if (super_blk || (group == 0))
+		ext2fs_mark_block_bitmap2(bmap, super_blk);
+	if ((group == 0) && (fs->blocksize == 1024) &&
+	    EXT2FS_CLUSTER_RATIO(fs) > 1)
+		ext2fs_mark_block_bitmap2(bmap, 0);
+
+	if (old_desc_blk) {
+		num_blocks = old_desc_blocks;
+		if (old_desc_blk + num_blocks >= ext2fs_blocks_count(fs->super))
+			num_blocks = ext2fs_blocks_count(fs->super) -
+				old_desc_blk;
+		ext2fs_mark_block_bitmap_range2(bmap, old_desc_blk, num_blocks);
+	}
+	if (new_desc_blk)
+		ext2fs_mark_block_bitmap2(bmap, new_desc_blk);
+
+	num_blocks = ext2fs_group_blocks_count(fs, group);
+	num_blocks -= 2 + fs->inode_blocks_per_group + used_blks;
+
+	return num_blocks  ;
+}
diff --git a/lib/ext2fs/alloc_stats.c b/lib/ext2fs/alloc_stats.c
new file mode 100644
index 0000000..6f98bcc
--- /dev/null
+++ b/lib/ext2fs/alloc_stats.c
@@ -0,0 +1,165 @@
+/*
+ * alloc_stats.c --- Update allocation statistics for ext2fs
+ *
+ * Copyright (C) 2001 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+void ext2fs_inode_alloc_stats2(ext2_filsys fs, ext2_ino_t ino,
+			       int inuse, int isdir)
+{
+	int	group = ext2fs_group_of_ino(fs, ino);
+
+	if (ino > fs->super->s_inodes_count) {
+#ifndef OMIT_COM_ERR
+		com_err("ext2fs_inode_alloc_stats2", 0,
+			"Illegal inode number: %lu", (unsigned long) ino);
+#endif
+		return;
+	}
+	if (inuse > 0)
+		ext2fs_mark_inode_bitmap2(fs->inode_map, ino);
+	else
+		ext2fs_unmark_inode_bitmap2(fs->inode_map, ino);
+	ext2fs_bg_free_inodes_count_set(fs, group, ext2fs_bg_free_inodes_count(fs, group) - inuse);
+	if (isdir)
+		ext2fs_bg_used_dirs_count_set(fs, group, ext2fs_bg_used_dirs_count(fs, group) + inuse);
+
+	/* We don't strictly need to be clearing the uninit flag if inuse < 0
+	 * (i.e. freeing inodes) but it also means something is bad. */
+	ext2fs_bg_flags_clear(fs, group, EXT2_BG_INODE_UNINIT);
+	if (ext2fs_has_group_desc_csum(fs)) {
+		ext2_ino_t first_unused_inode =	fs->super->s_inodes_per_group -
+			ext2fs_bg_itable_unused(fs, group) +
+			group * fs->super->s_inodes_per_group + 1;
+
+		if (ino >= first_unused_inode)
+			ext2fs_bg_itable_unused_set(fs, group, group * fs->super->s_inodes_per_group + fs->super->s_inodes_per_group - ino);
+		ext2fs_group_desc_csum_set(fs, group);
+	}
+
+	fs->super->s_free_inodes_count -= inuse;
+	ext2fs_mark_super_dirty(fs);
+	ext2fs_mark_ib_dirty(fs);
+}
+
+void ext2fs_inode_alloc_stats(ext2_filsys fs, ext2_ino_t ino, int inuse)
+{
+	ext2fs_inode_alloc_stats2(fs, ino, inuse, 0);
+}
+
+void ext2fs_block_alloc_stats2(ext2_filsys fs, blk64_t blk, int inuse)
+{
+	int	group = ext2fs_group_of_blk2(fs, blk);
+
+	if (blk < fs->super->s_first_data_block ||
+	    blk >= ext2fs_blocks_count(fs->super)) {
+#ifndef OMIT_COM_ERR
+		com_err("ext2fs_block_alloc_stats", 0,
+			"Illegal block number: %lu", (unsigned long) blk);
+#endif
+		return;
+	}
+	if (inuse > 0)
+		ext2fs_mark_block_bitmap2(fs->block_map, blk);
+	else
+		ext2fs_unmark_block_bitmap2(fs->block_map, blk);
+	ext2fs_bg_free_blocks_count_set(fs, group, ext2fs_bg_free_blocks_count(fs, group) - inuse);
+	ext2fs_bg_flags_clear(fs, group, EXT2_BG_BLOCK_UNINIT);
+	ext2fs_group_desc_csum_set(fs, group);
+
+	ext2fs_free_blocks_count_add(fs->super,
+			     -inuse * (blk64_t) EXT2FS_CLUSTER_RATIO(fs));
+	ext2fs_mark_super_dirty(fs);
+	ext2fs_mark_bb_dirty(fs);
+	if (fs->block_alloc_stats)
+		(fs->block_alloc_stats)(fs, (blk64_t) blk, inuse);
+}
+
+void ext2fs_block_alloc_stats(ext2_filsys fs, blk_t blk, int inuse)
+{
+	ext2fs_block_alloc_stats2(fs, blk, inuse);
+}
+
+void ext2fs_set_block_alloc_stats_callback(ext2_filsys fs,
+					   void (*func)(ext2_filsys fs,
+							blk64_t blk,
+							int inuse),
+					   void (**old)(ext2_filsys fs,
+							blk64_t blk,
+							int inuse))
+{
+	if (!fs || fs->magic != EXT2_ET_MAGIC_EXT2FS_FILSYS)
+		return;
+	if (old)
+		*old = fs->block_alloc_stats;
+
+	fs->block_alloc_stats = func;
+}
+
+void ext2fs_block_alloc_stats_range(ext2_filsys fs, blk64_t blk,
+				    blk_t num, int inuse)
+{
+#ifndef OMIT_COM_ERR
+	if (blk + num > ext2fs_blocks_count(fs->super)) {
+		com_err("ext2fs_block_alloc_stats_range", 0,
+			"Illegal block range: %llu (%u) ",
+			(unsigned long long) blk, num);
+		return;
+	}
+#endif
+	if (inuse == 0)
+		return;
+	if (inuse > 0) {
+		ext2fs_mark_block_bitmap_range2(fs->block_map, blk, num);
+		inuse = 1;
+	} else {
+		ext2fs_unmark_block_bitmap_range2(fs->block_map, blk, num);
+		inuse = -1;
+	}
+	while (num) {
+		int group = ext2fs_group_of_blk2(fs, blk);
+		blk64_t last_blk = ext2fs_group_last_block2(fs, group);
+		blk64_t n = num;
+
+		if (blk + num > last_blk)
+			n = last_blk - blk + 1;
+
+		ext2fs_bg_free_blocks_count_set(fs, group,
+			ext2fs_bg_free_blocks_count(fs, group) -
+			inuse*n/EXT2FS_CLUSTER_RATIO(fs));
+		ext2fs_bg_flags_clear(fs, group, EXT2_BG_BLOCK_UNINIT);
+		ext2fs_group_desc_csum_set(fs, group);
+		ext2fs_free_blocks_count_add(fs->super, -inuse * (blk64_t) n);
+		blk += n;
+		num -= n;
+	}
+	ext2fs_mark_super_dirty(fs);
+	ext2fs_mark_bb_dirty(fs);
+	if (fs->block_alloc_stats_range)
+		(fs->block_alloc_stats_range)(fs, blk, num, inuse);
+}
+
+void ext2fs_set_block_alloc_stats_range_callback(ext2_filsys fs,
+	void (*func)(ext2_filsys fs, blk64_t blk,
+				    blk_t num, int inuse),
+	void (**old)(ext2_filsys fs, blk64_t blk,
+				    blk_t num, int inuse))
+{
+	if (!fs || fs->magic != EXT2_ET_MAGIC_EXT2FS_FILSYS)
+		return;
+	if (old)
+		*old = fs->block_alloc_stats_range;
+
+	fs->block_alloc_stats_range = func;
+}
diff --git a/lib/ext2fs/alloc_tables.c b/lib/ext2fs/alloc_tables.c
new file mode 100644
index 0000000..e8a1fef
--- /dev/null
+++ b/lib/ext2fs/alloc_tables.c
@@ -0,0 +1,278 @@
+/*
+ * alloc_tables.c --- Allocate tables for a newly initialized
+ * filesystem.  Used by mke2fs when initializing a filesystem
+ *
+ * Copyright (C) 1996 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+#include "ext2fsP.h"
+
+/*
+ * This routine searches for free blocks that can allocate a full
+ * group of bitmaps or inode tables for a flexbg group.  Returns the
+ * block number with a correct offset were the bitmaps and inode
+ * tables can be allocated continuously and in order.
+ */
+static blk64_t flexbg_offset(ext2_filsys fs, dgrp_t group, blk64_t start_blk,
+			     ext2fs_block_bitmap bmap, int rem_grp,
+			     int elem_size)
+{
+	int		flexbg, flexbg_size, size;
+	blk64_t		last_blk, first_free = 0;
+	dgrp_t	       	last_grp;
+
+	flexbg_size = 1U << fs->super->s_log_groups_per_flex;
+	flexbg = group / flexbg_size;
+	size = rem_grp * elem_size;
+
+	if (size > (int) (fs->super->s_blocks_per_group / 4))
+		size = (int) fs->super->s_blocks_per_group / 4;
+
+	/*
+	 * Don't do a long search if the previous block search is still valid,
+	 * but skip minor obstructions such as group descriptor backups.
+	 */
+	if (start_blk && start_blk < ext2fs_blocks_count(fs->super) &&
+	    ext2fs_get_free_blocks2(fs, start_blk, start_blk + size, elem_size,
+				    bmap, &first_free) == 0)
+		return first_free;
+
+	start_blk = ext2fs_group_first_block2(fs, flexbg_size * flexbg);
+	last_grp = group | (flexbg_size - 1);
+	if (last_grp > fs->group_desc_count-1)
+		last_grp = fs->group_desc_count-1;
+	last_blk = ext2fs_group_last_block2(fs, last_grp);
+
+	/* Find the first available block */
+	if (ext2fs_get_free_blocks2(fs, start_blk, last_blk, size,
+				    bmap, &first_free) == 0)
+		return first_free;
+
+	if (ext2fs_get_free_blocks2(fs, start_blk, last_blk, elem_size,
+				   bmap, &first_free) == 0)
+		return first_free;
+
+	if (ext2fs_get_free_blocks2(fs, 0, last_blk, elem_size, bmap,
+				    &first_free) == 0)
+		return first_free;
+
+	return first_free;
+}
+
+errcode_t ext2fs_allocate_group_table(ext2_filsys fs, dgrp_t group,
+				      ext2fs_block_bitmap bmap)
+{
+	errcode_t	retval;
+	blk64_t		group_blk, start_blk, last_blk, new_blk;
+	dgrp_t		last_grp = 0;
+	int		rem_grps = 0, flexbg_size = 0, table_offset = 0;
+
+	group_blk = ext2fs_group_first_block2(fs, group);
+	last_blk = ext2fs_group_last_block2(fs, group);
+
+	if (!bmap)
+		bmap = fs->block_map;
+
+	if (ext2fs_has_feature_flex_bg(fs->super) &&
+	    fs->super->s_log_groups_per_flex) {
+		flexbg_size = 1U << fs->super->s_log_groups_per_flex;
+		last_grp = group | (flexbg_size - 1);
+		if (last_grp > fs->group_desc_count-1)
+			last_grp = fs->group_desc_count-1;
+		rem_grps = last_grp - group + 1;
+	}
+
+	/*
+	 * Allocate the block and inode bitmaps, if necessary
+	 */
+	if (fs->stride && !flexbg_size) {
+		retval = ext2fs_get_free_blocks2(fs, group_blk, last_blk,
+						 1, bmap, &start_blk);
+		if (retval)
+			return retval;
+		start_blk += fs->inode_blocks_per_group;
+		start_blk += ((fs->stride * group) %
+			      (last_blk - start_blk + 1));
+		if (start_blk >= last_blk)
+			start_blk = group_blk;
+	} else
+		start_blk = group_blk;
+
+	if (flexbg_size) {
+		blk64_t prev_block = 0;
+
+		table_offset = flexbg_size;
+		if (group % flexbg_size)
+			prev_block = ext2fs_block_bitmap_loc(fs, group - 1) + 1;
+		else if (last_grp == fs->group_desc_count-1) {
+			/*
+			 * If we are allocating for the last flex_bg
+			 * keep the metadata tables contiguous
+			 */
+			table_offset = last_grp & (flexbg_size - 1);
+			if (table_offset == 0)
+				table_offset = flexbg_size;
+			else
+				table_offset++;
+		}
+		/* FIXME: Take backup group descriptor blocks into account
+		 * if the flexbg allocations will grow to overlap them... */
+		start_blk = flexbg_offset(fs, group, prev_block, bmap,
+					  rem_grps, 1);
+		last_blk = ext2fs_group_last_block2(fs, last_grp);
+	}
+
+	if (!ext2fs_block_bitmap_loc(fs, group)) {
+		retval = ext2fs_get_free_blocks2(fs, start_blk, last_blk,
+						 1, bmap, &new_blk);
+		if (retval == EXT2_ET_BLOCK_ALLOC_FAIL)
+			retval = ext2fs_get_free_blocks2(fs, group_blk,
+					last_blk, 1, bmap, &new_blk);
+		if (retval)
+			return retval;
+		ext2fs_mark_block_bitmap2(bmap, new_blk);
+		ext2fs_block_bitmap_loc_set(fs, group, new_blk);
+		if (flexbg_size) {
+			dgrp_t gr = ext2fs_group_of_blk2(fs, new_blk);
+			ext2fs_bg_free_blocks_count_set(fs, gr, ext2fs_bg_free_blocks_count(fs, gr) - 1);
+			ext2fs_free_blocks_count_add(fs->super, -1);
+			ext2fs_bg_flags_clear(fs, gr, EXT2_BG_BLOCK_UNINIT);
+			ext2fs_group_desc_csum_set(fs, gr);
+		}
+	}
+
+	if (flexbg_size) {
+		blk64_t prev_block = 0;
+		if (group % flexbg_size)
+			prev_block = ext2fs_inode_bitmap_loc(fs, group - 1) + 1;
+		else
+			prev_block = ext2fs_block_bitmap_loc(fs, group) +
+				table_offset;
+		/* FIXME: Take backup group descriptor blocks into account
+		 * if the flexbg allocations will grow to overlap them... */
+		start_blk = flexbg_offset(fs, group, prev_block, bmap,
+					  rem_grps, 1);
+		last_blk = ext2fs_group_last_block2(fs, last_grp);
+	}
+
+	if (!ext2fs_inode_bitmap_loc(fs, group)) {
+		retval = ext2fs_get_free_blocks2(fs, start_blk, last_blk,
+						 1, bmap, &new_blk);
+		if (retval == EXT2_ET_BLOCK_ALLOC_FAIL)
+			retval = ext2fs_get_free_blocks2(fs, group_blk,
+					 last_blk, 1, bmap, &new_blk);
+		if (retval)
+			return retval;
+		ext2fs_mark_block_bitmap2(bmap, new_blk);
+		ext2fs_inode_bitmap_loc_set(fs, group, new_blk);
+		if (flexbg_size) {
+			dgrp_t gr = ext2fs_group_of_blk2(fs, new_blk);
+			ext2fs_bg_free_blocks_count_set(fs, gr, ext2fs_bg_free_blocks_count(fs, gr) - 1);
+			ext2fs_free_blocks_count_add(fs->super, -1);
+			ext2fs_bg_flags_clear(fs, gr, EXT2_BG_BLOCK_UNINIT);
+			ext2fs_group_desc_csum_set(fs, gr);
+		}
+	}
+
+	/*
+	 * Allocate the inode table
+	 */
+	if (flexbg_size) {
+		blk64_t prev_block = 0;
+
+		if (group % flexbg_size)
+			prev_block = ext2fs_inode_table_loc(fs, group - 1) +
+				fs->inode_blocks_per_group;
+		else
+			prev_block = ext2fs_inode_bitmap_loc(fs, group) +
+				table_offset;
+
+		/* FIXME: Take backup group descriptor blocks into account
+		 * if the flexbg allocations will grow to overlap them... */
+		group_blk = flexbg_offset(fs, group, prev_block, bmap,
+					  rem_grps, fs->inode_blocks_per_group);
+		last_blk = ext2fs_group_last_block2(fs, last_grp);
+	}
+
+	if (!ext2fs_inode_table_loc(fs, group)) {
+		retval = ext2fs_get_free_blocks2(fs, group_blk, last_blk,
+						fs->inode_blocks_per_group,
+						bmap, &new_blk);
+		if (retval)
+			return retval;
+
+		ext2fs_mark_block_bitmap_range2(bmap,
+			new_blk, fs->inode_blocks_per_group);
+		if (flexbg_size) {
+			blk64_t num, blk;
+			num = fs->inode_blocks_per_group;
+			blk = new_blk;
+			while (num) {
+				int gr = ext2fs_group_of_blk2(fs, blk);
+				last_blk = ext2fs_group_last_block2(fs, gr);
+				blk64_t n = num;
+
+				if (blk + num > last_blk)
+					n = last_blk - blk + 1;
+
+				ext2fs_bg_free_blocks_count_set(fs, gr,
+					ext2fs_bg_free_blocks_count(fs, gr) -
+					n/EXT2FS_CLUSTER_RATIO(fs));
+				ext2fs_bg_flags_clear(fs, gr,
+					EXT2_BG_BLOCK_UNINIT);
+				ext2fs_group_desc_csum_set(fs, gr);
+				ext2fs_free_blocks_count_add(fs->super, -n);
+				blk += n;
+				num -= n;
+			}
+		}
+		ext2fs_inode_table_loc_set(fs, group, new_blk);
+	}
+	ext2fs_group_desc_csum_set(fs, group);
+	return 0;
+}
+
+errcode_t ext2fs_allocate_tables(ext2_filsys fs)
+{
+	errcode_t	retval;
+	dgrp_t		i;
+	struct ext2fs_numeric_progress_struct progress;
+
+	if (fs->progress_ops && fs->progress_ops->init)
+		(fs->progress_ops->init)(fs, &progress, NULL,
+					 fs->group_desc_count);
+
+	for (i = 0; i < fs->group_desc_count; i++) {
+		if (fs->progress_ops && fs->progress_ops->update)
+			(fs->progress_ops->update)(fs, &progress, i);
+		retval = ext2fs_allocate_group_table(fs, i, fs->block_map);
+		if (retval)
+			return retval;
+	}
+	if (fs->progress_ops && fs->progress_ops->close)
+		(fs->progress_ops->close)(fs, &progress, NULL);
+	return 0;
+}
+
diff --git a/lib/ext2fs/atexit.c b/lib/ext2fs/atexit.c
new file mode 100644
index 0000000..b3be1d5
--- /dev/null
+++ b/lib/ext2fs/atexit.c
@@ -0,0 +1,116 @@
+/*
+ * atexit.c --- Clean things up when we exit normally.
+ *
+ * Copyright Oracle, 2014
+ * Author Darrick J. Wong <darrick.wong@oracle.com>
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#ifndef _LARGEFILE_SOURCE
+#define _LARGEFILE_SOURCE
+#endif
+#ifndef _LARGEFILE64_SOURCE
+#define _LARGEFILE64_SOURCE
+#endif
+
+#include "config.h"
+#include <stdlib.h>
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+#include "ext2fsP.h"
+
+struct exit_data {
+	ext2_exit_fn func;
+	void *data;
+};
+
+static struct exit_data *items;
+static size_t nr_items;
+
+static void handle_exit(void)
+{
+	struct exit_data *ed;
+
+	for (ed = items + nr_items - 1; ed >= items; ed--) {
+		if (ed->func == NULL)
+			continue;
+		ed->func(ed->data);
+	}
+
+	ext2fs_free_mem(&items);
+	nr_items = 0;
+}
+
+/*
+ * Schedule a function to be called at (normal) program termination.
+ * If you want this to be called during a signal exit, you must capture
+ * the signal and call exit() yourself!
+ */
+errcode_t ext2fs_add_exit_fn(ext2_exit_fn func, void *data)
+{
+	struct exit_data *ed, *free_ed = NULL;
+	size_t x;
+	errcode_t ret;
+
+	if (func == NULL)
+		return EXT2_ET_INVALID_ARGUMENT;
+
+	for (x = 0, ed = items; x < nr_items; x++, ed++) {
+		if (ed->func == func && ed->data == data)
+			return EXT2_ET_FILE_EXISTS;
+		if (ed->func == NULL)
+			free_ed = ed;
+	}
+
+	if (free_ed) {
+		free_ed->func = func;
+		free_ed->data = data;
+		return 0;
+	}
+
+	if (nr_items == 0) {
+		ret = atexit(handle_exit);
+		if (ret)
+			return ret;
+	}
+
+	ret = ext2fs_resize_mem(0, (nr_items + 1) * sizeof(struct exit_data),
+				&items);
+	if (ret)
+		return ret;
+
+	items[nr_items].func = func;
+	items[nr_items].data = data;
+	nr_items++;
+
+	return 0;
+}
+
+/* Remove a function from the exit cleanup list. */
+errcode_t ext2fs_remove_exit_fn(ext2_exit_fn func, void *data)
+{
+	struct exit_data *ed;
+	size_t x;
+
+	if (func == NULL)
+		return EXT2_ET_INVALID_ARGUMENT;
+
+	for (x = 0, ed = items; x < nr_items; x++, ed++) {
+		if (ed->func == NULL)
+			return 0;
+		if (ed->func == func && ed->data == data) {
+			size_t sz = (nr_items - (x + 1)) *
+				    sizeof(struct exit_data);
+			memmove(ed, ed + 1, sz);
+			memset(items + nr_items - 1, 0,
+			       sizeof(struct exit_data));
+		}
+	}
+
+	return 0;
+}
diff --git a/lib/ext2fs/badblocks.c b/lib/ext2fs/badblocks.c
new file mode 100644
index 0000000..a306bc0
--- /dev/null
+++ b/lib/ext2fs/badblocks.c
@@ -0,0 +1,328 @@
+/*
+ * badblocks.c --- routines to manipulate the bad block structure
+ *
+ * Copyright (C) 1994, 1995, 1996 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fsP.h"
+
+/*
+ * Helper function for making a badblocks list
+ */
+static errcode_t make_u32_list(int size, int num, __u32 *list,
+			       ext2_u32_list *ret)
+{
+	ext2_u32_list	bb;
+	errcode_t	retval;
+
+	retval = ext2fs_get_mem(sizeof(struct ext2_struct_u32_list), &bb);
+	if (retval)
+		return retval;
+	memset(bb, 0, sizeof(struct ext2_struct_u32_list));
+	bb->magic = EXT2_ET_MAGIC_BADBLOCKS_LIST;
+	bb->size = size ? size : 10;
+	bb->num = num;
+	retval = ext2fs_get_array(bb->size, sizeof(blk_t), &bb->list);
+	if (retval) {
+		ext2fs_free_mem(&bb);
+		return retval;
+	}
+	if (list)
+		memcpy(bb->list, list, bb->size * sizeof(blk_t));
+	else
+		memset(bb->list, 0, bb->size * sizeof(blk_t));
+	*ret = bb;
+	return 0;
+}
+
+
+/*
+ * This procedure creates an empty u32 list.
+ */
+errcode_t ext2fs_u32_list_create(ext2_u32_list *ret, int size)
+{
+	return make_u32_list(size, 0, 0, ret);
+}
+
+/*
+ * This procedure creates an empty badblocks list.
+ */
+errcode_t ext2fs_badblocks_list_create(ext2_badblocks_list *ret, int size)
+{
+	return make_u32_list(size, 0, 0, (ext2_badblocks_list *) ret);
+}
+
+
+/*
+ * This procedure copies a badblocks list
+ */
+errcode_t ext2fs_u32_copy(ext2_u32_list src, ext2_u32_list *dest)
+{
+	errcode_t	retval;
+
+	retval = make_u32_list(src->size, src->num, src->list, dest);
+	if (retval)
+		return retval;
+	(*dest)->badblocks_flags = src->badblocks_flags;
+	return 0;
+}
+
+errcode_t ext2fs_badblocks_copy(ext2_badblocks_list src,
+				ext2_badblocks_list *dest)
+{
+	return ext2fs_u32_copy((ext2_u32_list) src,
+			       (ext2_u32_list *) dest);
+}
+
+/*
+ * This procedure frees a badblocks list.
+ *
+ * (note: moved to closefs.c)
+ */
+
+
+/*
+ * This procedure adds an item to a tracking list (e.g. badblocks or casefold).
+ */
+errcode_t ext2fs_u32_list_add(ext2_u32_list bb, __u32 blk)
+{
+	errcode_t	retval;
+	int		i, j;
+	unsigned long	old_size;
+
+	EXT2_CHECK_MAGIC(bb, EXT2_ET_MAGIC_BADBLOCKS_LIST);
+
+	if (bb->num >= bb->size) {
+		old_size = bb->size * sizeof(__u32);
+		bb->size += 100;
+		retval = ext2fs_resize_mem(old_size, bb->size * sizeof(__u32),
+					   &bb->list);
+		if (retval) {
+			bb->size -= 100;
+			return retval;
+		}
+	}
+
+	/*
+	 * Add special case code for appending to the end of the list
+	 */
+	i = bb->num-1;
+	if ((bb->num != 0) && (bb->list[i] == blk))
+		return 0;
+	if ((bb->num == 0) || (bb->list[i] < blk)) {
+		bb->list[bb->num++] = blk;
+		return 0;
+	}
+
+	j = bb->num;
+	for (i=0; i < bb->num; i++) {
+		if (bb->list[i] == blk)
+			return 0;
+		if (bb->list[i] > blk) {
+			j = i;
+			break;
+		}
+	}
+	for (i=bb->num; i > j; i--)
+		bb->list[i] = bb->list[i-1];
+	bb->list[j] = blk;
+	bb->num++;
+	return 0;
+}
+
+errcode_t ext2fs_badblocks_list_add(ext2_badblocks_list bb, blk_t blk)
+{
+	return ext2fs_u32_list_add((ext2_u32_list) bb, (__u32) blk);
+}
+
+/*
+ * This procedure finds a particular block is on a badblocks
+ * list.
+ */
+int ext2fs_u32_list_find(ext2_u32_list bb, __u32 blk)
+{
+	int	low, high, mid;
+
+	if (bb->magic != EXT2_ET_MAGIC_BADBLOCKS_LIST)
+		return -1;
+
+	if (bb->num == 0)
+		return -1;
+
+	low = 0;
+	high = bb->num-1;
+	if (blk == bb->list[low])
+		return low;
+	if (blk == bb->list[high])
+		return high;
+
+	while (low < high) {
+		mid = ((unsigned)low + (unsigned)high)/2;
+		if (mid == low || mid == high)
+			break;
+		if (blk == bb->list[mid])
+			return mid;
+		if (blk < bb->list[mid])
+			high = mid;
+		else
+			low = mid;
+	}
+	return -1;
+}
+
+/*
+ * This procedure tests to see if a particular block is on a badblocks
+ * list.
+ */
+int ext2fs_u32_list_test(ext2_u32_list bb, __u32 blk)
+{
+	if (ext2fs_u32_list_find(bb, blk) < 0)
+		return 0;
+	else
+		return 1;
+}
+
+int ext2fs_badblocks_list_test(ext2_badblocks_list bb, blk_t blk)
+{
+	return ext2fs_u32_list_test((ext2_u32_list) bb, (__u32) blk);
+}
+
+
+/*
+ * Remove a block from the badblock list
+ */
+int ext2fs_u32_list_del(ext2_u32_list bb, __u32 blk)
+{
+	int	remloc, i;
+
+	if (bb->num == 0)
+		return -1;
+
+	remloc = ext2fs_u32_list_find(bb, blk);
+	if (remloc < 0)
+		return -1;
+
+	for (i = remloc ; i < bb->num-1; i++)
+		bb->list[i] = bb->list[i+1];
+	bb->num--;
+	return 0;
+}
+
+void ext2fs_badblocks_list_del(ext2_u32_list bb, __u32 blk)
+{
+	ext2fs_u32_list_del(bb, blk);
+}
+
+errcode_t ext2fs_u32_list_iterate_begin(ext2_u32_list bb,
+					ext2_u32_iterate *ret)
+{
+	ext2_u32_iterate iter;
+	errcode_t		retval;
+
+	EXT2_CHECK_MAGIC(bb, EXT2_ET_MAGIC_BADBLOCKS_LIST);
+
+	retval = ext2fs_get_mem(sizeof(struct ext2_struct_u32_iterate), &iter);
+	if (retval)
+		return retval;
+
+	iter->magic = EXT2_ET_MAGIC_BADBLOCKS_ITERATE;
+	iter->bb = bb;
+	iter->ptr = 0;
+	*ret = iter;
+	return 0;
+}
+
+errcode_t ext2fs_badblocks_list_iterate_begin(ext2_badblocks_list bb,
+					      ext2_badblocks_iterate *ret)
+{
+	return ext2fs_u32_list_iterate_begin((ext2_u32_list) bb,
+					      (ext2_u32_iterate *) ret);
+}
+
+
+int ext2fs_u32_list_iterate(ext2_u32_iterate iter, __u32 *blk)
+{
+	ext2_u32_list	bb;
+
+	if (iter->magic != EXT2_ET_MAGIC_BADBLOCKS_ITERATE)
+		return 0;
+
+	bb = iter->bb;
+
+	if (bb->magic != EXT2_ET_MAGIC_BADBLOCKS_LIST)
+		return 0;
+
+	if (iter->ptr < bb->num) {
+		*blk = bb->list[iter->ptr++];
+		return 1;
+	}
+	*blk = 0;
+	return 0;
+}
+
+int ext2fs_badblocks_list_iterate(ext2_badblocks_iterate iter, blk_t *blk)
+{
+	return ext2fs_u32_list_iterate((ext2_u32_iterate) iter,
+				       (__u32 *) blk);
+}
+
+
+void ext2fs_u32_list_iterate_end(ext2_u32_iterate iter)
+{
+	if (!iter || (iter->magic != EXT2_ET_MAGIC_BADBLOCKS_ITERATE))
+		return;
+
+	iter->bb = 0;
+	ext2fs_free_mem(&iter);
+}
+
+void ext2fs_badblocks_list_iterate_end(ext2_badblocks_iterate iter)
+{
+	ext2fs_u32_list_iterate_end((ext2_u32_iterate) iter);
+}
+
+
+int ext2fs_u32_list_equal(ext2_u32_list bb1, ext2_u32_list bb2)
+{
+	EXT2_CHECK_MAGIC(bb1, EXT2_ET_MAGIC_BADBLOCKS_LIST);
+	EXT2_CHECK_MAGIC(bb2, EXT2_ET_MAGIC_BADBLOCKS_LIST);
+
+	if (bb1->num != bb2->num)
+		return 0;
+
+	if (memcmp(bb1->list, bb2->list, bb1->num * sizeof(blk_t)) != 0)
+		return 0;
+	return 1;
+}
+
+int ext2fs_badblocks_equal(ext2_badblocks_list bb1, ext2_badblocks_list bb2)
+{
+	return ext2fs_u32_list_equal((ext2_u32_list) bb1,
+				     (ext2_u32_list) bb2);
+}
+
+int ext2fs_u32_list_count(ext2_u32_list bb)
+{
+	return bb->num;
+}
diff --git a/lib/ext2fs/bb_compat.c b/lib/ext2fs/bb_compat.c
new file mode 100644
index 0000000..373792a
--- /dev/null
+++ b/lib/ext2fs/bb_compat.c
@@ -0,0 +1,64 @@
+/*
+ * bb_compat.c --- compatibility badblocks routines
+ *
+ * Copyright (C) 1997 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fsP.h"
+
+errcode_t badblocks_list_create(badblocks_list *ret, int size)
+{
+	return ext2fs_badblocks_list_create(ret, size);
+}
+
+void badblocks_list_free(badblocks_list bb)
+{
+	ext2fs_badblocks_list_free(bb);
+}
+
+errcode_t badblocks_list_add(badblocks_list bb, blk_t blk)
+{
+	return ext2fs_badblocks_list_add(bb, blk);
+}
+
+int badblocks_list_test(badblocks_list bb, blk_t blk)
+{
+	return ext2fs_badblocks_list_test(bb, blk);
+}
+
+errcode_t badblocks_list_iterate_begin(badblocks_list bb,
+				       badblocks_iterate *ret)
+{
+	return ext2fs_badblocks_list_iterate_begin(bb, ret);
+}
+
+int badblocks_list_iterate(badblocks_iterate iter, blk_t *blk)
+{
+	return ext2fs_badblocks_list_iterate(iter, blk);
+}
+
+void badblocks_list_iterate_end(badblocks_iterate iter)
+{
+	ext2fs_badblocks_list_iterate_end(iter);
+}
diff --git a/lib/ext2fs/bb_inode.c b/lib/ext2fs/bb_inode.c
new file mode 100644
index 0000000..11f10eb
--- /dev/null
+++ b/lib/ext2fs/bb_inode.c
@@ -0,0 +1,270 @@
+/*
+ * bb_inode.c --- routines to update the bad block inode.
+ *
+ * WARNING: This routine modifies a lot of state in the filesystem; if
+ * this routine returns an error, the bad block inode may be in an
+ * inconsistent state.
+ *
+ * Copyright (C) 1994, 1995 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+struct set_badblock_record {
+	ext2_badblocks_iterate	bb_iter;
+	int		bad_block_count;
+	blk_t		*ind_blocks;
+	int		max_ind_blocks;
+	int		ind_blocks_size;
+	int		ind_blocks_ptr;
+	char		*block_buf;
+	errcode_t	err;
+};
+
+static int set_bad_block_proc(ext2_filsys fs, blk_t *block_nr,
+			      e2_blkcnt_t blockcnt,
+			      blk_t ref_block, int ref_offset,
+			      void *priv_data);
+static int clear_bad_block_proc(ext2_filsys fs, blk_t *block_nr,
+				e2_blkcnt_t blockcnt,
+				blk_t ref_block, int ref_offset,
+				void *priv_data);
+
+/*
+ * Given a bad blocks bitmap, update the bad blocks inode to reflect
+ * the map.
+ */
+errcode_t ext2fs_update_bb_inode(ext2_filsys fs, ext2_badblocks_list bb_list)
+{
+	errcode_t			retval;
+	struct set_badblock_record 	rec;
+	struct ext2_inode		inode;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	if (!fs->block_map)
+		return EXT2_ET_NO_BLOCK_BITMAP;
+
+	memset(&rec, 0, sizeof(rec));
+	rec.max_ind_blocks = 10;
+	retval = ext2fs_get_array(rec.max_ind_blocks, sizeof(blk_t),
+				&rec.ind_blocks);
+	if (retval)
+		return retval;
+	memset(rec.ind_blocks, 0, rec.max_ind_blocks * sizeof(blk_t));
+	retval = ext2fs_get_mem(fs->blocksize, &rec.block_buf);
+	if (retval)
+		goto cleanup;
+	memset(rec.block_buf, 0, fs->blocksize);
+	rec.err = 0;
+
+	/*
+	 * First clear the old bad blocks (while saving the indirect blocks)
+	 */
+	retval = ext2fs_block_iterate2(fs, EXT2_BAD_INO,
+				       BLOCK_FLAG_DEPTH_TRAVERSE, 0,
+				       clear_bad_block_proc, &rec);
+	if (retval)
+		goto cleanup;
+	if (rec.err) {
+		retval = rec.err;
+		goto cleanup;
+	}
+
+	/*
+	 * Now set the bad blocks!
+	 *
+	 * First, mark the bad blocks as used.  This prevents a bad
+	 * block from being used as an indirect block for the bad
+	 * block inode (!).
+	 */
+	if (bb_list) {
+		retval = ext2fs_badblocks_list_iterate_begin(bb_list,
+							     &rec.bb_iter);
+		if (retval)
+			goto cleanup;
+		retval = ext2fs_block_iterate2(fs, EXT2_BAD_INO,
+					       BLOCK_FLAG_APPEND, 0,
+					       set_bad_block_proc, &rec);
+		ext2fs_badblocks_list_iterate_end(rec.bb_iter);
+		if (retval)
+			goto cleanup;
+		if (rec.err) {
+			retval = rec.err;
+			goto cleanup;
+		}
+	}
+
+	/*
+	 * Update the bad block inode's mod time and block count
+	 * field.
+	 */
+	retval = ext2fs_read_inode(fs, EXT2_BAD_INO, &inode);
+	if (retval)
+		goto cleanup;
+
+	inode.i_atime = inode.i_mtime = fs->now ? fs->now : time(0);
+	if (!inode.i_ctime)
+		inode.i_ctime = fs->now ? fs->now : time(0);
+	ext2fs_iblk_set(fs, &inode, rec.bad_block_count);
+	retval = ext2fs_inode_size_set(fs, &inode,
+				       rec.bad_block_count * fs->blocksize);
+	if (retval)
+		goto cleanup;
+
+	retval = ext2fs_write_inode(fs, EXT2_BAD_INO, &inode);
+	if (retval)
+		goto cleanup;
+
+cleanup:
+	ext2fs_free_mem(&rec.ind_blocks);
+	ext2fs_free_mem(&rec.block_buf);
+	return retval;
+}
+
+/*
+ * Helper function for update_bb_inode()
+ *
+ * Clear the bad blocks in the bad block inode, while saving the
+ * indirect blocks.
+ */
+#ifdef __TURBOC__
+ #pragma argsused
+#endif
+static int clear_bad_block_proc(ext2_filsys fs, blk_t *block_nr,
+				e2_blkcnt_t blockcnt,
+				blk_t ref_block EXT2FS_ATTR((unused)),
+				int ref_offset EXT2FS_ATTR((unused)),
+				void *priv_data)
+{
+	struct set_badblock_record *rec = (struct set_badblock_record *)
+		priv_data;
+	errcode_t	retval;
+	unsigned long 	old_size;
+
+	if (!*block_nr)
+		return 0;
+
+	/*
+	 * If the block number is outrageous, clear it and ignore it.
+	 */
+	if (*block_nr >= ext2fs_blocks_count(fs->super) ||
+	    *block_nr < fs->super->s_first_data_block) {
+		*block_nr = 0;
+		return BLOCK_CHANGED;
+	}
+
+	if (blockcnt < 0) {
+		if (rec->ind_blocks_size >= rec->max_ind_blocks) {
+			old_size = rec->max_ind_blocks * sizeof(blk_t);
+			rec->max_ind_blocks += 10;
+			retval = ext2fs_resize_mem(old_size,
+				   rec->max_ind_blocks * sizeof(blk_t),
+				   &rec->ind_blocks);
+			if (retval) {
+				rec->max_ind_blocks -= 10;
+				rec->err = retval;
+				return BLOCK_ABORT;
+			}
+		}
+		rec->ind_blocks[rec->ind_blocks_size++] = *block_nr;
+	}
+
+	/*
+	 * Mark the block as unused, and update accounting information
+	 */
+	ext2fs_block_alloc_stats2(fs, *block_nr, -1);
+
+	*block_nr = 0;
+	return BLOCK_CHANGED;
+}
+
+
+/*
+ * Helper function for update_bb_inode()
+ *
+ * Set the block list in the bad block inode, using the supplied bitmap.
+ */
+#ifdef __TURBOC__
+ #pragma argsused
+#endif
+static int set_bad_block_proc(ext2_filsys fs, blk_t *block_nr,
+			      e2_blkcnt_t blockcnt,
+			      blk_t ref_block EXT2FS_ATTR((unused)),
+			      int ref_offset EXT2FS_ATTR((unused)),
+			      void *priv_data)
+{
+	struct set_badblock_record *rec = (struct set_badblock_record *)
+		priv_data;
+	errcode_t	retval;
+	blk_t		blk;
+
+	if (blockcnt >= 0) {
+		/*
+		 * Get the next bad block.
+		 */
+		if (!ext2fs_badblocks_list_iterate(rec->bb_iter, &blk))
+			return BLOCK_ABORT;
+		rec->bad_block_count++;
+	} else {
+		/*
+		 * An indirect block; fetch a block from the
+		 * previously used indirect block list.  The block
+		 * most be not marked as used; if so, get another one.
+		 * If we run out of reserved indirect blocks, allocate
+		 * a new one.
+		 */
+	retry:
+		if (rec->ind_blocks_ptr < rec->ind_blocks_size) {
+			blk = rec->ind_blocks[rec->ind_blocks_ptr++];
+			if (ext2fs_test_block_bitmap2(fs->block_map, blk))
+				goto retry;
+		} else {
+			retval = ext2fs_new_block(fs, 0, 0, &blk);
+			if (retval) {
+				rec->err = retval;
+				return BLOCK_ABORT;
+			}
+		}
+		retval = io_channel_write_blk64(fs->io, blk, 1, rec->block_buf);
+		if (retval) {
+			rec->err = retval;
+			return BLOCK_ABORT;
+		}
+	}
+
+	/*
+	 * Update block counts
+	 */
+	ext2fs_block_alloc_stats2(fs, blk, +1);
+
+	*block_nr = blk;
+	return BLOCK_CHANGED;
+}
+
+
+
+
+
+
diff --git a/lib/ext2fs/bitmaps.c b/lib/ext2fs/bitmaps.c
new file mode 100644
index 0000000..8bfa24b
--- /dev/null
+++ b/lib/ext2fs/bitmaps.c
@@ -0,0 +1,320 @@
+/*
+ * bitmaps.c --- routines to read, write, and manipulate the inode and
+ * block bitmaps.
+ *
+ * Copyright (C) 1993, 1994, 1995, 1996 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+#include "ext2fsP.h"
+#include "bmap64.h"
+
+void ext2fs_free_inode_bitmap(ext2fs_inode_bitmap bitmap)
+{
+	ext2fs_free_generic_bmap(bitmap);
+}
+
+void ext2fs_free_block_bitmap(ext2fs_block_bitmap bitmap)
+{
+	ext2fs_free_generic_bmap(bitmap);
+}
+
+errcode_t ext2fs_copy_bitmap(ext2fs_generic_bitmap src,
+			     ext2fs_generic_bitmap *dest)
+{
+	return (ext2fs_copy_generic_bmap(src, dest));
+}
+void ext2fs_set_bitmap_padding(ext2fs_generic_bitmap map)
+{
+	ext2fs_set_generic_bmap_padding(map);
+}
+
+errcode_t ext2fs_allocate_inode_bitmap(ext2_filsys fs,
+				       const char *descr,
+				       ext2fs_inode_bitmap *ret)
+{
+	__u64		start, end, real_end;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	if (ext2fs_has_feature_journal_dev(fs->super))
+		return EXT2_ET_EXTERNAL_JOURNAL_NOSUPP;
+
+	fs->write_bitmaps = ext2fs_write_bitmaps;
+
+	start = 1;
+	end = fs->super->s_inodes_count;
+	real_end = (__u64)EXT2_INODES_PER_GROUP(fs->super) *
+		fs->group_desc_count;
+
+	/* Are we permitted to use new-style bitmaps? */
+	if (fs->flags & EXT2_FLAG_64BITS)
+		return (ext2fs_alloc_generic_bmap(fs,
+				EXT2_ET_MAGIC_INODE_BITMAP64,
+				fs->default_bitmap_type,
+				start, end, real_end, descr, ret));
+
+	/* Otherwise, check to see if the file system is small enough
+	 * to use old-style 32-bit bitmaps */
+	if ((end > ~0U) || (real_end > ~0U))
+		return EXT2_ET_CANT_USE_LEGACY_BITMAPS;
+
+	return (ext2fs_make_generic_bitmap(EXT2_ET_MAGIC_INODE_BITMAP, fs,
+					 start, end, real_end,
+					 descr, 0,
+					 (ext2fs_generic_bitmap *) ret));
+}
+
+errcode_t ext2fs_allocate_block_bitmap(ext2_filsys fs,
+				       const char *descr,
+				       ext2fs_block_bitmap *ret)
+{
+	__u64		start, end, real_end;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	if (ext2fs_has_feature_journal_dev(fs->super))
+		return EXT2_ET_EXTERNAL_JOURNAL_NOSUPP;
+
+	fs->write_bitmaps = ext2fs_write_bitmaps;
+
+	start = EXT2FS_B2C(fs, fs->super->s_first_data_block);
+	end = EXT2FS_B2C(fs, ext2fs_blocks_count(fs->super)-1);
+	real_end = ((__u64) EXT2_CLUSTERS_PER_GROUP(fs->super)
+		    * (__u64) fs->group_desc_count)-1 + start;
+
+	if (fs->flags & EXT2_FLAG_64BITS)
+		return (ext2fs_alloc_generic_bmap(fs,
+				EXT2_ET_MAGIC_BLOCK_BITMAP64,
+				fs->default_bitmap_type,
+				start, end, real_end, descr, ret));
+
+	if ((end > ~0U) || (real_end > ~0U))
+		return EXT2_ET_CANT_USE_LEGACY_BITMAPS;
+
+	return (ext2fs_make_generic_bitmap(EXT2_ET_MAGIC_BLOCK_BITMAP, fs,
+					   start, end, real_end,
+					   descr, 0,
+					   (ext2fs_generic_bitmap *) ret));
+}
+
+/*
+ * ext2fs_allocate_block_bitmap() really allocates a per-cluster
+ * bitmap for backwards compatibility.  This function allocates a
+ * block bitmap which is truly per-block, even if clusters/bigalloc
+ * are enabled.  mke2fs and e2fsck need this for tracking the
+ * allocation of the file system metadata blocks.
+ */
+errcode_t ext2fs_allocate_subcluster_bitmap(ext2_filsys fs,
+					    const char *descr,
+					    ext2fs_block_bitmap *ret)
+{
+	__u64			start, end, real_end;
+	ext2fs_generic_bitmap	bmap;
+	ext2fs_generic_bitmap_64 bmap64;
+	errcode_t		retval;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	if (ext2fs_has_feature_journal_dev(fs->super))
+		return EXT2_ET_EXTERNAL_JOURNAL_NOSUPP;
+
+	fs->write_bitmaps = ext2fs_write_bitmaps;
+
+	if (!fs->cluster_ratio_bits)
+		return ext2fs_allocate_block_bitmap(fs, descr, ret);
+
+	if ((fs->flags & EXT2_FLAG_64BITS) == 0)
+		return EXT2_ET_CANT_USE_LEGACY_BITMAPS;
+
+	start = fs->super->s_first_data_block;
+	end = ext2fs_blocks_count(fs->super)-1;
+	real_end = ((__u64) EXT2_BLOCKS_PER_GROUP(fs->super)
+		    * (__u64) fs->group_desc_count)-1 + start;
+
+	retval = ext2fs_alloc_generic_bmap(fs, EXT2_ET_MAGIC_BLOCK_BITMAP64,
+					   fs->default_bitmap_type, start,
+					   end, real_end, descr, &bmap);
+	if (retval)
+		return retval;
+	bmap64 = (ext2fs_generic_bitmap_64) bmap;
+	bmap64->cluster_bits = 0;
+	*ret = bmap;
+	return 0;
+}
+
+int ext2fs_get_bitmap_granularity(ext2fs_block_bitmap bitmap)
+{
+	ext2fs_generic_bitmap_64 bmap = (ext2fs_generic_bitmap_64) bitmap;
+
+	if (!EXT2FS_IS_64_BITMAP(bmap))
+		return 0;
+
+	return bmap->cluster_bits;
+}
+
+errcode_t ext2fs_fudge_inode_bitmap_end(ext2fs_inode_bitmap bitmap,
+					ext2_ino_t end, ext2_ino_t *oend)
+{
+	__u64 tmp_oend;
+	int retval;
+
+	retval = ext2fs_fudge_generic_bmap_end((ext2fs_generic_bitmap) bitmap,
+					       EXT2_ET_FUDGE_INODE_BITMAP_END,
+					       end, &tmp_oend);
+	if (oend)
+		*oend = tmp_oend;
+	return retval;
+}
+
+errcode_t ext2fs_fudge_block_bitmap_end(ext2fs_block_bitmap bitmap,
+					blk_t end, blk_t *oend)
+{
+	return (ext2fs_fudge_generic_bitmap_end(bitmap,
+						EXT2_ET_MAGIC_BLOCK_BITMAP,
+						EXT2_ET_FUDGE_BLOCK_BITMAP_END,
+						end, oend));
+}
+
+errcode_t ext2fs_fudge_block_bitmap_end2(ext2fs_block_bitmap bitmap,
+					 blk64_t end, blk64_t *oend)
+{
+	return (ext2fs_fudge_generic_bmap_end(bitmap,
+					      EXT2_ET_FUDGE_BLOCK_BITMAP_END,
+					      end, oend));
+}
+
+void ext2fs_clear_inode_bitmap(ext2fs_inode_bitmap bitmap)
+{
+	ext2fs_clear_generic_bmap(bitmap);
+}
+
+void ext2fs_clear_block_bitmap(ext2fs_block_bitmap bitmap)
+{
+	ext2fs_clear_generic_bmap(bitmap);
+}
+
+errcode_t ext2fs_resize_inode_bitmap(__u32 new_end, __u32 new_real_end,
+				     ext2fs_inode_bitmap bmap)
+{
+	return (ext2fs_resize_generic_bitmap(EXT2_ET_MAGIC_INODE_BITMAP,
+					     new_end, new_real_end, bmap));
+}
+
+errcode_t ext2fs_resize_inode_bitmap2(__u64 new_end, __u64 new_real_end,
+				      ext2fs_inode_bitmap bmap)
+{
+	return (ext2fs_resize_generic_bmap(bmap, new_end, new_real_end));
+}
+
+errcode_t ext2fs_resize_block_bitmap(__u32 new_end, __u32 new_real_end,
+				     ext2fs_block_bitmap bmap)
+{
+	return (ext2fs_resize_generic_bitmap(EXT2_ET_MAGIC_BLOCK_BITMAP,
+					     new_end, new_real_end, bmap));
+}
+
+errcode_t ext2fs_resize_block_bitmap2(__u64 new_end, __u64 new_real_end,
+				      ext2fs_block_bitmap bmap)
+{
+	return (ext2fs_resize_generic_bmap(bmap, new_end, new_real_end));
+}
+
+errcode_t ext2fs_compare_block_bitmap(ext2fs_block_bitmap bm1,
+				      ext2fs_block_bitmap bm2)
+{
+	return (ext2fs_compare_generic_bmap(EXT2_ET_NEQ_BLOCK_BITMAP,
+					    bm1, bm2));
+}
+
+errcode_t ext2fs_compare_inode_bitmap(ext2fs_inode_bitmap bm1,
+				      ext2fs_inode_bitmap bm2)
+{
+	return (ext2fs_compare_generic_bmap(EXT2_ET_NEQ_INODE_BITMAP,
+					    bm1, bm2));
+}
+
+errcode_t ext2fs_set_inode_bitmap_range(ext2fs_inode_bitmap bmap,
+					ext2_ino_t start, unsigned int num,
+					void *in)
+{
+	return (ext2fs_set_generic_bitmap_range(bmap,
+						EXT2_ET_MAGIC_INODE_BITMAP,
+						start, num, in));
+}
+
+errcode_t ext2fs_set_inode_bitmap_range2(ext2fs_inode_bitmap bmap,
+					 __u64 start, size_t num,
+					 void *in)
+{
+	return (ext2fs_set_generic_bmap_range(bmap, start, num, in));
+}
+
+errcode_t ext2fs_get_inode_bitmap_range(ext2fs_inode_bitmap bmap,
+					ext2_ino_t start, unsigned int num,
+					void *out)
+{
+	return (ext2fs_get_generic_bitmap_range(bmap,
+						EXT2_ET_MAGIC_INODE_BITMAP,
+						start, num, out));
+}
+
+errcode_t ext2fs_get_inode_bitmap_range2(ext2fs_inode_bitmap bmap,
+					 __u64 start, size_t num,
+					 void *out)
+{
+	return (ext2fs_get_generic_bmap_range(bmap, start, num, out));
+}
+
+errcode_t ext2fs_set_block_bitmap_range(ext2fs_block_bitmap bmap,
+					blk_t start, unsigned int num,
+					void *in)
+{
+	return (ext2fs_set_generic_bitmap_range(bmap,
+						EXT2_ET_MAGIC_BLOCK_BITMAP,
+						start, num, in));
+}
+
+errcode_t ext2fs_set_block_bitmap_range2(ext2fs_block_bitmap bmap,
+					 blk64_t start, size_t num,
+					 void *in)
+{
+	return (ext2fs_set_generic_bmap_range(bmap, start, num, in));
+}
+
+errcode_t ext2fs_get_block_bitmap_range(ext2fs_block_bitmap bmap,
+					blk_t start, unsigned int num,
+					void *out)
+{
+	return (ext2fs_get_generic_bitmap_range(bmap,
+						EXT2_ET_MAGIC_BLOCK_BITMAP,
+						start, num, out));
+}
+
+errcode_t ext2fs_get_block_bitmap_range2(ext2fs_block_bitmap bmap,
+					 blk64_t start, size_t num,
+					 void *out)
+{
+	return (ext2fs_get_generic_bmap_range(bmap, start, num, out));
+}
diff --git a/lib/ext2fs/bitops.c b/lib/ext2fs/bitops.c
new file mode 100644
index 0000000..ce2acc4
--- /dev/null
+++ b/lib/ext2fs/bitops.c
@@ -0,0 +1,148 @@
+/*
+ * bitops.c --- Bitmap frobbing code.  See bitops.h for the inlined
+ * 	routines.
+ *
+ * Copyright (C) 1993, 1994, 1995, 1996 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+/*
+ * C language bitmap functions written by Theodore Ts'o, 9/26/92.
+ * Modified by Pete A. Zaitcev 7/14/95 to be portable to big endian
+ * systems, as well as non-32 bit systems.
+ */
+
+int ext2fs_set_bit(unsigned int nr,void * addr)
+{
+	int		mask, retval;
+	unsigned char	*ADDR = (unsigned char *) addr;
+
+	ADDR += nr >> 3;
+	mask = 1 << (nr & 0x07);
+	retval = mask & *ADDR;
+	*ADDR |= mask;
+	return retval;
+}
+
+int ext2fs_clear_bit(unsigned int nr, void * addr)
+{
+	int		mask, retval;
+	unsigned char	*ADDR = (unsigned char *) addr;
+
+	ADDR += nr >> 3;
+	mask = 1 << (nr & 0x07);
+	retval = mask & *ADDR;
+	*ADDR &= ~mask;
+	return retval;
+}
+
+int ext2fs_test_bit(unsigned int nr, const void * addr)
+{
+	int			mask;
+	const unsigned char	*ADDR = (const unsigned char *) addr;
+
+	ADDR += nr >> 3;
+	mask = 1 << (nr & 0x07);
+	return (mask & *ADDR);
+}
+
+void ext2fs_warn_bitmap(errcode_t errcode, unsigned long arg,
+			const char *description)
+{
+#ifndef OMIT_COM_ERR
+	if (description)
+		com_err(0, errcode, "#%lu for %s", arg, description);
+	else
+		com_err(0, errcode, "#%lu", arg);
+#endif
+}
+
+/* Bitmap functions that take a 64-bit offset */
+
+int ext2fs_set_bit64(__u64 nr, void * addr)
+{
+	int		mask, retval;
+	unsigned char	*ADDR = (unsigned char *) addr;
+
+	ADDR += nr >> 3;
+	mask = 1 << (nr & 0x07);
+	retval = mask & *ADDR;
+	*ADDR |= mask;
+	return retval;
+}
+
+int ext2fs_clear_bit64(__u64 nr, void * addr)
+{
+	int		mask, retval;
+	unsigned char	*ADDR = (unsigned char *) addr;
+
+	ADDR += nr >> 3;
+	mask = 1 << (nr & 0x07);
+	retval = mask & *ADDR;
+	*ADDR &= ~mask;
+	return retval;
+}
+
+int ext2fs_test_bit64(__u64 nr, const void * addr)
+{
+	int			mask;
+	const unsigned char	*ADDR = (const unsigned char *) addr;
+
+	ADDR += nr >> 3;
+	mask = 1 << (nr & 0x07);
+	return (mask & *ADDR);
+}
+
+static unsigned int popcount8(unsigned int w)
+{
+	unsigned int res = w - ((w >> 1) & 0x55);
+	res = (res & 0x33) + ((res >> 2) & 0x33);
+	return (res + (res >> 4)) & 0x0F;
+}
+
+static unsigned int popcount32(unsigned int w)
+{
+	unsigned int res = w - ((w >> 1) & 0x55555555);
+	res = (res & 0x33333333) + ((res >> 2) & 0x33333333);
+	res = (res + (res >> 4)) & 0x0F0F0F0F;
+	res = res + (res >> 8);
+	return (res + (res >> 16)) & 0x000000FF;
+}
+
+unsigned int ext2fs_bitcount(const void *addr, unsigned int nbytes)
+{
+	const unsigned char *cp = addr;
+	const __u32 *p;
+	unsigned int res = 0;
+
+	while (((((uintptr_t) cp) & 3) != 0) && (nbytes > 0)) {
+		res += popcount8(*cp++);
+		nbytes--;
+	}
+	p = (const __u32 *) cp;
+
+	while (nbytes > 4) {
+		res += popcount32(*p++);
+		nbytes -= 4;
+	}
+	cp = (const unsigned char *) p;
+
+	while (nbytes > 0) {
+		res += popcount8(*cp++);
+		nbytes--;
+	}
+	return res;
+}
diff --git a/lib/ext2fs/bitops.h b/lib/ext2fs/bitops.h
new file mode 100644
index 0000000..9edf594
--- /dev/null
+++ b/lib/ext2fs/bitops.h
@@ -0,0 +1,606 @@
+/*
+ * bitops.h --- Bitmap frobbing code.  The byte swapping routines are
+ * 	also included here.
+ *
+ * Copyright (C) 1993, 1994, 1995, 1996 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#ifdef WORDS_BIGENDIAN
+#define ext2fs_cpu_to_le64(x) ((__force __le64)ext2fs_swab64((__u64)(x)))
+#define ext2fs_le64_to_cpu(x) ext2fs_swab64((__force __u64)(__le64)(x))
+#define ext2fs_cpu_to_le32(x) ((__force __le32)ext2fs_swab32((__u32)(x)))
+#define ext2fs_le32_to_cpu(x) ext2fs_swab32((__force __u32)(__le32)(x))
+#define ext2fs_cpu_to_le16(x) ((__force __le16)ext2fs_swab16((__u16)(x)))
+#define ext2fs_le16_to_cpu(x) ext2fs_swab16((__force __u16)(__le16)(x))
+
+#define ext2fs_cpu_to_be64(x) ((__force __be64)(__u64)(x))
+#define ext2fs_be64_to_cpu(x) ((__force __u64)(__be64)(x))
+#define ext2fs_cpu_to_be32(x) ((__force __be32)(__u32)(x))
+#define ext2fs_be32_to_cpu(x) ((__force __u32)(__be32)(x))
+#define ext2fs_cpu_to_be16(x) ((__force __be16)(__u16)(x))
+#define ext2fs_be16_to_cpu(x) ((__force __u16)(__be16)(x))
+#else
+#define ext2fs_cpu_to_le64(x) ((__force __le64)(__u64)(x))
+#define ext2fs_le64_to_cpu(x) ((__force __u64)(__le64)(x))
+#define ext2fs_cpu_to_le32(x) ((__force __le32)(__u32)(x))
+#define ext2fs_le32_to_cpu(x) ((__force __u32)(__le32)(x))
+#define ext2fs_cpu_to_le16(x) ((__force __le16)(__u16)(x))
+#define ext2fs_le16_to_cpu(x) ((__force __u16)(__le16)(x))
+
+#define ext2fs_cpu_to_be64(x) ((__force __be64)ext2fs_swab64((__u64)(x)))
+#define ext2fs_be64_to_cpu(x) ext2fs_swab64((__force __u64)(__be64)(x))
+#define ext2fs_cpu_to_be32(x) ((__force __be32)ext2fs_swab32((__u32)(x)))
+#define ext2fs_be32_to_cpu(x) ext2fs_swab32((__force __u32)(__be32)(x))
+#define ext2fs_cpu_to_be16(x) ((__force __be16)ext2fs_swab16((__u16)(x)))
+#define ext2fs_be16_to_cpu(x) ext2fs_swab16((__force __u16)(__be16)(x))
+#endif
+
+/*
+ * EXT2FS bitmap manipulation routines.
+ */
+
+/* Support for sending warning messages from the inline subroutines */
+extern const char *ext2fs_block_string;
+extern const char *ext2fs_inode_string;
+extern const char *ext2fs_mark_string;
+extern const char *ext2fs_unmark_string;
+extern const char *ext2fs_test_string;
+extern void ext2fs_warn_bitmap(errcode_t errcode, unsigned long arg,
+			       const char *description);
+extern void ext2fs_warn_bitmap2(ext2fs_generic_bitmap bitmap,
+				int code, unsigned long arg);
+
+#ifdef NO_INLINE_FUNCS
+extern void ext2fs_fast_set_bit(unsigned int nr,void * addr);
+extern void ext2fs_fast_clear_bit(unsigned int nr, void * addr);
+extern void ext2fs_fast_set_bit64(__u64 nr,void * addr);
+extern void ext2fs_fast_clear_bit64(__u64 nr, void * addr);
+extern __u16 ext2fs_swab16(__u16 val);
+extern __u32 ext2fs_swab32(__u32 val);
+extern __u64 ext2fs_swab64(__u64 val);
+
+extern int ext2fs_mark_block_bitmap(ext2fs_block_bitmap bitmap, blk_t block);
+extern int ext2fs_unmark_block_bitmap(ext2fs_block_bitmap bitmap,
+				       blk_t block);
+extern int ext2fs_test_block_bitmap(ext2fs_block_bitmap bitmap, blk_t block);
+
+extern int ext2fs_mark_inode_bitmap(ext2fs_inode_bitmap bitmap, ext2_ino_t inode);
+extern int ext2fs_unmark_inode_bitmap(ext2fs_inode_bitmap bitmap,
+				       ext2_ino_t inode);
+extern int ext2fs_test_inode_bitmap(ext2fs_inode_bitmap bitmap, ext2_ino_t inode);
+
+extern void ext2fs_fast_mark_block_bitmap(ext2fs_block_bitmap bitmap,
+					  blk_t block);
+extern void ext2fs_fast_unmark_block_bitmap(ext2fs_block_bitmap bitmap,
+					    blk_t block);
+extern int ext2fs_fast_test_block_bitmap(ext2fs_block_bitmap bitmap,
+					 blk_t block);
+
+extern void ext2fs_fast_mark_inode_bitmap(ext2fs_inode_bitmap bitmap,
+					  ext2_ino_t inode);
+extern void ext2fs_fast_unmark_inode_bitmap(ext2fs_inode_bitmap bitmap,
+					    ext2_ino_t inode);
+extern int ext2fs_fast_test_inode_bitmap(ext2fs_inode_bitmap bitmap,
+					 ext2_ino_t inode);
+extern blk_t ext2fs_get_block_bitmap_start(ext2fs_block_bitmap bitmap);
+extern ext2_ino_t ext2fs_get_inode_bitmap_start(ext2fs_inode_bitmap bitmap);
+extern blk_t ext2fs_get_block_bitmap_end(ext2fs_block_bitmap bitmap);
+extern ext2_ino_t ext2fs_get_inode_bitmap_end(ext2fs_inode_bitmap bitmap);
+
+extern void ext2fs_fast_mark_block_bitmap_range(ext2fs_block_bitmap bitmap,
+						blk_t block, int num);
+extern void ext2fs_fast_unmark_block_bitmap_range(ext2fs_block_bitmap bitmap,
+						  blk_t block, int num);
+extern int ext2fs_fast_test_block_bitmap_range(ext2fs_block_bitmap bitmap,
+					       blk_t block, int num);
+#endif
+
+/* These functions routines moved to gen_bitmap.c */
+extern void ext2fs_mark_block_bitmap_range(ext2fs_block_bitmap bitmap,
+					   blk_t block, int num);
+extern void ext2fs_unmark_block_bitmap_range(ext2fs_block_bitmap bitmap,
+					     blk_t block, int num);
+extern int ext2fs_test_block_bitmap_range(ext2fs_block_bitmap bitmap,
+					  blk_t block, int num);
+extern int ext2fs_test_inode_bitmap_range(ext2fs_inode_bitmap bitmap,
+					  ext2_ino_t inode, int num);
+extern int ext2fs_mark_generic_bitmap(ext2fs_generic_bitmap bitmap,
+					 __u32 bitno);
+extern int ext2fs_unmark_generic_bitmap(ext2fs_generic_bitmap bitmap,
+					   blk_t bitno);
+extern int ext2fs_test_generic_bitmap(ext2fs_generic_bitmap bitmap,
+				      blk_t bitno);
+extern int ext2fs_test_block_bitmap_range(ext2fs_block_bitmap bitmap,
+					  blk_t block, int num);
+extern void ext2fs_set_bitmap_padding(ext2fs_generic_bitmap map);
+extern __u32 ext2fs_get_generic_bitmap_start(ext2fs_generic_bitmap bitmap);
+extern __u32 ext2fs_get_generic_bitmap_end(ext2fs_generic_bitmap bitmap);
+
+/* 64-bit versions */
+
+#ifdef NO_INLINE_FUNCS
+extern int ext2fs_mark_block_bitmap2(ext2fs_block_bitmap bitmap,
+				     blk64_t block);
+extern int ext2fs_unmark_block_bitmap2(ext2fs_block_bitmap bitmap,
+				       blk64_t block);
+extern int ext2fs_test_block_bitmap2(ext2fs_block_bitmap bitmap,
+				     blk64_t block);
+
+extern int ext2fs_mark_inode_bitmap2(ext2fs_inode_bitmap bitmap,
+				     ext2_ino_t inode);
+extern int ext2fs_unmark_inode_bitmap2(ext2fs_inode_bitmap bitmap,
+				       ext2_ino_t inode);
+extern int ext2fs_test_inode_bitmap2(ext2fs_inode_bitmap bitmap,
+				     ext2_ino_t inode);
+
+extern void ext2fs_fast_mark_block_bitmap2(ext2fs_block_bitmap bitmap,
+					   blk64_t block);
+extern void ext2fs_fast_unmark_block_bitmap2(ext2fs_block_bitmap bitmap,
+					     blk64_t block);
+extern int ext2fs_fast_test_block_bitmap2(ext2fs_block_bitmap bitmap,
+					  blk64_t block);
+
+extern void ext2fs_fast_mark_inode_bitmap2(ext2fs_inode_bitmap bitmap,
+					   ext2_ino_t inode);
+extern void ext2fs_fast_unmark_inode_bitmap2(ext2fs_inode_bitmap bitmap,
+					    ext2_ino_t inode);
+extern int ext2fs_fast_test_inode_bitmap2(ext2fs_inode_bitmap bitmap,
+					  ext2_ino_t inode);
+extern errcode_t ext2fs_find_first_zero_block_bitmap2(ext2fs_block_bitmap bitmap,
+						      blk64_t start,
+						      blk64_t end,
+						      blk64_t *out);
+extern errcode_t ext2fs_find_first_zero_inode_bitmap2(ext2fs_inode_bitmap bitmap,
+						      ext2_ino_t start,
+						      ext2_ino_t end,
+						      ext2_ino_t *out);
+extern errcode_t ext2fs_find_first_set_block_bitmap2(ext2fs_block_bitmap bitmap,
+						     blk64_t start,
+						     blk64_t end,
+						     blk64_t *out);
+extern errcode_t ext2fs_find_first_set_inode_bitmap2(ext2fs_inode_bitmap bitmap,
+						      ext2_ino_t start,
+						      ext2_ino_t end,
+						      ext2_ino_t *out);
+extern blk64_t ext2fs_get_block_bitmap_start2(ext2fs_block_bitmap bitmap);
+extern ext2_ino_t ext2fs_get_inode_bitmap_start2(ext2fs_inode_bitmap bitmap);
+extern blk64_t ext2fs_get_block_bitmap_end2(ext2fs_block_bitmap bitmap);
+extern ext2_ino_t ext2fs_get_inode_bitmap_end2(ext2fs_inode_bitmap bitmap);
+
+extern int ext2fs_fast_test_block_bitmap_range2(ext2fs_block_bitmap bitmap,
+						blk64_t block,
+						unsigned int num);
+extern void ext2fs_fast_mark_block_bitmap_range2(ext2fs_block_bitmap bitmap,
+						 blk64_t block,
+						 unsigned int num);
+extern void ext2fs_fast_unmark_block_bitmap_range2(ext2fs_block_bitmap bitmap,
+						   blk64_t block,
+						   unsigned int num);
+#endif
+
+/* These routines moved to gen_bitmap64.c */
+extern void ext2fs_clear_generic_bmap(ext2fs_generic_bitmap bitmap);
+extern errcode_t ext2fs_compare_generic_bmap(errcode_t neq,
+					     ext2fs_generic_bitmap bm1,
+					     ext2fs_generic_bitmap bm2);
+extern void ext2fs_set_generic_bmap_padding(ext2fs_generic_bitmap bmap);
+extern int ext2fs_mark_generic_bmap(ext2fs_generic_bitmap bitmap,
+				    blk64_t bitno);
+extern int ext2fs_unmark_generic_bmap(ext2fs_generic_bitmap bitmap,
+				      blk64_t bitno);
+extern int ext2fs_test_generic_bmap(ext2fs_generic_bitmap bitmap,
+				    blk64_t bitno);
+extern int ext2fs_test_block_bitmap_range2(ext2fs_block_bitmap bitmap,
+					   blk64_t block, unsigned int num);
+extern __u64 ext2fs_get_generic_bmap_start(ext2fs_generic_bitmap bitmap);
+extern __u64 ext2fs_get_generic_bmap_end(ext2fs_generic_bitmap bitmap);
+extern int ext2fs_test_block_bitmap_range2(ext2fs_block_bitmap bitmap,
+					   blk64_t block, unsigned int num);
+extern void ext2fs_mark_block_bitmap_range2(ext2fs_block_bitmap bitmap,
+					    blk64_t block, unsigned int num);
+extern void ext2fs_unmark_block_bitmap_range2(ext2fs_block_bitmap bitmap,
+					      blk64_t block, unsigned int num);
+extern errcode_t ext2fs_find_first_zero_generic_bmap(ext2fs_generic_bitmap bitmap,
+						     __u64 start, __u64 end,
+						     __u64 *out);
+extern errcode_t ext2fs_find_first_set_generic_bmap(ext2fs_generic_bitmap bitmap,
+						    __u64 start, __u64 end,
+						    __u64 *out);
+
+/*
+ * The inline routines themselves...
+ *
+ * If NO_INLINE_FUNCS is defined, then we won't try to do inline
+ * functions at all; they will be included as normal functions in
+ * inline.c
+ */
+
+#if (defined(INCLUDE_INLINE_FUNCS) || !defined(NO_INLINE_FUNCS))
+#ifdef INCLUDE_INLINE_FUNCS
+#if (__STDC_VERSION__ >= 199901L)
+#define _INLINE_ extern inline
+#else
+#define _INLINE_ inline
+#endif
+#else /* !INCLUDE_INLINE FUNCS */
+#if (__STDC_VERSION__ >= 199901L)
+#define _INLINE_ inline
+#else /* not C99 */
+#ifdef __GNUC__
+#define _INLINE_ extern __inline__
+#else				/* For Watcom C */
+#define _INLINE_ extern inline
+#endif /* __GNUC__ */
+#endif /* __STDC_VERSION__ >= 199901L */
+#endif /* INCLUDE_INLINE_FUNCS */
+
+/*
+ * Fast bit set/clear functions that doesn't need to return the
+ * previous bit value.
+ */
+
+_INLINE_ void ext2fs_fast_set_bit(unsigned int nr,void * addr)
+{
+	unsigned char	*ADDR = (unsigned char *) addr;
+
+	ADDR += nr >> 3;
+	*ADDR |= (unsigned char) (1 << (nr & 0x07));
+}
+
+_INLINE_ void ext2fs_fast_clear_bit(unsigned int nr, void * addr)
+{
+	unsigned char	*ADDR = (unsigned char *) addr;
+
+	ADDR += nr >> 3;
+	*ADDR &= (unsigned char) ~(1 << (nr & 0x07));
+}
+
+
+_INLINE_ void ext2fs_fast_set_bit64(__u64 nr, void * addr)
+{
+	unsigned char	*ADDR = (unsigned char *) addr;
+
+	ADDR += nr >> 3;
+	*ADDR |= (unsigned char) (1 << (nr & 0x07));
+}
+
+_INLINE_ void ext2fs_fast_clear_bit64(__u64 nr, void * addr)
+{
+	unsigned char	*ADDR = (unsigned char *) addr;
+
+	ADDR += nr >> 3;
+	*ADDR &= (unsigned char) ~(1 << (nr & 0x07));
+}
+
+_INLINE_ __u16 ext2fs_swab16(__u16 val)
+{
+	return (val >> 8) | (__u16) (val << 8);
+}
+
+_INLINE_ __u32 ext2fs_swab32(__u32 val)
+{
+	return ((val>>24) | ((val>>8)&0xFF00) |
+		((val<<8)&0xFF0000) | (val<<24));
+}
+
+_INLINE_ __u64 ext2fs_swab64(__u64 val)
+{
+	return (ext2fs_swab32((__u32) (val >> 32)) |
+		(((__u64)ext2fs_swab32(val & 0xFFFFFFFFUL)) << 32));
+}
+
+_INLINE_ int ext2fs_mark_block_bitmap(ext2fs_block_bitmap bitmap,
+				       blk_t block)
+{
+	return ext2fs_mark_generic_bitmap((ext2fs_generic_bitmap) bitmap,
+					  block);
+}
+
+_INLINE_ int ext2fs_unmark_block_bitmap(ext2fs_block_bitmap bitmap,
+					 blk_t block)
+{
+	return ext2fs_unmark_generic_bitmap((ext2fs_generic_bitmap) bitmap,
+					    block);
+}
+
+_INLINE_ int ext2fs_test_block_bitmap(ext2fs_block_bitmap bitmap,
+				       blk_t block)
+{
+	return ext2fs_test_generic_bitmap((ext2fs_generic_bitmap) bitmap,
+					  block);
+}
+
+_INLINE_ int ext2fs_mark_inode_bitmap(ext2fs_inode_bitmap bitmap,
+				       ext2_ino_t inode)
+{
+	return ext2fs_mark_generic_bitmap((ext2fs_generic_bitmap) bitmap,
+					  inode);
+}
+
+_INLINE_ int ext2fs_unmark_inode_bitmap(ext2fs_inode_bitmap bitmap,
+					 ext2_ino_t inode)
+{
+	return ext2fs_unmark_generic_bitmap((ext2fs_generic_bitmap) bitmap,
+				     inode);
+}
+
+_INLINE_ int ext2fs_test_inode_bitmap(ext2fs_inode_bitmap bitmap,
+				       ext2_ino_t inode)
+{
+	return ext2fs_test_generic_bitmap((ext2fs_generic_bitmap) bitmap,
+					  inode);
+}
+
+_INLINE_ void ext2fs_fast_mark_block_bitmap(ext2fs_block_bitmap bitmap,
+					    blk_t block)
+{
+	ext2fs_mark_generic_bitmap((ext2fs_generic_bitmap) bitmap, block);
+}
+
+_INLINE_ void ext2fs_fast_unmark_block_bitmap(ext2fs_block_bitmap bitmap,
+					      blk_t block)
+{
+	ext2fs_unmark_generic_bitmap((ext2fs_generic_bitmap) bitmap, block);
+}
+
+_INLINE_ int ext2fs_fast_test_block_bitmap(ext2fs_block_bitmap bitmap,
+					    blk_t block)
+{
+	return ext2fs_test_generic_bitmap((ext2fs_generic_bitmap) bitmap,
+					  block);
+}
+
+_INLINE_ void ext2fs_fast_mark_inode_bitmap(ext2fs_inode_bitmap bitmap,
+					    ext2_ino_t inode)
+{
+	ext2fs_mark_generic_bitmap((ext2fs_generic_bitmap) bitmap, inode);
+}
+
+_INLINE_ void ext2fs_fast_unmark_inode_bitmap(ext2fs_inode_bitmap bitmap,
+					      ext2_ino_t inode)
+{
+	ext2fs_unmark_generic_bitmap((ext2fs_generic_bitmap) bitmap, inode);
+}
+
+_INLINE_ int ext2fs_fast_test_inode_bitmap(ext2fs_inode_bitmap bitmap,
+					   ext2_ino_t inode)
+{
+	return ext2fs_test_generic_bitmap((ext2fs_generic_bitmap) bitmap,
+					  inode);
+}
+
+_INLINE_ blk_t ext2fs_get_block_bitmap_start(ext2fs_block_bitmap bitmap)
+{
+	return ext2fs_get_generic_bitmap_start((ext2fs_generic_bitmap) bitmap);
+}
+
+_INLINE_ ext2_ino_t ext2fs_get_inode_bitmap_start(ext2fs_inode_bitmap bitmap)
+{
+	return ext2fs_get_generic_bitmap_start((ext2fs_generic_bitmap) bitmap);
+}
+
+_INLINE_ blk_t ext2fs_get_block_bitmap_end(ext2fs_block_bitmap bitmap)
+{
+	return ext2fs_get_generic_bitmap_end((ext2fs_generic_bitmap) bitmap);
+}
+
+_INLINE_ ext2_ino_t ext2fs_get_inode_bitmap_end(ext2fs_inode_bitmap bitmap)
+{
+	return ext2fs_get_generic_bitmap_end((ext2fs_generic_bitmap) bitmap);
+}
+
+_INLINE_ int ext2fs_fast_test_block_bitmap_range(ext2fs_block_bitmap bitmap,
+						 blk_t block, int num)
+{
+	return ext2fs_test_block_bitmap_range(bitmap, block, num);
+}
+
+_INLINE_ void ext2fs_fast_mark_block_bitmap_range(ext2fs_block_bitmap bitmap,
+						  blk_t block, int num)
+{
+	ext2fs_mark_block_bitmap_range(bitmap, block, num);
+}
+
+_INLINE_ void ext2fs_fast_unmark_block_bitmap_range(ext2fs_block_bitmap bitmap,
+						    blk_t block, int num)
+{
+	ext2fs_unmark_block_bitmap_range(bitmap, block, num);
+}
+
+/* 64-bit versions */
+
+_INLINE_ int ext2fs_mark_block_bitmap2(ext2fs_block_bitmap bitmap,
+				       blk64_t block)
+{
+	return ext2fs_mark_generic_bmap((ext2fs_generic_bitmap) bitmap,
+					block);
+}
+
+_INLINE_ int ext2fs_unmark_block_bitmap2(ext2fs_block_bitmap bitmap,
+					 blk64_t block)
+{
+	return ext2fs_unmark_generic_bmap((ext2fs_generic_bitmap) bitmap, block);
+}
+
+_INLINE_ int ext2fs_test_block_bitmap2(ext2fs_block_bitmap bitmap,
+				       blk64_t block)
+{
+	return ext2fs_test_generic_bmap((ext2fs_generic_bitmap) bitmap,
+					block);
+}
+
+_INLINE_ int ext2fs_mark_inode_bitmap2(ext2fs_inode_bitmap bitmap,
+				       ext2_ino_t inode)
+{
+	return ext2fs_mark_generic_bmap((ext2fs_generic_bitmap) bitmap,
+					inode);
+}
+
+_INLINE_ int ext2fs_unmark_inode_bitmap2(ext2fs_inode_bitmap bitmap,
+					 ext2_ino_t inode)
+{
+	return ext2fs_unmark_generic_bmap((ext2fs_generic_bitmap) bitmap,
+					  inode);
+}
+
+_INLINE_ int ext2fs_test_inode_bitmap2(ext2fs_inode_bitmap bitmap,
+				       ext2_ino_t inode)
+{
+	return ext2fs_test_generic_bmap((ext2fs_generic_bitmap) bitmap,
+					inode);
+}
+
+_INLINE_ void ext2fs_fast_mark_block_bitmap2(ext2fs_block_bitmap bitmap,
+					     blk64_t block)
+{
+	ext2fs_mark_generic_bmap((ext2fs_generic_bitmap) bitmap, block);
+}
+
+_INLINE_ void ext2fs_fast_unmark_block_bitmap2(ext2fs_block_bitmap bitmap,
+					       blk64_t block)
+{
+	ext2fs_unmark_generic_bmap((ext2fs_generic_bitmap) bitmap, block);
+}
+
+_INLINE_ int ext2fs_fast_test_block_bitmap2(ext2fs_block_bitmap bitmap,
+					    blk64_t block)
+{
+	return ext2fs_test_generic_bmap((ext2fs_generic_bitmap) bitmap,
+					block);
+}
+
+_INLINE_ void ext2fs_fast_mark_inode_bitmap2(ext2fs_inode_bitmap bitmap,
+					     ext2_ino_t inode)
+{
+	ext2fs_mark_generic_bmap((ext2fs_generic_bitmap) bitmap, inode);
+}
+
+_INLINE_ void ext2fs_fast_unmark_inode_bitmap2(ext2fs_inode_bitmap bitmap,
+					       ext2_ino_t inode)
+{
+	ext2fs_unmark_generic_bmap((ext2fs_generic_bitmap) bitmap, inode);
+}
+
+_INLINE_ int ext2fs_fast_test_inode_bitmap2(ext2fs_inode_bitmap bitmap,
+					    ext2_ino_t inode)
+{
+	return ext2fs_test_generic_bmap((ext2fs_generic_bitmap) bitmap,
+					inode);
+}
+
+_INLINE_ errcode_t ext2fs_find_first_zero_block_bitmap2(ext2fs_block_bitmap bitmap,
+							blk64_t start,
+							blk64_t end,
+							blk64_t *out)
+{
+	__u64 o;
+	errcode_t rv;
+
+	rv = ext2fs_find_first_zero_generic_bmap((ext2fs_generic_bitmap) bitmap,
+						 start, end, &o);
+	if (!rv)
+		*out = o;
+	return rv;
+}
+
+_INLINE_ errcode_t ext2fs_find_first_zero_inode_bitmap2(ext2fs_inode_bitmap bitmap,
+							ext2_ino_t start,
+							ext2_ino_t end,
+							ext2_ino_t *out)
+{
+	__u64 o;
+	errcode_t rv;
+
+	rv = ext2fs_find_first_zero_generic_bmap((ext2fs_generic_bitmap) bitmap,
+						 start, end, &o);
+	if (!rv)
+		*out = (ext2_ino_t) o;
+	return rv;
+}
+
+_INLINE_ errcode_t ext2fs_find_first_set_block_bitmap2(ext2fs_block_bitmap bitmap,
+						       blk64_t start,
+						       blk64_t end,
+						       blk64_t *out)
+{
+	__u64 o;
+	errcode_t rv;
+
+	rv = ext2fs_find_first_set_generic_bmap((ext2fs_generic_bitmap) bitmap,
+						start, end, &o);
+	if (!rv)
+		*out = o;
+	return rv;
+}
+
+_INLINE_ errcode_t ext2fs_find_first_set_inode_bitmap2(ext2fs_inode_bitmap bitmap,
+						       ext2_ino_t start,
+						       ext2_ino_t end,
+						       ext2_ino_t *out)
+{
+	__u64 o;
+	errcode_t rv;
+
+	rv = ext2fs_find_first_set_generic_bmap((ext2fs_generic_bitmap) bitmap,
+						start, end, &o);
+	if (!rv)
+		*out = (ext2_ino_t) o;
+	return rv;
+}
+
+_INLINE_ blk64_t ext2fs_get_block_bitmap_start2(ext2fs_block_bitmap bitmap)
+{
+	return ext2fs_get_generic_bmap_start((ext2fs_generic_bitmap) bitmap);
+}
+
+_INLINE_ ext2_ino_t ext2fs_get_inode_bitmap_start2(ext2fs_inode_bitmap bitmap)
+{
+	return (ext2_ino_t) ext2fs_get_generic_bmap_start((ext2fs_generic_bitmap) bitmap);
+}
+
+_INLINE_ blk64_t ext2fs_get_block_bitmap_end2(ext2fs_block_bitmap bitmap)
+{
+	return ext2fs_get_generic_bmap_end((ext2fs_generic_bitmap) bitmap);
+}
+
+_INLINE_ ext2_ino_t ext2fs_get_inode_bitmap_end2(ext2fs_inode_bitmap bitmap)
+{
+	return (ext2_ino_t) ext2fs_get_generic_bmap_end((ext2fs_generic_bitmap) bitmap);
+}
+
+_INLINE_ int ext2fs_fast_test_block_bitmap_range2(ext2fs_block_bitmap bitmap,
+						  blk64_t block,
+						  unsigned int num)
+{
+	return ext2fs_test_block_bitmap_range2(bitmap, block, num);
+}
+
+_INLINE_ void ext2fs_fast_mark_block_bitmap_range2(ext2fs_block_bitmap bitmap,
+						   blk64_t block,
+						   unsigned int num)
+{
+	ext2fs_mark_block_bitmap_range2(bitmap, block, num);
+}
+
+_INLINE_ void ext2fs_fast_unmark_block_bitmap_range2(ext2fs_block_bitmap bitmap,
+						     blk64_t block,
+						     unsigned int num)
+{
+	ext2fs_unmark_block_bitmap_range2(bitmap, block, num);
+}
+
+#undef _INLINE_
+#endif
+
+extern int ext2fs_set_bit(unsigned int nr,void * addr);
+extern int ext2fs_clear_bit(unsigned int nr, void * addr);
+extern int ext2fs_test_bit(unsigned int nr, const void * addr);
+extern int ext2fs_set_bit64(__u64 nr,void * addr);
+extern int ext2fs_clear_bit64(__u64 nr, void * addr);
+extern int ext2fs_test_bit64(__u64 nr, const void * addr);
+extern unsigned int ext2fs_bitcount(const void *addr, unsigned int nbytes);
diff --git a/lib/ext2fs/blkmap64_ba.c b/lib/ext2fs/blkmap64_ba.c
new file mode 100644
index 0000000..5d8f154
--- /dev/null
+++ b/lib/ext2fs/blkmap64_ba.c
@@ -0,0 +1,492 @@
+/*
+ * blkmap64_ba.c --- Simple bitarray implementation for bitmaps
+ *
+ * Copyright (C) 2008 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Public
+ * License.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fsP.h"
+#include "bmap64.h"
+
+/*
+ * Private data for bit array implementation of bitmap ops.
+ * Currently, this is just a pointer to our big flat hunk of memory,
+ * exactly equivalent to the old-skool char * bitmap member.
+ */
+
+struct ext2fs_ba_private_struct {
+	char *bitarray;
+};
+
+typedef struct ext2fs_ba_private_struct *ext2fs_ba_private;
+
+static errcode_t ba_alloc_private_data (ext2fs_generic_bitmap_64 bitmap)
+{
+	ext2fs_ba_private bp;
+	errcode_t	retval;
+	size_t		size;
+
+	/*
+	 * Since we only have the one pointer, we could just shove our
+	 * private data in the void *private field itself, but then
+	 * we'd have to do a fair bit of rewriting if we ever added a
+	 * field.  I'm agnostic.
+	 */
+	retval = ext2fs_get_mem(sizeof (ext2fs_ba_private), &bp);
+	if (retval)
+		return retval;
+
+	size = (size_t) (((bitmap->real_end - bitmap->start) / 8) + 1);
+
+	retval = ext2fs_get_mem(size, &bp->bitarray);
+	if (retval) {
+		ext2fs_free_mem(&bp);
+		bp = 0;
+		return retval;
+	}
+	bitmap->private = (void *) bp;
+	return 0;
+}
+
+static errcode_t ba_new_bmap(ext2_filsys fs EXT2FS_ATTR((unused)),
+			     ext2fs_generic_bitmap_64 bitmap)
+{
+	ext2fs_ba_private bp;
+	errcode_t	retval;
+	size_t		size;
+
+	retval = ba_alloc_private_data (bitmap);
+	if (retval)
+		return retval;
+
+	bp = (ext2fs_ba_private) bitmap->private;
+	size = (size_t) (((bitmap->real_end - bitmap->start) / 8) + 1);
+	memset(bp->bitarray, 0, size);
+
+	return 0;
+}
+
+static void ba_free_bmap(ext2fs_generic_bitmap_64 bitmap)
+{
+	ext2fs_ba_private bp = (ext2fs_ba_private) bitmap->private;
+
+	if (!bp)
+		return;
+
+	if (bp->bitarray) {
+		ext2fs_free_mem (&bp->bitarray);
+		bp->bitarray = 0;
+	}
+	ext2fs_free_mem (&bp);
+	bp = 0;
+}
+
+static errcode_t ba_copy_bmap(ext2fs_generic_bitmap_64 src,
+			      ext2fs_generic_bitmap_64 dest)
+{
+	ext2fs_ba_private src_bp = (ext2fs_ba_private) src->private;
+	ext2fs_ba_private dest_bp;
+	errcode_t retval;
+	size_t size;
+
+	retval = ba_alloc_private_data (dest);
+	if (retval)
+		return retval;
+
+	dest_bp = (ext2fs_ba_private) dest->private;
+
+	size = (size_t) (((src->real_end - src->start) / 8) + 1);
+	memcpy (dest_bp->bitarray, src_bp->bitarray, size);
+
+	return 0;
+}
+
+static errcode_t ba_resize_bmap(ext2fs_generic_bitmap_64 bmap,
+				__u64 new_end, __u64 new_real_end)
+{
+	ext2fs_ba_private bp = (ext2fs_ba_private) bmap->private;
+	errcode_t	retval;
+	size_t		size, new_size;
+	__u64		bitno;
+
+	/*
+	 * If we're expanding the bitmap, make sure all of the new
+	 * parts of the bitmap are zero.
+	 */
+	if (new_end > bmap->end) {
+		bitno = bmap->real_end;
+		if (bitno > new_end)
+			bitno = new_end;
+		for (; bitno > bmap->end; bitno--)
+			ext2fs_clear_bit64(bitno - bmap->start, bp->bitarray);
+	}
+	if (new_real_end == bmap->real_end) {
+		bmap->end = new_end;
+		return 0;
+	}
+
+	size = ((bmap->real_end - bmap->start) / 8) + 1;
+	new_size = ((new_real_end - bmap->start) / 8) + 1;
+
+	if (size != new_size) {
+		retval = ext2fs_resize_mem(size, new_size, &bp->bitarray);
+		if (retval)
+			return retval;
+	}
+	if (new_size > size)
+		memset(bp->bitarray + size, 0, new_size - size);
+
+	bmap->end = new_end;
+	bmap->real_end = new_real_end;
+	return 0;
+
+}
+
+static int ba_mark_bmap(ext2fs_generic_bitmap_64 bitmap, __u64 arg)
+{
+	ext2fs_ba_private bp = (ext2fs_ba_private) bitmap->private;
+	blk64_t bitno = (blk64_t) arg;
+
+	return ext2fs_set_bit64(bitno - bitmap->start, bp->bitarray);
+}
+
+static int ba_unmark_bmap(ext2fs_generic_bitmap_64 bitmap, __u64 arg)
+{
+	ext2fs_ba_private bp = (ext2fs_ba_private) bitmap->private;
+	blk64_t bitno = (blk64_t) arg;
+
+	return ext2fs_clear_bit64(bitno - bitmap->start, bp->bitarray);
+}
+
+static int ba_test_bmap(ext2fs_generic_bitmap_64 bitmap, __u64 arg)
+{
+	ext2fs_ba_private bp = (ext2fs_ba_private) bitmap->private;
+	blk64_t bitno = (blk64_t) arg;
+
+	return ext2fs_test_bit64(bitno - bitmap->start, bp->bitarray);
+}
+
+static void ba_mark_bmap_extent(ext2fs_generic_bitmap_64 bitmap, __u64 arg,
+				unsigned int num)
+{
+	ext2fs_ba_private bp = (ext2fs_ba_private) bitmap->private;
+	blk64_t bitno = (blk64_t) arg;
+	unsigned int i;
+
+	for (i = 0; i < num; i++)
+		ext2fs_fast_set_bit64(bitno + i - bitmap->start, bp->bitarray);
+}
+
+static void ba_unmark_bmap_extent(ext2fs_generic_bitmap_64 bitmap, __u64 arg,
+				  unsigned int num)
+{
+	ext2fs_ba_private bp = (ext2fs_ba_private) bitmap->private;
+	blk64_t bitno = (blk64_t) arg;
+	unsigned int i;
+
+	for (i = 0; i < num; i++)
+		ext2fs_fast_clear_bit64(bitno + i - bitmap->start, bp->bitarray);
+}
+
+static int ba_test_clear_bmap_extent(ext2fs_generic_bitmap_64 bitmap,
+				     __u64 start, unsigned int len)
+{
+	ext2fs_ba_private bp = (ext2fs_ba_private) bitmap->private;
+	__u64 start_byte, len_byte = len >> 3;
+	unsigned int start_bit, len_bit = len % 8;
+	unsigned int first_bit = 0;
+	unsigned int last_bit  = 0;
+	int mark_count = 0;
+	int mark_bit = 0;
+	int i;
+	const char *ADDR;
+
+	ADDR = bp->bitarray;
+	start -= bitmap->start;
+	start_byte = start >> 3;
+	start_bit = start % 8;
+
+	if (start_bit != 0) {
+		/*
+		 * The compared start block number or start inode number
+		 * is not the first bit in a byte.
+		 */
+		mark_count = 8 - start_bit;
+		if (len < 8 - start_bit) {
+			mark_count = (int)len;
+			mark_bit = len + start_bit - 1;
+		} else
+			mark_bit = 7;
+
+		for (i = mark_count; i > 0; i--, mark_bit--)
+			first_bit |= 1 << mark_bit;
+
+		/*
+		 * Compare blocks or inodes in the first byte.
+		 * If there is any marked bit, this function returns 0.
+		 */
+		if (first_bit & ADDR[start_byte])
+			return 0;
+		else if (len <= 8 - start_bit)
+			return 1;
+
+		start_byte++;
+		len_bit = (len - mark_count) % 8;
+		len_byte = (len - mark_count) >> 3;
+	}
+
+	/*
+	 * The compared start block number or start inode number is
+	 * the first bit in a byte.
+	 */
+	if (len_bit != 0) {
+		/*
+		 * The compared end block number or end inode number is
+		 * not the last bit in a byte.
+		 */
+		for (mark_bit = len_bit - 1; mark_bit >= 0; mark_bit--)
+			last_bit |= 1 << mark_bit;
+
+		/*
+		 * Compare blocks or inodes in the last byte.
+		 * If there is any marked bit, this function returns 0.
+		 */
+		if (last_bit & ADDR[start_byte + len_byte])
+			return 0;
+		else if (len_byte == 0)
+			return 1;
+	}
+
+	/* Check whether all bytes are 0 */
+	return ext2fs_mem_is_zero(ADDR + start_byte, len_byte);
+}
+
+
+static errcode_t ba_set_bmap_range(ext2fs_generic_bitmap_64 bitmap,
+				     __u64 start, size_t num, void *in)
+{
+	ext2fs_ba_private bp = (ext2fs_ba_private) bitmap->private;
+
+	memcpy (bp->bitarray + (start >> 3), in, (num + 7) >> 3);
+
+	return 0;
+}
+
+static errcode_t ba_get_bmap_range(ext2fs_generic_bitmap_64 bitmap,
+				     __u64 start, size_t num, void *out)
+{
+	ext2fs_ba_private bp = (ext2fs_ba_private) bitmap->private;
+
+	memcpy (out, bp->bitarray + (start >> 3), (num + 7) >> 3);
+
+	return 0;
+}
+
+static void ba_clear_bmap(ext2fs_generic_bitmap_64 bitmap)
+{
+	ext2fs_ba_private bp = (ext2fs_ba_private) bitmap->private;
+
+	memset(bp->bitarray, 0,
+	       (size_t) (((bitmap->real_end - bitmap->start) / 8) + 1));
+}
+
+#ifdef ENABLE_BMAP_STATS
+static void ba_print_stats(ext2fs_generic_bitmap_64 bitmap)
+{
+	fprintf(stderr, "%16llu Bytes used by bitarray\n", (unsigned long long)
+		((bitmap->real_end - bitmap->start) >> 3) + 1 +
+		sizeof(struct ext2fs_ba_private_struct));
+}
+#else
+static void ba_print_stats(ext2fs_generic_bitmap_64 bitmap EXT2FS_ATTR((unused)))
+{
+}
+#endif
+
+/* Find the first zero bit between start and end, inclusive. */
+static errcode_t ba_find_first_zero(ext2fs_generic_bitmap_64 bitmap,
+				    __u64 start, __u64 end, __u64 *out)
+{
+	ext2fs_ba_private bp = (ext2fs_ba_private)bitmap->private;
+	unsigned long bitpos = start - bitmap->start;
+	unsigned long count = end - start + 1;
+	int byte_found = 0; /* whether a != 0xff byte has been found */
+	const unsigned char *pos;
+	unsigned long max_loop_count, i;
+
+	/* scan bits until we hit a byte boundary */
+	while ((bitpos & 0x7) != 0 && count > 0) {
+		if (!ext2fs_test_bit64(bitpos, bp->bitarray)) {
+			*out = bitpos + bitmap->start;
+			return 0;
+		}
+		bitpos++;
+		count--;
+	}
+
+	if (!count)
+		return ENOENT;
+
+	pos = ((unsigned char *)bp->bitarray) + (bitpos >> 3);
+	/* scan bytes until 8-byte (64-bit) aligned */
+	while (count >= 8 && (((uintptr_t)pos) & 0x07)) {
+		if (*pos != 0xff) {
+			byte_found = 1;
+			break;
+		}
+		pos++;
+		count -= 8;
+		bitpos += 8;
+	}
+
+	if (!byte_found) {
+		max_loop_count = count >> 6; /* 8-byte blocks */
+		i = max_loop_count;
+		while (i) {
+			if (*((const __u64 *)pos) != ((__u64)-1))
+				break;
+			pos += 8;
+			i--;
+		}
+		count -= 64 * (max_loop_count - i);
+		bitpos += 64 * (max_loop_count - i);
+
+		max_loop_count = count >> 3;
+		i = max_loop_count;
+		while (i) {
+			if (*pos != 0xff) {
+				byte_found = 1;
+				break;
+			}
+			pos++;
+			i--;
+		}
+		count -= 8 * (max_loop_count - i);
+		bitpos += 8 * (max_loop_count - i);
+	}
+
+	/* Here either count < 8 or byte_found == 1. */
+	while (count-- > 0) {
+		if (!ext2fs_test_bit64(bitpos, bp->bitarray)) {
+			*out = bitpos + bitmap->start;
+			return 0;
+		}
+		bitpos++;
+	}
+
+	return ENOENT;
+}
+
+/* Find the first one bit between start and end, inclusive. */
+static errcode_t ba_find_first_set(ext2fs_generic_bitmap_64 bitmap,
+				    __u64 start, __u64 end, __u64 *out)
+{
+	ext2fs_ba_private bp = (ext2fs_ba_private)bitmap->private;
+	unsigned long bitpos = start - bitmap->start;
+	unsigned long count = end - start + 1;
+	int byte_found = 0; /* whether a != 0xff byte has been found */
+	const unsigned char *pos;
+	unsigned long max_loop_count, i;
+
+	/* scan bits until we hit a byte boundary */
+	while ((bitpos & 0x7) != 0 && count > 0) {
+		if (ext2fs_test_bit64(bitpos, bp->bitarray)) {
+			*out = bitpos + bitmap->start;
+			return 0;
+		}
+		bitpos++;
+		count--;
+	}
+
+	if (!count)
+		return ENOENT;
+
+	pos = ((unsigned char *)bp->bitarray) + (bitpos >> 3);
+	/* scan bytes until 8-byte (64-bit) aligned */
+	while (count >= 8 && (((uintptr_t)pos) & 0x07)) {
+		if (*pos != 0) {
+			byte_found = 1;
+			break;
+		}
+		pos++;
+		count -= 8;
+		bitpos += 8;
+	}
+
+	if (!byte_found) {
+		max_loop_count = count >> 6; /* 8-byte blocks */
+		i = max_loop_count;
+		while (i) {
+			if (*((const __u64 *)pos) != 0)
+				break;
+			pos += 8;
+			i--;
+		}
+		count -= 64 * (max_loop_count - i);
+		bitpos += 64 * (max_loop_count - i);
+
+		max_loop_count = count >> 3;
+		i = max_loop_count;
+		while (i) {
+			if (*pos != 0) {
+				byte_found = 1;
+				break;
+			}
+			pos++;
+			i--;
+		}
+		count -= 8 * (max_loop_count - i);
+		bitpos += 8 * (max_loop_count - i);
+	}
+
+	/* Here either count < 8 or byte_found == 1. */
+	while (count-- > 0) {
+		if (ext2fs_test_bit64(bitpos, bp->bitarray)) {
+			*out = bitpos + bitmap->start;
+			return 0;
+		}
+		bitpos++;
+	}
+
+	return ENOENT;
+}
+
+struct ext2_bitmap_ops ext2fs_blkmap64_bitarray = {
+	.type = EXT2FS_BMAP64_BITARRAY,
+	.new_bmap = ba_new_bmap,
+	.free_bmap = ba_free_bmap,
+	.copy_bmap = ba_copy_bmap,
+	.resize_bmap = ba_resize_bmap,
+	.mark_bmap = ba_mark_bmap,
+	.unmark_bmap = ba_unmark_bmap,
+	.test_bmap = ba_test_bmap,
+	.test_clear_bmap_extent = ba_test_clear_bmap_extent,
+	.mark_bmap_extent = ba_mark_bmap_extent,
+	.unmark_bmap_extent = ba_unmark_bmap_extent,
+	.set_bmap_range = ba_set_bmap_range,
+	.get_bmap_range = ba_get_bmap_range,
+	.clear_bmap = ba_clear_bmap,
+	.print_stats = ba_print_stats,
+	.find_first_zero = ba_find_first_zero,
+	.find_first_set = ba_find_first_set
+};
diff --git a/lib/ext2fs/blkmap64_rb.c b/lib/ext2fs/blkmap64_rb.c
new file mode 100644
index 0000000..0df58dc
--- /dev/null
+++ b/lib/ext2fs/blkmap64_rb.c
@@ -0,0 +1,998 @@
+/*
+ * blkmap64_rb.c --- Simple rb-tree implementation for bitmaps
+ *
+ * (C)2010 Red Hat, Inc., Lukas Czerner <lczerner@redhat.com>
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Public
+ * License.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+#if HAVE_LINUX_TYPES_H
+#include <linux/types.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fsP.h"
+#include "bmap64.h"
+#include "rbtree.h"
+
+#include <limits.h>
+
+struct bmap_rb_extent {
+	struct rb_node node;
+	__u64 start;
+	__u64 count;
+};
+
+struct ext2fs_rb_private {
+	struct rb_root root;
+	struct bmap_rb_extent *wcursor;
+	struct bmap_rb_extent *rcursor;
+	struct bmap_rb_extent *rcursor_next;
+#ifdef ENABLE_BMAP_STATS_OPS
+	__u64 mark_hit;
+	__u64 test_hit;
+#endif
+};
+
+inline static struct bmap_rb_extent *node_to_extent(struct rb_node *node)
+{
+	/*
+	 * This depends on the fact the struct rb_node is at the
+	 * beginning of the bmap_rb_extent structure.  We use this
+	 * instead of the ext2fs_rb_entry macro because it causes gcc
+	 * -Wall to generate a huge amount of noise.
+	 */
+	return (struct bmap_rb_extent *) node;
+}
+
+static int rb_insert_extent(__u64 start, __u64 count,
+			    struct ext2fs_rb_private *);
+static void rb_get_new_extent(struct bmap_rb_extent **, __u64, __u64);
+
+/* #define DEBUG_RB */
+
+#ifdef DEBUG_RB
+static void print_tree(struct rb_root *root)
+{
+	struct rb_node *node = NULL;
+	struct bmap_rb_extent *ext;
+
+	fprintf(stderr, "\t\t\t=================================\n");
+	node = ext2fs_rb_first(root);
+	for (node = ext2fs_rb_first(root); node != NULL; 
+	     node = ext2fs_rb_next(node)) {
+		ext = node_to_extent(node);
+		fprintf(stderr, "\t\t\t--> (%llu -> %llu)\n",
+			(unsigned long long) ext->start,
+			(unsigned long long) ext->start + ext->count);
+	}
+	fprintf(stderr, "\t\t\t=================================\n");
+}
+
+static void check_tree(struct rb_root *root, const char *msg)
+{
+	struct rb_node *node;
+	struct bmap_rb_extent *ext, *old = NULL;
+
+	for (node = ext2fs_rb_first(root); node;
+	     node = ext2fs_rb_next(node)) {
+		ext = node_to_extent(node);
+		if (ext->count == 0) {
+			fprintf(stderr, "Tree Error: count is zero\n");
+			fprintf(stderr, "extent: %llu -> %llu (%llu)\n",
+				(unsigned long long) ext->start,
+				(unsigned long long) ext->start + ext->count,
+				(unsigned long long) ext->count);
+			goto err_out;
+		}
+		if (ext->start + ext->count < ext->start) {
+			fprintf(stderr,
+				"Tree Error: start or count is crazy\n");
+			fprintf(stderr, "extent: %llu -> %llu (%llu)\n",
+				(unsigned long long) ext->start,
+				(unsigned long long) ext->start + ext->count,
+				(unsigned long long) ext->count);
+			goto err_out;
+		}
+
+		if (old) {
+			if (old->start > ext->start) {
+				fprintf(stderr, "Tree Error: start is crazy\n");
+				fprintf(stderr, "extent: %llu -> %llu (%llu)\n",
+					(unsigned long long) old->start,
+					(unsigned long long) old->start + old->count,
+					(unsigned long long) old->count);
+				fprintf(stderr,
+					"extent next: %llu -> %llu (%llu)\n",
+					(unsigned long long) ext->start,
+					(unsigned long long) ext->start + ext->count,
+					(unsigned long long) ext->count);
+				goto err_out;
+			}
+			if ((old->start + old->count) >= ext->start) {
+				fprintf(stderr,
+					"Tree Error: extent is crazy\n");
+				fprintf(stderr, "extent: %llu -> %llu (%llu)\n",
+					(unsigned long long) old->start,
+					(unsigned long long) old->start + old->count,
+					(unsigned long long) old->count);
+				fprintf(stderr,
+					"extent next: %llu -> %llu (%llu)\n",
+					(unsigned long long) ext->start,
+					(unsigned long long) ext->start + ext->count,
+					(unsigned long long) ext->count);
+				goto err_out;
+			}
+		}
+		old = ext;
+	}
+	return;
+
+err_out:
+	fprintf(stderr, "%s\n", msg);
+	print_tree(root);
+	exit(1);
+}
+#else
+#define check_tree(root, msg) do {} while (0)
+#define print_tree(root) do {} while (0)
+#endif
+
+static void rb_get_new_extent(struct bmap_rb_extent **ext, __u64 start,
+			     __u64 count)
+{
+	struct bmap_rb_extent *new_ext;
+	int retval;
+
+	retval = ext2fs_get_mem(sizeof (struct bmap_rb_extent),
+				&new_ext);
+	if (retval)
+		abort();
+
+	new_ext->start = start;
+	new_ext->count = count;
+	*ext = new_ext;
+}
+
+inline
+static void rb_free_extent(struct ext2fs_rb_private *bp,
+			   struct bmap_rb_extent *ext)
+{
+	if (bp->wcursor == ext)
+		bp->wcursor = NULL;
+	if (bp->rcursor == ext)
+		bp->rcursor = NULL;
+	if (bp->rcursor_next == ext)
+		bp->rcursor_next = NULL;
+	ext2fs_free_mem(&ext);
+}
+
+static errcode_t rb_alloc_private_data (ext2fs_generic_bitmap_64 bitmap)
+{
+	struct ext2fs_rb_private *bp;
+	errcode_t	retval;
+
+	retval = ext2fs_get_mem(sizeof (struct ext2fs_rb_private), &bp);
+	if (retval)
+		return retval;
+
+	bp->root = RB_ROOT;
+	bp->rcursor = NULL;
+	bp->rcursor_next = NULL;
+	bp->wcursor = NULL;
+
+#ifdef ENABLE_BMAP_STATS_OPS
+	bp->test_hit = 0;
+	bp->mark_hit = 0;
+#endif
+
+	bitmap->private = (void *) bp;
+	return 0;
+}
+
+static errcode_t rb_new_bmap(ext2_filsys fs EXT2FS_ATTR((unused)),
+			     ext2fs_generic_bitmap_64 bitmap)
+{
+	errcode_t	retval;
+
+	retval = rb_alloc_private_data (bitmap);
+	if (retval)
+		return retval;
+
+	return 0;
+}
+
+static void rb_free_tree(struct rb_root *root)
+{
+	struct bmap_rb_extent *ext;
+	struct rb_node *node, *next;
+
+	for (node = ext2fs_rb_first(root); node; node = next) {
+		next = ext2fs_rb_next(node);
+		ext = node_to_extent(node);
+		ext2fs_rb_erase(node, root);
+		ext2fs_free_mem(&ext);
+	}
+}
+
+static void rb_free_bmap(ext2fs_generic_bitmap_64 bitmap)
+{
+	struct ext2fs_rb_private *bp;
+
+	bp = (struct ext2fs_rb_private *) bitmap->private;
+
+	rb_free_tree(&bp->root);
+	ext2fs_free_mem(&bp);
+	bp = 0;
+}
+
+static errcode_t rb_copy_bmap(ext2fs_generic_bitmap_64 src,
+			      ext2fs_generic_bitmap_64 dest)
+{
+	struct ext2fs_rb_private *src_bp, *dest_bp;
+	struct bmap_rb_extent *src_ext, *dest_ext;
+	struct rb_node *dest_node, *src_node, *dest_last, **n;
+	errcode_t retval = 0;
+
+	retval = rb_alloc_private_data (dest);
+	if (retval)
+		return retval;
+
+	src_bp = (struct ext2fs_rb_private *) src->private;
+	dest_bp = (struct ext2fs_rb_private *) dest->private;
+	src_bp->rcursor = NULL;
+	dest_bp->rcursor = NULL;
+
+	src_node = ext2fs_rb_first(&src_bp->root);
+	while (src_node) {
+		src_ext = node_to_extent(src_node);
+		retval = ext2fs_get_mem(sizeof (struct bmap_rb_extent),
+					&dest_ext);
+		if (retval)
+			break;
+
+		memcpy(dest_ext, src_ext, sizeof(struct bmap_rb_extent));
+
+		dest_node = &dest_ext->node;
+		n = &dest_bp->root.rb_node;
+
+		dest_last = NULL;
+		if (*n) {
+			dest_last = ext2fs_rb_last(&dest_bp->root);
+			n = &(dest_last)->rb_right;
+		}
+
+		ext2fs_rb_link_node(dest_node, dest_last, n);
+		ext2fs_rb_insert_color(dest_node, &dest_bp->root);
+
+		src_node = ext2fs_rb_next(src_node);
+	}
+
+	return retval;
+}
+
+static void rb_truncate(__u64 new_max, struct rb_root *root)
+{
+	struct bmap_rb_extent *ext;
+	struct rb_node *node;
+
+	node = ext2fs_rb_last(root);
+	while (node) {
+		ext = node_to_extent(node);
+
+		if ((ext->start + ext->count - 1) <= new_max)
+			break;
+		else if (ext->start > new_max) {
+			ext2fs_rb_erase(node, root);
+			ext2fs_free_mem(&ext);
+			node = ext2fs_rb_last(root);
+			continue;
+		} else
+			ext->count = new_max - ext->start + 1;
+	}
+}
+
+static errcode_t rb_resize_bmap(ext2fs_generic_bitmap_64 bmap,
+				__u64 new_end, __u64 new_real_end)
+{
+	struct ext2fs_rb_private *bp;
+
+	bp = (struct ext2fs_rb_private *) bmap->private;
+	bp->rcursor = NULL;
+	bp->wcursor = NULL;
+
+	rb_truncate(((new_end < bmap->end) ? new_end : bmap->end) - bmap->start,
+		    &bp->root);
+
+	bmap->end = new_end;
+	bmap->real_end = new_real_end;
+
+	if (bmap->end < bmap->real_end)
+		rb_insert_extent(bmap->end + 1 - bmap->start,
+				 bmap->real_end - bmap->end, bp);
+	return 0;
+
+}
+
+inline static int
+rb_test_bit(struct ext2fs_rb_private *bp, __u64 bit)
+{
+	struct bmap_rb_extent *rcursor, *next_ext = NULL;
+	struct rb_node *parent = NULL, *next;
+	struct rb_node **n = &bp->root.rb_node;
+	struct bmap_rb_extent *ext;
+
+	rcursor = bp->rcursor;
+	if (!rcursor)
+		goto search_tree;
+
+	if (bit >= rcursor->start && bit < rcursor->start + rcursor->count) {
+#ifdef ENABLE_BMAP_STATS_OPS
+		bp->test_hit++;
+#endif
+		return 1;
+	}
+
+	next_ext = bp->rcursor_next;
+	if (!next_ext) {
+		next = ext2fs_rb_next(&rcursor->node);
+		if (next)
+			next_ext = node_to_extent(next);
+		bp->rcursor_next = next_ext;
+	}
+	if (next_ext) {
+		if ((bit >= rcursor->start + rcursor->count) &&
+		    (bit < next_ext->start)) {
+#ifdef BMAP_STATS_OPS
+			bp->test_hit++;
+#endif
+			return 0;
+		}
+	}
+	bp->rcursor = NULL;
+	bp->rcursor_next = NULL;
+
+	rcursor = bp->wcursor;
+	if (!rcursor)
+		goto search_tree;
+
+	if (bit >= rcursor->start && bit < rcursor->start + rcursor->count)
+		return 1;
+
+search_tree:
+
+	while (*n) {
+		parent = *n;
+		ext = node_to_extent(parent);
+		if (bit < ext->start)
+			n = &(*n)->rb_left;
+		else if (bit >= (ext->start + ext->count))
+			n = &(*n)->rb_right;
+		else {
+			bp->rcursor = ext;
+			bp->rcursor_next = NULL;
+			return 1;
+		}
+	}
+	return 0;
+}
+
+static int rb_insert_extent(__u64 start, __u64 count,
+			    struct ext2fs_rb_private *bp)
+{
+	struct rb_root *root = &bp->root;
+	struct rb_node *parent = NULL, **n = &root->rb_node;
+	struct rb_node *new_node, *node, *next;
+	struct bmap_rb_extent *new_ext;
+	struct bmap_rb_extent *ext;
+	int retval = 0;
+
+	if (count == 0)
+		return 0;
+
+	bp->rcursor_next = NULL;
+	ext = bp->wcursor;
+	if (ext) {
+		if (start >= ext->start &&
+		    start <= (ext->start + ext->count)) {
+#ifdef ENABLE_BMAP_STATS_OPS
+			bp->mark_hit++;
+#endif
+			goto got_extent;
+		}
+	}
+
+	while (*n) {
+		parent = *n;
+		ext = node_to_extent(parent);
+
+		if (start < ext->start) {
+			n = &(*n)->rb_left;
+		} else if (start > (ext->start + ext->count)) {
+			n = &(*n)->rb_right;
+		} else {
+got_extent:
+			if ((start + count) <= (ext->start + ext->count))
+				return 1;
+
+			if ((ext->start + ext->count) == start)
+				retval = 0;
+			else
+				retval = 1;
+
+			count += (start - ext->start);
+			start = ext->start;
+			new_ext = ext;
+			new_node = &ext->node;
+
+			goto skip_insert;
+		}
+	}
+
+	rb_get_new_extent(&new_ext, start, count);
+
+	new_node = &new_ext->node;
+	ext2fs_rb_link_node(new_node, parent, n);
+	ext2fs_rb_insert_color(new_node, root);
+	bp->wcursor = new_ext;
+
+	node = ext2fs_rb_prev(new_node);
+	if (node) {
+		ext = node_to_extent(node);
+		if ((ext->start + ext->count) == start) {
+			start = ext->start;
+			count += ext->count;
+			ext2fs_rb_erase(node, root);
+			rb_free_extent(bp, ext);
+		}
+	}
+
+skip_insert:
+	/* See if we can merge extent to the right */
+	for (node = ext2fs_rb_next(new_node); node != NULL; node = next) {
+		next = ext2fs_rb_next(node);
+		ext = node_to_extent(node);
+
+		if ((ext->start + ext->count) <= start)
+			continue;
+
+		/* No more merging */
+		if ((start + count) < ext->start)
+			break;
+
+		/* ext is embedded in new_ext interval */
+		if ((start + count) >= (ext->start + ext->count)) {
+			ext2fs_rb_erase(node, root);
+			rb_free_extent(bp, ext);
+			continue;
+		} else {
+		/* merge ext with new_ext */
+			count += ((ext->start + ext->count) -
+				  (start + count));
+			ext2fs_rb_erase(node, root);
+			rb_free_extent(bp, ext);
+			break;
+		}
+	}
+
+	new_ext->start = start;
+	new_ext->count = count;
+
+	return retval;
+}
+
+static int rb_remove_extent(__u64 start, __u64 count,
+			    struct ext2fs_rb_private *bp)
+{
+	struct rb_root *root = &bp->root;
+	struct rb_node *parent = NULL, **n = &root->rb_node;
+	struct rb_node *node;
+	struct bmap_rb_extent *ext;
+	__u64 new_start, new_count;
+	int retval = 0;
+
+	if (ext2fs_rb_empty_root(root))
+		return 0;
+
+	while (*n) {
+		parent = *n;
+		ext = node_to_extent(parent);
+		if (start < ext->start) {
+			n = &(*n)->rb_left;
+			continue;
+		} else if (start >= (ext->start + ext->count)) {
+			n = &(*n)->rb_right;
+			continue;
+		}
+
+		if ((start > ext->start) &&
+		    (start + count) < (ext->start + ext->count)) {
+			/* We have to split extent into two */
+			new_start = start + count;
+			new_count = (ext->start + ext->count) - new_start;
+
+			ext->count = start - ext->start;
+
+			rb_insert_extent(new_start, new_count, bp);
+			return 1;
+		}
+
+		if ((start + count) >= (ext->start + ext->count)) {
+			ext->count = start - ext->start;
+			retval = 1;
+		}
+
+		if (0 == ext->count) {
+			parent = ext2fs_rb_next(&ext->node);
+			ext2fs_rb_erase(&ext->node, root);
+			rb_free_extent(bp, ext);
+			break;
+		}
+
+		if (start == ext->start) {
+			ext->start += count;
+			ext->count -= count;
+			return 1;
+		}
+	}
+
+	/* See if we should delete or truncate extent on the right */
+	for (; parent != NULL; parent = node) {
+		node = ext2fs_rb_next(parent);
+		ext = node_to_extent(parent);
+		if ((ext->start + ext->count) <= start)
+			continue;
+
+		/* No more extents to be removed/truncated */
+		if ((start + count) < ext->start)
+			break;
+
+		/* The entire extent is within the region to be removed */
+		if ((start + count) >= (ext->start + ext->count)) {
+			ext2fs_rb_erase(parent, root);
+			rb_free_extent(bp, ext);
+			retval = 1;
+			continue;
+		} else {
+			/* modify the last extent in region to be removed */
+			ext->count -= ((start + count) - ext->start);
+			ext->start = start + count;
+			retval = 1;
+			break;
+		}
+	}
+
+	return retval;
+}
+
+static int rb_mark_bmap(ext2fs_generic_bitmap_64 bitmap, __u64 arg)
+{
+	struct ext2fs_rb_private *bp;
+	int retval;
+
+	bp = (struct ext2fs_rb_private *) bitmap->private;
+	arg -= bitmap->start;
+
+	retval = rb_insert_extent(arg, 1, bp);
+	check_tree(&bp->root, __func__);
+	return retval;
+}
+
+static int rb_unmark_bmap(ext2fs_generic_bitmap_64 bitmap, __u64 arg)
+{
+	struct ext2fs_rb_private *bp;
+	int retval;
+
+	bp = (struct ext2fs_rb_private *) bitmap->private;
+	arg -= bitmap->start;
+
+	retval = rb_remove_extent(arg, 1, bp);
+	check_tree(&bp->root, __func__);
+
+	return retval;
+}
+
+inline
+static int rb_test_bmap(ext2fs_generic_bitmap_64 bitmap, __u64 arg)
+{
+	struct ext2fs_rb_private *bp;
+
+	bp = (struct ext2fs_rb_private *) bitmap->private;
+	arg -= bitmap->start;
+
+	return rb_test_bit(bp, arg);
+}
+
+static void rb_mark_bmap_extent(ext2fs_generic_bitmap_64 bitmap, __u64 arg,
+				unsigned int num)
+{
+	struct ext2fs_rb_private *bp;
+
+	bp = (struct ext2fs_rb_private *) bitmap->private;
+	arg -= bitmap->start;
+
+	rb_insert_extent(arg, num, bp);
+	check_tree(&bp->root, __func__);
+}
+
+static void rb_unmark_bmap_extent(ext2fs_generic_bitmap_64 bitmap, __u64 arg,
+				  unsigned int num)
+{
+	struct ext2fs_rb_private *bp;
+
+	bp = (struct ext2fs_rb_private *) bitmap->private;
+	arg -= bitmap->start;
+
+	rb_remove_extent(arg, num, bp);
+	check_tree(&bp->root, __func__);
+}
+
+static int rb_test_clear_bmap_extent(ext2fs_generic_bitmap_64 bitmap,
+				     __u64 start, unsigned int len)
+{
+	struct rb_node *parent = NULL, **n;
+	struct rb_node *node, *next;
+	struct ext2fs_rb_private *bp;
+	struct bmap_rb_extent *ext;
+	int retval = 1;
+
+	bp = (struct ext2fs_rb_private *) bitmap->private;
+	n = &bp->root.rb_node;
+	start -= bitmap->start;
+
+	if (len == 0 || ext2fs_rb_empty_root(&bp->root))
+		return 1;
+
+	/*
+	 * If we find nothing, we should examine whole extent, but
+	 * when we find match, the extent is not clean, thus be return
+	 * false.
+	 */
+	while (*n) {
+		parent = *n;
+		ext = node_to_extent(parent);
+		if (start < ext->start) {
+			n = &(*n)->rb_left;
+		} else if (start >= (ext->start + ext->count)) {
+			n = &(*n)->rb_right;
+		} else {
+			/*
+			 * We found extent int the tree -> extent is not
+			 * clean
+			 */
+			return 0;
+		}
+	}
+
+	node = parent;
+	while (node) {
+		next = ext2fs_rb_next(node);
+		ext = node_to_extent(node);
+		node = next;
+
+		if ((ext->start + ext->count) <= start)
+			continue;
+
+		/* No more merging */
+		if ((start + len) <= ext->start)
+			break;
+
+		retval = 0;
+		break;
+	}
+	return retval;
+}
+
+static errcode_t rb_set_bmap_range(ext2fs_generic_bitmap_64 bitmap,
+				     __u64 start, size_t num, void *in)
+{
+	struct ext2fs_rb_private *bp;
+	unsigned char *cp = in;
+	size_t i;
+	int first_set = -1;
+
+	bp = (struct ext2fs_rb_private *) bitmap->private;
+
+	for (i = 0; i < num; i++) {
+		if ((i & 7) == 0) {
+			unsigned char c = cp[i/8];
+			if (c == 0xFF) {
+				if (first_set == -1)
+					first_set = i;
+				i += 7;
+				continue;
+			}
+			if ((c == 0x00) && (first_set == -1)) {
+				i += 7;
+				continue;
+			}
+		}
+		if (ext2fs_test_bit(i, in)) {
+			if (first_set == -1)
+				first_set = i;
+			continue;
+		}
+		if (first_set == -1)
+			continue;
+
+		rb_insert_extent(start + first_set - bitmap->start,
+				 i - first_set, bp);
+		check_tree(&bp->root, __func__);
+		first_set = -1;
+	}
+	if (first_set != -1) {
+		rb_insert_extent(start + first_set - bitmap->start,
+				 num - first_set, bp);
+		check_tree(&bp->root, __func__);
+	}
+
+	return 0;
+}
+
+static errcode_t rb_get_bmap_range(ext2fs_generic_bitmap_64 bitmap,
+				     __u64 start, size_t num, void *out)
+{
+
+	struct rb_node *parent = NULL, *next, **n;
+	struct ext2fs_rb_private *bp;
+	struct bmap_rb_extent *ext;
+	__u64 count, pos;
+
+	bp = (struct ext2fs_rb_private *) bitmap->private;
+	n = &bp->root.rb_node;
+	start -= bitmap->start;
+
+	if (ext2fs_rb_empty_root(&bp->root))
+		return 0;
+
+	while (*n) {
+		parent = *n;
+		ext = node_to_extent(parent);
+		if (start < ext->start) {
+			n = &(*n)->rb_left;
+		} else if (start >= (ext->start + ext->count)) {
+			n = &(*n)->rb_right;
+		} else
+			break;
+	}
+
+	memset(out, 0, (num + 7) >> 3);
+
+	for (; parent != NULL; parent = next) {
+		next = ext2fs_rb_next(parent);
+		ext = node_to_extent(parent);
+
+		pos = ext->start;
+		count = ext->count;
+		if (pos >= start + num)
+			break;
+		if (pos < start) {
+			if (pos + count <  start)
+				continue;
+			count -= start - pos;
+			pos = start;
+		}
+		if (pos + count > start + num)
+			count = start + num - pos;
+
+		while (count > 0) {
+			if ((count >= 8) &&
+			    ((pos - start) % 8) == 0) {
+				int nbytes = count >> 3;
+				int offset = (pos - start) >> 3;
+
+				memset(((char *) out) + offset, 0xFF, nbytes);
+				pos += nbytes << 3;
+				count -= nbytes << 3;
+				continue;
+			}
+			ext2fs_fast_set_bit64((pos - start), out);
+			pos++;
+			count--;
+		}
+	}
+	return 0;
+}
+
+static void rb_clear_bmap(ext2fs_generic_bitmap_64 bitmap)
+{
+	struct ext2fs_rb_private *bp;
+
+	bp = (struct ext2fs_rb_private *) bitmap->private;
+
+	rb_free_tree(&bp->root);
+	bp->rcursor = NULL;
+	bp->rcursor_next = NULL;
+	bp->wcursor = NULL;
+	check_tree(&bp->root, __func__);
+}
+
+static errcode_t rb_find_first_zero(ext2fs_generic_bitmap_64 bitmap,
+				   __u64 start, __u64 end, __u64 *out)
+{
+	struct rb_node *parent = NULL, **n;
+	struct ext2fs_rb_private *bp;
+	struct bmap_rb_extent *ext;
+
+	bp = (struct ext2fs_rb_private *) bitmap->private;
+	n = &bp->root.rb_node;
+	start -= bitmap->start;
+	end -= bitmap->start;
+
+	if (start > end)
+		return EINVAL;
+
+	if (ext2fs_rb_empty_root(&bp->root))
+		return ENOENT;
+
+	while (*n) {
+		parent = *n;
+		ext = node_to_extent(parent);
+		if (start < ext->start) {
+			n = &(*n)->rb_left;
+		} else if (start >= (ext->start + ext->count)) {
+			n = &(*n)->rb_right;
+		} else if (ext->start + ext->count <= end) {
+			*out = ext->start + ext->count + bitmap->start;
+			return 0;
+		} else
+			return ENOENT;
+	}
+
+	*out = start + bitmap->start;
+	return 0;
+}
+
+static errcode_t rb_find_first_set(ext2fs_generic_bitmap_64 bitmap,
+				   __u64 start, __u64 end, __u64 *out)
+{
+	struct rb_node *parent = NULL, **n;
+	struct rb_node *node;
+	struct ext2fs_rb_private *bp;
+	struct bmap_rb_extent *ext;
+
+	bp = (struct ext2fs_rb_private *) bitmap->private;
+	n = &bp->root.rb_node;
+	start -= bitmap->start;
+	end -= bitmap->start;
+
+	if (start > end)
+		return EINVAL;
+
+	if (ext2fs_rb_empty_root(&bp->root))
+		return ENOENT;
+
+	while (*n) {
+		parent = *n;
+		ext = node_to_extent(parent);
+		if (start < ext->start) {
+			n = &(*n)->rb_left;
+		} else if (start >= (ext->start + ext->count)) {
+			n = &(*n)->rb_right;
+		} else {
+			/* The start bit is set */
+			*out = start + bitmap->start;
+			return 0;
+		}
+	}
+
+	node = parent;
+	ext = node_to_extent(node);
+	if (ext->start < start) {
+		node = ext2fs_rb_next(node);
+		if (node == NULL)
+			return ENOENT;
+		ext = node_to_extent(node);
+	}
+	if (ext->start <= end) {
+		*out = ext->start + bitmap->start;
+		return 0;
+	}
+	return ENOENT;
+}
+
+#ifdef ENABLE_BMAP_STATS
+static void rb_print_stats(ext2fs_generic_bitmap_64 bitmap)
+{
+	struct ext2fs_rb_private *bp;
+	struct rb_node *node = NULL;
+	struct bmap_rb_extent *ext;
+	__u64 count = 0;
+	__u64 max_size = 0;
+	__u64 min_size = ULONG_MAX;
+	__u64 size = 0, avg_size = 0;
+	double eff;
+#ifdef ENABLE_BMAP_STATS_OPS
+	__u64 mark_all, test_all;
+	double m_hit = 0.0, t_hit = 0.0;
+#endif
+
+	bp = (struct ext2fs_rb_private *) bitmap->private;
+
+	for (node = ext2fs_rb_first(&bp->root); node != NULL;
+	     node = ext2fs_rb_next(node)) {
+		ext = node_to_extent(node);
+		count++;
+		if (ext->count > max_size)
+			max_size = ext->count;
+		if (ext->count < min_size)
+			min_size = ext->count;
+		size += ext->count;
+	}
+
+	if (count)
+		avg_size = size / count;
+	if (min_size == ULONG_MAX)
+		min_size = 0;
+	eff = (double)((count * sizeof(struct bmap_rb_extent)) << 3) /
+	      (bitmap->real_end - bitmap->start);
+#ifdef ENABLE_BMAP_STATS_OPS
+	mark_all = bitmap->stats.mark_count + bitmap->stats.mark_ext_count;
+	test_all = bitmap->stats.test_count + bitmap->stats.test_ext_count;
+	if (mark_all)
+		m_hit = ((double)bp->mark_hit / mark_all) * 100;
+	if (test_all)
+		t_hit = ((double)bp->test_hit / test_all) * 100;
+
+	fprintf(stderr, "%16llu cache hits on test (%.2f%%)\n"
+		"%16llu cache hits on mark (%.2f%%)\n",
+		bp->test_hit, t_hit, bp->mark_hit, m_hit);
+#endif
+	fprintf(stderr, "%16llu extents (%llu bytes)\n",
+		(unsigned long long) count, (unsigned long long)
+		((count * sizeof(struct bmap_rb_extent)) +
+		 sizeof(struct ext2fs_rb_private)));
+ 	fprintf(stderr, "%16llu bits minimum size\n",
+		(unsigned long long) min_size);
+	fprintf(stderr, "%16llu bits maximum size\n"
+		"%16llu bits average size\n",
+		(unsigned long long) max_size, (unsigned long long) avg_size);
+	fprintf(stderr, "%16llu bits set in bitmap (out of %llu)\n",
+		(unsigned long long) size,
+		(unsigned long long) bitmap->real_end - bitmap->start);
+	fprintf(stderr,
+		"%16.4lf memory / bitmap bit memory ratio (bitarray = 1)\n",
+		eff);
+}
+#else
+static void rb_print_stats(ext2fs_generic_bitmap_64 bitmap EXT2FS_ATTR((unused)))
+{
+}
+#endif
+
+struct ext2_bitmap_ops ext2fs_blkmap64_rbtree = {
+	.type = EXT2FS_BMAP64_RBTREE,
+	.new_bmap = rb_new_bmap,
+	.free_bmap = rb_free_bmap,
+	.copy_bmap = rb_copy_bmap,
+	.resize_bmap = rb_resize_bmap,
+	.mark_bmap = rb_mark_bmap,
+	.unmark_bmap = rb_unmark_bmap,
+	.test_bmap = rb_test_bmap,
+	.test_clear_bmap_extent = rb_test_clear_bmap_extent,
+	.mark_bmap_extent = rb_mark_bmap_extent,
+	.unmark_bmap_extent = rb_unmark_bmap_extent,
+	.set_bmap_range = rb_set_bmap_range,
+	.get_bmap_range = rb_get_bmap_range,
+	.clear_bmap = rb_clear_bmap,
+	.print_stats = rb_print_stats,
+	.find_first_zero = rb_find_first_zero,
+	.find_first_set = rb_find_first_set,
+};
diff --git a/lib/ext2fs/blknum.c b/lib/ext2fs/blknum.c
new file mode 100644
index 0000000..04839d8
--- /dev/null
+++ b/lib/ext2fs/blknum.c
@@ -0,0 +1,606 @@
+/*
+ * blknum.c --- Functions to handle blk64_t and high/low 64-bit block
+ * number.
+ *
+ * Copyright IBM Corporation, 2007
+ * Author Jose R. Santos <jrs@us.ibm.com>
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Public
+ * License.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include "ext2fs.h"
+
+/*
+ * Return the group # of a block
+ */
+dgrp_t ext2fs_group_of_blk2(ext2_filsys fs, blk64_t blk)
+{
+	return (blk - fs->super->s_first_data_block) /
+		fs->super->s_blocks_per_group;
+}
+
+/*
+ * Return the first block (inclusive) in a group
+ */
+blk64_t ext2fs_group_first_block2(ext2_filsys fs, dgrp_t group)
+{
+	return fs->super->s_first_data_block +
+		EXT2_GROUPS_TO_BLOCKS(fs->super, group);
+}
+
+/*
+ * Return the last block (inclusive) in a group
+ */
+blk64_t ext2fs_group_last_block2(ext2_filsys fs, dgrp_t group)
+{
+	return (group == fs->group_desc_count - 1 ?
+		ext2fs_blocks_count(fs->super) - 1 :
+		ext2fs_group_first_block2(fs, group) +
+			(fs->super->s_blocks_per_group - 1));
+}
+
+/*
+ * Return the number of blocks in a group
+ */
+int ext2fs_group_blocks_count(ext2_filsys fs, dgrp_t group)
+{
+	int num_blocks;
+
+	if (group == fs->group_desc_count - 1) {
+		num_blocks = (ext2fs_blocks_count(fs->super) -
+				fs->super->s_first_data_block) %
+			      fs->super->s_blocks_per_group;
+		if (!num_blocks)
+			num_blocks = fs->super->s_blocks_per_group;
+	} else
+		num_blocks = fs->super->s_blocks_per_group;
+
+	return num_blocks;
+}
+
+/*
+ * Return the inode data block count
+ */
+blk64_t ext2fs_inode_data_blocks2(ext2_filsys fs,
+					struct ext2_inode *inode)
+{
+	return (inode->i_blocks |
+		(ext2fs_has_feature_huge_file(fs->super) ?
+		 (__u64) inode->osd2.linux2.l_i_blocks_hi << 32 : 0)) -
+		(inode->i_file_acl ? EXT2_CLUSTER_SIZE(fs->super) >> 9 : 0);
+}
+
+/*
+ * Return the inode i_blocks count
+ */
+blk64_t ext2fs_inode_i_blocks(ext2_filsys fs,
+					struct ext2_inode *inode)
+{
+	return (inode->i_blocks |
+		(ext2fs_has_feature_huge_file(fs->super) ?
+		 (__u64)inode->osd2.linux2.l_i_blocks_hi << 32 : 0));
+}
+
+/*
+ * Return the inode i_blocks in stat (512 byte) units
+ */
+blk64_t ext2fs_get_stat_i_blocks(ext2_filsys fs,
+				 struct ext2_inode *inode)
+{
+	blk64_t	ret = inode->i_blocks;
+
+	if (ext2fs_has_feature_huge_file(fs->super)) {
+		ret += ((long long) inode->osd2.linux2.l_i_blocks_hi) << 32;
+		if (inode->i_flags & EXT4_HUGE_FILE_FL)
+			ret *= (fs->blocksize / 512);
+	}
+	return ret;
+}
+
+/*
+ * Return the fs block count
+ */
+blk64_t ext2fs_blocks_count(struct ext2_super_block *super)
+{
+	return super->s_blocks_count |
+		(ext2fs_has_feature_64bit(super) ?
+		(__u64) super->s_blocks_count_hi << 32 : 0);
+}
+
+/*
+ * Set the fs block count
+ */
+void ext2fs_blocks_count_set(struct ext2_super_block *super, blk64_t blk)
+{
+	super->s_blocks_count = blk;
+	if (ext2fs_has_feature_64bit(super))
+		super->s_blocks_count_hi = (__u64) blk >> 32;
+}
+
+/*
+ * Add to the current fs block count
+ */
+void ext2fs_blocks_count_add(struct ext2_super_block *super, blk64_t blk)
+{
+	blk64_t tmp;
+	tmp = ext2fs_blocks_count(super) + blk;
+	ext2fs_blocks_count_set(super, tmp);
+}
+
+/*
+ * Return the fs reserved block count
+ */
+blk64_t ext2fs_r_blocks_count(struct ext2_super_block *super)
+{
+	return super->s_r_blocks_count |
+		(ext2fs_has_feature_64bit(super) ?
+		(__u64) super->s_r_blocks_count_hi << 32 : 0);
+}
+
+/*
+ * Set the fs reserved block count
+ */
+void ext2fs_r_blocks_count_set(struct ext2_super_block *super, blk64_t blk)
+{
+	super->s_r_blocks_count = blk;
+	if (ext2fs_has_feature_64bit(super))
+		super->s_r_blocks_count_hi = (__u64) blk >> 32;
+}
+
+/*
+ * Add to the current reserved fs block count
+ */
+void ext2fs_r_blocks_count_add(struct ext2_super_block *super, blk64_t blk)
+{
+	blk64_t tmp;
+	tmp = ext2fs_r_blocks_count(super) + blk;
+	ext2fs_r_blocks_count_set(super, tmp);
+}
+
+/*
+ * Return the fs free block count
+ */
+blk64_t ext2fs_free_blocks_count(struct ext2_super_block *super)
+{
+	return super->s_free_blocks_count |
+		(ext2fs_has_feature_64bit(super) ?
+		(__u64) super->s_free_blocks_hi << 32 : 0);
+}
+
+/*
+ * Set the fs free block count
+ */
+void ext2fs_free_blocks_count_set(struct ext2_super_block *super, blk64_t blk)
+{
+	super->s_free_blocks_count = blk;
+	if (ext2fs_has_feature_64bit(super))
+		super->s_free_blocks_hi = (__u64) blk >> 32;
+}
+
+/*
+ * Add to the current free fs block count
+ */
+void ext2fs_free_blocks_count_add(struct ext2_super_block *super, blk64_t blk)
+{
+	blk64_t tmp;
+	tmp = ext2fs_free_blocks_count(super) + blk;
+	ext2fs_free_blocks_count_set(super, tmp);
+}
+
+/*
+ * Get a pointer to a block group descriptor.  We need the explicit
+ * pointer to the group desc for code that swaps block group
+ * descriptors before writing them out, as it wants to make a copy and
+ * do the swap there.
+ */
+struct ext2_group_desc *ext2fs_group_desc(ext2_filsys fs,
+					  struct opaque_ext2_group_desc *gdp,
+					  dgrp_t group)
+{
+	struct ext2_group_desc *ret_gdp;
+	errcode_t	retval;
+	static char	*buf = 0;
+	static unsigned	bufsize = 0;
+	blk64_t		blk;
+	int		desc_size = EXT2_DESC_SIZE(fs->super) & ~7;
+	int		desc_per_blk = EXT2_DESC_PER_BLOCK(fs->super);
+
+	if (group > fs->group_desc_count)
+		return NULL;
+	if (gdp)
+		return (struct ext2_group_desc *)((char *)gdp +
+						  group * desc_size);
+	/*
+	 * If fs->group_desc wasn't read in when the file system was
+	 * opened, then read it on demand here.
+	 */
+	if (bufsize < fs->blocksize)
+		ext2fs_free_mem(&buf);
+	if (!buf) {
+		retval = ext2fs_get_mem(fs->blocksize, &buf);
+		if (retval)
+			return NULL;
+		bufsize = fs->blocksize;
+	}
+	blk = ext2fs_descriptor_block_loc2(fs, fs->super->s_first_data_block,
+					   group / desc_per_blk);
+	retval = io_channel_read_blk(fs->io, blk, 1, buf);
+	if (retval)
+		return NULL;
+	ret_gdp = (struct ext2_group_desc *)
+		(buf + ((group % desc_per_blk) * desc_size));
+#ifdef WORDS_BIGENDIAN
+	ext2fs_swap_group_desc2(fs, ret_gdp);
+#endif
+	return ret_gdp;
+}
+
+/* Do the same but as an ext4 group desc for internal use here */
+static struct ext4_group_desc *ext4fs_group_desc(ext2_filsys fs,
+					  struct opaque_ext2_group_desc *gdp,
+					  dgrp_t group)
+{
+	return (struct ext4_group_desc *)ext2fs_group_desc(fs, gdp, group);
+}
+
+/*
+ * Return the block bitmap checksum of a group
+ */
+__u32 ext2fs_block_bitmap_checksum(ext2_filsys fs, dgrp_t group)
+{
+	struct ext4_group_desc *gdp;
+	__u32 csum;
+
+	gdp = ext4fs_group_desc(fs, fs->group_desc, group);
+	csum = gdp->bg_block_bitmap_csum_lo;
+	if (EXT2_DESC_SIZE(fs->super) >= EXT4_BG_BLOCK_BITMAP_CSUM_HI_LOCATION)
+		csum |= ((__u32)gdp->bg_block_bitmap_csum_hi << 16);
+	return csum;
+}
+
+/*
+ * Return the block bitmap block of a group
+ */
+blk64_t ext2fs_block_bitmap_loc(ext2_filsys fs, dgrp_t group)
+{
+	struct ext4_group_desc *gdp;
+
+	gdp = ext4fs_group_desc(fs, fs->group_desc, group);
+	return gdp->bg_block_bitmap |
+		(ext2fs_has_feature_64bit(fs->super) ?
+		 (__u64)gdp->bg_block_bitmap_hi << 32 : 0);
+}
+
+/*
+ * Set the block bitmap block of a group
+ */
+void ext2fs_block_bitmap_loc_set(ext2_filsys fs, dgrp_t group, blk64_t blk)
+{
+	struct ext4_group_desc *gdp;
+
+	gdp = ext4fs_group_desc(fs, fs->group_desc, group);
+	gdp->bg_block_bitmap = blk;
+	if (ext2fs_has_feature_64bit(fs->super))
+		gdp->bg_block_bitmap_hi = (__u64) blk >> 32;
+}
+
+/*
+ * Return the inode bitmap checksum of a group
+ */
+__u32 ext2fs_inode_bitmap_checksum(ext2_filsys fs, dgrp_t group)
+{
+	struct ext4_group_desc *gdp;
+	__u32 csum;
+
+	gdp = ext4fs_group_desc(fs, fs->group_desc, group);
+	csum = gdp->bg_inode_bitmap_csum_lo;
+	if (EXT2_DESC_SIZE(fs->super) >= EXT4_BG_INODE_BITMAP_CSUM_HI_END)
+		csum |= ((__u32)gdp->bg_inode_bitmap_csum_hi << 16);
+	return csum;
+}
+
+/*
+ * Return the inode bitmap block of a group
+ */
+blk64_t ext2fs_inode_bitmap_loc(ext2_filsys fs, dgrp_t group)
+{
+	struct ext4_group_desc *gdp;
+
+	gdp = ext4fs_group_desc(fs, fs->group_desc, group);
+	return gdp->bg_inode_bitmap |
+		(ext2fs_has_feature_64bit(fs->super) ?
+		 (__u64) gdp->bg_inode_bitmap_hi << 32 : 0);
+}
+
+/*
+ * Set the inode bitmap block of a group
+ */
+void ext2fs_inode_bitmap_loc_set(ext2_filsys fs, dgrp_t group, blk64_t blk)
+{
+	struct ext4_group_desc *gdp;
+
+	gdp = ext4fs_group_desc(fs, fs->group_desc, group);
+	gdp->bg_inode_bitmap = blk;
+	if (ext2fs_has_feature_64bit(fs->super))
+		gdp->bg_inode_bitmap_hi = (__u64) blk >> 32;
+}
+
+/*
+ * Return the inode table block of a group
+ */
+blk64_t ext2fs_inode_table_loc(ext2_filsys fs, dgrp_t group)
+{
+	struct ext4_group_desc *gdp;
+
+	gdp = ext4fs_group_desc(fs, fs->group_desc, group);
+	return gdp->bg_inode_table |
+		(ext2fs_has_feature_64bit(fs->super) ?
+		 (__u64) gdp->bg_inode_table_hi << 32 : 0);
+}
+
+/*
+ * Set the inode table block of a group
+ */
+void ext2fs_inode_table_loc_set(ext2_filsys fs, dgrp_t group, blk64_t blk)
+{
+	struct ext4_group_desc *gdp;
+
+	gdp = ext4fs_group_desc(fs, fs->group_desc, group);
+	gdp->bg_inode_table = blk;
+	if (ext2fs_has_feature_64bit(fs->super))
+		gdp->bg_inode_table_hi = (__u64) blk >> 32;
+}
+
+/*
+ * Return the free blocks count of a group
+ */
+__u32 ext2fs_bg_free_blocks_count(ext2_filsys fs, dgrp_t group)
+{
+	struct ext4_group_desc *gdp;
+
+	gdp = ext4fs_group_desc(fs, fs->group_desc, group);
+	return gdp->bg_free_blocks_count |
+		(ext2fs_has_feature_64bit(fs->super) ?
+		 (__u32) gdp->bg_free_blocks_count_hi << 16 : 0);
+}
+
+/*
+ * Set the free blocks count of a group
+ */
+void ext2fs_bg_free_blocks_count_set(ext2_filsys fs, dgrp_t group, __u32 n)
+{
+	struct ext4_group_desc *gdp;
+
+	gdp = ext4fs_group_desc(fs, fs->group_desc, group);
+	gdp->bg_free_blocks_count = n;
+
+	if (ext2fs_has_feature_64bit(fs->super))
+		gdp->bg_free_blocks_count_hi = (__u32) n >> 16;
+}
+
+/*
+ * Return the free inodes count of a group
+ */
+__u32 ext2fs_bg_free_inodes_count(ext2_filsys fs, dgrp_t group)
+{
+	struct ext4_group_desc *gdp;
+
+	gdp = ext4fs_group_desc(fs, fs->group_desc, group);
+	return gdp->bg_free_inodes_count |
+		(ext2fs_has_feature_64bit(fs->super) ?
+		 (__u32) gdp->bg_free_inodes_count_hi << 16 : 0);
+}
+
+/*
+ * Set the free inodes count of a group
+ */
+void ext2fs_bg_free_inodes_count_set(ext2_filsys fs, dgrp_t group, __u32 n)
+{
+	struct ext4_group_desc *gdp;
+
+	gdp = ext4fs_group_desc(fs, fs->group_desc, group);
+	gdp->bg_free_inodes_count = n;
+	if (ext2fs_has_feature_64bit(fs->super))
+		gdp->bg_free_inodes_count_hi = (__u32) n >> 16;
+}
+
+/*
+ * Return the used dirs count of a group
+ */
+__u32 ext2fs_bg_used_dirs_count(ext2_filsys fs, dgrp_t group)
+{
+	struct ext4_group_desc *gdp;
+
+	gdp = ext4fs_group_desc(fs, fs->group_desc, group);
+	return gdp->bg_used_dirs_count |
+		(ext2fs_has_feature_64bit(fs->super) ?
+		 (__u32) gdp->bg_used_dirs_count_hi << 16 : 0);
+}
+
+/*
+ * Set the used dirs count of a group
+ */
+void ext2fs_bg_used_dirs_count_set(ext2_filsys fs, dgrp_t group, __u32 n)
+{
+	struct ext4_group_desc *gdp;
+
+	gdp = ext4fs_group_desc(fs, fs->group_desc, group);
+	gdp->bg_used_dirs_count = n;
+	if (ext2fs_has_feature_64bit(fs->super))
+		gdp->bg_used_dirs_count_hi = (__u32) n >> 16;
+}
+
+/*
+ * Return the unused inodes count of a group
+ */
+__u32 ext2fs_bg_itable_unused(ext2_filsys fs, dgrp_t group)
+{
+	struct ext4_group_desc *gdp;
+
+	gdp = ext4fs_group_desc(fs, fs->group_desc, group);
+	return gdp->bg_itable_unused |
+		(ext2fs_has_feature_64bit(fs->super) ?
+		 (__u32) gdp->bg_itable_unused_hi << 16 : 0);
+}
+
+/*
+ * Set the unused inodes count of a group
+ */
+void ext2fs_bg_itable_unused_set(ext2_filsys fs, dgrp_t group, __u32 n)
+{
+	struct ext4_group_desc *gdp;
+
+	gdp = ext4fs_group_desc(fs, fs->group_desc, group);
+	gdp->bg_itable_unused = n;
+	if (ext2fs_has_feature_64bit(fs->super))
+		gdp->bg_itable_unused_hi = (__u32) n >> 16;
+}
+
+/*
+ * Get the flags for this block group
+ */
+__u16 ext2fs_bg_flags(ext2_filsys fs, dgrp_t group)
+{
+	struct ext4_group_desc *gdp;
+
+	gdp = ext4fs_group_desc(fs, fs->group_desc, group);
+	return gdp->bg_flags;
+}
+
+/*
+ * Zero out the flags for this block group
+ */
+void ext2fs_bg_flags_zap(ext2_filsys fs, dgrp_t group)
+{
+	struct ext4_group_desc *gdp;
+
+	gdp = ext4fs_group_desc(fs, fs->group_desc, group);
+	gdp->bg_flags = 0;
+	return;
+}
+
+/*
+ * Get the value of a particular flag for this block group
+ */
+int ext2fs_bg_flags_test(ext2_filsys fs, dgrp_t group, __u16 bg_flag)
+{
+	struct ext4_group_desc *gdp;
+
+	gdp = ext4fs_group_desc(fs, fs->group_desc, group);
+	return gdp->bg_flags & bg_flag;
+}
+
+/*
+ * Set a flag or set of flags for this block group
+ */
+void ext2fs_bg_flags_set(ext2_filsys fs, dgrp_t group, __u16 bg_flags)
+{
+	struct ext4_group_desc *gdp;
+
+	gdp = ext4fs_group_desc(fs, fs->group_desc, group);
+	gdp->bg_flags |= bg_flags;
+	return;
+}
+
+/*
+ * Clear a flag or set of flags for this block group
+ */
+void ext2fs_bg_flags_clear(ext2_filsys fs, dgrp_t group, __u16 bg_flags)
+{
+	struct ext4_group_desc *gdp;
+
+	gdp = ext4fs_group_desc(fs, fs->group_desc, group);
+	gdp->bg_flags &= ~bg_flags;
+	return;
+}
+
+/*
+ * Get the checksum for this block group
+ */
+__u16 ext2fs_bg_checksum(ext2_filsys fs, dgrp_t group)
+{
+	struct ext4_group_desc *gdp;
+
+	gdp = ext4fs_group_desc(fs, fs->group_desc, group);
+	return gdp->bg_checksum;
+}
+
+/*
+ * Set the checksum for this block group to a previously calculated value
+ */
+void ext2fs_bg_checksum_set(ext2_filsys fs, dgrp_t group, __u16 checksum)
+{
+	struct ext4_group_desc *gdp;
+
+	gdp = ext4fs_group_desc(fs, fs->group_desc, group);
+	gdp->bg_checksum = checksum;
+	return;
+}
+
+/*
+ * Get the acl block of a file
+ */
+blk64_t ext2fs_file_acl_block(ext2_filsys fs, const struct ext2_inode *inode)
+{
+	blk64_t	blk = inode->i_file_acl;
+
+	if (fs && ext2fs_has_feature_64bit(fs->super))
+		blk |= ((__u64) inode->osd2.linux2.l_i_file_acl_high) << 32;
+	return blk;
+}
+
+/*
+ * Set the acl block of a file
+ */
+void ext2fs_file_acl_block_set(ext2_filsys fs, struct ext2_inode *inode,
+			       blk64_t blk)
+{
+	inode->i_file_acl = blk;
+	if (fs && ext2fs_has_feature_64bit(fs->super))
+		inode->osd2.linux2.l_i_file_acl_high = (__u64) blk >> 32;
+}
+
+/*
+ * Set the size of the inode
+ */
+errcode_t ext2fs_inode_size_set(ext2_filsys fs, struct ext2_inode *inode,
+				ext2_off64_t size)
+{
+	if (size < 0)
+		return EINVAL;
+
+	/* If writing a large inode, set the large_file or large_dir flag */
+	if (ext2fs_needs_large_file_feature(size)) {
+		int dirty_sb = 0;
+
+		if (LINUX_S_ISREG(inode->i_mode)) {
+			if (!ext2fs_has_feature_large_file(fs->super)) {
+				ext2fs_set_feature_large_file(fs->super);
+				dirty_sb = 1;
+			}
+		} else if (LINUX_S_ISDIR(inode->i_mode)) {
+			if (!ext2fs_has_feature_largedir(fs->super)) {
+				ext2fs_set_feature_largedir(fs->super);
+				dirty_sb = 1;
+			}
+		} else {
+			/* Only regular files get to be larger than 4GB */
+			return EXT2_ET_FILE_TOO_BIG;
+		}
+		if (dirty_sb) {
+			if (fs->super->s_rev_level == EXT2_GOOD_OLD_REV)
+				ext2fs_update_dynamic_rev(fs);
+			ext2fs_mark_super_dirty(fs);
+		}
+	}
+
+	inode->i_size = size & 0xffffffff;
+	inode->i_size_high = (size >> 32);
+
+	return 0;
+}
+
diff --git a/lib/ext2fs/block.c b/lib/ext2fs/block.c
new file mode 100644
index 0000000..06eed6e
--- /dev/null
+++ b/lib/ext2fs/block.c
@@ -0,0 +1,659 @@
+/*
+ * block.c --- iterate over all blocks in an inode
+ *
+ * Copyright (C) 1993, 1994, 1995, 1996 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+struct block_context {
+	ext2_filsys	fs;
+	int (*func)(ext2_filsys	fs,
+		    blk64_t	*blocknr,
+		    e2_blkcnt_t	bcount,
+		    blk64_t	ref_blk,
+		    int		ref_offset,
+		    void	*priv_data);
+	e2_blkcnt_t	bcount;
+	int		bsize;
+	int		flags;
+	errcode_t	errcode;
+	char	*ind_buf;
+	char	*dind_buf;
+	char	*tind_buf;
+	void	*priv_data;
+};
+
+#define check_for_ro_violation_return(ctx, ret)				\
+	do {								\
+		if (((ctx)->flags & BLOCK_FLAG_READ_ONLY) &&		\
+		    ((ret) & BLOCK_CHANGED)) {				\
+			(ctx)->errcode = EXT2_ET_RO_BLOCK_ITERATE;	\
+			ret |= BLOCK_ABORT | BLOCK_ERROR;		\
+			return ret;					\
+		}							\
+	} while (0)
+
+#define check_for_ro_violation_goto(ctx, ret, label)			\
+	do {								\
+		if (((ctx)->flags & BLOCK_FLAG_READ_ONLY) &&		\
+		    ((ret) & BLOCK_CHANGED)) {				\
+			(ctx)->errcode = EXT2_ET_RO_BLOCK_ITERATE;	\
+			ret |= BLOCK_ABORT | BLOCK_ERROR;		\
+			goto label;					\
+		}							\
+	} while (0)
+
+static int block_iterate_ind(blk_t *ind_block, blk_t ref_block,
+			     int ref_offset, struct block_context *ctx)
+{
+	int	ret = 0, changed = 0;
+	int	i, flags, limit, offset;
+	blk_t	*block_nr;
+	blk64_t	blk64;
+
+	limit = ctx->fs->blocksize >> 2;
+	if (!(ctx->flags & BLOCK_FLAG_DEPTH_TRAVERSE) &&
+	    !(ctx->flags & BLOCK_FLAG_DATA_ONLY)) {
+		blk64 = *ind_block;
+		ret = (*ctx->func)(ctx->fs, &blk64,
+				   BLOCK_COUNT_IND, ref_block,
+				   ref_offset, ctx->priv_data);
+		*ind_block = blk64;
+	}
+	check_for_ro_violation_return(ctx, ret);
+	if (!*ind_block || (ret & BLOCK_ABORT)) {
+		ctx->bcount += limit;
+		return ret;
+	}
+	if (*ind_block >= ext2fs_blocks_count(ctx->fs->super) ||
+	    *ind_block < ctx->fs->super->s_first_data_block) {
+		ctx->errcode = EXT2_ET_BAD_IND_BLOCK;
+		ret |= BLOCK_ERROR;
+		return ret;
+	}
+	ctx->errcode = ext2fs_read_ind_block(ctx->fs, *ind_block,
+					     ctx->ind_buf);
+	if (ctx->errcode) {
+		ret |= BLOCK_ERROR;
+		return ret;
+	}
+
+	block_nr = (blk_t *) ctx->ind_buf;
+	offset = 0;
+	if (ctx->flags & BLOCK_FLAG_APPEND) {
+		for (i = 0; i < limit; i++, ctx->bcount++, block_nr++) {
+			blk64 = *block_nr;
+			flags = (*ctx->func)(ctx->fs, &blk64, ctx->bcount,
+					     *ind_block, offset,
+					     ctx->priv_data);
+			*block_nr = blk64;
+			changed	|= flags;
+			if (flags & BLOCK_ABORT) {
+				ret |= BLOCK_ABORT;
+				break;
+			}
+			offset += sizeof(blk_t);
+		}
+	} else {
+		for (i = 0; i < limit; i++, ctx->bcount++, block_nr++) {
+			if (*block_nr == 0)
+				goto skip_sparse;
+			blk64 = *block_nr;
+			flags = (*ctx->func)(ctx->fs, &blk64, ctx->bcount,
+					     *ind_block, offset,
+					     ctx->priv_data);
+			*block_nr = blk64;
+			changed	|= flags;
+			if (flags & BLOCK_ABORT) {
+				ret |= BLOCK_ABORT;
+				break;
+			}
+		skip_sparse:
+			offset += sizeof(blk_t);
+		}
+	}
+	check_for_ro_violation_return(ctx, changed);
+	if (changed & BLOCK_CHANGED) {
+		ctx->errcode = ext2fs_write_ind_block(ctx->fs, *ind_block,
+						      ctx->ind_buf);
+		if (ctx->errcode)
+			ret |= BLOCK_ERROR | BLOCK_ABORT;
+	}
+	if ((ctx->flags & BLOCK_FLAG_DEPTH_TRAVERSE) &&
+	    !(ctx->flags & BLOCK_FLAG_DATA_ONLY) &&
+	    !(ret & BLOCK_ABORT)) {
+		blk64 = *ind_block;
+		ret |= (*ctx->func)(ctx->fs, &blk64,
+				    BLOCK_COUNT_IND, ref_block,
+				    ref_offset, ctx->priv_data);
+		*ind_block = blk64;
+	}
+	check_for_ro_violation_return(ctx, ret);
+	return ret;
+}
+
+static int block_iterate_dind(blk_t *dind_block, blk_t ref_block,
+			      int ref_offset, struct block_context *ctx)
+{
+	int	ret = 0, changed = 0;
+	int	i, flags, limit, offset;
+	blk_t	*block_nr;
+	blk64_t	blk64;
+
+	limit = ctx->fs->blocksize >> 2;
+	if (!(ctx->flags & (BLOCK_FLAG_DEPTH_TRAVERSE |
+			    BLOCK_FLAG_DATA_ONLY))) {
+		blk64 = *dind_block;
+		ret = (*ctx->func)(ctx->fs, &blk64,
+				   BLOCK_COUNT_DIND, ref_block,
+				   ref_offset, ctx->priv_data);
+		*dind_block = blk64;
+	}
+	check_for_ro_violation_return(ctx, ret);
+	if (!*dind_block || (ret & BLOCK_ABORT)) {
+		ctx->bcount += limit*limit;
+		return ret;
+	}
+	if (*dind_block >= ext2fs_blocks_count(ctx->fs->super) ||
+	    *dind_block < ctx->fs->super->s_first_data_block) {
+		ctx->errcode = EXT2_ET_BAD_DIND_BLOCK;
+		ret |= BLOCK_ERROR;
+		return ret;
+	}
+	ctx->errcode = ext2fs_read_ind_block(ctx->fs, *dind_block,
+					     ctx->dind_buf);
+	if (ctx->errcode) {
+		ret |= BLOCK_ERROR;
+		return ret;
+	}
+
+	block_nr = (blk_t *) ctx->dind_buf;
+	offset = 0;
+	if (ctx->flags & BLOCK_FLAG_APPEND) {
+		for (i = 0; i < limit; i++, block_nr++) {
+			flags = block_iterate_ind(block_nr,
+						  *dind_block, offset,
+						  ctx);
+			changed |= flags;
+			if (flags & (BLOCK_ABORT | BLOCK_ERROR)) {
+				ret |= flags & (BLOCK_ABORT | BLOCK_ERROR);
+				break;
+			}
+			offset += sizeof(blk_t);
+		}
+	} else {
+		for (i = 0; i < limit; i++, block_nr++) {
+			if (*block_nr == 0) {
+				ctx->bcount += limit;
+				continue;
+			}
+			flags = block_iterate_ind(block_nr,
+						  *dind_block, offset,
+						  ctx);
+			changed |= flags;
+			if (flags & (BLOCK_ABORT | BLOCK_ERROR)) {
+				ret |= flags & (BLOCK_ABORT | BLOCK_ERROR);
+				break;
+			}
+			offset += sizeof(blk_t);
+		}
+	}
+	check_for_ro_violation_return(ctx, changed);
+	if (changed & BLOCK_CHANGED) {
+		ctx->errcode = ext2fs_write_ind_block(ctx->fs, *dind_block,
+						      ctx->dind_buf);
+		if (ctx->errcode)
+			ret |= BLOCK_ERROR | BLOCK_ABORT;
+	}
+	if ((ctx->flags & BLOCK_FLAG_DEPTH_TRAVERSE) &&
+	    !(ctx->flags & BLOCK_FLAG_DATA_ONLY) &&
+	    !(ret & BLOCK_ABORT)) {
+		blk64 = *dind_block;
+		ret |= (*ctx->func)(ctx->fs, &blk64,
+				    BLOCK_COUNT_DIND, ref_block,
+				    ref_offset, ctx->priv_data);
+		*dind_block = blk64;
+	}
+	check_for_ro_violation_return(ctx, ret);
+	return ret;
+}
+
+static int block_iterate_tind(blk_t *tind_block, blk_t ref_block,
+			      int ref_offset, struct block_context *ctx)
+{
+	int	ret = 0, changed = 0;
+	int	i, flags, limit, offset;
+	blk_t	*block_nr;
+	blk64_t	blk64;
+
+	limit = ctx->fs->blocksize >> 2;
+	if (!(ctx->flags & (BLOCK_FLAG_DEPTH_TRAVERSE |
+			    BLOCK_FLAG_DATA_ONLY))) {
+		blk64 = *tind_block;
+		ret = (*ctx->func)(ctx->fs, &blk64,
+				   BLOCK_COUNT_TIND, ref_block,
+				   ref_offset, ctx->priv_data);
+		*tind_block = blk64;
+	}
+	check_for_ro_violation_return(ctx, ret);
+	if (!*tind_block || (ret & BLOCK_ABORT)) {
+		ctx->bcount += ((unsigned long long) limit)*limit*limit;
+		return ret;
+	}
+	if (*tind_block >= ext2fs_blocks_count(ctx->fs->super) ||
+	    *tind_block < ctx->fs->super->s_first_data_block) {
+		ctx->errcode = EXT2_ET_BAD_TIND_BLOCK;
+		ret |= BLOCK_ERROR;
+		return ret;
+	}
+	ctx->errcode = ext2fs_read_ind_block(ctx->fs, *tind_block,
+					     ctx->tind_buf);
+	if (ctx->errcode) {
+		ret |= BLOCK_ERROR;
+		return ret;
+	}
+
+	block_nr = (blk_t *) ctx->tind_buf;
+	offset = 0;
+	if (ctx->flags & BLOCK_FLAG_APPEND) {
+		for (i = 0; i < limit; i++, block_nr++) {
+			flags = block_iterate_dind(block_nr,
+						   *tind_block,
+						   offset, ctx);
+			changed |= flags;
+			if (flags & (BLOCK_ABORT | BLOCK_ERROR)) {
+				ret |= flags & (BLOCK_ABORT | BLOCK_ERROR);
+				break;
+			}
+			offset += sizeof(blk_t);
+		}
+	} else {
+		for (i = 0; i < limit; i++, block_nr++) {
+			if (*block_nr == 0) {
+				ctx->bcount += limit*limit;
+				continue;
+			}
+			flags = block_iterate_dind(block_nr,
+						   *tind_block,
+						   offset, ctx);
+			changed |= flags;
+			if (flags & (BLOCK_ABORT | BLOCK_ERROR)) {
+				ret |= flags & (BLOCK_ABORT | BLOCK_ERROR);
+				break;
+			}
+			offset += sizeof(blk_t);
+		}
+	}
+	check_for_ro_violation_return(ctx, changed);
+	if (changed & BLOCK_CHANGED) {
+		ctx->errcode = ext2fs_write_ind_block(ctx->fs, *tind_block,
+						      ctx->tind_buf);
+		if (ctx->errcode)
+			ret |= BLOCK_ERROR | BLOCK_ABORT;
+	}
+	if ((ctx->flags & BLOCK_FLAG_DEPTH_TRAVERSE) &&
+	    !(ctx->flags & BLOCK_FLAG_DATA_ONLY) &&
+	    !(ret & BLOCK_ABORT)) {
+		blk64 = *tind_block;
+		ret |= (*ctx->func)(ctx->fs, &blk64,
+				    BLOCK_COUNT_TIND, ref_block,
+				    ref_offset, ctx->priv_data);
+		*tind_block = blk64;
+	}
+	check_for_ro_violation_return(ctx, ret);
+	return ret;
+}
+
+errcode_t ext2fs_block_iterate3(ext2_filsys fs,
+				ext2_ino_t ino,
+				int	flags,
+				char *block_buf,
+				int (*func)(ext2_filsys fs,
+					    blk64_t	*blocknr,
+					    e2_blkcnt_t	blockcnt,
+					    blk64_t	ref_blk,
+					    int		ref_offset,
+					    void	*priv_data),
+				void *priv_data)
+{
+	int	i;
+	int	r, ret = 0;
+	struct ext2_inode inode;
+	errcode_t	retval;
+	struct block_context ctx;
+	int	limit;
+	blk64_t	blk64;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	ctx.errcode = ext2fs_read_inode(fs, ino, &inode);
+	if (ctx.errcode)
+		return ctx.errcode;
+
+	/*
+	 * An inode with inline data has no blocks over which to
+	 * iterate, so return an error code indicating this fact.
+	 */
+	if (inode.i_flags & EXT4_INLINE_DATA_FL)
+		return EXT2_ET_INLINE_DATA_CANT_ITERATE;
+
+	/*
+	 * Check to see if we need to limit large files
+	 */
+	if (flags & BLOCK_FLAG_NO_LARGE) {
+		if (!LINUX_S_ISDIR(inode.i_mode) &&
+		    (inode.i_size_high != 0))
+			return EXT2_ET_FILE_TOO_BIG;
+	}
+
+	limit = fs->blocksize >> 2;
+
+	ctx.fs = fs;
+	ctx.func = func;
+	ctx.priv_data = priv_data;
+	ctx.flags = flags;
+	ctx.bcount = 0;
+	if (block_buf) {
+		ctx.ind_buf = block_buf;
+	} else {
+		retval = ext2fs_get_array(3, fs->blocksize, &ctx.ind_buf);
+		if (retval)
+			return retval;
+	}
+	ctx.dind_buf = ctx.ind_buf + fs->blocksize;
+	ctx.tind_buf = ctx.dind_buf + fs->blocksize;
+
+	/*
+	 * Iterate over the HURD translator block (if present)
+	 */
+	if ((fs->super->s_creator_os == EXT2_OS_HURD) &&
+	    !(flags & BLOCK_FLAG_DATA_ONLY)) {
+		if (inode.osd1.hurd1.h_i_translator) {
+			blk64 = inode.osd1.hurd1.h_i_translator;
+			ret |= (*ctx.func)(fs, &blk64,
+					   BLOCK_COUNT_TRANSLATOR,
+					   0, 0, priv_data);
+			inode.osd1.hurd1.h_i_translator = (blk_t) blk64;
+			if (ret & BLOCK_ABORT)
+				goto abort_exit;
+			check_for_ro_violation_goto(&ctx, ret, abort_exit);
+		}
+	}
+
+	if (inode.i_flags & EXT4_EXTENTS_FL) {
+		ext2_extent_handle_t	handle;
+		struct ext2fs_extent	extent, next;
+		e2_blkcnt_t		blockcnt = 0;
+		blk64_t			blk, new_blk;
+		int			op = EXT2_EXTENT_ROOT;
+		int			uninit;
+		unsigned int		j;
+
+		ctx.errcode = ext2fs_extent_open2(fs, ino, &inode, &handle);
+		if (ctx.errcode)
+			goto abort_exit;
+
+		while (1) {
+			if (op == EXT2_EXTENT_CURRENT)
+				ctx.errcode = 0;
+			else
+				ctx.errcode = ext2fs_extent_get(handle, op,
+								&extent);
+			if (ctx.errcode) {
+				if (ctx.errcode != EXT2_ET_EXTENT_NO_NEXT)
+					break;
+				ctx.errcode = 0;
+				if (!(flags & BLOCK_FLAG_APPEND))
+					break;
+			next_block_set:
+				blk = 0;
+				r = (*ctx.func)(fs, &blk, blockcnt,
+						0, 0, priv_data);
+				ret |= r;
+				check_for_ro_violation_goto(&ctx, ret,
+							    extent_done);
+				if (r & BLOCK_CHANGED) {
+					ctx.errcode =
+						ext2fs_extent_set_bmap(handle,
+						       (blk64_t) blockcnt++,
+						       (blk64_t) blk, 0);
+					if (ctx.errcode || (ret & BLOCK_ABORT))
+						break;
+					if (blk)
+						goto next_block_set;
+				}
+				break;
+			}
+
+			op = EXT2_EXTENT_NEXT;
+			blk = extent.e_pblk;
+			if (!(extent.e_flags & EXT2_EXTENT_FLAGS_LEAF)) {
+				if (ctx.flags & BLOCK_FLAG_DATA_ONLY)
+					continue;
+				if ((!(extent.e_flags &
+				       EXT2_EXTENT_FLAGS_SECOND_VISIT) &&
+				     !(ctx.flags & BLOCK_FLAG_DEPTH_TRAVERSE)) ||
+				    ((extent.e_flags &
+				      EXT2_EXTENT_FLAGS_SECOND_VISIT) &&
+				     (ctx.flags & BLOCK_FLAG_DEPTH_TRAVERSE))) {
+					ret |= (*ctx.func)(fs, &blk,
+							   -1, 0, 0, priv_data);
+					if (ret & BLOCK_CHANGED) {
+						extent.e_pblk = blk;
+						ctx.errcode =
+				ext2fs_extent_replace(handle, 0, &extent);
+						if (ctx.errcode)
+							break;
+					}
+					if (ret & BLOCK_ABORT)
+						break;
+				}
+				continue;
+			}
+			uninit = 0;
+			if (extent.e_flags & EXT2_EXTENT_FLAGS_UNINIT)
+				uninit = EXT2_EXTENT_SET_BMAP_UNINIT;
+
+			/* 
+			 * Get the next extent before we start messing
+			 * with the current extent
+			 */
+			retval = ext2fs_extent_get(handle, op, &next);
+
+#if 0
+			printf("lblk %llu pblk %llu len %d blockcnt %llu\n",
+			       extent.e_lblk, extent.e_pblk,
+			       extent.e_len, blockcnt);
+#endif
+			if (extent.e_lblk + extent.e_len <= (blk64_t) blockcnt)
+				continue;
+			if (extent.e_lblk > (blk64_t) blockcnt)
+				blockcnt = extent.e_lblk;
+			j = blockcnt - extent.e_lblk;
+			blk += j;
+			for (blockcnt = extent.e_lblk, j = 0;
+			     j < extent.e_len;
+			     blk++, blockcnt++, j++) {
+				new_blk = blk;
+				r = (*ctx.func)(fs, &new_blk, blockcnt,
+						0, 0, priv_data);
+				ret |= r;
+				check_for_ro_violation_goto(&ctx, ret,
+							    extent_done);
+				if (r & BLOCK_CHANGED) {
+					ctx.errcode =
+						ext2fs_extent_set_bmap(handle,
+						       (blk64_t) blockcnt,
+						       new_blk, uninit);
+					if (ctx.errcode)
+						goto extent_done;
+				}
+				if (ret & BLOCK_ABORT)
+					goto extent_done;
+			}
+			if (retval == 0) {
+				extent = next;
+				op = EXT2_EXTENT_CURRENT;
+			}
+		}
+
+	extent_done:
+		ext2fs_extent_free(handle);
+		ret |= BLOCK_ERROR; /* ctx.errcode is always valid here */
+		goto errout;
+	}
+
+	/*
+	 * Iterate over normal data blocks
+	 */
+	for (i = 0; i < EXT2_NDIR_BLOCKS ; i++, ctx.bcount++) {
+		if (inode.i_block[i] || (flags & BLOCK_FLAG_APPEND)) {
+			blk64 = inode.i_block[i];
+			ret |= (*ctx.func)(fs, &blk64, ctx.bcount, 0, i, 
+					   priv_data);
+			inode.i_block[i] = (blk_t) blk64;
+			if (ret & BLOCK_ABORT)
+				goto abort_exit;
+		}
+	}
+	check_for_ro_violation_goto(&ctx, ret, abort_exit);
+	if (inode.i_block[EXT2_IND_BLOCK] || (flags & BLOCK_FLAG_APPEND)) {
+		ret |= block_iterate_ind(&inode.i_block[EXT2_IND_BLOCK], 
+					 0, EXT2_IND_BLOCK, &ctx);
+		if (ret & BLOCK_ABORT)
+			goto abort_exit;
+	} else
+		ctx.bcount += limit;
+	if (inode.i_block[EXT2_DIND_BLOCK] || (flags & BLOCK_FLAG_APPEND)) {
+		ret |= block_iterate_dind(&inode.i_block[EXT2_DIND_BLOCK],
+					  0, EXT2_DIND_BLOCK, &ctx);
+		if (ret & BLOCK_ABORT)
+			goto abort_exit;
+	} else
+		ctx.bcount += limit * limit;
+	if (inode.i_block[EXT2_TIND_BLOCK] || (flags & BLOCK_FLAG_APPEND)) {
+		ret |= block_iterate_tind(&inode.i_block[EXT2_TIND_BLOCK],
+					  0, EXT2_TIND_BLOCK, &ctx);
+		if (ret & BLOCK_ABORT)
+			goto abort_exit;
+	}
+
+abort_exit:
+	if (ret & BLOCK_CHANGED) {
+		retval = ext2fs_write_inode(fs, ino, &inode);
+		if (retval) {
+			ret |= BLOCK_ERROR;
+			ctx.errcode = retval;
+		}
+	}
+errout:
+	if (!block_buf)
+		ext2fs_free_mem(&ctx.ind_buf);
+
+	return (ret & BLOCK_ERROR) ? ctx.errcode : 0;
+}
+
+/*
+ * Emulate the old ext2fs_block_iterate function!
+ */
+
+struct xlate64 {
+	int (*func)(ext2_filsys fs,
+		    blk_t	*blocknr,
+		    e2_blkcnt_t	blockcnt,
+		    blk_t	ref_blk,
+		    int		ref_offset,
+		    void	*priv_data);
+	void *real_private;
+};
+
+static int xlate64_func(ext2_filsys fs, blk64_t	*blocknr,
+			e2_blkcnt_t blockcnt, blk64_t ref_blk,
+			int ref_offset, void *priv_data)
+{
+	struct xlate64 *xl = (struct xlate64 *) priv_data;
+	int		ret;
+	blk_t		block32 = *blocknr;
+	
+	ret = (*xl->func)(fs, &block32, blockcnt, (blk_t) ref_blk, ref_offset,
+			     xl->real_private);
+	*blocknr = block32;
+	return ret;
+}
+
+errcode_t ext2fs_block_iterate2(ext2_filsys fs,
+				ext2_ino_t ino,
+				int	flags,
+				char *block_buf,
+				int (*func)(ext2_filsys fs,
+					    blk_t	*blocknr,
+					    e2_blkcnt_t	blockcnt,
+					    blk_t	ref_blk,
+					    int		ref_offset,
+					    void	*priv_data),
+				void *priv_data)
+{
+	struct xlate64 xl;
+
+	xl.real_private = priv_data;
+	xl.func = func;
+
+	return ext2fs_block_iterate3(fs, ino, flags, block_buf, 
+				     xlate64_func, &xl);
+}
+
+
+struct xlate {
+	int (*func)(ext2_filsys	fs,
+		    blk_t	*blocknr,
+		    int		bcount,
+		    void	*priv_data);
+	void *real_private;
+};
+
+#ifdef __TURBOC__
+ #pragma argsused
+#endif
+static int xlate_func(ext2_filsys fs, blk_t *blocknr, e2_blkcnt_t blockcnt,
+		      blk_t ref_block EXT2FS_ATTR((unused)),
+		      int ref_offset EXT2FS_ATTR((unused)),
+		      void *priv_data)
+{
+	struct xlate *xl = (struct xlate *) priv_data;
+
+	return (*xl->func)(fs, blocknr, (int) blockcnt, xl->real_private);
+}
+
+errcode_t ext2fs_block_iterate(ext2_filsys fs,
+			       ext2_ino_t ino,
+			       int	flags,
+			       char *block_buf,
+			       int (*func)(ext2_filsys fs,
+					   blk_t	*blocknr,
+					   int	blockcnt,
+					   void	*priv_data),
+			       void *priv_data)
+{
+	struct xlate xl;
+
+	xl.real_private = priv_data;
+	xl.func = func;
+
+	return ext2fs_block_iterate2(fs, ino, BLOCK_FLAG_NO_LARGE | flags,
+				     block_buf, xlate_func, &xl);
+}
+
diff --git a/lib/ext2fs/bmap.c b/lib/ext2fs/bmap.c
new file mode 100644
index 0000000..65c45c5
--- /dev/null
+++ b/lib/ext2fs/bmap.c
@@ -0,0 +1,499 @@
+/*
+ * bmap.c --- logical to physical block mapping
+ *
+ * Copyright (C) 1997 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <errno.h>
+
+#include "ext2_fs.h"
+#include "ext2fsP.h"
+
+#if defined(__GNUC__) && !defined(NO_INLINE_FUNCS)
+#define _BMAP_INLINE_	__inline__
+#else
+#define _BMAP_INLINE_
+#endif
+
+extern errcode_t ext2fs_bmap(ext2_filsys fs, ext2_ino_t ino,
+			     struct ext2_inode *inode,
+			     char *block_buf, int bmap_flags,
+			     blk_t block, blk_t *phys_blk);
+
+#define inode_bmap(inode, nr) ((inode)->i_block[(nr)])
+
+static _BMAP_INLINE_ errcode_t block_ind_bmap(ext2_filsys fs, int flags,
+					      blk_t ind, char *block_buf,
+					      int *blocks_alloc,
+					      blk_t nr, blk_t *ret_blk)
+{
+	errcode_t	retval;
+	blk_t		b;
+
+	if (!ind) {
+		if (flags & BMAP_SET)
+			return EXT2_ET_SET_BMAP_NO_IND;
+		*ret_blk = 0;
+		return 0;
+	}
+	retval = io_channel_read_blk(fs->io, ind, 1, block_buf);
+	if (retval)
+		return retval;
+
+	if (flags & BMAP_SET) {
+		b = *ret_blk;
+#ifdef WORDS_BIGENDIAN
+		b = ext2fs_swab32(b);
+#endif
+		((blk_t *) block_buf)[nr] = b;
+		return io_channel_write_blk(fs->io, ind, 1, block_buf);
+	}
+
+	b = ((blk_t *) block_buf)[nr];
+
+#ifdef WORDS_BIGENDIAN
+	b = ext2fs_swab32(b);
+#endif
+
+	if (!b && (flags & BMAP_ALLOC)) {
+		b = nr ? ext2fs_le32_to_cpu(((blk_t *)block_buf)[nr - 1]) : ind;
+		retval = ext2fs_alloc_block(fs, b,
+					    block_buf + fs->blocksize, &b);
+		if (retval)
+			return retval;
+
+#ifdef WORDS_BIGENDIAN
+		((blk_t *) block_buf)[nr] = ext2fs_swab32(b);
+#else
+		((blk_t *) block_buf)[nr] = b;
+#endif
+
+		retval = io_channel_write_blk(fs->io, ind, 1, block_buf);
+		if (retval)
+			return retval;
+
+		(*blocks_alloc)++;
+	}
+
+	*ret_blk = b;
+	return 0;
+}
+
+static _BMAP_INLINE_ errcode_t block_dind_bmap(ext2_filsys fs, int flags,
+					       blk_t dind, char *block_buf,
+					       int *blocks_alloc,
+					       blk_t nr, blk_t *ret_blk)
+{
+	blk_t		b = 0;
+	errcode_t	retval;
+	blk_t		addr_per_block;
+
+	addr_per_block = (blk_t) fs->blocksize >> 2;
+
+	retval = block_ind_bmap(fs, flags & ~BMAP_SET, dind, block_buf,
+				blocks_alloc, nr / addr_per_block, &b);
+	if (retval)
+		return retval;
+	retval = block_ind_bmap(fs, flags, b, block_buf, blocks_alloc,
+				nr % addr_per_block, ret_blk);
+	return retval;
+}
+
+static _BMAP_INLINE_ errcode_t block_tind_bmap(ext2_filsys fs, int flags,
+					       blk_t tind, char *block_buf,
+					       int *blocks_alloc,
+					       blk_t nr, blk_t *ret_blk)
+{
+	blk_t		b = 0;
+	errcode_t	retval;
+	blk_t		addr_per_block;
+
+	addr_per_block = (blk_t) fs->blocksize >> 2;
+
+	retval = block_dind_bmap(fs, flags & ~BMAP_SET, tind, block_buf,
+				 blocks_alloc, nr / addr_per_block, &b);
+	if (retval)
+		return retval;
+	retval = block_ind_bmap(fs, flags, b, block_buf, blocks_alloc,
+				nr % addr_per_block, ret_blk);
+	return retval;
+}
+
+static errcode_t extent_bmap(ext2_filsys fs, ext2_ino_t ino,
+			     struct ext2_inode *inode,
+			     ext2_extent_handle_t handle,
+			     char *block_buf, int bmap_flags, blk64_t block,
+			     int *ret_flags, int *blocks_alloc,
+			     blk64_t *phys_blk);
+
+static errcode_t implied_cluster_alloc(ext2_filsys fs, ext2_ino_t ino,
+				       struct ext2_inode *inode,
+				       ext2_extent_handle_t handle,
+				       blk64_t lblk, blk64_t *phys_blk)
+{
+	blk64_t	base_block, pblock = 0;
+	int i;
+
+	if (!ext2fs_has_feature_bigalloc(fs->super))
+		return 0;
+
+	base_block = lblk & ~EXT2FS_CLUSTER_MASK(fs);
+	/*
+	 * Except for the logical block (lblk) that was passed in, search all
+	 * blocks in this logical cluster for a mapping to a physical cluster.
+	 * If any such map exists, calculate the physical block that maps to
+	 * the logical block and return that.
+	 *
+	 * The old code wouldn't even look if (block % cluster_ratio) == 0;
+	 * this is incorrect if we're allocating blocks in reverse order.
+	 */
+	for (i = 0; i < EXT2FS_CLUSTER_RATIO(fs); i++) {
+		if (base_block + i == lblk)
+			continue;
+		extent_bmap(fs, ino, inode, handle, 0, 0,
+			    base_block + i, 0, 0, &pblock);
+		if (pblock)
+			break;
+	}
+	if (pblock == 0)
+		return 0;
+	*phys_blk = pblock - i + (lblk - base_block);
+	return 0;
+}
+
+/* Try to map a logical block to an already-allocated physical cluster. */
+errcode_t ext2fs_map_cluster_block(ext2_filsys fs, ext2_ino_t ino,
+				   struct ext2_inode *inode, blk64_t lblk,
+				   blk64_t *pblk)
+{
+	ext2_extent_handle_t handle;
+	errcode_t retval;
+
+	/* Need bigalloc and extents to be enabled */
+	*pblk = 0;
+	if (!ext2fs_has_feature_bigalloc(fs->super) ||
+	    !(inode->i_flags & EXT4_EXTENTS_FL))
+		return 0;
+
+	retval = ext2fs_extent_open2(fs, ino, inode, &handle);
+	if (retval)
+		goto out;
+
+	retval = implied_cluster_alloc(fs, ino, inode, handle, lblk, pblk);
+	if (retval)
+		goto out2;
+
+out2:
+	ext2fs_extent_free(handle);
+out:
+	return retval;
+}
+
+static errcode_t extent_bmap(ext2_filsys fs, ext2_ino_t ino,
+			     struct ext2_inode *inode,
+			     ext2_extent_handle_t handle,
+			     char *block_buf, int bmap_flags, blk64_t block,
+			     int *ret_flags, int *blocks_alloc,
+			     blk64_t *phys_blk)
+{
+	struct blk_alloc_ctx	alloc_ctx;
+	struct ext2fs_extent	extent;
+	unsigned int		offset;
+	errcode_t		retval = 0;
+	blk64_t			blk64 = 0;
+	int			alloc = 0;
+	int			set_flags;
+
+	set_flags = bmap_flags & BMAP_UNINIT ? EXT2_EXTENT_SET_BMAP_UNINIT : 0;
+
+	if (bmap_flags & BMAP_SET) {
+		retval = ext2fs_extent_set_bmap(handle, block,
+						*phys_blk, set_flags);
+		return retval;
+	}
+	retval = ext2fs_extent_goto(handle, block);
+	if (retval) {
+		/* If the extent is not found, return phys_blk = 0 */
+		if (retval == EXT2_ET_EXTENT_NOT_FOUND) {
+			extent.e_lblk = block;
+			goto got_block;
+		}
+		return retval;
+	}
+	retval = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT, &extent);
+	if (retval)
+		return retval;
+	offset = block - extent.e_lblk;
+	if (block >= extent.e_lblk && (offset <= extent.e_len)) {
+		*phys_blk = extent.e_pblk + offset;
+		if (ret_flags && extent.e_flags & EXT2_EXTENT_FLAGS_UNINIT)
+			*ret_flags |= BMAP_RET_UNINIT;
+	}
+got_block:
+	if ((*phys_blk == 0) && (bmap_flags & BMAP_ALLOC)) {
+		implied_cluster_alloc(fs, ino, inode, handle, block, &blk64);
+		if (blk64)
+			goto set_extent;
+		retval = extent_bmap(fs, ino, inode, handle, block_buf,
+				     0, block-1, 0, blocks_alloc, &blk64);
+		if (retval)
+			blk64 = ext2fs_find_inode_goal(fs, ino, inode, block);
+		alloc_ctx.ino = ino;
+		alloc_ctx.inode = inode;
+		alloc_ctx.lblk = extent.e_lblk;
+		alloc_ctx.flags = BLOCK_ALLOC_DATA;
+		retval = ext2fs_alloc_block3(fs, blk64, block_buf, &blk64,
+					     &alloc_ctx);
+		if (retval)
+			return retval;
+		blk64 &= ~EXT2FS_CLUSTER_MASK(fs);
+		blk64 += EXT2FS_CLUSTER_MASK(fs) & block;
+		alloc++;
+	set_extent:
+		retval = ext2fs_extent_set_bmap(handle, block,
+						blk64, set_flags);
+		if (retval) {
+			ext2fs_block_alloc_stats2(fs, blk64, -1);
+			return retval;
+		}
+		/* Update inode after setting extent */
+		retval = ext2fs_read_inode(fs, ino, inode);
+		if (retval)
+			return retval;
+		*blocks_alloc += alloc;
+		*phys_blk = blk64;
+	}
+	return 0;
+}
+
+int ext2fs_file_block_offset_too_big(ext2_filsys fs,
+				     struct ext2_inode *inode,
+				     blk64_t offset)
+{
+	blk64_t addr_per_block, max_map_block;
+
+	/* Kernel seems to cut us off at 4294967294 blocks */
+	if (offset >= (1ULL << 32) - 1)
+		return 1;
+
+	if (inode->i_flags & EXT4_EXTENTS_FL)
+		return 0;
+
+	addr_per_block = fs->blocksize >> 2;
+	max_map_block = addr_per_block;
+	max_map_block += addr_per_block * addr_per_block;
+	max_map_block += addr_per_block * addr_per_block * addr_per_block;
+	max_map_block += 12;
+
+	return offset >= max_map_block;
+}
+
+errcode_t ext2fs_bmap2(ext2_filsys fs, ext2_ino_t ino, struct ext2_inode *inode,
+		       char *block_buf, int bmap_flags, blk64_t block,
+		       int *ret_flags, blk64_t *phys_blk)
+{
+	struct ext2_inode inode_buf;
+	ext2_extent_handle_t handle = 0;
+	blk_t addr_per_block;
+	blk_t	b, blk32;
+	blk64_t b64;
+	char	*buf = 0;
+	errcode_t	retval = 0;
+	int		blocks_alloc = 0, inode_dirty = 0;
+	struct blk_alloc_ctx alloc_ctx = {
+		.ino	= ino,
+		.inode	= inode,
+		.lblk	= 0,
+		.flags	= BLOCK_ALLOC_DATA,
+	};
+
+	if (!(bmap_flags & BMAP_SET))
+		*phys_blk = 0;
+
+	if (ret_flags)
+		*ret_flags = 0;
+
+	/* Read inode structure if necessary */
+	if (!inode) {
+		retval = ext2fs_read_inode(fs, ino, &inode_buf);
+		if (retval)
+			return retval;
+		inode = &inode_buf;
+	}
+	addr_per_block = (blk_t) fs->blocksize >> 2;
+
+	if (ext2fs_file_block_offset_too_big(fs, inode, block))
+		return EXT2_ET_FILE_TOO_BIG;
+
+	/*
+	 * If an inode has inline data, that means that it doesn't have
+	 * any blocks and we shouldn't map any blocks for it.
+	 */
+	if (inode->i_flags & EXT4_INLINE_DATA_FL)
+		return EXT2_ET_INLINE_DATA_NO_BLOCK;
+
+	if (!block_buf) {
+		retval = ext2fs_get_array(2, fs->blocksize, &buf);
+		if (retval)
+			return retval;
+		block_buf = buf;
+	}
+
+	if (inode->i_flags & EXT4_EXTENTS_FL) {
+		retval = ext2fs_extent_open2(fs, ino, inode, &handle);
+		if (retval)
+			goto done;
+		retval = extent_bmap(fs, ino, inode, handle, block_buf,
+				     bmap_flags, block, ret_flags,
+				     &blocks_alloc, phys_blk);
+		goto done;
+	}
+
+	if (block < EXT2_NDIR_BLOCKS) {
+		if (bmap_flags & BMAP_SET) {
+			b = *phys_blk;
+			inode_bmap(inode, block) = b;
+			inode_dirty++;
+			goto done;
+		}
+
+		*phys_blk = inode_bmap(inode, block);
+		b = block ? inode_bmap(inode, block - 1) :
+			    ext2fs_find_inode_goal(fs, ino, inode, block);
+
+		if ((*phys_blk == 0) && (bmap_flags & BMAP_ALLOC)) {
+			b64 = b;
+			retval = ext2fs_alloc_block3(fs, b64, block_buf, &b64,
+						     &alloc_ctx);
+			b = b64;
+			if (retval)
+				goto done;
+			inode_bmap(inode, block) = b;
+			blocks_alloc++;
+			*phys_blk = b;
+		}
+		goto done;
+	}
+
+	/* Indirect block */
+	block -= EXT2_NDIR_BLOCKS;
+	blk32 = *phys_blk;
+	if (block < addr_per_block) {
+		b = inode_bmap(inode, EXT2_IND_BLOCK);
+		if (!b) {
+			if (!(bmap_flags & BMAP_ALLOC)) {
+				if (bmap_flags & BMAP_SET)
+					retval = EXT2_ET_SET_BMAP_NO_IND;
+				goto done;
+			}
+
+			b = inode_bmap(inode, EXT2_IND_BLOCK-1);
+			b64 = b;
+			retval = ext2fs_alloc_block3(fs, b64, block_buf, &b64,
+						     &alloc_ctx);
+			b = b64;
+			if (retval)
+				goto done;
+			inode_bmap(inode, EXT2_IND_BLOCK) = b;
+			blocks_alloc++;
+		}
+		retval = block_ind_bmap(fs, bmap_flags, b, block_buf,
+					&blocks_alloc, block, &blk32);
+		if (retval == 0)
+			*phys_blk = blk32;
+		goto done;
+	}
+
+	/* Doubly indirect block  */
+	block -= addr_per_block;
+	if (block < addr_per_block * addr_per_block) {
+		b = inode_bmap(inode, EXT2_DIND_BLOCK);
+		if (!b) {
+			if (!(bmap_flags & BMAP_ALLOC)) {
+				if (bmap_flags & BMAP_SET)
+					retval = EXT2_ET_SET_BMAP_NO_IND;
+				goto done;
+			}
+
+			b = inode_bmap(inode, EXT2_IND_BLOCK);
+			b64 = b;
+			retval = ext2fs_alloc_block3(fs, b64, block_buf, &b64,
+						     &alloc_ctx);
+			b = b64;
+			if (retval)
+				goto done;
+			inode_bmap(inode, EXT2_DIND_BLOCK) = b;
+			blocks_alloc++;
+		}
+		retval = block_dind_bmap(fs, bmap_flags, b, block_buf,
+					 &blocks_alloc, block, &blk32);
+		if (retval == 0)
+			*phys_blk = blk32;
+		goto done;
+	}
+
+	/* Triply indirect block */
+	block -= addr_per_block * addr_per_block;
+	b = inode_bmap(inode, EXT2_TIND_BLOCK);
+	if (!b) {
+		if (!(bmap_flags & BMAP_ALLOC)) {
+			if (bmap_flags & BMAP_SET)
+				retval = EXT2_ET_SET_BMAP_NO_IND;
+			goto done;
+		}
+
+		b = inode_bmap(inode, EXT2_DIND_BLOCK);
+		b64 = b;
+		retval = ext2fs_alloc_block3(fs, b64, block_buf, &b64,
+					     &alloc_ctx);
+		b = b64;
+		if (retval)
+			goto done;
+		inode_bmap(inode, EXT2_TIND_BLOCK) = b;
+		blocks_alloc++;
+	}
+	retval = block_tind_bmap(fs, bmap_flags, b, block_buf,
+				 &blocks_alloc, block, &blk32);
+	if (retval == 0)
+		*phys_blk = blk32;
+done:
+	if (*phys_blk && retval == 0 && (bmap_flags & BMAP_ZERO))
+		retval = ext2fs_zero_blocks2(fs, *phys_blk, 1, NULL, NULL);
+	if (buf)
+		ext2fs_free_mem(&buf);
+	if (handle)
+		ext2fs_extent_free(handle);
+	if ((retval == 0) && (blocks_alloc || inode_dirty)) {
+		ext2fs_iblk_add_blocks(fs, inode, blocks_alloc);
+		retval = ext2fs_write_inode(fs, ino, inode);
+	}
+	return retval;
+}
+
+errcode_t ext2fs_bmap(ext2_filsys fs, ext2_ino_t ino, struct ext2_inode *inode,
+		      char *block_buf, int bmap_flags, blk_t block,
+		      blk_t *phys_blk)
+{
+	errcode_t ret;
+	blk64_t	ret_blk = *phys_blk;
+
+	ret = ext2fs_bmap2(fs, ino, inode, block_buf, bmap_flags, block,
+			    0, &ret_blk);
+	if (ret)
+		return ret;
+	if (ret_blk >= ((long long) 1 << 32))
+		return EOVERFLOW;
+	*phys_blk = ret_blk;
+	return 0;
+}
diff --git a/lib/ext2fs/bmap64.h b/lib/ext2fs/bmap64.h
new file mode 100644
index 0000000..de33454
--- /dev/null
+++ b/lib/ext2fs/bmap64.h
@@ -0,0 +1,106 @@
+/*
+ * bmap64.h --- 64-bit bitmap structure
+ *
+ * Copyright (C) 2007, 2008 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Public
+ * License.
+ * %End-Header%
+ */
+
+struct ext2_bmap_statistics {
+	int		type;
+	struct timeval	created;
+
+#ifdef ENABLE_BMAP_STATS_OPS
+	unsigned long	copy_count;
+	unsigned long	resize_count;
+	unsigned long	mark_count;
+	unsigned long	unmark_count;
+	unsigned long	test_count;
+	unsigned long	mark_ext_count;
+	unsigned long	unmark_ext_count;
+	unsigned long	test_ext_count;
+	unsigned long	set_range_count;
+	unsigned long	get_range_count;
+	unsigned long	clear_count;
+
+	blk64_t		last_marked;
+	blk64_t		last_tested;
+	blk64_t		mark_back;
+	blk64_t		test_back;
+
+	unsigned long	mark_seq;
+	unsigned long	test_seq;
+#endif /* ENABLE_BMAP_STATS_OPS */
+};
+
+
+struct ext2fs_struct_generic_bitmap_64 {
+	errcode_t		magic;
+	ext2_filsys 		fs;
+	struct ext2_bitmap_ops	*bitmap_ops;
+	int			flags;
+	__u64			start, end;
+	__u64			real_end;
+	int			cluster_bits;
+	char			*description;
+	void			*private;
+	errcode_t		base_error_code;
+#ifdef ENABLE_BMAP_STATS
+	struct ext2_bmap_statistics	stats;
+#endif
+};
+
+typedef struct ext2fs_struct_generic_bitmap_64 *ext2fs_generic_bitmap_64;
+
+#define EXT2FS_IS_32_BITMAP(bmap) \
+	(((bmap)->magic == EXT2_ET_MAGIC_GENERIC_BITMAP) || \
+	 ((bmap)->magic == EXT2_ET_MAGIC_BLOCK_BITMAP) || \
+	 ((bmap)->magic == EXT2_ET_MAGIC_INODE_BITMAP))
+
+#define EXT2FS_IS_64_BITMAP(bmap) \
+	(((bmap)->magic == EXT2_ET_MAGIC_GENERIC_BITMAP64) || \
+	 ((bmap)->magic == EXT2_ET_MAGIC_BLOCK_BITMAP64) || \
+	 ((bmap)->magic == EXT2_ET_MAGIC_INODE_BITMAP64))
+
+struct ext2_bitmap_ops {
+	int	type;
+	/* Generic bmap operators */
+	errcode_t (*new_bmap)(ext2_filsys fs, ext2fs_generic_bitmap_64 bmap);
+	void	(*free_bmap)(ext2fs_generic_bitmap_64 bitmap);
+	errcode_t (*copy_bmap)(ext2fs_generic_bitmap_64 src,
+			     ext2fs_generic_bitmap_64 dest);
+	errcode_t (*resize_bmap)(ext2fs_generic_bitmap_64 bitmap,
+			       __u64 new_end,
+			       __u64 new_real_end);
+	/* bit set/test operators */
+	int	(*mark_bmap)(ext2fs_generic_bitmap_64 bitmap, __u64 arg);
+	int	(*unmark_bmap)(ext2fs_generic_bitmap_64 bitmap, __u64 arg);
+	int	(*test_bmap)(ext2fs_generic_bitmap_64 bitmap, __u64 arg);
+	void	(*mark_bmap_extent)(ext2fs_generic_bitmap_64 bitmap, __u64 arg,
+				    unsigned int num);
+	void	(*unmark_bmap_extent)(ext2fs_generic_bitmap_64 bitmap, __u64 arg,
+				      unsigned int num);
+	int	(*test_clear_bmap_extent)(ext2fs_generic_bitmap_64 bitmap,
+					  __u64 arg, unsigned int num);
+	errcode_t (*set_bmap_range)(ext2fs_generic_bitmap_64 bitmap,
+				    __u64 start, size_t num, void *in);
+	errcode_t (*get_bmap_range)(ext2fs_generic_bitmap_64 bitmap,
+				    __u64 start, size_t num, void *out);
+	void (*clear_bmap)(ext2fs_generic_bitmap_64 bitmap);
+	void (*print_stats)(ext2fs_generic_bitmap_64);
+
+	/* Find the first zero bit between start and end, inclusive.
+	 * May be NULL, in which case a generic function is used. */
+	errcode_t (*find_first_zero)(ext2fs_generic_bitmap_64 bitmap,
+				     __u64 start, __u64 end, __u64 *out);
+	/* Find the first set bit between start and end, inclusive.
+	 * May be NULL, in which case a generic function is used. */
+	errcode_t (*find_first_set)(ext2fs_generic_bitmap_64 bitmap,
+				    __u64 start, __u64 end, __u64 *out);
+};
+
+extern struct ext2_bitmap_ops ext2fs_blkmap64_bitarray;
+extern struct ext2_bitmap_ops ext2fs_blkmap64_rbtree;
diff --git a/lib/ext2fs/bmove.c b/lib/ext2fs/bmove.c
new file mode 100644
index 0000000..e2ea405
--- /dev/null
+++ b/lib/ext2fs/bmove.c
@@ -0,0 +1,167 @@
+/*
+ * bmove.c --- Move blocks around to make way for a particular
+ * 	filesystem structure.
+ *
+ * Copyright (C) 1997 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+#if HAVE_SYS_TIME_H
+#include <sys/time.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fsP.h"
+
+struct process_block_struct {
+	ext2_ino_t		ino;
+	struct ext2_inode *	inode;
+	ext2fs_block_bitmap	reserve;
+	ext2fs_block_bitmap	alloc_map;
+	errcode_t		error;
+	char			*buf;
+	int			add_dir;
+	int			flags;
+};
+
+static int process_block(ext2_filsys fs, blk64_t *block_nr,
+			 e2_blkcnt_t blockcnt, blk64_t ref_block,
+			 int ref_offset, void *priv_data)
+{
+	struct process_block_struct *pb;
+	errcode_t	retval;
+	int		ret;
+	blk64_t		block, orig;
+
+	pb = (struct process_block_struct *) priv_data;
+	block = orig = *block_nr;
+	ret = 0;
+
+	/*
+	 * Let's see if this is one which we need to relocate
+	 */
+	if (ext2fs_test_block_bitmap2(pb->reserve, block)) {
+		do {
+			if (++block >= ext2fs_blocks_count(fs->super))
+				block = fs->super->s_first_data_block;
+			if (block == orig) {
+				pb->error = EXT2_ET_BLOCK_ALLOC_FAIL;
+				return BLOCK_ABORT;
+			}
+		} while (ext2fs_test_block_bitmap2(pb->reserve, block) ||
+			 ext2fs_test_block_bitmap2(pb->alloc_map, block));
+
+		retval = io_channel_read_blk64(fs->io, orig, 1, pb->buf);
+		if (retval) {
+			pb->error = retval;
+			return BLOCK_ABORT;
+		}
+		retval = io_channel_write_blk64(fs->io, block, 1, pb->buf);
+		if (retval) {
+			pb->error = retval;
+			return BLOCK_ABORT;
+		}
+		*block_nr = block;
+		ext2fs_mark_block_bitmap2(pb->alloc_map, block);
+		ret = BLOCK_CHANGED;
+		if (pb->flags & EXT2_BMOVE_DEBUG)
+			printf("ino=%u, blockcnt=%lld, %llu->%llu\n",
+			       (unsigned) pb->ino, blockcnt, 
+			       (unsigned long long) orig,
+			       (unsigned long long) block);
+	}
+	if (pb->add_dir) {
+		retval = ext2fs_add_dir_block2(fs->dblist, pb->ino,
+					       block, blockcnt);
+		if (retval) {
+			pb->error = retval;
+			ret |= BLOCK_ABORT;
+		}
+	}
+	return ret;
+}
+
+errcode_t ext2fs_move_blocks(ext2_filsys fs,
+			     ext2fs_block_bitmap reserve,
+			     ext2fs_block_bitmap alloc_map,
+			     int flags)
+{
+	ext2_ino_t	ino;
+	struct ext2_inode inode;
+	errcode_t	retval;
+	struct process_block_struct pb;
+	ext2_inode_scan	scan;
+	char		*block_buf;
+
+	retval = ext2fs_open_inode_scan(fs, 0, &scan);
+	if (retval)
+		return retval;
+
+	pb.reserve = reserve;
+	pb.error = 0;
+	pb.alloc_map = alloc_map ? alloc_map : fs->block_map;
+	pb.flags = flags;
+
+	retval = ext2fs_get_array(4, fs->blocksize, &block_buf);
+	if (retval)
+		return retval;
+	pb.buf = block_buf + fs->blocksize * 3;
+
+	/*
+	 * If GET_DBLIST is set in the flags field, then we should
+	 * gather directory block information while we're doing the
+	 * block move.
+	 */
+	if (flags & EXT2_BMOVE_GET_DBLIST) {
+		if (fs->dblist) {
+			ext2fs_free_dblist(fs->dblist);
+			fs->dblist = NULL;
+		}
+		retval = ext2fs_init_dblist(fs, 0);
+		if (retval)
+			return retval;
+	}
+
+	retval = ext2fs_get_next_inode(scan, &ino, &inode);
+	if (retval)
+		return retval;
+
+	while (ino) {
+		if ((inode.i_links_count == 0) ||
+		    !ext2fs_inode_has_valid_blocks2(fs, &inode))
+			goto next;
+
+		pb.ino = ino;
+		pb.inode = &inode;
+
+		pb.add_dir = (LINUX_S_ISDIR(inode.i_mode) &&
+			      flags & EXT2_BMOVE_GET_DBLIST);
+
+		retval = ext2fs_block_iterate3(fs, ino, 0, block_buf,
+					       process_block, &pb);
+		if (retval)
+			return retval;
+		if (pb.error)
+			return pb.error;
+
+	next:
+		retval = ext2fs_get_next_inode(scan, &ino, &inode);
+		if (retval == EXT2_ET_BAD_BLOCK_IN_INODE_TABLE)
+			goto next;
+	}
+	return 0;
+}
+
diff --git a/lib/ext2fs/brel.h b/lib/ext2fs/brel.h
new file mode 100644
index 0000000..9fdddd4
--- /dev/null
+++ b/lib/ext2fs/brel.h
@@ -0,0 +1,86 @@
+/*
+ * brel.h
+ *
+ * Copyright (C) 1996, 1997 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+struct ext2_block_relocate_entry {
+	blk64_t	new;
+	__s16	offset;
+	__u16	flags;
+	union {
+		blk64_t		block_ref;
+		ext2_ino_t	inode_ref;
+	} owner;
+};
+
+#define RELOCATE_TYPE_REF  0x0007
+#define RELOCATE_BLOCK_REF 0x0001
+#define RELOCATE_INODE_REF 0x0002
+
+typedef struct ext2_block_relocation_table *ext2_brel;
+
+struct ext2_block_relocation_table {
+	__u32	magic;
+	char	*name;
+	blk64_t	current;
+	void	*priv_data;
+
+	/*
+	 * Add a block relocation entry.
+	 */
+	errcode_t (*put)(ext2_brel brel, blk64_t old,
+			      struct ext2_block_relocate_entry *ent);
+
+	/*
+	 * Get a block relocation entry.
+	 */
+	errcode_t (*get)(ext2_brel brel, blk64_t old,
+			      struct ext2_block_relocate_entry *ent);
+
+	/*
+	 * Initialize for iterating over the block relocation entries.
+	 */
+	errcode_t (*start_iter)(ext2_brel brel);
+
+	/*
+	 * The iterator function for the inode relocation entries.
+	 * Returns an inode number of 0 when out of entries.
+	 */
+	errcode_t (*next)(ext2_brel brel, blk64_t *old,
+			  struct ext2_block_relocate_entry *ent);
+
+	/*
+	 * Move the inode relocation table from one block number to
+	 * another.
+	 */
+	errcode_t (*move)(ext2_brel brel, blk64_t old, blk_t new);
+
+	/*
+	 * Remove a block relocation entry.
+	 */
+	errcode_t (*delete)(ext2_brel brel, blk64_t old);
+
+
+	/*
+	 * Free the block relocation table.
+	 */
+	errcode_t (*free)(ext2_brel brel);
+};
+
+errcode_t ext2fs_brel_memarray_create(char *name, blk64_t max_block,
+				    ext2_brel *brel);
+
+#define ext2fs_brel_put(brel, old, ent) ((brel)->put((brel), old, ent))
+#define ext2fs_brel_get(brel, old, ent) ((brel)->get((brel), old, ent))
+#define ext2fs_brel_start_iter(brel) ((brel)->start_iter((brel)))
+#define ext2fs_brel_next(brel, old, ent) ((brel)->next((brel), old, ent))
+#define ext2fs_brel_move(brel, old, new) ((brel)->move((brel), old, new))
+#define ext2fs_brel_delete(brel, old) ((brel)->delete((brel), old))
+#define ext2fs_brel_free(brel) ((brel)->free((brel)))
+
diff --git a/lib/ext2fs/brel_ma.c b/lib/ext2fs/brel_ma.c
new file mode 100644
index 0000000..a12afae
--- /dev/null
+++ b/lib/ext2fs/brel_ma.c
@@ -0,0 +1,199 @@
+/*
+ * brel_ma.c
+ *
+ * Copyright (C) 1996, 1997 Theodore Ts'o.
+ *
+ * TODO: rewrite to not use a direct array!!!  (Fortunately this
+ * module isn't really used yet.)
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <fcntl.h>
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#if HAVE_ERRNO_H
+#include <errno.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+#include "brel.h"
+
+static errcode_t bma_put(ext2_brel brel, blk64_t old,
+			struct ext2_block_relocate_entry *ent);
+static errcode_t bma_get(ext2_brel brel, blk64_t old,
+			struct ext2_block_relocate_entry *ent);
+static errcode_t bma_start_iter(ext2_brel brel);
+static errcode_t bma_next(ext2_brel brel, blk64_t *old,
+			 struct ext2_block_relocate_entry *ent);
+static errcode_t bma_move(ext2_brel brel, blk64_t old, blk64_t new);
+static errcode_t bma_delete(ext2_brel brel, blk64_t old);
+static errcode_t bma_free(ext2_brel brel);
+
+struct brel_ma {
+	__u32 magic;
+	blk64_t max_block;
+	struct ext2_block_relocate_entry *entries;
+};
+
+errcode_t ext2fs_brel_memarray_create(char *name, blk64_t max_block,
+				      ext2_brel *new_brel)
+{
+	ext2_brel		brel = 0;
+	errcode_t	retval;
+	struct brel_ma 	*ma = 0;
+	size_t		size;
+
+	*new_brel = 0;
+
+	/*
+	 * Allocate memory structures
+	 */
+	retval = ext2fs_get_mem(sizeof(struct ext2_block_relocation_table),
+				&brel);
+	if (retval)
+		goto errout;
+	memset(brel, 0, sizeof(struct ext2_block_relocation_table));
+
+	retval = ext2fs_get_mem(strlen(name)+1, &brel->name);
+	if (retval)
+		goto errout;
+	strcpy(brel->name, name);
+
+	retval = ext2fs_get_mem(sizeof(struct brel_ma), &ma);
+	if (retval)
+		goto errout;
+	memset(ma, 0, sizeof(struct brel_ma));
+	brel->priv_data = ma;
+
+	size = (size_t) (sizeof(struct ext2_block_relocate_entry) *
+			 (max_block+1));
+	retval = ext2fs_get_array(max_block+1,
+		sizeof(struct ext2_block_relocate_entry), &ma->entries);
+	if (retval)
+		goto errout;
+	memset(ma->entries, 0, size);
+	ma->max_block = max_block;
+
+	/*
+	 * Fill in the brel data structure
+	 */
+	brel->put = bma_put;
+	brel->get = bma_get;
+	brel->start_iter = bma_start_iter;
+	brel->next = bma_next;
+	brel->move = bma_move;
+	brel->delete = bma_delete;
+	brel->free = bma_free;
+
+	*new_brel = brel;
+	return 0;
+
+errout:
+	bma_free(brel);
+	return retval;
+}
+
+static errcode_t bma_put(ext2_brel brel, blk64_t old,
+			struct ext2_block_relocate_entry *ent)
+{
+	struct brel_ma 	*ma;
+
+	ma = brel->priv_data;
+	if (old > ma->max_block)
+		return EXT2_ET_INVALID_ARGUMENT;
+	ma->entries[(unsigned)old] = *ent;
+	return 0;
+}
+
+static errcode_t bma_get(ext2_brel brel, blk64_t old,
+			struct ext2_block_relocate_entry *ent)
+{
+	struct brel_ma 	*ma;
+
+	ma = brel->priv_data;
+	if (old > ma->max_block)
+		return EXT2_ET_INVALID_ARGUMENT;
+	if (ma->entries[(unsigned)old].new == 0)
+		return ENOENT;
+	*ent = ma->entries[old];
+	return 0;
+}
+
+static errcode_t bma_start_iter(ext2_brel brel)
+{
+	brel->current = 0;
+	return 0;
+}
+
+static errcode_t bma_next(ext2_brel brel, blk64_t *old,
+			  struct ext2_block_relocate_entry *ent)
+{
+	struct brel_ma 	*ma;
+
+	ma = brel->priv_data;
+	while (++brel->current < ma->max_block) {
+		if (ma->entries[(unsigned)brel->current].new == 0)
+			continue;
+		*old = brel->current;
+		*ent = ma->entries[(unsigned)brel->current];
+		return 0;
+	}
+	*old = 0;
+	return 0;
+}
+
+static errcode_t bma_move(ext2_brel brel, blk64_t old, blk64_t new)
+{
+	struct brel_ma 	*ma;
+
+	ma = brel->priv_data;
+	if ((old > ma->max_block) || (new > ma->max_block))
+		return EXT2_ET_INVALID_ARGUMENT;
+	if (ma->entries[(unsigned)old].new == 0)
+		return ENOENT;
+	ma->entries[(unsigned)new] = ma->entries[old];
+	ma->entries[(unsigned)old].new = 0;
+	return 0;
+}
+
+static errcode_t bma_delete(ext2_brel brel, blk64_t old)
+{
+	struct brel_ma 	*ma;
+
+	ma = brel->priv_data;
+	if (old > ma->max_block)
+		return EXT2_ET_INVALID_ARGUMENT;
+	if (ma->entries[(unsigned)old].new == 0)
+		return ENOENT;
+	ma->entries[(unsigned)old].new = 0;
+	return 0;
+}
+
+static errcode_t bma_free(ext2_brel brel)
+{
+	struct brel_ma 	*ma;
+
+	if (!brel)
+		return 0;
+
+	ma = brel->priv_data;
+
+	if (ma) {
+		if (ma->entries)
+			ext2fs_free_mem(&ma->entries);
+		ext2fs_free_mem(&ma);
+	}
+	if (brel->name)
+		ext2fs_free_mem(&brel->name);
+	ext2fs_free_mem(&brel);
+	return 0;
+}
diff --git a/lib/ext2fs/check_desc.c b/lib/ext2fs/check_desc.c
new file mode 100644
index 0000000..3e3fa94
--- /dev/null
+++ b/lib/ext2fs/check_desc.c
@@ -0,0 +1,104 @@
+/*
+ * check_desc.c --- Check the group descriptors of an ext2 filesystem
+ *
+ * Copyright (C) 1993, 1994, 1995, 1996 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+/*
+ * This routine sanity checks the group descriptors
+ */
+errcode_t ext2fs_check_desc(ext2_filsys fs)
+{
+	ext2fs_block_bitmap bmap;
+	errcode_t retval;
+	dgrp_t i;
+	blk64_t first_block = fs->super->s_first_data_block;
+	blk64_t last_block = ext2fs_blocks_count(fs->super)-1;
+	blk64_t blk, b;
+	unsigned int j;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	if (EXT2_DESC_SIZE(fs->super) & (EXT2_DESC_SIZE(fs->super) - 1))
+		return EXT2_ET_BAD_DESC_SIZE;
+
+	retval = ext2fs_allocate_subcluster_bitmap(fs, "check_desc map", &bmap);
+	if (retval)
+		return retval;
+
+	for (i = 0; i < fs->group_desc_count; i++)
+		ext2fs_reserve_super_and_bgd(fs, i, bmap);
+
+	for (i = 0; i < fs->group_desc_count; i++) {
+		if (!ext2fs_has_feature_flex_bg(fs->super)) {
+			first_block = ext2fs_group_first_block2(fs, i);
+			last_block = ext2fs_group_last_block2(fs, i);
+		}
+
+		/*
+		 * Check to make sure the block bitmap for group is sane
+		 */
+		blk = ext2fs_block_bitmap_loc(fs, i);
+		if (blk < first_block || blk > last_block ||
+		    ext2fs_test_block_bitmap2(bmap, blk)) {
+			retval = EXT2_ET_GDESC_BAD_BLOCK_MAP;
+			goto errout;
+		}
+		ext2fs_mark_block_bitmap2(bmap, blk);
+
+		/*
+		 * Check to make sure the inode bitmap for group is sane
+		 */
+		blk = ext2fs_inode_bitmap_loc(fs, i);
+		if (blk < first_block || blk > last_block ||
+		    ext2fs_test_block_bitmap2(bmap, blk)) {
+			retval = EXT2_ET_GDESC_BAD_INODE_MAP;
+			goto errout;
+		}
+		ext2fs_mark_block_bitmap2(bmap, blk);
+
+		/*
+		 * Check to make sure the inode table for group is sane
+		 */
+		blk = ext2fs_inode_table_loc(fs, i);
+		if (blk < first_block ||
+		    ((blk + fs->inode_blocks_per_group - 1) > last_block)) {
+			retval = EXT2_ET_GDESC_BAD_INODE_TABLE;
+			goto errout;
+		}
+		for (j = 0, b = blk; j < fs->inode_blocks_per_group;
+		     j++, b++) {
+			if (ext2fs_test_block_bitmap2(bmap, b)) {
+				retval = EXT2_ET_GDESC_BAD_INODE_TABLE;
+				goto errout;
+			}
+			ext2fs_mark_block_bitmap2(bmap, b);
+		}
+	}
+errout:
+	ext2fs_free_block_bitmap(bmap);
+	return retval;
+}
diff --git a/lib/ext2fs/closefs.c b/lib/ext2fs/closefs.c
new file mode 100644
index 0000000..69cbdd8
--- /dev/null
+++ b/lib/ext2fs/closefs.c
@@ -0,0 +1,521 @@
+/*
+ * closefs.c --- close an ext2 filesystem
+ *
+ * Copyright (C) 1993, 1994, 1995, 1996 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <time.h>
+#include <string.h>
+
+#include "ext2_fs.h"
+#include "ext2fsP.h"
+
+static int test_root(unsigned int a, unsigned int b)
+{
+	while (1) {
+		if (a < b)
+			return 0;
+		if (a == b)
+			return 1;
+		if (a % b)
+			return 0;
+		a = a / b;
+	}
+}
+
+int ext2fs_bg_has_super(ext2_filsys fs, dgrp_t group)
+{
+	if (group == 0)
+		return 1;
+	if (ext2fs_has_feature_sparse_super2(fs->super)) {
+		if (group == fs->super->s_backup_bgs[0] ||
+		    group == fs->super->s_backup_bgs[1])
+			return 1;
+		return 0;
+	}
+	if ((group <= 1) || !ext2fs_has_feature_sparse_super(fs->super))
+		return 1;
+	if (!(group & 1))
+		return 0;
+	if (test_root(group, 3) || (test_root(group, 5)) ||
+	    test_root(group, 7))
+		return 1;
+
+	return 0;
+}
+
+/*
+ * ext2fs_super_and_bgd_loc2()
+ * @fs:			ext2 fs pointer
+ * @group		given block group
+ * @ret_super_blk:	if !NULL, returns super block location
+ * @ret_old_desc_blk:	if !NULL, returns location of the old block
+ *			group descriptor
+ * @ret_new_desc_blk:	if !NULL, returns location of meta_bg block
+ *			group descriptor
+ * @ret_used_blks:	if !NULL, returns number of blocks used by
+ *			super block and group_descriptors.
+ *
+ * Returns errcode_t of 0
+ */
+errcode_t ext2fs_super_and_bgd_loc2(ext2_filsys fs,
+					   dgrp_t group,
+					   blk64_t *ret_super_blk,
+					   blk64_t *ret_old_desc_blk,
+					   blk64_t *ret_new_desc_blk,
+					   blk_t *ret_used_blks)
+{
+	blk64_t	group_block, super_blk = 0, old_desc_blk = 0, new_desc_blk = 0;
+	unsigned int meta_bg, meta_bg_size;
+	blk_t	numblocks = 0;
+	blk64_t old_desc_blocks;
+	int	has_super;
+
+	group_block = ext2fs_group_first_block2(fs, group);
+	if (group_block == 0 && fs->blocksize == 1024)
+		group_block = 1; /* Deal with 1024 blocksize && bigalloc */
+
+	if (ext2fs_has_feature_meta_bg(fs->super))
+		old_desc_blocks = fs->super->s_first_meta_bg;
+	else
+		old_desc_blocks =
+			fs->desc_blocks + fs->super->s_reserved_gdt_blocks;
+
+	has_super = ext2fs_bg_has_super(fs, group);
+
+	if (has_super) {
+		super_blk = group_block;
+		numblocks++;
+	}
+	meta_bg_size = EXT2_DESC_PER_BLOCK(fs->super);
+	meta_bg = group / meta_bg_size;
+
+	if (!ext2fs_has_feature_meta_bg(fs->super) ||
+	    (meta_bg < fs->super->s_first_meta_bg)) {
+		if (has_super) {
+			old_desc_blk = group_block + 1;
+			numblocks += old_desc_blocks;
+		}
+	} else {
+		if (((group % meta_bg_size) == 0) ||
+		    ((group % meta_bg_size) == 1) ||
+		    ((group % meta_bg_size) == (meta_bg_size-1))) {
+			if (has_super)
+				has_super = 1;
+			new_desc_blk = group_block + has_super;
+			numblocks++;
+		}
+	}
+
+	if (ret_super_blk)
+		*ret_super_blk = super_blk;
+	if (ret_old_desc_blk)
+		*ret_old_desc_blk = old_desc_blk;
+	if (ret_new_desc_blk)
+		*ret_new_desc_blk = new_desc_blk;
+	if (ret_used_blks)
+		*ret_used_blks = numblocks;
+
+	return 0;
+}
+
+/*
+ * This function returns the location of the superblock, block group
+ * descriptors for a given block group.  It currently returns the
+ * number of free blocks assuming that inode table and allocation
+ * bitmaps will be in the group.  This is not necessarily the case
+ * when the flex_bg feature is enabled, so callers should take care!
+ * It was only really intended for use by mke2fs, and even there it's
+ * not that useful.
+ *
+ * The ext2fs_super_and_bgd_loc2() function is 64-bit block number
+ * capable and returns the number of blocks used by super block and
+ * group descriptors.
+ */
+int ext2fs_super_and_bgd_loc(ext2_filsys fs,
+			     dgrp_t group,
+			     blk_t *ret_super_blk,
+			     blk_t *ret_old_desc_blk,
+			     blk_t *ret_new_desc_blk,
+			     int *ret_meta_bg)
+{
+	blk64_t ret_super_blk2;
+	blk64_t ret_old_desc_blk2;
+	blk64_t ret_new_desc_blk2;
+	blk_t ret_used_blks;
+	blk_t numblocks;
+	unsigned int meta_bg_size;
+
+	ext2fs_super_and_bgd_loc2(fs, group, &ret_super_blk2,
+					&ret_old_desc_blk2,
+					&ret_new_desc_blk2,
+					&ret_used_blks);
+
+	numblocks = ext2fs_group_blocks_count(fs, group);
+
+	if (ret_super_blk)
+		*ret_super_blk = (blk_t)ret_super_blk2;
+	if (ret_old_desc_blk)
+		*ret_old_desc_blk = (blk_t)ret_old_desc_blk2;
+	if (ret_new_desc_blk)
+		*ret_new_desc_blk = (blk_t)ret_new_desc_blk2;
+	if (ret_meta_bg) {
+		meta_bg_size = EXT2_DESC_PER_BLOCK(fs->super);
+		*ret_meta_bg = group / meta_bg_size;
+	}
+
+	numblocks -= 2 + fs->inode_blocks_per_group + ret_used_blks;
+
+	return numblocks;
+}
+
+/*
+ * This function forces out the primary superblock.  We need to only
+ * write out those fields which we have changed, since if the
+ * filesystem is mounted, it may have changed some of the other
+ * fields.
+ *
+ * It takes as input a superblock which has already been byte swapped
+ * (if necessary).
+ *
+ */
+static errcode_t write_primary_superblock(ext2_filsys fs,
+					  struct ext2_super_block *super)
+{
+	__u16		*old_super, *new_super;
+	int		check_idx, write_idx, size;
+	errcode_t	retval;
+
+	if (!fs->io->manager->write_byte || !fs->orig_super) {
+	fallback:
+		io_channel_set_blksize(fs->io, SUPERBLOCK_OFFSET);
+		retval = io_channel_write_blk64(fs->io, 1, -SUPERBLOCK_SIZE,
+					      super);
+		io_channel_set_blksize(fs->io, fs->blocksize);
+		return retval;
+	}
+
+	old_super = (__u16 *) fs->orig_super;
+	new_super = (__u16 *) super;
+
+	for (check_idx = 0; check_idx < SUPERBLOCK_SIZE/2; check_idx++) {
+		if (old_super[check_idx] == new_super[check_idx])
+			continue;
+		write_idx = check_idx;
+		for (check_idx++; check_idx < SUPERBLOCK_SIZE/2; check_idx++)
+			if (old_super[check_idx] == new_super[check_idx])
+				break;
+		size = 2 * (check_idx - write_idx);
+#if 0
+		printf("Writing %d bytes starting at %d\n",
+		       size, write_idx*2);
+#endif
+		retval = io_channel_write_byte(fs->io,
+			       SUPERBLOCK_OFFSET + (2 * write_idx), size,
+					       new_super + write_idx);
+		if (retval == EXT2_ET_UNIMPLEMENTED)
+			goto fallback;
+		if (retval)
+			return retval;
+	}
+	memcpy(fs->orig_super, super, SUPERBLOCK_SIZE);
+	return 0;
+}
+
+
+/*
+ * Updates the revision to EXT2_DYNAMIC_REV
+ */
+void ext2fs_update_dynamic_rev(ext2_filsys fs)
+{
+	struct ext2_super_block *sb = fs->super;
+
+	if (sb->s_rev_level > EXT2_GOOD_OLD_REV)
+		return;
+
+	sb->s_rev_level = EXT2_DYNAMIC_REV;
+	sb->s_first_ino = EXT2_GOOD_OLD_FIRST_INO;
+	sb->s_inode_size = EXT2_GOOD_OLD_INODE_SIZE;
+	/* s_uuid is handled by e2fsck already */
+	/* other fields should be left alone */
+}
+
+static errcode_t write_backup_super(ext2_filsys fs, dgrp_t group,
+				    blk64_t group_block,
+				    struct ext2_super_block *super_shadow)
+{
+	errcode_t retval;
+	dgrp_t	sgrp = group;
+
+	if (sgrp > ((1 << 16) - 1))
+		sgrp = (1 << 16) - 1;
+
+	super_shadow->s_block_group_nr = ext2fs_cpu_to_le16(sgrp);
+
+	retval = ext2fs_superblock_csum_set(fs, super_shadow);
+	if (retval)
+		return retval;
+
+	return io_channel_write_blk64(fs->io, group_block, -SUPERBLOCK_SIZE,
+				    super_shadow);
+}
+
+errcode_t ext2fs_flush(ext2_filsys fs)
+{
+	return ext2fs_flush2(fs, 0);
+}
+
+errcode_t ext2fs_flush2(ext2_filsys fs, int flags)
+{
+	dgrp_t		i;
+	errcode_t	retval;
+	unsigned long	fs_state;
+	__u32		feature_incompat;
+	struct ext2_super_block *super_shadow = 0;
+	struct opaque_ext2_group_desc *group_shadow = 0;
+#ifdef WORDS_BIGENDIAN
+	struct ext2_group_desc *gdp;
+	dgrp_t		j;
+#endif
+	char	*group_ptr;
+	blk64_t	old_desc_blocks;
+	struct ext2fs_numeric_progress_struct progress;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	if ((fs->flags & EXT2_FLAG_SUPER_ONLY) == 0 &&
+	    !ext2fs_has_feature_journal_dev(fs->super) &&
+	    fs->group_desc == NULL)
+		return EXT2_ET_NO_GDESC;
+
+	fs_state = fs->super->s_state;
+	feature_incompat = fs->super->s_feature_incompat;
+
+	fs->super->s_wtime = fs->now ? fs->now : time(NULL);
+	fs->super->s_block_group_nr = 0;
+
+	/*
+	 * If the write_bitmaps() function is present, call it to
+	 * flush the bitmaps.  This is done this way so that a simple
+	 * program that doesn't mess with the bitmaps doesn't need to
+	 * drag in the bitmaps.c code.
+	 *
+	 * Bitmap checksums live in the group descriptor, so the
+	 * bitmaps need to be written before the descriptors.
+	 */
+	if (fs->write_bitmaps) {
+		retval = fs->write_bitmaps(fs);
+		if (retval)
+			goto errout;
+	}
+
+	/*
+	 * Set the state of the FS to be non-valid.  (The state has
+	 * already been backed up earlier, and will be restored after
+	 * we write out the backup superblocks.)
+	 */
+	fs->super->s_state &= ~EXT2_VALID_FS;
+	ext2fs_clear_feature_journal_needs_recovery(fs->super);
+
+	/* Byte swap the superblock and the group descriptors if necessary */
+#ifdef WORDS_BIGENDIAN
+	retval = EXT2_ET_NO_MEMORY;
+	retval = ext2fs_get_mem(SUPERBLOCK_SIZE, &super_shadow);
+	if (retval)
+		goto errout;
+	memcpy(super_shadow, fs->super, sizeof(struct ext2_super_block));
+	ext2fs_swap_super(super_shadow);
+
+	if (((fs->flags & EXT2_FLAG_SUPER_ONLY) == 0) &&
+	    !ext2fs_has_feature_journal_dev(fs->super)) {
+		retval = ext2fs_get_array(fs->desc_blocks, fs->blocksize,
+					  &group_shadow);
+		if (retval)
+			goto errout;
+		memcpy(group_shadow, fs->group_desc, (size_t) fs->blocksize *
+		       fs->desc_blocks);
+
+		for (j = 0; j < fs->group_desc_count; j++) {
+			gdp = ext2fs_group_desc(fs, group_shadow, j);
+			ext2fs_swap_group_desc2(fs, gdp);
+		}
+	}
+#else
+	super_shadow = fs->super;
+	group_shadow = fs->group_desc;
+#endif
+
+	/*
+	 * If this is an external journal device, don't write out the
+	 * block group descriptors or any of the backup superblocks
+	 */
+	if (ext2fs_has_feature_journal_dev(fs->super))
+		goto write_primary_superblock_only;
+
+	/*
+	 * Write out the master group descriptors, and the backup
+	 * superblocks and group descriptors.
+	 */
+	group_ptr = (char *) group_shadow;
+	if (ext2fs_has_feature_meta_bg(fs->super)) {
+		old_desc_blocks = fs->super->s_first_meta_bg;
+		if (old_desc_blocks > fs->desc_blocks)
+			old_desc_blocks = fs->desc_blocks;
+	} else
+		old_desc_blocks = fs->desc_blocks;
+
+	if (fs->progress_ops && fs->progress_ops->init)
+		(fs->progress_ops->init)(fs, &progress, NULL,
+					 fs->group_desc_count);
+
+
+	for (i = 0; i < fs->group_desc_count; i++) {
+		blk64_t	super_blk, old_desc_blk, new_desc_blk;
+
+		if (fs->progress_ops && fs->progress_ops->update)
+			(fs->progress_ops->update)(fs, &progress, i);
+		ext2fs_super_and_bgd_loc2(fs, i, &super_blk, &old_desc_blk,
+					 &new_desc_blk, 0);
+
+		if (!(fs->flags & EXT2_FLAG_MASTER_SB_ONLY) &&i && super_blk) {
+			retval = write_backup_super(fs, i, super_blk,
+						    super_shadow);
+			if (retval)
+				goto errout;
+		}
+		if (fs->flags & EXT2_FLAG_SUPER_ONLY)
+			continue;
+		if ((old_desc_blk) &&
+		    (!(fs->flags & EXT2_FLAG_MASTER_SB_ONLY) || (i == 0))) {
+			retval = io_channel_write_blk64(fs->io,
+			      old_desc_blk, old_desc_blocks, group_ptr);
+			if (retval)
+				goto errout;
+		}
+		if (new_desc_blk) {
+			int meta_bg = i / EXT2_DESC_PER_BLOCK(fs->super);
+
+			retval = io_channel_write_blk64(fs->io, new_desc_blk,
+				1, group_ptr + (meta_bg*fs->blocksize));
+			if (retval)
+				goto errout;
+		}
+	}
+
+	if (fs->progress_ops && fs->progress_ops->close)
+		(fs->progress_ops->close)(fs, &progress, NULL);
+
+write_primary_superblock_only:
+	/*
+	 * Write out master superblock.  This has to be done
+	 * separately, since it is located at a fixed location
+	 * (SUPERBLOCK_OFFSET).  We flush all other pending changes
+	 * out to disk first, just to avoid a race condition with an
+	 * insy-tinsy window....
+	 */
+
+	fs->super->s_block_group_nr = 0;
+	fs->super->s_state = fs_state;
+	fs->super->s_feature_incompat = feature_incompat;
+#ifdef WORDS_BIGENDIAN
+	*super_shadow = *fs->super;
+	ext2fs_swap_super(super_shadow);
+#endif
+
+	retval = ext2fs_superblock_csum_set(fs, super_shadow);
+	if (retval)
+		return retval;
+
+	if (!(flags & EXT2_FLAG_FLUSH_NO_SYNC)) {
+		retval = io_channel_flush(fs->io);
+		if (retval)
+			goto errout;
+	}
+	retval = write_primary_superblock(fs, super_shadow);
+	if (retval)
+		goto errout;
+
+	fs->flags &= ~EXT2_FLAG_DIRTY;
+
+	if (!(flags & EXT2_FLAG_FLUSH_NO_SYNC)) {
+		retval = io_channel_flush(fs->io);
+		if (retval)
+			goto errout;
+	}
+errout:
+	fs->super->s_state = fs_state;
+#ifdef WORDS_BIGENDIAN
+	if (super_shadow)
+		ext2fs_free_mem(&super_shadow);
+	if (group_shadow)
+		ext2fs_free_mem(&group_shadow);
+#endif
+	return retval;
+}
+
+errcode_t ext2fs_close_free(ext2_filsys *fs_ptr)
+{
+	errcode_t ret;
+	ext2_filsys fs = *fs_ptr;
+
+	ret = ext2fs_close2(fs, 0);
+	if (ret)
+		ext2fs_free(fs);
+	*fs_ptr = NULL;
+	return ret;
+}
+
+errcode_t ext2fs_close(ext2_filsys fs)
+{
+	return ext2fs_close2(fs, 0);
+}
+
+errcode_t ext2fs_close2(ext2_filsys fs, int flags)
+{
+	errcode_t	retval;
+	int		meta_blks;
+	io_stats stats = 0;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	if (fs->write_bitmaps) {
+		retval = fs->write_bitmaps(fs);
+		if (retval)
+			return retval;
+	}
+	if (fs->super->s_kbytes_written &&
+	    fs->io->manager->get_stats)
+		fs->io->manager->get_stats(fs->io, &stats);
+	if (stats && stats->bytes_written && (fs->flags & EXT2_FLAG_RW)) {
+		fs->super->s_kbytes_written += stats->bytes_written >> 10;
+		meta_blks = fs->desc_blocks + 1;
+		if (!(fs->flags & EXT2_FLAG_SUPER_ONLY))
+			fs->super->s_kbytes_written += meta_blks /
+				(fs->blocksize / 1024);
+		if ((fs->flags & EXT2_FLAG_DIRTY) == 0)
+			fs->flags |= EXT2_FLAG_SUPER_ONLY | EXT2_FLAG_DIRTY;
+	}
+	if (fs->flags & EXT2_FLAG_DIRTY) {
+		retval = ext2fs_flush2(fs, flags);
+		if (retval)
+			return retval;
+	}
+
+	retval = ext2fs_mmp_stop(fs);
+	if (retval)
+		return retval;
+
+	ext2fs_free(fs);
+	return 0;
+}
+
diff --git a/lib/ext2fs/compiler.h b/lib/ext2fs/compiler.h
new file mode 100644
index 0000000..3bb3521
--- /dev/null
+++ b/lib/ext2fs/compiler.h
@@ -0,0 +1,26 @@
+#ifndef _EXT2FS_COMPILER_H
+#define _EXT2FS_COMPILER_H
+
+#include <stddef.h>
+
+#ifdef __GNUC__
+
+#ifndef __GNUC_PREREQ
+#if defined(__GNUC__) && defined(__GNUC_MINOR__)
+#define __GNUC_PREREQ(maj, min) \
+	((__GNUC__ << 16) + __GNUC_MINOR__ >= ((maj) << 16) + (min))
+#else
+#define __GNUC_PREREQ(maj, min) 0
+#endif
+#endif
+
+#define container_of(ptr, type, member) ({				\
+	__typeof__( ((type *)0)->member ) *__mptr = (ptr);	\
+	(type *)( (char *)__mptr - offsetof(type,member) );})
+#else
+#define container_of(ptr, type, member)				\
+	((type *)((char *)(ptr) - offsetof(type, member)))
+#endif
+
+
+#endif /* _EXT2FS_COMPILER_H */
diff --git a/lib/ext2fs/crc16.c b/lib/ext2fs/crc16.c
new file mode 100644
index 0000000..2fdeb24
--- /dev/null
+++ b/lib/ext2fs/crc16.c
@@ -0,0 +1,74 @@
+/*
+ *      crc16.c
+ *
+ * This source code is licensed under the GNU General Public License,
+ * Version 2. See the file COPYING for more details.
+ */
+
+#include "config.h"
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+#include <ext2fs/ext2_types.h>
+
+#include "crc16.h"
+
+/** CRC table for the CRC-16. The poly is 0x8005 (x16 + x15 + x2 + 1) */
+static __u16 const crc16_table[256] = {
+	0x0000, 0xC0C1, 0xC181, 0x0140, 0xC301, 0x03C0, 0x0280, 0xC241,
+	0xC601, 0x06C0, 0x0780, 0xC741, 0x0500, 0xC5C1, 0xC481, 0x0440,
+	0xCC01, 0x0CC0, 0x0D80, 0xCD41, 0x0F00, 0xCFC1, 0xCE81, 0x0E40,
+	0x0A00, 0xCAC1, 0xCB81, 0x0B40, 0xC901, 0x09C0, 0x0880, 0xC841,
+	0xD801, 0x18C0, 0x1980, 0xD941, 0x1B00, 0xDBC1, 0xDA81, 0x1A40,
+	0x1E00, 0xDEC1, 0xDF81, 0x1F40, 0xDD01, 0x1DC0, 0x1C80, 0xDC41,
+	0x1400, 0xD4C1, 0xD581, 0x1540, 0xD701, 0x17C0, 0x1680, 0xD641,
+	0xD201, 0x12C0, 0x1380, 0xD341, 0x1100, 0xD1C1, 0xD081, 0x1040,
+	0xF001, 0x30C0, 0x3180, 0xF141, 0x3300, 0xF3C1, 0xF281, 0x3240,
+	0x3600, 0xF6C1, 0xF781, 0x3740, 0xF501, 0x35C0, 0x3480, 0xF441,
+	0x3C00, 0xFCC1, 0xFD81, 0x3D40, 0xFF01, 0x3FC0, 0x3E80, 0xFE41,
+	0xFA01, 0x3AC0, 0x3B80, 0xFB41, 0x3900, 0xF9C1, 0xF881, 0x3840,
+	0x2800, 0xE8C1, 0xE981, 0x2940, 0xEB01, 0x2BC0, 0x2A80, 0xEA41,
+	0xEE01, 0x2EC0, 0x2F80, 0xEF41, 0x2D00, 0xEDC1, 0xEC81, 0x2C40,
+	0xE401, 0x24C0, 0x2580, 0xE541, 0x2700, 0xE7C1, 0xE681, 0x2640,
+	0x2200, 0xE2C1, 0xE381, 0x2340, 0xE101, 0x21C0, 0x2080, 0xE041,
+	0xA001, 0x60C0, 0x6180, 0xA141, 0x6300, 0xA3C1, 0xA281, 0x6240,
+	0x6600, 0xA6C1, 0xA781, 0x6740, 0xA501, 0x65C0, 0x6480, 0xA441,
+	0x6C00, 0xACC1, 0xAD81, 0x6D40, 0xAF01, 0x6FC0, 0x6E80, 0xAE41,
+	0xAA01, 0x6AC0, 0x6B80, 0xAB41, 0x6900, 0xA9C1, 0xA881, 0x6840,
+	0x7800, 0xB8C1, 0xB981, 0x7940, 0xBB01, 0x7BC0, 0x7A80, 0xBA41,
+	0xBE01, 0x7EC0, 0x7F80, 0xBF41, 0x7D00, 0xBDC1, 0xBC81, 0x7C40,
+	0xB401, 0x74C0, 0x7580, 0xB541, 0x7700, 0xB7C1, 0xB681, 0x7640,
+	0x7200, 0xB2C1, 0xB381, 0x7340, 0xB101, 0x71C0, 0x7080, 0xB041,
+	0x5000, 0x90C1, 0x9181, 0x5140, 0x9301, 0x53C0, 0x5280, 0x9241,
+	0x9601, 0x56C0, 0x5780, 0x9741, 0x5500, 0x95C1, 0x9481, 0x5440,
+	0x9C01, 0x5CC0, 0x5D80, 0x9D41, 0x5F00, 0x9FC1, 0x9E81, 0x5E40,
+	0x5A00, 0x9AC1, 0x9B81, 0x5B40, 0x9901, 0x59C0, 0x5880, 0x9841,
+	0x8801, 0x48C0, 0x4980, 0x8941, 0x4B00, 0x8BC1, 0x8A81, 0x4A40,
+	0x4E00, 0x8EC1, 0x8F81, 0x4F40, 0x8D01, 0x4DC0, 0x4C80, 0x8C41,
+	0x4400, 0x84C1, 0x8581, 0x4540, 0x8701, 0x47C0, 0x4680, 0x8641,
+	0x8201, 0x42C0, 0x4380, 0x8341, 0x4100, 0x81C1, 0x8081, 0x4040
+};
+
+/**
+ * Compute the CRC-16 for the data buffer
+ *
+ * @param crc     previous CRC value
+ * @param buffer  data pointer
+ * @param len     number of bytes in the buffer
+ * @return        the updated CRC value
+ */
+crc16_t ext2fs_crc16(crc16_t crc, const void *buffer, unsigned int len)
+{
+	const unsigned char *cp = buffer;
+
+	while (len--)
+		/*
+		 * for an unknown reason, PPC treats __u16 as signed
+		 * and keeps doing sign extension on the value.
+		 * Instead, use only the low 16 bits of an unsigned
+		 * int for holding the CRC value to avoid this.
+		 */
+		crc = (((crc >> 8) & 0xffU) ^
+		       crc16_table[(crc ^ *cp++) & 0xffU]) & 0x0000ffffU;
+	return crc;
+}
diff --git a/lib/ext2fs/crc16.h b/lib/ext2fs/crc16.h
new file mode 100644
index 0000000..322e68d
--- /dev/null
+++ b/lib/ext2fs/crc16.h
@@ -0,0 +1,26 @@
+/*
+ *	crc16.h - CRC-16 routine
+ *
+ * Implements the standard CRC-16:
+ *   Width 16
+ *   Poly  0x8005 (x16 + x15 + x2 + 1)
+ *   Init  0
+ *
+ * Copyright (c) 2005 Ben Gardner <bgardner@wabtec.com>
+ *
+ * This source code is licensed under the GNU General Public License,
+ * Version 2. See the file COPYING for more details.
+ */
+
+#ifndef __CRC16_H
+#define __CRC16_H
+
+/* for an unknown reason, PPC treats __u16 as signed and keeps doing sign
+ * extension on the value.  Instead, use only the low 16 bits of an
+ * unsigned int for holding the CRC value to avoid this.
+ */
+typedef unsigned int crc16_t;
+
+extern crc16_t ext2fs_crc16(crc16_t crc, const void *buffer, unsigned int len);
+
+#endif /* __CRC16_H */
diff --git a/lib/ext2fs/crc32c.c b/lib/ext2fs/crc32c.c
new file mode 100644
index 0000000..df5cf9b
--- /dev/null
+++ b/lib/ext2fs/crc32c.c
@@ -0,0 +1,938 @@
+/*
+ * crc32c.c
+ *
+ * August 26, 2011 Darrick J. Wong <djwong at us.ibm.com>
+ * Reuse Bob Pearson's slice-by-8 implementation for e2fsprogs.
+ *
+ * July 20, 2011 Bob Pearson <rpearson at systemfabricworks.com>
+ * added slice by 8 algorithm to the existing conventional and
+ * slice by 4 algorithms.
+ *
+ * Oct 15, 2000 Matt Domsch <Matt_Domsch@dell.com>
+ * Nicer crc32 functions/docs submitted by linux@horizon.com.  Thanks!
+ * Code was from the public domain, copyright abandoned.  Code was
+ * subsequently included in the kernel, thus was re-licensed under the
+ * GNU GPL v2.
+ *
+ * Oct 12, 2000 Matt Domsch <Matt_Domsch@dell.com>
+ * Same crc32 function was used in 5 other places in the kernel.
+ * I made one version, and deleted the others.
+ * There are various incantations of crc32().  Some use a seed of 0 or ~0.
+ * Some xor at the end with ~0.  The generic crc32() function takes
+ * seed as an argument, and doesn't xor at the end.  Then individual
+ * users can do whatever they need.
+ *   drivers/net/smc9194.c uses seed ~0, doesn't xor with ~0.
+ *   fs/jffs2 uses seed 0, doesn't xor with ~0.
+ *   fs/partitions/efi.c uses seed ~0, xor's with ~0.
+ *
+ * This source code is licensed under the GNU General Public License,
+ * Version 2.  See the file COPYING for more details.
+ */
+#include "config.h"
+#include <stdint.h>
+#include <stdlib.h>
+#include <stdio.h>
+#define min(x, y)		((x) > (y) ? (y) : (x))
+#define __ALIGN_KERNEL_MASK(x, mask)	(((x) + (mask)) & ~(mask))
+#define __ALIGN_KERNEL(x, a)	__ALIGN_KERNEL_MASK(x, (__typeof__(x))(a) - 1)
+#define ALIGN(x, a)		__ALIGN_KERNEL((x), (a))
+#define PTR_ALIGN(p, a)		((__typeof__(p))ALIGN((unsigned long)(p), (a)))
+#include "crc32c_defs.h"
+
+#include "ext2fs.h"
+#ifdef WORDS_BIGENDIAN
+#define __constant_cpu_to_le32(x) ___constant_swab32((x))
+#define __constant_cpu_to_be32(x) (x)
+#define __be32_to_cpu(x) (x)
+#define __cpu_to_be32(x) (x)
+#define __cpu_to_le32(x) (ext2fs_cpu_to_le32((x)))
+#define __le32_to_cpu(x) (ext2fs_le32_to_cpu((x)))
+#else
+#define __constant_cpu_to_le32(x) (x)
+#define __constant_cpu_to_be32(x) ___constant_swab32((x))
+#define __be32_to_cpu(x) (ext2fs_be32_to_cpu((x)))
+#define __cpu_to_be32(x) (ext2fs_cpu_to_be32((x)))
+#define __cpu_to_le32(x) (x)
+#define __le32_to_cpu(x) (x)
+#endif
+
+#if CRC_LE_BITS > 8
+# define tole(x) __constant_cpu_to_le32(x)
+#else
+# define tole(x) (x)
+#endif
+
+#if CRC_BE_BITS > 8
+# define tobe(x) __constant_cpu_to_be32(x)
+#else
+# define tobe(x) (x)
+#endif
+
+#include "crc32c_table.h"
+
+#if CRC_LE_BITS > 8 || CRC_BE_BITS > 8
+
+#if CRC_LE_BITS < 64 && CRC_BE_BITS < 64
+#define CRC_INLINE inline
+#else
+#define CRC_INLINE
+#endif
+
+/* implements slicing-by-4 or slicing-by-8 algorithm */
+static CRC_INLINE uint32_t
+crc32_body(uint32_t crc, unsigned char const *buf, size_t len,
+	   const uint32_t (*tab)[256])
+{
+# ifndef WORDS_BIGENDIAN
+#  define DO_CRC(x) (crc = t0[(crc ^ (x)) & 255] ^ (crc >> 8))
+#  define DO_CRC4 (t3[(q) & 255] ^ t2[(q >> 8) & 255] ^ \
+		   t1[(q >> 16) & 255] ^ t0[(q >> 24) & 255])
+#  define DO_CRC8 (t7[(q) & 255] ^ t6[(q >> 8) & 255] ^ \
+		   t5[(q >> 16) & 255] ^ t4[(q >> 24) & 255])
+# else
+#  define DO_CRC(x) (crc = t0[((crc >> 24) ^ (x)) & 255] ^ (crc << 8))
+#  define DO_CRC4 (t0[(q) & 255] ^ t1[(q >> 8) & 255] ^ \
+		   t2[(q >> 16) & 255] ^ t3[(q >> 24) & 255])
+#  define DO_CRC8 (t4[(q) & 255] ^ t5[(q >> 8) & 255] ^ \
+		   t6[(q >> 16) & 255] ^ t7[(q >> 24) & 255])
+# endif
+	const uint32_t *b;
+	size_t rem_len;
+	const uint32_t *t0 = tab[0], *t1 = tab[1], *t2 = tab[2], *t3 = tab[3];
+	const uint32_t *t4 = tab[4], *t5 = tab[5], *t6 = tab[6], *t7 = tab[7];
+	uint32_t q;
+
+	/* Align it */
+	if (unlikely((uintptr_t)buf & 3 && len)) {
+		do {
+			DO_CRC(*buf++);
+		} while ((--len) && ((uintptr_t)buf)&3);
+	}
+
+# if CRC_LE_BITS == 32
+	rem_len = len & 3;
+	len = len >> 2;
+# else
+	rem_len = len & 7;
+	len = len >> 3;
+# endif
+
+	b = (const uint32_t *)buf;
+	for (--b; len; --len) {
+		q = crc ^ *++b; /* use pre increment for speed */
+# if CRC_LE_BITS == 32
+		crc = DO_CRC4;
+# else
+		crc = DO_CRC8;
+		q = *++b;
+		crc ^= DO_CRC4;
+# endif
+	}
+	len = rem_len;
+	/* And the last few bytes */
+	if (len) {
+		const uint8_t *p = (const uint8_t *)(b + 1) - 1;
+		do {
+			DO_CRC(*++p); /* use pre increment for speed */
+		} while (--len);
+	}
+	return crc;
+#undef DO_CRC
+#undef DO_CRC4
+#undef DO_CRC8
+}
+#endif
+
+/**
+ * crc32_le() - Calculate bitwise little-endian Ethernet AUTODIN II CRC32
+ * @crc: seed value for computation.  ~0 for Ethernet, sometimes 0 for
+ *	other uses, or the previous crc32 value if computing incrementally.
+ * @p: pointer to buffer over which CRC is run
+ * @len: length of buffer @p
+ */
+static inline uint32_t crc32_le_generic(uint32_t crc, unsigned char const *p,
+					size_t len, const uint32_t (*tab)[256],
+					uint32_t polynomial EXT2FS_ATTR((unused)))
+{
+#if CRC_LE_BITS == 1
+	int i;
+	while (len--) {
+		crc ^= *p++;
+		for (i = 0; i < 8; i++)
+			crc = (crc >> 1) ^ ((crc & 1) ? polynomial : 0);
+	}
+# elif CRC_LE_BITS == 2
+	while (len--) {
+		crc ^= *p++;
+		crc = (crc >> 2) ^ tab[0][crc & 3];
+		crc = (crc >> 2) ^ tab[0][crc & 3];
+		crc = (crc >> 2) ^ tab[0][crc & 3];
+		crc = (crc >> 2) ^ tab[0][crc & 3];
+	}
+# elif CRC_LE_BITS == 4
+	while (len--) {
+		crc ^= *p++;
+		crc = (crc >> 4) ^ tab[0][crc & 15];
+		crc = (crc >> 4) ^ tab[0][crc & 15];
+	}
+# elif CRC_LE_BITS == 8
+	/* aka Sarwate algorithm */
+	while (len--) {
+		crc ^= *p++;
+		crc = (crc >> 8) ^ tab[0][crc & 255];
+	}
+# else
+	crc = __cpu_to_le32(crc);
+	crc = crc32_body(crc, p, len, tab);
+	crc = __le32_to_cpu(crc);
+#endif
+	return crc;
+}
+
+uint32_t ext2fs_crc32c_le(uint32_t crc, unsigned char const *p, size_t len)
+{
+	return crc32_le_generic(crc, p, len, crc32ctable_le, CRC32C_POLY_LE);
+}
+
+/**
+ * crc32_be() - Calculate bitwise big-endian Ethernet AUTODIN II CRC32
+ * @crc: seed value for computation.  ~0 for Ethernet, sometimes 0 for
+ *	other uses, or the previous crc32 value if computing incrementally.
+ * @p: pointer to buffer over which CRC is run
+ * @len: length of buffer @p
+ */
+static inline uint32_t crc32_be_generic(uint32_t crc, unsigned char const *p,
+					size_t len, const uint32_t (*tab)[256],
+					uint32_t polynomial EXT2FS_ATTR((unused)))
+{
+#if CRC_BE_BITS == 1
+	int i;
+	while (len--) {
+		crc ^= *p++ << 24;
+		for (i = 0; i < 8; i++)
+			crc =
+			    (crc << 1) ^ ((crc & 0x80000000) ? polynomial :
+					  0);
+	}
+# elif CRC_BE_BITS == 2
+	while (len--) {
+		crc ^= *p++ << 24;
+		crc = (crc << 2) ^ tab[0][crc >> 30];
+		crc = (crc << 2) ^ tab[0][crc >> 30];
+		crc = (crc << 2) ^ tab[0][crc >> 30];
+		crc = (crc << 2) ^ tab[0][crc >> 30];
+	}
+# elif CRC_BE_BITS == 4
+	while (len--) {
+		crc ^= *p++ << 24;
+		crc = (crc << 4) ^ tab[0][crc >> 28];
+		crc = (crc << 4) ^ tab[0][crc >> 28];
+	}
+# elif CRC_BE_BITS == 8
+	while (len--) {
+		crc ^= *p++ << 24;
+		crc = (crc << 8) ^ tab[0][crc >> 24];
+	}
+# else
+	crc = __cpu_to_be32(crc);
+	crc = crc32_body(crc, p, len, tab);
+	crc = __be32_to_cpu(crc);
+# endif
+	return crc;
+}
+
+uint32_t ext2fs_crc32_be(uint32_t crc, unsigned char const *p, size_t len)
+{
+	return crc32_be_generic(crc, p, len, crc32table_be, CRCPOLY_BE);
+}
+
+#ifdef UNITTEST
+static uint8_t test_buf[] = {
+	0xd9, 0xd7, 0x6a, 0x13, 0x3a, 0xb1, 0x05, 0x48,
+	0xda, 0xad, 0x14, 0xbd, 0x03, 0x3a, 0x58, 0x5e,
+	0x6e, 0xd1, 0x56, 0xc9, 0x2e, 0xc4, 0xcb, 0x6b,
+	0xe8, 0x77, 0x52, 0x37, 0x4e, 0x0f, 0x55, 0xd2,
+	0x12, 0x65, 0x90, 0xc2, 0x41, 0x49, 0x81, 0x01,
+	0xf5, 0x01, 0xeb, 0x2d, 0x78, 0x74, 0x23, 0x5d,
+	0x84, 0x5c, 0x81, 0x92, 0x21, 0xe9, 0x8d, 0x1d,
+	0x89, 0xf2, 0x4a, 0xac, 0xdd, 0xf9, 0xaf, 0xee,
+	0x44, 0xe7, 0x6e, 0xed, 0xfb, 0xd8, 0x89, 0x0e,
+	0x96, 0x62, 0xcd, 0xa4, 0x4b, 0xa9, 0xe5, 0x45,
+	0xb1, 0x29, 0x9b, 0x0f, 0xfc, 0xbd, 0x83, 0xab,
+	0xa8, 0x54, 0x96, 0x44, 0x2c, 0x7f, 0xbb, 0xe7,
+	0x52, 0x29, 0x08, 0xee, 0x14, 0xc5, 0xc2, 0xec,
+	0x5a, 0xeb, 0x40, 0x40, 0xea, 0xd1, 0x3d, 0x15,
+	0x73, 0xaa, 0x8c, 0x73, 0xfc, 0xf2, 0x2b, 0x49,
+	0x0b, 0x13, 0x96, 0xd9, 0x8e, 0x4b, 0xbc, 0xe0,
+	0xf4, 0xd2, 0xe0, 0x2e, 0x7a, 0xf0, 0x5d, 0x1f,
+	0xd2, 0x92, 0x97, 0xe0, 0xaa, 0x59, 0xab, 0xc9,
+	0x5c, 0xa6, 0x51, 0x1a, 0xe3, 0xd6, 0x06, 0xb9,
+	0xae, 0xb8, 0x76, 0x36, 0x79, 0x37, 0x52, 0xf6,
+	0x34, 0xaf, 0x27, 0x19, 0xe1, 0xc0, 0x2b, 0xdd,
+	0x01, 0x15, 0xcd, 0xce, 0x44, 0xf6, 0x4c, 0x18,
+	0x92, 0x69, 0xbe, 0x8a, 0x76, 0x23, 0x52, 0x13,
+	0x3f, 0xf9, 0xe0, 0xf5, 0x06, 0x28, 0x7c, 0xc7,
+	0xf3, 0x42, 0x0f, 0xdd, 0x40, 0x33, 0xf7, 0x99,
+	0xe2, 0xad, 0x26, 0xd9, 0x53, 0x10, 0x72, 0x0c,
+	0x4e, 0x43, 0x4c, 0x61, 0xfe, 0xd9, 0xc1, 0x16,
+	0xa1, 0x93, 0xca, 0x3c, 0x75, 0x7f, 0x07, 0x7a,
+	0x65, 0xb3, 0x53, 0x2a, 0x52, 0x00, 0xa0, 0x62,
+	0xe0, 0xa3, 0x1f, 0xad, 0xd7, 0xbb, 0xc0, 0x83,
+	0x5d, 0x54, 0x87, 0x5f, 0xc8, 0x2f, 0xc8, 0xbf,
+	0x69, 0x04, 0x91, 0xc8, 0xa6, 0x1d, 0x4d, 0x46,
+	0x91, 0xfc, 0x26, 0xf4, 0x16, 0xd1, 0xa4, 0xbf,
+	0x5c, 0xa2, 0x6c, 0xdd, 0xb4, 0x40, 0xf2, 0x2e,
+	0xa2, 0xad, 0xf7, 0xf4, 0xa5, 0x8a, 0x3e, 0x23,
+	0x64, 0x08, 0xc8, 0xa1, 0xa0, 0xf0, 0x5d, 0x70,
+	0xd2, 0x77, 0xfd, 0xc8, 0x50, 0x83, 0x0f, 0xd6,
+	0x2b, 0xe4, 0x1f, 0x52, 0x34, 0x33, 0x68, 0xfd,
+	0x92, 0xbe, 0x9f, 0x97, 0x6b, 0x8d, 0x81, 0x91,
+	0x0f, 0xef, 0x65, 0xc8, 0x0d, 0x15, 0x01, 0x77,
+	0x58, 0xb2, 0xf4, 0x1b, 0x06, 0x7e, 0xf5, 0xca,
+	0x15, 0x2e, 0x38, 0xd8, 0x81, 0x1c, 0x1c, 0xa0,
+	0xb6, 0x13, 0x6a, 0x2b, 0x71, 0x34, 0x52, 0xd7,
+	0x1d, 0xbd, 0x37, 0x59, 0xbc, 0x86, 0x25, 0x2b,
+	0xa8, 0x93, 0xce, 0x1a, 0x03, 0x16, 0xfe, 0x01,
+	0x57, 0x99, 0x24, 0x25, 0x2c, 0xb3, 0xab, 0x1e,
+	0x2d, 0x65, 0x20, 0x89, 0x17, 0x02, 0x0e, 0x0a,
+	0xf5, 0x1e, 0xc7, 0xff, 0x1f, 0x61, 0xa9, 0x54,
+	0x18, 0xd4, 0xba, 0x50, 0x57, 0x02, 0xa1, 0xab,
+	0x22, 0x2e, 0x07, 0xea, 0xa9, 0xa3, 0x83, 0x4f,
+	0x27, 0xf5, 0xc5, 0xee, 0x3c, 0x3b, 0x10, 0xad,
+	0x32, 0x2b, 0x1c, 0x03, 0xcb, 0xaf, 0x98, 0x83,
+	0x54, 0xc3, 0x68, 0x63, 0xd4, 0xe0, 0x0e, 0x3c,
+	0x1a, 0x4e, 0xc0, 0x81, 0xd0, 0xe8, 0x6a, 0x62,
+	0x6b, 0x3e, 0x6f, 0xc4, 0xc6, 0x33, 0x4e, 0x26,
+	0x21, 0xf5, 0x04, 0xdf, 0xfa, 0xce, 0x45, 0xaf,
+	0xdc, 0x5e, 0x1b, 0xad, 0x93, 0xca, 0xf5, 0xcf,
+	0xd7, 0xee, 0x0c, 0x5c, 0x5e, 0xb4, 0xf0, 0x92,
+	0xd2, 0xf2, 0xf0, 0xa9, 0x1e, 0xab, 0x80, 0x68,
+	0x46, 0xef, 0xcc, 0x26, 0x0c, 0x5c, 0xdd, 0x4e,
+	0x83, 0xb8, 0xb9, 0x53, 0x6e, 0xf8, 0x93, 0x38,
+	0x67, 0xa4, 0x41, 0x87, 0x72, 0xe7, 0x7e, 0x86,
+	0xc9, 0x49, 0x00, 0x33, 0xb1, 0x38, 0x6c, 0x71,
+	0xd7, 0x1d, 0x8e, 0x61, 0x01, 0xb6, 0x57, 0xa9,
+	0xf1, 0xac, 0x15, 0xc2, 0x83, 0x77, 0xca, 0x64,
+	0xca, 0x7b, 0x6c, 0xa1, 0x10, 0x1b, 0x13, 0xd0,
+	0xd3, 0x9e, 0x9e, 0x10, 0x70, 0xc8, 0x1a, 0xbb,
+	0x3f, 0x19, 0x86, 0xab, 0x01, 0x0e, 0xea, 0x34,
+	0x22, 0xea, 0xe2, 0x15, 0xb7, 0xed, 0x21, 0x21,
+	0x75, 0xa5, 0xe7, 0x08, 0xa1, 0x38, 0xe0, 0x91,
+	0x05, 0x60, 0xea, 0xa7, 0x50, 0x27, 0x18, 0x07,
+	0x9d, 0xe0, 0x18, 0x2b, 0xd4, 0x07, 0x59, 0x00,
+	0xe6, 0x45, 0x18, 0x2a, 0x30, 0x6e, 0xf3, 0xb4,
+	0xd0, 0xef, 0xa6, 0x5b, 0x71, 0xa2, 0x5a, 0x3b,
+	0x89, 0x4c, 0xaf, 0x3f, 0xcb, 0x9f, 0x03, 0xfb,
+	0x43, 0x7c, 0x6b, 0xd3, 0x6a, 0xea, 0xce, 0x4a,
+	0x5f, 0x64, 0xb5, 0x62, 0xda, 0x5d, 0x27, 0xb7,
+	0xb8, 0x11, 0xca, 0x33, 0x30, 0xec, 0x70, 0xf0,
+	0x1b, 0x03, 0x50, 0xff, 0x5e, 0xa6, 0x08, 0xde,
+	0x37, 0x70, 0xc0, 0x81, 0x55, 0x60, 0x17, 0xa1,
+	0x85, 0xae, 0x26, 0x44, 0xe4, 0x67, 0x3c, 0x91,
+	0xfd, 0xc4, 0x3d, 0x97, 0x72, 0x23, 0xf3, 0x3c,
+	0x8f, 0xe0, 0xe2, 0xf2, 0x09, 0x96, 0x10, 0x67,
+	0xb5, 0xfe, 0xff, 0x3d, 0x4a, 0xc8, 0x62, 0x11,
+	0xa5, 0x98, 0xc1, 0x2d, 0x40, 0x82, 0x88, 0x8b,
+	0xe5, 0xb0, 0x75, 0xbf, 0x2f, 0xa8, 0x6a, 0x55,
+	0x49, 0x2e, 0x9c, 0x29, 0xd2, 0x7c, 0xbf, 0xf3,
+	0xaa, 0x3a, 0x16, 0x4a, 0xa4, 0x15, 0xf3, 0x48,
+	0xde, 0x38, 0x13, 0x44, 0x26, 0x02, 0xe6, 0xe9,
+	0xa8, 0x24, 0x89, 0xb5, 0x43, 0x95, 0xe4, 0x4c,
+	0xc3, 0xa0, 0xdf, 0xcc, 0x42, 0xf8, 0x8d, 0xb0,
+	0x3b, 0xea, 0x10, 0xb7, 0xe1, 0x40, 0x54, 0xb9,
+	0xa3, 0x2d, 0xfb, 0xb4, 0x91, 0xc0, 0x3e, 0x94,
+	0xf1, 0xa1, 0x3c, 0xbe, 0xef, 0xb8, 0x70, 0x55,
+	0x0a, 0x26, 0x93, 0xbf, 0xe6, 0x21, 0x92, 0x32,
+	0x3c, 0x39, 0x27, 0x6a, 0x23, 0x48, 0x02, 0x35,
+	0x3c, 0xd4, 0xcc, 0x04, 0xc0, 0x4e, 0xa7, 0x02,
+	0x63, 0x37, 0xc2, 0xb8, 0x56, 0x1d, 0x57, 0x57,
+	0x42, 0x04, 0x8d, 0xee, 0xcf, 0x8b, 0xc9, 0xc3,
+	0xba, 0x3b, 0x15, 0xd7, 0xaf, 0xbf, 0x9e, 0xcd,
+	0x44, 0xcf, 0xf0, 0x00, 0xb7, 0x3a, 0xfc, 0xa8,
+	0x12, 0xab, 0x3a, 0x62, 0x01, 0x21, 0x46, 0xe9,
+	0x1e, 0x48, 0x37, 0xfc, 0x13, 0x4d, 0xf6, 0x2a,
+	0x72, 0x40, 0x75, 0x38, 0x71, 0xf2, 0x17, 0x20,
+	0x2c, 0xdd, 0xc0, 0x49, 0xbc, 0x63, 0x33, 0xea,
+	0x06, 0x75, 0x41, 0xe7, 0x5c, 0x1f, 0xfb, 0xf9,
+	0x68, 0x83, 0xc2, 0x5a, 0x4a, 0x1e, 0x61, 0x08,
+	0x57, 0xf3, 0x00, 0xba, 0x77, 0x92, 0x63, 0xa5,
+	0xb7, 0xfe, 0x97, 0x22, 0xda, 0x5e, 0xd3, 0xaf,
+	0xbc, 0x89, 0x0d, 0x4c, 0x37, 0xa9, 0x27, 0x4a,
+	0x7f, 0xdb, 0x81, 0x39, 0x11, 0x86, 0x12, 0xf9,
+	0x10, 0x50, 0xe4, 0xdb, 0x72, 0xf9, 0xae, 0x10,
+	0x7c, 0xed, 0x50, 0x5c, 0x61, 0xeb, 0x42, 0x1e,
+	0xa4, 0xf4, 0xf0, 0xfa, 0x45, 0x4d, 0x95, 0x2b,
+	0xd4, 0x67, 0x4a, 0xe3, 0x8a, 0x15, 0x55, 0x92,
+	0x77, 0x64, 0x8c, 0x51, 0x38, 0xf9, 0x26, 0x3e,
+	0x68, 0xe2, 0xac, 0xbb, 0x64, 0x77, 0xe2, 0x82,
+	0xa4, 0x42, 0x41, 0x38, 0xa0, 0xf0, 0xc9, 0xd8,
+	0x6c, 0xe0, 0xef, 0x4c, 0xda, 0xb4, 0x92, 0xef,
+	0x1b, 0xe3, 0x9b, 0xc1, 0x44, 0x3c, 0xb9, 0xb7,
+	0x39, 0xac, 0x5c, 0x32, 0x39, 0xb4, 0x21, 0x85,
+	0x93, 0xbc, 0xf2, 0x51, 0x43, 0xb7, 0xae, 0x1e,
+	0x61, 0x9c, 0x38, 0x9c, 0xaa, 0xff, 0xde, 0xfc,
+	0xbf, 0x85, 0xef, 0x17, 0x34, 0x36, 0x71, 0x5f,
+	0x04, 0x16, 0xa6, 0x9e, 0xfd, 0x3a, 0x03, 0xd8,
+	0xbf, 0x71, 0x70, 0x20, 0x8f, 0x7c, 0xfb, 0xff,
+	0x61, 0xe0, 0xe2, 0x60, 0xa7, 0xb1, 0xc0, 0xe0,
+	0xd9, 0x3f, 0xdc, 0x8d, 0x4a, 0xa4, 0x52, 0x61,
+	0xaf, 0x9d, 0xdf, 0x8a, 0x0d, 0x41, 0xc0, 0x25,
+	0x68, 0x12, 0x7b, 0xd5, 0xc7, 0xdb, 0x68, 0x70,
+	0x2d, 0x7d, 0x95, 0x12, 0x03, 0x23, 0x0c, 0xe8,
+	0x14, 0x41, 0x11, 0x28, 0xec, 0x9d, 0xd3, 0x28,
+	0x77, 0x7a, 0x3c, 0x93, 0x8e, 0x5c, 0x7e, 0xb3,
+	0x42, 0x9a, 0x18, 0x25, 0x93, 0xc8, 0xea, 0x43,
+	0x1b, 0xbe, 0xd5, 0x27, 0xf1, 0xd4, 0xe0, 0x1e,
+	0xce, 0xc7, 0xc7, 0x2c, 0x25, 0x35, 0x58, 0xb8,
+	0x6c, 0xf3, 0xa2, 0xad, 0xe7, 0x58, 0x49, 0x47,
+	0xf7, 0xca, 0xde, 0x8b, 0x81, 0xb7, 0x75, 0xf4,
+	0x95, 0xa7, 0x5c, 0xc3, 0x2c, 0x0e, 0x1c, 0x52,
+	0x9a, 0xc3, 0x2a, 0x00, 0x21, 0xa7, 0x51, 0x6b,
+	0xf0, 0x05, 0x87, 0x8c, 0x42, 0x1b, 0xc3, 0x2e,
+	0xa3, 0x76, 0x22, 0xd5, 0x7f, 0x56, 0x10, 0xef,
+	0x98, 0x85, 0x65, 0x86, 0x71, 0x87, 0xd2, 0x8c,
+	0xc0, 0x47, 0x20, 0xe8, 0xb5, 0x1c, 0xe3, 0xdd,
+	0x3c, 0x5c, 0x03, 0xbb, 0x0e, 0x97, 0x3b, 0xe1,
+	0x56, 0x9a, 0xd5, 0x0a, 0x63, 0xd5, 0x33, 0xaf,
+	0x36, 0xca, 0xcf, 0x8f, 0x00, 0x28, 0xa3, 0x45,
+	0xb8, 0xcd, 0xde, 0x73, 0xd4, 0xfa, 0x2d, 0x6f,
+	0xdb, 0x93, 0xaa, 0xdd, 0x7f, 0xd2, 0x22, 0x9c,
+	0x96, 0x48, 0x1e, 0xa8, 0x63, 0xbe, 0xbc, 0x0d,
+	0x14, 0x3c, 0x2e, 0x11, 0x1f, 0xd2, 0xf4, 0x57,
+	0xb3, 0x47, 0xf8, 0xa6, 0x1b, 0xc3, 0xa7, 0x95,
+	0x2d, 0xd4, 0xca, 0xb8, 0x0d, 0xfb, 0x06, 0x85,
+	0xda, 0x63, 0xf0, 0x3e, 0x9d, 0x5e, 0xee, 0xce,
+	0xed, 0x74, 0x1d, 0x2c, 0x97, 0x3f, 0x71, 0x95,
+	0x12, 0x03, 0xc5, 0x92, 0x46, 0x84, 0x1b, 0x07,
+	0xe6, 0xb4, 0x1d, 0x3a, 0xf1, 0x89, 0x90, 0x50,
+	0x10, 0x29, 0x34, 0xc0, 0x90, 0xbe, 0x4a, 0xa9,
+	0x0d, 0xb0, 0x7b, 0xfb, 0x35, 0xee, 0x4e, 0x34,
+	0xec, 0x5a, 0x58, 0xbc, 0xb8, 0xda, 0x38, 0x88,
+	0x8c, 0x74, 0x1e, 0xc9, 0xab, 0x78, 0x2e, 0x2a,
+	0x17, 0x8a, 0x43, 0x3d, 0xa1, 0x2a, 0x41, 0xb5,
+	0xd6, 0xe8, 0x5b, 0xc5, 0x4a, 0x1c, 0x3c, 0x9f,
+	0x8d, 0x3a, 0x69, 0x88, 0xf8, 0x80, 0xd2, 0x11,
+	0xfc, 0x7e, 0x80, 0x8e, 0x7f, 0x85, 0x64, 0x9c,
+	0x46, 0x58, 0xc8, 0x48, 0x98, 0x4b, 0xf5, 0x73,
+	0x3f, 0x49, 0xce, 0x53, 0x2c, 0xd5, 0xfc, 0x33,
+	0xf1, 0x6f, 0xd8, 0xe9, 0x2e, 0x70, 0x2e, 0xdc,
+	0xe5, 0x43, 0x80, 0x38, 0xf2, 0x87, 0xed, 0x85,
+	0xe4, 0x3e, 0x45, 0x14, 0x20, 0xcf, 0xa0, 0x61,
+	0x4f, 0xe8, 0xd7, 0x5b, 0xb3, 0x0d, 0x0e, 0x4e,
+	0x4d, 0xce, 0xbe, 0xba, 0xaa, 0x90, 0x09, 0xcb,
+	0x4b, 0x5d, 0x08, 0xff, 0x52, 0xd5, 0x23, 0xbc,
+	0xad, 0x8d, 0xd3, 0x06, 0x4a, 0xa0, 0x51, 0x56,
+	0xa7, 0xd8, 0x33, 0xab, 0xbc, 0xd0, 0xdf, 0x92,
+	0x87, 0x20, 0x2d, 0x7b, 0x5e, 0xfa, 0x30, 0xa7,
+	0x06, 0x06, 0xe5, 0x4f, 0x2c, 0xb5, 0x61, 0xd7,
+	0x54, 0xd3, 0xdf, 0xd0, 0x0a, 0xb0, 0x06, 0xce,
+	0xf6, 0x86, 0xb7, 0x8e, 0xaa, 0x7b, 0x78, 0xd5,
+	0xb9, 0xeb, 0x07, 0xac, 0x5f, 0xc5, 0xd2, 0x8c,
+	0x40, 0xe0, 0x7f, 0x98, 0xd4, 0xe5, 0x4b, 0xca,
+	0xfb, 0x47, 0xef, 0xef, 0xb9, 0x4d, 0x6d, 0x8f,
+	0x82, 0x68, 0x74, 0x84, 0xe0, 0x0a, 0x93, 0x0f,
+	0xb2, 0x01, 0xa9, 0x9f, 0x68, 0x6a, 0xe8, 0xf7,
+	0xfb, 0x0b, 0xde, 0x17, 0xe0, 0x30, 0x38, 0x51,
+	0xbc, 0x07, 0xb8, 0x2c, 0x91, 0x0f, 0xc1, 0x0e,
+	0xa6, 0xf9, 0xf0, 0xd5, 0x48, 0x76, 0x8a, 0xde,
+	0x74, 0xe3, 0x30, 0x65, 0x56, 0xb3, 0x5c, 0xe2,
+	0x89, 0x8d, 0xda, 0x80, 0xad, 0x0f, 0x22, 0xfb,
+	0x24, 0x1d, 0x16, 0xdd, 0x34, 0x4b, 0x90, 0x58,
+	0x4e, 0x0c, 0x13, 0x28, 0xcf, 0x1d, 0xa4, 0xaa,
+	0xb7, 0xf3, 0xb1, 0x66, 0xad, 0x3b, 0xcf, 0x79,
+	0x12, 0x04, 0xd7, 0x79, 0xd9, 0x5f, 0xdf, 0x89,
+	0xb2, 0x5b, 0xa7, 0x9a, 0x26, 0x1e, 0x67, 0x46,
+	0x7c, 0x66, 0x95, 0x67, 0xe6, 0x45, 0x8b, 0x1f,
+	0x65, 0x79, 0x9f, 0x6d, 0x11, 0x81, 0x17, 0x0d,
+	0x11, 0xb0, 0x5c, 0xb4, 0xc7, 0x27, 0x87, 0xab,
+	0x5d, 0x0a, 0x18, 0xae, 0x4e, 0x06, 0xa3, 0x3d,
+	0xc7, 0xb0, 0x22, 0xba, 0x03, 0xa4, 0x0f, 0xe5,
+	0x1c, 0x72, 0x2a, 0x04, 0xce, 0x83, 0xe9, 0xf3,
+	0xd7, 0xc9, 0x67, 0x6c, 0x1e, 0x6b, 0x3c, 0x9b,
+	0x0b, 0x5e, 0x6a, 0xa6, 0x79, 0x0a, 0xf1, 0xbe,
+	0xd7, 0xb4, 0x6f, 0x45, 0x1e, 0xfb, 0x78, 0x97,
+	0xaf, 0x34, 0x76, 0x95, 0x52, 0xf7, 0x3d, 0x5d,
+	0x07, 0x28, 0x57, 0x9c, 0x4a, 0x0f, 0xcf, 0x0b,
+	0x1b, 0xc4, 0xc2, 0x72, 0xd7, 0x72, 0x38, 0x9b,
+	0xea, 0xeb, 0xee, 0xae, 0x34, 0xc8, 0x01, 0xd7,
+	0xa5, 0xe3, 0xce, 0x41, 0xad, 0x02, 0x60, 0x23,
+	0x18, 0x36, 0xba, 0x17, 0xfa, 0xcf, 0xe4, 0xda,
+	0xdc, 0xfc, 0x82, 0xdc, 0x7c, 0x11, 0xf4, 0xb8,
+	0x52, 0x5d, 0xf7, 0x2f, 0xc8, 0xfe, 0x4a, 0xe6,
+	0xb9, 0xaf, 0x4b, 0x17, 0x18, 0x91, 0xc2, 0xfe,
+	0xd7, 0x3a, 0x77, 0x0c, 0xa0, 0x43, 0x9c, 0x6f,
+	0x13, 0x06, 0xbe, 0x6e, 0xe0, 0x1a, 0x3c, 0xf3,
+	0xf5, 0xcc, 0x78, 0xfb, 0x5d, 0xd5, 0xda, 0xb7,
+	0x58, 0xea, 0x86, 0x42, 0x6b, 0x32, 0xff, 0xb2,
+	0xe2, 0xee, 0x03, 0x1f, 0xf4, 0xef, 0xdb, 0x53,
+	0x79, 0xd5, 0x4e, 0xaf, 0x60, 0x8e, 0x02, 0xc2,
+	0xcc, 0x39, 0x97, 0x7b, 0xfd, 0xa1, 0xf8, 0x7a,
+	0x26, 0xe8, 0x55, 0xd6, 0xa4, 0x8b, 0xa0, 0x1b,
+	0x2d, 0x63, 0xaa, 0x73, 0x71, 0x6e, 0xbf, 0x8b,
+	0x3b, 0xe3, 0x1b, 0x0d, 0xbb, 0x2e, 0x44, 0x09,
+	0x64, 0xac, 0xc7, 0x9e, 0xb5, 0xc6, 0x77, 0xb0,
+	0x79, 0xb3, 0xaa, 0xfc, 0x67, 0x57, 0x9a, 0x50,
+	0x81, 0x37, 0x14, 0x7c, 0xd7, 0xa0, 0xd4, 0x6a,
+	0x79, 0x84, 0x51, 0x0e, 0x95, 0x0a, 0x30, 0xa3,
+	0x60, 0x55, 0x48, 0x05, 0x16, 0xae, 0x43, 0x90,
+	0xdc, 0x8e, 0x09, 0xbe, 0x79, 0xf6, 0x90, 0x74,
+	0xf8, 0x20, 0x96, 0x4d, 0xa7, 0xf5, 0x1a, 0x2b,
+	0xc7, 0x15, 0x9d, 0x18, 0xf7, 0x94, 0x87, 0xf7,
+	0xf4, 0xfb, 0x0d, 0x61, 0xb6, 0xd7, 0xbe, 0x10,
+	0x8e, 0x47, 0x3c, 0x10, 0x44, 0x90, 0x52, 0x21,
+	0x83, 0xc0, 0xf5, 0x99, 0xaa, 0xbc, 0xf6, 0x55,
+	0xae, 0xf5, 0xb2, 0xa4, 0xcd, 0x4d, 0xb9, 0x38,
+	0x6c, 0xbc, 0x80, 0xc3, 0xad, 0xf4, 0x46, 0x31,
+	0x01, 0x58, 0x2d, 0x88, 0x57, 0xc3, 0x23, 0xd1,
+	0x64, 0xc9, 0xa3, 0x21, 0x6b, 0x8b, 0x8a, 0x23,
+	0x2c, 0x4f, 0xa9, 0xcd, 0x67, 0xfa, 0x77, 0xad,
+	0xa3, 0x16, 0xa2, 0xe5, 0x19, 0x14, 0x70, 0x41,
+	0x5b, 0xda, 0x14, 0xde, 0xe3, 0xe5, 0xc1, 0x15,
+	0xb4, 0x77, 0xa4, 0x9b, 0xb8, 0xb1, 0x28, 0x51,
+	0x30, 0xb4, 0xf1, 0xf3, 0xf8, 0x6d, 0xd0, 0xc3,
+	0x8c, 0x4c, 0x76, 0xb0, 0x9a, 0xdf, 0xc8, 0xbe,
+	0xf8, 0x4a, 0x61, 0x6e, 0x3e, 0xd6, 0x3c, 0xe8,
+	0xde, 0x56, 0xa0, 0x9c, 0x25, 0xbe, 0xce, 0x93,
+	0x1f, 0x88, 0xfb, 0x9a, 0x1a, 0xe2, 0xff, 0x88,
+	0xad, 0x10, 0xcb, 0x6c, 0xd6, 0xe7, 0x39, 0x0b,
+	0xe5, 0x1a, 0x06, 0x05, 0x64, 0x5b, 0x0a, 0xdf,
+	0x22, 0x58, 0xd7, 0xfb, 0x88, 0x12, 0xdd, 0xb7,
+	0x52, 0x3a, 0xc9, 0xbf, 0x49, 0xdf, 0x8c, 0x87,
+	0x9f, 0x84, 0xb5, 0x0a, 0xf6, 0x00, 0x52, 0xae,
+	0x67, 0x12, 0x1a, 0x8c, 0x71, 0x15, 0xf5, 0xa1,
+	0x13, 0x39, 0xf0, 0x91, 0x7e, 0x88, 0x7c, 0xb3,
+	0x95, 0x50, 0x02, 0xa6, 0x63, 0xb5, 0x64, 0xfb,
+	0x90, 0x87, 0x61, 0xe2, 0x27, 0xaf, 0x11, 0x0c,
+	0x73, 0x83, 0xef, 0xa9, 0x28, 0xfe, 0xc8, 0x85,
+	0x1a, 0x3a, 0xde, 0xf2, 0xe5, 0x25, 0x64, 0x6d,
+	0xaa, 0x41, 0x4c, 0x80, 0x2e, 0x84, 0xff, 0xc1,
+	0xc0, 0x54, 0x0c, 0x29, 0x1b, 0xa3, 0x07, 0x7c,
+	0x33, 0x4c, 0x10, 0xf6, 0x6f, 0x79, 0xdf, 0xd3,
+	0xf0, 0x24, 0x57, 0xf1, 0x60, 0xe1, 0xf0, 0xbd,
+	0xc4, 0x1f, 0xf4, 0x67, 0xd2, 0xd3, 0xcc, 0x6a,
+	0x07, 0x72, 0x44, 0x16, 0x85, 0x46, 0xd0, 0x73,
+	0x87, 0xa9, 0xc7, 0x2f, 0xd1, 0xf5, 0xec, 0xe3,
+	0x28, 0xa3, 0x93, 0x4f, 0xd7, 0x76, 0xc1, 0x3c,
+	0x0d, 0x13, 0x33, 0xcf, 0x5b, 0xbd, 0x6a, 0x52,
+	0x4e, 0xee, 0xc8, 0x5e, 0xa1, 0x58, 0x4a, 0x08,
+	0x81, 0xd9, 0x23, 0xcc, 0xfb, 0x1c, 0xb2, 0xd8,
+	0xa3, 0xe4, 0x53, 0xfe, 0xf4, 0x4b, 0x48, 0xc1,
+	0x20, 0xa4, 0x97, 0xf8, 0x38, 0xa3, 0x69, 0xc1,
+	0x11, 0xf0, 0xa1, 0x3b, 0xa9, 0x9a, 0x12, 0x61,
+	0xe8, 0x8d, 0x99, 0x44, 0x3f, 0x94, 0x72, 0x82,
+	0x19, 0x96, 0x62, 0xb0, 0xa6, 0x64, 0x05, 0x19,
+	0x8f, 0xd6, 0x5d, 0x05, 0xbf, 0x79, 0x9e, 0x9d,
+	0xe4, 0x93, 0x4c, 0xad, 0x61, 0x8c, 0x18, 0xda,
+	0xb6, 0x2e, 0xb3, 0xca, 0x14, 0x4d, 0x53, 0xa4,
+	0x97, 0x27, 0x10, 0x56, 0xa2, 0x67, 0x5a, 0x5a,
+	0x5e, 0x13, 0xc0, 0xdb, 0xa7, 0x9f, 0x45, 0x5b,
+	0xeb, 0x1a, 0x14, 0x0c, 0x8c, 0x38, 0x5e, 0x77,
+	0x9a, 0xec, 0x75, 0x68, 0x93, 0x65, 0x02, 0x9c,
+	0xfb, 0x62, 0x60, 0x49, 0xdd, 0xb2, 0x2a, 0x67,
+	0x86, 0xe3, 0x8a, 0x7d, 0x8c, 0x46, 0x78, 0x81,
+	0x60, 0x69, 0xf2, 0x3f, 0x74, 0x11, 0x35, 0xff,
+	0x77, 0xa3, 0x66, 0x20, 0xfc, 0x98, 0x4a, 0x35,
+	0x7a, 0x52, 0xe4, 0x90, 0x13, 0x80, 0xb9, 0xa6,
+	0x73, 0x7a, 0x7d, 0x66, 0x6e, 0x6b, 0xb6, 0x43,
+	0x10, 0xd5, 0x91, 0x2b, 0x66, 0xdd, 0x89, 0x87,
+	0xe3, 0x8c, 0x58, 0x53, 0x2f, 0x40, 0x74, 0x45,
+	0x1b, 0x77, 0x7a, 0xa4, 0x44, 0x19, 0x78, 0xba,
+	0x87, 0x10, 0x41, 0x31, 0x32, 0x5f, 0x87, 0x68,
+	0xde, 0x43, 0x4a, 0xef, 0x33, 0xb3, 0x11, 0x83,
+	0xa9, 0xc2, 0x6f, 0x8d, 0x34, 0xe2, 0x95, 0x84,
+	0x3a, 0x4f, 0x6f, 0x8c, 0x31, 0x1d, 0xb6, 0xf5,
+	0x95, 0x0d, 0x01, 0x11, 0x20, 0xdf, 0x72, 0xf3,
+	0x3f, 0x9a, 0x33, 0xaa, 0xb1, 0x06, 0x6a, 0x63,
+	0x47, 0x91, 0x01, 0xdf, 0xb3, 0x54, 0x36, 0xfd,
+	0x06, 0x2d, 0xb8, 0x08, 0xe3, 0xd3, 0x65, 0xac,
+	0x66, 0x03, 0xee, 0xa4, 0x63, 0xbd, 0xd4, 0xce,
+	0xbd, 0x79, 0xa7, 0x48, 0x38, 0xc5, 0x7d, 0xb5,
+	0x71, 0x9a, 0x3c, 0x11, 0x7c, 0x6c, 0xe2, 0x54,
+	0x02, 0x5d, 0x42, 0xab, 0x25, 0x93, 0x66, 0x01,
+	0x37, 0x78, 0x35, 0x4a, 0x8c, 0x19, 0x4d, 0x00,
+	0x75, 0x4f, 0xcc, 0xc0, 0x26, 0x82, 0xc1, 0x35,
+	0x8c, 0xc7, 0xc2, 0x59, 0x01, 0x3e, 0x98, 0x22,
+	0x88, 0x9c, 0x90, 0x75, 0x05, 0x33, 0x07, 0xb9,
+	0x39, 0x81, 0x38, 0x58, 0x10, 0x29, 0xcf, 0xc8,
+	0x98, 0xb2, 0x03, 0xd7, 0x5b, 0xb3, 0x18, 0xba,
+	0x34, 0x0c, 0x9f, 0xab, 0xd7, 0xed, 0x29, 0x82,
+	0x41, 0xe0, 0x20, 0x97, 0x57, 0x92, 0xb2, 0xb8,
+	0x10, 0x2d, 0x0b, 0xa2, 0xc5, 0x8f, 0x90, 0x6f,
+	0xed, 0x12, 0x56, 0x25, 0xbe, 0xfd, 0x75, 0xf7,
+	0xb6, 0xf8, 0x40, 0x67, 0x39, 0x11, 0xfa, 0x15,
+	0xae, 0x6a, 0x54, 0x5f, 0x32, 0x2b, 0xf8, 0x48,
+	0x55, 0xbe, 0x86, 0x2f, 0x69, 0x48, 0x5b, 0x5d,
+	0x4d, 0xb7, 0x35, 0xaa, 0xb6, 0x91, 0x88, 0x19,
+	0x96, 0x1c, 0x68, 0xf6, 0x85, 0x9e, 0xb3, 0xb2,
+	0xa3, 0x32, 0xd4, 0x52, 0x70, 0xb7, 0x62, 0xe3,
+	0x14, 0xb6, 0x78, 0x5f, 0x1b, 0x1d, 0x04, 0x9c,
+	0x26, 0x0c, 0x33, 0x94, 0xb1, 0x97, 0x08, 0xdb,
+	0x0b, 0x39, 0x29, 0xd4, 0xbc, 0x6d, 0xdf, 0x02,
+	0xc6, 0x99, 0xab, 0x99, 0x32, 0xe5, 0xce, 0x51,
+	0x4f, 0xae, 0xb8, 0x8b, 0xe0, 0xaf, 0x07, 0xc4,
+	0xf9, 0x41, 0x7c, 0x59, 0xa0, 0xac, 0x74, 0x4d,
+	0x7e, 0x43, 0x77, 0x9c, 0x06, 0x49, 0x79, 0x8a,
+	0x14, 0x73, 0x93, 0xa8, 0x5b, 0x1b, 0x34, 0x29,
+	0x78, 0x04, 0x2f, 0xd7, 0x1f, 0x13, 0x90, 0xe0,
+	0xdd, 0x3b, 0x42, 0x6b, 0x79, 0x6e, 0x52, 0xc7,
+	0x0f, 0x38, 0xda, 0x01, 0x2c, 0x8d, 0xe6, 0x94,
+	0x5d, 0x59, 0x27, 0x1d, 0x10, 0x4e, 0x11, 0x36,
+	0xfb, 0x53, 0x16, 0x05, 0x25, 0xf2, 0x64, 0xd8,
+	0xf9, 0xcd, 0x5c, 0xfe, 0xb4, 0x18, 0x44, 0x80,
+	0x10, 0xbc, 0x3d, 0xf3, 0x1d, 0x5a, 0xf0, 0xc1,
+	0xc3, 0x55, 0xff, 0x41, 0x3e, 0xe3, 0xef, 0x44,
+	0xb2, 0xc0, 0x01, 0x18, 0xa2, 0x49, 0x88, 0x78,
+	0x0d, 0x4c, 0xc8, 0x73, 0xcf, 0x30, 0x85, 0x3a,
+	0x88, 0x90, 0x01, 0xcf, 0x69, 0x53, 0xa3, 0x18,
+	0x3f, 0xd6, 0xe7, 0x94, 0x14, 0xa7, 0xae, 0xcd,
+	0x6f, 0x11, 0x72, 0xfe, 0x2b, 0xb0, 0x81, 0x53,
+	0xea, 0x67, 0xd6, 0xe4, 0xca, 0x42, 0xa0, 0xf9,
+	0xb1, 0xd4, 0xb5, 0x3b, 0xc9, 0xf0, 0x36, 0xc1,
+	0x1c, 0xf4, 0xb1, 0xf6, 0x84, 0xd0, 0x86, 0x6c,
+	0x76, 0x9a, 0x03, 0xc2, 0xb6, 0x2e, 0x9a, 0x46,
+	0xf5, 0x5f, 0x2c, 0x38, 0xac, 0xad, 0x6f, 0x2e,
+	0x7a, 0x18, 0x2d, 0x22, 0x95, 0x5e, 0x5e, 0xc9,
+	0x7a, 0x0a, 0x56, 0xe1, 0xc7, 0x15, 0xfd, 0xbf,
+	0xff, 0xf7, 0x7e, 0x85, 0x20, 0xa9, 0x8a, 0x9c,
+	0xa9, 0x7d, 0xe8, 0xed, 0xfc, 0x7f, 0xbb, 0xf0,
+	0x05, 0x3f, 0xce, 0x4f, 0x4c, 0xee, 0xa4, 0xa0,
+	0xcc, 0x9c, 0x62, 0x1e, 0xd6, 0xd0, 0x30, 0x37,
+	0xb8, 0x98, 0x56, 0x1d, 0xaa, 0xd6, 0x5e, 0x73,
+	0x12, 0xe4, 0x88, 0x82, 0x48, 0x64, 0x06, 0xd7,
+	0x2a, 0x31, 0x50, 0x7b, 0x10, 0x17, 0xb8, 0x4c,
+	0x5a, 0x8d, 0xf1, 0xfc, 0xf1, 0x33, 0x3b, 0x98,
+	0x42, 0x18, 0x5b, 0x35, 0x78, 0xca, 0x8e, 0x41,
+	0x52, 0xae, 0x6d, 0xe1, 0xa2, 0x9d, 0x5b, 0xbd,
+	0xf3, 0x5f, 0x49, 0xc1, 0x27, 0x06, 0xc1, 0xaf,
+	0xc0, 0xa3, 0x9d, 0xf3, 0x1c, 0x8e, 0x90, 0x8a,
+	0xb0, 0x69, 0xb0, 0xc5, 0x11, 0x0c, 0x91, 0x14,
+	0x1f, 0x5e, 0x10, 0xe1, 0x1d, 0x14, 0x30, 0x54,
+	0x1e, 0x17, 0x3d, 0x31, 0x7b, 0xbf, 0x2f, 0x9d,
+	0x6d, 0x63, 0x32, 0xf0, 0x9d, 0x9f, 0x95, 0x3d,
+	0x0b, 0xd2, 0x4d, 0x10, 0xe2, 0x3f, 0x67, 0x69,
+	0x43, 0x9a, 0x4a, 0x2c, 0x54, 0x71, 0xa8, 0xa0,
+	0x9e, 0x9f, 0x10, 0xaf, 0x1b, 0xce, 0x99, 0xe3,
+	0x25, 0x32, 0x10, 0x54, 0x80, 0xfe, 0xda, 0x57,
+	0xd0, 0xb2, 0x92, 0x7f, 0xbb, 0x5f, 0xe7, 0x4d,
+	0x1b, 0x3d, 0x46, 0x4d, 0xe4, 0x4c, 0xd6, 0xaf,
+	0x1a, 0x32, 0x12, 0x40, 0xb8, 0x84, 0x8e, 0xe4,
+	0x80, 0xce, 0x7e, 0xc1, 0x13, 0x8b, 0xb0, 0xb7,
+	0x6f, 0x24, 0xba, 0x85, 0x50, 0x83, 0xc3, 0xcf,
+	0x19, 0xb3, 0xf0, 0xc7, 0xee, 0x68, 0xbe, 0x9e,
+	0x6d, 0xb9, 0xfb, 0xd5, 0x29, 0xce, 0x82, 0xcd,
+	0x69, 0x16, 0x68, 0x6b, 0x6a, 0xf4, 0x02, 0x32,
+	0xce, 0x60, 0x37, 0x0c, 0xb9, 0x38, 0x92, 0x9c,
+	0x42, 0xa9, 0x0b, 0x53, 0x96, 0xfe, 0x39, 0xc1,
+	0x24, 0x65, 0x9b, 0xcd, 0xe7, 0x8d, 0x36, 0x07,
+	0x9f, 0x1d, 0x35, 0x8e, 0xdc, 0x4c, 0xb5, 0x68,
+	0xc5, 0xfd, 0x44, 0x19, 0xf2, 0x6c, 0x59, 0x1c,
+	0xb1, 0x0b, 0x35, 0x48, 0x86, 0x1a, 0x05, 0x22,
+	0x03, 0x0c, 0x0c, 0xa2, 0x92, 0x90, 0x35, 0xfb,
+	0x37, 0x94, 0xc7, 0x15, 0x84, 0xae, 0xe8, 0x05,
+	0xa0, 0xf7, 0x30, 0x11, 0x5c, 0xe4, 0x5d, 0x3e,
+	0x12, 0x54, 0x80, 0x54, 0x6b, 0x09, 0x8c, 0xce,
+	0x80, 0x5e, 0xa7, 0xc8, 0x6a, 0x0c, 0x56, 0xe1,
+	0x18, 0x7d, 0xc9, 0x39, 0xc1, 0xef, 0xe3, 0x25,
+	0xa0, 0x8b, 0x2f, 0x60, 0x3a, 0x43, 0x39, 0xa6,
+	0x28, 0x28, 0x7b, 0x4c, 0x77, 0xd4, 0x49, 0x61,
+	0x46, 0xe9, 0x1b, 0x45, 0xd6, 0xb1, 0x56, 0xe1,
+	0x7d, 0x34, 0xcd, 0x06, 0xb6, 0x67, 0x8d, 0x7d,
+	0x7a, 0xe2, 0xbe, 0x68, 0x35, 0xa6, 0x78, 0xe5,
+	0x47, 0x48, 0xb7, 0xc7, 0xde, 0xcd, 0xc9, 0x05,
+	0xb4, 0xe7, 0x50, 0x48, 0xe1, 0x4b, 0xfe, 0x76,
+	0x77, 0xc6, 0xf7, 0x5f, 0xcb, 0xc2, 0xa8, 0xd7,
+	0xd6, 0x8a, 0xe5, 0x49, 0xd9, 0xca, 0x45, 0xf4,
+	0xda, 0xcd, 0x33, 0xd1, 0x59, 0x2d, 0x9e, 0xc1,
+	0x5c, 0xe6, 0x01, 0x18, 0xb8, 0xf0, 0x5e, 0xb1,
+	0x69, 0x95, 0x2f, 0x02, 0x2a, 0xe7, 0x4a, 0xd7,
+	0xd1, 0xc3, 0xd5, 0x6f, 0x15, 0xc8, 0xdc, 0x29,
+	0xde, 0xb9, 0x3f, 0x8b, 0xa6, 0xbc, 0xdd, 0x25,
+	0x84, 0x35, 0x3c, 0x90, 0x2d, 0xc2, 0x1e, 0x98,
+	0x8a, 0x50, 0x09, 0x77, 0x42, 0xe9, 0x35, 0x8a,
+	0x7c, 0x97, 0xbf, 0xe8, 0xbf, 0x56, 0xd0, 0x8b,
+	0x65, 0xd3, 0xaf, 0x1e, 0x05, 0x94, 0xfa, 0xac,
+	0xa8, 0x2b, 0x28, 0xcb, 0x37, 0x3e, 0xe8, 0xbb,
+	0x66, 0x3a, 0xed, 0xb2, 0x48, 0x10, 0x0f, 0x3a,
+	0x5a, 0xc5, 0xdb, 0x26, 0x0e, 0xaa, 0x5e, 0x69,
+	0x15, 0xd6, 0x81, 0xae, 0xbd, 0xe6, 0x03, 0xf1,
+	0xf6, 0x37, 0xc8, 0xde, 0x70, 0x1f, 0x64, 0xb9,
+	0x5e, 0xbf, 0x2e, 0x4f, 0xb1, 0xea, 0xa0, 0x17,
+	0xe6, 0x7c, 0xf9, 0x2f, 0x1e, 0xd8, 0x58, 0xde,
+	0xa7, 0xf0, 0x46, 0x52, 0x95, 0xdf, 0xa4, 0x96,
+	0xd0, 0xc4, 0x97, 0x2b, 0x95, 0xcd, 0x5e, 0x40,
+	0x23, 0x5c, 0x10, 0xee, 0xba, 0x72, 0x9b, 0xcf,
+	0x0b, 0xe8, 0x18, 0x3a, 0x70, 0xd2, 0x5e, 0x07,
+	0x68, 0x93, 0xef, 0x4a, 0x5b, 0x8d, 0x72, 0x41,
+	0x4e, 0xea, 0x33, 0x6a, 0x0a, 0x5e, 0xfb, 0x02,
+	0x3f, 0xd4, 0xed, 0x5b, 0xe0, 0x42, 0x84, 0xd4,
+	0xaa, 0x85, 0xdc, 0x5b, 0x67, 0xee, 0x71, 0x67,
+	0xba, 0x8e, 0xd2, 0xbe, 0x61, 0xdf, 0x5a, 0x26,
+	0xb9, 0xf0, 0x77, 0x81, 0x53, 0x24, 0x16, 0xcb,
+	0x8c, 0xb8, 0x06, 0x6e, 0x68, 0xda, 0xc8, 0x2d,
+	0x17, 0x54, 0xdb, 0x46, 0xcb, 0xfd, 0x1f, 0x3d,
+	0x94, 0x81, 0x09, 0x4b, 0xfa, 0xb1, 0x46, 0xd9,
+	0x11, 0xa3, 0xb7, 0x31, 0x9c, 0xd2, 0x38, 0xd6,
+	0xba, 0x3d, 0xa3, 0x74, 0xd8, 0xf1, 0x24, 0xe8,
+	0x9c, 0xcb, 0x1d, 0xf9, 0x4a, 0xf7, 0xc8, 0x4b,
+	0xfe, 0x97, 0x7c, 0xa1, 0x02, 0xeb, 0x40, 0xc3,
+	0x89, 0x71, 0x01, 0xcd, 0x33, 0x2a, 0xc2, 0x82,
+	0xce, 0x62, 0x8d, 0x53, 0x7c, 0xdf, 0xce, 0xd7,
+	0xf5, 0xa8, 0x4f, 0xf2, 0xf2, 0x2e, 0xc1, 0xeb,
+	0x97, 0x99, 0x37, 0x3c, 0x53, 0xa6, 0xb4, 0x46,
+	0x05, 0x64, 0x92, 0x87, 0x08, 0x3c, 0x23, 0x4b,
+	0x9d, 0x67, 0x18, 0xf9, 0xe2, 0x0b, 0x1c, 0x39,
+	0xd3, 0x87, 0x70, 0xc0, 0xb9, 0x1e, 0x52, 0x0a,
+	0x0f, 0x48, 0xe2, 0xe7, 0x51, 0x72, 0x94, 0xf7,
+	0xa3, 0xdc, 0xe5, 0x66, 0x33, 0x39, 0x54, 0x06,
+	0x55, 0x93, 0x30, 0xf9, 0x5e, 0x76, 0x8f, 0xe0,
+	0x59, 0x4d, 0x0d, 0xa7, 0xf5, 0xbe, 0xdb, 0x20,
+	0xad, 0x0d, 0x76, 0x88, 0x5f, 0x9c, 0x7c, 0x75,
+	0x2f, 0x2a, 0x0b, 0x79, 0x6e, 0xd3, 0xe2, 0x66,
+	0xf5, 0x4a, 0x2d, 0x87, 0x87, 0x49, 0x84, 0x17,
+	0xa2, 0x62, 0x4c, 0xbb, 0xe4, 0x6e, 0x98, 0x10,
+	0xc9, 0xfb, 0x8a, 0x04, 0x68, 0x8d, 0x22, 0x66,
+	0xad, 0xea, 0x2a, 0xc9, 0x97, 0x2d, 0x3c, 0xbc,
+	0xd0, 0x77, 0x5f, 0xe6, 0xb8, 0x7f, 0xe6, 0xf6,
+	0x39, 0xbf, 0x56, 0x0e, 0x26, 0x6d, 0xc5, 0x3e,
+	0x53, 0x19, 0xd6, 0xb4, 0x57, 0x36, 0xa3, 0xc6,
+	0xd3, 0x3d, 0x66, 0x79, 0x30, 0x5c, 0x14, 0x0c,
+	0x0f, 0x3e, 0x96, 0xae, 0x90, 0x97, 0xab, 0x0d,
+	0x9f, 0xc3, 0xe7, 0x66, 0x3e, 0xe0, 0x31, 0x43,
+	0x4b, 0x01, 0xb3, 0x0e, 0x9e, 0x8c, 0x82, 0x4a,
+	0x8c, 0xc7, 0x79, 0x85, 0xdf, 0x75, 0x0d, 0xb4,
+	0x2b, 0x03, 0x14, 0xef, 0x72, 0x58, 0xfd, 0x64,
+	0xc8, 0xe3, 0x0d, 0x9a, 0x14, 0x6f, 0x76, 0xf9,
+	0x46, 0xd1, 0xd2, 0x81, 0xb3, 0x16, 0x6e, 0xc7,
+	0x76, 0x82, 0xce, 0xf4, 0xee, 0x33, 0x00, 0xe6,
+	0x77, 0xc4, 0xad, 0x4f, 0x06, 0xa7, 0x48, 0x80,
+	0x9e, 0x21, 0x66, 0xca, 0x75, 0x69, 0x57, 0xcb,
+	0xf0, 0x67, 0x6a, 0xaa, 0x8f, 0x88, 0x14, 0xbd,
+	0x65, 0x62, 0xe2, 0xad, 0xcc, 0x22, 0x88, 0x7b,
+	0x94, 0xbd, 0x0e, 0xcd, 0xb6, 0x69, 0xa2, 0xcb,
+	0x7d, 0x57, 0x5c, 0xb4, 0x92, 0x80, 0x13, 0x99,
+	0x84, 0xf3, 0x79, 0x0a, 0x2d, 0x70, 0xa4, 0xe0,
+	0xde, 0xc6, 0x32, 0xb0, 0x8a, 0x62, 0xb5, 0xcf,
+	0xfa, 0x5e, 0x5a, 0x92, 0x32, 0x7d, 0x34, 0x07,
+	0xb5, 0x52, 0x3a, 0xb5, 0x7d, 0x0f, 0xa1, 0xba,
+	0x56, 0xd0, 0x07, 0x76, 0x11, 0xf2, 0xc3, 0x33,
+	0x9d, 0xbd, 0x12, 0x35, 0x5e, 0xf7, 0x05, 0x88,
+	0x76, 0x94, 0xa6, 0xbf, 0xed, 0xb8, 0xa4, 0xa2,
+	0x0c, 0xbe, 0x0f, 0x6a, 0xaf, 0xf3, 0x1b, 0x33,
+	0x4a, 0xb7, 0x68, 0x3f, 0xbe, 0x95, 0x13, 0x97,
+	0x0f, 0x15, 0x17, 0x1b, 0x23, 0xaa, 0x08, 0x78,
+	0xa6, 0x5b, 0x08, 0xa2, 0x9d, 0x03, 0xa8, 0xa7,
+	0x39, 0xdc, 0xbc, 0x9a, 0x85, 0xf5, 0xe5, 0x55,
+	0x59, 0x3c, 0xef, 0xf9, 0x3f, 0x22, 0x8e, 0xf8,
+	0xd8, 0x3e, 0x02, 0x0b, 0xd8, 0x78, 0x4b, 0x15,
+	0x7f, 0xaa, 0x2c, 0xff, 0xbe, 0x77, 0x33, 0xc7,
+	0x6a, 0x12, 0xaa, 0xa4, 0xbe, 0xc0, 0x3b, 0xcb,
+	0x13, 0x9d, 0x9c, 0x5a, 0x9f, 0x8a, 0x57, 0x36,
+	0x4f, 0x02, 0x5a, 0xf8, 0x1d, 0x97, 0x77, 0x43,
+	0xc8, 0xa5, 0xb7, 0x9b, 0x10, 0x98, 0xfd, 0x58,
+	0xbf, 0x42, 0xf6, 0xbf, 0xff, 0x6c, 0x40, 0x18,
+	0x18, 0xdf, 0xac, 0x57, 0x71, 0xea, 0xcc, 0x8e,
+	0xfd, 0xfe, 0x10, 0xfb, 0xb9, 0xfe, 0xbc, 0x9a,
+	0x9c, 0x27, 0xe4, 0x10, 0x15, 0x94, 0x41, 0xa1,
+	0xcc, 0xf6, 0x25, 0x49, 0x4f, 0x96, 0xc1, 0x8c,
+	0x9e, 0x3e, 0x18, 0x29, 0x49, 0x92, 0xe7, 0xfe,
+	0x22, 0xff, 0xed, 0x02, 0x16, 0x90, 0xef, 0xac,
+	0xec, 0x95, 0x1d, 0x5b, 0x94, 0x9c, 0xf6, 0x7c,
+	0x1b, 0x5a, 0x9d, 0xb0, 0x9b, 0x05, 0x36, 0xbf,
+	0xef, 0xec, 0x63, 0x35, 0x40, 0x24, 0x45, 0x40,
+	0x30, 0x1a, 0x9b, 0x90, 0xc3, 0xc2, 0xf7, 0x37,
+	0xfb, 0x08, 0x8e, 0x48, 0x19, 0x48, 0xed, 0xa8,
+	0xa8, 0x04, 0x6f, 0xd0, 0x33, 0xe9, 0xb8, 0x8d,
+	0xe7, 0x1e, 0x5c, 0x47, 0x74, 0xc0, 0x66, 0x30,
+	0x4e, 0xa7, 0x86, 0x73, 0xf1, 0xe5, 0x78, 0xa6,
+	0xe0, 0xc1, 0xda, 0x13, 0x72, 0x07, 0x85, 0x34,
+	0x63, 0x95, 0x49, 0x30, 0x4b, 0x9d, 0x03, 0xf1,
+	0x7a, 0x6b, 0x91, 0xa2, 0x85, 0x41, 0xf9, 0x4a,
+	0xd6, 0xff, 0xff, 0x86, 0xf7, 0xf0, 0xce, 0xb9,
+	0x07, 0xf1, 0x88, 0x04, 0x33, 0xaa, 0xeb, 0x54,
+	0xb2, 0x1c, 0x8e, 0x2e, 0x7b, 0x04, 0xa8, 0xcc,
+	0x2c, 0x7a, 0xb3, 0xad, 0x1a, 0x89, 0x38, 0x89,
+	0xd7, 0x11, 0x3a, 0x8c, 0xcf, 0xe3, 0xc5, 0xba,
+	0xb0, 0xcc, 0xc4, 0xe3, 0x33, 0xf3, 0x18, 0xba,
+	0xec, 0x56, 0xd9, 0x1c, 0x40, 0x70, 0x0d, 0x4e,
+	0x97, 0x01, 0x23, 0xf3, 0x5a, 0xdc, 0xbf, 0x68,
+	0x93, 0xc2, 0x1d, 0x8a, 0x96, 0xb7, 0xac, 0x18,
+	0x6f, 0xf7, 0x84, 0x71, 0x0d, 0x3d, 0xf8, 0xba,
+	0xdf, 0xb6, 0x89, 0x1d, 0x78, 0x19, 0xf2, 0x59,
+	0xe9, 0x15, 0x55, 0x29, 0x73, 0x50, 0x59, 0x14,
+	0x02, 0x21, 0x16, 0x8f, 0x0f, 0xdf, 0xa5, 0xf0,
+};
+
+static struct crc_test {
+	uint32_t crc;		/* random starting crc */
+	uint32_t start;		/* random offset in buf */
+	uint32_t length;	/* random length of test */
+	uint32_t crc32c_le;	/* expected crc32c_le result */
+	uint32_t crc32_be;	/* expected crc32_be result */
+} test[] = {
+	{0xffffffff, 0x00000000, 0x00001000, 0x13934bef, 0xd8ddcdc3},
+	{0xfe7328ea, 0x00000763, 0x00000717, 0xed2c0d70, 0xc863aef8},
+	{0x4c40684e, 0x00000721, 0x0000011e, 0xd7f46ccc, 0x173a11c4},
+	{0x6b487f90, 0x00000264, 0x000007bc, 0x759e9939, 0xd6307c56},
+	{0x9f5810db, 0x00000afa, 0x00000255, 0x2685197f, 0x2e5c9201},
+	{0xb15c4755, 0x00000d5b, 0x000002a4, 0xd8fadcb5, 0xf682c4be},
+	{0x06518253, 0x00000ffb, 0x00000004, 0xabee2433, 0x3d8abdf9},
+	{0xd9e71c55, 0x00000a2a, 0x00000259, 0x96682af2, 0x47b4d26c},
+	{0x0c1ae843, 0x00000ce4, 0x0000031b, 0x7b637c43, 0x62b47e8b},
+	{0xec3cd517, 0x000002ff, 0x00000566, 0x5d719a77, 0xff5bc5b7},
+	{0x77828e95, 0x0000067f, 0x0000038f, 0x43ee5b6c, 0x1a0cfacd},
+	{0xec87b4e3, 0x00000d1c, 0x000002e3, 0x2ddd2eee, 0x275118a7},
+	{0x412158bb, 0x00000eee, 0x00000111, 0x67b38ba2, 0xa74ecff5},
+	{0x2e52de3e, 0x00000c4a, 0x000003b5, 0xbcc5d61d, 0xbd800707},
+	{0x6ddaae8b, 0x00000d99, 0x00000266, 0x8b535544, 0xecbde1a1},
+	{0x049b6cb1, 0x000009c5, 0x000000b0, 0xfc22cabc, 0xfb78eb9f},
+	{0x77d4b954, 0x0000028a, 0x000007fa, 0x71d00923, 0x8c116f85},
+	{0x5e192355, 0x00000ac1, 0x000001fa, 0xb966b81a, 0x5aa17bbe},
+	{0x7d80b71d, 0x00000213, 0x000001e0, 0x2bba371a, 0xb5906aa6},
+	{0x01f6f1e4, 0x000001d6, 0x00000395, 0xb7e8a647, 0x3ad112b1},
+	{0x1dfabb13, 0x00000e14, 0x000001eb, 0x53917fba, 0xbaee0339},
+	{0xb00a4449, 0x00000bf6, 0x00000409, 0xedecb577, 0x6f3a3979},
+	{0x7ecd3981, 0x0000083f, 0x0000016b, 0xefef62b9, 0xe3e52eed},
+	{0xf8f330d2, 0x000004be, 0x00000757, 0x9357c9f3, 0x0835bc1b},
+	{0x03c38af2, 0x00000d23, 0x000002dc, 0x360fa8c0, 0x2ca885e6},
+	{0x687bb79b, 0x00000f3d, 0x000000c2, 0x448d3be2, 0x79be2f78},
+	{0x6710f550, 0x000009e9, 0x00000603, 0xdbfd1998, 0x1d25f627},
+	{0x873171d1, 0x00000787, 0x000004d5, 0xab7f1b62, 0xa76a5656},
+	{0x373b1314, 0x00000f0f, 0x000000f0, 0x184098ab, 0xba273974},
+	{0x90fad9cd, 0x00000ead, 0x00000152, 0x23ce52ff, 0xb7bc958c},
+	{0x19676fe7, 0x0000007d, 0x0000070d, 0xf8a76f1e, 0xf882b644},
+	{0x89facd45, 0x000005f3, 0x00000473, 0x4331a006, 0xe9dc1396},
+	{0x6f173747, 0x00000fc3, 0x0000003c, 0xb012f08e, 0xc6b888ee},
+	{0x4b44a106, 0x0000075a, 0x0000008b, 0xf6f7ac38, 0x60cd2b74},
+	{0xb620ad06, 0x00000774, 0x0000017e, 0xd34558e6, 0x3a0a615b},
+	{0x976f21e9, 0x000008d7, 0x0000034a, 0xe533aa3a, 0xa99e60be},
+	{0x687628c0, 0x000006c5, 0x0000061b, 0x3a840b15, 0x9bfcaef2},
+	{0xe24ac108, 0x00000cd0, 0x0000032f, 0x51010ae8, 0x20958672},
+	{0x361c44a3, 0x00000304, 0x00000719, 0xfd7bd481, 0xd70ff2b2},
+	{0xd93ff95e, 0x00000db7, 0x0000008e, 0xcfbbc304, 0xad716acd},
+	{0xed752d12, 0x00000883, 0x00000091, 0x65a6c868, 0x95c71c7b},
+	{0xb4ff4b54, 0x000003d3, 0x000001c1, 0xf82597e7, 0x44b7f99b},
+	{0x111b520f, 0x00000708, 0x000000eb, 0xc3e109f3, 0x71bc01ee},
+	{0x62c806f2, 0x00000ba3, 0x0000045c, 0x874d3a72, 0xc539b753},
+	{0x40d97470, 0x000005e1, 0x0000058d, 0x87a9684f, 0xea6073a5},
+	{0x4312179c, 0x00000056, 0x0000070e, 0x809a00f5, 0x209aea3b},
+	{0x13d5f84c, 0x00000a2d, 0x00000104, 0xf3d27578, 0xe087a8b6},
+	{0x1f302cb2, 0x00000151, 0x00000014, 0x1e162693, 0x95e4b90e},
+	{0xe491db24, 0x00000600, 0x000006f6, 0x7ff09615, 0x77611523},
+	{0xf9a98069, 0x000002ba, 0x000002ad, 0x01af7387, 0xea925faa},
+	{0xe9c477ad, 0x0000015f, 0x00000778, 0x6facf9a0, 0x1130f736},
+	{0x353f32b2, 0x0000087c, 0x00000783, 0x6cc964ea, 0x32459994},
+	{0x78e1b24f, 0x00000650, 0x000006a8, 0xb3bb7c27, 0x5a632f78},
+	{0x61aa400e, 0x00000049, 0x00000254, 0xb8cd1681, 0xdf2652d5},
+	{0xb84b10b0, 0x00000f73, 0x0000008c, 0x406a6450, 0x3619d31b},
+	{0x9fa99c9c, 0x00000a7c, 0x000004d7, 0xfb3d21b4, 0xea31c743},
+	{0x3fc9ebe3, 0x00000cd9, 0x000000d6, 0x43803f9c, 0x1f76a809},
+	{0x529879cd, 0x000002f2, 0x00000595, 0x78b4c6a6, 0x63b9b93f},
+	{0x3a933019, 0x00000516, 0x00000266, 0xdcb45436, 0x8f99c98c},
+	{0x887b4977, 0x00000227, 0x0000038d, 0xc5f7c3d9, 0xaf5e3091},
+	{0x770745de, 0x000008c6, 0x00000739, 0xf69145e8, 0x53d0dce1},
+	{0x28be3b47, 0x00000c46, 0x0000032b, 0x764c028f, 0x106d0905},
+	{0x5013a050, 0x00000cf6, 0x00000309, 0xea8fe164, 0x62180b57},
+	{0x2ec4c9ba, 0x000006e8, 0x0000078d, 0xa35557a9, 0xf44430a4},
+	{0xa9f950c9, 0x00000d33, 0x000002cc, 0x41ea8618, 0x587b4eb3},
+	{0x5b520229, 0x000007b2, 0x00000484, 0x44569f1f, 0x92406c32},
+	{0xd8dcbbfc, 0x0000002f, 0x0000048c, 0xdb88ab8b, 0x13bfe70e},
+	{0x25529792, 0x00000d1d, 0x000002e2, 0x20cda404, 0x19d3b4e4},
+	{0x9f3f6d71, 0x00000238, 0x0000079a, 0x0720443e, 0x3c107021},
+	{0x64121215, 0x000007ff, 0x0000038f, 0x6aacff2c, 0xb82fdc3e},
+	{0xfb6cdde0, 0x00000ef8, 0x00000107, 0xbd43a0f1, 0xab0d3c1d},
+	{0x221c9d6f, 0x000007b6, 0x0000014f, 0xb67f834b, 0x1371ad05},
+	{0x030e1de4, 0x00000836, 0x000004b4, 0x0d67d26a, 0xe2e72df1},
+	{0xb56fa6cf, 0x00000c07, 0x000003f8, 0x60601ac1, 0x039de73e},
+	{0xb55c89f5, 0x0000098e, 0x000001d4, 0x2400efbe, 0xfe39a2bb},
+	{0x5e90b6d5, 0x0000070b, 0x000003ea, 0x3bb5d6ea, 0xf0f794a0},
+	{0x2a7045ae, 0x00000961, 0x00000633, 0xfca89e4b, 0xe66ce41c},
+	{0x8b374ea9, 0x000006ba, 0x00000780, 0xbce036ed, 0x4cb28ef7},
+	{0x8bd90bc9, 0x00000562, 0x00000369, 0xcb26a24b, 0x40236d1d},
+	{0x5b1b1762, 0x000000fd, 0x0000051a, 0x33cdda07, 0xc32e420a},
+	{0xa4153555, 0x0000058f, 0x000005c7, 0xbe50eeca, 0x83a67f35},
+	{0x0be1f931, 0x00000651, 0x00000672, 0x95a25753, 0x88f1aac1},
+	{0xb7e78618, 0x00000a7f, 0x000002bb, 0xe06bcc1c, 0x74274f66},
+	{0x4a9bc41b, 0x00000e51, 0x000001ae, 0x709e8d2c, 0x54eff534},
+	{0xfc359d13, 0x00000440, 0x000002f8, 0x0a58451f, 0x55e9363f},
+	{0x5aa48619, 0x000006d1, 0x00000284, 0x928ead83, 0x31041c06},
+	{0xa609afa8, 0x0000053e, 0x00000272, 0xb048c141, 0x4704efba},
+	{0x3f108afb, 0x00000949, 0x00000150, 0x9a6bb5bc, 0x4e4430c8},
+	{0x79bec2d3, 0x000008ed, 0x00000712, 0x32692d57, 0x11d52a7b},
+	{0x9429e067, 0x00000bc3, 0x0000043c, 0x5295ceff, 0x04640f4d},
+	{0xae58b96a, 0x0000082d, 0x000007d2, 0xc2a681ba, 0xf7ca4a2c},
+	{0x95df24be, 0x00000985, 0x000004c1, 0x3a287765, 0x2c4af003},
+	{0x5e94976f, 0x00000596, 0x000004ed, 0xff00c489, 0x5ae11687},
+	{0xf5e5f1de, 0x00000d31, 0x000002ce, 0x35f28e91, 0x30d47957},
+	{0xa2c219cf, 0x00000a3c, 0x00000374, 0x707d21eb, 0x2a14a255},
+	{0xf21b6ceb, 0x00000919, 0x00000135, 0x0847fb8b, 0xcb8d3b93},
+	{0xaa988728, 0x00000787, 0x00000771, 0x885aeaa4, 0x6531b509},
+	{0xaa5dfaac, 0x000003e5, 0x0000051b, 0x52c48ab7, 0xe43cc5e9},
+	{0x0a053968, 0x00000d2a, 0x000002d5, 0x7a90256d, 0x8004765c},
+	{0x1421dc20, 0x00000eef, 0x00000110, 0x97d6da24, 0x1378f6ff},
+	{0xb47c2166, 0x00000a6a, 0x00000209, 0xcfd6cc52, 0x676e14a5},
+	{0x77dd1955, 0x000000de, 0x00000266, 0xba74bcaa, 0xc71b429c},
+	{0x68a03cc2, 0x0000082f, 0x000007b0, 0x752bd5d8, 0x19ed14aa},
+	{0x0226b0a3, 0x00000a5f, 0x000005a0, 0x82de4970, 0xf654d3ed},
+	{0x637bf3b1, 0x00000d93, 0x0000026c, 0x5c7115cb, 0x3cccb57e},
+	{0x3b120edf, 0x00000c13, 0x000003ec, 0x80d7d20f, 0x92132798},
+	{0xe2456780, 0x000002eb, 0x00000641, 0xc0a5d289, 0x6160c87a},
+	{0x9b2e7125, 0x00000c0c, 0x000003f3, 0xcc15f57e, 0x6f00f637},
+	{0x153033ef, 0x00000787, 0x000006b6, 0x3cde443b, 0xb46caa6e},
+	{0x18458b3f, 0x0000066c, 0x00000561, 0x9a2bd8c6, 0xb6c29121},
+	{0x4ff9d4b9, 0x00000c8f, 0x0000033a, 0xd0ee6d6d, 0xc81cf380},
+	{0xdf84b5d9, 0x00000802, 0x0000029a, 0xdab0d74a, 0xb2464559},
+	{0x81ee15df, 0x000003ce, 0x00000725, 0x9942e2de, 0x4ccf571b},
+	{0x5c768e04, 0x00000afd, 0x00000160, 0x36110831, 0xae0b305a},
+	{0xe5e18094, 0x00000b4b, 0x000000a0, 0xffa3e4a7, 0x6c8a4f09},
+	{0xed7263b6, 0x00000d0d, 0x000002f2, 0xb0006a35, 0x7e04af8c},
+	{0x5bfde7d7, 0x000006fb, 0x00000554, 0xa4193b76, 0xb3a91d12},
+	{0x67f4a743, 0x00000b85, 0x0000047a, 0xf05c8d8f, 0xfb472fdf},
+	{0xf13bdf22, 0x00000ff7, 0x00000008, 0x816351eb, 0xf347f235},
+	{0x08ecc608, 0x00000d5d, 0x00000098, 0x90492772, 0x0b7f1521},
+	{0x296f52ba, 0x000004f9, 0x00000788, 0x5e5a4896, 0x1cc67088},
+	{0xbe4624c2, 0x00000427, 0x000004ef, 0xcd267b94, 0x550caefd},
+	{0x906f7c7c, 0x00000a05, 0x0000003f, 0x03fcfc33, 0x9ed82a02},
+	{0x8f7b323e, 0x00000458, 0x000004c7, 0xcd4969c8, 0x633c38a8},
+	{0x88d6593d, 0x00000597, 0x000005b5, 0xf199cd3b, 0x0491452f},
+	{0x978a7768, 0x00000268, 0x000001d3, 0xb28c95bd, 0x1a42fe61},
+	{0x857a621e, 0x000007a7, 0x000003a8, 0xf4bf84ab, 0xcd0694c6},
+	{0xb0e121ef, 0x000005be, 0x00000644, 0x28747c14, 0xf0510c72},
+	{0, 0, 0, 0, 0},
+};
+
+static int test_crc32c(void)
+{
+	struct crc_test *t = test;
+	int failures = 0;
+
+	while (t->length) {
+		uint32_t be, le;
+		le = ext2fs_crc32c_le(t->crc, test_buf + t->start, t->length);
+		be = ext2fs_crc32_be(t->crc, test_buf + t->start, t->length);
+		if (le != t->crc32c_le) {
+			printf("Test %d LE fails, %x != %x\n",
+			       (int) (t - test), le, t->crc32c_le);
+			failures++;
+		}
+		if (be != t->crc32_be) {
+			printf("Test %d BE fails, %x != %x\n",
+			       (int) (t - test), be, t->crc32_be);
+			failures++;
+		}
+		t++;
+	}
+
+	return failures;
+}
+
+int main(int argc, char *argv[])
+{
+	int ret;
+
+	ret = test_crc32c();
+	if (!ret)
+		printf("No failures.\n");
+
+	return ret;
+}
+#endif /* UNITTEST */
diff --git a/lib/ext2fs/crc32c_defs.h b/lib/ext2fs/crc32c_defs.h
new file mode 100644
index 0000000..3f9a09e
--- /dev/null
+++ b/lib/ext2fs/crc32c_defs.h
@@ -0,0 +1,59 @@
+/*
+ * There are multiple 16-bit CRC polynomials in common use, but this is
+ * *the* standard CRC-32 polynomial, first popularized by Ethernet.
+ * x^32+x^26+x^23+x^22+x^16+x^12+x^11+x^10+x^8+x^7+x^5+x^4+x^2+x^1+x^0
+ */
+#define CRCPOLY_LE 0xedb88320
+#define CRCPOLY_BE 0x04c11db7
+
+/*
+ * This is the CRC32c polynomial, as outlined by Castagnoli.
+ * x^32+x^28+x^27+x^26+x^25+x^23+x^22+x^20+x^19+x^18+x^14+x^13+x^11+x^10+x^9+
+ * x^8+x^6+x^0
+ */
+#define CRC32C_POLY_LE 0x82F63B78
+#define CRC32C_POLY_BE 0x1EDC6F41
+
+/* How many bits at a time to use.  Valid values are 1, 2, 4, 8, 32 and 64. */
+/* For less performance-sensitive, use 4 */
+#ifndef CRC_LE_BITS
+# define CRC_LE_BITS 64
+#endif
+#ifndef CRC_BE_BITS
+# define CRC_BE_BITS 64
+#endif
+
+/*
+ * Little-endian CRC computation.  Used with serial bit streams sent
+ * lsbit-first.  Be sure to use cpu_to_le32() to append the computed CRC.
+ */
+#if CRC_LE_BITS > 64 || CRC_LE_BITS < 1 || CRC_LE_BITS == 16 || \
+	CRC_LE_BITS & CRC_LE_BITS-1
+# error "CRC_LE_BITS must be one of {1, 2, 4, 8, 32, 64}"
+#endif
+
+/*
+ * Big-endian CRC computation.  Used with serial bit streams sent
+ * msbit-first.  Be sure to use cpu_to_be32() to append the computed CRC.
+ */
+#if CRC_BE_BITS > 64 || CRC_BE_BITS < 1 || CRC_BE_BITS == 16 || \
+	CRC_BE_BITS & CRC_BE_BITS-1
+# error "CRC_BE_BITS must be one of {1, 2, 4, 8, 32, 64}"
+#endif
+
+
+#define ___constant_swab32(x) \
+	((uint32_t)( \
+		(((uint32_t)(x) & (uint32_t)0x000000ffUL) << 24) | \
+		(((uint32_t)(x) & (uint32_t)0x0000ff00UL) <<  8) | \
+		(((uint32_t)(x) & (uint32_t)0x00ff0000UL) >>  8) | \
+		(((uint32_t)(x) & (uint32_t)0xff000000UL) >> 24)))
+
+
+#if (__GNUC__ >= 3)
+#define likely(x)	__builtin_expect(!!(x), 1)
+#define unlikely(x)	__builtin_expect(!!(x), 0)
+#else
+#define likely(x)	(x)
+#define unlikely(x)	(x)
+#endif
diff --git a/lib/ext2fs/csum.c b/lib/ext2fs/csum.c
new file mode 100644
index 0000000..da32d94
--- /dev/null
+++ b/lib/ext2fs/csum.c
@@ -0,0 +1,1011 @@
+/*
+ * csum.c --- checksumming of ext3 structures
+ *
+ * Copyright (C) 2006 Cluster File Systems, Inc.
+ * Copyright (C) 2006, 2007 by Andreas Dilger <adilger@clusterfs.com>
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+#include "crc16.h"
+#include <assert.h>
+
+#ifndef offsetof
+#define offsetof(TYPE, MEMBER) ((size_t) &((TYPE *)0)->MEMBER)
+#endif
+
+#ifdef DEBUG
+#define STATIC
+#else
+#define STATIC static
+#endif
+
+void ext2fs_init_csum_seed(ext2_filsys fs)
+{
+	if (ext2fs_has_feature_csum_seed(fs->super))
+		fs->csum_seed = fs->super->s_checksum_seed;
+	else if (ext2fs_has_feature_metadata_csum(fs->super) ||
+		 ext2fs_has_feature_ea_inode(fs->super))
+		fs->csum_seed = ext2fs_crc32c_le(~0, fs->super->s_uuid,
+						 sizeof(fs->super->s_uuid));
+}
+
+static __u32 ext2fs_mmp_csum(ext2_filsys fs, struct mmp_struct *mmp)
+{
+	int offset = offsetof(struct mmp_struct, mmp_checksum);
+
+	return ext2fs_crc32c_le(fs->csum_seed, (unsigned char *)mmp, offset);
+}
+
+int ext2fs_mmp_csum_verify(ext2_filsys fs, struct mmp_struct *mmp)
+{
+	__u32 calculated;
+
+	if (!ext2fs_has_feature_metadata_csum(fs->super))
+		return 1;
+
+	calculated = ext2fs_mmp_csum(fs, mmp);
+
+	return ext2fs_le32_to_cpu(mmp->mmp_checksum) == calculated;
+}
+
+errcode_t ext2fs_mmp_csum_set(ext2_filsys fs, struct mmp_struct *mmp)
+{
+	__u32 crc;
+
+	if (!ext2fs_has_feature_metadata_csum(fs->super))
+		return 0;
+
+	crc = ext2fs_mmp_csum(fs, mmp);
+	mmp->mmp_checksum = ext2fs_cpu_to_le32(crc);
+
+	return 0;
+}
+
+int ext2fs_verify_csum_type(ext2_filsys fs, struct ext2_super_block *sb)
+{
+	if (!ext2fs_has_feature_metadata_csum(fs->super))
+		return 1;
+
+	return sb->s_checksum_type == EXT2_CRC32C_CHKSUM;
+}
+
+static __u32 ext2fs_superblock_csum(ext2_filsys fs EXT2FS_ATTR((unused)),
+				    struct ext2_super_block *sb)
+{
+	int offset = offsetof(struct ext2_super_block, s_checksum);
+
+	return ext2fs_crc32c_le(~0, (unsigned char *)sb, offset);
+}
+
+/* NOTE: The input to this function MUST be in LE order */
+int ext2fs_superblock_csum_verify(ext2_filsys fs, struct ext2_super_block *sb)
+{
+	__u32 flag, calculated;
+
+	if (fs->flags & EXT2_FLAG_SWAP_BYTES)
+		flag = EXT4_FEATURE_RO_COMPAT_METADATA_CSUM;
+	else
+		flag = ext2fs_cpu_to_le32(EXT4_FEATURE_RO_COMPAT_METADATA_CSUM);
+
+	if (!EXT2_HAS_RO_COMPAT_FEATURE(fs->super, flag))
+		return 1;
+
+	calculated = ext2fs_superblock_csum(fs, sb);
+
+	return ext2fs_le32_to_cpu(sb->s_checksum) == calculated;
+}
+
+/* NOTE: The input to this function MUST be in LE order */
+errcode_t ext2fs_superblock_csum_set(ext2_filsys fs,
+				     struct ext2_super_block *sb)
+{
+	__u32 flag, crc;
+
+	if (fs->flags & EXT2_FLAG_SWAP_BYTES)
+		flag = EXT4_FEATURE_RO_COMPAT_METADATA_CSUM;
+	else
+		flag = ext2fs_cpu_to_le32(EXT4_FEATURE_RO_COMPAT_METADATA_CSUM);
+
+	if (!EXT2_HAS_RO_COMPAT_FEATURE(fs->super, flag))
+		return 0;
+
+	crc = ext2fs_superblock_csum(fs, sb);
+	sb->s_checksum = ext2fs_cpu_to_le32(crc);
+
+	return 0;
+}
+
+static errcode_t ext2fs_ext_attr_block_csum(ext2_filsys fs,
+					    ext2_ino_t inum EXT2FS_ATTR((unused)),
+					    blk64_t block,
+					    struct ext2_ext_attr_header *hdr,
+					    __u32 *crc)
+{
+	char *buf = (char *)hdr;
+	__u32 old_crc = hdr->h_checksum;
+
+	hdr->h_checksum = 0;
+	block = ext2fs_cpu_to_le64(block);
+	*crc = ext2fs_crc32c_le(fs->csum_seed, (unsigned char *)&block,
+				sizeof(block));
+	*crc = ext2fs_crc32c_le(*crc, (unsigned char *)buf, fs->blocksize);
+	hdr->h_checksum = old_crc;
+
+	return 0;
+}
+
+int ext2fs_ext_attr_block_csum_verify(ext2_filsys fs, ext2_ino_t inum,
+				      blk64_t block,
+				      struct ext2_ext_attr_header *hdr)
+{
+	__u32 calculated;
+	errcode_t retval;
+
+	if (!ext2fs_has_feature_metadata_csum(fs->super))
+		return 1;
+
+	retval = ext2fs_ext_attr_block_csum(fs, inum, block, hdr, &calculated);
+	if (retval)
+		return 0;
+
+	return ext2fs_le32_to_cpu(hdr->h_checksum) == calculated;
+}
+
+errcode_t ext2fs_ext_attr_block_csum_set(ext2_filsys fs, ext2_ino_t inum,
+					 blk64_t block,
+					 struct ext2_ext_attr_header *hdr)
+{
+	errcode_t retval;
+	__u32 crc;
+
+	if (!ext2fs_has_feature_metadata_csum(fs->super))
+		return 0;
+
+	retval = ext2fs_ext_attr_block_csum(fs, inum, block, hdr, &crc);
+	if (retval)
+		return retval;
+	hdr->h_checksum = ext2fs_cpu_to_le32(crc);
+	return 0;
+}
+
+static __u16 do_nothing16(__u16 x)
+{
+	return x;
+}
+
+static __u16 disk_to_host16(__u16 x)
+{
+	return ext2fs_le16_to_cpu(x);
+}
+
+static errcode_t __get_dx_countlimit(ext2_filsys fs,
+				     struct ext2_dir_entry *dirent,
+				     struct ext2_dx_countlimit **cc,
+				     int *offset,
+				     int need_swab)
+{
+	struct ext2_dir_entry *dp;
+	struct ext2_dx_root_info *root;
+	struct ext2_dx_countlimit *c;
+	int count_offset, max_sane_entries;
+	unsigned int rec_len;
+	__u16 (*translate)(__u16) = (need_swab ? disk_to_host16 : do_nothing16);
+
+	rec_len = translate(dirent->rec_len);
+
+	if (rec_len == fs->blocksize && translate(dirent->name_len) == 0)
+		count_offset = 8;
+	else if (rec_len == 12) {
+		dp = (struct ext2_dir_entry *)(((char *)dirent) + rec_len);
+		rec_len = translate(dp->rec_len);
+		if (rec_len != fs->blocksize - 12)
+			return EXT2_ET_DB_NOT_FOUND;
+		root = (struct ext2_dx_root_info *)(((char *)dp + 12));
+		if (root->reserved_zero ||
+		    root->info_length != sizeof(struct ext2_dx_root_info))
+			return EXT2_ET_DB_NOT_FOUND;
+		count_offset = 32;
+	} else
+		return EXT2_ET_DB_NOT_FOUND;
+
+	c = (struct ext2_dx_countlimit *)(((char *)dirent) + count_offset);
+	max_sane_entries = (fs->blocksize - count_offset) /
+			   sizeof(struct ext2_dx_entry);
+	if (ext2fs_le16_to_cpu(c->limit) > max_sane_entries ||
+	    ext2fs_le16_to_cpu(c->count) > max_sane_entries)
+		return EXT2_ET_DIR_NO_SPACE_FOR_CSUM;
+
+	if (offset)
+		*offset = count_offset;
+	if (cc)
+		*cc = c;
+
+	return 0;
+}
+
+errcode_t ext2fs_get_dx_countlimit(ext2_filsys fs,
+				   struct ext2_dir_entry *dirent,
+				   struct ext2_dx_countlimit **cc,
+				   int *offset)
+{
+	return __get_dx_countlimit(fs, dirent, cc, offset, 0);
+}
+
+void ext2fs_initialize_dirent_tail(ext2_filsys fs,
+				   struct ext2_dir_entry_tail *t)
+{
+	memset(t, 0, sizeof(struct ext2_dir_entry_tail));
+	ext2fs_set_rec_len(fs, sizeof(struct ext2_dir_entry_tail),
+			   (struct ext2_dir_entry *)t);
+	t->det_reserved_name_len = EXT2_DIR_NAME_LEN_CSUM;
+}
+
+static errcode_t __get_dirent_tail(ext2_filsys fs,
+				   struct ext2_dir_entry *dirent,
+				   struct ext2_dir_entry_tail **tt,
+				   int need_swab)
+{
+	struct ext2_dir_entry *d;
+	void *top;
+	struct ext2_dir_entry_tail *t;
+	unsigned int rec_len;
+	errcode_t retval = 0;
+	__u16 (*translate)(__u16) = (need_swab ? disk_to_host16 : do_nothing16);
+
+	if (fs->blocksize < 1024)
+		return EXT2_FILSYS_CORRUPTED; /* Should never happen */
+
+	d = dirent;
+	top = EXT2_DIRENT_TAIL(dirent, fs->blocksize);
+
+	while ((void *) d < top) {
+		rec_len = translate(d->rec_len);
+		if ((rec_len < 8) || (rec_len & 0x03))
+			return EXT2_ET_DIR_CORRUPTED;
+		d = (struct ext2_dir_entry *)(((char *)d) + rec_len);
+	}
+
+	if ((char *)d > ((char *)dirent + fs->blocksize))
+			return EXT2_ET_DIR_CORRUPTED;
+	if (d != top)
+		return EXT2_ET_DIR_NO_SPACE_FOR_CSUM;
+
+	t = (struct ext2_dir_entry_tail *)d;
+	if (t->det_reserved_zero1 ||
+	    translate(t->det_rec_len) != sizeof(struct ext2_dir_entry_tail) ||
+	    translate(t->det_reserved_name_len) != EXT2_DIR_NAME_LEN_CSUM)
+		return EXT2_ET_DIR_NO_SPACE_FOR_CSUM;
+
+	if (tt)
+		*tt = t;
+	return retval;
+}
+
+int ext2fs_dirent_has_tail(ext2_filsys fs, struct ext2_dir_entry *dirent)
+{
+	return __get_dirent_tail(fs, dirent, NULL, 0) !=
+		EXT2_ET_DIR_NO_SPACE_FOR_CSUM;
+}
+
+static errcode_t ext2fs_dirent_csum(ext2_filsys fs, ext2_ino_t inum,
+				    struct ext2_dir_entry *dirent, __u32 *crc,
+				    int size)
+{
+	errcode_t retval;
+	char *buf = (char *)dirent;
+	__u32 gen;
+	struct ext2_inode inode;
+
+	retval = ext2fs_read_inode(fs, inum, &inode);
+	if (retval)
+		return retval;
+
+	inum = ext2fs_cpu_to_le32(inum);
+	gen = ext2fs_cpu_to_le32(inode.i_generation);
+	*crc = ext2fs_crc32c_le(fs->csum_seed, (unsigned char *)&inum,
+				sizeof(inum));
+	*crc = ext2fs_crc32c_le(*crc, (unsigned char *)&gen, sizeof(gen));
+	*crc = ext2fs_crc32c_le(*crc, (unsigned char *)buf, size);
+
+	return 0;
+}
+
+int ext2fs_dirent_csum_verify(ext2_filsys fs, ext2_ino_t inum,
+			      struct ext2_dir_entry *dirent)
+{
+	errcode_t retval;
+	__u32 calculated;
+	struct ext2_dir_entry_tail *t;
+
+	retval = __get_dirent_tail(fs, dirent, &t, 1);
+	if (retval)
+		return 1;
+
+	/*
+	 * The checksum field is overlaid with the dirent->name field
+	 * so the swapfs.c functions won't change the endianness.
+	 */
+	retval = ext2fs_dirent_csum(fs, inum, dirent, &calculated,
+				    (char *)t - (char *)dirent);
+	if (retval)
+		return 0;
+	return ext2fs_le32_to_cpu(t->det_checksum) == calculated;
+}
+
+static errcode_t ext2fs_dirent_csum_set(ext2_filsys fs, ext2_ino_t inum,
+					struct ext2_dir_entry *dirent)
+{
+	errcode_t retval;
+	__u32 crc;
+	struct ext2_dir_entry_tail *t;
+
+	retval = __get_dirent_tail(fs, dirent, &t, 1);
+	if (retval)
+		return retval;
+
+	/* swapfs.c functions don't change the checksum endianness */
+	retval = ext2fs_dirent_csum(fs, inum, dirent, &crc,
+				    (char *)t - (char *)dirent);
+	if (retval)
+		return retval;
+	t->det_checksum = ext2fs_cpu_to_le32(crc);
+	return 0;
+}
+
+errcode_t ext2fs_dx_csum(ext2_filsys fs, ext2_ino_t inum,
+			 struct ext2_dir_entry *dirent,
+			 __u32 *crc, struct ext2_dx_tail **ret_t)
+{
+	errcode_t retval;
+	char *buf = (char *)dirent;
+	int size;
+	__u32 gen, dummy_csum = 0;
+	struct ext2_inode inode;
+	struct ext2_dx_tail *t;
+	struct ext2_dx_countlimit *c;
+	int count_offset, limit, count;
+
+	retval = __get_dx_countlimit(fs, dirent, &c, &count_offset, 1);
+	if (retval)
+		return retval;
+	limit = ext2fs_le16_to_cpu(c->limit);
+	count = ext2fs_le16_to_cpu(c->count);
+	if (count_offset + (limit * sizeof(struct ext2_dx_entry)) >
+	    fs->blocksize - sizeof(struct ext2_dx_tail))
+		return EXT2_ET_DIR_NO_SPACE_FOR_CSUM;
+	/* htree structs are accessed in LE order */
+	t = (struct ext2_dx_tail *)(((struct ext2_dx_entry *)c) + limit);
+
+	size = count_offset + (count * sizeof(struct ext2_dx_entry));
+
+	retval = ext2fs_read_inode(fs, inum, &inode);
+	if (retval)
+		return retval;
+
+	inum = ext2fs_cpu_to_le32(inum);
+	gen = ext2fs_cpu_to_le32(inode.i_generation);
+	*crc = ext2fs_crc32c_le(fs->csum_seed, (unsigned char *)&inum,
+				sizeof(inum));
+	*crc = ext2fs_crc32c_le(*crc, (unsigned char *)&gen, sizeof(gen));
+	*crc = ext2fs_crc32c_le(*crc, (unsigned char *)buf, size);
+	*crc = ext2fs_crc32c_le(*crc, (unsigned char *)t, 4);
+	*crc = ext2fs_crc32c_le(*crc, (unsigned char *)&dummy_csum, 4);
+
+	if (ret_t)
+		*ret_t = t;
+	return 0;
+}
+
+static int ext2fs_dx_csum_verify(ext2_filsys fs, ext2_ino_t inum,
+				 struct ext2_dir_entry *dirent)
+{
+	__u32 calculated;
+	errcode_t retval;
+	struct ext2_dx_tail *t;
+
+	retval = ext2fs_dx_csum(fs, inum, dirent, &calculated, &t);
+	if (retval)
+		return 0;
+
+	return ext2fs_le32_to_cpu(t->dt_checksum) == calculated;
+}
+
+static errcode_t ext2fs_dx_csum_set(ext2_filsys fs, ext2_ino_t inum,
+				    struct ext2_dir_entry *dirent)
+{
+	__u32 crc;
+	errcode_t retval = 0;
+	struct ext2_dx_tail *t;
+
+	retval = ext2fs_dx_csum(fs, inum, dirent, &crc, &t);
+	if (retval)
+		return retval;
+	t->dt_checksum = ext2fs_cpu_to_le32(crc);
+	return retval;
+}
+
+int ext2fs_dir_block_csum_verify(ext2_filsys fs, ext2_ino_t inum,
+				 struct ext2_dir_entry *dirent)
+{
+	if (!ext2fs_has_feature_metadata_csum(fs->super))
+		return 1;
+
+	if (__get_dirent_tail(fs, dirent, NULL, 1) == 0)
+		return ext2fs_dirent_csum_verify(fs, inum, dirent);
+	if (__get_dx_countlimit(fs, dirent, NULL, NULL, 1) == 0)
+		return ext2fs_dx_csum_verify(fs, inum, dirent);
+
+	return 0;
+}
+
+errcode_t ext2fs_dir_block_csum_set(ext2_filsys fs, ext2_ino_t inum,
+				    struct ext2_dir_entry *dirent)
+{
+	if (!ext2fs_has_feature_metadata_csum(fs->super))
+		return 0;
+
+	if (__get_dirent_tail(fs, dirent, NULL, 1) == 0)
+		return ext2fs_dirent_csum_set(fs, inum, dirent);
+	if (__get_dx_countlimit(fs, dirent, NULL, NULL, 1) == 0)
+		return ext2fs_dx_csum_set(fs, inum, dirent);
+
+	if (fs->flags & EXT2_FLAG_IGNORE_CSUM_ERRORS)
+		return 0;
+	return EXT2_ET_DIR_NO_SPACE_FOR_CSUM;
+}
+
+#define EXT3_EXTENT_TAIL_OFFSET(hdr)	(sizeof(struct ext3_extent_header) + \
+	(sizeof(struct ext3_extent) * ext2fs_le16_to_cpu((hdr)->eh_max)))
+
+static struct ext3_extent_tail *get_extent_tail(struct ext3_extent_header *h)
+{
+	return (struct ext3_extent_tail *)(((char *)h) +
+					   EXT3_EXTENT_TAIL_OFFSET(h));
+}
+
+static errcode_t ext2fs_extent_block_csum(ext2_filsys fs, ext2_ino_t inum,
+					  struct ext3_extent_header *eh,
+					  __u32 *crc)
+{
+	int size;
+	__u32 gen;
+	errcode_t retval;
+	struct ext2_inode inode;
+
+	size = EXT3_EXTENT_TAIL_OFFSET(eh) + offsetof(struct ext3_extent_tail,
+						      et_checksum);
+
+	retval = ext2fs_read_inode(fs, inum, &inode);
+	if (retval)
+		return retval;
+	inum = ext2fs_cpu_to_le32(inum);
+	gen = ext2fs_cpu_to_le32(inode.i_generation);
+	*crc = ext2fs_crc32c_le(fs->csum_seed, (unsigned char *)&inum,
+				sizeof(inum));
+	*crc = ext2fs_crc32c_le(*crc, (unsigned char *)&gen, sizeof(gen));
+	*crc = ext2fs_crc32c_le(*crc, (unsigned char *)eh, size);
+
+	return 0;
+}
+
+int ext2fs_extent_block_csum_verify(ext2_filsys fs, ext2_ino_t inum,
+				    struct ext3_extent_header *eh)
+{
+	errcode_t retval;
+	__u32 provided, calculated;
+	struct ext3_extent_tail *t = get_extent_tail(eh);
+
+	/*
+	 * The extent tree structures are accessed in LE order, so we must
+	 * swap the checksum bytes here.
+	 */
+	if (!ext2fs_has_feature_metadata_csum(fs->super))
+		return 1;
+
+	provided = ext2fs_le32_to_cpu(t->et_checksum);
+	retval = ext2fs_extent_block_csum(fs, inum, eh, &calculated);
+	if (retval)
+		return 0;
+
+	return provided == calculated;
+}
+
+errcode_t ext2fs_extent_block_csum_set(ext2_filsys fs, ext2_ino_t inum,
+				       struct ext3_extent_header *eh)
+{
+	errcode_t retval;
+	__u32 crc;
+	struct ext3_extent_tail *t = get_extent_tail(eh);
+
+	if (!ext2fs_has_feature_metadata_csum(fs->super))
+		return 0;
+
+	/*
+	 * The extent tree structures are accessed in LE order, so we must
+	 * swap the checksum bytes here.
+	 */
+	retval = ext2fs_extent_block_csum(fs, inum, eh, &crc);
+	if (retval)
+		return retval;
+	t->et_checksum = ext2fs_cpu_to_le32(crc);
+	return retval;
+}
+
+int ext2fs_inode_bitmap_csum_verify(ext2_filsys fs, dgrp_t group,
+				    char *bitmap, int size)
+{
+	struct ext4_group_desc *gdp = (struct ext4_group_desc *)
+			ext2fs_group_desc(fs, fs->group_desc, group);
+	__u32 provided, calculated;
+
+	if (!ext2fs_has_feature_metadata_csum(fs->super))
+		return 1;
+	provided = gdp->bg_inode_bitmap_csum_lo;
+	calculated = ext2fs_crc32c_le(fs->csum_seed, (unsigned char *)bitmap,
+				      size);
+	if (EXT2_DESC_SIZE(fs->super) >= EXT4_BG_INODE_BITMAP_CSUM_HI_END)
+		provided |= (__u32)gdp->bg_inode_bitmap_csum_hi << 16;
+	else
+		calculated &= 0xFFFF;
+
+	return provided == calculated;
+}
+
+errcode_t ext2fs_inode_bitmap_csum_set(ext2_filsys fs, dgrp_t group,
+				       char *bitmap, int size)
+{
+	__u32 crc;
+	struct ext4_group_desc *gdp = (struct ext4_group_desc *)
+			ext2fs_group_desc(fs, fs->group_desc, group);
+
+	if (!ext2fs_has_feature_metadata_csum(fs->super))
+		return 0;
+
+	crc = ext2fs_crc32c_le(fs->csum_seed, (unsigned char *)bitmap, size);
+	gdp->bg_inode_bitmap_csum_lo = crc & 0xFFFF;
+	if (EXT2_DESC_SIZE(fs->super) >= EXT4_BG_INODE_BITMAP_CSUM_HI_END)
+		gdp->bg_inode_bitmap_csum_hi = crc >> 16;
+
+	return 0;
+}
+
+int ext2fs_block_bitmap_csum_verify(ext2_filsys fs, dgrp_t group,
+				    char *bitmap, int size)
+{
+	struct ext4_group_desc *gdp = (struct ext4_group_desc *)
+			ext2fs_group_desc(fs, fs->group_desc, group);
+	__u32 provided, calculated;
+
+	if (!ext2fs_has_feature_metadata_csum(fs->super))
+		return 1;
+	provided = gdp->bg_block_bitmap_csum_lo;
+	calculated = ext2fs_crc32c_le(fs->csum_seed, (unsigned char *)bitmap,
+				      size);
+	if (EXT2_DESC_SIZE(fs->super) >= EXT4_BG_BLOCK_BITMAP_CSUM_HI_LOCATION)
+		provided |= (__u32)gdp->bg_block_bitmap_csum_hi << 16;
+	else
+		calculated &= 0xFFFF;
+
+	return provided == calculated;
+}
+
+errcode_t ext2fs_block_bitmap_csum_set(ext2_filsys fs, dgrp_t group,
+				       char *bitmap, int size)
+{
+	__u32 crc;
+	struct ext4_group_desc *gdp = (struct ext4_group_desc *)
+			ext2fs_group_desc(fs, fs->group_desc, group);
+
+	if (!ext2fs_has_feature_metadata_csum(fs->super))
+		return 0;
+
+	crc = ext2fs_crc32c_le(fs->csum_seed, (unsigned char *)bitmap, size);
+	gdp->bg_block_bitmap_csum_lo = crc & 0xFFFF;
+	if (EXT2_DESC_SIZE(fs->super) >= EXT4_BG_BLOCK_BITMAP_CSUM_HI_LOCATION)
+		gdp->bg_block_bitmap_csum_hi = crc >> 16;
+
+	return 0;
+}
+
+static errcode_t ext2fs_inode_csum(ext2_filsys fs, ext2_ino_t inum,
+			       struct ext2_inode_large *inode,
+			       __u32 *crc, int has_hi)
+{
+	__u32 gen;
+	struct ext2_inode_large *desc = inode;
+	size_t size = EXT2_INODE_SIZE(fs->super);
+	__u16 old_lo;
+	__u16 old_hi = 0;
+
+	old_lo = inode->i_checksum_lo;
+	inode->i_checksum_lo = 0;
+	if (has_hi) {
+		old_hi = inode->i_checksum_hi;
+		inode->i_checksum_hi = 0;
+	}
+
+	inum = ext2fs_cpu_to_le32(inum);
+	gen = inode->i_generation;
+	*crc = ext2fs_crc32c_le(fs->csum_seed, (unsigned char *)&inum,
+				sizeof(inum));
+	*crc = ext2fs_crc32c_le(*crc, (unsigned char *)&gen, sizeof(gen));
+	*crc = ext2fs_crc32c_le(*crc, (unsigned char *)desc, size);
+
+	inode->i_checksum_lo = old_lo;
+	if (has_hi)
+		inode->i_checksum_hi = old_hi;
+	return 0;
+}
+
+int ext2fs_inode_csum_verify(ext2_filsys fs, ext2_ino_t inum,
+			     struct ext2_inode_large *inode)
+{
+	errcode_t retval;
+	__u32 provided, calculated;
+	unsigned int i, has_hi;
+	char *cp;
+
+	if (!ext2fs_has_feature_metadata_csum(fs->super))
+		return 1;
+
+	has_hi = (EXT2_INODE_SIZE(fs->super) > EXT2_GOOD_OLD_INODE_SIZE &&
+		  inode->i_extra_isize >= EXT4_INODE_CSUM_HI_EXTRA_END);
+
+	provided = ext2fs_le16_to_cpu(inode->i_checksum_lo);
+	retval = ext2fs_inode_csum(fs, inum, inode, &calculated, has_hi);
+	if (retval)
+		return 0;
+	if (has_hi) {
+		__u32 hi = ext2fs_le16_to_cpu(inode->i_checksum_hi);
+		provided |= hi << 16;
+	} else
+		calculated &= 0xFFFF;
+
+	if (provided == calculated)
+		return 1;
+
+	/*
+	 * If the checksum didn't match, it's possible it was due to
+	 * the inode being all zero's.  It's unlikely this is the
+	 * case, but it can happen.  So check for it here.  (We only
+	 * check the base inode since that's good enough, and it's not
+	 * worth the bother to figure out how much of the extended
+	 * inode, if any, is present.)
+	 */
+	for (cp = (char *) inode, i = 0;
+	     i < sizeof(struct ext2_inode);
+	     cp++, i++)
+		if (*cp)
+			return 0;
+	return 1;		/* Inode must have been all zero's */
+}
+
+errcode_t ext2fs_inode_csum_set(ext2_filsys fs, ext2_ino_t inum,
+			   struct ext2_inode_large *inode)
+{
+	errcode_t retval;
+	__u32 crc;
+	int has_hi;
+
+	if (!ext2fs_has_feature_metadata_csum(fs->super))
+		return 0;
+
+	has_hi = (EXT2_INODE_SIZE(fs->super) > EXT2_GOOD_OLD_INODE_SIZE &&
+		  inode->i_extra_isize >= EXT4_INODE_CSUM_HI_EXTRA_END);
+
+	retval = ext2fs_inode_csum(fs, inum, inode, &crc, has_hi);
+	if (retval)
+		return retval;
+	inode->i_checksum_lo = ext2fs_cpu_to_le16(crc & 0xFFFF);
+	if (has_hi)
+		inode->i_checksum_hi = ext2fs_cpu_to_le16(crc >> 16);
+	return 0;
+}
+
+__u16 ext2fs_group_desc_csum(ext2_filsys fs, dgrp_t group)
+{
+	struct ext2_group_desc *desc = ext2fs_group_desc(fs, fs->group_desc,
+							 group);
+	size_t offset, size = EXT2_DESC_SIZE(fs->super);
+	__u16 crc = 0;
+#ifdef WORDS_BIGENDIAN
+	struct ext4_group_desc swabdesc;
+	size_t save_size = size;
+	const size_t ext4_bg_size = sizeof(struct ext4_group_desc);
+	struct ext2_group_desc *save_desc = desc;
+
+	/* Have to swab back to little-endian to do the checksum */
+	if (size > ext4_bg_size)
+		size = ext4_bg_size;
+	memcpy(&swabdesc, desc, size);
+	ext2fs_swap_group_desc2(fs, (struct ext2_group_desc *) &swabdesc);
+	desc = (struct ext2_group_desc *) &swabdesc;
+	group = ext2fs_swab32(group);
+#endif
+
+	if (ext2fs_has_feature_metadata_csum(fs->super)) {
+		/* new metadata csum code */
+		__u16 old_crc;
+		__u32 crc32;
+
+		old_crc = desc->bg_checksum;
+		desc->bg_checksum = 0;
+		crc32 = ext2fs_crc32c_le(fs->csum_seed, (unsigned char *)&group,
+					 sizeof(group));
+		crc32 = ext2fs_crc32c_le(crc32, (unsigned char *)desc,
+					 size);
+		desc->bg_checksum = old_crc;
+#ifdef WORDS_BIGENDIAN
+		if (save_size > ext4_bg_size)
+			crc32 = ext2fs_crc32c_le(crc32,
+				     (unsigned char *)save_desc + ext4_bg_size,
+	                             save_size - ext4_bg_size);
+#endif
+		crc = crc32 & 0xFFFF;
+		goto out;
+	}
+
+	/* old crc16 code */
+	offset = offsetof(struct ext2_group_desc, bg_checksum);
+	crc = ext2fs_crc16(~0, fs->super->s_uuid,
+			   sizeof(fs->super->s_uuid));
+	crc = ext2fs_crc16(crc, &group, sizeof(group));
+	crc = ext2fs_crc16(crc, desc, offset);
+	offset += sizeof(desc->bg_checksum); /* skip checksum */
+	/* for checksum of struct ext4_group_desc do the rest...*/
+	if (offset < size) {
+		crc = ext2fs_crc16(crc, (char *)desc + offset,
+				   size - offset);
+	}
+#ifdef WORDS_BIGENDIAN
+	/*
+	 * If the size of the bg descriptor is greater than 64
+	 * bytes, which is the size of the traditional ext4 bg
+	 * descriptor, checksum the rest of the descriptor here
+	 */
+	if (save_size > ext4_bg_size)
+		crc = ext2fs_crc16(crc, (char *)save_desc + ext4_bg_size,
+				   save_size - ext4_bg_size);
+#endif
+
+out:
+	return crc;
+}
+
+int ext2fs_group_desc_csum_verify(ext2_filsys fs, dgrp_t group)
+{
+	if (ext2fs_has_group_desc_csum(fs) &&
+	    (ext2fs_bg_checksum(fs, group) !=
+	     ext2fs_group_desc_csum(fs, group)))
+		return 0;
+
+	return 1;
+}
+
+void ext2fs_group_desc_csum_set(ext2_filsys fs, dgrp_t group)
+{
+	if (!ext2fs_has_group_desc_csum(fs))
+		return;
+
+	/* ext2fs_bg_checksum_set() sets the actual checksum field but
+	 * does not calculate the checksum itself. */
+	ext2fs_bg_checksum_set(fs, group, ext2fs_group_desc_csum(fs, group));
+}
+
+static __u32 find_last_inode_ingrp(ext2fs_inode_bitmap bitmap,
+				   __u32 inodes_per_grp, dgrp_t grp_no)
+{
+	ext2_ino_t i, start_ino, end_ino;
+
+	start_ino = grp_no * inodes_per_grp + 1;
+	end_ino = start_ino + inodes_per_grp - 1;
+
+	for (i = end_ino; i >= start_ino; i--) {
+		if (ext2fs_fast_test_inode_bitmap2(bitmap, i))
+			return i - start_ino + 1;
+	}
+	return inodes_per_grp;
+}
+
+/* update the bitmap flags, set the itable high watermark, and calculate
+ * checksums for the group descriptors */
+errcode_t ext2fs_set_gdt_csum(ext2_filsys fs)
+{
+	struct ext2_super_block *sb = fs->super;
+	int dirty = 0;
+	dgrp_t i;
+
+	if (!fs->inode_map)
+		return EXT2_ET_NO_INODE_BITMAP;
+
+	if (!ext2fs_has_group_desc_csum(fs))
+		return 0;
+
+	for (i = 0; i < fs->group_desc_count; i++) {
+		__u32 old_csum = ext2fs_bg_checksum(fs, i);
+		__u32 old_unused = ext2fs_bg_itable_unused(fs, i);
+		__u32 old_flags = ext2fs_bg_flags(fs, i);
+		__u32 old_free_inodes_count = ext2fs_bg_free_inodes_count(fs, i);
+		__u32 old_free_blocks_count = ext2fs_bg_free_blocks_count(fs, i);
+
+		if (old_free_blocks_count == sb->s_blocks_per_group &&
+		    i != fs->group_desc_count - 1)
+			ext2fs_bg_flags_set(fs, i, EXT2_BG_BLOCK_UNINIT);
+
+		if (old_free_inodes_count == sb->s_inodes_per_group) {
+			ext2fs_bg_flags_set(fs, i, EXT2_BG_INODE_UNINIT);
+			ext2fs_bg_itable_unused_set(fs, i, sb->s_inodes_per_group);
+		} else {
+			int unused =
+				sb->s_inodes_per_group -
+				find_last_inode_ingrp(fs->inode_map,
+						      sb->s_inodes_per_group, i);
+
+			ext2fs_bg_flags_clear(fs, i, EXT2_BG_INODE_UNINIT);
+			ext2fs_bg_itable_unused_set(fs, i, unused);
+		}
+
+		ext2fs_group_desc_csum_set(fs, i);
+		if (old_flags != ext2fs_bg_flags(fs, i))
+			dirty = 1;
+		if (old_unused != ext2fs_bg_itable_unused(fs, i))
+			dirty = 1;
+		if (old_csum != ext2fs_bg_checksum(fs, i))
+			dirty = 1;
+	}
+	if (dirty)
+		ext2fs_mark_super_dirty(fs);
+	return 0;
+}
+
+#ifdef DEBUG
+#include "e2p/e2p.h"
+
+void print_csum(const char *msg, ext2_filsys fs, dgrp_t group)
+{
+	__u16 crc1, crc2, crc3;
+	dgrp_t swabgroup;
+	struct ext2_group_desc *desc = ext2fs_group_desc(fs, fs->group_desc,
+							 group);
+	size_t size = EXT2_DESC_SIZE(fs->super);
+	struct ext2_super_block *sb = fs->super;
+	int offset = offsetof(struct ext2_group_desc, bg_checksum);
+#ifdef WORDS_BIGENDIAN
+	struct ext4_group_desc swabdesc;
+	struct ext2_group_desc *save_desc = desc;
+	const size_t ext4_bg_size = sizeof(struct ext4_group_desc);
+	size_t save_size = size;
+#endif
+
+#ifdef WORDS_BIGENDIAN
+	/* Have to swab back to little-endian to do the checksum */
+	if (size > ext4_bg_size)
+		size = ext4_bg_size;
+	memcpy(&swabdesc, desc, size);
+	ext2fs_swap_group_desc2(fs, (struct ext2_group_desc *) &swabdesc);
+	desc = (struct ext2_group_desc *) &swabdesc;
+
+	swabgroup = ext2fs_swab32(group);
+#else
+	swabgroup = group;
+#endif
+
+	crc1 = ext2fs_crc16(~0, sb->s_uuid, sizeof(fs->super->s_uuid));
+	crc2 = ext2fs_crc16(crc1, &swabgroup, sizeof(swabgroup));
+	crc3 = ext2fs_crc16(crc2, desc, offset);
+	offset += sizeof(desc->bg_checksum); /* skip checksum */
+	/* for checksum of struct ext4_group_desc do the rest...*/
+	if (offset < size)
+		crc3 = ext2fs_crc16(crc3, (char *)desc + offset, size - offset);
+#ifdef WORDS_BIGENDIAN
+	if (save_size > ext4_bg_size)
+		crc3 = ext2fs_crc16(crc3, (char *)save_desc + ext4_bg_size,
+				    save_size - ext4_bg_size);
+#endif
+
+	printf("%s UUID %s=%04x, grp %u=%04x: %04x=%04x\n",
+	       msg, e2p_uuid2str(sb->s_uuid), crc1, group, crc2, crc3,
+	       ext2fs_group_desc_csum(fs, group));
+}
+
+unsigned char sb_uuid[16] = { 0x4f, 0x25, 0xe8, 0xcf, 0xe7, 0x97, 0x48, 0x23,
+			      0xbe, 0xfa, 0xa7, 0x88, 0x4b, 0xae, 0xec, 0xdb };
+
+int main(int argc, char **argv)
+{
+	struct ext2_super_block param;
+	errcode_t		retval;
+	ext2_filsys		fs;
+	int			i;
+	__u16 csum1, csum2, csum_known = 0xd3a4;
+
+	memset(&param, 0, sizeof(param));
+	ext2fs_blocks_count_set(&param, 32768);
+#if 0
+	param.s_feature_incompat |= EXT4_FEATURE_INCOMPAT_64BIT;
+	param.s_desc_size = 128;
+	csum_known = 0x5b6e;
+#endif
+
+	retval = ext2fs_initialize("test fs", EXT2_FLAG_64BITS, &param,
+				   test_io_manager, &fs);
+	if (retval) {
+		com_err("setup", retval,
+			"While initializing filesystem");
+		exit(1);
+	}
+	memcpy(fs->super->s_uuid, sb_uuid, 16);
+	fs->super->s_feature_ro_compat = EXT4_FEATURE_RO_COMPAT_GDT_CSUM;
+
+	for (i=0; i < fs->group_desc_count; i++) {
+		ext2fs_block_bitmap_loc_set(fs, i, 124);
+		ext2fs_inode_bitmap_loc_set(fs, i, 125);
+		ext2fs_inode_table_loc_set(fs, i, 126);
+		ext2fs_bg_free_blocks_count_set(fs, i, 31119);
+		ext2fs_bg_free_inodes_count_set(fs, i, 15701);
+		ext2fs_bg_used_dirs_count_set(fs, i, 2);
+		ext2fs_bg_flags_zap(fs, i);
+	};
+
+	csum1 = ext2fs_group_desc_csum(fs, 0);
+	print_csum("csum0000", fs, 0);
+
+	if (csum1 != csum_known) {
+		printf("checksum for group 0 should be %04x\n", csum_known);
+		exit(1);
+	}
+	csum2 = ext2fs_group_desc_csum(fs, 1);
+	print_csum("csum0001", fs, 1);
+	if (csum1 == csum2) {
+		printf("checksums for different groups shouldn't match\n");
+		exit(1);
+	}
+	csum2 = ext2fs_group_desc_csum(fs, 2);
+	print_csum("csumffff", fs, 2);
+	if (csum1 == csum2) {
+		printf("checksums for different groups shouldn't match\n");
+		exit(1);
+	}
+	ext2fs_bg_checksum_set(fs, 0, csum1);
+	csum2 = ext2fs_group_desc_csum(fs, 0);
+	print_csum("csum_set", fs, 0);
+	if (csum1 != csum2) {
+		printf("checksums should not depend on checksum field\n");
+		exit(1);
+	}
+	if (!ext2fs_group_desc_csum_verify(fs, 0)) {
+		printf("checksums should verify against gd_checksum\n");
+		exit(1);
+	}
+	memset(fs->super->s_uuid, 0x30, sizeof(fs->super->s_uuid));
+	print_csum("new_uuid", fs, 0);
+	if (ext2fs_group_desc_csum_verify(fs, 0) != 0) {
+		printf("checksums for different filesystems shouldn't match\n");
+		exit(1);
+	}
+	csum1 = ext2fs_group_desc_csum(fs, 0);
+	ext2fs_bg_checksum_set(fs, 0, csum1);
+	print_csum("csum_new", fs, 0);
+	ext2fs_bg_free_blocks_count_set(fs, 0, 1);
+	csum2 = ext2fs_group_desc_csum(fs, 0);
+	print_csum("csum_blk", fs, 0);
+	if (csum1 == csum2) {
+		printf("checksums for different data shouldn't match\n");
+		exit(1);
+	}
+	ext2fs_free(fs);
+
+	return 0;
+}
+#endif
diff --git a/lib/ext2fs/dblist.c b/lib/ext2fs/dblist.c
new file mode 100644
index 0000000..bbdb221
--- /dev/null
+++ b/lib/ext2fs/dblist.c
@@ -0,0 +1,403 @@
+/*
+ * dblist.c -- directory block list functions
+ *
+ * Copyright 1997 by Theodore Ts'o
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <string.h>
+#include <time.h>
+
+#include "ext2_fs.h"
+#include "ext2fsP.h"
+
+static EXT2_QSORT_TYPE dir_block_cmp(const void *a, const void *b);
+static EXT2_QSORT_TYPE dir_block_cmp2(const void *a, const void *b);
+static EXT2_QSORT_TYPE (*sortfunc32)(const void *a, const void *b);
+
+/*
+ * helper function for making a new directory block list (for
+ * initialize and copy).
+ */
+static errcode_t make_dblist(ext2_filsys fs, ext2_ino_t size,
+			     ext2_ino_t count,
+			     struct ext2_db_entry2 *list,
+			     ext2_dblist *ret_dblist)
+{
+	ext2_dblist	dblist = NULL;
+	errcode_t	retval;
+	ext2_ino_t	num_dirs;
+	size_t		len;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	if ((ret_dblist == 0) && fs->dblist &&
+	    (fs->dblist->magic == EXT2_ET_MAGIC_DBLIST))
+		return 0;
+
+	retval = ext2fs_get_mem(sizeof(struct ext2_struct_dblist), &dblist);
+	if (retval)
+		goto cleanup;
+	memset(dblist, 0, sizeof(struct ext2_struct_dblist));
+
+	dblist->magic = EXT2_ET_MAGIC_DBLIST;
+	dblist->fs = fs;
+	if (size)
+		dblist->size = size;
+	else {
+		retval = ext2fs_get_num_dirs(fs, &num_dirs);
+		if (retval)
+			goto cleanup;
+		dblist->size = (num_dirs * 2) + 12;
+	}
+	len = (size_t) sizeof(struct ext2_db_entry2) * dblist->size;
+	dblist->count = count;
+	retval = ext2fs_get_array(dblist->size, sizeof(struct ext2_db_entry2),
+		&dblist->list);
+	if (retval)
+		goto cleanup;
+
+	if (list)
+		memcpy(dblist->list, list, len);
+	else
+		memset(dblist->list, 0, len);
+	if (ret_dblist)
+		*ret_dblist = dblist;
+	else
+		fs->dblist = dblist;
+	return 0;
+cleanup:
+	if (dblist)
+		ext2fs_free_mem(&dblist);
+	return retval;
+}
+
+/*
+ * Initialize a directory block list
+ */
+errcode_t ext2fs_init_dblist(ext2_filsys fs, ext2_dblist *ret_dblist)
+{
+	ext2_dblist	dblist;
+	errcode_t	retval;
+
+	retval = make_dblist(fs, 0, 0, 0, &dblist);
+	if (retval)
+		return retval;
+
+	dblist->sorted = 1;
+	if (ret_dblist)
+		*ret_dblist = dblist;
+	else
+		fs->dblist = dblist;
+
+	return 0;
+}
+
+/*
+ * Copy a directory block list
+ */
+errcode_t ext2fs_copy_dblist(ext2_dblist src, ext2_dblist *dest)
+{
+	ext2_dblist	dblist;
+	errcode_t	retval;
+
+	retval = make_dblist(src->fs, src->size, src->count, src->list,
+			     &dblist);
+	if (retval)
+		return retval;
+	dblist->sorted = src->sorted;
+	*dest = dblist;
+	return 0;
+}
+
+/*
+ * Close a directory block list
+ *
+ * (moved to closefs.c)
+ */
+
+
+/*
+ * Add a directory block to the directory block list
+ */
+errcode_t ext2fs_add_dir_block2(ext2_dblist dblist, ext2_ino_t ino,
+				blk64_t blk, e2_blkcnt_t blockcnt)
+{
+	struct ext2_db_entry2 	*new_entry;
+	errcode_t		retval;
+	unsigned long		old_size;
+
+	EXT2_CHECK_MAGIC(dblist, EXT2_ET_MAGIC_DBLIST);
+
+	if (dblist->count >= dblist->size) {
+		old_size = dblist->size * sizeof(struct ext2_db_entry2);
+		dblist->size += dblist->size > 200 ? dblist->size / 2 : 100;
+		retval = ext2fs_resize_mem(old_size, (size_t) dblist->size *
+					   sizeof(struct ext2_db_entry2),
+					   &dblist->list);
+		if (retval) {
+			dblist->size = old_size / sizeof(struct ext2_db_entry2);
+			return retval;
+		}
+	}
+	new_entry = dblist->list + ( dblist->count++);
+	new_entry->blk = blk;
+	new_entry->ino = ino;
+	new_entry->blockcnt = blockcnt;
+
+	dblist->sorted = 0;
+
+	return 0;
+}
+
+/*
+ * Change the directory block to the directory block list
+ */
+errcode_t ext2fs_set_dir_block2(ext2_dblist dblist, ext2_ino_t ino,
+				blk64_t blk, e2_blkcnt_t blockcnt)
+{
+	dgrp_t			i;
+
+	EXT2_CHECK_MAGIC(dblist, EXT2_ET_MAGIC_DBLIST);
+
+	for (i=0; i < dblist->count; i++) {
+		if ((dblist->list[i].ino != ino) ||
+		    (dblist->list[i].blockcnt != blockcnt))
+			continue;
+		dblist->list[i].blk = blk;
+		dblist->sorted = 0;
+		return 0;
+	}
+	return EXT2_ET_DB_NOT_FOUND;
+}
+
+void ext2fs_dblist_sort2(ext2_dblist dblist,
+			 EXT2_QSORT_TYPE (*sortfunc)(const void *,
+						     const void *))
+{
+	if (!sortfunc)
+		sortfunc = dir_block_cmp2;
+	qsort(dblist->list, (size_t) dblist->count,
+	      sizeof(struct ext2_db_entry2), sortfunc);
+	dblist->sorted = 1;
+}
+
+/*
+ * This function iterates over the directory block list
+ */
+errcode_t ext2fs_dblist_iterate3(ext2_dblist dblist,
+				 int (*func)(ext2_filsys fs,
+					     struct ext2_db_entry2 *db_info,
+					     void	*priv_data),
+				 unsigned long long start,
+				 unsigned long long count,
+				 void *priv_data)
+{
+	unsigned long long	i, end;
+	int		ret;
+
+	EXT2_CHECK_MAGIC(dblist, EXT2_ET_MAGIC_DBLIST);
+
+	end = start + count;
+	if (!dblist->sorted)
+		ext2fs_dblist_sort2(dblist, 0);
+	if (end > dblist->count)
+		end = dblist->count;
+	for (i = start; i < end; i++) {
+		ret = (*func)(dblist->fs, &dblist->list[i], priv_data);
+		if (ret & DBLIST_ABORT)
+			return 0;
+	}
+	return 0;
+}
+
+errcode_t ext2fs_dblist_iterate2(ext2_dblist dblist,
+				 int (*func)(ext2_filsys fs,
+					     struct ext2_db_entry2 *db_info,
+					     void	*priv_data),
+				 void *priv_data)
+{
+	return ext2fs_dblist_iterate3(dblist, func, 0, dblist->count,
+				      priv_data);
+}
+
+static EXT2_QSORT_TYPE dir_block_cmp2(const void *a, const void *b)
+{
+	const struct ext2_db_entry2 *db_a =
+		(const struct ext2_db_entry2 *) a;
+	const struct ext2_db_entry2 *db_b =
+		(const struct ext2_db_entry2 *) b;
+
+	if (db_a->blk != db_b->blk)
+		return (int) (db_a->blk - db_b->blk);
+
+	if (db_a->ino != db_b->ino)
+		return (int) (db_a->ino - db_b->ino);
+
+	return (db_a->blockcnt - db_b->blockcnt);
+}
+
+blk64_t ext2fs_dblist_count2(ext2_dblist dblist)
+{
+	return dblist->count;
+}
+
+errcode_t ext2fs_dblist_get_last2(ext2_dblist dblist,
+				  struct ext2_db_entry2 **entry)
+{
+	EXT2_CHECK_MAGIC(dblist, EXT2_ET_MAGIC_DBLIST);
+
+	if (dblist->count == 0)
+		return EXT2_ET_DBLIST_EMPTY;
+
+	if (entry)
+		*entry = dblist->list + ( dblist->count-1);
+	return 0;
+}
+
+errcode_t ext2fs_dblist_drop_last(ext2_dblist dblist)
+{
+	EXT2_CHECK_MAGIC(dblist, EXT2_ET_MAGIC_DBLIST);
+
+	if (dblist->count == 0)
+		return EXT2_ET_DBLIST_EMPTY;
+
+	dblist->count--;
+	return 0;
+}
+
+/*
+ * Legacy 32-bit versions
+ */
+
+/*
+ * Add a directory block to the directory block list
+ */
+errcode_t ext2fs_add_dir_block(ext2_dblist dblist, ext2_ino_t ino, blk_t blk,
+			       int blockcnt)
+{
+	return ext2fs_add_dir_block2(dblist, ino, blk, blockcnt);
+}
+
+/*
+ * Change the directory block to the directory block list
+ */
+errcode_t ext2fs_set_dir_block(ext2_dblist dblist, ext2_ino_t ino, blk_t blk,
+			       int blockcnt)
+{
+	return ext2fs_set_dir_block2(dblist, ino, blk, blockcnt);
+}
+
+void ext2fs_dblist_sort(ext2_dblist dblist,
+			EXT2_QSORT_TYPE (*sortfunc)(const void *,
+						    const void *))
+{
+	if (sortfunc) {
+		sortfunc32 = sortfunc;
+		sortfunc = dir_block_cmp;
+	} else
+		sortfunc = dir_block_cmp2;
+	qsort(dblist->list, (size_t) dblist->count,
+	      sizeof(struct ext2_db_entry2), sortfunc);
+	dblist->sorted = 1;
+}
+
+/*
+ * This function iterates over the directory block list
+ */
+struct iterate_passthrough {
+	int (*func)(ext2_filsys fs,
+		    struct ext2_db_entry *db_info,
+		    void	*priv_data);
+	void *priv_data;
+};
+
+static int passthrough_func(ext2_filsys fs,
+			    struct ext2_db_entry2 *db_info,
+			    void	*priv_data)
+{
+	struct iterate_passthrough *p = priv_data;
+	struct ext2_db_entry db;
+	int ret;
+
+	db.ino = db_info->ino;
+	db.blk = (blk_t) db_info->blk;
+	db.blockcnt = (int) db_info->blockcnt;
+	ret = (p->func)(fs, &db, p->priv_data);
+	db_info->ino = db.ino;
+	db_info->blk = db.blk;
+	db_info->blockcnt = db.blockcnt;
+	return ret;
+}
+
+errcode_t ext2fs_dblist_iterate(ext2_dblist dblist,
+				int (*func)(ext2_filsys fs,
+					    struct ext2_db_entry *db_info,
+					    void	*priv_data),
+				void *priv_data)
+{
+	struct iterate_passthrough pass;
+
+	EXT2_CHECK_MAGIC(dblist, EXT2_ET_MAGIC_DBLIST);
+	pass.func = func;
+	pass.priv_data = priv_data;
+
+	return ext2fs_dblist_iterate2(dblist, passthrough_func, &pass);
+}
+
+static EXT2_QSORT_TYPE dir_block_cmp(const void *a, const void *b)
+{
+	const struct ext2_db_entry2 *db_a =
+		(const struct ext2_db_entry2 *) a;
+	const struct ext2_db_entry2 *db_b =
+		(const struct ext2_db_entry2 *) b;
+
+	struct ext2_db_entry a32, b32;
+
+	a32.ino = db_a->ino;  a32.blk = db_a->blk;
+	a32.blockcnt = db_a->blockcnt;
+
+	b32.ino = db_b->ino;  b32.blk = db_b->blk;
+	b32.blockcnt = db_b->blockcnt;
+
+	return sortfunc32(&a32, &b32);
+}
+
+int ext2fs_dblist_count(ext2_dblist dblist)
+{
+	return dblist->count;
+}
+
+errcode_t ext2fs_dblist_get_last(ext2_dblist dblist,
+				 struct ext2_db_entry **entry)
+{
+	static struct ext2_db_entry ret_entry;
+	struct ext2_db_entry2 *last;
+
+	EXT2_CHECK_MAGIC(dblist, EXT2_ET_MAGIC_DBLIST);
+
+	if (dblist->count == 0)
+		return EXT2_ET_DBLIST_EMPTY;
+
+	if (!entry)
+		return 0;
+
+	last = dblist->list + dblist->count -1;
+
+	ret_entry.ino = last->ino;
+	ret_entry.blk = last->blk;
+	ret_entry.blockcnt = last->blockcnt;
+	*entry = &ret_entry;
+
+	return 0;
+}
+
diff --git a/lib/ext2fs/dblist_dir.c b/lib/ext2fs/dblist_dir.c
new file mode 100644
index 0000000..864a3ca
--- /dev/null
+++ b/lib/ext2fs/dblist_dir.c
@@ -0,0 +1,88 @@
+/*
+ * dblist_dir.c --- iterate by directory entry
+ *
+ * Copyright 1997 by Theodore Ts'o
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <string.h>
+#include <time.h>
+
+#include "ext2_fs.h"
+#include "ext2fsP.h"
+
+static int db_dir_proc(ext2_filsys fs, struct ext2_db_entry2 *db_info,
+		       void *priv_data);
+
+errcode_t ext2fs_dblist_dir_iterate(ext2_dblist dblist,
+				    int	flags,
+				    char	*block_buf,
+				    int (*func)(ext2_ino_t dir,
+						int	entry,
+						struct ext2_dir_entry *dirent,
+						int	offset,
+						int	blocksize,
+						char	*buf,
+						void	*priv_data),
+				    void *priv_data)
+{
+	errcode_t		retval;
+	struct dir_context	ctx;
+
+	EXT2_CHECK_MAGIC(dblist, EXT2_ET_MAGIC_DBLIST);
+
+	ctx.dir = 0;
+	ctx.flags = flags;
+	if (block_buf)
+		ctx.buf = block_buf;
+	else {
+		retval = ext2fs_get_mem(dblist->fs->blocksize, &ctx.buf);
+		if (retval)
+			return retval;
+	}
+	ctx.func = func;
+	ctx.priv_data = priv_data;
+	ctx.errcode = 0;
+
+	retval = ext2fs_dblist_iterate2(dblist, db_dir_proc, &ctx);
+
+	if (!block_buf)
+		ext2fs_free_mem(&ctx.buf);
+	if (retval)
+		return retval;
+	return ctx.errcode;
+}
+
+static int db_dir_proc(ext2_filsys fs, struct ext2_db_entry2 *db_info,
+		       void *priv_data)
+{
+	struct ext2_inode	inode;
+	struct dir_context	*ctx;
+	int			ret;
+
+	ctx = (struct dir_context *) priv_data;
+	ctx->dir = db_info->ino;
+	ctx->errcode = 0;
+
+	ctx->errcode = ext2fs_read_inode(fs, ctx->dir, &inode);
+	if (ctx->errcode)
+		return DBLIST_ABORT;
+	if (inode.i_flags & EXT4_INLINE_DATA_FL)
+		ret = ext2fs_inline_data_dir_iterate(fs, ctx->dir, ctx);
+	else
+		ret = ext2fs_process_dir_block(fs, &db_info->blk,
+					       db_info->blockcnt, 0, 0,
+					       priv_data);
+	if ((ret & BLOCK_ABORT) && !ctx->errcode)
+		return DBLIST_ABORT;
+	return 0;
+}
diff --git a/lib/ext2fs/digest_encode.c b/lib/ext2fs/digest_encode.c
new file mode 100644
index 0000000..075963f
--- /dev/null
+++ b/lib/ext2fs/digest_encode.c
@@ -0,0 +1,187 @@
+/*
+ * lib/ext2fs/digest_encode.c
+ *
+ * A function to encode a digest using 64 characters that are valid in a
+ * filename per ext2fs rules.
+ *
+ * Written by Uday Savagaonkar, 2014.
+ *
+ * Copyright 2014 Google Inc.  All Rights Reserved.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+#include "ext2fs.h"
+
+static const char *lookup_table =
+	"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+,";
+
+/**
+ * ext2fs_digest_encode() -
+ *
+ * Encodes the input digest using characters from the set [a-zA-Z0-9_+].
+ * The encoded string is roughly 4/3 times the size of the input string.
+ */
+int ext2fs_digest_encode(const char *src, int len, char *dst)
+{
+	int i = 0, bits = 0, ac = 0;
+	char *cp = dst;
+
+	while (i < len) {
+		ac += (((unsigned char) src[i]) << bits);
+		bits += 8;
+		do {
+			*cp++ = lookup_table[ac & 0x3f];
+			ac >>= 6;
+			bits -= 6;
+		} while (bits >= 6);
+		i++;
+	}
+	if (bits)
+		*cp++ = lookup_table[ac & 0x3f];
+	return cp - dst;
+}
+
+int ext2fs_digest_decode(const char *src, int len, char *dst)
+{
+	int i = 0, bits = 0, ac = 0;
+	const char *p;
+	char *cp = dst;
+
+	while (i < len) {
+		p = strchr(lookup_table, src[i]);
+		if (p == NULL || src[i] == 0)
+			return -1;
+		ac += (p - lookup_table) << bits;
+		bits += 6;
+		if (bits >= 8) {
+			*cp++ = ac & 0xff;
+			ac >>= 8;
+			bits -= 8;
+		}
+		i++;
+	}
+	if (ac)
+		return -1;
+	return cp - dst;
+}
+
+
+#ifdef UNITTEST
+static const struct {
+	unsigned char d[32];
+	unsigned int len;
+	const char *ed;
+} tests[] = {
+	{ { 0xe3, 0xb0, 0xc4, 0x42, 0x98, 0xfc, 0x1c, 0x14,
+	    0x9a, 0xfb, 0xf4, 0xc8, 0x99, 0x6f, 0xb9, 0x24,
+	    0x27, 0xae, 0x41, 0xe4, 0x64, 0x9b, 0x93, 0x4c,
+	    0xa4, 0x95, 0x99, 0x1b, 0x78, 0x52, 0xb8, 0x55 }, 32,
+	"jDLxChJ,cQhm7TPyZ+WukcirBROZbOJTkWZmbgnU4WF"
+	},
+	{ { 0xba, 0x78, 0x16, 0xbf, 0x8f, 0x01, 0xcf, 0xea,
+	    0x41, 0x41, 0x40, 0xde, 0x5d, 0xae, 0x22, 0x23,
+	    0xb0, 0x03, 0x61, 0xa3, 0x96, 0x17, 0x7a, 0x9c,
+	    0xb4, 0x10, 0xff, 0x61, 0xf2, 0x00, 0x15, 0xad }, 32,
+	"6inF,+YAPreQBBk3d5qIjA7AhNqlXoHn0Cx,hJPAV0K"
+	},
+	{ { 0x24, 0x8d, 0x6a, 0x61, 0xd2, 0x06, 0x38, 0xb8,
+	    0xe5, 0xc0, 0x26, 0x93, 0x0c, 0x3e, 0x60, 0x39,
+	    0xa3, 0x3c, 0xe4, 0x59, 0x64, 0xff, 0x21, 0x67,
+	    0xf6, 0xec, 0xed, 0xd4, 0x19, 0xdb, 0x06, 0xc1 }, 32,
+	"k0oahJtB4gb5AbykM4DY5MKPknFZ,HyZ2ze7Unx2GEM"
+	},
+	{ { 0x00, }, 1,
+	"AA"
+	},
+	{ { 0x01, }, 1,
+	"BA"
+	},
+	{ { 0x01, 0x02 }, 2,
+	"BIA"
+	},
+	{ { 0x01, 0x02, 0x03 }, 3,
+	"BIwA"
+	},
+	{ { 0x01, 0x02, 0x03, 0x04 }, 4,
+	"BIwAEA"
+	},
+	{ { 0x01, 0x02, 0x03, 0x04, 0xff }, 5,
+	"BIwAE8P"
+	},
+	{ { 0x01, 0x02, 0x03, 0x04, 0xff, 0xfe }, 6,
+	"BIwAE8v,"
+	},
+	{ { 0x01, 0x02, 0x03, 0x04, 0xff, 0xfe, 0xfd }, 7,
+	"BIwAE8v,9D"
+	},
+};
+
+int main(int argc, char **argv)
+{
+	int i, ret, len;
+	int errors = 0;
+	char tmp[1024], tmp2[1024];
+
+	if (argc == 3 && !strcmp(argv[1], "encode")) {
+		memset(tmp, 0, sizeof(tmp));
+		ext2fs_digest_encode(argv[2], strlen(argv[2]), tmp);
+		puts(tmp);
+		exit(0);
+	}
+	if (argc == 3 && !strcmp(argv[1], "decode")) {
+		memset(tmp, 0, sizeof(tmp));
+		ret = ext2fs_digest_decode(argv[2], strlen(argv[2]), tmp);
+		puts(tmp);
+		fprintf(stderr, "returned %d\n", ret);
+		exit(0);
+	}
+	for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) {
+		memset(tmp, 0, sizeof(tmp));
+		ret = ext2fs_digest_encode((const char *) tests[i].d,
+					   tests[i].len, tmp);
+		len = strlen(tmp);
+		printf("Test Digest %d (returned %d): ", i, ret);
+		if (ret != len) {
+			printf("FAILED returned %d, string length was %d\n",
+			       ret, len);
+			errors++;
+			continue;
+		} else if (strcmp(tmp, tests[i].ed) != 0) {
+			printf("FAILED: got %s, expected %s\n", tmp,
+			       tests[i].ed);
+			errors++;
+			continue;
+		}
+		ret = ext2fs_digest_decode(tmp, len, tmp2);
+		if (ret != tests[i].len) {
+			printf("FAILED decode returned %d, expected %d\n",
+			       ret, tests[i].len);
+			errors++;
+			continue;
+		}
+		if (memcmp(tmp2, tests[i].d, ret) != 0) {
+			puts("FAILED: decode mismatched");
+			errors++;
+			continue;
+		}
+		printf("OK\n");
+	}
+	for (i = 1; i < argc; i++) {
+		memset(tmp, 0, sizeof(tmp));
+		ret = ext2fs_digest_encode(argv[i], strlen(argv[i]), tmp);
+		len = strlen(tmp);
+		printf("Digest of '%s' is '%s' (returned %d, length %d)\n",
+		       argv[i], tmp, ret, len);
+	}
+	return errors;
+}
+
+#endif /* UNITTEST */
diff --git a/lib/ext2fs/dir_iterate.c b/lib/ext2fs/dir_iterate.c
new file mode 100644
index 0000000..7798a48
--- /dev/null
+++ b/lib/ext2fs/dir_iterate.c
@@ -0,0 +1,315 @@
+/*
+ * dir_iterate.c --- ext2fs directory iteration operations
+ *
+ * Copyright (C) 1993, 1994, 1994, 1995, 1996, 1997 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#if HAVE_ERRNO_H
+#include <errno.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fsP.h"
+
+#define EXT4_MAX_REC_LEN		((1<<16)-1)
+
+errcode_t ext2fs_get_rec_len(ext2_filsys fs,
+			     struct ext2_dir_entry *dirent,
+			     unsigned int *rec_len)
+{
+	unsigned int len = dirent->rec_len;
+
+	if (fs->blocksize < 65536)
+		*rec_len = len;
+	else if (len == EXT4_MAX_REC_LEN || len == 0)
+		*rec_len = fs->blocksize;
+	else 
+		*rec_len = (len & 65532) | ((len & 3) << 16);
+	return 0;
+}
+
+errcode_t ext2fs_set_rec_len(ext2_filsys fs,
+			     unsigned int len,
+			     struct ext2_dir_entry *dirent)
+{
+	if ((len > fs->blocksize) || (fs->blocksize > (1 << 18)) || (len & 3))
+		return EINVAL;
+	if (len < 65536) {
+		dirent->rec_len = len;
+		return 0;
+	}
+	if (len == fs->blocksize) {
+		if (fs->blocksize == 65536)
+			dirent->rec_len = EXT4_MAX_REC_LEN;
+		else 
+			dirent->rec_len = 0;
+	} else
+		dirent->rec_len = (len & 65532) | ((len >> 16) & 3);
+	return 0;
+}
+
+/*
+ * This function checks to see whether or not a potential deleted
+ * directory entry looks valid.  What we do is check the deleted entry
+ * and each successive entry to make sure that they all look valid and
+ * that the last deleted entry ends at the beginning of the next
+ * undeleted entry.  Returns 1 if the deleted entry looks valid, zero
+ * if not valid.
+ */
+static int ext2fs_validate_entry(ext2_filsys fs, char *buf,
+				 unsigned int offset,
+				 unsigned int final_offset)
+{
+	struct ext2_dir_entry *dirent;
+	unsigned int rec_len;
+#define DIRENT_MIN_LENGTH 12
+
+	while ((offset < final_offset) &&
+	       (offset <= fs->blocksize - DIRENT_MIN_LENGTH)) {
+		dirent = (struct ext2_dir_entry *)(buf + offset);
+		if (ext2fs_get_rec_len(fs, dirent, &rec_len))
+			return 0;
+		offset += rec_len;
+		if ((rec_len < 8) ||
+		    ((rec_len % 4) != 0) ||
+		    ((ext2fs_dirent_name_len(dirent)+8) > (int) rec_len))
+			return 0;
+	}
+	return (offset == final_offset);
+}
+
+errcode_t ext2fs_dir_iterate2(ext2_filsys fs,
+			      ext2_ino_t dir,
+			      int flags,
+			      char *block_buf,
+			      int (*func)(ext2_ino_t	dir,
+					  int		entry,
+					  struct ext2_dir_entry *dirent,
+					  int	offset,
+					  int	blocksize,
+					  char	*buf,
+					  void	*priv_data),
+			      void *priv_data)
+{
+	struct		dir_context	ctx;
+	errcode_t	retval;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	retval = ext2fs_check_directory(fs, dir);
+	if (retval)
+		return retval;
+
+	ctx.dir = dir;
+	ctx.flags = flags;
+	if (block_buf)
+		ctx.buf = block_buf;
+	else {
+		retval = ext2fs_get_mem(fs->blocksize, &ctx.buf);
+		if (retval)
+			return retval;
+	}
+	ctx.func = func;
+	ctx.priv_data = priv_data;
+	ctx.errcode = 0;
+	retval = ext2fs_block_iterate3(fs, dir, BLOCK_FLAG_READ_ONLY, 0,
+				       ext2fs_process_dir_block, &ctx);
+	if (!block_buf)
+		ext2fs_free_mem(&ctx.buf);
+	if (retval == EXT2_ET_INLINE_DATA_CANT_ITERATE) {
+		(void) ext2fs_inline_data_dir_iterate(fs, dir, &ctx);
+		retval = 0;
+	}
+	if (retval)
+		return retval;
+	return ctx.errcode;
+}
+
+struct xlate {
+	int (*func)(struct ext2_dir_entry *dirent,
+		    int		offset,
+		    int		blocksize,
+		    char	*buf,
+		    void	*priv_data);
+	void *real_private;
+};
+
+static int xlate_func(ext2_ino_t dir EXT2FS_ATTR((unused)),
+		      int entry EXT2FS_ATTR((unused)),
+		      struct ext2_dir_entry *dirent, int offset,
+		      int blocksize, char *buf, void *priv_data)
+{
+	struct xlate *xl = (struct xlate *) priv_data;
+
+	return (*xl->func)(dirent, offset, blocksize, buf, xl->real_private);
+}
+
+errcode_t ext2fs_dir_iterate(ext2_filsys fs,
+			     ext2_ino_t dir,
+			     int flags,
+			     char *block_buf,
+			     int (*func)(struct ext2_dir_entry *dirent,
+					 int	offset,
+					 int	blocksize,
+					 char	*buf,
+					 void	*priv_data),
+			     void *priv_data)
+{
+	struct xlate xl;
+
+	xl.real_private = priv_data;
+	xl.func = func;
+
+	return ext2fs_dir_iterate2(fs, dir, flags, block_buf,
+				   xlate_func, &xl);
+}
+
+
+/*
+ * Helper function which is private to this module.  Used by
+ * ext2fs_dir_iterate() and ext2fs_dblist_dir_iterate()
+ */
+int ext2fs_process_dir_block(ext2_filsys fs,
+			     blk64_t	*blocknr,
+			     e2_blkcnt_t blockcnt,
+			     blk64_t	ref_block EXT2FS_ATTR((unused)),
+			     int	ref_offset EXT2FS_ATTR((unused)),
+			     void	*priv_data)
+{
+	struct dir_context *ctx = (struct dir_context *) priv_data;
+	unsigned int	offset = 0;
+	unsigned int	next_real_entry = 0;
+	int		ret = 0;
+	int		changed = 0;
+	int		do_abort = 0;
+	unsigned int	rec_len, size, buflen;
+	int		entry;
+	struct ext2_dir_entry *dirent;
+	int		csum_size = 0;
+	int		inline_data;
+	errcode_t	retval = 0;
+
+	if (blockcnt < 0)
+		return 0;
+
+	entry = blockcnt ? DIRENT_OTHER_FILE : DIRENT_DOT_FILE;
+
+	/* If a dir has inline data, we don't need to read block */
+	inline_data = !!(ctx->flags & DIRENT_FLAG_INCLUDE_INLINE_DATA);
+	if (!inline_data) {
+		ctx->errcode = ext2fs_read_dir_block4(fs, *blocknr, ctx->buf, 0,
+						      ctx->dir);
+		if (ctx->errcode)
+			return BLOCK_ABORT;
+		/* If we handle a normal dir, we traverse the entire block */
+		buflen = fs->blocksize;
+	} else {
+		buflen = ctx->buflen;
+	}
+
+	if (ext2fs_has_feature_metadata_csum(fs->super))
+		csum_size = sizeof(struct ext2_dir_entry_tail);
+
+	if (buflen < 8) {
+		ctx->errcode = EXT2_ET_DIR_CORRUPTED;
+		return BLOCK_ABORT;
+	}
+	while (offset < buflen - 8) {
+		dirent = (struct ext2_dir_entry *) (ctx->buf + offset);
+		if (ext2fs_get_rec_len(fs, dirent, &rec_len))
+			return BLOCK_ABORT;
+		if (((offset + rec_len) > buflen) ||
+		    (rec_len < 8) ||
+		    ((rec_len % 4) != 0) ||
+		    ((ext2fs_dirent_name_len(dirent)+8) > (int) rec_len)) {
+			ctx->errcode = EXT2_ET_DIR_CORRUPTED;
+			return BLOCK_ABORT;
+		}
+		if (!dirent->inode) {
+			/*
+			 * We just need to check metadata_csum when this
+			 * dir hasn't inline data.  That means that 'buflen'
+			 * should be blocksize.
+			 */
+			if (!inline_data &&
+			    (offset == buflen - csum_size) &&
+			    (dirent->rec_len == csum_size) &&
+			    (dirent->name_len == EXT2_DIR_NAME_LEN_CSUM)) {
+				if (!(ctx->flags & DIRENT_FLAG_INCLUDE_CSUM))
+					goto next;
+				entry = DIRENT_CHECKSUM;
+			} else if (!(ctx->flags & DIRENT_FLAG_INCLUDE_EMPTY))
+				goto next;
+		}
+
+		ret = (ctx->func)(ctx->dir,
+				  (next_real_entry > offset) ?
+				  DIRENT_DELETED_FILE : entry,
+				  dirent, offset,
+				  buflen, ctx->buf,
+				  ctx->priv_data);
+		if (entry < DIRENT_OTHER_FILE)
+			entry++;
+
+		if (ret & DIRENT_CHANGED) {
+			if (ext2fs_get_rec_len(fs, dirent, &rec_len))
+				return BLOCK_ABORT;
+			changed++;
+		}
+		if (ret & DIRENT_ABORT) {
+			do_abort++;
+			break;
+		}
+next:
+ 		if (next_real_entry == offset)
+			next_real_entry += rec_len;
+
+ 		if (ctx->flags & DIRENT_FLAG_INCLUDE_REMOVED) {
+			size = (ext2fs_dirent_name_len(dirent) + 11) & ~3;
+
+			if (rec_len != size)  {
+				unsigned int final_offset;
+
+				final_offset = offset + rec_len;
+				offset += size;
+				while (offset < final_offset &&
+				       !ext2fs_validate_entry(fs, ctx->buf,
+							      offset,
+							      final_offset))
+					offset += 4;
+				continue;
+			}
+		}
+		offset += rec_len;
+	}
+
+	if (changed) {
+		if (!inline_data) {
+			ctx->errcode = ext2fs_write_dir_block4(fs, *blocknr,
+							       ctx->buf,
+							       0, ctx->dir);
+			if (ctx->errcode)
+				return BLOCK_ABORT;
+		} else {
+			/*
+			 * return BLOCK_INLINE_DATA_CHANGED to notify caller
+			 * that inline data has been changed.
+			 */
+			retval = BLOCK_INLINE_DATA_CHANGED;
+		}
+	}
+	if (do_abort)
+		return retval | BLOCK_ABORT;
+	return retval;
+}
diff --git a/lib/ext2fs/dirblock.c b/lib/ext2fs/dirblock.c
new file mode 100644
index 0000000..54b2777
--- /dev/null
+++ b/lib/ext2fs/dirblock.c
@@ -0,0 +1,113 @@
+/*
+ * dirblock.c --- directory block routines.
+ *
+ * Copyright (C) 1995, 1996 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <string.h>
+#include <time.h>
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+errcode_t ext2fs_read_dir_block4(ext2_filsys fs, blk64_t block,
+				 void *buf, int flags EXT2FS_ATTR((unused)),
+				 ext2_ino_t ino)
+{
+	errcode_t	retval;
+	int		corrupt = 0;
+
+	retval = io_channel_read_blk64(fs->io, block, 1, buf);
+	if (retval)
+		return retval;
+
+	if (!(fs->flags & EXT2_FLAG_IGNORE_CSUM_ERRORS) &&
+	    !ext2fs_dir_block_csum_verify(fs, ino,
+					  (struct ext2_dir_entry *)buf))
+		corrupt = 1;
+
+#ifdef WORDS_BIGENDIAN
+	retval = ext2fs_dirent_swab_in(fs, buf, flags);
+#endif
+	if (!retval && corrupt)
+		retval = EXT2_ET_DIR_CSUM_INVALID;
+	return retval;
+}
+
+errcode_t ext2fs_read_dir_block3(ext2_filsys fs, blk64_t block,
+				 void *buf, int flags EXT2FS_ATTR((unused)))
+{
+	return ext2fs_read_dir_block4(fs, block, buf, flags, 0);
+}
+
+errcode_t ext2fs_read_dir_block2(ext2_filsys fs, blk_t block,
+				 void *buf, int flags EXT2FS_ATTR((unused)))
+{
+	return ext2fs_read_dir_block3(fs, block, buf, flags);
+}
+
+errcode_t ext2fs_read_dir_block(ext2_filsys fs, blk_t block,
+				 void *buf)
+{
+	return ext2fs_read_dir_block3(fs, block, buf, 0);
+}
+
+
+errcode_t ext2fs_write_dir_block4(ext2_filsys fs, blk64_t block,
+				  void *inbuf, int flags EXT2FS_ATTR((unused)),
+				  ext2_ino_t ino)
+{
+	errcode_t	retval;
+	char		*buf = inbuf;
+
+#ifdef WORDS_BIGENDIAN
+	retval = ext2fs_get_mem(fs->blocksize, &buf);
+	if (retval)
+		return retval;
+	memcpy(buf, inbuf, fs->blocksize);
+	retval = ext2fs_dirent_swab_out(fs, buf, flags);
+	if (retval)
+		return retval;
+#endif
+	retval = ext2fs_dir_block_csum_set(fs, ino,
+					   (struct ext2_dir_entry *)buf);
+	if (retval)
+		goto out;
+
+	retval = io_channel_write_blk64(fs->io, block, 1, buf);
+
+out:
+#ifdef WORDS_BIGENDIAN
+	ext2fs_free_mem(&buf);
+#endif
+	return retval;
+}
+
+errcode_t ext2fs_write_dir_block3(ext2_filsys fs, blk64_t block,
+				  void *inbuf, int flags EXT2FS_ATTR((unused)))
+{
+	return ext2fs_write_dir_block4(fs, block, inbuf, flags, 0);
+}
+
+errcode_t ext2fs_write_dir_block2(ext2_filsys fs, blk_t block,
+				 void *inbuf, int flags EXT2FS_ATTR((unused)))
+{
+	return ext2fs_write_dir_block3(fs, block, inbuf, flags);
+}
+
+errcode_t ext2fs_write_dir_block(ext2_filsys fs, blk_t block,
+				 void *inbuf)
+{
+	return ext2fs_write_dir_block3(fs, block, inbuf, 0);
+}
+
diff --git a/lib/ext2fs/dirhash.c b/lib/ext2fs/dirhash.c
new file mode 100644
index 0000000..42fe98b
--- /dev/null
+++ b/lib/ext2fs/dirhash.c
@@ -0,0 +1,307 @@
+/*
+ * dirhash.c -- Calculate the hash of a directory entry
+ *
+ * Copyright (c) 2001  Daniel Phillips
+ *
+ * Copyright (c) 2002 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#include <limits.h>
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+#include "ext2fsP.h"
+
+#ifndef PATH_MAX
+#define PATH_MAX 4096
+#endif
+
+/*
+ * Keyed 32-bit hash function using TEA in a Davis-Meyer function
+ *   H0 = Key
+ *   Hi = E Mi(Hi-1) + Hi-1
+ *
+ * (see Applied Cryptography, 2nd edition, p448).
+ *
+ * Jeremy Fitzhardinge <jeremy@zip.com.au> 1998
+ *
+ * This code is made available under the terms of the GPL
+ */
+#define DELTA 0x9E3779B9
+
+static void TEA_transform(__u32 buf[4], __u32 const in[])
+{
+	__u32	sum = 0;
+	__u32	b0 = buf[0], b1 = buf[1];
+	__u32	a = in[0], b = in[1], c = in[2], d = in[3];
+	int	n = 16;
+
+	do {
+		sum += DELTA;
+		b0 += ((b1 << 4)+a) ^ (b1+sum) ^ ((b1 >> 5)+b);
+		b1 += ((b0 << 4)+c) ^ (b0+sum) ^ ((b0 >> 5)+d);
+	} while(--n);
+
+	buf[0] += b0;
+	buf[1] += b1;
+}
+
+/* F, G and H are basic MD4 functions: selection, majority, parity */
+#define F(x, y, z) ((z) ^ ((x) & ((y) ^ (z))))
+#define G(x, y, z) (((x) & (y)) + (((x) ^ (y)) & (z)))
+#define H(x, y, z) ((x) ^ (y) ^ (z))
+
+/*
+ * The generic round function.  The application is so specific that
+ * we don't bother protecting all the arguments with parens, as is generally
+ * good macro practice, in favor of extra legibility.
+ * Rotation is separate from addition to prevent recomputation
+ */
+#define ROUND(f, a, b, c, d, x, s)	\
+	(a += f(b, c, d) + x, a = (a << s) | (a >> (32-s)))
+#define K1 0
+#define K2 013240474631UL
+#define K3 015666365641UL
+
+/*
+ * Basic cut-down MD4 transform.  Returns only 32 bits of result.
+ */
+static void halfMD4Transform (__u32 buf[4], __u32 const in[])
+{
+	__u32	a = buf[0], b = buf[1], c = buf[2], d = buf[3];
+
+	/* Round 1 */
+	ROUND(F, a, b, c, d, in[0] + K1,  3);
+	ROUND(F, d, a, b, c, in[1] + K1,  7);
+	ROUND(F, c, d, a, b, in[2] + K1, 11);
+	ROUND(F, b, c, d, a, in[3] + K1, 19);
+	ROUND(F, a, b, c, d, in[4] + K1,  3);
+	ROUND(F, d, a, b, c, in[5] + K1,  7);
+	ROUND(F, c, d, a, b, in[6] + K1, 11);
+	ROUND(F, b, c, d, a, in[7] + K1, 19);
+
+	/* Round 2 */
+	ROUND(G, a, b, c, d, in[1] + K2,  3);
+	ROUND(G, d, a, b, c, in[3] + K2,  5);
+	ROUND(G, c, d, a, b, in[5] + K2,  9);
+	ROUND(G, b, c, d, a, in[7] + K2, 13);
+	ROUND(G, a, b, c, d, in[0] + K2,  3);
+	ROUND(G, d, a, b, c, in[2] + K2,  5);
+	ROUND(G, c, d, a, b, in[4] + K2,  9);
+	ROUND(G, b, c, d, a, in[6] + K2, 13);
+
+	/* Round 3 */
+	ROUND(H, a, b, c, d, in[3] + K3,  3);
+	ROUND(H, d, a, b, c, in[7] + K3,  9);
+	ROUND(H, c, d, a, b, in[2] + K3, 11);
+	ROUND(H, b, c, d, a, in[6] + K3, 15);
+	ROUND(H, a, b, c, d, in[1] + K3,  3);
+	ROUND(H, d, a, b, c, in[5] + K3,  9);
+	ROUND(H, c, d, a, b, in[0] + K3, 11);
+	ROUND(H, b, c, d, a, in[4] + K3, 15);
+
+	buf[0] += a;
+	buf[1] += b;
+	buf[2] += c;
+	buf[3] += d;
+}
+
+#undef ROUND
+#undef F
+#undef G
+#undef H
+#undef K1
+#undef K2
+#undef K3
+
+/* The old legacy hash */
+static ext2_dirhash_t dx_hack_hash (const char *name, int len,
+				    int unsigned_flag)
+{
+	__u32 hash, hash0 = 0x12a3fe2d, hash1 = 0x37abe8f9;
+	const unsigned char *ucp = (const unsigned char *) name;
+	const signed char *scp = (const signed char *) name;
+	int c;
+
+	while (len--) {
+		if (unsigned_flag)
+			c = (int) *ucp++;
+		else
+			c = (int) *scp++;
+		hash = hash1 + (hash0 ^ (c * 7152373));
+
+		if (hash & 0x80000000) hash -= 0x7fffffff;
+		hash1 = hash0;
+		hash0 = hash;
+	}
+	return (hash0 << 1);
+}
+
+static void str2hashbuf(const char *msg, int len, __u32 *buf, int num,
+			int unsigned_flag)
+{
+	__u32	pad, val;
+	int	i, c;
+	const unsigned char *ucp = (const unsigned char *) msg;
+	const signed char *scp = (const signed char *) msg;
+
+	pad = (__u32)len | ((__u32)len << 8);
+	pad |= pad << 16;
+
+	val = pad;
+	if (len > num*4)
+		len = num * 4;
+	for (i=0; i < len; i++) {
+		if (unsigned_flag)
+			c = (int) ucp[i];
+		else
+			c = (int) scp[i];
+
+		val = c + (val << 8);
+		if ((i % 4) == 3) {
+			*buf++ = val;
+			val = pad;
+			num--;
+		}
+	}
+	if (--num >= 0)
+		*buf++ = val;
+	while (--num >= 0)
+		*buf++ = pad;
+}
+
+/*
+ * Returns the hash of a filename.  If len is 0 and name is NULL, then
+ * this function can be used to test whether or not a hash version is
+ * supported.
+ *
+ * The seed is an 4 longword (32 bits) "secret" which can be used to
+ * uniquify a hash.  If the seed is all zero's, then some default seed
+ * may be used.
+ *
+ * A particular hash version specifies whether or not the seed is
+ * represented, and whether or not the returned hash is 32 bits or 64
+ * bits.  32 bit hashes will return 0 for the minor hash.
+ *
+ * This function doesn't do any normalization or casefolding of the
+ * input string.  To take charset encoding into account, use
+ * ext2fs_dirhash2.
+ *
+ */
+errcode_t ext2fs_dirhash(int version, const char *name, int len,
+			 const __u32 *seed,
+			 ext2_dirhash_t *ret_hash,
+			 ext2_dirhash_t *ret_minor_hash)
+{
+	__u32	hash;
+	__u32	minor_hash = 0;
+	const char	*p;
+	int		i;
+	__u32 		in[8], buf[4];
+	int		unsigned_flag = 0;
+
+	/* Initialize the default seed for the hash checksum functions */
+	buf[0] = 0x67452301;
+	buf[1] = 0xefcdab89;
+	buf[2] = 0x98badcfe;
+	buf[3] = 0x10325476;
+
+	/* Check to see if the seed is all zero's */
+	if (seed) {
+		for (i=0; i < 4; i++) {
+			if (seed[i])
+				break;
+		}
+		if (i < 4)
+			memcpy(buf, seed, sizeof(buf));
+	}
+
+	switch (version) {
+	case EXT2_HASH_LEGACY_UNSIGNED:
+		unsigned_flag++;
+		/* fallthrough */
+	case EXT2_HASH_LEGACY:
+		hash = dx_hack_hash(name, len, unsigned_flag);
+		break;
+	case EXT2_HASH_HALF_MD4_UNSIGNED:
+		unsigned_flag++;
+		/* fallthrough */
+	case EXT2_HASH_HALF_MD4:
+		p = name;
+		while (len > 0) {
+			str2hashbuf(p, len, in, 8, unsigned_flag);
+			halfMD4Transform(buf, in);
+			len -= 32;
+			p += 32;
+		}
+		minor_hash = buf[2];
+		hash = buf[1];
+		break;
+	case EXT2_HASH_TEA_UNSIGNED:
+		unsigned_flag++;
+		/* fallthrough */
+	case EXT2_HASH_TEA:
+		p = name;
+		while (len > 0) {
+			str2hashbuf(p, len, in, 4, unsigned_flag);
+			TEA_transform(buf, in);
+			len -= 16;
+			p += 16;
+		}
+		hash = buf[0];
+		minor_hash = buf[1];
+		break;
+	default:
+		*ret_hash = 0;
+		return EXT2_ET_DIRHASH_UNSUPP;
+	}
+	*ret_hash = hash & ~1;
+	if (ret_minor_hash)
+		*ret_minor_hash = minor_hash;
+	return 0;
+}
+
+/*
+ * Returns the hash of a filename considering normalization and
+ * casefolding.  This is a wrapper around ext2fs_dirhash with string
+ * encoding support based on the nls_table and the flags. Check
+ * ext2fs_dirhash for documentation on the input and output parameters.
+ */
+errcode_t ext2fs_dirhash2(int version, const char *name, int len,
+			  const struct ext2fs_nls_table *charset,
+			  int hash_flags, const __u32 *seed,
+			  ext2_dirhash_t *ret_hash,
+			  ext2_dirhash_t *ret_minor_hash)
+{
+	errcode_t r;
+	int dlen;
+
+	if (len && charset && (hash_flags & EXT4_CASEFOLD_FL)) {
+		char buff[PATH_MAX];
+
+		dlen = charset->ops->casefold(charset,
+			      (const unsigned char *) name, len,
+			      (unsigned char *) buff, sizeof(buff));
+		if (dlen < 0) {
+			if (dlen == -EINVAL)
+				goto opaque_seq;
+
+			return dlen;
+		}
+		r = ext2fs_dirhash(version, buff, dlen, seed, ret_hash,
+				   ret_minor_hash);
+		return r;
+	}
+
+opaque_seq:
+	return ext2fs_dirhash(version, name, len, seed, ret_hash,
+			      ret_minor_hash);
+}
diff --git a/lib/ext2fs/dosio.c b/lib/ext2fs/dosio.c
new file mode 100644
index 0000000..d0cf269
--- /dev/null
+++ b/lib/ext2fs/dosio.c
@@ -0,0 +1,459 @@
+/*
+ * dosio.c -- Disk I/O module for the ext2fs/DOS library.
+ *
+ * Copyright (c) 1997 by Theodore Ts'o.
+ *
+ * Copyright (c) 1997 Mark Habersack
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <bios.h>
+#include <string.h>
+#include <ctype.h>
+#include <io.h>
+#ifdef HAVE_ERRNO_H
+#include <errno.h>
+#endif
+
+#include <ext2fs/ext2_types.h>
+#include "utils.h"
+#include "dosio.h"
+#include "et/com_err.h"
+#include "ext2_err.h"
+#include "ext2fs/io.h"
+
+/*
+ * Some helper macros
+ */
+#define LINUX_EXT2FS       0x83
+#define LINUX_SWAP         0x82
+#define WRITE_ERR(_msg_) write(2, _msg_, strlen(_msg_))
+#define WRITE_ERR_S(_msg_) write(2, _msg_, sizeof(_msg_))
+
+/*
+ * Exported variables
+ */
+unsigned long        _dio_error;
+unsigned long        _dio_hw_error;
+
+/*
+ * Array of all opened partitions
+ */
+static PARTITION        **partitions = NULL;
+static unsigned short   npart = 0; /* Number of mapped partitions */
+static PARTITION        *active = NULL;
+
+/*
+ * I/O Manager routine prototypes
+ */
+static errcode_t dos_open(const char *dev, int flags, io_channel *channel);
+static errcode_t dos_close(io_channel channel);
+static errcode_t dos_set_blksize(io_channel channel, int blksize);
+static errcode_t dos_read_blk(io_channel channel, unsigned long block,
+                                             int count, void *buf);
+static errcode_t dos_write_blk(io_channel channel, unsigned long block,
+                               int count, const void *buf);
+static errcode_t dos_flush(io_channel channel);
+
+static struct struct_io_manager struct_dos_manager = {
+	.magic		= EXT2_ET_MAGIC_IO_MANAGER,
+	.name		= "DOS I/O Manager",
+	.open		= dos_open,
+	.close		= dos_close,
+	.set_blksize	= dos_set_blksize,
+	.read_blk	= dos_read_blk,
+	.write_blk	= dos_write_blk,
+	.flush		= dos_flush
+};
+
+io_manager dos_io_manager = &struct_dos_manager;
+
+/*
+ * Macro taken from unix_io.c
+ */
+/*
+ * For checking structure magic numbers...
+ */
+
+#define EXT2_CHECK_MAGIC(struct, code) \
+          if ((struct)->magic != (code)) return (code)
+
+/*
+ * Calculates a CHS address of a sector from its LBA
+ * offset for the given partition.
+ */
+static void lba2chs(unsigned long lba_addr, CHS *chs, PARTITION *part)
+{
+  unsigned long      abss;
+
+  chs->offset = lba_addr & 0x000001FF;
+  abss = (lba_addr >> 9) + part->start;
+  chs->cyl    = abss / (part->sects * part->heads);
+  chs->head   = (abss / part->sects) % part->heads;
+  chs->sector = (abss % part->sects) + 1;
+}
+
+#ifdef __TURBOC__
+#pragma argsused
+#endif
+/*
+ * Scans the passed partition table looking for *pno partition
+ * that has LINUX_EXT2FS type.
+ *
+ * TODO:
+ * For partition numbers >5 Linux uses DOS extended partitions -
+ * dive into them an return an appropriate entry. Also dive into
+ * extended partitions when scanning for a first Linux/ext2fs.
+ */
+static PTABLE_ENTRY *scan_partition_table(PTABLE_ENTRY *pentry,
+                                          unsigned short phys,
+                                          unsigned char *pno)
+{
+  unsigned        i;
+
+  if(*pno != 0xFF && *pno >= 5)
+     return NULL; /* We don't support extended partitions for now */
+
+  if(*pno != 0xFF)
+  {
+    if(pentry[*pno].type == LINUX_EXT2FS)
+      return &pentry[*pno];
+    else
+    {
+      if(!pentry[*pno].type)
+        *pno = 0xFE;
+      else if(pentry[*pno].type == LINUX_SWAP)
+        *pno = 0xFD;
+      return NULL;
+    }
+  }
+
+  for(i = 0; i < 4; i++)
+    if(pentry[i].type == LINUX_EXT2FS)
+    {
+      *pno = i;
+      return &pentry[i];
+    }
+
+  return NULL;
+}
+
+/*
+ * Allocate libext2fs structures associated with I/O manager
+ */
+static io_channel alloc_io_channel(PARTITION *part)
+{
+  io_channel     ioch;
+
+  ioch = (io_channel)malloc(sizeof(struct struct_io_channel));
+  if (!ioch)
+	  return NULL;
+  memset(ioch, 0, sizeof(struct struct_io_channel));
+  ioch->magic = EXT2_ET_MAGIC_IO_CHANNEL;
+  ioch->manager = dos_io_manager;
+  ioch->name = (char *)malloc(strlen(part->dev)+1);
+  if (!ioch->name) {
+	  free(ioch);
+	  return NULL;
+  }
+  strcpy(ioch->name, part->dev);
+  ioch->private_data = part;
+  ioch->block_size = 1024; /* The smallest ext2fs block size */
+  ioch->read_error = 0;
+  ioch->write_error = 0;
+
+  return ioch;
+}
+
+#ifdef __TURBOC__
+#pragma argsused
+#endif
+/*
+ * Open the 'name' partition, initialize all information structures
+ * we need to keep and create libext2fs I/O manager.
+ */
+static errcode_t dos_open(const char *dev, int flags, io_channel *channel)
+{
+  unsigned char  *tmp, sec[512];
+  PARTITION      *part;
+  PTABLE_ENTRY   *pent;
+  PARTITION        **newparts;
+
+  if(!dev)
+  {
+    _dio_error = ERR_BADDEV;
+    return EXT2_ET_BAD_DEVICE_NAME;
+  }
+
+  /*
+   * First check whether the dev name is OK
+   */
+  tmp = (unsigned char*)strrchr(dev, '/');
+  if(!tmp)
+  {
+    _dio_error = ERR_BADDEV;
+    return EXT2_ET_BAD_DEVICE_NAME;
+  }
+  *tmp = 0;
+  if(strcmp(dev, "/dev"))
+  {
+    _dio_error = ERR_BADDEV;
+    return EXT2_ET_BAD_DEVICE_NAME;
+  }
+  *tmp++ = '/';
+
+  /*
+   * Check whether the partition data is already in cache
+   */
+
+  part = (PARTITION*)malloc(sizeof(PARTITION));
+  if (!part)
+	  return ENOMEM;
+  {
+    int   i = 0;
+
+    for(;i < npart; i++)
+      if(!strcmp(partitions[i]->dev, dev))
+      {
+        /* Found it! Make it the active one */
+        active = partitions[i];
+        *channel = alloc_io_channel(active);
+	if (!*channel)
+		return ENOMEM;
+        return 0;
+      }
+  }
+
+  /*
+   * Drive number & optionally partn number
+   */
+  switch(tmp[0])
+  {
+    case 'h':
+    case 's':
+      part->phys = 0x80;
+      part->phys += toupper(tmp[2]) - 'A';
+      /*
+       * Do we have the partition number?
+       */
+      if(tmp[3])
+        part->pno = isdigit((int)tmp[3]) ? tmp[3] - '0' - 1: 0;
+      else
+        part->pno = 0xFF;
+      break;
+
+    case 'f':
+      if(tmp[2])
+        part->phys = isdigit((int)tmp[2]) ? tmp[2] - '0' : 0;
+      else
+        part->phys = 0x00; /* We'll assume /dev/fd0 */
+      break;
+
+    default:
+      _dio_error = ERR_BADDEV;
+      return ENODEV;
+  }
+
+  if(part->phys < 0x80)
+  {
+     /* We don't support floppies for now */
+     _dio_error = ERR_NOTSUPP;
+     return EINVAL;
+  }
+
+  part->dev = strdup(dev);
+
+  /*
+   * Get drive's geometry
+   */
+  _dio_hw_error = biosdisk(DISK_GET_GEOMETRY,
+                           part->phys,
+                           0, /* head */
+                           0, /* cylinder */
+                           1, /* sector */
+                           1, /* just one sector */
+                           sec);
+
+  if(!HW_OK())
+  {
+    _dio_error = ERR_HARDWARE;
+    free(part->dev);
+    free(part);
+    return EFAULT;
+  }
+
+  /*
+   * Calculate the geometry
+   */
+  part->cyls  = (unsigned short)(((sec[0] >> 6) << 8) + sec[1] + 1);
+  part->heads = sec[3] + 1;
+  part->sects = sec[0] & 0x3F;
+
+  /*
+   * Now that we know all we need, let's look for the partition
+   */
+  _dio_hw_error = biosdisk(DISK_READ, part->phys, 0, 0, 1, 1, sec);
+
+  if(!HW_OK())
+  {
+    _dio_error = ERR_HARDWARE;
+    free(part->dev);
+    free(part);
+    return EFAULT;
+  }
+
+  pent = (PTABLE_ENTRY*)&sec[0x1BE];
+  pent = scan_partition_table(pent, part->phys, &part->pno);
+
+  if(!pent)
+  {
+    _dio_error = part->pno == 0xFE ? ERR_EMPTYPART :
+                 part->pno == 0xFD ? ERR_LINUXSWAP : ERR_NOTEXT2FS;
+    free(part->dev);
+    free(part);
+    return ENODEV;
+  }
+
+  /*
+   * Calculate the remaining figures
+   */
+  {
+    unsigned long    fsec, fhead, fcyl;
+
+    fsec = (unsigned long)(pent->start_sec & 0x3F);
+    fhead = (unsigned long)pent->start_head;
+    fcyl = ((pent->start_sec >> 6) << 8) + pent->start_cyl;
+    part->start = fsec + fhead * part->sects + fcyl *
+                  (part->heads * part->sects) - 1;
+    part->len = pent->size;
+  }
+
+  /*
+   * Add the partition to the table
+   */
+  newparts = (PARTITION**)realloc(partitions, sizeof(PARTITION) * npart);
+  if (!newparts) {
+	  free(part);
+	  return ENOMEM;
+  }
+  partitions = newparts;
+  partitions[npart++] = active = part;
+
+  /*
+   * Now alloc all libe2fs structures
+   */
+  *channel = alloc_io_channel(active);
+  if (!*channel)
+	  return ENOMEM;
+
+  return 0;
+}
+
+static errcode_t dos_close(io_channel channel)
+{
+	free(channel->name);
+	free(channel);
+
+	return 0;
+}
+
+static errcode_t dos_set_blksize(io_channel channel, int blksize)
+{
+  channel->block_size = blksize;
+
+  return 0;
+}
+
+static errcode_t dos_read_blk(io_channel channel, unsigned long block,
+                                             int count, void *buf)
+{
+  PARTITION     *part;
+  size_t        size;
+  ext2_loff_t   loc;
+  CHS           chs;
+
+  EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+  part = (PARTITION*)channel->private_data;
+
+  size = (size_t)((count < 0) ? -count : count * channel->block_size);
+  loc = (ext2_loff_t) block * channel->block_size;
+
+  lba2chs(loc, &chs, part);
+  /*
+   * Potential bug here:
+   *   If DJGPP is used then reads of >18 sectors will fail!
+   *   Have to rewrite biosdisk.
+   */
+  _dio_hw_error = biosdisk(DISK_READ,
+                           part->phys,
+                           chs.head,
+                           chs.cyl,
+                           chs.sector,
+                           size < 512 ? 1 : size/512,
+                           buf);
+
+  if(!HW_OK())
+  {
+    _dio_error = ERR_HARDWARE;
+    return EFAULT;
+  }
+
+  return 0;
+}
+
+static errcode_t dos_write_blk(io_channel channel, unsigned long block,
+                               int count, const void *buf)
+{
+  PARTITION     *part;
+  size_t        size;
+  ext2_loff_t   loc;
+  CHS           chs;
+
+  EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+  part = (PARTITION*)channel->private_data;
+
+  if(count == 1)
+    size = (size_t)channel->block_size;
+  else
+  {
+    if (count < 0)
+      size = (size_t)-count;
+    else
+      size = (size_t)(count * channel->block_size);
+  }
+
+  loc = (ext2_loff_t)block * channel->block_size;
+  lba2chs(loc, &chs, part);
+  _dio_hw_error = biosdisk(DISK_WRITE,
+                           part->phys,
+                           chs.head,
+                           chs.cyl,
+                           chs.sector,
+                           size < 512 ? 1 : size/512,
+                           (void*)buf);
+
+  if(!HW_OK())
+  {
+    _dio_error = ERR_HARDWARE;
+    return EFAULT;
+  }
+
+  return 0;
+}
+
+#ifdef __TURBOC__
+#pragma argsused
+#endif
+static errcode_t dos_flush(io_channel channel)
+{
+  /*
+   * No buffers, no flush...
+   */
+  return 0;
+}
diff --git a/lib/ext2fs/dosio.h b/lib/ext2fs/dosio.h
new file mode 100644
index 0000000..d2a8f03
--- /dev/null
+++ b/lib/ext2fs/dosio.h
@@ -0,0 +1,157 @@
+/*
+ * v1.0
+ *
+ * Disk I/O include file for the ext2fs/DOS library.
+ *
+ * Copyright (c) 1997 Mark Habersack
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#ifndef __diskio_h
+#define __diskio_h
+#ifdef __TURBOC__
+#ifndef __LARGE__
+# error "ext2fs/DOS library requires LARGE model!"
+#endif
+#endif
+
+#ifdef __TURBOC__
+#include "msdos.h"
+#endif
+
+/*
+ * A helper structure used in LBA => CHS conversion
+ */
+typedef struct
+{
+  unsigned short       cyl;     /* Cylinder (or track) */
+  unsigned short       head;
+  unsigned short       sector;
+  unsigned short       offset;  /* Offset of byte within the sector */
+} CHS;
+
+/*
+ * All partition data we need is here
+ */
+typedef struct
+{
+  char                 *dev;  /* _Linux_ device name (like "/dev/hda1") */
+  unsigned char        phys;  /* Physical DOS drive number */
+  unsigned long        start; /* LBA address of partition start */
+  unsigned long        len;   /* length of partition in sectors */
+  unsigned char        pno;   /* Partition number (read from *dev) */
+
+  /* This partition's drive geometry */
+  unsigned short       cyls;
+  unsigned short       heads;
+  unsigned short       sects;
+} PARTITION;
+
+/*
+ * PC partition table entry format
+ */
+#ifdef __DJGPP__
+#pragma pack(1)
+#endif
+typedef struct
+{
+  unsigned char        active;
+  unsigned char        start_head;
+  unsigned char        start_sec;
+  unsigned char        start_cyl;
+  unsigned char        type;
+  unsigned char        end_head;
+  unsigned char        end_sec;
+  unsigned char        end_cyl;
+  unsigned long        first_sec_rel;
+  unsigned long        size;
+} PTABLE_ENTRY;
+#ifdef __DJGPP__
+#pragma pack()
+#endif
+
+/*
+ * INT 0x13 operation codes
+ */
+#define DISK_READ          0x02
+#define DISK_WRITE         0x03
+#define DISK_GET_GEOMETRY  0x08
+#define DISK_READY         0x10
+
+/*
+ * Errors to put in _dio_error
+ */
+#define ERR_BADDEV         0x00000001L
+#define ERR_HARDWARE       0x00000002L
+#define ERR_NOTSUPP        0x00000003L
+#define ERR_NOTEXT2FS      0x00000004L
+#define ERR_EMPTYPART      0x00000005L
+#define ERR_LINUXSWAP      0x00000006L
+
+/*
+ * Functions in diskio.c
+ */
+
+/*
+ * Variable contains last module's error
+ */
+extern unsigned long        _dio_error;
+
+/*
+ * This one contains last hardware error (if _dio_error == ERR_HARDWARE)
+ */
+extern unsigned long        _dio_hw_error;
+
+/*
+ * Macros to check for disk hardware errors
+ */
+#define HW_OK()             ((unsigned char)_dio_hw_error == 0x00)
+#define HW_BAD_CMD()        ((unsigned char)_dio_hw_error == 0x01)
+#define HW_NO_ADDR_MARK()   ((unsigned char)_dio_hw_error == 0x02)
+#define HW_WRITE_PROT()     ((unsigned char)_dio_hw_error == 0x03)
+#define HW_NO_SECTOR()      ((unsigned char)_dio_hw_error == 0x04)
+#define HW_RESET_FAIL()     ((unsigned char)_dio_hw_error == 0x05)
+#define HW_DISK_CHANGED()   ((unsigned char)_dio_hw_error == 0x06)
+#define HW_DRIVE_FAIL()     ((unsigned char)_dio_hw_error == 0x07)
+#define HW_DMA_OVERRUN()    ((unsigned char)_dio_hw_error == 0x08)
+#define HW_DMA_BOUNDARY()   ((unsigned char)_dio_hw_error == 0x09)
+#define HW_BAD_SECTOR()     ((unsigned char)_dio_hw_error == 0x0A)
+#define HW_BAD_TRACK()      ((unsigned char)_dio_hw_error == 0x0B)
+#define HW_UNSUPP_TRACK()   ((unsigned char)_dio_hw_error == 0x0C)
+#define HW_BAD_CRC_ECC()    ((unsigned char)_dio_hw_error == 0x10)
+#define HW_CRC_ECC_CORR()   ((unsigned char)_dio_hw_error == 0x11)
+#define HW_CONTR_FAIL()     ((unsigned char)_dio_hw_error == 0x20)
+#define HW_SEEK_FAIL()      ((unsigned char)_dio_hw_error == 0x40)
+#define HW_ATTACH_FAIL()    ((unsigned char)_dio_hw_error == 0x80)
+#define HW_DRIVE_NREADY()   ((unsigned char)_dio_hw_error == 0xAA)
+#define HW_UNDEF_ERROR()    ((unsigned char)_dio_hw_error == 0xBB)
+#define HW_WRITE_FAULT()    ((unsigned char)_dio_hw_error == 0xCC)
+#define HW_STATUS_ERROR()   ((unsigned char)_dio_hw_error == 0xE0)
+#define HW_SENSE_FAIL()     ((unsigned char)_dio_hw_error == 0xFF)
+
+
+/*
+ * Open the specified partition.
+ * String 'dev' must have a format:
+ *
+ *  /dev/{sd|hd|fd}[X]
+ *
+ * where,
+ *
+ *  only one of the option in curly braces can be used and X is an optional
+ *  partition number for the given device. If X is not specified, function
+ *  scans the drive's partition table in search for the first Linux ext2fs
+ *  partition (signature 0x83). Along the way it dives into every extended
+ *  partition encountered.
+ *  Scan ends if either (a) there are no more used partition entries, or
+ *  (b) there is no Xth partition.
+ *
+ * Routine returns 0 on success and !=0 otherwise.
+ */
+int open_partition(char *dev);
+
+#endif /* __diskio_h */
diff --git a/lib/ext2fs/dupfs.c b/lib/ext2fs/dupfs.c
new file mode 100644
index 0000000..02721e1
--- /dev/null
+++ b/lib/ext2fs/dupfs.c
@@ -0,0 +1,122 @@
+/*
+ * dupfs.c --- duplicate a ext2 filesystem handle
+ *
+ * Copyright (C) 1997, 1998, 2001, 2003, 2005 by Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <time.h>
+#include <string.h>
+
+#include "ext2_fs.h"
+#include "ext2fsP.h"
+
+errcode_t ext2fs_dup_handle(ext2_filsys src, ext2_filsys *dest)
+{
+	ext2_filsys	fs;
+	errcode_t	retval;
+
+	EXT2_CHECK_MAGIC(src, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	retval = ext2fs_get_mem(sizeof(struct struct_ext2_filsys), &fs);
+	if (retval)
+		return retval;
+
+	*fs = *src;
+	fs->device_name = 0;
+	fs->super = 0;
+	fs->orig_super = 0;
+	fs->group_desc = 0;
+	fs->inode_map = 0;
+	fs->block_map = 0;
+	fs->badblocks = 0;
+	fs->dblist = 0;
+	fs->mmp_buf = 0;
+	fs->mmp_cmp = 0;
+	fs->mmp_fd = -1;
+
+	io_channel_bumpcount(fs->io);
+	if (fs->icache)
+		fs->icache->refcount++;
+
+	retval = ext2fs_get_mem(strlen(src->device_name)+1, &fs->device_name);
+	if (retval)
+		goto errout;
+	strcpy(fs->device_name, src->device_name);
+
+	retval = ext2fs_get_mem(SUPERBLOCK_SIZE, &fs->super);
+	if (retval)
+		goto errout;
+	memcpy(fs->super, src->super, SUPERBLOCK_SIZE);
+
+	retval = ext2fs_get_mem(SUPERBLOCK_SIZE, &fs->orig_super);
+	if (retval)
+		goto errout;
+	memcpy(fs->orig_super, src->orig_super, SUPERBLOCK_SIZE);
+
+	retval = ext2fs_get_array(fs->desc_blocks, fs->blocksize,
+				&fs->group_desc);
+	if (retval)
+		goto errout;
+	memcpy(fs->group_desc, src->group_desc,
+	       (size_t) fs->desc_blocks * fs->blocksize);
+
+	if (src->inode_map) {
+		retval = ext2fs_copy_bitmap(src->inode_map, &fs->inode_map);
+		if (retval)
+			goto errout;
+	}
+	if (src->block_map) {
+		retval = ext2fs_copy_bitmap(src->block_map, &fs->block_map);
+		if (retval)
+			goto errout;
+	}
+	if (src->badblocks) {
+		retval = ext2fs_badblocks_copy(src->badblocks, &fs->badblocks);
+		if (retval)
+			goto errout;
+	}
+	if (src->dblist) {
+		retval = ext2fs_copy_dblist(src->dblist, &fs->dblist);
+		if (retval)
+			goto errout;
+	}
+	if (src->mmp_buf) {
+		retval = ext2fs_get_mem(src->blocksize, &fs->mmp_buf);
+		if (retval)
+			goto errout;
+		memcpy(fs->mmp_buf, src->mmp_buf, src->blocksize);
+	}
+	if (src->mmp_fd >= 0) {
+		fs->mmp_fd = dup(src->mmp_fd);
+		if (fs->mmp_fd < 0) {
+			retval = EXT2_ET_MMP_OPEN_DIRECT;
+			goto errout;
+		}
+	}
+	if (src->mmp_cmp) {
+		int align = ext2fs_get_dio_alignment(src->mmp_fd);
+
+		retval = ext2fs_get_memalign(src->blocksize, align,
+					     &fs->mmp_cmp);
+		if (retval)
+			goto errout;
+		memcpy(fs->mmp_cmp, src->mmp_cmp, src->blocksize);
+	}
+	*dest = fs;
+	return 0;
+errout:
+	ext2fs_free(fs);
+	return retval;
+
+}
+
diff --git a/lib/ext2fs/e2image.h b/lib/ext2fs/e2image.h
new file mode 100644
index 0000000..53b20cc
--- /dev/null
+++ b/lib/ext2fs/e2image.h
@@ -0,0 +1,37 @@
+/*
+ * e2image.h --- header file describing the ext2 image format
+ *
+ * Copyright (C) 2000 Theodore Ts'o.
+ *
+ * Note: this uses the POSIX IO interfaces, unlike most of the other
+ * functions in this library.  So sue me.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+struct ext2_image_hdr {
+	__u32	magic_number;	/* This must be EXT2_ET_MAGIC_E2IMAGE */
+	char	magic_descriptor[16]; /* "Ext2 Image 1.0", w/ null padding */
+	char	fs_hostname[64];/* Hostname of machine of image */
+	char	fs_netaddr[32];	/* Network address */
+	__u32	fs_netaddr_type;/* 0 = IPV4, 1 = IPV6, etc. */
+	__u32	fs_device;	/* Device number of image */
+	char	fs_device_name[64]; /* Device name */
+	char	fs_uuid[16];	/* UUID of filesystem */
+	__u32	fs_blocksize;	/* Block size of the filesystem */
+	__u32	fs_reserved[8];
+
+	__u32	image_device;	/* Device number of image file */
+	__u32	image_inode;	/* Inode number of image file */
+	__u32	image_time;	/* Time of image creation */
+	__u32	image_reserved[8];
+
+	__u32	offset_super;	/* Byte offset of the sb and descriptors */
+	__u32	offset_inode;	/* Byte offset of the inode table  */
+	__u32	offset_inodemap; /* Byte offset of the inode bitmaps */
+	__u32	offset_blockmap; /* Byte offset of the inode bitmaps */
+	__u32	offset_reserved[8];
+};
diff --git a/lib/ext2fs/expanddir.c b/lib/ext2fs/expanddir.c
new file mode 100644
index 0000000..b5d5abd
--- /dev/null
+++ b/lib/ext2fs/expanddir.c
@@ -0,0 +1,143 @@
+/*
+ * expand.c --- expand an ext2fs directory
+ *
+ * Copyright (C) 1993, 1994, 1995, 1996, 1997, 1998, 1999  Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+#include "ext2fsP.h"
+
+struct expand_dir_struct {
+	int		done;
+	int		newblocks;
+	blk64_t		goal;
+	errcode_t	err;
+	ext2_ino_t	dir;
+};
+
+static int expand_dir_proc(ext2_filsys	fs,
+			   blk64_t	*blocknr,
+			   e2_blkcnt_t	blockcnt,
+			   blk64_t	ref_block EXT2FS_ATTR((unused)),
+			   int		ref_offset EXT2FS_ATTR((unused)),
+			   void		*priv_data)
+{
+	struct expand_dir_struct *es = (struct expand_dir_struct *) priv_data;
+	blk64_t	new_blk;
+	char		*block;
+	errcode_t	retval;
+
+	if (*blocknr) {
+		if (blockcnt >= 0)
+			es->goal = *blocknr;
+		return 0;
+	}
+	if (blockcnt &&
+	    (EXT2FS_B2C(fs, es->goal) == EXT2FS_B2C(fs, es->goal+1)))
+		new_blk = es->goal+1;
+	else {
+		es->goal &= ~EXT2FS_CLUSTER_MASK(fs);
+		retval = ext2fs_new_block2(fs, es->goal, 0, &new_blk);
+		if (retval) {
+			es->err = retval;
+			return BLOCK_ABORT;
+		}
+		es->newblocks++;
+		ext2fs_block_alloc_stats2(fs, new_blk, +1);
+	}
+	if (blockcnt > 0) {
+		retval = ext2fs_new_dir_block(fs, 0, 0, &block);
+		if (retval) {
+			es->err = retval;
+			return BLOCK_ABORT;
+		}
+		es->done = 1;
+		retval = ext2fs_write_dir_block4(fs, new_blk, block, 0,
+						 es->dir);
+		ext2fs_free_mem(&block);
+	} else
+		retval = ext2fs_zero_blocks2(fs, new_blk, 1, NULL, NULL);
+	if (blockcnt >= 0)
+		es->goal = new_blk;
+	if (retval) {
+		es->err = retval;
+		return BLOCK_ABORT;
+	}
+	*blocknr = new_blk;
+
+	if (es->done)
+		return (BLOCK_CHANGED | BLOCK_ABORT);
+	else
+		return BLOCK_CHANGED;
+}
+
+errcode_t ext2fs_expand_dir(ext2_filsys fs, ext2_ino_t dir)
+{
+	errcode_t	retval;
+	struct expand_dir_struct es;
+	struct ext2_inode	inode;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	if (!(fs->flags & EXT2_FLAG_RW))
+		return EXT2_ET_RO_FILSYS;
+
+	if (!fs->block_map)
+		return EXT2_ET_NO_BLOCK_BITMAP;
+
+	retval = ext2fs_check_directory(fs, dir);
+	if (retval)
+		return retval;
+
+	retval = ext2fs_read_inode(fs, dir, &inode);
+	if (retval)
+		return retval;
+
+	es.done = 0;
+	es.err = 0;
+	es.goal = ext2fs_find_inode_goal(fs, dir, &inode, 0);
+	es.newblocks = 0;
+	es.dir = dir;
+
+	retval = ext2fs_block_iterate3(fs, dir, BLOCK_FLAG_APPEND,
+				       0, expand_dir_proc, &es);
+	if (retval == EXT2_ET_INLINE_DATA_CANT_ITERATE)
+		return ext2fs_inline_data_expand(fs, dir);
+
+	if (es.err)
+		return es.err;
+	if (!es.done)
+		return EXT2_ET_EXPAND_DIR_ERR;
+
+	/*
+	 * Update the size and block count fields in the inode.
+	 */
+	retval = ext2fs_read_inode(fs, dir, &inode);
+	if (retval)
+		return retval;
+
+	retval = ext2fs_inode_size_set(fs, &inode,
+				       EXT2_I_SIZE(&inode) + fs->blocksize);
+	if (retval)
+		return retval;
+	ext2fs_iblk_add_blocks(fs, &inode, es.newblocks);
+
+	retval = ext2fs_write_inode(fs, dir, &inode);
+	if (retval)
+		return retval;
+
+	return 0;
+}
diff --git a/lib/ext2fs/ext2_err.et.in b/lib/ext2fs/ext2_err.et.in
new file mode 100644
index 0000000..de14019
--- /dev/null
+++ b/lib/ext2fs/ext2_err.et.in
@@ -0,0 +1,560 @@
+#
+# Copyright (C) 1993, 1994, 1995, 1996 Theodore Ts'o.  
+#
+# %Begin-Header%
+# This file may be redistributed under the terms of the GNU Public
+# License.
+# %End-Header%
+#
+	error_table ext2
+
+ec	EXT2_ET_BASE,
+	"EXT2FS Library version @E2FSPROGS_VERSION@"
+
+ec	EXT2_ET_MAGIC_EXT2FS_FILSYS,
+	"Wrong magic number for ext2_filsys structure"
+
+ec	EXT2_ET_MAGIC_BADBLOCKS_LIST,
+	"Wrong magic number for badblocks_list structure"
+
+ec	EXT2_ET_MAGIC_BADBLOCKS_ITERATE,
+	"Wrong magic number for badblocks_iterate structure"
+
+ec	EXT2_ET_MAGIC_INODE_SCAN,
+	"Wrong magic number for inode_scan structure"
+
+ec	EXT2_ET_MAGIC_IO_CHANNEL,
+	"Wrong magic number for io_channel structure"
+
+ec	EXT2_ET_MAGIC_UNIX_IO_CHANNEL,
+	"Wrong magic number for unix io_channel structure"
+
+ec	EXT2_ET_MAGIC_IO_MANAGER,
+	"Wrong magic number for io_manager structure"
+
+ec	EXT2_ET_MAGIC_BLOCK_BITMAP,
+	"Wrong magic number for block_bitmap structure"
+
+ec	EXT2_ET_MAGIC_INODE_BITMAP,
+	"Wrong magic number for inode_bitmap structure"
+
+ec	EXT2_ET_MAGIC_GENERIC_BITMAP,
+	"Wrong magic number for generic_bitmap structure"
+
+ec	EXT2_ET_MAGIC_TEST_IO_CHANNEL,
+	"Wrong magic number for test io_channel structure"
+
+ec	EXT2_ET_MAGIC_DBLIST,
+	"Wrong magic number for directory block list structure"
+
+ec	EXT2_ET_MAGIC_ICOUNT,
+	"Wrong magic number for icount structure"
+
+ec	EXT2_ET_MAGIC_PQ_IO_CHANNEL,
+	"Wrong magic number for Powerquest io_channel structure"
+
+ec	EXT2_ET_MAGIC_EXT2_FILE,
+	"Wrong magic number for ext2 file structure"
+
+ec	EXT2_ET_MAGIC_E2IMAGE,
+	"Wrong magic number for Ext2 Image Header"
+
+ec	EXT2_ET_MAGIC_INODE_IO_CHANNEL,
+	"Wrong magic number for inode io_channel structure"
+
+ec	EXT2_ET_MAGIC_EXTENT_HANDLE,
+	"Wrong magic number for ext4 extent handle"
+
+ec	EXT2_ET_BAD_MAGIC,
+	"Bad magic number in super-block"
+
+ec	EXT2_ET_REV_TOO_HIGH,
+	"Filesystem revision too high"
+
+ec	EXT2_ET_RO_FILSYS,
+	"Attempt to write to filesystem opened read-only"
+
+ec	EXT2_ET_GDESC_READ,
+	"Can't read group descriptors"
+
+ec	EXT2_ET_GDESC_WRITE,
+	"Can't write group descriptors"
+
+ec	EXT2_ET_GDESC_BAD_BLOCK_MAP,
+	"Corrupt group descriptor: bad block for block bitmap"
+
+ec	EXT2_ET_GDESC_BAD_INODE_MAP,
+	"Corrupt group descriptor: bad block for inode bitmap"
+
+ec	EXT2_ET_GDESC_BAD_INODE_TABLE,
+	"Corrupt group descriptor: bad block for inode table"
+
+ec	EXT2_ET_INODE_BITMAP_WRITE,
+	"Can't write an inode bitmap"
+
+ec	EXT2_ET_INODE_BITMAP_READ,
+	"Can't read an inode bitmap"
+
+ec	EXT2_ET_BLOCK_BITMAP_WRITE,
+	"Can't write a block bitmap"
+
+ec	EXT2_ET_BLOCK_BITMAP_READ,
+	"Can't read a block bitmap"
+
+ec	EXT2_ET_INODE_TABLE_WRITE,
+	"Can't write an inode table"
+
+ec	EXT2_ET_INODE_TABLE_READ,
+	"Can't read an inode table"
+
+ec	EXT2_ET_NEXT_INODE_READ,
+	"Can't read next inode"
+
+ec	EXT2_ET_UNEXPECTED_BLOCK_SIZE,
+	"Filesystem has unexpected block size"
+
+ec	EXT2_ET_DIR_CORRUPTED,
+	"EXT2 directory corrupted"
+
+ec	EXT2_ET_SHORT_READ,
+	"Attempt to read block from filesystem resulted in short read"
+
+ec	EXT2_ET_SHORT_WRITE,
+	"Attempt to write block to filesystem resulted in short write"
+
+ec	EXT2_ET_DIR_NO_SPACE,
+	"No free space in the directory"
+
+ec	EXT2_ET_NO_INODE_BITMAP,
+	"Inode bitmap not loaded"
+
+ec	EXT2_ET_NO_BLOCK_BITMAP,
+	"Block bitmap not loaded"
+
+ec	EXT2_ET_BAD_INODE_NUM,
+	"Illegal inode number"
+
+ec	EXT2_ET_BAD_BLOCK_NUM,
+	"Illegal block number"
+
+ec	EXT2_ET_EXPAND_DIR_ERR,
+	"Internal error in ext2fs_expand_dir"
+
+ec	EXT2_ET_TOOSMALL,
+	"Not enough space to build proposed filesystem"
+
+ec	EXT2_ET_BAD_BLOCK_MARK,
+	"Illegal block number passed to ext2fs_mark_block_bitmap"
+
+ec	EXT2_ET_BAD_BLOCK_UNMARK,
+	"Illegal block number passed to ext2fs_unmark_block_bitmap"
+
+ec	EXT2_ET_BAD_BLOCK_TEST,
+	"Illegal block number passed to ext2fs_test_block_bitmap"
+
+ec	EXT2_ET_BAD_INODE_MARK,
+	"Illegal inode number passed to ext2fs_mark_inode_bitmap"
+
+ec	EXT2_ET_BAD_INODE_UNMARK,
+	"Illegal inode number passed to ext2fs_unmark_inode_bitmap"
+
+ec	EXT2_ET_BAD_INODE_TEST,
+	"Illegal inode number passed to ext2fs_test_inode_bitmap"
+
+ec	EXT2_ET_FUDGE_BLOCK_BITMAP_END,
+	"Attempt to fudge end of block bitmap past the real end"
+
+ec	EXT2_ET_FUDGE_INODE_BITMAP_END,
+	"Attempt to fudge end of inode bitmap past the real end"
+
+ec	EXT2_ET_BAD_IND_BLOCK,
+	"Illegal indirect block found" 
+
+ec	EXT2_ET_BAD_DIND_BLOCK,
+	"Illegal doubly indirect block found" 
+
+ec	EXT2_ET_BAD_TIND_BLOCK,
+	"Illegal triply indirect block found" 
+
+ec	EXT2_ET_NEQ_BLOCK_BITMAP,
+	"Block bitmaps are not the same"
+
+ec	EXT2_ET_NEQ_INODE_BITMAP,
+	"Inode bitmaps are not the same"
+
+ec	EXT2_ET_BAD_DEVICE_NAME,
+	"Illegal or malformed device name"
+
+ec	EXT2_ET_MISSING_INODE_TABLE,
+	"A block group is missing an inode table"
+
+ec	EXT2_ET_CORRUPT_SUPERBLOCK,
+	"The ext2 superblock is corrupt"
+
+ec	EXT2_ET_BAD_GENERIC_MARK,
+	"Illegal generic bit number passed to ext2fs_mark_generic_bitmap"
+
+ec	EXT2_ET_BAD_GENERIC_UNMARK,
+	"Illegal generic bit number passed to ext2fs_unmark_generic_bitmap"
+
+ec	EXT2_ET_BAD_GENERIC_TEST,
+	"Illegal generic bit number passed to ext2fs_test_generic_bitmap"
+
+ec	EXT2_ET_SYMLINK_LOOP,
+	"Too many symbolic links encountered."
+
+ec	EXT2_ET_CALLBACK_NOTHANDLED,
+	"The callback function will not handle this case"
+
+ec	EXT2_ET_BAD_BLOCK_IN_INODE_TABLE,
+	"The inode is from a bad block in the inode table"
+
+ec	EXT2_ET_UNSUPP_FEATURE,
+	"Filesystem has unsupported feature(s)"
+
+ec	EXT2_ET_RO_UNSUPP_FEATURE,
+	"Filesystem has unsupported read-only feature(s)"
+
+ec	EXT2_ET_LLSEEK_FAILED,
+	"IO Channel failed to seek on read or write"
+
+ec	EXT2_ET_NO_MEMORY,
+	"Memory allocation failed"
+
+ec	EXT2_ET_INVALID_ARGUMENT,
+	"Invalid argument passed to ext2 library"
+
+ec	EXT2_ET_BLOCK_ALLOC_FAIL,
+	"Could not allocate block in ext2 filesystem"
+
+ec	EXT2_ET_INODE_ALLOC_FAIL,
+	"Could not allocate inode in ext2 filesystem"
+
+ec	EXT2_ET_NO_DIRECTORY,
+	"Ext2 inode is not a directory"
+
+ec	EXT2_ET_TOO_MANY_REFS,
+	"Too many references in table"
+
+ec	EXT2_ET_FILE_NOT_FOUND,
+	"File not found by ext2_lookup"
+
+ec	EXT2_ET_FILE_RO,
+	"File open read-only"
+
+ec	EXT2_ET_DB_NOT_FOUND,
+	"Ext2 directory block not found"
+
+ec	EXT2_ET_DIR_EXISTS,
+	"Ext2 directory already exists"
+
+ec	EXT2_ET_UNIMPLEMENTED,
+	"Unimplemented ext2 library function"
+
+ec	EXT2_ET_CANCEL_REQUESTED,
+	"User cancel requested"
+
+ec	EXT2_ET_FILE_TOO_BIG,
+	"Ext2 file too big"
+
+ec	EXT2_ET_JOURNAL_NOT_BLOCK,
+	"Supplied journal device not a block device"
+
+ec	EXT2_ET_NO_JOURNAL_SB,
+	"Journal superblock not found"
+
+ec	EXT2_ET_JOURNAL_TOO_SMALL,
+	"Journal must be at least 1024 blocks"
+
+ec	EXT2_ET_JOURNAL_UNSUPP_VERSION,
+	"Unsupported journal version"
+
+ec	EXT2_ET_LOAD_EXT_JOURNAL,
+	"Error loading external journal"
+
+ec	EXT2_ET_NO_JOURNAL,
+	"Journal not found"
+
+ec	EXT2_ET_DIRHASH_UNSUPP,
+	"Directory hash unsupported"
+
+ec	EXT2_ET_BAD_EA_BLOCK_NUM,
+	"Illegal extended attribute block number"
+
+ec	EXT2_ET_TOO_MANY_INODES,
+	"Cannot create filesystem with requested number of inodes"
+
+ec	EXT2_ET_NOT_IMAGE_FILE,
+	"E2image snapshot not in use"
+
+ec	EXT2_ET_RES_GDT_BLOCKS,
+	"Too many reserved group descriptor blocks"
+
+ec	EXT2_ET_RESIZE_INODE_CORRUPT,
+	"Resize inode is corrupt"
+
+ec	EXT2_ET_SET_BMAP_NO_IND,
+	"Tried to set block bmap with missing indirect block"
+
+ec	EXT2_ET_TDB_SUCCESS,
+	"TDB: Success"
+
+ec	EXT2_ET_TDB_ERR_CORRUPT,
+	"TDB: Corrupt database"
+
+ec	EXT2_ET_TDB_ERR_IO,
+	"TDB: IO Error"
+
+ec	EXT2_ET_TDB_ERR_LOCK,
+	"TDB: Locking error"
+
+ec	EXT2_ET_TDB_ERR_OOM,
+	"TDB: Out of memory"
+
+ec	EXT2_ET_TDB_ERR_EXISTS,
+	"TDB: Record exists"
+
+ec	EXT2_ET_TDB_ERR_NOLOCK,
+	"TDB: Lock exists on other keys"
+
+ec	EXT2_ET_TDB_ERR_EINVAL,
+	"TDB: Invalid parameter"
+
+ec	EXT2_ET_TDB_ERR_NOEXIST,
+	"TDB: Record does not exist"
+
+ec	EXT2_ET_TDB_ERR_RDONLY,
+	"TDB: Write not permitted"
+
+ec	EXT2_ET_DBLIST_EMPTY,
+	"Ext2fs directory block list is empty"
+
+ec	EXT2_ET_RO_BLOCK_ITERATE,
+	"Attempt to modify a block mapping via a read-only block iterator"
+
+ec	EXT2_ET_MAGIC_EXTENT_PATH,
+	"Wrong magic number for ext4 extent saved path"
+
+ec	EXT2_ET_MAGIC_GENERIC_BITMAP64,
+	"Wrong magic number for 64-bit generic bitmap"
+
+ec	EXT2_ET_MAGIC_BLOCK_BITMAP64,
+	"Wrong magic number for 64-bit block bitmap"
+
+ec	EXT2_ET_MAGIC_INODE_BITMAP64,
+	"Wrong magic number for 64-bit inode bitmap"
+
+ec	EXT2_ET_MAGIC_RESERVED_13,
+	"Wrong magic number --- RESERVED_13"
+
+ec	EXT2_ET_MAGIC_RESERVED_14,
+	"Wrong magic number --- RESERVED_14"
+
+ec	EXT2_ET_MAGIC_RESERVED_15,
+	"Wrong magic number --- RESERVED_15"
+
+ec	EXT2_ET_MAGIC_RESERVED_16,
+	"Wrong magic number --- RESERVED_16"
+
+ec	EXT2_ET_MAGIC_RESERVED_17,
+	"Wrong magic number --- RESERVED_17"
+
+ec	EXT2_ET_MAGIC_RESERVED_18,
+	"Wrong magic number --- RESERVED_18"
+
+ec	EXT2_ET_MAGIC_RESERVED_19,
+	"Wrong magic number --- RESERVED_19"
+
+ec	EXT2_ET_EXTENT_HEADER_BAD,
+	"Corrupt extent header"
+
+ec	EXT2_ET_EXTENT_INDEX_BAD,
+	"Corrupt extent index"
+
+ec	EXT2_ET_EXTENT_LEAF_BAD,
+	"Corrupt extent"
+
+ec	EXT2_ET_EXTENT_NO_SPACE,
+	"No free space in extent map"
+
+ec	EXT2_ET_INODE_NOT_EXTENT,
+	"Inode does not use extents"
+
+ec	EXT2_ET_EXTENT_NO_NEXT,
+	"No 'next' extent"
+
+ec	EXT2_ET_EXTENT_NO_PREV,
+	"No 'previous' extent"
+
+ec	EXT2_ET_EXTENT_NO_UP,
+	"No 'up' extent"
+
+ec	EXT2_ET_EXTENT_NO_DOWN,
+	"No 'down' extent"
+
+ec	EXT2_ET_NO_CURRENT_NODE,
+	"No current node"
+
+ec	EXT2_ET_OP_NOT_SUPPORTED,
+	"Ext2fs operation not supported"
+
+ec	EXT2_ET_CANT_INSERT_EXTENT,
+	"No room to insert extent in node"
+
+ec	EXT2_ET_CANT_SPLIT_EXTENT,
+	"Splitting would result in empty node"
+
+ec	EXT2_ET_EXTENT_NOT_FOUND,
+	"Extent not found"
+
+ec	EXT2_ET_EXTENT_NOT_SUPPORTED,
+	"Operation not supported for inodes containing extents"
+
+ec	EXT2_ET_EXTENT_INVALID_LENGTH,
+	"Extent length is invalid"
+
+ec	EXT2_ET_IO_CHANNEL_NO_SUPPORT_64,
+	"I/O Channel does not support 64-bit block numbers"
+
+ec	EXT2_ET_NO_MTAB_FILE,
+	"Can't check if filesystem is mounted due to missing mtab file"
+
+ec	EXT2_ET_CANT_USE_LEGACY_BITMAPS,
+	"Filesystem too large to use legacy bitmaps"
+
+ec	EXT2_ET_MMP_MAGIC_INVALID,
+	"MMP: invalid magic number"
+
+ec	EXT2_ET_MMP_FAILED,
+	"MMP: device currently active"
+
+ec	EXT2_ET_MMP_FSCK_ON,
+	"MMP: e2fsck being run"
+
+ec	EXT2_ET_MMP_BAD_BLOCK,
+	"MMP: block number beyond filesystem range"
+
+ec	EXT2_ET_MMP_UNKNOWN_SEQ,
+	"MMP: undergoing an unknown operation"
+
+ec	EXT2_ET_MMP_CHANGE_ABORT,
+	"MMP: filesystem still in use"
+
+ec	EXT2_ET_MMP_OPEN_DIRECT,
+	"MMP: open with O_DIRECT failed"
+
+ec	EXT2_ET_BAD_DESC_SIZE,
+	"Block group descriptor size incorrect"
+
+ec	EXT2_ET_INODE_CSUM_INVALID,
+	"Inode checksum does not match inode"
+
+ec	EXT2_ET_INODE_BITMAP_CSUM_INVALID,
+	"Inode bitmap checksum does not match bitmap"
+
+ec	EXT2_ET_EXTENT_CSUM_INVALID,
+	"Extent block checksum does not match extent block"
+
+ec	EXT2_ET_DIR_NO_SPACE_FOR_CSUM,
+	"Directory block does not have space for checksum"
+
+ec	EXT2_ET_DIR_CSUM_INVALID,
+	"Directory block checksum does not match directory block"
+
+ec	EXT2_ET_EXT_ATTR_CSUM_INVALID,
+	"Extended attribute block checksum does not match block"
+
+ec	EXT2_ET_SB_CSUM_INVALID,
+	"Superblock checksum does not match superblock"
+
+ec	EXT2_ET_UNKNOWN_CSUM,
+	"Unknown checksum algorithm"
+
+ec	EXT2_ET_MMP_CSUM_INVALID,
+	"MMP block checksum does not match"
+
+ec	EXT2_ET_FILE_EXISTS,
+	"Ext2 file already exists"
+
+ec	EXT2_ET_BLOCK_BITMAP_CSUM_INVALID,
+	"Block bitmap checksum does not match bitmap"
+
+ec	EXT2_ET_INLINE_DATA_CANT_ITERATE,
+	"Cannot iterate data blocks of an inode containing inline data"
+
+ec	EXT2_ET_EA_BAD_NAME_LEN,
+	"Extended attribute has an invalid name length"
+
+ec	EXT2_ET_EA_BAD_VALUE_SIZE,
+	"Extended attribute has an invalid value length"
+
+ec	EXT2_ET_BAD_EA_HASH,
+	"Extended attribute has an incorrect hash"
+
+ec	EXT2_ET_BAD_EA_HEADER,
+	"Extended attribute block has a bad header"
+
+ec	EXT2_ET_EA_KEY_NOT_FOUND,
+	"Extended attribute key not found"
+
+ec	EXT2_ET_EA_NO_SPACE,
+	"Insufficient space to store extended attribute data"
+
+ec	EXT2_ET_MISSING_EA_FEATURE,
+	"Filesystem is missing ext_attr or inline_data feature"
+
+ec	EXT2_ET_NO_INLINE_DATA,
+	"Inode doesn't have inline data"
+
+ec	EXT2_ET_INLINE_DATA_NO_BLOCK,
+	"No block for an inode with inline data"
+
+ec	EXT2_ET_INLINE_DATA_NO_SPACE,
+	"No free space in inline data"
+
+ec	EXT2_ET_MAGIC_EA_HANDLE,
+	"Wrong magic number for extended attribute structure"
+
+ec	EXT2_ET_INODE_IS_GARBAGE,
+	"Inode seems to contain garbage"
+
+ec	EXT2_ET_EA_BAD_VALUE_OFFSET,
+	"Extended attribute has an invalid value offset"
+
+ec	EXT2_ET_JOURNAL_FLAGS_WRONG,
+	"Journal flags inconsistent"
+
+ec	EXT2_ET_UNDO_FILE_CORRUPT,
+	"Undo file corrupt"
+
+ec	EXT2_ET_UNDO_FILE_WRONG,
+	"Wrong undo file for this filesystem"
+
+ec	EXT2_ET_FILESYSTEM_CORRUPTED,
+	"File system is corrupted"
+
+ec	EXT2_ET_BAD_CRC,
+	"Bad CRC detected in file system"
+
+ec	EXT2_ET_CORRUPT_JOURNAL_SB,
+	"The journal superblock is corrupt"
+
+ec	EXT2_ET_INODE_CORRUPTED,
+	"Inode is corrupted"
+
+ec	EXT2_ET_EA_INODE_CORRUPTED,
+	"Inode containing extended attribute value is corrupted"
+
+ec	EXT2_ET_NO_GDESC,
+	"Group descriptors not loaded"
+
+ec	EXT2_FILSYS_CORRUPTED,
+	"The internal ext2_filsys data structure appears to be corrupted"
+
+ec	EXT2_ET_EXTENT_CYCLE,
+	"Found cyclic loop in extent tree"
+
+ec	EXT2_ET_EXTERNAL_JOURNAL_NOSUPP,
+	"Operation not supported on an external journal"
+
+	end
diff --git a/lib/ext2fs/ext2_ext_attr.h b/lib/ext2fs/ext2_ext_attr.h
new file mode 100644
index 0000000..c6068c4
--- /dev/null
+++ b/lib/ext2fs/ext2_ext_attr.h
@@ -0,0 +1,84 @@
+/*
+  File: linux/ext2_ext_attr.h
+
+  On-disk format of extended attributes for the ext2 filesystem.
+
+  (C) 2000 Andreas Gruenbacher, <a.gruenbacher@computer.org>
+*/
+
+#ifndef _EXT2_EXT_ATTR_H
+#define _EXT2_EXT_ATTR_H
+/* Magic value in attribute blocks */
+#define EXT2_EXT_ATTR_MAGIC_v1		0xEA010000
+#define EXT2_EXT_ATTR_MAGIC		0xEA020000
+
+/* Maximum number of references to one attribute block */
+#define EXT2_EXT_ATTR_REFCOUNT_MAX	1024
+
+struct ext2_ext_attr_header {
+	__u32	h_magic;	/* magic number for identification */
+	__u32	h_refcount;	/* reference count */
+	__u32	h_blocks;	/* number of disk blocks used */
+	__u32	h_hash;		/* hash value of all attributes */
+	__u32	h_checksum;	/* crc32c(uuid+id+xattrs) */
+				/* id = inum if refcount = 1, else blknum */
+	__u32	h_reserved[3];	/* zero right now */
+};
+
+struct ext2_ext_attr_entry {
+	__u8	e_name_len;	/* length of name */
+	__u8	e_name_index;	/* attribute name index */
+	__u16	e_value_offs;	/* offset in disk block of value */
+	__u32	e_value_inum;	/* inode in which the value is stored */
+	__u32	e_value_size;	/* size of attribute value */
+	__u32	e_hash;		/* hash value of name and value */
+#if 0
+	char	e_name[0];	/* attribute name */
+#endif
+};
+
+#define EXT2_EXT_ATTR_PAD_BITS		2
+#define EXT2_EXT_ATTR_PAD		((unsigned) 1<<EXT2_EXT_ATTR_PAD_BITS)
+#define EXT2_EXT_ATTR_ROUND		(EXT2_EXT_ATTR_PAD-1)
+#define EXT2_EXT_ATTR_LEN(name_len) \
+	(((name_len) + EXT2_EXT_ATTR_ROUND + \
+	sizeof(struct ext2_ext_attr_entry)) & ~EXT2_EXT_ATTR_ROUND)
+#define EXT2_EXT_ATTR_NEXT(entry) \
+	( (struct ext2_ext_attr_entry *)( \
+	  (char *)(entry) + EXT2_EXT_ATTR_LEN((entry)->e_name_len)) )
+#define EXT2_EXT_ATTR_SIZE(size) \
+	(((size) + EXT2_EXT_ATTR_ROUND) & ~EXT2_EXT_ATTR_ROUND)
+#define EXT2_EXT_IS_LAST_ENTRY(entry) (*((__u32 *)(entry)) == 0UL)
+#define EXT2_EXT_ATTR_NAME(entry) \
+	(((char *) (entry)) + sizeof(struct ext2_ext_attr_entry))
+#define EXT2_XATTR_LEN(name_len) \
+	(((name_len) + EXT2_EXT_ATTR_ROUND + \
+	sizeof(struct ext2_xattr_entry)) & ~EXT2_EXT_ATTR_ROUND)
+#define EXT2_XATTR_SIZE(size) \
+	(((size) + EXT2_EXT_ATTR_ROUND) & ~EXT2_EXT_ATTR_ROUND)
+
+/*
+ * XATTR_SIZE_MAX is currently 64k, but for the purposes of checking
+ * for file system consistency errors, we use a somewhat bigger value.
+ * This allows XATTR_SIZE_MAX to grow in the future, but by using this
+ * instead of INT_MAX for certain consistency checks, we don't need to
+ * worry about arithmetic overflows.  (Actually XATTR_SIZE_MAX is
+ * defined in include/uapi/linux/limits.h, so changing it is going
+ * not going to be trivial....)
+ */
+#define EXT2_XATTR_SIZE_MAX (1 << 24)
+
+#ifdef __KERNEL__
+# ifdef CONFIG_EXT2_FS_EXT_ATTR
+extern int ext2_get_ext_attr(struct inode *, const char *, char *, size_t, int);
+extern int ext2_set_ext_attr(struct inode *, const char *, char *, size_t, int);
+extern void ext2_ext_attr_free_inode(struct inode *inode);
+extern void ext2_ext_attr_put_super(struct super_block *sb);
+extern int ext2_ext_attr_init(void);
+extern void ext2_ext_attr_done(void);
+# else
+#  define ext2_get_ext_attr NULL
+#  define ext2_set_ext_attr NULL
+# endif
+#endif  /* __KERNEL__ */
+#endif  /* _EXT2_EXT_ATTR_H */
diff --git a/lib/ext2fs/ext2_fs.h b/lib/ext2fs/ext2_fs.h
new file mode 100644
index 0000000..0fc9c09
--- /dev/null
+++ b/lib/ext2fs/ext2_fs.h
@@ -0,0 +1,1201 @@
+/*
+ *  linux/include/linux/ext2_fs.h
+ *
+ * Copyright (C) 1992, 1993, 1994, 1995
+ * Remy Card (card@masi.ibp.fr)
+ * Laboratoire MASI - Institut Blaise Pascal
+ * Universite Pierre et Marie Curie (Paris VI)
+ *
+ *  from
+ *
+ *  linux/include/linux/minix_fs.h
+ *
+ *  Copyright (C) 1991, 1992  Linus Torvalds
+ */
+
+#ifndef _LINUX_EXT2_FS_H
+#define _LINUX_EXT2_FS_H
+
+#include <ext2fs/ext2_types.h>		/* Changed from linux/types.h */
+
+#ifndef __GNUC_PREREQ
+#if defined(__GNUC__) && defined(__GNUC_MINOR__)
+#define __GNUC_PREREQ(maj, min) \
+	((__GNUC__ << 16) + __GNUC_MINOR__ >= ((maj) << 16) + (min))
+#else
+#define __GNUC_PREREQ(maj, min) 0
+#endif
+#endif
+
+#ifndef __nonstring
+#ifdef __has_attribute
+#if __has_attribute(__nonstring__)
+#define __nonstring                    __attribute__((__nonstring__))
+#else
+#define __nonstring
+#endif /* __has_attribute(__nonstring__) */
+#else
+# define __nonstring
+#endif /* __has_attribute */
+#endif /* __nonstring */
+
+/*
+ * The second extended filesystem constants/structures
+ */
+
+/*
+ * Define EXT2FS_DEBUG to produce debug messages
+ */
+#undef EXT2FS_DEBUG
+
+/*
+ * Define EXT2_PREALLOCATE to preallocate data blocks for expanding files
+ */
+#define EXT2_PREALLOCATE
+#define EXT2_DEFAULT_PREALLOC_BLOCKS	8
+
+/*
+ * The second extended file system version
+ */
+#define EXT2FS_DATE		"95/08/09"
+#define EXT2FS_VERSION		"0.5b"
+
+/*
+ * Special inode numbers
+ */
+#define EXT2_BAD_INO		 1	/* Bad blocks inode */
+#define EXT2_ROOT_INO		 2	/* Root inode */
+#define EXT4_USR_QUOTA_INO	 3	/* User quota inode */
+#define EXT4_GRP_QUOTA_INO	 4	/* Group quota inode */
+#define EXT2_BOOT_LOADER_INO	 5	/* Boot loader inode */
+#define EXT2_UNDEL_DIR_INO	 6	/* Undelete directory inode */
+#define EXT2_RESIZE_INO		 7	/* Reserved group descriptors inode */
+#define EXT2_JOURNAL_INO	 8	/* Journal inode */
+#define EXT2_EXCLUDE_INO	 9	/* The "exclude" inode, for snapshots */
+#define EXT4_REPLICA_INO	10	/* Used by non-upstream feature */
+
+/* First non-reserved inode for old ext2 filesystems */
+#define EXT2_GOOD_OLD_FIRST_INO	11
+
+/*
+ * The second extended file system magic number
+ */
+#define EXT2_SUPER_MAGIC	0xEF53
+
+#ifdef __KERNEL__
+#define EXT2_SB(sb)	(&((sb)->u.ext2_sb))
+#else
+/* Assume that user mode programs are passing in an ext2fs superblock, not
+ * a kernel struct super_block.  This will allow us to call the feature-test
+ * macros from user land. */
+#define EXT2_SB(sb)	(sb)
+#endif
+
+/*
+ * Maximal count of links to a file
+ */
+#define EXT2_LINK_MAX		65000
+
+/*
+ * Macro-instructions used to manage several block sizes
+ */
+#define EXT2_MIN_BLOCK_LOG_SIZE		10	/* 1024 */
+#define EXT2_MAX_BLOCK_LOG_SIZE		16	/* 65536 */
+#define EXT2_MIN_BLOCK_SIZE	(1 << EXT2_MIN_BLOCK_LOG_SIZE)
+#define EXT2_MAX_BLOCK_SIZE	(1 << EXT2_MAX_BLOCK_LOG_SIZE)
+#ifdef __KERNEL__
+#define EXT2_BLOCK_SIZE(s)	((s)->s_blocksize)
+#define EXT2_BLOCK_SIZE_BITS(s)	((s)->s_blocksize_bits)
+#define EXT2_ADDR_PER_BLOCK_BITS(s)	(EXT2_SB(s)->addr_per_block_bits)
+#define EXT2_INODE_SIZE(s)	(EXT2_SB(s)->s_inode_size)
+#define EXT2_FIRST_INO(s)	(EXT2_SB(s)->s_first_ino)
+#else
+#define EXT2_BLOCK_SIZE(s)	(EXT2_MIN_BLOCK_SIZE << (s)->s_log_block_size)
+#define EXT2_BLOCK_SIZE_BITS(s)	((s)->s_log_block_size + 10)
+#define EXT2_INODE_SIZE(s)	(((s)->s_rev_level == EXT2_GOOD_OLD_REV) ? \
+				 EXT2_GOOD_OLD_INODE_SIZE : (s)->s_inode_size)
+#define EXT2_FIRST_INO(s)	(((s)->s_rev_level == EXT2_GOOD_OLD_REV) ? \
+				 EXT2_GOOD_OLD_FIRST_INO : (s)->s_first_ino)
+#endif
+#define EXT2_ADDR_PER_BLOCK(s)	(EXT2_BLOCK_SIZE(s) / sizeof(__u32))
+
+/*
+ * Macro-instructions used to manage allocation clusters
+ */
+#define EXT2_MIN_CLUSTER_LOG_SIZE	EXT2_MIN_BLOCK_LOG_SIZE
+#define EXT2_MAX_CLUSTER_LOG_SIZE	29	/* 512MB  */
+#define EXT2_MIN_CLUSTER_SIZE		EXT2_MIN_BLOCK_SIZE
+#define EXT2_MAX_CLUSTER_SIZE		(1 << EXT2_MAX_CLUSTER_LOG_SIZE)
+#define EXT2_CLUSTER_SIZE(s)		(EXT2_MIN_BLOCK_SIZE << \
+						(s)->s_log_cluster_size)
+#define EXT2_CLUSTER_SIZE_BITS(s)	((s)->s_log_cluster_size + 10)
+
+/*
+ * Macro-instructions used to manage fragments
+ *
+ * Note: for backwards compatibility only, for the dump program.
+ * Ext2/3/4 will never support fragments....
+ */
+#define EXT2_MIN_FRAG_SIZE              EXT2_MIN_BLOCK_SIZE
+#define EXT2_MAX_FRAG_SIZE              EXT2_MAX_BLOCK_SIZE
+#define EXT2_MIN_FRAG_LOG_SIZE          EXT2_MIN_BLOCK_LOG_SIZE
+#define EXT2_FRAG_SIZE(s)		EXT2_BLOCK_SIZE(s)
+#define EXT2_FRAGS_PER_BLOCK(s)		1
+
+/*
+ * ACL structures
+ */
+struct ext2_acl_header	/* Header of Access Control Lists */
+{
+	__u32	aclh_size;
+	__u32	aclh_file_count;
+	__u32	aclh_acle_count;
+	__u32	aclh_first_acle;
+};
+
+struct ext2_acl_entry	/* Access Control List Entry */
+{
+	__u32	acle_size;
+	__u16	acle_perms;	/* Access permissions */
+	__u16	acle_type;	/* Type of entry */
+	__u16	acle_tag;	/* User or group identity */
+	__u16	acle_pad1;
+	__u32	acle_next;	/* Pointer on next entry for the */
+					/* same inode or on next free entry */
+};
+
+/*
+ * Structure of a blocks group descriptor
+ */
+struct ext2_group_desc
+{
+	__u32	bg_block_bitmap;	/* Blocks bitmap block */
+	__u32	bg_inode_bitmap;	/* Inodes bitmap block */
+	__u32	bg_inode_table;		/* Inodes table block */
+	__u16	bg_free_blocks_count;	/* Free blocks count */
+	__u16	bg_free_inodes_count;	/* Free inodes count */
+	__u16	bg_used_dirs_count;	/* Directories count */
+	__u16	bg_flags;
+	__u32	bg_exclude_bitmap_lo;	/* Exclude bitmap for snapshots */
+	__u16	bg_block_bitmap_csum_lo;/* crc32c(s_uuid+grp_num+bitmap) LSB */
+	__u16	bg_inode_bitmap_csum_lo;/* crc32c(s_uuid+grp_num+bitmap) LSB */
+	__u16	bg_itable_unused;	/* Unused inodes count */
+	__u16	bg_checksum;		/* crc16(s_uuid+group_num+group_desc)*/
+};
+
+/*
+ * Structure of a blocks group descriptor
+ */
+struct ext4_group_desc
+{
+	__u32	bg_block_bitmap;	/* Blocks bitmap block */
+	__u32	bg_inode_bitmap;	/* Inodes bitmap block */
+	__u32	bg_inode_table;		/* Inodes table block */
+	__u16	bg_free_blocks_count;	/* Free blocks count */
+	__u16	bg_free_inodes_count;	/* Free inodes count */
+	__u16	bg_used_dirs_count;	/* Directories count */
+	__u16	bg_flags;		/* EXT4_BG_flags (INODE_UNINIT, etc) */
+	__u32	bg_exclude_bitmap_lo;	/* Exclude bitmap for snapshots */
+	__u16	bg_block_bitmap_csum_lo;/* crc32c(s_uuid+grp_num+bitmap) LSB */
+	__u16	bg_inode_bitmap_csum_lo;/* crc32c(s_uuid+grp_num+bitmap) LSB */
+	__u16	bg_itable_unused;	/* Unused inodes count */
+	__u16	bg_checksum;		/* crc16(sb_uuid+group+desc) */
+	__u32	bg_block_bitmap_hi;	/* Blocks bitmap block MSB */
+	__u32	bg_inode_bitmap_hi;	/* Inodes bitmap block MSB */
+	__u32	bg_inode_table_hi;	/* Inodes table block MSB */
+	__u16	bg_free_blocks_count_hi;/* Free blocks count MSB */
+	__u16	bg_free_inodes_count_hi;/* Free inodes count MSB */
+	__u16	bg_used_dirs_count_hi;	/* Directories count MSB */
+	__u16	bg_itable_unused_hi;	/* Unused inodes count MSB */
+	__u32	bg_exclude_bitmap_hi;	/* Exclude bitmap block MSB */
+	__u16	bg_block_bitmap_csum_hi;/* crc32c(s_uuid+grp_num+bitmap) MSB */
+	__u16	bg_inode_bitmap_csum_hi;/* crc32c(s_uuid+grp_num+bitmap) MSB */
+	__u32	bg_reserved;
+};
+
+#define EXT4_BG_INODE_BITMAP_CSUM_HI_END	\
+	(offsetof(struct ext4_group_desc, bg_inode_bitmap_csum_hi) + \
+	 sizeof(__u16))
+#define EXT4_BG_BLOCK_BITMAP_CSUM_HI_LOCATION	\
+	(offsetof(struct ext4_group_desc, bg_block_bitmap_csum_hi) + \
+	 sizeof(__u16))
+
+#define EXT2_BG_INODE_UNINIT	0x0001 /* Inode table/bitmap not initialized */
+#define EXT2_BG_BLOCK_UNINIT	0x0002 /* Block bitmap not initialized */
+#define EXT2_BG_INODE_ZEROED	0x0004 /* On-disk itable initialized to zero */
+
+/*
+ * Data structures used by the directory indexing feature
+ *
+ * Note: all of the multibyte integer fields are little endian.
+ */
+
+/*
+ * Note: dx_root_info is laid out so that if it should somehow get
+ * overlaid by a dirent the two low bits of the hash version will be
+ * zero.  Therefore, the hash version mod 4 should never be 0.
+ * Sincerely, the paranoia department.
+ */
+struct ext2_dx_root_info {
+	__u32 reserved_zero;
+	__u8 hash_version; /* 0 now, 1 at release */
+	__u8 info_length; /* 8 */
+	__u8 indirect_levels;
+	__u8 unused_flags;
+};
+
+#define EXT2_HASH_LEGACY		0
+#define EXT2_HASH_HALF_MD4		1
+#define EXT2_HASH_TEA			2
+#define EXT2_HASH_LEGACY_UNSIGNED	3 /* reserved for userspace lib */
+#define EXT2_HASH_HALF_MD4_UNSIGNED	4 /* reserved for userspace lib */
+#define EXT2_HASH_TEA_UNSIGNED		5 /* reserved for userspace lib */
+#define EXT2_HASH_SIPHASH		6
+
+#define EXT2_HASH_FLAG_INCOMPAT	0x1
+
+#define EXT4_DX_BLOCK_MASK 0x0fffffff
+
+struct ext2_dx_entry {
+	__le32 hash;
+	__le32 block;
+};
+
+struct ext2_dx_countlimit {
+	__le16 limit;
+	__le16 count;
+};
+
+/*
+ * This goes at the end of each htree block.
+ */
+struct ext2_dx_tail {
+	__le32 dt_reserved;
+	__le32 dt_checksum;	/* crc32c(uuid+inum+dxblock) */
+};
+
+/*
+ * Macro-instructions used to manage group descriptors
+ */
+#define EXT2_MIN_DESC_SIZE             32
+#define EXT2_MIN_DESC_SIZE_64BIT       64
+#define EXT2_MAX_DESC_SIZE             EXT2_MIN_BLOCK_SIZE
+#define EXT2_DESC_SIZE(s)                                                \
+	(ext2fs_has_feature_64bit(s) ? (s)->s_desc_size : EXT2_MIN_DESC_SIZE)
+
+#define EXT2_BLOCKS_PER_GROUP(s)	(EXT2_SB(s)->s_blocks_per_group)
+#define EXT2_INODES_PER_GROUP(s)	(EXT2_SB(s)->s_inodes_per_group)
+#define EXT2_CLUSTERS_PER_GROUP(s)	(EXT2_SB(s)->s_clusters_per_group)
+#define EXT2_INODES_PER_BLOCK(s)	(EXT2_BLOCK_SIZE(s)/EXT2_INODE_SIZE(s))
+/* limits imposed by 16-bit value gd_free_{blocks,inode}_count */
+#define EXT2_MAX_BLOCKS_PER_GROUP(s)	((((unsigned) 1 << 16) - 8) *	\
+					 (EXT2_CLUSTER_SIZE(s) / \
+					  EXT2_BLOCK_SIZE(s)))
+#define EXT2_MAX_CLUSTERS_PER_GROUP(s)	(((unsigned) 1 << 16) - 8)
+#define EXT2_MAX_INODES_PER_GROUP(s)	(((unsigned) 1 << 16) - \
+					 EXT2_INODES_PER_BLOCK(s))
+#ifdef __KERNEL__
+#define EXT2_DESC_PER_BLOCK(s)		(EXT2_SB(s)->s_desc_per_block)
+#define EXT2_DESC_PER_BLOCK_BITS(s)	(EXT2_SB(s)->s_desc_per_block_bits)
+#else
+#define EXT2_DESC_PER_BLOCK(s)		(EXT2_BLOCK_SIZE(s) / EXT2_DESC_SIZE(s))
+#endif
+
+#define EXT2_GROUPS_TO_BLOCKS(s, g)   ((blk64_t) EXT2_BLOCKS_PER_GROUP(s) * \
+				       (g))
+#define EXT2_GROUPS_TO_CLUSTERS(s, g) ((blk64_t) EXT2_CLUSTERS_PER_GROUP(s) * \
+				       (g))
+
+/*
+ * Constants relative to the data blocks
+ */
+#define EXT2_NDIR_BLOCKS		12
+#define EXT2_IND_BLOCK			EXT2_NDIR_BLOCKS
+#define EXT2_DIND_BLOCK			(EXT2_IND_BLOCK + 1)
+#define EXT2_TIND_BLOCK			(EXT2_DIND_BLOCK + 1)
+#define EXT2_N_BLOCKS			(EXT2_TIND_BLOCK + 1)
+
+/*
+ * Inode flags
+ */
+#define EXT2_SECRM_FL			0x00000001 /* Secure deletion */
+#define EXT2_UNRM_FL			0x00000002 /* Undelete */
+#define EXT2_COMPR_FL			0x00000004 /* Compress file */
+#define EXT2_SYNC_FL			0x00000008 /* Synchronous updates */
+#define EXT2_IMMUTABLE_FL		0x00000010 /* Immutable file */
+#define EXT2_APPEND_FL			0x00000020 /* writes to file may only append */
+#define EXT2_NODUMP_FL			0x00000040 /* do not dump file */
+#define EXT2_NOATIME_FL			0x00000080 /* do not update atime */
+/* Reserved for compression usage... */
+#define EXT2_DIRTY_FL			0x00000100
+#define EXT2_COMPRBLK_FL		0x00000200 /* One or more compressed clusters */
+#define EXT2_NOCOMPR_FL			0x00000400 /* Access raw compressed data */
+	/* nb: was previously EXT2_ECOMPR_FL */
+#define EXT4_ENCRYPT_FL			0x00000800 /* encrypted inode */
+/* End compression flags --- maybe not all used */
+#define EXT2_BTREE_FL			0x00001000 /* btree format dir */
+#define EXT2_INDEX_FL			0x00001000 /* hash-indexed directory */
+#define EXT2_IMAGIC_FL			0x00002000
+#define EXT3_JOURNAL_DATA_FL		0x00004000 /* file data should be journaled */
+#define EXT2_NOTAIL_FL			0x00008000 /* file tail should not be merged */
+#define EXT2_DIRSYNC_FL 		0x00010000 /* Synchronous directory modifications */
+#define EXT2_TOPDIR_FL			0x00020000 /* Top of directory hierarchies*/
+#define EXT4_HUGE_FILE_FL               0x00040000 /* Set to each huge file */
+#define EXT4_EXTENTS_FL 		0x00080000 /* Inode uses extents */
+#define EXT4_VERITY_FL			0x00100000 /* Verity protected inode */
+#define EXT4_EA_INODE_FL	        0x00200000 /* Inode used for large EA */
+/* EXT4_EOFBLOCKS_FL 0x00400000 was here */
+#define FS_NOCOW_FL			0x00800000 /* Do not cow file */
+#define EXT4_SNAPFILE_FL		0x01000000  /* Inode is a snapshot */
+#define FS_DAX_FL			0x02000000 /* Inode is DAX */
+#define EXT4_SNAPFILE_DELETED_FL	0x04000000  /* Snapshot is being deleted */
+#define EXT4_SNAPFILE_SHRUNK_FL		0x08000000  /* Snapshot shrink has completed */
+#define EXT4_INLINE_DATA_FL		0x10000000 /* Inode has inline data */
+#define EXT4_PROJINHERIT_FL		0x20000000 /* Create with parents projid */
+#define EXT4_CASEFOLD_FL		0x40000000 /* Casefolded file */
+#define EXT2_RESERVED_FL		0x80000000 /* reserved for ext2 lib */
+
+#define EXT2_FL_USER_VISIBLE		0x604BDFFF /* User visible flags */
+#define EXT2_FL_USER_MODIFIABLE		0x604B80FF /* User modifiable flags */
+
+/*
+ * ioctl commands
+ */
+
+/* Used for online resize */
+struct ext2_new_group_input {
+	__u32 group;		/* Group number for this data */
+	__u32 block_bitmap;	/* Absolute block number of block bitmap */
+	__u32 inode_bitmap;	/* Absolute block number of inode bitmap */
+	__u32 inode_table;	/* Absolute block number of inode table start */
+	__u32 blocks_count;	/* Total number of blocks in this group */
+	__u16 reserved_blocks;	/* Number of reserved blocks in this group */
+	__u16 unused;		/* Number of reserved GDT blocks in group */
+};
+
+struct ext4_new_group_input {
+	__u32 group;		/* Group number for this data */
+	__u64 block_bitmap;	/* Absolute block number of block bitmap */
+	__u64 inode_bitmap;	/* Absolute block number of inode bitmap */
+	__u64 inode_table;	/* Absolute block number of inode table start */
+	__u32 blocks_count;	/* Total number of blocks in this group */
+	__u16 reserved_blocks;	/* Number of reserved blocks in this group */
+	__u16 unused;
+};
+
+#ifdef __GNU__			/* Needed for the Hurd */
+#define _IOT_ext2_new_group_input _IOT (_IOTS(__u32), 5, _IOTS(__u16), 2, 0, 0)
+#endif
+
+#define EXT2_IOC_GETFLAGS		_IOR('f', 1, long)
+#define EXT2_IOC_SETFLAGS		_IOW('f', 2, long)
+#define EXT2_IOC_GETVERSION		_IOR('v', 1, long)
+#define EXT2_IOC_SETVERSION		_IOW('v', 2, long)
+#define EXT2_IOC_GETVERSION_NEW		_IOR('f', 3, long)
+#define EXT2_IOC_SETVERSION_NEW		_IOW('f', 4, long)
+#define EXT2_IOC_GROUP_EXTEND		_IOW('f', 7, unsigned long)
+#define EXT2_IOC_GROUP_ADD		_IOW('f', 8,struct ext2_new_group_input)
+#define EXT4_IOC_GROUP_ADD		_IOW('f', 8,struct ext4_new_group_input)
+#define EXT4_IOC_RESIZE_FS		_IOW('f', 16, __u64)
+
+/*
+ * Structure of an inode on the disk
+ */
+struct ext2_inode {
+/*00*/	__u16	i_mode;		/* File mode */
+	__u16	i_uid;		/* Low 16 bits of Owner Uid */
+	__u32	i_size;		/* Size in bytes */
+	__u32	i_atime;	/* Access time */
+	__u32	i_ctime;	/* Inode change time */
+/*10*/	__u32	i_mtime;	/* Modification time */
+	__u32	i_dtime;	/* Deletion Time */
+	__u16	i_gid;		/* Low 16 bits of Group Id */
+	__u16	i_links_count;	/* Links count */
+	__u32	i_blocks;	/* Blocks count */
+/*20*/	__u32	i_flags;	/* File flags */
+	union {
+		struct {
+			__u32	l_i_version; /* was l_i_reserved1 */
+		} linux1;
+		struct {
+			__u32  h_i_translator;
+		} hurd1;
+	} osd1;				/* OS dependent 1 */
+/*28*/	__u32	i_block[EXT2_N_BLOCKS];/* Pointers to blocks */
+/*64*/	__u32	i_generation;	/* File version (for NFS) */
+	__u32	i_file_acl;	/* File ACL */
+	__u32	i_size_high;
+/*70*/	__u32	i_faddr;	/* Fragment address */
+	union {
+		struct {
+			__u16	l_i_blocks_hi;
+			__u16	l_i_file_acl_high;
+			__u16	l_i_uid_high;	/* these 2 fields    */
+			__u16	l_i_gid_high;	/* were reserved2[0] */
+			__u16	l_i_checksum_lo; /* crc32c(uuid+inum+inode) */
+			__u16	l_i_reserved;
+		} linux2;
+		struct {
+			__u8	h_i_frag;	/* Fragment number */
+			__u8	h_i_fsize;	/* Fragment size */
+			__u16	h_i_mode_high;
+			__u16	h_i_uid_high;
+			__u16	h_i_gid_high;
+			__u32	h_i_author;
+		} hurd2;
+	} osd2;				/* OS dependent 2 */
+};
+
+/*
+ * Permanent part of an large inode on the disk
+ */
+struct ext2_inode_large {
+/*00*/	__u16	i_mode;		/* File mode */
+	__u16	i_uid;		/* Low 16 bits of Owner Uid */
+	__u32	i_size;		/* Size in bytes */
+	__u32	i_atime;	/* Access time */
+	__u32	i_ctime;	/* Inode Change time */
+/*10*/	__u32	i_mtime;	/* Modification time */
+	__u32	i_dtime;	/* Deletion Time */
+	__u16	i_gid;		/* Low 16 bits of Group Id */
+	__u16	i_links_count;	/* Links count */
+	__u32	i_blocks;	/* Blocks count */
+/*20*/	__u32	i_flags;	/* File flags */
+	union {
+		struct {
+			__u32	l_i_version; /* was l_i_reserved1 */
+		} linux1;
+		struct {
+			__u32  h_i_translator;
+		} hurd1;
+	} osd1;				/* OS dependent 1 */
+/*28*/	__u32	i_block[EXT2_N_BLOCKS];/* Pointers to blocks */
+/*64*/	__u32	i_generation;	/* File version (for NFS) */
+	__u32	i_file_acl;	/* File ACL */
+	__u32	i_size_high;
+/*70*/	__u32	i_faddr;	/* Fragment address */
+	union {
+		struct {
+			__u16	l_i_blocks_hi;
+			__u16	l_i_file_acl_high;
+			__u16	l_i_uid_high;	/* these 2 fields    */
+			__u16	l_i_gid_high;	/* were reserved2[0] */
+			__u16	l_i_checksum_lo; /* crc32c(uuid+inum+inode) */
+			__u16	l_i_reserved;
+		} linux2;
+		struct {
+			__u8	h_i_frag;	/* Fragment number */
+			__u8	h_i_fsize;	/* Fragment size */
+			__u16	h_i_mode_high;
+			__u16	h_i_uid_high;
+			__u16	h_i_gid_high;
+			__u32	h_i_author;
+		} hurd2;
+	} osd2;				/* OS dependent 2 */
+/*80*/	__u16	i_extra_isize;
+	__u16	i_checksum_hi;	/* crc32c(uuid+inum+inode) */
+	__u32	i_ctime_extra;	/* extra Change time (nsec << 2 | epoch) */
+	__u32	i_mtime_extra;	/* extra Modification time (nsec << 2 | epoch) */
+	__u32	i_atime_extra;	/* extra Access time (nsec << 2 | epoch) */
+/*90*/	__u32	i_crtime;	/* File creation time */
+	__u32	i_crtime_extra;	/* extra File creation time (nsec << 2 | epoch)*/
+	__u32	i_version_hi;	/* high 32 bits for 64-bit version */
+/*9c*/	__u32   i_projid;       /* Project ID */
+};
+
+#define EXT4_INODE_CSUM_HI_EXTRA_END	\
+	(offsetof(struct ext2_inode_large, i_checksum_hi) + sizeof(__u16) - \
+	 EXT2_GOOD_OLD_INODE_SIZE)
+
+#define EXT4_EPOCH_BITS 2
+#define EXT4_EPOCH_MASK ((1 << EXT4_EPOCH_BITS) - 1)
+
+#define i_checksum_lo	osd2.linux2.l_i_checksum_lo
+
+#define inode_includes(size, field)			\
+       (size >= (sizeof(((struct ext2_inode_large *)0)->field) + \
+                 offsetof(struct ext2_inode_large, field)))
+
+#if defined(__KERNEL__) || defined(__linux__)
+#define i_reserved1	osd1.linux1.l_i_reserved1
+#define i_frag		osd2.linux2.l_i_frag
+#define i_fsize		osd2.linux2.l_i_fsize
+#define i_uid_low	i_uid
+#define i_gid_low	i_gid
+#define i_uid_high	osd2.linux2.l_i_uid_high
+#define i_gid_high	osd2.linux2.l_i_gid_high
+#else
+#if defined(__GNU__)
+
+#define i_translator	osd1.hurd1.h_i_translator
+#define i_frag		osd2.hurd2.h_i_frag;
+#define i_fsize		osd2.hurd2.h_i_fsize;
+#define i_uid_high	osd2.hurd2.h_i_uid_high
+#define i_gid_high	osd2.hurd2.h_i_gid_high
+#define i_author	osd2.hurd2.h_i_author
+
+#endif  /* __GNU__ */
+#endif	/* defined(__KERNEL__) || defined(__linux__) */
+
+#define inode_uid(inode)	((inode).i_uid | (unsigned)(inode).osd2.linux2.l_i_uid_high << 16)
+#define inode_gid(inode)	((inode).i_gid | (unsigned)(inode).osd2.linux2.l_i_gid_high << 16)
+#define inode_projid(inode)	((inode).i_projid)
+#define ext2fs_set_i_uid_high(inode,x) ((inode).osd2.linux2.l_i_uid_high = (x))
+#define ext2fs_set_i_gid_high(inode,x) ((inode).osd2.linux2.l_i_gid_high = (x))
+
+static inline
+struct ext2_inode *EXT2_INODE(struct ext2_inode_large *large_inode)
+{
+	return (struct ext2_inode *) large_inode;
+}
+
+/*
+ * File system states
+ */
+#define EXT2_VALID_FS			0x0001	/* Unmounted cleanly */
+#define EXT2_ERROR_FS			0x0002	/* Errors detected */
+#define EXT3_ORPHAN_FS			0x0004	/* Orphans being recovered */
+#define EXT4_FC_REPLAY			0x0020	/* Ext4 fast commit replay ongoing */
+
+/*
+ * Misc. filesystem flags
+ */
+#define EXT2_FLAGS_SIGNED_HASH		0x0001  /* Signed dirhash in use */
+#define EXT2_FLAGS_UNSIGNED_HASH	0x0002  /* Unsigned dirhash in use */
+#define EXT2_FLAGS_TEST_FILESYS		0x0004	/* OK for use on development code */
+#define EXT2_FLAGS_IS_SNAPSHOT		0x0010	/* This is a snapshot image */
+#define EXT2_FLAGS_FIX_SNAPSHOT		0x0020	/* Snapshot inodes corrupted */
+#define EXT2_FLAGS_FIX_EXCLUDE		0x0040	/* Exclude bitmaps corrupted */
+
+/*
+ * Mount flags
+ */
+#define EXT2_MOUNT_CHECK		0x0001	/* Do mount-time checks */
+#define EXT2_MOUNT_GRPID		0x0004	/* Create files with directory's group */
+#define EXT2_MOUNT_DEBUG		0x0008	/* Some debugging messages */
+#define EXT2_MOUNT_ERRORS_CONT		0x0010	/* Continue on errors */
+#define EXT2_MOUNT_ERRORS_RO		0x0020	/* Remount fs ro on errors */
+#define EXT2_MOUNT_ERRORS_PANIC		0x0040	/* Panic on errors */
+#define EXT2_MOUNT_MINIX_DF		0x0080	/* Mimics the Minix statfs */
+#define EXT2_MOUNT_NO_UID32		0x0200  /* Disable 32-bit UIDs */
+
+#define clear_opt(o, opt)		o &= ~EXT2_MOUNT_##opt
+#define set_opt(o, opt)			o |= EXT2_MOUNT_##opt
+#define test_opt(sb, opt)		(EXT2_SB(sb)->s_mount_opt & \
+					 EXT2_MOUNT_##opt)
+/*
+ * Maximal mount counts between two filesystem checks
+ */
+#define EXT2_DFL_MAX_MNT_COUNT		20	/* Allow 20 mounts */
+#define EXT2_DFL_CHECKINTERVAL		0	/* Don't use interval check */
+
+/*
+ * Behaviour when detecting errors
+ */
+#define EXT2_ERRORS_CONTINUE		1	/* Continue execution */
+#define EXT2_ERRORS_RO			2	/* Remount fs read-only */
+#define EXT2_ERRORS_PANIC		3	/* Panic */
+#define EXT2_ERRORS_DEFAULT		EXT2_ERRORS_CONTINUE
+
+#if (__GNUC__ >= 4)
+#define ext4_offsetof(TYPE,MEMBER) __builtin_offsetof(TYPE,MEMBER)
+#else
+#define ext4_offsetof(TYPE, MEMBER) ((size_t) &((TYPE *)0)->MEMBER)
+#endif
+
+/* Metadata checksum algorithms */
+#define EXT2_CRC32C_CHKSUM		1
+
+/* Encryption algorithms, key size and key reference len */
+#define EXT4_ENCRYPTION_MODE_INVALID		0
+#define EXT4_ENCRYPTION_MODE_AES_256_XTS	1
+#define EXT4_ENCRYPTION_MODE_AES_256_GCM	2
+#define EXT4_ENCRYPTION_MODE_AES_256_CBC	3
+#define EXT4_ENCRYPTION_MODE_AES_256_CTS	4
+
+#define EXT4_AES_256_XTS_KEY_SIZE		64
+#define EXT4_AES_256_GCM_KEY_SIZE		32
+#define EXT4_AES_256_CBC_KEY_SIZE		32
+#define EXT4_AES_256_CTS_KEY_SIZE		32
+#define EXT4_MAX_KEY_SIZE			64
+
+#define EXT4_KEY_DESCRIPTOR_SIZE		8
+#define EXT4_CRYPTO_BLOCK_SIZE			16
+
+/* Password derivation constants */
+#define EXT4_MAX_PASSPHRASE_SIZE		1024
+#define EXT4_MAX_SALT_SIZE			256
+#define EXT4_PBKDF2_ITERATIONS			0xFFFF
+
+#define EXT2_LABEL_LEN				16
+
+/*
+ * Policy provided via an ioctl on the topmost directory. This
+ * structure is also in the kernel.
+ */
+struct ext4_encryption_policy {
+  char version;
+  char contents_encryption_mode;
+  char filenames_encryption_mode;
+  char flags;
+  char master_key_descriptor[EXT4_KEY_DESCRIPTOR_SIZE];
+} __attribute__((__packed__));
+
+struct ext4_encryption_key {
+        __u32 mode;
+        char raw[EXT4_MAX_KEY_SIZE];
+        __u32 size;
+} __attribute__((__packed__));
+
+/*
+ * Structure of the super block
+ */
+struct ext2_super_block {
+/*000*/	__u32	s_inodes_count;		/* Inodes count */
+	__u32	s_blocks_count;		/* Blocks count */
+	__u32	s_r_blocks_count;	/* Reserved blocks count */
+	__u32	s_free_blocks_count;	/* Free blocks count */
+/*010*/	__u32	s_free_inodes_count;	/* Free inodes count */
+	__u32	s_first_data_block;	/* First Data Block */
+	__u32	s_log_block_size;	/* Block size */
+	__u32	s_log_cluster_size;	/* Allocation cluster size */
+/*020*/	__u32	s_blocks_per_group;	/* # Blocks per group */
+	__u32	s_clusters_per_group;	/* # Fragments per group */
+	__u32	s_inodes_per_group;	/* # Inodes per group */
+	__u32	s_mtime;		/* Mount time */
+/*030*/	__u32	s_wtime;		/* Write time */
+	__u16	s_mnt_count;		/* Mount count */
+	__s16	s_max_mnt_count;	/* Maximal mount count */
+	__u16	s_magic;		/* Magic signature */
+	__u16	s_state;		/* File system state */
+	__u16	s_errors;		/* Behaviour when detecting errors */
+	__u16	s_minor_rev_level;	/* minor revision level */
+/*040*/	__u32	s_lastcheck;		/* time of last check */
+	__u32	s_checkinterval;	/* max. time between checks */
+	__u32	s_creator_os;		/* OS */
+	__u32	s_rev_level;		/* Revision level */
+/*050*/	__u16	s_def_resuid;		/* Default uid for reserved blocks */
+	__u16	s_def_resgid;		/* Default gid for reserved blocks */
+	/*
+	 * These fields are for EXT2_DYNAMIC_REV superblocks only.
+	 *
+	 * Note: the difference between the compatible feature set and
+	 * the incompatible feature set is that if there is a bit set
+	 * in the incompatible feature set that the kernel doesn't
+	 * know about, it should refuse to mount the filesystem.
+	 *
+	 * e2fsck's requirements are more strict; if it doesn't know
+	 * about a feature in either the compatible or incompatible
+	 * feature set, it must abort and not try to meddle with
+	 * things it doesn't understand...
+	 */
+	__u32	s_first_ino;		/* First non-reserved inode */
+	__u16   s_inode_size;		/* size of inode structure */
+	__u16	s_block_group_nr;	/* block group # of this superblock */
+	__u32	s_feature_compat;	/* compatible feature set */
+/*060*/	__u32	s_feature_incompat;	/* incompatible feature set */
+	__u32	s_feature_ro_compat;	/* readonly-compatible feature set */
+/*068*/	__u8	s_uuid[16] __nonstring;		/* 128-bit uuid for volume */
+/*078*/	__u8	s_volume_name[EXT2_LABEL_LEN] __nonstring;	/* volume name, no NUL? */
+/*088*/	__u8	s_last_mounted[64] __nonstring;	/* directory last mounted on, no NUL? */
+/*0c8*/	__u32	s_algorithm_usage_bitmap; /* For compression */
+	/*
+	 * Performance hints.  Directory preallocation should only
+	 * happen if the EXT2_FEATURE_COMPAT_DIR_PREALLOC flag is on.
+	 */
+	__u8	s_prealloc_blocks;	/* Nr of blocks to try to preallocate*/
+	__u8	s_prealloc_dir_blocks;	/* Nr to preallocate for dirs */
+	__u16	s_reserved_gdt_blocks;	/* Per group table for online growth */
+	/*
+	 * Journaling support valid if EXT2_FEATURE_COMPAT_HAS_JOURNAL set.
+	 */
+/*0d0*/	__u8	s_journal_uuid[16] __nonstring;	/* uuid of journal superblock */
+/*0e0*/	__u32	s_journal_inum;		/* inode number of journal file */
+	__u32	s_journal_dev;		/* device number of journal file */
+	__u32	s_last_orphan;		/* start of list of inodes to delete */
+/*0ec*/	__u32	s_hash_seed[4];		/* HTREE hash seed */
+/*0fc*/	__u8	s_def_hash_version;	/* Default hash version to use */
+	__u8	s_jnl_backup_type;	/* Default type of journal backup */
+	__u16	s_desc_size;		/* Group desc. size: INCOMPAT_64BIT */
+/*100*/	__u32	s_default_mount_opts;	/* default EXT2_MOUNT_* flags used */
+	__u32	s_first_meta_bg;	/* First metablock group */
+	__u32	s_mkfs_time;		/* When the filesystem was created */
+/*10c*/	__u32	s_jnl_blocks[17];	/* Backup of the journal inode */
+/*150*/	__u32	s_blocks_count_hi;	/* Blocks count high 32bits */
+	__u32	s_r_blocks_count_hi;	/* Reserved blocks count high 32 bits*/
+	__u32	s_free_blocks_hi;	/* Free blocks count */
+	__u16	s_min_extra_isize;	/* All inodes have at least # bytes */
+	__u16	s_want_extra_isize;	/* New inodes should reserve # bytes */
+/*160*/	__u32	s_flags;		/* Miscellaneous flags */
+	__u16	s_raid_stride;		/* RAID stride in blocks */
+	__u16	s_mmp_update_interval;  /* # seconds to wait in MMP checking */
+	__u64	s_mmp_block;		/* Block for multi-mount protection */
+/*170*/	__u32	s_raid_stripe_width;	/* blocks on all data disks (N*stride)*/
+	__u8	s_log_groups_per_flex;	/* FLEX_BG group size */
+	__u8	s_checksum_type;	/* metadata checksum algorithm */
+	__u8	s_encryption_level;	/* versioning level for encryption */
+	__u8	s_reserved_pad;		/* Padding to next 32bits */
+	__u64	s_kbytes_written;	/* nr of lifetime kilobytes written */
+/*180*/	__u32	s_snapshot_inum;	/* Inode number of active snapshot */
+	__u32	s_snapshot_id;		/* sequential ID of active snapshot */
+	__u64	s_snapshot_r_blocks_count; /* active snapshot reserved blocks */
+/*190*/	__u32	s_snapshot_list;	/* inode number of disk snapshot list */
+#define EXT4_S_ERR_START ext4_offsetof(struct ext2_super_block, s_error_count)
+	__u32	s_error_count;		/* number of fs errors */
+	__u32	s_first_error_time;	/* first time an error happened */
+	__u32	s_first_error_ino;	/* inode involved in first error */
+/*1a0*/	__u64	s_first_error_block;	/* block involved in first error */
+	__u8	s_first_error_func[32] __nonstring;	/* function where error hit, no NUL? */
+/*1c8*/	__u32	s_first_error_line;	/* line number where error happened */
+	__u32	s_last_error_time;	/* most recent time of an error */
+/*1d0*/	__u32	s_last_error_ino;	/* inode involved in last error */
+	__u32	s_last_error_line;	/* line number where error happened */
+	__u64	s_last_error_block;	/* block involved of last error */
+/*1e0*/	__u8	s_last_error_func[32] __nonstring;	/* function where error hit, no NUL? */
+#define EXT4_S_ERR_END ext4_offsetof(struct ext2_super_block, s_mount_opts)
+/*200*/	__u8	s_mount_opts[64] __nonstring;	/* default mount options, no NUL? */
+/*240*/	__u32	s_usr_quota_inum;	/* inode number of user quota file */
+	__u32	s_grp_quota_inum;	/* inode number of group quota file */
+	__u32	s_overhead_clusters;	/* overhead blocks/clusters in fs */
+/*24c*/	__u32	s_backup_bgs[2];	/* If sparse_super2 enabled */
+/*254*/	__u8	s_encrypt_algos[4];	/* Encryption algorithms in use  */
+/*258*/	__u8	s_encrypt_pw_salt[16];	/* Salt used for string2key algorithm */
+/*268*/	__le32	s_lpf_ino;		/* Location of the lost+found inode */
+	__le32  s_prj_quota_inum;	/* inode for tracking project quota */
+/*270*/	__le32	s_checksum_seed;	/* crc32c(orig_uuid) if csum_seed set */
+/*274*/	__u8	s_wtime_hi;
+	__u8	s_mtime_hi;
+	__u8	s_mkfs_time_hi;
+	__u8	s_lastcheck_hi;
+	__u8	s_first_error_time_hi;
+	__u8	s_last_error_time_hi;
+	__u8	s_first_error_errcode;
+	__u8    s_last_error_errcode;
+/*27c*/ __le16	s_encoding;		/* Filename charset encoding */
+	__le16	s_encoding_flags;	/* Filename charset encoding flags */
+	__le32  s_orphan_file_inum;	/* Inode for tracking orphan inodes */
+	__le32	s_reserved[94];		/* Padding to the end of the block */
+/*3fc*/	__u32	s_checksum;		/* crc32c(superblock) */
+};
+
+#define EXT4_S_ERR_LEN (EXT4_S_ERR_END - EXT4_S_ERR_START)
+#define EXT2_LEN_STR(buf) (int)sizeof(buf), (char *)buf
+
+/*
+ * Codes for operating systems
+ */
+#define EXT2_OS_LINUX		0
+#define EXT2_OS_HURD		1
+#define EXT2_OBSO_OS_MASIX	2
+#define EXT2_OS_FREEBSD		3
+#define EXT2_OS_LITES		4
+
+/*
+ * Revision levels
+ */
+#define EXT2_GOOD_OLD_REV	0	/* The good old (original) format */
+#define EXT2_DYNAMIC_REV	1	/* V2 format w/ dynamic inode sizes */
+
+#define EXT2_CURRENT_REV	EXT2_GOOD_OLD_REV
+#define EXT2_MAX_SUPP_REV	EXT2_DYNAMIC_REV
+
+#define EXT2_GOOD_OLD_INODE_SIZE 128
+
+/*
+ * Journal inode backup types
+ */
+#define EXT3_JNL_BACKUP_BLOCKS	1
+
+/*
+ * Feature set definitions
+ */
+
+#define EXT2_HAS_COMPAT_FEATURE(sb,mask)			\
+	( EXT2_SB(sb)->s_feature_compat & (mask) )
+#define EXT2_HAS_RO_COMPAT_FEATURE(sb,mask)			\
+	( EXT2_SB(sb)->s_feature_ro_compat & (mask) )
+#define EXT2_HAS_INCOMPAT_FEATURE(sb,mask)			\
+	( EXT2_SB(sb)->s_feature_incompat & (mask) )
+
+#define EXT2_FEATURE_COMPAT_DIR_PREALLOC	0x0001
+#define EXT2_FEATURE_COMPAT_IMAGIC_INODES	0x0002
+#define EXT3_FEATURE_COMPAT_HAS_JOURNAL		0x0004
+#define EXT2_FEATURE_COMPAT_EXT_ATTR		0x0008
+#define EXT2_FEATURE_COMPAT_RESIZE_INODE	0x0010
+#define EXT2_FEATURE_COMPAT_DIR_INDEX		0x0020
+#define EXT2_FEATURE_COMPAT_LAZY_BG		0x0040
+/* #define EXT2_FEATURE_COMPAT_EXCLUDE_INODE	0x0080 not used, legacy */
+#define EXT2_FEATURE_COMPAT_EXCLUDE_BITMAP	0x0100
+#define EXT4_FEATURE_COMPAT_SPARSE_SUPER2	0x0200
+#define EXT4_FEATURE_COMPAT_FAST_COMMIT		0x0400
+#define EXT4_FEATURE_COMPAT_STABLE_INODES	0x0800
+#define EXT4_FEATURE_COMPAT_ORPHAN_FILE		0x1000
+
+#define EXT2_FEATURE_RO_COMPAT_SPARSE_SUPER	0x0001
+#define EXT2_FEATURE_RO_COMPAT_LARGE_FILE	0x0002
+/* #define EXT2_FEATURE_RO_COMPAT_BTREE_DIR	0x0004 not used */
+#define EXT4_FEATURE_RO_COMPAT_HUGE_FILE	0x0008
+#define EXT4_FEATURE_RO_COMPAT_GDT_CSUM		0x0010
+#define EXT4_FEATURE_RO_COMPAT_DIR_NLINK	0x0020
+#define EXT4_FEATURE_RO_COMPAT_EXTRA_ISIZE	0x0040
+#define EXT4_FEATURE_RO_COMPAT_HAS_SNAPSHOT	0x0080
+#define EXT4_FEATURE_RO_COMPAT_QUOTA		0x0100
+#define EXT4_FEATURE_RO_COMPAT_BIGALLOC		0x0200
+/*
+ * METADATA_CSUM implies GDT_CSUM.  When METADATA_CSUM is set, group
+ * descriptor checksums use the same algorithm as all other data
+ * structures' checksums.
+ */
+#define EXT4_FEATURE_RO_COMPAT_METADATA_CSUM	0x0400
+#define EXT4_FEATURE_RO_COMPAT_REPLICA		0x0800
+#define EXT4_FEATURE_RO_COMPAT_READONLY		0x1000
+#define EXT4_FEATURE_RO_COMPAT_PROJECT		0x2000 /* Project quota */
+#define EXT4_FEATURE_RO_COMPAT_SHARED_BLOCKS	0x4000
+#define EXT4_FEATURE_RO_COMPAT_VERITY		0x8000
+#define EXT4_FEATURE_RO_COMPAT_ORPHAN_PRESENT	0x10000
+
+#define EXT2_FEATURE_INCOMPAT_COMPRESSION	0x0001
+#define EXT2_FEATURE_INCOMPAT_FILETYPE		0x0002
+#define EXT3_FEATURE_INCOMPAT_RECOVER		0x0004 /* Needs recovery */
+#define EXT3_FEATURE_INCOMPAT_JOURNAL_DEV	0x0008 /* Journal device */
+#define EXT2_FEATURE_INCOMPAT_META_BG		0x0010
+#define EXT3_FEATURE_INCOMPAT_EXTENTS		0x0040
+#define EXT4_FEATURE_INCOMPAT_64BIT		0x0080
+#define EXT4_FEATURE_INCOMPAT_MMP		0x0100
+#define EXT4_FEATURE_INCOMPAT_FLEX_BG		0x0200
+#define EXT4_FEATURE_INCOMPAT_EA_INODE		0x0400
+#define EXT4_FEATURE_INCOMPAT_DIRDATA		0x1000
+#define EXT4_FEATURE_INCOMPAT_CSUM_SEED		0x2000
+#define EXT4_FEATURE_INCOMPAT_LARGEDIR		0x4000 /* >2GB or 3-lvl htree */
+#define EXT4_FEATURE_INCOMPAT_INLINE_DATA	0x8000 /* data in inode */
+#define EXT4_FEATURE_INCOMPAT_ENCRYPT		0x10000
+#define EXT4_FEATURE_INCOMPAT_CASEFOLD		0x20000
+
+#define EXT4_FEATURE_COMPAT_FUNCS(name, ver, flagname) \
+static inline int ext2fs_has_feature_##name(struct ext2_super_block *sb) \
+{ \
+	return ((EXT2_SB(sb)->s_feature_compat & \
+		 EXT##ver##_FEATURE_COMPAT_##flagname) != 0); \
+} \
+static inline void ext2fs_set_feature_##name(struct ext2_super_block *sb) \
+{ \
+	EXT2_SB(sb)->s_feature_compat |= \
+		EXT##ver##_FEATURE_COMPAT_##flagname; \
+} \
+static inline void ext2fs_clear_feature_##name(struct ext2_super_block *sb) \
+{ \
+	EXT2_SB(sb)->s_feature_compat &= \
+		~EXT##ver##_FEATURE_COMPAT_##flagname; \
+}
+
+#define EXT4_FEATURE_RO_COMPAT_FUNCS(name, ver, flagname) \
+static inline int ext2fs_has_feature_##name(struct ext2_super_block *sb) \
+{ \
+	return ((EXT2_SB(sb)->s_feature_ro_compat & \
+		 EXT##ver##_FEATURE_RO_COMPAT_##flagname) != 0); \
+} \
+static inline void ext2fs_set_feature_##name(struct ext2_super_block *sb) \
+{ \
+	EXT2_SB(sb)->s_feature_ro_compat |= \
+		EXT##ver##_FEATURE_RO_COMPAT_##flagname; \
+} \
+static inline void ext2fs_clear_feature_##name(struct ext2_super_block *sb) \
+{ \
+	EXT2_SB(sb)->s_feature_ro_compat &= \
+		~EXT##ver##_FEATURE_RO_COMPAT_##flagname; \
+}
+
+#define EXT4_FEATURE_INCOMPAT_FUNCS(name, ver, flagname) \
+static inline int ext2fs_has_feature_##name(struct ext2_super_block *sb) \
+{ \
+	return ((EXT2_SB(sb)->s_feature_incompat & \
+		 EXT##ver##_FEATURE_INCOMPAT_##flagname) != 0); \
+} \
+static inline void ext2fs_set_feature_##name(struct ext2_super_block *sb) \
+{ \
+	EXT2_SB(sb)->s_feature_incompat |= \
+		EXT##ver##_FEATURE_INCOMPAT_##flagname; \
+} \
+static inline void ext2fs_clear_feature_##name(struct ext2_super_block *sb) \
+{ \
+	EXT2_SB(sb)->s_feature_incompat &= \
+		~EXT##ver##_FEATURE_INCOMPAT_##flagname; \
+}
+
+EXT4_FEATURE_COMPAT_FUNCS(dir_prealloc,		2, DIR_PREALLOC)
+EXT4_FEATURE_COMPAT_FUNCS(imagic_inodes,	2, IMAGIC_INODES)
+EXT4_FEATURE_COMPAT_FUNCS(journal,		3, HAS_JOURNAL)
+EXT4_FEATURE_COMPAT_FUNCS(xattr,		2, EXT_ATTR)
+EXT4_FEATURE_COMPAT_FUNCS(resize_inode,		2, RESIZE_INODE)
+EXT4_FEATURE_COMPAT_FUNCS(dir_index,		2, DIR_INDEX)
+EXT4_FEATURE_COMPAT_FUNCS(lazy_bg,		2, LAZY_BG)
+EXT4_FEATURE_COMPAT_FUNCS(exclude_bitmap,	2, EXCLUDE_BITMAP)
+EXT4_FEATURE_COMPAT_FUNCS(sparse_super2,	4, SPARSE_SUPER2)
+EXT4_FEATURE_COMPAT_FUNCS(fast_commit,		4, FAST_COMMIT)
+EXT4_FEATURE_COMPAT_FUNCS(stable_inodes,	4, STABLE_INODES)
+EXT4_FEATURE_COMPAT_FUNCS(orphan_file,		4, ORPHAN_FILE)
+
+EXT4_FEATURE_RO_COMPAT_FUNCS(sparse_super,	2, SPARSE_SUPER)
+EXT4_FEATURE_RO_COMPAT_FUNCS(large_file,	2, LARGE_FILE)
+EXT4_FEATURE_RO_COMPAT_FUNCS(huge_file,		4, HUGE_FILE)
+EXT4_FEATURE_RO_COMPAT_FUNCS(gdt_csum,		4, GDT_CSUM)
+EXT4_FEATURE_RO_COMPAT_FUNCS(dir_nlink,		4, DIR_NLINK)
+EXT4_FEATURE_RO_COMPAT_FUNCS(extra_isize,	4, EXTRA_ISIZE)
+EXT4_FEATURE_RO_COMPAT_FUNCS(has_snapshot,	4, HAS_SNAPSHOT)
+EXT4_FEATURE_RO_COMPAT_FUNCS(quota,		4, QUOTA)
+EXT4_FEATURE_RO_COMPAT_FUNCS(bigalloc,		4, BIGALLOC)
+EXT4_FEATURE_RO_COMPAT_FUNCS(metadata_csum,	4, METADATA_CSUM)
+EXT4_FEATURE_RO_COMPAT_FUNCS(replica,		4, REPLICA)
+EXT4_FEATURE_RO_COMPAT_FUNCS(readonly,		4, READONLY)
+EXT4_FEATURE_RO_COMPAT_FUNCS(project,		4, PROJECT)
+EXT4_FEATURE_RO_COMPAT_FUNCS(shared_blocks,	4, SHARED_BLOCKS)
+EXT4_FEATURE_RO_COMPAT_FUNCS(verity,		4, VERITY)
+EXT4_FEATURE_RO_COMPAT_FUNCS(orphan_present,	4, ORPHAN_PRESENT)
+
+EXT4_FEATURE_INCOMPAT_FUNCS(compression,	2, COMPRESSION)
+EXT4_FEATURE_INCOMPAT_FUNCS(filetype,		2, FILETYPE)
+EXT4_FEATURE_INCOMPAT_FUNCS(journal_needs_recovery,	3, RECOVER)
+EXT4_FEATURE_INCOMPAT_FUNCS(journal_dev,	3, JOURNAL_DEV)
+EXT4_FEATURE_INCOMPAT_FUNCS(meta_bg,		2, META_BG)
+EXT4_FEATURE_INCOMPAT_FUNCS(extents,		3, EXTENTS)
+EXT4_FEATURE_INCOMPAT_FUNCS(64bit,		4, 64BIT)
+EXT4_FEATURE_INCOMPAT_FUNCS(mmp,		4, MMP)
+EXT4_FEATURE_INCOMPAT_FUNCS(flex_bg,		4, FLEX_BG)
+EXT4_FEATURE_INCOMPAT_FUNCS(ea_inode,		4, EA_INODE)
+EXT4_FEATURE_INCOMPAT_FUNCS(dirdata,		4, DIRDATA)
+EXT4_FEATURE_INCOMPAT_FUNCS(csum_seed,		4, CSUM_SEED)
+EXT4_FEATURE_INCOMPAT_FUNCS(largedir,		4, LARGEDIR)
+EXT4_FEATURE_INCOMPAT_FUNCS(inline_data,	4, INLINE_DATA)
+EXT4_FEATURE_INCOMPAT_FUNCS(encrypt,		4, ENCRYPT)
+EXT4_FEATURE_INCOMPAT_FUNCS(casefold,		4, CASEFOLD)
+
+#define EXT2_FEATURE_COMPAT_SUPP	0
+#define EXT2_FEATURE_INCOMPAT_SUPP    (EXT2_FEATURE_INCOMPAT_FILETYPE| \
+				       EXT4_FEATURE_INCOMPAT_MMP| \
+				       EXT4_FEATURE_INCOMPAT_LARGEDIR| \
+				       EXT4_FEATURE_INCOMPAT_EA_INODE)
+#define EXT2_FEATURE_RO_COMPAT_SUPP	(EXT2_FEATURE_RO_COMPAT_SPARSE_SUPER| \
+					 EXT2_FEATURE_RO_COMPAT_LARGE_FILE| \
+					 EXT4_FEATURE_RO_COMPAT_DIR_NLINK| \
+					 EXT2_FEATURE_RO_COMPAT_BTREE_DIR| \
+					 EXT4_FEATURE_RO_COMPAT_VERITY)
+
+/*
+ * Default values for user and/or group using reserved blocks
+ */
+#define EXT2_DEF_RESUID		0
+#define EXT2_DEF_RESGID		0
+
+/*
+ * Default mount options
+ */
+#define EXT2_DEFM_DEBUG		0x0001
+#define EXT2_DEFM_BSDGROUPS	0x0002
+#define EXT2_DEFM_XATTR_USER	0x0004
+#define EXT2_DEFM_ACL		0x0008
+#define EXT2_DEFM_UID16		0x0010
+#define EXT3_DEFM_JMODE		0x0060
+#define EXT3_DEFM_JMODE_DATA	0x0020
+#define EXT3_DEFM_JMODE_ORDERED	0x0040
+#define EXT3_DEFM_JMODE_WBACK	0x0060
+#define EXT4_DEFM_NOBARRIER	0x0100
+#define EXT4_DEFM_BLOCK_VALIDITY 0x0200
+#define EXT4_DEFM_DISCARD	0x0400
+#define EXT4_DEFM_NODELALLOC	0x0800
+
+static inline int ext4_hash_in_dirent(const struct ext2_inode *inode)
+{
+	return (inode->i_flags & EXT4_ENCRYPT_FL) &&
+		(inode->i_flags & EXT4_CASEFOLD_FL);
+}
+
+/*
+ * Structure of a directory entry
+ */
+#define EXT2_NAME_LEN 255
+
+struct ext2_dir_entry {
+	__u32	inode;			/* Inode number */
+	__u16	rec_len;		/* Directory entry length */
+	__u16	name_len;		/* Name length */
+	char	name[EXT2_NAME_LEN];	/* File name */
+};
+
+/*
+ * The new version of the directory entry.  Since EXT2 structures are
+ * stored in intel byte order, and the name_len field could never be
+ * bigger than 255 chars, it's safe to reclaim the extra byte for the
+ * file_type field.
+ *
+ * This structure is deprecated due to endian issues. Please use struct
+ * ext2_dir_entry and accessor functions
+ *   ext2fs_dirent_name_len
+ *   ext2fs_dirent_set_name_len
+ *   ext2fs_dirent_file_type
+ *   ext2fs_dirent_set_file_type
+ * to get and set name_len and file_type fields.
+ */
+struct ext2_dir_entry_2 {
+	__u32	inode;			/* Inode number */
+	__u16	rec_len;		/* Directory entry length */
+	__u8	name_len;		/* Name length */
+	__u8	file_type;
+	char	name[EXT2_NAME_LEN];	/* File name */
+};
+
+/*
+ * Hashes for ext4_dir_entry for casefolded and ecrypted directories.
+ * This is located at the first 4 bit aligned location after the name.
+ */
+
+struct ext2_dir_entry_hash {
+	__le32 hash;
+	__le32 minor_hash;
+};
+
+#define EXT2_DIRENT_HASHES(entry) \
+	((struct ext2_dir_entry_hash *) &entry->name[\
+		(ext2fs_dirent_name_len(entry) + \
+			EXT2_DIR_ROUND) & ~EXT2_DIR_ROUND])
+#define EXT2_DIRENT_HASH(entry) \
+		ext2fs_le32_to_cpu(EXT2_DIRENT_HASHES(entry)->hash)
+#define EXT2_DIRENT_MINOR_HASH(entry) \
+		ext2fs_le32_to_cpu(EXT2_DIRENT_HASHES(entry)->minor_hash)
+
+/*
+ * This is a bogus directory entry at the end of each leaf block that
+ * records checksums.
+ */
+struct ext2_dir_entry_tail {
+	__u32	det_reserved_zero1;	/* Pretend to be unused */
+	__u16	det_rec_len;		/* 12 */
+	__u16	det_reserved_name_len;	/* 0xDE00, fake namelen/filetype */
+	__u32	det_checksum;		/* crc32c(uuid+inode+dirent) */
+};
+
+/*
+ * Ext2 directory file types.  Only the low 3 bits are used.  The
+ * other bits are reserved for now.
+ */
+#define EXT2_FT_UNKNOWN		0
+#define EXT2_FT_REG_FILE	1
+#define EXT2_FT_DIR		2
+#define EXT2_FT_CHRDEV		3
+#define EXT2_FT_BLKDEV		4
+#define EXT2_FT_FIFO		5
+#define EXT2_FT_SOCK		6
+#define EXT2_FT_SYMLINK		7
+
+#define EXT2_FT_MAX		8
+
+/*
+ * Annoyingly, e2fsprogs always swab16s ext2_dir_entry.name_len, so we
+ * have to build ext2_dir_entry_tail with that assumption too.  This
+ * constant helps to build the dir_entry_tail to look like it has an
+ * "invalid" file type.
+ */
+#define EXT2_DIR_NAME_LEN_CSUM	0xDE00
+
+/*
+ * EXT2_DIR_PAD defines the directory entries boundaries
+ *
+ * NOTE: It must be a multiple of 4
+ */
+#define EXT2_DIR_ENTRY_HEADER_LEN	8
+#define EXT2_DIR_ENTRY_HASH_LEN		8
+#define EXT2_DIR_PAD			4
+#define EXT2_DIR_ROUND			(EXT2_DIR_PAD - 1)
+#define EXT2_DIR_REC_LEN(name_len) ext2fs_dir_rec_len(name_len, 0)
+
+static inline unsigned int ext2fs_dir_rec_len(__u8 name_len,
+						int extended)
+{
+	int rec_len = (name_len + EXT2_DIR_ENTRY_HEADER_LEN + EXT2_DIR_ROUND);
+
+	rec_len &= ~EXT2_DIR_ROUND;
+	if (extended)
+		rec_len += EXT2_DIR_ENTRY_HASH_LEN;
+	return rec_len;
+}
+
+#define EXT4_ORPHAN_BLOCK_MAGIC 0x0b10ca04
+
+/* Structure at the tail of orphan block */
+struct ext4_orphan_block_tail {
+	__u32 ob_magic;
+	__u32 ob_checksum;
+};
+
+/*
+ * Constants for ext4's extended time encoding
+ */
+#define EXT4_EPOCH_BITS 2
+#define EXT4_EPOCH_MASK ((1 << EXT4_EPOCH_BITS) - 1)
+#define EXT4_NSEC_MASK  (~0UL << EXT4_EPOCH_BITS)
+
+/*
+ * This structure is used for multiple mount protection. It is written
+ * into the block number saved in the s_mmp_block field in the superblock.
+ * Programs that check MMP should assume that if SEQ_FSCK (or any unknown
+ * code above SEQ_MAX) is present then it is NOT safe to use the filesystem,
+ * regardless of how old the timestamp is.
+ *
+ * The timestamp in the MMP structure will be updated by e2fsck at some
+ * arbitrary intervals (start of passes, after every few groups of inodes
+ * in pass1 and pass1b).  There is no guarantee that e2fsck is updating
+ * the MMP block in a timely manner, and the updates it does are purely
+ * for the convenience of the sysadmin and not for automatic validation.
+ *
+ * Note: Only the mmp_seq value is used to determine whether the MMP block
+ *	is being updated.  The mmp_time, mmp_nodename, and mmp_bdevname
+ *	fields are only for informational purposes for the administrator,
+ *	due to clock skew between nodes and hostname HA service takeover.
+ */
+#define EXT4_MMP_MAGIC     0x004D4D50U /* ASCII for MMP */
+#define EXT4_MMP_SEQ_CLEAN 0xFF4D4D50U /* mmp_seq value for clean unmount */
+#define EXT4_MMP_SEQ_FSCK  0xE24D4D50U /* mmp_seq value when being fscked */
+#define EXT4_MMP_SEQ_MAX   0xE24D4D4FU /* maximum valid mmp_seq value */
+
+/* Not endian-annotated; it's swapped at read/write time */
+struct mmp_struct {
+	__u32	mmp_magic;		/* Magic number for MMP */
+	__u32	mmp_seq;		/* Sequence no. updated periodically */
+	__u64	mmp_time;		/* Time last updated (seconds) */
+	__u8	mmp_nodename[64] __nonstring;	/* Node updating MMP block, no NUL? */
+	__u8	mmp_bdevname[32] __nonstring;	/* Bdev updating MMP block, no NUL? */
+	__u16	mmp_check_interval;	/* Changed mmp_check_interval */
+	__u16	mmp_pad1;
+	__u32	mmp_pad2[226];
+	__u32	mmp_checksum;		/* crc32c(uuid+mmp_block) */
+};
+
+/*
+ * Default interval for MMP update in seconds.
+ */
+#define EXT4_MMP_UPDATE_INTERVAL	5
+
+/*
+ * Maximum interval for MMP update in seconds.
+ */
+#define EXT4_MMP_MAX_UPDATE_INTERVAL	300
+
+/*
+ * Minimum interval for MMP checking in seconds.
+ */
+#define EXT4_MMP_MIN_CHECK_INTERVAL     5
+
+/*
+ * Minimum size of inline data.
+ */
+#define EXT4_MIN_INLINE_DATA_SIZE	((sizeof(__u32) * EXT2_N_BLOCKS))
+
+/*
+ * Size of a parent inode in inline data directory.
+ */
+#define EXT4_INLINE_DATA_DOTDOT_SIZE	(4)
+
+#define EXT4_ENC_UTF8_12_1	1
+
+#define EXT4_ENC_STRICT_MODE_FL			(1 << 0) /* Reject invalid sequences */
+
+#endif	/* _LINUX_EXT2_FS_H */
diff --git a/lib/ext2fs/ext2_io.h b/lib/ext2fs/ext2_io.h
new file mode 100644
index 0000000..679184e
--- /dev/null
+++ b/lib/ext2fs/ext2_io.h
@@ -0,0 +1,179 @@
+/*
+ * io.h --- the I/O manager abstraction
+ *
+ * Copyright (C) 1993, 1994, 1995, 1996 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#ifndef _EXT2FS_EXT2_IO_H
+#define _EXT2FS_EXT2_IO_H
+
+#include <ext2fs/ext2_types.h>
+
+/*
+ * ext2_loff_t is defined here since unix_io.c needs it.
+ */
+#if defined(__GNUC__) || defined(HAS_LONG_LONG)
+typedef long long	ext2_loff_t;
+#else
+typedef long		ext2_loff_t;
+#endif
+
+/* llseek.c */
+ext2_loff_t ext2fs_llseek (int, ext2_loff_t, int);
+
+typedef struct struct_io_manager *io_manager;
+typedef struct struct_io_channel *io_channel;
+typedef struct struct_io_stats *io_stats;
+
+#define CHANNEL_FLAGS_WRITETHROUGH	0x01
+#define CHANNEL_FLAGS_DISCARD_ZEROES	0x02
+#define CHANNEL_FLAGS_BLOCK_DEVICE	0x04
+#define CHANNEL_FLAGS_THREADS		0x08
+
+#define io_channel_discard_zeroes_data(i) (i->flags & CHANNEL_FLAGS_DISCARD_ZEROES)
+
+struct struct_io_channel {
+	errcode_t	magic;
+	io_manager	manager;
+	char		*name;
+	int		block_size;
+	errcode_t	(*read_error)(io_channel channel,
+				      unsigned long block,
+				      int count,
+				      void *data,
+				      size_t size,
+				      int actual_bytes_read,
+				      errcode_t	error);
+	errcode_t	(*write_error)(io_channel channel,
+				       unsigned long block,
+				       int count,
+				       const void *data,
+				       size_t size,
+				       int actual_bytes_written,
+				       errcode_t error);
+	int		refcount;
+	int		flags;
+	long		reserved[14];
+	void		*private_data;
+	void		*app_data;
+	int		align;
+};
+
+struct struct_io_stats {
+	int			num_fields;
+	int			reserved;
+	unsigned long long	bytes_read;
+	unsigned long long	bytes_written;
+};
+
+struct struct_io_manager {
+	errcode_t magic;
+	const char *name;
+	errcode_t (*open)(const char *name, int flags, io_channel *channel);
+	errcode_t (*close)(io_channel channel);
+	errcode_t (*set_blksize)(io_channel channel, int blksize);
+	errcode_t (*read_blk)(io_channel channel, unsigned long block,
+			      int count, void *data);
+	errcode_t (*write_blk)(io_channel channel, unsigned long block,
+			       int count, const void *data);
+	errcode_t (*flush)(io_channel channel);
+	errcode_t (*write_byte)(io_channel channel, unsigned long offset,
+				int count, const void *data);
+	errcode_t (*set_option)(io_channel channel, const char *option,
+				const char *arg);
+	errcode_t (*get_stats)(io_channel channel, io_stats *io_stats);
+	errcode_t (*read_blk64)(io_channel channel, unsigned long long block,
+					int count, void *data);
+	errcode_t (*write_blk64)(io_channel channel, unsigned long long block,
+					int count, const void *data);
+	errcode_t (*discard)(io_channel channel, unsigned long long block,
+			     unsigned long long count);
+	errcode_t (*cache_readahead)(io_channel channel,
+				     unsigned long long block,
+				     unsigned long long count);
+	errcode_t (*zeroout)(io_channel channel, unsigned long long block,
+			     unsigned long long count);
+	long	reserved[14];
+};
+
+#define IO_FLAG_RW		0x0001
+#define IO_FLAG_EXCLUSIVE	0x0002
+#define IO_FLAG_DIRECT_IO	0x0004
+#define IO_FLAG_FORCE_BOUNCE	0x0008
+#define IO_FLAG_THREADS		0x0010
+#define IO_FLAG_NOCACHE		0x0020
+
+/*
+ * Convenience functions....
+ */
+#define io_channel_close(c) 		((c)->manager->close((c)))
+#define io_channel_set_blksize(c,s)	((c)->manager->set_blksize((c),s))
+#define io_channel_read_blk(c,b,n,d)	((c)->manager->read_blk((c),b,n,d))
+#define io_channel_write_blk(c,b,n,d)	((c)->manager->write_blk((c),b,n,d))
+#define io_channel_flush(c) 		((c)->manager->flush((c)))
+#define io_channel_bumpcount(c)		((c)->refcount++)
+
+/* io_manager.c */
+extern errcode_t io_channel_set_options(io_channel channel,
+					const char *options);
+extern errcode_t io_channel_write_byte(io_channel channel,
+				       unsigned long offset,
+				       int count, const void *data);
+extern errcode_t io_channel_read_blk64(io_channel channel,
+				       unsigned long long block,
+				       int count, void *data);
+extern errcode_t io_channel_write_blk64(io_channel channel,
+					unsigned long long block,
+					int count, const void *data);
+extern errcode_t io_channel_discard(io_channel channel,
+				    unsigned long long block,
+				    unsigned long long count);
+extern errcode_t io_channel_zeroout(io_channel channel,
+				    unsigned long long block,
+				    unsigned long long count);
+extern errcode_t io_channel_alloc_buf(io_channel channel,
+				      int count, void *ptr);
+extern errcode_t io_channel_cache_readahead(io_channel io,
+					    unsigned long long block,
+					    unsigned long long count);
+
+#ifdef _WIN32
+/* windows_io.c */
+extern io_manager windows_io_manager;
+#define default_io_manager windows_io_manager
+#else
+/* unix_io.c */
+extern io_manager unix_io_manager;
+extern io_manager unixfd_io_manager;
+#define default_io_manager unix_io_manager
+#endif
+
+/* sparse_io.c */
+extern io_manager sparse_io_manager;
+extern io_manager sparsefd_io_manager;
+
+/* undo_io.c */
+extern io_manager undo_io_manager;
+extern errcode_t set_undo_io_backing_manager(io_manager manager);
+extern errcode_t set_undo_io_backup_file(char *file_name);
+
+/* test_io.c */
+extern io_manager test_io_manager, test_io_backing_manager;
+extern void (*test_io_cb_read_blk)
+	(unsigned long block, int count, errcode_t err);
+extern void (*test_io_cb_write_blk)
+	(unsigned long block, int count, errcode_t err);
+extern void (*test_io_cb_read_blk64)
+	(unsigned long long block, int count, errcode_t err);
+extern void (*test_io_cb_write_blk64)
+	(unsigned long long block, int count, errcode_t err);
+extern void (*test_io_cb_set_blksize)
+	(int blksize, errcode_t err);
+
+#endif /* _EXT2FS_EXT2_IO_H */
+
diff --git a/lib/ext2fs/ext2_types.h.in b/lib/ext2fs/ext2_types.h.in
new file mode 100644
index 0000000..98cc65b
--- /dev/null
+++ b/lib/ext2fs/ext2_types.h.in
@@ -0,0 +1,196 @@
+/*
+ * If linux/types.h is already been included, assume it has defined
+ * everything we need.  (cross fingers)  Other header files may have
+ * also defined the types that we need.
+ */
+#if (!defined(_LINUX_TYPES_H) && !defined(_BLKID_TYPES_H) && \
+	!defined(_EXT2_TYPES_H))
+#define _EXT2_TYPES_H
+
+@ASM_TYPES_HEADER@
+
+#ifndef HAVE___U8
+#define HAVE___U8
+#ifdef __U8_TYPEDEF
+typedef __U8_TYPEDEF __u8;
+#else
+typedef unsigned char __u8;
+#endif
+#endif /* HAVE___U8 */
+
+#ifndef HAVE___S8
+#define HAVE___S8
+#ifdef __S8_TYPEDEF
+typedef __S8_TYPEDEF __s8;
+#else
+typedef signed char __s8;
+#endif
+#endif /* HAVE___S8 */
+
+#ifndef HAVE___U16
+#define HAVE___U16
+#ifdef __U16_TYPEDEF
+typedef __U16_TYPEDEF __u16;
+#else
+#if (@SIZEOF_INT@ == 2)
+typedef	unsigned int	__u16;
+#else
+#if (@SIZEOF_SHORT@ == 2)
+typedef	unsigned short	__u16;
+#else
+#undef HAVE___U16
+  ?==error: undefined 16 bit type
+#endif /* SIZEOF_SHORT == 2 */
+#endif /* SIZEOF_INT == 2 */
+#endif /* __U16_TYPEDEF */
+#endif /* HAVE___U16 */
+
+#ifndef HAVE___S16
+#define HAVE___S16
+#ifdef __S16_TYPEDEF
+typedef __S16_TYPEDEF __s16;
+#else
+#if (@SIZEOF_INT@ == 2)
+typedef	int		__s16;
+#else
+#if (@SIZEOF_SHORT@ == 2)
+typedef	short		__s16;
+#else
+#undef HAVE___S16
+  ?==error: undefined 16 bit type
+#endif /* SIZEOF_SHORT == 2 */
+#endif /* SIZEOF_INT == 2 */
+#endif /* __S16_TYPEDEF */
+#endif /* HAVE___S16 */
+
+#ifndef HAVE___U32
+#define HAVE___U32
+#ifdef __U32_TYPEDEF
+typedef __U32_TYPEDEF __u32;
+#else
+#if (@SIZEOF_INT@ == 4)
+typedef	unsigned int	__u32;
+#else
+#if (@SIZEOF_LONG@ == 4)
+typedef	unsigned long	__u32;
+#else
+#if (@SIZEOF_SHORT@ == 4)
+typedef	unsigned short	__u32;
+#else
+#undef HAVE___U32
+ ?== error: undefined 32 bit type
+#endif /* SIZEOF_SHORT == 4 */
+#endif /* SIZEOF_LONG == 4 */
+#endif /* SIZEOF_INT == 4 */
+#endif /* __U32_TYPEDEF */
+#endif /* HAVE___U32 */
+
+#ifndef HAVE___S32
+#define HAVE___S32
+#ifdef __S32_TYPEDEF
+typedef __S32_TYPEDEF __s32;
+#else
+#if (@SIZEOF_INT@ == 4)
+typedef	int		__s32;
+#else
+#if (@SIZEOF_LONG@ == 4)
+typedef	long		__s32;
+#else
+#if (@SIZEOF_SHORT@ == 4)
+typedef	short		__s32;
+#else
+#undef HAVE___S32
+ ?== error: undefined 32 bit type
+#endif /* SIZEOF_SHORT == 4 */
+#endif /* SIZEOF_LONG == 4 */
+#endif /* SIZEOF_INT == 4 */
+#endif /* __S32_TYPEDEF */
+#endif /* HAVE___S32 */
+
+#ifndef HAVE___U64
+#define HAVE___U64
+#ifdef __U64_TYPEDEF
+typedef __U64_TYPEDEF __u64;
+#else
+#if (@SIZEOF_INT@ == 8)
+typedef unsigned int	__u64;
+#else
+#if (@SIZEOF_LONG_LONG@ == 8)
+typedef unsigned long long	__u64;
+#else
+#if (@SIZEOF_LONG@ == 8)
+typedef unsigned long	__u64;
+#else
+#undef HAVE___U64
+ ?== error: undefined 64 bit type
+#endif /* SIZEOF_LONG_LONG == 8 */
+#endif /* SIZEOF_LONG == 8 */
+#endif /* SIZEOF_INT == 8 */
+#endif /* __U64_TYPEDEF */
+#endif /* HAVE___U64 */
+
+#ifndef HAVE___S64
+#define HAVE___S64
+#ifdef __S64_TYPEDEF
+typedef __S64_TYPEDEF __s64;
+#else
+#if (@SIZEOF_INT@ == 8)
+typedef int		__s64;
+#else
+#if (@SIZEOF_LONG_LONG@ == 8)
+#if defined(__GNUC__)
+typedef __signed__ long long	__s64;
+#else
+typedef signed long long	__s64;
+#endif /* __GNUC__ */
+#else
+#if (@SIZEOF_LONG@ == 8)
+typedef long		__s64;
+#else
+#undef HAVE___S64
+ ?== error: undefined 64 bit type
+#endif /* SIZEOF_LONG_LONG == 8 */
+#endif /* SIZEOF_LONG == 8 */
+#endif /* SIZEOF_INT == 8 */
+#endif /* __S64_TYPEDEF */
+#endif /* HAVE___S64 */
+
+#undef __S8_TYPEDEF
+#undef __U8_TYPEDEF
+#undef __S16_TYPEDEF
+#undef __U16_TYPEDEF
+#undef __S32_TYPEDEF
+#undef __U32_TYPEDEF
+#undef __S64_TYPEDEF
+#undef __U64_TYPEDEF
+
+#endif /* _*_TYPES_H */
+
+#include <stdint.h>
+
+/* endian checking stuff */
+#ifndef EXT2_ENDIAN_H_
+#define EXT2_ENDIAN_H_
+
+#ifdef __CHECKER__
+# ifndef __bitwise
+#  define __bitwise		__attribute__((bitwise))
+# endif
+#define __force			__attribute__((force))
+#else
+# ifndef __bitwise
+#  define __bitwise
+# endif
+#define __force
+#endif
+
+typedef __u16	__bitwise	__le16;
+typedef __u32	__bitwise	__le32;
+typedef __u64	__bitwise	__le64;
+typedef __u16	__bitwise	__be16;
+typedef __u32	__bitwise	__be32;
+typedef __u64	__bitwise	__be64;
+
+#endif /* EXT2_ENDIAN_H_ */
+
+@PUBLIC_CONFIG_HEADER@
diff --git a/lib/ext2fs/ext2fs.h b/lib/ext2fs/ext2fs.h
new file mode 100644
index 0000000..72c60d2
--- /dev/null
+++ b/lib/ext2fs/ext2fs.h
@@ -0,0 +1,2224 @@
+/*
+ * ext2fs.h --- ext2fs
+ *
+ * Copyright (C) 1993, 1994, 1995, 1996 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#ifndef _EXT2FS_EXT2FS_H
+#define _EXT2FS_EXT2FS_H
+
+#ifdef __GNUC__
+#define EXT2FS_ATTR(x) __attribute__(x)
+#else
+#define EXT2FS_ATTR(x)
+#endif
+
+#ifndef __nonstring
+#ifdef __has_attribute
+#if __has_attribute(__nonstring__)
+#define __nonstring                    __attribute__((__nonstring__))
+#else
+#define __nonstring
+#endif /* __has_attribute(__nonstring__) */
+#else
+# define __nonstring
+#endif /* __has_attribute */
+#endif /* __nonstring */
+
+#ifdef CONFIG_TDB
+#define EXT2FS_NO_TDB_UNUSED
+#else
+#define EXT2FS_NO_TDB_UNUSED	EXT2FS_ATTR((unused))
+#endif
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+/*
+ * Non-GNU C compilers won't necessarily understand inline
+ */
+#if (!defined(__GNUC__) && !defined(__WATCOMC__))
+#define NO_INLINE_FUNCS
+#endif
+
+/*
+ * Where the master copy of the superblock is located, and how big
+ * superblocks are supposed to be.  We define SUPERBLOCK_SIZE because
+ * the size of the superblock structure is not necessarily trustworthy
+ * (some versions have the padding set up so that the superblock is
+ * 1032 bytes long).
+ */
+#define SUPERBLOCK_OFFSET	1024
+#define SUPERBLOCK_SIZE		1024
+
+#define UUID_STR_SIZE 37
+
+/*
+ * The last ext2fs revision level that this version of the library is
+ * able to support.
+ */
+#define EXT2_LIB_CURRENT_REV	EXT2_DYNAMIC_REV
+
+#ifdef HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#include <time.h>
+#include <errno.h>
+
+#if EXT2_FLAT_INCLUDES
+#include "e2_types.h"
+#include "ext2_fs.h"
+#include "ext3_extents.h"
+#else
+#include <ext2fs/ext2_types.h>
+#include <ext2fs/ext2_fs.h>
+#include <ext2fs/ext3_extents.h>
+#endif /* EXT2_FLAT_INCLUDES */
+
+typedef __u32 __bitwise		ext2_ino_t;
+typedef __u32 __bitwise		blk_t;
+typedef __u64 __bitwise		blk64_t;
+typedef __u32 __bitwise		dgrp_t;
+typedef __s32 __bitwise		ext2_off_t;
+typedef __s64 __bitwise		ext2_off64_t;
+typedef __s64 __bitwise		e2_blkcnt_t;
+typedef __u32 __bitwise		ext2_dirhash_t;
+
+#if EXT2_FLAT_INCLUDES
+#include "com_err.h"
+#include "ext2_io.h"
+#include "ext2_err.h"
+#include "ext2_ext_attr.h"
+#else
+#include <et/com_err.h>
+#include <ext2fs/ext2_io.h>
+#include <ext2fs/ext2_err.h>
+#include <ext2fs/ext2_ext_attr.h>
+#endif
+
+#include "hashmap.h"
+
+/*
+ * Portability help for Microsoft Visual C++
+ */
+#ifdef _MSC_VER
+#define EXT2_QSORT_TYPE int __cdecl
+#else
+#define EXT2_QSORT_TYPE int
+#endif
+
+typedef struct struct_ext2_filsys *ext2_filsys;
+
+#define EXT2FS_MARK_ERROR 	0
+#define EXT2FS_UNMARK_ERROR 	1
+#define EXT2FS_TEST_ERROR	2
+
+struct ext2fs_struct_generic_bitmap_base {
+	errcode_t		magic;
+	ext2_filsys 		fs;
+};
+
+typedef struct ext2fs_struct_generic_bitmap_base *ext2fs_generic_bitmap;
+typedef struct ext2fs_struct_generic_bitmap_base *ext2fs_inode_bitmap;
+typedef struct ext2fs_struct_generic_bitmap_base *ext2fs_block_bitmap;
+
+#define EXT2_FIRST_INODE(s)	EXT2_FIRST_INO(s)
+
+
+/*
+ * Badblocks list definitions
+ */
+
+typedef struct ext2_struct_u32_list *ext2_badblocks_list;
+typedef struct ext2_struct_u32_iterate *ext2_badblocks_iterate;
+
+typedef struct ext2_struct_u32_list *ext2_u32_list;
+typedef struct ext2_struct_u32_iterate *ext2_u32_iterate;
+
+/* old */
+typedef struct ext2_struct_u32_list *badblocks_list;
+typedef struct ext2_struct_u32_iterate *badblocks_iterate;
+
+#define BADBLOCKS_FLAG_DIRTY	1
+
+/*
+ * ext2_dblist structure and abstractions (see dblist.c)
+ */
+struct ext2_db_entry2 {
+	ext2_ino_t	ino;
+	blk64_t	blk;
+	e2_blkcnt_t	blockcnt;
+};
+
+/* Ye Olde 32-bit version */
+struct ext2_db_entry {
+	ext2_ino_t	ino;
+	blk_t	blk;
+	int	blockcnt;
+};
+
+typedef struct ext2_struct_dblist *ext2_dblist;
+
+#define DBLIST_ABORT	1
+
+/*
+ * ext2_fileio definitions
+ */
+
+#define EXT2_FILE_WRITE		0x0001
+#define EXT2_FILE_CREATE	0x0002
+
+#define EXT2_FILE_MASK		0x00FF
+
+#define EXT2_FILE_BUF_DIRTY	0x4000
+#define EXT2_FILE_BUF_VALID	0x2000
+
+typedef struct ext2_file *ext2_file_t;
+
+#define EXT2_SEEK_SET	0
+#define EXT2_SEEK_CUR	1
+#define EXT2_SEEK_END	2
+
+/*
+ * Flags for the ext2_filsys structure and for ext2fs_open()
+ */
+#define EXT2_FLAG_RW			0x01
+#define EXT2_FLAG_CHANGED		0x02
+#define EXT2_FLAG_DIRTY			0x04
+#define EXT2_FLAG_VALID			0x08
+#define EXT2_FLAG_IB_DIRTY		0x10
+#define EXT2_FLAG_BB_DIRTY		0x20
+#define EXT2_FLAG_SWAP_BYTES		0x40
+#define EXT2_FLAG_SWAP_BYTES_READ	0x80
+#define EXT2_FLAG_SWAP_BYTES_WRITE	0x100
+#define EXT2_FLAG_MASTER_SB_ONLY	0x200
+#define EXT2_FLAG_FORCE			0x400
+#define EXT2_FLAG_SUPER_ONLY		0x800
+#define EXT2_FLAG_JOURNAL_DEV_OK	0x1000
+#define EXT2_FLAG_IMAGE_FILE		0x2000
+#define EXT2_FLAG_EXCLUSIVE		0x4000
+#define EXT2_FLAG_SOFTSUPP_FEATURES	0x8000
+#define EXT2_FLAG_NOFREE_ON_ERROR	0x10000
+#define EXT2_FLAG_64BITS		0x20000
+#define EXT2_FLAG_PRINT_PROGRESS	0x40000
+#define EXT2_FLAG_DIRECT_IO		0x80000
+#define EXT2_FLAG_SKIP_MMP		0x100000
+#define EXT2_FLAG_IGNORE_CSUM_ERRORS	0x200000
+#define EXT2_FLAG_SHARE_DUP		0x400000
+#define EXT2_FLAG_IGNORE_SB_ERRORS	0x800000
+#define EXT2_FLAG_BBITMAP_TAIL_PROBLEM	0x1000000
+#define EXT2_FLAG_IBITMAP_TAIL_PROBLEM	0x2000000
+#define EXT2_FLAG_THREADS		0x4000000
+#define EXT2_FLAG_IGNORE_SWAP_DIRENT	0x8000000
+
+/*
+ * Special flag in the ext2 inode i_flag field that means that this is
+ * a new inode.  (So that ext2_write_inode() can clear extra fields.)
+ */
+#define EXT2_NEW_INODE_FL	0x80000000
+
+/*
+ * Flags for mkjournal
+ */
+#define EXT2_MKJOURNAL_V1_SUPER	0x0000001 /* create V1 superblock (deprecated) */
+#define EXT2_MKJOURNAL_LAZYINIT	0x0000002 /* don't zero journal inode before use*/
+#define EXT2_MKJOURNAL_NO_MNT_CHECK 0x0000004 /* don't check mount status */
+
+/*
+ * Normal journal area size to fast commit area size ratio. This is used to
+ * set default size of fast commit area.
+ */
+#define EXT2_JOURNAL_TO_FC_BLKS_RATIO		64
+
+struct blk_alloc_ctx;
+struct opaque_ext2_group_desc;
+
+struct struct_ext2_filsys {
+	errcode_t			magic;
+	io_channel			io;
+	int				flags;
+	char *				device_name;
+	struct ext2_super_block	* 	super;
+	unsigned int			blocksize;
+	int				fragsize;
+	dgrp_t				group_desc_count;
+	unsigned long			desc_blocks;
+	struct opaque_ext2_group_desc *	group_desc;
+	unsigned int			inode_blocks_per_group;
+	ext2fs_inode_bitmap		inode_map;
+	ext2fs_block_bitmap		block_map;
+	/* XXX FIXME-64: not 64-bit safe, but not used? */
+	errcode_t (*get_blocks)(ext2_filsys fs, ext2_ino_t ino, blk_t *blocks);
+	errcode_t (*check_directory)(ext2_filsys fs, ext2_ino_t ino);
+	errcode_t (*write_bitmaps)(ext2_filsys fs);
+	errcode_t (*read_inode)(ext2_filsys fs, ext2_ino_t ino,
+				struct ext2_inode *inode);
+	errcode_t (*write_inode)(ext2_filsys fs, ext2_ino_t ino,
+				struct ext2_inode *inode);
+	ext2_badblocks_list		badblocks;
+	ext2_dblist			dblist;
+	__u32				stride;	/* for mke2fs */
+	struct ext2_super_block *	orig_super;
+	struct ext2_image_hdr *		image_header;
+	__u32				umask;
+	time_t				now;
+	int				cluster_ratio_bits;
+	__u16				default_bitmap_type;
+	__u16				pad;
+	/*
+	 * Reserved for future expansion
+	 */
+	__u32				reserved[5];
+
+	/*
+	 * Reserved for the use of the calling application.
+	 */
+	void *				priv_data;
+
+	/*
+	 * Inode cache
+	 */
+	struct ext2_inode_cache		*icache;
+	io_channel			image_io;
+
+	/*
+	 * More callback functions
+	 */
+	errcode_t (*get_alloc_block)(ext2_filsys fs, blk64_t goal,
+				     blk64_t *ret);
+	errcode_t (*get_alloc_block2)(ext2_filsys fs, blk64_t goal,
+				      blk64_t *ret, struct blk_alloc_ctx *ctx);
+	void (*block_alloc_stats)(ext2_filsys fs, blk64_t blk, int inuse);
+
+	/*
+	 * Buffers for Multiple mount protection(MMP) block.
+	 */
+	void *mmp_buf;
+	void *mmp_cmp;
+	int mmp_fd;
+
+	/*
+	 * Time at which e2fsck last updated the MMP block.
+	 */
+	long mmp_last_written;
+
+	/* progress operation functions */
+	struct ext2fs_progress_ops *progress_ops;
+
+	/* Precomputed FS UUID checksum for seeding other checksums */
+	__u32 csum_seed;
+
+	io_channel			journal_io;
+	char				*journal_name;
+
+	/* New block range allocation hooks */
+	errcode_t (*new_range)(ext2_filsys fs, int flags, blk64_t goal,
+			       blk64_t len, blk64_t *pblk, blk64_t *plen);
+	void (*block_alloc_stats_range)(ext2_filsys fs, blk64_t blk, blk_t num,
+					int inuse);
+
+	/* hashmap for SHA of data blocks */
+	struct ext2fs_hashmap* block_sha_map;
+
+	const struct ext2fs_nls_table *encoding;
+};
+
+#if EXT2_FLAT_INCLUDES
+#include "e2_bitops.h"
+#else
+#include <ext2fs/bitops.h>
+#endif
+
+/*
+ * 64-bit bitmap backend types
+ */
+#define EXT2FS_BMAP64_BITARRAY	1
+#define EXT2FS_BMAP64_RBTREE	2
+#define EXT2FS_BMAP64_AUTODIR	3
+
+/*
+ * Return flags for the block iterator functions
+ */
+#define BLOCK_CHANGED			1
+#define BLOCK_ABORT			2
+#define BLOCK_ERROR			4
+#define BLOCK_INLINE_DATA_CHANGED	8
+
+/*
+ * Block iterate flags
+ *
+ * BLOCK_FLAG_APPEND, or BLOCK_FLAG_HOLE, indicates that the iterator
+ * function should be called on blocks where the block number is zero.
+ * This is used by ext2fs_expand_dir() to be able to add a new block
+ * to an inode.  It can also be used for programs that want to be able
+ * to deal with files that contain "holes".
+ *
+ * BLOCK_FLAG_DEPTH_TRAVERSE indicates that the iterator function for
+ * the indirect, doubly indirect, etc. blocks should be called after
+ * all of the blocks contained in the indirect blocks are processed.
+ * This is useful if you are going to be deallocating blocks from an
+ * inode.
+ *
+ * BLOCK_FLAG_DATA_ONLY indicates that the iterator function should be
+ * called for data blocks only.
+ *
+ * BLOCK_FLAG_READ_ONLY is a promise by the caller that it will not
+ * modify returned block number.
+ *
+ * BLOCK_FLAG_NO_LARGE is for internal use only.  It informs
+ * ext2fs_block_iterate2 that large files won't be accepted.
+ */
+#define BLOCK_FLAG_APPEND	1
+#define BLOCK_FLAG_HOLE		1
+#define BLOCK_FLAG_DEPTH_TRAVERSE	2
+#define BLOCK_FLAG_DATA_ONLY	4
+#define BLOCK_FLAG_READ_ONLY	8
+
+#define BLOCK_FLAG_NO_LARGE	0x1000
+
+/*
+ * Magic "block count" return values for the block iterator function.
+ */
+#define BLOCK_COUNT_IND		(-1)
+#define BLOCK_COUNT_DIND	(-2)
+#define BLOCK_COUNT_TIND	(-3)
+#define BLOCK_COUNT_TRANSLATOR	(-4)
+
+#define BLOCK_ALLOC_UNKNOWN	0
+#define BLOCK_ALLOC_DATA	1
+#define BLOCK_ALLOC_METADATA	2
+
+struct blk_alloc_ctx {
+	ext2_ino_t		ino;
+	struct ext2_inode	*inode;
+	blk64_t			lblk;
+	int			flags;
+};
+
+#if 0
+/*
+ * Flags for ext2fs_move_blocks
+ */
+#define EXT2_BMOVE_GET_DBLIST	0x0001
+#define EXT2_BMOVE_DEBUG	0x0002
+#endif
+
+/*
+ * Generic (non-filesystem layout specific) extents structure
+ */
+
+#define EXT2_EXTENT_FLAGS_LEAF		0x0001
+#define EXT2_EXTENT_FLAGS_UNINIT	0x0002
+#define EXT2_EXTENT_FLAGS_SECOND_VISIT	0x0004
+
+struct ext2fs_extent {
+	blk64_t	e_pblk;		/* first physical block */
+	blk64_t	e_lblk;		/* first logical block extent covers */
+	__u32	e_len;		/* number of blocks covered by extent */
+	__u32	e_flags;	/* extent flags */
+};
+
+typedef struct ext2_extent_handle *ext2_extent_handle_t;
+typedef struct ext2_extent_path *ext2_extent_path_t;
+
+/*
+ * Flags used by ext2fs_extent_get()
+ */
+#define EXT2_EXTENT_CURRENT	0x0000
+#define EXT2_EXTENT_MOVE_MASK	0x000F
+#define EXT2_EXTENT_ROOT	0x0001
+#define EXT2_EXTENT_LAST_LEAF	0x0002
+#define EXT2_EXTENT_FIRST_SIB	0x0003
+#define EXT2_EXTENT_LAST_SIB	0x0004
+#define EXT2_EXTENT_NEXT_SIB	0x0005
+#define EXT2_EXTENT_PREV_SIB	0x0006
+#define EXT2_EXTENT_NEXT_LEAF	0x0007
+#define EXT2_EXTENT_PREV_LEAF	0x0008
+#define EXT2_EXTENT_NEXT	0x0009
+#define EXT2_EXTENT_PREV	0x000A
+#define EXT2_EXTENT_UP		0x000B
+#define EXT2_EXTENT_DOWN	0x000C
+#define EXT2_EXTENT_DOWN_AND_LAST 0x000D
+
+/*
+ * Flags used by ext2fs_extent_insert()
+ */
+#define EXT2_EXTENT_INSERT_AFTER	0x0001 /* insert after handle loc'n */
+#define EXT2_EXTENT_INSERT_NOSPLIT	0x0002 /* insert may not cause split */
+
+/*
+ * Flags used by ext2fs_extent_delete()
+ */
+#define EXT2_EXTENT_DELETE_KEEP_EMPTY	0x001 /* keep node if last extent gone */
+
+/*
+ * Flags used by ext2fs_extent_set_bmap()
+ */
+#define EXT2_EXTENT_SET_BMAP_UNINIT	0x0001
+
+/*
+ * Data structure returned by ext2fs_extent_get_info()
+ */
+struct ext2_extent_info {
+	int		curr_entry;
+	int		curr_level;
+	int		num_entries;
+	int		max_entries;
+	int		max_depth;
+	int		bytes_avail;
+	blk64_t		max_lblk;
+	blk64_t		max_pblk;
+	__u32		max_len;
+	__u32		max_uninit_len;
+};
+
+/*
+ * Flags for directory block reading and writing functions
+ */
+#define EXT2_DIRBLOCK_V2_STRUCT	0x0001
+
+/*
+ * Return flags for the directory iterator functions
+ */
+#define DIRENT_CHANGED	1
+#define DIRENT_ABORT	2
+#define DIRENT_ERROR	3
+
+/*
+ * Directory iterator flags
+ */
+
+#define DIRENT_FLAG_INCLUDE_EMPTY	1
+#define DIRENT_FLAG_INCLUDE_REMOVED	2
+#define DIRENT_FLAG_INCLUDE_CSUM	4
+#define DIRENT_FLAG_INCLUDE_INLINE_DATA 8
+
+#define DIRENT_DOT_FILE		1
+#define DIRENT_DOT_DOT_FILE	2
+#define DIRENT_OTHER_FILE	3
+#define DIRENT_DELETED_FILE	4
+#define DIRENT_CHECKSUM		5
+
+/*
+ * Inode scan definitions
+ */
+typedef struct ext2_struct_inode_scan *ext2_inode_scan;
+
+/*
+ * ext2fs_scan flags
+ */
+#define EXT2_SF_CHK_BADBLOCKS	0x0001
+#define EXT2_SF_BAD_INODE_BLK	0x0002
+#define EXT2_SF_BAD_EXTRA_BYTES	0x0004
+#define EXT2_SF_SKIP_MISSING_ITABLE	0x0008
+#define EXT2_SF_DO_LAZY		0x0010
+#define EXT2_SF_WARN_GARBAGE_INODES	0x0020
+
+/*
+ * ext2fs_check_if_mounted flags
+ */
+#define EXT2_MF_MOUNTED		1
+#define EXT2_MF_ISROOT		2
+#define EXT2_MF_READONLY	4
+#define EXT2_MF_SWAP		8
+#define EXT2_MF_BUSY		16
+#define EXT2_MF_EXTFS		32
+
+/*
+ * Ext2/linux mode flags.  We define them here so that we don't need
+ * to depend on the OS's sys/stat.h, since we may be compiling on a
+ * non-Linux system.
+ */
+#define LINUX_S_IFMT  00170000
+#define LINUX_S_IFSOCK 0140000
+#define LINUX_S_IFLNK	 0120000
+#define LINUX_S_IFREG  0100000
+#define LINUX_S_IFBLK  0060000
+#define LINUX_S_IFDIR  0040000
+#define LINUX_S_IFCHR  0020000
+#define LINUX_S_IFIFO  0010000
+#define LINUX_S_ISUID  0004000
+#define LINUX_S_ISGID  0002000
+#define LINUX_S_ISVTX  0001000
+
+#define LINUX_S_IRWXU 00700
+#define LINUX_S_IRUSR 00400
+#define LINUX_S_IWUSR 00200
+#define LINUX_S_IXUSR 00100
+
+#define LINUX_S_IRWXG 00070
+#define LINUX_S_IRGRP 00040
+#define LINUX_S_IWGRP 00020
+#define LINUX_S_IXGRP 00010
+
+#define LINUX_S_IRWXO 00007
+#define LINUX_S_IROTH 00004
+#define LINUX_S_IWOTH 00002
+#define LINUX_S_IXOTH 00001
+
+#define LINUX_S_ISLNK(m)	(((m) & LINUX_S_IFMT) == LINUX_S_IFLNK)
+#define LINUX_S_ISREG(m)	(((m) & LINUX_S_IFMT) == LINUX_S_IFREG)
+#define LINUX_S_ISDIR(m)	(((m) & LINUX_S_IFMT) == LINUX_S_IFDIR)
+#define LINUX_S_ISCHR(m)	(((m) & LINUX_S_IFMT) == LINUX_S_IFCHR)
+#define LINUX_S_ISBLK(m)	(((m) & LINUX_S_IFMT) == LINUX_S_IFBLK)
+#define LINUX_S_ISFIFO(m)	(((m) & LINUX_S_IFMT) == LINUX_S_IFIFO)
+#define LINUX_S_ISSOCK(m)	(((m) & LINUX_S_IFMT) == LINUX_S_IFSOCK)
+
+/*
+ * ext2 size of an inode
+ */
+#define EXT2_I_SIZE(i)	((i)->i_size | ((__u64) (i)->i_size_high << 32))
+
+/*
+ * ext2_icount_t abstraction
+ */
+#define EXT2_ICOUNT_OPT_INCREMENT	0x01
+#define EXT2_ICOUNT_OPT_FULLMAP		0x02
+
+typedef struct ext2_icount *ext2_icount_t;
+
+/*
+ * Flags for ext2fs_bmap
+ */
+#define BMAP_ALLOC	0x0001
+#define BMAP_SET	0x0002
+#define BMAP_UNINIT	0x0004
+#define BMAP_ZERO	0x0008
+
+/*
+ * Returned flags from ext2fs_bmap
+ */
+#define BMAP_RET_UNINIT	0x0001
+
+/*
+ * Flags for ext2fs_read_inode2
+ */
+#define READ_INODE_NOCSUM	0x0001
+
+/*
+ * Flags for ext2fs_write_inode2
+ */
+#define WRITE_INODE_NOCSUM	0x0001
+
+/*
+ * Flags for imager.c functions
+ */
+#define IMAGER_FLAG_INODEMAP	1
+#define IMAGER_FLAG_SPARSEWRITE	2
+
+/*
+ * For checking structure magic numbers...
+ */
+
+#define EXT2_CHECK_MAGIC(struct, code) \
+	  if ((struct)->magic != (code)) return (code)
+
+/*
+ * Features supported by this version of the library
+ */
+#define EXT2_LIB_FEATURE_COMPAT_SUPP	(EXT2_FEATURE_COMPAT_DIR_PREALLOC|\
+					 EXT2_FEATURE_COMPAT_IMAGIC_INODES|\
+					 EXT3_FEATURE_COMPAT_HAS_JOURNAL|\
+					 EXT2_FEATURE_COMPAT_RESIZE_INODE|\
+					 EXT2_FEATURE_COMPAT_DIR_INDEX|\
+					 EXT2_FEATURE_COMPAT_EXT_ATTR|\
+					 EXT4_FEATURE_COMPAT_SPARSE_SUPER2|\
+					 EXT4_FEATURE_COMPAT_FAST_COMMIT|\
+					 EXT4_FEATURE_COMPAT_STABLE_INODES|\
+					 EXT4_FEATURE_COMPAT_ORPHAN_FILE)
+
+#ifdef CONFIG_MMP
+#define EXT4_LIB_INCOMPAT_MMP		EXT4_FEATURE_INCOMPAT_MMP
+#else
+#define EXT4_LIB_INCOMPAT_MMP		(0)
+#endif
+
+#define EXT2_LIB_FEATURE_INCOMPAT_SUPP	(EXT2_FEATURE_INCOMPAT_FILETYPE|\
+					 EXT3_FEATURE_INCOMPAT_JOURNAL_DEV|\
+					 EXT2_FEATURE_INCOMPAT_META_BG|\
+					 EXT3_FEATURE_INCOMPAT_RECOVER|\
+					 EXT3_FEATURE_INCOMPAT_EXTENTS|\
+					 EXT4_FEATURE_INCOMPAT_FLEX_BG|\
+					 EXT4_FEATURE_INCOMPAT_EA_INODE|\
+					 EXT4_LIB_INCOMPAT_MMP|\
+					 EXT4_FEATURE_INCOMPAT_64BIT|\
+					 EXT4_FEATURE_INCOMPAT_INLINE_DATA|\
+					 EXT4_FEATURE_INCOMPAT_ENCRYPT|\
+					 EXT4_FEATURE_INCOMPAT_CASEFOLD|\
+					 EXT4_FEATURE_INCOMPAT_CSUM_SEED|\
+					 EXT4_FEATURE_INCOMPAT_LARGEDIR)
+
+#define EXT2_LIB_FEATURE_RO_COMPAT_SUPP	(EXT2_FEATURE_RO_COMPAT_SPARSE_SUPER|\
+					 EXT4_FEATURE_RO_COMPAT_HUGE_FILE|\
+					 EXT2_FEATURE_RO_COMPAT_LARGE_FILE|\
+					 EXT4_FEATURE_RO_COMPAT_DIR_NLINK|\
+					 EXT4_FEATURE_RO_COMPAT_EXTRA_ISIZE|\
+					 EXT4_FEATURE_RO_COMPAT_GDT_CSUM|\
+					 EXT4_FEATURE_RO_COMPAT_BIGALLOC|\
+					 EXT4_FEATURE_RO_COMPAT_QUOTA|\
+					 EXT4_FEATURE_RO_COMPAT_METADATA_CSUM|\
+					 EXT4_FEATURE_RO_COMPAT_READONLY |\
+					 EXT4_FEATURE_RO_COMPAT_PROJECT |\
+					 EXT4_FEATURE_RO_COMPAT_SHARED_BLOCKS |\
+					 EXT4_FEATURE_RO_COMPAT_VERITY |\
+					 EXT4_FEATURE_RO_COMPAT_ORPHAN_PRESENT)
+
+/*
+ * These features are only allowed if EXT2_FLAG_SOFTSUPP_FEATURES is passed
+ * to ext2fs_openfs()
+ */
+#define EXT2_LIB_SOFTSUPP_INCOMPAT	(0)
+#define EXT2_LIB_SOFTSUPP_RO_COMPAT	(EXT4_FEATURE_RO_COMPAT_REPLICA)
+
+
+/* Translate a block number to a cluster number */
+#define EXT2FS_CLUSTER_RATIO(fs)	(1 << (fs)->cluster_ratio_bits)
+#define EXT2FS_CLUSTER_MASK(fs)		(EXT2FS_CLUSTER_RATIO(fs) - 1)
+#define EXT2FS_B2C(fs, blk)		((blk) >> (fs)->cluster_ratio_bits)
+/* Translate a cluster number to a block number */
+#define EXT2FS_C2B(fs, cluster)		((cluster) << (fs)->cluster_ratio_bits)
+/* Translate # of blks to # of clusters */
+#define EXT2FS_NUM_B2C(fs, blks)	(((blks) + EXT2FS_CLUSTER_MASK(fs)) >> \
+					 (fs)->cluster_ratio_bits)
+
+#if defined(HAVE_FSTAT64) && !defined(__OSX_AVAILABLE_BUT_DEPRECATED)
+typedef struct stat64 ext2fs_struct_stat;
+#else
+typedef struct stat ext2fs_struct_stat;
+#endif
+
+/*
+ * For ext2fs_close2() and ext2fs_flush2(), this flag allows you to
+ * avoid the fsync call.
+ */
+#define EXT2_FLAG_FLUSH_NO_SYNC          1
+
+/*
+ * Modify and iterate extended attributes
+ */
+struct ext2_xattr_handle;
+#define XATTR_ABORT	1
+#define XATTR_CHANGED	2
+
+/*
+ * flags for ext2fs_rw_bitmaps()
+ */
+#define EXT2FS_BITMAPS_WRITE		0x0001
+#define EXT2FS_BITMAPS_BLOCK		0x0002
+#define EXT2FS_BITMAPS_INODE		0x0004
+#define EXT2FS_BITMAPS_VALID_FLAGS	0x0007
+
+/*
+ * function prototypes
+ */
+static inline int ext2fs_has_group_desc_csum(ext2_filsys fs)
+{
+	return ext2fs_has_feature_metadata_csum(fs->super) ||
+	       ext2fs_has_feature_gdt_csum(fs->super);
+}
+
+/* The LARGE_FILE feature should be set if we have stored files 2GB+ in size */
+static inline int ext2fs_needs_large_file_feature(unsigned long long file_size)
+{
+	return file_size >= 0x80000000ULL;
+}
+
+/* alloc.c */
+extern void ext2fs_clear_block_uninit(ext2_filsys fs, dgrp_t group);
+extern errcode_t ext2fs_new_inode(ext2_filsys fs, ext2_ino_t dir, int mode,
+				  ext2fs_inode_bitmap map, ext2_ino_t *ret);
+extern errcode_t ext2fs_new_block(ext2_filsys fs, blk_t goal,
+				  ext2fs_block_bitmap map, blk_t *ret);
+extern errcode_t ext2fs_new_block2(ext2_filsys fs, blk64_t goal,
+				   ext2fs_block_bitmap map, blk64_t *ret);
+extern errcode_t ext2fs_new_block3(ext2_filsys fs, blk64_t goal,
+				   ext2fs_block_bitmap map, blk64_t *ret,
+				   struct blk_alloc_ctx *ctx);
+extern errcode_t ext2fs_get_free_blocks(ext2_filsys fs, blk_t start,
+					blk_t finish, int num,
+					ext2fs_block_bitmap map,
+					blk_t *ret);
+extern errcode_t ext2fs_get_free_blocks2(ext2_filsys fs, blk64_t start,
+					 blk64_t finish, int num,
+					 ext2fs_block_bitmap map,
+					 blk64_t *ret);
+extern errcode_t ext2fs_alloc_block(ext2_filsys fs, blk_t goal,
+				    char *block_buf, blk_t *ret);
+extern errcode_t ext2fs_alloc_block2(ext2_filsys fs, blk64_t goal,
+				     char *block_buf, blk64_t *ret);
+extern errcode_t ext2fs_alloc_block3(ext2_filsys fs, blk64_t goal,
+				     char *block_buf, blk64_t *ret,
+				     struct blk_alloc_ctx *ctx);
+
+extern void ext2fs_set_alloc_block_callback(ext2_filsys fs,
+					    errcode_t (*func)(ext2_filsys fs,
+							      blk64_t goal,
+							      blk64_t *ret),
+					    errcode_t (**old)(ext2_filsys fs,
+							      blk64_t goal,
+							      blk64_t *ret));
+blk64_t ext2fs_find_inode_goal(ext2_filsys fs, ext2_ino_t ino,
+			       struct ext2_inode *inode, blk64_t lblk);
+extern void ext2fs_set_new_range_callback(ext2_filsys fs,
+	errcode_t (*func)(ext2_filsys fs, int flags, blk64_t goal,
+			       blk64_t len, blk64_t *pblk, blk64_t *plen),
+	errcode_t (**old)(ext2_filsys fs, int flags, blk64_t goal,
+			       blk64_t len, blk64_t *pblk, blk64_t *plen));
+extern void ext2fs_set_block_alloc_stats_range_callback(ext2_filsys fs,
+	void (*func)(ext2_filsys fs, blk64_t blk,
+				    blk_t num, int inuse),
+	void (**old)(ext2_filsys fs, blk64_t blk,
+				    blk_t num, int inuse));
+#define EXT2_NEWRANGE_FIXED_GOAL	(0x1)
+#define EXT2_NEWRANGE_MIN_LENGTH	(0x2)
+#define EXT2_NEWRANGE_ALL_FLAGS		(0x3)
+errcode_t ext2fs_new_range(ext2_filsys fs, int flags, blk64_t goal,
+			   blk64_t len, ext2fs_block_bitmap map, blk64_t *pblk,
+			   blk64_t *plen);
+#define EXT2_ALLOCRANGE_FIXED_GOAL	(0x1)
+#define EXT2_ALLOCRANGE_ZERO_BLOCKS	(0x2)
+#define EXT2_ALLOCRANGE_ALL_FLAGS	(0x3)
+errcode_t ext2fs_alloc_range(ext2_filsys fs, int flags, blk64_t goal,
+			     blk_t len, blk64_t *ret);
+
+/* alloc_sb.c */
+extern int ext2fs_reserve_super_and_bgd(ext2_filsys fs,
+					dgrp_t group,
+					ext2fs_block_bitmap bmap);
+extern void ext2fs_set_block_alloc_stats_callback(ext2_filsys fs,
+						  void (*func)(ext2_filsys fs,
+							       blk64_t blk,
+							       int inuse),
+						  void (**old)(ext2_filsys fs,
+							       blk64_t blk,
+							       int inuse));
+
+/* alloc_stats.c */
+void ext2fs_inode_alloc_stats(ext2_filsys fs, ext2_ino_t ino, int inuse);
+void ext2fs_inode_alloc_stats2(ext2_filsys fs, ext2_ino_t ino,
+			       int inuse, int isdir);
+void ext2fs_block_alloc_stats(ext2_filsys fs, blk_t blk, int inuse);
+void ext2fs_block_alloc_stats2(ext2_filsys fs, blk64_t blk, int inuse);
+void ext2fs_block_alloc_stats_range(ext2_filsys fs, blk64_t blk,
+				    blk_t num, int inuse);
+
+/* alloc_tables.c */
+extern errcode_t ext2fs_allocate_tables(ext2_filsys fs);
+extern errcode_t ext2fs_allocate_group_table(ext2_filsys fs, dgrp_t group,
+					     ext2fs_block_bitmap bmap);
+
+/* badblocks.c */
+extern errcode_t ext2fs_u32_list_create(ext2_u32_list *ret, int size);
+extern errcode_t ext2fs_u32_list_add(ext2_u32_list bb, __u32 blk);
+extern int ext2fs_u32_list_find(ext2_u32_list bb, __u32 blk);
+extern int ext2fs_u32_list_test(ext2_u32_list bb, blk_t blk);
+extern errcode_t ext2fs_u32_list_iterate_begin(ext2_u32_list bb,
+					       ext2_u32_iterate *ret);
+extern int ext2fs_u32_list_iterate(ext2_u32_iterate iter, blk_t *blk);
+extern void ext2fs_u32_list_iterate_end(ext2_u32_iterate iter);
+extern errcode_t ext2fs_u32_copy(ext2_u32_list src, ext2_u32_list *dest);
+extern int ext2fs_u32_list_equal(ext2_u32_list bb1, ext2_u32_list bb2);
+
+extern errcode_t ext2fs_badblocks_list_create(ext2_badblocks_list *ret,
+					    int size);
+extern errcode_t ext2fs_badblocks_list_add(ext2_badblocks_list bb,
+					   blk_t blk);
+extern int ext2fs_badblocks_list_test(ext2_badblocks_list bb,
+				    blk_t blk);
+extern int ext2fs_u32_list_del(ext2_u32_list bb, __u32 blk);
+extern void ext2fs_badblocks_list_del(ext2_u32_list bb, __u32 blk);
+extern errcode_t
+	ext2fs_badblocks_list_iterate_begin(ext2_badblocks_list bb,
+					    ext2_badblocks_iterate *ret);
+extern int ext2fs_badblocks_list_iterate(ext2_badblocks_iterate iter,
+					 blk_t *blk);
+extern void ext2fs_badblocks_list_iterate_end(ext2_badblocks_iterate iter);
+extern errcode_t ext2fs_badblocks_copy(ext2_badblocks_list src,
+				       ext2_badblocks_list *dest);
+extern int ext2fs_badblocks_equal(ext2_badblocks_list bb1,
+				  ext2_badblocks_list bb2);
+extern int ext2fs_u32_list_count(ext2_u32_list bb);
+
+/* bb_compat */
+extern errcode_t badblocks_list_create(badblocks_list *ret, int size);
+extern errcode_t badblocks_list_add(badblocks_list bb, blk_t blk);
+extern int badblocks_list_test(badblocks_list bb, blk_t blk);
+extern errcode_t badblocks_list_iterate_begin(badblocks_list bb,
+					      badblocks_iterate *ret);
+extern int badblocks_list_iterate(badblocks_iterate iter, blk_t *blk);
+extern void badblocks_list_iterate_end(badblocks_iterate iter);
+extern void badblocks_list_free(badblocks_list bb);
+
+/* bb_inode.c */
+extern errcode_t ext2fs_update_bb_inode(ext2_filsys fs,
+					ext2_badblocks_list bb_list);
+
+/* bitmaps.c */
+extern void ext2fs_free_block_bitmap(ext2fs_block_bitmap bitmap);
+extern void ext2fs_free_inode_bitmap(ext2fs_inode_bitmap bitmap);
+extern errcode_t ext2fs_copy_bitmap(ext2fs_generic_bitmap src,
+				    ext2fs_generic_bitmap *dest);
+extern errcode_t ext2fs_allocate_block_bitmap(ext2_filsys fs,
+					      const char *descr,
+					      ext2fs_block_bitmap *ret);
+extern errcode_t ext2fs_allocate_subcluster_bitmap(ext2_filsys fs,
+						   const char *descr,
+						   ext2fs_block_bitmap *ret);
+extern int ext2fs_get_bitmap_granularity(ext2fs_block_bitmap bitmap);
+extern errcode_t ext2fs_allocate_inode_bitmap(ext2_filsys fs,
+					      const char *descr,
+					      ext2fs_inode_bitmap *ret);
+extern errcode_t ext2fs_fudge_inode_bitmap_end(ext2fs_inode_bitmap bitmap,
+					       ext2_ino_t end, ext2_ino_t *oend);
+extern errcode_t ext2fs_fudge_block_bitmap_end(ext2fs_block_bitmap bitmap,
+					       blk_t end, blk_t *oend);
+extern errcode_t ext2fs_fudge_block_bitmap_end2(ext2fs_block_bitmap bitmap,
+					 blk64_t end, blk64_t *oend);
+extern void ext2fs_clear_inode_bitmap(ext2fs_inode_bitmap bitmap);
+extern void ext2fs_clear_block_bitmap(ext2fs_block_bitmap bitmap);
+extern errcode_t ext2fs_resize_inode_bitmap(__u32 new_end, __u32 new_real_end,
+					    ext2fs_inode_bitmap bmap);
+extern errcode_t ext2fs_resize_inode_bitmap2(__u64 new_end,
+					     __u64 new_real_end,
+					     ext2fs_inode_bitmap bmap);
+extern errcode_t ext2fs_resize_block_bitmap(__u32 new_end, __u32 new_real_end,
+					    ext2fs_block_bitmap bmap);
+extern errcode_t ext2fs_resize_block_bitmap2(__u64 new_end,
+					     __u64 new_real_end,
+					     ext2fs_block_bitmap bmap);
+extern errcode_t ext2fs_compare_block_bitmap(ext2fs_block_bitmap bm1,
+					     ext2fs_block_bitmap bm2);
+extern errcode_t ext2fs_compare_inode_bitmap(ext2fs_inode_bitmap bm1,
+					     ext2fs_inode_bitmap bm2);
+extern errcode_t ext2fs_set_inode_bitmap_range(ext2fs_inode_bitmap bmap,
+					ext2_ino_t start, unsigned int num,
+					void *in);
+extern errcode_t ext2fs_set_inode_bitmap_range2(ext2fs_inode_bitmap bmap,
+					 __u64 start, size_t num,
+					 void *in);
+extern errcode_t ext2fs_get_inode_bitmap_range(ext2fs_inode_bitmap bmap,
+					ext2_ino_t start, unsigned int num,
+					void *out);
+extern errcode_t ext2fs_get_inode_bitmap_range2(ext2fs_inode_bitmap bmap,
+					 __u64 start, size_t num,
+					 void *out);
+extern errcode_t ext2fs_set_block_bitmap_range(ext2fs_block_bitmap bmap,
+					blk_t start, unsigned int num,
+					void *in);
+extern errcode_t ext2fs_set_block_bitmap_range2(ext2fs_block_bitmap bmap,
+					 blk64_t start, size_t num,
+					 void *in);
+extern errcode_t ext2fs_get_block_bitmap_range(ext2fs_block_bitmap bmap,
+					blk_t start, unsigned int num,
+					void *out);
+extern errcode_t ext2fs_get_block_bitmap_range2(ext2fs_block_bitmap bmap,
+					 blk64_t start, size_t num,
+					 void *out);
+
+/* blknum.c */
+extern __u32 ext2fs_inode_bitmap_checksum(ext2_filsys fs, dgrp_t group);
+extern __u32 ext2fs_block_bitmap_checksum(ext2_filsys fs, dgrp_t group);
+extern dgrp_t ext2fs_group_of_blk2(ext2_filsys fs, blk64_t);
+extern blk64_t ext2fs_group_first_block2(ext2_filsys fs, dgrp_t group);
+extern blk64_t ext2fs_group_last_block2(ext2_filsys fs, dgrp_t group);
+extern int ext2fs_group_blocks_count(ext2_filsys fs, dgrp_t group);
+extern blk64_t ext2fs_inode_data_blocks2(ext2_filsys fs,
+					 struct ext2_inode *inode);
+extern blk64_t ext2fs_inode_i_blocks(ext2_filsys fs,
+				     struct ext2_inode *inode);
+extern blk64_t ext2fs_get_stat_i_blocks(ext2_filsys fs,
+					struct ext2_inode *inode);
+extern blk64_t ext2fs_blocks_count(struct ext2_super_block *super);
+extern void ext2fs_blocks_count_set(struct ext2_super_block *super,
+				    blk64_t blk);
+extern void ext2fs_blocks_count_add(struct ext2_super_block *super,
+				    blk64_t blk);
+extern blk64_t ext2fs_r_blocks_count(struct ext2_super_block *super);
+extern void ext2fs_r_blocks_count_set(struct ext2_super_block *super,
+				      blk64_t blk);
+extern void ext2fs_r_blocks_count_add(struct ext2_super_block *super,
+				      blk64_t blk);
+extern blk64_t ext2fs_free_blocks_count(struct ext2_super_block *super);
+extern void ext2fs_free_blocks_count_set(struct ext2_super_block *super,
+					 blk64_t blk);
+extern void ext2fs_free_blocks_count_add(struct ext2_super_block *super,
+					 blk64_t blk);
+/* Block group descriptor accessor functions */
+extern struct ext2_group_desc *ext2fs_group_desc(ext2_filsys fs,
+					  struct opaque_ext2_group_desc *gdp,
+					  dgrp_t group);
+extern blk64_t ext2fs_block_bitmap_csum(ext2_filsys fs, dgrp_t group);
+extern blk64_t ext2fs_block_bitmap_loc(ext2_filsys fs, dgrp_t group);
+extern void ext2fs_block_bitmap_loc_set(ext2_filsys fs, dgrp_t group,
+					blk64_t blk);
+extern __u32 ext2fs_inode_bitmap_csum(ext2_filsys fs, dgrp_t group);
+extern blk64_t ext2fs_inode_bitmap_loc(ext2_filsys fs, dgrp_t group);
+extern void ext2fs_inode_bitmap_loc_set(ext2_filsys fs, dgrp_t group,
+					blk64_t blk);
+extern blk64_t ext2fs_inode_table_loc(ext2_filsys fs, dgrp_t group);
+extern void ext2fs_inode_table_loc_set(ext2_filsys fs, dgrp_t group,
+				       blk64_t blk);
+extern __u32 ext2fs_bg_free_blocks_count(ext2_filsys fs, dgrp_t group);
+extern void ext2fs_bg_free_blocks_count_set(ext2_filsys fs, dgrp_t group,
+					 __u32 n);
+extern __u32 ext2fs_bg_free_inodes_count(ext2_filsys fs, dgrp_t group);
+extern void ext2fs_bg_free_inodes_count_set(ext2_filsys fs, dgrp_t group,
+					 __u32 n);
+extern __u32 ext2fs_bg_used_dirs_count(ext2_filsys fs, dgrp_t group);
+extern void ext2fs_bg_used_dirs_count_set(ext2_filsys fs, dgrp_t group,
+				       __u32 n);
+extern __u32 ext2fs_bg_itable_unused(ext2_filsys fs, dgrp_t group);
+extern void ext2fs_bg_itable_unused_set(ext2_filsys fs, dgrp_t group,
+				     __u32 n);
+extern __u16 ext2fs_bg_flags(ext2_filsys fs, dgrp_t group);
+extern void ext2fs_bg_flags_zap(ext2_filsys fs, dgrp_t group);
+extern int ext2fs_bg_flags_test(ext2_filsys fs, dgrp_t group, __u16 bg_flag);
+extern void ext2fs_bg_flags_set(ext2_filsys fs, dgrp_t group, __u16 bg_flags);
+extern void ext2fs_bg_flags_clear(ext2_filsys fs, dgrp_t group, __u16 bg_flags);
+extern __u16 ext2fs_bg_checksum(ext2_filsys fs, dgrp_t group);
+extern void ext2fs_bg_checksum_set(ext2_filsys fs, dgrp_t group, __u16 checksum);
+extern blk64_t ext2fs_file_acl_block(ext2_filsys fs,
+				     const struct ext2_inode *inode);
+extern void ext2fs_file_acl_block_set(ext2_filsys fs,
+				      struct ext2_inode *inode, blk64_t blk);
+extern errcode_t ext2fs_inode_size_set(ext2_filsys fs, struct ext2_inode *inode,
+				       ext2_off64_t size);
+
+/* block.c */
+extern errcode_t ext2fs_block_iterate(ext2_filsys fs,
+				      ext2_ino_t	ino,
+				      int	flags,
+				      char *block_buf,
+				      int (*func)(ext2_filsys fs,
+						  blk_t	*blocknr,
+						  int	blockcnt,
+						  void	*priv_data),
+				      void *priv_data);
+errcode_t ext2fs_block_iterate2(ext2_filsys fs,
+				ext2_ino_t	ino,
+				int	flags,
+				char *block_buf,
+				int (*func)(ext2_filsys fs,
+					    blk_t	*blocknr,
+					    e2_blkcnt_t	blockcnt,
+					    blk_t	ref_blk,
+					    int		ref_offset,
+					    void	*priv_data),
+				void *priv_data);
+errcode_t ext2fs_block_iterate3(ext2_filsys fs,
+				ext2_ino_t ino,
+				int	flags,
+				char *block_buf,
+				int (*func)(ext2_filsys fs,
+					    blk64_t	*blocknr,
+					    e2_blkcnt_t	blockcnt,
+					    blk64_t	ref_blk,
+					    int		ref_offset,
+					    void	*priv_data),
+				void *priv_data);
+
+/* bmap.c */
+extern errcode_t ext2fs_bmap(ext2_filsys fs, ext2_ino_t ino,
+			     struct ext2_inode *inode,
+			     char *block_buf, int bmap_flags,
+			     blk_t block, blk_t *phys_blk);
+extern errcode_t ext2fs_bmap2(ext2_filsys fs, ext2_ino_t ino,
+			      struct ext2_inode *inode,
+			      char *block_buf, int bmap_flags, blk64_t block,
+			      int *ret_flags, blk64_t *phys_blk);
+errcode_t ext2fs_map_cluster_block(ext2_filsys fs, ext2_ino_t ino,
+				   struct ext2_inode *inode, blk64_t lblk,
+				   blk64_t *pblk);
+
+#if 0
+/* bmove.c */
+extern errcode_t ext2fs_move_blocks(ext2_filsys fs,
+				    ext2fs_block_bitmap reserve,
+				    ext2fs_block_bitmap alloc_map,
+				    int flags);
+#endif
+
+/* check_desc.c */
+extern errcode_t ext2fs_check_desc(ext2_filsys fs);
+
+/* closefs.c */
+extern errcode_t ext2fs_close(ext2_filsys fs);
+extern errcode_t ext2fs_close2(ext2_filsys fs, int flags);
+extern errcode_t ext2fs_close_free(ext2_filsys *fs);
+extern errcode_t ext2fs_flush(ext2_filsys fs);
+extern errcode_t ext2fs_flush2(ext2_filsys fs, int flags);
+extern int ext2fs_bg_has_super(ext2_filsys fs, dgrp_t group_block);
+extern errcode_t ext2fs_super_and_bgd_loc2(ext2_filsys fs,
+				    dgrp_t group,
+				    blk64_t *ret_super_blk,
+				    blk64_t *ret_old_desc_blk,
+				    blk64_t *ret_new_desc_blk,
+				    blk_t *ret_used_blks);
+extern int ext2fs_super_and_bgd_loc(ext2_filsys fs,
+				    dgrp_t group,
+				    blk_t *ret_super_blk,
+				    blk_t *ret_old_desc_blk,
+				    blk_t *ret_new_desc_blk,
+				    int *ret_meta_bg);
+extern void ext2fs_update_dynamic_rev(ext2_filsys fs);
+
+/* crc32c.c */
+extern __u32 ext2fs_crc32_be(__u32 crc, unsigned char const *p, size_t len);
+extern __u32 ext2fs_crc32c_le(__u32 crc, unsigned char const *p, size_t len);
+
+/* csum.c */
+extern void ext2fs_init_csum_seed(ext2_filsys fs);
+extern errcode_t ext2fs_mmp_csum_set(ext2_filsys fs, struct mmp_struct *mmp);
+extern int ext2fs_mmp_csum_verify(ext2_filsys, struct mmp_struct *mmp);
+extern int ext2fs_verify_csum_type(ext2_filsys fs, struct ext2_super_block *sb);
+extern errcode_t ext2fs_superblock_csum_set(ext2_filsys fs,
+					    struct ext2_super_block *sb);
+extern int ext2fs_superblock_csum_verify(ext2_filsys fs,
+					 struct ext2_super_block *sb);
+extern errcode_t ext2fs_ext_attr_block_csum_set(ext2_filsys fs,
+					ext2_ino_t inum, blk64_t block,
+					struct ext2_ext_attr_header *hdr);
+extern int ext2fs_ext_attr_block_csum_verify(ext2_filsys fs, ext2_ino_t inum,
+					     blk64_t block,
+					     struct ext2_ext_attr_header *hdr);
+#define EXT2_DIRENT_TAIL(block, blocksize) \
+	((struct ext2_dir_entry_tail *)(((char *)(block)) + \
+	(blocksize) - sizeof(struct ext2_dir_entry_tail)))
+
+extern void ext2fs_initialize_dirent_tail(ext2_filsys fs,
+					  struct ext2_dir_entry_tail *t);
+extern int ext2fs_dirent_has_tail(ext2_filsys fs,
+				  struct ext2_dir_entry *dirent);
+extern int ext2fs_dirent_csum_verify(ext2_filsys fs, ext2_ino_t inum,
+				     struct ext2_dir_entry *dirent);
+extern int ext2fs_dir_block_csum_verify(ext2_filsys fs, ext2_ino_t inum,
+					struct ext2_dir_entry *dirent);
+extern errcode_t ext2fs_dir_block_csum_set(ext2_filsys fs, ext2_ino_t inum,
+					   struct ext2_dir_entry *dirent);
+extern errcode_t ext2fs_get_dx_countlimit(ext2_filsys fs,
+					  struct ext2_dir_entry *dirent,
+					  struct ext2_dx_countlimit **cc,
+					  int *offset);
+extern errcode_t ext2fs_dx_csum(ext2_filsys fs, ext2_ino_t inum,
+				struct ext2_dir_entry *dirent,
+				__u32 *crc, struct ext2_dx_tail **ret_t);
+extern errcode_t ext2fs_extent_block_csum_set(ext2_filsys fs,
+					      ext2_ino_t inum,
+					      struct ext3_extent_header *eh);
+extern int ext2fs_extent_block_csum_verify(ext2_filsys fs,
+					   ext2_ino_t inum,
+					   struct ext3_extent_header *eh);
+extern errcode_t ext2fs_block_bitmap_csum_set(ext2_filsys fs, dgrp_t group,
+					      char *bitmap, int size);
+extern int ext2fs_block_bitmap_csum_verify(ext2_filsys fs, dgrp_t group,
+					   char *bitmap, int size);
+extern errcode_t ext2fs_inode_bitmap_csum_set(ext2_filsys fs, dgrp_t group,
+					      char *bitmap, int size);
+extern int ext2fs_inode_bitmap_csum_verify(ext2_filsys fs, dgrp_t group,
+					   char *bitmap, int size);
+extern errcode_t ext2fs_inode_csum_set(ext2_filsys fs, ext2_ino_t inum,
+				       struct ext2_inode_large *inode);
+extern int ext2fs_inode_csum_verify(ext2_filsys fs, ext2_ino_t inum,
+				    struct ext2_inode_large *inode);
+extern void ext2fs_group_desc_csum_set(ext2_filsys fs, dgrp_t group);
+extern int ext2fs_group_desc_csum_verify(ext2_filsys fs, dgrp_t group);
+extern errcode_t ext2fs_set_gdt_csum(ext2_filsys fs);
+extern __u16 ext2fs_group_desc_csum(ext2_filsys fs, dgrp_t group);
+
+/* dblist.c */
+extern errcode_t ext2fs_init_dblist(ext2_filsys fs, ext2_dblist *ret_dblist);
+extern errcode_t ext2fs_add_dir_block(ext2_dblist dblist, ext2_ino_t ino,
+				      blk_t blk, int blockcnt);
+extern errcode_t ext2fs_add_dir_block2(ext2_dblist dblist, ext2_ino_t ino,
+				       blk64_t blk, e2_blkcnt_t blockcnt);
+extern void ext2fs_dblist_sort(ext2_dblist dblist,
+			       EXT2_QSORT_TYPE (*sortfunc)(const void *,
+							   const void *));
+extern void ext2fs_dblist_sort2(ext2_dblist dblist,
+				EXT2_QSORT_TYPE (*sortfunc)(const void *,
+							    const void *));
+extern errcode_t ext2fs_dblist_iterate(ext2_dblist dblist,
+	int (*func)(ext2_filsys fs, struct ext2_db_entry *db_info,
+		    void	*priv_data),
+	void *priv_data);
+extern errcode_t ext2fs_dblist_iterate2(ext2_dblist dblist,
+	int (*func)(ext2_filsys fs, struct ext2_db_entry2 *db_info,
+		    void	*priv_data),
+	void *priv_data);
+extern errcode_t ext2fs_dblist_iterate3(ext2_dblist dblist,
+	int (*func)(ext2_filsys fs, struct ext2_db_entry2 *db_info,
+		    void	*priv_data),
+	unsigned long long start,
+	unsigned long long count,
+	void *priv_data);
+extern errcode_t ext2fs_set_dir_block(ext2_dblist dblist, ext2_ino_t ino,
+				      blk_t blk, int blockcnt);
+extern errcode_t ext2fs_set_dir_block2(ext2_dblist dblist, ext2_ino_t ino,
+				       blk64_t blk, e2_blkcnt_t blockcnt);
+extern errcode_t ext2fs_copy_dblist(ext2_dblist src,
+				    ext2_dblist *dest);
+extern int ext2fs_dblist_count(ext2_dblist dblist);
+extern blk64_t ext2fs_dblist_count2(ext2_dblist dblist);
+extern errcode_t ext2fs_dblist_get_last(ext2_dblist dblist,
+					struct ext2_db_entry **entry);
+extern errcode_t ext2fs_dblist_get_last2(ext2_dblist dblist,
+					struct ext2_db_entry2 **entry);
+extern errcode_t ext2fs_dblist_drop_last(ext2_dblist dblist);
+
+/* dblist_dir.c */
+extern errcode_t
+	ext2fs_dblist_dir_iterate(ext2_dblist dblist,
+				  int	flags,
+				  char	*block_buf,
+				  int (*func)(ext2_ino_t	dir,
+					      int		entry,
+					      struct ext2_dir_entry *dirent,
+					      int	offset,
+					      int	blocksize,
+					      char	*buf,
+					      void	*priv_data),
+				  void *priv_data);
+
+#if 0
+/* digest_encode.c */
+#define EXT2FS_DIGEST_SIZE EXT2FS_SHA256_LENGTH
+extern int ext2fs_digest_encode(const char *src, int len, char *dst);
+extern int ext2fs_digest_decode(const char *src, int len, char *dst);
+#endif
+
+/* dirblock.c */
+extern errcode_t ext2fs_read_dir_block(ext2_filsys fs, blk_t block,
+				       void *buf);
+extern errcode_t ext2fs_read_dir_block2(ext2_filsys fs, blk_t block,
+					void *buf, int flags);
+extern errcode_t ext2fs_read_dir_block3(ext2_filsys fs, blk64_t block,
+					void *buf, int flags);
+extern errcode_t ext2fs_read_dir_block4(ext2_filsys fs, blk64_t block,
+					void *buf, int flags, ext2_ino_t ino);
+extern errcode_t ext2fs_write_dir_block(ext2_filsys fs, blk_t block,
+					void *buf);
+extern errcode_t ext2fs_write_dir_block2(ext2_filsys fs, blk_t block,
+					 void *buf, int flags);
+extern errcode_t ext2fs_write_dir_block3(ext2_filsys fs, blk64_t block,
+					 void *buf, int flags);
+extern errcode_t ext2fs_write_dir_block4(ext2_filsys fs, blk64_t block,
+					 void *buf, int flags, ext2_ino_t ino);
+
+/* dirhash.c */
+extern errcode_t ext2fs_dirhash(int version, const char *name, int len,
+				const __u32 *seed,
+				ext2_dirhash_t *ret_hash,
+				ext2_dirhash_t *ret_minor_hash);
+
+extern errcode_t ext2fs_dirhash2(int version, const char *name, int len,
+				 const struct ext2fs_nls_table *charset,
+				 int hash_flags,
+				 const __u32 *seed,
+				 ext2_dirhash_t *ret_hash,
+				 ext2_dirhash_t *ret_minor_hash);
+
+/* dir_iterate.c */
+extern errcode_t ext2fs_get_rec_len(ext2_filsys fs,
+				    struct ext2_dir_entry *dirent,
+				    unsigned int *rec_len);
+extern errcode_t ext2fs_set_rec_len(ext2_filsys fs,
+				    unsigned int len,
+				    struct ext2_dir_entry *dirent);
+extern errcode_t ext2fs_dir_iterate(ext2_filsys fs,
+			      ext2_ino_t dir,
+			      int flags,
+			      char *block_buf,
+			      int (*func)(struct ext2_dir_entry *dirent,
+					  int	offset,
+					  int	blocksize,
+					  char	*buf,
+					  void	*priv_data),
+			      void *priv_data);
+extern errcode_t ext2fs_dir_iterate2(ext2_filsys fs,
+			      ext2_ino_t dir,
+			      int flags,
+			      char *block_buf,
+			      int (*func)(ext2_ino_t	dir,
+					  int	entry,
+					  struct ext2_dir_entry *dirent,
+					  int	offset,
+					  int	blocksize,
+					  char	*buf,
+					  void	*priv_data),
+			      void *priv_data);
+
+/* dupfs.c */
+extern errcode_t ext2fs_dup_handle(ext2_filsys src, ext2_filsys *dest);
+
+/* expanddir.c */
+extern errcode_t ext2fs_expand_dir(ext2_filsys fs, ext2_ino_t dir);
+
+/* ext_attr.c */
+extern __u32 ext2fs_ext_attr_hash_entry(struct ext2_ext_attr_entry *entry,
+					void *data);
+extern __u32 ext2fs_ext_attr_hash_entry_signed(struct ext2_ext_attr_entry *entry,
+					       void *data);
+extern errcode_t ext2fs_ext_attr_hash_entry2(ext2_filsys fs,
+					     struct ext2_ext_attr_entry *entry,
+					     void *data, __u32 *hash);
+extern errcode_t ext2fs_ext_attr_hash_entry3(ext2_filsys fs,
+					     struct ext2_ext_attr_entry *entry,
+					     void *data, __u32 *hash,
+					     __u32 *signed_hash);
+extern errcode_t ext2fs_read_ext_attr(ext2_filsys fs, blk_t block, void *buf);
+extern errcode_t ext2fs_read_ext_attr2(ext2_filsys fs, blk64_t block,
+				       void *buf);
+extern errcode_t ext2fs_read_ext_attr3(ext2_filsys fs, blk64_t block,
+				       void *buf, ext2_ino_t inum);
+extern errcode_t ext2fs_write_ext_attr(ext2_filsys fs, blk_t block,
+				       void *buf);
+extern errcode_t ext2fs_write_ext_attr2(ext2_filsys fs, blk64_t block,
+				       void *buf);
+extern errcode_t ext2fs_write_ext_attr3(ext2_filsys fs, blk64_t block,
+				       void *buf, ext2_ino_t inum);
+extern errcode_t ext2fs_adjust_ea_refcount(ext2_filsys fs, blk_t blk,
+					   char *block_buf,
+					   int adjust, __u32 *newcount);
+extern errcode_t ext2fs_adjust_ea_refcount2(ext2_filsys fs, blk64_t blk,
+					   char *block_buf,
+					   int adjust, __u32 *newcount);
+extern errcode_t ext2fs_adjust_ea_refcount3(ext2_filsys fs, blk64_t blk,
+					   char *block_buf,
+					   int adjust, __u32 *newcount,
+					   ext2_ino_t inum);
+errcode_t ext2fs_xattrs_write(struct ext2_xattr_handle *handle);
+errcode_t ext2fs_xattrs_read(struct ext2_xattr_handle *handle);
+errcode_t ext2fs_xattrs_read_inode(struct ext2_xattr_handle *handle,
+				   struct ext2_inode_large *inode);
+errcode_t ext2fs_xattrs_iterate(struct ext2_xattr_handle *h,
+				int (*func)(char *name, char *value,
+					    size_t value_len, void *data),
+				void *data);
+errcode_t ext2fs_xattr_get(struct ext2_xattr_handle *h, const char *key,
+			   void **value, size_t *value_len);
+errcode_t ext2fs_xattr_set(struct ext2_xattr_handle *handle,
+			   const char *key,
+			   const void *value,
+			   size_t value_len);
+errcode_t ext2fs_xattr_remove(struct ext2_xattr_handle *handle,
+			      const char *key);
+errcode_t ext2fs_xattrs_open(ext2_filsys fs, ext2_ino_t ino,
+			     struct ext2_xattr_handle **handle);
+errcode_t ext2fs_xattrs_close(struct ext2_xattr_handle **handle);
+errcode_t ext2fs_free_ext_attr(ext2_filsys fs, ext2_ino_t ino,
+			       struct ext2_inode_large *inode);
+errcode_t ext2fs_xattrs_count(struct ext2_xattr_handle *handle, size_t *count);
+errcode_t ext2fs_xattr_inode_max_size(ext2_filsys fs, ext2_ino_t ino,
+				      size_t *size);
+#define XATTR_HANDLE_FLAG_RAW	0x0001
+errcode_t ext2fs_xattrs_flags(struct ext2_xattr_handle *handle,
+			      unsigned int *new_flags, unsigned int *old_flags);
+extern void ext2fs_ext_attr_block_rehash(struct ext2_ext_attr_header *header,
+					 struct ext2_ext_attr_entry *end);
+extern __u32 ext2fs_get_ea_inode_hash(struct ext2_inode *inode);
+extern void ext2fs_set_ea_inode_hash(struct ext2_inode *inode, __u32 hash);
+extern __u64 ext2fs_get_ea_inode_ref(struct ext2_inode *inode);
+extern void ext2fs_set_ea_inode_ref(struct ext2_inode *inode, __u64 ref_count);
+
+/* extent.c */
+extern errcode_t ext2fs_extent_header_verify(void *ptr, int size);
+extern errcode_t ext2fs_extent_open(ext2_filsys fs, ext2_ino_t ino,
+				    ext2_extent_handle_t *handle);
+extern errcode_t ext2fs_extent_open2(ext2_filsys fs, ext2_ino_t ino,
+					struct ext2_inode *inode,
+					ext2_extent_handle_t *ret_handle);
+extern void ext2fs_extent_free(ext2_extent_handle_t handle);
+extern errcode_t ext2fs_extent_get(ext2_extent_handle_t handle,
+				   int flags, struct ext2fs_extent *extent);
+extern errcode_t ext2fs_extent_node_split(ext2_extent_handle_t handle);
+extern errcode_t ext2fs_extent_replace(ext2_extent_handle_t handle, int flags,
+				       struct ext2fs_extent *extent);
+extern errcode_t ext2fs_extent_insert(ext2_extent_handle_t handle, int flags,
+				      struct ext2fs_extent *extent);
+extern errcode_t ext2fs_extent_set_bmap(ext2_extent_handle_t handle,
+					blk64_t logical, blk64_t physical,
+					int flags);
+extern errcode_t ext2fs_extent_delete(ext2_extent_handle_t handle, int flags);
+extern errcode_t ext2fs_extent_get_info(ext2_extent_handle_t handle,
+					struct ext2_extent_info *info);
+extern errcode_t ext2fs_extent_goto(ext2_extent_handle_t handle,
+				    blk64_t blk);
+extern errcode_t ext2fs_extent_goto2(ext2_extent_handle_t handle,
+				     int leaf_level, blk64_t blk);
+extern errcode_t ext2fs_extent_fix_parents(ext2_extent_handle_t handle);
+extern size_t ext2fs_max_extent_depth(ext2_extent_handle_t handle);
+extern errcode_t ext2fs_fix_extents_checksums(ext2_filsys fs, ext2_ino_t ino,
+					      struct ext2_inode *inode);
+extern errcode_t ext2fs_count_blocks(ext2_filsys fs, ext2_ino_t ino,
+				     struct ext2_inode *inode, blk64_t *ret_count);
+extern errcode_t ext2fs_decode_extent(struct ext2fs_extent *to, void *from,
+				      int len);
+
+/* fallocate.c */
+#define EXT2_FALLOCATE_ZERO_BLOCKS	(0x1)
+#define EXT2_FALLOCATE_FORCE_INIT	(0x2)
+#define EXT2_FALLOCATE_FORCE_UNINIT	(0x4)
+#define EXT2_FALLOCATE_INIT_BEYOND_EOF	(0x8)
+#define EXT2_FALLOCATE_ALL_FLAGS	(0xF)
+errcode_t ext2fs_fallocate(ext2_filsys fs, int flags, ext2_ino_t ino,
+			   struct ext2_inode *inode, blk64_t goal,
+			   blk64_t start, blk64_t len);
+
+/* fileio.c */
+extern errcode_t ext2fs_file_open2(ext2_filsys fs, ext2_ino_t ino,
+				   struct ext2_inode *inode,
+				   int flags, ext2_file_t *ret);
+extern errcode_t ext2fs_file_open(ext2_filsys fs, ext2_ino_t ino,
+				  int flags, ext2_file_t *ret);
+extern ext2_filsys ext2fs_file_get_fs(ext2_file_t file);
+struct ext2_inode *ext2fs_file_get_inode(ext2_file_t file);
+extern ext2_ino_t ext2fs_file_get_inode_num(ext2_file_t file);
+extern errcode_t ext2fs_file_close(ext2_file_t file);
+extern errcode_t ext2fs_file_flush(ext2_file_t file);
+extern errcode_t ext2fs_file_read(ext2_file_t file, void *buf,
+				  unsigned int wanted, unsigned int *got);
+extern errcode_t ext2fs_file_write(ext2_file_t file, const void *buf,
+				   unsigned int nbytes, unsigned int *written);
+extern errcode_t ext2fs_file_llseek(ext2_file_t file, __u64 offset,
+				   int whence, __u64 *ret_pos);
+extern errcode_t ext2fs_file_lseek(ext2_file_t file, ext2_off_t offset,
+				   int whence, ext2_off_t *ret_pos);
+errcode_t ext2fs_file_get_lsize(ext2_file_t file, __u64 *ret_size);
+extern ext2_off_t ext2fs_file_get_size(ext2_file_t file);
+extern errcode_t ext2fs_file_set_size(ext2_file_t file, ext2_off_t size);
+extern errcode_t ext2fs_file_set_size2(ext2_file_t file, ext2_off64_t size);
+
+/* finddev.c */
+extern char *ext2fs_find_block_device(dev_t device);
+
+/* flushb.c */
+extern errcode_t ext2fs_sync_device(int fd, int flushb);
+
+/* freefs.c */
+extern void ext2fs_free(ext2_filsys fs);
+extern void ext2fs_free_dblist(ext2_dblist dblist);
+extern void ext2fs_badblocks_list_free(ext2_badblocks_list bb);
+extern void ext2fs_u32_list_free(ext2_u32_list bb);
+
+/* gen_bitmap.c */
+extern void ext2fs_free_generic_bitmap(ext2fs_inode_bitmap bitmap);
+extern errcode_t ext2fs_make_generic_bitmap(errcode_t magic, ext2_filsys fs,
+					    __u32 start, __u32 end,
+					    __u32 real_end,
+					    const char *descr, char *init_map,
+					    ext2fs_generic_bitmap *ret);
+extern errcode_t ext2fs_allocate_generic_bitmap(__u32 start,
+						__u32 end,
+						__u32 real_end,
+						const char *descr,
+						ext2fs_generic_bitmap *ret);
+extern errcode_t ext2fs_copy_generic_bitmap(ext2fs_generic_bitmap src,
+					    ext2fs_generic_bitmap *dest);
+extern void ext2fs_clear_generic_bitmap(ext2fs_generic_bitmap bitmap);
+extern errcode_t ext2fs_fudge_generic_bitmap_end(ext2fs_inode_bitmap bitmap,
+						 errcode_t magic,
+						 errcode_t neq,
+						 ext2_ino_t end,
+						 ext2_ino_t *oend);
+extern void ext2fs_set_generic_bitmap_padding(ext2fs_generic_bitmap map);
+extern errcode_t ext2fs_resize_generic_bitmap(errcode_t magic,
+					      __u32 new_end,
+					      __u32 new_real_end,
+					      ext2fs_generic_bitmap bmap);
+extern errcode_t ext2fs_compare_generic_bitmap(errcode_t magic, errcode_t neq,
+					       ext2fs_generic_bitmap bm1,
+					       ext2fs_generic_bitmap bm2);
+extern errcode_t ext2fs_get_generic_bitmap_range(ext2fs_generic_bitmap bmap,
+						 errcode_t magic,
+						 __u32 start, __u32 num,
+						 void *out);
+extern errcode_t ext2fs_set_generic_bitmap_range(ext2fs_generic_bitmap bmap,
+						 errcode_t magic,
+						 __u32 start, __u32 num,
+						 void *in);
+extern errcode_t ext2fs_find_first_zero_generic_bitmap(ext2fs_generic_bitmap bitmap,
+						       __u32 start, __u32 end,
+						       __u32 *out);
+extern errcode_t ext2fs_find_first_set_generic_bitmap(ext2fs_generic_bitmap bitmap,
+						       __u32 start, __u32 end,
+						       __u32 *out);
+
+/* gen_bitmap64.c */
+void ext2fs_free_generic_bmap(ext2fs_generic_bitmap bmap);
+errcode_t ext2fs_alloc_generic_bmap(ext2_filsys fs, errcode_t magic,
+				    int type, __u64 start, __u64 end,
+				    __u64 real_end,
+				    const char *descr,
+				    ext2fs_generic_bitmap *ret);
+errcode_t ext2fs_copy_generic_bmap(ext2fs_generic_bitmap src,
+				   ext2fs_generic_bitmap *dest);
+void ext2fs_clear_generic_bmap(ext2fs_generic_bitmap bitmap);
+errcode_t ext2fs_fudge_generic_bmap_end(ext2fs_generic_bitmap bitmap,
+					errcode_t neq,
+					__u64 end, __u64 *oend);
+void ext2fs_set_generic_bmap_padding(ext2fs_generic_bitmap bmap);
+errcode_t ext2fs_resize_generic_bmap(ext2fs_generic_bitmap bmap,
+				     __u64 new_end,
+				     __u64 new_real_end);
+errcode_t ext2fs_compare_generic_bmap(errcode_t neq,
+				      ext2fs_generic_bitmap bm1,
+				      ext2fs_generic_bitmap bm2);
+errcode_t ext2fs_get_generic_bmap_range(ext2fs_generic_bitmap bmap,
+					__u64 start, unsigned int num,
+					void *out);
+errcode_t ext2fs_set_generic_bmap_range(ext2fs_generic_bitmap bmap,
+					__u64 start, unsigned int num,
+					void *in);
+errcode_t ext2fs_convert_subcluster_bitmap(ext2_filsys fs,
+					   ext2fs_block_bitmap *bitmap);
+errcode_t ext2fs_count_used_clusters(ext2_filsys fs, blk64_t start,
+				     blk64_t end, blk64_t *out);
+
+/* get_num_dirs.c */
+extern errcode_t ext2fs_get_num_dirs(ext2_filsys fs, ext2_ino_t *ret_num_dirs);
+
+/* getsize.c */
+extern errcode_t ext2fs_get_device_size(const char *file, int blocksize,
+					blk_t *retblocks);
+extern errcode_t ext2fs_get_device_size2(const char *file, int blocksize,
+					blk64_t *retblocks);
+
+/* getsectsize.c */
+extern int ext2fs_get_dio_alignment(int fd);
+errcode_t ext2fs_get_device_sectsize(const char *file, int *sectsize);
+errcode_t ext2fs_get_device_phys_sectsize(const char *file, int *sectsize);
+
+/* i_block.c */
+errcode_t ext2fs_iblk_add_blocks(ext2_filsys fs, struct ext2_inode *inode,
+				 blk64_t num_blocks);
+errcode_t ext2fs_iblk_sub_blocks(ext2_filsys fs, struct ext2_inode *inode,
+				 blk64_t num_blocks);
+errcode_t ext2fs_iblk_set(ext2_filsys fs, struct ext2_inode *inode, blk64_t b);
+
+/* imager.c */
+extern errcode_t ext2fs_image_inode_write(ext2_filsys fs, int fd, int flags);
+extern errcode_t ext2fs_image_inode_read(ext2_filsys fs, int fd, int flags);
+extern errcode_t ext2fs_image_super_write(ext2_filsys fs, int fd, int flags);
+extern errcode_t ext2fs_image_super_read(ext2_filsys fs, int fd, int flags);
+extern errcode_t ext2fs_image_bitmap_write(ext2_filsys fs, int fd, int flags);
+extern errcode_t ext2fs_image_bitmap_read(ext2_filsys fs, int fd, int flags);
+
+/* ind_block.c */
+errcode_t ext2fs_read_ind_block(ext2_filsys fs, blk_t blk, void *buf);
+errcode_t ext2fs_write_ind_block(ext2_filsys fs, blk_t blk, void *buf);
+
+/* initialize.c */
+extern errcode_t ext2fs_initialize(const char *name, int flags,
+				   struct ext2_super_block *param,
+				   io_manager manager, ext2_filsys *ret_fs);
+extern errcode_t ext2fs_calculate_summary_stats(ext2_filsys fs, int super_only);
+
+/* icount.c */
+extern void ext2fs_free_icount(ext2_icount_t icount);
+extern errcode_t ext2fs_create_icount_tdb(ext2_filsys fs, char *tdb_dir,
+					  int flags, ext2_icount_t *ret);
+extern errcode_t ext2fs_create_icount2(ext2_filsys fs, int flags,
+				       unsigned int size,
+				       ext2_icount_t hint, ext2_icount_t *ret);
+extern errcode_t ext2fs_create_icount(ext2_filsys fs, int flags,
+				      unsigned int size,
+				      ext2_icount_t *ret);
+extern errcode_t ext2fs_icount_fetch(ext2_icount_t icount, ext2_ino_t ino,
+				     __u16 *ret);
+extern errcode_t ext2fs_icount_increment(ext2_icount_t icount, ext2_ino_t ino,
+					 __u16 *ret);
+extern errcode_t ext2fs_icount_decrement(ext2_icount_t icount, ext2_ino_t ino,
+					 __u16 *ret);
+extern errcode_t ext2fs_icount_store(ext2_icount_t icount, ext2_ino_t ino,
+				     __u16 count);
+extern ext2_ino_t ext2fs_get_icount_size(ext2_icount_t icount);
+errcode_t ext2fs_icount_validate(ext2_icount_t icount, FILE *);
+
+/* inline.c */
+
+extern errcode_t ext2fs_get_memalign(unsigned long size,
+				     unsigned long align, void *ptr);
+
+/* inline_data.c */
+extern errcode_t ext2fs_inline_data_init(ext2_filsys fs, ext2_ino_t ino);
+extern errcode_t ext2fs_inline_data_size(ext2_filsys fs, ext2_ino_t ino,
+					 size_t *size);
+extern errcode_t ext2fs_inline_data_get(ext2_filsys fs, ext2_ino_t ino,
+					struct ext2_inode *inode,
+					void *buf, size_t *size);
+extern errcode_t ext2fs_inline_data_set(ext2_filsys fs, ext2_ino_t ino,
+					struct ext2_inode *inode,
+					void *buf, size_t size);
+
+/* inode.c */
+extern errcode_t ext2fs_create_inode_cache(ext2_filsys fs,
+					   unsigned int cache_size);
+extern void ext2fs_free_inode_cache(struct ext2_inode_cache *icache);
+extern errcode_t ext2fs_flush_icache(ext2_filsys fs);
+extern errcode_t ext2fs_get_next_inode_full(ext2_inode_scan scan,
+					    ext2_ino_t *ino,
+					    struct ext2_inode *inode,
+					    int bufsize);
+#define EXT2_INODE_SCAN_DEFAULT_BUFFER_BLOCKS	8
+extern errcode_t ext2fs_open_inode_scan(ext2_filsys fs, int buffer_blocks,
+				  ext2_inode_scan *ret_scan);
+extern void ext2fs_close_inode_scan(ext2_inode_scan scan);
+extern errcode_t ext2fs_get_next_inode(ext2_inode_scan scan, ext2_ino_t *ino,
+			       struct ext2_inode *inode);
+extern errcode_t ext2fs_inode_scan_goto_blockgroup(ext2_inode_scan scan,
+						   int	group);
+extern void ext2fs_set_inode_callback
+	(ext2_inode_scan scan,
+	 errcode_t (*done_group)(ext2_filsys fs,
+				 ext2_inode_scan scan,
+				 dgrp_t group,
+				 void * priv_data),
+	 void *done_group_data);
+extern int ext2fs_inode_scan_flags(ext2_inode_scan scan, int set_flags,
+				   int clear_flags);
+extern errcode_t ext2fs_read_inode_full(ext2_filsys fs, ext2_ino_t ino,
+					struct ext2_inode * inode,
+					int bufsize);
+extern errcode_t ext2fs_read_inode(ext2_filsys fs, ext2_ino_t ino,
+			    struct ext2_inode * inode);
+extern errcode_t ext2fs_read_inode2(ext2_filsys fs, ext2_ino_t ino,
+				    struct ext2_inode * inode,
+				    int bufsize, int flags);
+extern errcode_t ext2fs_write_inode_full(ext2_filsys fs, ext2_ino_t ino,
+					 struct ext2_inode * inode,
+					 int bufsize);
+extern errcode_t ext2fs_write_inode(ext2_filsys fs, ext2_ino_t ino,
+			    struct ext2_inode * inode);
+extern errcode_t ext2fs_write_inode2(ext2_filsys fs, ext2_ino_t ino,
+				     struct ext2_inode * inode,
+				     int bufsize, int flags);
+extern errcode_t ext2fs_write_new_inode(ext2_filsys fs, ext2_ino_t ino,
+			    struct ext2_inode * inode);
+extern errcode_t ext2fs_get_blocks(ext2_filsys fs, ext2_ino_t ino, blk_t *blocks);
+extern errcode_t ext2fs_check_directory(ext2_filsys fs, ext2_ino_t ino);
+
+/* inode_io.c */
+extern io_manager inode_io_manager;
+extern errcode_t ext2fs_inode_io_intern(ext2_filsys fs, ext2_ino_t ino,
+					char **name);
+extern errcode_t ext2fs_inode_io_intern2(ext2_filsys fs, ext2_ino_t ino,
+					 struct ext2_inode *inode,
+					 char **name);
+
+/* ismounted.c */
+extern errcode_t ext2fs_check_if_mounted(const char *file, int *mount_flags);
+extern errcode_t ext2fs_check_mount_point(const char *device, int *mount_flags,
+					  char *mtpt, int mtlen);
+
+/* punch.c */
+/*
+ * NOTE: This function removes from an inode the blocks "start", "end", and
+ * every block in between.
+ */
+extern errcode_t ext2fs_punch(ext2_filsys fs, ext2_ino_t ino,
+			      struct ext2_inode *inode,
+			      char *block_buf, blk64_t start,
+			      blk64_t end);
+
+/* namei.c */
+extern errcode_t ext2fs_lookup(ext2_filsys fs, ext2_ino_t dir, const char *name,
+			 int namelen, char *buf, ext2_ino_t *inode);
+extern errcode_t ext2fs_namei(ext2_filsys fs, ext2_ino_t root, ext2_ino_t cwd,
+			const char *name, ext2_ino_t *inode);
+errcode_t ext2fs_namei_follow(ext2_filsys fs, ext2_ino_t root, ext2_ino_t cwd,
+			      const char *name, ext2_ino_t *inode);
+extern errcode_t ext2fs_follow_link(ext2_filsys fs, ext2_ino_t root, ext2_ino_t cwd,
+			ext2_ino_t inode, ext2_ino_t *res_inode);
+
+/* native.c */
+int ext2fs_native_flag(void);
+
+/* newdir.c */
+extern errcode_t ext2fs_new_dir_block(ext2_filsys fs, ext2_ino_t dir_ino,
+				ext2_ino_t parent_ino, char **block);
+extern errcode_t ext2fs_new_dir_inline_data(ext2_filsys fs, ext2_ino_t dir_ino,
+				ext2_ino_t parent_ino, __u32 *iblock);
+
+/* nls_utf8.c */
+extern const struct ext2fs_nls_table *ext2fs_load_nls_table(int encoding);
+extern int ext2fs_check_encoded_name(const struct ext2fs_nls_table *table,
+				     char *s, size_t len, char **pos);
+extern int ext2fs_casefold_cmp(const struct ext2fs_nls_table *table,
+			       const unsigned char *str1, size_t len1,
+			       const unsigned char *str2, size_t len2);
+
+/* mkdir.c */
+extern errcode_t ext2fs_mkdir(ext2_filsys fs, ext2_ino_t parent, ext2_ino_t inum,
+			      const char *name);
+
+/* mkjournal.c */
+struct ext2fs_journal_params {
+	blk_t num_journal_blocks;
+	blk_t num_fc_blocks;
+};
+extern errcode_t ext2fs_get_journal_params(
+		struct ext2fs_journal_params *params, ext2_filsys fs);
+extern errcode_t ext2fs_zero_blocks(ext2_filsys fs, blk_t blk, int num,
+				    blk_t *ret_blk, int *ret_count);
+extern errcode_t ext2fs_zero_blocks2(ext2_filsys fs, blk64_t blk, int num,
+				     blk64_t *ret_blk, int *ret_count);
+extern errcode_t ext2fs_create_journal_superblock(ext2_filsys fs,
+						  __u32 num_blocks, int flags,
+						  char  **ret_jsb);
+extern errcode_t ext2fs_create_journal_superblock2(ext2_filsys fs,
+						  struct ext2fs_journal_params *params,
+						  int flags, char  **ret_jsb);
+extern errcode_t ext2fs_add_journal_device(ext2_filsys fs,
+					   ext2_filsys journal_dev);
+extern errcode_t ext2fs_add_journal_inode(ext2_filsys fs, blk_t num_blocks,
+					  int flags);
+extern errcode_t ext2fs_add_journal_inode2(ext2_filsys fs, blk_t num_blocks,
+					   blk64_t goal, int flags);
+extern errcode_t ext2fs_add_journal_inode3(ext2_filsys fs,
+				    struct ext2fs_journal_params *params,
+				    blk64_t goal, int flags);
+extern int ext2fs_default_journal_size(__u64 num_blocks);
+extern int ext2fs_journal_sb_start(int blocksize);
+
+/* openfs.c */
+extern errcode_t ext2fs_open(const char *name, int flags, int superblock,
+			     unsigned int block_size, io_manager manager,
+			     ext2_filsys *ret_fs);
+extern errcode_t ext2fs_open2(const char *name, const char *io_options,
+			      int flags, int superblock,
+			      unsigned int block_size, io_manager manager,
+			      ext2_filsys *ret_fs);
+/*
+ * The dgrp_t argument to these two functions is not actually a group number
+ * but a block number offset within a group table!  Convert with the formula
+ * (group_number / groups_per_block).
+ */
+extern blk64_t ext2fs_descriptor_block_loc2(ext2_filsys fs,
+					blk64_t group_block, dgrp_t i);
+extern blk_t ext2fs_descriptor_block_loc(ext2_filsys fs, blk_t group_block,
+					 dgrp_t i);
+errcode_t ext2fs_get_data_io(ext2_filsys fs, io_channel *old_io);
+errcode_t ext2fs_set_data_io(ext2_filsys fs, io_channel new_io);
+errcode_t ext2fs_rewrite_to_io(ext2_filsys fs, io_channel new_io);
+
+/* orphan.c */
+extern errcode_t ext2fs_create_orphan_file(ext2_filsys fs, blk_t num_blocks);
+extern errcode_t ext2fs_truncate_orphan_file(ext2_filsys fs);
+extern e2_blkcnt_t ext2fs_default_orphan_file_blocks(ext2_filsys fs);
+extern __u32 ext2fs_do_orphan_file_block_csum(ext2_filsys fs, ext2_ino_t ino,
+					      __u32 gen, blk64_t blk,
+					      char *buf);
+extern errcode_t ext2fs_orphan_file_block_csum_set(ext2_filsys fs,
+						   ext2_ino_t ino, blk64_t blk,
+						   char *buf);
+extern int ext2fs_orphan_file_block_csum_verify(ext2_filsys fs, ext2_ino_t ino,
+						blk64_t blk, char *buf);
+
+/* get_pathname.c */
+extern errcode_t ext2fs_get_pathname(ext2_filsys fs, ext2_ino_t dir, ext2_ino_t ino,
+			       char **name);
+
+/* link.c */
+#define EXT2FS_UNLINK_FORCE		0x1	/* Forcefully unlink even if
+						 * the inode number doesn't
+						 * match the dirent
+						 */
+errcode_t ext2fs_link(ext2_filsys fs, ext2_ino_t dir, const char *name,
+		      ext2_ino_t ino, int flags);
+errcode_t ext2fs_unlink(ext2_filsys fs, ext2_ino_t dir, const char *name,
+			ext2_ino_t ino, int flags);
+
+/* symlink.c */
+errcode_t ext2fs_symlink(ext2_filsys fs, ext2_ino_t parent, ext2_ino_t ino,
+			 const char *name, const char *target);
+int ext2fs_is_fast_symlink(struct ext2_inode *inode);
+
+/* mmp.c */
+errcode_t ext2fs_mmp_read(ext2_filsys fs, blk64_t mmp_blk, void *buf);
+errcode_t ext2fs_mmp_write(ext2_filsys fs, blk64_t mmp_blk, void *buf);
+errcode_t ext2fs_mmp_clear(ext2_filsys fs);
+errcode_t ext2fs_mmp_init(ext2_filsys fs);
+errcode_t ext2fs_mmp_start(ext2_filsys fs);
+errcode_t ext2fs_mmp_update(ext2_filsys fs);
+errcode_t ext2fs_mmp_update2(ext2_filsys fs, int immediately);
+errcode_t ext2fs_mmp_stop(ext2_filsys fs);
+unsigned ext2fs_mmp_new_seq(void);
+
+/* read_bb.c */
+extern errcode_t ext2fs_read_bb_inode(ext2_filsys fs,
+				      ext2_badblocks_list *bb_list);
+
+/* read_bb_file.c */
+extern errcode_t ext2fs_read_bb_FILE2(ext2_filsys fs, FILE *f,
+				      ext2_badblocks_list *bb_list,
+				      void *priv_data,
+				      void (*invalid)(ext2_filsys fs,
+						      blk_t blk,
+						      char *badstr,
+						      void *priv_data));
+extern errcode_t ext2fs_read_bb_FILE(ext2_filsys fs, FILE *f,
+				     ext2_badblocks_list *bb_list,
+				     void (*invalid)(ext2_filsys fs,
+						     blk_t blk));
+
+/* res_gdt.c */
+extern errcode_t ext2fs_create_resize_inode(ext2_filsys fs);
+
+/* rw_bitmaps.c */
+extern errcode_t ext2fs_rw_bitmaps(ext2_filsys fs, int flags, int num_threads);
+extern errcode_t ext2fs_read_bitmaps(ext2_filsys fs);
+extern errcode_t ext2fs_read_inode_bitmap (ext2_filsys fs);
+extern errcode_t ext2fs_read_block_bitmap(ext2_filsys fs);
+extern errcode_t ext2fs_write_bitmaps(ext2_filsys fs);
+extern errcode_t ext2fs_write_inode_bitmap(ext2_filsys fs);
+extern errcode_t ext2fs_write_block_bitmap (ext2_filsys fs);
+
+/*sha256.c */
+#define EXT2FS_SHA256_LENGTH 32
+#if 0
+extern void ext2fs_sha256(const unsigned char *in, unsigned long in_size,
+		   unsigned char out[EXT2FS_SHA256_LENGTH]);
+#endif
+
+/* sha512.c */
+#define EXT2FS_SHA512_LENGTH 64
+extern void ext2fs_sha512(const unsigned char *in, unsigned long in_size,
+			  unsigned char out[EXT2FS_SHA512_LENGTH]);
+
+/* swapfs.c */
+extern errcode_t ext2fs_dirent_swab_in2(ext2_filsys fs, char *buf, size_t size,
+					int flags);
+extern errcode_t ext2fs_dirent_swab_in(ext2_filsys fs, char *buf, int flags);
+extern errcode_t ext2fs_dirent_swab_out2(ext2_filsys fs, char *buf, size_t size,
+					 int flags);
+extern errcode_t ext2fs_dirent_swab_out(ext2_filsys fs, char *buf, int flags);
+extern void ext2fs_swap_ext_attr(char *to, char *from, int bufsize,
+				 int has_header);
+extern void ext2fs_swap_ext_attr_header(struct ext2_ext_attr_header *to_header,
+					struct ext2_ext_attr_header *from_hdr);
+extern void ext2fs_swap_ext_attr_entry(struct ext2_ext_attr_entry *to_entry,
+				       struct ext2_ext_attr_entry *from_entry);
+extern void ext2fs_swap_super(struct ext2_super_block * super);
+extern void ext2fs_swap_group_desc(struct ext2_group_desc *gdp);
+extern void ext2fs_swap_group_desc2(ext2_filsys, struct ext2_group_desc *gdp);
+extern void ext2fs_swap_inode_full(ext2_filsys fs, struct ext2_inode_large *t,
+				   struct ext2_inode_large *f, int hostorder,
+				   int bufsize);
+extern void ext2fs_swap_inode(ext2_filsys fs,struct ext2_inode *t,
+			      struct ext2_inode *f, int hostorder);
+extern void ext2fs_swap_mmp(struct mmp_struct *mmp);
+
+/* unix_io.c */
+extern int ext2fs_open_file(const char *pathname, int flags, mode_t mode);
+extern int ext2fs_stat(const char *path, ext2fs_struct_stat *buf);
+extern int ext2fs_fstat(int fd, ext2fs_struct_stat *buf);
+
+/* valid_blk.c */
+extern int ext2fs_inode_has_valid_blocks(struct ext2_inode *inode);
+extern int ext2fs_inode_has_valid_blocks2(ext2_filsys fs,
+					  struct ext2_inode *inode);
+
+/* version.c */
+extern int ext2fs_parse_version_string(const char *ver_string);
+extern int ext2fs_get_library_version(const char **ver_string,
+				      const char **date_string);
+
+/* write_bb_file.c */
+extern errcode_t ext2fs_write_bb_FILE(ext2_badblocks_list bb_list,
+				      unsigned int flags,
+				      FILE *f);
+
+
+/* inline functions */
+#ifdef NO_INLINE_FUNCS
+extern errcode_t ext2fs_get_mem(unsigned long size, void *ptr);
+extern errcode_t ext2fs_get_memzero(unsigned long size, void *ptr);
+extern errcode_t ext2fs_get_array(unsigned long count,
+				  unsigned long size, void *ptr);
+extern errcode_t ext2fs_get_arrayzero(unsigned long count,
+				      unsigned long size, void *ptr);
+extern errcode_t ext2fs_free_mem(void *ptr);
+extern errcode_t ext2fs_resize_mem(unsigned long old_size,
+				   unsigned long size, void *ptr);
+extern errcode_t ext2fs_resize_array(unsigned long old_count, unsigned long count,
+				     unsigned long size, void *ptr);
+extern void ext2fs_mark_super_dirty(ext2_filsys fs);
+extern void ext2fs_mark_changed(ext2_filsys fs);
+extern int ext2fs_test_changed(ext2_filsys fs);
+extern void ext2fs_mark_valid(ext2_filsys fs);
+extern void ext2fs_unmark_valid(ext2_filsys fs);
+extern int ext2fs_test_valid(ext2_filsys fs);
+extern void ext2fs_mark_ib_dirty(ext2_filsys fs);
+extern void ext2fs_mark_bb_dirty(ext2_filsys fs);
+extern int ext2fs_test_ib_dirty(ext2_filsys fs);
+extern int ext2fs_test_bb_dirty(ext2_filsys fs);
+extern dgrp_t ext2fs_group_of_blk(ext2_filsys fs, blk_t blk);
+extern dgrp_t ext2fs_group_of_ino(ext2_filsys fs, ext2_ino_t ino);
+extern blk_t ext2fs_group_first_block(ext2_filsys fs, dgrp_t group);
+extern blk_t ext2fs_group_last_block(ext2_filsys fs, dgrp_t group);
+extern blk_t ext2fs_inode_data_blocks(ext2_filsys fs,
+				      struct ext2_inode *inode);
+extern int ext2fs_htree_intnode_maxrecs(ext2_filsys fs, int blocks);
+extern unsigned int ext2fs_div_ceil(unsigned int a, unsigned int b);
+extern __u64 ext2fs_div64_ceil(__u64 a, __u64 b);
+extern int ext2fs_dirent_name_len(const struct ext2_dir_entry *entry);
+extern void ext2fs_dirent_set_name_len(struct ext2_dir_entry *entry, int len);
+extern int ext2fs_dirent_file_type(const struct ext2_dir_entry *entry);
+extern void ext2fs_dirent_set_file_type(struct ext2_dir_entry *entry, int type);
+extern struct ext2_inode *ext2fs_inode(struct ext2_inode_large * large_inode);
+extern const struct ext2_inode *ext2fs_const_inode(const struct ext2_inode_large * large_inode);
+extern int ext2fs_inodes_per_orphan_block(ext2_filsys fs);
+extern struct ext4_orphan_block_tail *ext2fs_orphan_block_tail(ext2_filsys fs,
+							       char *buf);
+#endif
+
+/*
+ * The actual inlined functions definitions themselves...
+ *
+ * If NO_INLINE_FUNCS is defined, then we won't try to do inline
+ * functions at all!
+ */
+#if (defined(INCLUDE_INLINE_FUNCS) || !defined(NO_INLINE_FUNCS))
+#ifdef INCLUDE_INLINE_FUNCS
+#define _INLINE_ extern
+#else
+#if (__STDC_VERSION__ >= 199901L)
+#define _INLINE_ inline
+#else
+#ifdef __GNUC__
+#define _INLINE_ extern __inline__
+#else				/* For Watcom C */
+#define _INLINE_ extern inline
+#endif /* __GNUC__ */
+#endif /* __STDC_VERSION__ >= 199901L */
+#endif
+
+#ifndef EXT2_CUSTOM_MEMORY_ROUTINES
+#include <string.h>
+/*
+ *  Allocate memory.  The 'ptr' arg must point to a pointer.
+ */
+_INLINE_ errcode_t ext2fs_get_mem(unsigned long size, void *ptr)
+{
+	void *pp;
+
+	pp = malloc(size);
+	if (!pp)
+		return EXT2_ET_NO_MEMORY;
+	memcpy(ptr, &pp, sizeof (pp));
+	return 0;
+}
+
+_INLINE_ errcode_t ext2fs_get_memzero(unsigned long size, void *ptr)
+{
+	void *pp;
+
+	pp = malloc(size);
+	if (!pp)
+		return EXT2_ET_NO_MEMORY;
+	memset(pp, 0, size);
+	memcpy(ptr, &pp, sizeof(pp));
+	return 0;
+}
+
+_INLINE_ errcode_t ext2fs_get_array(unsigned long count, unsigned long size,
+				    void *ptr)
+{
+	if (count && (~0UL)/count < size)
+		return EXT2_ET_NO_MEMORY;
+	return ext2fs_get_mem(count*size, ptr);
+}
+
+_INLINE_ errcode_t ext2fs_get_arrayzero(unsigned long count,
+					unsigned long size, void *ptr)
+{
+	if (count && (~0UL)/count < size)
+		return EXT2_ET_NO_MEMORY;
+
+	return ext2fs_get_memzero((size_t)count * size, ptr);
+}
+
+/*
+ * Free memory.  The 'ptr' arg must point to a pointer.
+ */
+_INLINE_ errcode_t ext2fs_free_mem(void *ptr)
+{
+	void *p;
+
+	memcpy(&p, ptr, sizeof(p));
+	free(p);
+	p = 0;
+	memcpy(ptr, &p, sizeof(p));
+	return 0;
+}
+
+/*
+ *  Resize memory.  The 'ptr' arg must point to a pointer.
+ */
+_INLINE_ errcode_t ext2fs_resize_mem(unsigned long EXT2FS_ATTR((unused)) old_size,
+				     unsigned long size, void *ptr)
+{
+	void *p;
+
+	/* Use "memcpy" for pointer assignments here to avoid problems
+	 * with C99 strict type aliasing rules. */
+	memcpy(&p, ptr, sizeof(p));
+	p = realloc(p, size);
+	if (!p)
+		return EXT2_ET_NO_MEMORY;
+	memcpy(ptr, &p, sizeof(p));
+	return 0;
+}
+
+/*
+ *  Resize array.  The 'ptr' arg must point to a pointer.
+ */
+_INLINE_ errcode_t ext2fs_resize_array(unsigned long size,
+				       unsigned long old_count,
+				       unsigned long count, void *ptr)
+{
+	unsigned long old_size;
+	errcode_t retval;
+
+	if (count && (~0UL)/count < size)
+		return EXT2_ET_NO_MEMORY;
+
+	size *= count;
+	old_size = size * old_count;
+	retval = ext2fs_resize_mem(old_size, size, ptr);
+	if (retval)
+		return retval;
+
+	if (size > old_size) {
+		void *p;
+
+		memcpy(&p, ptr, sizeof(p));
+		memset((char *)p + old_size, 0, size - old_size);
+		memcpy(ptr, &p, sizeof(p));
+	}
+
+	return 0;
+}
+#endif	/* Custom memory routines */
+
+/*
+ * Mark a filesystem superblock as dirty
+ */
+_INLINE_ void ext2fs_mark_super_dirty(ext2_filsys fs)
+{
+	fs->flags |= EXT2_FLAG_DIRTY | EXT2_FLAG_CHANGED;
+}
+
+/*
+ * Mark a filesystem as changed
+ */
+_INLINE_ void ext2fs_mark_changed(ext2_filsys fs)
+{
+	fs->flags |= EXT2_FLAG_CHANGED;
+}
+
+/*
+ * Check to see if a filesystem has changed
+ */
+_INLINE_ int ext2fs_test_changed(ext2_filsys fs)
+{
+	return (fs->flags & EXT2_FLAG_CHANGED);
+}
+
+/*
+ * Mark a filesystem as valid
+ */
+_INLINE_ void ext2fs_mark_valid(ext2_filsys fs)
+{
+	fs->flags |= EXT2_FLAG_VALID;
+}
+
+/*
+ * Mark a filesystem as NOT valid
+ */
+_INLINE_ void ext2fs_unmark_valid(ext2_filsys fs)
+{
+	fs->flags &= ~EXT2_FLAG_VALID;
+}
+
+/*
+ * Check to see if a filesystem is valid
+ */
+_INLINE_ int ext2fs_test_valid(ext2_filsys fs)
+{
+	return (fs->flags & EXT2_FLAG_VALID);
+}
+
+/*
+ * Mark the inode bitmap as dirty
+ */
+_INLINE_ void ext2fs_mark_ib_dirty(ext2_filsys fs)
+{
+	fs->flags |= EXT2_FLAG_IB_DIRTY | EXT2_FLAG_CHANGED;
+}
+
+/*
+ * Mark the block bitmap as dirty
+ */
+_INLINE_ void ext2fs_mark_bb_dirty(ext2_filsys fs)
+{
+	fs->flags |= EXT2_FLAG_BB_DIRTY | EXT2_FLAG_CHANGED;
+}
+
+/*
+ * Check to see if a filesystem's inode bitmap is dirty
+ */
+_INLINE_ int ext2fs_test_ib_dirty(ext2_filsys fs)
+{
+	return (fs->flags & EXT2_FLAG_IB_DIRTY);
+}
+
+/*
+ * Check to see if a filesystem's block bitmap is dirty
+ */
+_INLINE_ int ext2fs_test_bb_dirty(ext2_filsys fs)
+{
+	return (fs->flags & EXT2_FLAG_BB_DIRTY);
+}
+
+/*
+ * Return the group # of a block
+ */
+_INLINE_ dgrp_t ext2fs_group_of_blk(ext2_filsys fs, blk_t blk)
+{
+	return ext2fs_group_of_blk2(fs, blk);
+}
+/*
+ * Return the group # of an inode number
+ */
+_INLINE_ dgrp_t ext2fs_group_of_ino(ext2_filsys fs, ext2_ino_t ino)
+{
+	return (ino - 1) / fs->super->s_inodes_per_group;
+}
+
+/*
+ * Return the first block (inclusive) in a group
+ */
+_INLINE_ blk_t ext2fs_group_first_block(ext2_filsys fs, dgrp_t group)
+{
+	return (blk_t) ext2fs_group_first_block2(fs, group);
+}
+
+/*
+ * Return the last block (inclusive) in a group
+ */
+_INLINE_ blk_t ext2fs_group_last_block(ext2_filsys fs, dgrp_t group)
+{
+	return (blk_t) ext2fs_group_last_block2(fs, group);
+}
+
+_INLINE_ blk_t ext2fs_inode_data_blocks(ext2_filsys fs,
+					struct ext2_inode *inode)
+{
+	return (blk_t) ext2fs_inode_data_blocks2(fs, inode);
+}
+
+_INLINE_ int ext2fs_htree_intnode_maxrecs(ext2_filsys fs, int blocks)
+{
+	int csum_size = 0;
+
+	if ((EXT2_SB(fs->super)->s_feature_ro_compat &
+	     EXT4_FEATURE_RO_COMPAT_METADATA_CSUM) != 0)
+		csum_size = sizeof(struct ext2_dx_tail);
+	return blocks * ((fs->blocksize - (8 + csum_size)) /
+						sizeof(struct ext2_dx_entry));
+}
+
+/*
+ * This is an efficient, overflow safe way of calculating ceil((1.0 * a) / b)
+ */
+_INLINE_ unsigned int ext2fs_div_ceil(unsigned int a, unsigned int b)
+{
+	if (!a)
+		return 0;
+	return ((a - 1) / b) + 1;
+}
+
+_INLINE_ __u64 ext2fs_div64_ceil(__u64 a, __u64 b)
+{
+	if (!a)
+		return 0;
+	return ((a - 1) / b) + 1;
+}
+
+_INLINE_ int ext2fs_dirent_name_len(const struct ext2_dir_entry *entry)
+{
+	return entry->name_len & 0xff;
+}
+
+_INLINE_ void ext2fs_dirent_set_name_len(struct ext2_dir_entry *entry, int len)
+{
+	entry->name_len = (entry->name_len & 0xff00) | (len & 0xff);
+}
+
+_INLINE_ int ext2fs_dirent_file_type(const struct ext2_dir_entry *entry)
+{
+	return entry->name_len >> 8;
+}
+
+_INLINE_ void ext2fs_dirent_set_file_type(struct ext2_dir_entry *entry, int type)
+{
+	entry->name_len = (entry->name_len & 0xff) | (type << 8);
+}
+
+_INLINE_ struct ext2_inode *ext2fs_inode(struct ext2_inode_large * large_inode)
+{
+	/* It is always safe to convert large inode to a small inode */
+	return (struct ext2_inode *) large_inode;
+}
+
+_INLINE_ const struct ext2_inode *
+ext2fs_const_inode(const struct ext2_inode_large * large_inode)
+{
+	/* It is always safe to convert large inode to a small inode */
+	return (const struct ext2_inode *) large_inode;
+}
+
+_INLINE_ int ext2fs_inodes_per_orphan_block(ext2_filsys fs)
+{
+	return (fs->blocksize - sizeof(struct ext4_orphan_block_tail)) /
+		sizeof(__u32);
+}
+
+_INLINE_ struct ext4_orphan_block_tail *
+ext2fs_orphan_block_tail(ext2_filsys fs, char *buf)
+{
+	return (struct ext4_orphan_block_tail *)(buf + fs->blocksize -
+		sizeof(struct ext4_orphan_block_tail));
+}
+
+#undef _INLINE_
+#endif
+
+/* htree levels for ext4 */
+#define EXT4_HTREE_LEVEL_COMPAT 2
+#define EXT4_HTREE_LEVEL	3
+
+static inline unsigned int ext2_dir_htree_level(ext2_filsys fs)
+{
+	if (ext2fs_has_feature_largedir(fs->super))
+		return EXT4_HTREE_LEVEL;
+
+	return EXT4_HTREE_LEVEL_COMPAT;
+}
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif /* _EXT2FS_EXT2FS_H */
diff --git a/lib/ext2fs/ext2fs.pc.in b/lib/ext2fs/ext2fs.pc.in
new file mode 100644
index 0000000..efac85e
--- /dev/null
+++ b/lib/ext2fs/ext2fs.pc.in
@@ -0,0 +1,11 @@
+prefix=@prefix@
+exec_prefix=@exec_prefix@
+libdir=@libdir@
+includedir=@includedir@
+
+Name: ext2fs
+Description: Ext2fs library
+Version: @E2FSPROGS_VERSION@
+Requires.private: com_err
+Cflags: -I${includedir}/ext2fs -I${includedir}
+Libs: -L${libdir} -lext2fs
diff --git a/lib/ext2fs/ext2fsP.h b/lib/ext2fs/ext2fsP.h
new file mode 100644
index 0000000..0687384
--- /dev/null
+++ b/lib/ext2fs/ext2fsP.h
@@ -0,0 +1,210 @@
+/*
+ * ext2fsP.h --- private header file for ext2 library
+ *
+ * Copyright (C) 1997 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+
+#include "ext2fs.h"
+
+#define EXT2FS_MAX_NESTED_LINKS  8
+
+static inline int ext2fsP_is_disk_device(mode_t mode)
+{
+#if defined(__FreeBSD__) || defined(__FreeBSD_kernel__)
+	return S_ISBLK(mode) || S_ISCHR(mode);
+#else
+	return S_ISBLK(mode);
+#endif
+}
+
+/*
+ * Badblocks list
+ */
+struct ext2_struct_u32_list {
+	int	magic;
+	int	num;
+	int	size;
+	__u32	*list;
+	int	badblocks_flags;
+};
+
+struct ext2_struct_u32_iterate {
+	int			magic;
+	ext2_u32_list		bb;
+	int			ptr;
+};
+
+
+/*
+ * Directory block iterator definition
+ */
+struct ext2_struct_dblist {
+	int			magic;
+	ext2_filsys		fs;
+	unsigned long long	size;
+	unsigned long long	count;
+	int			sorted;
+	struct ext2_db_entry2 *	list;
+};
+
+/*
+ * For directory iterators
+ */
+struct dir_context {
+	ext2_ino_t		dir;
+	int		flags;
+	char		*buf;
+	unsigned int	buflen;
+	int (*func)(ext2_ino_t	dir,
+		    int	entry,
+		    struct ext2_dir_entry *dirent,
+		    int	offset,
+		    int	blocksize,
+		    char	*buf,
+		    void	*priv_data);
+	void		*priv_data;
+	errcode_t	errcode;
+};
+
+/*
+ * Inode cache structure
+ */
+struct ext2_inode_cache {
+	void *				buffer;
+	blk64_t				buffer_blk;
+	int				cache_last;
+	unsigned int			cache_size;
+	int				refcount;
+	struct ext2_inode_cache_ent	*cache;
+};
+
+struct ext2_inode_cache_ent {
+	ext2_ino_t		ino;
+	struct ext2_inode	*inode;
+};
+
+/*
+ * NLS definitions
+ */
+struct ext2fs_nls_table {
+	int version;
+	const struct ext2fs_nls_ops *ops;
+};
+
+struct ext2fs_nls_ops {
+	int (*casefold)(const struct ext2fs_nls_table *charset,
+			const unsigned char *str, size_t len,
+			unsigned char *dest, size_t dlen);
+	int (*validate)(const struct ext2fs_nls_table *table,
+			char *s, size_t len, char **pos);
+	int (*casefold_cmp)(const struct ext2fs_nls_table *table,
+			    const unsigned char *str1, size_t len1,
+			    const unsigned char *str2, size_t len2);
+};
+
+/* Function prototypes */
+
+extern int ext2fs_process_dir_block(ext2_filsys  	fs,
+				    blk64_t		*blocknr,
+				    e2_blkcnt_t		blockcnt,
+				    blk64_t		ref_block,
+				    int			ref_offset,
+				    void		*priv_data);
+
+extern errcode_t ext2fs_inline_data_ea_remove(ext2_filsys fs, ext2_ino_t ino);
+extern errcode_t ext2fs_inline_data_expand(ext2_filsys fs, ext2_ino_t ino);
+extern int ext2fs_inline_data_dir_iterate(ext2_filsys fs,
+					  ext2_ino_t ino,
+					  void *priv_data);
+
+/* Generic numeric progress meter */
+
+struct ext2fs_numeric_progress_struct {
+	__u64		max;
+	int		log_max;
+	int		skip_progress;
+};
+
+/*
+ * progress callback functions
+ */
+struct ext2fs_progress_ops {
+	void (*init)(ext2_filsys fs,
+		     struct ext2fs_numeric_progress_struct * progress,
+		     const char *label, __u64 max);
+	void (*update)(ext2_filsys fs,
+		       struct ext2fs_numeric_progress_struct * progress,
+		       __u64 val);
+	void (*close)(ext2_filsys fs,
+		      struct ext2fs_numeric_progress_struct * progress,
+		      const char *message);
+};
+
+extern struct ext2fs_progress_ops ext2fs_numeric_progress_ops;
+
+extern void ext2fs_numeric_progress_init(ext2_filsys fs,
+					 struct ext2fs_numeric_progress_struct * progress,
+					 const char *label, __u64 max);
+extern void ext2fs_numeric_progress_update(ext2_filsys fs,
+					   struct ext2fs_numeric_progress_struct * progress,
+					   __u64 val);
+extern void ext2fs_numeric_progress_close(ext2_filsys fs,
+					  struct ext2fs_numeric_progress_struct * progress,
+					  const char *message);
+
+/*
+ * 64-bit bitmap support
+ */
+
+extern errcode_t ext2fs_alloc_generic_bmap(ext2_filsys fs, errcode_t magic,
+					   int type, __u64 start, __u64 end,
+					   __u64 real_end,
+					   const char * description,
+					   ext2fs_generic_bitmap *bmap);
+
+extern void ext2fs_free_generic_bmap(ext2fs_generic_bitmap bmap);
+
+extern errcode_t ext2fs_copy_generic_bmap(ext2fs_generic_bitmap src,
+					  ext2fs_generic_bitmap *dest);
+
+extern errcode_t ext2fs_resize_generic_bmap(ext2fs_generic_bitmap bmap,
+					    __u64 new_end,
+					    __u64 new_real_end);
+extern errcode_t ext2fs_fudge_generic_bmap_end(ext2fs_generic_bitmap bitmap,
+					       errcode_t neq,
+					       __u64 end, __u64 *oend);
+extern int ext2fs_mark_generic_bmap(ext2fs_generic_bitmap bitmap,
+				    __u64 arg);
+extern int ext2fs_unmark_generic_bmap(ext2fs_generic_bitmap bitmap,
+				      __u64 arg);
+extern int ext2fs_test_generic_bmap(ext2fs_generic_bitmap bitmap,
+				    __u64 arg);
+extern errcode_t ext2fs_set_generic_bmap_range(ext2fs_generic_bitmap bitmap,
+					       __u64 start, unsigned int num,
+					       void *in);
+extern errcode_t ext2fs_get_generic_bmap_range(ext2fs_generic_bitmap bitmap,
+					       __u64 start, unsigned int num,
+					       void *out);
+extern void ext2fs_warn_bitmap32(ext2fs_generic_bitmap bitmap,const char *func);
+
+extern int ext2fs_mem_is_zero(const char *mem, size_t len);
+
+extern int ext2fs_file_block_offset_too_big(ext2_filsys fs,
+					    struct ext2_inode *inode,
+					    blk64_t offset);
+
+/* atexit support */
+typedef void (*ext2_exit_fn)(void *);
+errcode_t ext2fs_add_exit_fn(ext2_exit_fn fn, void *data);
+errcode_t ext2fs_remove_exit_fn(ext2_exit_fn fn, void *data);
+
+#define EXT2FS_BUILD_BUG_ON(cond) ((void)sizeof(char[1 - 2*!!(cond)]))
diff --git a/lib/ext2fs/ext3_extents.h b/lib/ext2fs/ext3_extents.h
new file mode 100644
index 0000000..309fbc8
--- /dev/null
+++ b/lib/ext2fs/ext3_extents.h
@@ -0,0 +1,127 @@
+/*
+ * Copyright (c) 2003,2004 Cluster File Systems, Inc, info@clusterfs.com
+ * Written by Alex Tomas <alex@clusterfs.com>
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#ifndef _LINUX_EXT3_EXTENTS
+#define _LINUX_EXT3_EXTENTS
+
+/*
+ * ext3_inode has i_block array (total 60 bytes)
+ * first 4 bytes are used to store:
+ *  - tree depth (0 mean there is no tree yet. all extents in the inode)
+ *  - number of alive extents in the inode
+ */
+
+/*
+ * This is extent tail on-disk structure.
+ * All other extent structures are 12 bytes long.  It turns out that
+ * block_size % 12 >= 4 for at least all powers of 2 greater than 512, which
+ * covers all valid ext4 block sizes.  Therefore, this tail structure can be
+ * crammed into the end of the block without having to rebalance the tree.
+ */
+struct ext3_extent_tail {
+	__le32	et_checksum;	/* crc32c(uuid+inum+extent_block) */
+};
+
+/*
+ * this is extent on-disk structure
+ * it's used at the bottom of the tree
+ */
+struct ext3_extent {
+	__le32	ee_block;	/* first logical block extent covers */
+	__le16	ee_len;		/* number of blocks covered by extent */
+	__le16	ee_start_hi;	/* high 16 bits of physical block */
+	__le32	ee_start;	/* low 32 bigs of physical block */
+};
+
+/*
+ * this is index on-disk structure
+ * it's used at all the levels, but the bottom
+ */
+struct ext3_extent_idx {
+	__le32	ei_block;	/* index covers logical blocks from 'block' */
+	__le32	ei_leaf;	/* pointer to the physical block of the next *
+				 * level. leaf or next index could bet here */
+	__le16	ei_leaf_hi;	/* high 16 bits of physical block */
+	__le16	ei_unused;
+};
+
+/*
+ * each block (leaves and indexes), even inode-stored has header
+ */
+struct ext3_extent_header {
+	__le16	eh_magic;	/* probably will support different formats */
+	__le16	eh_entries;	/* number of valid entries */
+	__le16	eh_max;		/* capacity of store in entries */
+	__le16	eh_depth;	/* has tree real underlying blocks? */
+	__le32	eh_generation;	/* generation of the tree */
+};
+
+#define EXT3_EXT_MAGIC		0xf30a
+
+/*
+ * array of ext3_ext_path contains path to some extent
+ * creation/lookup routines use it for traversal/splitting/etc
+ * truncate uses it to simulate recursive walking
+ */
+struct ext3_ext_path {
+	__u32				p_block;
+	__u16				p_depth;
+	struct ext3_extent		*p_ext;
+	struct ext3_extent_idx		*p_idx;
+	struct ext3_extent_header	*p_hdr;
+	struct buffer_head		*p_bh;
+};
+
+/*
+ * EXT_INIT_MAX_LEN is the maximum number of blocks we can have in an
+ * initialized extent. This is 2^15 and not (2^16 - 1), since we use the
+ * MSB of ee_len field in the extent datastructure to signify if this
+ * particular extent is an initialized extent or an uninitialized (i.e.
+ * preallocated).
+ * EXT_UNINIT_MAX_LEN is the maximum number of blocks we can have in an
+ * uninitialized extent.
+ * If ee_len is <= 0x8000, it is an initialized extent. Otherwise, it is an
+ * uninitialized one. In other words, if MSB of ee_len is set, it is an
+ * uninitialized extent with only one special scenario when ee_len = 0x8000.
+ * In this case we can not have an uninitialized extent of zero length and
+ * thus we make it as a special case of initialized extent with 0x8000 length.
+ * This way we get better extent-to-group alignment for initialized extents.
+ * Hence, the maximum number of blocks we can have in an *initialized*
+ * extent is 2^15 (32768) and in an *uninitialized* extent is 2^15-1 (32767).
+ */
+#define EXT_INIT_MAX_LEN	(1UL << 15)
+#define EXT_UNINIT_MAX_LEN	(EXT_INIT_MAX_LEN - 1)
+#define EXT_MAX_EXTENT_LBLK	(((__u64) 1 << 32) - 1)
+#define EXT_MAX_EXTENT_PBLK	(((__u64) 1 << 48) - 1)
+
+#define EXT_FIRST_EXTENT(__hdr__) \
+	((struct ext3_extent *) (((char *) (__hdr__)) +		\
+				 sizeof(struct ext3_extent_header)))
+#define EXT_FIRST_INDEX(__hdr__) \
+	((struct ext3_extent_idx *) (((char *) (__hdr__)) +	\
+				     sizeof(struct ext3_extent_header)))
+#define EXT_HAS_FREE_INDEX(__path__) \
+	(ext2fs_le16_to_cpu((__path__)->p_hdr->eh_entries) < \
+	 ext2fs_le16_to_cpu((__path__)->p_hdr->eh_max))
+#define EXT_LAST_EXTENT(__hdr__) \
+	(EXT_FIRST_EXTENT((__hdr__)) + \
+	ext2fs_le16_to_cpu((__hdr__)->eh_entries) - 1)
+#define EXT_LAST_INDEX(__hdr__) \
+	(EXT_FIRST_INDEX((__hdr__)) + \
+	ext2fs_le16_to_cpu((__hdr__)->eh_entries) - 1)
+#define EXT_MAX_EXTENT(__hdr__) \
+	(EXT_FIRST_EXTENT((__hdr__)) + \
+	ext2fs_le16_to_cpu((__hdr__)->eh_max) - 1)
+#define EXT_MAX_INDEX(__hdr__) \
+	(EXT_FIRST_INDEX((__hdr__)) + \
+	ext2fs_le16_to_cpu((__hdr__)->eh_max) - 1)
+
+#endif /* _LINUX_EXT3_EXTENTS */
+
diff --git a/lib/ext2fs/ext4_acl.h b/lib/ext2fs/ext4_acl.h
new file mode 100644
index 0000000..8d4d974
--- /dev/null
+++ b/lib/ext2fs/ext4_acl.h
@@ -0,0 +1,62 @@
+/*
+ * Ext4's on-disk acl format.  From linux/fs/ext4/acl.h
+ */
+
+#define EXT4_ACL_VERSION        0x0001
+
+/* 23.2.5 acl_tag_t values */
+
+#define ACL_UNDEFINED_TAG	(0x00)
+#define ACL_USER_OBJ		(0x01)
+#define ACL_USER		(0x02)
+#define ACL_GROUP_OBJ		(0x04)
+#define ACL_GROUP		(0x08)
+#define ACL_MASK		(0x10)
+#define ACL_OTHER		(0x20)
+
+/* 23.3.6 acl_type_t values */
+
+#define ACL_TYPE_ACCESS		(0x8000)
+#define ACL_TYPE_DEFAULT	(0x4000)
+
+/* 23.2.7 ACL qualifier constants */
+
+#define ACL_UNDEFINED_ID	((id_t)-1)
+
+typedef struct {
+        __le16          e_tag;
+        __le16          e_perm;
+        __le32          e_id;
+ } ext4_acl_entry;
+ 
+typedef struct {
+        __le16          e_tag;
+        __le16          e_perm;
+} ext4_acl_entry_short;
+
+typedef struct {
+         __le32          a_version;
+} ext4_acl_header;
+
+
+/* Supported ACL a_version fields */
+ #define POSIX_ACL_XATTR_VERSION 0x0002
+
+typedef struct {
+        __le16                  e_tag;
+        __le16                  e_perm;
+        __le32                  e_id;
+} posix_acl_xattr_entry;
+
+typedef struct {
+        __le32                  a_version;
+#if __GNUC_PREREQ (4, 8)
+#pragma GCC diagnostic push
+#pragma GCC diagnostic ignored "-Wpedantic"
+#endif
+        posix_acl_xattr_entry   a_entries[0];
+#if __GNUC_PREREQ (4, 8)
+#pragma GCC diagnostic pop
+#endif
+} posix_acl_xattr_header;
+
diff --git a/lib/ext2fs/ext_attr.c b/lib/ext2fs/ext_attr.c
new file mode 100644
index 0000000..3494046
--- /dev/null
+++ b/lib/ext2fs/ext_attr.c
@@ -0,0 +1,1784 @@
+/*
+ * ext_attr.c --- extended attribute blocks
+ *
+ * Copyright (C) 2001 Andreas Gruenbacher, <a.gruenbacher@computer.org>
+ *
+ * Copyright (C) 2002 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <string.h>
+#include <time.h>
+
+#include "ext2_fs.h"
+#include "ext2_ext_attr.h"
+#include "ext4_acl.h"
+
+#include "ext2fs.h"
+
+static errcode_t read_ea_inode_hash(ext2_filsys fs, ext2_ino_t ino, __u32 *hash)
+{
+	struct ext2_inode inode;
+	errcode_t retval;
+
+	retval = ext2fs_read_inode(fs, ino, &inode);
+	if (retval)
+		return retval;
+	*hash = ext2fs_get_ea_inode_hash(&inode);
+	return 0;
+}
+
+#define NAME_HASH_SHIFT 5
+#define VALUE_HASH_SHIFT 16
+
+/*
+ * ext2_xattr_hash_entry()
+ *
+ * Compute the hash of an extended attribute.
+ */
+__u32 ext2fs_ext_attr_hash_entry(struct ext2_ext_attr_entry *entry, void *data)
+{
+	__u32 hash = 0;
+	unsigned char *name = (((unsigned char *) entry) +
+			       sizeof(struct ext2_ext_attr_entry));
+	int n;
+
+	for (n = 0; n < entry->e_name_len; n++) {
+		hash = (hash << NAME_HASH_SHIFT) ^
+		       (hash >> (8*sizeof(hash) - NAME_HASH_SHIFT)) ^
+		       *name++;
+	}
+
+	/* The hash needs to be calculated on the data in little-endian. */
+	if (entry->e_value_inum == 0 && entry->e_value_size != 0) {
+		__u32 *value = (__u32 *)data;
+		for (n = (entry->e_value_size + EXT2_EXT_ATTR_ROUND) >>
+			 EXT2_EXT_ATTR_PAD_BITS; n; n--) {
+			hash = (hash << VALUE_HASH_SHIFT) ^
+			       (hash >> (8*sizeof(hash) - VALUE_HASH_SHIFT)) ^
+			       ext2fs_le32_to_cpu(*value++);
+		}
+	}
+
+	return hash;
+}
+
+__u32 ext2fs_ext_attr_hash_entry_signed(struct ext2_ext_attr_entry *entry,
+					void *data)
+{
+	__u32 hash = 0;
+	signed char *name = (((signed char *) entry) +
+			     sizeof(struct ext2_ext_attr_entry));
+	int n;
+
+	for (n = 0; n < entry->e_name_len; n++) {
+		hash = (hash << NAME_HASH_SHIFT) ^
+		       (hash >> (8*sizeof(hash) - NAME_HASH_SHIFT)) ^
+		       *name++;
+	}
+
+	/* The hash needs to be calculated on the data in little-endian. */
+	if (entry->e_value_inum == 0 && entry->e_value_size != 0) {
+		__u32 *value = (__u32 *)data;
+		for (n = (entry->e_value_size + EXT2_EXT_ATTR_ROUND) >>
+			 EXT2_EXT_ATTR_PAD_BITS; n; n--) {
+			hash = (hash << VALUE_HASH_SHIFT) ^
+			       (hash >> (8*sizeof(hash) - VALUE_HASH_SHIFT)) ^
+			       ext2fs_le32_to_cpu(*value++);
+		}
+	}
+
+	return hash;
+}
+
+
+/*
+ * ext2fs_ext_attr_hash_entry3()
+ *
+ * Compute the hash of an extended attribute.  This version of the
+ * function supports hashing entries that reference external inodes
+ * (ea_inode feature) as well as calculating the old legacy signed
+ * hash variant.
+ */
+errcode_t ext2fs_ext_attr_hash_entry3(ext2_filsys fs,
+				      struct ext2_ext_attr_entry *entry,
+				      void *data, __u32 *hash,
+				      __u32 *signed_hash)
+{
+	*hash = ext2fs_ext_attr_hash_entry(entry, data);
+	if (signed_hash)
+		*signed_hash = ext2fs_ext_attr_hash_entry_signed(entry, data);
+
+	if (entry->e_value_inum) {
+		__u32 ea_inode_hash;
+		errcode_t retval;
+
+		retval = read_ea_inode_hash(fs, entry->e_value_inum,
+					    &ea_inode_hash);
+		if (retval)
+			return retval;
+
+		*hash = (*hash << VALUE_HASH_SHIFT) ^
+			(*hash >> (8*sizeof(*hash) - VALUE_HASH_SHIFT)) ^
+			ea_inode_hash;
+		if (signed_hash)
+			*signed_hash = (*signed_hash << VALUE_HASH_SHIFT) ^
+				(*signed_hash >> (8*sizeof(*hash) -
+						  VALUE_HASH_SHIFT)) ^
+				ea_inode_hash;
+	}
+	return 0;
+}
+
+/*
+ * ext2fs_ext_attr_hash_entry2()
+ *
+ * Compute the hash of an extended attribute.
+ * This version of the function supports hashing entries that reference
+ * external inodes (ea_inode feature).
+ */
+errcode_t ext2fs_ext_attr_hash_entry2(ext2_filsys fs,
+				      struct ext2_ext_attr_entry *entry,
+				      void *data, __u32 *hash)
+{
+	return ext2fs_ext_attr_hash_entry3(fs, entry, data, hash, NULL);
+}
+
+#undef NAME_HASH_SHIFT
+#undef VALUE_HASH_SHIFT
+
+#define BLOCK_HASH_SHIFT 16
+
+/* Mirrors ext4_xattr_rehash() implementation in kernel. */
+void ext2fs_ext_attr_block_rehash(struct ext2_ext_attr_header *header,
+				  struct ext2_ext_attr_entry *end)
+{
+	struct ext2_ext_attr_entry *here;
+	__u32 hash = 0;
+
+	here = (struct ext2_ext_attr_entry *)(header+1);
+	while (here < end && !EXT2_EXT_IS_LAST_ENTRY(here)) {
+		if (!here->e_hash) {
+			/* Block is not shared if an entry's hash value == 0 */
+			hash = 0;
+			break;
+		}
+		hash = (hash << BLOCK_HASH_SHIFT) ^
+		       (hash >> (8*sizeof(hash) - BLOCK_HASH_SHIFT)) ^
+		       here->e_hash;
+		here = EXT2_EXT_ATTR_NEXT(here);
+	}
+	header->h_hash = hash;
+}
+
+#undef BLOCK_HASH_SHIFT
+
+__u32 ext2fs_get_ea_inode_hash(struct ext2_inode *inode)
+{
+	return inode->i_atime;
+}
+
+void ext2fs_set_ea_inode_hash(struct ext2_inode *inode, __u32 hash)
+{
+	inode->i_atime = hash;
+}
+
+__u64 ext2fs_get_ea_inode_ref(struct ext2_inode *inode)
+{
+	return ((__u64)inode->i_ctime << 32) | inode->osd1.linux1.l_i_version;
+}
+
+void ext2fs_set_ea_inode_ref(struct ext2_inode *inode, __u64 ref_count)
+{
+	inode->i_ctime = (__u32)(ref_count >> 32);
+	inode->osd1.linux1.l_i_version = (__u32)ref_count;
+}
+
+static errcode_t check_ext_attr_header(struct ext2_ext_attr_header *header)
+{
+	if ((header->h_magic != EXT2_EXT_ATTR_MAGIC_v1 &&
+	     header->h_magic != EXT2_EXT_ATTR_MAGIC) ||
+	    header->h_blocks != 1)
+		return EXT2_ET_BAD_EA_HEADER;
+
+	return 0;
+}
+
+errcode_t ext2fs_read_ext_attr3(ext2_filsys fs, blk64_t block, void *buf,
+				ext2_ino_t inum)
+{
+	int		csum_failed = 0;
+	errcode_t	retval;
+
+	retval = io_channel_read_blk64(fs->io, block, 1, buf);
+	if (retval)
+		return retval;
+
+	if (!(fs->flags & EXT2_FLAG_IGNORE_CSUM_ERRORS) &&
+	    !ext2fs_ext_attr_block_csum_verify(fs, inum, block, buf))
+		csum_failed = 1;
+
+#ifdef WORDS_BIGENDIAN
+	ext2fs_swap_ext_attr(buf, buf, fs->blocksize, 1);
+#endif
+
+	retval = check_ext_attr_header(buf);
+	if (retval == 0 && csum_failed)
+		retval = EXT2_ET_EXT_ATTR_CSUM_INVALID;
+
+	return retval;
+}
+
+errcode_t ext2fs_read_ext_attr2(ext2_filsys fs, blk64_t block, void *buf)
+{
+	return ext2fs_read_ext_attr3(fs, block, buf, 0);
+}
+
+errcode_t ext2fs_read_ext_attr(ext2_filsys fs, blk_t block, void *buf)
+{
+	return ext2fs_read_ext_attr2(fs, block, buf);
+}
+
+errcode_t ext2fs_write_ext_attr3(ext2_filsys fs, blk64_t block, void *inbuf,
+				 ext2_ino_t inum)
+{
+	errcode_t	retval;
+	char		*write_buf;
+
+#ifdef WORDS_BIGENDIAN
+	retval = ext2fs_get_mem(fs->blocksize, &write_buf);
+	if (retval)
+		return retval;
+	ext2fs_swap_ext_attr(write_buf, inbuf, fs->blocksize, 1);
+#else
+	write_buf = (char *) inbuf;
+#endif
+
+	retval = ext2fs_ext_attr_block_csum_set(fs, inum, block,
+			(struct ext2_ext_attr_header *)write_buf);
+	if (retval)
+		return retval;
+
+	retval = io_channel_write_blk64(fs->io, block, 1, write_buf);
+#ifdef WORDS_BIGENDIAN
+	ext2fs_free_mem(&write_buf);
+#endif
+	if (!retval)
+		ext2fs_mark_changed(fs);
+	return retval;
+}
+
+errcode_t ext2fs_write_ext_attr2(ext2_filsys fs, blk64_t block, void *inbuf)
+{
+	return ext2fs_write_ext_attr3(fs, block, inbuf, 0);
+}
+
+errcode_t ext2fs_write_ext_attr(ext2_filsys fs, blk_t block, void *inbuf)
+{
+	return ext2fs_write_ext_attr2(fs, block, inbuf);
+}
+
+/*
+ * This function adjusts the reference count of the EA block.
+ */
+errcode_t ext2fs_adjust_ea_refcount3(ext2_filsys fs, blk64_t blk,
+				    char *block_buf, int adjust,
+				    __u32 *newcount, ext2_ino_t inum)
+{
+	errcode_t	retval;
+	struct ext2_ext_attr_header *header;
+	char	*buf = 0;
+
+	if ((blk >= ext2fs_blocks_count(fs->super)) ||
+	    (blk < fs->super->s_first_data_block))
+		return EXT2_ET_BAD_EA_BLOCK_NUM;
+
+	if (!block_buf) {
+		retval = ext2fs_get_mem(fs->blocksize, &buf);
+		if (retval)
+			return retval;
+		block_buf = buf;
+	}
+
+	retval = ext2fs_read_ext_attr3(fs, blk, block_buf, inum);
+	if (retval)
+		goto errout;
+
+	header = (struct ext2_ext_attr_header *) block_buf;
+	header->h_refcount += adjust;
+	if (newcount)
+		*newcount = header->h_refcount;
+
+	retval = ext2fs_write_ext_attr3(fs, blk, block_buf, inum);
+	if (retval)
+		goto errout;
+
+errout:
+	if (buf)
+		ext2fs_free_mem(&buf);
+	return retval;
+}
+
+errcode_t ext2fs_adjust_ea_refcount2(ext2_filsys fs, blk64_t blk,
+				    char *block_buf, int adjust,
+				    __u32 *newcount)
+{
+	return ext2fs_adjust_ea_refcount3(fs, blk, block_buf, adjust,
+					  newcount, 0);
+}
+
+errcode_t ext2fs_adjust_ea_refcount(ext2_filsys fs, blk_t blk,
+					char *block_buf, int adjust,
+					__u32 *newcount)
+{
+	return ext2fs_adjust_ea_refcount2(fs, blk, block_buf, adjust,
+					  newcount);
+}
+
+/* Manipulate the contents of extended attribute regions */
+struct ext2_xattr {
+	int name_index;
+	char *name;
+	char *short_name;
+	void *value;
+	unsigned int value_len;
+	ext2_ino_t ea_ino;
+};
+
+struct ext2_xattr_handle {
+	errcode_t magic;
+	ext2_filsys fs;
+	struct ext2_xattr *attrs;
+	int capacity;
+	int count;
+	int ibody_count;
+	ext2_ino_t ino;
+	unsigned int flags;
+};
+
+static errcode_t ext2fs_xattrs_expand(struct ext2_xattr_handle *h,
+				      unsigned int expandby)
+{
+	struct ext2_xattr *new_attrs;
+	errcode_t err;
+
+	err = ext2fs_get_arrayzero(h->capacity + expandby,
+				   sizeof(struct ext2_xattr), &new_attrs);
+	if (err)
+		return err;
+
+	memcpy(new_attrs, h->attrs, h->capacity * sizeof(struct ext2_xattr));
+	ext2fs_free_mem(&h->attrs);
+	h->capacity += expandby;
+	h->attrs = new_attrs;
+
+	return 0;
+}
+
+struct ea_name_index {
+	int index;
+	const char *name;
+};
+
+/* Keep these names sorted in order of decreasing specificity. */
+static struct ea_name_index ea_names[] = {
+	{10, "gnu."},
+	{3, "system.posix_acl_default"},
+	{2, "system.posix_acl_access"},
+	{8, "system.richacl"},
+	{6, "security."},
+	{4, "trusted."},
+	{7, "system."},
+	{1, "user."},
+	{0, NULL},
+};
+
+static const char *find_ea_prefix(int index)
+{
+	struct ea_name_index *e;
+
+	for (e = ea_names; e->name; e++)
+		if (e->index == index)
+			return e->name;
+
+	return NULL;
+}
+
+static int find_ea_index(const char *fullname, const char **name, int *index)
+{
+	struct ea_name_index *e;
+
+	for (e = ea_names; e->name; e++) {
+		if (strncmp(fullname, e->name, strlen(e->name)) == 0) {
+			*name = fullname + strlen(e->name);
+			*index = e->index;
+			return 1;
+		}
+	}
+	return 0;
+}
+
+errcode_t ext2fs_free_ext_attr(ext2_filsys fs, ext2_ino_t ino,
+			       struct ext2_inode_large *inode)
+{
+	struct ext2_ext_attr_header *header;
+	void *block_buf = NULL;
+	blk64_t blk;
+	errcode_t err;
+	struct ext2_inode_large i;
+
+	/* Read inode? */
+	if (inode == NULL) {
+		err = ext2fs_read_inode_full(fs, ino, (struct ext2_inode *)&i,
+					     sizeof(struct ext2_inode_large));
+		if (err)
+			return err;
+		inode = &i;
+	}
+
+	/* Do we already have an EA block? */
+	blk = ext2fs_file_acl_block(fs, (struct ext2_inode *)inode);
+	if (blk == 0)
+		return 0;
+
+	/* Find block, zero it, write back */
+	if ((blk < fs->super->s_first_data_block) ||
+	    (blk >= ext2fs_blocks_count(fs->super))) {
+		err = EXT2_ET_BAD_EA_BLOCK_NUM;
+		goto out;
+	}
+
+	err = ext2fs_get_mem(fs->blocksize, &block_buf);
+	if (err)
+		goto out;
+
+	err = ext2fs_read_ext_attr3(fs, blk, block_buf, ino);
+	if (err)
+		goto out2;
+
+	/* We only know how to deal with v2 EA blocks */
+	header = (struct ext2_ext_attr_header *) block_buf;
+	if (header->h_magic != EXT2_EXT_ATTR_MAGIC) {
+		err = EXT2_ET_BAD_EA_HEADER;
+		goto out2;
+	}
+
+	header->h_refcount--;
+	err = ext2fs_write_ext_attr3(fs, blk, block_buf, ino);
+	if (err)
+		goto out2;
+
+	/* Erase link to block */
+	ext2fs_file_acl_block_set(fs, (struct ext2_inode *)inode, 0);
+	if (header->h_refcount == 0)
+		ext2fs_block_alloc_stats2(fs, blk, -1);
+	err = ext2fs_iblk_sub_blocks(fs, (struct ext2_inode *)inode, 1);
+	if (err)
+		goto out2;
+
+	/* Write inode? */
+	if (inode == &i) {
+		err = ext2fs_write_inode_full(fs, ino, (struct ext2_inode *)&i,
+					      sizeof(struct ext2_inode_large));
+		if (err)
+			goto out2;
+	}
+
+out2:
+	ext2fs_free_mem(&block_buf);
+out:
+	return err;
+}
+
+static errcode_t prep_ea_block_for_write(ext2_filsys fs, ext2_ino_t ino,
+					 struct ext2_inode_large *inode)
+{
+	struct ext2_ext_attr_header *header;
+	void *block_buf = NULL;
+	blk64_t blk, goal;
+	errcode_t err;
+
+	/* Do we already have an EA block? */
+	blk = ext2fs_file_acl_block(fs, (struct ext2_inode *)inode);
+	if (blk != 0) {
+		if ((blk < fs->super->s_first_data_block) ||
+		    (blk >= ext2fs_blocks_count(fs->super))) {
+			err = EXT2_ET_BAD_EA_BLOCK_NUM;
+			goto out;
+		}
+
+		err = ext2fs_get_mem(fs->blocksize, &block_buf);
+		if (err)
+			goto out;
+
+		err = ext2fs_read_ext_attr3(fs, blk, block_buf, ino);
+		if (err)
+			goto out2;
+
+		/* We only know how to deal with v2 EA blocks */
+		header = (struct ext2_ext_attr_header *) block_buf;
+		if (header->h_magic != EXT2_EXT_ATTR_MAGIC) {
+			err = EXT2_ET_BAD_EA_HEADER;
+			goto out2;
+		}
+
+		/* Single-user block.  We're done here. */
+		if (header->h_refcount == 1)
+			goto out2;
+
+		/* We need to CoW the block. */
+		header->h_refcount--;
+		err = ext2fs_write_ext_attr3(fs, blk, block_buf, ino);
+		if (err)
+			goto out2;
+	} else {
+		/* No block, we must increment i_blocks */
+		err = ext2fs_iblk_add_blocks(fs, (struct ext2_inode *)inode,
+					     1);
+		if (err)
+			goto out;
+	}
+
+	/* Allocate a block */
+	goal = ext2fs_find_inode_goal(fs, ino, (struct ext2_inode *)inode, 0);
+	err = ext2fs_alloc_block2(fs, goal, NULL, &blk);
+	if (err)
+		goto out2;
+	ext2fs_file_acl_block_set(fs, (struct ext2_inode *)inode, blk);
+out2:
+	if (block_buf)
+		ext2fs_free_mem(&block_buf);
+out:
+	return err;
+}
+
+
+static inline int
+posix_acl_xattr_count(size_t size)
+{
+        if (size < sizeof(posix_acl_xattr_header))
+                return -1;
+        size -= sizeof(posix_acl_xattr_header);
+        if (size % sizeof(posix_acl_xattr_entry))
+                return -1;
+        return size / sizeof(posix_acl_xattr_entry);
+}
+
+/*
+ * The lgetxattr function returns data formatted in the POSIX extended
+ * attribute format.  The on-disk format uses a more compact encoding.
+ * See the ext4_acl_to_disk in fs/ext4/acl.c.
+ */
+static errcode_t convert_posix_acl_to_disk_buffer(const void *value, size_t size,
+						  void *out_buf, size_t *size_out)
+{
+	const posix_acl_xattr_header *header =
+		(const posix_acl_xattr_header*) value;
+	const posix_acl_xattr_entry *end, *entry =
+		(const posix_acl_xattr_entry *)(header+1);
+	ext4_acl_header *ext_acl;
+	size_t s;
+	char *e;
+
+	int count;
+
+	if (!value)
+		return EINVAL;
+	if (size < sizeof(posix_acl_xattr_header))
+		return ENOMEM;
+	if (header->a_version != ext2fs_cpu_to_le32(POSIX_ACL_XATTR_VERSION))
+		return EINVAL;
+
+	count = posix_acl_xattr_count(size);
+	ext_acl = out_buf;
+	ext_acl->a_version = ext2fs_cpu_to_le32(EXT4_ACL_VERSION);
+
+	if (count <= 0)
+		return EINVAL;
+
+	e = (char *) out_buf + sizeof(ext4_acl_header);
+	s = sizeof(ext4_acl_header);
+	for (end = entry + count; entry != end;entry++) {
+		ext4_acl_entry *disk_entry = (ext4_acl_entry*) e;
+		disk_entry->e_tag = entry->e_tag;
+		disk_entry->e_perm = entry->e_perm;
+
+		switch(ext2fs_le16_to_cpu(entry->e_tag)) {
+			case ACL_USER_OBJ:
+			case ACL_GROUP_OBJ:
+			case ACL_MASK:
+			case ACL_OTHER:
+				e += sizeof(ext4_acl_entry_short);
+				s += sizeof(ext4_acl_entry_short);
+				break;
+			case ACL_USER:
+			case ACL_GROUP:
+				disk_entry->e_id = entry->e_id;
+				e += sizeof(ext4_acl_entry);
+				s += sizeof(ext4_acl_entry);
+				break;
+			default:
+				return EINVAL;
+		}
+	}
+	*size_out = s;
+	return 0;
+}
+
+static errcode_t convert_disk_buffer_to_posix_acl(const void *value, size_t size,
+						  void **out_buf, size_t *size_out)
+{
+	posix_acl_xattr_header *header;
+	posix_acl_xattr_entry *entry;
+	const ext4_acl_header *ext_acl = (const ext4_acl_header *) value;
+	errcode_t err;
+	const char *cp;
+	char *out;
+
+	if ((!value) ||
+	    (size < sizeof(ext4_acl_header)) ||
+	    (ext_acl->a_version != ext2fs_cpu_to_le32(EXT4_ACL_VERSION)))
+		return EINVAL;
+
+	err = ext2fs_get_mem(size * 2, &out);
+	if (err)
+		return err;
+
+	header = (posix_acl_xattr_header *) out;
+	header->a_version = ext2fs_cpu_to_le32(POSIX_ACL_XATTR_VERSION);
+	entry = (posix_acl_xattr_entry *) (out + sizeof(posix_acl_xattr_header));
+
+	cp = (const char *) value + sizeof(ext4_acl_header);
+	size -= sizeof(ext4_acl_header);
+
+	while (size > 0) {
+		const ext4_acl_entry *disk_entry = (const ext4_acl_entry *) cp;
+
+		entry->e_tag = disk_entry->e_tag;
+		entry->e_perm = disk_entry->e_perm;
+
+		switch(ext2fs_le16_to_cpu(entry->e_tag)) {
+			case ACL_USER_OBJ:
+			case ACL_GROUP_OBJ:
+			case ACL_MASK:
+			case ACL_OTHER:
+				entry->e_id = 0;
+				cp += sizeof(ext4_acl_entry_short);
+				size -= sizeof(ext4_acl_entry_short);
+				break;
+			case ACL_USER:
+			case ACL_GROUP:
+				entry->e_id = disk_entry->e_id;
+				cp += sizeof(ext4_acl_entry);
+				size -= sizeof(ext4_acl_entry);
+				break;
+			default:
+				ext2fs_free_mem(&out);
+				return EINVAL;
+		}
+		entry++;
+	}
+	*out_buf = out;
+	*size_out = ((char *) entry - out);
+	return 0;
+}
+
+static errcode_t
+write_xattrs_to_buffer(ext2_filsys fs, struct ext2_xattr *attrs, int count,
+		       void *entries_start, unsigned int storage_size,
+		       unsigned int value_offset_correction, int write_hash)
+{
+	struct ext2_xattr *x;
+	struct ext2_ext_attr_entry *e = entries_start;
+	char *end = (char *) entries_start + storage_size;
+	unsigned int value_size;
+	errcode_t err;
+
+	memset(entries_start, 0, storage_size);
+	for (x = attrs; x < attrs + count; x++) {
+		value_size = ((x->value_len + EXT2_EXT_ATTR_PAD - 1) /
+			      EXT2_EXT_ATTR_PAD) * EXT2_EXT_ATTR_PAD;
+
+		/* Fill out e appropriately */
+		e->e_name_len = strlen(x->short_name);
+		e->e_name_index = x->name_index;
+
+		e->e_value_size = x->value_len;
+		e->e_value_inum = x->ea_ino;
+
+		/* Store name */
+		memcpy((char *)e + sizeof(*e), x->short_name, e->e_name_len);
+		if (x->ea_ino) {
+			e->e_value_offs = 0;
+		} else {
+			end -= value_size;
+			e->e_value_offs = end - (char *) entries_start +
+						value_offset_correction;
+			memcpy(end, x->value, e->e_value_size);
+		}
+
+		if (write_hash || x->ea_ino) {
+			err = ext2fs_ext_attr_hash_entry2(fs, e,
+							  x->ea_ino ? 0 : end,
+							  &e->e_hash);
+			if (err)
+				return err;
+		} else
+			e->e_hash = 0;
+
+		e = EXT2_EXT_ATTR_NEXT(e);
+		*(__u32 *)e = 0;
+	}
+	return 0;
+}
+
+errcode_t ext2fs_xattrs_write(struct ext2_xattr_handle *handle)
+{
+	ext2_filsys fs = handle->fs;
+	const unsigned int inode_size = EXT2_INODE_SIZE(fs->super);
+	struct ext2_inode_large *inode;
+	char *start, *block_buf = NULL;
+	struct ext2_ext_attr_header *header;
+	__u32 ea_inode_magic;
+	blk64_t blk;
+	unsigned int storage_size;
+	unsigned int i;
+	errcode_t err;
+
+	EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EA_HANDLE);
+	i = inode_size;
+	if (i < sizeof(*inode))
+		i = sizeof(*inode);
+	err = ext2fs_get_memzero(i, &inode);
+	if (err)
+		return err;
+
+	err = ext2fs_read_inode_full(fs, handle->ino, EXT2_INODE(inode),
+				     inode_size);
+	if (err)
+		goto out;
+
+	/* If extra_isize isn't set, we need to set it now */
+	if (inode->i_extra_isize == 0 &&
+	    inode_size > EXT2_GOOD_OLD_INODE_SIZE) {
+		char *p = (char *)inode;
+		size_t extra = fs->super->s_want_extra_isize;
+
+		if (extra == 0)
+			extra = sizeof(__u32);
+		memset(p + EXT2_GOOD_OLD_INODE_SIZE, 0, extra);
+		inode->i_extra_isize = extra;
+	}
+	if (inode->i_extra_isize & 3) {
+		err = EXT2_ET_INODE_CORRUPTED;
+		goto out;
+	}
+
+	/* Does the inode have space for EA? */
+	if (inode->i_extra_isize < sizeof(inode->i_extra_isize) ||
+	    inode_size <= EXT2_GOOD_OLD_INODE_SIZE + inode->i_extra_isize +
+								sizeof(__u32))
+		goto write_ea_block;
+
+	/* Write the inode EA */
+	ea_inode_magic = EXT2_EXT_ATTR_MAGIC;
+	memcpy(((char *) inode) + EXT2_GOOD_OLD_INODE_SIZE +
+	       inode->i_extra_isize, &ea_inode_magic, sizeof(__u32));
+	storage_size = inode_size - EXT2_GOOD_OLD_INODE_SIZE -
+				inode->i_extra_isize - sizeof(__u32);
+	start = ((char *) inode) + EXT2_GOOD_OLD_INODE_SIZE +
+				inode->i_extra_isize + sizeof(__u32);
+
+	err = write_xattrs_to_buffer(fs, handle->attrs, handle->ibody_count,
+				     start, storage_size, 0, 0);
+	if (err)
+		goto out;
+write_ea_block:
+	/* Are we done? */
+	if (handle->ibody_count == handle->count &&
+	    !ext2fs_file_acl_block(fs, EXT2_INODE(inode)))
+		goto skip_ea_block;
+
+	/* Write the EA block */
+	err = ext2fs_get_memzero(fs->blocksize, &block_buf);
+	if (err)
+		goto out;
+
+	storage_size = fs->blocksize - sizeof(struct ext2_ext_attr_header);
+	start = block_buf + sizeof(struct ext2_ext_attr_header);
+
+	err = write_xattrs_to_buffer(fs, handle->attrs + handle->ibody_count,
+				     handle->count - handle->ibody_count, start,
+				     storage_size, start - block_buf, 1);
+	if (err)
+		goto out2;
+
+	/* Write a header on the EA block */
+	header = (struct ext2_ext_attr_header *) block_buf;
+	header->h_magic = EXT2_EXT_ATTR_MAGIC;
+	header->h_refcount = 1;
+	header->h_blocks = 1;
+
+	/* Get a new block for writing */
+	err = prep_ea_block_for_write(fs, handle->ino, inode);
+	if (err)
+		goto out2;
+
+	/* Finally, write the new EA block */
+	blk = ext2fs_file_acl_block(fs, EXT2_INODE(inode));
+	err = ext2fs_write_ext_attr3(fs, blk, block_buf, handle->ino);
+	if (err)
+		goto out2;
+
+skip_ea_block:
+	blk = ext2fs_file_acl_block(fs, (struct ext2_inode *)inode);
+	if (!block_buf && blk) {
+		/* xattrs shrunk, free the block */
+		err = ext2fs_free_ext_attr(fs, handle->ino, inode);
+		if (err)
+			goto out;
+	}
+
+	/* Write the inode */
+	err = ext2fs_write_inode_full(fs, handle->ino, EXT2_INODE(inode),
+				      inode_size);
+	if (err)
+		goto out2;
+
+out2:
+	ext2fs_free_mem(&block_buf);
+out:
+	ext2fs_free_mem(&inode);
+	return err;
+}
+
+static errcode_t read_xattrs_from_buffer(struct ext2_xattr_handle *handle,
+					 struct ext2_inode_large *inode,
+					 struct ext2_ext_attr_entry *entries,
+					 unsigned int storage_size,
+					 char *value_start)
+{
+	struct ext2_xattr *x;
+	struct ext2_ext_attr_entry *entry, *end;
+	const char *prefix;
+	unsigned int remain, prefix_len;
+	errcode_t err;
+	unsigned int values_size = storage_size +
+			((char *)entries - value_start);
+
+	/* find the end */
+	end = entries;
+	remain = storage_size;
+	while (remain >= sizeof(struct ext2_ext_attr_entry) &&
+	       !EXT2_EXT_IS_LAST_ENTRY(end)) {
+
+		/* header eats this space */
+		remain -= sizeof(struct ext2_ext_attr_entry);
+
+		/* is attribute name valid? */
+		if (EXT2_EXT_ATTR_SIZE(end->e_name_len) > remain)
+			return EXT2_ET_EA_BAD_NAME_LEN;
+
+		/* attribute len eats this space */
+		remain -= EXT2_EXT_ATTR_SIZE(end->e_name_len);
+		end = EXT2_EXT_ATTR_NEXT(end);
+	}
+
+	entry = entries;
+	remain = storage_size;
+	while (remain >= sizeof(struct ext2_ext_attr_entry) &&
+	       !EXT2_EXT_IS_LAST_ENTRY(entry)) {
+
+		/* Allocate space for more attrs? */
+		if (handle->count == handle->capacity) {
+			err = ext2fs_xattrs_expand(handle, 4);
+			if (err)
+				return err;
+		}
+
+		x = handle->attrs + handle->count;
+
+		/* header eats this space */
+		remain -= sizeof(struct ext2_ext_attr_entry);
+
+		/* attribute len eats this space */
+		remain -= EXT2_EXT_ATTR_SIZE(entry->e_name_len);
+
+		/* Extract name */
+		prefix = find_ea_prefix(entry->e_name_index);
+		prefix_len = (prefix ? strlen(prefix) : 0);
+		err = ext2fs_get_memzero(entry->e_name_len + prefix_len + 1,
+					 &x->name);
+		if (err)
+			return err;
+		if (prefix)
+			memcpy(x->name, prefix, prefix_len);
+		if (entry->e_name_len)
+			memcpy(x->name + prefix_len,
+			       (char *)entry + sizeof(*entry),
+			       entry->e_name_len);
+		x->short_name = x->name + prefix_len;
+		x->name_index = entry->e_name_index;
+
+		/* Check & copy value */
+		if (!ext2fs_has_feature_ea_inode(handle->fs->super) &&
+		    entry->e_value_inum != 0)
+			return EXT2_ET_BAD_EA_BLOCK_NUM;
+
+		if (entry->e_value_inum == 0) {
+			if (entry->e_value_size > remain)
+				return EXT2_ET_EA_BAD_VALUE_SIZE;
+
+			if (entry->e_value_offs + entry->e_value_size > values_size)
+				return EXT2_ET_EA_BAD_VALUE_OFFSET;
+
+			if (entry->e_value_size > 0 &&
+			    value_start + entry->e_value_offs <
+			    (char *)end + sizeof(__u32))
+				return EXT2_ET_EA_BAD_VALUE_OFFSET;
+
+			remain -= entry->e_value_size;
+
+			err = ext2fs_get_mem(entry->e_value_size, &x->value);
+			if (err)
+				return err;
+			memcpy(x->value, value_start + entry->e_value_offs,
+			       entry->e_value_size);
+		} else {
+			struct ext2_inode *ea_inode;
+			ext2_file_t ea_file;
+
+			if (entry->e_value_offs != 0)
+				return EXT2_ET_EA_BAD_VALUE_OFFSET;
+
+			if (entry->e_value_size > (64 * 1024))
+				return EXT2_ET_EA_BAD_VALUE_SIZE;
+
+			err = ext2fs_get_mem(entry->e_value_size, &x->value);
+			if (err)
+				return err;
+
+			err = ext2fs_file_open(handle->fs, entry->e_value_inum,
+					       0, &ea_file);
+			if (err)
+				return err;
+
+			ea_inode = ext2fs_file_get_inode(ea_file);
+			if ((ea_inode->i_flags & EXT4_INLINE_DATA_FL) ||
+			    !(ea_inode->i_flags & EXT4_EA_INODE_FL) ||
+			    ea_inode->i_links_count == 0)
+				err = EXT2_ET_EA_INODE_CORRUPTED;
+			else if ((__u64) ext2fs_file_get_size(ea_file) !=
+				 entry->e_value_size)
+				err = EXT2_ET_EA_BAD_VALUE_SIZE;
+			else
+				err = ext2fs_file_read(ea_file, x->value,
+						       entry->e_value_size, 0);
+			ext2fs_file_close(ea_file);
+			if (err)
+				return err;
+		}
+
+		x->ea_ino = entry->e_value_inum;
+		x->value_len = entry->e_value_size;
+
+		/* e_hash may be 0 in older inode's ea */
+		if (entry->e_hash != 0) {
+			__u32 hash, signed_hash;
+
+			void *data = (entry->e_value_inum != 0) ?
+					0 : value_start + entry->e_value_offs;
+
+			err = ext2fs_ext_attr_hash_entry3(handle->fs, entry,
+							  data, &hash,
+							  &signed_hash);
+			if (err)
+				return err;
+			if ((entry->e_hash != hash) &&
+			    (entry->e_hash != signed_hash)) {
+				struct ext2_inode child;
+
+				/* Check whether this is an old Lustre-style
+				 * ea_inode reference.
+				 */
+				err = ext2fs_read_inode(handle->fs,
+							entry->e_value_inum,
+							&child);
+				if (err)
+					return err;
+				if (child.i_mtime != handle->ino ||
+				    child.i_generation != inode->i_generation)
+					return EXT2_ET_BAD_EA_HASH;
+			}
+		}
+
+		handle->count++;
+		entry = EXT2_EXT_ATTR_NEXT(entry);
+	}
+
+	return 0;
+}
+
+static void xattrs_free_keys(struct ext2_xattr_handle *h)
+{
+	struct ext2_xattr *a = h->attrs;
+	int i;
+
+	for (i = 0; i < h->capacity; i++) {
+		if (a[i].name)
+			ext2fs_free_mem(&a[i].name);
+		if (a[i].value)
+			ext2fs_free_mem(&a[i].value);
+	}
+	h->count = 0;
+	h->ibody_count = 0;
+}
+
+/* fetch xattrs from an already-loaded inode */
+errcode_t ext2fs_xattrs_read_inode(struct ext2_xattr_handle *handle,
+				   struct ext2_inode_large *inode)
+{
+	struct ext2_ext_attr_header *header;
+	__u32 ea_inode_magic;
+	unsigned int storage_size;
+	char *start, *block_buf = NULL;
+	blk64_t blk;
+	errcode_t err = 0;
+
+	EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EA_HANDLE);
+
+	xattrs_free_keys(handle);
+
+	/* Does the inode have space for EA? */
+	if (inode->i_extra_isize < sizeof(inode->i_extra_isize) ||
+	    EXT2_INODE_SIZE(handle->fs->super) <= EXT2_GOOD_OLD_INODE_SIZE +
+						  inode->i_extra_isize +
+						  sizeof(__u32))
+		goto read_ea_block;
+	if (inode->i_extra_isize & 3) {
+		err = EXT2_ET_INODE_CORRUPTED;
+		goto out;
+	}
+
+	/* Look for EA in the inode */
+	memcpy(&ea_inode_magic, ((char *) inode) + EXT2_GOOD_OLD_INODE_SIZE +
+	       inode->i_extra_isize, sizeof(__u32));
+	if (ea_inode_magic == EXT2_EXT_ATTR_MAGIC) {
+		storage_size = EXT2_INODE_SIZE(handle->fs->super) -
+			EXT2_GOOD_OLD_INODE_SIZE - inode->i_extra_isize -
+			sizeof(__u32);
+		start = ((char *) inode) + EXT2_GOOD_OLD_INODE_SIZE +
+			inode->i_extra_isize + sizeof(__u32);
+
+		err = read_xattrs_from_buffer(handle, inode,
+					(struct ext2_ext_attr_entry *) start,
+					storage_size, start);
+		if (err)
+			goto out;
+
+		handle->ibody_count = handle->count;
+	}
+
+read_ea_block:
+	/* Look for EA in a separate EA block */
+	blk = ext2fs_file_acl_block(handle->fs, EXT2_INODE(inode));
+	if (blk != 0) {
+		if ((blk < handle->fs->super->s_first_data_block) ||
+		    (blk >= ext2fs_blocks_count(handle->fs->super))) {
+			err = EXT2_ET_BAD_EA_BLOCK_NUM;
+			goto out;
+		}
+
+		err = ext2fs_get_mem(handle->fs->blocksize, &block_buf);
+		if (err)
+			goto out;
+
+		err = ext2fs_read_ext_attr3(handle->fs, blk, block_buf,
+					    handle->ino);
+		if (err)
+			goto out3;
+
+		/* We only know how to deal with v2 EA blocks */
+		header = (struct ext2_ext_attr_header *) block_buf;
+		if (header->h_magic != EXT2_EXT_ATTR_MAGIC) {
+			err = EXT2_ET_BAD_EA_HEADER;
+			goto out3;
+		}
+
+		/* Read EAs */
+		storage_size = handle->fs->blocksize -
+			sizeof(struct ext2_ext_attr_header);
+		start = block_buf + sizeof(struct ext2_ext_attr_header);
+		err = read_xattrs_from_buffer(handle, inode,
+					(struct ext2_ext_attr_entry *) start,
+					storage_size, block_buf);
+	}
+
+out3:
+	if (block_buf)
+		ext2fs_free_mem(&block_buf);
+out:
+	return err;
+}
+
+errcode_t ext2fs_xattrs_read(struct ext2_xattr_handle *handle)
+{
+	struct ext2_inode_large *inode;
+	size_t inode_size = EXT2_INODE_SIZE(handle->fs->super);
+	errcode_t err;
+
+	EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EA_HANDLE);
+
+	if (inode_size < sizeof(*inode))
+		inode_size = sizeof(*inode);
+	err = ext2fs_get_memzero(inode_size, &inode);
+	if (err)
+		return err;
+
+	err = ext2fs_read_inode_full(handle->fs, handle->ino, EXT2_INODE(inode),
+				     EXT2_INODE_SIZE(handle->fs->super));
+	if (err)
+		goto out;
+
+	err = ext2fs_xattrs_read_inode(handle, inode);
+
+out:
+	ext2fs_free_mem(&inode);
+
+	return err;
+}
+
+errcode_t ext2fs_xattrs_iterate(struct ext2_xattr_handle *h,
+				int (*func)(char *name, char *value,
+					    size_t value_len, void *data),
+				void *data)
+{
+	struct ext2_xattr *x;
+	int dirty = 0;
+	int ret;
+
+	EXT2_CHECK_MAGIC(h, EXT2_ET_MAGIC_EA_HANDLE);
+	for (x = h->attrs; x < h->attrs + h->count; x++) {
+		ret = func(x->name, x->value, x->value_len, data);
+		if (ret & XATTR_CHANGED)
+			dirty = 1;
+		if (ret & XATTR_ABORT)
+			break;
+	}
+
+	if (dirty)
+		return ext2fs_xattrs_write(h);
+	return 0;
+}
+
+errcode_t ext2fs_xattr_get(struct ext2_xattr_handle *h, const char *key,
+			   void **value, size_t *value_len)
+{
+	struct ext2_xattr *x;
+	char *val;
+	errcode_t err;
+
+	EXT2_CHECK_MAGIC(h, EXT2_ET_MAGIC_EA_HANDLE);
+	for (x = h->attrs; x < h->attrs + h->count; x++) {
+		if (strcmp(x->name, key))
+			continue;
+
+		if (!(h->flags & XATTR_HANDLE_FLAG_RAW) &&
+		    ((strcmp(key, "system.posix_acl_default") == 0) ||
+		     (strcmp(key, "system.posix_acl_access") == 0))) {
+			err = convert_disk_buffer_to_posix_acl(x->value, x->value_len,
+							       value, value_len);
+			return err;
+		} else {
+			err = ext2fs_get_mem(x->value_len, &val);
+			if (err)
+				return err;
+			memcpy(val, x->value, x->value_len);
+			*value = val;
+			*value_len = x->value_len;
+			return 0;
+		}
+	}
+
+	return EXT2_ET_EA_KEY_NOT_FOUND;
+}
+
+errcode_t ext2fs_xattr_inode_max_size(ext2_filsys fs, ext2_ino_t ino,
+				      size_t *size)
+{
+	struct ext2_ext_attr_entry *entry;
+	struct ext2_inode_large *inode;
+	__u32 ea_inode_magic;
+	unsigned int minoff;
+	char *start;
+	size_t i;
+	errcode_t err;
+
+	i = EXT2_INODE_SIZE(fs->super);
+	if (i < sizeof(*inode))
+		i = sizeof(*inode);
+	err = ext2fs_get_memzero(i, &inode);
+	if (err)
+		return err;
+
+	err = ext2fs_read_inode_full(fs, ino, (struct ext2_inode *)inode,
+				     EXT2_INODE_SIZE(fs->super));
+	if (err)
+		goto out;
+
+	/* Does the inode have size for EA? */
+	if (EXT2_INODE_SIZE(fs->super) <= EXT2_GOOD_OLD_INODE_SIZE +
+						  inode->i_extra_isize +
+						  sizeof(__u32)) {
+		err = EXT2_ET_INLINE_DATA_NO_SPACE;
+		goto out;
+	}
+
+	minoff = EXT2_INODE_SIZE(fs->super) - sizeof(*inode) - sizeof(__u32);
+	memcpy(&ea_inode_magic, ((char *) inode) + EXT2_GOOD_OLD_INODE_SIZE +
+	       inode->i_extra_isize, sizeof(__u32));
+	if (ea_inode_magic == EXT2_EXT_ATTR_MAGIC) {
+		/* has xattrs.  calculate the size */
+		start= ((char *) inode) + EXT2_GOOD_OLD_INODE_SIZE +
+			inode->i_extra_isize + sizeof(__u32);
+		entry = (struct ext2_ext_attr_entry *) start;
+		while (!EXT2_EXT_IS_LAST_ENTRY(entry)) {
+			if (!entry->e_value_inum && entry->e_value_size) {
+				unsigned int offs = entry->e_value_offs;
+				if (offs < minoff)
+					minoff = offs;
+			}
+			entry = EXT2_EXT_ATTR_NEXT(entry);
+		}
+		*size = minoff - ((char *)entry - (char *)start) - sizeof(__u32);
+	} else {
+		/* no xattr.  return a maximum size */
+		*size = EXT2_EXT_ATTR_SIZE(minoff -
+					   EXT2_EXT_ATTR_LEN(strlen("data")) -
+					   EXT2_EXT_ATTR_ROUND - sizeof(__u32));
+	}
+
+out:
+	ext2fs_free_mem(&inode);
+	return err;
+}
+
+static errcode_t xattr_create_ea_inode(ext2_filsys fs, const void *value,
+				       size_t value_len, ext2_ino_t *ea_ino)
+{
+	struct ext2_inode inode;
+	ext2_ino_t ino;
+	ext2_file_t file;
+	__u32 hash;
+	errcode_t ret;
+
+	ret = ext2fs_new_inode(fs, 0, 0, 0, &ino);
+	if (ret)
+		return ret;
+
+	memset(&inode, 0, sizeof(inode));
+	inode.i_flags |= EXT4_EA_INODE_FL;
+	if (ext2fs_has_feature_extents(fs->super))
+		inode.i_flags |= EXT4_EXTENTS_FL;
+	inode.i_size = 0;
+	inode.i_mode = LINUX_S_IFREG | 0600;
+	inode.i_links_count = 1;
+	ret = ext2fs_write_new_inode(fs, ino, &inode);
+	if (ret)
+		return ret;
+	/*
+	 * ref_count and hash utilize inode's i_*time fields.
+	 * ext2fs_write_new_inode() call above initializes these fields with
+	 * current time. That's why ref count and hash updates are done
+	 * separately below.
+	 */
+	ext2fs_set_ea_inode_ref(&inode, 1);
+	hash = ext2fs_crc32c_le(fs->csum_seed, value, value_len);
+	ext2fs_set_ea_inode_hash(&inode, hash);
+
+	ret = ext2fs_write_inode(fs, ino, &inode);
+	if (ret)
+		return ret;
+
+	ret = ext2fs_file_open(fs, ino, EXT2_FILE_WRITE, &file);
+	if (ret)
+		return ret;
+	ret = ext2fs_file_write(file, value, value_len, NULL);
+	ext2fs_file_close(file);
+	if (ret)
+		return ret;
+
+	ext2fs_inode_alloc_stats2(fs, ino, 1 /* inuse */, 0 /* isdir */);
+
+	*ea_ino = ino;
+	return 0;
+}
+
+static errcode_t xattr_inode_dec_ref(ext2_filsys fs, ext2_ino_t ino)
+{
+	struct ext2_inode_large inode;
+	__u64 ref_count;
+	errcode_t ret;
+
+	ret = ext2fs_read_inode_full(fs, ino, (struct ext2_inode *)&inode,
+				     sizeof(inode));
+	if (ret)
+		goto out;
+
+	ref_count = ext2fs_get_ea_inode_ref(EXT2_INODE(&inode));
+	ref_count--;
+	ext2fs_set_ea_inode_ref(EXT2_INODE(&inode), ref_count);
+
+	if (ref_count)
+		goto write_out;
+
+	inode.i_links_count = 0;
+	inode.i_dtime = fs->now ? fs->now : time(0);
+
+	ret = ext2fs_free_ext_attr(fs, ino, &inode);
+	if (ret)
+		goto write_out;
+
+	if (ext2fs_inode_has_valid_blocks2(fs, (struct ext2_inode *)&inode)) {
+		ret = ext2fs_punch(fs, ino, (struct ext2_inode *)&inode, NULL,
+				   0, ~0ULL);
+		if (ret)
+			goto out;
+	}
+
+	ext2fs_inode_alloc_stats2(fs, ino, -1 /* inuse */, 0 /* is_dir */);
+
+write_out:
+	ret = ext2fs_write_inode_full(fs, ino, (struct ext2_inode *)&inode,
+				      sizeof(inode));
+out:
+	return ret;
+}
+
+static errcode_t xattr_update_entry(ext2_filsys fs, struct ext2_xattr *x,
+				    const char *name, const char *short_name,
+				    int index, const void *value,
+				    size_t value_len, int in_inode)
+{
+	ext2_ino_t ea_ino = 0;
+	void *new_value = NULL;
+	char *new_name = NULL;
+	int name_len;
+	errcode_t ret;
+
+	if (!x->name) {
+		name_len = strlen(name);
+		ret = ext2fs_get_mem(name_len + 1, &new_name);
+		if (ret)
+			goto fail;
+		memcpy(new_name, name, name_len + 1);
+	}
+
+	ret = ext2fs_get_mem(value_len, &new_value);
+	if (ret)
+		goto fail;
+	memcpy(new_value, value, value_len);
+
+	if (in_inode) {
+		ret = xattr_create_ea_inode(fs, value, value_len, &ea_ino);
+		if (ret)
+			goto fail;
+	}
+
+	if (x->ea_ino) {
+		ret = xattr_inode_dec_ref(fs, x->ea_ino);
+		if (ret)
+			goto fail;
+	}
+
+	if (!x->name) {
+		x->name = new_name;
+		x->short_name = new_name + (short_name  - name);
+	}
+	x->name_index = index;
+
+	if (x->value)
+		ext2fs_free_mem(&x->value);
+	x->value = new_value;
+	x->value_len = value_len;
+	x->ea_ino = ea_ino;
+	return 0;
+fail:
+	if (new_name)
+		ext2fs_free_mem(&new_name);
+	if (new_value)
+		ext2fs_free_mem(&new_value);
+	if (ea_ino)
+		xattr_inode_dec_ref(fs, ea_ino);
+	return ret;
+}
+
+static int xattr_find_position(struct ext2_xattr *attrs, int count,
+			       const char *shortname, int name_idx)
+{
+	struct ext2_xattr *x;
+	int i;
+	int shortname_len, x_shortname_len;
+
+	shortname_len = strlen(shortname);
+
+	for (i = 0, x = attrs; i < count; i++, x++) {
+		if (name_idx < x->name_index)
+			break;
+		if (name_idx > x->name_index)
+			continue;
+
+		x_shortname_len = strlen(x->short_name);
+		if (shortname_len < x_shortname_len)
+			break;
+		if (shortname_len > x_shortname_len)
+			continue;
+
+		if (memcmp(shortname, x->short_name, shortname_len) <= 0)
+			break;
+	}
+	return i;
+}
+
+static errcode_t xattr_array_update(struct ext2_xattr_handle *h,
+				    const char *name,
+				    const void *value, size_t value_len,
+				    int ibody_free, int block_free,
+				    int old_idx, int in_inode)
+{
+	struct ext2_xattr tmp;
+	int add_to_ibody;
+	int needed;
+	int name_len, name_idx = 0;
+	const char *shortname = name;
+	int new_idx;
+	int ret;
+
+	find_ea_index(name, &shortname, &name_idx);
+	name_len = strlen(shortname);
+
+	needed = EXT2_EXT_ATTR_LEN(name_len);
+	if (!in_inode)
+		needed += EXT2_EXT_ATTR_SIZE(value_len);
+
+	if (old_idx >= 0 && old_idx < h->ibody_count) {
+		ibody_free += EXT2_EXT_ATTR_LEN(name_len);
+		if (!h->attrs[old_idx].ea_ino)
+			ibody_free += EXT2_EXT_ATTR_SIZE(
+						h->attrs[old_idx].value_len);
+	}
+
+	if (needed <= ibody_free) {
+		if (old_idx < 0) {
+			new_idx = h->ibody_count;
+			add_to_ibody = 1;
+			goto add_new;
+		}
+
+		/* Update the existing entry. */
+		ret = xattr_update_entry(h->fs, &h->attrs[old_idx], name,
+					 shortname, name_idx, value,
+					 value_len, in_inode);
+		if (ret)
+			return ret;
+		if (h->ibody_count <= old_idx) {
+			/* Move entry from block to the end of ibody. */
+			tmp = h->attrs[old_idx];
+			memmove(h->attrs + h->ibody_count + 1,
+				h->attrs + h->ibody_count,
+				(old_idx - h->ibody_count) * sizeof(*h->attrs));
+			h->attrs[h->ibody_count] = tmp;
+			h->ibody_count++;
+		}
+		return 0;
+	}
+
+	if (h->ibody_count <= old_idx) {
+		block_free += EXT2_EXT_ATTR_LEN(name_len);
+		if (!h->attrs[old_idx].ea_ino)
+			block_free +=
+				EXT2_EXT_ATTR_SIZE(h->attrs[old_idx].value_len);
+	}
+
+	if (needed > block_free)
+		return EXT2_ET_EA_NO_SPACE;
+
+	if (old_idx >= 0) {
+		/* Update the existing entry. */
+		ret = xattr_update_entry(h->fs, &h->attrs[old_idx], name,
+					 shortname, name_idx, value,
+					 value_len, in_inode);
+		if (ret)
+			return ret;
+		if (old_idx < h->ibody_count) {
+			/*
+			 * Move entry from ibody to the block. Note that
+			 * entries in the block are sorted.
+			 */
+			new_idx = xattr_find_position(h->attrs + h->ibody_count,
+						      h->count - h->ibody_count,
+						      shortname, name_idx);
+			new_idx += h->ibody_count - 1;
+			tmp = h->attrs[old_idx];
+			memmove(h->attrs + old_idx, h->attrs + old_idx + 1,
+				(new_idx - old_idx) * sizeof(*h->attrs));
+			h->attrs[new_idx] = tmp;
+			h->ibody_count--;
+		}
+		return 0;
+	}
+
+	new_idx = xattr_find_position(h->attrs + h->ibody_count,
+				      h->count - h->ibody_count,
+				      shortname, name_idx);
+	new_idx += h->ibody_count;
+	add_to_ibody = 0;
+
+add_new:
+	if (h->count == h->capacity) {
+		ret = ext2fs_xattrs_expand(h, 4);
+		if (ret)
+			return ret;
+	}
+
+	ret = xattr_update_entry(h->fs, &h->attrs[h->count], name, shortname,
+				 name_idx, value, value_len, in_inode);
+	if (ret)
+		return ret;
+
+	tmp = h->attrs[h->count];
+	memmove(h->attrs + new_idx + 1, h->attrs + new_idx,
+		(h->count - new_idx)*sizeof(*h->attrs));
+	h->attrs[new_idx] = tmp;
+	if (add_to_ibody)
+		h->ibody_count++;
+	h->count++;
+	return 0;
+}
+
+static int space_used(struct ext2_xattr *attrs, int count)
+{
+	int total = 0;
+	struct ext2_xattr *x;
+	int i, len;
+
+	for (i = 0, x = attrs; i < count; i++, x++) {
+		len = strlen(x->short_name);
+		total += EXT2_EXT_ATTR_LEN(len);
+		if (!x->ea_ino)
+			total += EXT2_EXT_ATTR_SIZE(x->value_len);
+	}
+	return total;
+}
+
+/*
+ * The minimum size of EA value when you start storing it in an external inode
+ * size of block - size of header - size of 1 entry - 4 null bytes
+ */
+#define EXT4_XATTR_MIN_LARGE_EA_SIZE(b)	\
+	((b) - EXT2_EXT_ATTR_LEN(3) - sizeof(struct ext2_ext_attr_header) - 4)
+
+errcode_t ext2fs_xattr_set(struct ext2_xattr_handle *h,
+			   const char *name,
+			   const void *value,
+			   size_t value_len)
+{
+	ext2_filsys fs = h->fs;
+	const int inode_size = EXT2_INODE_SIZE(fs->super);
+	struct ext2_inode_large *inode = NULL;
+	struct ext2_xattr *x;
+	char *new_value;
+	int ibody_free, block_free;
+	int in_inode = 0;
+	int old_idx = -1;
+	int extra_isize;
+	errcode_t ret;
+
+	EXT2_CHECK_MAGIC(h, EXT2_ET_MAGIC_EA_HANDLE);
+
+	ret = ext2fs_get_mem(value_len, &new_value);
+	if (ret)
+		return ret;
+	if (!(h->flags & XATTR_HANDLE_FLAG_RAW) &&
+	    ((strcmp(name, "system.posix_acl_default") == 0) ||
+	     (strcmp(name, "system.posix_acl_access") == 0))) {
+		ret = convert_posix_acl_to_disk_buffer(value, value_len,
+						       new_value, &value_len);
+		if (ret)
+			goto out;
+	} else if (value_len)
+		memcpy(new_value, value, value_len);
+
+	/* Imitate kernel behavior by skipping update if value is the same. */
+	for (x = h->attrs; x < h->attrs + h->count; x++) {
+		if (!strcmp(x->name, name)) {
+			if (!x->ea_ino && x->value_len == value_len &&
+			    (!value_len ||
+			     !memcmp(x->value, new_value, value_len))) {
+				ret = 0;
+				goto out;
+			}
+			old_idx = x - h->attrs;
+			break;
+		}
+	}
+
+	ret = ext2fs_get_memzero(inode_size, &inode);
+	if (ret)
+		goto out;
+	ret = ext2fs_read_inode_full(fs, h->ino,
+				     (struct ext2_inode *)inode,
+				     inode_size);
+	if (ret)
+		goto out;
+	if (inode_size > EXT2_GOOD_OLD_INODE_SIZE) {
+		extra_isize = inode->i_extra_isize;
+		if (extra_isize == 0) {
+			extra_isize = fs->super->s_want_extra_isize;
+			if (extra_isize == 0)
+				extra_isize = sizeof(__u32);
+		}
+		ibody_free = inode_size - EXT2_GOOD_OLD_INODE_SIZE;
+		ibody_free -= extra_isize;
+		/* Extended attribute magic and final null entry. */
+		ibody_free -= sizeof(__u32) * 2;
+		ibody_free -= space_used(h->attrs, h->ibody_count);
+	} else
+		ibody_free = 0;
+
+	/* Inline data can only go to ibody. */
+	if (strcmp(name, "system.data") == 0) {
+		if (h->ibody_count <= old_idx) {
+			ret = EXT2_ET_FILESYSTEM_CORRUPTED;
+			goto out;
+		}
+		ret = xattr_array_update(h, name, new_value, value_len,
+					 ibody_free,
+					 0 /* block_free */, old_idx,
+					 0 /* in_inode */);
+		if (ret)
+			goto out;
+		goto write_out;
+	}
+
+	block_free = fs->blocksize;
+	block_free -= sizeof(struct ext2_ext_attr_header);
+	/* Final null entry. */
+	block_free -= sizeof(__u32);
+	block_free -= space_used(h->attrs + h->ibody_count,
+				 h->count - h->ibody_count);
+
+	if (ext2fs_has_feature_ea_inode(fs->super) &&
+	    value_len > EXT4_XATTR_MIN_LARGE_EA_SIZE(fs->blocksize))
+		in_inode = 1;
+
+	ret = xattr_array_update(h, name, new_value, value_len, ibody_free,
+				 block_free, old_idx, in_inode);
+	if (ret == EXT2_ET_EA_NO_SPACE && !in_inode &&
+	    ext2fs_has_feature_ea_inode(fs->super))
+		ret = xattr_array_update(h, name, new_value, value_len,
+			ibody_free, block_free, old_idx, 1 /* in_inode */);
+	if (ret)
+		goto out;
+
+write_out:
+	ret = ext2fs_xattrs_write(h);
+out:
+	if (inode)
+		ext2fs_free_mem(&inode);
+	ext2fs_free_mem(&new_value);
+	return ret;
+}
+
+errcode_t ext2fs_xattr_remove(struct ext2_xattr_handle *handle,
+			      const char *key)
+{
+	struct ext2_xattr *x;
+	struct ext2_xattr *end = handle->attrs + handle->count;
+
+	EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EA_HANDLE);
+	for (x = handle->attrs; x < end; x++) {
+		if (strcmp(x->name, key) == 0) {
+			ext2fs_free_mem(&x->name);
+			ext2fs_free_mem(&x->value);
+			if (x->ea_ino)
+				xattr_inode_dec_ref(handle->fs, x->ea_ino);
+			memmove(x, x + 1, (end - x - 1)*sizeof(*x));
+			memset(end - 1, 0, sizeof(*end));
+			if (x < handle->attrs + handle->ibody_count)
+				handle->ibody_count--;
+			handle->count--;
+			return ext2fs_xattrs_write(handle);
+		}
+	}
+
+	/* no key found, success! */
+	return 0;
+}
+
+errcode_t ext2fs_xattrs_open(ext2_filsys fs, ext2_ino_t ino,
+			     struct ext2_xattr_handle **handle)
+{
+	struct ext2_xattr_handle *h;
+	errcode_t err;
+
+	if (!ext2fs_has_feature_xattr(fs->super) &&
+	    !ext2fs_has_feature_inline_data(fs->super))
+		return EXT2_ET_MISSING_EA_FEATURE;
+
+	err = ext2fs_get_memzero(sizeof(*h), &h);
+	if (err)
+		return err;
+
+	h->magic = EXT2_ET_MAGIC_EA_HANDLE;
+	h->capacity = 4;
+	err = ext2fs_get_arrayzero(h->capacity, sizeof(struct ext2_xattr),
+				   &h->attrs);
+	if (err) {
+		ext2fs_free_mem(&h);
+		return err;
+	}
+	h->count = 0;
+	h->ino = ino;
+	h->fs = fs;
+	*handle = h;
+	return 0;
+}
+
+errcode_t ext2fs_xattrs_close(struct ext2_xattr_handle **handle)
+{
+	struct ext2_xattr_handle *h = *handle;
+
+	EXT2_CHECK_MAGIC(h, EXT2_ET_MAGIC_EA_HANDLE);
+	xattrs_free_keys(h);
+	ext2fs_free_mem(&h->attrs);
+	ext2fs_free_mem(handle);
+	return 0;
+}
+
+errcode_t ext2fs_xattrs_count(struct ext2_xattr_handle *handle, size_t *count)
+{
+	EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EA_HANDLE);
+	*count = handle->count;
+	return 0;
+}
+
+errcode_t ext2fs_xattrs_flags(struct ext2_xattr_handle *handle,
+			      unsigned int *new_flags, unsigned int *old_flags)
+{
+	EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EA_HANDLE);
+	if (old_flags)
+		*old_flags = handle->flags;
+	if (new_flags)
+		handle->flags = *new_flags;
+	return 0;
+}
diff --git a/lib/ext2fs/extent.c b/lib/ext2fs/extent.c
new file mode 100644
index 0000000..82e75cc
--- /dev/null
+++ b/lib/ext2fs/extent.c
@@ -0,0 +1,1877 @@
+/*
+ * extent.c --- routines to implement extents support
+ *
+ * Copyright (C) 2007 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#if HAVE_ERRNO_H
+#include <errno.h>
+#endif
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fsP.h"
+#include "e2image.h"
+
+#undef DEBUG
+
+/*
+ * Definitions to be dropped in lib/ext2fs/ext2fs.h
+ */
+
+/*
+ * Private definitions
+ */
+
+struct extent_path {
+	char		*buf;
+	int		entries;
+	int		max_entries;
+	int		left;
+	int		visit_num;
+	int		flags;
+	blk64_t		end_blk;
+	blk64_t		blk;
+	void		*curr;
+};
+
+
+struct ext2_extent_handle {
+	errcode_t		magic;
+	ext2_filsys		fs;
+	ext2_ino_t 		ino;
+	struct ext2_inode	*inode;
+	struct ext2_inode	inodebuf;
+	int			type;
+	int			level;
+	int			max_depth;
+	int			max_paths;
+	struct extent_path	*path;
+};
+
+struct ext2_extent_path {
+	errcode_t		magic;
+	int			leaf_height;
+	blk64_t			lblk;
+};
+
+/*
+ *  Useful Debugging stuff
+ */
+
+#ifdef DEBUG
+static void dbg_show_header(struct ext3_extent_header *eh)
+{
+	printf("header: magic=%x entries=%u max=%u depth=%u generation=%u\n",
+			ext2fs_le16_to_cpu(eh->eh_magic),
+			ext2fs_le16_to_cpu(eh->eh_entries),
+			ext2fs_le16_to_cpu(eh->eh_max),
+			ext2fs_le16_to_cpu(eh->eh_depth),
+			ext2fs_le32_to_cpu(eh->eh_generation));
+}
+
+static void dbg_show_index(struct ext3_extent_idx *ix)
+{
+	printf("index: block=%u leaf=%u leaf_hi=%u unused=%u\n",
+			ext2fs_le32_to_cpu(ix->ei_block),
+			ext2fs_le32_to_cpu(ix->ei_leaf),
+			ext2fs_le16_to_cpu(ix->ei_leaf_hi),
+			ext2fs_le16_to_cpu(ix->ei_unused));
+}
+
+static void dbg_show_extent(struct ext3_extent *ex)
+{
+	printf("extent: block=%u-%u len=%u start=%u start_hi=%u\n",
+			ext2fs_le32_to_cpu(ex->ee_block),
+			ext2fs_le32_to_cpu(ex->ee_block) +
+			ext2fs_le16_to_cpu(ex->ee_len) - 1,
+			ext2fs_le16_to_cpu(ex->ee_len),
+			ext2fs_le32_to_cpu(ex->ee_start),
+			ext2fs_le16_to_cpu(ex->ee_start_hi));
+}
+
+static void dbg_print_extent(char *desc, struct ext2fs_extent *extent)
+{
+	if (desc)
+		printf("%s: ", desc);
+	printf("extent: lblk %llu--%llu, len %u, pblk %llu, flags: ",
+	       extent->e_lblk, extent->e_lblk + extent->e_len - 1,
+	       extent->e_len, extent->e_pblk);
+	if (extent->e_flags & EXT2_EXTENT_FLAGS_LEAF)
+		fputs("LEAF ", stdout);
+	if (extent->e_flags & EXT2_EXTENT_FLAGS_UNINIT)
+		fputs("UNINIT ", stdout);
+	if (extent->e_flags & EXT2_EXTENT_FLAGS_SECOND_VISIT)
+		fputs("2ND_VISIT ", stdout);
+	if (!extent->e_flags)
+		fputs("(none)", stdout);
+	fputc('\n', stdout);
+
+}
+
+static void dump_path(const char *tag, struct ext2_extent_handle *handle,
+		      struct extent_path *path)
+{
+	struct extent_path *ppp = path;
+	printf("%s: level=%d\n", tag, handle->level);
+
+	do {
+		printf("%s: path=%ld buf=%p entries=%d max_entries=%d left=%d "
+		       "visit_num=%d flags=0x%x end_blk=%llu curr=%p(%ld)\n",
+		       tag, (ppp - handle->path), ppp->buf, ppp->entries,
+		       ppp->max_entries, ppp->left, ppp->visit_num, ppp->flags,
+		       ppp->end_blk, ppp->curr, ppp->curr - (void *)ppp->buf);
+		printf("  ");
+		dbg_show_header((struct ext3_extent_header *)ppp->buf);
+		if (ppp->curr) {
+			printf("  ");
+			dbg_show_index(ppp->curr);
+			printf("  ");
+			dbg_show_extent(ppp->curr);
+		}
+		ppp--;
+	} while (ppp >= handle->path);
+	fflush(stdout);
+
+	return;
+}
+
+#else
+#define dbg_show_header(eh) do { } while (0)
+#define dbg_show_index(ix) do { } while (0)
+#define dbg_show_extent(ex) do { } while (0)
+#define dbg_print_extent(desc, ex) do { } while (0)
+#define dump_path(tag, handle, path) do { } while (0)
+#endif
+
+/*
+ * Verify the extent header as being sane
+ */
+errcode_t ext2fs_extent_header_verify(void *ptr, int size)
+{
+	int eh_max, entry_size;
+	struct ext3_extent_header *eh = ptr;
+
+	dbg_show_header(eh);
+	if (ext2fs_le16_to_cpu(eh->eh_magic) != EXT3_EXT_MAGIC)
+		return EXT2_ET_EXTENT_HEADER_BAD;
+	if (ext2fs_le16_to_cpu(eh->eh_entries) > ext2fs_le16_to_cpu(eh->eh_max))
+		return EXT2_ET_EXTENT_HEADER_BAD;
+	if (eh->eh_depth == 0)
+		entry_size = sizeof(struct ext3_extent);
+	else
+		entry_size = sizeof(struct ext3_extent_idx);
+
+	eh_max = (size - sizeof(*eh)) / entry_size;
+	/* Allow two extent-sized items at the end of the block, for
+	 * ext4_extent_tail with checksum in the future. */
+	if ((ext2fs_le16_to_cpu(eh->eh_max) > eh_max) ||
+	    (ext2fs_le16_to_cpu(eh->eh_max) < (eh_max - 2)))
+		return EXT2_ET_EXTENT_HEADER_BAD;
+
+	return 0;
+}
+
+
+/*
+ * Begin functions to handle an inode's extent information
+ */
+void ext2fs_extent_free(ext2_extent_handle_t handle)
+{
+	int			i;
+
+	if (!handle)
+		return;
+
+	if (handle->path) {
+		for (i = 1; i < handle->max_paths; i++) {
+			if (handle->path[i].buf)
+				ext2fs_free_mem(&handle->path[i].buf);
+		}
+		ext2fs_free_mem(&handle->path);
+	}
+	ext2fs_free_mem(&handle);
+}
+
+errcode_t ext2fs_extent_open(ext2_filsys fs, ext2_ino_t ino,
+				    ext2_extent_handle_t *ret_handle)
+{
+	return ext2fs_extent_open2(fs, ino, NULL, ret_handle);
+}
+
+errcode_t ext2fs_extent_open2(ext2_filsys fs, ext2_ino_t ino,
+				    struct ext2_inode *inode,
+				    ext2_extent_handle_t *ret_handle)
+{
+	struct ext2_extent_handle	*handle;
+	errcode_t			retval;
+	int				i;
+	struct ext3_extent_header	*eh;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	if (!inode)
+		if ((ino == 0) || (ino > fs->super->s_inodes_count))
+			return EXT2_ET_BAD_INODE_NUM;
+
+	retval = ext2fs_get_mem(sizeof(struct ext2_extent_handle), &handle);
+	if (retval)
+		return retval;
+	memset(handle, 0, sizeof(struct ext2_extent_handle));
+
+	handle->ino = ino;
+	handle->fs = fs;
+
+	if (inode) {
+		handle->inode = inode;
+	} else {
+		handle->inode = &handle->inodebuf;
+		retval = ext2fs_read_inode(fs, ino, handle->inode);
+		if (retval)
+			goto errout;
+	}
+
+	eh = (struct ext3_extent_header *) &handle->inode->i_block[0];
+
+	for (i=0; i < EXT2_N_BLOCKS; i++)
+		if (handle->inode->i_block[i])
+			break;
+	if (i >= EXT2_N_BLOCKS) {
+		eh->eh_magic = ext2fs_cpu_to_le16(EXT3_EXT_MAGIC);
+		eh->eh_depth = 0;
+		eh->eh_entries = 0;
+		i = (sizeof(handle->inode->i_block) - sizeof(*eh)) /
+			sizeof(struct ext3_extent);
+		eh->eh_max = ext2fs_cpu_to_le16(i);
+		handle->inode->i_flags |= EXT4_EXTENTS_FL;
+	}
+
+	if (!(handle->inode->i_flags & EXT4_EXTENTS_FL)) {
+		retval = EXT2_ET_INODE_NOT_EXTENT;
+		goto errout;
+	}
+
+	retval = ext2fs_extent_header_verify(eh, sizeof(handle->inode->i_block));
+	if (retval)
+		goto errout;
+
+	handle->max_depth = ext2fs_le16_to_cpu(eh->eh_depth);
+	handle->type = ext2fs_le16_to_cpu(eh->eh_magic);
+
+	handle->max_paths = handle->max_depth + 1;
+	retval = ext2fs_get_memzero(handle->max_paths *
+				    sizeof(struct extent_path),
+				    &handle->path);
+	handle->path[0].buf = (char *) handle->inode->i_block;
+
+	handle->path[0].left = handle->path[0].entries =
+		ext2fs_le16_to_cpu(eh->eh_entries);
+	handle->path[0].max_entries = ext2fs_le16_to_cpu(eh->eh_max);
+	handle->path[0].curr = 0;
+	handle->path[0].end_blk =
+		(EXT2_I_SIZE(handle->inode) + fs->blocksize - 1) >>
+		 EXT2_BLOCK_SIZE_BITS(fs->super);
+	handle->path[0].blk = 0;
+	handle->path[0].visit_num = 1;
+	handle->level = 0;
+	handle->magic = EXT2_ET_MAGIC_EXTENT_HANDLE;
+
+	*ret_handle = handle;
+	return 0;
+
+errout:
+	ext2fs_extent_free(handle);
+	return retval;
+}
+
+/*
+ * This function is responsible for (optionally) moving through the
+ * extent tree and then returning the current extent
+ */
+errcode_t ext2fs_extent_get(ext2_extent_handle_t handle,
+			    int flags, struct ext2fs_extent *extent)
+{
+	struct extent_path	*path, *newpath, *tp;
+	struct ext3_extent_header	*eh;
+	struct ext3_extent_idx		*ix = 0;
+	struct ext3_extent		*ex;
+	errcode_t			retval;
+	blk64_t				blk;
+	blk64_t				end_blk;
+	int				orig_op, op, l;
+	int				failed_csum = 0;
+
+	EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EXTENT_HANDLE);
+
+	if (!handle->path)
+		return EXT2_ET_NO_CURRENT_NODE;
+
+	orig_op = op = flags & EXT2_EXTENT_MOVE_MASK;
+
+retry:
+	path = handle->path + handle->level;
+	if ((orig_op == EXT2_EXTENT_NEXT) ||
+	    (orig_op == EXT2_EXTENT_NEXT_LEAF)) {
+		if (handle->level < handle->max_depth) {
+			/* interior node */
+			if (path->visit_num == 0) {
+				path->visit_num++;
+				op = EXT2_EXTENT_DOWN;
+			} else if (path->left > 0)
+				op = EXT2_EXTENT_NEXT_SIB;
+			else if (handle->level > 0)
+				op = EXT2_EXTENT_UP;
+			else
+				return EXT2_ET_EXTENT_NO_NEXT;
+		} else {
+			/* leaf node */
+			if (path->left > 0)
+				op = EXT2_EXTENT_NEXT_SIB;
+			else if (handle->level > 0)
+				op = EXT2_EXTENT_UP;
+			else
+				return EXT2_ET_EXTENT_NO_NEXT;
+		}
+		if (op != EXT2_EXTENT_NEXT_SIB) {
+#ifdef DEBUG_GET_EXTENT
+			printf("<<<< OP = %s\n",
+			       (op == EXT2_EXTENT_DOWN) ? "down" :
+			       ((op == EXT2_EXTENT_UP) ? "up" : "unknown"));
+#endif
+		}
+	}
+
+	if ((orig_op == EXT2_EXTENT_PREV) ||
+	    (orig_op == EXT2_EXTENT_PREV_LEAF)) {
+		if (handle->level < handle->max_depth) {
+			/* interior node */
+			if (path->visit_num > 0 ) {
+				/* path->visit_num = 0; */
+				op = EXT2_EXTENT_DOWN_AND_LAST;
+			} else if (path->left < path->entries-1)
+				op = EXT2_EXTENT_PREV_SIB;
+			else if (handle->level > 0)
+				op = EXT2_EXTENT_UP;
+			else
+				return EXT2_ET_EXTENT_NO_PREV;
+		} else {
+			/* leaf node */
+			if (path->left < path->entries-1)
+				op = EXT2_EXTENT_PREV_SIB;
+			else if (handle->level > 0)
+				op = EXT2_EXTENT_UP;
+			else
+				return EXT2_ET_EXTENT_NO_PREV;
+		}
+		if (op != EXT2_EXTENT_PREV_SIB) {
+#ifdef DEBUG_GET_EXTENT
+			printf("<<<< OP = %s\n",
+			       (op == EXT2_EXTENT_DOWN_AND_LAST) ? "down/last" :
+			       ((op == EXT2_EXTENT_UP) ? "up" : "unknown"));
+#endif
+		}
+	}
+
+	if (orig_op == EXT2_EXTENT_LAST_LEAF) {
+		if ((handle->level < handle->max_depth) &&
+		    (path->left == 0))
+			op = EXT2_EXTENT_DOWN;
+		else
+			op = EXT2_EXTENT_LAST_SIB;
+#ifdef DEBUG_GET_EXTENT
+		printf("<<<< OP = %s\n",
+			   (op == EXT2_EXTENT_DOWN) ? "down" : "last_sib");
+#endif
+	}
+
+	switch (op) {
+	case EXT2_EXTENT_CURRENT:
+		ix = path->curr;
+		break;
+	case EXT2_EXTENT_ROOT:
+		handle->level = 0;
+		path = handle->path + handle->level;
+		/* fallthrough */
+	case EXT2_EXTENT_FIRST_SIB:
+		path->left = path->entries;
+		path->curr = 0;
+		/* fallthrough */
+	case EXT2_EXTENT_NEXT_SIB:
+		if (path->left <= 0)
+			return EXT2_ET_EXTENT_NO_NEXT;
+		if (path->curr) {
+			ix = path->curr;
+			ix++;
+		} else {
+			eh = (struct ext3_extent_header *) path->buf;
+			ix = EXT_FIRST_INDEX(eh);
+		}
+		path->left--;
+		path->curr = ix;
+		path->visit_num = 0;
+		break;
+	case EXT2_EXTENT_PREV_SIB:
+		if (!path->curr ||
+		    path->left+1 >= path->entries)
+			return EXT2_ET_EXTENT_NO_PREV;
+		ix = path->curr;
+		ix--;
+		path->curr = ix;
+		path->left++;
+		if (handle->level < handle->max_depth)
+			path->visit_num = 1;
+		break;
+	case EXT2_EXTENT_LAST_SIB:
+		eh = (struct ext3_extent_header *) path->buf;
+		path->curr = EXT_LAST_EXTENT(eh);
+		ix = path->curr;
+		path->left = 0;
+		path->visit_num = 0;
+		break;
+	case EXT2_EXTENT_UP:
+		if (handle->level <= 0)
+			return EXT2_ET_EXTENT_NO_UP;
+		handle->level--;
+		path--;
+		ix = path->curr;
+		if ((orig_op == EXT2_EXTENT_PREV) ||
+		    (orig_op == EXT2_EXTENT_PREV_LEAF))
+			path->visit_num = 0;
+		break;
+	case EXT2_EXTENT_DOWN:
+	case EXT2_EXTENT_DOWN_AND_LAST:
+		if (!path->curr ||(handle->level >= handle->max_depth))
+			return EXT2_ET_EXTENT_NO_DOWN;
+
+		ix = path->curr;
+		newpath = path + 1;
+		if (!newpath->buf) {
+			retval = ext2fs_get_mem(handle->fs->blocksize,
+						&newpath->buf);
+			if (retval)
+				return retval;
+		}
+		blk = ext2fs_le32_to_cpu(ix->ei_leaf) +
+			((__u64) ext2fs_le16_to_cpu(ix->ei_leaf_hi) << 32);
+		for (l = handle->level, tp = path; l > 0; l--, tp--) {
+			if (blk == tp->blk)
+				return EXT2_ET_EXTENT_CYCLE;
+		}
+		newpath->blk = blk;
+		if ((handle->fs->flags & EXT2_FLAG_IMAGE_FILE) &&
+		    (handle->fs->io != handle->fs->image_io))
+			memset(newpath->buf, 0, handle->fs->blocksize);
+		else {
+			retval = io_channel_read_blk64(handle->fs->io,
+						     blk, 1, newpath->buf);
+			if (retval)
+				return retval;
+		}
+		handle->level++;
+
+		eh = (struct ext3_extent_header *) newpath->buf;
+
+		retval = ext2fs_extent_header_verify(eh, handle->fs->blocksize);
+		if (retval) {
+			handle->level--;
+			return retval;
+		}
+
+		if (!(handle->fs->flags & EXT2_FLAG_IGNORE_CSUM_ERRORS) &&
+		    !ext2fs_extent_block_csum_verify(handle->fs, handle->ino,
+						     eh))
+			failed_csum = 1;
+
+		newpath->left = newpath->entries =
+			ext2fs_le16_to_cpu(eh->eh_entries);
+		newpath->max_entries = ext2fs_le16_to_cpu(eh->eh_max);
+
+		/* Make sure there is at least one extent present */
+		if (newpath->left <= 0)
+			return EXT2_ET_EXTENT_NO_DOWN;
+
+		if (path->left > 0) {
+			ix++;
+			newpath->end_blk = ext2fs_le32_to_cpu(ix->ei_block);
+		} else
+			newpath->end_blk = path->end_blk;
+
+		path = newpath;
+		if (op == EXT2_EXTENT_DOWN) {
+			ix = EXT_FIRST_INDEX((struct ext3_extent_header *) eh);
+			path->curr = ix;
+			path->left = path->entries - 1;
+			path->visit_num = 0;
+		} else {
+			ix = EXT_LAST_INDEX((struct ext3_extent_header *) eh);
+			path->curr = ix;
+			path->left = 0;
+			if (handle->level < handle->max_depth)
+				path->visit_num = 1;
+		}
+#ifdef DEBUG_GET_EXTENT
+		printf("Down to level %d/%d, end_blk=%llu\n",
+			   handle->level, handle->max_depth,
+			   path->end_blk);
+#endif
+		break;
+	default:
+		return EXT2_ET_OP_NOT_SUPPORTED;
+	}
+
+	if (!ix)
+		return EXT2_ET_NO_CURRENT_NODE;
+
+	extent->e_flags = 0;
+#ifdef DEBUG_GET_EXTENT
+	printf("(Left %d)\n", path->left);
+#endif
+
+	if (handle->level == handle->max_depth) {
+		ex = (struct ext3_extent *) ix;
+
+		extent->e_pblk = ext2fs_le32_to_cpu(ex->ee_start) +
+			((__u64) ext2fs_le16_to_cpu(ex->ee_start_hi) << 32);
+		extent->e_lblk = ext2fs_le32_to_cpu(ex->ee_block);
+		extent->e_len = ext2fs_le16_to_cpu(ex->ee_len);
+		extent->e_flags |= EXT2_EXTENT_FLAGS_LEAF;
+		if (extent->e_len > EXT_INIT_MAX_LEN) {
+			extent->e_len -= EXT_INIT_MAX_LEN;
+			extent->e_flags |= EXT2_EXTENT_FLAGS_UNINIT;
+		}
+	} else {
+		extent->e_pblk = ext2fs_le32_to_cpu(ix->ei_leaf) +
+			((__u64) ext2fs_le16_to_cpu(ix->ei_leaf_hi) << 32);
+		extent->e_lblk = ext2fs_le32_to_cpu(ix->ei_block);
+		if (path->left > 0) {
+			ix++;
+			end_blk = ext2fs_le32_to_cpu(ix->ei_block);
+		} else
+			end_blk = path->end_blk;
+
+		extent->e_len = end_blk - extent->e_lblk;
+	}
+	if (path->visit_num)
+		extent->e_flags |= EXT2_EXTENT_FLAGS_SECOND_VISIT;
+
+	if (((orig_op == EXT2_EXTENT_NEXT_LEAF) ||
+	     (orig_op == EXT2_EXTENT_PREV_LEAF)) &&
+	    (handle->level != handle->max_depth))
+		goto retry;
+
+	if ((orig_op == EXT2_EXTENT_LAST_LEAF) &&
+	    ((handle->level != handle->max_depth) ||
+	     (path->left != 0)))
+		goto retry;
+
+	if (failed_csum)
+		return EXT2_ET_EXTENT_CSUM_INVALID;
+
+	return 0;
+}
+
+static errcode_t update_path(ext2_extent_handle_t handle)
+{
+	blk64_t				blk;
+	errcode_t			retval;
+	struct ext3_extent_idx		*ix;
+	struct ext3_extent_header	*eh;
+
+	if (handle->level == 0) {
+		retval = ext2fs_write_inode(handle->fs, handle->ino,
+					    handle->inode);
+	} else {
+		ix = handle->path[handle->level - 1].curr;
+		blk = ext2fs_le32_to_cpu(ix->ei_leaf) +
+			((__u64) ext2fs_le16_to_cpu(ix->ei_leaf_hi) << 32);
+
+		/* then update the checksum */
+		eh = (struct ext3_extent_header *)
+				handle->path[handle->level].buf;
+		retval = ext2fs_extent_block_csum_set(handle->fs, handle->ino,
+						      eh);
+		if (retval)
+			return retval;
+
+		retval = io_channel_write_blk64(handle->fs->io,
+				      blk, 1, handle->path[handle->level].buf);
+	}
+	return retval;
+}
+
+#if 0
+errcode_t ext2fs_extent_save_path(ext2_extent_handle_t handle,
+				  ext2_extent_path_t *ret_path)
+{
+	ext2_extent_path_t	save_path;
+	struct ext2fs_extent	extent;
+	struct ext2_extent_info	info;
+	errcode_t		retval;
+
+	retval = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT, &extent);
+	if (retval)
+		return retval;
+
+	retval = ext2fs_extent_get_info(handle, &info);
+	if (retval)
+		return retval;
+
+	retval = ext2fs_get_mem(sizeof(struct ext2_extent_path), &save_path);
+	if (retval)
+		return retval;
+	memset(save_path, 0, sizeof(struct ext2_extent_path));
+
+	save_path->magic = EXT2_ET_MAGIC_EXTENT_PATH;
+	save_path->leaf_height = info.max_depth - info.curr_level - 1;
+	save_path->lblk = extent.e_lblk;
+
+	*ret_path = save_path;
+	return 0;
+}
+
+errcode_t ext2fs_extent_free_path(ext2_extent_path_t path)
+{
+	EXT2_CHECK_MAGIC(path, EXT2_ET_MAGIC_EXTENT_PATH);
+
+	ext2fs_free_mem(&path);
+	return 0;
+}
+#endif
+
+/*
+ * Go to the node at leaf_level which contains logical block blk.
+ *
+ * leaf_level is height from the leaf node level, i.e.
+ * leaf_level 0 is at leaf node, leaf_level 1 is 1 above etc.
+ *
+ * If "blk" has no mapping (hole) then handle is left at last
+ * extent before blk.
+ */
+errcode_t ext2fs_extent_goto2(ext2_extent_handle_t handle,
+			      int leaf_level, blk64_t blk)
+{
+	struct ext2fs_extent	extent;
+	errcode_t		retval;
+
+	retval = ext2fs_extent_get(handle, EXT2_EXTENT_ROOT, &extent);
+	if (retval) {
+		if (retval == EXT2_ET_EXTENT_NO_NEXT)
+			retval = EXT2_ET_EXTENT_NOT_FOUND;
+		return retval;
+	}
+
+	if (leaf_level > handle->max_depth) {
+#ifdef DEBUG
+		printf("leaf level %d greater than tree depth %d\n",
+			leaf_level, handle->max_depth);
+#endif
+		return EXT2_ET_OP_NOT_SUPPORTED;
+	}
+
+#ifdef DEBUG
+	printf("goto extent ino %u, level %d, %llu\n", handle->ino,
+	       leaf_level, blk);
+#endif
+
+#ifdef DEBUG_GOTO_EXTENTS
+	dbg_print_extent("root", &extent);
+#endif
+	while (1) {
+		if (handle->max_depth - handle->level == leaf_level) {
+			/* block is in this &extent */
+			if ((blk >= extent.e_lblk) &&
+			    (blk < extent.e_lblk + extent.e_len))
+				return 0;
+			if (blk < extent.e_lblk) {
+				retval = ext2fs_extent_get(handle,
+							   EXT2_EXTENT_PREV_SIB,
+							   &extent);
+				return EXT2_ET_EXTENT_NOT_FOUND;
+			}
+			retval = ext2fs_extent_get(handle,
+						   EXT2_EXTENT_NEXT_SIB,
+						   &extent);
+			if (retval == EXT2_ET_EXTENT_NO_NEXT)
+				return EXT2_ET_EXTENT_NOT_FOUND;
+			if (retval)
+				return retval;
+			continue;
+		}
+
+		retval = ext2fs_extent_get(handle, EXT2_EXTENT_NEXT_SIB,
+					   &extent);
+		if (retval == EXT2_ET_EXTENT_NO_NEXT)
+			goto go_down;
+		if (retval)
+			return retval;
+
+#ifdef DEBUG_GOTO_EXTENTS
+		dbg_print_extent("next", &extent);
+#endif
+		if (blk == extent.e_lblk)
+			goto go_down;
+		if (blk > extent.e_lblk)
+			continue;
+
+		retval = ext2fs_extent_get(handle, EXT2_EXTENT_PREV_SIB,
+					   &extent);
+		if (retval)
+			return retval;
+
+#ifdef DEBUG_GOTO_EXTENTS
+		dbg_print_extent("prev", &extent);
+#endif
+
+	go_down:
+		retval = ext2fs_extent_get(handle, EXT2_EXTENT_DOWN,
+					   &extent);
+		if (retval)
+			return retval;
+
+#ifdef DEBUG_GOTO_EXTENTS
+		dbg_print_extent("down", &extent);
+#endif
+	}
+}
+
+errcode_t ext2fs_extent_goto(ext2_extent_handle_t handle,
+			     blk64_t blk)
+{
+	return ext2fs_extent_goto2(handle, 0, blk);
+}
+
+/*
+ * Traverse back up to root fixing parents of current node as needed.
+ *
+ * If we changed start of first entry in a node, fix parent index start
+ * and so on.
+ *
+ * Safe to call for any position in node; if not at the first entry,
+ * it will simply return.
+ *
+ * Note a subtlety of this function -- if there happen to be two extents
+ * mapping the same lblk and someone calls fix_parents on the second of the two
+ * extents, the position of the extent handle after the call will be the second
+ * extent if nothing happened, or the first extent if something did.  A caller
+ * in this situation must use ext2fs_extent_goto() after calling this function.
+ * Or simply don't map the same lblk with two extents, ever.
+ */
+errcode_t ext2fs_extent_fix_parents(ext2_extent_handle_t handle)
+{
+	int				retval = 0;
+	int				orig_height;
+	blk64_t				start;
+	struct extent_path		*path;
+	struct ext2fs_extent		extent;
+	struct ext2_extent_info		info;
+
+	EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EXTENT_HANDLE);
+
+	if (!(handle->fs->flags & EXT2_FLAG_RW))
+		return EXT2_ET_RO_FILSYS;
+
+	if (!handle->path)
+		return EXT2_ET_NO_CURRENT_NODE;
+
+	path = handle->path + handle->level;
+	if (!path->curr)
+		return EXT2_ET_NO_CURRENT_NODE;
+
+	retval = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT, &extent);
+	if (retval)
+		goto done;
+
+	/* modified node's start block */
+	start = extent.e_lblk;
+
+	if ((retval = ext2fs_extent_get_info(handle, &info)))
+		return retval;
+	orig_height = info.max_depth - info.curr_level;
+
+	/* traverse up until index not first, or startblk matches, or top */
+	while (handle->level > 0 &&
+	       (path->left == path->entries - 1)) {
+		retval = ext2fs_extent_get(handle, EXT2_EXTENT_UP, &extent);
+		if (retval)
+			goto done;
+		if (extent.e_lblk == start)
+			break;
+		path = handle->path + handle->level;
+		extent.e_len += (extent.e_lblk - start);
+		extent.e_lblk = start;
+		retval = ext2fs_extent_replace(handle, 0, &extent);
+		if (retval)
+			goto done;
+		update_path(handle);
+	}
+
+	/* put handle back to where we started */
+	retval = ext2fs_extent_goto2(handle, orig_height, start);
+done:
+	return retval;
+}
+
+errcode_t ext2fs_extent_replace(ext2_extent_handle_t handle,
+				int flags EXT2FS_ATTR((unused)),
+				struct ext2fs_extent *extent)
+{
+	struct extent_path		*path;
+	struct ext3_extent_idx		*ix;
+	struct ext3_extent		*ex;
+
+	EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EXTENT_HANDLE);
+
+	if (!(handle->fs->flags & EXT2_FLAG_RW))
+		return EXT2_ET_RO_FILSYS;
+
+	if (!handle->path)
+		return EXT2_ET_NO_CURRENT_NODE;
+
+	path = handle->path + handle->level;
+	if (!path->curr)
+		return EXT2_ET_NO_CURRENT_NODE;
+
+#ifdef DEBUG
+	printf("extent replace: %u ", handle->ino);
+	dbg_print_extent(0, extent);
+#endif
+
+	if (handle->level == handle->max_depth) {
+		ex = path->curr;
+
+		ex->ee_block = ext2fs_cpu_to_le32(extent->e_lblk);
+		ex->ee_start = ext2fs_cpu_to_le32(extent->e_pblk & 0xFFFFFFFF);
+		ex->ee_start_hi = ext2fs_cpu_to_le16(extent->e_pblk >> 32);
+		if (extent->e_flags & EXT2_EXTENT_FLAGS_UNINIT) {
+			if (extent->e_len > EXT_UNINIT_MAX_LEN)
+				return EXT2_ET_EXTENT_INVALID_LENGTH;
+			ex->ee_len = ext2fs_cpu_to_le16(extent->e_len +
+							EXT_INIT_MAX_LEN);
+		} else {
+			if (extent->e_len > EXT_INIT_MAX_LEN)
+				return EXT2_ET_EXTENT_INVALID_LENGTH;
+			ex->ee_len = ext2fs_cpu_to_le16(extent->e_len);
+		}
+	} else {
+		ix = path->curr;
+
+		ix->ei_leaf = ext2fs_cpu_to_le32(extent->e_pblk & 0xFFFFFFFF);
+		ix->ei_leaf_hi = ext2fs_cpu_to_le16(extent->e_pblk >> 32);
+		ix->ei_block = ext2fs_cpu_to_le32(extent->e_lblk);
+		ix->ei_unused = 0;
+	}
+	update_path(handle);
+	return 0;
+}
+
+static int splitting_at_eof(struct ext2_extent_handle *handle,
+			    struct extent_path *path)
+{
+	struct extent_path *ppp = path;
+	dump_path(__func__, handle, path);
+
+	if (handle->level == 0)
+		return 0;
+
+	do {
+		if (ppp->left)
+			return 0;
+		ppp--;
+	} while (ppp >= handle->path);
+
+	return 1;
+}
+
+/*
+ * allocate a new block, move half the current node to it, and update parent
+ *
+ * handle will be left pointing at original record.
+ */
+static errcode_t extent_node_split(ext2_extent_handle_t handle,
+				   int expand_allowed)
+{
+	errcode_t			retval = 0;
+	blk64_t				new_node_pblk;
+	blk64_t				new_node_start;
+	blk64_t				orig_lblk;
+	blk64_t				goal_blk = 0;
+	int				orig_height;
+	char				*block_buf = NULL;
+	struct ext2fs_extent		extent;
+	struct extent_path		*path, *newpath = 0;
+	struct ext3_extent_header	*eh, *neweh;
+	int				tocopy;
+	int				new_root = 0;
+	struct ext2_extent_info		info;
+	int				no_balance;
+
+	/* basic sanity */
+	EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EXTENT_HANDLE);
+
+	if (!(handle->fs->flags & EXT2_FLAG_RW))
+		return EXT2_ET_RO_FILSYS;
+
+	if (!handle->path)
+		return EXT2_ET_NO_CURRENT_NODE;
+
+#ifdef DEBUG
+	printf("splitting node at level %d\n", handle->level);
+#endif
+	retval = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT, &extent);
+	if (retval)
+		goto done;
+
+	retval = ext2fs_extent_get_info(handle, &info);
+	if (retval)
+		goto done;
+
+	/* save the position we were originally splitting... */
+	orig_height = info.max_depth - info.curr_level;
+	orig_lblk = extent.e_lblk;
+
+	/* Try to put the index block before the first extent */
+	path = handle->path + handle->level;
+	eh = (struct ext3_extent_header *) path->buf;
+	if (handle->level == handle->max_depth) {
+		struct ext3_extent	*ex;
+
+		ex = EXT_FIRST_EXTENT(eh);
+		goal_blk = ext2fs_le32_to_cpu(ex->ee_start) +
+			((__u64) ext2fs_le16_to_cpu(ex->ee_start_hi) << 32);
+	} else {
+		struct ext3_extent_idx	*ix;
+
+		ix = EXT_FIRST_INDEX(eh);
+		goal_blk = ext2fs_le32_to_cpu(ix->ei_leaf) +
+			((__u64) ext2fs_le16_to_cpu(ix->ei_leaf_hi) << 32);
+	}
+	goal_blk -= EXT2FS_CLUSTER_RATIO(handle->fs);
+	goal_blk &= ~EXT2FS_CLUSTER_MASK(handle->fs);
+
+	/* Is there room in the parent for a new entry? */
+	if (handle->level &&
+			(handle->path[handle->level - 1].entries >=
+			 handle->path[handle->level - 1].max_entries)) {
+
+#ifdef DEBUG
+		printf("parent level %d full; splitting it too\n",
+							handle->level - 1);
+#endif
+		/* split the parent */
+		retval = ext2fs_extent_get(handle, EXT2_EXTENT_UP, &extent);
+		if (retval)
+			goto done;
+
+		retval = extent_node_split(handle, expand_allowed);
+		if (retval)
+			goto done;
+
+		/* get handle back to our original split position */
+		retval = ext2fs_extent_goto2(handle, orig_height, orig_lblk);
+		if (retval)
+			goto done;
+	}
+
+	/* At this point, parent should have room for this split */
+	path = handle->path + handle->level;
+	if (!path->curr)
+		return EXT2_ET_NO_CURRENT_NODE;
+
+	/*
+	 * Normally, we try to split a full node in half.  This doesn't turn
+	 * out so well if we're tacking extents on the end of the file because
+	 * then we're stuck with a tree of half-full extent blocks.  This of
+	 * course doesn't apply to the root level.
+	 */
+	no_balance = expand_allowed ? splitting_at_eof(handle, path) : 0;
+
+	/* extent header of the current node we'll split */
+	eh = (struct ext3_extent_header *)path->buf;
+
+	/* splitting root level means moving them all out */
+	if (handle->level == 0) {
+		new_root = 1;
+		tocopy = ext2fs_le16_to_cpu(eh->eh_entries);
+		retval = ext2fs_get_memzero((handle->max_paths + 1) *
+					    sizeof(struct extent_path),
+					    &newpath);
+		if (retval)
+			goto done;
+	} else {
+		if (no_balance)
+			tocopy = 1;
+		else
+			tocopy = ext2fs_le16_to_cpu(eh->eh_entries) / 2;
+	}
+
+#ifdef DEBUG
+	printf("will copy out %d of %d entries at level %d\n",
+				tocopy, ext2fs_le16_to_cpu(eh->eh_entries),
+				handle->level);
+#endif
+
+	if (!tocopy && !no_balance) {
+#ifdef DEBUG
+		printf("Nothing to copy to new block!\n");
+#endif
+		retval = EXT2_ET_CANT_SPLIT_EXTENT;
+		goto done;
+	}
+
+	/* first we need a new block, or can do nothing. */
+	block_buf = malloc(handle->fs->blocksize);
+	if (!block_buf) {
+		retval = ENOMEM;
+		goto done;
+	}
+
+	if (!goal_blk)
+		goal_blk = ext2fs_find_inode_goal(handle->fs, handle->ino,
+						  handle->inode, 0);
+	retval = ext2fs_alloc_block2(handle->fs, goal_blk, block_buf,
+				    &new_node_pblk);
+	if (retval)
+		goto done;
+
+#ifdef DEBUG
+	printf("will copy to new node at block %lu\n",
+	       (unsigned long) new_node_pblk);
+#endif
+
+	/* Copy data into new block buffer */
+	/* First the header for the new block... */
+	neweh = (struct ext3_extent_header *) block_buf;
+	memcpy(neweh, eh, sizeof(struct ext3_extent_header));
+	neweh->eh_entries = ext2fs_cpu_to_le16(tocopy);
+	neweh->eh_max = ext2fs_cpu_to_le16((handle->fs->blocksize -
+			 sizeof(struct ext3_extent_header)) /
+				sizeof(struct ext3_extent));
+
+	/* then the entries for the new block... */
+	memcpy(EXT_FIRST_INDEX(neweh),
+		EXT_FIRST_INDEX(eh) +
+			(ext2fs_le16_to_cpu(eh->eh_entries) - tocopy),
+		sizeof(struct ext3_extent_idx) * tocopy);
+
+	new_node_start = ext2fs_le32_to_cpu(EXT_FIRST_INDEX(neweh)->ei_block);
+
+	/* then update the checksum */
+	retval = ext2fs_extent_block_csum_set(handle->fs, handle->ino, neweh);
+	if (retval)
+		goto done;
+
+	/* ...and write the new node block out to disk. */
+	retval = io_channel_write_blk64(handle->fs->io, new_node_pblk, 1,
+					block_buf);
+
+	if (retval)
+		goto done;
+
+	/* OK! we've created the new node; now adjust the tree */
+
+	/* current path now has fewer active entries, we copied some out */
+	if (handle->level == 0) {
+		memcpy(newpath, path,
+		       sizeof(struct extent_path) * handle->max_paths);
+		handle->path = newpath;
+		newpath = path;
+		path = handle->path;
+		path->entries = 1;
+		path->left = path->max_entries - 1;
+		handle->max_depth++;
+		handle->max_paths++;
+		eh->eh_depth = ext2fs_cpu_to_le16(handle->max_depth);
+	} else {
+		path->entries -= tocopy;
+		path->left -= tocopy;
+	}
+
+	eh->eh_entries = ext2fs_cpu_to_le16(path->entries);
+	/* this writes out the node, incl. the modified header */
+	retval = update_path(handle);
+	if (retval)
+		goto done;
+
+	/* now go up and insert/replace index for new node we created */
+	if (new_root) {
+		retval = ext2fs_extent_get(handle, EXT2_EXTENT_FIRST_SIB, &extent);
+		if (retval)
+			goto done;
+
+		extent.e_lblk = new_node_start;
+		extent.e_pblk = new_node_pblk;
+		extent.e_len = handle->path[0].end_blk - extent.e_lblk;
+		retval = ext2fs_extent_replace(handle, 0, &extent);
+		if (retval)
+			goto done;
+	} else {
+		__u32 new_node_length;
+
+		retval = ext2fs_extent_get(handle, EXT2_EXTENT_UP, &extent);
+		/* will insert after this one; it's length is shorter now */
+		new_node_length = new_node_start - extent.e_lblk;
+		extent.e_len -= new_node_length;
+		retval = ext2fs_extent_replace(handle, 0, &extent);
+		if (retval)
+			goto done;
+
+		/* now set up the new extent and insert it */
+		extent.e_lblk = new_node_start;
+		extent.e_pblk = new_node_pblk;
+		extent.e_len = new_node_length;
+		retval = ext2fs_extent_insert(handle, EXT2_EXTENT_INSERT_AFTER, &extent);
+		if (retval)
+			goto done;
+	}
+
+	/* get handle back to our original position */
+	retval = ext2fs_extent_goto2(handle, orig_height, orig_lblk);
+	if (retval)
+		goto done;
+
+	/* new node hooked in, so update inode block count (do this here?) */
+	ext2fs_iblk_add_blocks(handle->fs, handle->inode, 1);
+	retval = ext2fs_write_inode(handle->fs, handle->ino,
+				    handle->inode);
+	if (retval)
+		goto done;
+
+done:
+	if (newpath)
+		ext2fs_free_mem(&newpath);
+	free(block_buf);
+
+	return retval;
+}
+
+errcode_t ext2fs_extent_node_split(ext2_extent_handle_t handle)
+{
+	return extent_node_split(handle, 0);
+}
+
+errcode_t ext2fs_extent_insert(ext2_extent_handle_t handle, int flags,
+				      struct ext2fs_extent *extent)
+{
+	struct extent_path		*path;
+	struct ext3_extent_idx		*ix;
+	struct ext3_extent_header	*eh;
+	errcode_t			retval;
+
+	EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EXTENT_HANDLE);
+
+	if (!(handle->fs->flags & EXT2_FLAG_RW))
+		return EXT2_ET_RO_FILSYS;
+
+	if (!handle->path)
+		return EXT2_ET_NO_CURRENT_NODE;
+
+#ifdef DEBUG
+	printf("extent insert: %u ", handle->ino);
+	dbg_print_extent(0, extent);
+#endif
+
+	path = handle->path + handle->level;
+
+	if (path->entries >= path->max_entries) {
+		if (flags & EXT2_EXTENT_INSERT_NOSPLIT) {
+			return EXT2_ET_CANT_INSERT_EXTENT;
+		} else {
+#ifdef DEBUG
+			printf("node full (level %d) - splitting\n",
+				   handle->level);
+#endif
+			retval = extent_node_split(handle, 1);
+			if (retval)
+				return retval;
+			path = handle->path + handle->level;
+		}
+	}
+
+	eh = (struct ext3_extent_header *) path->buf;
+	if (path->curr) {
+		ix = path->curr;
+		if (flags & EXT2_EXTENT_INSERT_AFTER) {
+			ix++;
+			path->left--;
+		}
+	} else {
+		ix = EXT_FIRST_INDEX(eh);
+		path->left = -1;
+	}
+
+	path->curr = ix;
+
+	if (path->left >= 0)
+		memmove(ix + 1, ix,
+			(path->left+1) * sizeof(struct ext3_extent_idx));
+	path->left++;
+	path->entries++;
+
+	eh = (struct ext3_extent_header *) path->buf;
+	eh->eh_entries = ext2fs_cpu_to_le16(path->entries);
+
+	retval = ext2fs_extent_replace(handle, 0, extent);
+	if (retval)
+		goto errout;
+
+	retval = update_path(handle);
+	if (retval)
+		goto errout;
+
+	return 0;
+
+errout:
+	ext2fs_extent_delete(handle, 0);
+	return retval;
+}
+
+/*
+ * Sets the physical block for a logical file block in the extent tree.
+ *
+ * May: map unmapped, unmap mapped, or remap mapped blocks.
+ *
+ * Mapping an unmapped block adds a single-block extent.
+ *
+ * Unmapping first or last block modifies extent in-place
+ *  - But may need to fix parent's starts too in first-block case
+ *
+ * Mapping any unmapped block requires adding a (single-block) extent
+ * and inserting into proper point in tree.
+ *
+ * Modifying (unmapping or remapping) a block in the middle
+ * of an extent requires splitting the extent.
+ *  - Remapping case requires new single-block extent.
+ *
+ * Remapping first or last block adds an extent.
+ *
+ * We really need extent adding to be smart about merging.
+ */
+
+errcode_t ext2fs_extent_set_bmap(ext2_extent_handle_t handle,
+				 blk64_t logical, blk64_t physical, int flags)
+{
+	errcode_t		ec, retval = 0;
+	int			mapped = 1; /* logical is mapped? */
+	int			orig_height;
+	int			extent_uninit = 0;
+	int			prev_uninit = 0;
+	int			next_uninit = 0;
+	int			new_uninit = 0;
+	int			max_len = EXT_INIT_MAX_LEN;
+	int			has_prev, has_next;
+	blk64_t			orig_lblk;
+	struct extent_path	*path;
+	struct ext2fs_extent	extent, next_extent, prev_extent;
+	struct ext2fs_extent	newextent;
+	struct ext2_extent_info	info;
+
+	EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EXTENT_HANDLE);
+
+#ifdef DEBUG
+	printf("set_bmap ino %u log %lld phys %lld flags %d\n",
+	       handle->ino, logical, physical, flags);
+#endif
+
+	if (!(handle->fs->flags & EXT2_FLAG_RW))
+		return EXT2_ET_RO_FILSYS;
+
+	if (!handle->path)
+		return EXT2_ET_NO_CURRENT_NODE;
+
+	path = handle->path + handle->level;
+
+	if (flags & EXT2_EXTENT_SET_BMAP_UNINIT) {
+		new_uninit = 1;
+		max_len = EXT_UNINIT_MAX_LEN;
+	}
+
+	/* if (re)mapping, set up new extent to insert */
+	if (physical) {
+		newextent.e_len = 1;
+		newextent.e_pblk = physical;
+		newextent.e_lblk = logical;
+		newextent.e_flags = EXT2_EXTENT_FLAGS_LEAF;
+		if (new_uninit)
+			newextent.e_flags |= EXT2_EXTENT_FLAGS_UNINIT;
+	}
+
+	/* special case if the extent tree is completely empty */
+	if ((handle->max_depth == 0) && (path->entries == 0)) {
+		retval = ext2fs_extent_insert(handle, 0, &newextent);
+		return retval;
+	}
+
+	/* save our original location in the extent tree */
+	if ((retval = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT,
+					&extent))) {
+		if (retval != EXT2_ET_NO_CURRENT_NODE)
+			return retval;
+		memset(&extent, 0, sizeof(extent));
+	}
+	if ((retval = ext2fs_extent_get_info(handle, &info)))
+		return retval;
+	orig_height = info.max_depth - info.curr_level;
+	orig_lblk = extent.e_lblk;
+
+	/* go to the logical spot we want to (re/un)map */
+	retval = ext2fs_extent_goto(handle, logical);
+	if (retval) {
+		if (retval == EXT2_ET_EXTENT_NOT_FOUND) {
+			retval = 0;
+			mapped = 0;
+			if (!physical) {
+#ifdef DEBUG
+				printf("block %llu already unmapped\n",
+					logical);
+#endif
+				goto done;
+			}
+		} else
+			goto done;
+	}
+
+	/*
+	 * This may be the extent *before* the requested logical,
+	 * if it's currently unmapped.
+	 *
+	 * Get the previous and next leaf extents, if they are present.
+	 */
+	retval = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT, &extent);
+	if (retval)
+		goto done;
+	if (extent.e_flags & EXT2_EXTENT_FLAGS_UNINIT)
+		extent_uninit = 1;
+	retval = ext2fs_extent_get(handle, EXT2_EXTENT_NEXT_LEAF, &next_extent);
+	if (retval) {
+		has_next = 0;
+		if (retval != EXT2_ET_EXTENT_NO_NEXT)
+			goto done;
+	} else {
+		dbg_print_extent("set_bmap: next_extent",
+				 &next_extent);
+		has_next = 1;
+		if (next_extent.e_flags & EXT2_EXTENT_FLAGS_UNINIT)
+			next_uninit = 1;
+	}
+	retval = ext2fs_extent_goto(handle, logical);
+	if (retval && retval != EXT2_ET_EXTENT_NOT_FOUND)
+		goto done;
+	retval = ext2fs_extent_get(handle, EXT2_EXTENT_PREV_LEAF, &prev_extent);
+	if (retval) {
+		has_prev = 0;
+		if (retval != EXT2_ET_EXTENT_NO_PREV)
+			goto done;
+	} else {
+		has_prev = 1;
+		dbg_print_extent("set_bmap: prev_extent",
+				 &prev_extent);
+		if (prev_extent.e_flags & EXT2_EXTENT_FLAGS_UNINIT)
+			prev_uninit = 1;
+	}
+	retval = ext2fs_extent_goto(handle, logical);
+	if (retval && retval != EXT2_ET_EXTENT_NOT_FOUND)
+		goto done;
+
+	/* check if already pointing to the requested physical */
+	if (mapped && (new_uninit == extent_uninit) &&
+	    (extent.e_pblk + (logical - extent.e_lblk) == physical)) {
+#ifdef DEBUG
+		printf("physical block (at %llu) unchanged\n", logical);
+#endif
+		goto done;
+	}
+
+	if (!mapped) {
+#ifdef DEBUG
+		printf("mapping unmapped logical block %llu\n", logical);
+#endif
+		if ((logical == extent.e_lblk + extent.e_len) &&
+		    (physical == extent.e_pblk + extent.e_len) &&
+		    (new_uninit == extent_uninit) &&
+		    ((int) extent.e_len < max_len-1)) {
+			extent.e_len++;
+			retval = ext2fs_extent_replace(handle, 0, &extent);
+		} else if ((logical == extent.e_lblk - 1) &&
+			   (physical == extent.e_pblk - 1) &&
+			   (new_uninit == extent_uninit) &&
+			   ((int) extent.e_len < max_len - 1)) {
+			extent.e_len++;
+			extent.e_lblk--;
+			extent.e_pblk--;
+			retval = ext2fs_extent_replace(handle, 0, &extent);
+		} else if (has_next &&
+			   (logical == next_extent.e_lblk - 1) &&
+			   (physical == next_extent.e_pblk - 1) &&
+			   (new_uninit == next_uninit) &&
+			   ((int) next_extent.e_len < max_len - 1)) {
+			retval = ext2fs_extent_get(handle,
+						   EXT2_EXTENT_NEXT_LEAF,
+						   &next_extent);
+			if (retval)
+				goto done;
+			next_extent.e_len++;
+			next_extent.e_lblk--;
+			next_extent.e_pblk--;
+			retval = ext2fs_extent_replace(handle, 0, &next_extent);
+		} else if (logical < extent.e_lblk)
+			retval = ext2fs_extent_insert(handle, 0, &newextent);
+		else
+			retval = ext2fs_extent_insert(handle,
+				      EXT2_EXTENT_INSERT_AFTER, &newextent);
+		if (retval)
+			goto done;
+		retval = ext2fs_extent_fix_parents(handle);
+		if (retval)
+			goto done;
+	} else if ((logical == extent.e_lblk) && (extent.e_len == 1))  {
+#ifdef DEBUG
+		printf("(re/un)mapping only block in extent\n");
+#endif
+		if (physical) {
+			retval = ext2fs_extent_replace(handle, 0, &newextent);
+		} else {
+			retval = ext2fs_extent_delete(handle, 0);
+			if (retval)
+				goto done;
+			ec = ext2fs_extent_fix_parents(handle);
+			if (ec != EXT2_ET_NO_CURRENT_NODE)
+				retval = ec;
+		}
+
+		if (retval)
+			goto done;
+	} else if (logical == extent.e_lblk + extent.e_len - 1)  {
+#ifdef DEBUG
+		printf("(re/un)mapping last block in extent\n");
+#endif
+		if (physical) {
+			if (has_next &&
+			    (logical == (next_extent.e_lblk - 1)) &&
+			    (physical == (next_extent.e_pblk - 1)) &&
+			    (new_uninit == next_uninit) &&
+			    ((int) next_extent.e_len < max_len - 1)) {
+				retval = ext2fs_extent_get(handle,
+					EXT2_EXTENT_NEXT_LEAF, &next_extent);
+				if (retval)
+					goto done;
+				next_extent.e_len++;
+				next_extent.e_lblk--;
+				next_extent.e_pblk--;
+				retval = ext2fs_extent_replace(handle, 0,
+							       &next_extent);
+				if (retval)
+					goto done;
+			} else
+				retval = ext2fs_extent_insert(handle,
+				      EXT2_EXTENT_INSERT_AFTER, &newextent);
+			if (retval)
+				goto done;
+			retval = ext2fs_extent_fix_parents(handle);
+			if (retval)
+				goto done;
+			/*
+			 * Now pointing at inserted extent; move back to prev.
+			 *
+			 * We cannot use EXT2_EXTENT_PREV to go back; note the
+			 * subtlety in the comment for fix_parents().
+			 */
+			retval = ext2fs_extent_goto(handle, logical);
+			if (retval)
+				goto done;
+			retval = ext2fs_extent_get(handle,
+						   EXT2_EXTENT_CURRENT,
+						   &extent);
+			if (retval)
+				goto done;
+		}
+		extent.e_len--;
+		retval = ext2fs_extent_replace(handle, 0, &extent);
+		if (retval)
+			goto done;
+	} else if (logical == extent.e_lblk) {
+#ifdef DEBUG
+		printf("(re/un)mapping first block in extent\n");
+#endif
+		if (physical) {
+			if (has_prev &&
+			    (logical == (prev_extent.e_lblk +
+					 prev_extent.e_len)) &&
+			    (physical == (prev_extent.e_pblk +
+					  prev_extent.e_len)) &&
+			    (new_uninit == prev_uninit) &&
+			    ((int) prev_extent.e_len < max_len-1)) {
+				retval = ext2fs_extent_get(handle, 
+					EXT2_EXTENT_PREV_LEAF, &prev_extent);
+				if (retval)
+					goto done;
+				prev_extent.e_len++;
+				retval = ext2fs_extent_replace(handle, 0,
+							       &prev_extent);
+			} else
+				retval = ext2fs_extent_insert(handle,
+							      0, &newextent);
+			if (retval)
+				goto done;
+			retval = ext2fs_extent_fix_parents(handle);
+			if (retval)
+				goto done;
+			retval = ext2fs_extent_get(handle,
+						   EXT2_EXTENT_NEXT_LEAF,
+						   &extent);
+			if (retval)
+				goto done;
+		}
+		extent.e_pblk++;
+		extent.e_lblk++;
+		extent.e_len--;
+		retval = ext2fs_extent_replace(handle, 0, &extent);
+		if (retval)
+			goto done;
+		retval = ext2fs_extent_fix_parents(handle);
+		if (retval)
+			goto done;
+	} else {
+		__u32	save_length;
+		blk64_t	save_lblk;
+		struct ext2fs_extent save_extent;
+		errcode_t r2;
+
+#ifdef DEBUG
+		printf("(re/un)mapping in middle of extent\n");
+#endif
+		/* need to split this extent; later */
+		save_lblk = extent.e_lblk;
+		save_length = extent.e_len;
+		save_extent = extent;
+
+		/* shorten pre-split extent */
+		extent.e_len = (logical - extent.e_lblk);
+		retval = ext2fs_extent_replace(handle, 0, &extent);
+		if (retval)
+			goto done;
+		/* insert our new extent, if any */
+		if (physical) {
+			/* insert new extent after current */
+			retval = ext2fs_extent_insert(handle,
+					EXT2_EXTENT_INSERT_AFTER, &newextent);
+			if (retval) {
+				r2 = ext2fs_extent_goto(handle, save_lblk);
+				if (r2 == 0)
+					(void)ext2fs_extent_replace(handle, 0,
+							      &save_extent);
+				goto done;
+			}
+		}
+		/* add post-split extent */
+		extent.e_pblk += extent.e_len + 1;
+		extent.e_lblk += extent.e_len + 1;
+		extent.e_len = save_length - extent.e_len - 1;
+		retval = ext2fs_extent_insert(handle,
+				EXT2_EXTENT_INSERT_AFTER, &extent);
+		if (retval) {
+			if (physical) {
+				r2 = ext2fs_extent_goto(handle,
+							newextent.e_lblk);
+				if (r2 == 0)
+					(void)ext2fs_extent_delete(handle, 0);
+			}
+			r2 = ext2fs_extent_goto(handle, save_lblk);
+			if (r2 == 0)
+				(void)ext2fs_extent_replace(handle, 0,
+							    &save_extent);
+			goto done;
+		}
+	}
+
+done:
+	/* get handle back to its position */
+	if (orig_height > handle->max_depth)
+		orig_height = handle->max_depth; /* In case we shortened the tree */
+	ext2fs_extent_goto2(handle, orig_height, orig_lblk);
+	return retval;
+}
+
+errcode_t ext2fs_extent_delete(ext2_extent_handle_t handle, int flags)
+{
+	struct extent_path		*path;
+	char 				*cp;
+	struct ext3_extent_header	*eh;
+	errcode_t			retval = 0;
+
+	EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EXTENT_HANDLE);
+
+	if (!(handle->fs->flags & EXT2_FLAG_RW))
+		return EXT2_ET_RO_FILSYS;
+
+	if (!handle->path)
+		return EXT2_ET_NO_CURRENT_NODE;
+
+#ifdef DEBUG
+	{
+		struct ext2fs_extent	extent;
+
+		retval = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT,
+					   &extent);
+		if (retval == 0) {
+			printf("extent delete %u ", handle->ino);
+			dbg_print_extent(0, &extent);
+		}
+	}
+#endif
+
+	path = handle->path + handle->level;
+	if (!path->curr)
+		return EXT2_ET_NO_CURRENT_NODE;
+
+	cp = path->curr;
+
+	/* Sanity check before memmove() */
+	if (path->left < 0)
+		return EXT2_ET_EXTENT_LEAF_BAD;
+
+	if (path->left) {
+		memmove(cp, cp + sizeof(struct ext3_extent_idx),
+			path->left * sizeof(struct ext3_extent_idx));
+		path->left--;
+	} else {
+		struct ext3_extent_idx	*ix = path->curr;
+		ix--;
+		path->curr = ix;
+	}
+	if (--path->entries == 0)
+		path->curr = 0;
+
+	/* if non-root node has no entries left, remove it & parent ptr to it */
+	if (path->entries == 0 && handle->level) {
+		if (!(flags & EXT2_EXTENT_DELETE_KEEP_EMPTY)) {
+			struct ext2fs_extent	extent;
+
+			retval = ext2fs_extent_get(handle, EXT2_EXTENT_UP,
+								&extent);
+			if (retval)
+				return retval;
+
+			retval = ext2fs_extent_delete(handle, flags);
+			handle->inode->i_blocks -=
+				(handle->fs->blocksize *
+				 EXT2FS_CLUSTER_RATIO(handle->fs)) / 512;
+			retval = ext2fs_write_inode(handle->fs, handle->ino,
+						    handle->inode);
+			ext2fs_block_alloc_stats2(handle->fs,
+						  extent.e_pblk, -1);
+		}
+	} else {
+		eh = (struct ext3_extent_header *) path->buf;
+		eh->eh_entries = ext2fs_cpu_to_le16(path->entries);
+		if ((path->entries == 0) && (handle->level == 0)) {
+			eh->eh_depth = 0;
+			handle->max_depth = 0;
+		}
+		retval = update_path(handle);
+	}
+	return retval;
+}
+
+errcode_t ext2fs_extent_get_info(ext2_extent_handle_t handle,
+				 struct ext2_extent_info *info)
+{
+	struct extent_path		*path;
+
+	EXT2_CHECK_MAGIC(handle, EXT2_ET_MAGIC_EXTENT_HANDLE);
+
+	memset(info, 0, sizeof(struct ext2_extent_info));
+
+	path = handle->path + handle->level;
+	if (path) {
+		if (path->curr)
+			info->curr_entry = ((char *) path->curr - path->buf) /
+				sizeof(struct ext3_extent_idx);
+		else
+			info->curr_entry = 0;
+		info->num_entries = path->entries;
+		info->max_entries = path->max_entries;
+		info->bytes_avail = (path->max_entries - path->entries) *
+			sizeof(struct ext3_extent);
+	}
+
+	info->curr_level = handle->level;
+	info->max_depth = handle->max_depth;
+	info->max_lblk = EXT_MAX_EXTENT_LBLK;
+	info->max_pblk = EXT_MAX_EXTENT_PBLK;
+	info->max_len = EXT_INIT_MAX_LEN;
+	info->max_uninit_len = EXT_UNINIT_MAX_LEN;
+
+	return 0;
+}
+
+static int ul_log2(unsigned long arg)
+{
+	int	l = 0;
+
+	arg >>= 1;
+	while (arg) {
+		l++;
+		arg >>= 1;
+	}
+	return l;
+}
+
+size_t ext2fs_max_extent_depth(ext2_extent_handle_t handle)
+{
+	size_t iblock_sz = sizeof(((struct ext2_inode *)NULL)->i_block);
+	size_t iblock_extents = (iblock_sz - sizeof(struct ext3_extent_header)) /
+				sizeof(struct ext3_extent);
+	size_t extents_per_block = (handle->fs->blocksize -
+				    sizeof(struct ext3_extent_header)) /
+				   sizeof(struct ext3_extent);
+	static unsigned int last_blocksize = 0;
+	static size_t last_result = 0;
+
+	if (last_blocksize && last_blocksize == handle->fs->blocksize)
+		return last_result;
+
+	last_result = 1 + ((ul_log2(EXT_MAX_EXTENT_LBLK) - ul_log2(iblock_extents)) /
+		    ul_log2(extents_per_block));
+	last_blocksize = handle->fs->blocksize;
+	return last_result;
+}
+
+errcode_t ext2fs_fix_extents_checksums(ext2_filsys fs, ext2_ino_t ino,
+				       struct ext2_inode *inode)
+{
+	ext2_extent_handle_t	handle;
+	struct ext2fs_extent	extent;
+	errcode_t		errcode;
+	int    			save_flags = fs->flags;
+
+	if (!ext2fs_has_feature_metadata_csum(fs->super) ||
+	    (inode && !(inode->i_flags & EXT4_EXTENTS_FL)))
+		return 0;
+
+	errcode = ext2fs_extent_open2(fs, ino, inode, &handle);
+	if (errcode) {
+		if (errcode == EXT2_ET_INODE_NOT_EXTENT)
+			errcode = 0;
+		return errcode;
+	}
+
+	fs->flags &= ~EXT2_FLAG_IGNORE_CSUM_ERRORS;
+	errcode = ext2fs_extent_get(handle, EXT2_EXTENT_ROOT, &extent);
+	if (errcode)
+		goto out;
+
+	do {
+		/* Skip to the end of a block of leaf nodes */
+		if (extent.e_flags & EXT2_EXTENT_FLAGS_LEAF) {
+			errcode = ext2fs_extent_get(handle,
+						    EXT2_EXTENT_LAST_SIB,
+						    &extent);
+			if (errcode)
+				break;
+		}
+
+		errcode = ext2fs_extent_get(handle, EXT2_EXTENT_NEXT, &extent);
+		if (errcode == EXT2_ET_EXTENT_CSUM_INVALID)
+			errcode = update_path(handle);
+	} while (errcode == 0);
+
+out:
+	/* Ok if we run off the end */
+	if (errcode == EXT2_ET_EXTENT_NO_NEXT)
+		errcode = 0;
+	ext2fs_extent_free(handle);
+	fs->flags = save_flags;
+	return errcode;
+}
+
+errcode_t ext2fs_decode_extent(struct ext2fs_extent *to, void *addr, int len)
+{
+	struct ext3_extent *from = (struct ext3_extent *)addr;
+
+	if (len != sizeof(struct ext3_extent))
+		return EXT2_ET_INVALID_ARGUMENT;
+
+	to->e_pblk = ext2fs_le32_to_cpu(from->ee_start) +
+		((__u64) ext2fs_le16_to_cpu(from->ee_start_hi)
+			<< 32);
+	to->e_lblk = ext2fs_le32_to_cpu(from->ee_block);
+	to->e_len = ext2fs_le16_to_cpu(from->ee_len);
+	to->e_flags = EXT2_EXTENT_FLAGS_LEAF;
+	if (to->e_len > EXT_INIT_MAX_LEN) {
+		to->e_len -= EXT_INIT_MAX_LEN;
+		to->e_flags |= EXT2_EXTENT_FLAGS_UNINIT;
+	}
+
+	return 0;
+}
+
+errcode_t ext2fs_count_blocks(ext2_filsys fs, ext2_ino_t ino,
+			      struct ext2_inode *inode, blk64_t *ret_count)
+{
+	ext2_extent_handle_t	handle = NULL;
+	struct ext2fs_extent	extent;
+	errcode_t		errcode;
+	int			i;
+	blk64_t			blkcount = 0;
+	blk64_t			*intermediate_nodes;
+
+	errcode = ext2fs_extent_open2(fs, ino, inode, &handle);
+	if (errcode)
+		goto out;
+
+	errcode = ext2fs_extent_get(handle, EXT2_EXTENT_ROOT, &extent);
+	if (errcode)
+		goto out;
+
+	errcode = ext2fs_get_array(handle->max_depth, sizeof(blk64_t),
+				   &intermediate_nodes);
+	if (errcode)
+		goto out;
+
+	blkcount = handle->level;
+	while (!errcode) {
+		if (extent.e_flags & EXT2_EXTENT_FLAGS_LEAF) {
+			blkcount += extent.e_len;
+			for (i = 0; i < handle->level; i++) {
+				if (intermediate_nodes[i] !=
+					handle->path[i].end_blk) {
+					blkcount++;
+					intermediate_nodes[i] =
+						handle->path[i].end_blk;
+				}
+			}
+		}
+		errcode = ext2fs_extent_get(handle, EXT2_EXTENT_NEXT, &extent);
+	}
+	ext2fs_free_mem(&intermediate_nodes);
+out:
+	*ret_count = blkcount;
+	ext2fs_extent_free(handle);
+
+	return 0;
+}
+
+#ifdef DEBUG
+/*
+ * Override debugfs's prompt
+ */
+const char *debug_prog_name = "tst_extents";
+
+#endif
+
diff --git a/lib/ext2fs/fallocate.c b/lib/ext2fs/fallocate.c
new file mode 100644
index 0000000..5cde7d5
--- /dev/null
+++ b/lib/ext2fs/fallocate.c
@@ -0,0 +1,873 @@
+/*
+ * fallocate.c -- Allocate large chunks of file.
+ *
+ * Copyright (C) 2014 Oracle.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+#define min(a, b) ((a) < (b) ? (a) : (b))
+
+#undef DEBUG
+
+#ifdef DEBUG
+# define dbg_printf(f, a...)  do {printf(f, ## a); fflush(stdout); } while (0)
+#else
+# define dbg_printf(f, a...)
+#endif
+
+/*
+ * Extent-based fallocate code.
+ *
+ * Find runs of unmapped logical blocks by starting at start and walking the
+ * extents until we reach the end of the range we want.
+ *
+ * For each run of unmapped blocks, try to find the extents on either side of
+ * the range.  If there's a left extent that can grow by at least a cluster and
+ * there are lblocks between start and the next lcluster after start, see if
+ * there's an implied cluster allocation; if so, zero the blocks (if the left
+ * extent is initialized) and adjust the extent.  Ditto for the blocks between
+ * the end of the last full lcluster and end, if there's a right extent.
+ *
+ * Try to attach as much as we can to the left extent, then try to attach as
+ * much as we can to the right extent.  For the remainder, try to allocate the
+ * whole range; map in whatever we get; and repeat until we're done.
+ *
+ * To attach to a left extent, figure out the maximum amount we can add to the
+ * extent and try to allocate that much, and append if successful.  To attach
+ * to a right extent, figure out the max we can add to the extent, try to
+ * allocate that much, and prepend if successful.
+ *
+ * We need an alloc_range function that tells us how much we can allocate given
+ * a maximum length and one of a suggested start, a fixed start, or a fixed end
+ * point.
+ *
+ * Every time we modify the extent tree we also need to update the block stats.
+ *
+ * At the end, update i_blocks and i_size appropriately.
+ */
+
+static void dbg_print_extent(const char *desc EXT2FS_ATTR((unused)),
+		const struct ext2fs_extent *extent EXT2FS_ATTR((unused)))
+{
+#ifdef DEBUG
+	if (desc)
+		printf("%s: ", desc);
+	printf("extent: lblk %llu--%llu, len %u, pblk %llu, flags: ",
+	       extent->e_lblk, extent->e_lblk + extent->e_len - 1,
+	       extent->e_len, extent->e_pblk);
+	if (extent->e_flags & EXT2_EXTENT_FLAGS_LEAF)
+		fputs("LEAF ", stdout);
+	if (extent->e_flags & EXT2_EXTENT_FLAGS_UNINIT)
+		fputs("UNINIT ", stdout);
+	if (extent->e_flags & EXT2_EXTENT_FLAGS_SECOND_VISIT)
+		fputs("2ND_VISIT ", stdout);
+	if (!extent->e_flags)
+		fputs("(none)", stdout);
+	fputc('\n', stdout);
+	fflush(stdout);
+#endif
+}
+
+static errcode_t claim_range(ext2_filsys fs, struct ext2_inode *inode,
+			     blk64_t blk, blk64_t len)
+{
+	blk64_t	clusters;
+
+	clusters = (len + EXT2FS_CLUSTER_RATIO(fs) - 1) /
+		   EXT2FS_CLUSTER_RATIO(fs);
+	ext2fs_block_alloc_stats_range(fs, blk,
+			clusters * EXT2FS_CLUSTER_RATIO(fs), +1);
+	return ext2fs_iblk_add_blocks(fs, inode, clusters);
+}
+
+static errcode_t ext_falloc_helper(ext2_filsys fs,
+				   int flags,
+				   ext2_ino_t ino,
+				   struct ext2_inode *inode,
+				   ext2_extent_handle_t handle,
+				   struct ext2fs_extent *left_ext,
+				   struct ext2fs_extent *right_ext,
+				   blk64_t range_start, blk64_t range_len,
+				   blk64_t alloc_goal)
+{
+	struct ext2fs_extent	newex, ex;
+	int			op;
+	blk64_t			fillable, pblk, plen, x, y;
+	blk64_t			eof_blk = 0, cluster_fill = 0;
+	errcode_t		err;
+	blk_t			max_extent_len, max_uninit_len, max_init_len;
+
+#ifdef DEBUG
+	printf("%s: ", __func__);
+	if (left_ext)
+		printf("left_ext=%llu--%llu, ", left_ext->e_lblk,
+		       left_ext->e_lblk + left_ext->e_len - 1);
+	if (right_ext)
+		printf("right_ext=%llu--%llu, ", right_ext->e_lblk,
+		       right_ext->e_lblk + right_ext->e_len - 1);
+	printf("start=%llu len=%llu, goal=%llu\n", range_start, range_len,
+	       alloc_goal);
+	fflush(stdout);
+#endif
+	/* Can't create initialized extents past EOF? */
+	if (!(flags & EXT2_FALLOCATE_INIT_BEYOND_EOF))
+		eof_blk = EXT2_I_SIZE(inode) / fs->blocksize;
+
+	/* The allocation goal must be as far into a cluster as range_start. */
+	alloc_goal = (alloc_goal & ~EXT2FS_CLUSTER_MASK(fs)) |
+		     (range_start & EXT2FS_CLUSTER_MASK(fs));
+
+	max_uninit_len = EXT_UNINIT_MAX_LEN & ~EXT2FS_CLUSTER_MASK(fs);
+	max_init_len = EXT_INIT_MAX_LEN & ~EXT2FS_CLUSTER_MASK(fs);
+
+	/* We must lengthen the left extent to the end of the cluster */
+	if (left_ext && EXT2FS_CLUSTER_RATIO(fs) > 1) {
+		/* How many more blocks can be attached to left_ext? */
+		if (left_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT)
+			fillable = max_uninit_len - left_ext->e_len;
+		else
+			fillable = max_init_len - left_ext->e_len;
+
+		if (fillable > range_len)
+			fillable = range_len;
+		if (fillable == 0)
+			goto expand_right;
+
+		/*
+		 * If range_start isn't on a cluster boundary, try an
+		 * implied cluster allocation for left_ext.
+		 */
+		cluster_fill = EXT2FS_CLUSTER_RATIO(fs) -
+			       (range_start & EXT2FS_CLUSTER_MASK(fs));
+		cluster_fill &= EXT2FS_CLUSTER_MASK(fs);
+		if (cluster_fill == 0)
+			goto expand_right;
+
+		if (cluster_fill > fillable)
+			cluster_fill = fillable;
+
+		/* Don't expand an initialized left_ext beyond EOF */
+		if (!(flags & EXT2_FALLOCATE_INIT_BEYOND_EOF)) {
+			x = left_ext->e_lblk + left_ext->e_len - 1;
+			dbg_printf("%s: lend=%llu newlend=%llu eofblk=%llu\n",
+				   __func__, x, x + cluster_fill, eof_blk);
+			if (eof_blk >= x && eof_blk <= x + cluster_fill)
+				cluster_fill = eof_blk - x;
+			if (cluster_fill == 0)
+				goto expand_right;
+		}
+
+		err = ext2fs_extent_goto(handle, left_ext->e_lblk);
+		if (err)
+			goto expand_right;
+		left_ext->e_len += cluster_fill;
+		range_start += cluster_fill;
+		range_len -= cluster_fill;
+		alloc_goal += cluster_fill;
+
+		dbg_print_extent("ext_falloc clus left+", left_ext);
+		err = ext2fs_extent_replace(handle, 0, left_ext);
+		if (err)
+			goto out;
+		err = ext2fs_extent_fix_parents(handle);
+		if (err)
+			goto out;
+
+		/* Zero blocks */
+		if (!(left_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT)) {
+			err = ext2fs_zero_blocks2(fs, left_ext->e_pblk +
+						  left_ext->e_len -
+						  cluster_fill, cluster_fill,
+						  NULL, NULL);
+			if (err)
+				goto out;
+		}
+	}
+
+expand_right:
+	/* We must lengthen the right extent to the beginning of the cluster */
+	if (right_ext && EXT2FS_CLUSTER_RATIO(fs) > 1) {
+		/* How much can we attach to right_ext? */
+		if (right_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT)
+			fillable = max_uninit_len - right_ext->e_len;
+		else
+			fillable = max_init_len - right_ext->e_len;
+
+		if (fillable > range_len)
+			fillable = range_len;
+		if (fillable == 0)
+			goto try_merge;
+
+		/*
+		 * If range_end isn't on a cluster boundary, try an implied
+		 * cluster allocation for right_ext.
+		 */
+		cluster_fill = right_ext->e_lblk & EXT2FS_CLUSTER_MASK(fs);
+		if (cluster_fill == 0)
+			goto try_merge;
+
+		err = ext2fs_extent_goto(handle, right_ext->e_lblk);
+		if (err)
+			goto out;
+
+		if (cluster_fill > fillable)
+			cluster_fill = fillable;
+		right_ext->e_lblk -= cluster_fill;
+		right_ext->e_pblk -= cluster_fill;
+		right_ext->e_len += cluster_fill;
+		range_len -= cluster_fill;
+
+		dbg_print_extent("ext_falloc clus right+", right_ext);
+		err = ext2fs_extent_replace(handle, 0, right_ext);
+		if (err)
+			goto out;
+		err = ext2fs_extent_fix_parents(handle);
+		if (err)
+			goto out;
+
+		/* Zero blocks if necessary */
+		if (!(right_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT)) {
+			err = ext2fs_zero_blocks2(fs, right_ext->e_pblk,
+						  cluster_fill, NULL, NULL);
+			if (err)
+				goto out;
+		}
+	}
+
+try_merge:
+	/* Merge both extents together, perhaps? */
+	if (left_ext && right_ext) {
+		/* Are the two extents mergeable? */
+		if ((left_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT) !=
+		    (right_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT))
+			goto try_left;
+
+		/* User requires init/uninit but extent is uninit/init. */
+		if (((flags & EXT2_FALLOCATE_FORCE_INIT) &&
+		     (left_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT)) ||
+		    ((flags & EXT2_FALLOCATE_FORCE_UNINIT) &&
+		     !(left_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT)))
+			goto try_left;
+
+		/*
+		 * Skip initialized extent unless user wants to zero blocks
+		 * or requires init extent.
+		 */
+		if (!(left_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT) &&
+		    (!(flags & EXT2_FALLOCATE_ZERO_BLOCKS) ||
+		     !(flags & EXT2_FALLOCATE_FORCE_INIT)))
+			goto try_left;
+
+		/* Will it even fit? */
+		x = left_ext->e_len + range_len + right_ext->e_len;
+		if (x > (left_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT ?
+				max_uninit_len : max_init_len))
+			goto try_left;
+
+		err = ext2fs_extent_goto(handle, left_ext->e_lblk);
+		if (err)
+			goto try_left;
+
+		/* Allocate blocks */
+		y = left_ext->e_pblk + left_ext->e_len;
+		err = ext2fs_new_range(fs, EXT2_NEWRANGE_FIXED_GOAL |
+				       EXT2_NEWRANGE_MIN_LENGTH, y,
+				       right_ext->e_pblk - y + 1, NULL,
+				       &pblk, &plen);
+		if (err)
+			goto try_left;
+		if (pblk + plen != right_ext->e_pblk)
+			goto try_left;
+		err = claim_range(fs, inode, pblk, plen);
+		if (err)
+			goto out;
+
+		/* Modify extents */
+		left_ext->e_len = x;
+		dbg_print_extent("ext_falloc merge", left_ext);
+		err = ext2fs_extent_replace(handle, 0, left_ext);
+		if (err)
+			goto out;
+		err = ext2fs_extent_fix_parents(handle);
+		if (err)
+			goto out;
+		err = ext2fs_extent_get(handle, EXT2_EXTENT_NEXT_LEAF, &newex);
+		if (err)
+			goto out;
+		err = ext2fs_extent_delete(handle, 0);
+		if (err)
+			goto out;
+		err = ext2fs_extent_fix_parents(handle);
+		if (err)
+			goto out;
+		*right_ext = *left_ext;
+
+		/* Zero blocks */
+		if (!(left_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT) &&
+		    (flags & EXT2_FALLOCATE_ZERO_BLOCKS)) {
+			err = ext2fs_zero_blocks2(fs, range_start, range_len,
+						  NULL, NULL);
+			if (err)
+				goto out;
+		}
+
+		return 0;
+	}
+
+try_left:
+	/* Extend the left extent */
+	if (left_ext) {
+		/* How many more blocks can be attached to left_ext? */
+		if (left_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT)
+			fillable = max_uninit_len - left_ext->e_len;
+		else if (flags & EXT2_FALLOCATE_ZERO_BLOCKS)
+			fillable = max_init_len - left_ext->e_len;
+		else
+			fillable = 0;
+
+		/* User requires init/uninit but extent is uninit/init. */
+		if (((flags & EXT2_FALLOCATE_FORCE_INIT) &&
+		     (left_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT)) ||
+		    ((flags & EXT2_FALLOCATE_FORCE_UNINIT) &&
+		     !(left_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT)))
+			goto try_right;
+
+		if (fillable > range_len)
+			fillable = range_len;
+
+		/* Don't expand an initialized left_ext beyond EOF */
+		x = left_ext->e_lblk + left_ext->e_len - 1;
+		if (!(flags & EXT2_FALLOCATE_INIT_BEYOND_EOF)) {
+			dbg_printf("%s: lend=%llu newlend=%llu eofblk=%llu\n",
+				   __func__, x, x + fillable, eof_blk);
+			if (eof_blk >= x && eof_blk <= x + fillable)
+				fillable = eof_blk - x;
+		}
+
+		if (fillable == 0)
+			goto try_right;
+
+		/* Test if the right edge of the range is already mapped? */
+		if (EXT2FS_CLUSTER_RATIO(fs) > 1) {
+			err = ext2fs_map_cluster_block(fs, ino, inode,
+					x + fillable, &pblk);
+			if (err)
+				goto out;
+			if (pblk)
+				fillable -= 1 + ((x + fillable)
+						 & EXT2FS_CLUSTER_MASK(fs));
+			if (fillable == 0)
+				goto try_right;
+		}
+
+		/* Allocate range of blocks */
+		x = left_ext->e_pblk + left_ext->e_len;
+		err = ext2fs_new_range(fs, EXT2_NEWRANGE_FIXED_GOAL |
+				EXT2_NEWRANGE_MIN_LENGTH,
+				x, fillable, NULL, &pblk, &plen);
+		if (err)
+			goto try_right;
+		err = claim_range(fs, inode, pblk, plen);
+		if (err)
+			goto out;
+
+		/* Modify left_ext */
+		err = ext2fs_extent_goto(handle, left_ext->e_lblk);
+		if (err)
+			goto out;
+		range_start += plen;
+		range_len -= plen;
+		left_ext->e_len += plen;
+		dbg_print_extent("ext_falloc left+", left_ext);
+		err = ext2fs_extent_replace(handle, 0, left_ext);
+		if (err)
+			goto out;
+		err = ext2fs_extent_fix_parents(handle);
+		if (err)
+			goto out;
+
+		/* Zero blocks if necessary */
+		if (!(left_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT) &&
+		    (flags & EXT2_FALLOCATE_ZERO_BLOCKS)) {
+			err = ext2fs_zero_blocks2(fs, pblk, plen, NULL, NULL);
+			if (err)
+				goto out;
+		}
+	}
+
+try_right:
+	/* Extend the right extent */
+	if (right_ext) {
+		/* How much can we attach to right_ext? */
+		if (right_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT)
+			fillable = max_uninit_len - right_ext->e_len;
+		else if (flags & EXT2_FALLOCATE_ZERO_BLOCKS)
+			fillable = max_init_len - right_ext->e_len;
+		else
+			fillable = 0;
+
+		/* User requires init/uninit but extent is uninit/init. */
+		if (((flags & EXT2_FALLOCATE_FORCE_INIT) &&
+		     (right_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT)) ||
+		    ((flags & EXT2_FALLOCATE_FORCE_UNINIT) &&
+		     !(right_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT)))
+			goto try_anywhere;
+
+		if (fillable > range_len)
+			fillable = range_len;
+		if (fillable == 0)
+			goto try_anywhere;
+
+		/* Test if the left edge of the range is already mapped? */
+		if (EXT2FS_CLUSTER_RATIO(fs) > 1) {
+			err = ext2fs_map_cluster_block(fs, ino, inode,
+					right_ext->e_lblk - fillable, &pblk);
+			if (err)
+				goto out;
+			if (pblk)
+				fillable -= EXT2FS_CLUSTER_RATIO(fs) -
+						((right_ext->e_lblk - fillable)
+						 & EXT2FS_CLUSTER_MASK(fs));
+			if (fillable == 0)
+				goto try_anywhere;
+		}
+
+		/*
+		 * FIXME: It would be nice if we could handle allocating a
+		 * variable range from a fixed end point instead of just
+		 * skipping to the general allocator if the whole range is
+		 * unavailable.
+		 */
+		err = ext2fs_new_range(fs, EXT2_NEWRANGE_FIXED_GOAL |
+				EXT2_NEWRANGE_MIN_LENGTH,
+				right_ext->e_pblk - fillable,
+				fillable, NULL, &pblk, &plen);
+		if (err)
+			goto try_anywhere;
+		err = claim_range(fs, inode,
+			      pblk & ~EXT2FS_CLUSTER_MASK(fs),
+			      plen + (pblk & EXT2FS_CLUSTER_MASK(fs)));
+		if (err)
+			goto out;
+
+		/* Modify right_ext */
+		err = ext2fs_extent_goto(handle, right_ext->e_lblk);
+		if (err)
+			goto out;
+		range_len -= plen;
+		right_ext->e_lblk -= plen;
+		right_ext->e_pblk -= plen;
+		right_ext->e_len += plen;
+		dbg_print_extent("ext_falloc right+", right_ext);
+		err = ext2fs_extent_replace(handle, 0, right_ext);
+		if (err)
+			goto out;
+		err = ext2fs_extent_fix_parents(handle);
+		if (err)
+			goto out;
+
+		/* Zero blocks if necessary */
+		if (!(right_ext->e_flags & EXT2_EXTENT_FLAGS_UNINIT) &&
+		    (flags & EXT2_FALLOCATE_ZERO_BLOCKS)) {
+			err = ext2fs_zero_blocks2(fs, pblk,
+					plen + cluster_fill, NULL, NULL);
+			if (err)
+				goto out;
+		}
+	}
+
+try_anywhere:
+	/* Try implied cluster alloc on the left and right ends */
+	if (range_len > 0 && (range_start & EXT2FS_CLUSTER_MASK(fs))) {
+		cluster_fill = EXT2FS_CLUSTER_RATIO(fs) -
+			       (range_start & EXT2FS_CLUSTER_MASK(fs));
+		cluster_fill &= EXT2FS_CLUSTER_MASK(fs);
+		if (cluster_fill > range_len)
+			cluster_fill = range_len;
+		newex.e_lblk = range_start;
+		err = ext2fs_map_cluster_block(fs, ino, inode, newex.e_lblk,
+					       &pblk);
+		if (err)
+			goto out;
+		if (pblk == 0)
+			goto try_right_implied;
+		newex.e_pblk = pblk;
+		newex.e_len = cluster_fill;
+		newex.e_flags = (flags & EXT2_FALLOCATE_FORCE_INIT ? 0 :
+				 EXT2_EXTENT_FLAGS_UNINIT);
+		dbg_print_extent("ext_falloc iclus left+", &newex);
+		ext2fs_extent_goto(handle, newex.e_lblk);
+		err = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT,
+					&ex);
+		if (err == EXT2_ET_NO_CURRENT_NODE)
+			ex.e_lblk = 0;
+		else if (err)
+			goto out;
+
+		if (ex.e_lblk > newex.e_lblk)
+			op = 0; /* insert before */
+		else
+			op = EXT2_EXTENT_INSERT_AFTER;
+		dbg_printf("%s: inserting %s lblk %llu newex=%llu\n",
+			   __func__, op ? "after" : "before", ex.e_lblk,
+			   newex.e_lblk);
+		err = ext2fs_extent_insert(handle, op, &newex);
+		if (err)
+			goto out;
+		err = ext2fs_extent_fix_parents(handle);
+		if (err)
+			goto out;
+
+		if (!(newex.e_flags & EXT2_EXTENT_FLAGS_UNINIT) &&
+		    (flags & EXT2_FALLOCATE_ZERO_BLOCKS)) {
+			err = ext2fs_zero_blocks2(fs, newex.e_pblk,
+						  newex.e_len, NULL, NULL);
+			if (err)
+				goto out;
+		}
+
+		range_start += cluster_fill;
+		range_len -= cluster_fill;
+	}
+
+try_right_implied:
+	y = range_start + range_len;
+	if (range_len > 0 && (y & EXT2FS_CLUSTER_MASK(fs))) {
+		cluster_fill = y & EXT2FS_CLUSTER_MASK(fs);
+		if (cluster_fill > range_len)
+			cluster_fill = range_len;
+		newex.e_lblk = y & ~EXT2FS_CLUSTER_MASK(fs);
+		err = ext2fs_map_cluster_block(fs, ino, inode, newex.e_lblk,
+					       &pblk);
+		if (err)
+			goto out;
+		if (pblk == 0)
+			goto no_implied;
+		newex.e_pblk = pblk;
+		newex.e_len = cluster_fill;
+		newex.e_flags = (flags & EXT2_FALLOCATE_FORCE_INIT ? 0 :
+				 EXT2_EXTENT_FLAGS_UNINIT);
+		dbg_print_extent("ext_falloc iclus right+", &newex);
+		ext2fs_extent_goto(handle, newex.e_lblk);
+		err = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT,
+					&ex);
+		if (err == EXT2_ET_NO_CURRENT_NODE)
+			ex.e_lblk = 0;
+		else if (err)
+			goto out;
+
+		if (ex.e_lblk > newex.e_lblk)
+			op = 0; /* insert before */
+		else
+			op = EXT2_EXTENT_INSERT_AFTER;
+		dbg_printf("%s: inserting %s lblk %llu newex=%llu\n",
+			   __func__, op ? "after" : "before", ex.e_lblk,
+			   newex.e_lblk);
+		err = ext2fs_extent_insert(handle, op, &newex);
+		if (err)
+			goto out;
+		err = ext2fs_extent_fix_parents(handle);
+		if (err)
+			goto out;
+
+		if (!(newex.e_flags & EXT2_EXTENT_FLAGS_UNINIT) &&
+		    (flags & EXT2_FALLOCATE_ZERO_BLOCKS)) {
+			err = ext2fs_zero_blocks2(fs, newex.e_pblk,
+						  newex.e_len, NULL, NULL);
+			if (err)
+				goto out;
+		}
+
+		range_len -= cluster_fill;
+	}
+
+no_implied:
+	if (range_len == 0)
+		return 0;
+
+	newex.e_lblk = range_start;
+	if (flags & EXT2_FALLOCATE_FORCE_INIT) {
+		max_extent_len = max_init_len;
+		newex.e_flags = 0;
+	} else {
+		max_extent_len = max_uninit_len;
+		newex.e_flags = EXT2_EXTENT_FLAGS_UNINIT;
+	}
+	pblk = alloc_goal;
+	y = range_len;
+	for (x = 0; x < y;) {
+		cluster_fill = newex.e_lblk & EXT2FS_CLUSTER_MASK(fs);
+		fillable = min(range_len + cluster_fill, max_extent_len);
+		err = ext2fs_new_range(fs, 0, pblk & ~EXT2FS_CLUSTER_MASK(fs),
+				       fillable,
+				       NULL, &pblk, &plen);
+		if (err)
+			goto out;
+		err = claim_range(fs, inode, pblk, plen);
+		if (err)
+			goto out;
+
+		/* Create extent */
+		newex.e_pblk = pblk + cluster_fill;
+		newex.e_len = plen - cluster_fill;
+		dbg_print_extent("ext_falloc create", &newex);
+		ext2fs_extent_goto(handle, newex.e_lblk);
+		err = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT,
+					&ex);
+		if (err == EXT2_ET_NO_CURRENT_NODE)
+			ex.e_lblk = 0;
+		else if (err)
+			goto out;
+
+		if (ex.e_lblk > newex.e_lblk)
+			op = 0; /* insert before */
+		else
+			op = EXT2_EXTENT_INSERT_AFTER;
+		dbg_printf("%s: inserting %s lblk %llu newex=%llu\n",
+			   __func__, op ? "after" : "before", ex.e_lblk,
+			   newex.e_lblk);
+		err = ext2fs_extent_insert(handle, op, &newex);
+		if (err)
+			goto out;
+		err = ext2fs_extent_fix_parents(handle);
+		if (err)
+			goto out;
+
+		if (!(newex.e_flags & EXT2_EXTENT_FLAGS_UNINIT) &&
+		    (flags & EXT2_FALLOCATE_ZERO_BLOCKS)) {
+			err = ext2fs_zero_blocks2(fs, pblk, plen, NULL, NULL);
+			if (err)
+				goto out;
+		}
+
+		/* Update variables at end of loop */
+		x += plen - cluster_fill;
+		range_len -= plen - cluster_fill;
+		newex.e_lblk += plen - cluster_fill;
+		pblk += plen - cluster_fill;
+		if (pblk >= ext2fs_blocks_count(fs->super))
+			pblk = fs->super->s_first_data_block;
+	}
+
+out:
+	return err;
+}
+
+static errcode_t extent_fallocate(ext2_filsys fs, int flags, ext2_ino_t ino,
+				      struct ext2_inode *inode, blk64_t goal,
+				      blk64_t start, blk64_t len)
+{
+	ext2_extent_handle_t	handle;
+	struct ext2fs_extent	left_extent, right_extent;
+	struct ext2fs_extent	*left_adjacent, *right_adjacent;
+	errcode_t		err;
+	blk64_t			range_start, range_end = 0, end, next;
+	blk64_t			count, goal_distance;
+
+	end = start + len - 1;
+	err = ext2fs_extent_open2(fs, ino, inode, &handle);
+	if (err)
+		return err;
+
+	/*
+	 * Find the extent closest to the start of the alloc range.  We don't
+	 * check the return value because _goto() sets the current node to the
+	 * next-lowest extent if 'start' is in a hole; or the next-highest
+	 * extent if there aren't any lower ones; or doesn't set a current node
+	 * if there was a real error reading the extent tree.  In that case,
+	 * _get() will error out.
+	 */
+start_again:
+	ext2fs_extent_goto(handle, start);
+	err = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT, &left_extent);
+	if (err == EXT2_ET_NO_CURRENT_NODE) {
+		blk64_t max_blocks = ext2fs_blocks_count(fs->super);
+
+		if (goal == ~0ULL)
+			goal = ext2fs_find_inode_goal(fs, ino, inode, start);
+		err = ext2fs_find_first_zero_block_bitmap2(fs->block_map,
+						goal, max_blocks - 1, &goal);
+		goal += start;
+		err = ext_falloc_helper(fs, flags, ino, inode, handle, NULL,
+					NULL, start, len, goal);
+		goto errout;
+	} else if (err)
+		goto errout;
+
+	dbg_print_extent("ext_falloc initial", &left_extent);
+	next = left_extent.e_lblk + left_extent.e_len;
+	if (left_extent.e_lblk > start) {
+		/* The nearest extent we found was beyond start??? */
+		goal = left_extent.e_pblk - (left_extent.e_lblk - start);
+		err = ext_falloc_helper(fs, flags, ino, inode, handle, NULL,
+					&left_extent, start,
+					left_extent.e_lblk - start, goal);
+		if (err)
+			goto errout;
+
+		goto start_again;
+	} else if (next >= start) {
+		range_start = next;
+		left_adjacent = &left_extent;
+	} else {
+		range_start = start;
+		left_adjacent = NULL;
+	}
+	goal = left_extent.e_pblk + (range_start - left_extent.e_lblk);
+
+	do {
+		err = ext2fs_extent_get(handle, EXT2_EXTENT_NEXT_LEAF,
+					   &right_extent);
+		dbg_printf("%s: ino=%d get next =%d\n", __func__, ino,
+			   (int)err);
+		dbg_print_extent("ext_falloc next", &right_extent);
+		/* Stop if we've seen this extent before */
+		if (!err && right_extent.e_lblk <= left_extent.e_lblk)
+			err = EXT2_ET_EXTENT_NO_NEXT;
+
+		if (err && err != EXT2_ET_EXTENT_NO_NEXT)
+			goto errout;
+		if (err == EXT2_ET_EXTENT_NO_NEXT ||
+		    right_extent.e_lblk > end + 1) {
+			range_end = end;
+			right_adjacent = NULL;
+		} else {
+			/* Handle right_extent.e_lblk <= end */
+			range_end = right_extent.e_lblk - 1;
+			right_adjacent = &right_extent;
+		}
+		goal_distance = range_start - next;
+		if (err != EXT2_ET_EXTENT_NO_NEXT &&
+		    goal_distance > (range_end - right_extent.e_lblk))
+			goal = right_extent.e_pblk -
+					(right_extent.e_lblk - range_start);
+
+		dbg_printf("%s: ino=%d rstart=%llu rend=%llu\n", __func__, ino,
+			   range_start, range_end);
+		err = 0;
+		if (range_start <= range_end) {
+			count = range_end - range_start + 1;
+			err = ext_falloc_helper(fs, flags, ino, inode, handle,
+						left_adjacent, right_adjacent,
+						range_start, count, goal);
+			if (err)
+				goto errout;
+		}
+
+		if (range_end == end)
+			break;
+
+		err = ext2fs_extent_goto(handle, right_extent.e_lblk);
+		if (err)
+			goto errout;
+		next = right_extent.e_lblk + right_extent.e_len;
+		left_extent = right_extent;
+		left_adjacent = &left_extent;
+		range_start = next;
+		goal = left_extent.e_pblk + (range_start - left_extent.e_lblk);
+	} while (range_end < end);
+
+errout:
+	ext2fs_extent_free(handle);
+	return err;
+}
+
+/*
+ * Map physical blocks to a range of logical blocks within a file.  The range
+ * of logical blocks are (start, start + len).  If there are already extents,
+ * the mappings will try to extend the mappings; otherwise, it will try to map
+ * start as if logical block 0 points to goal.  If goal is ~0ULL, then the goal
+ * is calculated based on the inode group.
+ *
+ * Flags:
+ * - EXT2_FALLOCATE_ZERO_BLOCKS: Zero the blocks that are allocated.
+ * - EXT2_FALLOCATE_FORCE_INIT: Create only initialized extents.
+ * - EXT2_FALLOCATE_FORCE_UNINIT: Create only uninitialized extents.
+ * - EXT2_FALLOCATE_INIT_BEYOND_EOF: Create extents beyond EOF.
+ *
+ * If neither FORCE_INIT nor FORCE_UNINIT are specified, this function will
+ * try to expand any extents it finds, zeroing blocks as necessary.
+ */
+errcode_t ext2fs_fallocate(ext2_filsys fs, int flags, ext2_ino_t ino,
+			   struct ext2_inode *inode, blk64_t goal,
+			   blk64_t start, blk64_t len)
+{
+	struct ext2_inode	inode_buf;
+	blk64_t			blk, x, zero_blk, last = 0;
+	int			zero_len = 0;
+	errcode_t		err;
+
+	if (((flags & EXT2_FALLOCATE_FORCE_INIT) &&
+	    (flags & EXT2_FALLOCATE_FORCE_UNINIT)) ||
+	   (flags & ~EXT2_FALLOCATE_ALL_FLAGS))
+		return EXT2_ET_INVALID_ARGUMENT;
+
+	if (len > ext2fs_blocks_count(fs->super))
+		return EXT2_ET_BLOCK_ALLOC_FAIL;
+	else if (len == 0)
+		return 0;
+
+	/* Read inode structure if necessary */
+	if (!inode) {
+		err = ext2fs_read_inode(fs, ino, &inode_buf);
+		if (err)
+			return err;
+		inode = &inode_buf;
+	}
+	dbg_printf("%s: ino=%d start=%llu len=%llu goal=%llu\n", __func__, ino,
+		   start, len, goal);
+
+	if (inode->i_flags & EXT4_EXTENTS_FL) {
+		err = extent_fallocate(fs, flags, ino, inode, goal, start, len);
+		goto out;
+	}
+
+	/* XXX: Allocate a bunch of blocks the slow way */
+	for (blk = start; blk < start + len; blk++) {
+		err = ext2fs_bmap2(fs, ino, inode, NULL, 0, blk, 0, &x);
+		if (err)
+			return err;
+		if (x)
+			continue;
+
+		err = ext2fs_bmap2(fs, ino, inode, NULL, BMAP_ALLOC,
+				   blk, 0, &x);
+		if (err)
+			goto errout;
+		if ((zero_len && (x != last+1)) ||
+		    (zero_len >= 65536)) {
+			err = ext2fs_zero_blocks2(fs, zero_blk, zero_len,
+						  NULL, NULL);
+			zero_len = 0;
+			if (err)
+				goto errout;
+		}
+		if (zero_len == 0) {
+			zero_blk = x;
+			zero_len = 1;
+		} else {
+			zero_len++;
+		}
+		last = x;
+	}
+
+out:
+	if (inode == &inode_buf)
+		ext2fs_write_inode(fs, ino, inode);
+errout:
+	if (zero_len)
+		ext2fs_zero_blocks2(fs, zero_blk, zero_len, NULL, NULL);
+	return err;
+}
diff --git a/lib/ext2fs/fast_commit.h b/lib/ext2fs/fast_commit.h
new file mode 100644
index 0000000..4ad38f1
--- /dev/null
+++ b/lib/ext2fs/fast_commit.h
@@ -0,0 +1,190 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+
+#ifndef __FAST_COMMIT_H__
+#define __FAST_COMMIT_H__
+
+#include "jfs_compat.h"
+
+/*
+ * Note this file is present in e2fsprogs/lib/ext2fs/fast_commit.h and
+ * linux/fs/ext4/fast_commit.h. These file should always be byte identical.
+ */
+
+/* Fast commit tags */
+#define EXT4_FC_TAG_ADD_RANGE		0x0001
+#define EXT4_FC_TAG_DEL_RANGE		0x0002
+#define EXT4_FC_TAG_CREAT		0x0003
+#define EXT4_FC_TAG_LINK		0x0004
+#define EXT4_FC_TAG_UNLINK		0x0005
+#define EXT4_FC_TAG_INODE		0x0006
+#define EXT4_FC_TAG_PAD			0x0007
+#define EXT4_FC_TAG_TAIL		0x0008
+#define EXT4_FC_TAG_HEAD		0x0009
+
+#define EXT4_FC_SUPPORTED_FEATURES	0x0
+
+/* On disk fast commit tlv value structures */
+
+/* Fast commit on disk tag length structure */
+struct ext4_fc_tl {
+	__le16 fc_tag;
+	__le16 fc_len;
+};
+
+/* Value structure for tag EXT4_FC_TAG_HEAD. */
+struct ext4_fc_head {
+	__le32 fc_features;
+	__le32 fc_tid;
+};
+
+/* Value structure for EXT4_FC_TAG_ADD_RANGE. */
+struct ext4_fc_add_range {
+	__le32 fc_ino;
+	__u8 fc_ex[12];
+};
+
+/* Value structure for tag EXT4_FC_TAG_DEL_RANGE. */
+struct ext4_fc_del_range {
+	__le32 fc_ino;
+	__le32 fc_lblk;
+	__le32 fc_len;
+};
+
+/*
+ * This is the value structure for tags EXT4_FC_TAG_CREAT, EXT4_FC_TAG_LINK
+ * and EXT4_FC_TAG_UNLINK.
+ */
+struct ext4_fc_dentry_info {
+	__le32 fc_parent_ino;
+	__le32 fc_ino;
+	__u8 fc_dname[0];
+};
+
+/* Value structure for EXT4_FC_TAG_INODE and EXT4_FC_TAG_INODE_PARTIAL. */
+struct ext4_fc_inode {
+	__le32 fc_ino;
+	__u8 fc_raw_inode[0];
+};
+
+/* Value structure for tag EXT4_FC_TAG_TAIL. */
+struct ext4_fc_tail {
+	__le32 fc_tid;
+	__le32 fc_crc;
+};
+
+/*
+ * Fast commit reason codes
+ */
+enum {
+	/*
+	 * Commit status codes:
+	 */
+	EXT4_FC_REASON_OK = 0,
+	EXT4_FC_REASON_INELIGIBLE,
+	EXT4_FC_REASON_ALREADY_COMMITTED,
+	EXT4_FC_REASON_FC_START_FAILED,
+	EXT4_FC_REASON_FC_FAILED,
+
+	/*
+	 * Fast commit ineligiblity reasons:
+	 */
+	EXT4_FC_REASON_XATTR = 0,
+	EXT4_FC_REASON_CROSS_RENAME,
+	EXT4_FC_REASON_JOURNAL_FLAG_CHANGE,
+	EXT4_FC_REASON_NOMEM,
+	EXT4_FC_REASON_SWAP_BOOT,
+	EXT4_FC_REASON_RESIZE,
+	EXT4_FC_REASON_RENAME_DIR,
+	EXT4_FC_REASON_FALLOC_RANGE,
+	EXT4_FC_REASON_INODE_JOURNAL_DATA,
+	EXT4_FC_COMMIT_FAILED,
+	EXT4_FC_REASON_MAX
+};
+
+#ifdef __KERNEL__
+/*
+ * In memory list of dentry updates that are performed on the file
+ * system used by fast commit code.
+ */
+struct ext4_fc_dentry_update {
+	int fcd_op;		/* Type of update create / unlink / link */
+	int fcd_parent;		/* Parent inode number */
+	int fcd_ino;		/* Inode number */
+	struct qstr fcd_name;	/* Dirent name */
+	unsigned char fcd_iname[DNAME_INLINE_LEN];	/* Dirent name string */
+	struct list_head fcd_list;
+};
+
+struct ext4_fc_stats {
+	unsigned int fc_ineligible_reason_count[EXT4_FC_REASON_MAX];
+	unsigned long fc_num_commits;
+	unsigned long fc_ineligible_commits;
+	unsigned long fc_numblks;
+};
+
+#define EXT4_FC_REPLAY_REALLOC_INCREMENT	4
+
+/*
+ * Physical block regions added to different inodes due to fast commit
+ * recovery. These are set during the SCAN phase. During the replay phase,
+ * our allocator excludes these from its allocation. This ensures that
+ * we don't accidentally allocating a block that is going to be used by
+ * another inode.
+ */
+struct ext4_fc_alloc_region {
+	ext4_lblk_t lblk;
+	ext4_fsblk_t pblk;
+	int ino, len;
+};
+
+/*
+ * Fast commit replay state.
+ */
+struct ext4_fc_replay_state {
+	int fc_replay_num_tags;
+	int fc_replay_expected_off;
+	int fc_current_pass;
+	int fc_cur_tag;
+	int fc_crc;
+	struct ext4_fc_alloc_region *fc_regions;
+	int fc_regions_size, fc_regions_used, fc_regions_valid;
+	int *fc_modified_inodes;
+	int fc_modified_inodes_used, fc_modified_inodes_size;
+};
+
+#define region_last(__region) (((__region)->lblk) + ((__region)->len) - 1)
+#endif
+
+static inline const char *tag2str(__u16 tag)
+{
+	switch (tag) {
+	case EXT4_FC_TAG_LINK:
+		return "ADD_ENTRY";
+	case EXT4_FC_TAG_UNLINK:
+		return "DEL_ENTRY";
+	case EXT4_FC_TAG_ADD_RANGE:
+		return "ADD_RANGE";
+	case EXT4_FC_TAG_CREAT:
+		return "CREAT_DENTRY";
+	case EXT4_FC_TAG_DEL_RANGE:
+		return "DEL_RANGE";
+	case EXT4_FC_TAG_INODE:
+		return "INODE";
+	case EXT4_FC_TAG_PAD:
+		return "PAD";
+	case EXT4_FC_TAG_TAIL:
+		return "TAIL";
+	case EXT4_FC_TAG_HEAD:
+		return "HEAD";
+	default:
+		return "ERROR";
+	}
+}
+
+/* Get length of a particular tlv */
+static inline int ext4_fc_tag_len(struct ext4_fc_tl *tl)
+{
+	return le16_to_cpu(tl->fc_len);
+}
+
+#endif /* __FAST_COMMIT_H__ */
diff --git a/lib/ext2fs/fiemap.h b/lib/ext2fs/fiemap.h
new file mode 100644
index 0000000..33ab8fb
--- /dev/null
+++ b/lib/ext2fs/fiemap.h
@@ -0,0 +1,93 @@
+/*
+ * FS_IOC_FIEMAP ioctl infrastructure.
+ *
+ * Some portions copyright (C) 2007 Cluster File Systems, Inc
+ *
+ * Authors: Mark Fasheh <mfasheh@suse.com>
+ *          Kalpak Shah <kalpak.shah@sun.com>
+ *          Andreas Dilger <adilger@sun.com>
+ */
+
+#ifndef _LINUX_FIEMAP_H
+#define _LINUX_FIEMAP_H
+
+struct fiemap_extent {
+	__u64 fe_logical;  /* logical offset in bytes for the start of
+			    * the extent from the beginning of the file */
+	__u64 fe_physical; /* physical offset in bytes for the start
+			    * of the extent from the beginning of the disk */
+	__u64 fe_length;   /* length in bytes for this extent */
+	__u64 fe_reserved64[2];
+	__u32 fe_flags;    /* FIEMAP_EXTENT_* flags for this extent */
+	__u32 fe_reserved[3];
+};
+
+struct fiemap {
+	__u64 fm_start;		/* logical offset (inclusive) at
+				 * which to start mapping (in) */
+	__u64 fm_length;	/* logical length of mapping which
+				 * userspace wants (in) */
+	__u32 fm_flags;		/* FIEMAP_FLAG_* flags for request (in/out) */
+	__u32 fm_mapped_extents;/* number of extents that were mapped (out) */
+	__u32 fm_extent_count;  /* size of fm_extents array (in) */
+	__u32 fm_reserved;
+#if __GNUC_PREREQ (4, 8)
+#pragma GCC diagnostic push
+#pragma GCC diagnostic ignored "-Wpedantic"
+#endif
+	struct fiemap_extent fm_extents[0]; /* array of mapped extents (out) */
+#if __GNUC_PREREQ (4, 8)
+#pragma GCC diagnostic pop
+#endif
+};
+
+#if defined(__linux__) && !defined(FS_IOC_FIEMAP)
+#define FS_IOC_FIEMAP	_IOWR('f', 11, struct fiemap)
+#endif
+
+#if defined(__linux__) && !defined(FS_IOC_GETSTATE)
+#define EXT4_IOC_GETSTATE		_IOW('f', 41, __u32)
+#endif
+
+#if defined(__linux__) && !defined(EXT4_IOC_GET_ES_CACHE)
+#define EXT4_IOC_GET_ES_CACHE		_IOWR('f', 42, struct fiemap)
+#endif
+
+#if defined(__linux__) && !defined(EXT4_STATE_FLAG_EXT_PRECACHED)
+#define EXT4_STATE_FLAG_EXT_PRECACHED	0x00000001
+#endif
+
+#define FIEMAP_MAX_OFFSET	(~0ULL)
+
+#define FIEMAP_FLAG_SYNC	0x00000001 /* sync file data before map */
+#define FIEMAP_FLAG_XATTR	0x00000002 /* map extended attribute tree */
+#define FIEMAP_FLAG_CACHE	0x00000004 /* request caching of the extents */
+
+#define FIEMAP_FLAGS_COMPAT	(FIEMAP_FLAG_SYNC | FIEMAP_FLAG_XATTR)
+
+#define FIEMAP_EXTENT_LAST		0x00000001 /* Last extent in file. */
+#define FIEMAP_EXTENT_UNKNOWN		0x00000002 /* Data location unknown. */
+#define FIEMAP_EXTENT_DELALLOC		0x00000004 /* Location still pending.
+						    * Sets EXTENT_UNKNOWN. */
+#define FIEMAP_EXTENT_ENCODED		0x00000008 /* Data can not be read
+						    * while fs is unmounted */
+#define FIEMAP_EXTENT_DATA_ENCRYPTED	0x00000080 /* Data is encrypted by fs.
+						    * Sets EXTENT_NO_BYPASS. */
+#define FIEMAP_EXTENT_NOT_ALIGNED	0x00000100 /* Extent offsets may not be
+						    * block aligned. */
+#define FIEMAP_EXTENT_DATA_INLINE	0x00000200 /* Data mixed with metadata.
+						    * Sets EXTENT_NOT_ALIGNED.*/
+#define FIEMAP_EXTENT_DATA_TAIL		0x00000400 /* Multiple files in block.
+						    * Sets EXTENT_NOT_ALIGNED.*/
+#define FIEMAP_EXTENT_UNWRITTEN		0x00000800 /* Space allocated, but
+						    * no data (i.e. zero). */
+#define FIEMAP_EXTENT_MERGED		0x00001000 /* File does not natively
+						    * support extents. Result
+						    * merged for efficiency. */
+#define FIEMAP_EXTENT_SHARED		0x00002000 /* Space shared with other
+						    * files. */
+
+#define EXT4_FIEMAP_EXTENT_HOLE		0x08000000 /* Entry in extent status
+						      cache for a hole*/
+
+#endif /* _LINUX_FIEMAP_H */
diff --git a/lib/ext2fs/fileio.c b/lib/ext2fs/fileio.c
new file mode 100644
index 0000000..818f7f0
--- /dev/null
+++ b/lib/ext2fs/fileio.c
@@ -0,0 +1,666 @@
+/*
+ * fileio.c --- Simple file I/O routines
+ *
+ * Copyright (C) 1997 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+#include "ext2fsP.h"
+
+struct ext2_file {
+	errcode_t		magic;
+	ext2_filsys 		fs;
+	ext2_ino_t		ino;
+	struct ext2_inode	inode;
+	int 			flags;
+	__u64			pos;
+	blk64_t			blockno;
+	blk64_t			physblock;
+	char 			*buf;
+};
+
+struct block_entry {
+	blk64_t		physblock;
+	unsigned char 	sha[EXT2FS_SHA512_LENGTH];
+};
+typedef struct block_entry *block_entry_t;
+
+#define BMAP_BUFFER (file->buf + fs->blocksize)
+
+errcode_t ext2fs_file_open2(ext2_filsys fs, ext2_ino_t ino,
+			    struct ext2_inode *inode,
+			    int flags, ext2_file_t *ret)
+{
+	ext2_file_t 	file;
+	errcode_t	retval;
+
+	/*
+	 * Don't let caller create or open a file for writing if the
+	 * filesystem is read-only.
+	 */
+	if ((flags & (EXT2_FILE_WRITE | EXT2_FILE_CREATE)) &&
+	    !(fs->flags & EXT2_FLAG_RW))
+		return EXT2_ET_RO_FILSYS;
+
+	retval = ext2fs_get_mem(sizeof(struct ext2_file), &file);
+	if (retval)
+		return retval;
+
+	memset(file, 0, sizeof(struct ext2_file));
+	file->magic = EXT2_ET_MAGIC_EXT2_FILE;
+	file->fs = fs;
+	file->ino = ino;
+	file->flags = flags & EXT2_FILE_MASK;
+
+	if (inode) {
+		memcpy(&file->inode, inode, sizeof(struct ext2_inode));
+	} else {
+		retval = ext2fs_read_inode(fs, ino, &file->inode);
+		if (retval)
+			goto fail;
+	}
+
+	retval = ext2fs_get_array(3, fs->blocksize, &file->buf);
+	if (retval)
+		goto fail;
+
+	*ret = file;
+	return 0;
+
+fail:
+	if (file->buf)
+		ext2fs_free_mem(&file->buf);
+	ext2fs_free_mem(&file);
+	return retval;
+}
+
+errcode_t ext2fs_file_open(ext2_filsys fs, ext2_ino_t ino,
+			   int flags, ext2_file_t *ret)
+{
+	return ext2fs_file_open2(fs, ino, NULL, flags, ret);
+}
+
+/*
+ * This function returns the filesystem handle of a file from the structure
+ */
+ext2_filsys ext2fs_file_get_fs(ext2_file_t file)
+{
+	if (file->magic != EXT2_ET_MAGIC_EXT2_FILE)
+		return 0;
+	return file->fs;
+}
+
+/*
+ * This function returns the pointer to the inode of a file from the structure
+ */
+struct ext2_inode *ext2fs_file_get_inode(ext2_file_t file)
+{
+	if (file->magic != EXT2_ET_MAGIC_EXT2_FILE)
+		return NULL;
+	return &file->inode;
+}
+
+/* This function returns the inode number from the structure */
+ext2_ino_t ext2fs_file_get_inode_num(ext2_file_t file)
+{
+	if (file->magic != EXT2_ET_MAGIC_EXT2_FILE)
+		return 0;
+	return file->ino;
+}
+
+/*
+ * This function flushes the dirty block buffer out to disk if
+ * necessary.
+ */
+errcode_t ext2fs_file_flush(ext2_file_t file)
+{
+	errcode_t	retval;
+	ext2_filsys fs;
+	int		ret_flags;
+	blk64_t		dontcare;
+
+	EXT2_CHECK_MAGIC(file, EXT2_ET_MAGIC_EXT2_FILE);
+	fs = file->fs;
+
+	if (!(file->flags & EXT2_FILE_BUF_VALID) ||
+	    !(file->flags & EXT2_FILE_BUF_DIRTY))
+		return 0;
+
+	/* Is this an uninit block? */
+	if (file->physblock && file->inode.i_flags & EXT4_EXTENTS_FL) {
+		retval = ext2fs_bmap2(fs, file->ino, &file->inode, BMAP_BUFFER,
+				      0, file->blockno, &ret_flags, &dontcare);
+		if (retval)
+			return retval;
+		if (ret_flags & BMAP_RET_UNINIT) {
+			retval = ext2fs_bmap2(fs, file->ino, &file->inode,
+					      BMAP_BUFFER, BMAP_SET,
+					      file->blockno, 0,
+					      &file->physblock);
+			if (retval)
+				return retval;
+		}
+	}
+
+	/*
+	 * OK, the physical block hasn't been allocated yet.
+	 * Allocate it.
+	 */
+	if (!file->physblock) {
+		retval = ext2fs_bmap2(fs, file->ino, &file->inode,
+				     BMAP_BUFFER, file->ino ? BMAP_ALLOC : 0,
+				     file->blockno, 0, &file->physblock);
+		if (retval)
+			return retval;
+	}
+
+	retval = io_channel_write_blk64(fs->io, file->physblock, 1, file->buf);
+	if (retval)
+		return retval;
+
+	file->flags &= ~EXT2_FILE_BUF_DIRTY;
+
+	return retval;
+}
+
+/*
+ * This function synchronizes the file's block buffer and the current
+ * file position, possibly invalidating block buffer if necessary
+ */
+static errcode_t sync_buffer_position(ext2_file_t file)
+{
+	blk64_t	b;
+	errcode_t	retval;
+
+	b = file->pos / file->fs->blocksize;
+	if (b != file->blockno) {
+		retval = ext2fs_file_flush(file);
+		if (retval)
+			return retval;
+		file->flags &= ~EXT2_FILE_BUF_VALID;
+	}
+	file->blockno = b;
+	return 0;
+}
+
+/*
+ * This function loads the file's block buffer with valid data from
+ * the disk as necessary.
+ *
+ * If dontfill is true, then skip initializing the buffer since we're
+ * going to be replacing its entire contents anyway.  If set, then the
+ * function basically only sets file->physblock and EXT2_FILE_BUF_VALID
+ */
+#define DONTFILL 1
+static errcode_t load_buffer(ext2_file_t file, int dontfill)
+{
+	ext2_filsys	fs = file->fs;
+	errcode_t	retval;
+	int		ret_flags;
+
+	if (!(file->flags & EXT2_FILE_BUF_VALID)) {
+		retval = ext2fs_bmap2(fs, file->ino, &file->inode,
+				     BMAP_BUFFER, 0, file->blockno, &ret_flags,
+				     &file->physblock);
+		if (retval)
+			return retval;
+		if (!dontfill) {
+			if (file->physblock &&
+			    !(ret_flags & BMAP_RET_UNINIT)) {
+				retval = io_channel_read_blk64(fs->io,
+							       file->physblock,
+							       1, file->buf);
+				if (retval)
+					return retval;
+			} else
+				memset(file->buf, 0, fs->blocksize);
+		}
+		file->flags |= EXT2_FILE_BUF_VALID;
+	}
+	return 0;
+}
+
+
+errcode_t ext2fs_file_close(ext2_file_t file)
+{
+	errcode_t	retval;
+
+	EXT2_CHECK_MAGIC(file, EXT2_ET_MAGIC_EXT2_FILE);
+
+	retval = ext2fs_file_flush(file);
+
+	if (file->buf)
+		ext2fs_free_mem(&file->buf);
+	ext2fs_free_mem(&file);
+
+	return retval;
+}
+
+
+static errcode_t
+ext2fs_file_read_inline_data(ext2_file_t file, void *buf,
+			     unsigned int wanted, unsigned int *got)
+{
+	ext2_filsys fs;
+	errcode_t retval;
+	unsigned int count = 0;
+	size_t size;
+
+	fs = file->fs;
+	retval = ext2fs_inline_data_get(fs, file->ino, &file->inode,
+					file->buf, &size);
+	if (retval)
+		return retval;
+
+	if (file->pos >= size)
+		goto out;
+
+	count = size - file->pos;
+	if (count > wanted)
+		count = wanted;
+	memcpy(buf, file->buf + file->pos, count);
+	file->pos += count;
+	buf = (char *) buf + count;
+
+out:
+	if (got)
+		*got = count;
+	return retval;
+}
+
+
+errcode_t ext2fs_file_read(ext2_file_t file, void *buf,
+			   unsigned int wanted, unsigned int *got)
+{
+	ext2_filsys	fs;
+	errcode_t	retval = 0;
+	unsigned int	start, c, count = 0;
+	__u64		left;
+	char		*ptr = (char *) buf;
+
+	EXT2_CHECK_MAGIC(file, EXT2_ET_MAGIC_EXT2_FILE);
+	fs = file->fs;
+
+	/* If an inode has inline data, things get complicated. */
+	if (file->inode.i_flags & EXT4_INLINE_DATA_FL)
+		return ext2fs_file_read_inline_data(file, buf, wanted, got);
+
+	while ((file->pos < EXT2_I_SIZE(&file->inode)) && (wanted > 0)) {
+		retval = sync_buffer_position(file);
+		if (retval)
+			goto fail;
+		retval = load_buffer(file, 0);
+		if (retval)
+			goto fail;
+
+		start = file->pos % fs->blocksize;
+		c = fs->blocksize - start;
+		if (c > wanted)
+			c = wanted;
+		left = EXT2_I_SIZE(&file->inode) - file->pos ;
+		if (c > left)
+			c = left;
+
+		memcpy(ptr, file->buf+start, c);
+		file->pos += c;
+		ptr += c;
+		count += c;
+		wanted -= c;
+	}
+
+fail:
+	if (got)
+		*got = count;
+	return retval;
+}
+
+
+static errcode_t
+ext2fs_file_write_inline_data(ext2_file_t file, const void *buf,
+			      unsigned int nbytes, unsigned int *written)
+{
+	ext2_filsys fs;
+	errcode_t retval;
+	unsigned int count = 0;
+	size_t size;
+
+	fs = file->fs;
+	retval = ext2fs_inline_data_get(fs, file->ino, &file->inode,
+					file->buf, &size);
+	if (retval)
+		return retval;
+
+	if (file->pos < size) {
+		count = nbytes - file->pos;
+		memcpy(file->buf + file->pos, buf, count);
+
+		retval = ext2fs_inline_data_set(fs, file->ino, &file->inode,
+						file->buf, count);
+		if (retval == EXT2_ET_INLINE_DATA_NO_SPACE)
+			goto expand;
+		if (retval)
+			return retval;
+
+		file->pos += count;
+
+		/* Update inode size */
+		if (count != 0 && EXT2_I_SIZE(&file->inode) < file->pos) {
+			errcode_t	rc;
+
+			rc = ext2fs_file_set_size2(file, file->pos);
+			if (retval == 0)
+				retval = rc;
+		}
+
+		if (written)
+			*written = count;
+		return 0;
+	}
+
+expand:
+	retval = ext2fs_inline_data_expand(fs, file->ino);
+	if (retval)
+		return retval;
+	/*
+	 * reload inode and return no space error
+	 *
+	 * XXX: file->inode could be copied from the outside
+	 * in ext2fs_file_open2().  We have no way to modify
+	 * the outside inode.
+	 */
+	retval = ext2fs_read_inode(fs, file->ino, &file->inode);
+	if (retval)
+		return retval;
+	return EXT2_ET_INLINE_DATA_NO_SPACE;
+}
+
+
+errcode_t ext2fs_file_write(ext2_file_t file, const void *buf,
+			    unsigned int nbytes, unsigned int *written)
+{
+	ext2_filsys	fs;
+	errcode_t	retval = 0;
+	unsigned int	start, c, count = 0;
+	const char	*ptr = (const char *) buf;
+	block_entry_t	new_block = NULL, old_block = NULL;
+	int		bmap_flags = 0;
+
+	EXT2_CHECK_MAGIC(file, EXT2_ET_MAGIC_EXT2_FILE);
+	fs = file->fs;
+
+	if (!(file->flags & EXT2_FILE_WRITE))
+		return EXT2_ET_FILE_RO;
+
+	/* If an inode has inline data, things get complicated. */
+	if (file->inode.i_flags & EXT4_INLINE_DATA_FL) {
+		retval = ext2fs_file_write_inline_data(file, buf, nbytes,
+						       written);
+		if (retval != EXT2_ET_INLINE_DATA_NO_SPACE)
+			return retval;
+		/* fall through to read data from the block */
+		retval = 0;
+	}
+
+	while (nbytes > 0) {
+		retval = sync_buffer_position(file);
+		if (retval)
+			goto fail;
+
+		start = file->pos % fs->blocksize;
+		c = fs->blocksize - start;
+		if (c > nbytes)
+			c = nbytes;
+
+		/*
+		 * We only need to do a read-modify-update cycle if
+		 * we're doing a partial write.
+		 */
+		retval = load_buffer(file, (c == fs->blocksize));
+		if (retval)
+			goto fail;
+
+		file->flags |= EXT2_FILE_BUF_DIRTY;
+		memcpy(file->buf+start, ptr, c);
+
+		/*
+		 * OK, the physical block hasn't been allocated yet.
+		 * Allocate it.
+		 */
+		if (!file->physblock) {
+			bmap_flags = (file->ino ? BMAP_ALLOC : 0);
+			if (fs->flags & EXT2_FLAG_SHARE_DUP) {
+				new_block = calloc(1, sizeof(*new_block));
+				if (!new_block) {
+					retval = EXT2_ET_NO_MEMORY;
+					goto fail;
+				}
+				ext2fs_sha512((const unsigned char*)file->buf,
+						fs->blocksize, new_block->sha);
+				old_block = ext2fs_hashmap_lookup(
+							fs->block_sha_map,
+							new_block->sha,
+							sizeof(new_block->sha));
+			}
+
+			if (old_block) {
+				file->physblock = old_block->physblock;
+				bmap_flags |= BMAP_SET;
+				free(new_block);
+				new_block = NULL;
+			}
+
+			retval = ext2fs_bmap2(fs, file->ino, &file->inode,
+					      BMAP_BUFFER,
+					      bmap_flags,
+					      file->blockno, 0,
+					      &file->physblock);
+			if (retval) {
+				free(new_block);
+				new_block = NULL;
+				goto fail;
+			}
+
+			if (new_block) {
+				new_block->physblock = file->physblock;
+				int ret = ext2fs_hashmap_add(fs->block_sha_map,
+						new_block, new_block->sha,
+						sizeof(new_block->sha));
+				if (ret) {
+					retval = EXT2_ET_NO_MEMORY;
+					free(new_block);
+					goto fail;
+				}
+			}
+
+			if (bmap_flags & BMAP_SET) {
+				ext2fs_iblk_add_blocks(fs, &file->inode, 1);
+				ext2fs_write_inode(fs, file->ino, &file->inode);
+			}
+		}
+
+		file->pos += c;
+		ptr += c;
+		count += c;
+		nbytes -= c;
+	}
+
+fail:
+	/* Update inode size */
+	if (count != 0 && EXT2_I_SIZE(&file->inode) < file->pos) {
+		errcode_t	rc;
+
+		rc = ext2fs_file_set_size2(file, file->pos);
+		if (retval == 0)
+			retval = rc;
+	}
+
+	if (written)
+		*written = count;
+	return retval;
+}
+
+errcode_t ext2fs_file_llseek(ext2_file_t file, __u64 offset,
+			    int whence, __u64 *ret_pos)
+{
+	EXT2_CHECK_MAGIC(file, EXT2_ET_MAGIC_EXT2_FILE);
+
+	if (whence == EXT2_SEEK_SET)
+		file->pos = offset;
+	else if (whence == EXT2_SEEK_CUR)
+		file->pos += offset;
+	else if (whence == EXT2_SEEK_END)
+		file->pos = EXT2_I_SIZE(&file->inode) + offset;
+	else
+		return EXT2_ET_INVALID_ARGUMENT;
+
+	if (ret_pos)
+		*ret_pos = file->pos;
+
+	return 0;
+}
+
+errcode_t ext2fs_file_lseek(ext2_file_t file, ext2_off_t offset,
+			    int whence, ext2_off_t *ret_pos)
+{
+	__u64		loffset, ret_loffset = 0;
+	errcode_t	retval;
+
+	loffset = offset;
+	retval = ext2fs_file_llseek(file, loffset, whence, &ret_loffset);
+	if (ret_pos)
+		*ret_pos = (ext2_off_t) ret_loffset;
+	return retval;
+}
+
+
+/*
+ * This function returns the size of the file, according to the inode
+ */
+errcode_t ext2fs_file_get_lsize(ext2_file_t file, __u64 *ret_size)
+{
+	if (file->magic != EXT2_ET_MAGIC_EXT2_FILE)
+		return EXT2_ET_MAGIC_EXT2_FILE;
+	*ret_size = EXT2_I_SIZE(&file->inode);
+	return 0;
+}
+
+/*
+ * This function returns the size of the file, according to the inode
+ */
+ext2_off_t ext2fs_file_get_size(ext2_file_t file)
+{
+	__u64	size;
+
+	if (ext2fs_file_get_lsize(file, &size))
+		return 0;
+	if ((size >> 32) != 0)
+		return 0;
+	return size;
+}
+
+/* Zero the parts of the last block that are past EOF. */
+static errcode_t ext2fs_file_zero_past_offset(ext2_file_t file,
+					      ext2_off64_t offset)
+{
+	ext2_filsys fs = file->fs;
+	char *b = NULL;
+	ext2_off64_t off = offset % fs->blocksize;
+	blk64_t blk;
+	int ret_flags;
+	errcode_t retval;
+
+	if (off == 0)
+		return 0;
+
+	retval = sync_buffer_position(file);
+	if (retval)
+		return retval;
+
+	/* Is there an initialized block at the end? */
+	retval = ext2fs_bmap2(fs, file->ino, NULL, NULL, 0,
+			      offset / fs->blocksize, &ret_flags, &blk);
+	if (retval)
+		return retval;
+	if ((blk == 0) || (ret_flags & BMAP_RET_UNINIT))
+		return 0;
+
+	/* Zero to the end of the block */
+	retval = ext2fs_get_mem(fs->blocksize, &b);
+	if (retval)
+		return retval;
+
+	/* Read/zero/write block */
+	retval = io_channel_read_blk64(fs->io, blk, 1, b);
+	if (retval)
+		goto out;
+
+	memset(b + off, 0, fs->blocksize - off);
+
+	retval = io_channel_write_blk64(fs->io, blk, 1, b);
+	if (retval)
+		goto out;
+
+out:
+	ext2fs_free_mem(&b);
+	return retval;
+}
+
+/*
+ * This function sets the size of the file, truncating it if necessary
+ *
+ */
+errcode_t ext2fs_file_set_size2(ext2_file_t file, ext2_off64_t size)
+{
+	ext2_off64_t	old_size;
+	errcode_t	retval;
+	blk64_t		old_truncate, truncate_block;
+
+	EXT2_CHECK_MAGIC(file, EXT2_ET_MAGIC_EXT2_FILE);
+
+	if (size && ext2fs_file_block_offset_too_big(file->fs, &file->inode,
+					(size - 1) / file->fs->blocksize))
+		return EXT2_ET_FILE_TOO_BIG;
+	truncate_block = ((size + file->fs->blocksize - 1) >>
+			  EXT2_BLOCK_SIZE_BITS(file->fs->super));
+	old_size = EXT2_I_SIZE(&file->inode);
+	old_truncate = ((old_size + file->fs->blocksize - 1) >>
+		      EXT2_BLOCK_SIZE_BITS(file->fs->super));
+
+	retval = ext2fs_inode_size_set(file->fs, &file->inode, size);
+	if (retval)
+		return retval;
+
+	if (file->ino) {
+		retval = ext2fs_write_inode(file->fs, file->ino, &file->inode);
+		if (retval)
+			return retval;
+	}
+
+	retval = ext2fs_file_zero_past_offset(file, size);
+	if (retval)
+		return retval;
+
+	if (truncate_block >= old_truncate)
+		return 0;
+
+	return ext2fs_punch(file->fs, file->ino, &file->inode, 0,
+			    truncate_block, ~0ULL);
+}
+
+errcode_t ext2fs_file_set_size(ext2_file_t file, ext2_off_t size)
+{
+	return ext2fs_file_set_size2(file, size);
+}
diff --git a/lib/ext2fs/finddev.c b/lib/ext2fs/finddev.c
new file mode 100644
index 0000000..cd85ef5
--- /dev/null
+++ b/lib/ext2fs/finddev.c
@@ -0,0 +1,218 @@
+/*
+ * finddev.c -- this routine attempts to find a particular device in
+ * 	/dev
+ *
+ * Copyright (C) 2000 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <stdlib.h>
+#include <string.h>
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#include <dirent.h>
+#if HAVE_ERRNO_H
+#include <errno.h>
+#endif
+#if HAVE_SYS_MKDEV_H
+#include <sys/mkdev.h>
+#endif
+#ifdef HAVE_SYS_SYSMACROS_H
+#include <sys/sysmacros.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+#include "ext2fsP.h"
+
+struct dir_list {
+	char	*name;
+	struct dir_list *next;
+};
+
+/*
+ * This function adds an entry to the directory list
+ */
+static void add_to_dirlist(const char *name, struct dir_list **list)
+{
+	struct dir_list *dp;
+
+	dp = malloc(sizeof(struct dir_list));
+	if (!dp)
+		return;
+	dp->name = malloc(strlen(name)+1);
+	if (!dp->name) {
+		free(dp);
+		return;
+	}
+	strcpy(dp->name, name);
+	dp->next = *list;
+	*list = dp;
+}
+
+/*
+ * This function frees a directory list
+ */
+static void free_dirlist(struct dir_list **list)
+{
+	struct dir_list *dp, *next;
+
+	for (dp = *list; dp; dp = next) {
+		next = dp->next;
+		free(dp->name);
+		free(dp);
+	}
+	*list = 0;
+}
+
+static int scan_dir(char *dirname, dev_t device, struct dir_list **list,
+		    char **ret_path)
+{
+	DIR	*dir;
+	struct dirent *dp;
+	char	path[1024], *cp;
+	int	dirlen;
+	struct stat st;
+
+	dirlen = strlen(dirname);
+	if ((dir = opendir(dirname)) == NULL)
+		return errno;
+	dp = readdir(dir);
+	while (dp) {
+		if (dirlen + strlen(dp->d_name) + 2 >= sizeof(path))
+			goto skip_to_next;
+		if (dp->d_name[0] == '.' &&
+		    ((dp->d_name[1] == 0) ||
+		     ((dp->d_name[1] == '.') && (dp->d_name[2] == 0))))
+			goto skip_to_next;
+		sprintf(path, "%s/%s", dirname, dp->d_name);
+		if (stat(path, &st) < 0)
+			goto skip_to_next;
+		if (S_ISDIR(st.st_mode))
+			add_to_dirlist(path, list);
+		if (ext2fsP_is_disk_device(st.st_mode) &&
+		    st.st_rdev == device) {
+			cp = malloc(strlen(path)+1);
+			if (!cp) {
+				closedir(dir);
+				return ENOMEM;
+			}
+			strcpy(cp, path);
+			*ret_path = cp;
+			goto success;
+		}
+	skip_to_next:
+		dp = readdir(dir);
+	}
+success:
+	closedir(dir);
+	return 0;
+}
+
+/*
+ * This function finds the pathname to a block device with a given
+ * device number.  It returns a pointer to allocated memory to the
+ * pathname on success, and NULL on failure.
+ */
+char *ext2fs_find_block_device(dev_t device)
+{
+	struct dir_list *list = 0, *new_list = 0;
+	struct dir_list *current;
+	char	*ret_path = 0;
+	int    level = 0;
+
+	/*
+	 * Add the starting directories to search...
+	 */
+	add_to_dirlist("/devices", &list);
+	add_to_dirlist("/devfs", &list);
+	add_to_dirlist("/dev", &list);
+
+	while (list) {
+		current = list;
+		list = list->next;
+#ifdef DEBUG
+		printf("Scanning directory %s\n", current->name);
+#endif
+		scan_dir(current->name, device, &new_list, &ret_path);
+		free(current->name);
+		free(current);
+		if (ret_path)
+			break;
+		/*
+		 * If we're done checking at this level, descend to
+		 * the next level of subdirectories. (breadth-first)
+		 */
+		if (list == 0) {
+			list = new_list;
+			new_list = 0;
+			/* Avoid infinite loop */
+			if (++level >= EXT2FS_MAX_NESTED_LINKS)
+				break;
+		}
+	}
+	free_dirlist(&list);
+	free_dirlist(&new_list);
+	return ret_path;
+}
+
+
+#ifdef DEBUG
+int main(int argc, char** argv)
+{
+	char	*devname, *tmp;
+	int	major, minor;
+	dev_t	device;
+	const char *errmsg = "Couldn't parse %s: %s\n";
+
+	if ((argc != 2) && (argc != 3)) {
+		fprintf(stderr, "Usage: %s device_number\n", argv[0]);
+		fprintf(stderr, "\t: %s major minor\n", argv[0]);
+		exit(1);
+	}
+	if (argc == 2) {
+		device = strtoul(argv[1], &tmp, 0);
+		if (*tmp) {
+			fprintf(stderr, errmsg, "device number", argv[1]);
+			exit(1);
+		}
+	} else {
+		major = strtoul(argv[1], &tmp, 0);
+		if (*tmp) {
+			fprintf(stderr, errmsg, "major number", argv[1]);
+			exit(1);
+		}
+		minor = strtoul(argv[2], &tmp, 0);
+		if (*tmp) {
+			fprintf(stderr, errmsg, "minor number", argv[2]);
+			exit(1);
+		}
+		device = makedev(major, minor);
+		printf("Looking for device 0x%04x (%d:%d)\n", device,
+		       major, minor);
+	}
+	devname = ext2fs_find_block_device(device);
+	if (devname) {
+		printf("Found device!  %s\n", devname);
+		free(devname);
+	} else {
+		printf("Couldn't find device.\n");
+	}
+	return 0;
+}
+
+#endif
diff --git a/lib/ext2fs/flushb.c b/lib/ext2fs/flushb.c
new file mode 100644
index 0000000..bb7daf4
--- /dev/null
+++ b/lib/ext2fs/flushb.c
@@ -0,0 +1,88 @@
+/*
+ * flushb.c --- Hides system-dependent information for both syncing a
+ * 	device to disk and to flush any buffers from disk cache.
+ *
+ * Copyright (C) 2000 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#if HAVE_ERRNO_H
+#include <errno.h>
+#endif
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#if HAVE_SYS_IOCTL_H
+#include <sys/ioctl.h>
+#endif
+#if HAVE_SYS_MOUNT_H
+#include <sys/param.h>
+#include <sys/mount.h>		/* This may define BLKFLSBUF */
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+/*
+ * For Linux, define BLKFLSBUF and FDFLUSH if necessary, since
+ * not all portable header file does so for us.  This really should be
+ * fixed in the glibc header files.  (Recent glibcs appear to define
+ * BLKFLSBUF in sys/mount.h, but FDFLUSH still doesn't seem to be
+ * defined anywhere portable.)  Until then....
+ */
+#ifdef __linux__
+#ifndef BLKFLSBUF
+#define BLKFLSBUF	_IO(0x12,97)	/* flush buffer cache */
+#endif
+#ifndef FDFLUSH
+#define FDFLUSH		_IO(2,0x4b)	/* flush floppy disk */
+#endif
+#endif
+
+/*
+ * This function will sync a device/file, and optionally attempt to
+ * flush the buffer cache.  The latter is basically only useful for
+ * system benchmarks and for torturing systems in burn-in tests.  :)
+ */
+errcode_t ext2fs_sync_device(int fd, int flushb)
+{
+	/*
+	 * We always sync the device in case we're running on old
+	 * kernels for which we can lose data if we don't.  (There
+	 * still is a race condition for those kernels, but this
+	 * reduces it greatly.)
+	 */
+#if defined(HAVE_FSYNC)
+	if (fsync (fd) == -1)
+		return errno;
+#endif
+
+	if (flushb) {
+		errcode_t	retval = 0;
+
+#ifdef BLKFLSBUF
+		if (ioctl (fd, BLKFLSBUF, 0) == 0)
+			return 0;
+		retval = errno;
+#elif defined(__linux__)
+#warning BLKFLSBUF not defined
+#endif
+#ifdef FDFLUSH
+		/* In case this is a floppy */
+		if (ioctl(fd, FDFLUSH, 0) == 0)
+			return 0;
+		if (retval == 0)
+			retval = errno;
+#elif defined(__linux__)
+#warning FDFLUSH not defined
+#endif
+		return retval;
+	}
+	return 0;
+}
diff --git a/lib/ext2fs/freefs.c b/lib/ext2fs/freefs.c
new file mode 100644
index 0000000..68b8e9a
--- /dev/null
+++ b/lib/ext2fs/freefs.c
@@ -0,0 +1,108 @@
+/*
+ * freefs.c --- free an ext2 filesystem
+ *
+ * Copyright (C) 1993, 1994, 1995, 1996 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fsP.h"
+#include "hashmap.h"
+
+void ext2fs_free(ext2_filsys fs)
+{
+	if (!fs || (fs->magic != EXT2_ET_MAGIC_EXT2FS_FILSYS))
+		return;
+	if (fs->image_io != fs->io) {
+		if (fs->image_io)
+			io_channel_close(fs->image_io);
+	}
+	if (fs->io) {
+		io_channel_close(fs->io);
+	}
+	if (fs->device_name)
+		ext2fs_free_mem(&fs->device_name);
+	if (fs->super)
+		ext2fs_free_mem(&fs->super);
+	if (fs->orig_super)
+		ext2fs_free_mem(&fs->orig_super);
+	if (fs->group_desc)
+		ext2fs_free_mem(&fs->group_desc);
+	if (fs->block_map)
+		ext2fs_free_block_bitmap(fs->block_map);
+	if (fs->inode_map)
+		ext2fs_free_inode_bitmap(fs->inode_map);
+	if (fs->image_header)
+		ext2fs_free_mem(&fs->image_header);
+
+	if (fs->badblocks)
+		ext2fs_badblocks_list_free(fs->badblocks);
+	fs->badblocks = 0;
+
+	if (fs->dblist)
+		ext2fs_free_dblist(fs->dblist);
+
+	if (fs->icache)
+		ext2fs_free_inode_cache(fs->icache);
+
+	if (fs->mmp_buf)
+		ext2fs_free_mem(&fs->mmp_buf);
+	if (fs->mmp_cmp)
+		ext2fs_free_mem(&fs->mmp_cmp);
+
+	if (fs->block_sha_map)
+		ext2fs_hashmap_free(fs->block_sha_map);
+
+	fs->magic = 0;
+
+	ext2fs_zero_blocks2(NULL, 0, 0, NULL, NULL);
+	ext2fs_free_mem(&fs);
+}
+
+/*
+ * This procedure frees a badblocks list.
+ */
+void ext2fs_u32_list_free(ext2_u32_list bb)
+{
+	if (bb->magic != EXT2_ET_MAGIC_BADBLOCKS_LIST)
+		return;
+
+	if (bb->list)
+		ext2fs_free_mem(&bb->list);
+	bb->list = 0;
+	ext2fs_free_mem(&bb);
+}
+
+void ext2fs_badblocks_list_free(ext2_badblocks_list bb)
+{
+	ext2fs_u32_list_free((ext2_u32_list) bb);
+}
+
+
+/*
+ * Free a directory block list
+ */
+void ext2fs_free_dblist(ext2_dblist dblist)
+{
+	if (!dblist || (dblist->magic != EXT2_ET_MAGIC_DBLIST))
+		return;
+
+	if (dblist->list)
+		ext2fs_free_mem(&dblist->list);
+	dblist->list = 0;
+	if (dblist->fs && dblist->fs->dblist == dblist)
+		dblist->fs->dblist = 0;
+	dblist->magic = 0;
+	ext2fs_free_mem(&dblist);
+}
+
diff --git a/lib/ext2fs/gen_bitmap.c b/lib/ext2fs/gen_bitmap.c
new file mode 100644
index 0000000..1536d4b
--- /dev/null
+++ b/lib/ext2fs/gen_bitmap.c
@@ -0,0 +1,650 @@
+/*
+ * gen_bitmap.c --- Generic (32-bit) bitmap routines
+ *
+ * Copyright (C) 2001 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fsP.h"
+
+struct ext2fs_struct_generic_bitmap_32 {
+	errcode_t	magic;
+	ext2_filsys 	fs;
+	__u32		start, end;
+	__u32		real_end;
+	char	*	description;
+	char	*	bitmap;
+	errcode_t	base_error_code;
+	__u32		reserved[7];
+};
+
+typedef struct ext2fs_struct_generic_bitmap_32 *ext2fs_generic_bitmap_32;
+
+#define EXT2FS_IS_32_BITMAP(bmap) \
+	(((bmap)->magic == EXT2_ET_MAGIC_GENERIC_BITMAP) || \
+	 ((bmap)->magic == EXT2_ET_MAGIC_BLOCK_BITMAP) || \
+	 ((bmap)->magic == EXT2_ET_MAGIC_INODE_BITMAP))
+
+#define EXT2FS_IS_64_BITMAP(bmap) \
+	(((bmap)->magic == EXT2_ET_MAGIC_GENERIC_BITMAP64) || \
+	 ((bmap)->magic == EXT2_ET_MAGIC_BLOCK_BITMAP64) || \
+	 ((bmap)->magic == EXT2_ET_MAGIC_INODE_BITMAP64))
+
+/*
+ * Used by previously inlined function, so we have to export this and
+ * not change the function signature
+ */
+void ext2fs_warn_bitmap2(ext2fs_generic_bitmap gen_bitmap,
+			    int code, unsigned long arg)
+{
+	ext2fs_generic_bitmap_32 bitmap = (ext2fs_generic_bitmap_32) gen_bitmap;
+
+#ifndef OMIT_COM_ERR
+	if (bitmap->description)
+		com_err(0, bitmap->base_error_code+code,
+			"#%lu for %s", arg, bitmap->description);
+	else
+		com_err(0, bitmap->base_error_code + code, "#%lu", arg);
+#endif
+}
+
+static errcode_t check_magic(ext2fs_generic_bitmap bitmap)
+{
+	if (!bitmap || !((bitmap->magic == EXT2_ET_MAGIC_GENERIC_BITMAP) ||
+			 (bitmap->magic == EXT2_ET_MAGIC_INODE_BITMAP) ||
+			 (bitmap->magic == EXT2_ET_MAGIC_BLOCK_BITMAP)))
+		return EXT2_ET_MAGIC_GENERIC_BITMAP;
+	return 0;
+}
+
+errcode_t ext2fs_make_generic_bitmap(errcode_t magic, ext2_filsys fs,
+				     __u32 start, __u32 end, __u32 real_end,
+				     const char *descr, char *init_map,
+				     ext2fs_generic_bitmap *ret)
+{
+	ext2fs_generic_bitmap_32 bitmap;
+	errcode_t		retval;
+	size_t			size;
+
+	retval = ext2fs_get_mem(sizeof(struct ext2fs_struct_generic_bitmap_32),
+				&bitmap);
+	if (retval)
+		return retval;
+
+	bitmap->magic = magic;
+	bitmap->fs = fs;
+	bitmap->start = start;
+	bitmap->end = end;
+	bitmap->real_end = real_end;
+	switch (magic) {
+	case EXT2_ET_MAGIC_INODE_BITMAP:
+		bitmap->base_error_code = EXT2_ET_BAD_INODE_MARK;
+		break;
+	case EXT2_ET_MAGIC_BLOCK_BITMAP:
+		bitmap->base_error_code = EXT2_ET_BAD_BLOCK_MARK;
+		break;
+	default:
+		bitmap->base_error_code = EXT2_ET_BAD_GENERIC_MARK;
+	}
+	if (descr) {
+		retval = ext2fs_get_mem(strlen(descr)+1, &bitmap->description);
+		if (retval) {
+			ext2fs_free_mem(&bitmap);
+			return retval;
+		}
+		strcpy(bitmap->description, descr);
+	} else
+		bitmap->description = 0;
+
+	size = (size_t) (((bitmap->real_end - bitmap->start) / 8) + 1);
+	/* Round up to allow for the BT x86 instruction */
+	size = (size + 7) & ~3;
+	retval = ext2fs_get_mem(size, &bitmap->bitmap);
+	if (retval) {
+		ext2fs_free_mem(&bitmap->description);
+		ext2fs_free_mem(&bitmap);
+		return retval;
+	}
+
+	if (init_map)
+		memcpy(bitmap->bitmap, init_map, size);
+	else
+		memset(bitmap->bitmap, 0, size);
+	*ret = (ext2fs_generic_bitmap) bitmap;
+	return 0;
+}
+
+errcode_t ext2fs_allocate_generic_bitmap(__u32 start,
+					 __u32 end,
+					 __u32 real_end,
+					 const char *descr,
+					 ext2fs_generic_bitmap *ret)
+{
+	return ext2fs_make_generic_bitmap(EXT2_ET_MAGIC_GENERIC_BITMAP, 0,
+					  start, end, real_end, descr, 0, ret);
+}
+
+errcode_t ext2fs_copy_generic_bitmap(ext2fs_generic_bitmap gen_src,
+				     ext2fs_generic_bitmap *dest)
+{
+	ext2fs_generic_bitmap_32 src = (ext2fs_generic_bitmap_32) gen_src;
+
+	return (ext2fs_make_generic_bitmap(src->magic, src->fs,
+					   src->start, src->end,
+					   src->real_end,
+					   src->description, src->bitmap,
+					   dest));
+}
+
+void ext2fs_free_generic_bitmap(ext2fs_inode_bitmap gen_bitmap)
+{
+	ext2fs_generic_bitmap_32 bitmap = (ext2fs_generic_bitmap_32) gen_bitmap;
+
+	if (check_magic(gen_bitmap))
+		return;
+
+	bitmap->magic = 0;
+	if (bitmap->description) {
+		ext2fs_free_mem(&bitmap->description);
+		bitmap->description = 0;
+	}
+	if (bitmap->bitmap) {
+		ext2fs_free_mem(&bitmap->bitmap);
+		bitmap->bitmap = 0;
+	}
+	ext2fs_free_mem(&bitmap);
+}
+
+int ext2fs_test_generic_bitmap(ext2fs_generic_bitmap bitmap,
+					blk_t bitno)
+{
+	ext2fs_generic_bitmap_32 bitmap32 = (ext2fs_generic_bitmap_32) bitmap;
+
+	if (!EXT2FS_IS_32_BITMAP(bitmap)) {
+		if (EXT2FS_IS_64_BITMAP(bitmap)) {
+			ext2fs_warn_bitmap32(bitmap, __func__);
+			return ext2fs_test_generic_bmap(bitmap, bitno);
+		}
+#ifndef OMIT_COM_ERR
+		com_err(0, EXT2_ET_MAGIC_GENERIC_BITMAP,
+			"test_bitmap(%lu)", (unsigned long) bitno);
+#endif
+		return 0;
+	}
+
+	if ((bitno < bitmap32->start) || (bitno > bitmap32->end)) {
+		ext2fs_warn_bitmap2(bitmap, EXT2FS_TEST_ERROR, bitno);
+		return 0;
+	}
+	return ext2fs_test_bit(bitno - bitmap32->start, bitmap32->bitmap);
+}
+
+int ext2fs_mark_generic_bitmap(ext2fs_generic_bitmap bitmap,
+					 __u32 bitno)
+{
+	ext2fs_generic_bitmap_32 bitmap32 = (ext2fs_generic_bitmap_32) bitmap;
+
+	if (!EXT2FS_IS_32_BITMAP(bitmap)) {
+		if (EXT2FS_IS_64_BITMAP(bitmap)) {
+			ext2fs_warn_bitmap32(bitmap, __func__);
+			return ext2fs_mark_generic_bmap(bitmap, bitno);
+		}
+#ifndef OMIT_COM_ERR
+		com_err(0, EXT2_ET_MAGIC_GENERIC_BITMAP,
+			"mark_bitmap(%lu)", (unsigned long) bitno);
+#endif
+		return 0;
+	}
+
+	if ((bitno < bitmap32->start) || (bitno > bitmap32->end)) {
+		ext2fs_warn_bitmap2(bitmap, EXT2FS_MARK_ERROR, bitno);
+		return 0;
+	}
+	return ext2fs_set_bit(bitno - bitmap32->start, bitmap32->bitmap);
+}
+
+int ext2fs_unmark_generic_bitmap(ext2fs_generic_bitmap bitmap,
+					   blk_t bitno)
+{
+	ext2fs_generic_bitmap_32 bitmap32 = (ext2fs_generic_bitmap_32) bitmap;
+
+	if (!EXT2FS_IS_32_BITMAP(bitmap)) {
+		if (EXT2FS_IS_64_BITMAP(bitmap)) {
+			ext2fs_warn_bitmap32(bitmap, __func__);
+			return ext2fs_unmark_generic_bmap(bitmap, bitno);
+		}
+#ifndef OMIT_COM_ERR
+		com_err(0, EXT2_ET_MAGIC_GENERIC_BITMAP,
+			"mark_bitmap(%lu)", (unsigned long) bitno);
+#endif
+		return 0;
+	}
+
+	if ((bitno < bitmap32->start) || (bitno > bitmap32->end)) {
+		ext2fs_warn_bitmap2(bitmap, EXT2FS_UNMARK_ERROR, bitno);
+		return 0;
+	}
+	return ext2fs_clear_bit(bitno - bitmap32->start, bitmap32->bitmap);
+}
+
+__u32 ext2fs_get_generic_bitmap_start(ext2fs_generic_bitmap bitmap)
+{
+	ext2fs_generic_bitmap_32 bitmap32 = (ext2fs_generic_bitmap_32) bitmap;
+
+	if (!EXT2FS_IS_32_BITMAP(bitmap)) {
+		if (EXT2FS_IS_64_BITMAP(bitmap)) {
+			ext2fs_warn_bitmap32(bitmap, __func__);
+			return ext2fs_get_generic_bmap_start(bitmap);
+		}
+#ifndef OMIT_COM_ERR
+		com_err(0, EXT2_ET_MAGIC_GENERIC_BITMAP,
+			"get_bitmap_start");
+#endif
+		return 0;
+	}
+
+	return bitmap32->start;
+}
+
+__u32 ext2fs_get_generic_bitmap_end(ext2fs_generic_bitmap bitmap)
+{
+	ext2fs_generic_bitmap_32 bitmap32 = (ext2fs_generic_bitmap_32) bitmap;
+
+	if (!EXT2FS_IS_32_BITMAP(bitmap)) {
+		if (EXT2FS_IS_64_BITMAP(bitmap)) {
+			ext2fs_warn_bitmap32(bitmap, __func__);
+			return ext2fs_get_generic_bmap_end(bitmap);
+		}
+#ifndef OMIT_COM_ERR
+		com_err(0, EXT2_ET_MAGIC_GENERIC_BITMAP,
+			"get_bitmap_end");
+#endif
+		return 0;
+	}
+	return bitmap32->end;
+}
+
+void ext2fs_clear_generic_bitmap(ext2fs_generic_bitmap bitmap)
+{
+	ext2fs_generic_bitmap_32 bitmap32 = (ext2fs_generic_bitmap_32) bitmap;
+
+	if (!EXT2FS_IS_32_BITMAP(bitmap)) {
+		if (EXT2FS_IS_64_BITMAP(bitmap)) {
+			ext2fs_warn_bitmap32(bitmap, __func__);
+			ext2fs_clear_generic_bmap(bitmap);
+			return;
+		}
+#ifndef OMIT_COM_ERR
+		com_err(0, EXT2_ET_MAGIC_GENERIC_BITMAP,
+			"clear_generic_bitmap");
+#endif
+		return;
+	}
+
+	memset(bitmap32->bitmap, 0,
+	       (size_t) (((bitmap32->real_end - bitmap32->start) / 8) + 1));
+}
+
+errcode_t ext2fs_fudge_generic_bitmap_end(ext2fs_inode_bitmap gen_bitmap,
+					  errcode_t magic, errcode_t neq,
+					  ext2_ino_t end, ext2_ino_t *oend)
+{
+	ext2fs_generic_bitmap_32 bitmap = (ext2fs_generic_bitmap_32) gen_bitmap;
+
+	EXT2_CHECK_MAGIC(bitmap, magic);
+
+	if (end > bitmap->real_end)
+		return neq;
+	if (oend)
+		*oend = bitmap->end;
+	bitmap->end = end;
+	return 0;
+}
+
+errcode_t ext2fs_resize_generic_bitmap(errcode_t magic,
+				       __u32 new_end, __u32 new_real_end,
+				       ext2fs_generic_bitmap gen_bmap)
+{
+	ext2fs_generic_bitmap_32 bmap = (ext2fs_generic_bitmap_32) gen_bmap;
+	errcode_t	retval;
+	size_t		size, new_size;
+	__u32		bitno;
+
+	if (!bmap || (bmap->magic != magic))
+		return magic;
+
+	/*
+	 * If we're expanding the bitmap, make sure all of the new
+	 * parts of the bitmap are zero.
+	 */
+	if (new_end > bmap->end) {
+		bitno = bmap->real_end;
+		if (bitno > new_end)
+			bitno = new_end;
+		for (; bitno > bmap->end; bitno--)
+			ext2fs_clear_bit(bitno - bmap->start, bmap->bitmap);
+	}
+	if (new_real_end == bmap->real_end) {
+		bmap->end = new_end;
+		return 0;
+	}
+
+	size = ((bmap->real_end - bmap->start) / 8) + 1;
+	new_size = ((new_real_end - bmap->start) / 8) + 1;
+
+	if (size != new_size) {
+		retval = ext2fs_resize_mem(size, new_size, &bmap->bitmap);
+		if (retval)
+			return retval;
+	}
+	if (new_size > size)
+		memset(bmap->bitmap + size, 0, new_size - size);
+
+	bmap->end = new_end;
+	bmap->real_end = new_real_end;
+	return 0;
+}
+
+errcode_t ext2fs_compare_generic_bitmap(errcode_t magic, errcode_t neq,
+					ext2fs_generic_bitmap gen_bm1,
+					ext2fs_generic_bitmap gen_bm2)
+{
+	ext2fs_generic_bitmap_32 bm1 = (ext2fs_generic_bitmap_32) gen_bm1;
+	ext2fs_generic_bitmap_32 bm2 = (ext2fs_generic_bitmap_32) gen_bm2;
+	blk_t	i;
+
+	if (!bm1 || bm1->magic != magic)
+		return magic;
+	if (!bm2 || bm2->magic != magic)
+		return magic;
+
+	if ((bm1->start != bm2->start) ||
+	    (bm1->end != bm2->end) ||
+	    (memcmp(bm1->bitmap, bm2->bitmap,
+		    (size_t) (bm1->end - bm1->start)/8)))
+		return neq;
+
+	for (i = bm1->end - ((bm1->end - bm1->start) % 8); i <= bm1->end; i++)
+		if (ext2fs_fast_test_block_bitmap(gen_bm1, i) !=
+		    ext2fs_fast_test_block_bitmap(gen_bm2, i))
+			return neq;
+
+	return 0;
+}
+
+void ext2fs_set_generic_bitmap_padding(ext2fs_generic_bitmap gen_map)
+{
+	ext2fs_generic_bitmap_32 map = (ext2fs_generic_bitmap_32) gen_map;
+	__u32	i, j;
+
+	/* Protect loop from wrap-around if map->real_end is maxed */
+	for (i=map->end+1, j = i - map->start;
+	     i <= map->real_end && i > map->end;
+	     i++, j++)
+		ext2fs_set_bit(j, map->bitmap);
+}
+
+errcode_t ext2fs_get_generic_bitmap_range(ext2fs_generic_bitmap gen_bmap,
+					  errcode_t magic,
+					  __u32 start, __u32 num,
+					  void *out)
+{
+	ext2fs_generic_bitmap_32 bmap = (ext2fs_generic_bitmap_32) gen_bmap;
+
+	if (!bmap || (bmap->magic != magic))
+		return magic;
+
+	if ((start < bmap->start) || (start+num-1 > bmap->real_end))
+		return EXT2_ET_INVALID_ARGUMENT;
+
+	memcpy(out, bmap->bitmap + ((start - bmap->start) >> 3), (num+7) >> 3);
+	return 0;
+}
+
+errcode_t ext2fs_set_generic_bitmap_range(ext2fs_generic_bitmap gen_bmap,
+					  errcode_t magic,
+					  __u32 start, __u32 num,
+					  void *in)
+{
+	ext2fs_generic_bitmap_32 bmap = (ext2fs_generic_bitmap_32) gen_bmap;
+
+	if (!bmap || (bmap->magic != magic))
+		return magic;
+
+	if ((start < bmap->start) || (start+num-1 > bmap->real_end))
+		return EXT2_ET_INVALID_ARGUMENT;
+
+	memcpy(bmap->bitmap + ((start - bmap->start) >> 3), in, (num+7) >> 3);
+	return 0;
+}
+
+/*
+ * Compare @mem to zero buffer by 256 bytes.
+ * Return 1 if @mem is zeroed memory, otherwise return 0.
+ */
+int ext2fs_mem_is_zero(const char *mem, size_t len)
+{
+	static const char zero_buf[256];
+
+	while (len >= sizeof(zero_buf)) {
+		if (memcmp(mem, zero_buf, sizeof(zero_buf)))
+			return 0;
+		len -= sizeof(zero_buf);
+		mem += sizeof(zero_buf);
+	}
+	/* Deal with leftover bytes. */
+	if (len)
+		return !memcmp(mem, zero_buf, len);
+	return 1;
+}
+
+/*
+ * Return true if all of the bits in a specified range are clear
+ */
+static int ext2fs_test_clear_generic_bitmap_range(ext2fs_generic_bitmap gen_bitmap,
+						  unsigned int start,
+						  unsigned int len)
+{
+	ext2fs_generic_bitmap_32 bitmap = (ext2fs_generic_bitmap_32) gen_bitmap;
+	size_t start_byte, len_byte = len >> 3;
+	unsigned int start_bit, len_bit = len % 8;
+	int first_bit = 0;
+	int last_bit  = 0;
+	int mark_count = 0;
+	int mark_bit = 0;
+	int i;
+	const char *ADDR = bitmap->bitmap;
+
+	start -= bitmap->start;
+	start_byte = start >> 3;
+	start_bit = start % 8;
+
+	if (start_bit != 0) {
+		/*
+		 * The compared start block number or start inode number
+		 * is not the first bit in a byte.
+		 */
+		mark_count = 8 - start_bit;
+		if (len < 8 - start_bit) {
+			mark_count = (int)len;
+			mark_bit = len + start_bit - 1;
+		} else
+			mark_bit = 7;
+
+		for (i = mark_count; i > 0; i--, mark_bit--)
+			first_bit |= 1 << mark_bit;
+
+		/*
+		 * Compare blocks or inodes in the first byte.
+		 * If there is any marked bit, this function returns 0.
+		 */
+		if (first_bit & ADDR[start_byte])
+			return 0;
+		else if (len <= 8 - start_bit)
+			return 1;
+
+		start_byte++;
+		len_bit = (len - mark_count) % 8;
+		len_byte = (len - mark_count) >> 3;
+	}
+
+	/*
+	 * The compared start block number or start inode number is
+	 * the first bit in a byte.
+	 */
+	if (len_bit != 0) {
+		/*
+		 * The compared end block number or end inode number is
+		 * not the last bit in a byte.
+		 */
+		for (mark_bit = len_bit - 1; mark_bit >= 0; mark_bit--)
+			last_bit |= 1 << mark_bit;
+
+		/*
+		 * Compare blocks or inodes in the last byte.
+		 * If there is any marked bit, this function returns 0.
+		 */
+		if (last_bit & ADDR[start_byte + len_byte])
+			return 0;
+		else if (len_byte == 0)
+			return 1;
+	}
+
+	/* Check whether all bytes are 0 */
+	return ext2fs_mem_is_zero(ADDR + start_byte, len_byte);
+}
+
+errcode_t ext2fs_find_first_zero_generic_bitmap(ext2fs_generic_bitmap gen_bitmap,
+						__u32 start, __u32 end,
+						__u32 *out)
+{
+	ext2fs_generic_bitmap_32 bitmap = (ext2fs_generic_bitmap_32) gen_bitmap;
+	blk_t b;
+
+	if (start < bitmap->start || end > bitmap->end || start > end) {
+		ext2fs_warn_bitmap2(gen_bitmap, EXT2FS_TEST_ERROR, start);
+		return EINVAL;
+	}
+
+	while (start <= end) {
+		b = ext2fs_test_bit(start - bitmap->start, bitmap->bitmap);
+		if (!b) {
+			*out = start;
+			return 0;
+		}
+		start++;
+	}
+
+	return ENOENT;
+}
+
+errcode_t ext2fs_find_first_set_generic_bitmap(ext2fs_generic_bitmap gen_bitmap,
+					       __u32 start, __u32 end,
+					       __u32 *out)
+{
+	ext2fs_generic_bitmap_32 bitmap = (ext2fs_generic_bitmap_32) gen_bitmap;
+	blk_t b;
+
+	if (start < bitmap->start || end > bitmap->end || start > end) {
+		ext2fs_warn_bitmap2(gen_bitmap, EXT2FS_TEST_ERROR, start);
+		return EINVAL;
+	}
+
+	while (start <= end) {
+		b = ext2fs_test_bit(start - bitmap->start, bitmap->bitmap);
+		if (b) {
+			*out = start;
+			return 0;
+		}
+		start++;
+	}
+
+	return ENOENT;
+}
+
+int ext2fs_test_block_bitmap_range(ext2fs_block_bitmap gen_bitmap,
+				   blk_t block, int num)
+{
+	ext2fs_generic_bitmap_32 bitmap = (ext2fs_generic_bitmap_32) gen_bitmap;
+
+	EXT2_CHECK_MAGIC(bitmap, EXT2_ET_MAGIC_BLOCK_BITMAP);
+	if ((block < bitmap->start) || (block > bitmap->real_end) ||
+	    (block+num-1 > bitmap->real_end)) {
+		ext2fs_warn_bitmap(EXT2_ET_BAD_BLOCK_TEST,
+				   block, bitmap->description);
+		return 0;
+	}
+	return ext2fs_test_clear_generic_bitmap_range((ext2fs_generic_bitmap)
+						      bitmap, block, num);
+}
+
+int ext2fs_test_inode_bitmap_range(ext2fs_inode_bitmap gen_bitmap,
+				   ext2_ino_t inode, int num)
+{
+	ext2fs_generic_bitmap_32 bitmap = (ext2fs_generic_bitmap_32) gen_bitmap;
+
+	EXT2_CHECK_MAGIC(bitmap, EXT2_ET_MAGIC_INODE_BITMAP);
+	if ((inode < bitmap->start) || (inode > bitmap->real_end) ||
+	    (inode+num-1 > bitmap->real_end)) {
+		ext2fs_warn_bitmap(EXT2_ET_BAD_INODE_TEST,
+				   inode, bitmap->description);
+		return 0;
+	}
+	return ext2fs_test_clear_generic_bitmap_range((ext2fs_generic_bitmap)
+						      bitmap, inode, num);
+}
+
+void ext2fs_mark_block_bitmap_range(ext2fs_block_bitmap gen_bitmap,
+				    blk_t block, int num)
+{
+	ext2fs_generic_bitmap_32 bitmap = (ext2fs_generic_bitmap_32) gen_bitmap;
+	int	i;
+
+	if ((block < bitmap->start) || (block > bitmap->end) ||
+	    (block+num-1 > bitmap->end)) {
+		ext2fs_warn_bitmap(EXT2_ET_BAD_BLOCK_MARK, block,
+				   bitmap->description);
+		return;
+	}
+	for (i=0; i < num; i++)
+		ext2fs_fast_set_bit(block + i - bitmap->start, bitmap->bitmap);
+}
+
+void ext2fs_unmark_block_bitmap_range(ext2fs_block_bitmap gen_bitmap,
+				      blk_t block, int num)
+{
+	ext2fs_generic_bitmap_32 bitmap = (ext2fs_generic_bitmap_32) gen_bitmap;
+	int	i;
+
+	if ((block < bitmap->start) || (block > bitmap->end) ||
+	    (block+num-1 > bitmap->end)) {
+		ext2fs_warn_bitmap(EXT2_ET_BAD_BLOCK_UNMARK, block,
+				   bitmap->description);
+		return;
+	}
+	for (i=0; i < num; i++)
+		ext2fs_fast_clear_bit(block + i - bitmap->start,
+				      bitmap->bitmap);
+}
+
diff --git a/lib/ext2fs/gen_bitmap64.c b/lib/ext2fs/gen_bitmap64.c
new file mode 100644
index 0000000..4289e81
--- /dev/null
+++ b/lib/ext2fs/gen_bitmap64.c
@@ -0,0 +1,981 @@
+/*
+ * gen_bitmap64.c --- routines to read, write, and manipulate the new qinode and
+ * block bitmaps.
+ *
+ * Copyright (C) 2007, 2008 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Public
+ * License.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#include <errno.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+#ifdef HAVE_SYS_TIME_H
+#include <sys/time.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fsP.h"
+#include "bmap64.h"
+
+/*
+ * Design of 64-bit bitmaps
+ *
+ * In order maintain ABI compatibility with programs that don't
+ * understand about 64-bit blocks/inodes,
+ * ext2fs_allocate_inode_bitmap() and ext2fs_allocate_block_bitmap()
+ * will create old-style bitmaps unless the application passes the
+ * flag EXT2_FLAG_64BITS to ext2fs_open().  If this flag is
+ * passed, then we know the application has been recompiled, so we can
+ * use the new-style bitmaps.  If it is not passed, we have to return
+ * an error if trying to open a filesystem which needs 64-bit bitmaps.
+ *
+ * The new bitmaps use a new set of structure magic numbers, so that
+ * both the old-style and new-style interfaces can identify which
+ * version of the data structure was used.  Both the old-style and
+ * new-style interfaces will support either type of bitmap, although
+ * of course 64-bit operation will only be possible when both the
+ * new-style interface and the new-style bitmap are used.
+ *
+ * For example, the new bitmap interfaces will check the structure
+ * magic numbers and so will be able to detect old-stype bitmap.  If
+ * they see an old-style bitmap, they will pass it to the gen_bitmap.c
+ * functions for handling.  The same will be true for the old
+ * interfaces as well.
+ *
+ * The new-style interfaces will have several different back-end
+ * implementations, so we can support different encodings that are
+ * appropriate for different applications.  In general the default
+ * should be whatever makes sense, and what the application/library
+ * will use.  However, e2fsck may need specialized implementations for
+ * its own uses.  For example, when doing parent directory pointer
+ * loop detections in pass 3, the bitmap will *always* be sparse, so
+ * e2fsck can request an encoding which is optimized for that.
+ */
+
+static void warn_bitmap(ext2fs_generic_bitmap_64 bitmap,
+			int code, __u64 arg)
+{
+#ifndef OMIT_COM_ERR
+	if (bitmap->description)
+		com_err(0, bitmap->base_error_code+code,
+			"#%llu for %s", (unsigned long long) arg,
+			bitmap->description);
+	else
+		com_err(0, bitmap->base_error_code + code, "#%llu",
+			(unsigned long long) arg);
+#endif
+}
+
+#ifdef ENABLE_BMAP_STATS_OPS
+#define INC_STAT(map, name) map->stats.name
+#else
+#define INC_STAT(map, name) ;;
+#endif
+
+
+errcode_t ext2fs_alloc_generic_bmap(ext2_filsys fs, errcode_t magic,
+				    int type, __u64 start, __u64 end,
+				    __u64 real_end,
+				    const char *descr,
+				    ext2fs_generic_bitmap *ret)
+{
+	ext2fs_generic_bitmap_64 bitmap;
+	struct ext2_bitmap_ops	*ops;
+	ext2_ino_t num_dirs;
+	errcode_t retval;
+
+	if (!type)
+		type = EXT2FS_BMAP64_BITARRAY;
+
+	switch (type) {
+	case EXT2FS_BMAP64_BITARRAY:
+		ops = &ext2fs_blkmap64_bitarray;
+		break;
+	case EXT2FS_BMAP64_RBTREE:
+		ops = &ext2fs_blkmap64_rbtree;
+		break;
+	case EXT2FS_BMAP64_AUTODIR:
+		retval = ext2fs_get_num_dirs(fs, &num_dirs);
+		if (retval || num_dirs > (fs->super->s_inodes_count / 320))
+			ops = &ext2fs_blkmap64_bitarray;
+		else
+			ops = &ext2fs_blkmap64_rbtree;
+		break;
+	default:
+		return EINVAL;
+	}
+
+	retval = ext2fs_get_memzero(sizeof(struct ext2fs_struct_generic_bitmap_64),
+				    &bitmap);
+	if (retval)
+		return retval;
+
+#ifdef ENABLE_BMAP_STATS
+	if (gettimeofday(&bitmap->stats.created,
+			 (struct timezone *) NULL) == -1) {
+		perror("gettimeofday");
+		ext2fs_free_mem(&bitmap);
+		return 1;
+	}
+	bitmap->stats.type = type;
+#endif
+
+	/* XXX factor out, repeated in copy_bmap */
+	bitmap->magic = magic;
+	bitmap->fs = fs;
+	bitmap->start = start;
+	bitmap->end = end;
+	bitmap->real_end = real_end;
+	bitmap->bitmap_ops = ops;
+	bitmap->cluster_bits = 0;
+	switch (magic) {
+	case EXT2_ET_MAGIC_INODE_BITMAP64:
+		bitmap->base_error_code = EXT2_ET_BAD_INODE_MARK;
+		break;
+	case EXT2_ET_MAGIC_BLOCK_BITMAP64:
+		bitmap->base_error_code = EXT2_ET_BAD_BLOCK_MARK;
+		bitmap->cluster_bits = fs->cluster_ratio_bits;
+		break;
+	default:
+		bitmap->base_error_code = EXT2_ET_BAD_GENERIC_MARK;
+	}
+	if (descr) {
+		retval = ext2fs_get_mem(strlen(descr)+1, &bitmap->description);
+		if (retval) {
+			ext2fs_free_mem(&bitmap);
+			return retval;
+		}
+		strcpy(bitmap->description, descr);
+	} else
+		bitmap->description = 0;
+
+	retval = bitmap->bitmap_ops->new_bmap(fs, bitmap);
+	if (retval) {
+		ext2fs_free_mem(&bitmap->description);
+		ext2fs_free_mem(&bitmap);
+		return retval;
+	}
+
+	*ret = (ext2fs_generic_bitmap) bitmap;
+	return 0;
+}
+
+#ifdef ENABLE_BMAP_STATS
+static void ext2fs_print_bmap_statistics(ext2fs_generic_bitmap_64 bitmap)
+{
+	struct ext2_bmap_statistics *stats = &bitmap->stats;
+#ifdef ENABLE_BMAP_STATS_OPS
+	float mark_seq_perc = 0.0, test_seq_perc = 0.0;
+	float mark_back_perc = 0.0, test_back_perc = 0.0;
+	struct timeval now;
+	double inuse;
+
+	if (stats->test_count) {
+		test_seq_perc = ((float)stats->test_seq /
+				 stats->test_count) * 100;
+		test_back_perc = ((float)stats->test_back /
+				  stats->test_count) * 100;
+	}
+
+	if (stats->mark_count) {
+		mark_seq_perc = ((float)stats->mark_seq /
+				 stats->mark_count) * 100;
+		mark_back_perc = ((float)stats->mark_back /
+				  stats->mark_count) * 100;
+	}
+
+	if (gettimeofday(&now, (struct timezone *) NULL) == -1) {
+		perror("gettimeofday");
+		return;
+	}
+
+	inuse = (double) now.tv_sec + \
+		(((double) now.tv_usec) * 0.000001);
+	inuse -= (double) stats->created.tv_sec + \
+		(((double) stats->created.tv_usec) * 0.000001);
+#endif /* ENABLE_BMAP_STATS_OPS */
+
+	fprintf(stderr, "\n[+] %s bitmap (type %d)\n", bitmap->description,
+		stats->type);
+	fprintf(stderr, "=================================================\n");
+#ifdef ENABLE_BMAP_STATS_OPS
+	fprintf(stderr, "%16llu bits long\n",
+		bitmap->real_end - bitmap->start);
+	fprintf(stderr, "%16lu copy_bmap\n%16lu resize_bmap\n",
+		stats->copy_count, stats->resize_count);
+	fprintf(stderr, "%16lu mark bmap\n%16lu unmark_bmap\n",
+		stats->mark_count, stats->unmark_count);
+	fprintf(stderr, "%16lu test_bmap\n%16lu mark_bmap_extent\n",
+		stats->test_count, stats->mark_ext_count);
+	fprintf(stderr, "%16lu unmark_bmap_extent\n"
+		"%16lu test_clear_bmap_extent\n",
+		stats->unmark_ext_count, stats->test_ext_count);
+	fprintf(stderr, "%16lu set_bmap_range\n%16lu set_bmap_range\n",
+		stats->set_range_count, stats->get_range_count);
+	fprintf(stderr, "%16lu clear_bmap\n%16lu contiguous bit test (%.2f%%)\n",
+		stats->clear_count, stats->test_seq, test_seq_perc);
+	fprintf(stderr, "%16lu contiguous bit mark (%.2f%%)\n"
+		"%16llu bits tested backwards (%.2f%%)\n",
+		stats->mark_seq, mark_seq_perc,
+		stats->test_back, test_back_perc);
+	fprintf(stderr, "%16llu bits marked backwards (%.2f%%)\n"
+		"%16.2f seconds in use\n",
+		stats->mark_back, mark_back_perc, inuse);
+#endif /* ENABLE_BMAP_STATS_OPS */
+}
+#endif
+
+void ext2fs_free_generic_bmap(ext2fs_generic_bitmap gen_bmap)
+{
+	ext2fs_generic_bitmap_64 bmap = (ext2fs_generic_bitmap_64) gen_bmap;
+
+	if (!bmap)
+		return;
+
+	if (EXT2FS_IS_32_BITMAP(bmap)) {
+		ext2fs_free_generic_bitmap(gen_bmap);
+		return;
+	}
+
+	if (!EXT2FS_IS_64_BITMAP(bmap))
+		return;
+
+#ifdef ENABLE_BMAP_STATS
+	if (getenv("E2FSPROGS_BITMAP_STATS")) {
+		ext2fs_print_bmap_statistics(bmap);
+		bmap->bitmap_ops->print_stats(bmap);
+	}
+#endif
+
+	bmap->bitmap_ops->free_bmap(bmap);
+
+	if (bmap->description) {
+		ext2fs_free_mem(&bmap->description);
+		bmap->description = 0;
+	}
+	bmap->magic = 0;
+	ext2fs_free_mem(&bmap);
+}
+
+errcode_t ext2fs_copy_generic_bmap(ext2fs_generic_bitmap gen_src,
+				   ext2fs_generic_bitmap *dest)
+{
+	ext2fs_generic_bitmap_64 src = (ext2fs_generic_bitmap_64) gen_src;
+	char *descr, *new_descr;
+	ext2fs_generic_bitmap_64 new_bmap;
+	errcode_t retval;
+
+	if (!src)
+		return EINVAL;
+
+	if (EXT2FS_IS_32_BITMAP(src))
+		return ext2fs_copy_generic_bitmap(gen_src, dest);
+
+	if (!EXT2FS_IS_64_BITMAP(src))
+		return EINVAL;
+
+	/* Allocate a new bitmap struct */
+	retval = ext2fs_get_memzero(sizeof(struct ext2fs_struct_generic_bitmap_64),
+				    &new_bmap);
+	if (retval)
+		return retval;
+
+
+#ifdef ENABLE_BMAP_STATS_OPS
+	src->stats.copy_count++;
+#endif
+#ifdef ENABLE_BMAP_STATS
+	if (gettimeofday(&new_bmap->stats.created,
+			 (struct timezone *) NULL) == -1) {
+		perror("gettimeofday");
+		ext2fs_free_mem(&new_bmap);
+		return 1;
+	}
+	new_bmap->stats.type = src->stats.type;
+#endif
+
+	/* Copy all the high-level parts over */
+	new_bmap->magic = src->magic;
+	new_bmap->fs = src->fs;
+	new_bmap->start = src->start;
+	new_bmap->end = src->end;
+	new_bmap->real_end = src->real_end;
+	new_bmap->bitmap_ops = src->bitmap_ops;
+	new_bmap->base_error_code = src->base_error_code;
+	new_bmap->cluster_bits = src->cluster_bits;
+
+	descr = src->description;
+	if (descr) {
+		retval = ext2fs_get_mem(strlen(descr)+10, &new_descr);
+		if (retval) {
+			ext2fs_free_mem(&new_bmap);
+			return retval;
+		}
+		strcpy(new_descr, "copy of ");
+		strcat(new_descr, descr);
+		new_bmap->description = new_descr;
+	}
+
+	retval = src->bitmap_ops->copy_bmap(src, new_bmap);
+	if (retval) {
+		ext2fs_free_mem(&new_bmap->description);
+		ext2fs_free_mem(&new_bmap);
+		return retval;
+	}
+
+	*dest = (ext2fs_generic_bitmap) new_bmap;
+
+	return 0;
+}
+
+errcode_t ext2fs_resize_generic_bmap(ext2fs_generic_bitmap gen_bmap,
+				     __u64 new_end,
+				     __u64 new_real_end)
+{
+	ext2fs_generic_bitmap_64 bmap = (ext2fs_generic_bitmap_64) gen_bmap;
+
+	if (!bmap)
+		return EINVAL;
+
+	if (EXT2FS_IS_32_BITMAP(bmap))
+		return ext2fs_resize_generic_bitmap(gen_bmap->magic, new_end,
+						    new_real_end, gen_bmap);
+
+	if (!EXT2FS_IS_64_BITMAP(bmap))
+		return EINVAL;
+
+	INC_STAT(bmap, resize_count);
+
+	return bmap->bitmap_ops->resize_bmap(bmap, new_end, new_real_end);
+}
+
+errcode_t ext2fs_fudge_generic_bmap_end(ext2fs_generic_bitmap gen_bitmap,
+					errcode_t neq,
+					__u64 end, __u64 *oend)
+{
+	ext2fs_generic_bitmap_64 bitmap = (ext2fs_generic_bitmap_64) gen_bitmap;
+
+	if (!bitmap)
+		return EINVAL;
+
+	if (EXT2FS_IS_32_BITMAP(bitmap)) {
+		ext2_ino_t tmp_oend;
+		int retval;
+
+		retval = ext2fs_fudge_generic_bitmap_end(gen_bitmap,
+							 bitmap->magic,
+							 neq, end, &tmp_oend);
+		if (oend)
+			*oend = tmp_oend;
+		return retval;
+	}
+
+	if (!EXT2FS_IS_64_BITMAP(bitmap))
+		return EINVAL;
+
+	if (end > bitmap->real_end)
+		return neq;
+	if (oend)
+		*oend = bitmap->end;
+	bitmap->end = end;
+	return 0;
+}
+
+__u64 ext2fs_get_generic_bmap_start(ext2fs_generic_bitmap gen_bitmap)
+{
+	ext2fs_generic_bitmap_64 bitmap = (ext2fs_generic_bitmap_64) gen_bitmap;
+
+	if (!bitmap)
+		return EINVAL;
+
+	if (EXT2FS_IS_32_BITMAP(bitmap))
+		return ext2fs_get_generic_bitmap_start(gen_bitmap);
+
+	if (!EXT2FS_IS_64_BITMAP(bitmap))
+		return EINVAL;
+
+	return bitmap->start;
+}
+
+__u64 ext2fs_get_generic_bmap_end(ext2fs_generic_bitmap gen_bitmap)
+{
+	ext2fs_generic_bitmap_64 bitmap = (ext2fs_generic_bitmap_64) gen_bitmap;
+
+	if (!bitmap)
+		return EINVAL;
+
+	if (EXT2FS_IS_32_BITMAP(bitmap))
+		return ext2fs_get_generic_bitmap_end(gen_bitmap);
+
+	if (!EXT2FS_IS_64_BITMAP(bitmap))
+		return EINVAL;
+
+	return bitmap->end;
+}
+
+void ext2fs_clear_generic_bmap(ext2fs_generic_bitmap gen_bitmap)
+{
+	ext2fs_generic_bitmap_64 bitmap = (ext2fs_generic_bitmap_64) gen_bitmap;
+
+	if (EXT2FS_IS_32_BITMAP(bitmap))
+		ext2fs_clear_generic_bitmap(gen_bitmap);
+	else
+		bitmap->bitmap_ops->clear_bmap(bitmap);
+}
+
+int ext2fs_mark_generic_bmap(ext2fs_generic_bitmap gen_bitmap,
+			     __u64 arg)
+{
+	ext2fs_generic_bitmap_64 bitmap = (ext2fs_generic_bitmap_64) gen_bitmap;
+
+	if (!bitmap)
+		return 0;
+
+	if (EXT2FS_IS_32_BITMAP(bitmap)) {
+		if (arg & ~0xffffffffULL) {
+			ext2fs_warn_bitmap2(gen_bitmap,
+					    EXT2FS_MARK_ERROR, 0xffffffff);
+			return 0;
+		}
+		return ext2fs_mark_generic_bitmap(gen_bitmap, arg);
+	}
+
+	if (!EXT2FS_IS_64_BITMAP(bitmap))
+		return 0;
+
+	arg >>= bitmap->cluster_bits;
+
+#ifdef ENABLE_BMAP_STATS_OPS
+	if (arg == bitmap->stats.last_marked + 1)
+		bitmap->stats.mark_seq++;
+	if (arg < bitmap->stats.last_marked)
+		bitmap->stats.mark_back++;
+	bitmap->stats.last_marked = arg;
+	bitmap->stats.mark_count++;
+#endif
+
+	if ((arg < bitmap->start) || (arg > bitmap->end)) {
+		warn_bitmap(bitmap, EXT2FS_MARK_ERROR, arg);
+		return 0;
+	}
+
+	return bitmap->bitmap_ops->mark_bmap(bitmap, arg);
+}
+
+int ext2fs_unmark_generic_bmap(ext2fs_generic_bitmap gen_bitmap,
+			       __u64 arg)
+{
+	ext2fs_generic_bitmap_64 bitmap = (ext2fs_generic_bitmap_64) gen_bitmap;
+
+	if (!bitmap)
+		return 0;
+
+	if (EXT2FS_IS_32_BITMAP(bitmap)) {
+		if (arg & ~0xffffffffULL) {
+			ext2fs_warn_bitmap2(gen_bitmap, EXT2FS_UNMARK_ERROR,
+					    0xffffffff);
+			return 0;
+		}
+		return ext2fs_unmark_generic_bitmap(gen_bitmap, arg);
+	}
+
+	if (!EXT2FS_IS_64_BITMAP(bitmap))
+		return 0;
+
+	arg >>= bitmap->cluster_bits;
+
+	INC_STAT(bitmap, unmark_count);
+
+	if ((arg < bitmap->start) || (arg > bitmap->end)) {
+		warn_bitmap(bitmap, EXT2FS_UNMARK_ERROR, arg);
+		return 0;
+	}
+
+	return bitmap->bitmap_ops->unmark_bmap(bitmap, arg);
+}
+
+int ext2fs_test_generic_bmap(ext2fs_generic_bitmap gen_bitmap,
+			     __u64 arg)
+{
+	ext2fs_generic_bitmap_64 bitmap = (ext2fs_generic_bitmap_64) gen_bitmap;
+	if (!bitmap)
+		return 0;
+
+	if (EXT2FS_IS_32_BITMAP(bitmap)) {
+		if (arg & ~0xffffffffULL) {
+			ext2fs_warn_bitmap2(gen_bitmap, EXT2FS_TEST_ERROR,
+					    0xffffffff);
+			return 0;
+		}
+		return ext2fs_test_generic_bitmap(gen_bitmap, arg);
+	}
+
+	if (!EXT2FS_IS_64_BITMAP(bitmap))
+		return 0;
+
+	arg >>= bitmap->cluster_bits;
+
+#ifdef ENABLE_BMAP_STATS_OPS
+	bitmap->stats.test_count++;
+	if (arg == bitmap->stats.last_tested + 1)
+		bitmap->stats.test_seq++;
+	if (arg < bitmap->stats.last_tested)
+		bitmap->stats.test_back++;
+	bitmap->stats.last_tested = arg;
+#endif
+
+	if ((arg < bitmap->start) || (arg > bitmap->end)) {
+		warn_bitmap(bitmap, EXT2FS_TEST_ERROR, arg);
+		return 0;
+	}
+
+	return bitmap->bitmap_ops->test_bmap(bitmap, arg);
+}
+
+errcode_t ext2fs_set_generic_bmap_range(ext2fs_generic_bitmap gen_bmap,
+					__u64 start, unsigned int num,
+					void *in)
+{
+	ext2fs_generic_bitmap_64 bmap = (ext2fs_generic_bitmap_64) gen_bmap;
+
+	if (!bmap)
+		return EINVAL;
+
+	if (EXT2FS_IS_32_BITMAP(bmap)) {
+		if ((start+num-1) & ~0xffffffffULL) {
+			ext2fs_warn_bitmap2(gen_bmap, EXT2FS_UNMARK_ERROR,
+					    0xffffffff);
+			return EINVAL;
+		}
+		return ext2fs_set_generic_bitmap_range(gen_bmap, bmap->magic,
+						       start, num, in);
+	}
+
+	if (!EXT2FS_IS_64_BITMAP(bmap))
+		return EINVAL;
+
+	INC_STAT(bmap, set_range_count);
+
+	return bmap->bitmap_ops->set_bmap_range(bmap, start, num, in);
+}
+
+errcode_t ext2fs_get_generic_bmap_range(ext2fs_generic_bitmap gen_bmap,
+					__u64 start, unsigned int num,
+					void *out)
+{
+	ext2fs_generic_bitmap_64 bmap = (ext2fs_generic_bitmap_64) gen_bmap;
+
+	if (!bmap)
+		return EINVAL;
+
+	if (EXT2FS_IS_32_BITMAP(bmap)) {
+		if ((start+num-1) & ~0xffffffffULL) {
+			ext2fs_warn_bitmap2(gen_bmap,
+					    EXT2FS_UNMARK_ERROR, 0xffffffff);
+			return EINVAL;
+		}
+		return ext2fs_get_generic_bitmap_range(gen_bmap, bmap->magic,
+						       start, num, out);
+	}
+
+	if (!EXT2FS_IS_64_BITMAP(bmap))
+		return EINVAL;
+
+	INC_STAT(bmap, get_range_count);
+
+	return bmap->bitmap_ops->get_bmap_range(bmap, start, num, out);
+}
+
+errcode_t ext2fs_compare_generic_bmap(errcode_t neq,
+				      ext2fs_generic_bitmap gen_bm1,
+				      ext2fs_generic_bitmap gen_bm2)
+{
+	ext2fs_generic_bitmap_64 bm1 = (ext2fs_generic_bitmap_64) gen_bm1;
+	ext2fs_generic_bitmap_64 bm2 = (ext2fs_generic_bitmap_64) gen_bm2;
+	blk64_t	i;
+
+	if (!bm1 || !bm2)
+		return EINVAL;
+	if (bm1->magic != bm2->magic)
+		return EINVAL;
+
+	/* Now we know both bitmaps have the same magic */
+	if (EXT2FS_IS_32_BITMAP(bm1))
+		return ext2fs_compare_generic_bitmap(bm1->magic, neq,
+						     gen_bm1, gen_bm2);
+
+	if (!EXT2FS_IS_64_BITMAP(bm1))
+		return EINVAL;
+
+	if ((bm1->start != bm2->start) ||
+	    (bm1->end != bm2->end))
+		return neq;
+
+	for (i = bm1->start; i < bm1->end; i++) {
+		int ret1, ret2;
+		ret1 = !!ext2fs_test_generic_bmap(gen_bm1, i);
+		ret2 = !!ext2fs_test_generic_bmap(gen_bm2, i);
+		if (ret1 != ret2) {
+			return neq;
+		}
+	}
+
+	return 0;
+}
+
+void ext2fs_set_generic_bmap_padding(ext2fs_generic_bitmap gen_bmap)
+{
+	ext2fs_generic_bitmap_64 bmap = (ext2fs_generic_bitmap_64) gen_bmap;
+	__u64	start, num;
+
+	if (EXT2FS_IS_32_BITMAP(bmap)) {
+		ext2fs_set_generic_bitmap_padding(gen_bmap);
+		return;
+	}
+
+	start = bmap->end + 1;
+	num = bmap->real_end - bmap->end;
+	bmap->bitmap_ops->mark_bmap_extent(bmap, start, num);
+	/* XXX ought to warn on error */
+}
+
+int ext2fs_test_block_bitmap_range2(ext2fs_block_bitmap gen_bmap,
+				    blk64_t block, unsigned int num)
+{
+	ext2fs_generic_bitmap_64 bmap = (ext2fs_generic_bitmap_64) gen_bmap;
+	__u64	end = block + num;
+
+	if (!bmap)
+		return EINVAL;
+
+	if (num == 1)
+		return !ext2fs_test_generic_bmap((ext2fs_generic_bitmap)
+						 bmap, block);
+
+	if (EXT2FS_IS_32_BITMAP(bmap)) {
+		if ((block & ~0xffffffffULL) ||
+		    ((block+num-1) & ~0xffffffffULL)) {
+			ext2fs_warn_bitmap2((ext2fs_generic_bitmap) bmap,
+					    EXT2FS_UNMARK_ERROR, 0xffffffff);
+			return EINVAL;
+		}
+		return ext2fs_test_block_bitmap_range(
+			(ext2fs_generic_bitmap) bmap, block, num);
+	}
+
+	if (!EXT2FS_IS_64_BITMAP(bmap))
+		return EINVAL;
+
+	INC_STAT(bmap, test_ext_count);
+
+	/* convert to clusters if necessary */
+	block >>= bmap->cluster_bits;
+	end += (1ULL << bmap->cluster_bits) - 1;
+	end >>= bmap->cluster_bits;
+	num = end - block;
+
+	if ((block < bmap->start) || (block > bmap->end) ||
+	    (block+num-1 > bmap->end)) {
+		ext2fs_warn_bitmap(EXT2_ET_BAD_BLOCK_TEST, block,
+				   bmap->description);
+		return EINVAL;
+	}
+
+	return bmap->bitmap_ops->test_clear_bmap_extent(bmap, block, num);
+}
+
+void ext2fs_mark_block_bitmap_range2(ext2fs_block_bitmap gen_bmap,
+				     blk64_t block, unsigned int num)
+{
+	ext2fs_generic_bitmap_64 bmap = (ext2fs_generic_bitmap_64) gen_bmap;
+	__u64	end = block + num;
+
+	if (!bmap)
+		return;
+
+	if (EXT2FS_IS_32_BITMAP(bmap)) {
+		if ((block & ~0xffffffffULL) ||
+		    ((block+num-1) & ~0xffffffffULL)) {
+			ext2fs_warn_bitmap2((ext2fs_generic_bitmap) bmap,
+					    EXT2FS_UNMARK_ERROR, 0xffffffff);
+			return;
+		}
+		ext2fs_mark_block_bitmap_range((ext2fs_generic_bitmap) bmap,
+					       block, num);
+	}
+
+	if (!EXT2FS_IS_64_BITMAP(bmap))
+		return;
+
+	INC_STAT(bmap, mark_ext_count);
+
+	/* convert to clusters if necessary */
+	block >>= bmap->cluster_bits;
+	end += (1ULL << bmap->cluster_bits) - 1;
+	end >>= bmap->cluster_bits;
+	num = end - block;
+
+	if ((block < bmap->start) || (block > bmap->end) ||
+	    (block+num-1 > bmap->end)) {
+		ext2fs_warn_bitmap(EXT2_ET_BAD_BLOCK_MARK, block,
+				   bmap->description);
+		return;
+	}
+
+	bmap->bitmap_ops->mark_bmap_extent(bmap, block, num);
+}
+
+void ext2fs_unmark_block_bitmap_range2(ext2fs_block_bitmap gen_bmap,
+				       blk64_t block, unsigned int num)
+{
+	ext2fs_generic_bitmap_64 bmap = (ext2fs_generic_bitmap_64) gen_bmap;
+	__u64	end = block + num;
+
+	if (!bmap)
+		return;
+
+	if (EXT2FS_IS_32_BITMAP(bmap)) {
+		if ((block & ~0xffffffffULL) ||
+		    ((block+num-1) & ~0xffffffffULL)) {
+			ext2fs_warn_bitmap2((ext2fs_generic_bitmap) bmap,
+					    EXT2FS_UNMARK_ERROR, 0xffffffff);
+			return;
+		}
+		ext2fs_unmark_block_bitmap_range((ext2fs_generic_bitmap) bmap,
+						 block, num);
+	}
+
+	if (!EXT2FS_IS_64_BITMAP(bmap))
+		return;
+
+	INC_STAT(bmap, unmark_ext_count);
+
+	/* convert to clusters if necessary */
+	block >>= bmap->cluster_bits;
+	end += (1ULL << bmap->cluster_bits) - 1;
+	end >>= bmap->cluster_bits;
+	num = end - block;
+
+	if ((block < bmap->start) || (block > bmap->end) ||
+	    (block+num-1 > bmap->end)) {
+		ext2fs_warn_bitmap(EXT2_ET_BAD_BLOCK_UNMARK, block,
+				   bmap->description);
+		return;
+	}
+
+	bmap->bitmap_ops->unmark_bmap_extent(bmap, block, num);
+}
+
+void ext2fs_warn_bitmap32(ext2fs_generic_bitmap gen_bitmap, const char *func)
+{
+	ext2fs_generic_bitmap_64 bitmap = (ext2fs_generic_bitmap_64) gen_bitmap;
+
+#ifndef OMIT_COM_ERR
+	if (bitmap && bitmap->description)
+		com_err(0, EXT2_ET_MAGIC_GENERIC_BITMAP,
+			"called %s with 64-bit bitmap for %s", func,
+			bitmap->description);
+	else
+		com_err(0, EXT2_ET_MAGIC_GENERIC_BITMAP,
+			"called %s with 64-bit bitmap", func);
+#endif
+}
+
+errcode_t ext2fs_convert_subcluster_bitmap(ext2_filsys fs,
+					   ext2fs_block_bitmap *bitmap)
+{
+	ext2fs_generic_bitmap_64 bmap, cmap;
+	ext2fs_block_bitmap	gen_bmap = *bitmap, gen_cmap;
+	errcode_t		retval;
+	blk64_t			i, next, b_end, c_end;
+
+	bmap = (ext2fs_generic_bitmap_64) gen_bmap;
+	if (fs->cluster_ratio_bits == ext2fs_get_bitmap_granularity(gen_bmap))
+		return 0;	/* Nothing to do */
+
+	retval = ext2fs_allocate_block_bitmap(fs, "converted cluster bitmap",
+					      &gen_cmap);
+	if (retval)
+		return retval;
+
+	cmap = (ext2fs_generic_bitmap_64) gen_cmap;
+	i = bmap->start;
+	b_end = bmap->end;
+	bmap->end = bmap->real_end;
+	c_end = cmap->end;
+	cmap->end = cmap->real_end;
+	while (i < bmap->real_end) {
+		retval = ext2fs_find_first_set_block_bitmap2(gen_bmap,
+						i, bmap->real_end, &next);
+		if (retval)
+			break;
+		ext2fs_mark_block_bitmap2(gen_cmap, next);
+		i = EXT2FS_C2B(fs, EXT2FS_B2C(fs, next) + 1);
+	}
+	bmap->end = b_end;
+	cmap->end = c_end;
+	ext2fs_free_block_bitmap(gen_bmap);
+	*bitmap = (ext2fs_block_bitmap) cmap;
+	return 0;
+}
+
+errcode_t ext2fs_find_first_zero_generic_bmap(ext2fs_generic_bitmap bitmap,
+					      __u64 start, __u64 end, __u64 *out)
+{
+	ext2fs_generic_bitmap_64 bmap64 = (ext2fs_generic_bitmap_64) bitmap;
+	__u64 cstart, cend, cout;
+	errcode_t retval;
+
+	if (!bitmap)
+		return EINVAL;
+
+	if (EXT2FS_IS_32_BITMAP(bitmap)) {
+		blk_t blk = 0;
+
+		if (((start) & ~0xffffffffULL) ||
+		    ((end) & ~0xffffffffULL)) {
+			ext2fs_warn_bitmap2(bitmap, EXT2FS_TEST_ERROR, start);
+			return EINVAL;
+		}
+
+		retval = ext2fs_find_first_zero_generic_bitmap(bitmap, start,
+							       end, &blk);
+		if (retval == 0)
+			*out = blk;
+		return retval;
+	}
+
+	if (!EXT2FS_IS_64_BITMAP(bitmap))
+		return EINVAL;
+
+	cstart = start >> bmap64->cluster_bits;
+	cend = end >> bmap64->cluster_bits;
+
+	if (cstart < bmap64->start || cend > bmap64->end || start > end) {
+		warn_bitmap(bmap64, EXT2FS_TEST_ERROR, start);
+		return EINVAL;
+	}
+
+	if (bmap64->bitmap_ops->find_first_zero) {
+		retval = bmap64->bitmap_ops->find_first_zero(bmap64, cstart,
+							     cend, &cout);
+		if (retval)
+			return retval;
+	found:
+		cout <<= bmap64->cluster_bits;
+		*out = (cout >= start) ? cout : start;
+		return 0;
+	}
+
+	for (cout = cstart; cout <= cend; cout++)
+		if (!bmap64->bitmap_ops->test_bmap(bmap64, cout))
+			goto found;
+
+	return ENOENT;
+}
+
+errcode_t ext2fs_find_first_set_generic_bmap(ext2fs_generic_bitmap bitmap,
+					     __u64 start, __u64 end, __u64 *out)
+{
+	ext2fs_generic_bitmap_64 bmap64 = (ext2fs_generic_bitmap_64) bitmap;
+	__u64 cstart, cend, cout;
+	errcode_t retval;
+
+	if (!bitmap)
+		return EINVAL;
+
+	if (EXT2FS_IS_32_BITMAP(bitmap)) {
+		blk_t blk = 0;
+
+		if (((start) & ~0xffffffffULL) ||
+		    ((end) & ~0xffffffffULL)) {
+			ext2fs_warn_bitmap2(bitmap, EXT2FS_TEST_ERROR, start);
+			return EINVAL;
+		}
+
+		retval = ext2fs_find_first_set_generic_bitmap(bitmap, start,
+							      end, &blk);
+		if (retval == 0)
+			*out = blk;
+		return retval;
+	}
+
+	if (!EXT2FS_IS_64_BITMAP(bitmap))
+		return EINVAL;
+
+	cstart = start >> bmap64->cluster_bits;
+	cend = end >> bmap64->cluster_bits;
+
+	if (cstart < bmap64->start || cend > bmap64->end || start > end) {
+		warn_bitmap(bmap64, EXT2FS_TEST_ERROR, start);
+		return EINVAL;
+	}
+
+	if (bmap64->bitmap_ops->find_first_set) {
+		retval = bmap64->bitmap_ops->find_first_set(bmap64, cstart,
+							    cend, &cout);
+		if (retval)
+			return retval;
+	found:
+		cout <<= bmap64->cluster_bits;
+		*out = (cout >= start) ? cout : start;
+		return 0;
+	}
+
+	for (cout = cstart; cout <= cend; cout++)
+		if (bmap64->bitmap_ops->test_bmap(bmap64, cout))
+			goto found;
+
+	return ENOENT;
+}
+
+errcode_t ext2fs_count_used_clusters(ext2_filsys fs, blk64_t start,
+				     blk64_t end, blk64_t *out)
+{
+	blk64_t		next;
+	blk64_t		tot_set = 0;
+	errcode_t	retval = 0;
+
+	while (start < end) {
+		retval = ext2fs_find_first_set_block_bitmap2(fs->block_map,
+							start, end, &next);
+		if (retval) {
+			if (retval == ENOENT)
+				retval = 0;
+			break;
+		}
+		start = next;
+
+		retval = ext2fs_find_first_zero_block_bitmap2(fs->block_map,
+							start, end, &next);
+		if (retval == 0) {
+			tot_set += next - start;
+			start  = next + 1;
+		} else if (retval == ENOENT) {
+			retval = 0;
+			tot_set += end - start + 1;
+			break;
+		} else
+			break;
+	}
+
+	if (!retval)
+		*out = EXT2FS_NUM_B2C(fs, tot_set);
+	return retval;
+}
diff --git a/lib/ext2fs/gen_crc32ctable.c b/lib/ext2fs/gen_crc32ctable.c
new file mode 100644
index 0000000..a0742ee
--- /dev/null
+++ b/lib/ext2fs/gen_crc32ctable.c
@@ -0,0 +1,117 @@
+#include <stdio.h>
+#include "crc32c_defs.h"
+#include <inttypes.h>
+
+#define ENTRIES_PER_LINE 4
+
+#if CRC_LE_BITS > 8
+# define LE_TABLE_ROWS (CRC_LE_BITS/8)
+# define LE_TABLE_SIZE 256
+#else
+# define LE_TABLE_ROWS 1
+# define LE_TABLE_SIZE (1 << CRC_LE_BITS)
+#endif
+
+#if CRC_BE_BITS > 8
+# define BE_TABLE_ROWS (CRC_BE_BITS/8)
+# define BE_TABLE_SIZE 256
+#else
+# define BE_TABLE_ROWS 1
+# define BE_TABLE_SIZE (1 << CRC_BE_BITS)
+#endif
+
+static uint32_t crc32table_be[BE_TABLE_ROWS][256];
+static uint32_t crc32ctable_le[LE_TABLE_ROWS][256];
+
+/**
+ * crc32init_le() - allocate and initialize LE table data
+ *
+ * crc is the crc of the byte i; other entries are filled in based on the
+ * fact that crctable[i^j] = crctable[i] ^ crctable[j].
+ *
+ */
+static void crc32cinit_le(void)
+{
+	unsigned i, j;
+	uint32_t crc = 1;
+
+	crc32ctable_le[0][0] = 0;
+
+	for (i = LE_TABLE_SIZE >> 1; i; i >>= 1) {
+		crc = (crc >> 1) ^ ((crc & 1) ? CRC32C_POLY_LE : 0);
+		for (j = 0; j < LE_TABLE_SIZE; j += 2 * i)
+			crc32ctable_le[0][i + j] = crc ^ crc32ctable_le[0][j];
+	}
+	for (i = 0; i < LE_TABLE_SIZE; i++) {
+		crc = crc32ctable_le[0][i];
+		for (j = 1; j < LE_TABLE_ROWS; j++) {
+			crc = crc32ctable_le[0][crc & 0xff] ^ (crc >> 8);
+			crc32ctable_le[j][i] = crc;
+		}
+	}
+}
+
+/**
+ * crc32init_be() - allocate and initialize BE table data
+ */
+static void crc32init_be(void)
+{
+	unsigned i, j;
+	uint32_t crc = 0x80000000;
+
+	crc32table_be[0][0] = 0;
+
+	for (i = 1; i < BE_TABLE_SIZE; i <<= 1) {
+		crc = (crc << 1) ^ ((crc & 0x80000000) ? CRCPOLY_BE : 0);
+		for (j = 0; j < i; j++)
+			crc32table_be[0][i + j] = crc ^ crc32table_be[0][j];
+	}
+	for (i = 0; i < BE_TABLE_SIZE; i++) {
+		crc = crc32table_be[0][i];
+		for (j = 1; j < BE_TABLE_ROWS; j++) {
+			crc = crc32table_be[0][(crc >> 24) & 0xff] ^ (crc << 8);
+			crc32table_be[j][i] = crc;
+		}
+	}
+}
+
+static void output_table(uint32_t (*table)[256], int rows, int len, char *trans)
+{
+	int i, j;
+
+	for (j = 0 ; j < rows; j++) {
+		printf("{");
+		for (i = 0; i < len - 1; i++) {
+			if (i % ENTRIES_PER_LINE == 0)
+				printf("\n");
+			printf("%s(0x%8.8xL), ", trans, table[j][i]);
+		}
+		printf("%s(0x%8.8xL)},\n", trans, table[j][len - 1]);
+	}
+}
+
+int main(int argc, char **argv)
+{
+	printf("/* this file is generated - do not edit */\n\n");
+
+	if (CRC_BE_BITS > 1) {
+		crc32init_be();
+		printf("static const uint32_t "
+		       "crc32table_be[%d][%d] = {",
+		       BE_TABLE_ROWS, BE_TABLE_SIZE);
+		output_table(crc32table_be, LE_TABLE_ROWS,
+			     BE_TABLE_SIZE, "tobe");
+		printf("};\n");
+	}
+	if (CRC_LE_BITS > 1) {
+		crc32cinit_le();
+		printf("static const uint32_t "
+		       "crc32ctable_le[%d][%d] = {",
+		       LE_TABLE_ROWS, LE_TABLE_SIZE);
+		output_table(crc32ctable_le, LE_TABLE_ROWS,
+			     LE_TABLE_SIZE, "tole");
+		printf("};\n");
+	}
+
+	return 0;
+}
diff --git a/lib/ext2fs/get_num_dirs.c b/lib/ext2fs/get_num_dirs.c
new file mode 100644
index 0000000..f5644f8
--- /dev/null
+++ b/lib/ext2fs/get_num_dirs.c
@@ -0,0 +1,50 @@
+/*
+ * get_num_dirs.c -- calculate number of directories
+ *
+ * Copyright 1997 by Theodore Ts'o
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <string.h>
+#include <time.h>
+
+#include "ext2_fs.h"
+#include "ext2fsP.h"
+
+/*
+ * Returns the number of directories in the filesystem as reported by
+ * the group descriptors.  Of course, the group descriptors could be
+ * wrong!
+ */
+errcode_t ext2fs_get_num_dirs(ext2_filsys fs, ext2_ino_t *ret_num_dirs)
+{
+	dgrp_t	i;
+	ext2_ino_t	num_dirs, max_dirs;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	num_dirs = 0;
+	max_dirs = fs->super->s_inodes_per_group;
+	for (i = 0; i < fs->group_desc_count; i++) {
+		if (ext2fs_bg_used_dirs_count(fs, i) > max_dirs)
+			num_dirs += max_dirs / 8;
+		else
+			num_dirs += ext2fs_bg_used_dirs_count(fs, i);
+	}
+	if (num_dirs > fs->super->s_inodes_count)
+		num_dirs = fs->super->s_inodes_count;
+
+	*ret_num_dirs = num_dirs;
+
+	return 0;
+}
+
diff --git a/lib/ext2fs/get_pathname.c b/lib/ext2fs/get_pathname.c
new file mode 100644
index 0000000..8cfaf6e
--- /dev/null
+++ b/lib/ext2fs/get_pathname.c
@@ -0,0 +1,171 @@
+/*
+ * get_pathname.c --- do directory/inode -> name translation
+ *
+ * Copyright (C) 1993, 1994, 1995 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+/*
+ *
+ * 	ext2fs_get_pathname(fs, dir, ino, name)
+ *
+ * 	This function translates takes two inode numbers into a
+ * 	string, placing the result in <name>.  <dir> is the containing
+ * 	directory inode, and <ino> is the inode number itself.  If
+ * 	<ino> is zero, then ext2fs_get_pathname will return pathname
+ * 	of the the directory <dir>.
+ *
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+struct get_pathname_struct {
+	ext2_ino_t	search_ino;
+	ext2_ino_t	parent;
+	char		*name;
+	errcode_t	errcode;
+};
+
+#ifdef __TURBOC__
+ #pragma argsused
+#endif
+static int get_pathname_proc(struct ext2_dir_entry *dirent,
+			     int	offset EXT2FS_ATTR((unused)),
+			     int	blocksize EXT2FS_ATTR((unused)),
+			     char	*buf EXT2FS_ATTR((unused)),
+			     void	*priv_data)
+{
+	struct get_pathname_struct	*gp;
+	errcode_t			retval;
+	int name_len = ext2fs_dirent_name_len(dirent);
+
+	gp = (struct get_pathname_struct *) priv_data;
+
+	if ((name_len == 2) && !strncmp(dirent->name, "..", 2))
+		gp->parent = dirent->inode;
+	if (dirent->inode == gp->search_ino) {
+		retval = ext2fs_get_mem(name_len + 1, &gp->name);
+		if (retval) {
+			gp->errcode = retval;
+			return DIRENT_ABORT;
+		}
+		strncpy(gp->name, dirent->name, name_len);
+		gp->name[name_len] = '\0';
+		return DIRENT_ABORT;
+	}
+	return 0;
+}
+
+static errcode_t ext2fs_get_pathname_int(ext2_filsys fs, ext2_ino_t dir,
+					 ext2_ino_t ino, int maxdepth,
+					 char *buf, char **name)
+{
+	struct get_pathname_struct gp;
+	char	*parent_name = 0, *ret;
+	errcode_t	retval;
+
+	if (dir == ino) {
+		retval = ext2fs_get_mem(2, name);
+		if (retval)
+			return retval;
+		strcpy(*name, (dir == EXT2_ROOT_INO) ? "/" : ".");
+		return 0;
+	}
+
+	if (!dir || (maxdepth < 0)) {
+		retval = ext2fs_get_mem(4, name);
+		if (retval)
+			return retval;
+		strcpy(*name, "...");
+		return 0;
+	}
+
+	gp.search_ino = ino;
+	gp.parent = 0;
+	gp.name = 0;
+	gp.errcode = 0;
+
+	retval = ext2fs_dir_iterate(fs, dir, 0, buf, get_pathname_proc, &gp);
+	if (retval == EXT2_ET_NO_DIRECTORY) {
+		char tmp[32];
+
+		if (ino)
+			snprintf(tmp, sizeof(tmp), "<%u>/<%u>", dir, ino);
+		else
+			snprintf(tmp, sizeof(tmp), "<%u>", dir);
+		retval = ext2fs_get_mem(strlen(tmp)+1, name);
+		if (retval)
+			goto cleanup;
+		strcpy(*name, tmp);
+		return 0;
+	} else if (retval)
+		goto cleanup;
+	if (gp.errcode) {
+		retval = gp.errcode;
+		goto cleanup;
+	}
+
+	retval = ext2fs_get_pathname_int(fs, gp.parent, dir, maxdepth-1,
+					 buf, &parent_name);
+	if (retval)
+		goto cleanup;
+	if (!ino) {
+		*name = parent_name;
+		return 0;
+	}
+
+	if (gp.name)
+		retval = ext2fs_get_mem(strlen(parent_name)+strlen(gp.name)+2,
+					&ret);
+	else
+		retval = ext2fs_get_mem(strlen(parent_name)+5, &ret);
+	if (retval)
+		goto cleanup;
+
+	ret[0] = 0;
+	if (parent_name[1])
+		strcat(ret, parent_name);
+	strcat(ret, "/");
+	if (gp.name)
+		strcat(ret, gp.name);
+	else
+		strcat(ret, "???");
+	*name = ret;
+	retval = 0;
+
+cleanup:
+	ext2fs_free_mem(&parent_name);
+	ext2fs_free_mem(&gp.name);
+	return retval;
+}
+
+errcode_t ext2fs_get_pathname(ext2_filsys fs, ext2_ino_t dir, ext2_ino_t ino,
+			      char **name)
+{
+	char	*buf;
+	errcode_t	retval;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	retval = ext2fs_get_mem(fs->blocksize, &buf);
+	if (retval)
+		return retval;
+	if (dir == ino)
+		ino = 0;
+	retval = ext2fs_get_pathname_int(fs, dir, ino, 32, buf, name);
+	ext2fs_free_mem(&buf);
+	return retval;
+
+}
diff --git a/lib/ext2fs/getsectsize.c b/lib/ext2fs/getsectsize.c
new file mode 100644
index 0000000..bd978c5
--- /dev/null
+++ b/lib/ext2fs/getsectsize.c
@@ -0,0 +1,151 @@
+/*
+ * getsectsize.c --- get the sector size of a device.
+ *
+ * Copyright (C) 1995, 1995 Theodore Ts'o.
+ * Copyright (C) 2003 VMware, Inc.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#ifndef _LARGEFILE_SOURCE
+#define _LARGEFILE_SOURCE
+#endif
+#ifndef _LARGEFILE64_SOURCE
+#define _LARGEFILE64_SOURCE
+#endif
+
+#include "config.h"
+#include <stdio.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#if HAVE_ERRNO_H
+#include <errno.h>
+#endif
+#include <fcntl.h>
+#ifdef HAVE_SYS_DISK_H
+#include <sys/disk.h>
+#endif
+#ifdef HAVE_LINUX_FD_H
+#include <sys/ioctl.h>
+#include <linux/fd.h>
+#endif
+
+#if defined(__linux__) && defined(_IO)
+#if !defined(BLKSSZGET)
+#define BLKSSZGET  _IO(0x12,104)/* get block device sector size */
+#endif
+#if !defined(BLKPBSZGET)
+#define BLKPBSZGET _IO(0x12,123)/* get block physical sector size */
+#endif
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+/*
+ * Returns the logical sector size of a device
+ */
+errcode_t ext2fs_get_device_sectsize(const char *file, int *sectsize)
+{
+#ifdef _WIN32
+	*sectsize = 512; // just guessing
+	return 0;
+#else // not _WIN32
+
+	int	fd;
+
+	fd = ext2fs_open_file(file, O_RDONLY, 0);
+	if (fd < 0)
+		return errno;
+
+#ifdef BLKSSZGET
+	if (ioctl(fd, BLKSSZGET, sectsize) >= 0) {
+		close(fd);
+		return 0;
+	}
+#endif
+#ifdef DIOCGSECTORSIZE
+	if (ioctl(fd, DIOCGSECTORSIZE, sectsize) >= 0) {
+		close(fd);
+		return 0;
+	}
+#endif
+	*sectsize = 0;
+	close(fd);
+	return 0;
+
+#endif // ifdef _WIN32
+}
+
+/*
+ * Return desired alignment for direct I/O
+ */
+int ext2fs_get_dio_alignment(int fd)
+{
+	int align = 0;
+
+#ifdef BLKSSZGET
+	if (ioctl(fd, BLKSSZGET, &align) < 0)
+		align = 0;
+#endif
+#ifdef DIOCGSECTORSIZE
+	if (align <= 0 &&
+	    ioctl(fd, DIOCGSECTORSIZE, &align) < 0)
+		align = 0;
+#endif
+
+#ifdef _SC_PAGESIZE
+	if (align <= 0)
+		align = sysconf(_SC_PAGESIZE);
+#endif
+#ifdef HAVE_GETPAGESIZE
+	if (align <= 0)
+		align = getpagesize();
+#endif
+	if (align <= 0)
+		align = 4096;
+
+	return align;
+}
+
+/*
+ * Returns the physical sector size of a device
+ */
+errcode_t ext2fs_get_device_phys_sectsize(const char *file, int *sectsize)
+{
+#ifdef _WIN32
+
+	return ext2fs_get_device_sectsize(file, sectsize);
+
+#else // not _WIN32
+
+	int	fd;
+
+	fd = ext2fs_open_file(file, O_RDONLY, 0);
+	if (fd < 0)
+		return errno;
+
+#ifdef BLKPBSZGET
+	if (ioctl(fd, BLKPBSZGET, sectsize) >= 0) {
+		close(fd);
+		return 0;
+	}
+#endif
+#ifdef DIOCGSECTORSIZE
+	/* This isn't really the physical sector size, but FreeBSD
+	 * doesn't seem to have this concept. */
+	if (ioctl(fd, DIOCGSECTORSIZE, sectsize) >= 0) {
+		close(fd);
+		return 0;
+	}
+#endif
+	*sectsize = 0;
+	close(fd);
+	return 0;
+
+#endif // ifdef _WIN32
+}
diff --git a/lib/ext2fs/getsize.c b/lib/ext2fs/getsize.c
new file mode 100644
index 0000000..bcf3020
--- /dev/null
+++ b/lib/ext2fs/getsize.c
@@ -0,0 +1,324 @@
+/*
+ * getsize.c --- get the size of a partition.
+ *
+ * Copyright (C) 1995, 1995 Theodore Ts'o.
+ * Copyright (C) 2003 VMware, Inc.
+ *
+ * Windows version of ext2fs_get_device_size by Chris Li, VMware.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#ifndef _LARGEFILE_SOURCE
+#define _LARGEFILE_SOURCE
+#endif
+#ifndef _LARGEFILE64_SOURCE
+#define _LARGEFILE64_SOURCE
+#endif
+
+#include "config.h"
+#include <stdio.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#if HAVE_ERRNO_H
+#include <errno.h>
+#endif
+#include <fcntl.h>
+#ifdef HAVE_SYS_IOCTL_H
+#include <sys/ioctl.h>
+#endif
+#ifdef HAVE_LINUX_FD_H
+#include <linux/fd.h>
+#endif
+#ifdef HAVE_SYS_DISKLABEL_H
+#include <sys/disklabel.h>
+#endif
+#ifdef HAVE_SYS_DISK_H
+#include <sys/disk.h>
+#endif
+#ifdef __linux__
+#include <sys/utsname.h>
+#endif
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#include <ctype.h>
+
+#if defined(__linux__) && defined(_IO) && !defined(BLKGETSIZE)
+#define BLKGETSIZE _IO(0x12,96)	/* return device size */
+#endif
+
+#if defined(__linux__) && defined(_IOR) && !defined(BLKGETSIZE64)
+#define BLKGETSIZE64 _IOR(0x12,114,size_t)	/* return device size in bytes (u64 *arg) */
+#endif
+
+#ifdef APPLE_DARWIN
+#define BLKGETSIZE DKIOCGETBLOCKCOUNT32
+#endif /* APPLE_DARWIN */
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+#if defined(__CYGWIN__) || defined (WIN32)
+#include "windows.h"
+#include "winioctl.h"
+
+#if (_WIN32_WINNT >= 0x0500)
+#define HAVE_GET_FILE_SIZE_EX 1
+#endif
+
+HANDLE windows_get_handle(io_channel channel);
+
+errcode_t ext2fs_get_device_size2(const char *file, int blocksize,
+				  blk64_t *retblocks)
+{
+	HANDLE dev;
+	PARTITION_INFORMATION pi;
+	DISK_GEOMETRY gi;
+	DWORD retbytes;
+#ifdef HAVE_GET_FILE_SIZE_EX
+	LARGE_INTEGER filesize;
+#else
+	DWORD filesize;
+#endif /* HAVE_GET_FILE_SIZE_EX */
+
+	io_channel data_io = 0;
+	int retval;
+
+	retval = windows_io_manager->open(file, 0, &data_io);
+	if (retval)
+		return retval;
+
+	dev = windows_get_handle(data_io);
+	if (dev == INVALID_HANDLE_VALUE)
+		return EBADF;
+
+	if (DeviceIoControl(dev, IOCTL_DISK_GET_PARTITION_INFO,
+			    &pi, sizeof(PARTITION_INFORMATION),
+			    &pi, sizeof(PARTITION_INFORMATION),
+			    &retbytes, NULL)) {
+
+		*retblocks = pi.PartitionLength.QuadPart / blocksize;
+
+	} else if (DeviceIoControl(dev, IOCTL_DISK_GET_DRIVE_GEOMETRY,
+				&gi, sizeof(DISK_GEOMETRY),
+				&gi, sizeof(DISK_GEOMETRY),
+				&retbytes, NULL)) {
+
+		*retblocks = gi.BytesPerSector *
+			     gi.SectorsPerTrack *
+			     gi.TracksPerCylinder *
+			     gi.Cylinders.QuadPart / blocksize;
+
+#ifdef HAVE_GET_FILE_SIZE_EX
+	} else if (GetFileSizeEx(dev, &filesize)) {
+		*retblocks = filesize.QuadPart / blocksize;
+	}
+#else
+	} else {
+		filesize = GetFileSize(dev, NULL);
+		if (INVALID_FILE_SIZE != filesize) {
+			*retblocks = filesize / blocksize;
+		}
+	}
+#endif /* HAVE_GET_FILE_SIZE_EX */
+
+	windows_io_manager->close(data_io);
+
+	return 0;
+}
+
+#else
+
+static int valid_offset (int fd, ext2_loff_t offset)
+{
+	char ch;
+
+	if (ext2fs_llseek (fd, offset, 0) < 0)
+		return 0;
+	if (read (fd, &ch, 1) < 1)
+		return 0;
+	return 1;
+}
+
+/*
+ * Returns the number of blocks in a partition
+ */
+errcode_t ext2fs_get_device_size2(const char *file, int blocksize,
+				  blk64_t *retblocks)
+{
+	int	fd, rc = 0;
+	unsigned long long size64;
+	ext2_loff_t high, low;
+
+	fd = ext2fs_open_file(file, O_RDONLY, 0);
+	if (fd < 0)
+		return errno;
+
+#if defined DKIOCGETBLOCKCOUNT && defined DKIOCGETBLOCKSIZE	/* For Apple Darwin */
+	unsigned int size;
+
+	if (ioctl(fd, DKIOCGETBLOCKCOUNT, &size64) >= 0 &&
+	    ioctl(fd, DKIOCGETBLOCKSIZE, &size) >= 0) {
+		*retblocks = size64 * size / blocksize;
+		goto out;
+	}
+#endif
+
+#ifdef BLKGETSIZE64
+	{
+		int valid_blkgetsize64 = 1;
+#ifdef __linux__
+		struct utsname ut;
+
+		if ((uname(&ut) == 0) &&
+		    ((ut.release[0] == '2') && (ut.release[1] == '.') &&
+		     (ut.release[2] < '6') && (ut.release[3] == '.')))
+			valid_blkgetsize64 = 0;
+#endif
+		if (valid_blkgetsize64 &&
+		    ioctl(fd, BLKGETSIZE64, &size64) >= 0) {
+			*retblocks = size64 / blocksize;
+			goto out;
+		}
+	}
+#endif /* BLKGETSIZE64 */
+
+#ifdef BLKGETSIZE
+	{
+		unsigned long	size;
+
+		if (ioctl(fd, BLKGETSIZE, &size) >= 0) {
+			*retblocks = size / (blocksize / 512);
+			goto out;
+		}
+	}
+#endif
+
+#ifdef FDGETPRM
+	{
+		struct floppy_struct this_floppy;
+
+		if (ioctl(fd, FDGETPRM, &this_floppy) >= 0) {
+			*retblocks = this_floppy.size / (blocksize / 512);
+			goto out;
+		}
+	}
+#endif
+
+#ifdef HAVE_SYS_DISKLABEL_H
+	{
+		int part;
+		struct disklabel lab;
+		struct partition *pp;
+		char ch;
+
+#if defined(DIOCGMEDIASIZE)
+		{
+			off_t ms;
+			u_int bs;
+			if (ioctl(fd, DIOCGMEDIASIZE, &ms) >= 0) {
+				*retblocks = ms / blocksize;
+				goto out;
+			}
+		}
+#elif defined(DIOCGDINFO)
+		/* old disklabel interface */
+		part = strlen(file) - 1;
+		if (part >= 0) {
+			ch = file[part];
+			if (isdigit(ch))
+				part = 0;
+			else if (ch >= 'a' && ch <= 'h')
+				part = ch - 'a';
+			else
+				part = -1;
+		}
+		if (part >= 0 && (ioctl(fd, DIOCGDINFO, (char *)&lab) >= 0)) {
+			pp = &lab.d_partitions[part];
+			if (pp->p_size) {
+				*retblocks = pp->p_size / (blocksize / 512);
+				goto out;
+			}
+		}
+#endif /* defined(DIOCG*) */
+	}
+#endif /* HAVE_SYS_DISKLABEL_H */
+
+	{
+		ext2fs_struct_stat st;
+
+		if (ext2fs_fstat(fd, &st) == 0)
+			if (S_ISREG(st.st_mode)) {
+				*retblocks = st.st_size / blocksize;
+				goto out;
+			}
+	}
+
+	/*
+	 * OK, we couldn't figure it out by using a specialized ioctl,
+	 * which is generally the best way.  So do binary search to
+	 * find the size of the partition.
+	 */
+	low = 0;
+	for (high = 1024; valid_offset(fd, high); high *= 2)
+		low = high;
+	while (low < high - 1) {
+		const ext2_loff_t mid = (low + high) / 2;
+
+		if (valid_offset (fd, mid))
+			low = mid;
+		else
+			high = mid;
+	}
+	valid_offset(fd, 0);
+	size64 = low + 1;
+	*retblocks = size64 / blocksize;
+out:
+	close(fd);
+	return rc;
+}
+
+#endif /* WIN32 */
+
+errcode_t ext2fs_get_device_size(const char *file, int blocksize,
+				 blk_t *retblocks)
+{
+	errcode_t retval;
+	blk64_t	blocks;
+
+	retval = ext2fs_get_device_size2(file, blocksize, &blocks);
+	if (retval)
+		return retval;
+	if (blocks >= (1ULL << 32))
+		return EFBIG;
+	*retblocks = (blk_t) blocks;
+	return 0;
+}
+
+#ifdef DEBUG
+int main(int argc, char **argv)
+{
+	blk64_t	blocks;
+	int	retval;
+
+	if (argc < 2) {
+		fprintf(stderr, "Usage: %s device\n", argv[0]);
+		exit(1);
+	}
+
+	retval = ext2fs_get_device_size2(argv[1], 1024, &blocks);
+	if (retval) {
+		com_err(argv[0], retval,
+			"while calling ext2fs_get_device_size");
+		exit(1);
+	}
+	printf("Device %s has %llu 1k blocks.\n", argv[1],
+	       (unsigned long long) locks);
+	exit(0);
+}
+#endif
diff --git a/lib/ext2fs/hashmap.c b/lib/ext2fs/hashmap.c
new file mode 100644
index 0000000..697b2bc
--- /dev/null
+++ b/lib/ext2fs/hashmap.c
@@ -0,0 +1,109 @@
+#include "hashmap.h"
+#include <string.h>
+
+struct ext2fs_hashmap {
+	uint32_t size;
+	uint32_t(*hash)(const void *key, size_t len);
+	void(*free)(void*);
+	struct ext2fs_hashmap_entry *first;
+	struct ext2fs_hashmap_entry *last;
+#if __GNUC_PREREQ (4, 8)
+#pragma GCC diagnostic push
+#pragma GCC diagnostic ignored "-Wpedantic"
+#endif
+	struct ext2fs_hashmap_entry *entries[0];
+#if __GNUC_PREREQ (4, 8)
+#pragma GCC diagnostic pop
+#endif
+};
+
+uint32_t ext2fs_djb2_hash(const void *str, size_t size)
+{
+	int c;
+	const char *s = str;
+	uint32_t hash = 5381;
+
+	while (size-- > 0) {
+		c = *s++;
+		hash = ((hash << 5) + hash) + c;
+	}
+	return hash;
+}
+
+struct ext2fs_hashmap *ext2fs_hashmap_create(
+				uint32_t(*hash_fct)(const void*, size_t),
+				void(*free_fct)(void*), size_t size)
+{
+	struct ext2fs_hashmap *h = calloc(sizeof(struct ext2fs_hashmap) +
+				sizeof(struct ext2fs_hashmap_entry) * size, 1);
+	if (!h)
+		return NULL;
+
+	h->size = size;
+	h->free = free_fct;
+	h->hash = hash_fct;
+	h->first = h->last = NULL;
+	return h;
+}
+
+int ext2fs_hashmap_add(struct ext2fs_hashmap *h,
+		       void *data, const void *key, size_t key_len)
+{
+	uint32_t hash = h->hash(key, key_len) % h->size;
+	struct ext2fs_hashmap_entry *e = malloc(sizeof(*e));
+
+	if (!e)
+		return -1;
+
+	e->data = data;
+	e->key = key;
+	e->key_len = key_len;
+	e->next = h->entries[hash];
+	h->entries[hash] = e;
+
+	e->list_prev = NULL;
+	e->list_next = h->first;
+	if (h->first)
+		h->first->list_prev = e;
+	h->first = e;
+	if (!h->last)
+		h->last = e;
+
+	return 0;
+}
+
+void *ext2fs_hashmap_lookup(struct ext2fs_hashmap *h, const void *key,
+			    size_t key_len)
+{
+	struct ext2fs_hashmap_entry *iter;
+	uint32_t hash = h->hash(key, key_len) % h->size;
+
+	for (iter = h->entries[hash]; iter; iter = iter->next)
+		if (iter->key_len == key_len && !memcmp(iter->key, key, key_len))
+			return iter->data;
+	return NULL;
+}
+
+void *ext2fs_hashmap_iter_in_order(struct ext2fs_hashmap *h,
+				   struct ext2fs_hashmap_entry **it)
+{
+	*it = *it ? (*it)->list_next : h->first;
+	return *it ? (*it)->data : NULL;
+}
+
+void ext2fs_hashmap_free(struct ext2fs_hashmap *h)
+{
+	size_t	i;
+
+	for (i = 0; i < h->size; ++i) {
+		struct ext2fs_hashmap_entry *it = h->entries[i];
+		while (it) {
+			struct ext2fs_hashmap_entry *tmp = it->next;
+			if (h->free)
+				h->free(it->data);
+			free(it);
+			it = tmp;
+		}
+	}
+	free(h);
+}
diff --git a/lib/ext2fs/hashmap.h b/lib/ext2fs/hashmap.h
new file mode 100644
index 0000000..0c09d2b
--- /dev/null
+++ b/lib/ext2fs/hashmap.h
@@ -0,0 +1,42 @@
+#ifndef HASHMAP_H
+# define HASHMAP_H
+
+# include <stdlib.h>
+# include <stdint.h>
+
+#ifndef __GNUC_PREREQ
+#if defined(__GNUC__) && defined(__GNUC_MINOR__)
+#define __GNUC_PREREQ(maj, min) \
+	((__GNUC__ << 16) + __GNUC_MINOR__ >= ((maj) << 16) + (min))
+#else
+#define __GNUC_PREREQ(maj, min) 0
+#endif
+#endif
+
+struct ext2fs_hashmap;
+
+struct ext2fs_hashmap_entry {
+	void *data;
+	const void *key;
+	size_t key_len;
+	struct ext2fs_hashmap_entry *next;
+	struct ext2fs_hashmap_entry *list_next;
+	struct ext2fs_hashmap_entry *list_prev;
+};
+
+struct ext2fs_hashmap *ext2fs_hashmap_create(
+				uint32_t(*hash_fct)(const void*, size_t),
+				void(*free_fct)(void*), size_t size);
+int ext2fs_hashmap_add(struct ext2fs_hashmap *h,
+		       void *data, const void *key,size_t key_len);
+void *ext2fs_hashmap_lookup(struct ext2fs_hashmap *h, const void *key,
+			    size_t key_len);
+void *ext2fs_hashmap_iter_in_order(struct ext2fs_hashmap *h,
+				   struct ext2fs_hashmap_entry **it);
+void ext2fs_hashmap_del(struct ext2fs_hashmap *h,
+			struct ext2fs_hashmap_entry *e);
+void ext2fs_hashmap_free(struct ext2fs_hashmap *h);
+
+uint32_t ext2fs_djb2_hash(const void *str, size_t size);
+
+#endif /* !HASHMAP_H */
diff --git a/lib/ext2fs/i_block.c b/lib/ext2fs/i_block.c
new file mode 100644
index 0000000..2eecf02
--- /dev/null
+++ b/lib/ext2fs/i_block.c
@@ -0,0 +1,90 @@
+/*
+ * i_block.c --- Manage the i_block field for i_blocks
+ *
+ * Copyright (C) 2008 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <time.h>
+#include <string.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+#include <errno.h>
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+errcode_t ext2fs_iblk_add_blocks(ext2_filsys fs, struct ext2_inode *inode,
+				 blk64_t num_blocks)
+{
+	unsigned long long b = inode->i_blocks;
+
+	if (ext2fs_has_feature_huge_file(fs->super))
+		b += ((long long) inode->osd2.linux2.l_i_blocks_hi) << 32;
+
+	if (!ext2fs_has_feature_huge_file(fs->super) ||
+	    !(inode->i_flags & EXT4_HUGE_FILE_FL))
+	    num_blocks *= fs->blocksize / 512;
+	num_blocks *= EXT2FS_CLUSTER_RATIO(fs);
+
+	b += num_blocks;
+
+	if (ext2fs_has_feature_huge_file(fs->super))
+		inode->osd2.linux2.l_i_blocks_hi = b >> 32;
+	else if (b > 0xFFFFFFFF)
+		return EOVERFLOW;
+	inode->i_blocks = b & 0xFFFFFFFF;
+	return 0;
+}
+
+errcode_t ext2fs_iblk_sub_blocks(ext2_filsys fs, struct ext2_inode *inode,
+				 blk64_t num_blocks)
+{
+	unsigned long long b = inode->i_blocks;
+
+	if (ext2fs_has_feature_huge_file(fs->super))
+		b += ((long long) inode->osd2.linux2.l_i_blocks_hi) << 32;
+
+	if (!ext2fs_has_feature_huge_file(fs->super) ||
+	    !(inode->i_flags & EXT4_HUGE_FILE_FL))
+	    num_blocks *= fs->blocksize / 512;
+	num_blocks *= EXT2FS_CLUSTER_RATIO(fs);
+
+	if (num_blocks > b)
+		return EOVERFLOW;
+
+	b -= num_blocks;
+
+	if (ext2fs_has_feature_huge_file(fs->super))
+		inode->osd2.linux2.l_i_blocks_hi = b >> 32;
+	inode->i_blocks = b & 0xFFFFFFFF;
+	return 0;
+}
+
+errcode_t ext2fs_iblk_set(ext2_filsys fs, struct ext2_inode *inode, blk64_t b)
+{
+	if (!ext2fs_has_feature_huge_file(fs->super) ||
+	    !(inode->i_flags & EXT4_HUGE_FILE_FL))
+		b *= fs->blocksize / 512;
+	b *= EXT2FS_CLUSTER_RATIO(fs);
+
+	inode->i_blocks = b & 0xFFFFFFFF;
+	if (ext2fs_has_feature_huge_file(fs->super))
+		inode->osd2.linux2.l_i_blocks_hi = b >> 32;
+	else if (b >> 32)
+		return EOVERFLOW;
+	return 0;
+}
diff --git a/lib/ext2fs/icount.c b/lib/ext2fs/icount.c
new file mode 100644
index 0000000..888a90b
--- /dev/null
+++ b/lib/ext2fs/icount.c
@@ -0,0 +1,921 @@
+/*
+ * icount.c --- an efficient inode count abstraction
+ *
+ * Copyright (C) 1997 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <string.h>
+#include <stdio.h>
+#include <sys/stat.h>
+#include <fcntl.h>
+#include <errno.h>
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+#include "tdb.h"
+
+/*
+ * The data storage strategy used by icount relies on the observation
+ * that most inode counts are either zero (for non-allocated inodes),
+ * one (for most files), and only a few that are two or more
+ * (directories and files that are linked to more than one directory).
+ *
+ * Also, e2fsck tends to load the icount data sequentially.
+ *
+ * So, we use an inode bitmap to indicate which inodes have a count of
+ * one, and then use a sorted list to store the counts for inodes
+ * which are greater than one.
+ *
+ * We also use an optional bitmap to indicate which inodes are already
+ * in the sorted list, to speed up the use of this abstraction by
+ * e2fsck's pass 2.  Pass 2 increments inode counts as it finds them,
+ * so this extra bitmap avoids searching the sorted list to see if a
+ * particular inode is on the sorted list already.
+ */
+
+struct ext2_icount_el {
+	ext2_ino_t	ino;
+	__u32		count;
+};
+
+struct ext2_icount {
+	errcode_t		magic;
+	ext2fs_inode_bitmap	single;
+	ext2fs_inode_bitmap	multiple;
+	ext2_ino_t		count;
+	ext2_ino_t		size;
+	ext2_ino_t		num_inodes;
+	ext2_ino_t		cursor;
+	struct ext2_icount_el	*list;
+	struct ext2_icount_el	*last_lookup;
+#ifdef CONFIG_TDB
+	char			*tdb_fn;
+	TDB_CONTEXT		*tdb;
+#endif
+	__u16			*fullmap;
+};
+
+/*
+ * We now use a 32-bit counter field because it doesn't cost us
+ * anything extra for the in-memory data structure, due to alignment
+ * padding.  But there's no point changing the interface if most of
+ * the time we only care if the number is bigger than 65,000 or not.
+ * So use the following translation function to return a 16-bit count.
+ */
+#define icount_16_xlate(x) (((x) > 65500) ? 65500 : (x))
+
+void ext2fs_free_icount(ext2_icount_t icount)
+{
+	if (!icount)
+		return;
+
+	icount->magic = 0;
+	if (icount->list)
+		ext2fs_free_mem(&icount->list);
+	if (icount->single)
+		ext2fs_free_inode_bitmap(icount->single);
+	if (icount->multiple)
+		ext2fs_free_inode_bitmap(icount->multiple);
+#ifdef CONFIG_TDB
+	if (icount->tdb)
+		tdb_close(icount->tdb);
+	if (icount->tdb_fn) {
+		(void) unlink(icount->tdb_fn);
+		free(icount->tdb_fn);
+	}
+#endif
+
+	if (icount->fullmap)
+		ext2fs_free_mem(&icount->fullmap);
+
+	ext2fs_free_mem(&icount);
+}
+
+static errcode_t alloc_icount(ext2_filsys fs, int flags, ext2_icount_t *ret)
+{
+	ext2_icount_t	icount;
+	errcode_t	retval;
+
+	*ret = 0;
+
+	retval = ext2fs_get_mem(sizeof(struct ext2_icount), &icount);
+	if (retval)
+		return retval;
+	memset(icount, 0, sizeof(struct ext2_icount));
+	icount->magic = EXT2_ET_MAGIC_ICOUNT;
+	icount->num_inodes = fs->super->s_inodes_count;
+
+	if ((flags & EXT2_ICOUNT_OPT_FULLMAP) &&
+	    (flags & EXT2_ICOUNT_OPT_INCREMENT)) {
+		unsigned sz = sizeof(*icount->fullmap) * icount->num_inodes;
+
+		retval = ext2fs_get_mem(sz, &icount->fullmap);
+		/* If we can't allocate, fall back */
+		if (!retval) {
+			memset(icount->fullmap, 0, sz);
+			*ret = icount;
+			return 0;
+		}
+	}
+
+	retval = ext2fs_allocate_inode_bitmap(fs, "icount", &icount->single);
+	if (retval)
+		goto errout;
+
+	if (flags & EXT2_ICOUNT_OPT_INCREMENT) {
+		retval = ext2fs_allocate_inode_bitmap(fs, "icount_inc",
+						      &icount->multiple);
+		if (retval)
+			goto errout;
+	} else
+		icount->multiple = 0;
+
+	*ret = icount;
+	return 0;
+
+errout:
+	ext2fs_free_icount(icount);
+	return(retval);
+}
+
+#ifdef CONFIG_TDB
+struct uuid {
+	__u32	time_low;
+	__u16	time_mid;
+	__u16	time_hi_and_version;
+	__u16	clock_seq;
+	__u8	node[6];
+};
+
+static void unpack_uuid(void *in, struct uuid *uu)
+{
+	__u8	*ptr = in;
+	__u32	tmp;
+
+	tmp = *ptr++;
+	tmp = (tmp << 8) | *ptr++;
+	tmp = (tmp << 8) | *ptr++;
+	tmp = (tmp << 8) | *ptr++;
+	uu->time_low = tmp;
+
+	tmp = *ptr++;
+	tmp = (tmp << 8) | *ptr++;
+	uu->time_mid = tmp;
+
+	tmp = *ptr++;
+	tmp = (tmp << 8) | *ptr++;
+	uu->time_hi_and_version = tmp;
+
+	tmp = *ptr++;
+	tmp = (tmp << 8) | *ptr++;
+	uu->clock_seq = tmp;
+
+	memcpy(uu->node, ptr, 6);
+}
+
+static void uuid_unparse(void *uu, char *out)
+{
+	struct uuid uuid;
+
+	unpack_uuid(uu, &uuid);
+	sprintf(out,
+		"%08x-%04x-%04x-%02x%02x-%02x%02x%02x%02x%02x%02x",
+		uuid.time_low, uuid.time_mid, uuid.time_hi_and_version,
+		uuid.clock_seq >> 8, uuid.clock_seq & 0xFF,
+		uuid.node[0], uuid.node[1], uuid.node[2],
+		uuid.node[3], uuid.node[4], uuid.node[5]);
+}
+#endif
+
+errcode_t ext2fs_create_icount_tdb(ext2_filsys fs EXT2FS_NO_TDB_UNUSED,
+				   char *tdb_dir EXT2FS_NO_TDB_UNUSED,
+				   int flags EXT2FS_NO_TDB_UNUSED,
+				   ext2_icount_t *ret EXT2FS_NO_TDB_UNUSED)
+{
+#ifdef CONFIG_TDB
+	ext2_icount_t	icount;
+	errcode_t	retval;
+	char 		*fn, uuid[40];
+	ext2_ino_t	num_inodes;
+	mode_t		save_umask;
+	int		fd;
+
+	retval = alloc_icount(fs, flags,  &icount);
+	if (retval)
+		return retval;
+
+	retval = ext2fs_get_mem(strlen(tdb_dir) + 64, &fn);
+	if (retval)
+		goto errout;
+	uuid_unparse(fs->super->s_uuid, uuid);
+	sprintf(fn, "%s/%s-icount-XXXXXX", tdb_dir, uuid);
+	save_umask = umask(077);
+	fd = mkstemp(fn);
+	if (fd < 0) {
+		retval = errno;
+		ext2fs_free_mem(&fn);
+		goto errout;
+	}
+	icount->tdb_fn = fn;
+	umask(save_umask);
+	/*
+	 * This is an overestimate of the size that we will need; the
+	 * ideal value is the number of used inodes with a count
+	 * greater than 1.  OTOH the times when we really need this is
+	 * with the backup programs that use lots of hard links, in
+	 * which case the number of inodes in use approaches the ideal
+	 * value.
+	 */
+	num_inodes = fs->super->s_inodes_count - fs->super->s_free_inodes_count;
+
+	icount->tdb = tdb_open(fn, num_inodes, TDB_NOLOCK | TDB_NOSYNC,
+			       O_RDWR | O_CREAT | O_TRUNC, 0600);
+	close(fd);
+	if (icount->tdb == NULL) {
+		retval = errno;
+		goto errout;
+	}
+	*ret = icount;
+	return 0;
+errout:
+	ext2fs_free_icount(icount);
+	return(retval);
+#else
+	return EXT2_ET_UNIMPLEMENTED;
+#endif
+}
+
+errcode_t ext2fs_create_icount2(ext2_filsys fs, int flags, unsigned int size,
+				ext2_icount_t hint, ext2_icount_t *ret)
+{
+	ext2_icount_t	icount;
+	errcode_t	retval;
+	size_t		bytes;
+	ext2_ino_t	i;
+
+	if (hint) {
+		EXT2_CHECK_MAGIC(hint, EXT2_ET_MAGIC_ICOUNT);
+		if (hint->size > size)
+			size = (size_t) hint->size;
+	}
+
+	retval = alloc_icount(fs, flags, &icount);
+	if (retval)
+		return retval;
+
+	if (icount->fullmap)
+		goto successout;
+
+	if (size) {
+		icount->size = size;
+	} else {
+		/*
+		 * Figure out how many special case inode counts we will
+		 * have.  We know we will need one for each directory;
+		 * we also need to reserve some extra room for file links
+		 */
+		retval = ext2fs_get_num_dirs(fs, &icount->size);
+		if (retval)
+			goto errout;
+		icount->size += fs->super->s_inodes_count / 50;
+	}
+
+	bytes = (size_t) (icount->size * sizeof(struct ext2_icount_el));
+#if 0
+	printf("Icount allocated %u entries, %d bytes.\n",
+	       icount->size, bytes);
+#endif
+	retval = ext2fs_get_array(icount->size, sizeof(struct ext2_icount_el),
+			 &icount->list);
+	if (retval)
+		goto errout;
+	memset(icount->list, 0, bytes);
+
+	icount->count = 0;
+	icount->cursor = 0;
+
+	/*
+	 * Populate the sorted list with those entries which were
+	 * found in the hint icount (since those are ones which will
+	 * likely need to be in the sorted list this time around).
+	 */
+	if (hint) {
+		for (i=0; i < hint->count; i++)
+			icount->list[i].ino = hint->list[i].ino;
+		icount->count = hint->count;
+	}
+
+successout:
+	*ret = icount;
+	return 0;
+
+errout:
+	ext2fs_free_icount(icount);
+	return(retval);
+}
+
+errcode_t ext2fs_create_icount(ext2_filsys fs, int flags,
+			       unsigned int size,
+			       ext2_icount_t *ret)
+{
+	return ext2fs_create_icount2(fs, flags, size, 0, ret);
+}
+
+/*
+ * insert_icount_el() --- Insert a new entry into the sorted list at a
+ * 	specified position.
+ */
+static struct ext2_icount_el *insert_icount_el(ext2_icount_t icount,
+					    ext2_ino_t ino, int pos)
+{
+	struct ext2_icount_el 	*el;
+	errcode_t		retval;
+	ext2_ino_t		new_size = 0;
+	int			num;
+
+	if (icount->last_lookup && icount->last_lookup->ino == ino)
+		return icount->last_lookup;
+
+	if (icount->count >= icount->size) {
+		if (icount->count) {
+			new_size = icount->list[(unsigned)icount->count-1].ino;
+			new_size = (ext2_ino_t) (icount->count *
+				((float) icount->num_inodes / new_size));
+		}
+		if (new_size < (icount->size + 100))
+			new_size = icount->size + 100;
+#if 0
+		printf("Reallocating icount %u entries...\n", new_size);
+#endif
+		retval = ext2fs_resize_mem((size_t) icount->size *
+					   sizeof(struct ext2_icount_el),
+					   (size_t) new_size *
+					   sizeof(struct ext2_icount_el),
+					   &icount->list);
+		if (retval)
+			return 0;
+		icount->size = new_size;
+	}
+	num = (int) icount->count - pos;
+	if (num < 0)
+		return 0;	/* should never happen */
+	if (num) {
+		memmove(&icount->list[pos+1], &icount->list[pos],
+			sizeof(struct ext2_icount_el) * num);
+	}
+	icount->count++;
+	el = &icount->list[pos];
+	el->count = 0;
+	el->ino = ino;
+	icount->last_lookup = el;
+	return el;
+}
+
+/*
+ * get_icount_el() --- given an inode number, try to find icount
+ * 	information in the sorted list.  If the create flag is set,
+ * 	and we can't find an entry, create one in the sorted list.
+ */
+static struct ext2_icount_el *get_icount_el(ext2_icount_t icount,
+					    ext2_ino_t ino, int create)
+{
+	int	low, high, mid;
+
+	if (!icount || !icount->list)
+		return 0;
+
+	if (create && ((icount->count == 0) ||
+		       (ino > icount->list[(unsigned)icount->count-1].ino))) {
+		return insert_icount_el(icount, ino, (unsigned) icount->count);
+	}
+	if (icount->count == 0)
+		return 0;
+
+	if (icount->cursor >= icount->count)
+		icount->cursor = 0;
+	if (ino == icount->list[icount->cursor].ino)
+		return &icount->list[icount->cursor++];
+#if 0
+	printf("Non-cursor get_icount_el: %u\n", ino);
+#endif
+	low = 0;
+	high = (int) icount->count-1;
+	while (low <= high) {
+		mid = ((unsigned)low + (unsigned)high) >> 1;
+		if (ino == icount->list[mid].ino) {
+			icount->cursor = mid+1;
+			return &icount->list[mid];
+		}
+		if (ino < icount->list[mid].ino)
+			high = mid-1;
+		else
+			low = mid+1;
+	}
+	/*
+	 * If we need to create a new entry, it should be right at
+	 * low (where high will be left at low-1).
+	 */
+	if (create)
+		return insert_icount_el(icount, ino, low);
+	return 0;
+}
+
+static errcode_t set_inode_count(ext2_icount_t icount, ext2_ino_t ino,
+				 __u32 count)
+{
+	struct ext2_icount_el 	*el;
+#ifdef CONFIG_TDB
+	TDB_DATA key, data;
+
+	if (icount->tdb) {
+		key.dptr = (unsigned char *) &ino;
+		key.dsize = sizeof(ext2_ino_t);
+		data.dptr = (unsigned char *) &count;
+		data.dsize = sizeof(__u32);
+		if (count) {
+			if (tdb_store(icount->tdb, key, data, TDB_REPLACE))
+				return tdb_error(icount->tdb) +
+					EXT2_ET_TDB_SUCCESS;
+		} else {
+			if (tdb_delete(icount->tdb, key))
+				return tdb_error(icount->tdb) +
+					EXT2_ET_TDB_SUCCESS;
+		}
+		return 0;
+	}
+#endif
+	if (icount->fullmap) {
+		icount->fullmap[ino] = icount_16_xlate(count);
+		return 0;
+	}
+
+	el = get_icount_el(icount, ino, 1);
+	if (!el)
+		return EXT2_ET_NO_MEMORY;
+
+	el->count = count;
+	return 0;
+}
+
+static errcode_t get_inode_count(ext2_icount_t icount, ext2_ino_t ino,
+				 __u32 *count)
+{
+	struct ext2_icount_el 	*el;
+#ifdef CONFIG_TDB
+	TDB_DATA key, data;
+
+	if (icount->tdb) {
+		key.dptr = (unsigned char *) &ino;
+		key.dsize = sizeof(ext2_ino_t);
+
+		data = tdb_fetch(icount->tdb, key);
+		if (data.dptr == NULL) {
+			*count = 0;
+			return tdb_error(icount->tdb) + EXT2_ET_TDB_SUCCESS;
+		}
+
+		*count = *((__u32 *) data.dptr);
+		free(data.dptr);
+		return 0;
+	}
+#endif
+	if (icount->fullmap) {
+		*count = icount->fullmap[ino];
+		return 0;
+	}
+
+	el = get_icount_el(icount, ino, 0);
+	if (!el) {
+		*count = 0;
+		return ENOENT;
+	}
+
+	*count = el->count;
+	return 0;
+}
+
+errcode_t ext2fs_icount_validate(ext2_icount_t icount, FILE *out)
+{
+	errcode_t	ret = 0;
+	unsigned int	i;
+	const char *bad = "bad icount";
+
+	EXT2_CHECK_MAGIC(icount, EXT2_ET_MAGIC_ICOUNT);
+
+	if (icount->count > icount->size) {
+		fprintf(out, "%s: count > size\n", bad);
+		return EXT2_ET_INVALID_ARGUMENT;
+	}
+	for (i=1; i < icount->count; i++) {
+		if (icount->list[i-1].ino >= icount->list[i].ino) {
+			fprintf(out, "%s: list[%d].ino=%u, list[%d].ino=%u\n",
+				bad, i-1, icount->list[i-1].ino,
+				i, icount->list[i].ino);
+			ret = EXT2_ET_INVALID_ARGUMENT;
+		}
+	}
+	return ret;
+}
+
+errcode_t ext2fs_icount_fetch(ext2_icount_t icount, ext2_ino_t ino, __u16 *ret)
+{
+	__u32	val;
+	EXT2_CHECK_MAGIC(icount, EXT2_ET_MAGIC_ICOUNT);
+
+	if (!ino || (ino > icount->num_inodes))
+		return EXT2_ET_INVALID_ARGUMENT;
+
+	if (!icount->fullmap) {
+		if (ext2fs_test_inode_bitmap2(icount->single, ino)) {
+			*ret = 1;
+			return 0;
+		}
+		if (icount->multiple &&
+			!ext2fs_test_inode_bitmap2(icount->multiple, ino)) {
+			*ret = 0;
+			return 0;
+		}
+	}
+	get_inode_count(icount, ino, &val);
+	*ret = icount_16_xlate(val);
+	return 0;
+}
+
+errcode_t ext2fs_icount_increment(ext2_icount_t icount, ext2_ino_t ino,
+				  __u16 *ret)
+{
+	__u32			curr_value;
+
+	EXT2_CHECK_MAGIC(icount, EXT2_ET_MAGIC_ICOUNT);
+
+	if (!ino || (ino > icount->num_inodes))
+		return EXT2_ET_INVALID_ARGUMENT;
+
+	if (icount->fullmap) {
+		curr_value = icount_16_xlate(icount->fullmap[ino] + 1);
+		icount->fullmap[ino] = curr_value;
+	} else if (ext2fs_test_inode_bitmap2(icount->single, ino)) {
+		/*
+		 * If the existing count is 1, then we know there is
+		 * no entry in the list.
+		 */
+		if (set_inode_count(icount, ino, 2))
+			return EXT2_ET_NO_MEMORY;
+		curr_value = 2;
+		ext2fs_unmark_inode_bitmap2(icount->single, ino);
+	} else if (icount->multiple) {
+		/*
+		 * The count is either zero or greater than 1; if the
+		 * inode is set in icount->multiple, then there should
+		 * be an entry in the list, so we need to fix it.
+		 */
+		if (ext2fs_test_inode_bitmap2(icount->multiple, ino)) {
+			get_inode_count(icount, ino, &curr_value);
+			curr_value++;
+			if (set_inode_count(icount, ino, curr_value))
+				return EXT2_ET_NO_MEMORY;
+		} else {
+			/*
+			 * The count was zero; mark the single bitmap
+			 * and return.
+			 */
+			ext2fs_mark_inode_bitmap2(icount->single, ino);
+			if (ret)
+				*ret = 1;
+			return 0;
+		}
+	} else {
+		/*
+		 * The count is either zero or greater than 1; try to
+		 * find an entry in the list to determine which.
+		 */
+		get_inode_count(icount, ino, &curr_value);
+		curr_value++;
+		if (set_inode_count(icount, ino, curr_value))
+			return EXT2_ET_NO_MEMORY;
+	}
+	if (icount->multiple)
+		ext2fs_mark_inode_bitmap2(icount->multiple, ino);
+	if (ret)
+		*ret = icount_16_xlate(curr_value);
+	return 0;
+}
+
+errcode_t ext2fs_icount_decrement(ext2_icount_t icount, ext2_ino_t ino,
+				  __u16 *ret)
+{
+	__u32			curr_value;
+
+	if (!ino || (ino > icount->num_inodes))
+		return EXT2_ET_INVALID_ARGUMENT;
+
+	EXT2_CHECK_MAGIC(icount, EXT2_ET_MAGIC_ICOUNT);
+
+	if (icount->fullmap) {
+		if (!icount->fullmap[ino])
+			return EXT2_ET_INVALID_ARGUMENT;
+
+		curr_value = --icount->fullmap[ino];
+		if (ret)
+			*ret = icount_16_xlate(curr_value);
+		return 0;
+	}
+
+	if (ext2fs_test_inode_bitmap2(icount->single, ino)) {
+		ext2fs_unmark_inode_bitmap2(icount->single, ino);
+		if (icount->multiple)
+			ext2fs_unmark_inode_bitmap2(icount->multiple, ino);
+		else {
+			set_inode_count(icount, ino, 0);
+		}
+		if (ret)
+			*ret = 0;
+		return 0;
+	}
+
+	if (icount->multiple &&
+	    !ext2fs_test_inode_bitmap2(icount->multiple, ino))
+		return EXT2_ET_INVALID_ARGUMENT;
+
+	get_inode_count(icount, ino, &curr_value);
+	if (!curr_value)
+		return EXT2_ET_INVALID_ARGUMENT;
+	curr_value--;
+	if (set_inode_count(icount, ino, curr_value))
+		return EXT2_ET_NO_MEMORY;
+
+	if (curr_value == 1)
+		ext2fs_mark_inode_bitmap2(icount->single, ino);
+	if ((curr_value == 0) && icount->multiple)
+		ext2fs_unmark_inode_bitmap2(icount->multiple, ino);
+
+	if (ret)
+		*ret = icount_16_xlate(curr_value);
+	return 0;
+}
+
+errcode_t ext2fs_icount_store(ext2_icount_t icount, ext2_ino_t ino,
+			      __u16 count)
+{
+	if (!ino || (ino > icount->num_inodes))
+		return EXT2_ET_INVALID_ARGUMENT;
+
+	EXT2_CHECK_MAGIC(icount, EXT2_ET_MAGIC_ICOUNT);
+
+	if (icount->fullmap)
+		return set_inode_count(icount, ino, count);
+
+	if (count == 1) {
+		ext2fs_mark_inode_bitmap2(icount->single, ino);
+		if (icount->multiple)
+			ext2fs_unmark_inode_bitmap2(icount->multiple, ino);
+		return 0;
+	}
+	if (count == 0) {
+		ext2fs_unmark_inode_bitmap2(icount->single, ino);
+		if (icount->multiple) {
+			/*
+			 * If the icount->multiple bitmap is enabled,
+			 * we can just clear both bitmaps and we're done
+			 */
+			ext2fs_unmark_inode_bitmap2(icount->multiple, ino);
+		} else
+			set_inode_count(icount, ino, 0);
+		return 0;
+	}
+
+	if (set_inode_count(icount, ino, count))
+		return EXT2_ET_NO_MEMORY;
+	ext2fs_unmark_inode_bitmap2(icount->single, ino);
+	if (icount->multiple)
+		ext2fs_mark_inode_bitmap2(icount->multiple, ino);
+	return 0;
+}
+
+ext2_ino_t ext2fs_get_icount_size(ext2_icount_t icount)
+{
+	if (!icount || icount->magic != EXT2_ET_MAGIC_ICOUNT)
+		return 0;
+
+	return icount->size;
+}
+
+#ifdef DEBUG
+
+ext2_filsys	test_fs;
+ext2_icount_t	icount;
+
+#define EXIT		0x00
+#define FETCH		0x01
+#define STORE		0x02
+#define INCREMENT	0x03
+#define DECREMENT	0x04
+
+struct test_program {
+	int		cmd;
+	ext2_ino_t	ino;
+	__u16		arg;
+	__u16		expected;
+};
+
+struct test_program prog[] = {
+	{ STORE, 42, 42, 42 },
+	{ STORE, 1,  1, 1 },
+	{ STORE, 2,  2, 2 },
+	{ STORE, 3,  3, 3 },
+	{ STORE, 10, 1, 1 },
+	{ STORE, 42, 0, 0 },
+	{ INCREMENT, 5, 0, 1 },
+	{ INCREMENT, 5, 0, 2 },
+	{ INCREMENT, 5, 0, 3 },
+	{ INCREMENT, 5, 0, 4 },
+	{ DECREMENT, 5, 0, 3 },
+	{ DECREMENT, 5, 0, 2 },
+	{ DECREMENT, 5, 0, 1 },
+	{ DECREMENT, 5, 0, 0 },
+	{ FETCH, 10, 0, 1 },
+	{ FETCH, 1, 0, 1 },
+	{ FETCH, 2, 0, 2 },
+	{ FETCH, 3, 0, 3 },
+	{ INCREMENT, 1, 0, 2 },
+	{ DECREMENT, 2, 0, 1 },
+	{ DECREMENT, 2, 0, 0 },
+	{ FETCH, 12, 0, 0 },
+	{ EXIT, 0, 0, 0 }
+};
+
+struct test_program extended[] = {
+	{ STORE, 1,  1, 1 },
+	{ STORE, 2,  2, 2 },
+	{ STORE, 3,  3, 3 },
+	{ STORE, 4,  4, 4 },
+	{ STORE, 5,  5, 5 },
+	{ STORE, 6,  1, 1 },
+	{ STORE, 7,  2, 2 },
+	{ STORE, 8,  3, 3 },
+	{ STORE, 9,  4, 4 },
+	{ STORE, 10, 5, 5 },
+	{ STORE, 11, 1, 1 },
+	{ STORE, 12, 2, 2 },
+	{ STORE, 13, 3, 3 },
+	{ STORE, 14, 4, 4 },
+	{ STORE, 15, 5, 5 },
+	{ STORE, 16, 1, 1 },
+	{ STORE, 17, 2, 2 },
+	{ STORE, 18, 3, 3 },
+	{ STORE, 19, 4, 4 },
+	{ STORE, 20, 5, 5 },
+	{ STORE, 21, 1, 1 },
+	{ STORE, 22, 2, 2 },
+	{ STORE, 23, 3, 3 },
+	{ STORE, 24, 4, 4 },
+	{ STORE, 25, 5, 5 },
+	{ STORE, 26, 1, 1 },
+	{ STORE, 27, 2, 2 },
+	{ STORE, 28, 3, 3 },
+	{ STORE, 29, 4, 4 },
+	{ STORE, 30, 5, 5 },
+	{ EXIT, 0, 0, 0 }
+};
+
+/*
+ * Setup the variables for doing the inode scan test.
+ */
+static void setup(void)
+{
+	errcode_t	retval;
+	struct ext2_super_block param;
+
+	initialize_ext2_error_table();
+
+	memset(&param, 0, sizeof(param));
+	ext2fs_blocks_count_set(&param, 12000);
+
+	retval = ext2fs_initialize("test fs", EXT2_FLAG_64BITS, &param,
+				   test_io_manager, &test_fs);
+	if (retval) {
+		com_err("setup", retval,
+			"while initializing filesystem");
+		exit(1);
+	}
+	retval = ext2fs_allocate_tables(test_fs);
+	if (retval) {
+		com_err("setup", retval,
+			"while allocating tables for test filesystem");
+		exit(1);
+	}
+}
+
+int run_test(int flags, int size, char *dir, struct test_program *prog)
+{
+	errcode_t	retval;
+	ext2_icount_t	icount;
+	struct test_program *pc;
+	__u16		result;
+	int		problem = 0;
+
+	if (dir) {
+#ifdef CONFIG_TDB
+		retval = ext2fs_create_icount_tdb(test_fs, dir,
+						  flags, &icount);
+		if (retval) {
+			com_err("run_test", retval,
+				"while creating icount using tdb");
+			exit(1);
+		}
+#else
+		printf("Skipped\n");
+		return 0;
+#endif
+	} else {
+		retval = ext2fs_create_icount2(test_fs, flags, size, 0,
+					       &icount);
+		if (retval) {
+			com_err("run_test", retval, "while creating icount");
+			exit(1);
+		}
+	}
+	for (pc = prog; pc->cmd != EXIT; pc++) {
+		switch (pc->cmd) {
+		case FETCH:
+			printf("icount_fetch(%u) = ", pc->ino);
+			break;
+		case STORE:
+			retval = ext2fs_icount_store(icount, pc->ino, pc->arg);
+			if (retval) {
+				com_err("run_test", retval,
+					"while calling icount_store");
+				exit(1);
+			}
+			printf("icount_store(%u, %u) = ", pc->ino, pc->arg);
+			break;
+		case INCREMENT:
+			retval = ext2fs_icount_increment(icount, pc->ino, 0);
+			if (retval) {
+				com_err("run_test", retval,
+					"while calling icount_increment");
+				exit(1);
+			}
+			printf("icount_increment(%u) = ", pc->ino);
+			break;
+		case DECREMENT:
+			retval = ext2fs_icount_decrement(icount, pc->ino, 0);
+			if (retval) {
+				com_err("run_test", retval,
+					"while calling icount_decrement");
+				exit(1);
+			}
+			printf("icount_decrement(%u) = ", pc->ino);
+			break;
+		}
+		retval = ext2fs_icount_fetch(icount, pc->ino, &result);
+		if (retval) {
+			com_err("run_test", retval,
+				"while calling icount_fetch");
+			exit(1);
+		}
+		printf("%u (%s)\n", result, (result == pc->expected) ?
+		       "OK" : "NOT OK");
+		if (result != pc->expected)
+			problem++;
+	}
+	printf("icount size is %u\n", ext2fs_get_icount_size(icount));
+	retval = ext2fs_icount_validate(icount, stdout);
+	if (retval) {
+		com_err("run_test", retval, "while calling icount_validate");
+		exit(1);
+	}
+	ext2fs_free_icount(icount);
+	return problem;
+}
+
+
+int main(int argc, char **argv)
+{
+	int failed = 0;
+
+	setup();
+	printf("Standard icount run:\n");
+	failed += run_test(0, 0, 0, prog);
+	printf("\nMultiple bitmap test:\n");
+	failed += run_test(EXT2_ICOUNT_OPT_INCREMENT, 0, 0, prog);
+	printf("\nResizing icount:\n");
+	failed += run_test(0, 3, 0, extended);
+	printf("\nStandard icount run with tdb:\n");
+	failed += run_test(0, 0, ".", prog);
+	printf("\nMultiple bitmap test with tdb:\n");
+	failed += run_test(EXT2_ICOUNT_OPT_INCREMENT, 0, ".", prog);
+	if (failed)
+		printf("FAILED!\n");
+	return failed;
+}
+#endif
diff --git a/lib/ext2fs/imager.c b/lib/ext2fs/imager.c
new file mode 100644
index 0000000..23290a6
--- /dev/null
+++ b/lib/ext2fs/imager.c
@@ -0,0 +1,470 @@
+/*
+ * image.c --- writes out the critical parts of the filesystem as a
+ * 	flat file.
+ *
+ * Copyright (C) 2000 Theodore Ts'o.
+ *
+ * Note: this uses the POSIX IO interfaces, unlike most of the other
+ * functions in this library.  So sue me.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#if HAVE_ERRNO_H
+#include <errno.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+#ifndef HAVE_TYPE_SSIZE_T
+typedef int ssize_t;
+#endif
+
+/*
+ * This function returns 1 if the specified block is all zeros
+ */
+static int check_zero_block(char *buf, int blocksize)
+{
+	char	*cp = buf;
+	int	left = blocksize;
+
+	while (left > 0) {
+		if (*cp++)
+			return 0;
+		left--;
+	}
+	return 1;
+}
+
+/*
+ * Write the inode table out as a single block.
+ */
+#define BUF_BLOCKS	32
+
+errcode_t ext2fs_image_inode_write(ext2_filsys fs, int fd, int flags)
+{
+	dgrp_t		group;
+	ssize_t		left, c, d;
+	char		*buf, *cp;
+	blk64_t		blk;
+	ssize_t		actual;
+	errcode_t	retval;
+	ext2_loff_t	r;
+
+	buf = malloc(fs->blocksize * BUF_BLOCKS);
+	if (!buf)
+		return ENOMEM;
+
+	for (group = 0; group < fs->group_desc_count; group++) {
+		blk = ext2fs_inode_table_loc(fs, group);
+		if (!blk) {
+			retval = EXT2_ET_MISSING_INODE_TABLE;
+			goto errout;
+		}
+		left = fs->inode_blocks_per_group;
+		if ((blk < fs->super->s_first_data_block) ||
+		    (blk + left - 1 >= ext2fs_blocks_count(fs->super))) {
+			retval = EXT2_ET_GDESC_BAD_INODE_TABLE;
+			goto errout;
+		}
+		while (left) {
+			c = BUF_BLOCKS;
+			if (c > left)
+				c = left;
+			retval = io_channel_read_blk64(fs->io, blk, c, buf);
+			if (retval)
+				goto errout;
+			cp = buf;
+			while (c) {
+				if (!(flags & IMAGER_FLAG_SPARSEWRITE)) {
+					d = c;
+					goto skip_sparse;
+				}
+				/* Skip zero blocks */
+				if (check_zero_block(cp, fs->blocksize)) {
+					c--;
+					blk++;
+					left--;
+					cp += fs->blocksize;
+					r = ext2fs_llseek(fd, fs->blocksize,
+							  SEEK_CUR);
+					if (r < 0) {
+						retval = errno;
+						goto errout;
+					}
+					continue;
+				}
+				/* Find non-zero blocks */
+				for (d = 1; d < c; d++) {
+					if (check_zero_block(cp +
+							     d * fs->blocksize,
+							     fs->blocksize))
+						break;
+				}
+			skip_sparse:
+				actual = write(fd, cp, d * fs->blocksize);
+				if (actual == -1) {
+					retval = errno;
+					goto errout;
+				}
+				if (actual != d * fs->blocksize) {
+					retval = EXT2_ET_SHORT_WRITE;
+					goto errout;
+				}
+				blk += d;
+				left -= d;
+				cp += d * fs->blocksize;
+				c -= d;
+			}
+		}
+	}
+	retval = 0;
+
+errout:
+	free(buf);
+	return retval;
+}
+
+/*
+ * Read in the inode table and stuff it into place
+ */
+errcode_t ext2fs_image_inode_read(ext2_filsys fs, int fd,
+				  int flags EXT2FS_ATTR((unused)))
+{
+	dgrp_t		group;
+	ssize_t		c, left;
+	char		*buf;
+	blk64_t		blk;
+	ssize_t		actual;
+	errcode_t	retval;
+
+	buf = malloc(fs->blocksize * BUF_BLOCKS);
+	if (!buf)
+		return ENOMEM;
+
+	for (group = 0; group < fs->group_desc_count; group++) {
+		blk = ext2fs_inode_table_loc(fs, group);
+		if (!blk) {
+			retval = EXT2_ET_MISSING_INODE_TABLE;
+			goto errout;
+		}
+		left = fs->inode_blocks_per_group;
+		while (left) {
+			c = BUF_BLOCKS;
+			if (c > left)
+				c = left;
+			actual = read(fd, buf, fs->blocksize * c);
+			if (actual == -1) {
+				retval = errno;
+				goto errout;
+			}
+			if (actual != fs->blocksize * c) {
+				retval = EXT2_ET_SHORT_READ;
+				goto errout;
+			}
+			retval = io_channel_write_blk64(fs->io, blk, c, buf);
+			if (retval)
+				goto errout;
+
+			blk += c;
+			left -= c;
+		}
+	}
+	retval = ext2fs_flush_icache(fs);
+
+errout:
+	free(buf);
+	return retval;
+}
+
+/*
+ * Write out superblock and group descriptors
+ */
+errcode_t ext2fs_image_super_write(ext2_filsys fs, int fd,
+				   int flags EXT2FS_ATTR((unused)))
+{
+	char		*buf, *cp;
+	ssize_t		actual;
+	errcode_t	retval;
+#ifdef WORDS_BIGENDIAN
+	unsigned int	groups_per_block;
+	struct		ext2_group_desc *gdp;
+	int		j;
+#endif
+
+	if (fs->group_desc == NULL)
+		return EXT2_ET_NO_GDESC;
+
+	buf = malloc(fs->blocksize);
+	if (!buf)
+		return ENOMEM;
+
+	/*
+	 * Write out the superblock
+	 */
+	memset(buf, 0, fs->blocksize);
+#ifdef WORDS_BIGENDIAN
+	/*
+	 * We're writing out superblock so let's convert
+	 * it to little endian and then back if needed
+	 */
+	ext2fs_swap_super(fs->super);
+	memcpy(buf, fs->super, SUPERBLOCK_SIZE);
+	ext2fs_swap_super(fs->super);
+#else
+	memcpy(buf, fs->super, SUPERBLOCK_SIZE);
+#endif
+	actual = write(fd, buf, fs->blocksize);
+	if (actual == -1) {
+		retval = errno;
+		goto errout;
+	}
+	if (actual != (ssize_t) fs->blocksize) {
+		retval = EXT2_ET_SHORT_WRITE;
+		goto errout;
+	}
+
+	/*
+	 * Now write out the block group descriptors
+	 */
+
+	cp = (char *) fs->group_desc;
+
+#ifdef WORDS_BIGENDIAN
+	/*
+	 * Convert group descriptors to little endian and back
+	 * if needed
+	 */
+	groups_per_block = EXT2_DESC_PER_BLOCK(fs->super);
+	for (j=0; j < groups_per_block*fs->desc_blocks; j++) {
+		gdp = ext2fs_group_desc(fs, fs->group_desc, j);
+		if (gdp)
+			ext2fs_swap_group_desc2(fs, gdp);
+	}
+#endif
+
+	actual = write(fd, cp, (ssize_t)fs->blocksize * fs->desc_blocks);
+
+
+#ifdef WORDS_BIGENDIAN
+	groups_per_block = EXT2_DESC_PER_BLOCK(fs->super);
+	for (j=0; j < groups_per_block*fs->desc_blocks; j++) {
+		gdp = ext2fs_group_desc(fs, fs->group_desc, j);
+		if (gdp)
+			ext2fs_swap_group_desc2(fs, gdp);
+	}
+#endif
+
+	if (actual == -1) {
+		retval = errno;
+		goto errout;
+	}
+	if (actual != (ssize_t)(fs->blocksize * fs->desc_blocks)) {
+		retval = EXT2_ET_SHORT_WRITE;
+		goto errout;
+	}
+
+	retval = 0;
+
+errout:
+	free(buf);
+	return retval;
+}
+
+/*
+ * Read the superblock and group descriptors and overwrite them.
+ */
+errcode_t ext2fs_image_super_read(ext2_filsys fs, int fd,
+				  int flags EXT2FS_ATTR((unused)))
+{
+	char		*buf;
+	ssize_t		actual, size;
+	errcode_t	retval;
+
+	size = (ssize_t)fs->blocksize * (fs->group_desc_count + 1);
+	buf = malloc(size);
+	if (!buf)
+		return ENOMEM;
+
+	/*
+	 * Read it all in.
+	 */
+	actual = read(fd, buf, size);
+	if (actual == -1) {
+		retval = errno;
+		goto errout;
+	}
+	if (actual != size) {
+		retval = EXT2_ET_SHORT_READ;
+		goto errout;
+	}
+
+	/*
+	 * Now copy in the superblock and group descriptors
+	 */
+	memcpy(fs->super, buf, SUPERBLOCK_SIZE);
+
+	memcpy(fs->group_desc, buf + fs->blocksize,
+	       (ssize_t)fs->blocksize * fs->group_desc_count);
+
+	retval = 0;
+
+errout:
+	free(buf);
+	return retval;
+}
+
+/*
+ * Write the block/inode bitmaps.
+ */
+errcode_t ext2fs_image_bitmap_write(ext2_filsys fs, int fd, int flags)
+{
+	ext2fs_generic_bitmap	bmap;
+	errcode_t		retval;
+	ssize_t			actual;
+	size_t			c;
+	__u64			itr, cnt, size, total_size;
+	char			buf[1024];
+
+	if (flags & IMAGER_FLAG_INODEMAP) {
+		if (!fs->inode_map) {
+			retval = ext2fs_read_inode_bitmap(fs);
+			if (retval)
+				return retval;
+		}
+		bmap = fs->inode_map;
+		itr = 1;
+		cnt = (__u64)EXT2_INODES_PER_GROUP(fs->super) *
+			fs->group_desc_count;
+		size = (EXT2_INODES_PER_GROUP(fs->super) / 8);
+	} else {
+		if (!fs->block_map) {
+			retval = ext2fs_read_block_bitmap(fs);
+			if (retval)
+				return retval;
+		}
+		bmap = fs->block_map;
+		itr = fs->super->s_first_data_block;
+		cnt = EXT2_GROUPS_TO_CLUSTERS(fs->super, fs->group_desc_count);
+		size = EXT2_CLUSTERS_PER_GROUP(fs->super) / 8;
+	}
+	total_size = size * fs->group_desc_count;
+
+	while (cnt > 0) {
+		size = sizeof(buf);
+		if (size > (cnt >> 3))
+			size = (cnt >> 3);
+		if (size == 0)
+			break;
+
+		retval = ext2fs_get_generic_bmap_range(bmap, itr,
+						       size << 3, buf);
+		if (retval)
+			return retval;
+
+		actual = write(fd, buf, size);
+		if (actual == -1)
+			return errno;
+		if (actual != (int) size)
+			return EXT2_ET_SHORT_READ;
+
+		itr += size << 3;
+		cnt -= size << 3;
+	}
+
+	size = total_size % fs->blocksize;
+	memset(buf, 0, sizeof(buf));
+	if (size) {
+		size = fs->blocksize - size;
+		while (size) {
+			c = size;
+			if (c > (int) sizeof(buf))
+				c = sizeof(buf);
+			actual = write(fd, buf, c);
+			if (actual < 0)
+				return errno;
+			if ((size_t) actual != c)
+				return EXT2_ET_SHORT_WRITE;
+			size -= c;
+		}
+	}
+	return 0;
+}
+
+
+/*
+ * Read the block/inode bitmaps.
+ */
+errcode_t ext2fs_image_bitmap_read(ext2_filsys fs, int fd, int flags)
+{
+	ext2fs_generic_bitmap	bmap;
+	errcode_t		retval;
+	__u64			itr, cnt;
+	char			buf[1024];
+	unsigned int		size;
+	ssize_t			actual;
+
+	if (flags & IMAGER_FLAG_INODEMAP) {
+		if (!fs->inode_map) {
+			retval = ext2fs_read_inode_bitmap(fs);
+			if (retval)
+				return retval;
+		}
+		bmap = fs->inode_map;
+		itr = 1;
+		cnt = (__u64)EXT2_INODES_PER_GROUP(fs->super) *
+			fs->group_desc_count;
+		size = (EXT2_INODES_PER_GROUP(fs->super) / 8);
+	} else {
+		if (!fs->block_map) {
+			retval = ext2fs_read_block_bitmap(fs);
+			if (retval)
+				return retval;
+		}
+		bmap = fs->block_map;
+		itr = fs->super->s_first_data_block;
+		cnt = EXT2_GROUPS_TO_BLOCKS(fs->super, fs->group_desc_count);
+		size = EXT2_BLOCKS_PER_GROUP(fs->super) / 8;
+	}
+
+	while (cnt > 0) {
+		size = sizeof(buf);
+		if (size > (cnt >> 3))
+			size = (cnt >> 3);
+		if (size == 0)
+			break;
+
+		actual = read(fd, buf, size);
+		if (actual == -1)
+			return errno;
+		if (actual != (int) size)
+			return EXT2_ET_SHORT_READ;
+
+		retval = ext2fs_set_generic_bmap_range(bmap, itr,
+						       size << 3, buf);
+		if (retval)
+			return retval;
+
+		itr += size << 3;
+		cnt -= size << 3;
+	}
+	return 0;
+}
diff --git a/lib/ext2fs/ind_block.c b/lib/ext2fs/ind_block.c
new file mode 100644
index 0000000..aa82ae6
--- /dev/null
+++ b/lib/ext2fs/ind_block.c
@@ -0,0 +1,67 @@
+/*
+ * ind_block.c --- indirect block I/O routines
+ *
+ * Copyright (C) 1993, 1994, 1995, 1996, 1997, 1998, 1999, 2000,
+ * 	2001, 2002, 2003, 2004, 2005 by  Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+errcode_t ext2fs_read_ind_block(ext2_filsys fs, blk_t blk, void *buf)
+{
+	errcode_t	retval;
+#ifdef WORDS_BIGENDIAN
+	blk_t		*block_nr;
+	int		i;
+	int		limit = fs->blocksize >> 2;
+#endif
+
+	if ((fs->flags & EXT2_FLAG_IMAGE_FILE) &&
+	    (fs->io != fs->image_io))
+		memset(buf, 0, fs->blocksize);
+	else {
+		retval = io_channel_read_blk(fs->io, blk, 1, buf);
+		if (retval)
+			return retval;
+	}
+#ifdef WORDS_BIGENDIAN
+	block_nr = (blk_t *) buf;
+	for (i = 0; i < limit; i++, block_nr++)
+		*block_nr = ext2fs_swab32(*block_nr);
+#endif
+	return 0;
+}
+
+errcode_t ext2fs_write_ind_block(ext2_filsys fs, blk_t blk, void *buf)
+{
+#ifdef WORDS_BIGENDIAN
+	blk_t		*block_nr;
+	int		i;
+	int		limit = fs->blocksize >> 2;
+#endif
+
+	if (fs->flags & EXT2_FLAG_IMAGE_FILE)
+		return 0;
+
+#ifdef WORDS_BIGENDIAN
+	block_nr = (blk_t *) buf;
+	for (i = 0; i < limit; i++, block_nr++)
+		*block_nr = ext2fs_swab32(*block_nr);
+#endif
+	return io_channel_write_blk(fs->io, blk, 1, buf);
+}
+
+
diff --git a/lib/ext2fs/initialize.c b/lib/ext2fs/initialize.c
new file mode 100644
index 0000000..edd692b
--- /dev/null
+++ b/lib/ext2fs/initialize.c
@@ -0,0 +1,671 @@
+/*
+ * initialize.c --- initialize a filesystem handle given superblock
+ * 	parameters.  Used by mke2fs when initializing a filesystem.
+ *
+ * Copyright (C) 1994, 1995, 1996 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+#ifndef O_BINARY
+#define O_BINARY 0
+#endif
+
+#if defined(__linux__)    &&	defined(EXT2_OS_LINUX)
+#define CREATOR_OS EXT2_OS_LINUX
+#else
+#if defined(__GNU__)     &&	defined(EXT2_OS_HURD)
+#define CREATOR_OS EXT2_OS_HURD
+#else
+#if defined(__FreeBSD__) &&	defined(EXT2_OS_FREEBSD)
+#define CREATOR_OS EXT2_OS_FREEBSD
+#else
+#if defined(LITES) 	   &&	defined(EXT2_OS_LITES)
+#define CREATOR_OS EXT2_OS_LITES
+#else
+#define CREATOR_OS EXT2_OS_LINUX /* by default */
+#endif /* defined(LITES) && defined(EXT2_OS_LITES) */
+#endif /* defined(__FreeBSD__) && defined(EXT2_OS_FREEBSD) */
+#endif /* defined(__GNU__)     && defined(EXT2_OS_HURD) */
+#endif /* defined(__linux__)   && defined(EXT2_OS_LINUX) */
+
+/*
+ * Calculate the number of GDT blocks to reserve for online filesystem growth.
+ * The absolute maximum number of GDT blocks we can reserve is determined by
+ * the number of block pointers that can fit into a single block.
+ */
+static unsigned int calc_reserved_gdt_blocks(ext2_filsys fs)
+{
+	struct ext2_super_block *sb = fs->super;
+	unsigned long bpg = sb->s_blocks_per_group;
+	unsigned int gdpb = EXT2_DESC_PER_BLOCK(sb);
+	unsigned long max_blocks = 0xffffffff;
+	unsigned long rsv_groups;
+	unsigned int rsv_gdb;
+
+	/* We set it at 1024x the current filesystem size, or
+	 * the upper block count limit (2^32), whichever is lower.
+	 */
+	if (ext2fs_blocks_count(sb) < max_blocks / 1024)
+		max_blocks = ext2fs_blocks_count(sb) * 1024;
+	/*
+	 * ext2fs_div64_ceil() is unnecessary because max_blocks is
+	 * max _GDT_ blocks, which is limited to 32 bits.
+	 */
+	rsv_groups = ext2fs_div_ceil(max_blocks - sb->s_first_data_block, bpg);
+	rsv_gdb = ext2fs_div_ceil(rsv_groups, gdpb) - fs->desc_blocks;
+	if (rsv_gdb > EXT2_ADDR_PER_BLOCK(sb))
+		rsv_gdb = EXT2_ADDR_PER_BLOCK(sb);
+#ifdef RES_GDT_DEBUG
+	printf("max_blocks %lu, rsv_groups = %lu, rsv_gdb = %u\n",
+	       max_blocks, rsv_groups, rsv_gdb);
+#endif
+
+	return rsv_gdb;
+}
+
+errcode_t ext2fs_initialize(const char *name, int flags,
+			    struct ext2_super_block *param,
+			    io_manager manager, ext2_filsys *ret_fs)
+{
+	ext2_filsys	fs;
+	errcode_t	retval;
+	struct ext2_super_block *super;
+	unsigned int	rem;
+	unsigned int	overhead = 0;
+	unsigned int	ipg;
+	dgrp_t		i;
+	blk64_t		free_blocks;
+	blk_t		numblocks;
+	int		rsv_gdt;
+	int		csum_flag;
+	int		bigalloc_flag;
+	int		io_flags;
+	int		has_bg;
+	unsigned	reserved_inos;
+	char		*buf = 0;
+	char		c;
+	double		reserved_ratio;
+	char		*time_env;
+
+	if (!param || !ext2fs_blocks_count(param))
+		return EXT2_ET_INVALID_ARGUMENT;
+
+	retval = ext2fs_get_mem(sizeof(struct struct_ext2_filsys), &fs);
+	if (retval)
+		return retval;
+
+	memset(fs, 0, sizeof(struct struct_ext2_filsys));
+	fs->magic = EXT2_ET_MAGIC_EXT2FS_FILSYS;
+	fs->flags = flags | EXT2_FLAG_RW;
+	fs->umask = 022;
+	fs->default_bitmap_type = EXT2FS_BMAP64_RBTREE;
+#ifdef WORDS_BIGENDIAN
+	fs->flags |= EXT2_FLAG_SWAP_BYTES;
+#endif
+
+	time_env = getenv("E2FSPROGS_FAKE_TIME");
+	if (time_env)
+		fs->now = strtoul(time_env, NULL, 0);
+
+	io_flags = IO_FLAG_RW;
+	if (flags & EXT2_FLAG_EXCLUSIVE)
+		io_flags |= IO_FLAG_EXCLUSIVE;
+	if (flags & EXT2_FLAG_DIRECT_IO)
+		io_flags |= IO_FLAG_DIRECT_IO;
+	io_flags |= O_BINARY;
+	retval = manager->open(name, io_flags, &fs->io);
+	if (retval)
+		goto cleanup;
+	fs->image_io = fs->io;
+	fs->io->app_data = fs;
+	retval = ext2fs_get_mem(strlen(name)+1, &fs->device_name);
+	if (retval)
+		goto cleanup;
+
+	strcpy(fs->device_name, name);
+	retval = ext2fs_get_mem(SUPERBLOCK_SIZE, &super);
+	if (retval)
+		goto cleanup;
+	fs->super = super;
+
+	memset(super, 0, SUPERBLOCK_SIZE);
+
+#define set_field(field, default) (super->field = param->field ? \
+				   param->field : (default))
+#define assign_field(field)	(super->field = param->field)
+
+	super->s_magic = EXT2_SUPER_MAGIC;
+	super->s_state = EXT2_VALID_FS;
+
+	bigalloc_flag = ext2fs_has_feature_bigalloc(param);
+
+	assign_field(s_log_block_size);
+
+	if (bigalloc_flag) {
+		set_field(s_log_cluster_size, super->s_log_block_size+4);
+		if (super->s_log_block_size > super->s_log_cluster_size) {
+			retval = EXT2_ET_INVALID_ARGUMENT;
+			goto cleanup;
+		}
+	} else
+		super->s_log_cluster_size = super->s_log_block_size;
+
+	set_field(s_first_data_block, super->s_log_cluster_size ? 0 : 1);
+	set_field(s_max_mnt_count, 0);
+	set_field(s_errors, EXT2_ERRORS_DEFAULT);
+	set_field(s_feature_compat, 0);
+	set_field(s_feature_incompat, 0);
+	set_field(s_feature_ro_compat, 0);
+	set_field(s_default_mount_opts, 0);
+	set_field(s_first_meta_bg, 0);
+	set_field(s_raid_stride, 0);		/* default stride size: 0 */
+	set_field(s_raid_stripe_width, 0);	/* default stripe width: 0 */
+	set_field(s_log_groups_per_flex, 0);
+	set_field(s_flags, 0);
+	assign_field(s_backup_bgs[0]);
+	assign_field(s_backup_bgs[1]);
+
+	assign_field(s_encoding);
+	assign_field(s_encoding_flags);
+
+	if (ext2fs_has_feature_casefold(param))
+		fs->encoding = ext2fs_load_nls_table(param->s_encoding);
+
+	if (super->s_feature_incompat & ~EXT2_LIB_FEATURE_INCOMPAT_SUPP) {
+		retval = EXT2_ET_UNSUPP_FEATURE;
+		goto cleanup;
+	}
+	if (super->s_feature_ro_compat & ~EXT2_LIB_FEATURE_RO_COMPAT_SUPP) {
+		retval = EXT2_ET_RO_UNSUPP_FEATURE;
+		goto cleanup;
+	}
+
+	set_field(s_rev_level, EXT2_GOOD_OLD_REV);
+	if (super->s_rev_level >= EXT2_DYNAMIC_REV) {
+		set_field(s_first_ino, EXT2_GOOD_OLD_FIRST_INO);
+		set_field(s_inode_size, EXT2_GOOD_OLD_INODE_SIZE);
+		if (super->s_inode_size >= sizeof(struct ext2_inode_large)) {
+			int extra_isize = sizeof(struct ext2_inode_large) -
+				EXT2_GOOD_OLD_INODE_SIZE;
+			set_field(s_min_extra_isize, extra_isize);
+			set_field(s_want_extra_isize, extra_isize);
+		}
+	} else {
+		super->s_first_ino = EXT2_GOOD_OLD_FIRST_INO;
+		super->s_inode_size = EXT2_GOOD_OLD_INODE_SIZE;
+	}
+
+	set_field(s_checkinterval, 0);
+	super->s_mkfs_time = super->s_lastcheck = fs->now ? fs->now : time(NULL);
+
+	super->s_creator_os = CREATOR_OS;
+
+	fs->fragsize = fs->blocksize = EXT2_BLOCK_SIZE(super);
+	fs->cluster_ratio_bits = super->s_log_cluster_size -
+		super->s_log_block_size;
+
+	if (bigalloc_flag) {
+		unsigned long long bpg;
+
+		if (param->s_blocks_per_group &&
+		    param->s_clusters_per_group &&
+		    ((param->s_clusters_per_group * EXT2FS_CLUSTER_RATIO(fs)) !=
+		     param->s_blocks_per_group)) {
+			retval = EXT2_ET_INVALID_ARGUMENT;
+			goto cleanup;
+		}
+		if (param->s_clusters_per_group)
+			assign_field(s_clusters_per_group);
+		else if (param->s_blocks_per_group)
+			super->s_clusters_per_group = 
+				param->s_blocks_per_group /
+				EXT2FS_CLUSTER_RATIO(fs);
+		else if (super->s_log_cluster_size + 15 < 32)
+			super->s_clusters_per_group = fs->blocksize * 8;
+		else
+			super->s_clusters_per_group = (fs->blocksize - 1) * 8;
+		if (super->s_clusters_per_group > EXT2_MAX_CLUSTERS_PER_GROUP(super))
+			super->s_clusters_per_group = EXT2_MAX_CLUSTERS_PER_GROUP(super);
+		bpg = EXT2FS_C2B(fs,
+			(unsigned long long) super->s_clusters_per_group);
+		if (bpg >= (((unsigned long long) 1) << 32)) {
+			retval = EXT2_ET_INVALID_ARGUMENT;
+			goto cleanup;
+		}
+		super->s_blocks_per_group = bpg;
+	} else {
+		set_field(s_blocks_per_group, fs->blocksize * 8);
+		if (super->s_blocks_per_group > EXT2_MAX_BLOCKS_PER_GROUP(super))
+			super->s_blocks_per_group = EXT2_MAX_BLOCKS_PER_GROUP(super);
+		super->s_clusters_per_group = super->s_blocks_per_group;
+	}
+
+	ext2fs_blocks_count_set(super, ext2fs_blocks_count(param) &
+				~((blk64_t) EXT2FS_CLUSTER_MASK(fs)));
+	ext2fs_r_blocks_count_set(super, ext2fs_r_blocks_count(param));
+	if (ext2fs_r_blocks_count(super) >= ext2fs_blocks_count(param)) {
+		retval = EXT2_ET_INVALID_ARGUMENT;
+		goto cleanup;
+	}
+
+	set_field(s_mmp_update_interval, 0);
+
+	/*
+	 * If we're creating an external journal device, we don't need
+	 * to bother with the rest.
+	 */
+	if (ext2fs_has_feature_journal_dev(super)) {
+		fs->group_desc_count = 0;
+		ext2fs_mark_super_dirty(fs);
+		*ret_fs = fs;
+		return 0;
+	}
+
+retry:
+	fs->group_desc_count = (dgrp_t) ext2fs_div64_ceil(
+		ext2fs_blocks_count(super) - super->s_first_data_block,
+		EXT2_BLOCKS_PER_GROUP(super));
+	if (fs->group_desc_count == 0) {
+		retval = EXT2_ET_TOOSMALL;
+		goto cleanup;
+	}
+
+	set_field(s_desc_size,
+		  ext2fs_has_feature_64bit(super) ?
+		  EXT2_MIN_DESC_SIZE_64BIT : 0);
+
+	fs->desc_blocks = ext2fs_div_ceil(fs->group_desc_count,
+					  EXT2_DESC_PER_BLOCK(super));
+
+	i = fs->blocksize >= 4096 ? 1 : 4096 / fs->blocksize;
+
+	if (ext2fs_has_feature_64bit(super) &&
+	    (ext2fs_blocks_count(super) / i) >= (1ULL << 32))
+		set_field(s_inodes_count, ~0U);
+	else
+		set_field(s_inodes_count, ext2fs_blocks_count(super) / i);
+
+	/*
+	 * Make sure we have at least EXT2_FIRST_INO + 1 inodes, so
+	 * that we have enough inodes for the filesystem(!)
+	 */
+	if (super->s_inodes_count < EXT2_FIRST_INODE(super)+1)
+		super->s_inodes_count = EXT2_FIRST_INODE(super)+1;
+
+	/*
+	 * There should be at least as many inodes as the user
+	 * requested.  Figure out how many inodes per group that
+	 * should be.  But make sure that we don't allocate more than
+	 * one bitmap's worth of inodes each group.
+	 */
+	ipg = ext2fs_div_ceil(super->s_inodes_count, fs->group_desc_count);
+	if (ipg > fs->blocksize * 8) {
+		if (!bigalloc_flag && super->s_blocks_per_group >= 256) {
+			/* Try again with slightly different parameters */
+			super->s_blocks_per_group -= 8;
+			ext2fs_blocks_count_set(super,
+						ext2fs_blocks_count(param));
+			super->s_clusters_per_group = super->s_blocks_per_group;
+			goto retry;
+		} else {
+			retval = EXT2_ET_TOO_MANY_INODES;
+			goto cleanup;
+		}
+	}
+
+	if (ipg > (unsigned) EXT2_MAX_INODES_PER_GROUP(super))
+		ipg = EXT2_MAX_INODES_PER_GROUP(super);
+
+ipg_retry:
+	super->s_inodes_per_group = ipg;
+
+	/*
+	 * Make sure the number of inodes per group completely fills
+	 * the inode table blocks in the descriptor.  If not, add some
+	 * additional inodes/group.  Waste not, want not...
+	 */
+	fs->inode_blocks_per_group = (((super->s_inodes_per_group *
+					EXT2_INODE_SIZE(super)) +
+				       EXT2_BLOCK_SIZE(super) - 1) /
+				      EXT2_BLOCK_SIZE(super));
+	super->s_inodes_per_group = ((fs->inode_blocks_per_group *
+				      EXT2_BLOCK_SIZE(super)) /
+				     EXT2_INODE_SIZE(super));
+	/*
+	 * Finally, make sure the number of inodes per group is a
+	 * multiple of 8.  This is needed to simplify the bitmap
+	 * splicing code.
+	 */
+	if (super->s_inodes_per_group < 8)
+		super->s_inodes_per_group = 8;
+	super->s_inodes_per_group &= ~7;
+	fs->inode_blocks_per_group = (((super->s_inodes_per_group *
+					EXT2_INODE_SIZE(super)) +
+				       EXT2_BLOCK_SIZE(super) - 1) /
+				      EXT2_BLOCK_SIZE(super));
+
+	/*
+	 * adjust inode count to reflect the adjusted inodes_per_group
+	 */
+	if ((__u64)super->s_inodes_per_group * fs->group_desc_count > ~0U) {
+		ipg--;
+		goto ipg_retry;
+	}
+	super->s_inodes_count = super->s_inodes_per_group *
+		fs->group_desc_count;
+	super->s_free_inodes_count = super->s_inodes_count;
+
+	/*
+	 * check the number of reserved group descriptor table blocks
+	 */
+	if (ext2fs_has_feature_resize_inode(super))
+		rsv_gdt = calc_reserved_gdt_blocks(fs);
+	else
+		rsv_gdt = 0;
+	set_field(s_reserved_gdt_blocks, rsv_gdt);
+	if (super->s_reserved_gdt_blocks > EXT2_ADDR_PER_BLOCK(super)) {
+		retval = EXT2_ET_RES_GDT_BLOCKS;
+		goto cleanup;
+	}
+	/* Enable meta_bg if we'd lose more than 3/4 of a BG to GDT blocks. */
+	if (super->s_reserved_gdt_blocks + fs->desc_blocks >
+	    super->s_blocks_per_group * 3 / 4) {
+		ext2fs_set_feature_meta_bg(fs->super);
+		ext2fs_clear_feature_resize_inode(fs->super);
+		set_field(s_reserved_gdt_blocks, 0);
+	}
+
+	/*
+	 * Calculate the maximum number of bookkeeping blocks per
+	 * group.  It includes the superblock, the block group
+	 * descriptors, the block bitmap, the inode bitmap, the inode
+	 * table, and the reserved gdt blocks.
+	 */
+	overhead = (int) (3 + fs->inode_blocks_per_group +
+			  super->s_reserved_gdt_blocks);
+
+	if (ext2fs_has_feature_meta_bg(fs->super))
+		overhead++;
+	else
+		overhead += fs->desc_blocks;
+
+	/* This can only happen if the user requested too many inodes */
+	if (overhead > super->s_blocks_per_group) {
+		retval = EXT2_ET_TOO_MANY_INODES;
+		goto cleanup;
+	}
+
+	/*
+	 * See if the last group is big enough to support the
+	 * necessary data structures.  If not, we need to get rid of
+	 * it.  We need to recalculate the overhead for the last block
+	 * group, since it might or might not have a superblock
+	 * backup.
+	 */
+	overhead = (int) (2 + fs->inode_blocks_per_group);
+	has_bg = 0;
+	if (ext2fs_has_feature_sparse_super2(super)) {
+		/*
+		 * We have to do this manually since
+		 * super->s_backup_bgs hasn't been set up yet.
+		 */
+		if (fs->group_desc_count == 2)
+			has_bg = param->s_backup_bgs[0] != 0;
+		else
+			has_bg = param->s_backup_bgs[1] != 0;
+	} else
+		has_bg = ext2fs_bg_has_super(fs, fs->group_desc_count - 1);
+	if (has_bg)
+		overhead += 1 + fs->desc_blocks + super->s_reserved_gdt_blocks;
+	rem = ((ext2fs_blocks_count(super) - super->s_first_data_block) %
+	       super->s_blocks_per_group);
+	if ((fs->group_desc_count == 1) && rem && (rem < overhead)) {
+		retval = EXT2_ET_TOOSMALL;
+		goto cleanup;
+	}
+	if (rem && (rem < overhead+50)) {
+		ext2fs_blocks_count_set(super, ext2fs_blocks_count(super) -
+					rem);
+		/*
+		 * If blocks count is changed, we need to recalculate
+		 * reserved blocks count not to exceed 50%.
+		 */
+		reserved_ratio = 100.0 * ext2fs_r_blocks_count(param) /
+			ext2fs_blocks_count(param);
+		ext2fs_r_blocks_count_set(super, reserved_ratio *
+			ext2fs_blocks_count(super) / 100.0);
+
+		goto retry;
+	}
+
+	/*
+	 * At this point we know how big the filesystem will be.  So
+	 * we can do any and all allocations that depend on the block
+	 * count.
+	 */
+
+	/* Set up the locations of the backup superblocks */
+	if (ext2fs_has_feature_sparse_super2(super)) {
+		if (super->s_backup_bgs[0] >= fs->group_desc_count)
+			super->s_backup_bgs[0] = fs->group_desc_count - 1;
+		if (super->s_backup_bgs[1] >= fs->group_desc_count)
+			super->s_backup_bgs[1] = fs->group_desc_count - 1;
+		if (super->s_backup_bgs[0] == super->s_backup_bgs[1])
+			super->s_backup_bgs[1] = 0;
+		if (super->s_backup_bgs[0] > super->s_backup_bgs[1]) {
+			__u32 t = super->s_backup_bgs[0];
+			super->s_backup_bgs[0] = super->s_backup_bgs[1];
+			super->s_backup_bgs[1] = t;
+		}
+	}
+
+	retval = ext2fs_get_mem(strlen(fs->device_name) + 80, &buf);
+	if (retval)
+		goto cleanup;
+
+	strcpy(buf, "block bitmap for ");
+	strcat(buf, fs->device_name);
+	retval = ext2fs_allocate_subcluster_bitmap(fs, buf, &fs->block_map);
+	if (retval)
+		goto cleanup;
+
+	strcpy(buf, "inode bitmap for ");
+	strcat(buf, fs->device_name);
+	retval = ext2fs_allocate_inode_bitmap(fs, buf, &fs->inode_map);
+	if (retval)
+		goto cleanup;
+
+	ext2fs_free_mem(&buf);
+
+	retval = ext2fs_get_array(fs->desc_blocks, fs->blocksize,
+				&fs->group_desc);
+	if (retval)
+		goto cleanup;
+
+	memset(fs->group_desc, 0, (size_t) fs->desc_blocks * fs->blocksize);
+
+	/*
+	 * Reserve the superblock and group descriptors for each
+	 * group, and fill in the correct group statistics for group.
+	 * Note that although the block bitmap, inode bitmap, and
+	 * inode table have not been allocated (and in fact won't be
+	 * by this routine), they are accounted for nevertheless.
+	 *
+	 * If FLEX_BG meta-data grouping is used, only account for the
+	 * superblock and group descriptors (the inode tables and
+	 * bitmaps will be accounted for when allocated).
+	 */
+	free_blocks = 0;
+	csum_flag = ext2fs_has_group_desc_csum(fs);
+	reserved_inos = super->s_first_ino;
+	for (i = 0; i < fs->group_desc_count; i++) {
+		/*
+		 * Don't set the BLOCK_UNINIT group for the last group
+		 * because the block bitmap needs to be padded.
+		 */
+		if (csum_flag) {
+			if (i != fs->group_desc_count - 1)
+				ext2fs_bg_flags_set(fs, i,
+						    EXT2_BG_BLOCK_UNINIT);
+			ext2fs_bg_flags_set(fs, i, EXT2_BG_INODE_UNINIT);
+			numblocks = super->s_inodes_per_group;
+			if (reserved_inos) {
+				if (numblocks > reserved_inos) {
+					numblocks -= reserved_inos;
+					reserved_inos = 0;
+				} else {
+					reserved_inos -= numblocks;
+					numblocks = 0;
+				}
+			}
+			ext2fs_bg_itable_unused_set(fs, i, numblocks);
+		}
+		numblocks = ext2fs_reserve_super_and_bgd(fs, i, fs->block_map);
+		if (fs->super->s_log_groups_per_flex)
+			numblocks += 2 + fs->inode_blocks_per_group;
+
+		free_blocks += numblocks;
+		ext2fs_bg_free_blocks_count_set(fs, i, numblocks);
+		ext2fs_bg_free_inodes_count_set(fs, i, fs->super->s_inodes_per_group);
+		ext2fs_bg_used_dirs_count_set(fs, i, 0);
+		ext2fs_group_desc_csum_set(fs, i);
+	}
+	free_blocks &= ~EXT2FS_CLUSTER_MASK(fs);
+	ext2fs_free_blocks_count_set(super, free_blocks);
+
+	c = (char) 255;
+	if (((int) c) == -1) {
+		super->s_flags |= EXT2_FLAGS_SIGNED_HASH;
+	} else {
+		super->s_flags |= EXT2_FLAGS_UNSIGNED_HASH;
+	}
+
+	ext2fs_mark_super_dirty(fs);
+	ext2fs_mark_bb_dirty(fs);
+	ext2fs_mark_ib_dirty(fs);
+
+	io_channel_set_blksize(fs->io, fs->blocksize);
+
+	*ret_fs = fs;
+	return 0;
+cleanup:
+	free(buf);
+	ext2fs_free(fs);
+	return retval;
+}
+
+errcode_t ext2fs_calculate_summary_stats(ext2_filsys fs, int super_only)
+{
+	blk64_t		blk;
+	ext2_ino_t	ino;
+	unsigned int	group = 0;
+	unsigned int	count = 0;
+	int		total_free = 0;
+	int		group_free = 0;
+	int		last_allocated = 0;
+	int		uninit;
+
+	/*
+	 * First calculate the block statistics
+	 */
+	uninit = 1;
+	for (blk = fs->super->s_first_data_block;
+	     blk < ext2fs_blocks_count(fs->super); blk++) {
+		if (!ext2fs_fast_test_block_bitmap2(fs->block_map, blk)) {
+			group_free++;
+			total_free++;
+		} else {
+			uninit = 0;
+		}
+		count++;
+		if ((count == fs->super->s_blocks_per_group) ||
+		    (blk == ext2fs_blocks_count(fs->super)-1)) {
+			ext2fs_bg_free_blocks_count_set(fs, group,
+							group_free);
+			if (!super_only) {
+				if (uninit && blk !=
+					ext2fs_blocks_count(fs->super) - 1)
+					ext2fs_bg_flags_set(fs, group,
+							EXT2_BG_BLOCK_UNINIT);
+				else
+					ext2fs_bg_flags_clear(fs, group,
+							EXT2_BG_BLOCK_UNINIT);
+			}
+			count = 0;
+			group_free = 0;
+			uninit = 1;
+			group++;
+		}
+	}
+	total_free = EXT2FS_C2B(fs, total_free);
+	ext2fs_free_blocks_count_set(fs->super, total_free);
+
+	/*
+	 * Next, calculate the inode statistics
+	 */
+	group_free = 0;
+	total_free = 0;
+	last_allocated = 0;
+	count = 0;
+	group = 0;
+
+	/* Protect loop from wrap-around if s_inodes_count maxed */
+	for (ino = 1; ino <= fs->super->s_inodes_count && ino > 0; ino++) {
+		if (!ext2fs_test_inode_bitmap2(fs->inode_map, ino)) {
+			group_free++;
+			total_free++;
+		} else {
+			last_allocated = ino;
+		}
+		count++;
+		if ((count == fs->super->s_inodes_per_group) ||
+		    (ino == fs->super->s_inodes_count)) {
+			if (!super_only) {
+				if (last_allocated) {
+					ext2fs_bg_flags_clear(fs, group,
+						EXT2_BG_INODE_UNINIT);
+					ext2fs_bg_itable_unused_set(fs, group,
+						fs->super->s_inodes_per_group -
+						(last_allocated %
+						fs->super->s_inodes_per_group));
+				} else {
+					ext2fs_bg_flags_set(fs, group,
+						EXT2_BG_INODE_UNINIT);
+					ext2fs_bg_itable_unused_set(fs, group,
+									0);
+				}
+				ext2fs_bg_free_inodes_count_set(fs, group,
+								group_free);
+			}
+			group++;
+			count = 0;
+			group_free = 0;
+			last_allocated = 0;
+		}
+	}
+	fs->super->s_free_inodes_count = total_free;
+	ext2fs_mark_super_dirty(fs);
+	return 0;
+}
diff --git a/lib/ext2fs/inline.c b/lib/ext2fs/inline.c
new file mode 100644
index 0000000..ae2ae6e
--- /dev/null
+++ b/lib/ext2fs/inline.c
@@ -0,0 +1,118 @@
+/*
+ * inline.c --- Includes the inlined functions defined in the header
+ * 	files as standalone functions, in case the application program
+ * 	is compiled with inlining turned off.
+ *
+ * Copyright (C) 1993, 1994 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#ifndef _XOPEN_SOURCE
+#define _XOPEN_SOURCE 600	/* for posix_memalign() */
+#endif
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+#if HAVE_MALLOC_H
+#include <malloc.h>
+#endif
+
+#include "ext2_fs.h"
+#define INCLUDE_INLINE_FUNCS
+#include "ext2fs.h"
+
+/*
+ * We used to define this as an inline, but since we are now using
+ * autoconf-defined #ifdef's, we need to export this as a
+ * library-provided function exclusively.
+ */
+errcode_t ext2fs_get_memalign(unsigned long size,
+			      unsigned long align, void *ptr)
+{
+	errcode_t retval = 0;
+	void **p = ptr;
+
+	if (align < 8)
+		align = 8;
+#ifdef HAVE_POSIX_MEMALIGN
+	retval = posix_memalign(p, align, size);
+	if (retval == ENOMEM)
+		return EXT2_ET_NO_MEMORY;
+#else  /* !HAVE_POSIX_MEMALIGN */
+#ifdef HAVE_MEMALIGN
+	*p = memalign(align, size);
+	if (*p == NULL) {
+		if (errno)
+			return errno;
+		else
+			return EXT2_ET_NO_MEMORY;
+	}
+#else  /* !HAVE_MEMALIGN */
+#ifdef HAVE_VALLOC
+	if (align > sizeof(long long))
+		*p = valloc(size);
+	else
+#endif
+		*p = malloc(size);
+	if ((uintptr_t) *p & (align - 1)) {
+		free(*p);
+		*p = 0;
+	}
+	if (*p == 0)
+		return EXT2_ET_NO_MEMORY;
+#endif	/* HAVE_MEMALIGN */
+#endif	/* HAVE_POSIX_MEMALIGN */
+	return retval;
+}
+
+#ifdef DEBUG
+static int isaligned(void *ptr, unsigned long align)
+{
+	return (((unsigned long) ptr & (align - 1)) == 0);
+}
+
+static errcode_t test_memalign(unsigned long align)
+{
+	void *ptr = 0;
+	errcode_t retval;
+
+	retval = ext2fs_get_memalign(32, align, &ptr);
+	if (!retval && !isaligned(ptr, align))
+		retval = EINVAL;
+	free(ptr);
+	printf("tst_memalign(%lu) is %s\n", align,
+	       retval ? error_message(retval) : "OK");
+	return retval;
+}
+
+int main(int argc, char **argv)
+{
+	int err = 0;
+
+	if (test_memalign(4))
+		err++;
+	if (test_memalign(32))
+		err++;
+	if (test_memalign(1024))
+		err++;
+	if (test_memalign(4096))
+		err++;
+	return err;
+}
+#endif
diff --git a/lib/ext2fs/inline_data.c b/lib/ext2fs/inline_data.c
new file mode 100644
index 0000000..bd52e37
--- /dev/null
+++ b/lib/ext2fs/inline_data.c
@@ -0,0 +1,842 @@
+/*
+ * inline_data.c --- data in inode
+ *
+ * Copyright (C) 2012 Zheng Liu <wenqing.lz@taobao.com>
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <time.h>
+#include <limits.h> /* for PATH_MAX */
+
+#include "ext2_fs.h"
+#include "ext2_ext_attr.h"
+
+#include "ext2fs.h"
+#include "ext2fsP.h"
+
+struct ext2_inline_data {
+	ext2_filsys fs;
+	ext2_ino_t ino;
+	size_t ea_size;	/* the size of inline data in ea area */
+	void *ea_data;
+};
+
+static errcode_t ext2fs_inline_data_ea_set(struct ext2_inline_data *data)
+{
+	struct ext2_xattr_handle *handle;
+	errcode_t retval;
+
+	retval = ext2fs_xattrs_open(data->fs, data->ino, &handle);
+	if (retval)
+		return retval;
+
+	retval = ext2fs_xattrs_read(handle);
+	if (retval)
+		goto err;
+
+	retval = ext2fs_xattr_set(handle, "system.data",
+				  data->ea_data, data->ea_size);
+err:
+	(void) ext2fs_xattrs_close(&handle);
+	return retval;
+}
+
+static errcode_t ext2fs_inline_data_ea_get(struct ext2_inline_data *data)
+{
+	struct ext2_xattr_handle *handle;
+	errcode_t retval;
+
+	data->ea_size = 0;
+	data->ea_data = 0;
+
+	retval = ext2fs_xattrs_open(data->fs, data->ino, &handle);
+	if (retval)
+		return retval;
+
+	retval = ext2fs_xattrs_read(handle);
+	if (retval)
+		goto err;
+
+	retval = ext2fs_xattr_get(handle, "system.data",
+				  (void **)&data->ea_data, &data->ea_size);
+	if (retval == EXT2_ET_EA_KEY_NOT_FOUND) {
+		data->ea_size = 0;
+		data->ea_data = NULL;
+		retval = 0;
+	} else if (retval)
+		goto err;
+
+err:
+	(void) ext2fs_xattrs_close(&handle);
+	return retval;
+}
+
+errcode_t ext2fs_inline_data_init(ext2_filsys fs, ext2_ino_t ino)
+{
+	struct ext2_inline_data data;
+	char empty[1] = { '\0' };
+
+	data.fs = fs;
+	data.ino = ino;
+	data.ea_size = 0;
+	data.ea_data = empty;
+	return ext2fs_inline_data_ea_set(&data);
+}
+
+errcode_t ext2fs_inline_data_size(ext2_filsys fs, ext2_ino_t ino, size_t *size)
+{
+	struct ext2_inode inode;
+	struct ext2_inline_data data;
+	errcode_t retval;
+
+	retval = ext2fs_read_inode(fs, ino, &inode);
+	if (retval)
+		return retval;
+
+	if (!(inode.i_flags & EXT4_INLINE_DATA_FL))
+		return EXT2_ET_NO_INLINE_DATA;
+
+	data.fs = fs;
+	data.ino = ino;
+	retval = ext2fs_inline_data_ea_get(&data);
+	if (retval)
+		return retval;
+
+	*size = EXT4_MIN_INLINE_DATA_SIZE + data.ea_size;
+	return ext2fs_free_mem(&data.ea_data);
+}
+
+int ext2fs_inline_data_dir_iterate(ext2_filsys fs, ext2_ino_t ino,
+				   void *priv_data)
+{
+	struct dir_context *ctx;
+	struct ext2_inode inode;
+	struct ext2_dir_entry dirent;
+	struct ext2_inline_data data;
+	int ret = BLOCK_ABORT;
+	e2_blkcnt_t blockcnt = 0;
+	char *old_buf;
+	unsigned int old_buflen;
+	int old_flags;
+
+	ctx = (struct dir_context *)priv_data;
+	old_buf = ctx->buf;
+	old_buflen = ctx->buflen;
+	old_flags = ctx->flags;
+	ctx->flags |= DIRENT_FLAG_INCLUDE_INLINE_DATA;
+
+	ctx->errcode = ext2fs_read_inode(fs, ino, &inode);
+	if (ctx->errcode)
+		goto out;
+
+	if (!(inode.i_flags & EXT4_INLINE_DATA_FL)) {
+		ctx->errcode = EXT2_ET_NO_INLINE_DATA;
+		goto out;
+	}
+
+	if (!LINUX_S_ISDIR(inode.i_mode)) {
+		ctx->errcode = EXT2_ET_NO_DIRECTORY;
+		goto out;
+	}
+	ret = 0;
+
+	/* we first check '.' and '..' dir */
+	dirent.inode = ino;
+	dirent.name_len = 1;
+	ext2fs_set_rec_len(fs, EXT2_DIR_REC_LEN(2), &dirent);
+	dirent.name[0] = '.';
+	dirent.name[1] = '\0';
+	ctx->buf = (char *)&dirent;
+	ext2fs_get_rec_len(fs, &dirent, &ctx->buflen);
+	ret |= ext2fs_process_dir_block(fs, 0, blockcnt++, 0, 0, priv_data);
+	if (ret & BLOCK_ABORT)
+		goto out;
+
+	dirent.inode = ext2fs_le32_to_cpu(inode.i_block[0]);
+	dirent.name_len = 2;
+	ext2fs_set_rec_len(fs, EXT2_DIR_REC_LEN(3), &dirent);
+	dirent.name[0] = '.';
+	dirent.name[1] = '.';
+	dirent.name[2] = '\0';
+	ctx->buf = (char *)&dirent;
+	ext2fs_get_rec_len(fs, &dirent, &ctx->buflen);
+	ret |= ext2fs_process_dir_block(fs, 0, blockcnt++, 0, 0, priv_data);
+	if (ret & BLOCK_INLINE_DATA_CHANGED) {
+		errcode_t err;
+
+		inode.i_block[0] = ext2fs_cpu_to_le32(dirent.inode);
+		err = ext2fs_write_inode(fs, ino, &inode);
+		if (err)
+			goto out;
+		ret &= ~BLOCK_INLINE_DATA_CHANGED;
+	}
+	if (ret & BLOCK_ABORT)
+		goto out;
+
+	ctx->buf = (char *)inode.i_block + EXT4_INLINE_DATA_DOTDOT_SIZE;
+	ctx->buflen = EXT4_MIN_INLINE_DATA_SIZE - EXT4_INLINE_DATA_DOTDOT_SIZE;
+#ifdef WORDS_BIGENDIAN
+	ctx->errcode = ext2fs_dirent_swab_in2(fs, ctx->buf, ctx->buflen, 0);
+	if (ctx->errcode) {
+		ret |= BLOCK_ABORT;
+		goto out;
+	}
+#endif
+	ret |= ext2fs_process_dir_block(fs, 0, blockcnt++, 0, 0, priv_data);
+	if (ret & BLOCK_INLINE_DATA_CHANGED) {
+#ifdef WORDS_BIGENDIAN
+		ctx->errcode = ext2fs_dirent_swab_out2(fs, ctx->buf,
+						       ctx->buflen, 0);
+		if (ctx->errcode) {
+			ret |= BLOCK_ABORT;
+			goto out;
+		}
+#endif
+		ctx->errcode = ext2fs_write_inode(fs, ino, &inode);
+		if (ctx->errcode)
+			ret |= BLOCK_ABORT;
+		ret &= ~BLOCK_INLINE_DATA_CHANGED;
+	}
+	if (ret & BLOCK_ABORT)
+		goto out;
+
+	data.fs = fs;
+	data.ino = ino;
+	ctx->errcode = ext2fs_inline_data_ea_get(&data);
+	if (ctx->errcode) {
+		ret |= BLOCK_ABORT;
+		goto out;
+	}
+	if (data.ea_size <= 0)
+		goto out1;
+
+	ctx->buf = data.ea_data;
+	ctx->buflen = data.ea_size;
+#ifdef WORDS_BIGENDIAN
+	ctx->errcode = ext2fs_dirent_swab_in2(fs, ctx->buf, ctx->buflen, 0);
+	if (ctx->errcode) {
+		ret |= BLOCK_ABORT;
+		goto out1;
+	}
+#endif
+
+	ret |= ext2fs_process_dir_block(fs, 0, blockcnt++, 0, 0, priv_data);
+	if (ret & BLOCK_INLINE_DATA_CHANGED) {
+#ifdef WORDS_BIGENDIAN
+		ctx->errcode = ext2fs_dirent_swab_out2(fs, ctx->buf,
+						      ctx->buflen, 0);
+		if (ctx->errcode) {
+			ret |= BLOCK_ABORT;
+			goto out1;
+		}
+#endif
+		ctx->errcode = ext2fs_inline_data_ea_set(&data);
+		if (ctx->errcode)
+			ret |= BLOCK_ABORT;
+	}
+
+out1:
+	ext2fs_free_mem(&data.ea_data);
+out:
+	ctx->buf = old_buf;
+	ctx->buflen = old_buflen;
+	ctx->flags = old_flags;
+	ret &= ~(BLOCK_ABORT | BLOCK_INLINE_DATA_CHANGED);
+	return ret;
+}
+
+errcode_t ext2fs_inline_data_ea_remove(ext2_filsys fs, ext2_ino_t ino)
+{
+	struct ext2_xattr_handle *handle;
+	errcode_t retval;
+
+	retval = ext2fs_xattrs_open(fs, ino, &handle);
+	if (retval)
+		return retval;
+
+	retval = ext2fs_xattrs_read(handle);
+	if (retval)
+		goto err;
+
+	retval = ext2fs_xattr_remove(handle, "system.data");
+err:
+	(void) ext2fs_xattrs_close(&handle);
+	return retval;
+}
+
+static errcode_t ext2fs_inline_data_convert_dir(ext2_filsys fs, ext2_ino_t ino,
+						char *bbuf, char *ibuf, int size)
+{
+	struct ext2_dir_entry *dir, *dir2;
+	struct ext2_dir_entry_tail *t;
+	errcode_t retval;
+	int offset;
+	unsigned int rec_len;
+	int csum_size = 0;
+	int filetype = 0;
+
+	if (ext2fs_has_feature_metadata_csum(fs->super))
+		csum_size = sizeof(struct ext2_dir_entry_tail);
+
+	/* Create '.' and '..' */
+	if (ext2fs_has_feature_filetype(fs->super))
+		filetype = EXT2_FT_DIR;
+
+	/*
+	 * Set up entry for '.'
+	 */
+	dir = (struct ext2_dir_entry *) bbuf;
+	dir->inode = ino;
+	ext2fs_dirent_set_name_len(dir, 1);
+	ext2fs_dirent_set_file_type(dir, filetype);
+	dir->name[0] = '.';
+	rec_len = (fs->blocksize - csum_size) - EXT2_DIR_REC_LEN(1);
+	dir->rec_len = EXT2_DIR_REC_LEN(1);
+
+	/*
+	 * Set up entry for '..'
+	 */
+	dir = (struct ext2_dir_entry *) (bbuf + dir->rec_len);
+	dir->rec_len = EXT2_DIR_REC_LEN(2);
+	dir->inode = ext2fs_le32_to_cpu(((__u32 *)ibuf)[0]);
+	ext2fs_dirent_set_name_len(dir, 2);
+	ext2fs_dirent_set_file_type(dir, filetype);
+	dir->name[0] = '.';
+	dir->name[1] = '.';
+
+	/*
+	 * Adjust the last rec_len
+	 */
+	offset = EXT2_DIR_REC_LEN(1) + EXT2_DIR_REC_LEN(2);
+	dir = (struct ext2_dir_entry *) (bbuf + offset);
+	memcpy(bbuf + offset, ibuf + EXT4_INLINE_DATA_DOTDOT_SIZE,
+	       size - EXT4_INLINE_DATA_DOTDOT_SIZE);
+	size += EXT2_DIR_REC_LEN(1) + EXT2_DIR_REC_LEN(2) -
+		EXT4_INLINE_DATA_DOTDOT_SIZE;
+
+	do {
+		dir2 = dir;
+		retval = ext2fs_get_rec_len(fs, dir, &rec_len);
+		if (retval)
+			goto err;
+		offset += rec_len;
+		dir = (struct ext2_dir_entry *) (bbuf + offset);
+	} while (offset < size);
+	rec_len += fs->blocksize - csum_size - offset;
+	retval = ext2fs_set_rec_len(fs, rec_len, dir2);
+	if (retval)
+		goto err;
+
+	if (csum_size) {
+		t = EXT2_DIRENT_TAIL(bbuf, fs->blocksize);
+		ext2fs_initialize_dirent_tail(fs, t);
+	}
+
+err:
+	return retval;
+}
+
+static errcode_t
+ext2fs_inline_data_dir_expand(ext2_filsys fs, ext2_ino_t ino,
+			      struct ext2_inode *inode, char *buf, size_t size)
+{
+	errcode_t retval;
+	blk64_t blk;
+	char *blk_buf;
+
+	retval = ext2fs_get_memzero(fs->blocksize, &blk_buf);
+	if (retval)
+		return retval;
+
+#ifdef WORDS_BIGENDIAN
+	retval = ext2fs_dirent_swab_in2(fs, buf + EXT4_INLINE_DATA_DOTDOT_SIZE,
+					size, 0);
+	if (retval)
+		goto errout;
+#endif
+
+	/* Adjust the rec_len */
+	retval = ext2fs_inline_data_convert_dir(fs, ino, blk_buf, buf, size);
+	if (retval)
+		goto errout;
+	/* Allocate a new block */
+	retval = ext2fs_new_block2(fs, 0, 0, &blk);
+	if (retval)
+		goto errout;
+	retval = ext2fs_write_dir_block4(fs, blk, blk_buf, 0, ino);
+	if (retval)
+		goto errout;
+
+	/* Update inode */
+	if (ext2fs_has_feature_extents(fs->super))
+		inode->i_flags |= EXT4_EXTENTS_FL;
+	inode->i_flags &= ~EXT4_INLINE_DATA_FL;
+	retval = ext2fs_iblk_add_blocks(fs, inode, 1);
+	if (retval)
+		goto errout;
+	inode->i_size = fs->blocksize;
+	retval = ext2fs_bmap2(fs, ino, inode, 0, BMAP_SET, 0, 0, &blk);
+	if (retval)
+		goto errout;
+	retval = ext2fs_write_inode(fs, ino, inode);
+	if (retval)
+		goto errout;
+	ext2fs_block_alloc_stats(fs, blk, +1);
+
+errout:
+	ext2fs_free_mem(&blk_buf);
+	return retval;
+}
+
+static errcode_t
+ext2fs_inline_data_file_expand(ext2_filsys fs, ext2_ino_t ino,
+			       struct ext2_inode *inode, char *buf, size_t size)
+{
+	ext2_file_t e2_file;
+	errcode_t retval;
+
+	/* Update inode */
+	memset(inode->i_block, 0, sizeof(inode->i_block));
+	if (ext2fs_has_feature_extents(fs->super)) {
+		ext2_extent_handle_t handle;
+
+		inode->i_flags &= ~EXT4_EXTENTS_FL;
+		retval = ext2fs_extent_open2(fs, ino, inode, &handle);
+		if (retval)
+			return retval;
+		ext2fs_extent_free(handle);
+	}
+	inode->i_flags &= ~EXT4_INLINE_DATA_FL;
+	inode->i_size = 0;
+	retval = ext2fs_write_inode(fs, ino, inode);
+	if (retval)
+		return retval;
+
+	/* Write out the block buffer */
+	retval = ext2fs_file_open(fs, ino, EXT2_FILE_WRITE, &e2_file);
+	if (retval)
+		return retval;
+	retval = ext2fs_file_write(e2_file, buf, size, 0);
+	ext2fs_file_close(e2_file);
+	return retval;
+}
+
+errcode_t ext2fs_inline_data_expand(ext2_filsys fs, ext2_ino_t ino)
+{
+	struct ext2_inode inode;
+	struct ext2_inline_data data;
+	errcode_t retval;
+	size_t inline_size;
+	char *inline_buf = 0;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	retval = ext2fs_read_inode(fs, ino, &inode);
+	if (retval)
+		return retval;
+
+	if (!(inode.i_flags & EXT4_INLINE_DATA_FL))
+		return EXT2_ET_NO_INLINE_DATA;
+
+	data.fs = fs;
+	data.ino = ino;
+	retval = ext2fs_inline_data_ea_get(&data);
+	if (retval)
+		return retval;
+	inline_size = data.ea_size + EXT4_MIN_INLINE_DATA_SIZE;
+	retval = ext2fs_get_mem(inline_size, &inline_buf);
+	if (retval)
+		goto errout;
+
+	memcpy(inline_buf, (void *)inode.i_block, EXT4_MIN_INLINE_DATA_SIZE);
+	if (data.ea_size > 0) {
+		memcpy(inline_buf + EXT4_MIN_INLINE_DATA_SIZE,
+		       data.ea_data, data.ea_size);
+	}
+
+	memset((void *)inode.i_block, 0, EXT4_MIN_INLINE_DATA_SIZE);
+	/*
+	 * NOTE: We must do this write -> ea_remove -> read cycle here because
+	 * removing the inline data EA can free the EA block, which is a change
+	 * that our stack copy of the inode will never see.  If that happens,
+	 * we can end up with the EA block and lblk 0 pointing to the same
+	 * pblk, which is bad news.
+	 */
+	retval = ext2fs_write_inode(fs, ino, &inode);
+	if (retval)
+		goto errout;
+	retval = ext2fs_inline_data_ea_remove(fs, ino);
+	if (retval)
+		goto errout;
+	retval = ext2fs_read_inode(fs, ino, &inode);
+	if (retval)
+		goto errout;
+
+	if (LINUX_S_ISDIR(inode.i_mode)) {
+		retval = ext2fs_inline_data_dir_expand(fs, ino, &inode,
+						inline_buf, inline_size);
+	} else {
+		retval = ext2fs_inline_data_file_expand(fs, ino, &inode,
+						inline_buf, inline_size);
+	}
+
+errout:
+	if (inline_buf)
+		ext2fs_free_mem(&inline_buf);
+	ext2fs_free_mem(&data.ea_data);
+	return retval;
+}
+
+/*
+ * When caller uses this function to retrieve the inline data, it must
+ * allocate a buffer which has the size of inline data.  The size of
+ * inline data can be know by ext2fs_inline_data_get_size().
+ */
+errcode_t ext2fs_inline_data_get(ext2_filsys fs, ext2_ino_t ino,
+				 struct ext2_inode *inode,
+				 void *buf, size_t *size)
+{
+	struct ext2_inode inode_buf;
+	struct ext2_inline_data data;
+	errcode_t retval;
+
+	if (!inode) {
+		retval = ext2fs_read_inode(fs, ino, &inode_buf);
+		if (retval)
+			return retval;
+		inode = &inode_buf;
+	}
+
+	data.fs = fs;
+	data.ino = ino;
+	retval = ext2fs_inline_data_ea_get(&data);
+	if (retval)
+		return retval;
+
+	memcpy(buf, (void *)inode->i_block, EXT4_MIN_INLINE_DATA_SIZE);
+	if (data.ea_size > 0)
+		memcpy((char *) buf + EXT4_MIN_INLINE_DATA_SIZE,
+		       data.ea_data, data.ea_size);
+
+	if (size)
+		*size = EXT4_MIN_INLINE_DATA_SIZE + data.ea_size;
+	ext2fs_free_mem(&data.ea_data);
+	return 0;
+}
+
+errcode_t ext2fs_inline_data_set(ext2_filsys fs, ext2_ino_t ino,
+				 struct ext2_inode *inode,
+				 void *buf, size_t size)
+{
+	struct ext2_inode inode_buf;
+	struct ext2_inline_data data = {
+		.fs = fs,
+		.ino = ino,
+	};
+	errcode_t retval;
+	size_t free_ea_size, existing_size, free_inode_size;
+
+	if (!inode) {
+		retval = ext2fs_read_inode(fs, ino, &inode_buf);
+		if (retval)
+			return retval;
+		inode = &inode_buf;
+	}
+
+	if (size <= EXT4_MIN_INLINE_DATA_SIZE) {
+		memcpy((void *)inode->i_block, buf, size);
+	} else {
+		retval = ext2fs_xattr_inode_max_size(fs, ino, &free_ea_size);
+		if (retval)
+			return retval;
+
+		retval = ext2fs_inline_data_size(fs, ino, &existing_size);
+		if (retval)
+			return retval;
+
+		if (existing_size < EXT4_MIN_INLINE_DATA_SIZE) {
+			free_inode_size = EXT4_MIN_INLINE_DATA_SIZE -
+					  existing_size;
+		} else {
+			free_inode_size = 0;
+		}
+
+		if (size != existing_size &&
+		    size > existing_size + free_ea_size + free_inode_size)
+			return EXT2_ET_INLINE_DATA_NO_SPACE;
+
+		memcpy((void *)inode->i_block, buf, EXT4_MIN_INLINE_DATA_SIZE);
+		if (size > EXT4_MIN_INLINE_DATA_SIZE)
+			data.ea_size = size - EXT4_MIN_INLINE_DATA_SIZE;
+		data.ea_data = (char *) buf + EXT4_MIN_INLINE_DATA_SIZE;
+	}
+	retval = ext2fs_write_inode(fs, ino, inode);
+	if (retval)
+		return retval;
+	return ext2fs_inline_data_ea_set(&data);
+}
+
+#ifdef DEBUG
+#include "e2p/e2p.h"
+
+/*
+ * The length of buffer is set to 64 because in inode's i_block member it only
+ * can save 60 bytes.  Thus this value can let the data being saved in extra
+ * space.
+ */
+#define BUFF_SIZE (64)
+
+static errcode_t file_test(ext2_filsys fs)
+{
+	struct ext2_inode inode;
+	ext2_ino_t newfile;
+	errcode_t retval;
+	size_t size;
+	char *buf = 0, *cmpbuf = 0;
+
+	/* create a new file */
+	retval = ext2fs_new_inode(fs, 2, 010755, 0, &newfile);
+	if (retval) {
+		com_err("file_test", retval, "while allocating a new inode");
+		return 1;
+	}
+
+	memset(&inode, 0, sizeof(inode));
+	inode.i_flags |= EXT4_INLINE_DATA_FL;
+	inode.i_size = EXT4_MIN_INLINE_DATA_SIZE;
+	inode.i_mode = LINUX_S_IFREG;
+	retval = ext2fs_write_new_inode(fs, newfile, &inode);
+	if (retval) {
+		com_err("file_test", retval, "while writing a new inode");
+		return 1;
+	}
+
+	retval = ext2fs_inline_data_init(fs, newfile);
+	if (retval) {
+		com_err("file_test", retval, "while init 'system.data'");
+		return 1;
+	}
+
+	retval = ext2fs_inline_data_size(fs, newfile, &size);
+	if (retval) {
+		com_err("file_test", retval, "while getting size");
+		return 1;
+	}
+
+	if (size != EXT4_MIN_INLINE_DATA_SIZE) {
+		fprintf(stderr,
+			"tst_inline_data: size of inline data is wrong\n");
+		return 1;
+	}
+
+	ext2fs_get_mem(BUFF_SIZE, &buf);
+	memset(buf, 'a', BUFF_SIZE);
+	retval = ext2fs_inline_data_set(fs, newfile, 0, buf, BUFF_SIZE);
+	if (retval) {
+		com_err("file_test", retval,
+			"while setting inline data %s", buf);
+		goto err;
+	}
+
+	ext2fs_get_mem(BUFF_SIZE, &cmpbuf);
+	retval = ext2fs_inline_data_get(fs, newfile, 0, cmpbuf, &size);
+	if (retval) {
+		com_err("file_test", retval, "while getting inline data");
+		goto err;
+	}
+
+	if (size != BUFF_SIZE) {
+		fprintf(stderr,
+			"tst_inline_data: size %zu != buflen %u\n",
+			size, BUFF_SIZE);
+		retval = 1;
+		goto err;
+	}
+
+	if (memcmp(buf, cmpbuf, BUFF_SIZE)) {
+		fprintf(stderr, "tst_inline_data: buf != cmpbuf\n");
+		retval = 1;
+		goto err;
+	}
+
+	retval = ext2fs_punch(fs, newfile, 0, 0, 0, ~0ULL);
+	if (retval) {
+		com_err("file_test", retval, "while truncating inode");
+		goto err;
+	}
+
+	/* reload inode and check isize */
+	ext2fs_read_inode(fs, newfile, &inode);
+	if (inode.i_size != 0) {
+		fprintf(stderr, "tst_inline_data: i_size should be 0\n");
+		retval = 1;
+	}
+
+err:
+	if (cmpbuf)
+		ext2fs_free_mem(&cmpbuf);
+	if (buf)
+		ext2fs_free_mem(&buf);
+	return retval;
+}
+
+static errcode_t dir_test(ext2_filsys fs)
+{
+	const char *dot_name = ".";
+	const char *stub_name = "stub";
+	const char *parent_name = "test";
+	ext2_ino_t parent, dir, tmp;
+	errcode_t retval;
+	char dirname[32];
+	int i;
+
+	retval = ext2fs_mkdir(fs, 11, 11, stub_name);
+	if (retval) {
+		com_err("dir_test", retval, "while creating %s dir", stub_name);
+		return retval;
+	}
+
+	retval = ext2fs_mkdir(fs, 11, 0, parent_name);
+	if (retval) {
+		com_err("dir_test", retval,
+			"while creating %s dir", parent_name);
+		return retval;
+	}
+
+	retval = ext2fs_lookup(fs, 11, parent_name, strlen(parent_name),
+			       0, &parent);
+	if (retval) {
+		com_err("dir_test", retval,
+			"while looking up %s dir", parent_name);
+		return retval;
+	}
+
+	retval = ext2fs_lookup(fs, parent, dot_name, strlen(dot_name),
+			       0, &tmp);
+	if (retval) {
+		com_err("dir_test", retval,
+			"while looking up %s dir", parent_name);
+		return retval;
+	}
+
+	if (parent != tmp) {
+		fprintf(stderr, "tst_inline_data: parent (%u) != tmp (%u)\n",
+			parent, tmp);
+		return 1;
+	}
+
+	for (i = 0, dir = 13; i < 4; i++, dir++) {
+		tmp = 0;
+		snprintf(dirname, sizeof(dirname), "%d", i);
+		retval = ext2fs_mkdir(fs, parent, 0, dirname);
+		if (retval) {
+			com_err("dir_test", retval,
+				"while creating %s dir", dirname);
+			return retval;
+		}
+
+		retval = ext2fs_lookup(fs, parent, dirname, strlen(dirname),
+				       0, &tmp);
+		if (retval) {
+			com_err("dir_test", retval,
+				"while looking up %s dir", parent_name);
+			return retval;
+		}
+
+		if (dir != tmp) {
+			fprintf(stderr,
+				"tst_inline_data: dir (%u) != tmp (%u)\n",
+				dir, tmp);
+			return 1;
+		}
+	}
+
+	snprintf(dirname, sizeof(dirname), "%d", i);
+	retval = ext2fs_mkdir(fs, parent, 0, dirname);
+	if (retval && retval != EXT2_ET_DIR_NO_SPACE) {
+		com_err("dir_test", retval, "while creating %s dir", dirname);
+		return retval;
+	}
+
+	retval = ext2fs_expand_dir(fs, parent);
+	if (retval) {
+		com_err("dir_test", retval, "while expanding %s dir", parent_name);
+		return retval;
+	}
+
+	return 0;
+}
+
+int main(int argc, char *argv[])
+{
+	ext2_filsys		fs;
+	struct ext2_super_block param;
+	errcode_t		retval;
+
+	/* setup */
+	initialize_ext2_error_table();
+
+	memset(&param, 0, sizeof(param));
+	ext2fs_blocks_count_set(&param, 32768);
+	param.s_inodes_count = 100;
+
+	param.s_feature_incompat |= EXT4_FEATURE_INCOMPAT_INLINE_DATA;
+	param.s_rev_level = EXT2_DYNAMIC_REV;
+	param.s_inode_size = 256;
+
+	retval = ext2fs_initialize("test fs", EXT2_FLAG_64BITS, &param,
+				   test_io_manager, &fs);
+	if (retval) {
+		com_err("setup", retval,
+			"while initializing filesystem");
+		exit(1);
+	}
+
+	retval = ext2fs_allocate_tables(fs);
+	if (retval) {
+		com_err("setup", retval,
+			"while allocating tables for test filesystem");
+		exit(1);
+	}
+
+	/* initialize inode cache */
+	if (!fs->icache) {
+		ext2_ino_t first_ino = EXT2_FIRST_INO(fs->super);
+		int i;
+
+		/* we just want to init inode cache.  So ignore error */
+		ext2fs_create_inode_cache(fs, 16);
+		if (!fs->icache) {
+			fprintf(stderr,
+				"tst_inline_data: init inode cache failed\n");
+			exit(1);
+		}
+
+		/* setup inode cache */
+		for (i = 0; i < fs->icache->cache_size; i++)
+			fs->icache->cache[i].ino = first_ino++;
+	}
+
+	/* test */
+	if (file_test(fs)) {
+		fprintf(stderr, "tst_inline_data(FILE): FAILED\n");
+		return 1;
+	}
+	printf("tst_inline_data(FILE): OK\n");
+
+	if (dir_test(fs)) {
+		fprintf(stderr, "tst_inline_data(DIR): FAILED\n");
+		return 1;
+	}
+	printf("tst_inline_data(DIR): OK\n");
+	ext2fs_free(fs);
+
+	return 0;
+}
+#endif
diff --git a/lib/ext2fs/inode.c b/lib/ext2fs/inode.c
new file mode 100644
index 0000000..957d5aa
--- /dev/null
+++ b/lib/ext2fs/inode.c
@@ -0,0 +1,1122 @@
+/*
+ * inode.c --- utility routines to read and write inodes
+ *
+ * Copyright (C) 1993, 1994, 1995, 1996, 1997 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#if HAVE_ERRNO_H
+#include <errno.h>
+#endif
+#include <time.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fsP.h"
+#include "e2image.h"
+
+#define IBLOCK_STATUS_CSUMS_OK	1
+#define IBLOCK_STATUS_INSANE	2
+#define SCAN_BLOCK_STATUS(scan)	((scan)->temp_buffer + (scan)->inode_size)
+
+struct ext2_struct_inode_scan {
+	errcode_t		magic;
+	ext2_filsys		fs;
+	ext2_ino_t		current_inode;
+	blk64_t			current_block;
+	dgrp_t			current_group;
+	ext2_ino_t		inodes_left;
+	blk_t			blocks_left;
+	dgrp_t			groups_left;
+	blk_t			inode_buffer_blocks;
+	char *			inode_buffer;
+	int			inode_size;
+	char *			ptr;
+	int			bytes_left;
+	char			*temp_buffer;
+	errcode_t		(*done_group)(ext2_filsys fs,
+					      ext2_inode_scan scan,
+					      dgrp_t group,
+					      void * priv_data);
+	void *			done_group_data;
+	int			bad_block_ptr;
+	int			scan_flags;
+	int			reserved[6];
+};
+
+/*
+ * This routine flushes the icache, if it exists.
+ */
+errcode_t ext2fs_flush_icache(ext2_filsys fs)
+{
+	unsigned	i;
+
+	if (!fs->icache)
+		return 0;
+
+	for (i=0; i < fs->icache->cache_size; i++)
+		fs->icache->cache[i].ino = 0;
+
+	fs->icache->buffer_blk = 0;
+	return 0;
+}
+
+/*
+ * Free the inode cache structure
+ */
+void ext2fs_free_inode_cache(struct ext2_inode_cache *icache)
+{
+	unsigned i;
+
+	if (--icache->refcount)
+		return;
+	if (icache->buffer)
+		ext2fs_free_mem(&icache->buffer);
+	for (i = 0; i < icache->cache_size; i++)
+		ext2fs_free_mem(&icache->cache[i].inode);
+	if (icache->cache)
+		ext2fs_free_mem(&icache->cache);
+	icache->buffer_blk = 0;
+	ext2fs_free_mem(&icache);
+}
+
+errcode_t ext2fs_create_inode_cache(ext2_filsys fs, unsigned int cache_size)
+{
+	unsigned	i;
+	errcode_t	retval;
+
+	if (fs->icache)
+		return 0;
+	retval = ext2fs_get_mem(sizeof(struct ext2_inode_cache), &fs->icache);
+	if (retval)
+		return retval;
+
+	memset(fs->icache, 0, sizeof(struct ext2_inode_cache));
+	retval = ext2fs_get_mem(fs->blocksize, &fs->icache->buffer);
+	if (retval)
+		goto errout;
+
+	fs->icache->buffer_blk = 0;
+	fs->icache->cache_last = -1;
+	fs->icache->cache_size = cache_size;
+	fs->icache->refcount = 1;
+	retval = ext2fs_get_array(fs->icache->cache_size,
+				  sizeof(struct ext2_inode_cache_ent),
+				  &fs->icache->cache);
+	if (retval)
+		goto errout;
+
+	for (i = 0; i < fs->icache->cache_size; i++) {
+		retval = ext2fs_get_mem(EXT2_INODE_SIZE(fs->super),
+					&fs->icache->cache[i].inode);
+		if (retval)
+			goto errout;
+	}
+
+	ext2fs_flush_icache(fs);
+	return 0;
+errout:
+	ext2fs_free_inode_cache(fs->icache);
+	fs->icache = 0;
+	return retval;
+}
+
+errcode_t ext2fs_open_inode_scan(ext2_filsys fs, int buffer_blocks,
+				 ext2_inode_scan *ret_scan)
+{
+	ext2_inode_scan	scan;
+	errcode_t	retval;
+	errcode_t (*save_get_blocks)(ext2_filsys f, ext2_ino_t ino, blk_t *blocks);
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	if (ext2fs_has_feature_journal_dev(fs->super))
+		return EXT2_ET_EXTERNAL_JOURNAL_NOSUPP;
+
+	if (fs->blocksize < 1024)
+		return EXT2_FILSYS_CORRUPTED; /* Should never happen */
+
+	/*
+	 * If fs->badblocks isn't set, then set it --- since the inode
+	 * scanning functions require it.
+	 */
+	if (fs->badblocks == 0) {
+		/*
+		 * Temporarily save fs->get_blocks and set it to zero,
+		 * for compatibility with old e2fsck's.
+		 */
+		save_get_blocks = fs->get_blocks;
+		fs->get_blocks = 0;
+		retval = ext2fs_read_bb_inode(fs, &fs->badblocks);
+		if (retval && fs->badblocks) {
+			ext2fs_badblocks_list_free(fs->badblocks);
+			fs->badblocks = 0;
+		}
+		fs->get_blocks = save_get_blocks;
+	}
+
+	retval = ext2fs_get_mem(sizeof(struct ext2_struct_inode_scan), &scan);
+	if (retval)
+		return retval;
+	memset(scan, 0, sizeof(struct ext2_struct_inode_scan));
+
+	scan->magic = EXT2_ET_MAGIC_INODE_SCAN;
+	scan->fs = fs;
+	scan->inode_size = EXT2_INODE_SIZE(fs->super);
+	scan->bytes_left = 0;
+	scan->current_group = 0;
+	scan->groups_left = fs->group_desc_count - 1;
+	scan->inode_buffer_blocks = buffer_blocks ? buffer_blocks :
+				    EXT2_INODE_SCAN_DEFAULT_BUFFER_BLOCKS;
+	scan->current_block = ext2fs_inode_table_loc(scan->fs,
+						     scan->current_group);
+	if (scan->current_block &&
+	    ((scan->current_block < fs->super->s_first_data_block) ||
+	     (scan->current_block + fs->inode_blocks_per_group - 1 >=
+	      ext2fs_blocks_count(fs->super)))) {
+		ext2fs_free_mem(&scan);
+		return EXT2_ET_GDESC_BAD_INODE_TABLE;
+	}
+
+	scan->inodes_left = EXT2_INODES_PER_GROUP(scan->fs->super);
+	scan->blocks_left = scan->fs->inode_blocks_per_group;
+	if (ext2fs_has_group_desc_csum(fs)) {
+		__u32 unused = ext2fs_bg_itable_unused(fs, scan->current_group);
+		if (scan->inodes_left > unused)
+			scan->inodes_left -= unused;
+		else
+			scan->inodes_left = 0;
+		scan->blocks_left =
+			(scan->inodes_left +
+			 (fs->blocksize / scan->inode_size - 1)) *
+			scan->inode_size / fs->blocksize;
+	}
+	retval = io_channel_alloc_buf(fs->io, scan->inode_buffer_blocks,
+				      &scan->inode_buffer);
+	scan->done_group = 0;
+	scan->done_group_data = 0;
+	scan->bad_block_ptr = 0;
+	if (retval) {
+		ext2fs_free_mem(&scan);
+		return retval;
+	}
+	retval = ext2fs_get_mem(scan->inode_size + scan->inode_buffer_blocks,
+				&scan->temp_buffer);
+	if (retval) {
+		ext2fs_free_mem(&scan->inode_buffer);
+		ext2fs_free_mem(&scan);
+		return retval;
+	}
+	memset(SCAN_BLOCK_STATUS(scan), 0, scan->inode_buffer_blocks);
+	if (scan->fs->badblocks && scan->fs->badblocks->num)
+		scan->scan_flags |= EXT2_SF_CHK_BADBLOCKS;
+	if (ext2fs_has_group_desc_csum(fs))
+		scan->scan_flags |= EXT2_SF_DO_LAZY;
+	*ret_scan = scan;
+	return 0;
+}
+
+void ext2fs_close_inode_scan(ext2_inode_scan scan)
+{
+	if (!scan || (scan->magic != EXT2_ET_MAGIC_INODE_SCAN))
+		return;
+
+	ext2fs_free_mem(&scan->inode_buffer);
+	scan->inode_buffer = NULL;
+	ext2fs_free_mem(&scan->temp_buffer);
+	scan->temp_buffer = NULL;
+	ext2fs_free_mem(&scan);
+	return;
+}
+
+void ext2fs_set_inode_callback(ext2_inode_scan scan,
+			       errcode_t (*done_group)(ext2_filsys fs,
+						       ext2_inode_scan scan,
+						       dgrp_t group,
+						       void * priv_data),
+			       void *done_group_data)
+{
+	if (!scan || (scan->magic != EXT2_ET_MAGIC_INODE_SCAN))
+		return;
+
+	scan->done_group = done_group;
+	scan->done_group_data = done_group_data;
+}
+
+int ext2fs_inode_scan_flags(ext2_inode_scan scan, int set_flags,
+			    int clear_flags)
+{
+	int	old_flags;
+
+	if (!scan || (scan->magic != EXT2_ET_MAGIC_INODE_SCAN))
+		return 0;
+
+	old_flags = scan->scan_flags;
+	scan->scan_flags &= ~clear_flags;
+	scan->scan_flags |= set_flags;
+	return old_flags;
+}
+
+/*
+ * This function is called by ext2fs_get_next_inode when it needs to
+ * get ready to read in a new blockgroup.
+ */
+static errcode_t get_next_blockgroup(ext2_inode_scan scan)
+{
+	ext2_filsys fs = scan->fs;
+
+	scan->current_group++;
+	scan->groups_left--;
+
+	scan->current_block = ext2fs_inode_table_loc(scan->fs,
+						     scan->current_group);
+	scan->current_inode = scan->current_group *
+		EXT2_INODES_PER_GROUP(fs->super);
+
+	scan->bytes_left = 0;
+	scan->inodes_left = EXT2_INODES_PER_GROUP(fs->super);
+	scan->blocks_left = fs->inode_blocks_per_group;
+	if (ext2fs_has_group_desc_csum(fs)) {
+		__u32 unused = ext2fs_bg_itable_unused(fs, scan->current_group);
+		if (scan->inodes_left > unused)
+			scan->inodes_left -= unused;
+		else
+			scan->inodes_left = 0;
+		scan->blocks_left =
+			(scan->inodes_left +
+			 (fs->blocksize / scan->inode_size - 1)) *
+			scan->inode_size / fs->blocksize;
+	}
+	if (scan->current_block &&
+	    ((scan->current_block < fs->super->s_first_data_block) ||
+	     (scan->current_block + fs->inode_blocks_per_group - 1 >=
+	      ext2fs_blocks_count(fs->super))))
+		return EXT2_ET_GDESC_BAD_INODE_TABLE;
+	return 0;
+}
+
+errcode_t ext2fs_inode_scan_goto_blockgroup(ext2_inode_scan scan,
+					    int	group)
+{
+	scan->current_group = group - 1;
+	scan->groups_left = scan->fs->group_desc_count - group;
+	scan->bad_block_ptr = 0;
+	return get_next_blockgroup(scan);
+}
+
+/*
+ * This function is called by get_next_blocks() to check for bad
+ * blocks in the inode table.
+ *
+ * This function assumes that badblocks_list->list is sorted in
+ * increasing order.
+ */
+static errcode_t check_for_inode_bad_blocks(ext2_inode_scan scan,
+					    blk64_t *num_blocks)
+{
+	blk64_t	blk = scan->current_block;
+	badblocks_list	bb = scan->fs->badblocks;
+
+	/*
+	 * If the inode table is missing, then obviously there are no
+	 * bad blocks.  :-)
+	 */
+	if (blk == 0)
+		return 0;
+
+	/* Make sure bad_block_ptr is still valid */
+	if (scan->bad_block_ptr >= bb->num) {
+		scan->scan_flags &= ~EXT2_SF_CHK_BADBLOCKS;
+		return 0;
+	}
+
+	/*
+	 * If the current block is greater than the bad block listed
+	 * in the bad block list, then advance the pointer until this
+	 * is no longer the case.  If we run out of bad blocks, then
+	 * we don't need to do any more checking!
+	 */
+	while (blk > bb->list[scan->bad_block_ptr]) {
+		if (++scan->bad_block_ptr >= bb->num) {
+			scan->scan_flags &= ~EXT2_SF_CHK_BADBLOCKS;
+			return 0;
+		}
+	}
+
+	/*
+	 * If the current block is equal to the bad block listed in
+	 * the bad block list, then handle that one block specially.
+	 * (We could try to handle runs of bad blocks, but that
+	 * only increases CPU efficiency by a small amount, at the
+	 * expense of a huge expense of code complexity, and for an
+	 * uncommon case at that.)
+	 */
+	if (blk == bb->list[scan->bad_block_ptr]) {
+		scan->scan_flags |= EXT2_SF_BAD_INODE_BLK;
+		*num_blocks = 1;
+		if (++scan->bad_block_ptr >= bb->num)
+			scan->scan_flags &= ~EXT2_SF_CHK_BADBLOCKS;
+		return 0;
+	}
+
+	/*
+	 * If there is a bad block in the range that we're about to
+	 * read in, adjust the number of blocks to read so that we we
+	 * don't read in the bad block.  (Then the next block to read
+	 * will be the bad block, which is handled in the above case.)
+	 */
+	if ((blk + *num_blocks) > bb->list[scan->bad_block_ptr])
+		*num_blocks = (int) (bb->list[scan->bad_block_ptr] - blk);
+
+	return 0;
+}
+
+static int block_map_looks_insane(ext2_filsys fs,
+				  struct ext2_inode_large *inode)
+{
+	unsigned int i, bad;
+
+	/* We're only interested in block mapped files, dirs, and symlinks */
+	if ((inode->i_flags & EXT4_INLINE_DATA_FL) ||
+	    (inode->i_flags & EXT4_EXTENTS_FL))
+		return 0;
+	if (!LINUX_S_ISREG(inode->i_mode) &&
+	    !LINUX_S_ISLNK(inode->i_mode) &&
+	    !LINUX_S_ISDIR(inode->i_mode))
+		return 0;
+	if (LINUX_S_ISLNK(inode->i_mode) &&
+	    EXT2_I_SIZE(inode) <= sizeof(inode->i_block))
+		return 0;
+
+	/* Unused inodes probably aren't insane */
+	if (inode->i_links_count == 0)
+		return 0;
+
+	/* See if more than half the block maps are insane */
+	for (i = 0, bad = 0; i < EXT2_N_BLOCKS; i++)
+		if (inode->i_block[i] != 0 &&
+		    (inode->i_block[i] < fs->super->s_first_data_block ||
+		     inode->i_block[i] >= ext2fs_blocks_count(fs->super)))
+			bad++;
+	return bad > EXT2_N_BLOCKS / 2;
+}
+
+static int extent_head_looks_insane(struct ext2_inode_large *inode)
+{
+	if (!(inode->i_flags & EXT4_EXTENTS_FL) ||
+	    ext2fs_extent_header_verify(inode->i_block,
+					sizeof(inode->i_block)) == 0)
+		return 0;
+	return 1;
+}
+
+/*
+ * Check all the inodes that we just read into the buffer.  Record what we
+ * find here -- currently, we can observe that all checksums are ok; more
+ * than half the inodes are insane; or no conclusions at all.
+ */
+static void check_inode_block_sanity(ext2_inode_scan scan, blk64_t num_blocks)
+{
+	ext2_ino_t	ino, inodes_to_scan;
+	unsigned int	badness, checksum_failures;
+	unsigned int	inodes_in_buf, inodes_per_block;
+	char		*p;
+	struct ext2_inode_large *inode;
+	char		*block_status;
+	unsigned int	blk, bad_csum;
+
+	if (!(scan->scan_flags & EXT2_SF_WARN_GARBAGE_INODES))
+		return;
+
+	inodes_to_scan = scan->inodes_left;
+	inodes_in_buf = num_blocks * scan->fs->blocksize / scan->inode_size;
+	if (inodes_to_scan > inodes_in_buf)
+		inodes_to_scan = inodes_in_buf;
+
+	p = (char *) scan->inode_buffer;
+	ino = scan->current_inode + 1;
+	checksum_failures = badness = 0;
+	block_status = SCAN_BLOCK_STATUS(scan);
+	memset(block_status, 0, scan->inode_buffer_blocks);
+	inodes_per_block = EXT2_INODES_PER_BLOCK(scan->fs->super);
+
+	if (inodes_per_block < 2)
+		return;
+
+#ifdef WORDS_BIGENDIAN
+	if (ext2fs_get_mem(EXT2_INODE_SIZE(scan->fs->super), &inode))
+		return;
+#endif
+
+	while (inodes_to_scan > 0) {
+		blk = (p - (char *)scan->inode_buffer) / scan->fs->blocksize;
+		bad_csum = ext2fs_inode_csum_verify(scan->fs, ino,
+				(struct ext2_inode_large *) p) == 0;
+
+#ifdef WORDS_BIGENDIAN
+		ext2fs_swap_inode_full(scan->fs,
+			       (struct ext2_inode_large *) inode,
+			       (struct ext2_inode_large *) p,
+			       0, EXT2_INODE_SIZE(scan->fs->super));
+#else
+		inode = (struct ext2_inode_large *) p;
+#endif
+
+		/* Is this inode insane? */
+		if (bad_csum) {
+			checksum_failures++;
+			badness++;
+		} else if (extent_head_looks_insane(inode) ||
+			   block_map_looks_insane(scan->fs, inode))
+			badness++;
+
+		/* If more than half are insane, declare the whole block bad */
+		if (badness > inodes_per_block / 2) {
+			unsigned int ino_adj;
+
+			block_status[blk] |= IBLOCK_STATUS_INSANE;
+			ino_adj = inodes_per_block -
+						((ino - 1) % inodes_per_block);
+			if (ino_adj > inodes_to_scan)
+				ino_adj = inodes_to_scan;
+			inodes_to_scan -= ino_adj;
+			p += scan->inode_size * ino_adj;
+			ino += ino_adj;
+			checksum_failures = badness = 0;
+			continue;
+		}
+
+		if ((ino % inodes_per_block) == 0) {
+			if (checksum_failures == 0)
+				block_status[blk] |= IBLOCK_STATUS_CSUMS_OK;
+			checksum_failures = badness = 0;
+		}
+		inodes_to_scan--;
+		p += scan->inode_size;
+		ino++;
+	};
+
+#ifdef WORDS_BIGENDIAN
+	ext2fs_free_mem(&inode);
+#endif
+}
+
+/*
+ * This function is called by ext2fs_get_next_inode when it needs to
+ * read in more blocks from the current blockgroup's inode table.
+ */
+static errcode_t get_next_blocks(ext2_inode_scan scan)
+{
+	blk64_t		num_blocks;
+	errcode_t	retval;
+
+	/*
+	 * Figure out how many blocks to read; we read at most
+	 * inode_buffer_blocks, and perhaps less if there aren't that
+	 * many blocks left to read.
+	 */
+	num_blocks = scan->inode_buffer_blocks;
+	if (num_blocks > scan->blocks_left)
+		num_blocks = scan->blocks_left;
+
+	/*
+	 * If the past block "read" was a bad block, then mark the
+	 * left-over extra bytes as also being bad.
+	 */
+	if (scan->scan_flags & EXT2_SF_BAD_INODE_BLK) {
+		if (scan->bytes_left)
+			scan->scan_flags |= EXT2_SF_BAD_EXTRA_BYTES;
+		scan->scan_flags &= ~EXT2_SF_BAD_INODE_BLK;
+	}
+
+	/*
+	 * Do inode bad block processing, if necessary.
+	 */
+	if (scan->scan_flags & EXT2_SF_CHK_BADBLOCKS) {
+		retval = check_for_inode_bad_blocks(scan, &num_blocks);
+		if (retval)
+			return retval;
+	}
+
+	if ((scan->scan_flags & EXT2_SF_BAD_INODE_BLK) ||
+	    (scan->current_block == 0)) {
+		memset(scan->inode_buffer, 0,
+		       (size_t) num_blocks * scan->fs->blocksize);
+	} else {
+		retval = io_channel_read_blk64(scan->fs->io,
+					     scan->current_block,
+					     (int) num_blocks,
+					     scan->inode_buffer);
+		if (retval)
+			return EXT2_ET_NEXT_INODE_READ;
+	}
+	check_inode_block_sanity(scan, num_blocks);
+
+	scan->ptr = scan->inode_buffer;
+	scan->bytes_left = num_blocks * scan->fs->blocksize;
+
+	scan->blocks_left -= num_blocks;
+	if (scan->current_block)
+		scan->current_block += num_blocks;
+
+	return 0;
+}
+
+#if 0
+/*
+ * Returns 1 if the entire inode_buffer has a non-zero size and
+ * contains all zeros.  (Not just deleted inodes, since that means
+ * that part of the inode table was used at one point; we want all
+ * zeros, which means that the inode table is pristine.)
+ */
+static inline int is_empty_scan(ext2_inode_scan scan)
+{
+	int	i;
+
+	if (scan->bytes_left == 0)
+		return 0;
+
+	for (i=0; i < scan->bytes_left; i++)
+		if (scan->ptr[i])
+			return 0;
+	return 1;
+}
+#endif
+
+errcode_t ext2fs_get_next_inode_full(ext2_inode_scan scan, ext2_ino_t *ino,
+				     struct ext2_inode *inode, int bufsize)
+{
+	errcode_t	retval;
+	int		extra_bytes = 0;
+	int		length;
+	struct ext2_inode_large	*iptr = (struct ext2_inode_large *)inode;
+	char		*iblock_status;
+	unsigned int	iblk;
+
+	EXT2_CHECK_MAGIC(scan, EXT2_ET_MAGIC_INODE_SCAN);
+	length = EXT2_INODE_SIZE(scan->fs->super);
+	iblock_status = SCAN_BLOCK_STATUS(scan);
+
+	/*
+	 * Do we need to start reading a new block group?
+	 */
+	if (scan->inodes_left <= 0) {
+	force_new_group:
+		if (scan->done_group) {
+			retval = (scan->done_group)
+				(scan->fs, scan, scan->current_group,
+				 scan->done_group_data);
+			if (retval)
+				return retval;
+		}
+		if (scan->groups_left <= 0) {
+			*ino = 0;
+			return 0;
+		}
+		retval = get_next_blockgroup(scan);
+		if (retval)
+			return retval;
+	}
+	/*
+	 * These checks are done outside the above if statement so
+	 * they can be done for block group #0.
+	 */
+	if ((scan->scan_flags & EXT2_SF_DO_LAZY) &&
+	    (ext2fs_bg_flags_test(scan->fs, scan->current_group, EXT2_BG_INODE_UNINIT)
+	     ))
+		goto force_new_group;
+	if (scan->inodes_left == 0)
+		goto force_new_group;
+	if (scan->current_block == 0) {
+		if (scan->scan_flags & EXT2_SF_SKIP_MISSING_ITABLE) {
+			goto force_new_group;
+		} else
+			return EXT2_ET_MISSING_INODE_TABLE;
+	}
+
+
+	/*
+	 * Have we run out of space in the inode buffer?  If so, we
+	 * need to read in more blocks.
+	 */
+	if (scan->bytes_left < scan->inode_size) {
+		if (scan->bytes_left)
+			memcpy(scan->temp_buffer, scan->ptr, scan->bytes_left);
+		extra_bytes = scan->bytes_left;
+
+		retval = get_next_blocks(scan);
+		if (retval)
+			return retval;
+#if 0
+		/*
+		 * XXX test  Need check for used inode somehow.
+		 * (Note: this is hard.)
+		 */
+		if (is_empty_scan(scan))
+			goto force_new_group;
+#endif
+	}
+
+	if (bufsize < length) {
+		retval = ext2fs_get_mem(length, &iptr);
+		if (retval)
+			return retval;
+	}
+
+	retval = 0;
+	iblk = scan->current_inode % EXT2_INODES_PER_GROUP(scan->fs->super) /
+				EXT2_INODES_PER_BLOCK(scan->fs->super) %
+				scan->inode_buffer_blocks;
+	if (extra_bytes) {
+		memcpy(scan->temp_buffer+extra_bytes, scan->ptr,
+		       scan->inode_size - extra_bytes);
+		scan->ptr += scan->inode_size - extra_bytes;
+		scan->bytes_left -= scan->inode_size - extra_bytes;
+
+		/* Verify the inode checksum. */
+		if (!(iblock_status[iblk] & IBLOCK_STATUS_CSUMS_OK) &&
+		    !(scan->fs->flags & EXT2_FLAG_IGNORE_CSUM_ERRORS) &&
+		    !ext2fs_inode_csum_verify(scan->fs, scan->current_inode + 1,
+				(struct ext2_inode_large *)scan->temp_buffer))
+			retval = EXT2_ET_INODE_CSUM_INVALID;
+
+#ifdef WORDS_BIGENDIAN
+		memset(iptr, 0, length);
+		ext2fs_swap_inode_full(scan->fs,
+			       (struct ext2_inode_large *) iptr,
+			       (struct ext2_inode_large *) scan->temp_buffer,
+			       0, length);
+#else
+		memcpy(iptr, scan->temp_buffer, length);
+#endif
+		if (scan->scan_flags & EXT2_SF_BAD_EXTRA_BYTES)
+			retval = EXT2_ET_BAD_BLOCK_IN_INODE_TABLE;
+		scan->scan_flags &= ~EXT2_SF_BAD_EXTRA_BYTES;
+	} else {
+		/* Verify the inode checksum. */
+		if (!(iblock_status[iblk] & IBLOCK_STATUS_CSUMS_OK) &&
+		    !(scan->fs->flags & EXT2_FLAG_IGNORE_CSUM_ERRORS) &&
+		    !ext2fs_inode_csum_verify(scan->fs, scan->current_inode + 1,
+				(struct ext2_inode_large *)scan->ptr))
+			retval = EXT2_ET_INODE_CSUM_INVALID;
+
+#ifdef WORDS_BIGENDIAN
+		memset(iptr, 0, length);
+		ext2fs_swap_inode_full(scan->fs,
+				(struct ext2_inode_large *) iptr,
+				(struct ext2_inode_large *) scan->ptr,
+				0, length);
+#else
+		memcpy(iptr, scan->ptr, length);
+#endif
+		scan->ptr += scan->inode_size;
+		scan->bytes_left -= scan->inode_size;
+		if (scan->scan_flags & EXT2_SF_BAD_INODE_BLK)
+			retval = EXT2_ET_BAD_BLOCK_IN_INODE_TABLE;
+	}
+	if ((iblock_status[iblk] & IBLOCK_STATUS_INSANE) &&
+	    (retval == 0 || retval == EXT2_ET_INODE_CSUM_INVALID))
+		retval = EXT2_ET_INODE_IS_GARBAGE;
+
+	scan->inodes_left--;
+	scan->current_inode++;
+	*ino = scan->current_inode;
+	if (iptr != (struct ext2_inode_large *)inode) {
+		memcpy(inode, iptr, bufsize);
+		ext2fs_free_mem(&iptr);
+	}
+	return retval;
+}
+
+errcode_t ext2fs_get_next_inode(ext2_inode_scan scan, ext2_ino_t *ino,
+				struct ext2_inode *inode)
+{
+	return ext2fs_get_next_inode_full(scan, ino, inode,
+						sizeof(struct ext2_inode));
+}
+
+/*
+ * Functions to read and write a single inode.
+ */
+errcode_t ext2fs_read_inode2(ext2_filsys fs, ext2_ino_t ino,
+			     struct ext2_inode * inode, int bufsize,
+			     int flags)
+{
+	blk64_t		block_nr;
+	dgrp_t		group;
+	unsigned long 	block, offset;
+	char 		*ptr;
+	errcode_t	retval;
+	unsigned	i;
+	int		clen, inodes_per_block;
+	io_channel	io;
+	int		length = EXT2_INODE_SIZE(fs->super);
+	struct ext2_inode_large	*iptr;
+	int		cache_slot, fail_csum;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	if (ext2fs_has_feature_journal_dev(fs->super))
+		return EXT2_ET_EXTERNAL_JOURNAL_NOSUPP;
+
+	if (fs->blocksize < 1024)
+		return EXT2_FILSYS_CORRUPTED; /* Should never happen */
+
+	/* Check to see if user has an override function */
+	if (fs->read_inode &&
+	    ((bufsize == sizeof(struct ext2_inode)) ||
+	     (EXT2_INODE_SIZE(fs->super) == sizeof(struct ext2_inode)))) {
+		retval = (fs->read_inode)(fs, ino, inode);
+		if (retval != EXT2_ET_CALLBACK_NOTHANDLED)
+			return retval;
+	}
+	if ((ino == 0) || (ino > fs->super->s_inodes_count))
+		return EXT2_ET_BAD_INODE_NUM;
+	/* Create inode cache if not present */
+	if (!fs->icache) {
+		retval = ext2fs_create_inode_cache(fs, 4);
+		if (retval)
+			return retval;
+	}
+	/* Check to see if it's in the inode cache */
+	for (i = 0; i < fs->icache->cache_size; i++) {
+		if (fs->icache->cache[i].ino == ino) {
+			memcpy(inode, fs->icache->cache[i].inode,
+			       (bufsize > length) ? length : bufsize);
+			return 0;
+		}
+	}
+	if (fs->flags & EXT2_FLAG_IMAGE_FILE) {
+		inodes_per_block = fs->blocksize / EXT2_INODE_SIZE(fs->super);
+		block_nr = ext2fs_le32_to_cpu(fs->image_header->offset_inode) / fs->blocksize;
+		block_nr += (ino - 1) / inodes_per_block;
+		offset = ((ino - 1) % inodes_per_block) *
+			EXT2_INODE_SIZE(fs->super);
+		io = fs->image_io;
+	} else {
+		group = (ino - 1) / EXT2_INODES_PER_GROUP(fs->super);
+		if (group > fs->group_desc_count)
+			return EXT2_ET_BAD_INODE_NUM;
+		offset = ((ino - 1) % EXT2_INODES_PER_GROUP(fs->super)) *
+			EXT2_INODE_SIZE(fs->super);
+		block = offset >> EXT2_BLOCK_SIZE_BITS(fs->super);
+		block_nr = ext2fs_inode_table_loc(fs, group);
+		if (!block_nr)
+			return EXT2_ET_MISSING_INODE_TABLE;
+		if ((block_nr < fs->super->s_first_data_block) ||
+		    (block_nr + fs->inode_blocks_per_group - 1 >=
+		     ext2fs_blocks_count(fs->super)))
+			return EXT2_ET_GDESC_BAD_INODE_TABLE;
+		block_nr += block;
+		io = fs->io;
+	}
+	offset &= (EXT2_BLOCK_SIZE(fs->super) - 1);
+
+	cache_slot = (fs->icache->cache_last + 1) % fs->icache->cache_size;
+	iptr = (struct ext2_inode_large *)fs->icache->cache[cache_slot].inode;
+
+	ptr = (char *) iptr;
+	while (length) {
+		clen = length;
+		if ((offset + length) > fs->blocksize)
+			clen = fs->blocksize - offset;
+
+		if (block_nr != fs->icache->buffer_blk) {
+			retval = io_channel_read_blk64(io, block_nr, 1,
+						     fs->icache->buffer);
+			if (retval)
+				return retval;
+			fs->icache->buffer_blk = block_nr;
+		}
+
+		memcpy(ptr, ((char *) fs->icache->buffer) + (unsigned) offset,
+		       clen);
+
+		offset = 0;
+		length -= clen;
+		ptr += clen;
+		block_nr++;
+	}
+	length = EXT2_INODE_SIZE(fs->super);
+
+	/* Verify the inode checksum. */
+	fail_csum = !ext2fs_inode_csum_verify(fs, ino, iptr);
+
+#ifdef WORDS_BIGENDIAN
+	ext2fs_swap_inode_full(fs, (struct ext2_inode_large *) iptr,
+			       (struct ext2_inode_large *) iptr,
+			       0, length);
+#endif
+
+	/* Update the inode cache bookkeeping */
+	if (!fail_csum) {
+		fs->icache->cache_last = cache_slot;
+		fs->icache->cache[cache_slot].ino = ino;
+	}
+	memcpy(inode, iptr, (bufsize > length) ? length : bufsize);
+
+	if (!(fs->flags & EXT2_FLAG_IGNORE_CSUM_ERRORS) &&
+	    !(flags & READ_INODE_NOCSUM) && fail_csum)
+		return EXT2_ET_INODE_CSUM_INVALID;
+
+	return 0;
+}
+
+errcode_t ext2fs_read_inode_full(ext2_filsys fs, ext2_ino_t ino,
+				 struct ext2_inode * inode, int bufsize)
+{
+	return ext2fs_read_inode2(fs, ino, inode, bufsize, 0);
+}
+
+errcode_t ext2fs_read_inode(ext2_filsys fs, ext2_ino_t ino,
+			    struct ext2_inode * inode)
+{
+	return ext2fs_read_inode2(fs, ino, inode,
+				  sizeof(struct ext2_inode), 0);
+}
+
+errcode_t ext2fs_write_inode2(ext2_filsys fs, ext2_ino_t ino,
+			      struct ext2_inode * inode, int bufsize,
+			      int flags)
+{
+	blk64_t block_nr;
+	dgrp_t group;
+	unsigned long block, offset;
+	errcode_t retval = 0;
+	struct ext2_inode_large *w_inode;
+	char *ptr;
+	unsigned i;
+	int clen;
+	int length = EXT2_INODE_SIZE(fs->super);
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	if (ext2fs_has_feature_journal_dev(fs->super))
+		return EXT2_ET_EXTERNAL_JOURNAL_NOSUPP;
+
+	/* Check to see if user provided an override function */
+	if (fs->write_inode) {
+		retval = (fs->write_inode)(fs, ino, inode);
+		if (retval != EXT2_ET_CALLBACK_NOTHANDLED)
+			return retval;
+	}
+
+	if ((ino == 0) || (ino > fs->super->s_inodes_count))
+		return EXT2_ET_BAD_INODE_NUM;
+
+	/* Prepare our shadow buffer for read/modify/byteswap/write */
+	retval = ext2fs_get_mem(length, &w_inode);
+	if (retval)
+		return retval;
+
+	if (bufsize < length) {
+		retval = ext2fs_read_inode2(fs, ino,
+					    (struct ext2_inode *)w_inode,
+					    length, READ_INODE_NOCSUM);
+		if (retval)
+			goto errout;
+	}
+
+	/* Check to see if the inode cache needs to be updated */
+	if (fs->icache) {
+		for (i=0; i < fs->icache->cache_size; i++) {
+			if (fs->icache->cache[i].ino == ino) {
+				memcpy(fs->icache->cache[i].inode, inode,
+				       (bufsize > length) ? length : bufsize);
+				break;
+			}
+		}
+	} else {
+		retval = ext2fs_create_inode_cache(fs, 4);
+		if (retval)
+			goto errout;
+	}
+	memcpy(w_inode, inode, (bufsize > length) ? length : bufsize);
+
+	if (!(fs->flags & EXT2_FLAG_RW)) {
+		retval = EXT2_ET_RO_FILSYS;
+		goto errout;
+	}
+
+#ifdef WORDS_BIGENDIAN
+	ext2fs_swap_inode_full(fs, w_inode, w_inode, 1, length);
+#endif
+
+	if ((flags & WRITE_INODE_NOCSUM) == 0) {
+		retval = ext2fs_inode_csum_set(fs, ino, w_inode);
+		if (retval)
+			goto errout;
+	}
+
+	group = (ino - 1) / EXT2_INODES_PER_GROUP(fs->super);
+	offset = ((ino - 1) % EXT2_INODES_PER_GROUP(fs->super)) *
+		EXT2_INODE_SIZE(fs->super);
+	block = offset >> EXT2_BLOCK_SIZE_BITS(fs->super);
+	block_nr = ext2fs_inode_table_loc(fs, (unsigned) group);
+	if (!block_nr) {
+		retval = EXT2_ET_MISSING_INODE_TABLE;
+		goto errout;
+	}
+	if ((block_nr < fs->super->s_first_data_block) ||
+	    (block_nr + fs->inode_blocks_per_group - 1 >=
+	     ext2fs_blocks_count(fs->super))) {
+		retval = EXT2_ET_GDESC_BAD_INODE_TABLE;
+		goto errout;
+	}
+	block_nr += block;
+
+	offset &= (EXT2_BLOCK_SIZE(fs->super) - 1);
+
+	ptr = (char *) w_inode;
+
+	while (length) {
+		clen = length;
+		if ((offset + length) > fs->blocksize)
+			clen = fs->blocksize - offset;
+
+		if (fs->icache->buffer_blk != block_nr) {
+			retval = io_channel_read_blk64(fs->io, block_nr, 1,
+						     fs->icache->buffer);
+			if (retval)
+				goto errout;
+			fs->icache->buffer_blk = block_nr;
+		}
+
+
+		memcpy((char *) fs->icache->buffer + (unsigned) offset,
+		       ptr, clen);
+
+		retval = io_channel_write_blk64(fs->io, block_nr, 1,
+					      fs->icache->buffer);
+		if (retval)
+			goto errout;
+
+		offset = 0;
+		ptr += clen;
+		length -= clen;
+		block_nr++;
+	}
+
+	fs->flags |= EXT2_FLAG_CHANGED;
+errout:
+	ext2fs_free_mem(&w_inode);
+	return retval;
+}
+
+errcode_t ext2fs_write_inode_full(ext2_filsys fs, ext2_ino_t ino,
+				  struct ext2_inode * inode, int bufsize)
+{
+	return ext2fs_write_inode2(fs, ino, inode, bufsize, 0);
+}
+
+errcode_t ext2fs_write_inode(ext2_filsys fs, ext2_ino_t ino,
+			     struct ext2_inode *inode)
+{
+	return ext2fs_write_inode2(fs, ino, inode,
+				   sizeof(struct ext2_inode), 0);
+}
+
+/*
+ * This function should be called when writing a new inode.  It makes
+ * sure that extra part of large inodes is initialized properly.
+ */
+errcode_t ext2fs_write_new_inode(ext2_filsys fs, ext2_ino_t ino,
+				 struct ext2_inode *inode)
+{
+	struct ext2_inode	*buf;
+	int 			size = EXT2_INODE_SIZE(fs->super);
+	struct ext2_inode_large	*large_inode;
+	errcode_t		retval;
+	__u32 			t = fs->now ? fs->now : time(NULL);
+
+	if (!inode->i_ctime)
+		inode->i_ctime = t;
+	if (!inode->i_mtime)
+		inode->i_mtime = t;
+	if (!inode->i_atime)
+		inode->i_atime = t;
+
+	if (size == sizeof(struct ext2_inode))
+		return ext2fs_write_inode_full(fs, ino, inode,
+					       sizeof(struct ext2_inode));
+
+	buf = malloc(size);
+	if (!buf)
+		return ENOMEM;
+
+	memset(buf, 0, size);
+	*buf = *inode;
+
+	large_inode = (struct ext2_inode_large *) buf;
+	large_inode->i_extra_isize = sizeof(struct ext2_inode_large) -
+		EXT2_GOOD_OLD_INODE_SIZE;
+	if (!large_inode->i_crtime)
+		large_inode->i_crtime = t;
+
+	retval = ext2fs_write_inode_full(fs, ino, buf, size);
+	free(buf);
+	return retval;
+}
+
+
+errcode_t ext2fs_get_blocks(ext2_filsys fs, ext2_ino_t ino, blk_t *blocks)
+{
+	struct ext2_inode	inode;
+	int			i;
+	errcode_t		retval;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	if (ino > fs->super->s_inodes_count)
+		return EXT2_ET_BAD_INODE_NUM;
+
+	if (fs->get_blocks) {
+		if (!(*fs->get_blocks)(fs, ino, blocks))
+			return 0;
+	}
+	retval = ext2fs_read_inode(fs, ino, &inode);
+	if (retval)
+		return retval;
+	for (i=0; i < EXT2_N_BLOCKS; i++)
+		blocks[i] = inode.i_block[i];
+	return 0;
+}
+
+errcode_t ext2fs_check_directory(ext2_filsys fs, ext2_ino_t ino)
+{
+	struct	ext2_inode	inode;
+	errcode_t		retval;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	if (ino > fs->super->s_inodes_count)
+		return EXT2_ET_BAD_INODE_NUM;
+
+	if (fs->check_directory) {
+		retval = (fs->check_directory)(fs, ino);
+		if (retval != EXT2_ET_CALLBACK_NOTHANDLED)
+			return retval;
+	}
+	retval = ext2fs_read_inode(fs, ino, &inode);
+	if (retval)
+		return retval;
+	if (!LINUX_S_ISDIR(inode.i_mode))
+		return EXT2_ET_NO_DIRECTORY;
+	return 0;
+}
+
diff --git a/lib/ext2fs/inode_io.c b/lib/ext2fs/inode_io.c
new file mode 100644
index 0000000..d7474a6
--- /dev/null
+++ b/lib/ext2fs/inode_io.c
@@ -0,0 +1,290 @@
+/*
+ * inode_io.c --- This is allows an inode in an ext2 filesystem image
+ * 	to be accessed via the I/O manager interface.
+ *
+ * Copyright (C) 2002 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#if HAVE_ERRNO_H
+#include <errno.h>
+#endif
+#include <time.h>
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+/*
+ * For checking structure magic numbers...
+ */
+
+#define EXT2_CHECK_MAGIC(struct, code) \
+	  if ((struct)->magic != (code)) return (code)
+
+struct inode_private_data {
+	int				magic;
+	char				name[32];
+	ext2_file_t			file;
+	ext2_filsys			fs;
+	ext2_ino_t 			ino;
+	struct ext2_inode		inode;
+	int				flags;
+	struct inode_private_data	*next;
+};
+
+#define CHANNEL_HAS_INODE	0x8000
+
+static struct inode_private_data *top_intern;
+static int ino_unique = 0;
+
+static errcode_t inode_open(const char *name, int flags, io_channel *channel);
+static errcode_t inode_close(io_channel channel);
+static errcode_t inode_set_blksize(io_channel channel, int blksize);
+static errcode_t inode_read_blk(io_channel channel, unsigned long block,
+			       int count, void *data);
+static errcode_t inode_write_blk(io_channel channel, unsigned long block,
+				int count, const void *data);
+static errcode_t inode_flush(io_channel channel);
+static errcode_t inode_write_byte(io_channel channel, unsigned long offset,
+				int size, const void *data);
+static errcode_t inode_read_blk64(io_channel channel,
+				unsigned long long block, int count, void *data);
+static errcode_t inode_write_blk64(io_channel channel,
+				unsigned long long block, int count, const void *data);
+
+static struct struct_io_manager struct_inode_manager = {
+	.magic		= EXT2_ET_MAGIC_IO_MANAGER,
+	.name		= "Inode I/O Manager",
+	.open		= inode_open,
+	.close		= inode_close,
+	.set_blksize	= inode_set_blksize,
+	.read_blk	= inode_read_blk,
+	.write_blk	= inode_write_blk,
+	.flush		= inode_flush,
+	.write_byte	= inode_write_byte,
+	.read_blk64	= inode_read_blk64,
+	.write_blk64	= inode_write_blk64
+};
+
+io_manager inode_io_manager = &struct_inode_manager;
+
+errcode_t ext2fs_inode_io_intern2(ext2_filsys fs, ext2_ino_t ino,
+				  struct ext2_inode *inode,
+				  char **name)
+{
+	struct inode_private_data 	*data;
+	errcode_t			retval;
+
+	if ((retval = ext2fs_get_mem(sizeof(struct inode_private_data),
+				     &data)))
+		return retval;
+	data->magic = EXT2_ET_MAGIC_INODE_IO_CHANNEL;
+	sprintf(data->name, "%u:%d", ino, ino_unique++);
+	data->file = 0;
+	data->fs = fs;
+	data->ino = ino;
+	data->flags = 0;
+	if (inode) {
+		memcpy(&data->inode, inode, sizeof(struct ext2_inode));
+		data->flags |= CHANNEL_HAS_INODE;
+	}
+	data->next = top_intern;
+	top_intern = data;
+	*name = data->name;
+	return 0;
+}
+
+errcode_t ext2fs_inode_io_intern(ext2_filsys fs, ext2_ino_t ino,
+				 char **name)
+{
+	return ext2fs_inode_io_intern2(fs, ino, NULL, name);
+}
+
+
+static errcode_t inode_open(const char *name, int flags, io_channel *channel)
+{
+	io_channel	io = NULL;
+	struct inode_private_data *prev, *data = NULL;
+	errcode_t	retval;
+	int		open_flags;
+
+	if (name == 0)
+		return EXT2_ET_BAD_DEVICE_NAME;
+
+	for (data = top_intern, prev = NULL; data;
+	     prev = data, data = data->next)
+		if (strcmp(name, data->name) == 0)
+			break;
+	if (!data)
+		return ENOENT;
+	if (prev)
+		prev->next = data->next;
+	else
+		top_intern = data->next;
+
+	retval = ext2fs_get_mem(sizeof(struct struct_io_channel), &io);
+	if (retval)
+		goto cleanup;
+	memset(io, 0, sizeof(struct struct_io_channel));
+
+	io->magic = EXT2_ET_MAGIC_IO_CHANNEL;
+	io->manager = inode_io_manager;
+	retval = ext2fs_get_mem(strlen(name)+1, &io->name);
+	if (retval)
+		goto cleanup;
+
+	strcpy(io->name, name);
+	io->private_data = data;
+	io->block_size = 1024;
+	io->read_error = 0;
+	io->write_error = 0;
+	io->refcount = 1;
+
+	open_flags = (flags & IO_FLAG_RW) ? EXT2_FILE_WRITE : 0;
+	retval = ext2fs_file_open2(data->fs, data->ino,
+				   (data->flags & CHANNEL_HAS_INODE) ?
+				   &data->inode : 0, open_flags,
+				   &data->file);
+	if (retval)
+		goto cleanup;
+
+	*channel = io;
+	return 0;
+
+cleanup:
+	if (io && io->name)
+		ext2fs_free_mem(&io->name);
+	if (data)
+		ext2fs_free_mem(&data);
+	if (io)
+		ext2fs_free_mem(&io);
+	return retval;
+}
+
+static errcode_t inode_close(io_channel channel)
+{
+	struct inode_private_data *data;
+	errcode_t	retval = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct inode_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_INODE_IO_CHANNEL);
+
+	if (--channel->refcount > 0)
+		return 0;
+
+	retval = ext2fs_file_close(data->file);
+
+	ext2fs_free_mem(&channel->private_data);
+	if (channel->name)
+		ext2fs_free_mem(&channel->name);
+	ext2fs_free_mem(&channel);
+	return retval;
+}
+
+static errcode_t inode_set_blksize(io_channel channel, int blksize)
+{
+	struct inode_private_data *data;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct inode_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_INODE_IO_CHANNEL);
+
+	channel->block_size = blksize;
+	return 0;
+}
+
+
+static errcode_t inode_read_blk64(io_channel channel,
+				unsigned long long block, int count, void *buf)
+{
+	struct inode_private_data *data;
+	errcode_t	retval;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct inode_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_INODE_IO_CHANNEL);
+
+	if ((retval = ext2fs_file_llseek(data->file,
+				(ext2_off64_t)(block * channel->block_size),
+				EXT2_SEEK_SET, 0)))
+		return retval;
+
+	count = (count < 0) ? -count : (count * channel->block_size);
+
+	return ext2fs_file_read(data->file, buf, count, 0);
+}
+
+static errcode_t inode_read_blk(io_channel channel, unsigned long block,
+			       int count, void *buf)
+{
+	return inode_read_blk64(channel, block, count, buf);
+}
+
+static errcode_t inode_write_blk64(io_channel channel,
+				unsigned long long block, int count, const void *buf)
+{
+	struct inode_private_data *data;
+	errcode_t	retval;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct inode_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_INODE_IO_CHANNEL);
+
+	if ((retval = ext2fs_file_llseek(data->file,
+				(ext2_off64_t) (block * channel->block_size),
+				EXT2_SEEK_SET, 0)))
+		return retval;
+
+	count = (count < 0) ? -count : (count * channel->block_size);
+
+	return ext2fs_file_write(data->file, buf, count, 0);
+}
+
+static errcode_t inode_write_blk(io_channel channel, unsigned long block,
+				int count, const void *buf)
+{
+	return inode_write_blk64(channel, block, count, buf);
+}
+
+static errcode_t inode_write_byte(io_channel channel, unsigned long offset,
+				 int size, const void *buf)
+{
+	struct inode_private_data *data;
+	errcode_t	retval = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct inode_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_INODE_IO_CHANNEL);
+
+	if ((retval = ext2fs_file_lseek(data->file, offset,
+					EXT2_SEEK_SET, 0)))
+		return retval;
+
+	return ext2fs_file_write(data->file, buf, size, 0);
+}
+
+/*
+ * Flush data buffers to disk.
+ */
+static errcode_t inode_flush(io_channel channel)
+{
+	struct inode_private_data *data;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct inode_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_INODE_IO_CHANNEL);
+
+	return ext2fs_file_flush(data->file);
+}
+
diff --git a/lib/ext2fs/io_manager.c b/lib/ext2fs/io_manager.c
new file mode 100644
index 0000000..dca6af0
--- /dev/null
+++ b/lib/ext2fs/io_manager.c
@@ -0,0 +1,152 @@
+/*
+ * io_manager.c --- the I/O manager abstraction
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+errcode_t io_channel_set_options(io_channel channel, const char *opts)
+{
+	errcode_t retval = 0;
+	char *next, *ptr, *options, *arg;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+
+	if (!opts)
+		return 0;
+
+	if (!channel->manager->set_option)
+		return EXT2_ET_INVALID_ARGUMENT;
+
+	options = malloc(strlen(opts)+1);
+	if (!options)
+		return EXT2_ET_NO_MEMORY;
+	strcpy(options, opts);
+	ptr = options;
+
+	while (ptr && *ptr) {
+		next = strchr(ptr, '&');
+		if (next)
+			*next++ = 0;
+
+		arg = strchr(ptr, '=');
+		if (arg)
+			*arg++ = 0;
+
+		retval = (channel->manager->set_option)(channel, ptr, arg);
+		if (retval)
+			break;
+		ptr = next;
+	}
+	free(options);
+	return retval;
+}
+
+errcode_t io_channel_write_byte(io_channel channel, unsigned long offset,
+				int count, const void *data)
+{
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+
+	if (channel->manager->write_byte)
+		return channel->manager->write_byte(channel, offset,
+						    count, data);
+
+	return EXT2_ET_UNIMPLEMENTED;
+}
+
+errcode_t io_channel_read_blk64(io_channel channel, unsigned long long block,
+				 int count, void *data)
+{
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+
+	if (channel->manager->read_blk64)
+		return (channel->manager->read_blk64)(channel, block,
+						      count, data);
+
+	if ((block >> 32) != 0)
+		return EXT2_ET_IO_CHANNEL_NO_SUPPORT_64;
+
+	return (channel->manager->read_blk)(channel, (unsigned long) block,
+					     count, data);
+}
+
+errcode_t io_channel_write_blk64(io_channel channel, unsigned long long block,
+				 int count, const void *data)
+{
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+
+	if (channel->manager->write_blk64)
+		return (channel->manager->write_blk64)(channel, block,
+						       count, data);
+
+	if ((block >> 32) != 0)
+		return EXT2_ET_IO_CHANNEL_NO_SUPPORT_64;
+
+	return (channel->manager->write_blk)(channel, (unsigned long) block,
+					     count, data);
+}
+
+errcode_t io_channel_discard(io_channel channel, unsigned long long block,
+			     unsigned long long count)
+{
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+
+	if (channel->manager->discard)
+		return (channel->manager->discard)(channel, block, count);
+
+	return EXT2_ET_UNIMPLEMENTED;
+}
+
+errcode_t io_channel_zeroout(io_channel channel, unsigned long long block,
+			     unsigned long long count)
+{
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+
+	if (channel->manager->zeroout)
+		return (channel->manager->zeroout)(channel, block, count);
+
+	return EXT2_ET_UNIMPLEMENTED;
+}
+
+errcode_t io_channel_alloc_buf(io_channel io, int count, void *ptr)
+{
+	size_t	size;
+
+	if (count == 0)
+		size = io->block_size;
+	else if (count > 0)
+		size = io->block_size * count;
+	else
+		size = -count;
+
+	if (io->align > 0) {
+		if ((unsigned) io->align > size)
+			size = io->align;
+		return ext2fs_get_memalign(size, io->align, ptr);
+	} else
+		return ext2fs_get_mem(size, ptr);
+}
+
+errcode_t io_channel_cache_readahead(io_channel io, unsigned long long block,
+				     unsigned long long count)
+{
+	if (!io->manager->cache_readahead)
+		return EXT2_ET_OP_NOT_SUPPORTED;
+
+	return io->manager->cache_readahead(io, block, count);
+}
diff --git a/lib/ext2fs/irel.h b/lib/ext2fs/irel.h
new file mode 100644
index 0000000..23741ba
--- /dev/null
+++ b/lib/ext2fs/irel.h
@@ -0,0 +1,114 @@
+/*
+ * irel.h
+ *
+ * Copyright (C) 1996, 1997 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+struct ext2_inode_reference {
+	blk64_t	block;
+	__u16 offset;
+};
+
+struct ext2_inode_relocate_entry {
+	ext2_ino_t	new;
+	ext2_ino_t	orig;
+	__u16		flags;
+	__u16		max_refs;
+};
+
+typedef struct ext2_inode_relocation_table *ext2_irel;
+
+struct ext2_inode_relocation_table {
+	__u32	magic;
+	char	*name;
+	ext2_ino_t	current;
+	void	*priv_data;
+
+	/*
+	 * Add an inode relocation entry.
+	 */
+	errcode_t (*put)(ext2_irel irel, ext2_ino_t old,
+			      struct ext2_inode_relocate_entry *ent);
+	/*
+	 * Get an inode relocation entry.
+	 */
+	errcode_t (*get)(ext2_irel irel, ext2_ino_t old,
+			      struct ext2_inode_relocate_entry *ent);
+
+	/*
+	 * Get an inode relocation entry by its original inode number
+	 */
+	errcode_t (*get_by_orig)(ext2_irel irel, ext2_ino_t orig, ext2_ino_t *old,
+				 struct ext2_inode_relocate_entry *ent);
+
+	/*
+	 * Initialize for iterating over the inode relocation entries.
+	 */
+	errcode_t (*start_iter)(ext2_irel irel);
+
+	/*
+	 * The iterator function for the inode relocation entries.
+	 * Returns an inode number of 0 when out of entries.
+	 */
+	errcode_t (*next)(ext2_irel irel, ext2_ino_t *old,
+			  struct ext2_inode_relocate_entry *ent);
+
+	/*
+	 * Add an inode reference (i.e., note the fact that a
+	 * particular block/offset contains a reference to an inode)
+	 */
+	errcode_t (*add_ref)(ext2_irel irel, ext2_ino_t ino,
+			     struct ext2_inode_reference *ref);
+
+	/*
+	 * Initialize for iterating over the inode references for a
+	 * particular inode.
+	 */
+	errcode_t (*start_iter_ref)(ext2_irel irel, ext2_ino_t ino);
+
+	/*
+	 * The iterator function for the inode references for an
+	 * inode.  The references for only one inode can be iterator
+	 * over at a time, as the iterator state is stored in ext2_irel.
+	 */
+	errcode_t (*next_ref)(ext2_irel irel,
+			      struct ext2_inode_reference *ref);
+
+	/*
+	 * Move the inode relocation table from one inode number to
+	 * another.  Note that the inode references also must move.
+	 */
+	errcode_t (*move)(ext2_irel irel, ext2_ino_t old, ext2_ino_t new);
+
+	/*
+	 * Remove an inode relocation entry, along with all of the
+	 * inode references.
+	 */
+	errcode_t (*delete)(ext2_irel irel, ext2_ino_t old);
+
+	/*
+	 * Free the inode relocation table.
+	 */
+	errcode_t (*free)(ext2_irel irel);
+};
+
+errcode_t ext2fs_irel_memarray_create(char *name, ext2_ino_t max_inode,
+				    ext2_irel *irel);
+
+#define ext2fs_irel_put(irel, old, ent) ((irel)->put((irel), old, ent))
+#define ext2fs_irel_get(irel, old, ent) ((irel)->get((irel), old, ent))
+#define ext2fs_irel_get_by_orig(irel, orig, old, ent) \
+			((irel)->get_by_orig((irel), orig, old, ent))
+#define ext2fs_irel_start_iter(irel) ((irel)->start_iter((irel)))
+#define ext2fs_irel_next(irel, old, ent) ((irel)->next((irel), old, ent))
+#define ext2fs_irel_add_ref(irel, ino, ref) ((irel)->add_ref((irel), ino, ref))
+#define ext2fs_irel_start_iter_ref(irel, ino) ((irel)->start_iter_ref((irel), ino))
+#define ext2fs_irel_next_ref(irel, ref) ((irel)->next_ref((irel), ref))
+#define ext2fs_irel_move(irel, old, new) ((irel)->move((irel), old, new))
+#define ext2fs_irel_delete(irel, old) ((irel)->delete((irel), old))
+#define ext2fs_irel_free(irel) ((irel)->free((irel)))
diff --git a/lib/ext2fs/irel_ma.c b/lib/ext2fs/irel_ma.c
new file mode 100644
index 0000000..c64b7e7
--- /dev/null
+++ b/lib/ext2fs/irel_ma.c
@@ -0,0 +1,377 @@
+/*
+ * irel_ma.c
+ *
+ * Copyright (C) 1996, 1997 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <fcntl.h>
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#if HAVE_ERRNO_H
+#include <errno.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+#include "irel.h"
+
+static errcode_t ima_put(ext2_irel irel, ext2_ino_t old,
+			 struct ext2_inode_relocate_entry *ent);
+static errcode_t ima_get(ext2_irel irel, ext2_ino_t old,
+			 struct ext2_inode_relocate_entry *ent);
+static errcode_t ima_get_by_orig(ext2_irel irel, ext2_ino_t orig, ext2_ino_t *old,
+				 struct ext2_inode_relocate_entry *ent);
+static errcode_t ima_start_iter(ext2_irel irel);
+static errcode_t ima_next(ext2_irel irel, ext2_ino_t *old,
+			  struct ext2_inode_relocate_entry *ent);
+static errcode_t ima_add_ref(ext2_irel irel, ext2_ino_t ino,
+			     struct ext2_inode_reference *ref);
+static errcode_t ima_start_iter_ref(ext2_irel irel, ext2_ino_t ino);
+static errcode_t ima_next_ref(ext2_irel irel, struct ext2_inode_reference *ref);
+static errcode_t ima_move(ext2_irel irel, ext2_ino_t old, ext2_ino_t new);
+static errcode_t ima_delete(ext2_irel irel, ext2_ino_t old);
+static errcode_t ima_free(ext2_irel irel);
+
+/*
+ * This data structure stores the array of inode references; there is
+ * a structure for each inode.
+ */
+struct inode_reference_entry {
+	__u16 num;
+	struct ext2_inode_reference *refs;
+};
+
+struct irel_ma {
+	__u32 magic;
+	ext2_ino_t max_inode;
+	ext2_ino_t ref_current;
+	int   ref_iter;
+	ext2_ino_t	*orig_map;
+	struct ext2_inode_relocate_entry *entries;
+	struct inode_reference_entry *ref_entries;
+};
+
+errcode_t ext2fs_irel_memarray_create(char *name, ext2_ino_t max_inode,
+				      ext2_irel *new_irel)
+{
+	ext2_irel		irel = 0;
+	errcode_t	retval;
+	struct irel_ma 	*ma = 0;
+	size_t		size;
+
+	*new_irel = 0;
+
+	/*
+	 * Allocate memory structures
+	 */
+	retval = ext2fs_get_mem(sizeof(struct ext2_inode_relocation_table),
+				&irel);
+	if (retval)
+		goto errout;
+	memset(irel, 0, sizeof(struct ext2_inode_relocation_table));
+
+	retval = ext2fs_get_mem(strlen(name)+1, &irel->name);
+	if (retval)
+		goto errout;
+	strcpy(irel->name, name);
+
+	retval = ext2fs_get_mem(sizeof(struct irel_ma), &ma);
+	if (retval)
+		goto errout;
+	memset(ma, 0, sizeof(struct irel_ma));
+	irel->priv_data = ma;
+
+	size = (size_t) (sizeof(ext2_ino_t) * (max_inode+1));
+	retval = ext2fs_get_array(max_inode+1, sizeof(ext2_ino_t),
+		&ma->orig_map);
+	if (retval)
+		goto errout;
+	memset(ma->orig_map, 0, size);
+
+	size = (size_t) (sizeof(struct ext2_inode_relocate_entry) *
+			 (max_inode+1));
+	retval = ext2fs_get_array((max_inode+1,
+		sizeof(struct ext2_inode_relocate_entry), &ma->entries);
+	if (retval)
+		goto errout;
+	memset(ma->entries, 0, size);
+
+	size = (size_t) (sizeof(struct inode_reference_entry) *
+			 (max_inode+1));
+	retval = ext2fs_get_mem(max_inode+1,
+		sizeof(struct inode_reference_entry), &ma->ref_entries);
+	if (retval)
+		goto errout;
+	memset(ma->ref_entries, 0, size);
+	ma->max_inode = max_inode;
+
+	/*
+	 * Fill in the irel data structure
+	 */
+	irel->put = ima_put;
+	irel->get = ima_get;
+	irel->get_by_orig = ima_get_by_orig;
+	irel->start_iter = ima_start_iter;
+	irel->next = ima_next;
+	irel->add_ref = ima_add_ref;
+	irel->start_iter_ref = ima_start_iter_ref;
+	irel->next_ref = ima_next_ref;
+	irel->move = ima_move;
+	irel->delete = ima_delete;
+	irel->free = ima_free;
+
+	*new_irel = irel;
+	return 0;
+
+errout:
+	ima_free(irel);
+	return retval;
+}
+
+static errcode_t ima_put(ext2_irel irel, ext2_ino_t old,
+			struct ext2_inode_relocate_entry *ent)
+{
+	struct inode_reference_entry	*ref_ent;
+	struct irel_ma 			*ma;
+	errcode_t			retval;
+	size_t				size, old_size;
+
+	ma = irel->priv_data;
+	if (old > ma->max_inode)
+		return EXT2_ET_INVALID_ARGUMENT;
+
+	/*
+	 * Force the orig field to the correct value; the application
+	 * program shouldn't be messing with this field.
+	 */
+	if (ma->entries[(unsigned) old].new == 0)
+		ent->orig = old;
+	else
+		ent->orig = ma->entries[(unsigned) old].orig;
+
+	/*
+	 * If max_refs has changed, reallocate the refs array
+	 */
+	ref_ent = ma->ref_entries + (unsigned) old;
+	if (ref_ent->refs && ent->max_refs !=
+	    ma->entries[(unsigned) old].max_refs) {
+		size = (sizeof(struct ext2_inode_reference) * ent->max_refs);
+		old_size = (sizeof(struct ext2_inode_reference) *
+			    ma->entries[(unsigned) old].max_refs);
+		retval = ext2fs_resize_mem(old_size, size, &ref_ent->refs);
+		if (retval)
+			return retval;
+	}
+
+	ma->entries[(unsigned) old] = *ent;
+	ma->orig_map[(unsigned) ent->orig] = old;
+	return 0;
+}
+
+static errcode_t ima_get(ext2_irel irel, ext2_ino_t old,
+			struct ext2_inode_relocate_entry *ent)
+{
+	struct irel_ma 	*ma;
+
+	ma = irel->priv_data;
+	if (old > ma->max_inode)
+		return EXT2_ET_INVALID_ARGUMENT;
+	if (ma->entries[(unsigned) old].new == 0)
+		return ENOENT;
+	*ent = ma->entries[(unsigned) old];
+	return 0;
+}
+
+static errcode_t ima_get_by_orig(ext2_irel irel, ext2_ino_t orig, ext2_ino_t *old,
+			struct ext2_inode_relocate_entry *ent)
+{
+	struct irel_ma 	*ma;
+	ext2_ino_t	ino;
+
+	ma = irel->priv_data;
+	if (orig > ma->max_inode)
+		return EXT2_ET_INVALID_ARGUMENT;
+	ino = ma->orig_map[(unsigned) orig];
+	if (ino == 0)
+		return ENOENT;
+	*old = ino;
+	*ent = ma->entries[(unsigned) ino];
+	return 0;
+}
+
+static errcode_t ima_start_iter(ext2_irel irel)
+{
+	irel->current = 0;
+	return 0;
+}
+
+static errcode_t ima_next(ext2_irel irel, ext2_ino_t *old,
+			 struct ext2_inode_relocate_entry *ent)
+{
+	struct irel_ma 	*ma;
+
+	ma = irel->priv_data;
+	while (++irel->current < ma->max_inode) {
+		if (ma->entries[(unsigned) irel->current].new == 0)
+			continue;
+		*old = irel->current;
+		*ent = ma->entries[(unsigned) irel->current];
+		return 0;
+	}
+	*old = 0;
+	return 0;
+}
+
+static errcode_t ima_add_ref(ext2_irel irel, ext2_ino_t ino,
+			     struct ext2_inode_reference *ref)
+{
+	struct irel_ma 	*ma;
+	size_t		size;
+	struct inode_reference_entry *ref_ent;
+	struct ext2_inode_relocate_entry *ent;
+	errcode_t		retval;
+
+	ma = irel->priv_data;
+	if (ino > ma->max_inode)
+		return EXT2_ET_INVALID_ARGUMENT;
+
+	ref_ent = ma->ref_entries + (unsigned) ino;
+	ent = ma->entries + (unsigned) ino;
+
+	/*
+	 * If the inode reference array doesn't exist, create it.
+	 */
+	if (ref_ent->refs == 0) {
+		size = (size_t) ((sizeof(struct ext2_inode_reference) *
+				  ent->max_refs));
+		retval = ext2fs_get_array(ent->max_refs,
+			sizeof(struct ext2_inode_reference), &ref_ent->refs);
+		if (retval)
+			return retval;
+		memset(ref_ent->refs, 0, size);
+		ref_ent->num = 0;
+	}
+
+	if (ref_ent->num >= ent->max_refs)
+		return EXT2_ET_TOO_MANY_REFS;
+
+	ref_ent->refs[(unsigned) ref_ent->num++] = *ref;
+	return 0;
+}
+
+static errcode_t ima_start_iter_ref(ext2_irel irel, ext2_ino_t ino)
+{
+	struct irel_ma 	*ma;
+
+	ma = irel->priv_data;
+	if (ino > ma->max_inode)
+		return EXT2_ET_INVALID_ARGUMENT;
+	if (ma->entries[(unsigned) ino].new == 0)
+		return ENOENT;
+	ma->ref_current = ino;
+	ma->ref_iter = 0;
+	return 0;
+}
+
+static errcode_t ima_next_ref(ext2_irel irel,
+			      struct ext2_inode_reference *ref)
+{
+	struct irel_ma 	*ma;
+	struct inode_reference_entry *ref_ent;
+
+	ma = irel->priv_data;
+
+	ref_ent = ma->ref_entries + ma->ref_current;
+
+	if ((ref_ent->refs == NULL) ||
+	    (ma->ref_iter >= ref_ent->num)) {
+		ref->block = 0;
+		ref->offset = 0;
+		return 0;
+	}
+	*ref = ref_ent->refs[ma->ref_iter++];
+	return 0;
+}
+
+
+static errcode_t ima_move(ext2_irel irel, ext2_ino_t old, ext2_ino_t new)
+{
+	struct irel_ma 	*ma;
+
+	ma = irel->priv_data;
+	if ((old > ma->max_inode) || (new > ma->max_inode))
+		return EXT2_ET_INVALID_ARGUMENT;
+	if (ma->entries[(unsigned) old].new == 0)
+		return ENOENT;
+
+	ma->entries[(unsigned) new] = ma->entries[(unsigned) old];
+	if (ma->ref_entries[(unsigned) new].refs)
+		ext2fs_free_mem(&ma->ref_entries[(unsigned) new].refs);
+	ma->ref_entries[(unsigned) new] = ma->ref_entries[(unsigned) old];
+
+	ma->entries[(unsigned) old].new = 0;
+	ma->ref_entries[(unsigned) old].num = 0;
+	ma->ref_entries[(unsigned) old].refs = 0;
+
+	ma->orig_map[ma->entries[new].orig] = new;
+	return 0;
+}
+
+static errcode_t ima_delete(ext2_irel irel, ext2_ino_t old)
+{
+	struct irel_ma 	*ma;
+
+	ma = irel->priv_data;
+	if (old > ma->max_inode)
+		return EXT2_ET_INVALID_ARGUMENT;
+	if (ma->entries[(unsigned) old].new == 0)
+		return ENOENT;
+
+	ma->entries[old].new = 0;
+	if (ma->ref_entries[(unsigned) old].refs)
+		ext2fs_free_mem(&ma->ref_entries[(unsigned) old].refs);
+	ma->orig_map[ma->entries[(unsigned) old].orig] = 0;
+
+	ma->ref_entries[(unsigned) old].num = 0;
+	ma->ref_entries[(unsigned) old].refs = 0;
+	return 0;
+}
+
+static errcode_t ima_free(ext2_irel irel)
+{
+	struct irel_ma 	*ma;
+	ext2_ino_t	ino;
+
+	if (!irel)
+		return 0;
+
+	ma = irel->priv_data;
+
+	if (ma) {
+		if (ma->orig_map)
+			ext2fs_free_mem(&ma->orig_map);
+		if (ma->entries)
+			ext2fs_free_mem(&ma->entries);
+		if (ma->ref_entries) {
+			for (ino = 0; ino <= ma->max_inode; ino++) {
+				if (ma->ref_entries[(unsigned) ino].refs)
+					ext2fs_free_mem(&ma->ref_entries[(unsigned) ino].refs);
+			}
+			ext2fs_free_mem(&ma->ref_entries);
+		}
+		ext2fs_free_mem(&ma);
+	}
+	if (irel->name)
+		ext2fs_free_mem(&irel->name);
+	ext2fs_free_mem(&irel);
+	return 0;
+}
diff --git a/lib/ext2fs/ismounted.c b/lib/ext2fs/ismounted.c
new file mode 100644
index 0000000..a7db1a5
--- /dev/null
+++ b/lib/ext2fs/ismounted.c
@@ -0,0 +1,478 @@
+/*
+ * ismounted.c --- Check to see if the filesystem was mounted
+ *
+ * Copyright (C) 1995,1996,1997,1998,1999,2000 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+/* define BSD_SOURCE to make sure we get the major() macro */
+#ifndef _BSD_SOURCE
+#define _BSD_SOURCE
+#endif
+#ifndef _DEFAULT_SOURCE
+#define _DEFAULT_SOURCE	/* since glibc 2.20 _SVID_SOURCE is deprecated */
+#endif
+
+#include "config.h"
+#include <stdio.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#if HAVE_ERRNO_H
+#include <errno.h>
+#endif
+#include <fcntl.h>
+#ifdef HAVE_LINUX_FD_H
+#include <linux/fd.h>
+#endif
+#ifdef HAVE_LINUX_LOOP_H
+#include <linux/loop.h>
+#include <sys/ioctl.h>
+#ifdef HAVE_LINUX_MAJOR_H
+#include <linux/major.h>
+#endif /* HAVE_LINUX_MAJOR_H */
+#endif /* HAVE_LINUX_LOOP_H */
+#ifdef HAVE_MNTENT_H
+#include <mntent.h>
+#endif
+#ifdef HAVE_GETMNTINFO
+#include <paths.h>
+#include <sys/param.h>
+#include <sys/mount.h>
+#endif /* HAVE_GETMNTINFO */
+#include <string.h>
+#include <sys/stat.h>
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+#ifdef HAVE_SYS_SYSMACROS_H
+#include <sys/sysmacros.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+#include "ext2fsP.h"
+
+#ifdef HAVE_SETMNTENT
+/*
+ * Check to see if a regular file is mounted.
+ * If /etc/mtab/ is a symlink of /proc/mounts, you will need the following check
+ * because the name in /proc/mounts is a loopback device not a regular file.
+ */
+static int check_loop_mounted(const char *mnt_fsname, dev_t mnt_rdev,
+				dev_t file_dev, ino_t file_ino)
+{
+#if defined(HAVE_LINUX_LOOP_H) && defined(HAVE_LINUX_MAJOR_H)
+	struct loop_info64 loopinfo = {0, };
+	int loop_fd, ret;
+
+	if (major(mnt_rdev) == LOOP_MAJOR) {
+		loop_fd = open(mnt_fsname, O_RDONLY);
+		if (loop_fd < 0)
+			return -1;
+
+		ret = ioctl(loop_fd, LOOP_GET_STATUS64, &loopinfo);
+		close(loop_fd);
+		if (ret < 0)
+			return -1;
+
+		if (file_dev == loopinfo.lo_device &&
+				file_ino == loopinfo.lo_inode)
+			return 1;
+	}
+#endif /* defined(HAVE_LINUX_LOOP_H) && defined(HAVE_LINUX_MAJOR_H) */
+	return 0;
+}
+
+/*
+ * Helper function which checks a file in /etc/mtab format to see if a
+ * filesystem is mounted.  Returns an error if the file doesn't exist
+ * or can't be opened.
+ */
+static errcode_t check_mntent_file(const char *mtab_file, const char *file,
+				   int *mount_flags, char *mtpt, int mtlen)
+{
+	struct mntent 	*mnt;
+	struct stat	st_buf, dir_st_buf;
+	errcode_t	retval = 0;
+	dev_t		file_dev=0, file_rdev=0;
+	ino_t		file_ino=0;
+	FILE 		*f;
+	int		fd;
+
+	*mount_flags = 0;
+
+	if ((f = setmntent (mtab_file, "r")) == NULL) {
+		if (errno == ENOENT) {
+			if (getenv("EXT2FS_NO_MTAB_OK"))
+				return 0;
+			else
+				return EXT2_ET_NO_MTAB_FILE;
+		}
+		return errno;
+	}
+	if (stat(file, &st_buf) == 0) {
+		if (ext2fsP_is_disk_device(st_buf.st_mode)) {
+#ifndef __GNU__ /* The GNU hurd is broken with respect to stat devices */
+			file_rdev = st_buf.st_rdev;
+#endif	/* __GNU__ */
+		} else {
+			file_dev = st_buf.st_dev;
+			file_ino = st_buf.st_ino;
+		}
+	}
+	while ((mnt = getmntent (f)) != NULL) {
+		if (mnt->mnt_fsname[0] != '/')
+			continue;
+		if (strcmp(file, mnt->mnt_fsname) == 0) {
+			if (stat(mnt->mnt_dir, &st_buf) != 0)
+				continue;
+			if (file_rdev && (file_rdev != st_buf.st_dev)) {
+#ifdef DEBUG
+				printf("Bogus entry in %s!  "
+				       "(%s is not mounted on %s)\n",
+				       mtab_file, file, mnt->mnt_dir);
+#endif /* DEBUG */
+				continue;
+			}
+			break;
+		}
+		if (stat(mnt->mnt_fsname, &st_buf) == 0) {
+			if (ext2fsP_is_disk_device(st_buf.st_mode)) {
+#ifndef __GNU__
+				if (file_rdev &&
+				    (file_rdev == st_buf.st_rdev)) {
+					if (stat(mnt->mnt_dir,
+						 &dir_st_buf) != 0)
+						continue;
+					if (file_rdev == dir_st_buf.st_dev)
+						break;
+				}
+				if (check_loop_mounted(mnt->mnt_fsname,
+						st_buf.st_rdev, file_dev,
+						file_ino) == 1)
+					break;
+#endif	/* __GNU__ */
+			} else {
+				if (file_dev && ((file_dev == st_buf.st_dev) &&
+						 (file_ino == st_buf.st_ino)))
+					break;
+			}
+		}
+	}
+
+	if (mnt == 0) {
+#ifndef __GNU__ /* The GNU hurd is broken with respect to stat devices */
+		/*
+		 * Do an extra check to see if this is the root device.  We
+		 * can't trust /etc/mtab, and /proc/mounts will only list
+		 * /dev/root for the root filesystem.  Argh.  Instead we
+		 * check if the given device has the same major/minor number
+		 * as the device that the root directory is on.
+		 */
+		if (file_rdev && stat("/", &st_buf) == 0) {
+			if (st_buf.st_dev == file_rdev) {
+				*mount_flags = EXT2_MF_MOUNTED;
+				if (mtpt)
+					strncpy(mtpt, "/", mtlen);
+				goto is_root;
+			}
+		}
+#endif	/* __GNU__ */
+		goto errout;
+	}
+	*mount_flags = EXT2_MF_MOUNTED;
+
+#ifdef MNTOPT_RO
+	/* Check to see if the ro option is set */
+	if (hasmntopt(mnt, MNTOPT_RO))
+		*mount_flags |= EXT2_MF_READONLY;
+#endif
+
+	if (mtpt)
+		strncpy(mtpt, mnt->mnt_dir, mtlen);
+	/*
+	 * Check to see if we're referring to the root filesystem.
+	 * If so, do a manual check to see if we can open /etc/mtab
+	 * read/write, since if the root is mounted read/only, the
+	 * contents of /etc/mtab may not be accurate.
+	 */
+	if (!strcmp(mnt->mnt_dir, "/")) {
+is_root:
+#define TEST_FILE "/.ismount-test-file"
+		*mount_flags |= EXT2_MF_ISROOT;
+		fd = open(TEST_FILE, O_RDWR|O_CREAT, 0600);
+		if (fd < 0) {
+			if (errno == EROFS)
+				*mount_flags |= EXT2_MF_READONLY;
+		} else
+			close(fd);
+		(void) unlink(TEST_FILE);
+	}
+
+	if (mnt && mnt->mnt_type &&
+	    (!strcmp(mnt->mnt_type, "ext4") ||
+	     !strcmp(mnt->mnt_type, "ext3") ||
+	     !strcmp(mnt->mnt_type, "ext2")))
+		*mount_flags |= EXT2_MF_EXTFS;
+	retval = 0;
+errout:
+	endmntent (f);
+	return retval;
+}
+
+static errcode_t check_mntent(const char *file, int *mount_flags,
+			      char *mtpt, int mtlen)
+{
+	errcode_t	retval;
+
+#ifdef DEBUG
+	retval = check_mntent_file("/tmp/mtab", file, mount_flags,
+				   mtpt, mtlen);
+	if (retval == 0)
+		return 0;
+#endif /* DEBUG */
+#ifdef __linux__
+	retval = check_mntent_file("/proc/mounts", file, mount_flags,
+				   mtpt, mtlen);
+	if (retval == 0)
+		return 0;
+#endif /* __linux__ */
+#if defined(MOUNTED) || defined(_PATH_MOUNTED)
+#ifndef MOUNTED
+#define MOUNTED _PATH_MOUNTED
+#endif /* MOUNTED */
+	retval = check_mntent_file(MOUNTED, file, mount_flags, mtpt, mtlen);
+	return retval;
+#else
+	*mount_flags = 0;
+	return 0;
+#endif /* defined(MOUNTED) || defined(_PATH_MOUNTED) */
+}
+
+#else
+#if defined(HAVE_GETMNTINFO)
+
+static errcode_t check_getmntinfo(const char *file, int *mount_flags,
+				  char *mtpt, int mtlen)
+{
+	struct statfs *mp;
+        int    len, n;
+        const  char   *s1;
+	char	*s2;
+
+        n = getmntinfo(&mp, MNT_NOWAIT);
+        if (n == 0)
+		return errno;
+
+        len = sizeof(_PATH_DEV) - 1;
+        s1 = file;
+        if (strncmp(_PATH_DEV, s1, len) == 0)
+                s1 += len;
+
+	*mount_flags = 0;
+        while (--n >= 0) {
+                s2 = mp->f_mntfromname;
+                if (strncmp(_PATH_DEV, s2, len) == 0) {
+                        s2 += len - 1;
+                        *s2 = 'r';
+                }
+                if (strcmp(s1, s2) == 0 || strcmp(s1, &s2[1]) == 0) {
+			*mount_flags = EXT2_MF_MOUNTED;
+			break;
+		}
+                ++mp;
+	}
+	if (mtpt)
+		strncpy(mtpt, mp->f_mntonname, mtlen);
+	return 0;
+}
+#endif /* HAVE_GETMNTINFO */
+#endif /* HAVE_SETMNTENT */
+
+/*
+ * Check to see if we're dealing with the swap device.
+ */
+static int is_swap_device(const char *file)
+{
+	FILE		*f;
+	char		buf[1024], *cp;
+	dev_t		file_dev;
+	struct stat	st_buf;
+	int		ret = 0;
+
+	file_dev = 0;
+#ifndef __GNU__ /* The GNU hurd is broken with respect to stat devices */
+	if ((stat(file, &st_buf) == 0) &&
+	    ext2fsP_is_disk_device(st_buf.st_mode))
+		file_dev = st_buf.st_rdev;
+#endif	/* __GNU__ */
+
+	if (!(f = fopen("/proc/swaps", "r")))
+		return 0;
+	/* Skip the first line */
+	if (!fgets(buf, sizeof(buf), f))
+		goto leave;
+	if (*buf && strncmp(buf, "Filename\t", 9))
+		/* Linux <=2.6.19 contained a bug in the /proc/swaps
+		 * code where the header would not be displayed
+		 */
+		goto valid_first_line;
+
+	while (fgets(buf, sizeof(buf), f)) {
+valid_first_line:
+		if ((cp = strchr(buf, ' ')) != NULL)
+			*cp = 0;
+		if ((cp = strchr(buf, '\t')) != NULL)
+			*cp = 0;
+		if (strcmp(buf, file) == 0) {
+			ret++;
+			break;
+		}
+#ifndef __GNU__
+		if (file_dev && (stat(buf, &st_buf) == 0) &&
+		    ext2fsP_is_disk_device(st_buf.st_mode) &&
+		    file_dev == st_buf.st_rdev) {
+			ret++;
+			break;
+		}
+#endif 	/* __GNU__ */
+	}
+
+leave:
+	fclose(f);
+	return ret;
+}
+
+
+/*
+ * ext2fs_check_mount_point() fills determines if the device is
+ * mounted or otherwise busy, and fills in mount_flags with one or
+ * more of the following flags: EXT2_MF_MOUNTED, EXT2_MF_ISROOT,
+ * EXT2_MF_READONLY, EXT2_MF_SWAP, and EXT2_MF_BUSY.  If mtpt is
+ * non-NULL, the directory where the device is mounted is copied to
+ * where mtpt is pointing, up to mtlen characters.
+ */
+#ifdef __TURBOC__
+ #pragma argsused
+#endif
+errcode_t ext2fs_check_mount_point(const char *device, int *mount_flags,
+				  char *mtpt, int mtlen)
+{
+	errcode_t	retval = 0;
+	int 		busy = 0;
+
+	if (getenv("EXT2FS_PRETEND_RO_MOUNT")) {
+		*mount_flags = EXT2_MF_MOUNTED | EXT2_MF_READONLY;
+		if (getenv("EXT2FS_PRETEND_ROOTFS"))
+			*mount_flags = EXT2_MF_ISROOT;
+		return 0;
+	}
+	if (getenv("EXT2FS_PRETEND_RW_MOUNT")) {
+		*mount_flags = EXT2_MF_MOUNTED;
+		if (getenv("EXT2FS_PRETEND_ROOTFS"))
+			*mount_flags = EXT2_MF_ISROOT;
+		return 0;
+	}
+
+#ifdef __linux__ /* This only works on Linux 2.6+ systems */
+	{
+		struct stat st_buf;
+
+		if (stat(device, &st_buf) == 0 &&
+		    ext2fsP_is_disk_device(st_buf.st_mode)) {
+			int fd = open(device, O_RDONLY | O_EXCL);
+
+			if (fd >= 0) {
+				/*
+				 * The device is not busy so it's
+				 * definitelly not mounted. No need to
+				 * to perform any more checks.
+				 */
+				close(fd);
+				*mount_flags = 0;
+				return 0;
+			} else if (errno == EBUSY) {
+				busy = 1;
+			}
+		}
+	}
+#endif
+
+	if (is_swap_device(device)) {
+		*mount_flags = EXT2_MF_MOUNTED | EXT2_MF_SWAP;
+		if (mtpt)
+			strncpy(mtpt, "<swap>", mtlen);
+	} else {
+#ifdef HAVE_SETMNTENT
+		retval = check_mntent(device, mount_flags, mtpt, mtlen);
+#else
+#ifdef HAVE_GETMNTINFO
+		retval = check_getmntinfo(device, mount_flags, mtpt, mtlen);
+#else
+#if defined(__GNUC__) && !defined(_WIN32)
+ #warning "Can't use getmntent or getmntinfo to check for mounted filesystems!"
+#endif
+		*mount_flags = 0;
+#endif /* HAVE_GETMNTINFO */
+#endif /* HAVE_SETMNTENT */
+	}
+	if (retval)
+		return retval;
+
+	if (busy)
+		*mount_flags |= EXT2_MF_BUSY;
+
+	return 0;
+}
+
+/*
+ * ext2fs_check_if_mounted() sets the mount_flags EXT2_MF_MOUNTED,
+ * EXT2_MF_READONLY, and EXT2_MF_ROOT
+ *
+ */
+errcode_t ext2fs_check_if_mounted(const char *file, int *mount_flags)
+{
+	return ext2fs_check_mount_point(file, mount_flags, NULL, 0);
+}
+
+#ifdef DEBUG
+int main(int argc, char **argv)
+{
+	int	retval, mount_flags;
+	char	mntpt[80];
+
+	if (argc < 2) {
+		fprintf(stderr, "Usage: %s device\n", argv[0]);
+		exit(1);
+	}
+
+	add_error_table(&et_ext2_error_table);
+	mntpt[0] = 0;
+	retval = ext2fs_check_mount_point(argv[1], &mount_flags,
+					  mntpt, sizeof(mntpt));
+	if (retval) {
+		com_err(argv[0], retval,
+			"while calling ext2fs_check_if_mounted");
+		exit(1);
+	}
+	printf("Device %s reports flags %02x\n", argv[1], mount_flags);
+	if (mount_flags & EXT2_MF_BUSY)
+		printf("\t%s is apparently in use.\n", argv[1]);
+	if (mount_flags & EXT2_MF_MOUNTED)
+		printf("\t%s is mounted.\n", argv[1]);
+	if (mount_flags & EXT2_MF_SWAP)
+		printf("\t%s is a swap device.\n", argv[1]);
+	if (mount_flags & EXT2_MF_READONLY)
+		printf("\t%s is read-only.\n", argv[1]);
+	if (mount_flags & EXT2_MF_ISROOT)
+		printf("\t%s is the root filesystem.\n", argv[1]);
+	if (mntpt[0])
+		printf("\t%s is mounted on %s.\n", argv[1], mntpt);
+	exit(0);
+}
+#endif /* DEBUG */
diff --git a/lib/ext2fs/jfs_compat.h b/lib/ext2fs/jfs_compat.h
new file mode 100644
index 0000000..0e96b56
--- /dev/null
+++ b/lib/ext2fs/jfs_compat.h
@@ -0,0 +1,113 @@
+
+#ifndef _JFS_COMPAT_H
+#define _JFS_COMPAT_H
+
+#include "kernel-list.h"
+#include <errno.h>
+#ifdef HAVE_NETINET_IN_H
+#include <netinet/in.h>
+#endif
+#include <arpa/inet.h>
+#include <stdbool.h>
+
+#define printk printf
+#define KERN_ERR ""
+#define KERN_DEBUG ""
+
+#define REQ_OP_READ 0
+#define REQ_OP_WRITE 1
+
+#define cpu_to_le16(x)	ext2fs_cpu_to_le16(x)
+#define cpu_to_be16(x)	ext2fs_cpu_to_be16(x)
+#define cpu_to_le32(x)	ext2fs_cpu_to_le32(x)
+#define cpu_to_be32(x)	ext2fs_cpu_to_be32(x)
+#define cpu_to_le64(x)	ext2fs_cpu_to_le64(x)
+#define cpu_to_be64(x)	ext2fs_cpu_to_be64(x)
+
+#define le16_to_cpu(x)	ext2fs_le16_to_cpu(x)
+#define be16_to_cpu(x)	ext2fs_be16_to_cpu(x)
+#define le32_to_cpu(x)	ext2fs_le32_to_cpu(x)
+#define be32_to_cpu(x)	ext2fs_be32_to_cpu(x)
+#define le64_to_cpu(x)	ext2fs_le64_to_cpu(x)
+#define be64_to_cpu(x)	ext2fs_be64_to_cpu(x)
+
+typedef unsigned int tid_t;
+typedef struct journal_s journal_t;
+typedef struct kdev_s *kdev_t;
+
+struct buffer_head;
+struct inode;
+
+typedef unsigned int gfp_t;
+#define GFP_KERNEL	0
+#define GFP_NOFS	0
+#define __GFP_NOFAIL	0
+#define JBD2_TAG_SIZE32	JBD_TAG_SIZE32
+#define JBD2_BARRIER	0
+typedef __u64 u64;
+#define put_bh(x)	brelse(x)
+
+#define crc32_be(x, y, z)	ext2fs_crc32_be((x), (y), (z))
+#define spin_lock_init(x)
+#define spin_lock(x)
+#define spin_unlock(x)
+#define SLAB_HWCACHE_ALIGN	0
+#define SLAB_TEMPORARY		0
+#define KMEM_CACHE(__struct, __flags) kmem_cache_create(#__struct,\
+                sizeof(struct __struct), __alignof__(struct __struct),\
+                (__flags), NULL)
+
+#define blkdev_issue_flush(kdev)	sync_blockdev(kdev)
+#define is_power_of_2(x)	((x) != 0 && (((x) & ((x) - 1)) == 0))
+#define pr_emerg(fmt)
+#define pr_err(...)
+
+enum passtype {PASS_SCAN, PASS_REVOKE, PASS_REPLAY};
+
+#define JBD2_FC_REPLAY_STOP		0
+#define JBD2_FC_REPLAY_CONTINUE		1
+
+struct journal_s
+{
+	unsigned long		j_flags;
+	int			j_errno;
+	struct buffer_head *	j_sb_buffer;
+	struct journal_superblock_s *j_superblock;
+	int			j_format_version;
+	unsigned long		j_head;
+	unsigned long		j_tail;
+	unsigned long		j_fc_first;
+	unsigned long		j_fc_off;
+	unsigned long		j_fc_last;
+	unsigned long		j_free;
+	unsigned long		j_first, j_last;
+	kdev_t			j_dev;
+	kdev_t			j_fs_dev;
+	int			j_blocksize;
+	unsigned int		j_blk_offset;
+	unsigned int		j_total_len;
+	struct inode *		j_inode;
+	tid_t			j_tail_sequence;
+	tid_t			j_transaction_sequence;
+	__u8			j_uuid[16];
+	struct jbd2_revoke_table_s *j_revoke;
+	struct jbd2_revoke_table_s *j_revoke_table[2];
+	tid_t			j_failed_commit;
+	__u32			j_csum_seed;
+	int (*j_fc_replay_callback)(struct journal_s *journal,
+				    struct buffer_head *bh,
+				    enum passtype pass, int off,
+				    tid_t expected_tid);
+
+};
+
+#define is_journal_abort(x) 0
+
+#define BUFFER_TRACE(bh, info)	do {} while (0)
+
+/* Need this so we can compile with configure --enable-gcc-wall */
+#ifdef NO_INLINE_FUNCS
+#define inline
+#endif
+
+#endif /* _JFS_COMPAT_H */
diff --git a/lib/ext2fs/kernel-jbd.h b/lib/ext2fs/kernel-jbd.h
new file mode 100644
index 0000000..e569500
--- /dev/null
+++ b/lib/ext2fs/kernel-jbd.h
@@ -0,0 +1,456 @@
+/*
+ * linux/include/linux/jbd.h
+ *
+ * Written by Stephen C. Tweedie <sct@redhat.com>
+ *
+ * Copyright 1998-2000 Red Hat, Inc --- All Rights Reserved
+ *
+ * This file is part of the Linux kernel and is made available under
+ * the terms of the GNU General Public License, version 2, or at your
+ * option, any later version, incorporated herein by reference.
+ *
+ * Definitions for transaction data structures for the buffer cache
+ * filesystem journaling support.
+ */
+
+#ifndef _LINUX_JBD_H
+#define _LINUX_JBD_H
+
+#include "jfs_compat.h"
+#define JFS_DEBUG
+#define jfs_debug jbd_debug
+
+#ifndef __GNUC__
+#define __FUNCTION__ ""
+#endif
+
+#define journal_oom_retry 0
+
+#ifdef CONFIG_JBD_DEBUG
+/*
+ * Define JBD_EXPENSIVE_CHECKING to enable more expensive internal
+ * consistency checks.  By default we don't do this unless
+ * CONFIG_JBD_DEBUG is on.
+ */
+#define JBD_EXPENSIVE_CHECKING
+extern int journal_enable_debug;
+#else
+#define journal_enable_debug (-1)
+#endif /* !CONFIG_JBD_DEBUG */
+
+#ifdef __STDC__
+#define jbd_debug(n, f, a...)						\
+	do {								\
+		if ((n) <= journal_enable_debug) {			\
+			printk (KERN_DEBUG "(%s, %d): %s: ",		\
+				__FILE__, __LINE__, __FUNCTION__);	\
+		  	printk (f, ## a);				\
+		}							\
+	} while (0)
+#else
+#define jbd_debug(x)		/* AIX doesn't do STDC */
+#endif /* !__STDC__ */
+
+extern void * __jbd_kmalloc (char *where, size_t size, int flags, int retry);
+#define jbd_kmalloc(size, flags) \
+	__jbd_kmalloc(__FUNCTION__, (size), (flags), journal_oom_retry)
+#define jbd_rep_kmalloc(size, flags) \
+	__jbd_kmalloc(__FUNCTION__, (size), (flags), 1)
+
+#define JBD2_MIN_JOURNAL_BLOCKS 1024
+#define JBD2_DEFAULT_FAST_COMMIT_BLOCKS 256
+
+/*
+ * Internal structures used by the logging mechanism:
+ */
+
+#define JBD2_MAGIC_NUMBER 0xc03b3998U /* The first 4 bytes of /dev/random! */
+
+/*
+ * On-disk structures
+ */
+
+/*
+ * Descriptor block types:
+ */
+
+#define JBD2_DESCRIPTOR_BLOCK	1
+#define JBD2_COMMIT_BLOCK	2
+#define JBD2_SUPERBLOCK_V1	3
+#define JBD2_SUPERBLOCK_V2	4
+#define JBD2_REVOKE_BLOCK	5
+#define JBD2_FC_BLOCK		6
+
+/*
+ * Standard header for all descriptor blocks:
+ */
+typedef struct journal_header_s
+{
+	__be32		h_magic;
+	__be32		h_blocktype;
+	__be32		h_sequence;
+} journal_header_t;
+
+/*
+ * Checksum types.
+ */
+#define JBD2_CRC32_CHKSUM   1
+#define JBD2_MD5_CHKSUM     2
+#define JBD2_SHA1_CHKSUM    3
+#define JBD2_CRC32C_CHKSUM  4
+
+#define JBD2_CRC32_CHKSUM_SIZE 4
+
+#define JBD2_CHECKSUM_BYTES (32 / sizeof(__u32))
+/*
+ * Commit block header for storing transactional checksums:
+ *
+ * NOTE: If FEATURE_COMPAT_CHECKSUM (checksum v1) is set, the h_chksum*
+ * fields are used to store a checksum of the descriptor and data blocks.
+ *
+ * If FEATURE_INCOMPAT_CSUM_V2 (checksum v2) is set, then the h_chksum
+ * field is used to store crc32c(uuid+commit_block).  Each journal metadata
+ * block gets its own checksum, and data block checksums are stored in
+ * journal_block_tag (in the descriptor).  The other h_chksum* fields are
+ * not used.
+ *
+ * If FEATURE_INCOMPAT_CSUM_V3 is set, the descriptor block uses
+ * journal_block_tag3_t to store a full 32-bit checksum.  Everything else
+ * is the same as v2.
+ *
+ * Checksum v1, v2, and v3 are mutually exclusive features.
+ */
+struct commit_header {
+	__be32		h_magic;
+	__be32		h_blocktype;
+	__be32		h_sequence;
+	unsigned char	h_chksum_type;
+	unsigned char	h_chksum_size;
+	unsigned char	h_padding[2];
+	__be32		h_chksum[JBD2_CHECKSUM_BYTES];
+	__be64		h_commit_sec;
+	__be32		h_commit_nsec;
+};
+
+/*
+ * The block tag: used to describe a single buffer in the journal
+ */
+typedef struct journal_block_tag3_s
+{
+	__be32		t_blocknr;	/* The on-disk block number */
+	__be32		t_flags;	/* See below */
+	__be32		t_blocknr_high; /* most-significant high 32bits. */
+	__be32		t_checksum;	/* crc32c(uuid+seq+block) */
+} journal_block_tag3_t;
+
+typedef struct journal_block_tag_s
+{
+	__be32		t_blocknr;	/* The on-disk block number */
+	__be16		t_checksum;	/* truncated crc32c(uuid+seq+block) */
+	__be16		t_flags;	/* See below */
+	__be32		t_blocknr_high; /* most-significant high 32bits. */
+} journal_block_tag_t;
+
+/* Tail of descriptor or revoke block, for checksumming */
+struct jbd2_journal_block_tail {
+	__be32		t_checksum;
+};
+
+/*
+ * The revoke descriptor: used on disk to describe a series of blocks to
+ * be revoked from the log
+ */
+typedef struct journal_revoke_header_s
+{
+	journal_header_t r_header;
+	__be32		 r_count;	/* Count of bytes used in the block */
+} jbd2_journal_revoke_header_t;
+
+/* Definitions for the journal tag flags word: */
+#define JBD2_FLAG_ESCAPE		1	/* on-disk block is escaped */
+#define JBD2_FLAG_SAME_UUID	2	/* block has same uuid as previous */
+#define JBD2_FLAG_DELETED	4	/* block deleted by this transaction */
+#define JBD2_FLAG_LAST_TAG	8	/* last tag in this descriptor block */
+
+
+#define UUID_SIZE 16
+#define JBD2_USERS_MAX 48
+#define JBD2_USERS_SIZE (UUID_SIZE * JBD2_USERS_MAX)
+/*
+ * The journal superblock.  All fields are in big-endian byte order.
+ */
+typedef struct journal_superblock_s
+{
+/* 0x0000 */
+	journal_header_t s_header;
+
+/* 0x000C */
+	/* Static information describing the journal */
+	__be32	s_blocksize;		/* journal device blocksize */
+	__be32	s_maxlen;		/* total blocks in journal file */
+	__be32	s_first;		/* first block of log information */
+
+/* 0x0018 */
+	/* Dynamic information describing the current state of the log */
+	__be32	s_sequence;		/* first commit ID expected in log */
+	__be32	s_start;		/* blocknr of start of log */
+
+/* 0x0020 */
+	/* Error value, as set by journal_abort(). */
+	__s32	s_errno;
+
+/* 0x0024 */
+	/* Remaining fields are only valid in a version-2 superblock */
+	__be32	s_feature_compat; 	/* compatible feature set */
+	__be32	s_feature_incompat; 	/* incompatible feature set */
+	__be32	s_feature_ro_compat; 	/* readonly-compatible feature set */
+/* 0x0030 */
+	__u8	s_uuid[16];		/* 128-bit uuid for journal */
+
+/* 0x0040 */
+	__be32	s_nr_users;		/* Nr of filesystems sharing log */
+
+	__be32	s_dynsuper;		/* Blocknr of dynamic superblock copy*/
+
+/* 0x0048 */
+	__be32	s_max_transaction;	/* Limit of journal blocks per trans.*/
+	__be32	s_max_trans_data;	/* Limit of data blocks per trans. */
+
+/* 0x0050 */
+	__u8	s_checksum_type;	/* checksum type */
+	__u8	s_padding2[3];
+/* 0x0054 */
+	__be32	s_num_fc_blks;		/* Number of fast commit blocks */
+/* 0x0058 */
+	__be32	s_padding[41];
+	__be32	s_checksum;		/* crc32c(superblock) */
+
+/* 0x0100 */
+	__u8	s_users[JBD2_USERS_SIZE];		/* ids of all fs'es sharing the log */
+
+/* 0x0400 */
+} journal_superblock_t;
+
+#define JBD2_HAS_COMPAT_FEATURE(j,mask)					\
+	((j)->j_format_version >= 2 &&					\
+	 ((j)->j_superblock->s_feature_compat & ext2fs_cpu_to_be32((mask))))
+#define JBD2_HAS_RO_COMPAT_FEATURE(j,mask)				\
+	((j)->j_format_version >= 2 &&					\
+	 ((j)->j_superblock->s_feature_ro_compat & ext2fs_cpu_to_be32((mask))))
+#define JBD2_HAS_INCOMPAT_FEATURE(j,mask)				\
+	((j)->j_format_version >= 2 &&					\
+	 ((j)->j_superblock->s_feature_incompat & ext2fs_cpu_to_be32((mask))))
+
+#define JBD2_FEATURE_COMPAT_CHECKSUM		0x00000001
+
+#define JBD2_FEATURE_INCOMPAT_REVOKE		0x00000001
+#define JBD2_FEATURE_INCOMPAT_64BIT		0x00000002
+#define JBD2_FEATURE_INCOMPAT_ASYNC_COMMIT	0x00000004
+#define JBD2_FEATURE_INCOMPAT_CSUM_V2		0x00000008
+#define JBD2_FEATURE_INCOMPAT_CSUM_V3		0x00000010
+#define JBD2_FEATURE_INCOMPAT_FAST_COMMIT	0x00000020
+
+/* Features known to this kernel version: */
+#define JBD2_KNOWN_COMPAT_FEATURES	0
+#define JBD2_KNOWN_ROCOMPAT_FEATURES	0
+#define JBD2_KNOWN_INCOMPAT_FEATURES	(JBD2_FEATURE_INCOMPAT_REVOKE|\
+					 JBD2_FEATURE_INCOMPAT_ASYNC_COMMIT| \
+					 JBD2_FEATURE_INCOMPAT_64BIT|\
+					 JBD2_FEATURE_INCOMPAT_CSUM_V2|	\
+					 JBD2_FEATURE_INCOMPAT_CSUM_V3 | \
+					 JBD2_FEATURE_INCOMPAT_FAST_COMMIT)
+
+#ifdef NO_INLINE_FUNCS
+extern size_t journal_tag_bytes(journal_t *journal);
+extern int jbd2_journal_has_csum_v2or3(journal_t *journal);
+extern int jbd2_journal_get_num_fc_blks(journal_superblock_t *jsb);
+extern int tid_gt(tid_t x, tid_t y) EXT2FS_ATTR((unused));
+extern int tid_geq(tid_t x, tid_t y) EXT2FS_ATTR((unused));
+#endif
+
+#if (defined(E2FSCK_INCLUDE_INLINE_FUNCS) || !defined(NO_INLINE_FUNCS))
+#ifdef E2FSCK_INCLUDE_INLINE_FUNCS
+#if (__STDC_VERSION__ >= 199901L)
+#define _INLINE_ extern inline
+#else
+#define _INLINE_ inline
+#endif
+#else /* !E2FSCK_INCLUDE_INLINE FUNCS */
+#if (__STDC_VERSION__ >= 199901L)
+#define _INLINE_ inline
+#else /* not C99 */
+#ifdef __GNUC__
+#define _INLINE_ extern __inline__
+#else				/* For Watcom C */
+#define _INLINE_ extern inline
+#endif /* __GNUC__ */
+#endif /* __STDC_VERSION__ >= 199901L */
+#endif /* INCLUDE_INLINE_FUNCS */
+
+/* journal feature predicate functions */
+#define JBD2_FEATURE_COMPAT_FUNCS(name, flagname) \
+_INLINE_ int jbd2_has_feature_##name(journal_t *j); \
+_INLINE_ int jbd2_has_feature_##name(journal_t *j) \
+{ \
+	return ((j)->j_format_version >= 2 && \
+		((j)->j_superblock->s_feature_compat & \
+		 ext2fs_cpu_to_be32(JBD2_FEATURE_COMPAT_##flagname)) != 0); \
+} \
+_INLINE_ void jbd2_set_feature_##name(journal_t *j); \
+_INLINE_ void jbd2_set_feature_##name(journal_t *j) \
+{ \
+	(j)->j_superblock->s_feature_compat |= \
+		ext2fs_cpu_to_be32(JBD2_FEATURE_COMPAT_##flagname); \
+} \
+_INLINE_ void jbd2_clear_feature_##name(journal_t *j); \
+_INLINE_ void jbd2_clear_feature_##name(journal_t *j) \
+{ \
+	(j)->j_superblock->s_feature_compat &= \
+		~ext2fs_cpu_to_be32(JBD2_FEATURE_COMPAT_##flagname); \
+}
+
+#define JBD2_FEATURE_RO_COMPAT_FUNCS(name, flagname) \
+_INLINE_ int jbd2_has_feature_##name(journal_t *j);	\
+_INLINE_ int jbd2_has_feature_##name(journal_t *j) \
+{ \
+	return ((j)->j_format_version >= 2 && \
+		((j)->j_superblock->s_feature_ro_compat & \
+		 ext2fs_cpu_to_be32(JBD2_FEATURE_RO_COMPAT_##flagname)) != 0); \
+} \
+_INLINE_ void jbd2_set_feature_##name(journal_t *j); \
+_INLINE_ void jbd2_set_feature_##name(journal_t *j) \
+{ \
+	(j)->j_superblock->s_feature_ro_compat |= \
+		ext2fs_cpu_to_be32(JBD2_FEATURE_RO_COMPAT_##flagname); \
+} \
+_INLINE_ void jbd2_clear_feature_##name(journal_t *j); \
+_INLINE_ void jbd2_clear_feature_##name(journal_t *j) \
+{ \
+	(j)->j_superblock->s_feature_ro_compat &= \
+		~ext2fs_cpu_to_be32(JBD2_FEATURE_RO_COMPAT_##flagname); \
+}
+
+#define JBD2_FEATURE_INCOMPAT_FUNCS(name, flagname) \
+_INLINE_ int jbd2_has_feature_##name(journal_t *j); \
+_INLINE_ int jbd2_has_feature_##name(journal_t *j) \
+{ \
+	return ((j)->j_format_version >= 2 && \
+		((j)->j_superblock->s_feature_incompat & \
+		 ext2fs_cpu_to_be32(JBD2_FEATURE_INCOMPAT_##flagname)) != 0); \
+} \
+_INLINE_ void jbd2_set_feature_##name(journal_t *j); \
+_INLINE_ void jbd2_set_feature_##name(journal_t *j) \
+{ \
+	(j)->j_superblock->s_feature_incompat |= \
+		ext2fs_cpu_to_be32(JBD2_FEATURE_INCOMPAT_##flagname); \
+} \
+_INLINE_ void jbd2_clear_feature_##name(journal_t *j); \
+_INLINE_ void jbd2_clear_feature_##name(journal_t *j) \
+{ \
+	(j)->j_superblock->s_feature_incompat &= \
+		~ext2fs_cpu_to_be32(JBD2_FEATURE_INCOMPAT_##flagname); \
+}
+
+#else
+#define JBD2_FEATURE_COMPAT_FUNCS(name, flagname) \
+extern int jbd2_has_feature_##name(journal_t *j); \
+extern void jbd2_set_feature_##name(journal_t *j); \
+extern void jbd2_clear_feature_##name(journal_t *j);
+
+#define JBD2_FEATURE_RO_COMPAT_FUNCS(name, flagname) \
+extern int jbd2_has_feature_##name(journal_t *j); \
+extern void jbd2_set_feature_##name(journal_t *j); \
+extern void jbd2_clear_feature_##name(journal_t *j);
+
+#define JBD2_FEATURE_INCOMPAT_FUNCS(name, flagname) \
+extern int jbd2_has_feature_##name(journal_t *j); \
+extern void jbd2_set_feature_##name(journal_t *j); \
+extern void jbd2_clear_feature_##name(journal_t *j);
+
+#endif /* (defined(E2FSCK_INCLUDE_INLINE_FUNCS) || !defined(NO_INLINE_FUNCS)) */
+
+JBD2_FEATURE_COMPAT_FUNCS(checksum,		CHECKSUM)
+
+JBD2_FEATURE_INCOMPAT_FUNCS(revoke,		REVOKE)
+JBD2_FEATURE_INCOMPAT_FUNCS(64bit,		64BIT)
+JBD2_FEATURE_INCOMPAT_FUNCS(async_commit,	ASYNC_COMMIT)
+JBD2_FEATURE_INCOMPAT_FUNCS(csum2,		CSUM_V2)
+JBD2_FEATURE_INCOMPAT_FUNCS(csum3,		CSUM_V3)
+JBD2_FEATURE_INCOMPAT_FUNCS(fast_commit,	FAST_COMMIT)
+
+#if (defined(E2FSCK_INCLUDE_INLINE_FUNCS) || !defined(NO_INLINE_FUNCS))
+/*
+ * helper functions to deal with 32 or 64bit block numbers.
+ */
+_INLINE_ size_t journal_tag_bytes(journal_t *journal)
+{
+	size_t sz;
+
+	if (jbd2_has_feature_csum3(journal))
+		return sizeof(journal_block_tag3_t);
+
+	sz = sizeof(journal_block_tag_t);
+
+	if (jbd2_has_feature_csum2(journal))
+		sz += sizeof(__u16);
+
+	if (jbd2_has_feature_64bit(journal))
+		return sz;
+
+	return sz - sizeof(__u32);
+}
+
+_INLINE_ int jbd2_journal_has_csum_v2or3(journal_t *journal)
+{
+	if (jbd2_has_feature_csum2(journal) || jbd2_has_feature_csum3(journal))
+		return 1;
+
+	return 0;
+}
+
+_INLINE_ int jbd2_journal_get_num_fc_blks(journal_superblock_t *jsb)
+{
+	int num_fc_blocks = be32_to_cpu(jsb->s_num_fc_blks);
+
+	return num_fc_blocks ? num_fc_blocks : JBD2_DEFAULT_FAST_COMMIT_BLOCKS;
+}
+
+/* Comparison functions for transaction IDs: perform comparisons using
+ * modulo arithmetic so that they work over sequence number wraps. */
+
+_INLINE_ int tid_gt(tid_t x, tid_t y)
+{
+	int difference = (x - y);
+	return (difference > 0);
+}
+
+_INLINE_ int tid_geq(tid_t x, tid_t y)
+{
+	int difference = (x - y);
+	return (difference >= 0);
+}
+#endif /* (defined(E2FSCK_INCLUDE_INLINE_FUNCS) || !defined(NO_INLINE_FUNCS)) */
+
+#undef _INLINE_
+
+extern int journal_blocks_per_page(struct inode *inode);
+
+/*
+ * Definitions which augment the buffer_head layer
+ */
+
+/* journaling buffer types */
+#define BJ_None		0	/* Not journaled */
+#define BJ_SyncData	1	/* Normal data: flush before commit */
+#define BJ_AsyncData	2	/* writepage data: wait on it before commit */
+#define BJ_Metadata	3	/* Normal journaled metadata */
+#define BJ_Forget	4	/* Buffer superseded by this transaction */
+#define BJ_IO		5	/* Buffer is for temporary IO use */
+#define BJ_Shadow	6	/* Buffer contents being shadowed to the log */
+#define BJ_LogCtl	7	/* Buffer contains log descriptors */
+#define BJ_Reserved	8	/* Buffer is reserved for access by journal */
+#define BJ_Types	9
+
+extern int jbd_blocks_per_page(struct inode *inode);
+
+#endif	/* _LINUX_JBD_H */
diff --git a/lib/ext2fs/kernel-list.h b/lib/ext2fs/kernel-list.h
new file mode 100644
index 0000000..dd7b8e0
--- /dev/null
+++ b/lib/ext2fs/kernel-list.h
@@ -0,0 +1,111 @@
+#ifndef _LINUX_LIST_H
+#define _LINUX_LIST_H
+
+#include "compiler.h"
+
+/*
+ * Simple doubly linked list implementation.
+ *
+ * Some of the internal functions ("__xxx") are useful when
+ * manipulating whole lists rather than single entries, as
+ * sometimes we already know the next/prev entries and we can
+ * generate better code by using them directly rather than
+ * using the generic single-entry routines.
+ */
+
+struct list_head {
+	struct list_head *next, *prev;
+};
+
+#define LIST_HEAD_INIT(name) { &(name), &(name) }
+
+#define INIT_LIST_HEAD(ptr) do { \
+	(ptr)->next = (ptr); (ptr)->prev = (ptr); \
+} while (0)
+
+#if (!defined(__GNUC__) && !defined(__WATCOMC__))
+#define __inline__
+#endif
+
+/*
+ * Insert a new entry between two known consecutive entries.
+ *
+ * This is only for internal list manipulation where we know
+ * the prev/next entries already!
+ */
+static __inline__ void __list_add(struct list_head * new,
+	struct list_head * prev,
+	struct list_head * next)
+{
+	next->prev = new;
+	new->next = next;
+	new->prev = prev;
+	prev->next = new;
+}
+
+/*
+ * Insert a new entry after the specified head..
+ */
+static __inline__ void list_add(struct list_head *new, struct list_head *head)
+{
+	__list_add(new, head, head->next);
+}
+
+/*
+ * Insert a new entry at the tail
+ */
+static __inline__ void list_add_tail(struct list_head *new, struct list_head *head)
+{
+	__list_add(new, head->prev, head);
+}
+
+/*
+ * Delete a list entry by making the prev/next entries
+ * point to each other.
+ *
+ * This is only for internal list manipulation where we know
+ * the prev/next entries already!
+ */
+static __inline__ void __list_del(struct list_head * prev,
+				  struct list_head * next)
+{
+	next->prev = prev;
+	prev->next = next;
+}
+
+static __inline__ void list_del(struct list_head *entry)
+{
+	__list_del(entry->prev, entry->next);
+}
+
+static __inline__ int list_empty(struct list_head *head)
+{
+	return head->next == head;
+}
+
+/*
+ * Splice in "list" into "head"
+ */
+static __inline__ void list_splice(struct list_head *list, struct list_head *head)
+{
+	struct list_head *first = list->next;
+
+	if (first != list) {
+		struct list_head *last = list->prev;
+		struct list_head *at = head->next;
+
+		first->prev = head;
+		head->next = first;
+
+		last->next = at;
+		at->prev = last;
+	}
+}
+
+#define list_entry(ptr, type, member) \
+	container_of(ptr, type, member)
+
+#define list_for_each(pos, head) \
+        for (pos = (head)->next; pos != (head); pos = pos->next)
+
+#endif
diff --git a/lib/ext2fs/link.c b/lib/ext2fs/link.c
new file mode 100644
index 0000000..d69b1e3
--- /dev/null
+++ b/lib/ext2fs/link.c
@@ -0,0 +1,646 @@
+/*
+ * link.c --- create links in a ext2fs directory
+ *
+ * Copyright (C) 1993, 1994 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+#include "ext2fsP.h"
+
+#define EXT2_DX_ROOT_OFF 24
+
+struct dx_frame {
+	void *buf;
+	blk64_t pblock;
+	struct ext2_dx_countlimit *head;
+	struct ext2_dx_entry *entries;
+	struct ext2_dx_entry *at;
+};
+
+struct dx_lookup_info {
+	const char *name;
+	int namelen;
+	int hash_alg;
+	__u32 hash;
+	unsigned levels;
+	struct dx_frame frames[EXT4_HTREE_LEVEL];
+};
+
+static errcode_t alloc_dx_frame(ext2_filsys fs, struct dx_frame *frame)
+{
+	return ext2fs_get_mem(fs->blocksize, &frame->buf);
+}
+
+static void dx_release(struct dx_lookup_info *info)
+{
+	unsigned level;
+
+	for (level = 0; level < info->levels; level++) {
+		if (info->frames[level].buf == NULL)
+			break;
+		ext2fs_free_mem(&(info->frames[level].buf));
+	}
+	info->levels = 0;
+}
+
+static void dx_search_entry(struct dx_frame *frame, int count, __u32 hash)
+{
+	struct ext2_dx_entry *p, *q, *m;
+
+	p = frame->entries + 1;
+	q = frame->entries + count - 1;
+	while (p <= q) {
+		m = p + (q - p) / 2;
+		if (ext2fs_le32_to_cpu(m->hash) > hash)
+			q = m - 1;
+		else
+			p = m + 1;
+	}
+	frame->at = p - 1;
+}
+
+static errcode_t load_logical_dir_block(ext2_filsys fs, ext2_ino_t dir,
+					struct ext2_inode *diri, blk64_t block,
+					blk64_t *pblk, void *buf)
+{
+	errcode_t errcode;
+	int ret_flags;
+
+	errcode = ext2fs_bmap2(fs, dir, diri, NULL, 0, block, &ret_flags,
+			       pblk);
+	if (errcode)
+		return errcode;
+	if (ret_flags & BMAP_RET_UNINIT)
+		return EXT2_ET_DIR_CORRUPTED;
+	return ext2fs_read_dir_block4(fs, *pblk, buf, 0, dir);
+}
+
+static errcode_t dx_lookup(ext2_filsys fs, ext2_ino_t dir,
+			   struct ext2_inode *diri, struct dx_lookup_info *info)
+{
+	struct ext2_dx_root_info *root;
+	errcode_t errcode;
+	int level = 0;
+	int count, limit;
+	int hash_alg;
+	int hash_flags = diri->i_flags & EXT4_CASEFOLD_FL;
+	__u32 minor_hash;
+	struct dx_frame *frame;
+
+	errcode = alloc_dx_frame(fs, &(info->frames[0]));
+	if (errcode)
+		return errcode;
+	info->levels = 1;
+
+	errcode = load_logical_dir_block(fs, dir, diri, 0,
+					 &(info->frames[0].pblock),
+					 info->frames[0].buf);
+	if (errcode)
+		goto out_err;
+	root = (struct ext2_dx_root_info *) ((char *)info->frames[0].buf +
+					     EXT2_DX_ROOT_OFF);
+	hash_alg = root->hash_version;
+	if (hash_alg != EXT2_HASH_TEA && hash_alg != EXT2_HASH_HALF_MD4 &&
+	    hash_alg != EXT2_HASH_LEGACY) {
+		errcode = EXT2_ET_DIRHASH_UNSUPP;
+		goto out_err;
+	}
+	if (hash_alg <= EXT2_HASH_TEA &&
+	    fs->super->s_flags & EXT2_FLAGS_UNSIGNED_HASH)
+		hash_alg += 3;
+	if (root->indirect_levels >= ext2_dir_htree_level(fs)) {
+		errcode = EXT2_ET_DIR_CORRUPTED;
+		goto out_err;
+	}
+	info->hash_alg = hash_alg;
+
+	errcode = ext2fs_dirhash2(hash_alg, info->name, info->namelen,
+				  fs->encoding, hash_flags,
+				  fs->super->s_hash_seed, &info->hash,
+				  &minor_hash);
+	if (errcode)
+		goto out_err;
+
+	for (level = 0; level <= root->indirect_levels; level++) {
+		frame = &(info->frames[level]);
+		if (level > 0) {
+			errcode = alloc_dx_frame(fs, frame);
+			if (errcode)
+				goto out_err;
+			info->levels++;
+
+			errcode = load_logical_dir_block(fs, dir, diri,
+				ext2fs_le32_to_cpu(info->frames[level-1].at->block) & 0x0fffffff,
+				&(frame->pblock), frame->buf);
+			if (errcode)
+				goto out_err;
+		}
+		errcode = ext2fs_get_dx_countlimit(fs, frame->buf,
+						   &(frame->head), NULL);
+		if (errcode)
+			goto out_err;
+		count = ext2fs_le16_to_cpu(frame->head->count);
+		limit = ext2fs_le16_to_cpu(frame->head->limit);
+		frame->entries = (struct ext2_dx_entry *)(frame->head);
+		if (!count || count > limit) {
+			errcode = EXT2_ET_DIR_CORRUPTED;
+			goto out_err;
+		}
+
+		dx_search_entry(frame, count, info->hash);
+	}
+	return 0;
+out_err:
+	dx_release(info);
+	return errcode;
+}
+
+struct link_struct  {
+	ext2_filsys	fs;
+	const char	*name;
+	int		namelen;
+	ext2_ino_t	inode;
+	int		flags;
+	int		done;
+	unsigned int	blocksize;
+	errcode_t	err;
+	struct ext2_super_block *sb;
+};
+
+static int link_proc(ext2_ino_t dir EXT2FS_ATTR((unused)),
+		     int entru EXT2FS_ATTR((unused)),
+		     struct ext2_dir_entry *dirent,
+		     int	offset,
+		     int	blocksize,
+		     char	*buf,
+		     void	*priv_data)
+{
+	struct link_struct *ls = (struct link_struct *) priv_data;
+	struct ext2_dir_entry *next;
+	unsigned int rec_len, min_rec_len, curr_rec_len;
+	int ret = 0;
+	int csum_size = 0;
+
+	if (ls->done)
+		return DIRENT_ABORT;
+
+	rec_len = EXT2_DIR_REC_LEN(ls->namelen);
+
+	ls->err = ext2fs_get_rec_len(ls->fs, dirent, &curr_rec_len);
+	if (ls->err)
+		return DIRENT_ABORT;
+
+	if (ext2fs_has_feature_metadata_csum(ls->fs->super))
+		csum_size = sizeof(struct ext2_dir_entry_tail);
+	/*
+	 * See if the following directory entry (if any) is unused;
+	 * if so, absorb it into this one.
+	 */
+	next = (struct ext2_dir_entry *) (buf + offset + curr_rec_len);
+	if ((offset + (int) curr_rec_len < blocksize - (8 + csum_size)) &&
+	    (next->inode == 0) &&
+	    (offset + (int) curr_rec_len + (int) next->rec_len <= blocksize)) {
+		curr_rec_len += next->rec_len;
+		ls->err = ext2fs_set_rec_len(ls->fs, curr_rec_len, dirent);
+		if (ls->err)
+			return DIRENT_ABORT;
+		ret = DIRENT_CHANGED;
+	}
+
+	/*
+	 * If the directory entry is used, see if we can split the
+	 * directory entry to make room for the new name.  If so,
+	 * truncate it and return.
+	 */
+	if (dirent->inode) {
+		min_rec_len = EXT2_DIR_REC_LEN(ext2fs_dirent_name_len(dirent));
+		if (curr_rec_len < (min_rec_len + rec_len))
+			return ret;
+		rec_len = curr_rec_len - min_rec_len;
+		ls->err = ext2fs_set_rec_len(ls->fs, min_rec_len, dirent);
+		if (ls->err)
+			return DIRENT_ABORT;
+		next = (struct ext2_dir_entry *) (buf + offset +
+						  dirent->rec_len);
+		next->inode = 0;
+		ext2fs_dirent_set_name_len(next, 0);
+		ext2fs_dirent_set_file_type(next, 0);
+		ls->err = ext2fs_set_rec_len(ls->fs, rec_len, next);
+		if (ls->err)
+			return DIRENT_ABORT;
+		return DIRENT_CHANGED;
+	}
+
+	/*
+	 * If we get this far, then the directory entry is not used.
+	 * See if we can fit the request entry in.  If so, do it.
+	 */
+	if (curr_rec_len < rec_len)
+		return ret;
+	dirent->inode = ls->inode;
+	ext2fs_dirent_set_name_len(dirent, ls->namelen);
+	strncpy(dirent->name, ls->name, ls->namelen);
+	if (ext2fs_has_feature_filetype(ls->sb))
+		ext2fs_dirent_set_file_type(dirent, ls->flags & 0x7);
+
+	ls->done++;
+	return DIRENT_ABORT|DIRENT_CHANGED;
+}
+
+static errcode_t add_dirent_to_buf(ext2_filsys fs, e2_blkcnt_t blockcnt,
+				   char *buf, ext2_ino_t dir,
+				   struct ext2_inode *diri, const char *name,
+				   ext2_ino_t ino, int flags, blk64_t *pblkp)
+{
+	struct dir_context ctx;
+	struct link_struct ls;
+	errcode_t retval;
+
+	retval = load_logical_dir_block(fs, dir, diri, blockcnt, pblkp, buf);
+	if (retval)
+		return retval;
+	ctx.errcode = 0;
+	ctx.func = link_proc;
+	ctx.dir = dir;
+	ctx.flags = DIRENT_FLAG_INCLUDE_EMPTY;
+	ctx.buf = buf;
+	ctx.priv_data = &ls;
+
+	ls.fs = fs;
+	ls.name = name;
+	ls.namelen = strlen(name);
+	ls.inode = ino;
+	ls.flags = flags;
+	ls.done = 0;
+	ls.sb = fs->super;
+	ls.blocksize = fs->blocksize;
+	ls.err = 0;
+
+	ext2fs_process_dir_block(fs, pblkp, blockcnt, 0, 0, &ctx);
+	if (ctx.errcode)
+		return ctx.errcode;
+	if (ls.err)
+		return ls.err;
+	if (!ls.done)
+		return EXT2_ET_DIR_NO_SPACE;
+	return 0;
+}
+
+struct dx_hash_map {
+	__u32 hash;
+	int size;
+	int off;
+};
+
+static EXT2_QSORT_TYPE dx_hash_map_cmp(const void *ap, const void *bp)
+{
+	const struct dx_hash_map *a = ap, *b = bp;
+
+	if (a->hash < b->hash)
+		return -1;
+	if (a->hash > b->hash)
+		return 1;
+	return 0;
+}
+
+static errcode_t dx_move_dirents(ext2_filsys fs, struct dx_hash_map *map,
+				 int count, void *from, void *to)
+{
+	struct ext2_dir_entry *de;
+	int i;
+	int rec_len = 0;
+	errcode_t retval;
+	int csum_size = 0;
+	void *base = to;
+
+	if (ext2fs_has_feature_metadata_csum(fs->super))
+		csum_size = sizeof(struct ext2_dir_entry_tail);
+
+	for (i = 0; i < count; i++) {
+		de = (struct ext2_dir_entry *) ((char *)from + map[i].off);
+		rec_len = EXT2_DIR_REC_LEN(ext2fs_dirent_name_len(de));
+		memcpy(to, de, rec_len);
+		retval = ext2fs_set_rec_len(fs, rec_len, to);
+		if (retval)
+			return retval;
+		to = (char *)to + rec_len;
+	}
+	/*
+	 * Update rec_len of the last dir entry to stretch to the end of block
+	 */
+	to = (char *)to - rec_len;
+	rec_len = fs->blocksize - ((char *)to - (char *)base) - csum_size;
+	retval = ext2fs_set_rec_len(fs, rec_len, to);
+	if (retval)
+		return retval;
+	if (csum_size)
+		ext2fs_initialize_dirent_tail(fs,
+				EXT2_DIRENT_TAIL(base, fs->blocksize));
+	return 0;
+}
+
+static errcode_t dx_insert_entry(ext2_filsys fs, ext2_ino_t dir,
+				 struct dx_lookup_info *info, int level,
+				 __u32 hash, blk64_t lblk)
+{
+	int pcount;
+	struct ext2_dx_entry *top, *new;
+
+	pcount = ext2fs_le16_to_cpu(info->frames[level].head->count);
+	top = info->frames[level].entries + pcount;
+	new = info->frames[level].at + 1;
+	memmove(new + 1, new, (char *)top - (char *)new);
+	new->hash = ext2fs_cpu_to_le32(hash);
+	new->block = ext2fs_cpu_to_le32(lblk);
+	info->frames[level].head->count = ext2fs_cpu_to_le16(pcount + 1);
+	return ext2fs_write_dir_block4(fs, info->frames[level].pblock,
+				       info->frames[level].buf, 0, dir);
+}
+
+static errcode_t dx_split_leaf(ext2_filsys fs, ext2_ino_t dir,
+			       struct ext2_inode *diri,
+			       struct dx_lookup_info *info, void *buf,
+			       blk64_t leaf_pblk, blk64_t new_lblk,
+			       blk64_t new_pblk)
+{
+	int hash_flags = diri->i_flags & EXT4_CASEFOLD_FL;
+	struct ext2_dir_entry *de;
+	void *buf2;
+	errcode_t retval = 0;
+	unsigned int rec_len;
+	unsigned int offset, move_size;
+	int i, count = 0;
+	struct dx_hash_map *map;
+	int continued;
+	__u32 minor_hash;
+
+	retval = ext2fs_get_mem(fs->blocksize, &buf2);
+	if (retval)
+		return retval;
+	retval = ext2fs_get_array(fs->blocksize / 12,
+				  sizeof(struct dx_hash_map), &map);
+	if (retval) {
+		ext2fs_free_mem(&buf2);
+		return retval;
+	}
+	for (offset = 0; offset < fs->blocksize; offset += rec_len) {
+		de = (struct ext2_dir_entry *) ((char *)buf + offset);
+		retval = ext2fs_get_rec_len(fs, de, &rec_len);
+		if (retval)
+			goto out;
+		if (ext2fs_dirent_name_len(de) > 0 && de->inode) {
+			map[count].off = offset;
+			map[count].size = rec_len;
+			retval = ext2fs_dirhash2(info->hash_alg, de->name,
+					ext2fs_dirent_name_len(de),
+					fs->encoding, hash_flags,
+					fs->super->s_hash_seed,
+					&(map[count].hash),
+					&minor_hash);
+			if (retval)
+				goto out;
+			count++;
+		}
+	}
+	qsort(map, count, sizeof(struct dx_hash_map), dx_hash_map_cmp);
+	move_size = 0;
+	/* Find place to split block */
+	for (i = count - 1; i >= 0; i--) {
+		if (move_size + map[i].size / 2 > fs->blocksize / 2)
+			break;
+		move_size += map[i].size;
+	}
+	/* Let i be the first entry to move */
+	i++;
+	/* Move selected directory entries to new block */
+	retval = dx_move_dirents(fs, map + i, count - i, buf, buf2);
+	if (retval)
+		goto out;
+	retval = ext2fs_write_dir_block4(fs, new_pblk, buf2, 0, dir);
+	if (retval)
+		goto out;
+	/* Repack remaining entries in the old block */
+	retval = dx_move_dirents(fs, map, i, buf, buf2);
+	if (retval)
+		goto out;
+	retval = ext2fs_write_dir_block4(fs, leaf_pblk, buf2, 0, dir);
+	if (retval)
+		goto out;
+	/* Update parent node */
+	continued = map[i].hash == map[i-1].hash;
+	retval = dx_insert_entry(fs, dir, info, info->levels - 1,
+				 map[i].hash + continued, new_lblk);
+out:
+	ext2fs_free_mem(&buf2);
+	ext2fs_free_mem(&map);
+	return retval;
+}
+
+static errcode_t dx_grow_tree(ext2_filsys fs, ext2_ino_t dir,
+			      struct ext2_inode *diri,
+			      struct dx_lookup_info *info, void *buf,
+			      blk64_t leaf_pblk)
+{
+	int i;
+	errcode_t retval;
+	ext2_off64_t size = EXT2_I_SIZE(diri);
+	blk64_t lblk, pblk;
+	struct ext2_dir_entry *de;
+	struct ext2_dx_countlimit *head;
+	int csum_size = 0;
+	int count;
+
+	if (ext2fs_has_feature_metadata_csum(fs->super))
+		csum_size = sizeof(struct ext2_dx_tail);
+
+	/* Find level which can accommodate new child */
+	for (i = info->levels - 1; i >= 0; i--)
+		if (ext2fs_le16_to_cpu(info->frames[i].head->count) <
+		    ext2fs_le16_to_cpu(info->frames[i].head->limit))
+			break;
+	/* Need to grow tree depth? */
+	if (i < 0 && info->levels >= ext2_dir_htree_level(fs))
+		return EXT2_ET_DIR_NO_SPACE;
+	lblk = size / fs->blocksize;
+	size += fs->blocksize;
+	retval = ext2fs_inode_size_set(fs, diri, size);
+	if (retval)
+		return retval;
+	retval = ext2fs_fallocate(fs,
+			EXT2_FALLOCATE_FORCE_INIT | EXT2_FALLOCATE_ZERO_BLOCKS,
+			dir, diri, 0, lblk, 1);
+	if (retval)
+		return retval;
+	retval = ext2fs_write_inode(fs, dir, diri);
+	if (retval)
+		return retval;
+	retval = ext2fs_bmap2(fs, dir, diri, NULL, 0, lblk, NULL, &pblk);
+	if (retval)
+		return retval;
+	/* Only leaf addition needed? */
+	if (i == (int)info->levels - 1)
+		return dx_split_leaf(fs, dir, diri, info, buf, leaf_pblk,
+				     lblk, pblk);
+
+	de = buf;
+	de->inode = 0;
+	ext2fs_dirent_set_name_len(de, 0);
+	ext2fs_dirent_set_file_type(de, 0);
+	retval = ext2fs_set_rec_len(fs, fs->blocksize, de);
+	if (retval)
+		return retval;
+	head = (struct ext2_dx_countlimit *) ((char *)buf + 8);
+	count = ext2fs_le16_to_cpu(info->frames[i+1].head->count);
+	/* Growing tree depth? */
+	if (i < 0) {
+		struct ext2_dx_root_info *root;
+
+		memcpy(head, info->frames[0].entries,
+		       count * sizeof(struct ext2_dx_entry));
+		head->limit = ext2fs_cpu_to_le16(
+				(fs->blocksize - (8 + csum_size)) /
+				sizeof(struct ext2_dx_entry));
+		/* head->count gets set by memcpy above to correct value */
+
+		/* Now update tree root */
+		info->frames[0].head->count = ext2fs_cpu_to_le16(1);
+		info->frames[0].entries[0].block = ext2fs_cpu_to_le32(lblk);
+		root = (struct ext2_dx_root_info *)
+			((char *)info->frames[0].buf + EXT2_DX_ROOT_OFF);
+		root->indirect_levels++;
+	} else {
+		/* Splitting internal node in two */
+		int count1 = count / 2;
+		int count2 = count - count1;
+		__u32 split_hash = ext2fs_le32_to_cpu(info->frames[i+1].entries[count1].hash);
+
+		memcpy(head, info->frames[i+1].entries + count1,
+		       count2 * sizeof(struct ext2_dx_entry));
+		head->count = ext2fs_cpu_to_le16(count2);
+		head->limit = ext2fs_cpu_to_le16(
+				(fs->blocksize - (8 + csum_size)) /
+				sizeof(struct ext2_dx_entry));
+		info->frames[i+1].head->count = ext2fs_cpu_to_le16(count1);
+
+		/* Update parent node */
+		retval = dx_insert_entry(fs, dir, info, i, split_hash, lblk);
+		if (retval)
+			return retval;
+
+	}
+	/* Writeout split block / updated root */
+	retval = ext2fs_write_dir_block4(fs, info->frames[i+1].pblock,
+					 info->frames[i+1].buf, 0, dir);
+	if (retval)
+		return retval;
+	/* Writeout new tree block */
+	retval = ext2fs_write_dir_block4(fs, pblk, buf, 0, dir);
+	if (retval)
+		return retval;
+	return 0;
+}
+
+static errcode_t dx_link(ext2_filsys fs, ext2_ino_t dir,
+			 struct ext2_inode *diri, const char *name,
+			 ext2_ino_t ino, int flags)
+{
+	struct dx_lookup_info dx_info;
+	errcode_t retval;
+	void *blockbuf;
+	unsigned restart = 0;
+	blk64_t leaf_pblk;
+
+	retval = ext2fs_get_mem(fs->blocksize, &blockbuf);
+	if (retval)
+		return retval;
+
+	dx_info.name = name;
+	dx_info.namelen = strlen(name);
+again:
+	retval = dx_lookup(fs, dir, diri, &dx_info);
+	if (retval)
+		goto free_buf;
+
+	retval = add_dirent_to_buf(fs,
+		ext2fs_le32_to_cpu(dx_info.frames[dx_info.levels-1].at->block) & 0x0fffffff,
+		blockbuf, dir, diri, name, ino, flags, &leaf_pblk);
+	/*
+	 * Success or error other than ENOSPC...? We are done. We may need upto
+	 * two tries to add entry. One to split htree node and another to add
+	 * new leaf block.
+	 */
+	if (restart >= dx_info.levels || retval != EXT2_ET_DIR_NO_SPACE)
+		goto free_frames;
+	retval = dx_grow_tree(fs, dir, diri, &dx_info, blockbuf, leaf_pblk);
+	if (retval)
+		goto free_frames;
+	/* Restart everything now that the tree is larger */
+	restart++;
+	dx_release(&dx_info);
+	goto again;
+free_frames:
+	dx_release(&dx_info);
+free_buf:
+	ext2fs_free_mem(&blockbuf);
+	return retval;
+}
+
+/*
+ * Note: the low 3 bits of the flags field are used as the directory
+ * entry filetype.
+ */
+#ifdef __TURBOC__
+ #pragma argsused
+#endif
+errcode_t ext2fs_link(ext2_filsys fs, ext2_ino_t dir, const char *name,
+		      ext2_ino_t ino, int flags)
+{
+	errcode_t		retval;
+	struct link_struct	ls;
+	struct ext2_inode	inode;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	if (!(fs->flags & EXT2_FLAG_RW))
+		return EXT2_ET_RO_FILSYS;
+
+	if ((retval = ext2fs_read_inode(fs, dir, &inode)) != 0)
+		return retval;
+
+	if (inode.i_flags & EXT2_INDEX_FL)
+		return dx_link(fs, dir, &inode, name, ino, flags);
+
+	ls.fs = fs;
+	ls.name = name;
+	ls.namelen = name ? strlen(name) : 0;
+	ls.inode = ino;
+	ls.flags = flags;
+	ls.done = 0;
+	ls.sb = fs->super;
+	ls.blocksize = fs->blocksize;
+	ls.err = 0;
+
+	retval = ext2fs_dir_iterate2(fs, dir, DIRENT_FLAG_INCLUDE_EMPTY,
+				     NULL, link_proc, &ls);
+	if (retval)
+		return retval;
+	if (ls.err)
+		return ls.err;
+
+	if (!ls.done)
+		return EXT2_ET_DIR_NO_SPACE;
+	return 0;
+}
diff --git a/lib/ext2fs/llseek.c b/lib/ext2fs/llseek.c
new file mode 100644
index 0000000..45f21d0
--- /dev/null
+++ b/lib/ext2fs/llseek.c
@@ -0,0 +1,145 @@
+/*
+ * llseek.c -- stub calling the llseek system call
+ *
+ * Copyright (C) 1994, 1995, 1996, 1997 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#ifndef _LARGEFILE_SOURCE
+#define _LARGEFILE_SOURCE
+#endif
+#ifndef _LARGEFILE64_SOURCE
+#define _LARGEFILE64_SOURCE
+#endif
+
+#include "config.h"
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#if HAVE_ERRNO_H
+#include <errno.h>
+#endif
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#ifdef __MSDOS__
+#include <io.h>
+#endif
+#include "et/com_err.h"
+#include "ext2fs/ext2_io.h"
+
+#ifdef __linux__
+
+#if defined(HAVE_LSEEK64) && defined(HAVE_LSEEK64_PROTOTYPE)
+
+#define my_llseek lseek64
+
+#else
+#if defined(HAVE_LLSEEK)
+#include <sys/syscall.h>
+
+#ifndef HAVE_LLSEEK_PROTOTYPE
+extern long long llseek (int fd, long long offset, int origin);
+#endif
+
+#define my_llseek llseek
+
+#else	/* ! HAVE_LLSEEK */
+
+#if SIZEOF_LONG == SIZEOF_LONG_LONG || _FILE_OFFSET_BITS+0 == 64
+
+#define my_llseek lseek
+
+#else /* SIZEOF_LONG != SIZEOF_LONG_LONG */
+
+#include <linux/unistd.h>
+
+#ifndef __NR__llseek
+#define __NR__llseek            140
+#endif
+
+#ifndef __i386__
+static int _llseek (unsigned int, unsigned long,
+		   unsigned long, ext2_loff_t *, unsigned int);
+
+static _syscall5(int,_llseek,unsigned int,fd,unsigned long,offset_high,
+		 unsigned long, offset_low,ext2_loff_t *,result,
+		 unsigned int, origin);
+#endif
+
+static ext2_loff_t my_llseek (int fd, ext2_loff_t offset, int origin)
+{
+	ext2_loff_t result;
+	int retval;
+
+#ifndef __i386__
+	retval = _llseek(fd, ((unsigned long long) offset) >> 32,
+#else
+	retval = syscall(__NR__llseek, fd, (unsigned long long) (offset >> 32),
+#endif
+			  ((unsigned long long) offset) & 0xffffffff,
+			&result, origin);
+	return (retval == -1 ? (ext2_loff_t) retval : result);
+}
+
+#endif	/* SIZE_LONG == SIZEOF_LONG_LONG */
+
+#endif /* HAVE_LLSEEK */
+#endif /* defined(HAVE_LSEEK64) && defined(HAVE_LSEEK64_PROTOTYPE) */
+
+ext2_loff_t ext2fs_llseek (int fd, ext2_loff_t offset, int origin)
+{
+#if SIZEOF_OFF_T >= SIZEOF_LONG_LONG
+	return my_llseek (fd, offset, origin);
+#else
+	ext2_loff_t result;
+	static int do_compat = 0;
+
+	if (do_compat)
+		goto fallback;
+
+	result = my_llseek (fd, offset, origin);
+	if (result == -1 && errno == ENOSYS) {
+		/*
+		 * Just in case this code runs on top of an old kernel
+		 * which does not support the llseek system call
+		 */
+		do_compat++;
+	fallback:
+		if (offset < ((ext2_loff_t) 1 << ((sizeof(off_t)*8) -1)))
+			return lseek(fd, (off_t) offset, origin);
+		errno = EINVAL;
+		return -1;
+	}
+	return result;
+#endif
+}
+
+#else /* !linux */
+
+#ifndef EINVAL
+#define EINVAL EXT2_ET_INVALID_ARGUMENT
+#endif
+
+ext2_loff_t ext2fs_llseek (int fd, ext2_loff_t offset, int origin)
+{
+#if defined(HAVE_LSEEK64) && defined(HAVE_LSEEK64_PROTOTYPE)
+	return lseek64 (fd, offset, origin);
+#else
+	if ((sizeof(off_t) < sizeof(ext2_loff_t)) &&
+	    (offset >= ((ext2_loff_t) 1 << ((sizeof(off_t)*8) -1)))) {
+		errno = EINVAL;
+		return -1;
+	}
+	return lseek (fd, (off_t) offset, origin);
+#endif
+}
+
+#endif 	/* linux */
+
+
diff --git a/lib/ext2fs/lookup.c b/lib/ext2fs/lookup.c
new file mode 100644
index 0000000..c1d802c
--- /dev/null
+++ b/lib/ext2fs/lookup.c
@@ -0,0 +1,70 @@
+/*
+ * lookup.c --- ext2fs directory lookup operations
+ *
+ * Copyright (C) 1993, 1994, 1994, 1995 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+struct lookup_struct  {
+	const char	*name;
+	int		len;
+	ext2_ino_t	*inode;
+	int		found;
+};
+
+#ifdef __TURBOC__
+ #pragma argsused
+#endif
+static int lookup_proc(struct ext2_dir_entry *dirent,
+		       int	offset EXT2FS_ATTR((unused)),
+		       int	blocksize EXT2FS_ATTR((unused)),
+		       char	*buf EXT2FS_ATTR((unused)),
+		       void	*priv_data)
+{
+	struct lookup_struct *ls = (struct lookup_struct *) priv_data;
+
+	if (ls->len != ext2fs_dirent_name_len(dirent))
+		return 0;
+	if (strncmp(ls->name, dirent->name, ext2fs_dirent_name_len(dirent)))
+		return 0;
+	*ls->inode = dirent->inode;
+	ls->found++;
+	return DIRENT_ABORT;
+}
+
+
+errcode_t ext2fs_lookup(ext2_filsys fs, ext2_ino_t dir, const char *name,
+			int namelen, char *buf, ext2_ino_t *inode)
+{
+	errcode_t	retval;
+	struct lookup_struct ls;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	ls.name = name;
+	ls.len = namelen;
+	ls.inode = inode;
+	ls.found = 0;
+
+	retval = ext2fs_dir_iterate(fs, dir, 0, buf, lookup_proc, &ls);
+	if (retval)
+		return retval;
+
+	return (ls.found) ? 0 : EXT2_ET_FILE_NOT_FOUND;
+}
+
+
diff --git a/lib/ext2fs/mkdir.c b/lib/ext2fs/mkdir.c
new file mode 100644
index 0000000..437c8ff
--- /dev/null
+++ b/lib/ext2fs/mkdir.c
@@ -0,0 +1,200 @@
+/*
+ * mkdir.c --- make a directory in the filesystem
+ *
+ * Copyright (C) 1994, 1995 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+#include "ext2fsP.h"
+
+#ifndef EXT2_FT_DIR
+#define EXT2_FT_DIR		2
+#endif
+
+errcode_t ext2fs_mkdir(ext2_filsys fs, ext2_ino_t parent, ext2_ino_t inum,
+		       const char *name)
+{
+	ext2_extent_handle_t	handle;
+	errcode_t		retval;
+	struct ext2_inode	parent_inode, inode;
+	ext2_ino_t		ino = inum;
+	ext2_ino_t		scratch_ino;
+	blk64_t			blk;
+	char			*block = 0;
+	int			inline_data = 0;
+	int			drop_refcount = 0;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	/*
+	 * Create a new dir with inline data iff this feature is enabled
+	 * and ino >= EXT2_FIRST_INO.
+	 */
+	if ((!ino || ino >= EXT2_FIRST_INO(fs->super)) &&
+	    ext2fs_has_feature_inline_data(fs->super))
+		inline_data = 1;
+
+	/*
+	 * Allocate an inode, if necessary
+	 */
+	if (!ino) {
+		retval = ext2fs_new_inode(fs, parent, LINUX_S_IFDIR | 0755,
+					  0, &ino);
+		if (retval)
+			goto cleanup;
+	}
+
+	/*
+	 * Allocate a data block for the directory
+	 */
+	memset(&inode, 0, sizeof(struct ext2_inode));
+	if (!inline_data) {
+		retval = ext2fs_new_block2(fs, ext2fs_find_inode_goal(fs, ino,
+								      &inode,
+								      0),
+					   NULL, &blk);
+		if (retval)
+			goto cleanup;
+	}
+
+	/*
+	 * Create a scratch template for the directory
+	 */
+	if (inline_data)
+		retval = ext2fs_new_dir_inline_data(fs, ino, parent,
+						    inode.i_block);
+	else
+		retval = ext2fs_new_dir_block(fs, ino, parent, &block);
+	if (retval)
+		goto cleanup;
+
+	/*
+	 * Get the parent's inode, if necessary
+	 */
+	if (parent != ino) {
+		retval = ext2fs_read_inode(fs, parent, &parent_inode);
+		if (retval)
+			goto cleanup;
+	} else
+		memset(&parent_inode, 0, sizeof(parent_inode));
+
+	/*
+	 * Create the inode structure....
+	 */
+	inode.i_mode = LINUX_S_IFDIR | (0777 & ~fs->umask);
+	inode.i_uid = inode.i_gid = 0;
+	if (inline_data) {
+		inode.i_flags |= EXT4_INLINE_DATA_FL;
+		inode.i_size = EXT4_MIN_INLINE_DATA_SIZE;
+	} else {
+		if (ext2fs_has_feature_extents(fs->super))
+			inode.i_flags |= EXT4_EXTENTS_FL;
+		else
+			inode.i_block[0] = blk;
+		inode.i_size = fs->blocksize;
+		ext2fs_iblk_set(fs, &inode, 1);
+	}
+	inode.i_links_count = 2;
+
+	/*
+	 * Write out the inode and inode data block.  The inode generation
+	 * number is assigned by write_new_inode, which means that the call
+	 * to write_dir_block must come after that.
+	 */
+	retval = ext2fs_write_new_inode(fs, ino, &inode);
+	if (retval)
+		goto cleanup;
+	if (inline_data) {
+		/* init "system.data" for new dir */
+		retval = ext2fs_inline_data_init(fs, ino);
+	} else {
+		retval = ext2fs_write_dir_block4(fs, blk, block, 0, ino);
+		if (retval)
+			goto cleanup;
+
+		if (ext2fs_has_feature_extents(fs->super)) {
+			retval = ext2fs_extent_open2(fs, ino, &inode, &handle);
+			if (retval)
+				goto cleanup;
+			retval = ext2fs_extent_set_bmap(handle, 0, blk, 0);
+			ext2fs_extent_free(handle);
+			if (retval)
+				goto cleanup;
+		}
+	}
+
+	/*
+	 * Update accounting....
+	 */
+	if (!inline_data)
+		ext2fs_block_alloc_stats2(fs, blk, +1);
+	ext2fs_inode_alloc_stats2(fs, ino, +1, 1);
+	drop_refcount = 1;
+
+	/*
+	 * Link the directory into the filesystem hierarchy
+	 */
+	if (name) {
+		retval = ext2fs_lookup(fs, parent, name, strlen(name), 0,
+				       &scratch_ino);
+		if (!retval) {
+			retval = EXT2_ET_DIR_EXISTS;
+			name = 0;
+			goto cleanup;
+		}
+		if (retval != EXT2_ET_FILE_NOT_FOUND)
+			goto cleanup;
+		retval = ext2fs_link(fs, parent, name, ino, EXT2_FT_DIR);
+		if (retval)
+			goto cleanup;
+	}
+
+	/*
+	 * Update parent inode's counts
+	 */
+	if (parent != ino) {
+		/* reload parent inode due to inline data */
+		retval = ext2fs_read_inode(fs, parent, &parent_inode);
+		if (retval)
+			goto cleanup;
+		parent_inode.i_links_count++;
+		retval = ext2fs_write_inode(fs, parent, &parent_inode);
+		if (retval)
+			goto cleanup;
+	}
+	drop_refcount = 0;
+
+cleanup:
+	if (block)
+		ext2fs_free_mem(&block);
+	if (drop_refcount) {
+		if (!inline_data)
+			ext2fs_block_alloc_stats2(fs, blk, -1);
+		ext2fs_inode_alloc_stats2(fs, ino, -1, 1);
+	}
+	return retval;
+
+}
+
+
diff --git a/lib/ext2fs/mkjournal.c b/lib/ext2fs/mkjournal.c
new file mode 100644
index 0000000..54772dd
--- /dev/null
+++ b/lib/ext2fs/mkjournal.c
@@ -0,0 +1,654 @@
+/*
+ * mkjournal.c --- make a journal for a filesystem
+ *
+ * Copyright (C) 2000 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#include <assert.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#if HAVE_ERRNO_H
+#include <errno.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+#if HAVE_SYS_IOCTL_H
+#include <sys/ioctl.h>
+#endif
+#if HAVE_NETINET_IN_H
+#include <netinet/in.h>
+#endif
+
+#include "ext2_fs.h"
+#include "e2p/e2p.h"
+#include "ext2fs.h"
+
+#include "kernel-jbd.h"
+
+/*
+ * This function automatically sets up the journal superblock and
+ * returns it as an allocated block.
+ */
+errcode_t ext2fs_create_journal_superblock2(ext2_filsys fs,
+					   struct ext2fs_journal_params *jparams,
+					   int flags, char **ret_jsb)
+{
+	errcode_t		retval;
+	journal_superblock_t	*jsb;
+
+	if (jparams->num_journal_blocks < JBD2_MIN_JOURNAL_BLOCKS)
+		return EXT2_ET_JOURNAL_TOO_SMALL;
+
+	if ((retval = ext2fs_get_mem(fs->blocksize, &jsb)))
+		return retval;
+
+	memset (jsb, 0, fs->blocksize);
+
+	jsb->s_header.h_magic = htonl(JBD2_MAGIC_NUMBER);
+	if (flags & EXT2_MKJOURNAL_V1_SUPER)
+		jsb->s_header.h_blocktype = htonl(JBD2_SUPERBLOCK_V1);
+	else
+		jsb->s_header.h_blocktype = htonl(JBD2_SUPERBLOCK_V2);
+	jsb->s_blocksize = htonl(fs->blocksize);
+	jsb->s_maxlen = htonl(jparams->num_journal_blocks + jparams->num_fc_blocks);
+	jsb->s_nr_users = htonl(1);
+	jsb->s_first = htonl(1);
+	jsb->s_sequence = htonl(1);
+	jsb->s_num_fc_blks = htonl(jparams->num_fc_blocks);
+	memcpy(jsb->s_uuid, fs->super->s_uuid, sizeof(fs->super->s_uuid));
+	/*
+	 * If we're creating an external journal device, we need to
+	 * adjust these fields.
+	 */
+	if (ext2fs_has_feature_journal_dev(fs->super)) {
+		jsb->s_nr_users = 0;
+		jsb->s_first = htonl(ext2fs_journal_sb_start(fs->blocksize) + 1);
+	}
+
+	*ret_jsb = (char *) jsb;
+	return 0;
+}
+
+errcode_t ext2fs_create_journal_superblock(ext2_filsys fs, __u32 num_blocks,
+					int flags, char **ret_sb)
+{
+	struct ext2fs_journal_params jparams;
+
+	jparams.num_journal_blocks = num_blocks;
+	jparams.num_fc_blocks = 0;
+
+	return ext2fs_create_journal_superblock2(fs, &jparams, flags, ret_sb);
+}
+
+/*
+ * This function writes a journal using POSIX routines.  It is used
+ * for creating external journals and creating journals on live
+ * filesystems.
+ */
+static errcode_t write_journal_file(ext2_filsys fs, char *filename,
+				    struct ext2fs_journal_params *jparams,
+				    int flags)
+{
+	errcode_t	retval;
+	char		*buf = 0;
+	int		fd, ret_size;
+	blk_t		i;
+
+	if ((retval = ext2fs_create_journal_superblock2(fs, jparams, flags,
+						       &buf)))
+		return retval;
+
+	/* Open the device or journal file */
+	if ((fd = open(filename, O_WRONLY)) < 0) {
+		retval = errno;
+		goto errfree;
+	}
+
+	/* Write the superblock out */
+	retval = EXT2_ET_SHORT_WRITE;
+	ret_size = write(fd, buf, fs->blocksize);
+	if (ret_size < 0) {
+		retval = errno;
+		goto errout;
+	}
+	if (ret_size != (int) fs->blocksize)
+		goto errout;
+	memset(buf, 0, fs->blocksize);
+
+	if (flags & EXT2_MKJOURNAL_LAZYINIT)
+		goto success;
+
+	for (i = 1; i < jparams->num_journal_blocks + jparams->num_fc_blocks; i++) {
+		ret_size = write(fd, buf, fs->blocksize);
+		if (ret_size < 0) {
+			retval = errno;
+			goto errout;
+		}
+		if (ret_size != (int) fs->blocksize)
+			goto errout;
+	}
+
+success:
+	retval = 0;
+errout:
+	close(fd);
+errfree:
+	ext2fs_free_mem(&buf);
+	return retval;
+}
+
+/*
+ * Convenience function which zeros out _num_ blocks starting at
+ * _blk_.  In case of an error, the details of the error is returned
+ * via _ret_blk_ and _ret_count_ if they are non-NULL pointers.
+ * Returns 0 on success, and an error code on an error.
+ *
+ * As a special case, if the first argument is NULL, then it will
+ * attempt to free the static zeroizing buffer.  (This is to keep
+ * programs that check for memory leaks happy.)
+ */
+#define MAX_STRIDE_LENGTH (4194304 / (int) fs->blocksize)
+errcode_t ext2fs_zero_blocks2(ext2_filsys fs, blk64_t blk, int num,
+			      blk64_t *ret_blk, int *ret_count)
+{
+	int		j, count;
+	static void	*buf;
+	static int	stride_length;
+	errcode_t	retval;
+
+	/* If fs is null, clean up the static buffer and return */
+	if (!fs) {
+		if (buf) {
+			free(buf);
+			buf = 0;
+			stride_length = 0;
+		}
+		return 0;
+	}
+
+	/* Deal with zeroing less than 1 block */
+	if (num <= 0)
+		return 0;
+
+	/* Try a zero out command, if supported */
+	retval = io_channel_zeroout(fs->io, blk, num);
+	if (retval == 0)
+		return 0;
+
+	/* Allocate the zeroizing buffer if necessary */
+	if (num > stride_length && stride_length < MAX_STRIDE_LENGTH) {
+		void *p;
+		int new_stride = num;
+
+		if (new_stride > MAX_STRIDE_LENGTH)
+			new_stride = MAX_STRIDE_LENGTH;
+		p = realloc(buf, fs->blocksize * new_stride);
+		if (!p)
+			return EXT2_ET_NO_MEMORY;
+		buf = p;
+		stride_length = new_stride;
+		memset(buf, 0, fs->blocksize * stride_length);
+	}
+	/* OK, do the write loop */
+	j=0;
+	while (j < num) {
+		if (blk % stride_length) {
+			count = stride_length - (blk % stride_length);
+			if (count > (num - j))
+				count = num - j;
+		} else {
+			count = num - j;
+			if (count > stride_length)
+				count = stride_length;
+		}
+		retval = io_channel_write_blk64(fs->io, blk, count, buf);
+		if (retval) {
+			if (ret_count)
+				*ret_count = count;
+			if (ret_blk)
+				*ret_blk = blk;
+			return retval;
+		}
+		j += count; blk += count;
+	}
+	return 0;
+}
+
+errcode_t ext2fs_zero_blocks(ext2_filsys fs, blk_t blk, int num,
+			     blk_t *ret_blk, int *ret_count)
+{
+	blk64_t ret_blk2;
+	errcode_t retval;
+
+	retval = ext2fs_zero_blocks2(fs, blk, num, &ret_blk2, ret_count);
+	if (retval)
+		*ret_blk = (blk_t) ret_blk2;
+	return retval;
+}
+
+/*
+ * Calculate the initial goal block to be roughly at the middle of the
+ * filesystem.  Pick a group that has the largest number of free
+ * blocks.
+ */
+static blk64_t get_midpoint_journal_block(ext2_filsys fs)
+{
+	dgrp_t	group, start, end, i, log_flex;
+
+	group = ext2fs_group_of_blk2(fs, (ext2fs_blocks_count(fs->super) -
+					 fs->super->s_first_data_block) / 2);
+	log_flex = 1U << fs->super->s_log_groups_per_flex;
+	if (fs->super->s_log_groups_per_flex && (group > log_flex)) {
+		group = group & ~(log_flex - 1);
+		while ((group < fs->group_desc_count) &&
+		       ext2fs_bg_free_blocks_count(fs, group) == 0)
+			group++;
+		if (group == fs->group_desc_count)
+			group = 0;
+		start = group;
+	} else
+		start = (group > 0) ? group-1 : group;
+	end = ((group+1) < fs->group_desc_count) ? group+1 : group;
+	group = start;
+	for (i = start + 1; i <= end; i++)
+		if (ext2fs_bg_free_blocks_count(fs, i) >
+		    ext2fs_bg_free_blocks_count(fs, group))
+			group = i;
+	return ext2fs_group_first_block2(fs, group);
+}
+
+/*
+ * This function creates a journal using direct I/O routines.
+ */
+static errcode_t write_journal_inode(ext2_filsys fs, ext2_ino_t journal_ino,
+				     struct ext2fs_journal_params *jparams,
+				     blk64_t goal, int flags)
+{
+	char			*buf;
+	errcode_t		retval;
+	struct ext2_inode	inode;
+	unsigned long long	inode_size;
+	int			falloc_flags = EXT2_FALLOCATE_FORCE_INIT;
+	blk64_t			zblk;
+
+	if ((retval = ext2fs_create_journal_superblock2(fs, jparams, flags,
+						       &buf)))
+		return retval;
+
+	if ((retval = ext2fs_read_bitmaps(fs)))
+		goto out2;
+
+	if ((retval = ext2fs_read_inode(fs, journal_ino, &inode)))
+		goto out2;
+
+	if (inode.i_blocks > 0) {
+		retval = EEXIST;
+		goto out2;
+	}
+
+	if (goal == ~0ULL)
+		goal = get_midpoint_journal_block(fs);
+
+	if (ext2fs_has_feature_extents(fs->super))
+		inode.i_flags |= EXT4_EXTENTS_FL;
+
+	if (!(flags & EXT2_MKJOURNAL_LAZYINIT))
+		falloc_flags |= EXT2_FALLOCATE_ZERO_BLOCKS;
+
+	inode_size = (unsigned long long)fs->blocksize *
+			(jparams->num_journal_blocks + jparams->num_fc_blocks);
+	inode.i_mtime = inode.i_ctime = fs->now ? fs->now : time(0);
+	inode.i_links_count = 1;
+	inode.i_mode = LINUX_S_IFREG | 0600;
+	retval = ext2fs_inode_size_set(fs, &inode, inode_size);
+	if (retval)
+		goto out2;
+
+	retval = ext2fs_fallocate(fs, falloc_flags, journal_ino,
+				  &inode, goal, 0,
+				  jparams->num_journal_blocks + jparams->num_fc_blocks);
+	if (retval)
+		goto out2;
+
+	if ((retval = ext2fs_write_new_inode(fs, journal_ino, &inode)))
+		goto out2;
+
+	retval = ext2fs_bmap2(fs, journal_ino, &inode, NULL, 0, 0, NULL, &zblk);
+	if (retval)
+		goto out2;
+
+	retval = io_channel_write_blk64(fs->io, zblk, 1, buf);
+	if (retval)
+		goto out2;
+
+	memcpy(fs->super->s_jnl_blocks, inode.i_block, EXT2_N_BLOCKS*4);
+	fs->super->s_jnl_blocks[15] = inode.i_size_high;
+	fs->super->s_jnl_blocks[16] = inode.i_size;
+	fs->super->s_jnl_backup_type = EXT3_JNL_BACKUP_BLOCKS;
+	ext2fs_mark_super_dirty(fs);
+
+out2:
+	ext2fs_free_mem(&buf);
+	return retval;
+}
+
+/*
+ * Find a reasonable journal file size (in blocks) given the number of blocks
+ * in the filesystem.  For very small filesystems, it is not reasonable to
+ * have a journal that fills more than half of the filesystem.
+ *
+ * n.b. comments assume 4k blocks
+ */
+int ext2fs_default_journal_size(__u64 num_blocks)
+{
+	if (num_blocks < 2048)
+		return -1;
+	if (num_blocks < 32768)		/* 128 MB */
+		return (1024);			/* 4 MB */
+	if (num_blocks < 256*1024)	/* 1 GB */
+		return (4096);			/* 16 MB */
+	if (num_blocks < 512*1024)	/* 2 GB */
+		return (8192);			/* 32 MB */
+	if (num_blocks < 4096*1024)	/* 16 GB */
+		return (16384);			/* 64 MB */
+	if (num_blocks < 8192*1024)	/* 32 GB */
+		return (32768);			/* 128 MB */
+	if (num_blocks < 16384*1024)	/* 64 GB */
+		return (65536);			/* 256 MB */
+	if (num_blocks < 32768*1024)	/* 128 GB */
+		return (131072);		/* 512 MB */
+	return 262144;				/* 1 GB */
+}
+
+errcode_t ext2fs_get_journal_params(struct ext2fs_journal_params *params,
+		ext2_filsys fs)
+{
+	blk_t total_blks;
+	int ret;
+
+	memset(params, 0, sizeof(*params));
+	if (ext2fs_has_feature_journal_dev(fs->super)) {
+		total_blks = ext2fs_blocks_count(fs->super);
+		if (total_blks < JBD2_MIN_JOURNAL_BLOCKS)
+			return EXT2_ET_JOURNAL_TOO_SMALL;
+
+		if (!ext2fs_has_feature_fast_commit(fs->super)) {
+			params->num_journal_blocks = total_blks;
+			params->num_fc_blocks = 0;
+			return 0;
+		}
+		params->num_journal_blocks = ext2fs_blocks_count(fs->super) *
+				EXT2_JOURNAL_TO_FC_BLKS_RATIO /
+				(EXT2_JOURNAL_TO_FC_BLKS_RATIO + 1);
+		if (JBD2_MIN_JOURNAL_BLOCKS > params->num_journal_blocks)
+			params->num_journal_blocks = JBD2_MIN_JOURNAL_BLOCKS;
+		params->num_fc_blocks = total_blks - params->num_journal_blocks;
+		return 0;
+	}
+
+	ret = ext2fs_default_journal_size(ext2fs_blocks_count(fs->super));
+	if (ret < 0)
+		return EXT2_ET_JOURNAL_TOO_SMALL;
+
+	params->num_journal_blocks = ret;
+	if (ext2fs_has_feature_fast_commit(fs->super))
+		params->num_fc_blocks = params->num_journal_blocks /
+			EXT2_JOURNAL_TO_FC_BLKS_RATIO;
+	return 0;
+}
+
+int ext2fs_journal_sb_start(int blocksize)
+{
+	if (blocksize == EXT2_MIN_BLOCK_SIZE)
+		return 2;
+	return 1;
+}
+
+/*
+ * This function adds a journal device to a filesystem
+ */
+errcode_t ext2fs_add_journal_device(ext2_filsys fs, ext2_filsys journal_dev)
+{
+	struct stat	st;
+	errcode_t	retval;
+	char		buf[SUPERBLOCK_SIZE];
+	journal_superblock_t	*jsb;
+	int		start;
+	__u32		i, nr_users;
+
+	/* Make sure the device exists and is a block device */
+	if (stat(journal_dev->device_name, &st) < 0)
+		return errno;
+
+	if (!S_ISBLK(st.st_mode))
+		return EXT2_ET_JOURNAL_NOT_BLOCK; /* Must be a block device */
+
+	/* Get the journal superblock */
+	start = ext2fs_journal_sb_start(journal_dev->blocksize);
+	if ((retval = io_channel_read_blk64(journal_dev->io, start,
+					    -SUPERBLOCK_SIZE,
+					    buf)))
+		return retval;
+
+	jsb = (journal_superblock_t *) buf;
+	if ((jsb->s_header.h_magic != (unsigned) ntohl(JBD2_MAGIC_NUMBER)) ||
+	    (jsb->s_header.h_blocktype != (unsigned) ntohl(JBD2_SUPERBLOCK_V2)))
+		return EXT2_ET_NO_JOURNAL_SB;
+
+	if (ntohl(jsb->s_blocksize) != (unsigned long) fs->blocksize)
+		return EXT2_ET_UNEXPECTED_BLOCK_SIZE;
+
+	/* Check and see if this filesystem has already been added */
+	nr_users = ntohl(jsb->s_nr_users);
+	if (nr_users > JBD2_USERS_MAX)
+		return EXT2_ET_CORRUPT_JOURNAL_SB;
+	for (i=0; i < nr_users; i++) {
+		if (memcmp(fs->super->s_uuid,
+			   &jsb->s_users[i*16], 16) == 0)
+			break;
+	}
+	if (i >= nr_users) {
+		memcpy(&jsb->s_users[nr_users*16],
+		       fs->super->s_uuid, 16);
+		jsb->s_nr_users = htonl(nr_users+1);
+	}
+
+	/* Writeback the journal superblock */
+	if ((retval = io_channel_write_blk64(journal_dev->io, start,
+					    -SUPERBLOCK_SIZE, buf)))
+		return retval;
+
+	fs->super->s_journal_inum = 0;
+	fs->super->s_journal_dev = st.st_rdev;
+	memcpy(fs->super->s_journal_uuid, jsb->s_uuid,
+	       sizeof(fs->super->s_journal_uuid));
+	memset(fs->super->s_jnl_blocks, 0, sizeof(fs->super->s_jnl_blocks));
+	ext2fs_set_feature_journal(fs->super);
+	ext2fs_mark_super_dirty(fs);
+	return 0;
+}
+
+/*
+ * This function adds a journal inode to a filesystem, using either
+ * POSIX routines if the filesystem is mounted, or using direct I/O
+ * functions if it is not.
+ */
+errcode_t ext2fs_add_journal_inode3(ext2_filsys fs, struct ext2fs_journal_params *jparams,
+				    blk64_t goal, int flags)
+{
+	errcode_t		retval;
+	ext2_ino_t		journal_ino;
+	struct stat		st;
+	char			jfile[1024];
+	int			mount_flags;
+	int			fd = -1;
+
+	if (flags & EXT2_MKJOURNAL_NO_MNT_CHECK)
+		mount_flags = 0;
+	else if ((retval = ext2fs_check_mount_point(fs->device_name,
+						    &mount_flags,
+						    jfile, sizeof(jfile)-10)))
+		return retval;
+
+	if (mount_flags & EXT2_MF_MOUNTED) {
+#if HAVE_EXT2_IOCTLS
+		int f = 0;
+#endif
+		strcat(jfile, "/.journal");
+
+		/*
+		 * If .../.journal already exists, make sure any
+		 * immutable or append-only flags are cleared.
+		 */
+#if defined(HAVE_CHFLAGS) && defined(UF_NODUMP)
+		(void) chflags (jfile, 0);
+#else
+#if HAVE_EXT2_IOCTLS
+		fd = open(jfile, O_RDONLY);
+		if (fd >= 0) {
+			retval = ioctl(fd, EXT2_IOC_SETFLAGS, &f);
+			close(fd);
+			if (retval)
+				return errno;
+		}
+#endif
+#endif
+
+		/* Create the journal file */
+		if ((fd = open(jfile, O_CREAT|O_WRONLY, 0600)) < 0)
+			return errno;
+
+		/* Note that we can't do lazy journal initialization for mounted
+		 * filesystems, since the zero writing is also allocating the
+		 * journal blocks.  We could use fallocate, but not all kernels
+		 * support that, and creating a journal on a mounted ext2
+		 * filesystems is extremely rare these days...  Ignore it. */
+		flags &= ~EXT2_MKJOURNAL_LAZYINIT;
+
+		if ((retval = write_journal_file(fs, jfile, jparams, flags)))
+			goto errout;
+
+		/* Get inode number of the journal file */
+		if (fstat(fd, &st) < 0) {
+			retval = errno;
+			goto errout;
+		}
+
+#if defined(HAVE_CHFLAGS) && defined(UF_NODUMP)
+		retval = fchflags (fd, UF_NODUMP|UF_IMMUTABLE);
+#else
+#if HAVE_EXT2_IOCTLS
+		if (ioctl(fd, EXT2_IOC_GETFLAGS, &f) < 0) {
+			retval = errno;
+			goto errout;
+		}
+		f |= EXT2_NODUMP_FL | EXT2_IMMUTABLE_FL;
+		retval = ioctl(fd, EXT2_IOC_SETFLAGS, &f);
+#endif
+#endif
+		if (retval) {
+			retval = errno;
+			goto errout;
+		}
+
+		if (close(fd) < 0) {
+			retval = errno;
+			fd = -1;
+			goto errout;
+		}
+		journal_ino = st.st_ino;
+		memset(fs->super->s_jnl_blocks, 0,
+		       sizeof(fs->super->s_jnl_blocks));
+	} else {
+		if ((mount_flags & EXT2_MF_BUSY) &&
+		    !(fs->flags & EXT2_FLAG_EXCLUSIVE)) {
+			retval = EBUSY;
+			goto errout;
+		}
+		journal_ino = EXT2_JOURNAL_INO;
+		if ((retval = write_journal_inode(fs, journal_ino,
+						  jparams, goal, flags)))
+			return retval;
+	}
+
+	fs->super->s_journal_inum = journal_ino;
+	fs->super->s_journal_dev = 0;
+	memset(fs->super->s_journal_uuid, 0,
+	       sizeof(fs->super->s_journal_uuid));
+	ext2fs_set_feature_journal(fs->super);
+
+	ext2fs_mark_super_dirty(fs);
+	return 0;
+errout:
+	if (fd >= 0)
+		close(fd);
+	return retval;
+}
+
+errcode_t ext2fs_add_journal_inode2(ext2_filsys fs, blk_t num_blocks,
+				    blk64_t goal, int flags)
+{
+	struct ext2fs_journal_params jparams;
+
+	jparams.num_journal_blocks = num_blocks;
+	jparams.num_fc_blocks = 0;
+
+	return ext2fs_add_journal_inode3(fs, &jparams, goal, flags);
+}
+
+errcode_t ext2fs_add_journal_inode(ext2_filsys fs, blk_t num_blocks, int flags)
+{
+	return ext2fs_add_journal_inode2(fs, num_blocks, ~0ULL, flags);
+}
+
+
+#ifdef DEBUG
+main(int argc, char **argv)
+{
+	errcode_t	retval;
+	char		*device_name;
+	ext2_filsys	fs;
+
+	if (argc < 2) {
+		fprintf(stderr, "Usage: %s filesystem\n", argv[0]);
+		exit(1);
+	}
+	device_name = argv[1];
+
+	retval = ext2fs_open (device_name, EXT2_FLAG_RW, 0, 0,
+			      unix_io_manager, &fs);
+	if (retval) {
+		com_err(argv[0], retval, "while opening %s", device_name);
+		exit(1);
+	}
+
+	retval = ext2fs_add_journal_inode(fs, JBD2_MIN_JOURNAL_BLOCKS, 0);
+	if (retval) {
+		com_err(argv[0], retval, "while adding journal to %s",
+			device_name);
+		exit(1);
+	}
+	retval = ext2fs_flush(fs);
+	if (retval) {
+		printf("Warning, had trouble writing out superblocks.\n");
+	}
+	ext2fs_close_free(&fs);
+	exit(0);
+
+}
+#endif
diff --git a/lib/ext2fs/mmp.c b/lib/ext2fs/mmp.c
new file mode 100644
index 0000000..eb94170
--- /dev/null
+++ b/lib/ext2fs/mmp.c
@@ -0,0 +1,488 @@
+/*
+ * Helper functions for multiple mount protection (MMP).
+ *
+ * Copyright (C) 2011 Whamcloud, Inc.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#ifndef _GNU_SOURCE
+#define _GNU_SOURCE
+#endif
+#ifndef _DEFAULT_SOURCE
+#define _DEFAULT_SOURCE	/* since glibc 2.20 _SVID_SOURCE is deprecated */
+#endif
+
+#include "config.h"
+
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <sys/time.h>
+
+#include <sys/types.h>
+#include <sys/stat.h>
+#include <fcntl.h>
+
+#include "ext2fs/ext2_fs.h"
+#include "ext2fs/ext2fs.h"
+
+#ifndef O_DIRECT
+#define O_DIRECT 0
+#endif
+
+#if __GNUC_PREREQ (4, 6)
+#pragma GCC diagnostic push
+#ifndef CONFIG_MMP
+#pragma GCC diagnostic ignored "-Wunused-parameter"
+#endif
+#endif
+
+errcode_t ext2fs_mmp_read(ext2_filsys fs, blk64_t mmp_blk, void *buf)
+{
+#ifdef CONFIG_MMP
+	struct mmp_struct *mmp_cmp;
+	errcode_t retval = 0;
+
+	if ((mmp_blk <= fs->super->s_first_data_block) ||
+	    (mmp_blk >= ext2fs_blocks_count(fs->super)))
+		return EXT2_ET_MMP_BAD_BLOCK;
+
+	/* ext2fs_open() reserves fd0,1,2 to avoid stdio collision, so checking
+	 * mmp_fd <= 0 is OK to validate that the fd is valid.  This opens its
+	 * own fd to read the MMP block to ensure that it is using O_DIRECT,
+	 * regardless of how the io_manager is doing reads, to avoid caching of
+	 * the MMP block by the io_manager or the VM.  It needs to be fresh. */
+	if (fs->mmp_fd <= 0) {
+		struct stat st;
+		int flags = O_RDONLY | O_DIRECT;
+
+		/*
+		 * There is no reason for using O_DIRECT if we're working with
+		 * regular file. Disabling it also avoids problems with
+		 * alignment when the device of the host file system has sector
+		 * size larger than blocksize of the fs we're working with.
+		 */
+		if (stat(fs->device_name, &st) == 0 &&
+		    S_ISREG(st.st_mode))
+			flags &= ~O_DIRECT;
+
+		fs->mmp_fd = open(fs->device_name, flags);
+		if (fs->mmp_fd < 0) {
+			retval = EXT2_ET_MMP_OPEN_DIRECT;
+			goto out;
+		}
+	}
+
+	if (fs->mmp_cmp == NULL) {
+		int align = ext2fs_get_dio_alignment(fs->mmp_fd);
+
+		retval = ext2fs_get_memalign(fs->blocksize, align,
+					     &fs->mmp_cmp);
+		if (retval)
+			return retval;
+	}
+
+	if ((blk64_t) ext2fs_llseek(fs->mmp_fd, mmp_blk * fs->blocksize,
+				    SEEK_SET) !=
+	    mmp_blk * fs->blocksize) {
+		retval = EXT2_ET_LLSEEK_FAILED;
+		goto out;
+	}
+
+	if (read(fs->mmp_fd, fs->mmp_cmp, fs->blocksize) != fs->blocksize) {
+		retval = EXT2_ET_SHORT_READ;
+		goto out;
+	}
+
+	mmp_cmp = fs->mmp_cmp;
+
+	if (!(fs->flags & EXT2_FLAG_IGNORE_CSUM_ERRORS) &&
+	    !ext2fs_mmp_csum_verify(fs, mmp_cmp))
+		retval = EXT2_ET_MMP_CSUM_INVALID;
+
+#ifdef WORDS_BIGENDIAN
+	ext2fs_swap_mmp(mmp_cmp);
+#endif
+
+	if (buf != NULL && buf != fs->mmp_cmp)
+		memcpy(buf, fs->mmp_cmp, fs->blocksize);
+
+	if (mmp_cmp->mmp_magic != EXT4_MMP_MAGIC) {
+		retval = EXT2_ET_MMP_MAGIC_INVALID;
+		goto out;
+	}
+
+out:
+	return retval;
+#else
+	return EXT2_ET_OP_NOT_SUPPORTED;
+#endif
+}
+
+errcode_t ext2fs_mmp_write(ext2_filsys fs, blk64_t mmp_blk, void *buf)
+{
+#ifdef CONFIG_MMP
+	struct mmp_struct *mmp_s = buf;
+	struct timeval tv;
+	errcode_t retval = 0;
+
+	gettimeofday(&tv, 0);
+	mmp_s->mmp_time = tv.tv_sec;
+	fs->mmp_last_written = tv.tv_sec;
+
+	if (fs->super->s_mmp_block < fs->super->s_first_data_block ||
+	    fs->super->s_mmp_block > ext2fs_blocks_count(fs->super))
+		return EXT2_ET_MMP_BAD_BLOCK;
+
+#ifdef WORDS_BIGENDIAN
+	ext2fs_swap_mmp(mmp_s);
+#endif
+
+	retval = ext2fs_mmp_csum_set(fs, mmp_s);
+	if (retval)
+		return retval;
+
+	/* I was tempted to make this use O_DIRECT and the mmp_fd, but
+	 * this caused no end of grief, while leaving it as-is works. */
+	retval = io_channel_write_blk64(fs->io, mmp_blk, -(int)sizeof(struct mmp_struct), buf);
+
+#ifdef WORDS_BIGENDIAN
+	ext2fs_swap_mmp(mmp_s);
+#endif
+
+	/* Make sure the block gets to disk quickly */
+	io_channel_flush(fs->io);
+	return retval;
+#else
+	return EXT2_ET_OP_NOT_SUPPORTED;
+#endif
+}
+
+#ifdef HAVE_SRANDOM
+#define srand(x)	srandom(x)
+#define rand()		random()
+#endif
+
+unsigned ext2fs_mmp_new_seq(void)
+{
+#ifdef CONFIG_MMP
+	unsigned new_seq;
+	struct timeval tv;
+	unsigned long pid = getpid();
+
+	gettimeofday(&tv, 0);
+	pid = (pid >> 16) | ((pid & 0xFFFF) << 16);
+	srand(pid ^ getuid() ^ tv.tv_sec ^ tv.tv_usec);
+
+	gettimeofday(&tv, 0);
+	/* Crank the random number generator a few times */
+	for (new_seq = (tv.tv_sec ^ tv.tv_usec) & 0x1F; new_seq > 0; new_seq--)
+		rand();
+
+	do {
+		new_seq = rand();
+	} while (new_seq > EXT4_MMP_SEQ_MAX);
+
+	return new_seq;
+#else
+	return EXT2_ET_OP_NOT_SUPPORTED;
+#endif
+}
+
+#ifdef CONFIG_MMP
+static errcode_t ext2fs_mmp_reset(ext2_filsys fs)
+{
+	struct mmp_struct *mmp_s = NULL;
+	errcode_t retval = 0;
+
+	if (fs->mmp_buf == NULL) {
+		retval = ext2fs_get_mem(fs->blocksize, &fs->mmp_buf);
+		if (retval)
+			goto out;
+	}
+
+	memset(fs->mmp_buf, 0, fs->blocksize);
+	mmp_s = fs->mmp_buf;
+
+	mmp_s->mmp_magic = EXT4_MMP_MAGIC;
+	mmp_s->mmp_seq = EXT4_MMP_SEQ_CLEAN;
+	mmp_s->mmp_time = 0;
+#ifdef HAVE_GETHOSTNAME
+	gethostname((char *) mmp_s->mmp_nodename, sizeof(mmp_s->mmp_nodename));
+#else
+	mmp_s->mmp_nodename[0] = '\0';
+#endif
+	strncpy((char *) mmp_s->mmp_bdevname, fs->device_name,
+		sizeof(mmp_s->mmp_bdevname));
+
+	mmp_s->mmp_check_interval = fs->super->s_mmp_update_interval;
+	if (mmp_s->mmp_check_interval < EXT4_MMP_MIN_CHECK_INTERVAL)
+		mmp_s->mmp_check_interval = EXT4_MMP_MIN_CHECK_INTERVAL;
+
+	retval = ext2fs_mmp_write(fs, fs->super->s_mmp_block, fs->mmp_buf);
+out:
+	return retval;
+}
+#endif
+
+errcode_t ext2fs_mmp_update(ext2_filsys fs)
+{
+	return ext2fs_mmp_update2(fs, 0);
+}
+
+errcode_t ext2fs_mmp_clear(ext2_filsys fs)
+{
+#ifdef CONFIG_MMP
+	errcode_t retval = 0;
+
+	if (!(fs->flags & EXT2_FLAG_RW))
+		return EXT2_ET_RO_FILSYS;
+
+	retval = ext2fs_mmp_reset(fs);
+
+	return retval;
+#else
+	return EXT2_ET_OP_NOT_SUPPORTED;
+#endif
+}
+
+errcode_t ext2fs_mmp_init(ext2_filsys fs)
+{
+#ifdef CONFIG_MMP
+	struct ext2_super_block *sb = fs->super;
+	blk64_t mmp_block;
+	errcode_t retval;
+
+	if (sb->s_mmp_update_interval == 0)
+		sb->s_mmp_update_interval = EXT4_MMP_UPDATE_INTERVAL;
+	/* This is probably excessively large, but who knows? */
+	else if (sb->s_mmp_update_interval > EXT4_MMP_MAX_UPDATE_INTERVAL)
+		return EXT2_ET_INVALID_ARGUMENT;
+
+	if (fs->mmp_buf == NULL) {
+		retval = ext2fs_get_mem(fs->blocksize, &fs->mmp_buf);
+		if (retval)
+			goto out;
+	}
+
+	retval = ext2fs_alloc_block2(fs, 0, fs->mmp_buf, &mmp_block);
+	if (retval)
+		goto out;
+
+	sb->s_mmp_block = mmp_block;
+
+	retval = ext2fs_mmp_reset(fs);
+	if (retval)
+		goto out;
+
+out:
+	return retval;
+#else
+	return EXT2_ET_OP_NOT_SUPPORTED;
+#endif
+}
+
+#ifndef min
+#define min(x, y) ((x) < (y) ? (x) : (y))
+#endif
+
+/*
+ * Make sure that the fs is not mounted or being fsck'ed while opening the fs.
+ */
+errcode_t ext2fs_mmp_start(ext2_filsys fs)
+{
+#ifdef CONFIG_MMP
+	struct mmp_struct *mmp_s;
+	unsigned seq;
+	unsigned int mmp_check_interval;
+	errcode_t retval = 0;
+
+	if (fs->mmp_buf == NULL) {
+		retval = ext2fs_get_mem(fs->blocksize, &fs->mmp_buf);
+		if (retval)
+			goto mmp_error;
+	}
+
+	retval = ext2fs_mmp_read(fs, fs->super->s_mmp_block, fs->mmp_buf);
+	if (retval)
+		goto mmp_error;
+
+	mmp_s = fs->mmp_buf;
+
+	mmp_check_interval = fs->super->s_mmp_update_interval;
+	if (mmp_check_interval < EXT4_MMP_MIN_CHECK_INTERVAL)
+		mmp_check_interval = EXT4_MMP_MIN_CHECK_INTERVAL;
+
+	seq = mmp_s->mmp_seq;
+	if (seq == EXT4_MMP_SEQ_CLEAN)
+		goto clean_seq;
+	if (seq == EXT4_MMP_SEQ_FSCK) {
+		retval = EXT2_ET_MMP_FSCK_ON;
+		goto mmp_error;
+	}
+
+	if (seq > EXT4_MMP_SEQ_FSCK) {
+		retval = EXT2_ET_MMP_UNKNOWN_SEQ;
+		goto mmp_error;
+	}
+
+	/*
+	 * If check_interval in MMP block is larger, use that instead of
+	 * check_interval from the superblock.
+	 */
+	if (mmp_s->mmp_check_interval > mmp_check_interval)
+		mmp_check_interval = mmp_s->mmp_check_interval;
+
+	sleep(min(mmp_check_interval * 2 + 1, mmp_check_interval + 60));
+
+	retval = ext2fs_mmp_read(fs, fs->super->s_mmp_block, fs->mmp_buf);
+	if (retval)
+		goto mmp_error;
+
+	if (seq != mmp_s->mmp_seq) {
+		retval = EXT2_ET_MMP_FAILED;
+		goto mmp_error;
+	}
+
+clean_seq:
+	if (!(fs->flags & EXT2_FLAG_RW))
+		goto mmp_error;
+
+	mmp_s->mmp_seq = seq = ext2fs_mmp_new_seq();
+#ifdef HAVE_GETHOSTNAME
+	gethostname((char *) mmp_s->mmp_nodename, sizeof(mmp_s->mmp_nodename));
+#else
+	strcpy((char *) mmp_s->mmp_nodename, "unknown host");
+#endif
+	strncpy((char *) mmp_s->mmp_bdevname, fs->device_name,
+		sizeof(mmp_s->mmp_bdevname));
+
+	retval = ext2fs_mmp_write(fs, fs->super->s_mmp_block, fs->mmp_buf);
+	if (retval)
+		goto mmp_error;
+
+	sleep(min(2 * mmp_check_interval + 1, mmp_check_interval + 60));
+
+	retval = ext2fs_mmp_read(fs, fs->super->s_mmp_block, fs->mmp_buf);
+	if (retval)
+		goto mmp_error;
+
+	if (seq != mmp_s->mmp_seq) {
+		retval = EXT2_ET_MMP_FAILED;
+		goto mmp_error;
+	}
+
+	mmp_s->mmp_seq = EXT4_MMP_SEQ_FSCK;
+	retval = ext2fs_mmp_write(fs, fs->super->s_mmp_block, fs->mmp_buf);
+	if (retval)
+		goto mmp_error;
+
+	return 0;
+
+mmp_error:
+	return retval;
+#else
+	return EXT2_ET_OP_NOT_SUPPORTED;
+#endif
+}
+
+/*
+ * Clear the MMP usage in the filesystem.  If this function returns an
+ * error EXT2_ET_MMP_CHANGE_ABORT it means the filesystem was modified
+ * by some other process while in use, and changes should be dropped, or
+ * risk filesystem corruption.
+ */
+errcode_t ext2fs_mmp_stop(ext2_filsys fs)
+{
+#ifdef CONFIG_MMP
+	struct mmp_struct *mmp, *mmp_cmp;
+	errcode_t retval = 0;
+
+	if (!ext2fs_has_feature_mmp(fs->super) ||
+	    !(fs->flags & EXT2_FLAG_RW) || (fs->flags & EXT2_FLAG_SKIP_MMP) ||
+	    (fs->mmp_buf == NULL) || (fs->mmp_cmp == NULL))
+		goto mmp_error;
+
+	retval = ext2fs_mmp_read(fs, fs->super->s_mmp_block, NULL);
+	if (retval)
+		goto mmp_error;
+
+	/* Check if the MMP block is not changed. */
+	mmp = fs->mmp_buf;
+	mmp_cmp = fs->mmp_cmp;
+	if (memcmp(mmp, mmp_cmp, sizeof(*mmp_cmp))) {
+		retval = EXT2_ET_MMP_CHANGE_ABORT;
+		goto mmp_error;
+	}
+
+	mmp_cmp->mmp_seq = EXT4_MMP_SEQ_CLEAN;
+	retval = ext2fs_mmp_write(fs, fs->super->s_mmp_block, fs->mmp_cmp);
+
+mmp_error:
+	if (fs->mmp_fd > 0) {
+		close(fs->mmp_fd);
+		fs->mmp_fd = -1;
+	}
+
+	return retval;
+#else
+	if (!ext2fs_has_feature_mmp(fs->super) ||
+	    !(fs->flags & EXT2_FLAG_RW) || (fs->flags & EXT2_FLAG_SKIP_MMP))
+		return 0;
+
+	return EXT2_ET_OP_NOT_SUPPORTED;
+#endif
+}
+
+#define EXT2_MIN_MMP_UPDATE_INTERVAL 60
+
+/*
+ * Update the on-disk mmp buffer, after checking that it hasn't been changed.
+ */
+errcode_t ext2fs_mmp_update2(ext2_filsys fs, int immediately)
+{
+#ifdef CONFIG_MMP
+	struct mmp_struct *mmp, *mmp_cmp;
+	struct timeval tv;
+	errcode_t retval = 0;
+
+	if (!ext2fs_has_feature_mmp(fs->super) ||
+	    !(fs->flags & EXT2_FLAG_RW) || (fs->flags & EXT2_FLAG_SKIP_MMP))
+		return 0;
+
+	gettimeofday(&tv, 0);
+	if (!immediately &&
+	    tv.tv_sec - fs->mmp_last_written < EXT2_MIN_MMP_UPDATE_INTERVAL)
+		return 0;
+
+	retval = ext2fs_mmp_read(fs, fs->super->s_mmp_block, NULL);
+	if (retval)
+		goto mmp_error;
+
+	mmp = fs->mmp_buf;
+	mmp_cmp = fs->mmp_cmp;
+
+	if (memcmp(mmp, mmp_cmp, sizeof(*mmp_cmp)))
+		return EXT2_ET_MMP_CHANGE_ABORT;
+
+	mmp->mmp_time = tv.tv_sec;
+	mmp->mmp_seq = EXT4_MMP_SEQ_FSCK;
+	retval = ext2fs_mmp_write(fs, fs->super->s_mmp_block, fs->mmp_buf);
+
+mmp_error:
+	return retval;
+#else
+	if (!ext2fs_has_feature_mmp(fs->super) ||
+	    !(fs->flags & EXT2_FLAG_RW) || (fs->flags & EXT2_FLAG_SKIP_MMP))
+		return 0;
+
+	return EXT2_ET_OP_NOT_SUPPORTED;
+#endif
+}
+#if __GNUC_PREREQ (4, 6)
+#pragma GCC diagnostic pop
+#endif
diff --git a/lib/ext2fs/namei.c b/lib/ext2fs/namei.c
new file mode 100644
index 0000000..1064ab5
--- /dev/null
+++ b/lib/ext2fs/namei.c
@@ -0,0 +1,227 @@
+/*
+ * namei.c --- ext2fs directory lookup operations
+ *
+ * Copyright (C) 1993, 1994, 1994, 1995 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+
+/* #define NAMEI_DEBUG */
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+#include "ext2fsP.h"
+
+static errcode_t open_namei(ext2_filsys fs, ext2_ino_t root, ext2_ino_t base,
+			    const char *pathname, size_t pathlen, int follow,
+			    int link_count, char *buf, ext2_ino_t *res_inode);
+
+static errcode_t follow_link(ext2_filsys fs, ext2_ino_t root, ext2_ino_t dir,
+			     ext2_ino_t inode, int link_count,
+			     char *buf, ext2_ino_t *res_inode)
+{
+	char *pathname;
+	char *buffer = 0;
+	errcode_t retval;
+	struct ext2_inode ei;
+	blk64_t blk;
+
+#ifdef NAMEI_DEBUG
+	printf("follow_link: root=%lu, dir=%lu, inode=%lu, lc=%d\n",
+	       root, dir, inode, link_count);
+
+#endif
+	retval = ext2fs_read_inode (fs, inode, &ei);
+	if (retval) return retval;
+	if (!LINUX_S_ISLNK (ei.i_mode)) {
+		*res_inode = inode;
+		return 0;
+	}
+	if (link_count++ >= EXT2FS_MAX_NESTED_LINKS)
+		return EXT2_ET_SYMLINK_LOOP;
+
+	if (ext2fs_is_fast_symlink(&ei))
+		pathname = (char *)&(ei.i_block[0]);
+	else if (ei.i_flags & EXT4_INLINE_DATA_FL) {
+		retval = ext2fs_get_memzero(ei.i_size, &buffer);
+		if (retval)
+			return retval;
+
+		retval = ext2fs_inline_data_get(fs, inode,
+						&ei, buffer, NULL);
+		if (retval) {
+			ext2fs_free_mem(&buffer);
+			return retval;
+		}
+		pathname = buffer;
+	} else {
+		retval = ext2fs_bmap2(fs, inode, &ei, NULL, 0, 0, NULL, &blk);
+		if (retval)
+			return retval;
+
+		retval = ext2fs_get_mem(fs->blocksize, &buffer);
+		if (retval)
+			return retval;
+
+		retval = io_channel_read_blk64(fs->io, blk, 1, buffer);
+		if (retval) {
+			ext2fs_free_mem(&buffer);
+			return retval;
+		}
+		pathname = buffer;
+	}
+
+	retval = open_namei(fs, root, dir, pathname, ei.i_size, 1,
+			    link_count, buf, res_inode);
+	if (buffer)
+		ext2fs_free_mem(&buffer);
+	return retval;
+}
+
+/*
+ * This routine interprets a pathname in the context of the current
+ * directory and the root directory, and returns the inode of the
+ * containing directory, and a pointer to the filename of the file
+ * (pointing into the pathname) and the length of the filename.
+ */
+static errcode_t dir_namei(ext2_filsys fs, ext2_ino_t root, ext2_ino_t dir,
+			   const char *pathname, int pathlen,
+			   int link_count, char *buf,
+			   const char **name, int *namelen,
+			   ext2_ino_t *res_inode)
+{
+	char c;
+	const char *thisname;
+	int len;
+	ext2_ino_t inode;
+	errcode_t retval;
+
+	if ((c = *pathname) == '/') {
+        	dir = root;
+		pathname++;
+		pathlen--;
+	}
+	while (1) {
+        	thisname = pathname;
+		for (len=0; --pathlen >= 0;len++) {
+			c = *(pathname++);
+			if (c == '/')
+				break;
+		}
+		if (pathlen < 0)
+			break;
+		retval = ext2fs_lookup (fs, dir, thisname, len, buf, &inode);
+		if (retval) return retval;
+        	retval = follow_link (fs, root, dir, inode,
+				      link_count, buf, &dir);
+        	if (retval) return retval;
+    	}
+	*name = thisname;
+	*namelen = len;
+	*res_inode = dir;
+	return 0;
+}
+
+static errcode_t open_namei(ext2_filsys fs, ext2_ino_t root, ext2_ino_t base,
+			    const char *pathname, size_t pathlen, int follow,
+			    int link_count, char *buf, ext2_ino_t *res_inode)
+{
+	const char *base_name;
+	int namelen;
+	ext2_ino_t dir, inode;
+	errcode_t retval;
+
+#ifdef NAMEI_DEBUG
+	printf("open_namei: root=%lu, dir=%lu, path=%.*s, lc=%d\n",
+	       root, base, pathlen, pathname, link_count);
+#endif
+	retval = dir_namei(fs, root, base, pathname, pathlen,
+			   link_count, buf, &base_name, &namelen, &dir);
+	if (retval) return retval;
+	if (!namelen) {                     /* special case: '/usr/' etc */
+		*res_inode=dir;
+		return 0;
+	}
+	retval = ext2fs_lookup (fs, dir, base_name, namelen, buf, &inode);
+	if (retval)
+		return retval;
+	if (follow) {
+		retval = follow_link(fs, root, dir, inode, link_count,
+				     buf, &inode);
+		if (retval)
+			return retval;
+	}
+#ifdef NAMEI_DEBUG
+	printf("open_namei: (link_count=%d) returns %lu\n",
+	       link_count, inode);
+#endif
+	*res_inode = inode;
+	return 0;
+}
+
+errcode_t ext2fs_namei(ext2_filsys fs, ext2_ino_t root, ext2_ino_t cwd,
+		       const char *name, ext2_ino_t *inode)
+{
+	char *buf;
+	errcode_t retval;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	retval = ext2fs_get_mem(fs->blocksize, &buf);
+	if (retval)
+		return retval;
+
+	retval = open_namei(fs, root, cwd, name, strlen(name), 0, 0,
+			    buf, inode);
+
+	ext2fs_free_mem(&buf);
+	return retval;
+}
+
+errcode_t ext2fs_namei_follow(ext2_filsys fs, ext2_ino_t root, ext2_ino_t cwd,
+			      const char *name, ext2_ino_t *inode)
+{
+	char *buf;
+	errcode_t retval;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	retval = ext2fs_get_mem(fs->blocksize, &buf);
+	if (retval)
+		return retval;
+
+	retval = open_namei(fs, root, cwd, name, strlen(name), 1, 0,
+			    buf, inode);
+
+	ext2fs_free_mem(&buf);
+	return retval;
+}
+
+errcode_t ext2fs_follow_link(ext2_filsys fs, ext2_ino_t root, ext2_ino_t cwd,
+			ext2_ino_t inode, ext2_ino_t *res_inode)
+{
+	char *buf;
+	errcode_t retval;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	retval = ext2fs_get_mem(fs->blocksize, &buf);
+	if (retval)
+		return retval;
+
+	retval = follow_link(fs, root, cwd, inode, 0, buf, res_inode);
+
+	ext2fs_free_mem(&buf);
+	return retval;
+}
+
diff --git a/lib/ext2fs/native.c b/lib/ext2fs/native.c
new file mode 100644
index 0000000..ba3e0c8
--- /dev/null
+++ b/lib/ext2fs/native.c
@@ -0,0 +1,28 @@
+/*
+ * native.c --- returns the ext2_flag for a native byte order
+ *
+ * Copyright (C) 1996 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+int ext2fs_native_flag(void)
+{
+#ifdef WORDS_BIGENDIAN
+	return EXT2_FLAG_SWAP_BYTES;
+#else
+	return 0;
+#endif
+}
+
+
+
diff --git a/lib/ext2fs/newdir.c b/lib/ext2fs/newdir.c
new file mode 100644
index 0000000..7f47285
--- /dev/null
+++ b/lib/ext2fs/newdir.c
@@ -0,0 +1,126 @@
+/*
+ * newdir.c --- create a new directory block
+ *
+ * Copyright (C) 1994, 1995 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+#ifndef EXT2_FT_DIR
+#define EXT2_FT_DIR		2
+#endif
+
+/*
+ * Create new directory block
+ */
+errcode_t ext2fs_new_dir_block(ext2_filsys fs, ext2_ino_t dir_ino,
+			       ext2_ino_t parent_ino, char **block)
+{
+	struct ext2_dir_entry 	*dir = NULL;
+	errcode_t		retval;
+	char			*buf;
+	int			rec_len;
+	int			filetype = 0;
+	struct ext2_dir_entry_tail	*t;
+	int			csum_size = 0;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	retval = ext2fs_get_mem(fs->blocksize, &buf);
+	if (retval)
+		return retval;
+	memset(buf, 0, fs->blocksize);
+	dir = (struct ext2_dir_entry *) buf;
+
+	if (ext2fs_has_feature_metadata_csum(fs->super))
+		csum_size = sizeof(struct ext2_dir_entry_tail);
+
+	retval = ext2fs_set_rec_len(fs, fs->blocksize - csum_size, dir);
+	if (retval) {
+		ext2fs_free_mem(&buf);
+		return retval;
+	}
+
+	if (dir_ino) {
+		if (ext2fs_has_feature_filetype(fs->super))
+			filetype = EXT2_FT_DIR;
+		/*
+		 * Set up entry for '.'
+		 */
+		dir->inode = dir_ino;
+		ext2fs_dirent_set_name_len(dir, 1);
+		ext2fs_dirent_set_file_type(dir, filetype);
+		dir->name[0] = '.';
+		rec_len = (fs->blocksize - csum_size) - EXT2_DIR_REC_LEN(1);
+		dir->rec_len = EXT2_DIR_REC_LEN(1);
+
+		/*
+		 * Set up entry for '..'
+		 */
+		dir = (struct ext2_dir_entry *) (buf + dir->rec_len);
+		retval = ext2fs_set_rec_len(fs, rec_len, dir);
+		if (retval) {
+			ext2fs_free_mem(&buf);
+			return retval;
+		}
+		dir->inode = parent_ino;
+		ext2fs_dirent_set_name_len(dir, 2);
+		ext2fs_dirent_set_file_type(dir, filetype);
+		dir->name[0] = '.';
+		dir->name[1] = '.';
+
+	}
+
+	if (csum_size) {
+		t = EXT2_DIRENT_TAIL(buf, fs->blocksize);
+		ext2fs_initialize_dirent_tail(fs, t);
+	}
+	*block = buf;
+	return 0;
+}
+
+/*
+ * Create new directory on inline data
+ */
+errcode_t ext2fs_new_dir_inline_data(ext2_filsys fs,
+				     ext2_ino_t dir_ino EXT2FS_ATTR((unused)),
+				     ext2_ino_t parent_ino, __u32 *iblock)
+{
+	struct ext2_dir_entry 	*dir = NULL;
+	errcode_t		retval;
+	int			rec_len;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	iblock[0] = ext2fs_cpu_to_le32(parent_ino);
+
+	dir = (struct ext2_dir_entry *)((char *)iblock +
+					EXT4_INLINE_DATA_DOTDOT_SIZE);
+	dir->inode = 0;
+	rec_len = EXT4_MIN_INLINE_DATA_SIZE - EXT4_INLINE_DATA_DOTDOT_SIZE;
+	retval = ext2fs_set_rec_len(fs, rec_len, dir);
+	if (retval)
+		goto errout;
+
+#ifdef WORDS_BIGENDIAN
+	retval = ext2fs_dirent_swab_out2(fs, (char *)dir, rec_len, 0);
+	if (retval)
+		goto errout;
+#endif
+
+errout:
+	return retval;
+}
diff --git a/lib/ext2fs/nls_utf8.c b/lib/ext2fs/nls_utf8.c
new file mode 100644
index 0000000..b07e66e
--- /dev/null
+++ b/lib/ext2fs/nls_utf8.c
@@ -0,0 +1,1000 @@
+/*
+ * Copyright (c) 2014 SGI.
+ * Copyright (c) 2018 Collabora Ltd.
+ * All rights reserved.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation.
+ *
+ * This program is distributed in the hope that it would be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ */
+
+/*
+ * This code is adapted from the Linux Kernel.  We have a
+ * userspace version here such that the hashes will match that
+ * implementation.
+ */
+
+#include "config.h"
+#include <stdint.h>
+#include <unistd.h>
+#include <string.h>
+#include <limits.h>
+#include <errno.h>
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+#include "ext2fsP.h"
+
+/* Encoding a unicode version number as a single unsigned int. */
+#define UNICODE_MAJ_SHIFT		(16)
+#define UNICODE_MIN_SHIFT		(8)
+
+#define UNICODE_AGE(MAJ, MIN, REV)			\
+	(((unsigned int)(MAJ) << UNICODE_MAJ_SHIFT) |	\
+	 ((unsigned int)(MIN) << UNICODE_MIN_SHIFT) |	\
+	 ((unsigned int)(REV)))
+
+/* Needed in struct utf8cursor below. */
+#define UTF8HANGULLEAF	(12)
+
+/*
+ * Cursor structure used by the normalizer.
+ */
+struct utf8cursor {
+	const struct utf8data	*data;
+	const char	*s;
+	const char	*p;
+	const char	*ss;
+	const char	*sp;
+	unsigned int	len;
+	unsigned int	slen;
+	short int	ccc;
+	short int	nccc;
+	unsigned char	hangul[UTF8HANGULLEAF];
+};
+
+/*
+ * Initialize a utf8cursor to normalize a string.
+ * Returns 0 on success.
+ * Returns -1 on failure.
+ */
+// extern int utf8cursor(struct utf8cursor *u8c, const struct utf8data *data,
+//		      const char *s);
+// extern int utf8ncursor(struct utf8cursor *u8c, const struct utf8data *data,
+//		       const char *s, size_t len);
+
+/*
+ * Get the next byte in the normalization.
+ * Returns a value > 0 && < 256 on success.
+ * Returns 0 when the end of the normalization is reached.
+ * Returns -1 if the string being normalized is not valid UTF-8.
+ */
+// extern int utf8byte(struct utf8cursor *u8c);
+
+
+struct utf8data {
+	unsigned int maxage;
+	unsigned int offset;
+};
+
+#define __INCLUDED_FROM_UTF8NORM_C__
+#include "utf8data.h"
+#undef __INCLUDED_FROM_UTF8NORM_C__
+
+#define ARRAY_SIZE(array)			\
+        (sizeof(array) / sizeof(array[0]))
+
+#if 0
+/* Highest unicode version supported by the data tables. */
+static int utf8version_is_supported(uint8_t maj, uint8_t min, uint8_t rev)
+{
+	int i = ARRAY_SIZE(utf8agetab) - 1;
+	unsigned int sb_utf8version = UNICODE_AGE(maj, min, rev);
+
+	while (i >= 0 && utf8agetab[i] != 0) {
+		if (sb_utf8version == utf8agetab[i])
+			return 1;
+		i--;
+	}
+	return 0;
+}
+#endif
+
+#if 0
+static int utf8version_latest(void)
+{
+	return utf8vers;
+}
+#endif
+
+/*
+ * UTF-8 valid ranges.
+ *
+ * The UTF-8 encoding spreads the bits of a 32bit word over several
+ * bytes. This table gives the ranges that can be held and how they'd
+ * be represented.
+ *
+ * 0x00000000 0x0000007F: 0xxxxxxx
+ * 0x00000000 0x000007FF: 110xxxxx 10xxxxxx
+ * 0x00000000 0x0000FFFF: 1110xxxx 10xxxxxx 10xxxxxx
+ * 0x00000000 0x001FFFFF: 11110xxx 10xxxxxx 10xxxxxx 10xxxxxx
+ * 0x00000000 0x03FFFFFF: 111110xx 10xxxxxx 10xxxxxx 10xxxxxx 10xxxxxx
+ * 0x00000000 0x7FFFFFFF: 1111110x 10xxxxxx 10xxxxxx 10xxxxxx 10xxxxxx 10xxxxxx
+ *
+ * There is an additional requirement on UTF-8, in that only the
+ * shortest representation of a 32bit value is to be used.  A decoder
+ * must not decode sequences that do not satisfy this requirement.
+ * Thus the allowed ranges have a lower bound.
+ *
+ * 0x00000000 0x0000007F: 0xxxxxxx
+ * 0x00000080 0x000007FF: 110xxxxx 10xxxxxx
+ * 0x00000800 0x0000FFFF: 1110xxxx 10xxxxxx 10xxxxxx
+ * 0x00010000 0x001FFFFF: 11110xxx 10xxxxxx 10xxxxxx 10xxxxxx
+ * 0x00200000 0x03FFFFFF: 111110xx 10xxxxxx 10xxxxxx 10xxxxxx 10xxxxxx
+ * 0x04000000 0x7FFFFFFF: 1111110x 10xxxxxx 10xxxxxx 10xxxxxx 10xxxxxx 10xxxxxx
+ *
+ * Actual unicode characters are limited to the range 0x0 - 0x10FFFF,
+ * 17 planes of 65536 values.  This limits the sequences actually seen
+ * even more, to just the following.
+ *
+ *          0 -     0x7F: 0                   - 0x7F
+ *       0x80 -    0x7FF: 0xC2 0x80           - 0xDF 0xBF
+ *      0x800 -   0xFFFF: 0xE0 0xA0 0x80      - 0xEF 0xBF 0xBF
+ *    0x10000 - 0x10FFFF: 0xF0 0x90 0x80 0x80 - 0xF4 0x8F 0xBF 0xBF
+ *
+ * Within those ranges the surrogates 0xD800 - 0xDFFF are not allowed.
+ *
+ * Note that the longest sequence seen with valid usage is 4 bytes,
+ * the same a single UTF-32 character.  This makes the UTF-8
+ * representation of Unicode strictly smaller than UTF-32.
+ *
+ * The shortest sequence requirement was introduced by:
+ *    Corrigendum #1: UTF-8 Shortest Form
+ * It can be found here:
+ *    http://www.unicode.org/versions/corrigendum1.html
+ *
+ */
+
+/*
+ * Return the number of bytes used by the current UTF-8 sequence.
+ * Assumes the input points to the first byte of a valid UTF-8
+ * sequence.
+ */
+static inline int utf8clen(const char *s)
+{
+	unsigned char c = *s;
+
+	return 1 + (c >= 0xC0) + (c >= 0xE0) + (c >= 0xF0);
+}
+
+/*
+ * Decode a 3-byte UTF-8 sequence.
+ */
+static unsigned int
+utf8decode3(const char *str)
+{
+	unsigned int		uc;
+
+	uc = *str++ & 0x0F;
+	uc <<= 6;
+	uc |= *str++ & 0x3F;
+	uc <<= 6;
+	uc |= *str++ & 0x3F;
+
+	return uc;
+}
+
+/*
+ * Encode a 3-byte UTF-8 sequence.
+ */
+static int
+utf8encode3(char *str, unsigned int val)
+{
+	str[2] = (val & 0x3F) | 0x80;
+	val >>= 6;
+	str[1] = (val & 0x3F) | 0x80;
+	val >>= 6;
+	str[0] = val | 0xE0;
+
+	return 3;
+}
+
+/*
+ * utf8trie_t
+ *
+ * A compact binary tree, used to decode UTF-8 characters.
+ *
+ * Internal nodes are one byte for the node itself, and up to three
+ * bytes for an offset into the tree.  The first byte contains the
+ * following information:
+ *  NEXTBYTE  - flag        - advance to next byte if set
+ *  BITNUM    - 3 bit field - the bit number to tested
+ *  OFFLEN    - 2 bit field - number of bytes in the offset
+ * if offlen == 0 (non-branching node)
+ *  RIGHTPATH - 1 bit field - set if the following node is for the
+ *                            right-hand path (tested bit is set)
+ *  TRIENODE  - 1 bit field - set if the following node is an internal
+ *                            node, otherwise it is a leaf node
+ * if offlen != 0 (branching node)
+ *  LEFTNODE  - 1 bit field - set if the left-hand node is internal
+ *  RIGHTNODE - 1 bit field - set if the right-hand node is internal
+ *
+ * Due to the way utf8 works, there cannot be branching nodes with
+ * NEXTBYTE set, and moreover those nodes always have a righthand
+ * descendant.
+ */
+typedef const unsigned char utf8trie_t;
+#define BITNUM		0x07
+#define NEXTBYTE	0x08
+#define OFFLEN		0x30
+#define OFFLEN_SHIFT	4
+#define RIGHTPATH	0x40
+#define TRIENODE	0x80
+#define RIGHTNODE	0x40
+#define LEFTNODE	0x80
+
+/*
+ * utf8leaf_t
+ *
+ * The leaves of the trie are embedded in the trie, and so the same
+ * underlying datatype: unsigned char.
+ *
+ * leaf[0]: The unicode version, stored as a generation number that is
+ *          an index into utf8agetab[].  With this we can filter code
+ *          points based on the unicode version in which they were
+ *          defined.  The CCC of a non-defined code point is 0.
+ * leaf[1]: Canonical Combining Class. During normalization, we need
+ *          to do a stable sort into ascending order of all characters
+ *          with a non-zero CCC that occur between two characters with
+ *          a CCC of 0, or at the begin or end of a string.
+ *          The unicode standard guarantees that all CCC values are
+ *          between 0 and 254 inclusive, which leaves 255 available as
+ *          a special value.
+ *          Code points with CCC 0 are known as stoppers.
+ * leaf[2]: Decomposition. If leaf[1] == 255, then leaf[2] is the
+ *          start of a NUL-terminated string that is the decomposition
+ *          of the character.
+ *          The CCC of a decomposable character is the same as the CCC
+ *          of the first character of its decomposition.
+ *          Some characters decompose as the empty string: these are
+ *          characters with the Default_Ignorable_Code_Point property.
+ *          These do affect normalization, as they all have CCC 0.
+ *
+ * The decompositions in the trie have been fully expanded, with the
+ * exception of Hangul syllables, which are decomposed algorithmically.
+ *
+ * Casefolding, if applicable, is also done using decompositions.
+ *
+ * The trie is constructed in such a way that leaves exist for all
+ * UTF-8 sequences that match the criteria from the "UTF-8 valid
+ * ranges" comment above, and only for those sequences.  Therefore a
+ * lookup in the trie can be used to validate the UTF-8 input.
+ */
+typedef const unsigned char utf8leaf_t;
+
+#define LEAF_GEN(LEAF)	((LEAF)[0])
+#define LEAF_CCC(LEAF)	((LEAF)[1])
+#define LEAF_STR(LEAF)	((const char *)((LEAF) + 2))
+
+#define MINCCC		(0)
+#define MAXCCC		(254)
+#define STOPPER		(0)
+#define	DECOMPOSE	(255)
+
+/* Marker for hangul syllable decomposition. */
+#define HANGUL		((char)(255))
+/* Size of the synthesized leaf used for Hangul syllable decomposition. */
+#define UTF8HANGULLEAF	(12)
+
+/*
+ * Hangul decomposition (algorithm from Section 3.12 of Unicode 6.3.0)
+ *
+ * AC00;<Hangul Syllable, First>;Lo;0;L;;;;;N;;;;;
+ * D7A3;<Hangul Syllable, Last>;Lo;0;L;;;;;N;;;;;
+ *
+ * SBase = 0xAC00
+ * LBase = 0x1100
+ * VBase = 0x1161
+ * TBase = 0x11A7
+ * LCount = 19
+ * VCount = 21
+ * TCount = 28
+ * NCount = 588 (VCount * TCount)
+ * SCount = 11172 (LCount * NCount)
+ *
+ * Decomposition:
+ *   SIndex = s - SBase
+ *
+ * LV (Canonical/Full)
+ *   LIndex = SIndex / NCount
+ *   VIndex = (Sindex % NCount) / TCount
+ *   LPart = LBase + LIndex
+ *   VPart = VBase + VIndex
+ *
+ * LVT (Canonical)
+ *   LVIndex = (SIndex / TCount) * TCount
+ *   TIndex = (Sindex % TCount)
+ *   LVPart = SBase + LVIndex
+ *   TPart = TBase + TIndex
+ *
+ * LVT (Full)
+ *   LIndex = SIndex / NCount
+ *   VIndex = (Sindex % NCount) / TCount
+ *   TIndex = (Sindex % TCount)
+ *   LPart = LBase + LIndex
+ *   VPart = VBase + VIndex
+ *   if (TIndex == 0) {
+ *          d = <LPart, VPart>
+ *   } else {
+ *          TPart = TBase + TIndex
+ *          d = <LPart, TPart, VPart>
+ *   }
+ */
+
+/* Constants */
+#define SB	(0xAC00)
+#define LB	(0x1100)
+#define VB	(0x1161)
+#define TB	(0x11A7)
+#define LC	(19)
+#define VC	(21)
+#define TC	(28)
+#define NC	(VC * TC)
+#define SC	(LC * NC)
+
+/* Algorithmic decomposition of hangul syllable. */
+static utf8leaf_t *
+utf8hangul(const char *str, unsigned char *hangul)
+{
+	unsigned int	si;
+	unsigned int	li;
+	unsigned int	vi;
+	unsigned int	ti;
+	unsigned char	*h;
+
+	/* Calculate the SI, LI, VI, and TI values. */
+	si = utf8decode3(str) - SB;
+	li = si / NC;
+	vi = (si % NC) / TC;
+	ti = si % TC;
+
+	/* Fill in base of leaf. */
+	h = hangul;
+	LEAF_GEN(h) = 2;
+	LEAF_CCC(h) = DECOMPOSE;
+	h += 2;
+
+	/* Add LPart, a 3-byte UTF-8 sequence. */
+	h += utf8encode3((char *)h, li + LB);
+
+	/* Add VPart, a 3-byte UTF-8 sequence. */
+	h += utf8encode3((char *)h, vi + VB);
+
+	/* Add TPart if required, also a 3-byte UTF-8 sequence. */
+	if (ti)
+		h += utf8encode3((char *)h, ti + TB);
+
+	/* Terminate string. */
+	h[0] = '\0';
+
+	return hangul;
+}
+
+/*
+ * Use trie to scan s, touching at most len bytes.
+ * Returns the leaf if one exists, NULL otherwise.
+ *
+ * A non-NULL return guarantees that the UTF-8 sequence starting at s
+ * is well-formed and corresponds to a known unicode code point.  The
+ * shorthand for this will be "is valid UTF-8 unicode".
+ */
+static utf8leaf_t *utf8nlookup(const struct utf8data *data,
+			       unsigned char *hangul, const char *s, size_t len)
+{
+	utf8trie_t	*trie;
+	int		offlen;
+	int		offset;
+	int		mask;
+	int		node;
+
+	if (!data)
+		return NULL;
+	if (len == 0)
+		return NULL;
+
+	trie = utf8data + data->offset;
+	node = 1;
+	while (node) {
+		offlen = (*trie & OFFLEN) >> OFFLEN_SHIFT;
+		if (*trie & NEXTBYTE) {
+			if (--len == 0)
+				return NULL;
+			s++;
+		}
+		mask = 1 << (*trie & BITNUM);
+		if (*s & mask) {
+			/* Right leg */
+			if (offlen) {
+				/* Right node at offset of trie */
+				node = (*trie & RIGHTNODE);
+				offset = trie[offlen];
+				while (--offlen) {
+					offset <<= 8;
+					offset |= trie[offlen];
+				}
+				trie += offset;
+			} else if (*trie & RIGHTPATH) {
+				/* Right node after this node */
+				node = (*trie & TRIENODE);
+				trie++;
+			} else {
+				/* No right node. */
+				return NULL;
+			}
+		} else {
+			/* Left leg */
+			if (offlen) {
+				/* Left node after this node. */
+				node = (*trie & LEFTNODE);
+				trie += offlen + 1;
+			} else if (*trie & RIGHTPATH) {
+				/* No left node. */
+				return NULL;
+			} else {
+				/* Left node after this node */
+				node = (*trie & TRIENODE);
+				trie++;
+			}
+		}
+	}
+	/*
+	 * Hangul decomposition is done algorithmically. These are the
+	 * codepoints >= 0xAC00 and <= 0xD7A3. Their UTF-8 encoding is
+	 * always 3 bytes long, so s has been advanced twice, and the
+	 * start of the sequence is at s-2.
+	 */
+	if (LEAF_CCC(trie) == DECOMPOSE && LEAF_STR(trie)[0] == HANGUL)
+		trie = utf8hangul(s - 2, hangul);
+	return trie;
+}
+
+/*
+ * Use trie to scan s.
+ * Returns the leaf if one exists, NULL otherwise.
+ *
+ * Forwards to utf8nlookup().
+ */
+static utf8leaf_t *utf8lookup(const struct utf8data *data,
+			      unsigned char *hangul, const char *s)
+{
+	return utf8nlookup(data, hangul, s, (size_t)-1);
+}
+
+#if 0
+/*
+ * Maximum age of any character in s.
+ * Return -1 if s is not valid UTF-8 unicode.
+ * Return 0 if only non-assigned code points are used.
+ */
+static int utf8agemax(const struct utf8data *data, const char *s)
+{
+	utf8leaf_t	*leaf;
+	int		age = 0;
+	int		leaf_age;
+	unsigned char	hangul[UTF8HANGULLEAF];
+
+	if (!data)
+		return -1;
+
+	while (*s) {
+		leaf = utf8lookup(data, hangul, s);
+		if (!leaf)
+			return -1;
+
+		leaf_age = utf8agetab[LEAF_GEN(leaf)];
+		if (leaf_age <= data->maxage && leaf_age > age)
+			age = leaf_age;
+		s += utf8clen(s);
+	}
+	return age;
+}
+#endif
+
+#if 0
+/*
+ * Minimum age of any character in s.
+ * Return -1 if s is not valid UTF-8 unicode.
+ * Return 0 if non-assigned code points are used.
+ */
+static int utf8agemin(const struct utf8data *data, const char *s)
+{
+	utf8leaf_t	*leaf;
+	int		age;
+	int		leaf_age;
+	unsigned char	hangul[UTF8HANGULLEAF];
+
+	if (!data)
+		return -1;
+	age = data->maxage;
+	while (*s) {
+		leaf = utf8lookup(data, hangul, s);
+		if (!leaf)
+			return -1;
+		leaf_age = utf8agetab[LEAF_GEN(leaf)];
+		if (leaf_age <= data->maxage && leaf_age < age)
+			age = leaf_age;
+		s += utf8clen(s);
+	}
+	return age;
+}
+#endif
+
+#if 0
+/*
+ * Maximum age of any character in s, touch at most len bytes.
+ * Return -1 if s is not valid UTF-8 unicode.
+ */
+static int utf8nagemax(const struct utf8data *data, const char *s, size_t len)
+{
+	utf8leaf_t	*leaf;
+	int		age = 0;
+	int		leaf_age;
+	unsigned char	hangul[UTF8HANGULLEAF];
+
+	if (!data)
+		return -1;
+
+	while (len && *s) {
+		leaf = utf8nlookup(data, hangul, s, len);
+		if (!leaf)
+			return -1;
+		leaf_age = utf8agetab[LEAF_GEN(leaf)];
+		if (leaf_age <= data->maxage && leaf_age > age)
+			age = leaf_age;
+		len -= utf8clen(s);
+		s += utf8clen(s);
+	}
+	return age;
+}
+#endif
+
+#if 0
+/*
+ * Maximum age of any character in s, touch at most len bytes.
+ * Return -1 if s is not valid UTF-8 unicode.
+ */
+static int utf8nagemin(const struct utf8data *data, const char *s, size_t len)
+{
+	utf8leaf_t	*leaf;
+	int		leaf_age;
+	int		age;
+	unsigned char	hangul[UTF8HANGULLEAF];
+
+	if (!data)
+		return -1;
+	age = data->maxage;
+	while (len && *s) {
+		leaf = utf8nlookup(data, hangul, s, len);
+		if (!leaf)
+			return -1;
+		leaf_age = utf8agetab[LEAF_GEN(leaf)];
+		if (leaf_age <= data->maxage && leaf_age < age)
+			age = leaf_age;
+		len -= utf8clen(s);
+		s += utf8clen(s);
+	}
+	return age;
+}
+#endif
+
+#if 0
+/*
+ * Length of the normalization of s.
+ * Return -1 if s is not valid UTF-8 unicode.
+ *
+ * A string of Default_Ignorable_Code_Point has length 0.
+ */
+static ssize_t utf8len(const struct utf8data *data, const char *s)
+{
+	utf8leaf_t	*leaf;
+	size_t		ret = 0;
+	unsigned char	hangul[UTF8HANGULLEAF];
+
+	if (!data)
+		return -1;
+	while (*s) {
+		leaf = utf8lookup(data, hangul, s);
+		if (!leaf)
+			return -1;
+		if (utf8agetab[LEAF_GEN(leaf)] > data->maxage)
+			ret += utf8clen(s);
+		else if (LEAF_CCC(leaf) == DECOMPOSE)
+			ret += strlen(LEAF_STR(leaf));
+		else
+			ret += utf8clen(s);
+		s += utf8clen(s);
+	}
+	return ret;
+}
+#endif
+
+#if 0
+/*
+ * Length of the normalization of s, touch at most len bytes.
+ * Return -1 if s is not valid UTF-8 unicode.
+ */
+static ssize_t utf8nlen(const struct utf8data *data, const char *s, size_t len)
+{
+	utf8leaf_t	*leaf;
+	size_t		ret = 0;
+	unsigned char	hangul[UTF8HANGULLEAF];
+
+	if (!data)
+		return -1;
+	while (len && *s) {
+		leaf = utf8nlookup(data, hangul, s, len);
+		if (!leaf)
+			return -1;
+		if (utf8agetab[LEAF_GEN(leaf)] > data->maxage)
+			ret += utf8clen(s);
+		else if (LEAF_CCC(leaf) == DECOMPOSE)
+			ret += strlen(LEAF_STR(leaf));
+		else
+			ret += utf8clen(s);
+		len -= utf8clen(s);
+		s += utf8clen(s);
+	}
+	return ret;
+}
+#endif
+
+/*
+ * Set up an utf8cursor for use by utf8byte().
+ *
+ *   u8c    : pointer to cursor.
+ *   data   : const struct utf8data to use for normalization.
+ *   s      : string.
+ *   len    : length of s.
+ *
+ * Returns -1 on error, 0 on success.
+ */
+static int utf8ncursor(struct utf8cursor *u8c, const struct utf8data *data,
+		const char *s, size_t len)
+{
+	if (!data)
+		return -1;
+	if (!s)
+		return -1;
+	u8c->data = data;
+	u8c->s = s;
+	u8c->p = NULL;
+	u8c->ss = NULL;
+	u8c->sp = NULL;
+	u8c->len = len;
+	u8c->slen = 0;
+	u8c->ccc = STOPPER;
+	u8c->nccc = STOPPER;
+	/* Check we didn't clobber the maximum length. */
+	if (u8c->len != len)
+		return -1;
+	/* The first byte of s may not be an utf8 continuation. */
+	if (len > 0 && (*s & 0xC0) == 0x80)
+		return -1;
+	return 0;
+}
+
+#if 0
+/*
+ * Set up an utf8cursor for use by utf8byte().
+ *
+ *   u8c    : pointer to cursor.
+ *   data   : const struct utf8data to use for normalization.
+ *   s      : NUL-terminated string.
+ *
+ * Returns -1 on error, 0 on success.
+ */
+static int utf8cursor(struct utf8cursor *u8c, const struct utf8data *data,
+	       const char *s)
+{
+	return utf8ncursor(u8c, data, s, (unsigned int)-1);
+}
+#endif
+
+/*
+ * Get one byte from the normalized form of the string described by u8c.
+ *
+ * Returns the byte cast to an unsigned char on success, and -1 on failure.
+ *
+ * The cursor keeps track of the location in the string in u8c->s.
+ * When a character is decomposed, the current location is stored in
+ * u8c->p, and u8c->s is set to the start of the decomposition. Note
+ * that bytes from a decomposition do not count against u8c->len.
+ *
+ * Characters are emitted if they match the current CCC in u8c->ccc.
+ * Hitting end-of-string while u8c->ccc == STOPPER means we're done,
+ * and the function returns 0 in that case.
+ *
+ * Sorting by CCC is done by repeatedly scanning the string.  The
+ * values of u8c->s and u8c->p are stored in u8c->ss and u8c->sp at
+ * the start of the scan.  The first pass finds the lowest CCC to be
+ * emitted and stores it in u8c->nccc, the second pass emits the
+ * characters with this CCC and finds the next lowest CCC. This limits
+ * the number of passes to 1 + the number of different CCCs in the
+ * sequence being scanned.
+ *
+ * Therefore:
+ *  u8c->p  != NULL -> a decomposition is being scanned.
+ *  u8c->ss != NULL -> this is a repeating scan.
+ *  u8c->ccc == -1   -> this is the first scan of a repeating scan.
+ */
+static int utf8byte(struct utf8cursor *u8c)
+{
+	utf8leaf_t *leaf;
+	int ccc;
+
+	for (;;) {
+		/* Check for the end of a decomposed character. */
+		if (u8c->p && *u8c->s == '\0') {
+			u8c->s = u8c->p;
+			u8c->p = NULL;
+		}
+
+		/* Check for end-of-string. */
+		if (!u8c->p && (u8c->len == 0 || *u8c->s == '\0')) {
+			/* There is no next byte. */
+			if (u8c->ccc == STOPPER)
+				return 0;
+			/* End-of-string during a scan counts as a stopper. */
+			ccc = STOPPER;
+			goto ccc_mismatch;
+		} else if ((*u8c->s & 0xC0) == 0x80) {
+			/* This is a continuation of the current character. */
+			if (!u8c->p)
+				u8c->len--;
+			return (unsigned char)*u8c->s++;
+		}
+
+		/* Look up the data for the current character. */
+		if (u8c->p) {
+			leaf = utf8lookup(u8c->data, u8c->hangul, u8c->s);
+		} else {
+			leaf = utf8nlookup(u8c->data, u8c->hangul,
+					   u8c->s, u8c->len);
+		}
+
+		/* No leaf found implies that the input is a binary blob. */
+		if (!leaf)
+			return -1;
+
+		ccc = LEAF_CCC(leaf);
+		/* Characters that are too new have CCC 0. */
+		if (utf8agetab[LEAF_GEN(leaf)] > u8c->data->maxage) {
+			ccc = STOPPER;
+		} else if (ccc == DECOMPOSE) {
+			u8c->len -= utf8clen(u8c->s);
+			u8c->p = u8c->s + utf8clen(u8c->s);
+			u8c->s = LEAF_STR(leaf);
+			/* Empty decomposition implies CCC 0. */
+			if (*u8c->s == '\0') {
+				if (u8c->ccc == STOPPER)
+					continue;
+				ccc = STOPPER;
+				goto ccc_mismatch;
+			}
+
+			leaf = utf8lookup(u8c->data, u8c->hangul, u8c->s);
+			if (!leaf)
+				return -1;
+			ccc = LEAF_CCC(leaf);
+		}
+
+		/*
+		 * If this is not a stopper, then see if it updates
+		 * the next canonical class to be emitted.
+		 */
+		if (ccc != STOPPER && u8c->ccc < ccc && ccc < u8c->nccc)
+			u8c->nccc = ccc;
+
+		/*
+		 * Return the current byte if this is the current
+		 * combining class.
+		 */
+		if (ccc == u8c->ccc) {
+			if (!u8c->p)
+				u8c->len--;
+			return (unsigned char)*u8c->s++;
+		}
+
+		/* Current combining class mismatch. */
+ccc_mismatch:
+		if (u8c->nccc == STOPPER) {
+			/*
+			 * Scan forward for the first canonical class
+			 * to be emitted.  Save the position from
+			 * which to restart.
+			 */
+			u8c->ccc = MINCCC - 1;
+			u8c->nccc = ccc;
+			u8c->sp = u8c->p;
+			u8c->ss = u8c->s;
+			u8c->slen = u8c->len;
+			if (!u8c->p)
+				u8c->len -= utf8clen(u8c->s);
+			u8c->s += utf8clen(u8c->s);
+		} else if (ccc != STOPPER) {
+			/* Not a stopper, and not the ccc we're emitting. */
+			if (!u8c->p)
+				u8c->len -= utf8clen(u8c->s);
+			u8c->s += utf8clen(u8c->s);
+		} else if (u8c->nccc != MAXCCC + 1) {
+			/* At a stopper, restart for next ccc. */
+			u8c->ccc = u8c->nccc;
+			u8c->nccc = MAXCCC + 1;
+			u8c->s = u8c->ss;
+			u8c->p = u8c->sp;
+			u8c->len = u8c->slen;
+		} else {
+			/* All done, proceed from here. */
+			u8c->ccc = STOPPER;
+			u8c->nccc = STOPPER;
+			u8c->sp = NULL;
+			u8c->ss = NULL;
+			u8c->slen = 0;
+		}
+	}
+}
+
+#if 0
+/*
+ * Look for the correct const struct utf8data for a unicode version.
+ * Returns NULL if the version requested is too new.
+ *
+ * Two normalization forms are supported: nfdi and nfdicf.
+ *
+ * nfdi:
+ *  - Apply unicode normalization form NFD.
+ *  - Remove any Default_Ignorable_Code_Point.
+ *
+ * nfdicf:
+ *  - Apply unicode normalization form NFD.
+ *  - Remove any Default_Ignorable_Code_Point.
+ *  - Apply a full casefold (C + F).
+ */
+static const struct utf8data *utf8nfdi(unsigned int maxage)
+{
+	int i = ARRAY_SIZE(utf8nfdidata) - 1;
+
+	while (maxage < utf8nfdidata[i].maxage)
+		i--;
+	if (maxage > utf8nfdidata[i].maxage)
+		return NULL;
+	return &utf8nfdidata[i];
+}
+#endif
+
+static const struct utf8data *utf8nfdicf(unsigned int maxage)
+{
+	int i = ARRAY_SIZE(utf8nfdicfdata) - 1;
+
+	while (maxage < utf8nfdicfdata[i].maxage)
+		i--;
+	if (maxage > utf8nfdicfdata[i].maxage)
+		return NULL;
+	return &utf8nfdicfdata[i];
+}
+
+static int utf8_casefold(const struct ext2fs_nls_table *table,
+			  const unsigned char *str, size_t len,
+			  unsigned char *dest, size_t dlen)
+{
+	const struct utf8data *data = utf8nfdicf(table->version);
+	struct utf8cursor cur;
+	size_t nlen = 0;
+
+	if (utf8ncursor(&cur, data, (const char *) str, len) < 0)
+		goto invalid_seq;
+
+	for (nlen = 0; nlen < dlen; nlen++) {
+		int c = utf8byte(&cur);
+
+		dest[nlen] = c;
+		if (!c)
+			return nlen;
+		if (c == -1)
+			break;
+	}
+
+	return -ENAMETOOLONG;
+
+invalid_seq:
+	if (dlen < len)
+		return -ENAMETOOLONG;
+
+	/* Signal invalid sequence */
+	return -EINVAL;
+}
+
+static int utf8_validate(const struct ext2fs_nls_table *table,
+			 char *s, size_t len, char **pos)
+{
+	const struct utf8data *data = utf8nfdicf(table->version);
+	utf8leaf_t	*leaf;
+	unsigned char	hangul[UTF8HANGULLEAF];
+
+	if (!data)
+		return -1;
+	while (len && *s) {
+		leaf = utf8nlookup(data, hangul, s, len);
+		if (!leaf) {
+			*pos = s;
+			return 1;
+		}
+		len -= utf8clen(s);
+		s += utf8clen(s);
+	}
+	return 0;
+}
+
+static int utf8_casefold_cmp(const struct ext2fs_nls_table *table,
+			     const unsigned char *str1, size_t len1,
+			     const unsigned char *str2, size_t len2)
+{
+	const struct utf8data *data = utf8nfdicf(table->version);
+	int c1, c2;
+	struct utf8cursor cur1, cur2;
+
+	if (utf8ncursor(&cur1, data, (const char *) str1, len1) < 0)
+		return -1;
+	if (utf8ncursor(&cur2, data, (const char *) str2, len2) < 0)
+		return -1;
+
+	do {
+		c1 = utf8byte(&cur1);
+		c2 = utf8byte(&cur2);
+
+		if (c1 < 0 || c2 < 0)
+			return -1;
+		if (c1 != c2)
+			return c1 - c2;
+	} while (c1);
+
+	return 0;
+}
+
+static const struct ext2fs_nls_ops utf8_ops = {
+	.casefold = utf8_casefold,
+	.validate = utf8_validate,
+	.casefold_cmp = utf8_casefold_cmp,
+};
+
+static const struct ext2fs_nls_table nls_utf8 = {
+	.ops = &utf8_ops,
+	.version = UNICODE_AGE(12, 1, 0),
+};
+
+const struct ext2fs_nls_table *ext2fs_load_nls_table(int encoding)
+{
+	if (encoding == EXT4_ENC_UTF8_12_1)
+		return &nls_utf8;
+
+	return NULL;
+}
+
+int ext2fs_check_encoded_name(const struct ext2fs_nls_table *table,
+			      char *name, size_t len, char **pos)
+{
+	return table->ops->validate(table, name, len, pos);
+}
+
+int ext2fs_casefold_cmp(const struct ext2fs_nls_table *table,
+			const unsigned char *str1, size_t len1,
+			const unsigned char *str2, size_t len2)
+{
+	return table->ops->casefold_cmp(table, str1, len1, str2, len2);
+}
diff --git a/lib/ext2fs/nt_io.c b/lib/ext2fs/nt_io.c
new file mode 100644
index 0000000..234f6b1
--- /dev/null
+++ b/lib/ext2fs/nt_io.c
@@ -0,0 +1,1494 @@
+/*
+ * nt_io.c --- This is the Nt I/O interface to the I/O manager.
+ *
+ * Implements a one-block write-through cache.
+ *
+ * Copyright (C) 1993, 1994, 1995 Theodore Ts'o.
+ * Copyright (C) 1998 Andrey Shedel (andreys@ns.cr.cyco.com)
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#ifdef HAVE_CONFIG_H
+#include "config.h"
+#endif
+
+
+//
+// I need some warnings to disable...
+//
+
+
+#pragma warning(disable:4514) // unreferenced inline function has been removed
+#pragma warning(push,4)
+
+#pragma warning(disable:4201) // nonstandard extension used : nameless struct/union)
+#pragma warning(disable:4214) // nonstandard extension used : bit field types other than int
+#pragma warning(disable:4115) // named type definition in parentheses
+
+#include <ntddk.h>
+#include <ntdddisk.h>
+#include <ntstatus.h>
+
+#pragma warning(pop)
+
+
+//
+// Some native APIs.
+//
+
+NTSYSAPI
+ULONG
+NTAPI
+RtlNtStatusToDosError(
+    IN NTSTATUS Status
+   );
+
+NTSYSAPI
+NTSTATUS
+NTAPI
+NtClose(
+    IN HANDLE Handle
+   );
+
+
+NTSYSAPI
+NTSTATUS
+NTAPI
+NtOpenFile(
+    OUT PHANDLE FileHandle,
+    IN ACCESS_MASK DesiredAccess,
+    IN POBJECT_ATTRIBUTES ObjectAttributes,
+    OUT PIO_STATUS_BLOCK IoStatusBlock,
+    IN ULONG ShareAccess,
+    IN ULONG OpenOptions
+    );
+
+NTSYSAPI
+NTSTATUS
+NTAPI
+NtFlushBuffersFile(
+    IN HANDLE FileHandle,
+    OUT PIO_STATUS_BLOCK IoStatusBlock
+   );
+
+
+NTSYSAPI
+NTSTATUS
+NTAPI
+NtReadFile(
+    IN HANDLE FileHandle,
+    IN HANDLE Event OPTIONAL,
+    IN PIO_APC_ROUTINE ApcRoutine OPTIONAL,
+    IN PVOID ApcContext OPTIONAL,
+    OUT PIO_STATUS_BLOCK IoStatusBlock,
+    OUT PVOID Buffer,
+    IN ULONG Length,
+    IN PLARGE_INTEGER ByteOffset OPTIONAL,
+    IN PULONG Key OPTIONAL
+    );
+
+NTSYSAPI
+NTSTATUS
+NTAPI
+NtWriteFile(
+    IN HANDLE FileHandle,
+    IN HANDLE Event OPTIONAL,
+    IN PIO_APC_ROUTINE ApcRoutine OPTIONAL,
+    IN PVOID ApcContext OPTIONAL,
+    OUT PIO_STATUS_BLOCK IoStatusBlock,
+    IN PVOID Buffer,
+    IN ULONG Length,
+    IN PLARGE_INTEGER ByteOffset OPTIONAL,
+    IN PULONG Key OPTIONAL
+    );
+
+NTSYSAPI
+NTSTATUS
+NTAPI
+NtDeviceIoControlFile(
+    IN HANDLE FileHandle,
+    IN HANDLE Event OPTIONAL,
+    IN PIO_APC_ROUTINE ApcRoutine OPTIONAL,
+    IN PVOID ApcContext OPTIONAL,
+    OUT PIO_STATUS_BLOCK IoStatusBlock,
+    IN ULONG IoControlCode,
+    IN PVOID InputBuffer OPTIONAL,
+    IN ULONG InputBufferLength,
+    OUT PVOID OutputBuffer OPTIONAL,
+    IN ULONG OutputBufferLength
+    );
+
+NTSYSAPI
+NTSTATUS
+NTAPI
+NtFsControlFile(
+    IN HANDLE FileHandle,
+    IN HANDLE Event OPTIONAL,
+    IN PIO_APC_ROUTINE ApcRoutine OPTIONAL,
+    IN PVOID ApcContext OPTIONAL,
+    OUT PIO_STATUS_BLOCK IoStatusBlock,
+    IN ULONG IoControlCode,
+    IN PVOID InputBuffer OPTIONAL,
+    IN ULONG InputBufferLength,
+    OUT PVOID OutputBuffer OPTIONAL,
+    IN ULONG OutputBufferLength
+    );
+
+
+NTSYSAPI
+NTSTATUS
+NTAPI
+NtDelayExecution(
+    IN BOOLEAN Alertable,
+    IN PLARGE_INTEGER Interval
+    );
+
+
+#define FSCTL_LOCK_VOLUME               CTL_CODE(FILE_DEVICE_FILE_SYSTEM, 6, METHOD_BUFFERED, FILE_ANY_ACCESS)
+#define FSCTL_UNLOCK_VOLUME             CTL_CODE(FILE_DEVICE_FILE_SYSTEM, 7, METHOD_BUFFERED, FILE_ANY_ACCESS)
+#define FSCTL_DISMOUNT_VOLUME           CTL_CODE(FILE_DEVICE_FILE_SYSTEM, 8, METHOD_BUFFERED, FILE_ANY_ACCESS)
+#define FSCTL_IS_VOLUME_MOUNTED         CTL_CODE(FILE_DEVICE_FILE_SYSTEM,10, METHOD_BUFFERED, FILE_ANY_ACCESS)
+
+
+//
+// useful macros
+//
+
+#define BooleanFlagOn(Flags,SingleFlag) ((BOOLEAN)((((Flags) & (SingleFlag)) != 0)))
+
+
+//
+// Include Win32 error codes.
+//
+
+#include <winerror.h>
+
+//
+// standard stuff
+//
+
+#include <assert.h>
+#include <stdio.h>
+#include <string.h>
+#include <stdlib.h>
+#include <malloc.h>
+
+#include <linux/types.h>
+#include "ext2_fs.h"
+#include <errno.h>
+
+#include "et/com_err.h"
+#include "ext2fs/ext2fs.h"
+#include "ext2fs/ext2_err.h"
+
+
+
+
+//
+// For checking structure magic numbers...
+//
+
+
+#define EXT2_CHECK_MAGIC(struct, code) \
+	  if ((struct)->magic != (code)) return (code)
+
+#define EXT2_ET_MAGIC_NT_IO_CHANNEL  0x10ed
+
+
+//
+// Private data block
+//
+
+typedef struct _NT_PRIVATE_DATA {
+	int	   magic;
+	HANDLE Handle;
+	int	   Flags;
+	PCHAR  Buffer;
+	__u32  BufferBlockNumber;
+	ULONG  BufferSize;
+	BOOLEAN OpenedReadonly;
+	BOOLEAN Written;
+}NT_PRIVATE_DATA, *PNT_PRIVATE_DATA;
+
+
+
+//
+// Standard interface prototypes
+//
+
+static errcode_t nt_open(const char *name, int flags, io_channel *channel);
+static errcode_t nt_close(io_channel channel);
+static errcode_t nt_set_blksize(io_channel channel, int blksize);
+static errcode_t nt_read_blk(io_channel channel, unsigned long block,
+			       int count, void *data);
+static errcode_t nt_write_blk(io_channel channel, unsigned long block,
+				int count, const void *data);
+static errcode_t nt_flush(io_channel channel);
+
+static struct struct_io_manager struct_nt_manager = {
+	.magic		= EXT2_ET_MAGIC_IO_MANAGER,
+	.name		= "NT I/O Manager",
+	.open		= nt_open,
+	.close		= nt_close,
+	.set_blksize	= nt_set_blksize,
+	.read_blk	= nt_read_blk,
+	.write_blk	= nt_write_blk,
+	.flush		= nt_flush
+};
+
+//
+// function to get API
+//
+
+io_manager nt_io_manager()
+{
+	return &struct_nt_manager;
+}
+
+
+
+
+
+//
+// This is a code to convert Win32 errors to unix errno
+//
+
+typedef struct {
+	ULONG WinError;
+	int errnocode;
+}ERROR_ENTRY;
+
+static ERROR_ENTRY ErrorTable[] = {
+        {  ERROR_INVALID_FUNCTION,       EINVAL    },
+        {  ERROR_FILE_NOT_FOUND,         ENOENT    },
+        {  ERROR_PATH_NOT_FOUND,         ENOENT    },
+        {  ERROR_TOO_MANY_OPEN_FILES,    EMFILE    },
+        {  ERROR_ACCESS_DENIED,          EACCES    },
+        {  ERROR_INVALID_HANDLE,         EBADF     },
+        {  ERROR_ARENA_TRASHED,          ENOMEM    },
+        {  ERROR_NOT_ENOUGH_MEMORY,      ENOMEM    },
+        {  ERROR_INVALID_BLOCK,          ENOMEM    },
+        {  ERROR_BAD_ENVIRONMENT,        E2BIG     },
+        {  ERROR_BAD_FORMAT,             ENOEXEC   },
+        {  ERROR_INVALID_ACCESS,         EINVAL    },
+        {  ERROR_INVALID_DATA,           EINVAL    },
+        {  ERROR_INVALID_DRIVE,          ENOENT    },
+        {  ERROR_CURRENT_DIRECTORY,      EACCES    },
+        {  ERROR_NOT_SAME_DEVICE,        EXDEV     },
+        {  ERROR_NO_MORE_FILES,          ENOENT    },
+        {  ERROR_LOCK_VIOLATION,         EACCES    },
+        {  ERROR_BAD_NETPATH,            ENOENT    },
+        {  ERROR_NETWORK_ACCESS_DENIED,  EACCES    },
+        {  ERROR_BAD_NET_NAME,           ENOENT    },
+        {  ERROR_FILE_EXISTS,            EEXIST    },
+        {  ERROR_CANNOT_MAKE,            EACCES    },
+        {  ERROR_FAIL_I24,               EACCES    },
+        {  ERROR_INVALID_PARAMETER,      EINVAL    },
+        {  ERROR_NO_PROC_SLOTS,          EAGAIN    },
+        {  ERROR_DRIVE_LOCKED,           EACCES    },
+        {  ERROR_BROKEN_PIPE,            EPIPE     },
+        {  ERROR_DISK_FULL,              ENOSPC    },
+        {  ERROR_INVALID_TARGET_HANDLE,  EBADF     },
+        {  ERROR_INVALID_HANDLE,         EINVAL    },
+        {  ERROR_WAIT_NO_CHILDREN,       ECHILD    },
+        {  ERROR_CHILD_NOT_COMPLETE,     ECHILD    },
+        {  ERROR_DIRECT_ACCESS_HANDLE,   EBADF     },
+        {  ERROR_NEGATIVE_SEEK,          EINVAL    },
+        {  ERROR_SEEK_ON_DEVICE,         EACCES    },
+        {  ERROR_DIR_NOT_EMPTY,          ENOTEMPTY },
+        {  ERROR_NOT_LOCKED,             EACCES    },
+        {  ERROR_BAD_PATHNAME,           ENOENT    },
+        {  ERROR_MAX_THRDS_REACHED,      EAGAIN    },
+        {  ERROR_LOCK_FAILED,            EACCES    },
+        {  ERROR_ALREADY_EXISTS,         EEXIST    },
+        {  ERROR_FILENAME_EXCED_RANGE,   ENOENT    },
+        {  ERROR_NESTING_NOT_ALLOWED,    EAGAIN    },
+        {  ERROR_NOT_ENOUGH_QUOTA,       ENOMEM    }
+};
+
+
+
+
+static
+unsigned
+_MapDosError (
+    IN ULONG WinError
+   )
+{
+	int i;
+
+	//
+	// Lookup
+	//
+
+	for (i = 0; i < (sizeof(ErrorTable)/sizeof(ErrorTable[0])); ++i)
+	{
+		if (WinError == ErrorTable[i].WinError)
+		{
+			return ErrorTable[i].errnocode;
+		}
+	}
+
+	//
+	// not in table. Check ranges
+	//
+
+	if ((WinError >= ERROR_WRITE_PROTECT) &&
+		(WinError <= ERROR_SHARING_BUFFER_EXCEEDED))
+	{
+		return EACCES;
+	}
+	else if ((WinError >= ERROR_INVALID_STARTING_CODESEG) &&
+			 (WinError <= ERROR_INFLOOP_IN_RELOC_CHAIN))
+	{
+		return ENOEXEC;
+	}
+	else
+	{
+		return EINVAL;
+	}
+}
+
+
+
+
+
+
+
+//
+// Function to map NT status to dos error.
+//
+
+static
+__inline
+unsigned
+_MapNtStatus(
+    IN NTSTATUS Status
+   )
+{
+	return _MapDosError(RtlNtStatusToDosError(Status));
+}
+
+
+
+
+
+//
+// Helper functions to make things easier
+//
+
+static
+NTSTATUS
+_OpenNtName(
+    IN PCSTR Name,
+    IN BOOLEAN Readonly,
+    OUT PHANDLE Handle,
+    OUT PBOOLEAN OpenedReadonly OPTIONAL
+   )
+{
+	UNICODE_STRING UnicodeString;
+	ANSI_STRING    AnsiString;
+	WCHAR Buffer[512];
+	NTSTATUS Status;
+	OBJECT_ATTRIBUTES ObjectAttributes;
+	IO_STATUS_BLOCK IoStatusBlock;
+
+	//
+	// Make Unicode name from input string
+	//
+
+	UnicodeString.Buffer = &Buffer[0];
+	UnicodeString.Length = 0;
+	UnicodeString.MaximumLength = sizeof(Buffer); // in bytes!!!
+
+	RtlInitAnsiString(&AnsiString, Name);
+
+	Status = RtlAnsiStringToUnicodeString(&UnicodeString, &AnsiString, FALSE);
+
+	if(!NT_SUCCESS(Status))
+	{
+		return Status; // Unmappable character?
+	}
+
+	//
+	// Initialize object
+	//
+
+	InitializeObjectAttributes(&ObjectAttributes,
+							   &UnicodeString,
+							   OBJ_CASE_INSENSITIVE,
+							   NULL,
+							   NULL );
+
+	//
+	// Try to open it in initial mode
+	//
+
+	if(ARGUMENT_PRESENT(OpenedReadonly))
+	{
+		*OpenedReadonly = Readonly;
+	}
+
+
+	Status = NtOpenFile(Handle,
+						SYNCHRONIZE | FILE_READ_DATA | (Readonly ? 0 : FILE_WRITE_DATA),
+						&ObjectAttributes,
+						&IoStatusBlock,
+						FILE_SHARE_WRITE | FILE_SHARE_READ,
+						FILE_SYNCHRONOUS_IO_NONALERT);
+
+	if(!NT_SUCCESS(Status))
+	{
+		//
+		// Maybe was just mounted? wait 0.5 sec and retry.
+		//
+
+		LARGE_INTEGER Interval;
+		Interval.QuadPart = -5000000; // 0.5 sec. from now
+
+		NtDelayExecution(FALSE, &Interval);
+
+		Status = NtOpenFile(Handle,
+							SYNCHRONIZE | FILE_READ_DATA | (Readonly ? 0 : FILE_WRITE_DATA),
+							&ObjectAttributes,
+							&IoStatusBlock,
+							FILE_SHARE_WRITE | FILE_SHARE_READ,
+							FILE_SYNCHRONOUS_IO_NONALERT);
+
+		//
+		// Try to satisfy mode
+		//
+
+		if((STATUS_ACCESS_DENIED == Status) && !Readonly)
+		{
+			if(ARGUMENT_PRESENT(OpenedReadonly))
+			{
+				*OpenedReadonly = TRUE;
+			}
+
+			Status = NtOpenFile(Handle,
+							SYNCHRONIZE | FILE_READ_DATA,
+							&ObjectAttributes,
+							&IoStatusBlock,
+							FILE_SHARE_WRITE | FILE_SHARE_READ,
+							FILE_SYNCHRONOUS_IO_NONALERT);
+		}
+	}
+
+
+
+	//
+	// done
+	//
+
+	return Status;
+}
+
+
+static
+NTSTATUS
+_OpenDriveLetter(
+    IN CHAR Letter,
+    IN BOOLEAN ReadOnly,
+    OUT PHANDLE Handle,
+    OUT PBOOLEAN OpenedReadonly OPTIONAL
+   )
+{
+	CHAR Buffer[100];
+
+	sprintf(Buffer, "\\DosDevices\\%c:", Letter);
+
+	return _OpenNtName(Buffer, ReadOnly, Handle, OpenedReadonly);
+}
+
+
+//
+// Flush device
+//
+
+static
+__inline
+NTSTATUS
+_FlushDrive(
+		IN HANDLE Handle
+		)
+{
+	IO_STATUS_BLOCK IoStatusBlock;
+	return NtFlushBuffersFile(Handle, &IoStatusBlock);
+}
+
+
+//
+// lock drive
+//
+
+static
+__inline
+NTSTATUS
+_LockDrive(
+		IN HANDLE Handle
+		)
+{
+	IO_STATUS_BLOCK IoStatusBlock;
+	return NtFsControlFile(Handle, 0, 0, 0, &IoStatusBlock, FSCTL_LOCK_VOLUME, 0, 0, 0, 0);
+}
+
+
+//
+// unlock drive
+//
+
+static
+__inline
+NTSTATUS
+_UnlockDrive(
+	IN HANDLE Handle
+	)
+{
+	IO_STATUS_BLOCK IoStatusBlock;
+	return NtFsControlFile(Handle, 0, 0, 0, &IoStatusBlock, FSCTL_UNLOCK_VOLUME, 0, 0, 0, 0);
+}
+
+static
+__inline
+NTSTATUS
+_DismountDrive(
+	IN HANDLE Handle
+	)
+{
+	IO_STATUS_BLOCK IoStatusBlock;
+	return NtFsControlFile(Handle, 0, 0, 0, &IoStatusBlock, FSCTL_DISMOUNT_VOLUME, 0, 0, 0, 0);
+}
+
+
+//
+// is mounted
+//
+
+static
+__inline
+BOOLEAN
+_IsMounted(
+	IN HANDLE Handle
+	)
+{
+	IO_STATUS_BLOCK IoStatusBlock;
+	NTSTATUS Status;
+	Status = NtFsControlFile(Handle, 0, 0, 0, &IoStatusBlock, FSCTL_IS_VOLUME_MOUNTED, 0, 0, 0, 0);
+	return (BOOLEAN)(STATUS_SUCCESS == Status);
+}
+
+
+static
+__inline
+NTSTATUS
+_CloseDisk(
+		IN HANDLE Handle
+		)
+{
+	return NtClose(Handle);
+}
+
+
+
+
+//
+// Make NT name from any recognized name
+//
+
+static
+PCSTR
+_NormalizeDeviceName(
+    IN PCSTR Device,
+    IN PSTR NormalizedDeviceNameBuffer
+   )
+{
+	int PartitionNumber = -1;
+	UCHAR DiskNumber;
+	PSTR p;
+
+
+	//
+	// Do not try to parse NT name
+	//
+
+	if('\\' == *Device)
+		return Device;
+
+
+
+	//
+	// Strip leading '/dev/' if any
+	//
+
+	if(('/' == *(Device)) &&
+		('d' == *(Device + 1)) &&
+		('e' == *(Device + 2)) &&
+		('v' == *(Device + 3)) &&
+		('/' == *(Device + 4)))
+	{
+		Device += 5;
+	}
+
+	if('\0' == *Device)
+	{
+		return NULL;
+	}
+
+
+	//
+	// forms: hda[n], fd[n]
+	//
+
+	if('d' != *(Device + 1))
+	{
+		return NULL;
+	}
+
+	if('h' == *Device)
+	{
+		if((*(Device + 2) < 'a') || (*(Device + 2) > ('a' + 9)) ||
+		   ((*(Device + 3) != '\0') &&
+			((*(Device + 4) != '\0') ||
+			 ((*(Device + 3) < '0') || (*(Device + 3) > '9'))
+			)
+		   )
+		  )
+		{
+			return NULL;
+		}
+
+		DiskNumber = (UCHAR)(*(Device + 2) - 'a');
+
+		if(*(Device + 3) != '\0')
+		{
+			PartitionNumber = (*(Device + 3) - '0');
+		}
+
+	}
+	else if('f' == *Device)
+	{
+		//
+		// 3-d letter should be a digit.
+		//
+
+		if((*(Device + 3) != '\0') ||
+		   (*(Device + 2) < '0') || (*(Device + 2) > '9'))
+		{
+			return NULL;
+		}
+
+		DiskNumber = (UCHAR)(*(Device + 2) - '0');
+
+	}
+	else
+	{
+		//
+		// invalid prefix
+		//
+
+		return NULL;
+	}
+
+
+
+	//
+	// Prefix
+	//
+
+	strcpy(NormalizedDeviceNameBuffer, "\\Device\\");
+
+	//
+	// Media name
+	//
+
+	switch(*Device)
+	{
+
+	case 'f':
+		strcat(NormalizedDeviceNameBuffer, "Floppy0");
+		break;
+
+	case 'h':
+		strcat(NormalizedDeviceNameBuffer, "Harddisk0");
+		break;
+	}
+
+
+	p = NormalizedDeviceNameBuffer + strlen(NormalizedDeviceNameBuffer) - 1;
+	*p = (CHAR)(*p + DiskNumber);
+
+
+	//
+	// Partition nr.
+	//
+
+	if(PartitionNumber >= 0)
+	{
+		strcat(NormalizedDeviceNameBuffer, "\\Partition0");
+
+		p = NormalizedDeviceNameBuffer + strlen(NormalizedDeviceNameBuffer) - 1;
+		*p = (CHAR)(*p + PartitionNumber);
+	}
+
+
+	return NormalizedDeviceNameBuffer;
+}
+
+
+
+
+static
+VOID
+_GetDeviceSize(
+    IN HANDLE h,
+    OUT unsigned __int64 *FsSize
+   )
+{
+	PARTITION_INFORMATION pi;
+	DISK_GEOMETRY gi;
+	NTSTATUS Status;
+	IO_STATUS_BLOCK IoStatusBlock;
+
+	//
+	// Zero it
+	//
+
+	*FsSize = 0;
+
+	//
+	// Call driver
+	//
+
+	RtlZeroMemory(&pi, sizeof(PARTITION_INFORMATION));
+
+	Status = NtDeviceIoControlFile(
+		h, NULL, NULL, NULL, &IoStatusBlock, IOCTL_DISK_GET_PARTITION_INFO,
+		&pi, sizeof(PARTITION_INFORMATION),
+		&pi, sizeof(PARTITION_INFORMATION));
+
+
+	if(NT_SUCCESS(Status))
+	{
+		*FsSize = pi.PartitionLength.QuadPart;
+	}
+	else if(STATUS_INVALID_DEVICE_REQUEST == Status)
+	{
+		//
+		// No partitions: get device info.
+		//
+
+		RtlZeroMemory(&gi, sizeof(DISK_GEOMETRY));
+
+		Status = NtDeviceIoControlFile(
+				h, NULL, NULL, NULL, &IoStatusBlock, IOCTL_DISK_GET_DRIVE_GEOMETRY,
+				&gi, sizeof(DISK_GEOMETRY),
+				&gi, sizeof(DISK_GEOMETRY));
+
+
+		if(NT_SUCCESS(Status))
+		{
+			*FsSize =
+				gi.BytesPerSector *
+				gi.SectorsPerTrack *
+				gi.TracksPerCylinder *
+				gi.Cylinders.QuadPart;
+		}
+
+	}
+}
+
+
+
+//
+// Open device by name.
+//
+
+static
+BOOLEAN
+_Ext2OpenDevice(
+    IN PCSTR Name,
+    IN BOOLEAN ReadOnly,
+    OUT PHANDLE Handle,
+    OUT PBOOLEAN OpenedReadonly OPTIONAL,
+    OUT unsigned *Errno OPTIONAL
+   )
+{
+	CHAR NormalizedDeviceName[512];
+	NTSTATUS Status;
+
+	if(NULL == Name)
+	{
+		//
+		// Set not found
+		//
+
+		if(ARGUMENT_PRESENT(Errno))
+			*Errno = ENOENT;
+
+		return FALSE;
+	}
+
+
+	if((((*Name) | 0x20) >= 'a') && (((*Name) | 0x20) <= 'z') &&
+		(':' == *(Name + 1)) && ('\0' == *(Name + 2)))
+	{
+		Status = _OpenDriveLetter(*Name, ReadOnly, Handle, OpenedReadonly);
+	}
+	else
+	{
+		//
+		// Make name
+		//
+
+		Name = _NormalizeDeviceName(Name, NormalizedDeviceName);
+
+		if(NULL == Name)
+		{
+			//
+			// Set not found
+			//
+
+			if(ARGUMENT_PRESENT(Errno))
+				*Errno = ENOENT;
+
+			return FALSE;
+		}
+
+		//
+		// Try to open it
+		//
+
+		Status = _OpenNtName(Name, ReadOnly, Handle, OpenedReadonly);
+	}
+
+
+	if(!NT_SUCCESS(Status))
+	{
+		if(ARGUMENT_PRESENT(Errno))
+			*Errno = _MapNtStatus(Status);
+
+		return FALSE;
+	}
+
+	return TRUE;
+}
+
+
+//
+// Raw block io. Sets dos errno
+//
+
+static
+BOOLEAN
+_BlockIo(
+    IN HANDLE Handle,
+    IN LARGE_INTEGER Offset,
+    IN ULONG Bytes,
+    IN OUT PCHAR Buffer,
+    IN BOOLEAN Read,
+    OUT unsigned* Errno
+   )
+{
+	IO_STATUS_BLOCK IoStatusBlock;
+	NTSTATUS Status;
+
+	//
+	// Should be aligned
+	//
+
+	ASSERT(0 == (Bytes % 512));
+	ASSERT(0 == (Offset.LowPart % 512));
+
+
+	//
+	// perform io
+	//
+
+	if(Read)
+	{
+		Status = NtReadFile(Handle, NULL, NULL, NULL,
+			&IoStatusBlock, Buffer, Bytes, &Offset, NULL);
+	}
+	else
+	{
+		Status = NtWriteFile(Handle, NULL, NULL, NULL,
+			&IoStatusBlock, Buffer, Bytes, &Offset, NULL);
+	}
+
+
+	//
+	// translate error
+	//
+
+	if(NT_SUCCESS(Status))
+	{
+		*Errno = 0;
+		return TRUE;
+	}
+
+	*Errno = _MapNtStatus(Status);
+
+	return FALSE;
+}
+
+
+
+__inline
+BOOLEAN
+_RawWrite(
+    IN HANDLE Handle,
+    IN LARGE_INTEGER Offset,
+    IN ULONG Bytes,
+    OUT const CHAR* Buffer,
+    OUT unsigned* Errno
+   )
+{
+	return _BlockIo(Handle, Offset, Bytes, (PCHAR)Buffer, FALSE, Errno);
+}
+
+__inline
+BOOLEAN
+_RawRead(
+    IN HANDLE Handle,
+    IN LARGE_INTEGER Offset,
+    IN ULONG Bytes,
+    IN PCHAR Buffer,
+    OUT unsigned* Errno
+   )
+{
+	return _BlockIo(Handle, Offset, Bytes, Buffer, TRUE, Errno);
+}
+
+
+
+__inline
+BOOLEAN
+_SetPartType(
+    IN HANDLE Handle,
+    IN UCHAR Type
+   )
+{
+	IO_STATUS_BLOCK IoStatusBlock;
+	return STATUS_SUCCESS == NtDeviceIoControlFile(
+												   Handle, NULL, NULL, NULL, &IoStatusBlock, IOCTL_DISK_SET_PARTITION_INFO,
+												   &Type, sizeof(Type),
+												   NULL, 0);
+}
+
+
+
+//--------------------- interface part
+
+//
+// Interface functions.
+// Is_mounted is set to 1 if the device is mounted, 0 otherwise
+//
+
+errcode_t
+ext2fs_check_if_mounted(const char *file, int *mount_flags)
+{
+	HANDLE h;
+	BOOLEAN Readonly;
+
+	*mount_flags = 0;
+
+	if(!_Ext2OpenDevice(file, TRUE, &h, &Readonly, NULL))
+	{
+		return 0;
+	}
+
+
+	__try{
+		*mount_flags &= _IsMounted(h) ? EXT2_MF_MOUNTED : 0;
+	}
+	__finally{
+		_CloseDisk(h);
+	}
+
+	return 0;
+}
+
+
+
+//
+// Returns the number of blocks in a partition
+//
+
+static __int64 FsSize = 0;
+static char knowndevice[1024] = "";
+
+
+errcode_t
+ext2fs_get_device_size(const char *file, int blocksize,
+				 blk_t *retblocks)
+{
+	HANDLE h;
+	BOOLEAN Readonly;
+
+	if((0 == FsSize) || (0 != strcmp(knowndevice, file)))
+	{
+
+		if(!_Ext2OpenDevice(file, TRUE, &h, &Readonly, NULL))
+		{
+			return 0;
+		}
+
+
+		__try{
+
+			//
+			// Get size
+			//
+
+			_GetDeviceSize(h, &FsSize);
+			strcpy(knowndevice, file);
+		}
+		__finally{
+			_CloseDisk(h);
+		}
+
+	}
+
+	*retblocks = (blk_t)(unsigned __int64)(FsSize / blocksize);
+	UNREFERENCED_PARAMETER(file);
+	return 0;
+}
+
+
+
+
+
+
+//
+// Table elements
+//
+
+
+static
+errcode_t
+nt_open(const char *name, int flags, io_channel *channel)
+{
+	io_channel      io = NULL;
+	PNT_PRIVATE_DATA NtData = NULL;
+	errcode_t Errno = 0;
+
+	//
+	// Check name
+	//
+
+	if (NULL == name)
+	{
+		return EXT2_ET_BAD_DEVICE_NAME;
+	}
+
+	__try{
+
+		//
+		// Allocate channel handle
+		//
+
+		io = (io_channel) malloc(sizeof(struct struct_io_channel));
+
+		if (NULL == io)
+		{
+			Errno = ENOMEM;
+			__leave;
+		}
+
+		RtlZeroMemory(io, sizeof(struct struct_io_channel));
+		io->magic = EXT2_ET_MAGIC_IO_CHANNEL;
+
+		NtData = (PNT_PRIVATE_DATA)malloc(sizeof(NT_PRIVATE_DATA));
+
+		if (NULL == NtData)
+		{
+			Errno = ENOMEM;
+			__leave;
+		}
+
+
+		io->manager = nt_io_manager();
+		io->name = malloc(strlen(name) + 1);
+		if (NULL == io->name)
+		{
+			Errno = ENOMEM;
+			__leave;
+		}
+
+		strcpy(io->name, name);
+		io->private_data = NtData;
+		io->block_size = 1024;
+		io->read_error = 0;
+		io->write_error = 0;
+		io->refcount = 1;
+
+		//
+		// Initialize data
+		//
+
+		RtlZeroMemory(NtData, sizeof(NT_PRIVATE_DATA));
+
+		NtData->magic = EXT2_ET_MAGIC_NT_IO_CHANNEL;
+		NtData->BufferBlockNumber = 0xffffffff;
+		NtData->BufferSize = 1024;
+		NtData->Buffer = malloc(NtData->BufferSize);
+
+		if (NULL == NtData->Buffer)
+		{
+			Errno = ENOMEM;
+			__leave;
+		}
+
+		//
+		// Open it
+		//
+
+		if(!_Ext2OpenDevice(name, (BOOLEAN)!BooleanFlagOn(flags, EXT2_FLAG_RW), &NtData->Handle, &NtData->OpenedReadonly, &Errno))
+		{
+			__leave;
+		}
+
+
+		//
+		// get size
+		//
+
+		_GetDeviceSize(NtData->Handle, &FsSize);
+		strcpy(knowndevice, name);
+
+
+		//
+		// Lock/dismount
+		//
+
+		if(!NT_SUCCESS(_LockDrive(NtData->Handle)) /*|| !NT_SUCCESS(_DismountDrive(NtData->Handle))*/)
+		{
+			NtData->OpenedReadonly = TRUE;
+		}
+
+		//
+		// Done
+		//
+
+		*channel = io;
+
+
+	}
+	__finally{
+
+		if(0 != Errno)
+		{
+			//
+			// Cleanup
+			//
+
+			if (NULL != io)
+			{
+				free(io->name);
+				free(io);
+			}
+
+			if (NULL != NtData)
+			{
+				if(NULL != NtData->Handle)
+				{
+					_UnlockDrive(NtData->Handle);
+					_CloseDisk(NtData->Handle);
+				}
+
+				free(NtData->Buffer);
+				free(NtData);
+			}
+		}
+	}
+
+	return Errno;
+}
+
+
+//
+// Close api
+//
+
+static
+errcode_t
+nt_close(io_channel channel)
+{
+	PNT_PRIVATE_DATA NtData = NULL;
+
+	if(NULL == channel)
+	{
+		return 0;
+	}
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	NtData = (PNT_PRIVATE_DATA) channel->private_data;
+	EXT2_CHECK_MAGIC(NtData, EXT2_ET_MAGIC_NT_IO_CHANNEL);
+
+	if (--channel->refcount > 0)
+	{
+		return 0;
+	}
+
+	free(channel->name);
+	free(channel);
+
+	if (NULL != NtData)
+	{
+		if(NULL != NtData->Handle)
+		{
+			_DismountDrive(NtData->Handle);
+			_UnlockDrive(NtData->Handle);
+			_CloseDisk(NtData->Handle);
+		}
+
+		free(NtData->Buffer);
+		free(NtData);
+	}
+
+	return 0;
+}
+
+
+
+//
+// set block size
+//
+
+static
+errcode_t
+nt_set_blksize(io_channel channel, int blksize)
+{
+	PNT_PRIVATE_DATA NtData = NULL;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	NtData = (PNT_PRIVATE_DATA) channel->private_data;
+	EXT2_CHECK_MAGIC(NtData, EXT2_ET_MAGIC_NT_IO_CHANNEL);
+
+	if (channel->block_size != blksize)
+	{
+		channel->block_size = blksize;
+
+		free(NtData->Buffer);
+		NtData->BufferBlockNumber = 0xffffffff;
+		NtData->BufferSize = channel->block_size;
+		ASSERT(0 == (NtData->BufferSize % 512));
+
+		NtData->Buffer = malloc(NtData->BufferSize);
+
+		if (NULL == NtData->Buffer)
+		{
+			return ENOMEM;
+		}
+
+	}
+
+	return 0;
+}
+
+
+//
+// read block
+//
+
+static
+errcode_t
+nt_read_blk(io_channel channel, unsigned long block,
+			       int count, void *buf)
+{
+	PVOID BufferToRead;
+	ULONG SizeToRead;
+	ULONG Size;
+	LARGE_INTEGER Offset;
+	PNT_PRIVATE_DATA NtData = NULL;
+	unsigned Errno = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	NtData = (PNT_PRIVATE_DATA) channel->private_data;
+	EXT2_CHECK_MAGIC(NtData, EXT2_ET_MAGIC_NT_IO_CHANNEL);
+
+	//
+	// If it's in the cache, use it!
+	//
+
+	if ((1 == count) &&
+		(block == NtData->BufferBlockNumber) &&
+		(NtData->BufferBlockNumber != 0xffffffff))
+	{
+		memcpy(buf, NtData->Buffer, channel->block_size);
+		return 0;
+	}
+
+	Size = (count < 0) ? (ULONG)(-count) : (ULONG)(count * channel->block_size);
+
+	Offset.QuadPart = block * channel->block_size;
+
+	//
+	// If not fit to the block
+	//
+
+	if(Size <= NtData->BufferSize)
+	{
+		//
+		// Update the cache
+		//
+
+		NtData->BufferBlockNumber = block;
+		BufferToRead = NtData->Buffer;
+		SizeToRead = NtData->BufferSize;
+	}
+	else
+	{
+		SizeToRead = Size;
+		BufferToRead = buf;
+		ASSERT(0 == (SizeToRead % channel->block_size));
+	}
+
+	if(!_RawRead(NtData->Handle, Offset, SizeToRead, BufferToRead, &Errno))
+	{
+
+		if (channel->read_error)
+		{
+			return (channel->read_error)(channel, block, count, buf,
+					       Size, 0, Errno);
+		}
+		else
+		{
+			return Errno;
+		}
+	}
+
+
+	if(BufferToRead != buf)
+	{
+		ASSERT(Size <= SizeToRead);
+		memcpy(buf, BufferToRead, Size);
+	}
+
+	return 0;
+}
+
+
+//
+// write block
+//
+
+static
+errcode_t
+nt_write_blk(io_channel channel, unsigned long block,
+				int count, const void *buf)
+{
+	ULONG SizeToWrite;
+	LARGE_INTEGER Offset;
+	PNT_PRIVATE_DATA NtData = NULL;
+	unsigned Errno = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	NtData = (PNT_PRIVATE_DATA) channel->private_data;
+	EXT2_CHECK_MAGIC(NtData, EXT2_ET_MAGIC_NT_IO_CHANNEL);
+
+	if(NtData->OpenedReadonly)
+	{
+		return EACCES;
+	}
+
+	if (count == 1)
+	{
+		SizeToWrite = channel->block_size;
+	}
+	else
+	{
+		NtData->BufferBlockNumber = 0xffffffff;
+
+		if (count < 0)
+		{
+			SizeToWrite = (ULONG)(-count);
+		}
+		else
+		{
+			SizeToWrite = (ULONG)(count * channel->block_size);
+		}
+	}
+
+
+	ASSERT(0 == (SizeToWrite % 512));
+	Offset.QuadPart = block * channel->block_size;
+
+	if(!_RawWrite(NtData->Handle, Offset, SizeToWrite, buf, &Errno))
+	{
+		if (channel->write_error)
+		{
+			return (channel->write_error)(channel, block, count, buf,
+						SizeToWrite, 0, Errno);
+		}
+		else
+		{
+			return Errno;
+		}
+	}
+
+
+	//
+	// Stash a copy.
+	//
+
+	if(SizeToWrite >= NtData->BufferSize)
+	{
+		NtData->BufferBlockNumber = block;
+		memcpy(NtData->Buffer, buf, NtData->BufferSize);
+	}
+
+	NtData->Written = TRUE;
+
+	return 0;
+
+}
+
+
+
+//
+// Flush data buffers to disk.  Since we are currently using a
+// write-through cache, this is a no-op.
+//
+
+static
+errcode_t
+nt_flush(io_channel channel)
+{
+	PNT_PRIVATE_DATA NtData = NULL;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	NtData = (PNT_PRIVATE_DATA) channel->private_data;
+	EXT2_CHECK_MAGIC(NtData, EXT2_ET_MAGIC_NT_IO_CHANNEL);
+
+	if(NtData->OpenedReadonly)
+	{
+		return 0; // EACCESS;
+	}
+
+
+	//
+	// Flush file buffers.
+	//
+
+	_FlushDrive(NtData->Handle);
+
+
+	//
+	// Test and correct partition type.
+	//
+
+	if(NtData->Written)
+	{
+		_SetPartType(NtData->Handle, 0x83);
+	}
+
+	return 0;
+}
+
+
diff --git a/lib/ext2fs/openfs.c b/lib/ext2fs/openfs.c
new file mode 100644
index 0000000..fd56a9a
--- /dev/null
+++ b/lib/ext2fs/openfs.c
@@ -0,0 +1,590 @@
+/*
+ * openfs.c --- open an ext2 filesystem
+ *
+ * Copyright (C) 1993, 1994, 1995, 1996 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+#ifdef HAVE_ERRNO_H
+#include <errno.h>
+#endif
+
+#include "ext2_fs.h"
+
+#include "ext2fs.h"
+#include "e2image.h"
+
+blk64_t ext2fs_descriptor_block_loc2(ext2_filsys fs, blk64_t group_block,
+				     dgrp_t i)
+{
+	int	bg;
+	int	has_super = 0, group_zero_adjust = 0;
+	blk64_t	ret_blk;
+
+	/*
+	 * On a bigalloc FS with 1K blocks, block 0 is reserved for non-ext4
+	 * stuff, so adjust for that if we're being asked for group 0.
+	 */
+	if (i == 0 && fs->blocksize == 1024 && EXT2FS_CLUSTER_RATIO(fs) > 1)
+		group_zero_adjust = 1;
+
+	if (!ext2fs_has_feature_meta_bg(fs->super) ||
+	    (i < fs->super->s_first_meta_bg))
+		return group_block + i + 1 + group_zero_adjust;
+
+	bg = EXT2_DESC_PER_BLOCK(fs->super) * i;
+	if (ext2fs_bg_has_super(fs, bg))
+		has_super = 1;
+	ret_blk = ext2fs_group_first_block2(fs, bg);
+	/*
+	 * If group_block is not the normal value, we're trying to use
+	 * the backup group descriptors and superblock --- so use the
+	 * alternate location of the second block group in the
+	 * metablock group.  Ideally we should be testing each bg
+	 * descriptor block individually for correctness, but we don't
+	 * have the infrastructure in place to do that.
+	 */
+	if (group_block != fs->super->s_first_data_block &&
+	    ((ret_blk + has_super + fs->super->s_blocks_per_group) <
+	     ext2fs_blocks_count(fs->super))) {
+		ret_blk += fs->super->s_blocks_per_group;
+
+		/*
+		 * If we're going to jump forward a block group, make sure
+		 * that we adjust has_super to account for the next group's
+		 * backup superblock (or lack thereof).
+		 */
+		if (ext2fs_bg_has_super(fs, bg + 1))
+			has_super = 1;
+		else
+			has_super = 0;
+	}
+	return ret_blk + has_super + group_zero_adjust;
+}
+
+blk_t ext2fs_descriptor_block_loc(ext2_filsys fs, blk_t group_block, dgrp_t i)
+{
+	return ext2fs_descriptor_block_loc2(fs, group_block, i);
+}
+
+errcode_t ext2fs_open(const char *name, int flags, int superblock,
+		      unsigned int block_size, io_manager manager,
+		      ext2_filsys *ret_fs)
+{
+	return ext2fs_open2(name, 0, flags, superblock, block_size,
+			    manager, ret_fs);
+}
+
+static void block_sha_map_free_entry(void *data)
+{
+	free(data);
+	return;
+}
+
+/*
+ *  Note: if superblock is non-zero, block-size must also be non-zero.
+ * 	Superblock and block_size can be zero to use the default size.
+ *
+ * Valid flags for ext2fs_open()
+ *
+ * 	EXT2_FLAG_RW	- Open the filesystem for read/write.
+ * 	EXT2_FLAG_FORCE - Open the filesystem even if some of the
+ *				features aren't supported.
+ *	EXT2_FLAG_JOURNAL_DEV_OK - Open an ext3 journal device
+ *	EXT2_FLAG_SKIP_MMP - Open without multi-mount protection check.
+ *	EXT2_FLAG_64BITS - Allow 64-bit bitfields (needed for large
+ *				filesystems)
+ */
+errcode_t ext2fs_open2(const char *name, const char *io_options,
+		       int flags, int superblock,
+		       unsigned int block_size, io_manager manager,
+		       ext2_filsys *ret_fs)
+{
+	ext2_filsys	fs;
+	errcode_t	retval;
+	unsigned long	i, first_meta_bg;
+	__u32		features;
+	unsigned int	blocks_per_group, io_flags;
+	blk64_t		group_block, blk;
+	char		*dest, *cp;
+	int		group_zero_adjust = 0;
+	unsigned int	inode_size;
+	__u64		groups_cnt;
+#ifdef WORDS_BIGENDIAN
+	unsigned int	groups_per_block;
+	struct ext2_group_desc *gdp;
+	int		j;
+#endif
+	char		*time_env;
+	int		csum_retries = 0;
+
+	EXT2_CHECK_MAGIC(manager, EXT2_ET_MAGIC_IO_MANAGER);
+
+	retval = ext2fs_get_mem(sizeof(struct struct_ext2_filsys), &fs);
+	if (retval)
+		return retval;
+
+	memset(fs, 0, sizeof(struct struct_ext2_filsys));
+	fs->magic = EXT2_ET_MAGIC_EXT2FS_FILSYS;
+	fs->flags = flags;
+	/* don't overwrite sb backups unless flag is explicitly cleared */
+	fs->flags |= EXT2_FLAG_MASTER_SB_ONLY;
+	fs->umask = 022;
+
+	time_env = getenv("E2FSPROGS_FAKE_TIME");
+	if (time_env)
+		fs->now = strtoul(time_env, NULL, 0);
+
+	retval = ext2fs_get_mem(strlen(name)+1, &fs->device_name);
+	if (retval)
+		goto cleanup;
+	strcpy(fs->device_name, name);
+	cp = strchr(fs->device_name, '?');
+	if (!io_options && cp) {
+		*cp++ = 0;
+		io_options = cp;
+	}
+
+	io_flags = 0;
+	if (flags & EXT2_FLAG_RW)
+		io_flags |= IO_FLAG_RW;
+	if (flags & EXT2_FLAG_EXCLUSIVE)
+		io_flags |= IO_FLAG_EXCLUSIVE;
+	if (flags & EXT2_FLAG_DIRECT_IO)
+		io_flags |= IO_FLAG_DIRECT_IO;
+	if (flags & EXT2_FLAG_THREADS)
+		io_flags |= IO_FLAG_THREADS;
+	retval = manager->open(fs->device_name, io_flags, &fs->io);
+	if (retval)
+		goto cleanup;
+	if (io_options &&
+	    (retval = io_channel_set_options(fs->io, io_options)))
+		goto cleanup;
+	fs->image_io = fs->io;
+	fs->io->app_data = fs;
+	retval = io_channel_alloc_buf(fs->io, -SUPERBLOCK_SIZE, &fs->super);
+	if (retval)
+		goto cleanup;
+	if (flags & EXT2_FLAG_IMAGE_FILE) {
+		retval = ext2fs_get_mem(sizeof(struct ext2_image_hdr),
+					&fs->image_header);
+		if (retval)
+			goto cleanup;
+		retval = io_channel_read_blk(fs->io, 0,
+					     -(int)sizeof(struct ext2_image_hdr),
+					     fs->image_header);
+		if (retval)
+			goto cleanup;
+		if (ext2fs_le32_to_cpu(fs->image_header->magic_number) != EXT2_ET_MAGIC_E2IMAGE)
+			return EXT2_ET_MAGIC_E2IMAGE;
+		superblock = 1;
+		block_size = ext2fs_le32_to_cpu(fs->image_header->fs_blocksize);
+	}
+
+	/*
+	 * If the user specifies a specific block # for the
+	 * superblock, then he/she must also specify the block size!
+	 * Otherwise, read the master superblock located at offset
+	 * SUPERBLOCK_OFFSET from the start of the partition.
+	 *
+	 * Note: we only save a backup copy of the superblock if we
+	 * are reading the superblock from the primary superblock location.
+	 */
+	if (superblock) {
+		if (!block_size) {
+			retval = EXT2_ET_INVALID_ARGUMENT;
+			goto cleanup;
+		}
+		io_channel_set_blksize(fs->io, block_size);
+		group_block = superblock;
+		fs->orig_super = 0;
+	} else {
+		io_channel_set_blksize(fs->io, SUPERBLOCK_OFFSET);
+		superblock = 1;
+		group_block = 0;
+		retval = ext2fs_get_mem(SUPERBLOCK_SIZE, &fs->orig_super);
+		if (retval)
+			goto cleanup;
+	}
+retry:
+	retval = io_channel_read_blk(fs->io, superblock, -SUPERBLOCK_SIZE,
+				     fs->super);
+	if (retval)
+		goto cleanup;
+	if (fs->orig_super)
+		memcpy(fs->orig_super, fs->super, SUPERBLOCK_SIZE);
+
+	if (!(fs->flags & EXT2_FLAG_IGNORE_CSUM_ERRORS)) {
+		retval = 0;
+		if (!ext2fs_verify_csum_type(fs, fs->super))
+			retval = EXT2_ET_UNKNOWN_CSUM;
+		if (!ext2fs_superblock_csum_verify(fs, fs->super)) {
+			if (csum_retries++ < 3)
+				goto retry;
+			retval = EXT2_ET_SB_CSUM_INVALID;
+		}
+	}
+
+#ifdef WORDS_BIGENDIAN
+	fs->flags |= EXT2_FLAG_SWAP_BYTES;
+	ext2fs_swap_super(fs->super);
+#else
+	if (fs->flags & EXT2_FLAG_SWAP_BYTES) {
+		retval = EXT2_ET_UNIMPLEMENTED;
+		goto cleanup;
+	}
+#endif
+
+	if (fs->super->s_magic != EXT2_SUPER_MAGIC)
+		retval = EXT2_ET_BAD_MAGIC;
+	if (retval)
+		goto cleanup;
+
+	if (fs->super->s_rev_level > EXT2_LIB_CURRENT_REV) {
+		retval = EXT2_ET_REV_TOO_HIGH;
+		goto cleanup;
+	}
+
+	/*
+	 * Check for feature set incompatibility
+	 */
+	if (!(flags & EXT2_FLAG_FORCE)) {
+		features = fs->super->s_feature_incompat;
+#ifdef EXT2_LIB_SOFTSUPP_INCOMPAT
+		if (flags & EXT2_FLAG_SOFTSUPP_FEATURES)
+			features &= ~EXT2_LIB_SOFTSUPP_INCOMPAT;
+#endif
+		if (features & ~EXT2_LIB_FEATURE_INCOMPAT_SUPP) {
+			retval = EXT2_ET_UNSUPP_FEATURE;
+			goto cleanup;
+		}
+
+		features = fs->super->s_feature_ro_compat;
+#ifdef EXT2_LIB_SOFTSUPP_RO_COMPAT
+		if (flags & EXT2_FLAG_SOFTSUPP_FEATURES)
+			features &= ~EXT2_LIB_SOFTSUPP_RO_COMPAT;
+#endif
+		if ((flags & EXT2_FLAG_RW) &&
+		    (features & ~EXT2_LIB_FEATURE_RO_COMPAT_SUPP)) {
+			retval = EXT2_ET_RO_UNSUPP_FEATURE;
+			goto cleanup;
+		}
+
+		if (!(flags & EXT2_FLAG_JOURNAL_DEV_OK) &&
+		    ext2fs_has_feature_journal_dev(fs->super)) {
+			retval = EXT2_ET_UNSUPP_FEATURE;
+			goto cleanup;
+		}
+	}
+
+	if ((fs->super->s_log_block_size >
+	     (unsigned) (EXT2_MAX_BLOCK_LOG_SIZE - EXT2_MIN_BLOCK_LOG_SIZE)) ||
+	    (fs->super->s_log_cluster_size >
+	     (unsigned) (EXT2_MAX_CLUSTER_LOG_SIZE - EXT2_MIN_CLUSTER_LOG_SIZE)) ||
+	    (fs->super->s_log_block_size > fs->super->s_log_cluster_size) ||
+	    (fs->super->s_log_groups_per_flex > 31)) {
+		retval = EXT2_ET_CORRUPT_SUPERBLOCK;
+		goto cleanup;
+	}
+
+	/*
+	 * bigalloc requires cluster-aware bitfield operations, which at the
+	 * moment means we need EXT2_FLAG_64BITS.
+	 */
+	if (ext2fs_has_feature_bigalloc(fs->super) &&
+	    !(flags & EXT2_FLAG_64BITS)) {
+		retval = EXT2_ET_CANT_USE_LEGACY_BITMAPS;
+		goto cleanup;
+	}
+
+	if (!ext2fs_has_feature_bigalloc(fs->super) &&
+	    (fs->super->s_log_block_size != fs->super->s_log_cluster_size)) {
+		retval = EXT2_ET_CORRUPT_SUPERBLOCK;
+		goto cleanup;
+	}
+	fs->fragsize = fs->blocksize = EXT2_BLOCK_SIZE(fs->super);
+	inode_size = EXT2_INODE_SIZE(fs->super);
+	if ((inode_size < EXT2_GOOD_OLD_INODE_SIZE) ||
+	    (inode_size > fs->blocksize) ||
+	    (inode_size & (inode_size - 1))) {
+		retval = EXT2_ET_CORRUPT_SUPERBLOCK;
+		goto cleanup;
+	}
+
+	/* Enforce the block group descriptor size */
+	if (!(flags & EXT2_FLAG_IGNORE_SB_ERRORS) &&
+	    ext2fs_has_feature_64bit(fs->super)) {
+		unsigned desc_size = fs->super->s_desc_size;
+
+		if ((desc_size < EXT2_MIN_DESC_SIZE_64BIT) ||
+		    (desc_size > EXT2_MAX_DESC_SIZE) ||
+		    (desc_size & (desc_size - 1)) != 0) {
+			retval = EXT2_ET_BAD_DESC_SIZE;
+			goto cleanup;
+		}
+	}
+
+	fs->cluster_ratio_bits = fs->super->s_log_cluster_size -
+		fs->super->s_log_block_size;
+	if (EXT2_BLOCKS_PER_GROUP(fs->super) !=
+	    EXT2_CLUSTERS_PER_GROUP(fs->super) << fs->cluster_ratio_bits) {
+		retval = EXT2_ET_CORRUPT_SUPERBLOCK;
+		goto cleanup;
+	}
+	fs->inode_blocks_per_group = ((EXT2_INODES_PER_GROUP(fs->super) *
+				       EXT2_INODE_SIZE(fs->super) +
+				       EXT2_BLOCK_SIZE(fs->super) - 1) /
+				      EXT2_BLOCK_SIZE(fs->super));
+	if (block_size) {
+		if (block_size != fs->blocksize) {
+			retval = EXT2_ET_UNEXPECTED_BLOCK_SIZE;
+			goto cleanup;
+		}
+	}
+	/*
+	 * Set the blocksize to the filesystem's blocksize.
+	 */
+	io_channel_set_blksize(fs->io, fs->blocksize);
+
+	/*
+	 * If this is an external journal device, don't try to read
+	 * the group descriptors, because they're not there.
+	 */
+	if (ext2fs_has_feature_journal_dev(fs->super)) {
+		fs->group_desc_count = 0;
+		*ret_fs = fs;
+		return 0;
+	}
+
+	if (EXT2_INODES_PER_GROUP(fs->super) == 0) {
+		retval = EXT2_ET_CORRUPT_SUPERBLOCK;
+		goto cleanup;
+	}
+	/* Precompute the FS UUID to seed other checksums */
+	ext2fs_init_csum_seed(fs);
+
+	/*
+	 * Read group descriptors
+	 */
+	blocks_per_group = EXT2_BLOCKS_PER_GROUP(fs->super);
+	if (blocks_per_group < 8 ||
+	    blocks_per_group > EXT2_MAX_BLOCKS_PER_GROUP(fs->super) ||
+	    fs->inode_blocks_per_group > EXT2_MAX_INODES_PER_GROUP(fs->super) ||
+           EXT2_DESC_PER_BLOCK(fs->super) == 0 ||
+           fs->super->s_first_data_block >= ext2fs_blocks_count(fs->super)) {
+		retval = EXT2_ET_CORRUPT_SUPERBLOCK;
+		goto cleanup;
+	}
+	groups_cnt = ext2fs_div64_ceil(ext2fs_blocks_count(fs->super) -
+				       fs->super->s_first_data_block,
+				       blocks_per_group);
+	if (groups_cnt >> 32) {
+		retval = EXT2_ET_CORRUPT_SUPERBLOCK;
+		goto cleanup;
+	}
+	fs->group_desc_count = 	groups_cnt;
+	if (!(flags & EXT2_FLAG_IGNORE_SB_ERRORS) &&
+	    (__u64)fs->group_desc_count * EXT2_INODES_PER_GROUP(fs->super) !=
+	    fs->super->s_inodes_count) {
+		retval = EXT2_ET_CORRUPT_SUPERBLOCK;
+		goto cleanup;
+	}
+	fs->desc_blocks = ext2fs_div_ceil(fs->group_desc_count,
+					  EXT2_DESC_PER_BLOCK(fs->super));
+	if (ext2fs_has_feature_meta_bg(fs->super) &&
+	    (fs->super->s_first_meta_bg > fs->desc_blocks) &&
+	    !(flags & EXT2_FLAG_IGNORE_SB_ERRORS)) {
+		retval = EXT2_ET_CORRUPT_SUPERBLOCK;
+		goto cleanup;
+	}
+	if (flags & EXT2_FLAG_SUPER_ONLY)
+		goto skip_read_bg;
+	retval = ext2fs_get_array(fs->desc_blocks, fs->blocksize,
+				&fs->group_desc);
+	if (retval)
+		goto cleanup;
+	if (!group_block)
+		group_block = fs->super->s_first_data_block;
+	/*
+	 * On a FS with a 1K blocksize, block 0 is reserved for bootloaders
+	 * so we must increment block numbers to any group 0 items.
+	 *
+	 * However, we cannot touch group_block directly because in the meta_bg
+	 * case, the ext2fs_descriptor_block_loc2() function will interpret
+	 * group_block != s_first_data_block to mean that we want to access the
+	 * backup group descriptors.  This is not what we want if the caller
+	 * set superblock == 0 (i.e. auto-detect the superblock), which is
+	 * what's going on here.
+	 */
+	if (group_block == 0 && fs->blocksize == 1024)
+		group_zero_adjust = 1;
+	dest = (char *) fs->group_desc;
+#ifdef WORDS_BIGENDIAN
+	groups_per_block = EXT2_DESC_PER_BLOCK(fs->super);
+#endif
+	if (ext2fs_has_feature_meta_bg(fs->super) &&
+	    !(flags & EXT2_FLAG_IMAGE_FILE)) {
+		first_meta_bg = fs->super->s_first_meta_bg;
+		if (first_meta_bg > fs->desc_blocks)
+			first_meta_bg = fs->desc_blocks;
+	} else
+		first_meta_bg = fs->desc_blocks;
+	if (first_meta_bg) {
+		retval = io_channel_read_blk(fs->io, group_block +
+					     group_zero_adjust + 1,
+					     first_meta_bg, dest);
+		if (retval)
+			goto cleanup;
+#ifdef WORDS_BIGENDIAN
+		gdp = (struct ext2_group_desc *) dest;
+		for (j=0; j < groups_per_block*first_meta_bg; j++) {
+			gdp = ext2fs_group_desc(fs, fs->group_desc, j);
+			if (gdp)
+				ext2fs_swap_group_desc2(fs, gdp);
+		}
+#endif
+		dest += fs->blocksize*first_meta_bg;
+	}
+
+	for (i = first_meta_bg ; i < fs->desc_blocks; i++) {
+		blk = ext2fs_descriptor_block_loc2(fs, group_block, i);
+		io_channel_cache_readahead(fs->io, blk, 1);
+	}
+
+	for (i=first_meta_bg ; i < fs->desc_blocks; i++) {
+		blk = ext2fs_descriptor_block_loc2(fs, group_block, i);
+		retval = io_channel_read_blk64(fs->io, blk, 1, dest);
+		if (retval)
+			goto cleanup;
+#ifdef WORDS_BIGENDIAN
+		for (j=0; j < groups_per_block; j++) {
+			gdp = ext2fs_group_desc(fs, fs->group_desc,
+						i * groups_per_block + j);
+			if (gdp)
+				ext2fs_swap_group_desc2(fs, gdp);
+		}
+#endif
+		dest += fs->blocksize;
+	}
+
+	fs->stride = fs->super->s_raid_stride;
+
+	/*
+	 * If recovery is from backup superblock, Clear _UNININT flags &
+	 * reset bg_itable_unused to zero
+	 */
+	if (superblock > 1 && ext2fs_has_group_desc_csum(fs)) {
+		dgrp_t group;
+
+		for (group = 0; group < fs->group_desc_count; group++) {
+			ext2fs_bg_flags_clear(fs, group, EXT2_BG_BLOCK_UNINIT);
+			ext2fs_bg_flags_clear(fs, group, EXT2_BG_INODE_UNINIT);
+			ext2fs_bg_itable_unused_set(fs, group, 0);
+			/* The checksum will be reset later, but fix it here
+			 * anyway to avoid printing a lot of spurious errors. */
+			ext2fs_group_desc_csum_set(fs, group);
+		}
+		if (fs->flags & EXT2_FLAG_RW)
+			ext2fs_mark_super_dirty(fs);
+	}
+skip_read_bg:
+	if (ext2fs_has_feature_mmp(fs->super) &&
+	    !(flags & EXT2_FLAG_SKIP_MMP) &&
+	    (flags & (EXT2_FLAG_RW | EXT2_FLAG_EXCLUSIVE))) {
+		retval = ext2fs_mmp_start(fs);
+		if (retval) {
+			fs->flags |= EXT2_FLAG_SKIP_MMP; /* just do cleanup */
+			ext2fs_mmp_stop(fs);
+			goto cleanup;
+		}
+	}
+
+	if (fs->flags & EXT2_FLAG_SHARE_DUP) {
+		fs->block_sha_map = ext2fs_hashmap_create(ext2fs_djb2_hash,
+					block_sha_map_free_entry, 4096);
+		if (!fs->block_sha_map) {
+			retval = EXT2_ET_NO_MEMORY;
+			goto cleanup;
+		}
+		ext2fs_set_feature_shared_blocks(fs->super);
+	}
+
+	if (ext2fs_has_feature_casefold(fs->super))
+		fs->encoding = ext2fs_load_nls_table(fs->super->s_encoding);
+
+	fs->flags &= ~EXT2_FLAG_NOFREE_ON_ERROR;
+	*ret_fs = fs;
+
+	return 0;
+cleanup:
+	if (!(flags & EXT2_FLAG_NOFREE_ON_ERROR)) {
+		ext2fs_free(fs);
+		fs = NULL;
+	}
+	*ret_fs = fs;
+	return retval;
+}
+
+/*
+ * Set/get the filesystem data I/O channel.
+ *
+ * These functions are only valid if EXT2_FLAG_IMAGE_FILE is true.
+ */
+errcode_t ext2fs_get_data_io(ext2_filsys fs, io_channel *old_io)
+{
+	if ((fs->flags & EXT2_FLAG_IMAGE_FILE) == 0)
+		return EXT2_ET_NOT_IMAGE_FILE;
+	if (old_io) {
+		*old_io = (fs->image_io == fs->io) ? 0 : fs->io;
+	}
+	return 0;
+}
+
+errcode_t ext2fs_set_data_io(ext2_filsys fs, io_channel new_io)
+{
+	if ((fs->flags & EXT2_FLAG_IMAGE_FILE) == 0)
+		return EXT2_ET_NOT_IMAGE_FILE;
+	fs->io = new_io ? new_io : fs->image_io;
+	return 0;
+}
+
+errcode_t ext2fs_rewrite_to_io(ext2_filsys fs, io_channel new_io)
+{
+	errcode_t err;
+
+	if ((fs->flags & EXT2_FLAG_IMAGE_FILE) == 0)
+		return EXT2_ET_NOT_IMAGE_FILE;
+	err = io_channel_set_blksize(new_io, fs->blocksize);
+	if (err)
+		return err;
+	if ((new_io == fs->image_io) || (new_io == fs->io))
+		return 0;
+	if ((fs->image_io != fs->io) &&
+	    fs->image_io)
+		io_channel_close(fs->image_io);
+	if (fs->io)
+		io_channel_close(fs->io);
+	fs->io = fs->image_io = new_io;
+	fs->flags |= EXT2_FLAG_DIRTY | EXT2_FLAG_RW |
+		EXT2_FLAG_BB_DIRTY | EXT2_FLAG_IB_DIRTY;
+	fs->flags &= ~EXT2_FLAG_IMAGE_FILE;
+	return 0;
+}
diff --git a/lib/ext2fs/orphan.c b/lib/ext2fs/orphan.c
new file mode 100644
index 0000000..e25f20c
--- /dev/null
+++ b/lib/ext2fs/orphan.c
@@ -0,0 +1,273 @@
+/*
+ * orphan.c --- utility function to handle orphan file
+ *
+ * Copyright (C) 2015 Jan Kara.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <string.h>
+
+#include "ext2_fs.h"
+#include "ext2fsP.h"
+
+errcode_t ext2fs_truncate_orphan_file(ext2_filsys fs)
+{
+	struct ext2_inode inode;
+	errcode_t err;
+	ext2_ino_t ino = fs->super->s_orphan_file_inum;
+
+	err = ext2fs_read_inode(fs, ino, &inode);
+	if (err)
+		return err;
+
+	err = ext2fs_punch(fs, ino, &inode, NULL, 0, ~0ULL);
+	if (err)
+		return err;
+
+	fs->flags &= ~EXT2_FLAG_SUPER_ONLY;
+	memset(&inode, 0, sizeof(struct ext2_inode));
+	err = ext2fs_write_inode(fs, ino, &inode);
+
+	ext2fs_clear_feature_orphan_file(fs->super);
+	ext2fs_clear_feature_orphan_present(fs->super);
+	ext2fs_mark_super_dirty(fs);
+	/* Need to update group descriptors as well */
+	fs->flags &= ~EXT2_FLAG_SUPER_ONLY;
+
+	return err;
+}
+
+__u32 ext2fs_do_orphan_file_block_csum(ext2_filsys fs, ext2_ino_t ino,
+				       __u32 gen, blk64_t blk, char *buf)
+{
+	int inodes_per_ob = ext2fs_inodes_per_orphan_block(fs);
+	__u32 crc;
+
+	ino = ext2fs_cpu_to_le32(ino);
+	gen = ext2fs_cpu_to_le32(gen);
+	blk = ext2fs_cpu_to_le64(blk);
+	crc = ext2fs_crc32c_le(fs->csum_seed, (unsigned char *)&ino,
+			       sizeof(ino));
+	crc = ext2fs_crc32c_le(crc, (unsigned char *)&gen, sizeof(gen));
+	crc = ext2fs_crc32c_le(crc, (unsigned char *)&blk, sizeof(blk));
+	crc = ext2fs_crc32c_le(crc, (unsigned char *)buf,
+				inodes_per_ob * sizeof(__u32));
+
+	return ext2fs_cpu_to_le32(crc);
+}
+
+struct mkorphan_info {
+	char *buf;
+	char *zerobuf;
+	blk_t num_blocks;
+	blk_t alloc_blocks;
+	blk64_t last_blk;
+	errcode_t err;
+	ext2_ino_t ino;
+	__u32 generation;
+};
+
+static int mkorphan_proc(ext2_filsys	fs,
+			 blk64_t	*blocknr,
+			 e2_blkcnt_t	blockcnt,
+			 blk64_t	ref_block EXT2FS_ATTR((unused)),
+			 int		ref_offset EXT2FS_ATTR((unused)),
+			 void		*priv_data)
+{
+	struct mkorphan_info *oi = (struct mkorphan_info *)priv_data;
+	blk64_t new_blk;
+	errcode_t err;
+
+	/* Can we just continue in currently allocated cluster? */
+	if (blockcnt &&
+	    EXT2FS_B2C(fs, oi->last_blk) == EXT2FS_B2C(fs, oi->last_blk + 1)) {
+		new_blk = oi->last_blk + 1;
+	} else {
+		err = ext2fs_new_block2(fs, oi->last_blk, 0, &new_blk);
+		if (err) {
+			oi->err = err;
+			return BLOCK_ABORT;
+		}
+		ext2fs_block_alloc_stats2(fs, new_blk, +1);
+		oi->alloc_blocks++;
+	}
+	if (blockcnt >= 0) {
+		if (ext2fs_has_feature_metadata_csum(fs->super)) {
+			struct ext4_orphan_block_tail *tail;
+
+			tail = ext2fs_orphan_block_tail(fs, oi->buf);
+			tail->ob_checksum = ext2fs_do_orphan_file_block_csum(fs,
+				oi->ino, oi->generation, new_blk, oi->buf);
+		}
+		err = io_channel_write_blk64(fs->io, new_blk, 1, oi->buf);
+	} else	/* zerobuf is used to initialize new indirect blocks... */
+		err = io_channel_write_blk64(fs->io, new_blk, 1, oi->zerobuf);
+	if (err) {
+		oi->err = err;
+		return BLOCK_ABORT;
+	}
+	oi->last_blk = new_blk;
+	*blocknr = new_blk;
+	if (blockcnt >= 0 && --oi->num_blocks == 0)
+		return BLOCK_CHANGED | BLOCK_ABORT;
+	return BLOCK_CHANGED;
+}
+
+errcode_t ext2fs_create_orphan_file(ext2_filsys fs, blk_t num_blocks)
+{
+	struct ext2_inode inode;
+	ext2_ino_t ino = fs->super->s_orphan_file_inum;
+	errcode_t err;
+	char *buf = NULL, *zerobuf = NULL;
+	struct mkorphan_info oi;
+	struct ext4_orphan_block_tail *ob_tail;
+
+	if (!ino) {
+		err = ext2fs_new_inode(fs, EXT2_ROOT_INO, LINUX_S_IFREG | 0600,
+				       0, &ino);
+		if (err)
+			return err;
+		ext2fs_inode_alloc_stats2(fs, ino, +1, 0);
+		ext2fs_mark_ib_dirty(fs);
+	}
+
+	err = ext2fs_read_inode(fs, ino, &inode);
+	if (err)
+		return err;
+	if (EXT2_I_SIZE(&inode)) {
+		err = ext2fs_truncate_orphan_file(fs);
+		if (err)
+			return err;
+	}
+
+	memset(&inode, 0, sizeof(struct ext2_inode));
+	if (ext2fs_has_feature_extents(fs->super)) {
+		inode.i_flags |= EXT4_EXTENTS_FL;
+		err = ext2fs_write_inode(fs, ino, &inode);
+		if (err)
+			return err;
+	}
+
+	err = ext2fs_get_mem(fs->blocksize, &buf);
+	if (err)
+		return err;
+	err = ext2fs_get_mem(fs->blocksize, &zerobuf);
+	if (err)
+		goto out;
+	memset(buf, 0, fs->blocksize);
+	memset(zerobuf, 0, fs->blocksize);
+	ob_tail = ext2fs_orphan_block_tail(fs, buf);
+	ob_tail->ob_magic = ext2fs_cpu_to_le32(EXT4_ORPHAN_BLOCK_MAGIC);
+	oi.num_blocks = num_blocks;
+	oi.alloc_blocks = 0;
+	oi.last_blk = 0;
+	oi.generation = inode.i_generation;
+	oi.ino = ino;
+	oi.buf = buf;
+	oi.zerobuf = zerobuf;
+	oi.err = 0;
+	err = ext2fs_block_iterate3(fs, ino, BLOCK_FLAG_APPEND,
+				    0, mkorphan_proc, &oi);
+	if (err)
+		goto out;
+	if (oi.err) {
+		err = oi.err;
+		goto out;
+	}
+
+	/* Reread inode after blocks were allocated */
+	err = ext2fs_read_inode(fs, ino, &inode);
+	if (err)
+		goto out;
+	ext2fs_iblk_set(fs, &inode, 0);
+	inode.i_atime = inode.i_mtime =
+		inode.i_ctime = fs->now ? fs->now : time(0);
+	inode.i_links_count = 1;
+	inode.i_mode = LINUX_S_IFREG | 0600;
+	ext2fs_iblk_add_blocks(fs, &inode, oi.alloc_blocks);
+	err = ext2fs_inode_size_set(fs, &inode,
+			(unsigned long long)fs->blocksize * num_blocks);
+	if (err)
+		goto out;
+	err = ext2fs_write_new_inode(fs, ino, &inode);
+	if (err)
+		goto out;
+
+	fs->super->s_orphan_file_inum = ino;
+	ext2fs_set_feature_orphan_file(fs->super);
+	ext2fs_mark_super_dirty(fs);
+	/* Need to update group descriptors as well */
+	fs->flags &= ~EXT2_FLAG_SUPER_ONLY;
+out:
+	if (buf)
+		ext2fs_free_mem(&buf);
+	if (zerobuf)
+		ext2fs_free_mem(&zerobuf);
+	return err;
+}
+
+/*
+ * Find reasonable size for orphan file. We choose orphan file size to be
+ * between 32 and 512 filesystem blocks and not more than 1/4096 of the
+ * filesystem unless it is really small.
+ */
+e2_blkcnt_t ext2fs_default_orphan_file_blocks(ext2_filsys fs)
+{
+	__u64 num_blocks = ext2fs_blocks_count(fs->super);
+	e2_blkcnt_t blks = 512;
+
+	if (num_blocks < 128 * 1024)
+		blks = 32;
+	else if (num_blocks < 2 * 1024 * 1024)
+		blks = num_blocks / 4096;
+	return (blks + EXT2FS_CLUSTER_MASK(fs)) & ~EXT2FS_CLUSTER_MASK(fs);
+}
+
+static errcode_t ext2fs_orphan_file_block_csum(ext2_filsys fs, ext2_ino_t ino,
+					       blk64_t blk, char *buf,
+					       __u32 *crcp)
+{
+	struct ext2_inode inode;
+	errcode_t retval;
+
+	retval = ext2fs_read_inode(fs, ino, &inode);
+	if (retval)
+		return retval;
+	*crcp = ext2fs_do_orphan_file_block_csum(fs, ino, inode.i_generation,
+						 blk, buf);
+	return 0;
+}
+
+errcode_t ext2fs_orphan_file_block_csum_set(ext2_filsys fs, ext2_ino_t ino,
+					    blk64_t blk, char *buf)
+{
+	struct ext4_orphan_block_tail *tail;
+
+	if (!ext2fs_has_feature_metadata_csum(fs->super))
+		return 0;
+
+	tail = ext2fs_orphan_block_tail(fs, buf);
+	return ext2fs_orphan_file_block_csum(fs, ino, blk, buf,
+					     &tail->ob_checksum);
+}
+
+int ext2fs_orphan_file_block_csum_verify(ext2_filsys fs, ext2_ino_t ino,
+					 blk64_t blk, char *buf)
+{
+	struct ext4_orphan_block_tail *tail;
+	__u32 crc;
+	errcode_t retval;
+
+	if (!ext2fs_has_feature_metadata_csum(fs->super))
+		return 1;
+	retval = ext2fs_orphan_file_block_csum(fs, ino, blk, buf, &crc);
+	if (retval)
+		return 0;
+	tail = ext2fs_orphan_block_tail(fs, buf);
+	return ext2fs_le32_to_cpu(tail->ob_checksum) == crc;
+}
diff --git a/lib/ext2fs/progress.c b/lib/ext2fs/progress.c
new file mode 100644
index 0000000..fe4292f
--- /dev/null
+++ b/lib/ext2fs/progress.c
@@ -0,0 +1,103 @@
+/*
+ * progress.c - Numeric progress meter
+ *
+ * Copyright (C) 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001, 2002,
+ * 	2003, 2004, 2005 by Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Public
+ * License.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include "ext2fs.h"
+#include "ext2fsP.h"
+
+#include <time.h>
+
+static char spaces[80], backspaces[80];
+static time_t last_update;
+
+struct ext2fs_progress_ops ext2fs_numeric_progress_ops = {
+	.init		= ext2fs_numeric_progress_init,
+	.update		= ext2fs_numeric_progress_update,
+	.close		= ext2fs_numeric_progress_close,
+};
+
+static int int_log10(unsigned int arg)
+{
+	int	l;
+
+	for (l=0; arg ; l++)
+		arg = arg / 10;
+	return l;
+}
+
+void ext2fs_numeric_progress_init(ext2_filsys fs,
+				  struct ext2fs_numeric_progress_struct * progress,
+				  const char *label, __u64 max)
+{
+	/*
+	 * The PRINT_PROGRESS flag turns on or off ALL
+	 * progress-related messages, whereas the SKIP_PROGRESS
+	 * environment variable prints the start and end messages but
+	 * not the numeric countdown in the middle.
+	 */
+	if (!(fs->flags & EXT2_FLAG_PRINT_PROGRESS))
+		return;
+
+	memset(spaces, ' ', sizeof(spaces)-1);
+	spaces[sizeof(spaces)-1] = 0;
+	memset(backspaces, '\b', sizeof(backspaces)-1);
+	backspaces[sizeof(backspaces)-1] = 0;
+
+	memset(progress, 0, sizeof(*progress));
+	if (getenv("E2FSPROGS_SKIP_PROGRESS"))
+		progress->skip_progress++;
+
+
+	/*
+	 * Figure out how many digits we need
+	 */
+	progress->max = max;
+	progress->log_max = int_log10(max);
+
+	if (label) {
+		fputs(label, stdout);
+		fflush(stdout);
+	}
+	last_update = 0;
+}
+
+void ext2fs_numeric_progress_update(ext2_filsys fs,
+				    struct ext2fs_numeric_progress_struct * progress,
+				    __u64 val)
+{
+	time_t now;
+
+	if (!(fs->flags & EXT2_FLAG_PRINT_PROGRESS))
+		return;
+	if (progress->skip_progress)
+		return;
+	now = time(0);
+	if (now == last_update)
+		return;
+	last_update = now;
+
+	printf("%*llu/%*llu", progress->log_max, (unsigned long long) val,
+	       progress->log_max, (unsigned long long) progress->max);
+	fprintf(stdout, "%.*s", (2*progress->log_max)+1, backspaces);
+}
+
+void ext2fs_numeric_progress_close(ext2_filsys fs,
+				   struct ext2fs_numeric_progress_struct * progress,
+				   const char *message)
+{
+	if (!(fs->flags & EXT2_FLAG_PRINT_PROGRESS))
+		return;
+	fprintf(stdout, "%.*s", (2*progress->log_max)+1, spaces);
+	fprintf(stdout, "%.*s", (2*progress->log_max)+1, backspaces);
+	if (message)
+		fputs(message, stdout);
+}
diff --git a/lib/ext2fs/punch.c b/lib/ext2fs/punch.c
new file mode 100644
index 0000000..e2543e1
--- /dev/null
+++ b/lib/ext2fs/punch.c
@@ -0,0 +1,513 @@
+/*
+ * punch.c --- deallocate blocks allocated to an inode
+ *
+ * Copyright (C) 2010 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <errno.h>
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+#include "ext2fsP.h"
+
+#undef PUNCH_DEBUG
+
+/*
+ * This function returns 1 if the specified block is all zeros
+ */
+static int check_zero_block(char *buf, int blocksize)
+{
+	char	*cp = buf;
+	int	left = blocksize;
+
+	while (left > 0) {
+		if (*cp++)
+			return 0;
+		left--;
+	}
+	return 1;
+}
+
+/*
+ * This clever recursive function handles i_blocks[] as well as
+ * indirect, double indirect, and triple indirect blocks.  It iterates
+ * over the entries in the i_blocks array or indirect blocks, and for
+ * each one, will recursively handle any indirect blocks and then
+ * frees and deallocates the blocks.
+ */
+static errcode_t ind_punch(ext2_filsys fs, struct ext2_inode *inode,
+			   char *block_buf, blk_t *p, int level,
+			   blk64_t start, blk64_t count, int max)
+{
+	errcode_t	retval;
+	blk_t		b;
+	int		i;
+	blk64_t		offset, incr;
+	int		freed = 0;
+
+#ifdef PUNCH_DEBUG
+	printf("Entering ind_punch, level %d, start %llu, count %llu, "
+	       "max %d\n", level, start, count, max);
+#endif
+	incr = 1ULL << ((EXT2_BLOCK_SIZE_BITS(fs->super) - 2) * level);
+	for (i = 0, offset = 0; i < max; i++, p++, offset += incr) {
+		if (offset >= start + count)
+			break;
+		if (*p == 0 || (offset+incr) <= start)
+			continue;
+		b = *p;
+		if (level > 0) {
+			blk_t start2;
+#ifdef PUNCH_DEBUG
+			printf("Reading indirect block %u\n", b);
+#endif
+			retval = ext2fs_read_ind_block(fs, b, block_buf);
+			if (retval)
+				return retval;
+			start2 = (start > offset) ? start - offset : 0;
+			retval = ind_punch(fs, inode, block_buf + fs->blocksize,
+					   (blk_t *) block_buf, level - 1,
+					   start2, count - offset,
+					   fs->blocksize >> 2);
+			if (retval)
+				return retval;
+			retval = ext2fs_write_ind_block(fs, b, block_buf);
+			if (retval)
+				return retval;
+			if (!check_zero_block(block_buf, fs->blocksize))
+				continue;
+		}
+#ifdef PUNCH_DEBUG
+		printf("Freeing block %u (offset %llu)\n", b, offset);
+#endif
+		ext2fs_block_alloc_stats(fs, b, -1);
+		*p = 0;
+		freed++;
+	}
+#ifdef PUNCH_DEBUG
+	printf("Freed %d blocks\n", freed);
+#endif
+	return ext2fs_iblk_sub_blocks(fs, inode, freed);
+}
+
+#define BLK_T_MAX ((blk_t)~0ULL)
+static errcode_t ext2fs_punch_ind(ext2_filsys fs, struct ext2_inode *inode,
+				  char *block_buf, blk64_t start, blk64_t end)
+{
+	errcode_t		retval;
+	char			*buf = 0;
+	int			level;
+	int			num = EXT2_NDIR_BLOCKS;
+	blk_t			*bp = inode->i_block;
+	blk_t			addr_per_block;
+	blk64_t			max = EXT2_NDIR_BLOCKS;
+	blk_t			count;
+
+	/* Check start/end don't overflow the 2^32-1 indirect block limit */
+	if (start > BLK_T_MAX)
+		return 0;
+	if (end >= BLK_T_MAX || end - start + 1 >= BLK_T_MAX)
+		count = BLK_T_MAX - start;
+	else
+		count = end - start + 1;
+
+	if (!block_buf) {
+		retval = ext2fs_get_array(3, fs->blocksize, &buf);
+		if (retval)
+			return retval;
+		block_buf = buf;
+	}
+
+	addr_per_block = (blk_t)fs->blocksize >> 2;
+
+	for (level = 0; level < 4; level++, max *= (blk64_t)addr_per_block) {
+#ifdef PUNCH_DEBUG
+		printf("Main loop level %d, start %llu count %u "
+		       "max %llu num %d\n", level, start, count, max, num);
+#endif
+		if (start < max) {
+			retval = ind_punch(fs, inode, block_buf, bp, level,
+					   start, count, num);
+			if (retval)
+				goto errout;
+			if (count > max)
+				count -= max - start;
+			else
+				break;
+			start = 0;
+		} else
+			start -= max;
+		bp += num;
+		if (level == 0) {
+			num = 1;
+			max = 1;
+		}
+	}
+	retval = 0;
+errout:
+	if (buf)
+		ext2fs_free_mem(&buf);
+	return retval;
+}
+#undef BLK_T_MAX
+
+#ifdef PUNCH_DEBUG
+
+#define dbg_printf(f, a...)  printf(f, ## a)
+
+static void dbg_print_extent(char *desc, struct ext2fs_extent *extent)
+{
+	if (desc)
+		printf("%s: ", desc);
+	printf("extent: lblk %llu--%llu, len %u, pblk %llu, flags: ",
+	       extent->e_lblk, extent->e_lblk + extent->e_len - 1,
+	       extent->e_len, extent->e_pblk);
+	if (extent->e_flags & EXT2_EXTENT_FLAGS_LEAF)
+		fputs("LEAF ", stdout);
+	if (extent->e_flags & EXT2_EXTENT_FLAGS_UNINIT)
+		fputs("UNINIT ", stdout);
+	if (extent->e_flags & EXT2_EXTENT_FLAGS_SECOND_VISIT)
+		fputs("2ND_VISIT ", stdout);
+	if (!extent->e_flags)
+		fputs("(none)", stdout);
+	fputc('\n', stdout);
+
+}
+#else
+#define dbg_print_extent(desc, ex)	do { } while (0)
+#define dbg_printf(f, a...)		do { } while (0)
+#endif
+
+/* Free a range of blocks, respecting cluster boundaries */
+static errcode_t punch_extent_blocks(ext2_filsys fs, ext2_ino_t ino,
+				     struct ext2_inode *inode,
+				     blk64_t lfree_start, blk64_t free_start,
+				     __u32 free_count, int *freed)
+{
+	blk64_t		pblk;
+	int		freed_now = 0;
+	__u32		cluster_freed;
+	errcode_t	retval = 0;
+
+	if (free_start < fs->super->s_first_data_block ||
+	    (free_start + free_count) >= ext2fs_blocks_count(fs->super))
+		return EXT2_ET_BAD_BLOCK_NUM;
+
+	/* No bigalloc?  Just free each block. */
+	if (EXT2FS_CLUSTER_RATIO(fs) == 1) {
+		*freed += free_count;
+		while (free_count-- > 0)
+			ext2fs_block_alloc_stats2(fs, free_start++, -1);
+		return retval;
+	}
+
+	/*
+	 * Try to free up to the next cluster boundary.  We assume that all
+	 * blocks in a logical cluster map to blocks from the same physical
+	 * cluster, and that the offsets within the [pl]clusters match.
+	 */
+	if (free_start & EXT2FS_CLUSTER_MASK(fs)) {
+		retval = ext2fs_map_cluster_block(fs, ino, inode,
+						  lfree_start, &pblk);
+		if (retval)
+			goto errout;
+		if (!pblk) {
+			ext2fs_block_alloc_stats2(fs, free_start, -1);
+			freed_now++;
+		}
+		cluster_freed = EXT2FS_CLUSTER_RATIO(fs) -
+			(free_start & EXT2FS_CLUSTER_MASK(fs));
+		if (cluster_freed > free_count)
+			cluster_freed = free_count;
+		free_count -= cluster_freed;
+		free_start += cluster_freed;
+		lfree_start += cluster_freed;
+	}
+
+	/* Free whole clusters from the middle of the range. */
+	while (free_count > 0 && free_count >= (unsigned) EXT2FS_CLUSTER_RATIO(fs)) {
+		ext2fs_block_alloc_stats2(fs, free_start, -1);
+		freed_now++;
+		cluster_freed = EXT2FS_CLUSTER_RATIO(fs);
+		free_count -= cluster_freed;
+		free_start += cluster_freed;
+		lfree_start += cluster_freed;
+	}
+
+	/* Try to free the last cluster. */
+	if (free_count > 0) {
+		retval = ext2fs_map_cluster_block(fs, ino, inode,
+						  lfree_start, &pblk);
+		if (retval)
+			goto errout;
+		if (!pblk) {
+			ext2fs_block_alloc_stats2(fs, free_start, -1);
+			freed_now++;
+		}
+	}
+
+errout:
+	*freed += freed_now;
+	return retval;
+}
+
+static errcode_t ext2fs_punch_extent(ext2_filsys fs, ext2_ino_t ino,
+				     struct ext2_inode *inode,
+				     blk64_t start, blk64_t end)
+{
+	ext2_extent_handle_t	handle = 0;
+	struct ext2fs_extent	extent;
+	errcode_t		retval;
+	blk64_t			free_start, next, lfree_start;
+	__u32			free_count, newlen;
+	int			freed = 0;
+	int			op;
+
+	retval = ext2fs_extent_open2(fs, ino, inode, &handle);
+	if (retval)
+		return retval;
+	/*
+	 * Find the extent closest to the start of the punch range.  We don't
+	 * check the return value because _goto() sets the current node to the
+	 * next-lowest extent if 'start' is in a hole, and doesn't set a
+	 * current node if there was a real error reading the extent tree.
+	 * In that case, _get() will error out.
+	 *
+	 * Note: If _get() returns 'no current node', that simply means that
+	 * there aren't any blocks mapped past this point in the file, so we're
+	 * done.
+	 */
+	ext2fs_extent_goto(handle, start);
+	retval = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT, &extent);
+	if (retval == EXT2_ET_NO_CURRENT_NODE) {
+		retval = 0;
+		goto errout;
+	} else if (retval)
+		goto errout;
+	while (1) {
+		op = EXT2_EXTENT_NEXT_LEAF;
+		dbg_print_extent("main loop", &extent);
+		next = extent.e_lblk + extent.e_len;
+		dbg_printf("start %llu, end %llu, next %llu\n",
+			   (unsigned long long) start,
+			   (unsigned long long) end,
+			   (unsigned long long) next);
+		if (start <= extent.e_lblk) {
+			/*
+			 * Have we iterated past the end of the punch region?
+			 * If so, we can stop.
+			 */
+			if (end < extent.e_lblk)
+				break;
+			dbg_printf("Case #%d\n", 1);
+			/* Start of deleted region before extent; 
+			   adjust beginning of extent */
+			free_start = extent.e_pblk;
+			lfree_start = extent.e_lblk;
+			if (next > end)
+				free_count = end - extent.e_lblk + 1;
+			else
+				free_count = extent.e_len;
+			extent.e_len -= free_count;
+			extent.e_lblk += free_count;
+			extent.e_pblk += free_count;
+		} else if (end >= next-1) {
+			/*
+			 * Is the punch region beyond this extent?  This can
+			 * happen if start is already inside a hole.  Try to
+			 * advance to the next extent if this is the case.
+			 */
+			if (start >= next)
+				goto next_extent;
+			/* End of deleted region after extent;
+			   adjust end of extent */
+			dbg_printf("Case #%d\n", 2);
+			newlen = start - extent.e_lblk;
+			free_start = extent.e_pblk + newlen;
+			lfree_start = extent.e_lblk + newlen;
+			free_count = extent.e_len - newlen;
+			extent.e_len = newlen;
+		} else {
+			struct ext2fs_extent	newex;
+
+			dbg_printf("Case #%d\n", 3);
+			/* The hard case; we need to split the extent */
+			newex.e_pblk = extent.e_pblk +
+				(end + 1 - extent.e_lblk);
+			newex.e_lblk = end + 1;
+			newex.e_len = next - end - 1;
+			newex.e_flags = extent.e_flags;
+
+			extent.e_len = start - extent.e_lblk;
+			free_start = extent.e_pblk + extent.e_len;
+			lfree_start = extent.e_lblk + extent.e_len;
+			free_count = end - start + 1;
+
+			dbg_print_extent("inserting", &newex);
+			retval = ext2fs_extent_insert(handle,
+					EXT2_EXTENT_INSERT_AFTER, &newex);
+			if (retval)
+				goto errout;
+			retval = ext2fs_extent_fix_parents(handle);
+			if (retval)
+				goto errout;
+			/*
+			 * Now pointing at inserted extent; so go back.
+			 *
+			 * We cannot use EXT2_EXTENT_PREV to go back; note the
+			 * subtlety in the comment for fix_parents().
+			 */
+			retval = ext2fs_extent_goto(handle, extent.e_lblk);
+			if (retval)
+				goto errout;
+		} 
+		if (extent.e_len) {
+			dbg_print_extent("replacing", &extent);
+			retval = ext2fs_extent_replace(handle, 0, &extent);
+			if (retval)
+				goto errout;
+			retval = ext2fs_extent_fix_parents(handle);
+		} else {
+			struct ext2fs_extent	newex;
+			blk64_t			old_lblk, next_lblk;
+			dbg_printf("deleting current extent%s\n", "");
+
+			/*
+			 * Save the location of the next leaf, then slip
+			 * back to the current extent.
+			 */
+			retval = ext2fs_extent_get(handle, EXT2_EXTENT_CURRENT,
+						   &newex);
+			if (retval)
+				goto errout;
+			old_lblk = newex.e_lblk;
+
+			retval = ext2fs_extent_get(handle,
+						   EXT2_EXTENT_NEXT_LEAF,
+						   &newex);
+			if (retval == EXT2_ET_EXTENT_NO_NEXT)
+				next_lblk = old_lblk;
+			else if (retval)
+				goto errout;
+			else
+				next_lblk = newex.e_lblk;
+
+			retval = ext2fs_extent_goto(handle, old_lblk);
+			if (retval)
+				goto errout;
+
+			/* Now delete the extent. */
+			retval = ext2fs_extent_delete(handle, 0);
+			if (retval)
+				goto errout;
+
+			retval = ext2fs_extent_fix_parents(handle);
+			if (retval && retval != EXT2_ET_NO_CURRENT_NODE)
+				goto errout;
+			retval = 0;
+
+			/*
+			 * Jump forward to the next extent.  If there are
+			 * errors, the ext2fs_extent_get down below will
+			 * capture them for us.
+			 */
+			(void)ext2fs_extent_goto(handle, next_lblk);
+			op = EXT2_EXTENT_CURRENT;
+		}
+		if (retval)
+			goto errout;
+		dbg_printf("Free start %llu, free count = %u\n",
+		       free_start, free_count);
+		retval = punch_extent_blocks(fs, ino, inode, lfree_start,
+					     free_start, free_count, &freed);
+		if (retval)
+			goto errout;
+	next_extent:
+		retval = ext2fs_extent_get(handle, op,
+					   &extent);
+		if (retval == EXT2_ET_EXTENT_NO_NEXT ||
+		    retval == EXT2_ET_NO_CURRENT_NODE)
+			break;
+		if (retval)
+			goto errout;
+	}
+	dbg_printf("Freed %d blocks\n", freed);
+	retval = ext2fs_iblk_sub_blocks(fs, inode, freed);
+errout:
+	ext2fs_extent_free(handle);
+	return retval;
+}
+	
+static errcode_t ext2fs_punch_inline_data(ext2_filsys fs, ext2_ino_t ino,
+					  struct ext2_inode *inode,
+					  blk64_t start,
+					  blk64_t end EXT2FS_ATTR((unused)))
+{
+	errcode_t retval;
+
+	/*
+	 * In libext2fs ext2fs_punch is based on block unit.  So that
+	 * means that if start > 0 we don't need to do nothing.  Due
+	 * to this we will remove all inline data in ext2fs_punch()
+	 * now.
+	 */
+	if (start > 0)
+		return 0;
+
+	memset((char *)inode->i_block, 0, EXT4_MIN_INLINE_DATA_SIZE);
+	inode->i_size = 0;
+	retval = ext2fs_write_inode(fs, ino, inode);
+	if (retval)
+		return retval;
+
+	return ext2fs_inline_data_ea_remove(fs, ino);
+}
+
+/*
+ * Deallocate all logical _blocks_ starting at start to end, inclusive.
+ * If end is ~0ULL, then this is effectively truncate.
+ */
+errcode_t ext2fs_punch(ext2_filsys fs, ext2_ino_t ino,
+		       struct ext2_inode *inode,
+		       char *block_buf, blk64_t start,
+		       blk64_t end)
+{
+	errcode_t		retval;
+	struct ext2_inode	inode_buf;
+
+	if (start > end)
+		return EINVAL;
+
+	/* Read inode structure if necessary */
+	if (!inode) {
+		retval = ext2fs_read_inode(fs, ino, &inode_buf);
+		if (retval)
+			return retval;
+		inode = &inode_buf;
+	}
+	if (inode->i_flags & EXT4_INLINE_DATA_FL)
+		return ext2fs_punch_inline_data(fs, ino, inode, start, end);
+	else if (inode->i_flags & EXT4_EXTENTS_FL)
+		retval = ext2fs_punch_extent(fs, ino, inode, start, end);
+	else
+		retval = ext2fs_punch_ind(fs, inode, block_buf, start, end);
+	if (retval)
+		return retval;
+
+#ifdef PUNCH_DEBUG
+	printf("%u: write inode size now %lu blocks %u\n",
+		ino, EXT2_I_SIZE(inode), inode->i_blocks);
+#endif
+	return ext2fs_write_inode(fs, ino, inode);
+}
diff --git a/lib/ext2fs/qcow2.c b/lib/ext2fs/qcow2.c
new file mode 100644
index 0000000..2082417
--- /dev/null
+++ b/lib/ext2fs/qcow2.c
@@ -0,0 +1,272 @@
+/*
+ * qcow2.c --- Functions to generate qcow2 formatted disk images.  This
+ * format is used originally by QEMU for virtual machines, and stores the
+ * filesystem data on disk in a packed format to avoid creating sparse
+ * image files that need lots of seeking to read and write.
+ *
+ * The qcow2 format supports zlib compression, but that is not yet
+ * implemented.
+ *
+ * It is possible to directly mount a qcow2 image using qemu-nbd:
+ *
+ * [root]# modprobe nbd max_part=63
+ * [root]# qemu-nbd -c /dev/nbd0 image.img
+ * [root]# mount /dev/nbd0p1 /mnt/qemu
+ *
+ * Format details at http://people.gnome.org/~markmc/qcow-image-format.html
+ *
+ * Copyright (C) 2010 Red Hat, Inc., Lukas Czerner <lczerner@redhat.com>
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Public
+ * License.
+ * %End-Header%
+ */
+
+#ifndef _LARGEFILE_SOURCE
+#define _LARGEFILE_SOURCE
+#endif
+#ifndef _LARGEFILE64_SOURCE
+#define _LARGEFILE64_SOURCE
+#endif
+
+#include "config.h"
+#include <fcntl.h>
+#include <grp.h>
+#include <pwd.h>
+#include <stdio.h>
+#ifdef HAVE_STDLIB_H
+#include <stdlib.h>
+#endif
+#include <string.h>
+#include <time.h>
+#include <unistd.h>
+#include <fcntl.h>
+#include <errno.h>
+#include <sys/stat.h>
+#include <sys/types.h>
+#include <assert.h>
+
+#include "ext2fs/ext2fs.h"
+#include "qcow2.h"
+
+/* Functions for converting qcow2 image into raw image */
+
+struct ext2_qcow2_hdr *qcow2_read_header(int fd)
+{
+	void *buffer = NULL;
+	struct ext2_qcow2_hdr *hdr = NULL;
+	size_t size;
+	errcode_t ret;
+
+	ret = ext2fs_get_mem(sizeof(struct ext2_qcow2_hdr), &buffer);
+	if (ret)
+		return NULL;
+	memset(buffer, 0, sizeof(struct ext2_qcow2_hdr));
+
+	if (ext2fs_llseek(fd, 0, SEEK_SET < 0)) {
+		ext2fs_free_mem(&buffer);
+		return NULL;
+	}
+
+	size = read(fd, buffer, sizeof(struct ext2_qcow2_hdr));
+	if (size != sizeof(struct ext2_qcow2_hdr)) {
+		ext2fs_free_mem(&buffer);
+		return NULL;
+	}
+
+	hdr = (struct ext2_qcow2_hdr *)(buffer);
+
+	if ((ext2fs_be32_to_cpu(hdr->magic) != QCOW_MAGIC) ||
+	    (ext2fs_be32_to_cpu(hdr->version) != 2)) {
+		ext2fs_free_mem(&hdr);
+		return NULL;
+	}
+
+	return hdr;
+}
+
+static int qcow2_read_l1_table(struct ext2_qcow2_image *img)
+{
+	int fd = img->fd;
+	size_t size, l1_size = img->l1_size * sizeof(blk64_t);
+	blk64_t *table;
+	errcode_t ret;
+
+	ret = ext2fs_get_memzero(l1_size, &table);
+	if (ret)
+		return ret;
+
+	if (ext2fs_llseek(fd, img->l1_offset, SEEK_SET) < 0) {
+		ext2fs_free_mem(&table);
+		return errno;
+	}
+
+	size = read(fd, table, l1_size);
+	if (size != l1_size) {
+		ext2fs_free_mem(&table);
+		return errno;
+	}
+
+	img->l1_table = table;
+
+	return 0;
+}
+
+static int qcow2_read_l2_table(struct ext2_qcow2_image *img,
+			       __u64 offset, blk64_t **l2_table)
+{
+	int fd = img->fd;
+	size_t size;
+
+	assert(*l2_table);
+
+	if (ext2fs_llseek(fd, offset, SEEK_SET) < 0)
+		return errno;
+
+	size = read(fd, *l2_table, img->cluster_size);
+	if (size != img->cluster_size)
+		return errno;
+
+	return 0;
+}
+
+static int qcow2_copy_data(int fdin, int fdout, __u64 off_in,
+			   __u64 off_out, void *buf, size_t count)
+{
+	size_t size;
+
+	assert(buf);
+
+	if (ext2fs_llseek(fdout, off_out, SEEK_SET) < 0)
+		return errno;
+
+	if (ext2fs_llseek(fdin, off_in, SEEK_SET) < 0)
+		return errno;
+
+	size = read(fdin, buf, count);
+	if (size != count)
+		return errno;
+
+	size = write(fdout, buf, count);
+	if (size != count)
+		return errno;
+
+	return 0;
+}
+
+
+int qcow2_write_raw_image(int qcow2_fd, int raw_fd,
+			      struct ext2_qcow2_hdr *hdr)
+{
+	struct ext2_qcow2_image img;
+	errcode_t ret = 0;
+	unsigned int l1_index, l2_index;
+	__u64 offset;
+	blk64_t *l1_table, *l2_table = NULL;
+	void *copy_buf = NULL;
+	size_t size;
+	unsigned int max_l1_size;
+
+	if (hdr->crypt_method)
+		return -QCOW_ENCRYPTED;
+
+	img.fd = qcow2_fd;
+	img.hdr = hdr;
+	img.l2_cache = NULL;
+	img.l1_table = NULL;
+	img.cluster_bits = ext2fs_be32_to_cpu(hdr->cluster_bits);
+	if (img.cluster_bits < 9 || img.cluster_bits > 31)
+		return -QCOW_CORRUPTED;
+	img.cluster_size = 1 << img.cluster_bits;
+	img.l1_size = ext2fs_be32_to_cpu(hdr->l1_size);
+	img.l1_offset = ext2fs_be64_to_cpu(hdr->l1_table_offset);
+	img.l2_size = 1 << (img.cluster_bits - 3);
+	img.image_size = ext2fs_be64_to_cpu(hdr->size);
+
+	if (img.l1_offset & (img.cluster_size - 1))
+		return -QCOW_CORRUPTED;
+
+	max_l1_size = (img.image_size >> ((2 * img.cluster_bits) - 3)) +
+		img.cluster_size;
+	if (img.l1_size > max_l1_size)
+		return -QCOW_CORRUPTED;
+
+	ret = ext2fs_get_memzero(img.cluster_size, &l2_table);
+	if (ret)
+		goto out;
+
+	ret = ext2fs_get_memzero(1 << img.cluster_bits, &copy_buf);
+	if (ret)
+		goto out;
+
+	if (ext2fs_llseek(raw_fd, 0, SEEK_SET) < 0) {
+		ret = errno;
+		goto out;
+	}
+
+	ret = qcow2_read_l1_table(&img);
+	if (ret)
+		goto out;
+
+	l1_table = img.l1_table;
+	/* Walk through l1 table */
+	for (l1_index = 0; l1_index < img.l1_size; l1_index++) {
+		__u64 off_out;
+
+		offset = ext2fs_be64_to_cpu(l1_table[l1_index]) &
+			 ~QCOW_OFLAG_COPIED;
+
+		if ((offset > img.image_size) ||
+		    (offset <= 0))
+			continue;
+
+		if (offset & QCOW_OFLAG_COMPRESSED) {
+			ret = -QCOW_COMPRESSED;
+			goto out;
+		}
+
+		ret = qcow2_read_l2_table(&img, offset, &l2_table);
+		if (ret)
+			break;
+
+		/* Walk through l2 table and copy data blocks into raw image */
+		for (l2_index = 0; l2_index < img.l2_size; l2_index++) {
+			offset = ext2fs_be64_to_cpu(l2_table[l2_index]) &
+				 ~QCOW_OFLAG_COPIED;
+
+			if (offset == 0)
+				continue;
+
+			off_out = ((__u64)l1_index * img.l2_size) +
+				  l2_index;
+			off_out <<= img.cluster_bits;
+			ret = qcow2_copy_data(qcow2_fd, raw_fd, offset,
+					off_out, copy_buf, img.cluster_size);
+			if (ret)
+				goto out;
+		}
+	}
+
+	/* Resize the output image to the filesystem size */
+	if (ext2fs_llseek(raw_fd, img.image_size - 1, SEEK_SET) < 0) {
+		ret = errno;
+		goto out;
+	}
+
+	((char *)copy_buf)[0] = 0;
+	size = write(raw_fd, copy_buf, 1);
+	if (size != 1) {
+		ret = errno;
+		goto out;
+	}
+
+out:
+	if (copy_buf)
+		ext2fs_free_mem(&copy_buf);
+	if (img.l1_table)
+		ext2fs_free_mem(&img.l1_table);
+	if (l2_table)
+		ext2fs_free_mem(&l2_table);
+	return ret;
+}
diff --git a/lib/ext2fs/qcow2.h b/lib/ext2fs/qcow2.h
new file mode 100644
index 0000000..b649c9c
--- /dev/null
+++ b/lib/ext2fs/qcow2.h
@@ -0,0 +1,114 @@
+/*
+ * qcow2.h --- structures and function prototypes for qcow2.c to generate
+ * qcow2 formatted disk images.  This format is used originally by QEMU
+ * for virtual machines, and stores the filesystem data on disk in a
+ * packed format to avoid creating sparse image files that need lots of
+ * seeking to read and write.
+ *
+ * The qcow2 format supports zlib compression, but that is not yet
+ * implemented.
+ *
+ * It is possible to directly mount a qcow2 image using qemu-nbd:
+ *
+ * [root]# modprobe nbd max_part=63
+ * [root]# qemu-nbd -c /dev/nbd0 image.img
+ * [root]# mount /dev/nbd0p1 /mnt/qemu
+ *
+ * Format details at http://people.gnome.org/~markmc/qcow-image-format.html
+ *
+ * Copyright (C) 2010 Red Hat, Inc., Lukas Czerner <lczerner@redhat.com>
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Public
+ * License.
+ * %End-Header%
+ */
+
+/* Number of l2 tables in memory before writeback */
+#define L2_CACHE_PREALLOC	512
+
+
+#define QCOW_MAGIC (('Q' << 24) | ('F' << 16) | ('I' << 8) | 0xfb)
+#define QCOW_VERSION		2
+#define QCOW_OFLAG_COPIED	(1ULL << 63)
+#define QCOW_OFLAG_COMPRESSED	(1ULL << 62)
+
+#define QCOW_COMPRESSED		1
+#define QCOW_ENCRYPTED		2
+#define QCOW_CORRUPTED		3
+
+struct ext2_qcow2_hdr {
+	__u32	magic;
+	__u32	version;
+
+	__u64	backing_file_offset;
+	__u32	backing_file_size;
+
+	__u32	cluster_bits;
+	__u64	size;
+	__u32	crypt_method;
+
+	__u32	l1_size;
+	__u64	l1_table_offset;
+
+	__u64	refcount_table_offset;
+	__u32	refcount_table_clusters;
+
+	__u32	nb_snapshots;
+	__u64	snapshots_offset;
+};
+
+typedef struct ext2_qcow2_l2_table L2_CACHE_HEAD;
+
+struct ext2_qcow2_l2_table {
+	__u32		l1_index;
+	__u64		offset;
+	__u64		*data;
+	L2_CACHE_HEAD	*next;
+};
+
+struct ext2_qcow2_l2_cache {
+	L2_CACHE_HEAD	*used_head;
+	L2_CACHE_HEAD	*used_tail;
+	L2_CACHE_HEAD	*free_head;
+	__u32		free;
+	__u32		count;
+	__u64		next_offset;
+};
+
+struct ext2_qcow2_refcount {
+	__u64	*refcount_table;
+	__u64	refcount_table_offset;
+	__u64	refcount_block_offset;
+
+	__u32	refcount_table_clusters;
+	__u32	refcount_table_index;
+	__u32	refcount_block_index;
+
+	__u16	*refcount_block;
+};
+
+struct ext2_qcow2_image {
+	int	fd;
+	struct	ext2_qcow2_hdr		*hdr;
+	struct	ext2_qcow2_l2_cache	*l2_cache;
+	struct	ext2_qcow2_refcount	refcount;
+	__u32	cluster_size;
+	__u32	cluster_bits;
+	__u32	l1_size;
+	__u32	l2_size;
+
+	__u64	*l1_table;
+	__u64	l2_offset;
+	__u64	l1_offset;
+	__u64	image_size;
+};
+
+/* Function prototypes */
+
+/* qcow2.c */
+
+/* Functions for converting qcow2 image into raw image */
+struct ext2_qcow2_hdr *qcow2_read_header(int);
+int qcow2_write_raw_image(int, int, struct ext2_qcow2_hdr *);
+
diff --git a/lib/ext2fs/rbtree.c b/lib/ext2fs/rbtree.c
new file mode 100644
index 0000000..74426fa
--- /dev/null
+++ b/lib/ext2fs/rbtree.c
@@ -0,0 +1,383 @@
+/*
+  Red Black Trees
+  (C) 1999  Andrea Arcangeli <andrea@suse.de>
+  (C) 2002  David Woodhouse <dwmw2@infradead.org>
+
+  This program is free software; you can redistribute it and/or modify
+  it under the terms of the GNU General Public License as published by
+  the Free Software Foundation; either version 2 of the License, or
+  (at your option) any later version.
+
+  This program is distributed in the hope that it will be useful,
+  but WITHOUT ANY WARRANTY; without even the implied warranty of
+  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+  GNU General Public License for more details.
+
+  You should have received a copy of the GNU General Public License
+  along with this program; if not, write to the Free Software
+  Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301  USA
+
+  linux/lib/rbtree.c
+*/
+
+#include "rbtree.h"
+
+static void __rb_rotate_left(struct rb_node *node, struct rb_root *root)
+{
+	struct rb_node *right = node->rb_right;
+	struct rb_node *parent = ext2fs_rb_parent(node);
+
+	if ((node->rb_right = right->rb_left))
+		ext2fs_rb_set_parent(right->rb_left, node);
+	right->rb_left = node;
+
+	ext2fs_rb_set_parent(right, parent);
+
+	if (parent)
+	{
+		if (node == parent->rb_left)
+			parent->rb_left = right;
+		else
+			parent->rb_right = right;
+	}
+	else
+		root->rb_node = right;
+	ext2fs_rb_set_parent(node, right);
+}
+
+static void __rb_rotate_right(struct rb_node *node, struct rb_root *root)
+{
+	struct rb_node *left = node->rb_left;
+	struct rb_node *parent = ext2fs_rb_parent(node);
+
+	if ((node->rb_left = left->rb_right))
+		ext2fs_rb_set_parent(left->rb_right, node);
+	left->rb_right = node;
+
+	ext2fs_rb_set_parent(left, parent);
+
+	if (parent)
+	{
+		if (node == parent->rb_right)
+			parent->rb_right = left;
+		else
+			parent->rb_left = left;
+	}
+	else
+		root->rb_node = left;
+	ext2fs_rb_set_parent(node, left);
+}
+
+void ext2fs_rb_insert_color(struct rb_node *node, struct rb_root *root)
+{
+	struct rb_node *parent, *gparent;
+
+	while ((parent = ext2fs_rb_parent(node)) && ext2fs_rb_is_red(parent))
+	{
+		gparent = ext2fs_rb_parent(parent);
+
+		if (parent == gparent->rb_left)
+		{
+			{
+				register struct rb_node *uncle = gparent->rb_right;
+				if (uncle && ext2fs_rb_is_red(uncle))
+				{
+					ext2fs_rb_set_black(uncle);
+					ext2fs_rb_set_black(parent);
+					ext2fs_rb_set_red(gparent);
+					node = gparent;
+					continue;
+				}
+			}
+
+			if (parent->rb_right == node)
+			{
+				register struct rb_node *tmp;
+				__rb_rotate_left(parent, root);
+				tmp = parent;
+				parent = node;
+				node = tmp;
+			}
+
+			ext2fs_rb_set_black(parent);
+			ext2fs_rb_set_red(gparent);
+			__rb_rotate_right(gparent, root);
+		} else {
+			{
+				register struct rb_node *uncle = gparent->rb_left;
+				if (uncle && ext2fs_rb_is_red(uncle))
+				{
+					ext2fs_rb_set_black(uncle);
+					ext2fs_rb_set_black(parent);
+					ext2fs_rb_set_red(gparent);
+					node = gparent;
+					continue;
+				}
+			}
+
+			if (parent->rb_left == node)
+			{
+				register struct rb_node *tmp;
+				__rb_rotate_right(parent, root);
+				tmp = parent;
+				parent = node;
+				node = tmp;
+			}
+
+			ext2fs_rb_set_black(parent);
+			ext2fs_rb_set_red(gparent);
+			__rb_rotate_left(gparent, root);
+		}
+	}
+
+	ext2fs_rb_set_black(root->rb_node);
+}
+
+static void __rb_erase_color(struct rb_node *node, struct rb_node *parent,
+			     struct rb_root *root)
+{
+	struct rb_node *other;
+
+	while ((!node || ext2fs_rb_is_black(node)) && node != root->rb_node)
+	{
+		if (parent->rb_left == node)
+		{
+			other = parent->rb_right;
+			if (ext2fs_rb_is_red(other))
+			{
+				ext2fs_rb_set_black(other);
+				ext2fs_rb_set_red(parent);
+				__rb_rotate_left(parent, root);
+				other = parent->rb_right;
+			}
+			if ((!other->rb_left || ext2fs_rb_is_black(other->rb_left)) &&
+			    (!other->rb_right || ext2fs_rb_is_black(other->rb_right)))
+			{
+				ext2fs_rb_set_red(other);
+				node = parent;
+				parent = ext2fs_rb_parent(node);
+			}
+			else
+			{
+				if (!other->rb_right || ext2fs_rb_is_black(other->rb_right))
+				{
+					ext2fs_rb_set_black(other->rb_left);
+					ext2fs_rb_set_red(other);
+					__rb_rotate_right(other, root);
+					other = parent->rb_right;
+				}
+				ext2fs_rb_set_color(other, ext2fs_rb_color(parent));
+				ext2fs_rb_set_black(parent);
+				ext2fs_rb_set_black(other->rb_right);
+				__rb_rotate_left(parent, root);
+				node = root->rb_node;
+				break;
+			}
+		}
+		else
+		{
+			other = parent->rb_left;
+			if (ext2fs_rb_is_red(other))
+			{
+				ext2fs_rb_set_black(other);
+				ext2fs_rb_set_red(parent);
+				__rb_rotate_right(parent, root);
+				other = parent->rb_left;
+			}
+			if ((!other->rb_left || ext2fs_rb_is_black(other->rb_left)) &&
+			    (!other->rb_right || ext2fs_rb_is_black(other->rb_right)))
+			{
+				ext2fs_rb_set_red(other);
+				node = parent;
+				parent = ext2fs_rb_parent(node);
+			}
+			else
+			{
+				if (!other->rb_left || ext2fs_rb_is_black(other->rb_left))
+				{
+					ext2fs_rb_set_black(other->rb_right);
+					ext2fs_rb_set_red(other);
+					__rb_rotate_left(other, root);
+					other = parent->rb_left;
+				}
+				ext2fs_rb_set_color(other, ext2fs_rb_color(parent));
+				ext2fs_rb_set_black(parent);
+				ext2fs_rb_set_black(other->rb_left);
+				__rb_rotate_right(parent, root);
+				node = root->rb_node;
+				break;
+			}
+		}
+	}
+	if (node)
+		ext2fs_rb_set_black(node);
+}
+
+void ext2fs_rb_erase(struct rb_node *node, struct rb_root *root)
+{
+	struct rb_node *child, *parent;
+	int color;
+
+	if (!node->rb_left)
+		child = node->rb_right;
+	else if (!node->rb_right)
+		child = node->rb_left;
+	else
+	{
+		struct rb_node *old = node, *left;
+
+		node = node->rb_right;
+		while ((left = node->rb_left) != NULL)
+			node = left;
+
+		if (ext2fs_rb_parent(old)) {
+			if (ext2fs_rb_parent(old)->rb_left == old)
+				ext2fs_rb_parent(old)->rb_left = node;
+			else
+				ext2fs_rb_parent(old)->rb_right = node;
+		} else
+			root->rb_node = node;
+
+		child = node->rb_right;
+		parent = ext2fs_rb_parent(node);
+		color = ext2fs_rb_color(node);
+
+		if (parent == old) {
+			parent = node;
+		} else {
+			if (child)
+				ext2fs_rb_set_parent(child, parent);
+			parent->rb_left = child;
+
+			node->rb_right = old->rb_right;
+			ext2fs_rb_set_parent(old->rb_right, node);
+		}
+
+		node->rb_parent_color = old->rb_parent_color;
+		node->rb_left = old->rb_left;
+		ext2fs_rb_set_parent(old->rb_left, node);
+
+		goto color;
+	}
+
+	parent = ext2fs_rb_parent(node);
+	color = ext2fs_rb_color(node);
+
+	if (child)
+		ext2fs_rb_set_parent(child, parent);
+	if (parent)
+	{
+		if (parent->rb_left == node)
+			parent->rb_left = child;
+		else
+			parent->rb_right = child;
+	}
+	else
+		root->rb_node = child;
+
+ color:
+	if (color == RB_BLACK)
+		__rb_erase_color(child, parent, root);
+}
+
+/*
+ * This function returns the first node (in sort order) of the tree.
+ */
+struct rb_node *ext2fs_rb_first(const struct rb_root *root)
+{
+	struct rb_node	*n;
+
+	n = root->rb_node;
+	if (!n)
+		return NULL;
+	while (n->rb_left)
+		n = n->rb_left;
+	return n;
+}
+
+struct rb_node *ext2fs_rb_last(const struct rb_root *root)
+{
+	struct rb_node	*n;
+
+	n = root->rb_node;
+	if (!n)
+		return NULL;
+	while (n->rb_right)
+		n = n->rb_right;
+	return n;
+}
+
+struct rb_node *ext2fs_rb_next(struct rb_node *node)
+{
+	struct rb_node *parent;
+
+	if (ext2fs_rb_parent(node) == node)
+		return NULL;
+
+	/* If we have a right-hand child, go down and then left as far
+	   as we can. */
+	if (node->rb_right) {
+		node = node->rb_right;
+		while (node->rb_left)
+			node=node->rb_left;
+		return (struct rb_node *)node;
+	}
+
+	/* No right-hand children.  Everything down and left is
+	   smaller than us, so any 'next' node must be in the general
+	   direction of our parent. Go up the tree; any time the
+	   ancestor is a right-hand child of its parent, keep going
+	   up. First time it's a left-hand child of its parent, said
+	   parent is our 'next' node. */
+	while ((parent = ext2fs_rb_parent(node)) && node == parent->rb_right)
+		node = parent;
+
+	return parent;
+}
+
+struct rb_node *ext2fs_rb_prev(struct rb_node *node)
+{
+	struct rb_node *parent;
+
+	if (ext2fs_rb_parent(node) == node)
+		return NULL;
+
+	/* If we have a left-hand child, go down and then right as far
+	   as we can. */
+	if (node->rb_left) {
+		node = node->rb_left;
+		while (node->rb_right)
+			node=node->rb_right;
+		return (struct rb_node *)node;
+	}
+
+	/* No left-hand children. Go up till we find an ancestor which
+	   is a right-hand child of its parent */
+	while ((parent = ext2fs_rb_parent(node)) && node == parent->rb_left)
+		node = parent;
+
+	return parent;
+}
+
+void ext2fs_rb_replace_node(struct rb_node *victim, struct rb_node *new,
+			  struct rb_root *root)
+{
+	struct rb_node *parent = ext2fs_rb_parent(victim);
+
+	/* Set the surrounding nodes to point to the replacement */
+	if (parent) {
+		if (victim == parent->rb_left)
+			parent->rb_left = new;
+		else
+			parent->rb_right = new;
+	} else {
+		root->rb_node = new;
+	}
+	if (victim->rb_left)
+		ext2fs_rb_set_parent(victim->rb_left, new);
+	if (victim->rb_right)
+		ext2fs_rb_set_parent(victim->rb_right, new);
+
+	/* Copy the pointers/colour from the victim to the replacement */
+	*new = *victim;
+}
diff --git a/lib/ext2fs/rbtree.h b/lib/ext2fs/rbtree.h
new file mode 100644
index 0000000..790f5c1
--- /dev/null
+++ b/lib/ext2fs/rbtree.h
@@ -0,0 +1,183 @@
+/*
+  Red Black Trees
+  (C) 1999  Andrea Arcangeli <andrea@suse.de>
+
+  This program is free software; you can redistribute it and/or modify
+  it under the terms of the GNU General Public License as published by
+  the Free Software Foundation; either version 2 of the License, or
+  (at your option) any later version.
+
+  This program is distributed in the hope that it will be useful,
+  but WITHOUT ANY WARRANTY; without even the implied warranty of
+  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+  GNU General Public License for more details.
+
+  You should have received a copy of the GNU General Public License
+  along with this program; if not, write to the Free Software
+  Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301  USA
+
+  linux/include/linux/rbtree.h
+
+  To use rbtrees you'll have to implement your own insert and search cores.
+  This will avoid us to use callbacks and to drop dramatically performances.
+  I know it's not the cleaner way,  but in C (not in C++) to get
+  performances and genericity...
+
+  Some example of insert and search follows here. The search is a plain
+  normal search over an ordered tree. The insert instead must be implemented
+  in two steps: First, the code must insert the element in order as a red leaf
+  in the tree, and then the support library function rb_insert_color() must
+  be called. Such function will do the not trivial work to rebalance the
+  rbtree, if necessary.
+
+-----------------------------------------------------------------------
+static inline struct page * rb_search_page_cache(struct inode * inode,
+						 unsigned long offset)
+{
+	struct rb_node * n = inode->i_rb_page_cache.rb_node;
+	struct page * page;
+
+	while (n)
+	{
+		page = rb_entry(n, struct page, rb_page_cache);
+
+		if (offset < page->offset)
+			n = n->rb_left;
+		else if (offset > page->offset)
+			n = n->rb_right;
+		else
+			return page;
+	}
+	return NULL;
+}
+
+static inline struct page * __rb_insert_page_cache(struct inode * inode,
+						   unsigned long offset,
+						   struct rb_node * node)
+{
+	struct rb_node ** p = &inode->i_rb_page_cache.rb_node;
+	struct rb_node * parent = NULL;
+	struct page * page;
+
+	while (*p)
+	{
+		parent = *p;
+		page = rb_entry(parent, struct page, rb_page_cache);
+
+		if (offset < page->offset)
+			p = &(*p)->rb_left;
+		else if (offset > page->offset)
+			p = &(*p)->rb_right;
+		else
+			return page;
+	}
+
+	rb_link_node(node, parent, p);
+
+	return NULL;
+}
+
+static inline struct page * rb_insert_page_cache(struct inode * inode,
+						 unsigned long offset,
+						 struct rb_node * node)
+{
+	struct page * ret;
+	if ((ret = __rb_insert_page_cache(inode, offset, node)))
+		goto out;
+	rb_insert_color(node, &inode->i_rb_page_cache);
+ out:
+	return ret;
+}
+-----------------------------------------------------------------------
+*/
+
+#ifndef	_LINUX_RBTREE_H
+#define	_LINUX_RBTREE_H
+
+#include <stdlib.h>
+#include <stdint.h>
+#include "compiler.h"
+
+#if __GNUC_PREREQ (4, 6)
+#pragma GCC diagnostic push
+#pragma GCC diagnostic ignored "-Wunused-function"
+#endif
+
+struct rb_node
+{
+	uintptr_t  rb_parent_color;
+#define	RB_RED		0
+#define	RB_BLACK	1
+	struct rb_node *rb_right;
+	struct rb_node *rb_left;
+} __attribute__((aligned(sizeof(long))));
+    /* The alignment might seem pointless, but allegedly CRIS needs it */
+
+struct rb_root
+{
+	struct rb_node *rb_node;
+};
+
+
+#define ext2fs_rb_parent(r)   ((struct rb_node *)((r)->rb_parent_color & ~3))
+#define ext2fs_rb_color(r)   ((r)->rb_parent_color & 1)
+#define ext2fs_rb_is_red(r)   (!ext2fs_rb_color(r))
+#define ext2fs_rb_is_black(r) ext2fs_rb_color(r)
+#define ext2fs_rb_set_red(r)  do { (r)->rb_parent_color &= ~1; } while (0)
+#define ext2fs_rb_set_black(r)  do { (r)->rb_parent_color |= 1; } while (0)
+
+static inline void ext2fs_rb_set_parent(struct rb_node *rb, struct rb_node *p)
+{
+	rb->rb_parent_color = (rb->rb_parent_color & 3) | (uintptr_t)p;
+}
+static inline void ext2fs_rb_set_color(struct rb_node *rb, int color)
+{
+	rb->rb_parent_color = (rb->rb_parent_color & ~1) | color;
+}
+
+#define RB_ROOT	(struct rb_root) { NULL, }
+#define	ext2fs_rb_entry(ptr, type, member) container_of(ptr, type, member)
+
+static inline int ext2fs_rb_empty_root(struct rb_root *root)
+{
+	return root->rb_node == NULL;
+}
+
+static inline int ext2fs_rb_empty_node(struct rb_node *node)
+{
+	return ext2fs_rb_parent(node) == node;
+}
+
+static inline void ext2fs_rb_clear_node(struct rb_node *node)
+{
+	ext2fs_rb_set_parent(node, node);
+}
+
+extern void ext2fs_rb_insert_color(struct rb_node *, struct rb_root *);
+extern void ext2fs_rb_erase(struct rb_node *, struct rb_root *);
+
+/* Find logical next and previous nodes in a tree */
+extern struct rb_node *ext2fs_rb_next(struct rb_node *);
+extern struct rb_node *ext2fs_rb_prev(struct rb_node *);
+extern struct rb_node *ext2fs_rb_first(const struct rb_root *);
+extern struct rb_node *ext2fs_rb_last(const struct rb_root *);
+
+/* Fast replacement of a single node without remove/rebalance/add/rebalance */
+extern void ext2fs_rb_replace_node(struct rb_node *victim, struct rb_node *new,
+				 struct rb_root *root);
+
+static inline void ext2fs_rb_link_node(struct rb_node * node,
+				     struct rb_node * parent,
+				     struct rb_node ** rb_link)
+{
+	node->rb_parent_color = (uintptr_t)parent;
+	node->rb_left = node->rb_right = NULL;
+
+	*rb_link = node;
+}
+
+#if __GNUC_PREREQ (4, 6)
+#pragma GCC diagnostic pop
+#endif
+
+#endif	/* _LINUX_RBTREE_H */
diff --git a/lib/ext2fs/read_bb.c b/lib/ext2fs/read_bb.c
new file mode 100644
index 0000000..e58b7cb
--- /dev/null
+++ b/lib/ext2fs/read_bb.c
@@ -0,0 +1,102 @@
+/*
+ * read_bb --- read the bad blocks inode
+ *
+ * Copyright (C) 1994 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+struct read_bb_record {
+	ext2_badblocks_list	bb_list;
+	errcode_t	err;
+};
+
+/*
+ * Helper function for ext2fs_read_bb_inode()
+ */
+#ifdef __TURBOC__
+ #pragma argsused
+#endif
+static int mark_bad_block(ext2_filsys fs, blk_t *block_nr,
+			  e2_blkcnt_t blockcnt EXT2FS_ATTR((unused)),
+			  blk_t ref_block EXT2FS_ATTR((unused)),
+			  int ref_offset EXT2FS_ATTR((unused)),
+			  void *priv_data)
+{
+	struct read_bb_record *rb = (struct read_bb_record *) priv_data;
+
+	if (blockcnt < 0)
+		return 0;
+
+	if ((*block_nr < fs->super->s_first_data_block) ||
+	    (*block_nr >= ext2fs_blocks_count(fs->super)))
+		return 0;	/* Ignore illegal blocks */
+
+	rb->err = ext2fs_badblocks_list_add(rb->bb_list, *block_nr);
+	if (rb->err)
+		return BLOCK_ABORT;
+	return 0;
+}
+
+/*
+ * Reads the current bad blocks from the bad blocks inode.
+ */
+errcode_t ext2fs_read_bb_inode(ext2_filsys fs, ext2_badblocks_list *bb_list)
+{
+	errcode_t	retval;
+	struct read_bb_record rb;
+	struct ext2_inode inode;
+	blk_t	numblocks;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	if (!*bb_list) {
+		retval = ext2fs_read_inode(fs, EXT2_BAD_INO, &inode);
+		if (retval)
+			return retval;
+		numblocks = inode.i_blocks;
+		if (!(ext2fs_has_feature_huge_file(fs->super) &&
+		      (inode.i_flags & EXT4_HUGE_FILE_FL)))
+			numblocks = numblocks / (fs->blocksize / 512);
+		numblocks += 20;
+		if (numblocks < 50)
+			numblocks = 50;
+		if (numblocks > 50000)
+			numblocks = 500;
+		retval = ext2fs_badblocks_list_create(bb_list, numblocks);
+		if (retval)
+			return retval;
+	}
+
+	rb.bb_list = *bb_list;
+	rb.err = 0;
+	retval = ext2fs_block_iterate2(fs, EXT2_BAD_INO, BLOCK_FLAG_READ_ONLY,
+				       0, mark_bad_block, &rb);
+	if (retval)
+		return retval;
+
+	return rb.err;
+}
+
+
diff --git a/lib/ext2fs/read_bb_file.c b/lib/ext2fs/read_bb_file.c
new file mode 100644
index 0000000..a6d3beb
--- /dev/null
+++ b/lib/ext2fs/read_bb_file.c
@@ -0,0 +1,109 @@
+/*
+ * read_bb_file.c --- read a list of bad blocks from a FILE *
+ *
+ * Copyright (C) 1994, 1995, 2000 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+/*
+ * Reads a list of bad blocks from  a FILE *
+ */
+errcode_t ext2fs_read_bb_FILE2(ext2_filsys fs, FILE *f,
+			       ext2_badblocks_list *bb_list,
+			       void *priv_data,
+			       void (*invalid)(ext2_filsys fs,
+					       blk_t blk,
+					       char *badstr,
+					       void *priv_data))
+{
+	errcode_t	retval;
+	unsigned long long blockno;
+	int		count;
+	char		buf[128];
+
+	if (fs)
+		EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	if (!*bb_list) {
+		retval = ext2fs_badblocks_list_create(bb_list, 10);
+		if (retval)
+			return retval;
+	}
+
+	while (!feof (f)) {
+		if (fgets(buf, sizeof(buf), f) == NULL)
+			break;
+		count = sscanf(buf, "%llu", &blockno);
+		if (count <= 0)
+			continue;
+		/* Badblocks isn't going to be updated for 64bit */
+		if (blockno >> 32)
+			return EOVERFLOW;
+		if (fs &&
+		    ((blockno < fs->super->s_first_data_block) ||
+		     (blockno >= ext2fs_blocks_count(fs->super)))) {
+			if (invalid)
+				(invalid)(fs, (blk64_t) blockno, buf, priv_data);
+			continue;
+		}
+		retval = ext2fs_badblocks_list_add(*bb_list, (blk64_t) blockno);
+		if (retval)
+			return retval;
+	}
+	return 0;
+}
+
+struct compat_struct {
+	void (*invalid)(ext2_filsys, blk_t);
+};
+
+static void call_compat_invalid(ext2_filsys fs, blk_t blk,
+				char *badstr EXT2FS_ATTR((unused)),
+				void *priv_data)
+{
+	struct compat_struct *st;
+
+	st = (struct compat_struct *) priv_data;
+	if (st->invalid)
+		(st->invalid)(fs, blk);
+}
+
+
+/*
+ * Reads a list of bad blocks from  a FILE *
+ */
+errcode_t ext2fs_read_bb_FILE(ext2_filsys fs, FILE *f,
+			      ext2_badblocks_list *bb_list,
+			      void (*invalid)(ext2_filsys fs, blk_t blk))
+{
+	struct compat_struct st;
+
+	st.invalid = invalid;
+
+	return ext2fs_read_bb_FILE2(fs, f, bb_list, &st,
+				    call_compat_invalid);
+}
+
+
diff --git a/lib/ext2fs/res_gdt.c b/lib/ext2fs/res_gdt.c
new file mode 100644
index 0000000..fa8d8d6
--- /dev/null
+++ b/lib/ext2fs/res_gdt.c
@@ -0,0 +1,239 @@
+/*
+ * res_gdt.c --- reserve blocks for growing the group descriptor table
+ *               during online resizing.
+ *
+ * Copyright (C) 2002 Andreas Dilger
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#include <time.h>
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+/*
+ * Iterate through the groups which hold BACKUP superblock/GDT copies in an
+ * ext3 filesystem.  The counters should be initialized to 1, 5, and 7 before
+ * calling this for the first time.  In a sparse filesystem it will be the
+ * sequence of powers of 3, 5, and 7: 1, 3, 5, 7, 9, 25, 27, 49, 81, ...
+ * For a non-sparse filesystem it will be every group: 1, 2, 3, 4, ...
+ */
+static unsigned int list_backups(ext2_filsys fs, unsigned int *three,
+				 unsigned int *five, unsigned int *seven)
+{
+	unsigned int *min = three;
+	int mult = 3;
+	unsigned int ret;
+
+	if (ext2fs_has_feature_sparse_super2(fs->super)) {
+		if (*min == 1) {
+			*min += 1;
+			if (fs->super->s_backup_bgs[0])
+				return fs->super->s_backup_bgs[0];
+		}
+		if (*min == 2) {
+			*min += 1;
+			if (fs->super->s_backup_bgs[1])
+				return fs->super->s_backup_bgs[1];
+		}
+		return fs->group_desc_count;
+	}
+	if (!ext2fs_has_feature_sparse_super(fs->super)) {
+		ret = *min;
+		*min += 1;
+		return ret;
+	}
+
+	if (*five < *min) {
+		min = five;
+		mult = 5;
+	}
+	if (*seven < *min) {
+		min = seven;
+		mult = 7;
+	}
+
+	ret = *min;
+	*min *= mult;
+
+	return ret;
+}
+
+/*
+ * This code assumes that the reserved blocks have already been marked in-use
+ * during ext2fs_initialize(), so that they are not allocated for other
+ * uses before we can add them to the resize inode (which has to come
+ * after the creation of the inode table).
+ */
+errcode_t ext2fs_create_resize_inode(ext2_filsys fs)
+{
+	errcode_t		retval, retval2;
+	struct ext2_super_block	*sb;
+	struct ext2_inode	inode;
+	__u32			*dindir_buf, *gdt_buf;
+	unsigned long long	apb, inode_size;
+	/* FIXME-64 - can't deal with extents */
+	blk_t			dindir_blk, rsv_off, gdt_off, gdt_blk;
+	int			dindir_dirty = 0, inode_dirty = 0, sb_blk = 0;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	sb = fs->super;
+
+	retval = ext2fs_get_array(2, fs->blocksize, &dindir_buf);
+	if (retval)
+		return retval;
+	gdt_buf = (__u32 *)((char *)dindir_buf + fs->blocksize);
+
+	retval = ext2fs_read_inode(fs, EXT2_RESIZE_INO, &inode);
+	if (retval)
+		goto out_free;
+
+	/*
+	 * File systems with a blocksize of 1024 and bigalloc have
+	 * sb->s_first_data_block of 0; yet the superblock is still at
+	 * block #1.  We compensate for it here.
+	 */
+	sb_blk = sb->s_first_data_block;
+	if (fs->blocksize == 1024 && sb_blk == 0)
+		sb_blk = 1;
+
+	/* Maximum possible file size (we only use double indirect blocks) */
+	apb = EXT2_ADDR_PER_BLOCK(sb);
+	if ((dindir_blk = inode.i_block[EXT2_DIND_BLOCK])) {
+#ifdef RES_GDT_DEBUG
+		printf("reading GDT dindir %u\n", dindir_blk);
+#endif
+		retval = ext2fs_read_ind_block(fs, dindir_blk, dindir_buf);
+		if (retval)
+			goto out_inode;
+	} else {
+		blk_t goal = sb_blk + fs->desc_blocks +
+			sb->s_reserved_gdt_blocks + 2 +
+			fs->inode_blocks_per_group;
+
+		retval = ext2fs_alloc_block(fs, goal, 0, &dindir_blk);
+		if (retval)
+			goto out_free;
+		inode.i_mode = LINUX_S_IFREG | 0600;
+		inode.i_links_count = 1;
+		inode.i_block[EXT2_DIND_BLOCK] = dindir_blk;
+		ext2fs_iblk_set(fs, &inode, 1);
+		memset(dindir_buf, 0, fs->blocksize);
+#ifdef RES_GDT_DEBUG
+		printf("allocated GDT dindir %u\n", dindir_blk);
+#endif
+		dindir_dirty = inode_dirty = 1;
+		inode_size = apb*apb + apb + EXT2_NDIR_BLOCKS;
+		inode_size *= fs->blocksize;
+		retval = ext2fs_inode_size_set(fs, &inode, inode_size);
+		if (retval)
+			goto out_free;
+		inode.i_ctime = fs->now ? fs->now : time(0);
+	}
+
+	for (rsv_off = 0, gdt_off = fs->desc_blocks,
+	     gdt_blk = sb_blk + 1 + fs->desc_blocks;
+	     rsv_off < sb->s_reserved_gdt_blocks;
+	     rsv_off++, gdt_off++, gdt_blk++) {
+		unsigned int three = 1, five = 5, seven = 7;
+		unsigned int grp, last = 0;
+		int gdt_dirty = 0;
+
+		gdt_off %= apb;
+		if (!dindir_buf[gdt_off]) {
+			/* FIXME XXX XXX
+			blk_t new_blk;
+
+			retval = ext2fs_new_block(fs, gdt_blk, 0, &new_blk);
+			if (retval)
+				goto out_free;
+			if (new_blk != gdt_blk) {
+				// XXX free block
+				retval = -1; // XXX
+			}
+			*/
+			gdt_dirty = dindir_dirty = inode_dirty = 1;
+			memset(gdt_buf, 0, fs->blocksize);
+			dindir_buf[gdt_off] = gdt_blk;
+			ext2fs_iblk_add_blocks(fs, &inode, 1);
+#ifdef RES_GDT_DEBUG
+			printf("added primary GDT block %u at %u[%u]\n",
+			       gdt_blk, dindir_blk, gdt_off);
+#endif
+		} else if (dindir_buf[gdt_off] == gdt_blk) {
+#ifdef RES_GDT_DEBUG
+			printf("reading primary GDT block %u\n", gdt_blk);
+#endif
+			retval = ext2fs_read_ind_block(fs, gdt_blk, gdt_buf);
+			if (retval)
+				goto out_dindir;
+		} else {
+#ifdef RES_GDT_DEBUG
+			printf("bad primary GDT %u != %u at %u[%u]\n",
+			       dindir_buf[gdt_off], gdt_blk,dindir_blk,gdt_off);
+#endif
+			retval = EXT2_ET_RESIZE_INODE_CORRUPT;
+			goto out_dindir;
+		}
+
+		while ((grp = list_backups(fs, &three, &five, &seven)) <
+		       fs->group_desc_count) {
+			blk_t expect = gdt_blk + grp * sb->s_blocks_per_group;
+
+			if (!gdt_buf[last]) {
+#ifdef RES_GDT_DEBUG
+				printf("added backup GDT %u grp %u@%u[%u]\n",
+				       expect, grp, gdt_blk, last);
+#endif
+				gdt_buf[last] = expect;
+				ext2fs_iblk_add_blocks(fs, &inode, 1);
+				gdt_dirty = inode_dirty = 1;
+			} else if (gdt_buf[last] != expect) {
+#ifdef RES_GDT_DEBUG
+				printf("bad backup GDT %u != %u at %u[%u]\n",
+				       gdt_buf[last], expect, gdt_blk, last);
+#endif
+				retval = EXT2_ET_RESIZE_INODE_CORRUPT;
+				goto out_dindir;
+			}
+			last++;
+		}
+		if (gdt_dirty) {
+#ifdef RES_GDT_DEBUG
+			printf("writing primary GDT block %u\n", gdt_blk);
+#endif
+			retval = ext2fs_write_ind_block(fs, gdt_blk, gdt_buf);
+			if (retval)
+				goto out_dindir;
+		}
+	}
+
+out_dindir:
+	if (dindir_dirty) {
+		retval2 = ext2fs_write_ind_block(fs, dindir_blk, dindir_buf);
+		if (!retval)
+			retval = retval2;
+	}
+out_inode:
+#ifdef RES_GDT_DEBUG
+	printf("inode.i_blocks = %u, i_size = %lu\n", inode.i_blocks,
+	       EXT2_I_SIZE(&inode));
+#endif
+	if (inode_dirty) {
+		inode.i_atime = inode.i_mtime = fs->now ? fs->now : time(0);
+		retval2 = ext2fs_write_new_inode(fs, EXT2_RESIZE_INO, &inode);
+		if (!retval)
+			retval = retval2;
+	}
+out_free:
+	ext2fs_free_mem(&dindir_buf);
+	return retval;
+}
+
diff --git a/lib/ext2fs/rw_bitmaps.c b/lib/ext2fs/rw_bitmaps.c
new file mode 100644
index 0000000..1fe65f7
--- /dev/null
+++ b/lib/ext2fs/rw_bitmaps.c
@@ -0,0 +1,682 @@
+/*
+ * rw_bitmaps.c --- routines to read and write the  inode and block bitmaps.
+ *
+ * Copyright (C) 1993, 1994, 1994, 1996 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#ifdef HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#ifdef HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+#ifdef HAVE_PTHREAD_H
+#include <pthread.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+#include "e2image.h"
+
+#ifdef HAVE_PTHREAD
+typedef pthread_mutex_t mutex_t;
+
+static void unix_pthread_mutex_lock(mutex_t *mutex)
+{
+	if (mutex)
+		pthread_mutex_lock(mutex);
+}
+static void unix_pthread_mutex_unlock(mutex_t *mutex)
+{
+	if (mutex)
+		pthread_mutex_unlock(mutex);
+}
+#else
+typedef int mutex_t;
+#define unix_pthread_mutex_lock(mutex_t) do {} while (0)
+#define unix_pthread_mutex_unlock(mutex_t) do {} while (0)
+#endif
+
+static errcode_t write_bitmaps(ext2_filsys fs, int do_inode, int do_block)
+{
+	dgrp_t 		i;
+	unsigned int	j;
+	int		block_nbytes, inode_nbytes;
+	unsigned int	nbits;
+	errcode_t	retval;
+	char		*block_buf = NULL, *inode_buf = NULL;
+	int		csum_flag;
+	blk64_t		blk;
+	blk64_t		blk_itr = EXT2FS_B2C(fs, fs->super->s_first_data_block);
+	ext2_ino_t	ino_itr = 1;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	if (!(fs->flags & EXT2_FLAG_RW))
+		return EXT2_ET_RO_FILSYS;
+
+	csum_flag = ext2fs_has_group_desc_csum(fs);
+
+	inode_nbytes = block_nbytes = 0;
+	if (do_block) {
+		block_nbytes = EXT2_CLUSTERS_PER_GROUP(fs->super) / 8;
+		retval = io_channel_alloc_buf(fs->io, 0, &block_buf);
+		if (retval)
+			goto errout;
+		memset(block_buf, 0xff, fs->blocksize);
+	}
+	if (do_inode) {
+		inode_nbytes = (size_t)
+			((EXT2_INODES_PER_GROUP(fs->super)+7) / 8);
+		retval = io_channel_alloc_buf(fs->io, 0, &inode_buf);
+		if (retval)
+			goto errout;
+		memset(inode_buf, 0xff, fs->blocksize);
+	}
+
+	for (i = 0; i < fs->group_desc_count; i++) {
+		if (!do_block)
+			goto skip_block_bitmap;
+
+		if (csum_flag && ext2fs_bg_flags_test(fs, i, EXT2_BG_BLOCK_UNINIT)
+		    )
+			goto skip_this_block_bitmap;
+
+		retval = ext2fs_get_block_bitmap_range2(fs->block_map,
+				blk_itr, block_nbytes << 3, block_buf);
+		if (retval)
+			goto errout;
+
+		if (i == fs->group_desc_count - 1) {
+			/* Force bitmap padding for the last group */
+			nbits = EXT2FS_NUM_B2C(fs,
+				((ext2fs_blocks_count(fs->super)
+				  - (__u64) fs->super->s_first_data_block)
+				 % (__u64) EXT2_BLOCKS_PER_GROUP(fs->super)));
+			if (nbits)
+				for (j = nbits; j < fs->blocksize * 8; j++)
+					ext2fs_set_bit(j, block_buf);
+		}
+
+		retval = ext2fs_block_bitmap_csum_set(fs, i, block_buf,
+						      block_nbytes);
+		if (retval)
+			return retval;
+		ext2fs_group_desc_csum_set(fs, i);
+		fs->flags |= EXT2_FLAG_DIRTY;
+
+		blk = ext2fs_block_bitmap_loc(fs, i);
+		if (blk && blk < ext2fs_blocks_count(fs->super)) {
+			retval = io_channel_write_blk64(fs->io, blk, 1,
+							block_buf);
+			if (retval) {
+				retval = EXT2_ET_BLOCK_BITMAP_WRITE;
+				goto errout;
+			}
+		}
+	skip_this_block_bitmap:
+		blk_itr += block_nbytes << 3;
+	skip_block_bitmap:
+
+		if (!do_inode)
+			continue;
+
+		if (csum_flag && ext2fs_bg_flags_test(fs, i, EXT2_BG_INODE_UNINIT)
+		    )
+			goto skip_this_inode_bitmap;
+
+		retval = ext2fs_get_inode_bitmap_range2(fs->inode_map,
+				ino_itr, inode_nbytes << 3, inode_buf);
+		if (retval)
+			goto errout;
+
+		retval = ext2fs_inode_bitmap_csum_set(fs, i, inode_buf,
+						      inode_nbytes);
+		if (retval)
+			goto errout;
+		ext2fs_group_desc_csum_set(fs, i);
+		fs->flags |= EXT2_FLAG_DIRTY;
+
+		blk = ext2fs_inode_bitmap_loc(fs, i);
+		if (blk && blk < ext2fs_blocks_count(fs->super)) {
+			retval = io_channel_write_blk64(fs->io, blk, 1,
+						      inode_buf);
+			if (retval) {
+				retval = EXT2_ET_INODE_BITMAP_WRITE;
+				goto errout;
+			}
+		}
+	skip_this_inode_bitmap:
+		ino_itr += inode_nbytes << 3;
+
+	}
+	if (do_block) {
+		fs->flags &= ~EXT2_FLAG_BB_DIRTY;
+		ext2fs_free_mem(&block_buf);
+	}
+	if (do_inode) {
+		fs->flags &= ~EXT2_FLAG_IB_DIRTY;
+		ext2fs_free_mem(&inode_buf);
+	}
+	return 0;
+errout:
+	if (inode_buf)
+		ext2fs_free_mem(&inode_buf);
+	if (block_buf)
+		ext2fs_free_mem(&block_buf);
+	return retval;
+}
+
+static errcode_t mark_uninit_bg_group_blocks(ext2_filsys fs)
+{
+	dgrp_t			i;
+	blk64_t			blk;
+	ext2fs_block_bitmap	bmap = fs->block_map;
+
+	for (i = 0; i < fs->group_desc_count; i++) {
+		if (!ext2fs_bg_flags_test(fs, i, EXT2_BG_BLOCK_UNINIT))
+			continue;
+
+		ext2fs_reserve_super_and_bgd(fs, i, bmap);
+
+		/*
+		 * Mark the blocks used for the inode table
+		 */
+		blk = ext2fs_inode_table_loc(fs, i);
+		if (blk)
+			ext2fs_mark_block_bitmap_range2(bmap, blk,
+						fs->inode_blocks_per_group);
+
+		/*
+		 * Mark block used for the block bitmap
+		 */
+		blk = ext2fs_block_bitmap_loc(fs, i);
+		if (blk && blk < ext2fs_blocks_count(fs->super))
+			ext2fs_mark_block_bitmap2(bmap, blk);
+
+		/*
+		 * Mark block used for the inode bitmap
+		 */
+		blk = ext2fs_inode_bitmap_loc(fs, i);
+		if (blk && blk < ext2fs_blocks_count(fs->super))
+			ext2fs_mark_block_bitmap2(bmap, blk);
+	}
+	return 0;
+}
+
+static int bitmap_tail_verify(unsigned char *bitmap, int first, int last)
+{
+	int i;
+
+	for (i = first; i <= last; i++)
+		if (bitmap[i] != 0xff)
+			return 0;
+	return 1;
+}
+
+static errcode_t read_bitmaps_range_prepare(ext2_filsys fs, int flags)
+{
+	errcode_t retval;
+	int block_nbytes = EXT2_CLUSTERS_PER_GROUP(fs->super) / 8;
+	int inode_nbytes = EXT2_INODES_PER_GROUP(fs->super) / 8;
+	char *buf;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	if ((block_nbytes > (int) fs->blocksize) ||
+	    (inode_nbytes > (int) fs->blocksize))
+		return EXT2_ET_CORRUPT_SUPERBLOCK;
+
+	fs->write_bitmaps = ext2fs_write_bitmaps;
+
+	retval = ext2fs_get_mem(strlen(fs->device_name) + 80, &buf);
+	if (retval)
+		return retval;
+
+	if (flags & EXT2FS_BITMAPS_BLOCK) {
+		if (fs->block_map)
+			ext2fs_free_block_bitmap(fs->block_map);
+		strcpy(buf, "block bitmap for ");
+		strcat(buf, fs->device_name);
+		retval = ext2fs_allocate_block_bitmap(fs, buf, &fs->block_map);
+		if (retval)
+			goto cleanup;
+	}
+
+	if (flags & EXT2FS_BITMAPS_INODE) {
+		if (fs->inode_map)
+			ext2fs_free_inode_bitmap(fs->inode_map);
+		strcpy(buf, "inode bitmap for ");
+		strcat(buf, fs->device_name);
+		retval = ext2fs_allocate_inode_bitmap(fs, buf, &fs->inode_map);
+		if (retval)
+			goto cleanup;
+	}
+	ext2fs_free_mem(&buf);
+	return retval;
+
+cleanup:
+	if (flags & EXT2FS_BITMAPS_BLOCK) {
+		ext2fs_free_block_bitmap(fs->block_map);
+		fs->block_map = 0;
+	}
+	if (flags & EXT2FS_BITMAPS_INODE) {
+		ext2fs_free_inode_bitmap(fs->inode_map);
+		fs->inode_map = 0;
+	}
+	ext2fs_free_mem(&buf);
+	return retval;
+}
+
+static errcode_t read_bitmaps_range_start(ext2_filsys fs, int flags,
+					  dgrp_t start, dgrp_t end,
+					  mutex_t *mutex,
+					  int *tail_flags)
+{
+	dgrp_t i;
+	char *block_bitmap = 0, *inode_bitmap = 0;
+	errcode_t retval = 0;
+	int block_nbytes = EXT2_CLUSTERS_PER_GROUP(fs->super) / 8;
+	int inode_nbytes = EXT2_INODES_PER_GROUP(fs->super) / 8;
+	int csum_flag;
+	unsigned int	cnt;
+	blk64_t	blk;
+	blk64_t	blk_itr = EXT2FS_B2C(fs, fs->super->s_first_data_block);
+	blk64_t   blk_cnt;
+	ext2_ino_t ino_itr = 1;
+	ext2_ino_t ino_cnt;
+
+	csum_flag = ext2fs_has_group_desc_csum(fs);
+
+	if (flags & EXT2FS_BITMAPS_BLOCK) {
+		retval = io_channel_alloc_buf(fs->io, 0, &block_bitmap);
+		if (retval)
+			goto cleanup;
+	} else {
+		block_nbytes = 0;
+	}
+
+	if (flags & EXT2FS_BITMAPS_INODE) {
+		retval = io_channel_alloc_buf(fs->io, 0, &inode_bitmap);
+		if (retval)
+			goto cleanup;
+	} else {
+		inode_nbytes = 0;
+	}
+
+	/* io should be null */
+	if (fs->flags & EXT2_FLAG_IMAGE_FILE) {
+		blk = (ext2fs_le32_to_cpu(fs->image_header->offset_inodemap) / fs->blocksize);
+		ino_cnt = fs->super->s_inodes_count;
+		while (inode_bitmap && ino_cnt > 0) {
+			retval = io_channel_read_blk64(fs->image_io, blk++,
+						     1, inode_bitmap);
+			if (retval)
+				goto cleanup;
+			cnt = fs->blocksize << 3;
+			if (cnt > ino_cnt)
+				cnt = ino_cnt;
+			retval = ext2fs_set_inode_bitmap_range2(fs->inode_map,
+					       ino_itr, cnt, inode_bitmap);
+			if (retval)
+				goto cleanup;
+			ino_itr += cnt;
+			ino_cnt -= cnt;
+		}
+		blk = (ext2fs_le32_to_cpu(fs->image_header->offset_blockmap) /
+		       fs->blocksize);
+		blk_cnt = EXT2_GROUPS_TO_CLUSTERS(fs->super,
+						  fs->group_desc_count);
+		while (block_bitmap && blk_cnt > 0) {
+			retval = io_channel_read_blk64(fs->image_io, blk++,
+						     1, block_bitmap);
+			if (retval)
+				goto cleanup;
+			cnt = fs->blocksize << 3;
+			if (cnt > blk_cnt)
+				cnt = blk_cnt;
+			retval = ext2fs_set_block_bitmap_range2(fs->block_map,
+				       blk_itr, cnt, block_bitmap);
+			if (retval)
+				goto cleanup;
+			blk_itr += cnt;
+			blk_cnt -= cnt;
+		}
+		goto cleanup;
+	}
+
+	blk_itr += ((blk64_t)start * (block_nbytes << 3));
+	ino_itr += ((blk64_t)start * (inode_nbytes << 3));
+	for (i = start; i <= end; i++) {
+		if (block_bitmap) {
+			blk = ext2fs_block_bitmap_loc(fs, i);
+			if ((csum_flag &&
+			     ext2fs_bg_flags_test(fs, i, EXT2_BG_BLOCK_UNINIT) &&
+			     ext2fs_group_desc_csum_verify(fs, i)) ||
+			    (blk >= ext2fs_blocks_count(fs->super)))
+				blk = 0;
+			if (blk) {
+				retval = io_channel_read_blk64(fs->io, blk,
+							       1, block_bitmap);
+				if (retval) {
+					retval = EXT2_ET_BLOCK_BITMAP_READ;
+					goto cleanup;
+				}
+				/* verify block bitmap checksum */
+				if (!(fs->flags &
+				      EXT2_FLAG_IGNORE_CSUM_ERRORS) &&
+				    !ext2fs_block_bitmap_csum_verify(fs, i,
+						block_bitmap, block_nbytes)) {
+					retval =
+					EXT2_ET_BLOCK_BITMAP_CSUM_INVALID;
+					goto cleanup;
+				}
+				if (!bitmap_tail_verify((unsigned char *) block_bitmap,
+							block_nbytes, fs->blocksize - 1))
+					*tail_flags |= EXT2_FLAG_BBITMAP_TAIL_PROBLEM;
+			} else
+				memset(block_bitmap, 0, block_nbytes);
+			cnt = block_nbytes << 3;
+			unix_pthread_mutex_lock(mutex);
+			retval = ext2fs_set_block_bitmap_range2(fs->block_map,
+					       blk_itr, cnt, block_bitmap);
+			unix_pthread_mutex_unlock(mutex);
+			if (retval)
+				goto cleanup;
+			blk_itr += block_nbytes << 3;
+		}
+		if (inode_bitmap) {
+			blk = ext2fs_inode_bitmap_loc(fs, i);
+			if ((csum_flag &&
+			     ext2fs_bg_flags_test(fs, i, EXT2_BG_INODE_UNINIT) &&
+			     ext2fs_group_desc_csum_verify(fs, i)) ||
+			    (blk >= ext2fs_blocks_count(fs->super)))
+				blk = 0;
+			if (blk) {
+				retval = io_channel_read_blk64(fs->io, blk,
+							       1, inode_bitmap);
+				if (retval) {
+					retval = EXT2_ET_INODE_BITMAP_READ;
+					goto cleanup;
+				}
+
+				/* verify inode bitmap checksum */
+				if (!(fs->flags &
+				      EXT2_FLAG_IGNORE_CSUM_ERRORS) &&
+				    !ext2fs_inode_bitmap_csum_verify(fs, i,
+						inode_bitmap, inode_nbytes)) {
+					retval =
+					EXT2_ET_INODE_BITMAP_CSUM_INVALID;
+					goto cleanup;
+				}
+				if (!bitmap_tail_verify((unsigned char *) inode_bitmap,
+							inode_nbytes, fs->blocksize - 1))
+					*tail_flags |= EXT2_FLAG_IBITMAP_TAIL_PROBLEM;
+			} else
+				memset(inode_bitmap, 0, inode_nbytes);
+			cnt = inode_nbytes << 3;
+			unix_pthread_mutex_lock(mutex);
+			retval = ext2fs_set_inode_bitmap_range2(fs->inode_map,
+					       ino_itr, cnt, inode_bitmap);
+			unix_pthread_mutex_unlock(mutex);
+			if (retval)
+				goto cleanup;
+			ino_itr += inode_nbytes << 3;
+		}
+	}
+
+cleanup:
+	if (inode_bitmap)
+		ext2fs_free_mem(&inode_bitmap);
+	if (block_bitmap)
+		ext2fs_free_mem(&block_bitmap);
+	return retval;
+}
+
+static errcode_t read_bitmaps_range_end(ext2_filsys fs, int flags,
+					int tail_flags)
+{
+	errcode_t retval;
+
+	/* Mark group blocks for any BLOCK_UNINIT groups */
+	if (flags & EXT2FS_BITMAPS_BLOCK) {
+		retval = mark_uninit_bg_group_blocks(fs);
+		if (retval)
+			return retval;
+		fs->flags &= ~EXT2_FLAG_BBITMAP_TAIL_PROBLEM;
+	}
+	if (flags & EXT2FS_BITMAPS_INODE)
+		fs->flags &= ~EXT2_FLAG_IBITMAP_TAIL_PROBLEM;
+	fs->flags |= tail_flags;
+
+	return 0;
+}
+
+static void read_bitmaps_cleanup_on_error(ext2_filsys fs, int flags)
+{
+	if (flags & EXT2FS_BITMAPS_BLOCK) {
+		ext2fs_free_block_bitmap(fs->block_map);
+		fs->block_map = 0;
+	}
+	if (flags & EXT2FS_BITMAPS_INODE) {
+		ext2fs_free_inode_bitmap(fs->inode_map);
+		fs->inode_map = 0;
+	}
+}
+
+static errcode_t read_bitmaps_range(ext2_filsys fs, int flags,
+				    dgrp_t start, dgrp_t end)
+{
+	errcode_t retval;
+	int tail_flags = 0;
+
+	retval = read_bitmaps_range_prepare(fs, flags);
+	if (retval)
+		return retval;
+
+	retval = read_bitmaps_range_start(fs, flags, start, end,
+					  NULL, &tail_flags);
+	if (retval == 0)
+		retval = read_bitmaps_range_end(fs, flags, tail_flags);
+	if (retval)
+		read_bitmaps_cleanup_on_error(fs, flags);
+	return retval;
+}
+
+#ifdef HAVE_PTHREAD
+struct read_bitmaps_thread_info {
+	ext2_filsys	rbt_fs;
+	int		rbt_flags;
+	dgrp_t		rbt_grp_start;
+	dgrp_t		rbt_grp_end;
+	errcode_t	rbt_retval;
+	pthread_mutex_t *rbt_mutex;
+	int		rbt_tail_flags;
+};
+
+static void *read_bitmaps_thread(void *data)
+{
+	struct read_bitmaps_thread_info *rbt = data;
+
+	rbt->rbt_retval = read_bitmaps_range_start(rbt->rbt_fs, rbt->rbt_flags,
+				rbt->rbt_grp_start, rbt->rbt_grp_end,
+				rbt->rbt_mutex, &rbt->rbt_tail_flags);
+	return NULL;
+}
+#endif
+
+errcode_t ext2fs_rw_bitmaps(ext2_filsys fs, int flags, int num_threads)
+{
+#ifdef HAVE_PTHREAD
+	pthread_attr_t	attr;
+	pthread_t *thread_ids = NULL;
+	struct read_bitmaps_thread_info *thread_infos = NULL;
+	pthread_mutex_t rbt_mutex = PTHREAD_MUTEX_INITIALIZER;
+	errcode_t retval;
+	errcode_t rc;
+	unsigned flexbg_size = 1U << fs->super->s_log_groups_per_flex;
+	dgrp_t average_group;
+	int i, tail_flags = 0;
+#endif
+
+	if (flags & ~EXT2FS_BITMAPS_VALID_FLAGS)
+		return EXT2_ET_INVALID_ARGUMENT;
+
+	if (ext2fs_has_feature_journal_dev(fs->super))
+		return EXT2_ET_EXTERNAL_JOURNAL_NOSUPP;
+
+	if (flags & EXT2FS_BITMAPS_WRITE)
+		return write_bitmaps(fs, flags & EXT2FS_BITMAPS_INODE,
+				     flags & EXT2FS_BITMAPS_BLOCK);
+
+#ifdef HAVE_PTHREAD
+	if (((fs->io->flags & CHANNEL_FLAGS_THREADS) == 0) ||
+	    (num_threads == 1) || (fs->flags & EXT2_FLAG_IMAGE_FILE))
+		goto fallback;
+
+#if defined(HAVE_SYSCONF) && defined(_SC_NPROCESSORS_CONF)
+	if (num_threads < 0)
+		num_threads = sysconf(_SC_NPROCESSORS_CONF);
+#endif
+	/*
+	 * Guess for now; eventually we should probably define
+	 * ext2fs_get_num_cpus() and teach it how to get this info on
+	 * MacOS, FreeBSD, etc.
+	 * ref: https://stackoverflow.com/questions/150355
+	 */
+	if (num_threads < 0)
+		num_threads = 4;
+
+	if ((unsigned) num_threads > fs->group_desc_count)
+		num_threads = fs->group_desc_count;
+	average_group = fs->group_desc_count / num_threads;
+	if (ext2fs_has_feature_flex_bg(fs->super)) {
+		average_group = (average_group / flexbg_size) * flexbg_size;
+	}
+	if ((num_threads <= 1) || (average_group == 0))
+		goto fallback;
+
+	io_channel_set_options(fs->io, "cache=off");
+	retval = pthread_attr_init(&attr);
+	if (retval)
+		return retval;
+
+	thread_ids = calloc(sizeof(pthread_t), num_threads);
+	if (!thread_ids)
+		return ENOMEM;
+
+	thread_infos = calloc(sizeof(struct read_bitmaps_thread_info),
+				num_threads);
+	if (!thread_infos)
+		goto out;
+
+	retval = read_bitmaps_range_prepare(fs, flags);
+	if (retval)
+		goto out;
+
+//	fprintf(stdout, "Multiple threads triggered to read bitmaps\n");
+	for (i = 0; i < num_threads; i++) {
+		thread_infos[i].rbt_fs = fs;
+		thread_infos[i].rbt_flags = flags;
+		thread_infos[i].rbt_mutex = &rbt_mutex;
+		thread_infos[i].rbt_tail_flags = 0;
+		if (i == 0)
+			thread_infos[i].rbt_grp_start = 0;
+		else
+			thread_infos[i].rbt_grp_start = average_group * i + 1;
+
+		if (i == num_threads - 1)
+			thread_infos[i].rbt_grp_end = fs->group_desc_count - 1;
+		else
+			thread_infos[i].rbt_grp_end = average_group * (i + 1);
+		retval = pthread_create(&thread_ids[i], &attr,
+					&read_bitmaps_thread, &thread_infos[i]);
+		if (retval)
+			break;
+	}
+	for (i = 0; i < num_threads; i++) {
+		if (!thread_ids[i])
+			break;
+		rc = pthread_join(thread_ids[i], NULL);
+		if (rc && !retval)
+			retval = rc;
+		rc = thread_infos[i].rbt_retval;
+		if (rc && !retval)
+			retval = rc;
+		tail_flags |= thread_infos[i].rbt_tail_flags;
+	}
+out:
+	rc = pthread_attr_destroy(&attr);
+	if (rc && !retval)
+		retval = rc;
+	free(thread_infos);
+	free(thread_ids);
+
+	if (retval == 0)
+		retval = read_bitmaps_range_end(fs, flags, tail_flags);
+	if (retval)
+		read_bitmaps_cleanup_on_error(fs, flags);
+	/* XXX should save and restore cache setting */
+	io_channel_set_options(fs->io, "cache=on");
+	return retval;
+fallback:
+#endif /* HAVE_PTHREAD */
+	return read_bitmaps_range(fs, flags, 0, fs->group_desc_count - 1);
+}
+
+errcode_t ext2fs_read_inode_bitmap(ext2_filsys fs)
+{
+	return ext2fs_rw_bitmaps(fs, EXT2FS_BITMAPS_INODE, -1);
+}
+
+errcode_t ext2fs_read_block_bitmap(ext2_filsys fs)
+{
+	return ext2fs_rw_bitmaps(fs, EXT2FS_BITMAPS_BLOCK, -1);
+}
+
+errcode_t ext2fs_write_inode_bitmap(ext2_filsys fs)
+{
+	return write_bitmaps(fs, 1, 0);
+}
+
+errcode_t ext2fs_write_block_bitmap (ext2_filsys fs)
+{
+	return write_bitmaps(fs, 0, 1);
+}
+
+errcode_t ext2fs_read_bitmaps(ext2_filsys fs)
+{
+	int flags = 0;
+
+	if (!fs->inode_map)
+		flags |= EXT2FS_BITMAPS_INODE;
+	if (!fs->block_map)
+		flags |= EXT2FS_BITMAPS_BLOCK;
+	if (flags == 0)
+		return 0;
+	return ext2fs_rw_bitmaps(fs, flags, -1);
+}
+
+errcode_t ext2fs_write_bitmaps(ext2_filsys fs)
+{
+	int do_inode = fs->inode_map && ext2fs_test_ib_dirty(fs);
+	int do_block = fs->block_map && ext2fs_test_bb_dirty(fs);
+
+	if (!do_inode && !do_block)
+		return 0;
+
+	return write_bitmaps(fs, do_inode, do_block);
+}
diff --git a/lib/ext2fs/sha256.c b/lib/ext2fs/sha256.c
new file mode 100644
index 0000000..b1506e2
--- /dev/null
+++ b/lib/ext2fs/sha256.c
@@ -0,0 +1,254 @@
+/*
+ * sha256.c --- The sh256 algorithm
+ *
+ * Copyright (C) 2004 Sam Hocevar <sam@hocevar.net>
+ * (copied from libtomcrypt and then relicensed under GPLv2)
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+
+#include "config.h"
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+#include "ext2fs.h"
+
+static const __u32 K[64] = {
+    0x428a2f98UL, 0x71374491UL, 0xb5c0fbcfUL, 0xe9b5dba5UL, 0x3956c25bUL,
+    0x59f111f1UL, 0x923f82a4UL, 0xab1c5ed5UL, 0xd807aa98UL, 0x12835b01UL,
+    0x243185beUL, 0x550c7dc3UL, 0x72be5d74UL, 0x80deb1feUL, 0x9bdc06a7UL,
+    0xc19bf174UL, 0xe49b69c1UL, 0xefbe4786UL, 0x0fc19dc6UL, 0x240ca1ccUL,
+    0x2de92c6fUL, 0x4a7484aaUL, 0x5cb0a9dcUL, 0x76f988daUL, 0x983e5152UL,
+    0xa831c66dUL, 0xb00327c8UL, 0xbf597fc7UL, 0xc6e00bf3UL, 0xd5a79147UL,
+    0x06ca6351UL, 0x14292967UL, 0x27b70a85UL, 0x2e1b2138UL, 0x4d2c6dfcUL,
+    0x53380d13UL, 0x650a7354UL, 0x766a0abbUL, 0x81c2c92eUL, 0x92722c85UL,
+    0xa2bfe8a1UL, 0xa81a664bUL, 0xc24b8b70UL, 0xc76c51a3UL, 0xd192e819UL,
+    0xd6990624UL, 0xf40e3585UL, 0x106aa070UL, 0x19a4c116UL, 0x1e376c08UL,
+    0x2748774cUL, 0x34b0bcb5UL, 0x391c0cb3UL, 0x4ed8aa4aUL, 0x5b9cca4fUL,
+    0x682e6ff3UL, 0x748f82eeUL, 0x78a5636fUL, 0x84c87814UL, 0x8cc70208UL,
+    0x90befffaUL, 0xa4506cebUL, 0xbef9a3f7UL, 0xc67178f2UL
+};
+
+/* Various logical functions */
+#define Ch(x,y,z)       (z ^ (x & (y ^ z)))
+#define Maj(x,y,z)      (((x | y) & z) | (x & y)) 
+#define S(x, n)         RORc((x),(n))
+#define R(x, n)         (((x)&0xFFFFFFFFUL)>>(n))
+#define Sigma0(x)       (S(x, 2) ^ S(x, 13) ^ S(x, 22))
+#define Sigma1(x)       (S(x, 6) ^ S(x, 11) ^ S(x, 25))
+#define Gamma0(x)       (S(x, 7) ^ S(x, 18) ^ R(x, 3))
+#define Gamma1(x)       (S(x, 17) ^ S(x, 19) ^ R(x, 10))
+#define RORc(x, y) ( ((((__u32)(x)&0xFFFFFFFFUL)>>(__u32)((y)&31)) | ((__u32)(x)<<(__u32)(32-((y)&31)))) & 0xFFFFFFFFUL)
+
+#define RND(a,b,c,d,e,f,g,h,i)                         \
+     t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i];   \
+     t1 = Sigma0(a) + Maj(a, b, c);                    \
+     d += t0;                                          \
+     h  = t0 + t1;
+
+#define STORE64H(x, y) \
+	do { \
+		(y)[0] = (unsigned char)(((x)>>56)&255);\
+		(y)[1] = (unsigned char)(((x)>>48)&255);\
+		(y)[2] = (unsigned char)(((x)>>40)&255);\
+		(y)[3] = (unsigned char)(((x)>>32)&255);\
+		(y)[4] = (unsigned char)(((x)>>24)&255);\
+		(y)[5] = (unsigned char)(((x)>>16)&255);\
+		(y)[6] = (unsigned char)(((x)>>8)&255);\
+		(y)[7] = (unsigned char)((x)&255); } while(0)
+
+#define STORE32H(x, y)                                                                     \
+  do { (y)[0] = (unsigned char)(((x)>>24)&255); (y)[1] = (unsigned char)(((x)>>16)&255);   \
+       (y)[2] = (unsigned char)(((x)>>8)&255); (y)[3] = (unsigned char)((x)&255); } while(0)
+
+#define LOAD32H(x, y)                            \
+  do { x = ((__u32)((y)[0] & 255)<<24) | \
+           ((__u32)((y)[1] & 255)<<16) | \
+           ((__u32)((y)[2] & 255)<<8)  | \
+           ((__u32)((y)[3] & 255)); } while(0)
+
+struct sha256_state {
+    __u64 length;
+    __u32 state[8], curlen;
+    unsigned char buf[64];
+};
+
+/* This is a highly simplified version from libtomcrypt */
+struct hash_state {
+	struct sha256_state sha256;
+};
+
+static void sha256_compress(struct hash_state * md, const unsigned char *buf)
+{
+    __u32 S[8], W[64], t0, t1;
+    __u32 t;
+    int i;
+
+    /* copy state into S */
+    for (i = 0; i < 8; i++) {
+        S[i] = md->sha256.state[i];
+    }
+
+    /* copy the state into 512-bits into W[0..15] */
+    for (i = 0; i < 16; i++) {
+        LOAD32H(W[i], buf + (4*i));
+    }
+
+    /* fill W[16..63] */
+    for (i = 16; i < 64; i++) {
+        W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16];
+    }        
+
+    /* Compress */
+     for (i = 0; i < 64; ++i) {
+         RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i);
+         t = S[7]; S[7] = S[6]; S[6] = S[5]; S[5] = S[4]; 
+         S[4] = S[3]; S[3] = S[2]; S[2] = S[1]; S[1] = S[0]; S[0] = t;
+     }  
+
+    /* feedback */
+    for (i = 0; i < 8; i++) {
+        md->sha256.state[i] = md->sha256.state[i] + S[i];
+    }
+}
+
+static void sha256_init(struct hash_state * md)
+{
+    md->sha256.curlen = 0;
+    md->sha256.length = 0;
+    md->sha256.state[0] = 0x6A09E667UL;
+    md->sha256.state[1] = 0xBB67AE85UL;
+    md->sha256.state[2] = 0x3C6EF372UL;
+    md->sha256.state[3] = 0xA54FF53AUL;
+    md->sha256.state[4] = 0x510E527FUL;
+    md->sha256.state[5] = 0x9B05688CUL;
+    md->sha256.state[6] = 0x1F83D9ABUL;
+    md->sha256.state[7] = 0x5BE0CD19UL;
+}
+
+#define MIN(x, y) ( ((x)<(y))?(x):(y) )
+#define SHA256_BLOCKSIZE 64
+static void sha256_process(struct hash_state * md, const unsigned char *in, unsigned long inlen)
+{
+    unsigned long n;
+
+    while (inlen > 0) {
+	    if (md->sha256.curlen == 0 && inlen >= SHA256_BLOCKSIZE) {
+		    sha256_compress(md, in);
+		    md->sha256.length += SHA256_BLOCKSIZE * 8;
+		    in += SHA256_BLOCKSIZE;
+		    inlen -= SHA256_BLOCKSIZE;
+	    } else {
+		    n = MIN(inlen, (SHA256_BLOCKSIZE - md->sha256.curlen));
+		    memcpy(md->sha256.buf + md->sha256.curlen, in, (size_t)n);
+		    md->sha256.curlen += n;
+		    in += n;
+		    inlen -= n;
+		    if (md->sha256.curlen == SHA256_BLOCKSIZE) {
+			    sha256_compress(md, md->sha256.buf);
+			    md->sha256.length += 8*SHA256_BLOCKSIZE;
+			    md->sha256.curlen = 0;
+		    }
+	    }
+    }
+}
+
+
+static void sha256_done(struct hash_state * md, unsigned char *out)
+{
+    int i;
+
+    /* increase the length of the message */
+    md->sha256.length += md->sha256.curlen * 8;
+
+    /* append the '1' bit */
+    md->sha256.buf[md->sha256.curlen++] = (unsigned char)0x80;
+
+    /* if the length is currently above 56 bytes we append zeros
+     * then compress.  Then we can fall back to padding zeros and length
+     * encoding like normal.
+     */
+    if (md->sha256.curlen > 56) {
+        while (md->sha256.curlen < 64) {
+            md->sha256.buf[md->sha256.curlen++] = (unsigned char)0;
+        }
+        sha256_compress(md, md->sha256.buf);
+        md->sha256.curlen = 0;
+    }
+
+    /* pad up to 56 bytes of zeroes */
+    while (md->sha256.curlen < 56) {
+        md->sha256.buf[md->sha256.curlen++] = (unsigned char)0;
+    }
+
+    /* store length */
+    STORE64H(md->sha256.length, md->sha256.buf+56);
+    sha256_compress(md, md->sha256.buf);
+
+    /* copy output */
+    for (i = 0; i < 8; i++) {
+        STORE32H(md->sha256.state[i], out+(4*i));
+    }
+}
+
+void ext2fs_sha256(const unsigned char *in, unsigned long in_size,
+		   unsigned char out[EXT2FS_SHA256_LENGTH])
+{
+	struct hash_state md;
+
+	sha256_init(&md);
+	sha256_process(&md, in, in_size);
+	sha256_done(&md, out);
+}
+
+#ifdef UNITTEST
+static const struct {
+	char *msg;
+	unsigned char hash[32];
+} tests[] = {
+	{ "",
+	  { 0xe3, 0xb0, 0xc4, 0x42, 0x98, 0xfc, 0x1c, 0x14,
+	    0x9a, 0xfb, 0xf4, 0xc8, 0x99, 0x6f, 0xb9, 0x24,
+	    0x27, 0xae, 0x41, 0xe4, 0x64, 0x9b, 0x93, 0x4c,
+	    0xa4, 0x95, 0x99, 0x1b, 0x78, 0x52, 0xb8, 0x55 }
+	},
+	{ "abc",
+	  { 0xba, 0x78, 0x16, 0xbf, 0x8f, 0x01, 0xcf, 0xea,
+	    0x41, 0x41, 0x40, 0xde, 0x5d, 0xae, 0x22, 0x23,
+	    0xb0, 0x03, 0x61, 0xa3, 0x96, 0x17, 0x7a, 0x9c,
+	    0xb4, 0x10, 0xff, 0x61, 0xf2, 0x00, 0x15, 0xad }
+	},
+	{ "abcdbcdecdefdefgefghfghighijhijkijkljklmklmnlmnomnopnopq",
+	  { 0x24, 0x8d, 0x6a, 0x61, 0xd2, 0x06, 0x38, 0xb8,
+	    0xe5, 0xc0, 0x26, 0x93, 0x0c, 0x3e, 0x60, 0x39,
+	    0xa3, 0x3c, 0xe4, 0x59, 0x64, 0xff, 0x21, 0x67,
+	    0xf6, 0xec, 0xed, 0xd4, 0x19, 0xdb, 0x06, 0xc1 }
+	},
+};
+
+int main(int argc, char **argv)
+{
+	int i;
+	int errors = 0;
+	unsigned char tmp[32];
+
+	for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) {
+		unsigned char *msg = (unsigned char *) tests[i].msg;
+		int len = strlen(tests[i].msg);
+
+		ext2fs_sha256(msg, len, tmp);
+		printf("SHA256 test message %d: ", i);
+		if (memcmp(tmp, tests[i].hash, 32) != 0) {
+			printf("FAILED\n");
+			errors++;
+		} else
+			printf("OK\n");
+	}
+	return errors;
+}
+
+#endif /* UNITTEST */
diff --git a/lib/ext2fs/sha512.c b/lib/ext2fs/sha512.c
new file mode 100644
index 0000000..f246afb
--- /dev/null
+++ b/lib/ext2fs/sha512.c
@@ -0,0 +1,302 @@
+/*
+ * sha512.c --- The sha512 algorithm
+ *
+ * Copyright (C) 2004 Sam Hocevar <sam@hocevar.net>
+ * (copied from libtomcrypt and then relicensed under GPLv2)
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+
+#include "config.h"
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+#include "ext2fs.h"
+
+/* the K array */
+#define CONST64(n) n
+static const __u64 K[80] = {
+	CONST64(0x428a2f98d728ae22), CONST64(0x7137449123ef65cd),
+	CONST64(0xb5c0fbcfec4d3b2f), CONST64(0xe9b5dba58189dbbc),
+	CONST64(0x3956c25bf348b538), CONST64(0x59f111f1b605d019),
+	CONST64(0x923f82a4af194f9b), CONST64(0xab1c5ed5da6d8118),
+	CONST64(0xd807aa98a3030242), CONST64(0x12835b0145706fbe),
+	CONST64(0x243185be4ee4b28c), CONST64(0x550c7dc3d5ffb4e2),
+	CONST64(0x72be5d74f27b896f), CONST64(0x80deb1fe3b1696b1),
+	CONST64(0x9bdc06a725c71235), CONST64(0xc19bf174cf692694),
+	CONST64(0xe49b69c19ef14ad2), CONST64(0xefbe4786384f25e3),
+	CONST64(0x0fc19dc68b8cd5b5), CONST64(0x240ca1cc77ac9c65),
+	CONST64(0x2de92c6f592b0275), CONST64(0x4a7484aa6ea6e483),
+	CONST64(0x5cb0a9dcbd41fbd4), CONST64(0x76f988da831153b5),
+	CONST64(0x983e5152ee66dfab), CONST64(0xa831c66d2db43210),
+	CONST64(0xb00327c898fb213f), CONST64(0xbf597fc7beef0ee4),
+	CONST64(0xc6e00bf33da88fc2), CONST64(0xd5a79147930aa725),
+	CONST64(0x06ca6351e003826f), CONST64(0x142929670a0e6e70),
+	CONST64(0x27b70a8546d22ffc), CONST64(0x2e1b21385c26c926),
+	CONST64(0x4d2c6dfc5ac42aed), CONST64(0x53380d139d95b3df),
+	CONST64(0x650a73548baf63de), CONST64(0x766a0abb3c77b2a8),
+	CONST64(0x81c2c92e47edaee6), CONST64(0x92722c851482353b),
+	CONST64(0xa2bfe8a14cf10364), CONST64(0xa81a664bbc423001),
+	CONST64(0xc24b8b70d0f89791), CONST64(0xc76c51a30654be30),
+	CONST64(0xd192e819d6ef5218), CONST64(0xd69906245565a910),
+	CONST64(0xf40e35855771202a), CONST64(0x106aa07032bbd1b8),
+	CONST64(0x19a4c116b8d2d0c8), CONST64(0x1e376c085141ab53),
+	CONST64(0x2748774cdf8eeb99), CONST64(0x34b0bcb5e19b48a8),
+	CONST64(0x391c0cb3c5c95a63), CONST64(0x4ed8aa4ae3418acb),
+	CONST64(0x5b9cca4f7763e373), CONST64(0x682e6ff3d6b2b8a3),
+	CONST64(0x748f82ee5defb2fc), CONST64(0x78a5636f43172f60),
+	CONST64(0x84c87814a1f0ab72), CONST64(0x8cc702081a6439ec),
+	CONST64(0x90befffa23631e28), CONST64(0xa4506cebde82bde9),
+	CONST64(0xbef9a3f7b2c67915), CONST64(0xc67178f2e372532b),
+	CONST64(0xca273eceea26619c), CONST64(0xd186b8c721c0c207),
+	CONST64(0xeada7dd6cde0eb1e), CONST64(0xf57d4f7fee6ed178),
+	CONST64(0x06f067aa72176fba), CONST64(0x0a637dc5a2c898a6),
+	CONST64(0x113f9804bef90dae), CONST64(0x1b710b35131c471b),
+	CONST64(0x28db77f523047d84), CONST64(0x32caab7b40c72493),
+	CONST64(0x3c9ebe0a15c9bebc), CONST64(0x431d67c49c100d4c),
+	CONST64(0x4cc5d4becb3e42b6), CONST64(0x597f299cfc657e2a),
+	CONST64(0x5fcb6fab3ad6faec), CONST64(0x6c44198c4a475817)
+};
+#define Ch(x,y,z)       (z ^ (x & (y ^ z)))
+#define Maj(x,y,z)      (((x | y) & z) | (x & y))
+#define S(x, n)         ROR64c(x, n)
+#define R(x, n)         (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((__u64)n))
+#define Sigma0(x)       (S(x, 28) ^ S(x, 34) ^ S(x, 39))
+#define Sigma1(x)       (S(x, 14) ^ S(x, 18) ^ S(x, 41))
+#define Gamma0(x)       (S(x, 1) ^ S(x, 8) ^ R(x, 7))
+#define Gamma1(x)       (S(x, 19) ^ S(x, 61) ^ R(x, 6))
+#define RND(a,b,c,d,e,f,g,h,i)\
+		t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i];\
+		t1 = Sigma0(a) + Maj(a, b, c);\
+		d += t0;\
+		h  = t0 + t1;
+#define STORE64H(x, y) \
+	do { \
+		(y)[0] = (unsigned char)(((x)>>56)&255);\
+		(y)[1] = (unsigned char)(((x)>>48)&255);\
+		(y)[2] = (unsigned char)(((x)>>40)&255);\
+		(y)[3] = (unsigned char)(((x)>>32)&255);\
+		(y)[4] = (unsigned char)(((x)>>24)&255);\
+		(y)[5] = (unsigned char)(((x)>>16)&255);\
+		(y)[6] = (unsigned char)(((x)>>8)&255);\
+		(y)[7] = (unsigned char)((x)&255); } while(0)
+
+#define LOAD64H(x, y)\
+	do {x = \
+		(((__u64)((y)[0] & 255)) << 56) |\
+		(((__u64)((y)[1] & 255)) << 48) |\
+		(((__u64)((y)[2] & 255)) << 40) |\
+		(((__u64)((y)[3] & 255)) << 32) |\
+		(((__u64)((y)[4] & 255)) << 24) |\
+		(((__u64)((y)[5] & 255)) << 16) |\
+		(((__u64)((y)[6] & 255)) << 8) |\
+		(((__u64)((y)[7] & 255)));\
+	} while(0)
+
+#define ROR64c(x, y) \
+    ( ((((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((__u64)(y)&CONST64(63))) | \
+      ((x)<<((__u64)(64-((y)&CONST64(63)))))) & CONST64(0xFFFFFFFFFFFFFFFF))
+
+struct sha512_state {
+	__u64  length, state[8];
+	unsigned long curlen;
+	unsigned char buf[128];
+};
+
+/* This is a highly simplified version from libtomcrypt */
+struct hash_state {
+	struct sha512_state sha512;
+};
+
+static void sha512_compress(struct hash_state * md, const unsigned char *buf)
+{
+	__u64 S[8], W[80], t0, t1;
+	int i;
+
+	/* copy state into S */
+	for (i = 0; i < 8; i++) {
+		S[i] = md->sha512.state[i];
+	}
+
+	/* copy the state into 1024-bits into W[0..15] */
+	for (i = 0; i < 16; i++) {
+		LOAD64H(W[i], buf + (8*i));
+	}
+
+	/* fill W[16..79] */
+	for (i = 16; i < 80; i++) {
+		W[i] = Gamma1(W[i - 2]) + W[i - 7] +
+			Gamma0(W[i - 15]) + W[i - 16];
+	}
+
+	for (i = 0; i < 80; i += 8) {
+		RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i+0);
+		RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],i+1);
+		RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],i+2);
+		RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],i+3);
+		RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],i+4);
+		RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],i+5);
+		RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],i+6);
+		RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],i+7);
+	}
+
+	 /* feedback */
+	for (i = 0; i < 8; i++) {
+		md->sha512.state[i] = md->sha512.state[i] + S[i];
+	}
+}
+
+static void sha512_init(struct hash_state * md)
+{
+	md->sha512.curlen = 0;
+	md->sha512.length = 0;
+	md->sha512.state[0] = CONST64(0x6a09e667f3bcc908);
+	md->sha512.state[1] = CONST64(0xbb67ae8584caa73b);
+	md->sha512.state[2] = CONST64(0x3c6ef372fe94f82b);
+	md->sha512.state[3] = CONST64(0xa54ff53a5f1d36f1);
+	md->sha512.state[4] = CONST64(0x510e527fade682d1);
+	md->sha512.state[5] = CONST64(0x9b05688c2b3e6c1f);
+	md->sha512.state[6] = CONST64(0x1f83d9abfb41bd6b);
+	md->sha512.state[7] = CONST64(0x5be0cd19137e2179);
+}
+
+static void sha512_done(struct hash_state * md, unsigned char *out)
+{
+	int i;
+
+	/* increase the length of the message */
+	md->sha512.length += md->sha512.curlen * CONST64(8);
+
+	/* append the '1' bit */
+	md->sha512.buf[md->sha512.curlen++] = (unsigned char)0x80;
+
+	/* if the length is currently above 112 bytes we append zeros then
+	 * compress. Then we can fall back to padding zeros and length encoding
+	 * like normal. */
+	if (md->sha512.curlen > 112) {
+		while (md->sha512.curlen < 128) {
+			md->sha512.buf[md->sha512.curlen++] = (unsigned char)0;
+		}
+		sha512_compress(md, md->sha512.buf);
+		md->sha512.curlen = 0;
+	}
+
+	/* pad up to 120 bytes of zeroes note: that from 112 to 120 is the 64 MSB
+	 * of the length. We assume that you won't hash > 2^64 bits of data. */
+	while (md->sha512.curlen < 120) {
+		md->sha512.buf[md->sha512.curlen++] = (unsigned char)0;
+	}
+
+	/* store length */
+	STORE64H(md->sha512.length, md->sha512.buf + 120);
+	sha512_compress(md, md->sha512.buf);
+
+	/* copy output */
+	for (i = 0; i < 8; i++) {
+		STORE64H(md->sha512.state[i], out+(8 * i));
+	}
+}
+
+#define MIN(x, y) ( ((x)<(y))?(x):(y) )
+#define SHA512_BLOCKSIZE 128
+static void sha512_process(struct hash_state * md,
+			   const unsigned char *in,
+			   unsigned long inlen)
+{
+	unsigned long n;
+
+	while (inlen > 0) {
+		if (md->sha512.curlen == 0 && inlen >= SHA512_BLOCKSIZE) {
+			sha512_compress(md, in);
+			md->sha512.length += SHA512_BLOCKSIZE * 8;
+			in += SHA512_BLOCKSIZE;
+			inlen -= SHA512_BLOCKSIZE;
+		} else {
+			n = MIN(inlen, (SHA512_BLOCKSIZE - md->sha512.curlen));
+			memcpy(md->sha512.buf + md->sha512.curlen,
+			       in, (size_t)n);
+			md->sha512.curlen += n;
+			in += n;
+			inlen -= n;
+			if (md->sha512.curlen == SHA512_BLOCKSIZE) {
+				sha512_compress(md, md->sha512.buf);
+				md->sha512.length += SHA512_BLOCKSIZE * 8;
+				md->sha512.curlen = 0;
+			}
+		}
+	}
+}
+
+void ext2fs_sha512(const unsigned char *in, unsigned long in_size,
+		   unsigned char out[EXT2FS_SHA512_LENGTH])
+{
+	struct hash_state md;
+
+	sha512_init(&md);
+	sha512_process(&md, in, in_size);
+	sha512_done(&md, out);
+}
+
+#ifdef UNITTEST
+static const struct {
+	char *msg;
+	unsigned char hash[64];
+} tests[] = {
+	{ "",
+	  { 0xcf, 0x83, 0xe1, 0x35, 0x7e, 0xef, 0xb8, 0xbd,
+	    0xf1, 0x54, 0x28, 0x50, 0xd6, 0x6d, 0x80, 0x07,
+	    0xd6, 0x20, 0xe4, 0x05, 0x0b, 0x57, 0x15, 0xdc,
+	    0x83, 0xf4, 0xa9, 0x21, 0xd3, 0x6c, 0xe9, 0xce,
+	    0x47, 0xd0, 0xd1, 0x3c, 0x5d, 0x85, 0xf2, 0xb0,
+	    0xff, 0x83, 0x18, 0xd2, 0x87, 0x7e, 0xec, 0x2f,
+	    0x63, 0xb9, 0x31, 0xbd, 0x47, 0x41, 0x7a, 0x81,
+	    0xa5, 0x38, 0x32, 0x7a, 0xf9, 0x27, 0xda, 0x3e }
+	},
+	{ "abc",
+	  { 0xdd, 0xaf, 0x35, 0xa1, 0x93, 0x61, 0x7a, 0xba,
+	    0xcc, 0x41, 0x73, 0x49, 0xae, 0x20, 0x41, 0x31,
+	    0x12, 0xe6, 0xfa, 0x4e, 0x89, 0xa9, 0x7e, 0xa2,
+	    0x0a, 0x9e, 0xee, 0xe6, 0x4b, 0x55, 0xd3, 0x9a,
+	    0x21, 0x92, 0x99, 0x2a, 0x27, 0x4f, 0xc1, 0xa8,
+	    0x36, 0xba, 0x3c, 0x23, 0xa3, 0xfe, 0xeb, 0xbd,
+	    0x45, 0x4d, 0x44, 0x23, 0x64, 0x3c, 0xe8, 0x0e,
+	    0x2a, 0x9a, 0xc9, 0x4f, 0xa5, 0x4c, 0xa4, 0x9f }
+	},
+	{ "abcdefghbcdefghicdefghijdefghijkefghijklfghijklmghijklmnhijklmnoijklmnopjklmnopqklmnopqrlmnopqrsmnopqrstnopqrstu",
+	  { 0x8e, 0x95, 0x9b, 0x75, 0xda, 0xe3, 0x13, 0xda,
+	    0x8c, 0xf4, 0xf7, 0x28, 0x14, 0xfc, 0x14, 0x3f,
+	    0x8f, 0x77, 0x79, 0xc6, 0xeb, 0x9f, 0x7f, 0xa1,
+	    0x72, 0x99, 0xae, 0xad, 0xb6, 0x88, 0x90, 0x18,
+	    0x50, 0x1d, 0x28, 0x9e, 0x49, 0x00, 0xf7, 0xe4,
+	    0x33, 0x1b, 0x99, 0xde, 0xc4, 0xb5, 0x43, 0x3a,
+	    0xc7, 0xd3, 0x29, 0xee, 0xb6, 0xdd, 0x26, 0x54,
+	    0x5e, 0x96, 0xe5, 0x5b, 0x87, 0x4b, 0xe9, 0x09 }
+	},
+};
+
+int main(int argc, char **argv)
+{
+	int i;
+	int errors = 0;
+	unsigned char tmp[64];
+
+	for (i = 0; i < (int)(sizeof(tests) / sizeof(tests[0])); i++) {
+		unsigned char *msg = (unsigned char *) tests[i].msg;
+		int len = strlen(tests[i].msg);
+
+		ext2fs_sha512(msg, len, tmp);
+		printf("SHA512 test message %d: ", i);
+		if (memcmp(tmp, tests[i].hash, 64) != 0) {
+			printf("FAILED\n");
+			errors++;
+		} else
+			printf("OK\n");
+	}
+	return errors;
+}
+
+#endif /* UNITTEST */
diff --git a/lib/ext2fs/sparse_io.c b/lib/ext2fs/sparse_io.c
new file mode 100644
index 0000000..f287e76
--- /dev/null
+++ b/lib/ext2fs/sparse_io.c
@@ -0,0 +1,554 @@
+#include "config.h"
+#include <sys/types.h>
+#include <sys/stat.h>
+#include <fcntl.h>
+#include <unistd.h>
+#include <stdint.h>
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+#ifndef O_BINARY
+#define O_BINARY 0
+#endif
+
+#if !defined(ENABLE_LIBSPARSE)
+static errcode_t sparse_open(const char *name EXT2FS_ATTR((unused)),
+			     int flags EXT2FS_ATTR((unused)),
+			     io_channel *channel EXT2FS_ATTR((unused)))
+{
+	return EXT2_ET_UNIMPLEMENTED;
+}
+static errcode_t sparse_close(io_channel channel EXT2FS_ATTR((unused)))
+{
+	return EXT2_ET_UNIMPLEMENTED;
+}
+static struct struct_io_manager struct_sparse_manager = {
+	.magic			= EXT2_ET_MAGIC_IO_MANAGER,
+	.name			= "Android sparse I/O Manager",
+	.open			= sparse_open,
+	.close			= sparse_close,
+};
+static struct struct_io_manager struct_sparsefd_manager = {
+	.magic			= EXT2_ET_MAGIC_IO_MANAGER,
+	.name			= "Android sparse fd I/O Manager",
+	.open			= sparse_open,
+	.close			= sparse_close,
+};
+#else
+#include <sparse/sparse.h>
+
+struct sparse_map {
+	int			fd;
+	char			**blocks;
+	int			block_size;
+	uint64_t		blocks_count;
+	char			*file;
+	struct sparse_file	*sparse_file;
+	io_channel		channel;
+};
+
+struct sparse_io_params {
+	int			fd;
+	char			*file;
+	uint64_t		blocks_count;
+	unsigned int		block_size;
+};
+
+static errcode_t sparse_write_blk(io_channel channel, unsigned long block,
+				  int count, const void *buf);
+
+static void free_sparse_blocks(struct sparse_map *sm)
+{
+	uint64_t i;
+
+	for (i = 0; i < sm->blocks_count; ++i)
+		free(sm->blocks[i]);
+	free(sm->blocks);
+	sm->blocks = NULL;
+}
+
+static int sparse_import_segment(void *priv, const void *data, size_t len,
+				 unsigned int block, unsigned int nr_blocks)
+{
+	struct sparse_map *sm = priv;
+
+	/* Ignore chunk headers, only write the data */
+	if (!nr_blocks || len % sm->block_size)
+		return 0;
+
+	return sparse_write_blk(sm->channel, block, nr_blocks, data);
+}
+
+static errcode_t io_manager_import_sparse(struct sparse_io_params *params,
+					  struct sparse_map *sm, io_channel io)
+{
+	int fd;
+	errcode_t retval;
+	struct sparse_file *sparse_file;
+
+	if (params->fd < 0) {
+		fd = open(params->file, O_RDONLY);
+		if (fd < 0) {
+			retval = -1;
+			goto err_open;
+		}
+	} else
+		fd = params->fd;
+	sparse_file = sparse_file_import(fd, false, false);
+	if (!sparse_file) {
+		retval = -1;
+		goto err_sparse;
+	}
+
+	sm->block_size = sparse_file_block_size(sparse_file);
+	sm->blocks_count = (sparse_file_len(sparse_file, 0, 0) - 1)
+				/ sm->block_size + 1;
+	sm->blocks = calloc(sm->blocks_count, sizeof(char*));
+	if (!sm->blocks) {
+		retval = -1;
+		goto err_alloc;
+	}
+	io->block_size = sm->block_size;
+
+	retval = sparse_file_foreach_chunk(sparse_file, true, false,
+					   sparse_import_segment, sm);
+
+	if (retval)
+		free_sparse_blocks(sm);
+err_alloc:
+	sparse_file_destroy(sparse_file);
+err_sparse:
+	close(fd);
+err_open:
+	return retval;
+}
+
+static errcode_t io_manager_configure(struct sparse_io_params *params,
+				      int flags, io_channel io)
+{
+	errcode_t retval;
+	uint64_t img_size;
+	struct sparse_map *sm = calloc(1, sizeof(*sm));
+	if (!sm)
+		return EXT2_ET_NO_MEMORY;
+
+	sm->file = params->file;
+	sm->channel = io;
+	io->private_data = sm;
+	retval = io_manager_import_sparse(params, sm, io);
+	if (retval) {
+		if (!params->block_size || !params->blocks_count) {
+			retval = EINVAL;
+			goto err_params;
+		}
+		sm->block_size = params->block_size;
+		sm->blocks_count = params->blocks_count;
+		sm->blocks = calloc(params->blocks_count, sizeof(void*));
+		if (!sm->blocks) {
+			retval = EXT2_ET_NO_MEMORY;
+			goto err_alloc;
+		}
+	}
+	io->block_size = sm->block_size;
+	img_size = (uint64_t)sm->block_size * sm->blocks_count;
+
+	if (flags & IO_FLAG_RW) {
+		sm->sparse_file = sparse_file_new(sm->block_size, img_size);
+		if (!sm->sparse_file) {
+			retval = EXT2_ET_NO_MEMORY;
+			goto err_alloc;
+		}
+		if (params->fd < 0) {
+			sm->fd = open(params->file, O_CREAT | O_RDWR | O_TRUNC | O_BINARY,
+				      0644);
+			if (sm->fd < 0) {
+				retval = errno;
+				goto err_open;
+			}
+		} else
+			sm->fd = params->fd;
+	} else {
+		sm->fd = -1;
+		sm->sparse_file = NULL;
+	}
+	return 0;
+
+err_open:
+	sparse_file_destroy(sm->sparse_file);
+err_alloc:
+	free_sparse_blocks(sm);
+err_params:
+	free(sm);
+	return retval;
+}
+
+static errcode_t sparse_open_channel(struct sparse_io_params *sparse_params,
+				     int flags, io_channel *channel)
+{
+	errcode_t retval;
+	io_channel io;
+
+	io = calloc(1, sizeof(struct struct_io_channel));
+	io->magic = EXT2_ET_MAGIC_IO_CHANNEL;
+	io->block_size = 0;
+	io->refcount = 1;
+
+	retval = io_manager_configure(sparse_params, flags, io);
+	if (retval) {
+		free(io);
+		return retval;
+	}
+
+	*channel = io;
+	return 0;
+}
+
+static errcode_t read_sparse_argv(const char *name, bool is_fd,
+				  struct sparse_io_params *sparse_params)
+{
+	int ret;
+	sparse_params->fd = -1;
+	sparse_params->block_size = 0;
+	sparse_params->blocks_count = 0;
+
+	sparse_params->file = malloc(strlen(name) + 1);
+	if (!sparse_params->file) {
+		fprintf(stderr, "failed to alloc %zu\n", strlen(name) + 1);
+		return EXT2_ET_NO_MEMORY;
+	}
+
+	if (is_fd) {
+		ret = sscanf(name, "(%d):%llu:%u", &sparse_params->fd,
+			     (unsigned long long *)&sparse_params->blocks_count,
+			     &sparse_params->block_size);
+	} else {
+		ret = sscanf(name, "(%[^)])%*[:]%llu%*[:]%u", sparse_params->file,
+			     (unsigned long long *)&sparse_params->blocks_count,
+			     &sparse_params->block_size);
+	}
+
+	if (ret < 1) {
+		free(sparse_params->file);
+		return EINVAL;
+	}
+	return 0;
+}
+
+static errcode_t sparse_open(const char *name, int flags, io_channel *channel)
+{
+	errcode_t retval;
+	struct sparse_io_params sparse_params;
+
+	retval = read_sparse_argv(name, false, &sparse_params);
+	if (retval)
+		return EXT2_ET_BAD_DEVICE_NAME;
+
+	retval = sparse_open_channel(&sparse_params, flags, channel);
+	if (retval)
+		return retval;
+	(*channel)->manager = sparse_io_manager;
+
+	return retval;
+}
+
+static errcode_t sparsefd_open(const char *name, int flags, io_channel *channel)
+{
+	errcode_t retval;
+	struct sparse_io_params sparse_params;
+
+	retval = read_sparse_argv(name, true, &sparse_params);
+	if (retval)
+		return EXT2_ET_BAD_DEVICE_NAME;
+
+	retval = sparse_open_channel(&sparse_params, flags, channel);
+	if (retval)
+		return retval;
+	(*channel)->manager = sparsefd_io_manager;
+
+	return retval;
+}
+
+static errcode_t sparse_merge_blocks(struct sparse_map *sm, uint64_t start,
+					uint64_t num)
+{
+	char *buf;
+	uint64_t i;
+	unsigned int block_size = sm->block_size;
+	errcode_t retval = 0;
+
+	buf = calloc(num, block_size);
+	if (!buf) {
+		fprintf(stderr, "failed to alloc %llu\n",
+			(unsigned long long)num * block_size);
+		return EXT2_ET_NO_MEMORY;
+	}
+
+	for (i = 0; i < num; i++) {
+		memcpy(buf + i * block_size, sm->blocks[start + i] , block_size);
+		free(sm->blocks[start + i]);
+		sm->blocks[start + i] = NULL;
+	}
+
+	/* free_sparse_blocks will release this buf. */
+	sm->blocks[start] = buf;
+
+	retval = sparse_file_add_data(sm->sparse_file, sm->blocks[start],
+					block_size * num, start);
+
+	return retval;
+}
+
+static errcode_t sparse_close_channel(io_channel channel)
+{
+	uint64_t i;
+	errcode_t retval = 0;
+	struct sparse_map *sm = channel->private_data;
+
+	if (sm->sparse_file) {
+		int64_t chunk_start = (sm->blocks[0] == NULL) ? -1 : 0;
+		for (i = 0; i < sm->blocks_count; ++i) {
+			if (!sm->blocks[i] && chunk_start != -1) {
+				retval = sparse_merge_blocks(sm, chunk_start, i - chunk_start);
+				chunk_start = -1;
+			} else if (sm->blocks[i] && chunk_start == -1) {
+				chunk_start = i;
+			}
+			if (retval)
+				goto ret;
+		}
+		if (chunk_start != -1) {
+			retval = sparse_merge_blocks(sm, chunk_start,
+							sm->blocks_count - chunk_start);
+			if (retval)
+				goto ret;
+		}
+		retval = sparse_file_write(sm->sparse_file, sm->fd,
+					   /*gzip*/0, /*sparse*/1, /*crc*/0);
+	}
+
+ret:
+	if (sm->sparse_file)
+		sparse_file_destroy(sm->sparse_file);
+	free_sparse_blocks(sm);
+	free(sm->file);
+	free(sm);
+	free(channel);
+	return retval;
+}
+
+static errcode_t sparse_close(io_channel channel)
+{
+	errcode_t retval;
+	struct sparse_map *sm = channel->private_data;
+	int fd = sm->fd;
+
+	retval = sparse_close_channel(channel);
+	if (fd >= 0)
+		close(fd);
+
+	return retval;
+}
+
+static errcode_t sparse_set_blksize(io_channel channel, int blksize)
+{
+	channel->block_size = blksize;
+	return 0;
+}
+
+static blk64_t block_to_sparse_block(blk64_t block, blk64_t *offset,
+			       io_channel channel, struct sparse_map *sm)
+{
+	int ratio;
+	blk64_t ret = block;
+
+	ratio = sm->block_size / channel->block_size;
+	ret /= ratio;
+	*offset = (block % ratio) * channel->block_size;
+
+	return ret;
+}
+
+static errcode_t check_block_size(io_channel channel, struct sparse_map *sm)
+{
+	if (sm->block_size >= channel->block_size)
+		return 0;
+	return EXT2_ET_UNEXPECTED_BLOCK_SIZE;
+}
+
+static errcode_t sparse_read_blk64(io_channel channel, blk64_t block,
+				   int count, void *buf)
+{
+	int i;
+	char *out = buf;
+	blk64_t offset = 0, cur_block;
+	struct sparse_map *sm = channel->private_data;
+
+	if (check_block_size(channel, sm))
+		return EXT2_ET_UNEXPECTED_BLOCK_SIZE;
+
+	if (count < 0) { //partial read
+		count = -count;
+		cur_block = block_to_sparse_block(block, &offset, channel, sm);
+		if (sm->blocks[cur_block])
+			memcpy(out, (sm->blocks[cur_block]) + offset, count);
+		else
+			memset(out, 0, count);
+	} else {
+		for (i = 0; i < count; ++i) {
+			cur_block = block_to_sparse_block(block + i, &offset,
+						    channel, sm);
+			if (sm->blocks[cur_block])
+				memcpy(out + (i * channel->block_size),
+				       sm->blocks[cur_block] + offset,
+				       channel->block_size);
+			else if (sm->blocks)
+				memset(out + (i * channel->block_size), 0,
+				       channel->block_size);
+		}
+	}
+	return 0;
+}
+
+static errcode_t sparse_read_blk(io_channel channel, unsigned long block,
+				 int count, void *buf)
+{
+	return sparse_read_blk64(channel, block, count, buf);
+}
+
+static errcode_t sparse_write_blk64(io_channel channel, blk64_t block,
+				    int count, const void *buf)
+{
+	int i;
+	blk64_t offset = 0, cur_block;
+	const char *in = buf;
+	struct sparse_map *sm = channel->private_data;
+
+	if (check_block_size(channel, sm))
+		return EXT2_ET_UNEXPECTED_BLOCK_SIZE;
+
+	if (count < 0) { //partial write
+		count = -count;
+		cur_block = block_to_sparse_block(block, &offset, channel,
+						  sm);
+		if (!sm->blocks[cur_block]) {
+			sm->blocks[cur_block] = calloc(1, sm->block_size);
+			if (!sm->blocks[cur_block])
+				return EXT2_ET_NO_MEMORY;
+		}
+		memcpy(sm->blocks[cur_block] + offset, in, count);
+	} else {
+		for (i = 0; i < count; ++i) {
+			if (block + i >= sm->blocks_count)
+				return 0;
+			cur_block = block_to_sparse_block(block + i, &offset,
+						    channel, sm);
+			if (!sm->blocks[cur_block]) {
+				sm->blocks[cur_block] =
+					calloc(1, sm->block_size);
+				if (!sm->blocks[cur_block])
+					return EXT2_ET_NO_MEMORY;
+			}
+			memcpy(sm->blocks[cur_block] + offset,
+			       in + (i * channel->block_size),
+			       channel->block_size);
+		}
+	}
+	return 0;
+}
+
+static errcode_t sparse_write_blk(io_channel channel, unsigned long block,
+				  int count, const void *buf)
+{
+	return sparse_write_blk64(channel, block, count, buf);
+}
+
+static errcode_t sparse_discard(io_channel channel __attribute__((unused)),
+				blk64_t blk, unsigned long long count)
+{
+	blk64_t cur_block, offset;
+	struct sparse_map *sm = channel->private_data;
+
+	if (check_block_size(channel, sm))
+		return EXT2_ET_UNEXPECTED_BLOCK_SIZE;
+
+	for (unsigned long long i = 0; i < count; ++i) {
+		if (blk + i >= sm->blocks_count)
+			return 0;
+		cur_block = block_to_sparse_block(blk + i, &offset, channel,
+						  sm);
+		if (!sm->blocks[cur_block])
+			continue;
+		free(sm->blocks[cur_block]);
+		sm->blocks[cur_block] = NULL;
+	}
+	return 0;
+}
+
+static errcode_t sparse_zeroout(io_channel channel, blk64_t blk,
+				unsigned long long count)
+{
+	return sparse_discard(channel, blk, count);
+}
+
+static errcode_t sparse_flush(io_channel channel __attribute__((unused)))
+{
+	return 0;
+}
+
+static errcode_t sparse_set_option(io_channel channel __attribute__((unused)),
+                                   const char *option __attribute__((unused)),
+                                   const char *arg __attribute__((unused)))
+{
+	return 0;
+}
+
+static errcode_t sparse_cache_readahead(
+			io_channel channel __attribute__((unused)),
+			blk64_t blk __attribute__((unused)),
+			unsigned long long count __attribute__((unused)))
+{
+	return 0;
+}
+
+static struct struct_io_manager struct_sparse_manager = {
+	.magic			= EXT2_ET_MAGIC_IO_MANAGER,
+	.name			= "Android sparse I/O Manager",
+	.open			= sparse_open,
+	.close			= sparse_close,
+	.set_blksize		= sparse_set_blksize,
+	.read_blk		= sparse_read_blk,
+	.write_blk		= sparse_write_blk,
+	.flush			= sparse_flush,
+	.write_byte		= NULL,
+	.set_option		= sparse_set_option,
+	.get_stats		= NULL,
+	.read_blk64		= sparse_read_blk64,
+	.write_blk64		= sparse_write_blk64,
+	.discard		= sparse_discard,
+	.cache_readahead	= sparse_cache_readahead,
+	.zeroout		= sparse_zeroout,
+};
+
+static struct struct_io_manager struct_sparsefd_manager = {
+	.magic			= EXT2_ET_MAGIC_IO_MANAGER,
+	.name			= "Android sparse fd I/O Manager",
+	.open			= sparsefd_open,
+	.close			= sparse_close,
+	.set_blksize		= sparse_set_blksize,
+	.read_blk		= sparse_read_blk,
+	.write_blk		= sparse_write_blk,
+	.flush			= sparse_flush,
+	.write_byte		= NULL,
+	.set_option		= sparse_set_option,
+	.get_stats		= NULL,
+	.read_blk64		= sparse_read_blk64,
+	.write_blk64		= sparse_write_blk64,
+	.discard		= sparse_discard,
+	.cache_readahead	= sparse_cache_readahead,
+	.zeroout		= sparse_zeroout,
+};
+
+#endif
+
+io_manager sparse_io_manager = &struct_sparse_manager;
+io_manager sparsefd_io_manager = &struct_sparsefd_manager;
diff --git a/lib/ext2fs/swapfs.c b/lib/ext2fs/swapfs.c
new file mode 100644
index 0000000..fe764b9
--- /dev/null
+++ b/lib/ext2fs/swapfs.c
@@ -0,0 +1,491 @@
+/*
+ * swapfs.c --- swap ext2 filesystem data structures
+ *
+ * Copyright (C) 1995, 1996, 2002 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <string.h>
+#include <time.h>
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+#include "ext2fsP.h"
+#include <ext2fs/ext2_ext_attr.h>
+
+void ext2fs_swap_super(struct ext2_super_block * sb)
+{
+	int i;
+
+	sb->s_inodes_count = ext2fs_swab32(sb->s_inodes_count);
+	sb->s_blocks_count = ext2fs_swab32(sb->s_blocks_count);
+	sb->s_r_blocks_count = ext2fs_swab32(sb->s_r_blocks_count);
+	sb->s_free_blocks_count = ext2fs_swab32(sb->s_free_blocks_count);
+	sb->s_free_inodes_count = ext2fs_swab32(sb->s_free_inodes_count);
+	sb->s_first_data_block = ext2fs_swab32(sb->s_first_data_block);
+	sb->s_log_block_size = ext2fs_swab32(sb->s_log_block_size);
+	sb->s_log_cluster_size = ext2fs_swab32(sb->s_log_cluster_size);
+	sb->s_blocks_per_group = ext2fs_swab32(sb->s_blocks_per_group);
+	sb->s_clusters_per_group = ext2fs_swab32(sb->s_clusters_per_group);
+	sb->s_inodes_per_group = ext2fs_swab32(sb->s_inodes_per_group);
+	sb->s_mtime = ext2fs_swab32(sb->s_mtime);
+	sb->s_wtime = ext2fs_swab32(sb->s_wtime);
+	sb->s_mnt_count = ext2fs_swab16(sb->s_mnt_count);
+	sb->s_max_mnt_count = ext2fs_swab16(sb->s_max_mnt_count);
+	sb->s_magic = ext2fs_swab16(sb->s_magic);
+	sb->s_state = ext2fs_swab16(sb->s_state);
+	sb->s_errors = ext2fs_swab16(sb->s_errors);
+	sb->s_minor_rev_level = ext2fs_swab16(sb->s_minor_rev_level);
+	sb->s_lastcheck = ext2fs_swab32(sb->s_lastcheck);
+	sb->s_checkinterval = ext2fs_swab32(sb->s_checkinterval);
+	sb->s_creator_os = ext2fs_swab32(sb->s_creator_os);
+	sb->s_rev_level = ext2fs_swab32(sb->s_rev_level);
+	sb->s_def_resuid = ext2fs_swab16(sb->s_def_resuid);
+	sb->s_def_resgid = ext2fs_swab16(sb->s_def_resgid);
+	sb->s_first_ino = ext2fs_swab32(sb->s_first_ino);
+	sb->s_inode_size = ext2fs_swab16(sb->s_inode_size);
+	sb->s_block_group_nr = ext2fs_swab16(sb->s_block_group_nr);
+	sb->s_feature_compat = ext2fs_swab32(sb->s_feature_compat);
+	sb->s_feature_incompat = ext2fs_swab32(sb->s_feature_incompat);
+	sb->s_feature_ro_compat = ext2fs_swab32(sb->s_feature_ro_compat);
+	/* sb->s_uuid is __u8 and does not need swabbing */
+	/* sb->s_volume_name is char and does not need swabbing */
+	/* sb->s_last_mounted is char and does not need swabbing */
+	sb->s_algorithm_usage_bitmap = ext2fs_swab32(sb->s_algorithm_usage_bitmap);
+	/* sb->s_prealloc_blocks is __u8 and does not need swabbing */
+	/* sb->s_prealloc_dir_blocks is __u8 and does not need swabbing */
+	sb->s_reserved_gdt_blocks = ext2fs_swab16(sb->s_reserved_gdt_blocks);
+	/* sb->s_journal_uuid is __u8 and does not need swabbing */
+	sb->s_journal_inum = ext2fs_swab32(sb->s_journal_inum);
+	sb->s_journal_dev = ext2fs_swab32(sb->s_journal_dev);
+	sb->s_last_orphan = ext2fs_swab32(sb->s_last_orphan);
+	for (i = 0; i < 4; i++)
+		sb->s_hash_seed[i] = ext2fs_swab32(sb->s_hash_seed[i]);
+	/* sb->s_def_hash_version is __u8 and does not need swabbing */
+	/* sb->s_jnl_backup_type is __u8 and does not need swabbing */
+	sb->s_desc_size = ext2fs_swab16(sb->s_desc_size);
+	sb->s_default_mount_opts = ext2fs_swab32(sb->s_default_mount_opts);
+	sb->s_first_meta_bg = ext2fs_swab32(sb->s_first_meta_bg);
+	sb->s_mkfs_time = ext2fs_swab32(sb->s_mkfs_time);
+	/* if journal backup is for a valid extent-based journal... */
+	if (ext2fs_extent_header_verify(sb->s_jnl_blocks,
+					sizeof(sb->s_jnl_blocks)) == 0) {
+		/* ... swap only the journal i_size and i_size_high,
+		 * and the extent data is not swapped on read */
+		i = 15;
+	} else {
+		/* direct/indirect journal: swap it all */
+		i = 0;
+	}
+	for (; i < 17; i++)
+		sb->s_jnl_blocks[i] = ext2fs_swab32(sb->s_jnl_blocks[i]);
+	sb->s_blocks_count_hi = ext2fs_swab32(sb->s_blocks_count_hi);
+	sb->s_r_blocks_count_hi = ext2fs_swab32(sb->s_r_blocks_count_hi);
+	sb->s_free_blocks_hi = ext2fs_swab32(sb->s_free_blocks_hi);
+	sb->s_min_extra_isize = ext2fs_swab16(sb->s_min_extra_isize);
+	sb->s_want_extra_isize = ext2fs_swab16(sb->s_want_extra_isize);
+	sb->s_flags = ext2fs_swab32(sb->s_flags);
+	sb->s_raid_stride = ext2fs_swab16(sb->s_raid_stride);
+	sb->s_mmp_update_interval = ext2fs_swab16(sb->s_mmp_update_interval);
+	sb->s_mmp_block = ext2fs_swab64(sb->s_mmp_block);
+	sb->s_raid_stripe_width = ext2fs_swab32(sb->s_raid_stripe_width);
+	/* sb->s_log_groups_per_flex is __u8 and does not need swabbing */
+	/* sb->s_checksum_type is __u8 and does not need swabbing */
+	/* sb->s_encryption_level is __u8 and does not need swabbing */
+	/* sb->s_reserved_pad is __u8 and does not need swabbing */
+	sb->s_kbytes_written = ext2fs_swab64(sb->s_kbytes_written);
+	sb->s_snapshot_inum = ext2fs_swab32(sb->s_snapshot_inum);
+	sb->s_snapshot_id = ext2fs_swab32(sb->s_snapshot_id);
+	sb->s_snapshot_r_blocks_count =
+		ext2fs_swab64(sb->s_snapshot_r_blocks_count);
+	sb->s_snapshot_list = ext2fs_swab32(sb->s_snapshot_list);
+	sb->s_error_count = ext2fs_swab32(sb->s_error_count);
+	sb->s_first_error_time = ext2fs_swab32(sb->s_first_error_time);
+	sb->s_first_error_ino = ext2fs_swab32(sb->s_first_error_ino);
+	sb->s_first_error_block = ext2fs_swab64(sb->s_first_error_block);
+	/* sb->s_first_error_func is __u8 and does not need swabbing */
+	sb->s_last_error_time = ext2fs_swab32(sb->s_last_error_time);
+	sb->s_last_error_ino = ext2fs_swab32(sb->s_last_error_ino);
+	sb->s_last_error_block = ext2fs_swab64(sb->s_last_error_block);
+	/* sb->s_last_error_func is __u8 and does not need swabbing */
+	/* sb->s_mount_opts is __u8 and does not need swabbing */
+	sb->s_usr_quota_inum = ext2fs_swab32(sb->s_usr_quota_inum);
+	sb->s_grp_quota_inum = ext2fs_swab32(sb->s_grp_quota_inum);
+	sb->s_overhead_clusters = ext2fs_swab32(sb->s_overhead_clusters);
+	sb->s_backup_bgs[0] = ext2fs_swab32(sb->s_backup_bgs[0]);
+	sb->s_backup_bgs[1] = ext2fs_swab32(sb->s_backup_bgs[1]);
+	/* sb->s_encrypt_algos is __u8 and does not need swabbing */
+	/* sb->s_encrypt_pw_salt is __u8 and does not need swabbing */
+	sb->s_lpf_ino = ext2fs_swab32(sb->s_lpf_ino);
+	sb->s_prj_quota_inum = ext2fs_swab32(sb->s_prj_quota_inum);
+	sb->s_checksum_seed = ext2fs_swab32(sb->s_checksum_seed);
+	/* s_*_time_hi are __u8 and does not need swabbing */
+	sb->s_encoding = ext2fs_swab16(sb->s_encoding);
+	sb->s_encoding_flags = ext2fs_swab16(sb->s_encoding_flags);
+	sb->s_orphan_file_inum = ext2fs_swab32(sb->s_orphan_file_inum);
+	/* catch when new fields are used from s_reserved */
+	EXT2FS_BUILD_BUG_ON(sizeof(sb->s_reserved) != 94 * sizeof(__le32));
+	sb->s_checksum = ext2fs_swab32(sb->s_checksum);
+}
+
+void ext2fs_swap_group_desc2(ext2_filsys fs, struct ext2_group_desc *gdp)
+{
+	struct ext4_group_desc *gdp4 = (struct ext4_group_desc *)gdp;
+
+	/* Do the 32-bit parts first */
+	gdp->bg_block_bitmap = ext2fs_swab32(gdp->bg_block_bitmap);
+	gdp->bg_inode_bitmap = ext2fs_swab32(gdp->bg_inode_bitmap);
+	gdp->bg_inode_table = ext2fs_swab32(gdp->bg_inode_table);
+	gdp->bg_free_blocks_count = ext2fs_swab16(gdp->bg_free_blocks_count);
+	gdp->bg_free_inodes_count = ext2fs_swab16(gdp->bg_free_inodes_count);
+	gdp->bg_used_dirs_count = ext2fs_swab16(gdp->bg_used_dirs_count);
+	gdp->bg_flags = ext2fs_swab16(gdp->bg_flags);
+	gdp->bg_exclude_bitmap_lo = ext2fs_swab32(gdp->bg_exclude_bitmap_lo);
+	gdp->bg_block_bitmap_csum_lo =
+		ext2fs_swab16(gdp->bg_block_bitmap_csum_lo);
+	gdp->bg_inode_bitmap_csum_lo =
+		ext2fs_swab16(gdp->bg_inode_bitmap_csum_lo);
+	gdp->bg_itable_unused = ext2fs_swab16(gdp->bg_itable_unused);
+	gdp->bg_checksum = ext2fs_swab16(gdp->bg_checksum);
+	/* If we're 32-bit, we're done */
+	if (fs == NULL || EXT2_DESC_SIZE(fs->super) < EXT2_MIN_DESC_SIZE_64BIT)
+		return;
+
+	/* Swap the 64-bit parts */
+	gdp4->bg_block_bitmap_hi = ext2fs_swab32(gdp4->bg_block_bitmap_hi);
+	gdp4->bg_inode_bitmap_hi = ext2fs_swab32(gdp4->bg_inode_bitmap_hi);
+	gdp4->bg_inode_table_hi = ext2fs_swab32(gdp4->bg_inode_table_hi);
+	gdp4->bg_free_blocks_count_hi =
+		ext2fs_swab16(gdp4->bg_free_blocks_count_hi);
+	gdp4->bg_free_inodes_count_hi =
+		ext2fs_swab16(gdp4->bg_free_inodes_count_hi);
+	gdp4->bg_used_dirs_count_hi =
+		ext2fs_swab16(gdp4->bg_used_dirs_count_hi);
+	gdp4->bg_itable_unused_hi = ext2fs_swab16(gdp4->bg_itable_unused_hi);
+	gdp4->bg_exclude_bitmap_hi = ext2fs_swab16(gdp4->bg_exclude_bitmap_hi);
+	gdp4->bg_block_bitmap_csum_hi =
+		ext2fs_swab16(gdp4->bg_block_bitmap_csum_hi);
+	gdp4->bg_inode_bitmap_csum_hi =
+		ext2fs_swab16(gdp4->bg_inode_bitmap_csum_hi);
+	EXT2FS_BUILD_BUG_ON(sizeof(gdp4->bg_reserved) != sizeof(__u32));
+}
+
+void ext2fs_swap_group_desc(struct ext2_group_desc *gdp)
+{
+	ext2fs_swap_group_desc2(0, gdp);
+}
+
+
+void ext2fs_swap_ext_attr_header(struct ext2_ext_attr_header *to_header,
+				 struct ext2_ext_attr_header *from_header)
+{
+	int n;
+
+	to_header->h_magic    = ext2fs_swab32(from_header->h_magic);
+	to_header->h_blocks   = ext2fs_swab32(from_header->h_blocks);
+	to_header->h_refcount = ext2fs_swab32(from_header->h_refcount);
+	to_header->h_hash     = ext2fs_swab32(from_header->h_hash);
+	to_header->h_checksum = ext2fs_swab32(from_header->h_checksum);
+	for (n = 0; n < 3; n++)
+		to_header->h_reserved[n] =
+			ext2fs_swab32(from_header->h_reserved[n]);
+}
+
+void ext2fs_swap_ext_attr_entry(struct ext2_ext_attr_entry *to_entry,
+				struct ext2_ext_attr_entry *from_entry)
+{
+	to_entry->e_value_offs  = ext2fs_swab16(from_entry->e_value_offs);
+	to_entry->e_value_inum  = ext2fs_swab32(from_entry->e_value_inum);
+	to_entry->e_value_size  = ext2fs_swab32(from_entry->e_value_size);
+	to_entry->e_hash	= ext2fs_swab32(from_entry->e_hash);
+}
+
+void ext2fs_swap_ext_attr(char *to, char *from, int bufsize, int has_header)
+{
+	struct ext2_ext_attr_header *from_header =
+		(struct ext2_ext_attr_header *)from;
+	struct ext2_ext_attr_header *to_header =
+		(struct ext2_ext_attr_header *)to;
+	struct ext2_ext_attr_entry *from_entry, *to_entry;
+	char *from_end = (char *)from_header + bufsize;
+
+	if (to_header != from_header)
+		memcpy(to_header, from_header, bufsize);
+
+	if (has_header) {
+		ext2fs_swap_ext_attr_header(to_header, from_header);
+
+		from_entry = (struct ext2_ext_attr_entry *)(from_header+1);
+		to_entry   = (struct ext2_ext_attr_entry *)(to_header+1);
+	} else {
+		from_entry = (struct ext2_ext_attr_entry *)from_header;
+		to_entry   = (struct ext2_ext_attr_entry *)to_header;
+	}
+
+	while ((char *)from_entry < from_end &&
+	       (char *)EXT2_EXT_ATTR_NEXT(from_entry) <= from_end &&
+	       *(__u32 *)from_entry) {
+		ext2fs_swap_ext_attr_entry(to_entry, from_entry);
+		from_entry = EXT2_EXT_ATTR_NEXT(from_entry);
+		to_entry   = EXT2_EXT_ATTR_NEXT(to_entry);
+	}
+}
+
+void ext2fs_swap_inode_full(ext2_filsys fs, struct ext2_inode_large *t,
+			    struct ext2_inode_large *f, int hostorder,
+			    int bufsize)
+{
+	unsigned i, extra_isize, attr_magic;
+	int has_extents = 0, has_inline_data = 0, islnk = 0, fast_symlink = 0;
+	unsigned int inode_size;
+	__u32 *eaf, *eat;
+
+	/*
+	 * Note that t and f may point to the same address. That's why
+	 * if (hostorder) condition is executed before swab calls and
+	 * if (!hostorder) afterwards.
+	 */
+	if (hostorder) {
+		islnk = LINUX_S_ISLNK(f->i_mode);
+		fast_symlink = ext2fs_is_fast_symlink(EXT2_INODE(f));
+		has_extents = (f->i_flags & EXT4_EXTENTS_FL) != 0;
+		has_inline_data = (f->i_flags & EXT4_INLINE_DATA_FL) != 0;
+	}
+
+	t->i_mode = ext2fs_swab16(f->i_mode);
+	t->i_uid = ext2fs_swab16(f->i_uid);
+	t->i_size = ext2fs_swab32(f->i_size);
+	t->i_atime = ext2fs_swab32(f->i_atime);
+	t->i_ctime = ext2fs_swab32(f->i_ctime);
+	t->i_mtime = ext2fs_swab32(f->i_mtime);
+	t->i_dtime = ext2fs_swab32(f->i_dtime);
+	t->i_gid = ext2fs_swab16(f->i_gid);
+	t->i_links_count = ext2fs_swab16(f->i_links_count);
+	t->i_file_acl = ext2fs_swab32(f->i_file_acl);
+	t->i_blocks = ext2fs_swab32(f->i_blocks);
+	t->i_flags = ext2fs_swab32(f->i_flags);
+	t->i_size_high = ext2fs_swab32(f->i_size_high);
+
+	if (!hostorder) {
+		islnk = LINUX_S_ISLNK(t->i_mode);
+		fast_symlink = ext2fs_is_fast_symlink(EXT2_INODE(t));
+		has_extents = (t->i_flags & EXT4_EXTENTS_FL) != 0;
+		has_inline_data = (t->i_flags & EXT4_INLINE_DATA_FL) != 0;
+	}
+
+	/*
+	 * Extent data and inline data are swapped on access, not here
+	 */
+	if (!has_extents && !has_inline_data && (!islnk || !fast_symlink)) {
+		for (i = 0; i < EXT2_N_BLOCKS; i++)
+			t->i_block[i] = ext2fs_swab32(f->i_block[i]);
+	} else if (t != f) {
+		for (i = 0; i < EXT2_N_BLOCKS; i++)
+			t->i_block[i] = f->i_block[i];
+	}
+	t->i_generation = ext2fs_swab32(f->i_generation);
+	t->i_faddr = ext2fs_swab32(f->i_faddr);
+
+	switch (fs->super->s_creator_os) {
+	case EXT2_OS_LINUX:
+		t->osd1.linux1.l_i_version =
+			ext2fs_swab32(f->osd1.linux1.l_i_version);
+		t->osd2.linux2.l_i_blocks_hi =
+			ext2fs_swab16(f->osd2.linux2.l_i_blocks_hi);
+		t->osd2.linux2.l_i_file_acl_high =
+			ext2fs_swab16(f->osd2.linux2.l_i_file_acl_high);
+		t->osd2.linux2.l_i_uid_high =
+		  ext2fs_swab16 (f->osd2.linux2.l_i_uid_high);
+		t->osd2.linux2.l_i_gid_high =
+		  ext2fs_swab16 (f->osd2.linux2.l_i_gid_high);
+		t->osd2.linux2.l_i_checksum_lo =
+			ext2fs_swab16(f->osd2.linux2.l_i_checksum_lo);
+		break;
+	case EXT2_OS_HURD:
+		t->osd1.hurd1.h_i_translator =
+		  ext2fs_swab32 (f->osd1.hurd1.h_i_translator);
+		t->osd2.hurd2.h_i_frag = f->osd2.hurd2.h_i_frag;
+		t->osd2.hurd2.h_i_fsize = f->osd2.hurd2.h_i_fsize;
+		t->osd2.hurd2.h_i_mode_high =
+		  ext2fs_swab16 (f->osd2.hurd2.h_i_mode_high);
+		t->osd2.hurd2.h_i_uid_high =
+		  ext2fs_swab16 (f->osd2.hurd2.h_i_uid_high);
+		t->osd2.hurd2.h_i_gid_high =
+		  ext2fs_swab16 (f->osd2.hurd2.h_i_gid_high);
+		t->osd2.hurd2.h_i_author =
+		  ext2fs_swab32 (f->osd2.hurd2.h_i_author);
+		break;
+	default:
+		break;
+	}
+
+	if (bufsize < (int) (sizeof(struct ext2_inode) + sizeof(__u16)))
+		return; /* no i_extra_isize field */
+
+	if (hostorder)
+		extra_isize = f->i_extra_isize;
+	t->i_extra_isize = ext2fs_swab16(f->i_extra_isize);
+	if (!hostorder)
+		extra_isize = t->i_extra_isize;
+	if (extra_isize > EXT2_INODE_SIZE(fs->super) -
+				sizeof(struct ext2_inode)) {
+		/* this is error case: i_extra_size is too large */
+		return;
+	}
+	if (extra_isize & 3)
+		return;		/* Illegal inode extra_isize */
+
+	inode_size = EXT2_GOOD_OLD_INODE_SIZE + extra_isize;
+	if (inode_includes(inode_size, i_checksum_hi))
+		t->i_checksum_hi = ext2fs_swab16(f->i_checksum_hi);
+	if (inode_includes(inode_size, i_ctime_extra))
+		t->i_ctime_extra = ext2fs_swab32(f->i_ctime_extra);
+	if (inode_includes(inode_size, i_mtime_extra))
+		t->i_mtime_extra = ext2fs_swab32(f->i_mtime_extra);
+	if (inode_includes(inode_size, i_atime_extra))
+		t->i_atime_extra = ext2fs_swab32(f->i_atime_extra);
+	if (inode_includes(inode_size, i_crtime))
+		t->i_crtime = ext2fs_swab32(f->i_crtime);
+	if (inode_includes(inode_size, i_crtime_extra))
+		t->i_crtime_extra = ext2fs_swab32(f->i_crtime_extra);
+	if (inode_includes(inode_size, i_version_hi))
+		t->i_version_hi = ext2fs_swab32(f->i_version_hi);
+	if (inode_includes(inode_size, i_projid))
+                t->i_projid = ext2fs_swab32(f->i_projid);
+	/* catch new static fields added after i_projid */
+	EXT2FS_BUILD_BUG_ON(sizeof(struct ext2_inode_large) != 160);
+
+	i = sizeof(struct ext2_inode) + extra_isize + sizeof(__u32);
+	if (bufsize < (int) i)
+		return; /* no space for EA magic */
+
+	eaf = (__u32 *) (((char *) f) + sizeof(struct ext2_inode) +
+					extra_isize);
+
+	attr_magic = *eaf;
+	if (!hostorder)
+		attr_magic = ext2fs_swab32(attr_magic);
+
+	if (attr_magic != EXT2_EXT_ATTR_MAGIC)
+		return; /* it seems no magic here */
+
+	eat = (__u32 *) (((char *) t) + sizeof(struct ext2_inode) +
+					extra_isize);
+	*eat = ext2fs_swab32(*eaf);
+
+	/* convert EA(s) */
+	ext2fs_swap_ext_attr((char *) (eat + 1), (char *) (eaf + 1),
+			     bufsize - sizeof(struct ext2_inode) -
+			     extra_isize - sizeof(__u32), 0);
+
+}
+
+void ext2fs_swap_inode(ext2_filsys fs, struct ext2_inode *t,
+		       struct ext2_inode *f, int hostorder)
+{
+	ext2fs_swap_inode_full(fs, (struct ext2_inode_large *) t,
+				(struct ext2_inode_large *) f, hostorder,
+				sizeof(struct ext2_inode));
+}
+
+void ext2fs_swap_mmp(struct mmp_struct *mmp)
+{
+	mmp->mmp_magic = ext2fs_swab32(mmp->mmp_magic);
+	mmp->mmp_seq = ext2fs_swab32(mmp->mmp_seq);
+	mmp->mmp_time = ext2fs_swab64(mmp->mmp_time);
+	mmp->mmp_check_interval = ext2fs_swab16(mmp->mmp_check_interval);
+	mmp->mmp_checksum = ext2fs_swab32(mmp->mmp_checksum);
+}
+
+errcode_t ext2fs_dirent_swab_in(ext2_filsys fs, char *buf, int flags)
+{
+	return ext2fs_dirent_swab_in2(fs, buf, fs->blocksize, flags);
+}
+
+errcode_t ext2fs_dirent_swab_in2(ext2_filsys fs, char *buf,
+				 size_t size, int flags)
+{
+	errcode_t	retval;
+	char		*p, *end;
+	struct ext2_dir_entry *dirent;
+	unsigned int	name_len, rec_len, left;
+
+	p = (char *) buf;
+	end = (char *) buf + size;
+	left = size;
+	while (p < end-8) {
+		dirent = (struct ext2_dir_entry *) p;
+		dirent->inode = ext2fs_swab32(dirent->inode);
+		dirent->rec_len = ext2fs_swab16(dirent->rec_len);
+		dirent->name_len = ext2fs_swab16(dirent->name_len);
+		name_len = dirent->name_len;
+		if (flags & EXT2_DIRBLOCK_V2_STRUCT)
+			dirent->name_len = ext2fs_swab16(dirent->name_len);
+		retval = ext2fs_get_rec_len(fs, dirent, &rec_len);
+		if (retval)
+			return retval;
+		if ((rec_len < 8) || (rec_len % 4)) {
+			rec_len = 8;
+			if (!(fs->flags & EXT2_FLAG_IGNORE_SWAP_DIRENT))
+				return EXT2_ET_DIR_CORRUPTED;
+		} else if (((name_len & 0xFF) + 8) > rec_len)
+			if (!(fs->flags & EXT2_FLAG_IGNORE_SWAP_DIRENT))
+				return EXT2_ET_DIR_CORRUPTED;
+		if (rec_len > left)
+			if (!(fs->flags & EXT2_FLAG_IGNORE_SWAP_DIRENT))
+				return EXT2_ET_DIR_CORRUPTED;
+		left -= rec_len;
+		p += rec_len;
+	}
+
+	return 0;
+}
+
+errcode_t ext2fs_dirent_swab_out(ext2_filsys fs, char *buf, int flags)
+{
+	return ext2fs_dirent_swab_out2(fs, buf, fs->blocksize, flags);
+}
+
+errcode_t ext2fs_dirent_swab_out2(ext2_filsys fs, char *buf,
+				  size_t size, int flags)
+{
+	errcode_t	retval;
+	char		*p, *end;
+	unsigned int	rec_len;
+	struct ext2_dir_entry *dirent;
+
+	p = buf;
+	end = buf + size;
+	while (p < end) {
+		dirent = (struct ext2_dir_entry *) p;
+		retval = ext2fs_get_rec_len(fs, dirent, &rec_len);
+		if (retval)
+			return retval;
+		if ((rec_len < 8) ||
+		    (rec_len % 4)) {
+			ext2fs_free_mem(&buf);
+			return EXT2_ET_DIR_CORRUPTED;
+		}
+		p += rec_len;
+		dirent->inode = ext2fs_swab32(dirent->inode);
+		dirent->rec_len = ext2fs_swab16(dirent->rec_len);
+		dirent->name_len = ext2fs_swab16(dirent->name_len);
+		if (rec_len > size)
+			return EXT2_ET_DIR_CORRUPTED;
+		size -= rec_len;
+
+		if (flags & EXT2_DIRBLOCK_V2_STRUCT)
+			dirent->name_len = ext2fs_swab16(dirent->name_len);
+	}
+
+	return 0;
+}
diff --git a/lib/ext2fs/symlink.c b/lib/ext2fs/symlink.c
new file mode 100644
index 0000000..a66fb7e
--- /dev/null
+++ b/lib/ext2fs/symlink.c
@@ -0,0 +1,212 @@
+/*
+ * symlink.c --- make a symlink in the filesystem, based on mkdir.c
+ *
+ * Copyright (c) 2012, Intel Corporation.
+ * All Rights Reserved.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+#ifndef HAVE_STRNLEN
+/*
+ * Incredibly, libc5 doesn't appear to have strnlen.  So we have to
+ * provide our own.
+ */
+static int my_strnlen(const char * s, int count)
+{
+	const char *cp = s;
+
+	while (count-- && *cp)
+		cp++;
+	return cp - s;
+}
+#define strnlen(str, x) my_strnlen((str),(x))
+#endif
+
+errcode_t ext2fs_symlink(ext2_filsys fs, ext2_ino_t parent, ext2_ino_t ino,
+			 const char *name, const char *target)
+{
+	errcode_t		retval;
+	struct ext2_inode	inode;
+	ext2_ino_t		scratch_ino;
+	blk64_t			blk;
+	int			fastlink, inlinelink;
+	unsigned int		target_len;
+	char			*block_buf = 0;
+	int			drop_refcount = 0;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	/*
+	 * The Linux kernel doesn't allow for links longer than a block
+	 * (counting the NUL terminator)
+	 */
+	target_len = strnlen(target, fs->blocksize + 1);
+	if (target_len >= fs->blocksize) {
+		retval = EXT2_ET_INVALID_ARGUMENT;
+		goto cleanup;
+	}
+
+	/*
+	 * Allocate a data block for slow links
+	 */
+	retval = ext2fs_get_mem(fs->blocksize, &block_buf);
+	if (retval)
+		goto cleanup;
+	memset(block_buf, 0, fs->blocksize);
+	strncpy(block_buf, target, fs->blocksize);
+
+	memset(&inode, 0, sizeof(struct ext2_inode));
+	fastlink = (target_len < sizeof(inode.i_block));
+	if (!fastlink) {
+		retval = ext2fs_new_block2(fs, ext2fs_find_inode_goal(fs, ino,
+								      &inode,
+								      0),
+					   NULL, &blk);
+		if (retval)
+			goto cleanup;
+	}
+
+	/*
+	 * Allocate an inode, if necessary
+	 */
+	if (!ino) {
+		retval = ext2fs_new_inode(fs, parent, LINUX_S_IFLNK | 0755,
+					  0, &ino);
+		if (retval)
+			goto cleanup;
+	}
+
+	/*
+	 * Create the inode structure....
+	 */
+	inode.i_mode = LINUX_S_IFLNK | 0777;
+	inode.i_uid = inode.i_gid = 0;
+	inode.i_links_count = 1;
+	ext2fs_inode_size_set(fs, &inode, target_len);
+	/* The time fields are set by ext2fs_write_new_inode() */
+
+	inlinelink = !fastlink && ext2fs_has_feature_inline_data(fs->super);
+	if (fastlink) {
+		/* Fast symlinks, target stored in inode */
+		strcpy((char *)&inode.i_block, target);
+	} else if (inlinelink) {
+		/* Try inserting an inline data symlink */
+		inode.i_flags |= EXT4_INLINE_DATA_FL;
+		retval = ext2fs_write_new_inode(fs, ino, &inode);
+		if (retval)
+			goto cleanup;
+		retval = ext2fs_inline_data_set(fs, ino, &inode, block_buf,
+						target_len);
+		if (retval) {
+			inode.i_flags &= ~EXT4_INLINE_DATA_FL;
+			inlinelink = 0;
+			goto need_block;
+		}
+		retval = ext2fs_read_inode(fs, ino, &inode);
+		if (retval)
+			goto cleanup;
+	} else {
+need_block:
+		/* Slow symlinks, target stored in the first block */
+		ext2fs_iblk_set(fs, &inode, 1);
+		if (ext2fs_has_feature_extents(fs->super)) {
+			/*
+			 * The extent bmap is setup after the inode and block
+			 * have been written out below.
+			 */
+			inode.i_flags |= EXT4_EXTENTS_FL;
+		}
+	}
+
+	/*
+	 * Write out the inode and inode data block.  The inode generation
+	 * number is assigned by write_new_inode, which means that the
+	 * operations using ino must come after it.
+	 */
+	if (inlinelink)
+		retval = ext2fs_write_inode(fs, ino, &inode);
+	else
+		retval = ext2fs_write_new_inode(fs, ino, &inode);
+	if (retval)
+		goto cleanup;
+
+	if (!fastlink && !inlinelink) {
+		retval = ext2fs_bmap2(fs, ino, &inode, NULL, BMAP_SET, 0, NULL,
+				      &blk);
+		if (retval)
+			goto cleanup;
+
+		retval = io_channel_write_blk64(fs->io, blk, 1, block_buf);
+		if (retval)
+			goto cleanup;
+	}
+
+	/*
+	 * Update accounting....
+	 */
+	if (!fastlink && !inlinelink)
+		ext2fs_block_alloc_stats2(fs, blk, +1);
+	ext2fs_inode_alloc_stats2(fs, ino, +1, 0);
+	drop_refcount = 1;
+
+	/*
+	 * Link the symlink into the filesystem hierarchy
+	 */
+	if (name) {
+		retval = ext2fs_lookup(fs, parent, name, strlen(name), 0,
+				       &scratch_ino);
+		if (!retval) {
+			retval = EXT2_ET_FILE_EXISTS;
+			goto cleanup;
+		}
+		if (retval != EXT2_ET_FILE_NOT_FOUND)
+			goto cleanup;
+		retval = ext2fs_link(fs, parent, name, ino, EXT2_FT_SYMLINK);
+		if (retval)
+			goto cleanup;
+	}
+	drop_refcount = 0;
+
+cleanup:
+	if (block_buf)
+		ext2fs_free_mem(&block_buf);
+	if (drop_refcount) {
+		if (!fastlink && !inlinelink)
+			ext2fs_block_alloc_stats2(fs, blk, -1);
+		ext2fs_inode_alloc_stats2(fs, ino, -1, 0);
+	}
+	return retval;
+}
+
+/*
+ * Test whether an inode is a fast symlink.
+ *
+ * A fast symlink has its symlink data stored in inode->i_block.
+ */
+int ext2fs_is_fast_symlink(struct ext2_inode *inode)
+{
+	return LINUX_S_ISLNK(inode->i_mode) && EXT2_I_SIZE(inode) &&
+	       EXT2_I_SIZE(inode) < sizeof(inode->i_block);
+}
diff --git a/lib/ext2fs/tdb.c b/lib/ext2fs/tdb.c
new file mode 100644
index 0000000..b07b291
--- /dev/null
+++ b/lib/ext2fs/tdb.c
@@ -0,0 +1,4174 @@
+/*
+URL: svn://svnanon.samba.org/samba/branches/SAMBA_4_0/source/lib/tdb/common
+Rev: 23590
+Last Changed Date: 2007-06-22 13:36:10 -0400 (Fri, 22 Jun 2007)
+*/
+ /*
+   trivial database library - standalone version
+
+   Copyright (C) Andrew Tridgell              1999-2005
+   Copyright (C) Jeremy Allison               2000-2006
+   Copyright (C) Paul `Rusty' Russell         2000
+
+     ** NOTE! The following LGPL license applies to the tdb
+     ** library. This does NOT imply that all of Samba is released
+     ** under the LGPL
+
+   This library is free software; you can redistribute it and/or
+   modify it under the terms of the GNU Lesser General Public
+   License as published by the Free Software Foundation; either
+   version 2 of the License, or (at your option) any later version.
+
+   This library is distributed in the hope that it will be useful,
+   but WITHOUT ANY WARRANTY; without even the implied warranty of
+   MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+   Lesser General Public License for more details.
+
+   You should have received a copy of the GNU Lesser General Public
+   License along with this library; if not, write to the Free Software
+   Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301  USA
+*/
+
+#ifdef CONFIG_STAND_ALONE
+#define HAVE_MMAP
+#define HAVE_STRDUP
+#define HAVE_SYS_MMAN_H
+#define HAVE_UTIME_H
+#define HAVE_UTIME
+#endif
+#ifndef __FreeBSD__
+#define _XOPEN_SOURCE 600
+#endif
+
+#include "config.h"
+#include <unistd.h>
+#include <stdio.h>
+#include <stdlib.h>
+#include <stdarg.h>
+#include <stddef.h>
+#include <errno.h>
+#include <string.h>
+#ifdef HAVE_SYS_SELECT_H
+#include <sys/select.h>
+#endif
+#include <sys/time.h>
+#include <sys/types.h>
+#include <time.h>
+#ifdef HAVE_UTIME_H
+#include <utime.h>
+#endif
+#include <sys/stat.h>
+#include <sys/file.h>
+#include <fcntl.h>
+
+#ifdef HAVE_SYS_MMAN_H
+#include <sys/mman.h>
+#endif
+
+#ifdef __GNUC__
+#define EXT2FS_ATTR(x) __attribute__(x)
+#else
+#define EXT2FS_ATTR(x)
+#endif
+
+#ifndef MAP_FILE
+#define MAP_FILE 0
+#endif
+
+#ifndef MAP_FAILED
+#define MAP_FAILED ((void *)-1)
+#endif
+
+#ifndef HAVE_STRDUP
+#define strdup rep_strdup
+static char *rep_strdup(const char *s)
+{
+	char *ret;
+	int length;
+
+	if (!s)
+		return NULL;
+	length = strlen(s);
+	ret = malloc(length + 1);
+	if (ret) {
+		strncpy(ret, s, length);
+		ret[length] = '\0';
+	}
+	return ret;
+}
+#endif
+
+#ifndef PRINTF_ATTRIBUTE
+#if (__GNUC__ >= 3) && (__GNUC_MINOR__ >= 1 )
+/** Use gcc attribute to check printf fns.  a1 is the 1-based index of
+ * the parameter containing the format, and a2 the index of the first
+ * argument. Note that some gcc 2.x versions don't handle this
+ * properly **/
+#define PRINTF_ATTRIBUTE(a1, a2) __attribute__ ((format (__printf__, a1, a2)))
+#else
+#define PRINTF_ATTRIBUTE(a1, a2)
+#endif
+#endif
+
+typedef int bool;
+
+#include "tdb.h"
+
+static TDB_DATA tdb_null;
+
+#ifndef u32
+#define u32 unsigned
+#endif
+
+typedef u32 tdb_len_t;
+typedef u32 tdb_off_t;
+
+#ifndef offsetof
+#define offsetof(t,f) ((unsigned int)&((t *)0)->f)
+#endif
+
+#define TDB_MAGIC_FOOD "TDB file\n"
+#define TDB_VERSION (0x26011967 + 6)
+#define TDB_MAGIC (0x26011999U)
+#define TDB_FREE_MAGIC (~TDB_MAGIC)
+#define TDB_DEAD_MAGIC (0xFEE1DEAD)
+#define TDB_RECOVERY_MAGIC (0xf53bc0e7U)
+#define TDB_ALIGNMENT 4
+#define MIN_REC_SIZE (2*sizeof(struct list_struct) + TDB_ALIGNMENT)
+#define DEFAULT_HASH_SIZE 131
+#define FREELIST_TOP (sizeof(struct tdb_header))
+#define TDB_ALIGN(x,a) (((x) + (a)-1) & ~((a)-1))
+#define TDB_BYTEREV(x) (((((x)&0xff)<<24)|((x)&0xFF00)<<8)|(((x)>>8)&0xFF00)|((x)>>24))
+#define TDB_DEAD(r) ((r)->magic == TDB_DEAD_MAGIC)
+#define TDB_BAD_MAGIC(r) ((r)->magic != TDB_MAGIC && !TDB_DEAD(r))
+#define TDB_HASH_TOP(hash) (FREELIST_TOP + (BUCKET(hash)+1)*sizeof(tdb_off_t))
+#define TDB_HASHTABLE_SIZE(tdb) ((tdb->header.hash_size+1)*sizeof(tdb_off_t))
+#define TDB_DATA_START(hash_size) TDB_HASH_TOP(hash_size-1)
+#define TDB_RECOVERY_HEAD offsetof(struct tdb_header, recovery_start)
+#define TDB_SEQNUM_OFS    offsetof(struct tdb_header, sequence_number)
+#define TDB_PAD_BYTE 0x42
+#define TDB_PAD_U32  0x42424242
+
+/* NB assumes there is a local variable called "tdb" that is the
+ * current context, also takes doubly-parenthesized print-style
+ * argument. */
+#define TDB_LOG(x) tdb->log.log_fn x
+
+/* lock offsets */
+#define GLOBAL_LOCK      0
+#define ACTIVE_LOCK      4
+#define TRANSACTION_LOCK 8
+
+/* free memory if the pointer is valid and zero the pointer */
+#ifndef SAFE_FREE
+#define SAFE_FREE(x) do { if ((x) != NULL) {free(x); (x)=NULL;} } while(0)
+#endif
+
+#define BUCKET(hash) ((hash) % tdb->header.hash_size)
+
+#define DOCONV() (tdb->flags & TDB_CONVERT)
+#define CONVERT(x) (DOCONV() ? tdb_convert(&x, sizeof(x)) : &x)
+
+
+/* the body of the database is made of one list_struct for the free space
+   plus a separate data list for each hash value */
+struct list_struct {
+	tdb_off_t next; /* offset of the next record in the list */
+	tdb_len_t rec_len; /* total byte length of record */
+	tdb_len_t key_len; /* byte length of key */
+	tdb_len_t data_len; /* byte length of data */
+	u32 full_hash; /* the full 32 bit hash of the key */
+	u32 magic;   /* try to catch errors */
+	/* the following union is implied:
+		union {
+			char record[rec_len];
+			struct {
+				char key[key_len];
+				char data[data_len];
+			}
+			u32 totalsize; (tailer)
+		}
+	*/
+};
+
+
+/* this is stored at the front of every database */
+struct tdb_header {
+	char magic_food[32]; /* for /etc/magic */
+	u32 version; /* version of the code */
+	u32 hash_size; /* number of hash entries */
+	tdb_off_t rwlocks; /* obsolete - kept to detect old formats */
+	tdb_off_t recovery_start; /* offset of transaction recovery region */
+	tdb_off_t sequence_number; /* used when TDB_SEQNUM is set */
+	tdb_off_t reserved[29];
+};
+
+struct tdb_lock_type {
+	int list;
+	u32 count;
+	u32 ltype;
+};
+
+struct tdb_traverse_lock {
+	struct tdb_traverse_lock *next;
+	u32 off;
+	u32 hash;
+	int lock_rw;
+};
+
+
+struct tdb_methods {
+	int (*tdb_read)(struct tdb_context *, tdb_off_t , void *, tdb_len_t , int );
+	int (*tdb_write)(struct tdb_context *, tdb_off_t, const void *, tdb_len_t);
+	void (*next_hash_chain)(struct tdb_context *, u32 *);
+	int (*tdb_oob)(struct tdb_context *, tdb_off_t , int );
+	int (*tdb_expand_file)(struct tdb_context *, tdb_off_t , tdb_off_t );
+	int (*tdb_brlock)(struct tdb_context *, tdb_off_t , int, int, int, size_t);
+};
+
+struct tdb_context {
+	char *name; /* the name of the database */
+	void *map_ptr; /* where it is currently mapped */
+	int fd; /* open file descriptor for the database */
+	tdb_len_t map_size; /* how much space has been mapped */
+	int read_only; /* opened read-only */
+	int traverse_read; /* read-only traversal */
+	struct tdb_lock_type global_lock;
+	int num_lockrecs;
+	struct tdb_lock_type *lockrecs; /* only real locks, all with count>0 */
+	enum TDB_ERROR ecode; /* error code for last tdb error */
+	struct tdb_header header; /* a cached copy of the header */
+	u32 flags; /* the flags passed to tdb_open */
+	struct tdb_traverse_lock travlocks; /* current traversal locks */
+	struct tdb_context *next; /* all tdbs to avoid multiple opens */
+	dev_t device;	/* uniquely identifies this tdb */
+	ino_t inode;	/* uniquely identifies this tdb */
+	struct tdb_logging_context log;
+	unsigned int (*hash_fn)(TDB_DATA *key);
+	int open_flags; /* flags used in the open - needed by reopen */
+	unsigned int num_locks; /* number of chain locks held */
+	const struct tdb_methods *methods;
+	struct tdb_transaction *transaction;
+	int page_size;
+	int max_dead_records;
+	bool have_transaction_lock;
+	tdb_len_t real_map_size; /* how much space has been mapped */
+};
+
+
+/*
+  internal prototypes
+*/
+static int tdb_munmap(struct tdb_context *tdb);
+static void tdb_mmap(struct tdb_context *tdb);
+static int tdb_lock(struct tdb_context *tdb, int list, int ltype);
+int tdb_lock_nonblock(struct tdb_context *tdb, int list, int ltype);
+static int tdb_unlock(struct tdb_context *tdb, int list, int ltype);
+static int tdb_brlock(struct tdb_context *tdb, tdb_off_t offset, int rw_type, int lck_type, int probe, size_t len);
+static int tdb_transaction_lock(struct tdb_context *tdb, int ltype);
+static int tdb_transaction_unlock(struct tdb_context *tdb);
+static int tdb_brlock_upgrade(struct tdb_context *tdb, tdb_off_t offset, size_t len);
+static int tdb_write_lock_record(struct tdb_context *tdb, tdb_off_t off);
+static int tdb_write_unlock_record(struct tdb_context *tdb, tdb_off_t off);
+static int tdb_ofs_read(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d);
+static int tdb_ofs_write(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d);
+static void *tdb_convert(void *buf, u32 size);
+static int tdb_free(struct tdb_context *tdb, tdb_off_t offset, struct list_struct *rec);
+static tdb_off_t tdb_allocate(struct tdb_context *tdb, tdb_len_t length, struct list_struct *rec);
+static int tdb_ofs_read(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d);
+static int tdb_ofs_write(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d);
+static int tdb_lock_record(struct tdb_context *tdb, tdb_off_t off);
+static int tdb_unlock_record(struct tdb_context *tdb, tdb_off_t off);
+static int tdb_rec_read(struct tdb_context *tdb, tdb_off_t offset, struct list_struct *rec);
+static int tdb_rec_write(struct tdb_context *tdb, tdb_off_t offset, struct list_struct *rec);
+static int tdb_do_delete(struct tdb_context *tdb, tdb_off_t rec_ptr, struct list_struct *rec);
+static unsigned char *tdb_alloc_read(struct tdb_context *tdb, tdb_off_t offset, tdb_len_t len);
+static int tdb_parse_data(struct tdb_context *tdb, TDB_DATA key,
+		   tdb_off_t offset, tdb_len_t len,
+		   int (*parser)(TDB_DATA key, TDB_DATA data,
+				 void *private_data),
+		   void *private_data);
+static tdb_off_t tdb_find_lock_hash(struct tdb_context *tdb, TDB_DATA key, u32 hash, int locktype,
+			   struct list_struct *rec);
+static void tdb_io_init(struct tdb_context *tdb);
+static int tdb_expand(struct tdb_context *tdb, tdb_off_t size);
+static int tdb_rec_free_read(struct tdb_context *tdb, tdb_off_t off,
+		      struct list_struct *rec);
+
+
+/* file: error.c */
+
+enum TDB_ERROR tdb_error(struct tdb_context *tdb)
+{
+	return tdb->ecode;
+}
+
+static struct tdb_errname {
+	enum TDB_ERROR ecode; const char *estring;
+} emap[] = { {TDB_SUCCESS, "Success"},
+	     {TDB_ERR_CORRUPT, "Corrupt database"},
+	     {TDB_ERR_IO, "IO Error"},
+	     {TDB_ERR_LOCK, "Locking error"},
+	     {TDB_ERR_OOM, "Out of memory"},
+	     {TDB_ERR_EXISTS, "Record exists"},
+	     {TDB_ERR_NOLOCK, "Lock exists on other keys"},
+	     {TDB_ERR_EINVAL, "Invalid parameter"},
+	     {TDB_ERR_NOEXIST, "Record does not exist"},
+	     {TDB_ERR_RDONLY, "write not permitted"} };
+
+/* Error string for the last tdb error */
+const char *tdb_errorstr(struct tdb_context *tdb)
+{
+	u32 i;
+	for (i = 0; i < sizeof(emap) / sizeof(struct tdb_errname); i++)
+		if (tdb->ecode == emap[i].ecode)
+			return emap[i].estring;
+	return "Invalid error code";
+}
+
+/* file: lock.c */
+
+#define TDB_MARK_LOCK 0x80000000
+
+/* a byte range locking function - return 0 on success
+   this functions locks/unlocks 1 byte at the specified offset.
+
+   On error, errno is also set so that errors are passed back properly
+   through tdb_open().
+
+   note that a len of zero means lock to end of file
+*/
+int tdb_brlock(struct tdb_context *tdb, tdb_off_t offset,
+	       int rw_type, int lck_type, int probe, size_t len)
+{
+	struct flock fl;
+	int ret;
+
+	if (tdb->flags & TDB_NOLOCK) {
+		return 0;
+	}
+
+	if ((rw_type == F_WRLCK) && (tdb->read_only || tdb->traverse_read)) {
+		tdb->ecode = TDB_ERR_RDONLY;
+		return -1;
+	}
+
+	fl.l_type = rw_type;
+	fl.l_whence = SEEK_SET;
+	fl.l_start = offset;
+	fl.l_len = len;
+	fl.l_pid = 0;
+
+	do {
+		ret = fcntl(tdb->fd,lck_type,&fl);
+	} while (ret == -1 && errno == EINTR);
+
+	if (ret == -1) {
+		/* Generic lock error. errno set by fcntl.
+		 * EAGAIN is an expected return from non-blocking
+		 * locks. */
+		if (!probe && lck_type != F_SETLK) {
+			/* Ensure error code is set for log fun to examine. */
+			tdb->ecode = TDB_ERR_LOCK;
+			TDB_LOG((tdb, TDB_DEBUG_TRACE,"tdb_brlock failed (fd=%d) at offset %d rw_type=%d lck_type=%d len=%d\n",
+				 tdb->fd, offset, rw_type, lck_type, (int)len));
+		}
+		return TDB_ERRCODE(TDB_ERR_LOCK, -1);
+	}
+	return 0;
+}
+
+
+/*
+  upgrade a read lock to a write lock. This needs to be handled in a
+  special way as some OSes (such as solaris) have too conservative
+  deadlock detection and claim a deadlock when progress can be
+  made. For those OSes we may loop for a while.
+*/
+int tdb_brlock_upgrade(struct tdb_context *tdb, tdb_off_t offset, size_t len)
+{
+	int count = 1000;
+	while (count--) {
+		struct timeval tv;
+		if (tdb_brlock(tdb, offset, F_WRLCK, F_SETLKW, 1, len) == 0) {
+			return 0;
+		}
+		if (errno != EDEADLK) {
+			break;
+		}
+		/* sleep for as short a time as we can - more portable than usleep() */
+		tv.tv_sec = 0;
+		tv.tv_usec = 1;
+		select(0, NULL, NULL, NULL, &tv);
+	}
+	TDB_LOG((tdb, TDB_DEBUG_TRACE,"tdb_brlock_upgrade failed at offset %d\n", offset));
+	return -1;
+}
+
+
+/* lock a list in the database. list -1 is the alloc list */
+static int _tdb_lock(struct tdb_context *tdb, int list, int ltype, int op)
+{
+	struct tdb_lock_type *new_lck;
+	int i;
+	bool mark_lock = ((ltype & TDB_MARK_LOCK) == TDB_MARK_LOCK);
+
+	ltype &= ~TDB_MARK_LOCK;
+
+	/* a global lock allows us to avoid per chain locks */
+	if (tdb->global_lock.count &&
+	    ((u32)ltype == tdb->global_lock.ltype || ltype == F_RDLCK)) {
+		return 0;
+	}
+
+	if (tdb->global_lock.count) {
+		return TDB_ERRCODE(TDB_ERR_LOCK, -1);
+	}
+
+	if (list < -1 || list >= (int)tdb->header.hash_size) {
+		TDB_LOG((tdb, TDB_DEBUG_ERROR,"tdb_lock: invalid list %d for ltype=%d\n",
+			   list, ltype));
+		return -1;
+	}
+	if (tdb->flags & TDB_NOLOCK)
+		return 0;
+
+	for (i=0; i<tdb->num_lockrecs; i++) {
+		if (tdb->lockrecs[i].list == list) {
+			if (tdb->lockrecs[i].count == 0) {
+				/*
+				 * Can't happen, see tdb_unlock(). It should
+				 * be an assert.
+				 */
+				TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_lock: "
+					 "lck->count == 0 for list %d", list));
+			}
+			/*
+			 * Just increment the in-memory struct, posix locks
+			 * don't stack.
+			 */
+			tdb->lockrecs[i].count++;
+			return 0;
+		}
+	}
+
+	new_lck = (struct tdb_lock_type *)realloc(
+		tdb->lockrecs,
+		sizeof(*tdb->lockrecs) * (tdb->num_lockrecs+1));
+	if (new_lck == NULL) {
+		errno = ENOMEM;
+		return -1;
+	}
+	tdb->lockrecs = new_lck;
+
+	/* Since fcntl locks don't nest, we do a lock for the first one,
+	   and simply bump the count for future ones */
+	if (!mark_lock &&
+	    tdb->methods->tdb_brlock(tdb,FREELIST_TOP+4*list, ltype, op,
+				     0, 1)) {
+		return -1;
+	}
+
+	tdb->num_locks++;
+
+	tdb->lockrecs[tdb->num_lockrecs].list = list;
+	tdb->lockrecs[tdb->num_lockrecs].count = 1;
+	tdb->lockrecs[tdb->num_lockrecs].ltype = ltype;
+	tdb->num_lockrecs += 1;
+
+	return 0;
+}
+
+/* lock a list in the database. list -1 is the alloc list */
+int tdb_lock(struct tdb_context *tdb, int list, int ltype)
+{
+	int ret;
+	ret = _tdb_lock(tdb, list, ltype, F_SETLKW);
+	if (ret) {
+		TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_lock failed on list %d "
+			 "ltype=%d (%s)\n",  list, ltype, strerror(errno)));
+	}
+	return ret;
+}
+
+/* lock a list in the database. list -1 is the alloc list. non-blocking lock */
+int tdb_lock_nonblock(struct tdb_context *tdb, int list, int ltype)
+{
+	return _tdb_lock(tdb, list, ltype, F_SETLK);
+}
+
+
+/* unlock the database: returns void because it's too late for errors. */
+	/* changed to return int it may be interesting to know there
+	   has been an error  --simo */
+int tdb_unlock(struct tdb_context *tdb, int list, int ltype)
+{
+	int ret = -1;
+	int i;
+	struct tdb_lock_type *lck = NULL;
+	bool mark_lock = ((ltype & TDB_MARK_LOCK) == TDB_MARK_LOCK);
+
+	ltype &= ~TDB_MARK_LOCK;
+
+	/* a global lock allows us to avoid per chain locks */
+	if (tdb->global_lock.count &&
+	    ((u32)ltype == tdb->global_lock.ltype || ltype == F_RDLCK)) {
+		return 0;
+	}
+
+	if (tdb->global_lock.count) {
+		return TDB_ERRCODE(TDB_ERR_LOCK, -1);
+	}
+
+	if (tdb->flags & TDB_NOLOCK)
+		return 0;
+
+	/* Sanity checks */
+	if (list < -1 || list >= (int)tdb->header.hash_size) {
+		TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_unlock: list %d invalid (%d)\n", list, tdb->header.hash_size));
+		return ret;
+	}
+
+	for (i=0; i<tdb->num_lockrecs; i++) {
+		if (tdb->lockrecs[i].list == list) {
+			lck = &tdb->lockrecs[i];
+			break;
+		}
+	}
+
+	if ((lck == NULL) || (lck->count == 0)) {
+		TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_unlock: count is 0\n"));
+		return -1;
+	}
+
+	if (lck->count > 1) {
+		lck->count--;
+		return 0;
+	}
+
+	/*
+	 * This lock has count==1 left, so we need to unlock it in the
+	 * kernel. We don't bother with decrementing the in-memory array
+	 * element, we're about to overwrite it with the last array element
+	 * anyway.
+	 */
+
+	if (mark_lock) {
+		ret = 0;
+	} else {
+		ret = tdb->methods->tdb_brlock(tdb, FREELIST_TOP+4*list, F_UNLCK,
+					       F_SETLKW, 0, 1);
+	}
+	tdb->num_locks--;
+
+	/*
+	 * Shrink the array by overwriting the element just unlocked with the
+	 * last array element.
+	 */
+
+	if (tdb->num_lockrecs > 1) {
+		*lck = tdb->lockrecs[tdb->num_lockrecs-1];
+	}
+	tdb->num_lockrecs -= 1;
+
+	/*
+	 * We don't bother with realloc when the array shrinks, but if we have
+	 * a completely idle tdb we should get rid of the locked array.
+	 */
+
+	if (tdb->num_lockrecs == 0) {
+		SAFE_FREE(tdb->lockrecs);
+	}
+
+	if (ret)
+		TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_unlock: An error occurred unlocking!\n"));
+	return ret;
+}
+
+/*
+  get the transaction lock
+ */
+int tdb_transaction_lock(struct tdb_context *tdb, int ltype)
+{
+	if (tdb->have_transaction_lock || tdb->global_lock.count) {
+		return 0;
+	}
+	if (tdb->methods->tdb_brlock(tdb, TRANSACTION_LOCK, ltype,
+				     F_SETLKW, 0, 1) == -1) {
+		TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_transaction_lock: failed to get transaction lock\n"));
+		tdb->ecode = TDB_ERR_LOCK;
+		return -1;
+	}
+	tdb->have_transaction_lock = 1;
+	return 0;
+}
+
+/*
+  release the transaction lock
+ */
+int tdb_transaction_unlock(struct tdb_context *tdb)
+{
+	int ret;
+	if (!tdb->have_transaction_lock) {
+		return 0;
+	}
+	ret = tdb->methods->tdb_brlock(tdb, TRANSACTION_LOCK, F_UNLCK, F_SETLKW, 0, 1);
+	if (ret == 0) {
+		tdb->have_transaction_lock = 0;
+	}
+	return ret;
+}
+
+
+
+
+/* lock/unlock entire database */
+static int _tdb_lockall(struct tdb_context *tdb, int ltype, int op)
+{
+	bool mark_lock = ((ltype & TDB_MARK_LOCK) == TDB_MARK_LOCK);
+
+	ltype &= ~TDB_MARK_LOCK;
+
+	/* There are no locks on read-only dbs */
+	if (tdb->read_only || tdb->traverse_read)
+		return TDB_ERRCODE(TDB_ERR_LOCK, -1);
+
+	if (tdb->global_lock.count && tdb->global_lock.ltype == (u32)ltype) {
+		tdb->global_lock.count++;
+		return 0;
+	}
+
+	if (tdb->global_lock.count) {
+		/* a global lock of a different type exists */
+		return TDB_ERRCODE(TDB_ERR_LOCK, -1);
+	}
+
+	if (tdb->num_locks != 0) {
+		/* can't combine global and chain locks */
+		return TDB_ERRCODE(TDB_ERR_LOCK, -1);
+	}
+
+	if (!mark_lock &&
+	    tdb->methods->tdb_brlock(tdb, FREELIST_TOP, ltype, op,
+				     0, 4*tdb->header.hash_size)) {
+		if (op == F_SETLKW) {
+			TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_lockall failed (%s)\n", strerror(errno)));
+		}
+		return -1;
+	}
+
+	tdb->global_lock.count = 1;
+	tdb->global_lock.ltype = ltype;
+
+	return 0;
+}
+
+
+
+/* unlock entire db */
+static int _tdb_unlockall(struct tdb_context *tdb, int ltype)
+{
+	bool mark_lock = ((ltype & TDB_MARK_LOCK) == TDB_MARK_LOCK);
+
+	ltype &= ~TDB_MARK_LOCK;
+
+	/* There are no locks on read-only dbs */
+	if (tdb->read_only || tdb->traverse_read) {
+		return TDB_ERRCODE(TDB_ERR_LOCK, -1);
+	}
+
+	if (tdb->global_lock.ltype != (u32)ltype ||
+	    tdb->global_lock.count == 0) {
+		return TDB_ERRCODE(TDB_ERR_LOCK, -1);
+	}
+
+	if (tdb->global_lock.count > 1) {
+		tdb->global_lock.count--;
+		return 0;
+	}
+
+	if (!mark_lock &&
+	    tdb->methods->tdb_brlock(tdb, FREELIST_TOP, F_UNLCK, F_SETLKW,
+				     0, 4*tdb->header.hash_size)) {
+		TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_unlockall failed (%s)\n", strerror(errno)));
+		return -1;
+	}
+
+	tdb->global_lock.count = 0;
+	tdb->global_lock.ltype = 0;
+
+	return 0;
+}
+
+/* lock entire database with write lock */
+int tdb_lockall(struct tdb_context *tdb)
+{
+	return _tdb_lockall(tdb, F_WRLCK, F_SETLKW);
+}
+
+/* lock entire database with write lock - mark only */
+int tdb_lockall_mark(struct tdb_context *tdb)
+{
+	return _tdb_lockall(tdb, F_WRLCK | TDB_MARK_LOCK, F_SETLKW);
+}
+
+/* unlock entire database with write lock - unmark only */
+int tdb_lockall_unmark(struct tdb_context *tdb)
+{
+	return _tdb_unlockall(tdb, F_WRLCK | TDB_MARK_LOCK);
+}
+
+/* lock entire database with write lock - nonblocking variant */
+int tdb_lockall_nonblock(struct tdb_context *tdb)
+{
+	return _tdb_lockall(tdb, F_WRLCK, F_SETLK);
+}
+
+/* unlock entire database with write lock */
+int tdb_unlockall(struct tdb_context *tdb)
+{
+	return _tdb_unlockall(tdb, F_WRLCK);
+}
+
+/* lock entire database with read lock */
+int tdb_lockall_read(struct tdb_context *tdb)
+{
+	return _tdb_lockall(tdb, F_RDLCK, F_SETLKW);
+}
+
+/* lock entire database with read lock - nonblock variant */
+int tdb_lockall_read_nonblock(struct tdb_context *tdb)
+{
+	return _tdb_lockall(tdb, F_RDLCK, F_SETLK);
+}
+
+/* unlock entire database with read lock */
+int tdb_unlockall_read(struct tdb_context *tdb)
+{
+	return _tdb_unlockall(tdb, F_RDLCK);
+}
+
+/* lock/unlock one hash chain. This is meant to be used to reduce
+   contention - it cannot guarantee how many records will be locked */
+int tdb_chainlock(struct tdb_context *tdb, TDB_DATA key)
+{
+	return tdb_lock(tdb, BUCKET(tdb->hash_fn(&key)), F_WRLCK);
+}
+
+/* lock/unlock one hash chain, non-blocking. This is meant to be used
+   to reduce contention - it cannot guarantee how many records will be
+   locked */
+int tdb_chainlock_nonblock(struct tdb_context *tdb, TDB_DATA key)
+{
+	return tdb_lock_nonblock(tdb, BUCKET(tdb->hash_fn(&key)), F_WRLCK);
+}
+
+/* mark a chain as locked without actually locking it. Warning! use with great caution! */
+int tdb_chainlock_mark(struct tdb_context *tdb, TDB_DATA key)
+{
+	return tdb_lock(tdb, BUCKET(tdb->hash_fn(&key)), F_WRLCK | TDB_MARK_LOCK);
+}
+
+/* unmark a chain as locked without actually locking it. Warning! use with great caution! */
+int tdb_chainlock_unmark(struct tdb_context *tdb, TDB_DATA key)
+{
+	return tdb_unlock(tdb, BUCKET(tdb->hash_fn(&key)), F_WRLCK | TDB_MARK_LOCK);
+}
+
+int tdb_chainunlock(struct tdb_context *tdb, TDB_DATA key)
+{
+	return tdb_unlock(tdb, BUCKET(tdb->hash_fn(&key)), F_WRLCK);
+}
+
+int tdb_chainlock_read(struct tdb_context *tdb, TDB_DATA key)
+{
+	return tdb_lock(tdb, BUCKET(tdb->hash_fn(&key)), F_RDLCK);
+}
+
+int tdb_chainunlock_read(struct tdb_context *tdb, TDB_DATA key)
+{
+	return tdb_unlock(tdb, BUCKET(tdb->hash_fn(&key)), F_RDLCK);
+}
+
+
+
+/* record lock stops delete underneath */
+int tdb_lock_record(struct tdb_context *tdb, tdb_off_t off)
+{
+	return off ? tdb->methods->tdb_brlock(tdb, off, F_RDLCK, F_SETLKW, 0, 1) : 0;
+}
+
+/*
+  Write locks override our own fcntl readlocks, so check it here.
+  Note this is meant to be F_SETLK, *not* F_SETLKW, as it's not
+  an error to fail to get the lock here.
+*/
+int tdb_write_lock_record(struct tdb_context *tdb, tdb_off_t off)
+{
+	struct tdb_traverse_lock *i;
+	for (i = &tdb->travlocks; i; i = i->next)
+		if (i->off == off)
+			return -1;
+	return tdb->methods->tdb_brlock(tdb, off, F_WRLCK, F_SETLK, 1, 1);
+}
+
+/*
+  Note this is meant to be F_SETLK, *not* F_SETLKW, as it's not
+  an error to fail to get the lock here.
+*/
+int tdb_write_unlock_record(struct tdb_context *tdb, tdb_off_t off)
+{
+	return tdb->methods->tdb_brlock(tdb, off, F_UNLCK, F_SETLK, 0, 1);
+}
+
+/* fcntl locks don't stack: avoid unlocking someone else's */
+int tdb_unlock_record(struct tdb_context *tdb, tdb_off_t off)
+{
+	struct tdb_traverse_lock *i;
+	u32 count = 0;
+
+	if (off == 0)
+		return 0;
+	for (i = &tdb->travlocks; i; i = i->next)
+		if (i->off == off)
+			count++;
+	return (count == 1 ? tdb->methods->tdb_brlock(tdb, off, F_UNLCK, F_SETLKW, 0, 1) : 0);
+}
+
+/* file: io.c */
+
+/* check for an out of bounds access - if it is out of bounds then
+   see if the database has been expanded by someone else and expand
+   if necessary
+   note that "len" is the minimum length needed for the db
+*/
+static int tdb_oob(struct tdb_context *tdb, tdb_off_t len, int probe)
+{
+	struct stat st;
+	if (len <= tdb->map_size)
+		return 0;
+	if (tdb->flags & TDB_INTERNAL) {
+		if (!probe) {
+			/* Ensure ecode is set for log fn. */
+			tdb->ecode = TDB_ERR_IO;
+			TDB_LOG((tdb, TDB_DEBUG_FATAL,"tdb_oob len %d beyond internal malloc size %d\n",
+				 (int)len, (int)tdb->map_size));
+		}
+		return TDB_ERRCODE(TDB_ERR_IO, -1);
+	}
+
+	if (fstat(tdb->fd, &st) == -1) {
+		return TDB_ERRCODE(TDB_ERR_IO, -1);
+	}
+
+	if (st.st_size < (off_t)len) {
+		if (!probe) {
+			/* Ensure ecode is set for log fn. */
+			tdb->ecode = TDB_ERR_IO;
+			TDB_LOG((tdb, TDB_DEBUG_FATAL,"tdb_oob len %d beyond eof at %d\n",
+				 (int)len, (int)st.st_size));
+		}
+		return TDB_ERRCODE(TDB_ERR_IO, -1);
+	}
+
+	/* Unmap, update size, remap */
+	if (tdb_munmap(tdb) == -1)
+		return TDB_ERRCODE(TDB_ERR_IO, -1);
+	tdb->map_size = st.st_size;
+	tdb_mmap(tdb);
+	return 0;
+}
+
+/* write a lump of data at a specified offset */
+static int tdb_write(struct tdb_context *tdb, tdb_off_t off,
+		     const void *buf, tdb_len_t len)
+{
+	if (len == 0) {
+		return 0;
+	}
+
+	if (tdb->read_only || tdb->traverse_read) {
+		tdb->ecode = TDB_ERR_RDONLY;
+		return -1;
+	}
+
+	if (tdb->methods->tdb_oob(tdb, off + len, 0) != 0)
+		return -1;
+
+	if (tdb->map_ptr) {
+		memcpy(off + (char *)tdb->map_ptr, buf, len);
+	} else if (pwrite(tdb->fd, buf, len, off) != (ssize_t)len) {
+		/* Ensure ecode is set for log fn. */
+		tdb->ecode = TDB_ERR_IO;
+		TDB_LOG((tdb, TDB_DEBUG_FATAL,"tdb_write failed at %d len=%d (%s)\n",
+			   off, len, strerror(errno)));
+		return TDB_ERRCODE(TDB_ERR_IO, -1);
+	}
+	return 0;
+}
+
+/* Endian conversion: we only ever deal with 4 byte quantities */
+void *tdb_convert(void *buf, u32 size)
+{
+	u32 i, *p = (u32 *)buf;
+	for (i = 0; i < size / 4; i++)
+		p[i] = TDB_BYTEREV(p[i]);
+	return buf;
+}
+
+
+/* read a lump of data at a specified offset, maybe convert */
+static int tdb_read(struct tdb_context *tdb, tdb_off_t off, void *buf,
+		    tdb_len_t len, int cv)
+{
+	if (tdb->methods->tdb_oob(tdb, off + len, 0) != 0) {
+		return -1;
+	}
+
+	if (tdb->map_ptr) {
+		memcpy(buf, off + (char *)tdb->map_ptr, len);
+	} else {
+		ssize_t ret = pread(tdb->fd, buf, len, off);
+		if (ret != (ssize_t)len) {
+			/* Ensure ecode is set for log fn. */
+			tdb->ecode = TDB_ERR_IO;
+			TDB_LOG((tdb, TDB_DEBUG_FATAL,"tdb_read failed at %d "
+				 "len=%d ret=%d (%s) map_size=%d\n",
+				 (int)off, (int)len, (int)ret, strerror(errno),
+				 (int)tdb->map_size));
+			return TDB_ERRCODE(TDB_ERR_IO, -1);
+		}
+	}
+	if (cv) {
+		tdb_convert(buf, len);
+	}
+	return 0;
+}
+
+
+
+/*
+  do an unlocked scan of the hash table heads to find the next non-zero head. The value
+  will then be confirmed with the lock held
+*/
+static void tdb_next_hash_chain(struct tdb_context *tdb, u32 *chain)
+{
+	u32 h = *chain;
+	if (tdb->map_ptr) {
+		for (;h < tdb->header.hash_size;h++) {
+			if (0 != *(u32 *)(TDB_HASH_TOP(h) + (unsigned char *)tdb->map_ptr)) {
+				break;
+			}
+		}
+	} else {
+		u32 off=0;
+		for (;h < tdb->header.hash_size;h++) {
+			if (tdb_ofs_read(tdb, TDB_HASH_TOP(h), &off) != 0 || off != 0) {
+				break;
+			}
+		}
+	}
+	(*chain) = h;
+}
+
+
+int tdb_munmap(struct tdb_context *tdb)
+{
+	if (tdb->flags & TDB_INTERNAL)
+		return 0;
+
+#ifdef HAVE_MMAP
+	if (tdb->map_ptr) {
+		int ret = munmap(tdb->map_ptr, tdb->real_map_size);
+		if (ret != 0)
+			return ret;
+		tdb->real_map_size = 0;
+	}
+#endif
+	tdb->map_ptr = NULL;
+	return 0;
+}
+
+void tdb_mmap(struct tdb_context *tdb)
+{
+	if (tdb->flags & TDB_INTERNAL)
+		return;
+
+#ifdef HAVE_MMAP
+	if (!(tdb->flags & TDB_NOMMAP)) {
+		tdb->map_ptr = mmap(NULL, tdb->map_size,
+				    PROT_READ|(tdb->read_only? 0:PROT_WRITE),
+				    MAP_SHARED|MAP_FILE, tdb->fd, 0);
+
+		/*
+		 * NB. When mmap fails it returns MAP_FAILED *NOT* NULL !!!!
+		 */
+
+		if (tdb->map_ptr == MAP_FAILED) {
+			tdb->real_map_size = 0;
+			tdb->map_ptr = NULL;
+			TDB_LOG((tdb, TDB_DEBUG_WARNING, "tdb_mmap failed for size %d (%s)\n",
+				 tdb->map_size, strerror(errno)));
+		}
+		tdb->real_map_size = tdb->map_size;
+	} else {
+		tdb->map_ptr = NULL;
+	}
+#else
+	tdb->map_ptr = NULL;
+#endif
+}
+
+/* expand a file.  we prefer to use ftruncate, as that is what posix
+  says to use for mmap expansion */
+static int tdb_expand_file(struct tdb_context *tdb, tdb_off_t size, tdb_off_t addition)
+{
+	char buf[1024];
+
+	if (tdb->read_only || tdb->traverse_read) {
+		tdb->ecode = TDB_ERR_RDONLY;
+		return -1;
+	}
+
+	if (ftruncate(tdb->fd, size+addition) == -1) {
+		char b = 0;
+		if (pwrite(tdb->fd,  &b, 1, (size+addition) - 1) != 1) {
+			TDB_LOG((tdb, TDB_DEBUG_FATAL, "expand_file to %d failed (%s)\n",
+				 size+addition, strerror(errno)));
+			return -1;
+		}
+	}
+
+	/* now fill the file with something. This ensures that the
+	   file isn't sparse, which would be very bad if we ran out of
+	   disk. This must be done with write, not via mmap */
+	memset(buf, TDB_PAD_BYTE, sizeof(buf));
+	while (addition) {
+		int n = addition>sizeof(buf)?sizeof(buf):addition;
+		int ret = pwrite(tdb->fd, buf, n, size);
+		if (ret != n) {
+			TDB_LOG((tdb, TDB_DEBUG_FATAL, "expand_file write of %d failed (%s)\n",
+				   n, strerror(errno)));
+			return -1;
+		}
+		addition -= n;
+		size += n;
+	}
+	return 0;
+}
+
+
+/* expand the database at least size bytes by expanding the underlying
+   file and doing the mmap again if necessary */
+int tdb_expand(struct tdb_context *tdb, tdb_off_t size)
+{
+	struct list_struct rec;
+	tdb_off_t offset;
+
+	if (tdb_lock(tdb, -1, F_WRLCK) == -1) {
+		TDB_LOG((tdb, TDB_DEBUG_ERROR, "lock failed in tdb_expand\n"));
+		return -1;
+	}
+
+	/* must know about any previous expansions by another process */
+	tdb->methods->tdb_oob(tdb, tdb->map_size + 1, 1);
+
+	/* always make room for at least 10 more records, and round
+           the database up to a multiple of the page size */
+	size = TDB_ALIGN(tdb->map_size + size*10, tdb->page_size) - tdb->map_size;
+
+	if (!(tdb->flags & TDB_INTERNAL))
+		tdb_munmap(tdb);
+
+	/*
+	 * We must ensure the file is unmapped before doing this
+	 * to ensure consistency with systems like OpenBSD where
+	 * writes and mmaps are not consistent.
+	 */
+
+	/* expand the file itself */
+	if (!(tdb->flags & TDB_INTERNAL)) {
+		if (tdb->methods->tdb_expand_file(tdb, tdb->map_size, size) != 0)
+			goto fail;
+	}
+
+	tdb->map_size += size;
+
+	if (tdb->flags & TDB_INTERNAL) {
+		char *new_map_ptr = (char *)realloc(tdb->map_ptr,
+						    tdb->map_size);
+		if (!new_map_ptr) {
+			tdb->map_size -= size;
+			goto fail;
+		}
+		tdb->map_ptr = new_map_ptr;
+	} else {
+		/*
+		 * We must ensure the file is remapped before adding the space
+		 * to ensure consistency with systems like OpenBSD where
+		 * writes and mmaps are not consistent.
+		 */
+
+		/* We're ok if the mmap fails as we'll fallback to read/write */
+		tdb_mmap(tdb);
+	}
+
+	/* form a new freelist record */
+	memset(&rec,'\0',sizeof(rec));
+	rec.rec_len = size - sizeof(rec);
+
+	/* link it into the free list */
+	offset = tdb->map_size - size;
+	if (tdb_free(tdb, offset, &rec) == -1)
+		goto fail;
+
+	tdb_unlock(tdb, -1, F_WRLCK);
+	return 0;
+ fail:
+	tdb_unlock(tdb, -1, F_WRLCK);
+	return -1;
+}
+
+/* read/write a tdb_off_t */
+int tdb_ofs_read(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d)
+{
+	return tdb->methods->tdb_read(tdb, offset, (char*)d, sizeof(*d), DOCONV());
+}
+
+int tdb_ofs_write(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d)
+{
+	tdb_off_t off = *d;
+	return tdb->methods->tdb_write(tdb, offset, CONVERT(off), sizeof(*d));
+}
+
+
+/* read a lump of data, allocating the space for it */
+unsigned char *tdb_alloc_read(struct tdb_context *tdb, tdb_off_t offset, tdb_len_t len)
+{
+	unsigned char *buf;
+
+	/* some systems don't like zero length malloc */
+	if (len == 0) {
+		len = 1;
+	}
+
+	if (!(buf = (unsigned char *)malloc(len))) {
+		/* Ensure ecode is set for log fn. */
+		tdb->ecode = TDB_ERR_OOM;
+		TDB_LOG((tdb, TDB_DEBUG_ERROR,"tdb_alloc_read malloc failed len=%d (%s)\n",
+			   len, strerror(errno)));
+		return TDB_ERRCODE(TDB_ERR_OOM, buf);
+	}
+	if (tdb->methods->tdb_read(tdb, offset, buf, len, 0) == -1) {
+		SAFE_FREE(buf);
+		return NULL;
+	}
+	return buf;
+}
+
+/* Give a piece of tdb data to a parser */
+
+int tdb_parse_data(struct tdb_context *tdb, TDB_DATA key,
+		   tdb_off_t offset, tdb_len_t len,
+		   int (*parser)(TDB_DATA key, TDB_DATA data,
+				 void *private_data),
+		   void *private_data)
+{
+	TDB_DATA data;
+	int result;
+
+	data.dsize = len;
+
+	if ((tdb->transaction == NULL) && (tdb->map_ptr != NULL)) {
+		/*
+		 * Optimize by avoiding the malloc/memcpy/free, point the
+		 * parser directly at the mmap area.
+		 */
+		if (tdb->methods->tdb_oob(tdb, offset+len, 0) != 0) {
+			return -1;
+		}
+		data.dptr = offset + (unsigned char *)tdb->map_ptr;
+		return parser(key, data, private_data);
+	}
+
+	if (!(data.dptr = tdb_alloc_read(tdb, offset, len))) {
+		return -1;
+	}
+
+	result = parser(key, data, private_data);
+	free(data.dptr);
+	return result;
+}
+
+/* read/write a record */
+int tdb_rec_read(struct tdb_context *tdb, tdb_off_t offset, struct list_struct *rec)
+{
+	if (tdb->methods->tdb_read(tdb, offset, rec, sizeof(*rec),DOCONV()) == -1)
+		return -1;
+	if (TDB_BAD_MAGIC(rec)) {
+		/* Ensure ecode is set for log fn. */
+		tdb->ecode = TDB_ERR_CORRUPT;
+		TDB_LOG((tdb, TDB_DEBUG_FATAL,"tdb_rec_read bad magic 0x%x at offset=%d\n", rec->magic, offset));
+		return TDB_ERRCODE(TDB_ERR_CORRUPT, -1);
+	}
+	return tdb->methods->tdb_oob(tdb, rec->next+sizeof(*rec), 0);
+}
+
+int tdb_rec_write(struct tdb_context *tdb, tdb_off_t offset, struct list_struct *rec)
+{
+	struct list_struct r = *rec;
+	return tdb->methods->tdb_write(tdb, offset, CONVERT(r), sizeof(r));
+}
+
+static const struct tdb_methods io_methods = {
+	tdb_read,
+	tdb_write,
+	tdb_next_hash_chain,
+	tdb_oob,
+	tdb_expand_file,
+	tdb_brlock
+};
+
+/*
+  initialise the default methods table
+*/
+void tdb_io_init(struct tdb_context *tdb)
+{
+	tdb->methods = &io_methods;
+}
+
+/* file: transaction.c */
+
+/*
+  transaction design:
+
+  - only allow a single transaction at a time per database. This makes
+    using the transaction API simpler, as otherwise the caller would
+    have to cope with temporary failures in transactions that conflict
+    with other current transactions
+
+  - keep the transaction recovery information in the same file as the
+    database, using a special 'transaction recovery' record pointed at
+    by the header. This removes the need for extra journal files as
+    used by some other databases
+
+  - dynamically allocated the transaction recover record, re-using it
+    for subsequent transactions. If a larger record is needed then
+    tdb_free() the old record to place it on the normal tdb freelist
+    before allocating the new record
+
+  - during transactions, keep a linked list of writes all that have
+    been performed by intercepting all tdb_write() calls. The hooked
+    transaction versions of tdb_read() and tdb_write() check this
+    linked list and try to use the elements of the list in preference
+    to the real database.
+
+  - don't allow any locks to be held when a transaction starts,
+    otherwise we can end up with deadlock (plus lack of lock nesting
+    in posix locks would mean the lock is lost)
+
+  - if the caller gains a lock during the transaction but doesn't
+    release it then fail the commit
+
+  - allow for nested calls to tdb_transaction_start(), re-using the
+    existing transaction record. If the inner transaction is cancelled
+    then a subsequent commit will fail
+
+  - keep a mirrored copy of the tdb hash chain heads to allow for the
+    fast hash heads scan on traverse, updating the mirrored copy in
+    the transaction version of tdb_write
+
+  - allow callers to mix transaction and non-transaction use of tdb,
+    although once a transaction is started then an exclusive lock is
+    gained until the transaction is committed or cancelled
+
+  - the commit strategy involves first saving away all modified data
+    into a linearised buffer in the transaction recovery area, then
+    marking the transaction recovery area with a magic value to
+    indicate a valid recovery record. In total 4 fsync/msync calls are
+    needed per commit to prevent race conditions. It might be possible
+    to reduce this to 3 or even 2 with some more work.
+
+  - check for a valid recovery record on open of the tdb, while the
+    global lock is held. Automatically recover from the transaction
+    recovery area if needed, then continue with the open as
+    usual. This allows for smooth crash recovery with no administrator
+    intervention.
+
+  - if TDB_NOSYNC is passed to flags in tdb_open then transactions are
+    still available, but no transaction recovery area is used and no
+    fsync/msync calls are made.
+
+*/
+
+struct tdb_transaction_el {
+	struct tdb_transaction_el *next, *prev;
+	tdb_off_t offset;
+	tdb_len_t length;
+	unsigned char *data;
+};
+
+/*
+  hold the context of any current transaction
+*/
+struct tdb_transaction {
+	/* we keep a mirrored copy of the tdb hash heads here so
+	   tdb_next_hash_chain() can operate efficiently */
+	u32 *hash_heads;
+
+	/* the original io methods - used to do IOs to the real db */
+	const struct tdb_methods *io_methods;
+
+	/* the list of transaction elements. We use a doubly linked
+	   list with a last pointer to allow us to keep the list
+	   ordered, with first element at the front of the list. It
+	   needs to be doubly linked as the read/write traversals need
+	   to be backwards, while the commit needs to be forwards */
+	struct tdb_transaction_el *elements, *elements_last;
+
+	/* non-zero when an internal transaction error has
+	   occurred. All write operations will then fail until the
+	   transaction is ended */
+	int transaction_error;
+
+	/* when inside a transaction we need to keep track of any
+	   nested tdb_transaction_start() calls, as these are allowed,
+	   but don't create a new transaction */
+	int nesting;
+
+	/* old file size before transaction */
+	tdb_len_t old_map_size;
+};
+
+
+/*
+  read while in a transaction. We need to check first if the data is in our list
+  of transaction elements, then if not do a real read
+*/
+static int transaction_read(struct tdb_context *tdb, tdb_off_t off, void *buf,
+			    tdb_len_t len, int cv)
+{
+	struct tdb_transaction_el *el;
+
+	/* we need to walk the list backwards to get the most recent data */
+	for (el=tdb->transaction->elements_last;el;el=el->prev) {
+		tdb_len_t partial;
+
+		if (off+len <= el->offset) {
+			continue;
+		}
+		if (off >= el->offset + el->length) {
+			continue;
+		}
+
+		/* an overlapping read - needs to be split into up to
+		   2 reads and a memcpy */
+		if (off < el->offset) {
+			partial = el->offset - off;
+			if (transaction_read(tdb, off, buf, partial, cv) != 0) {
+				goto fail;
+			}
+			len -= partial;
+			off += partial;
+			buf = (void *)(partial + (char *)buf);
+		}
+		if (off + len <= el->offset + el->length) {
+			partial = len;
+		} else {
+			partial = el->offset + el->length - off;
+		}
+		memcpy(buf, el->data + (off - el->offset), partial);
+		if (cv) {
+			tdb_convert(buf, len);
+		}
+		len -= partial;
+		off += partial;
+		buf = (void *)(partial + (char *)buf);
+
+		if (len != 0 && transaction_read(tdb, off, buf, len, cv) != 0) {
+			goto fail;
+		}
+
+		return 0;
+	}
+
+	/* its not in the transaction elements - do a real read */
+	return tdb->transaction->io_methods->tdb_read(tdb, off, buf, len, cv);
+
+fail:
+	TDB_LOG((tdb, TDB_DEBUG_FATAL, "transaction_read: failed at off=%d len=%d\n", off, len));
+	tdb->ecode = TDB_ERR_IO;
+	tdb->transaction->transaction_error = 1;
+	return -1;
+}
+
+
+/*
+  write while in a transaction
+*/
+static int transaction_write(struct tdb_context *tdb, tdb_off_t off,
+			     const void *buf, tdb_len_t len)
+{
+	struct tdb_transaction_el *el, *best_el=NULL;
+
+	if (len == 0) {
+		return 0;
+	}
+
+	/* if the write is to a hash head, then update the transaction
+	   hash heads */
+	if (len == sizeof(tdb_off_t) && off >= FREELIST_TOP &&
+	    off < FREELIST_TOP+TDB_HASHTABLE_SIZE(tdb)) {
+		u32 chain = (off-FREELIST_TOP) / sizeof(tdb_off_t);
+		memcpy(&tdb->transaction->hash_heads[chain], buf, len);
+	}
+
+	/* first see if we can replace an existing entry */
+	for (el=tdb->transaction->elements_last;el;el=el->prev) {
+		tdb_len_t partial;
+
+		if (best_el == NULL && off == el->offset+el->length) {
+			best_el = el;
+		}
+
+		if (off+len <= el->offset) {
+			continue;
+		}
+		if (off >= el->offset + el->length) {
+			continue;
+		}
+
+		/* an overlapping write - needs to be split into up to
+		   2 writes and a memcpy */
+		if (off < el->offset) {
+			partial = el->offset - off;
+			if (transaction_write(tdb, off, buf, partial) != 0) {
+				goto fail;
+			}
+			len -= partial;
+			off += partial;
+			buf = (const void *)(partial + (const char *)buf);
+		}
+		if (off + len <= el->offset + el->length) {
+			partial = len;
+		} else {
+			partial = el->offset + el->length - off;
+		}
+		memcpy(el->data + (off - el->offset), buf, partial);
+		len -= partial;
+		off += partial;
+		buf = (const void *)(partial + (const char *)buf);
+
+		if (len != 0 && transaction_write(tdb, off, buf, len) != 0) {
+			goto fail;
+		}
+
+		return 0;
+	}
+
+	/* see if we can append the new entry to an existing entry */
+	if (best_el && best_el->offset + best_el->length == off &&
+	    (off+len < tdb->transaction->old_map_size ||
+	     off > tdb->transaction->old_map_size)) {
+		unsigned char *data = best_el->data;
+		el = best_el;
+		el->data = (unsigned char *)realloc(el->data,
+						    el->length + len);
+		if (el->data == NULL) {
+			tdb->ecode = TDB_ERR_OOM;
+			tdb->transaction->transaction_error = 1;
+			el->data = data;
+			return -1;
+		}
+		if (buf) {
+			memcpy(el->data + el->length, buf, len);
+		} else {
+			memset(el->data + el->length, TDB_PAD_BYTE, len);
+		}
+		el->length += len;
+		return 0;
+	}
+
+	/* add a new entry at the end of the list */
+	el = (struct tdb_transaction_el *)malloc(sizeof(*el));
+	if (el == NULL) {
+		tdb->ecode = TDB_ERR_OOM;
+		tdb->transaction->transaction_error = 1;
+		return -1;
+	}
+	el->next = NULL;
+	el->prev = tdb->transaction->elements_last;
+	el->offset = off;
+	el->length = len;
+	el->data = (unsigned char *)malloc(len);
+	if (el->data == NULL) {
+		free(el);
+		tdb->ecode = TDB_ERR_OOM;
+		tdb->transaction->transaction_error = 1;
+		return -1;
+	}
+	if (buf) {
+		memcpy(el->data, buf, len);
+	} else {
+		memset(el->data, TDB_PAD_BYTE, len);
+	}
+	if (el->prev) {
+		el->prev->next = el;
+	} else {
+		tdb->transaction->elements = el;
+	}
+	tdb->transaction->elements_last = el;
+	return 0;
+
+fail:
+	TDB_LOG((tdb, TDB_DEBUG_FATAL, "transaction_write: failed at off=%d len=%d\n", off, len));
+	tdb->ecode = TDB_ERR_IO;
+	tdb->transaction->transaction_error = 1;
+	return -1;
+}
+
+/*
+  accelerated hash chain head search, using the cached hash heads
+*/
+static void transaction_next_hash_chain(struct tdb_context *tdb, u32 *chain)
+{
+	u32 h = *chain;
+	for (;h < tdb->header.hash_size;h++) {
+		/* the +1 takes account of the freelist */
+		if (0 != tdb->transaction->hash_heads[h+1]) {
+			break;
+		}
+	}
+	(*chain) = h;
+}
+
+/*
+  out of bounds check during a transaction
+*/
+static int transaction_oob(struct tdb_context *tdb, tdb_off_t len,
+			   int probe EXT2FS_ATTR((unused)))
+{
+	if (len <= tdb->map_size) {
+		return 0;
+	}
+	return TDB_ERRCODE(TDB_ERR_IO, -1);
+}
+
+/*
+  transaction version of tdb_expand().
+*/
+static int transaction_expand_file(struct tdb_context *tdb, tdb_off_t size,
+				   tdb_off_t addition)
+{
+	/* add a write to the transaction elements, so subsequent
+	   reads see the zero data */
+	if (transaction_write(tdb, size, NULL, addition) != 0) {
+		return -1;
+	}
+
+	return 0;
+}
+
+/*
+  brlock during a transaction - ignore them
+*/
+static int transaction_brlock(struct tdb_context *tdb EXT2FS_ATTR((unused)),
+			      tdb_off_t offset EXT2FS_ATTR((unused)),
+			      int rw_type EXT2FS_ATTR((unused)),
+			      int lck_type EXT2FS_ATTR((unused)),
+			      int probe EXT2FS_ATTR((unused)),
+			      size_t len EXT2FS_ATTR((unused)))
+{
+	return 0;
+}
+
+static const struct tdb_methods transaction_methods = {
+	transaction_read,
+	transaction_write,
+	transaction_next_hash_chain,
+	transaction_oob,
+	transaction_expand_file,
+	transaction_brlock
+};
+
+
+/*
+  start a tdb transaction. No token is returned, as only a single
+  transaction is allowed to be pending per tdb_context
+*/
+int tdb_transaction_start(struct tdb_context *tdb)
+{
+	/* some sanity checks */
+	if (tdb->read_only || (tdb->flags & TDB_INTERNAL) || tdb->traverse_read) {
+		TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_transaction_start: cannot start a transaction on a read-only or internal db\n"));
+		tdb->ecode = TDB_ERR_EINVAL;
+		return -1;
+	}
+
+	/* cope with nested tdb_transaction_start() calls */
+	if (tdb->transaction != NULL) {
+		tdb->transaction->nesting++;
+		TDB_LOG((tdb, TDB_DEBUG_TRACE, "tdb_transaction_start: nesting %d\n",
+			 tdb->transaction->nesting));
+		return 0;
+	}
+
+	if (tdb->num_locks != 0 || tdb->global_lock.count) {
+		/* the caller must not have any locks when starting a
+		   transaction as otherwise we'll be screwed by lack
+		   of nested locks in posix */
+		TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_transaction_start: cannot start a transaction with locks held\n"));
+		tdb->ecode = TDB_ERR_LOCK;
+		return -1;
+	}
+
+	if (tdb->travlocks.next != NULL) {
+		/* you cannot use transactions inside a traverse (although you can use
+		   traverse inside a transaction) as otherwise you can end up with
+		   deadlock */
+		TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_transaction_start: cannot start a transaction within a traverse\n"));
+		tdb->ecode = TDB_ERR_LOCK;
+		return -1;
+	}
+
+	tdb->transaction = (struct tdb_transaction *)
+		calloc(sizeof(struct tdb_transaction), 1);
+	if (tdb->transaction == NULL) {
+		tdb->ecode = TDB_ERR_OOM;
+		return -1;
+	}
+
+	/* get the transaction write lock. This is a blocking lock. As
+	   discussed with Volker, there are a number of ways we could
+	   make this async, which we will probably do in the future */
+	if (tdb_transaction_lock(tdb, F_WRLCK) == -1) {
+		SAFE_FREE(tdb->transaction);
+		return -1;
+	}
+
+	/* get a read lock from the freelist to the end of file. This
+	   is upgraded to a write lock during the commit */
+	if (tdb_brlock(tdb, FREELIST_TOP, F_RDLCK, F_SETLKW, 0, 0) == -1) {
+		TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_transaction_start: failed to get hash locks\n"));
+		tdb->ecode = TDB_ERR_LOCK;
+		goto fail;
+	}
+
+	/* setup a copy of the hash table heads so the hash scan in
+	   traverse can be fast */
+	tdb->transaction->hash_heads = (u32 *)
+		calloc(tdb->header.hash_size+1, sizeof(u32));
+	if (tdb->transaction->hash_heads == NULL) {
+		tdb->ecode = TDB_ERR_OOM;
+		goto fail;
+	}
+	if (tdb->methods->tdb_read(tdb, FREELIST_TOP, tdb->transaction->hash_heads,
+				   TDB_HASHTABLE_SIZE(tdb), 0) != 0) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_start: failed to read hash heads\n"));
+		tdb->ecode = TDB_ERR_IO;
+		goto fail;
+	}
+
+	/* make sure we know about any file expansions already done by
+	   anyone else */
+	tdb->methods->tdb_oob(tdb, tdb->map_size + 1, 1);
+	tdb->transaction->old_map_size = tdb->map_size;
+
+	/* finally hook the io methods, replacing them with
+	   transaction specific methods */
+	tdb->transaction->io_methods = tdb->methods;
+	tdb->methods = &transaction_methods;
+
+	/* by calling this transaction write here, we ensure that we don't grow the
+	   transaction linked list due to hash table updates */
+	if (transaction_write(tdb, FREELIST_TOP, tdb->transaction->hash_heads,
+			      TDB_HASHTABLE_SIZE(tdb)) != 0) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_start: failed to prime hash table\n"));
+		tdb->ecode = TDB_ERR_IO;
+		tdb->methods = tdb->transaction->io_methods;
+		goto fail;
+	}
+
+	return 0;
+
+fail:
+	tdb_brlock(tdb, FREELIST_TOP, F_UNLCK, F_SETLKW, 0, 0);
+	tdb_transaction_unlock(tdb);
+	SAFE_FREE(tdb->transaction->hash_heads);
+	SAFE_FREE(tdb->transaction);
+	return -1;
+}
+
+
+/*
+  cancel the current transaction
+*/
+int tdb_transaction_cancel(struct tdb_context *tdb)
+{
+	if (tdb->transaction == NULL) {
+		TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_transaction_cancel: no transaction\n"));
+		return -1;
+	}
+
+	if (tdb->transaction->nesting != 0) {
+		tdb->transaction->transaction_error = 1;
+		tdb->transaction->nesting--;
+		return 0;
+	}
+
+	tdb->map_size = tdb->transaction->old_map_size;
+
+	/* free all the transaction elements */
+	while (tdb->transaction->elements) {
+		struct tdb_transaction_el *el = tdb->transaction->elements;
+		tdb->transaction->elements = el->next;
+		free(el->data);
+		free(el);
+	}
+
+	/* remove any global lock created during the transaction */
+	if (tdb->global_lock.count != 0) {
+		tdb_brlock(tdb, FREELIST_TOP, F_UNLCK, F_SETLKW, 0, 4*tdb->header.hash_size);
+		tdb->global_lock.count = 0;
+	}
+
+	/* remove any locks created during the transaction */
+	if (tdb->num_locks != 0) {
+		int i;
+		for (i=0;i<tdb->num_lockrecs;i++) {
+			tdb_brlock(tdb,FREELIST_TOP+4*tdb->lockrecs[i].list,
+				   F_UNLCK,F_SETLKW, 0, 1);
+		}
+		tdb->num_locks = 0;
+		tdb->num_lockrecs = 0;
+		SAFE_FREE(tdb->lockrecs);
+	}
+
+	/* restore the normal io methods */
+	tdb->methods = tdb->transaction->io_methods;
+
+	tdb_brlock(tdb, FREELIST_TOP, F_UNLCK, F_SETLKW, 0, 0);
+	tdb_transaction_unlock(tdb);
+	SAFE_FREE(tdb->transaction->hash_heads);
+	SAFE_FREE(tdb->transaction);
+
+	return 0;
+}
+
+/*
+  sync to disk
+*/
+static int transaction_sync(struct tdb_context *tdb, tdb_off_t offset, tdb_len_t length)
+{
+	if (fsync(tdb->fd) != 0) {
+		tdb->ecode = TDB_ERR_IO;
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction: fsync failed\n"));
+		return -1;
+	}
+#if defined(HAVE_MSYNC) && defined(MS_SYNC)
+	if (tdb->map_ptr) {
+		tdb_off_t moffset = offset & ~(tdb->page_size-1);
+		if (msync(moffset + (char *)tdb->map_ptr,
+			  length + (offset - moffset), MS_SYNC) != 0) {
+			tdb->ecode = TDB_ERR_IO;
+			TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction: msync failed - %s\n",
+				 strerror(errno)));
+			return -1;
+		}
+	}
+#endif
+	return 0;
+}
+
+
+/*
+  work out how much space the linearised recovery data will consume
+*/
+static tdb_len_t tdb_recovery_size(struct tdb_context *tdb)
+{
+	struct tdb_transaction_el *el;
+	tdb_len_t recovery_size = 0;
+
+	recovery_size = sizeof(u32);
+	for (el=tdb->transaction->elements;el;el=el->next) {
+		if (el->offset >= tdb->transaction->old_map_size) {
+			continue;
+		}
+		recovery_size += 2*sizeof(tdb_off_t) + el->length;
+	}
+
+	return recovery_size;
+}
+
+/*
+  allocate the recovery area, or use an existing recovery area if it is
+  large enough
+*/
+static int tdb_recovery_allocate(struct tdb_context *tdb,
+				 tdb_len_t *recovery_size,
+				 tdb_off_t *recovery_offset,
+				 tdb_len_t *recovery_max_size)
+{
+	struct list_struct rec;
+	const struct tdb_methods *methods = tdb->transaction->io_methods;
+	tdb_off_t recovery_head;
+
+	if (tdb_ofs_read(tdb, TDB_RECOVERY_HEAD, &recovery_head) == -1) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_recovery_allocate: failed to read recovery head\n"));
+		return -1;
+	}
+
+	rec.rec_len = 0;
+
+	if (recovery_head != 0 &&
+	    methods->tdb_read(tdb, recovery_head, &rec, sizeof(rec), DOCONV()) == -1) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_recovery_allocate: failed to read recovery record\n"));
+		return -1;
+	}
+
+	*recovery_size = tdb_recovery_size(tdb);
+
+	if (recovery_head != 0 && *recovery_size <= rec.rec_len) {
+		/* it fits in the existing area */
+		*recovery_max_size = rec.rec_len;
+		*recovery_offset = recovery_head;
+		return 0;
+	}
+
+	/* we need to free up the old recovery area, then allocate a
+	   new one at the end of the file. Note that we cannot use
+	   tdb_allocate() to allocate the new one as that might return
+	   us an area that is being currently used (as of the start of
+	   the transaction) */
+	if (recovery_head != 0) {
+		if (tdb_free(tdb, recovery_head, &rec) == -1) {
+			TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_recovery_allocate: failed to free previous recovery area\n"));
+			return -1;
+		}
+	}
+
+	/* the tdb_free() call might have increased the recovery size */
+	*recovery_size = tdb_recovery_size(tdb);
+
+	/* round up to a multiple of page size */
+	*recovery_max_size = TDB_ALIGN(sizeof(rec) + *recovery_size, tdb->page_size) - sizeof(rec);
+	*recovery_offset = tdb->map_size;
+	recovery_head = *recovery_offset;
+
+	if (methods->tdb_expand_file(tdb, tdb->transaction->old_map_size,
+				     (tdb->map_size - tdb->transaction->old_map_size) +
+				     sizeof(rec) + *recovery_max_size) == -1) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_recovery_allocate: failed to create recovery area\n"));
+		return -1;
+	}
+
+	/* remap the file (if using mmap) */
+	methods->tdb_oob(tdb, tdb->map_size + 1, 1);
+
+	/* we have to reset the old map size so that we don't try to expand the file
+	   again in the transaction commit, which would destroy the recovery area */
+	tdb->transaction->old_map_size = tdb->map_size;
+
+	/* write the recovery header offset and sync - we can sync without a race here
+	   as the magic ptr in the recovery record has not been set */
+	CONVERT(recovery_head);
+	if (methods->tdb_write(tdb, TDB_RECOVERY_HEAD,
+			       &recovery_head, sizeof(tdb_off_t)) == -1) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_recovery_allocate: failed to write recovery head\n"));
+		return -1;
+	}
+
+	return 0;
+}
+
+
+/*
+  setup the recovery data that will be used on a crash during commit
+*/
+static int transaction_setup_recovery(struct tdb_context *tdb,
+				      tdb_off_t *magic_offset)
+{
+	struct tdb_transaction_el *el;
+	tdb_len_t recovery_size;
+	unsigned char *data, *p;
+	const struct tdb_methods *methods = tdb->transaction->io_methods;
+	struct list_struct *rec;
+	tdb_off_t recovery_offset, recovery_max_size;
+	tdb_off_t old_map_size = tdb->transaction->old_map_size;
+	u32 magic, tailer;
+
+	/*
+	  check that the recovery area has enough space
+	*/
+	if (tdb_recovery_allocate(tdb, &recovery_size,
+				  &recovery_offset, &recovery_max_size) == -1) {
+		return -1;
+	}
+
+	data = (unsigned char *)malloc(recovery_size + sizeof(*rec));
+	if (data == NULL) {
+		tdb->ecode = TDB_ERR_OOM;
+		return -1;
+	}
+
+	rec = (struct list_struct *)data;
+	memset(rec, 0, sizeof(*rec));
+
+	rec->magic    = 0;
+	rec->data_len = recovery_size;
+	rec->rec_len  = recovery_max_size;
+	rec->key_len  = old_map_size;
+	CONVERT(rec);
+
+	/* build the recovery data into a single blob to allow us to do a single
+	   large write, which should be more efficient */
+	p = data + sizeof(*rec);
+	for (el=tdb->transaction->elements;el;el=el->next) {
+		if (el->offset >= old_map_size) {
+			continue;
+		}
+		if (el->offset + el->length > tdb->transaction->old_map_size) {
+			TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_setup_recovery: transaction data over new region boundary\n"));
+			free(data);
+			tdb->ecode = TDB_ERR_CORRUPT;
+			return -1;
+		}
+		memcpy(p, &el->offset, 4);
+		memcpy(p+4, &el->length, 4);
+		if (DOCONV()) {
+			tdb_convert(p, 8);
+		}
+		/* the recovery area contains the old data, not the
+		   new data, so we have to call the original tdb_read
+		   method to get it */
+		if (methods->tdb_read(tdb, el->offset, p + 8, el->length, 0) != 0) {
+			free(data);
+			tdb->ecode = TDB_ERR_IO;
+			return -1;
+		}
+		p += 8 + el->length;
+	}
+
+	/* and the tailer */
+	tailer = sizeof(*rec) + recovery_max_size;
+	memcpy(p, &tailer, 4);
+	CONVERT(p);
+
+	/* write the recovery data to the recovery area */
+	if (methods->tdb_write(tdb, recovery_offset, data, sizeof(*rec) + recovery_size) == -1) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_setup_recovery: failed to write recovery data\n"));
+		free(data);
+		tdb->ecode = TDB_ERR_IO;
+		return -1;
+	}
+
+	/* as we don't have ordered writes, we have to sync the recovery
+	   data before we update the magic to indicate that the recovery
+	   data is present */
+	if (transaction_sync(tdb, recovery_offset, sizeof(*rec) + recovery_size) == -1) {
+		free(data);
+		return -1;
+	}
+
+	free(data);
+
+	magic = TDB_RECOVERY_MAGIC;
+	CONVERT(magic);
+
+	*magic_offset = recovery_offset + offsetof(struct list_struct, magic);
+
+	if (methods->tdb_write(tdb, *magic_offset, &magic, sizeof(magic)) == -1) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_setup_recovery: failed to write recovery magic\n"));
+		tdb->ecode = TDB_ERR_IO;
+		return -1;
+	}
+
+	/* ensure the recovery magic marker is on disk */
+	if (transaction_sync(tdb, *magic_offset, sizeof(magic)) == -1) {
+		return -1;
+	}
+
+	return 0;
+}
+
+/*
+  commit the current transaction
+*/
+int tdb_transaction_commit(struct tdb_context *tdb)
+{
+	const struct tdb_methods *methods;
+	tdb_off_t magic_offset = 0;
+	u32 zero = 0;
+
+	if (tdb->transaction == NULL) {
+		TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_transaction_commit: no transaction\n"));
+		return -1;
+	}
+
+	if (tdb->transaction->transaction_error) {
+		tdb->ecode = TDB_ERR_IO;
+		tdb_transaction_cancel(tdb);
+		TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_transaction_commit: transaction error pending\n"));
+		return -1;
+	}
+
+	if (tdb->transaction->nesting != 0) {
+		tdb->transaction->nesting--;
+		return 0;
+	}
+
+	/* check for a null transaction */
+	if (tdb->transaction->elements == NULL) {
+		tdb_transaction_cancel(tdb);
+		return 0;
+	}
+
+	methods = tdb->transaction->io_methods;
+
+	/* if there are any locks pending then the caller has not
+	   nested their locks properly, so fail the transaction */
+	if (tdb->num_locks || tdb->global_lock.count) {
+		tdb->ecode = TDB_ERR_LOCK;
+		TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_transaction_commit: locks pending on commit\n"));
+		tdb_transaction_cancel(tdb);
+		return -1;
+	}
+
+	/* upgrade the main transaction lock region to a write lock */
+	if (tdb_brlock_upgrade(tdb, FREELIST_TOP, 0) == -1) {
+		TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_transaction_start: failed to upgrade hash locks\n"));
+		tdb->ecode = TDB_ERR_LOCK;
+		tdb_transaction_cancel(tdb);
+		return -1;
+	}
+
+	/* get the global lock - this prevents new users attaching to the database
+	   during the commit */
+	if (tdb_brlock(tdb, GLOBAL_LOCK, F_WRLCK, F_SETLKW, 0, 1) == -1) {
+		TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_transaction_commit: failed to get global lock\n"));
+		tdb->ecode = TDB_ERR_LOCK;
+		tdb_transaction_cancel(tdb);
+		return -1;
+	}
+
+	if (!(tdb->flags & TDB_NOSYNC)) {
+		/* write the recovery data to the end of the file */
+		if (transaction_setup_recovery(tdb, &magic_offset) == -1) {
+			TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_commit: failed to setup recovery data\n"));
+			tdb_brlock(tdb, GLOBAL_LOCK, F_UNLCK, F_SETLKW, 0, 1);
+			tdb_transaction_cancel(tdb);
+			return -1;
+		}
+	}
+
+	/* expand the file to the new size if needed */
+	if (tdb->map_size != tdb->transaction->old_map_size) {
+		if (methods->tdb_expand_file(tdb, tdb->transaction->old_map_size,
+					     tdb->map_size -
+					     tdb->transaction->old_map_size) == -1) {
+			tdb->ecode = TDB_ERR_IO;
+			TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_commit: expansion failed\n"));
+			tdb_brlock(tdb, GLOBAL_LOCK, F_UNLCK, F_SETLKW, 0, 1);
+			tdb_transaction_cancel(tdb);
+			return -1;
+		}
+		tdb->map_size = tdb->transaction->old_map_size;
+		methods->tdb_oob(tdb, tdb->map_size + 1, 1);
+	}
+
+	/* perform all the writes */
+	while (tdb->transaction->elements) {
+		struct tdb_transaction_el *el = tdb->transaction->elements;
+
+		if (methods->tdb_write(tdb, el->offset, el->data, el->length) == -1) {
+			TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_commit: write failed during commit\n"));
+
+			/* we've overwritten part of the data and
+			   possibly expanded the file, so we need to
+			   run the crash recovery code */
+			tdb->methods = methods;
+			tdb_transaction_recover(tdb);
+
+			tdb_transaction_cancel(tdb);
+			tdb_brlock(tdb, GLOBAL_LOCK, F_UNLCK, F_SETLKW, 0, 1);
+
+			TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_commit: write failed\n"));
+			return -1;
+		}
+		tdb->transaction->elements = el->next;
+		free(el->data);
+		free(el);
+	}
+
+	if (!(tdb->flags & TDB_NOSYNC)) {
+		/* ensure the new data is on disk */
+		if (transaction_sync(tdb, 0, tdb->map_size) == -1) {
+			return -1;
+		}
+
+		/* remove the recovery marker */
+		if (methods->tdb_write(tdb, magic_offset, &zero, 4) == -1) {
+			TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_commit: failed to remove recovery magic\n"));
+			return -1;
+		}
+
+		/* ensure the recovery marker has been removed on disk */
+		if (transaction_sync(tdb, magic_offset, 4) == -1) {
+			return -1;
+		}
+	}
+
+	tdb_brlock(tdb, GLOBAL_LOCK, F_UNLCK, F_SETLKW, 0, 1);
+
+	/*
+	  TODO: maybe write to some dummy hdr field, or write to magic
+	  offset without mmap, before the last sync, instead of the
+	  utime() call
+	*/
+
+	/* on some systems (like Linux 2.6.x) changes via mmap/msync
+	   don't change the mtime of the file, this means the file may
+	   not be backed up (as tdb rounding to block sizes means that
+	   file size changes are quite rare too). The following forces
+	   mtime changes when a transaction completes */
+#ifdef HAVE_UTIME
+	utime(tdb->name, NULL);
+#endif
+
+	/* use a transaction cancel to free memory and remove the
+	   transaction locks */
+	tdb_transaction_cancel(tdb);
+	return 0;
+}
+
+
+/*
+  recover from an aborted transaction. Must be called with exclusive
+  database write access already established (including the global
+  lock to prevent new processes attaching)
+*/
+int tdb_transaction_recover(struct tdb_context *tdb)
+{
+	tdb_off_t recovery_head, recovery_eof;
+	unsigned char *data, *p;
+	u32 zero = 0;
+	struct list_struct rec;
+
+	/* find the recovery area */
+	if (tdb_ofs_read(tdb, TDB_RECOVERY_HEAD, &recovery_head) == -1) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_recover: failed to read recovery head\n"));
+		tdb->ecode = TDB_ERR_IO;
+		return -1;
+	}
+
+	if (recovery_head == 0) {
+		/* we have never allocated a recovery record */
+		return 0;
+	}
+
+	/* read the recovery record */
+	if (tdb->methods->tdb_read(tdb, recovery_head, &rec,
+				   sizeof(rec), DOCONV()) == -1) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_recover: failed to read recovery record\n"));
+		tdb->ecode = TDB_ERR_IO;
+		return -1;
+	}
+
+	if (rec.magic != TDB_RECOVERY_MAGIC) {
+		/* there is no valid recovery data */
+		return 0;
+	}
+
+	if (tdb->read_only) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_recover: attempt to recover read only database\n"));
+		tdb->ecode = TDB_ERR_CORRUPT;
+		return -1;
+	}
+
+	recovery_eof = rec.key_len;
+
+	data = (unsigned char *)malloc(rec.data_len);
+	if (data == NULL) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_recover: failed to allocate recovery data\n"));
+		tdb->ecode = TDB_ERR_OOM;
+		return -1;
+	}
+
+	/* read the full recovery data */
+	if (tdb->methods->tdb_read(tdb, recovery_head + sizeof(rec), data,
+				   rec.data_len, 0) == -1) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_recover: failed to read recovery data\n"));
+		tdb->ecode = TDB_ERR_IO;
+		free(data);
+		return -1;
+	}
+
+	/* recover the file data */
+	p = data;
+	while (p+8 < data + rec.data_len) {
+		u32 ofs, len;
+		if (DOCONV()) {
+			tdb_convert(p, 8);
+		}
+		memcpy(&ofs, p, 4);
+		memcpy(&len, p+4, 4);
+
+		if (tdb->methods->tdb_write(tdb, ofs, p+8, len) == -1) {
+			free(data);
+			TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_recover: failed to recover %d bytes at offset %d\n", len, ofs));
+			tdb->ecode = TDB_ERR_IO;
+			return -1;
+		}
+		p += 8 + len;
+	}
+
+	free(data);
+
+	if (transaction_sync(tdb, 0, tdb->map_size) == -1) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_recover: failed to sync recovery\n"));
+		tdb->ecode = TDB_ERR_IO;
+		return -1;
+	}
+
+	/* if the recovery area is after the recovered eof then remove it */
+	if (recovery_eof <= recovery_head) {
+		if (tdb_ofs_write(tdb, TDB_RECOVERY_HEAD, &zero) == -1) {
+			TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_recover: failed to remove recovery head\n"));
+			tdb->ecode = TDB_ERR_IO;
+			return -1;
+		}
+	}
+
+	/* remove the recovery magic */
+	if (tdb_ofs_write(tdb, recovery_head + offsetof(struct list_struct, magic),
+			  &zero) == -1) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_recover: failed to remove recovery magic\n"));
+		tdb->ecode = TDB_ERR_IO;
+		return -1;
+	}
+
+	/* reduce the file size to the old size */
+	tdb_munmap(tdb);
+	if (ftruncate(tdb->fd, recovery_eof) != 0) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_recover: failed to reduce to recovery size\n"));
+		tdb->ecode = TDB_ERR_IO;
+		return -1;
+	}
+	tdb->map_size = recovery_eof;
+	tdb_mmap(tdb);
+
+	if (transaction_sync(tdb, 0, recovery_eof) == -1) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_transaction_recover: failed to sync2 recovery\n"));
+		tdb->ecode = TDB_ERR_IO;
+		return -1;
+	}
+
+	TDB_LOG((tdb, TDB_DEBUG_TRACE, "tdb_transaction_recover: recovered %d byte database\n",
+		 recovery_eof));
+
+	/* all done */
+	return 0;
+}
+
+/* file: freelist.c */
+
+/* read a freelist record and check for simple errors */
+static int tdb_rec_free_read(struct tdb_context *tdb, tdb_off_t off, struct list_struct *rec)
+{
+	if (tdb->methods->tdb_read(tdb, off, rec, sizeof(*rec),DOCONV()) == -1)
+		return -1;
+
+	if (rec->magic == TDB_MAGIC) {
+		/* this happens when a app is showdown while deleting a record - we should
+		   not completely fail when this happens */
+		TDB_LOG((tdb, TDB_DEBUG_WARNING, "tdb_rec_free_read non-free magic 0x%x at offset=%d - fixing\n",
+			 rec->magic, off));
+		rec->magic = TDB_FREE_MAGIC;
+		if (tdb->methods->tdb_write(tdb, off, rec, sizeof(*rec)) == -1)
+			return -1;
+	}
+
+	if (rec->magic != TDB_FREE_MAGIC) {
+		/* Ensure ecode is set for log fn. */
+		tdb->ecode = TDB_ERR_CORRUPT;
+		TDB_LOG((tdb, TDB_DEBUG_WARNING, "tdb_rec_free_read bad magic 0x%x at offset=%d\n",
+			   rec->magic, off));
+		return TDB_ERRCODE(TDB_ERR_CORRUPT, -1);
+	}
+	if (tdb->methods->tdb_oob(tdb, rec->next+sizeof(*rec), 0) != 0)
+		return -1;
+	return 0;
+}
+
+
+
+/* Remove an element from the freelist.  Must have alloc lock. */
+static int remove_from_freelist(struct tdb_context *tdb, tdb_off_t off, tdb_off_t next)
+{
+	tdb_off_t last_ptr, i;
+
+	/* read in the freelist top */
+	last_ptr = FREELIST_TOP;
+	while (tdb_ofs_read(tdb, last_ptr, &i) != -1 && i != 0) {
+		if (i == off) {
+			/* We've found it! */
+			return tdb_ofs_write(tdb, last_ptr, &next);
+		}
+		/* Follow chain (next offset is at start of record) */
+		last_ptr = i;
+	}
+	TDB_LOG((tdb, TDB_DEBUG_FATAL,"remove_from_freelist: not on list at off=%d\n", off));
+	return TDB_ERRCODE(TDB_ERR_CORRUPT, -1);
+}
+
+
+/* update a record tailer (must hold allocation lock) */
+static int update_tailer(struct tdb_context *tdb, tdb_off_t offset,
+			 const struct list_struct *rec)
+{
+	tdb_off_t totalsize;
+
+	/* Offset of tailer from record header */
+	totalsize = sizeof(*rec) + rec->rec_len;
+	return tdb_ofs_write(tdb, offset + totalsize - sizeof(tdb_off_t),
+			 &totalsize);
+}
+
+/* Add an element into the freelist. Merge adjacent records if
+   necessary. */
+int tdb_free(struct tdb_context *tdb, tdb_off_t offset, struct list_struct *rec)
+{
+	tdb_off_t right, left;
+
+	/* Allocation and tailer lock */
+	if (tdb_lock(tdb, -1, F_WRLCK) != 0)
+		return -1;
+
+	/* set an initial tailer, so if we fail we don't leave a bogus record */
+	if (update_tailer(tdb, offset, rec) != 0) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_free: update_tailer failed!\n"));
+		goto fail;
+	}
+
+	/* Look right first (I'm an Australian, dammit) */
+	right = offset + sizeof(*rec) + rec->rec_len;
+	if (right + sizeof(*rec) <= tdb->map_size) {
+		struct list_struct r;
+
+		if (tdb->methods->tdb_read(tdb, right, &r, sizeof(r), DOCONV()) == -1) {
+			TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_free: right read failed at %u\n", right));
+			goto left;
+		}
+
+		/* If it's free, expand to include it. */
+		if (r.magic == TDB_FREE_MAGIC) {
+			if (remove_from_freelist(tdb, right, r.next) == -1) {
+				TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_free: right free failed at %u\n", right));
+				goto left;
+			}
+			rec->rec_len += sizeof(r) + r.rec_len;
+		}
+	}
+
+left:
+	/* Look left */
+	left = offset - sizeof(tdb_off_t);
+	if (left > TDB_DATA_START(tdb->header.hash_size)) {
+		struct list_struct l;
+		tdb_off_t leftsize;
+
+		/* Read in tailer and jump back to header */
+		if (tdb_ofs_read(tdb, left, &leftsize) == -1) {
+			TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_free: left offset read failed at %u\n", left));
+			goto update;
+		}
+
+		/* it could be uninitialised data */
+		if (leftsize == 0 || leftsize == TDB_PAD_U32) {
+			goto update;
+		}
+
+		left = offset - leftsize;
+
+		/* Now read in record */
+		if (tdb->methods->tdb_read(tdb, left, &l, sizeof(l), DOCONV()) == -1) {
+			TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_free: left read failed at %u (%u)\n", left, leftsize));
+			goto update;
+		}
+
+		/* If it's free, expand to include it. */
+		if (l.magic == TDB_FREE_MAGIC) {
+			if (remove_from_freelist(tdb, left, l.next) == -1) {
+				TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_free: left free failed at %u\n", left));
+				goto update;
+			} else {
+				offset = left;
+				rec->rec_len += leftsize;
+			}
+		}
+	}
+
+update:
+	if (update_tailer(tdb, offset, rec) == -1) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_free: update_tailer failed at %u\n", offset));
+		goto fail;
+	}
+
+	/* Now, prepend to free list */
+	rec->magic = TDB_FREE_MAGIC;
+
+	if (tdb_ofs_read(tdb, FREELIST_TOP, &rec->next) == -1 ||
+	    tdb_rec_write(tdb, offset, rec) == -1 ||
+	    tdb_ofs_write(tdb, FREELIST_TOP, &offset) == -1) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_free record write failed at offset=%d\n", offset));
+		goto fail;
+	}
+
+	/* And we're done. */
+	tdb_unlock(tdb, -1, F_WRLCK);
+	return 0;
+
+ fail:
+	tdb_unlock(tdb, -1, F_WRLCK);
+	return -1;
+}
+
+
+/*
+   the core of tdb_allocate - called when we have decided which
+   free list entry to use
+ */
+static tdb_off_t tdb_allocate_ofs(struct tdb_context *tdb, tdb_len_t length, tdb_off_t rec_ptr,
+				struct list_struct *rec, tdb_off_t last_ptr)
+{
+	struct list_struct newrec;
+	tdb_off_t newrec_ptr;
+
+	memset(&newrec, '\0', sizeof(newrec));
+
+	/* found it - now possibly split it up  */
+	if (rec->rec_len > length + MIN_REC_SIZE) {
+		/* Length of left piece */
+		length = TDB_ALIGN(length, TDB_ALIGNMENT);
+
+		/* Right piece to go on free list */
+		newrec.rec_len = rec->rec_len - (sizeof(*rec) + length);
+		newrec_ptr = rec_ptr + sizeof(*rec) + length;
+
+		/* And left record is shortened */
+		rec->rec_len = length;
+	} else {
+		newrec_ptr = 0;
+	}
+
+	/* Remove allocated record from the free list */
+	if (tdb_ofs_write(tdb, last_ptr, &rec->next) == -1) {
+		return 0;
+	}
+
+	/* Update header: do this before we drop alloc
+	   lock, otherwise tdb_free() might try to
+	   merge with us, thinking we're free.
+	   (Thanks Jeremy Allison). */
+	rec->magic = TDB_MAGIC;
+	if (tdb_rec_write(tdb, rec_ptr, rec) == -1) {
+		return 0;
+	}
+
+	/* Did we create new block? */
+	if (newrec_ptr) {
+		/* Update allocated record tailer (we
+		   shortened it). */
+		if (update_tailer(tdb, rec_ptr, rec) == -1) {
+			return 0;
+		}
+
+		/* Free new record */
+		if (tdb_free(tdb, newrec_ptr, &newrec) == -1) {
+			return 0;
+		}
+	}
+
+	/* all done - return the new record offset */
+	return rec_ptr;
+}
+
+/* allocate some space from the free list. The offset returned points
+   to a unconnected list_struct within the database with room for at
+   least length bytes of total data
+
+   0 is returned if the space could not be allocated
+ */
+tdb_off_t tdb_allocate(struct tdb_context *tdb, tdb_len_t length, struct list_struct *rec)
+{
+	tdb_off_t rec_ptr, last_ptr, newrec_ptr;
+	struct {
+		tdb_off_t rec_ptr, last_ptr;
+		tdb_len_t rec_len;
+	} bestfit;
+
+	if (tdb_lock(tdb, -1, F_WRLCK) == -1)
+		return 0;
+
+	/* Extra bytes required for tailer */
+	length += sizeof(tdb_off_t);
+
+ again:
+	last_ptr = FREELIST_TOP;
+
+	/* read in the freelist top */
+	if (tdb_ofs_read(tdb, FREELIST_TOP, &rec_ptr) == -1)
+		goto fail;
+
+	bestfit.rec_ptr = 0;
+	bestfit.last_ptr = 0;
+	bestfit.rec_len = 0;
+
+	/*
+	   this is a best fit allocation strategy. Originally we used
+	   a first fit strategy, but it suffered from massive fragmentation
+	   issues when faced with a slowly increasing record size.
+	 */
+	while (rec_ptr) {
+		if (tdb_rec_free_read(tdb, rec_ptr, rec) == -1) {
+			goto fail;
+		}
+
+		if (rec->rec_len >= length) {
+			if (bestfit.rec_ptr == 0 ||
+			    rec->rec_len < bestfit.rec_len) {
+				bestfit.rec_len = rec->rec_len;
+				bestfit.rec_ptr = rec_ptr;
+				bestfit.last_ptr = last_ptr;
+				/* consider a fit to be good enough if
+				   we aren't wasting more than half
+				   the space */
+				if (bestfit.rec_len < 2*length) {
+					break;
+				}
+			}
+		}
+
+		/* move to the next record */
+		last_ptr = rec_ptr;
+		rec_ptr = rec->next;
+	}
+
+	if (bestfit.rec_ptr != 0) {
+		if (tdb_rec_free_read(tdb, bestfit.rec_ptr, rec) == -1) {
+			goto fail;
+		}
+
+		newrec_ptr = tdb_allocate_ofs(tdb, length, bestfit.rec_ptr, rec, bestfit.last_ptr);
+		tdb_unlock(tdb, -1, F_WRLCK);
+		return newrec_ptr;
+	}
+
+	/* we didn't find enough space. See if we can expand the
+	   database and if we can then try again */
+	if (tdb_expand(tdb, length + sizeof(*rec)) == 0)
+		goto again;
+ fail:
+	tdb_unlock(tdb, -1, F_WRLCK);
+	return 0;
+}
+
+/* file: freelistcheck.c */
+
+/* Check the freelist is good and contains no loops.
+   Very memory intensive - only do this as a consistency
+   checker. Heh heh - uses an in memory tdb as the storage
+   for the "seen" record list. For some reason this strikes
+   me as extremely clever as I don't have to write another tree
+   data structure implementation :-).
+ */
+
+static int seen_insert(struct tdb_context *mem_tdb, tdb_off_t rec_ptr)
+{
+	TDB_DATA key, data;
+
+	memset(&data, '\0', sizeof(data));
+	key.dptr = (unsigned char *)&rec_ptr;
+	key.dsize = sizeof(rec_ptr);
+	return tdb_store(mem_tdb, key, data, TDB_INSERT);
+}
+
+int tdb_validate_freelist(struct tdb_context *tdb, int *pnum_entries)
+{
+	struct tdb_context *mem_tdb = NULL;
+	struct list_struct rec;
+	tdb_off_t rec_ptr, last_ptr;
+	int ret = -1;
+
+	*pnum_entries = 0;
+
+	mem_tdb = tdb_open("flval", tdb->header.hash_size,
+				TDB_INTERNAL, O_RDWR, 0600);
+	if (!mem_tdb) {
+		return -1;
+	}
+
+	if (tdb_lock(tdb, -1, F_WRLCK) == -1) {
+		tdb_close(mem_tdb);
+		return 0;
+	}
+
+	last_ptr = FREELIST_TOP;
+
+	/* Store the FREELIST_TOP record. */
+	if (seen_insert(mem_tdb, last_ptr) == -1) {
+		ret = TDB_ERRCODE(TDB_ERR_CORRUPT, -1);
+		goto fail;
+	}
+
+	/* read in the freelist top */
+	if (tdb_ofs_read(tdb, FREELIST_TOP, &rec_ptr) == -1) {
+		goto fail;
+	}
+
+	while (rec_ptr) {
+
+		/* If we can't store this record (we've seen it
+		   before) then the free list has a loop and must
+		   be corrupt. */
+
+		if (seen_insert(mem_tdb, rec_ptr)) {
+			ret = TDB_ERRCODE(TDB_ERR_CORRUPT, -1);
+			goto fail;
+		}
+
+		if (tdb_rec_free_read(tdb, rec_ptr, &rec) == -1) {
+			goto fail;
+		}
+
+		/* move to the next record */
+		last_ptr = rec_ptr;
+		rec_ptr = rec.next;
+		*pnum_entries += 1;
+	}
+
+	ret = 0;
+
+  fail:
+
+	tdb_close(mem_tdb);
+	tdb_unlock(tdb, -1, F_WRLCK);
+	return ret;
+}
+
+/* file: traverse.c */
+
+/* Uses traverse lock: 0 = finish, -1 = error, other = record offset */
+static int tdb_next_lock(struct tdb_context *tdb, struct tdb_traverse_lock *tlock,
+			 struct list_struct *rec)
+{
+	int want_next = (tlock->off != 0);
+
+	/* Lock each chain from the start one. */
+	for (; tlock->hash < tdb->header.hash_size; tlock->hash++) {
+		if (!tlock->off && tlock->hash != 0) {
+			/* this is an optimisation for the common case where
+			   the hash chain is empty, which is particularly
+			   common for the use of tdb with ldb, where large
+			   hashes are used. In that case we spend most of our
+			   time in tdb_brlock(), locking empty hash chains.
+
+			   To avoid this, we do an unlocked pre-check to see
+			   if the hash chain is empty before starting to look
+			   inside it. If it is empty then we can avoid that
+			   hash chain. If it isn't empty then we can't believe
+			   the value we get back, as we read it without a
+			   lock, so instead we get the lock and re-fetch the
+			   value below.
+
+			   Notice that not doing this optimisation on the
+			   first hash chain is critical. We must guarantee
+			   that we have done at least one fcntl lock at the
+			   start of a search to guarantee that memory is
+			   coherent on SMP systems. If records are added by
+			   others during the search then that's OK, and we
+			   could possibly miss those with this trick, but we
+			   could miss them anyway without this trick, so the
+			   semantics don't change.
+
+			   With a non-indexed ldb search this trick gains us a
+			   factor of around 80 in speed on a linux 2.6.x
+			   system (testing using ldbtest).
+			*/
+			tdb->methods->next_hash_chain(tdb, &tlock->hash);
+			if (tlock->hash == tdb->header.hash_size) {
+				continue;
+			}
+		}
+
+		if (tdb_lock(tdb, tlock->hash, tlock->lock_rw) == -1)
+			return -1;
+
+		/* No previous record?  Start at top of chain. */
+		if (!tlock->off) {
+			if (tdb_ofs_read(tdb, TDB_HASH_TOP(tlock->hash),
+				     &tlock->off) == -1)
+				goto fail;
+		} else {
+			/* Otherwise unlock the previous record. */
+			if (tdb_unlock_record(tdb, tlock->off) != 0)
+				goto fail;
+		}
+
+		if (want_next) {
+			/* We have offset of old record: grab next */
+			if (tdb_rec_read(tdb, tlock->off, rec) == -1)
+				goto fail;
+			tlock->off = rec->next;
+		}
+
+		/* Iterate through chain */
+		while( tlock->off) {
+			tdb_off_t current;
+			if (tdb_rec_read(tdb, tlock->off, rec) == -1)
+				goto fail;
+
+			/* Detect infinite loops. From "Shlomi Yaakobovich" <Shlomi@exanet.com>. */
+			if (tlock->off == rec->next) {
+				TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_next_lock: loop detected.\n"));
+				goto fail;
+			}
+
+			if (!TDB_DEAD(rec)) {
+				/* Woohoo: we found one! */
+				if (tdb_lock_record(tdb, tlock->off) != 0)
+					goto fail;
+				return tlock->off;
+			}
+
+			/* Try to clean dead ones from old traverses */
+			current = tlock->off;
+			tlock->off = rec->next;
+			if (!(tdb->read_only || tdb->traverse_read) &&
+			    tdb_do_delete(tdb, current, rec) != 0)
+				goto fail;
+		}
+		tdb_unlock(tdb, tlock->hash, tlock->lock_rw);
+		want_next = 0;
+	}
+	/* We finished iteration without finding anything */
+	return TDB_ERRCODE(TDB_SUCCESS, 0);
+
+ fail:
+	tlock->off = 0;
+	if (tdb_unlock(tdb, tlock->hash, tlock->lock_rw) != 0)
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_next_lock: On error unlock failed!\n"));
+	return -1;
+}
+
+/* traverse the entire database - calling fn(tdb, key, data) on each element.
+   return -1 on error or the record count traversed
+   if fn is NULL then it is not called
+   a non-zero return value from fn() indicates that the traversal should stop
+  */
+static int tdb_traverse_internal(struct tdb_context *tdb,
+				 tdb_traverse_func fn, void *private_data,
+				 struct tdb_traverse_lock *tl)
+{
+	TDB_DATA key, dbuf;
+	struct list_struct rec;
+	int ret, count = 0;
+
+	/* This was in the initialization, above, but the IRIX compiler
+	 * did not like it.  crh
+	 */
+	tl->next = tdb->travlocks.next;
+
+	/* fcntl locks don't stack: beware traverse inside traverse */
+	tdb->travlocks.next = tl;
+
+	/* tdb_next_lock places locks on the record returned, and its chain */
+	while ((ret = tdb_next_lock(tdb, tl, &rec)) > 0) {
+		count++;
+		/* now read the full record */
+		key.dptr = tdb_alloc_read(tdb, tl->off + sizeof(rec),
+					  rec.key_len + rec.data_len);
+		if (!key.dptr) {
+			ret = -1;
+			if (tdb_unlock(tdb, tl->hash, tl->lock_rw) != 0)
+				goto out;
+			if (tdb_unlock_record(tdb, tl->off) != 0)
+				TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_traverse: key.dptr == NULL and unlock_record failed!\n"));
+			goto out;
+		}
+		key.dsize = rec.key_len;
+		dbuf.dptr = key.dptr + rec.key_len;
+		dbuf.dsize = rec.data_len;
+
+		/* Drop chain lock, call out */
+		if (tdb_unlock(tdb, tl->hash, tl->lock_rw) != 0) {
+			ret = -1;
+			SAFE_FREE(key.dptr);
+			goto out;
+		}
+		if (fn && fn(tdb, key, dbuf, private_data)) {
+			/* They want us to terminate traversal */
+			ret = count;
+			if (tdb_unlock_record(tdb, tl->off) != 0) {
+				TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_traverse: unlock_record failed!\n"));;
+				ret = -1;
+			}
+			SAFE_FREE(key.dptr);
+			goto out;
+		}
+		SAFE_FREE(key.dptr);
+	}
+out:
+	tdb->travlocks.next = tl->next;
+	if (ret < 0)
+		return -1;
+	else
+		return count;
+}
+
+
+/*
+  a write style traverse - temporarily marks the db read only
+*/
+int tdb_traverse_read(struct tdb_context *tdb,
+		      tdb_traverse_func fn, void *private_data)
+{
+	struct tdb_traverse_lock tl = { NULL, 0, 0, F_RDLCK };
+	int ret;
+
+	/* we need to get a read lock on the transaction lock here to
+	   cope with the lock ordering semantics of solaris10 */
+	if (tdb_transaction_lock(tdb, F_RDLCK)) {
+		return -1;
+	}
+
+	tdb->traverse_read++;
+	ret = tdb_traverse_internal(tdb, fn, private_data, &tl);
+	tdb->traverse_read--;
+
+	tdb_transaction_unlock(tdb);
+
+	return ret;
+}
+
+/*
+  a write style traverse - needs to get the transaction lock to
+  prevent deadlocks
+*/
+int tdb_traverse(struct tdb_context *tdb,
+		 tdb_traverse_func fn, void *private_data)
+{
+	struct tdb_traverse_lock tl = { NULL, 0, 0, F_WRLCK };
+	int ret;
+
+	if (tdb->read_only || tdb->traverse_read) {
+		return tdb_traverse_read(tdb, fn, private_data);
+	}
+
+	if (tdb_transaction_lock(tdb, F_WRLCK)) {
+		return -1;
+	}
+
+	ret = tdb_traverse_internal(tdb, fn, private_data, &tl);
+
+	tdb_transaction_unlock(tdb);
+
+	return ret;
+}
+
+
+/* find the first entry in the database and return its key */
+TDB_DATA tdb_firstkey(struct tdb_context *tdb)
+{
+	TDB_DATA key;
+	struct list_struct rec;
+
+	/* release any old lock */
+	if (tdb_unlock_record(tdb, tdb->travlocks.off) != 0)
+		return tdb_null;
+	tdb->travlocks.off = tdb->travlocks.hash = 0;
+	tdb->travlocks.lock_rw = F_RDLCK;
+
+	/* Grab first record: locks chain and returned record. */
+	if (tdb_next_lock(tdb, &tdb->travlocks, &rec) <= 0)
+		return tdb_null;
+	/* now read the key */
+	key.dsize = rec.key_len;
+	key.dptr =tdb_alloc_read(tdb,tdb->travlocks.off+sizeof(rec),key.dsize);
+
+	/* Unlock the hash chain of the record we just read. */
+	if (tdb_unlock(tdb, tdb->travlocks.hash, tdb->travlocks.lock_rw) != 0)
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_firstkey: error occurred while tdb_unlocking!\n"));
+	return key;
+}
+
+/* find the next entry in the database, returning its key */
+TDB_DATA tdb_nextkey(struct tdb_context *tdb, TDB_DATA oldkey)
+{
+	u32 oldhash;
+	TDB_DATA key = tdb_null;
+	struct list_struct rec;
+	unsigned char *k = NULL;
+
+	/* Is locked key the old key?  If so, traverse will be reliable. */
+	if (tdb->travlocks.off) {
+		if (tdb_lock(tdb,tdb->travlocks.hash,tdb->travlocks.lock_rw))
+			return tdb_null;
+		if (tdb_rec_read(tdb, tdb->travlocks.off, &rec) == -1
+		    || !(k = tdb_alloc_read(tdb,tdb->travlocks.off+sizeof(rec),
+					    rec.key_len))
+		    || memcmp(k, oldkey.dptr, oldkey.dsize) != 0) {
+			/* No, it wasn't: unlock it and start from scratch */
+			if (tdb_unlock_record(tdb, tdb->travlocks.off) != 0) {
+				SAFE_FREE(k);
+				return tdb_null;
+			}
+			if (tdb_unlock(tdb, tdb->travlocks.hash, tdb->travlocks.lock_rw) != 0) {
+				SAFE_FREE(k);
+				return tdb_null;
+			}
+			tdb->travlocks.off = 0;
+		}
+
+		SAFE_FREE(k);
+	}
+
+	if (!tdb->travlocks.off) {
+		/* No previous element: do normal find, and lock record */
+		tdb->travlocks.off = tdb_find_lock_hash(tdb, oldkey, tdb->hash_fn(&oldkey), tdb->travlocks.lock_rw, &rec);
+		if (!tdb->travlocks.off)
+			return tdb_null;
+		tdb->travlocks.hash = BUCKET(rec.full_hash);
+		if (tdb_lock_record(tdb, tdb->travlocks.off) != 0) {
+			TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_nextkey: lock_record failed (%s)!\n", strerror(errno)));
+			return tdb_null;
+		}
+	}
+	oldhash = tdb->travlocks.hash;
+
+	/* Grab next record: locks chain and returned record,
+	   unlocks old record */
+	if (tdb_next_lock(tdb, &tdb->travlocks, &rec) > 0) {
+		key.dsize = rec.key_len;
+		key.dptr = tdb_alloc_read(tdb, tdb->travlocks.off+sizeof(rec),
+					  key.dsize);
+		/* Unlock the chain of this new record */
+		if (tdb_unlock(tdb, tdb->travlocks.hash, tdb->travlocks.lock_rw) != 0)
+			TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_nextkey: WARNING tdb_unlock failed!\n"));
+	}
+	/* Unlock the chain of old record */
+	if (tdb_unlock(tdb, BUCKET(oldhash), tdb->travlocks.lock_rw) != 0)
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_nextkey: WARNING tdb_unlock failed!\n"));
+	return key;
+}
+
+/* file: dump.c */
+
+static tdb_off_t tdb_dump_record(struct tdb_context *tdb, int hash,
+				 tdb_off_t offset)
+{
+	struct list_struct rec;
+	tdb_off_t tailer_ofs, tailer;
+
+	if (tdb->methods->tdb_read(tdb, offset, (char *)&rec,
+				   sizeof(rec), DOCONV()) == -1) {
+		printf("ERROR: failed to read record at %u\n", offset);
+		return 0;
+	}
+
+	printf(" rec: hash=%d offset=0x%08x next=0x%08x rec_len=%d "
+	       "key_len=%d data_len=%d full_hash=0x%x magic=0x%x\n",
+	       hash, offset, rec.next, rec.rec_len, rec.key_len, rec.data_len,
+	       rec.full_hash, rec.magic);
+
+	tailer_ofs = offset + sizeof(rec) + rec.rec_len - sizeof(tdb_off_t);
+
+	if (tdb_ofs_read(tdb, tailer_ofs, &tailer) == -1) {
+		printf("ERROR: failed to read tailer at %u\n", tailer_ofs);
+		return rec.next;
+	}
+
+	if (tailer != rec.rec_len + sizeof(rec)) {
+		printf("ERROR: tailer does not match record! tailer=%u totalsize=%u\n",
+				(unsigned int)tailer, (unsigned int)(rec.rec_len + sizeof(rec)));
+	}
+	return rec.next;
+}
+
+static int tdb_dump_chain(struct tdb_context *tdb, int i)
+{
+	tdb_off_t rec_ptr, top;
+
+	top = TDB_HASH_TOP(i);
+
+	if (tdb_lock(tdb, i, F_WRLCK) != 0)
+		return -1;
+
+	if (tdb_ofs_read(tdb, top, &rec_ptr) == -1)
+		return tdb_unlock(tdb, i, F_WRLCK);
+
+	if (rec_ptr)
+		printf("hash=%d\n", i);
+
+	while (rec_ptr) {
+		rec_ptr = tdb_dump_record(tdb, i, rec_ptr);
+	}
+
+	return tdb_unlock(tdb, i, F_WRLCK);
+}
+
+void tdb_dump_all(struct tdb_context *tdb)
+{
+	int i;
+	for (i = 0; i < (int)tdb->header.hash_size; i++) {
+		tdb_dump_chain(tdb, i);
+	}
+	printf("freelist:\n");
+	tdb_dump_chain(tdb, -1);
+}
+
+int tdb_printfreelist(struct tdb_context *tdb)
+{
+	int ret;
+	long total_free = 0;
+	tdb_off_t offset, rec_ptr;
+	struct list_struct rec;
+
+	if ((ret = tdb_lock(tdb, -1, F_WRLCK)) != 0)
+		return ret;
+
+	offset = FREELIST_TOP;
+
+	/* read in the freelist top */
+	if (tdb_ofs_read(tdb, offset, &rec_ptr) == -1) {
+		tdb_unlock(tdb, -1, F_WRLCK);
+		return 0;
+	}
+
+	printf("freelist top=[0x%08x]\n", rec_ptr );
+	while (rec_ptr) {
+		if (tdb->methods->tdb_read(tdb, rec_ptr, (char *)&rec,
+					   sizeof(rec), DOCONV()) == -1) {
+			tdb_unlock(tdb, -1, F_WRLCK);
+			return -1;
+		}
+
+		if (rec.magic != TDB_FREE_MAGIC) {
+			printf("bad magic 0x%08x in free list\n", rec.magic);
+			tdb_unlock(tdb, -1, F_WRLCK);
+			return -1;
+		}
+
+		printf("entry offset=[0x%08x], rec.rec_len = [0x%08x (%d)] (end = 0x%08x)\n",
+		       rec_ptr, rec.rec_len, rec.rec_len, rec_ptr + rec.rec_len);
+		total_free += rec.rec_len;
+
+		/* move to the next record */
+		rec_ptr = rec.next;
+	}
+	printf("total rec_len = [0x%08x (%d)]\n", (int)total_free,
+               (int)total_free);
+
+	return tdb_unlock(tdb, -1, F_WRLCK);
+}
+
+/* file: tdb.c */
+
+/*
+  non-blocking increment of the tdb sequence number if the tdb has been opened using
+  the TDB_SEQNUM flag
+*/
+void tdb_increment_seqnum_nonblock(struct tdb_context *tdb)
+{
+	tdb_off_t seqnum=0;
+
+	if (!(tdb->flags & TDB_SEQNUM)) {
+		return;
+	}
+
+	/* we ignore errors from this, as we have no sane way of
+	   dealing with them.
+	*/
+	if (tdb_ofs_read(tdb, TDB_SEQNUM_OFS, &seqnum) == -1)
+		return;
+	seqnum++;
+	(void) tdb_ofs_write(tdb, TDB_SEQNUM_OFS, &seqnum);
+}
+
+/*
+  increment the tdb sequence number if the tdb has been opened using
+  the TDB_SEQNUM flag
+*/
+static void tdb_increment_seqnum(struct tdb_context *tdb)
+{
+	if (!(tdb->flags & TDB_SEQNUM)) {
+		return;
+	}
+
+	if (tdb_brlock(tdb, TDB_SEQNUM_OFS, F_WRLCK, F_SETLKW, 1, 1) != 0) {
+		return;
+	}
+
+	tdb_increment_seqnum_nonblock(tdb);
+
+	tdb_brlock(tdb, TDB_SEQNUM_OFS, F_UNLCK, F_SETLKW, 1, 1);
+}
+
+static int tdb_key_compare(TDB_DATA key, TDB_DATA data,
+			   void *private_data EXT2FS_ATTR((unused)))
+{
+	return memcmp(data.dptr, key.dptr, data.dsize);
+}
+
+/* Returns 0 on fail.  On success, return offset of record, and fills
+   in rec */
+static tdb_off_t tdb_find(struct tdb_context *tdb, TDB_DATA key, u32 hash,
+			struct list_struct *r)
+{
+	tdb_off_t rec_ptr;
+
+	/* read in the hash top */
+	if (tdb_ofs_read(tdb, TDB_HASH_TOP(hash), &rec_ptr) == -1)
+		return 0;
+
+	/* keep looking until we find the right record */
+	while (rec_ptr) {
+		if (tdb_rec_read(tdb, rec_ptr, r) == -1)
+			return 0;
+
+		if (!TDB_DEAD(r) && hash==r->full_hash
+		    && key.dsize==r->key_len
+		    && tdb_parse_data(tdb, key, rec_ptr + sizeof(*r),
+				      r->key_len, tdb_key_compare,
+				      NULL) == 0) {
+			return rec_ptr;
+		}
+		rec_ptr = r->next;
+	}
+	return TDB_ERRCODE(TDB_ERR_NOEXIST, 0);
+}
+
+/* As tdb_find, but if you succeed, keep the lock */
+tdb_off_t tdb_find_lock_hash(struct tdb_context *tdb, TDB_DATA key, u32 hash, int locktype,
+			   struct list_struct *rec)
+{
+	u32 rec_ptr;
+
+	if (tdb_lock(tdb, BUCKET(hash), locktype) == -1)
+		return 0;
+	if (!(rec_ptr = tdb_find(tdb, key, hash, rec)))
+		tdb_unlock(tdb, BUCKET(hash), locktype);
+	return rec_ptr;
+}
+
+
+/* update an entry in place - this only works if the new data size
+   is <= the old data size and the key exists.
+   on failure return -1.
+*/
+static int tdb_update_hash(struct tdb_context *tdb, TDB_DATA key, u32 hash, TDB_DATA dbuf)
+{
+	struct list_struct rec;
+	tdb_off_t rec_ptr;
+
+	/* find entry */
+	if (!(rec_ptr = tdb_find(tdb, key, hash, &rec)))
+		return -1;
+
+	/* must be long enough key, data and tailer */
+	if (rec.rec_len < key.dsize + dbuf.dsize + sizeof(tdb_off_t)) {
+		tdb->ecode = TDB_SUCCESS; /* Not really an error */
+		return -1;
+	}
+
+	if (tdb->methods->tdb_write(tdb, rec_ptr + sizeof(rec) + rec.key_len,
+		      dbuf.dptr, dbuf.dsize) == -1)
+		return -1;
+
+	if (dbuf.dsize != rec.data_len) {
+		/* update size */
+		rec.data_len = dbuf.dsize;
+		return tdb_rec_write(tdb, rec_ptr, &rec);
+	}
+
+	return 0;
+}
+
+/* find an entry in the database given a key */
+/* If an entry doesn't exist tdb_err will be set to
+ * TDB_ERR_NOEXIST. If a key has no data attached
+ * then the TDB_DATA will have zero length but
+ * a non-zero pointer
+ */
+TDB_DATA tdb_fetch(struct tdb_context *tdb, TDB_DATA key)
+{
+	tdb_off_t rec_ptr;
+	struct list_struct rec;
+	TDB_DATA ret;
+	u32 hash;
+
+	/* find which hash bucket it is in */
+	hash = tdb->hash_fn(&key);
+	if (!(rec_ptr = tdb_find_lock_hash(tdb,key,hash,F_RDLCK,&rec)))
+		return tdb_null;
+
+	ret.dptr = tdb_alloc_read(tdb, rec_ptr + sizeof(rec) + rec.key_len,
+				  rec.data_len);
+	ret.dsize = rec.data_len;
+	tdb_unlock(tdb, BUCKET(rec.full_hash), F_RDLCK);
+	return ret;
+}
+
+/*
+ * Find an entry in the database and hand the record's data to a parsing
+ * function. The parsing function is executed under the chain read lock, so it
+ * should be fast and should not block on other syscalls.
+ *
+ * DONT CALL OTHER TDB CALLS FROM THE PARSER, THIS MIGHT LEAD TO SEGFAULTS.
+ *
+ * For mmapped tdb's that do not have a transaction open it points the parsing
+ * function directly at the mmap area, it avoids the malloc/memcpy in this
+ * case. If a transaction is open or no mmap is available, it has to do
+ * malloc/read/parse/free.
+ *
+ * This is interesting for all readers of potentially large data structures in
+ * the tdb records, ldb indexes being one example.
+ */
+
+int tdb_parse_record(struct tdb_context *tdb, TDB_DATA key,
+		     int (*parser)(TDB_DATA key, TDB_DATA data,
+				   void *private_data),
+		     void *private_data)
+{
+	tdb_off_t rec_ptr;
+	struct list_struct rec;
+	int ret;
+	u32 hash;
+
+	/* find which hash bucket it is in */
+	hash = tdb->hash_fn(&key);
+
+	if (!(rec_ptr = tdb_find_lock_hash(tdb,key,hash,F_RDLCK,&rec))) {
+		return TDB_ERRCODE(TDB_ERR_NOEXIST, 0);
+	}
+
+	ret = tdb_parse_data(tdb, key, rec_ptr + sizeof(rec) + rec.key_len,
+			     rec.data_len, parser, private_data);
+
+	tdb_unlock(tdb, BUCKET(rec.full_hash), F_RDLCK);
+
+	return ret;
+}
+
+/* check if an entry in the database exists
+
+   note that 1 is returned if the key is found and 0 is returned if not found
+   this doesn't match the conventions in the rest of this module, but is
+   compatible with gdbm
+*/
+static int tdb_exists_hash(struct tdb_context *tdb, TDB_DATA key, u32 hash)
+{
+	struct list_struct rec;
+
+	if (tdb_find_lock_hash(tdb, key, hash, F_RDLCK, &rec) == 0)
+		return 0;
+	tdb_unlock(tdb, BUCKET(rec.full_hash), F_RDLCK);
+	return 1;
+}
+
+int tdb_exists(struct tdb_context *tdb, TDB_DATA key)
+{
+	u32 hash = tdb->hash_fn(&key);
+	return tdb_exists_hash(tdb, key, hash);
+}
+
+/* actually delete an entry in the database given the offset */
+int tdb_do_delete(struct tdb_context *tdb, tdb_off_t rec_ptr, struct list_struct*rec)
+{
+	tdb_off_t last_ptr, i;
+	struct list_struct lastrec;
+
+	if (tdb->read_only || tdb->traverse_read) return -1;
+
+	if (tdb_write_lock_record(tdb, rec_ptr) == -1) {
+		/* Someone traversing here: mark it as dead */
+		rec->magic = TDB_DEAD_MAGIC;
+		return tdb_rec_write(tdb, rec_ptr, rec);
+	}
+	if (tdb_write_unlock_record(tdb, rec_ptr) != 0)
+		return -1;
+
+	/* find previous record in hash chain */
+	if (tdb_ofs_read(tdb, TDB_HASH_TOP(rec->full_hash), &i) == -1)
+		return -1;
+	for (last_ptr = 0; i != rec_ptr; last_ptr = i, i = lastrec.next)
+		if (tdb_rec_read(tdb, i, &lastrec) == -1)
+			return -1;
+
+	/* unlink it: next ptr is at start of record. */
+	if (last_ptr == 0)
+		last_ptr = TDB_HASH_TOP(rec->full_hash);
+	if (tdb_ofs_write(tdb, last_ptr, &rec->next) == -1)
+		return -1;
+
+	/* recover the space */
+	if (tdb_free(tdb, rec_ptr, rec) == -1)
+		return -1;
+	return 0;
+}
+
+static int tdb_count_dead(struct tdb_context *tdb, u32 hash)
+{
+	int res = 0;
+	tdb_off_t rec_ptr;
+	struct list_struct rec;
+
+	/* read in the hash top */
+	if (tdb_ofs_read(tdb, TDB_HASH_TOP(hash), &rec_ptr) == -1)
+		return 0;
+
+	while (rec_ptr) {
+		if (tdb_rec_read(tdb, rec_ptr, &rec) == -1)
+			return 0;
+
+		if (rec.magic == TDB_DEAD_MAGIC) {
+			res += 1;
+		}
+		rec_ptr = rec.next;
+	}
+	return res;
+}
+
+/*
+ * Purge all DEAD records from a hash chain
+ */
+static int tdb_purge_dead(struct tdb_context *tdb, u32 hash)
+{
+	int res = -1;
+	struct list_struct rec;
+	tdb_off_t rec_ptr;
+
+	if (tdb_lock(tdb, -1, F_WRLCK) == -1) {
+		return -1;
+	}
+
+	/* read in the hash top */
+	if (tdb_ofs_read(tdb, TDB_HASH_TOP(hash), &rec_ptr) == -1)
+		goto fail;
+
+	while (rec_ptr) {
+		tdb_off_t next;
+
+		if (tdb_rec_read(tdb, rec_ptr, &rec) == -1) {
+			goto fail;
+		}
+
+		next = rec.next;
+
+		if (rec.magic == TDB_DEAD_MAGIC
+		    && tdb_do_delete(tdb, rec_ptr, &rec) == -1) {
+			goto fail;
+		}
+		rec_ptr = next;
+	}
+	res = 0;
+ fail:
+	tdb_unlock(tdb, -1, F_WRLCK);
+	return res;
+}
+
+/* delete an entry in the database given a key */
+static int tdb_delete_hash(struct tdb_context *tdb, TDB_DATA key, u32 hash)
+{
+	tdb_off_t rec_ptr;
+	struct list_struct rec;
+	int ret;
+
+	if (tdb->max_dead_records != 0) {
+
+		/*
+		 * Allow for some dead records per hash chain, mainly for
+		 * tdb's with a very high create/delete rate like locking.tdb.
+		 */
+
+		if (tdb_lock(tdb, BUCKET(hash), F_WRLCK) == -1)
+			return -1;
+
+		if (tdb_count_dead(tdb, hash) >= tdb->max_dead_records) {
+			/*
+			 * Don't let the per-chain freelist grow too large,
+			 * delete all existing dead records
+			 */
+			tdb_purge_dead(tdb, hash);
+		}
+
+		if (!(rec_ptr = tdb_find(tdb, key, hash, &rec))) {
+			tdb_unlock(tdb, BUCKET(hash), F_WRLCK);
+			return -1;
+		}
+
+		/*
+		 * Just mark the record as dead.
+		 */
+		rec.magic = TDB_DEAD_MAGIC;
+		ret = tdb_rec_write(tdb, rec_ptr, &rec);
+	}
+	else {
+		if (!(rec_ptr = tdb_find_lock_hash(tdb, key, hash, F_WRLCK,
+						   &rec)))
+			return -1;
+
+		ret = tdb_do_delete(tdb, rec_ptr, &rec);
+	}
+
+	if (ret == 0) {
+		tdb_increment_seqnum(tdb);
+	}
+
+	if (tdb_unlock(tdb, BUCKET(rec.full_hash), F_WRLCK) != 0)
+		TDB_LOG((tdb, TDB_DEBUG_WARNING, "tdb_delete: WARNING tdb_unlock failed!\n"));
+	return ret;
+}
+
+int tdb_delete(struct tdb_context *tdb, TDB_DATA key)
+{
+	u32 hash = tdb->hash_fn(&key);
+	return tdb_delete_hash(tdb, key, hash);
+}
+
+/*
+ * See if we have a dead record around with enough space
+ */
+static tdb_off_t tdb_find_dead(struct tdb_context *tdb, u32 hash,
+			       struct list_struct *r, tdb_len_t length)
+{
+	tdb_off_t rec_ptr;
+
+	/* read in the hash top */
+	if (tdb_ofs_read(tdb, TDB_HASH_TOP(hash), &rec_ptr) == -1)
+		return 0;
+
+	/* keep looking until we find the right record */
+	while (rec_ptr) {
+		if (tdb_rec_read(tdb, rec_ptr, r) == -1)
+			return 0;
+
+		if (TDB_DEAD(r) && r->rec_len >= length) {
+			/*
+			 * First fit for simple coding, TODO: change to best
+			 * fit
+			 */
+			return rec_ptr;
+		}
+		rec_ptr = r->next;
+	}
+	return 0;
+}
+
+/* store an element in the database, replacing any existing element
+   with the same key
+
+   return 0 on success, -1 on failure
+*/
+int tdb_store(struct tdb_context *tdb, TDB_DATA key, TDB_DATA dbuf, int flag)
+{
+	struct list_struct rec;
+	u32 hash;
+	tdb_off_t rec_ptr;
+	char *p = NULL;
+	int ret = -1;
+
+	if (tdb->read_only || tdb->traverse_read) {
+		tdb->ecode = TDB_ERR_RDONLY;
+		return -1;
+	}
+
+	/* find which hash bucket it is in */
+	hash = tdb->hash_fn(&key);
+	if (tdb_lock(tdb, BUCKET(hash), F_WRLCK) == -1)
+		return -1;
+
+	/* check for it existing, on insert. */
+	if (flag == TDB_INSERT) {
+		if (tdb_exists_hash(tdb, key, hash)) {
+			tdb->ecode = TDB_ERR_EXISTS;
+			goto fail;
+		}
+	} else {
+		/* first try in-place update, on modify or replace. */
+		if (tdb_update_hash(tdb, key, hash, dbuf) == 0) {
+			goto done;
+		}
+		if (tdb->ecode == TDB_ERR_NOEXIST &&
+		    flag == TDB_MODIFY) {
+			/* if the record doesn't exist and we are in TDB_MODIFY mode then
+			 we should fail the store */
+			goto fail;
+		}
+	}
+	/* reset the error code potentially set by the tdb_update() */
+	tdb->ecode = TDB_SUCCESS;
+
+	/* delete any existing record - if it doesn't exist we don't
+           care.  Doing this first reduces fragmentation, and avoids
+           coalescing with `allocated' block before it's updated. */
+	if (flag != TDB_INSERT)
+		tdb_delete_hash(tdb, key, hash);
+
+	/* Copy key+value *before* allocating free space in case malloc
+	   fails and we are left with a dead spot in the tdb. */
+
+	if (!(p = (char *)malloc(key.dsize + dbuf.dsize))) {
+		tdb->ecode = TDB_ERR_OOM;
+		goto fail;
+	}
+
+	memcpy(p, key.dptr, key.dsize);
+	if (dbuf.dsize)
+		memcpy(p+key.dsize, dbuf.dptr, dbuf.dsize);
+
+	if (tdb->max_dead_records != 0) {
+		/*
+		 * Allow for some dead records per hash chain, look if we can
+		 * find one that can hold the new record. We need enough space
+		 * for key, data and tailer. If we find one, we don't have to
+		 * consult the central freelist.
+		 */
+		rec_ptr = tdb_find_dead(
+			tdb, hash, &rec,
+			key.dsize + dbuf.dsize + sizeof(tdb_off_t));
+
+		if (rec_ptr != 0) {
+			rec.key_len = key.dsize;
+			rec.data_len = dbuf.dsize;
+			rec.full_hash = hash;
+			rec.magic = TDB_MAGIC;
+			if (tdb_rec_write(tdb, rec_ptr, &rec) == -1
+			    || tdb->methods->tdb_write(
+				    tdb, rec_ptr + sizeof(rec),
+				    p, key.dsize + dbuf.dsize) == -1) {
+				goto fail;
+			}
+			goto done;
+		}
+	}
+
+	/*
+	 * We have to allocate some space from the freelist, so this means we
+	 * have to lock it. Use the chance to purge all the DEAD records from
+	 * the hash chain under the freelist lock.
+	 */
+
+	if (tdb_lock(tdb, -1, F_WRLCK) == -1) {
+		goto fail;
+	}
+
+	if ((tdb->max_dead_records != 0)
+	    && (tdb_purge_dead(tdb, hash) == -1)) {
+		tdb_unlock(tdb, -1, F_WRLCK);
+		goto fail;
+	}
+
+	/* we have to allocate some space */
+	rec_ptr = tdb_allocate(tdb, key.dsize + dbuf.dsize, &rec);
+
+	tdb_unlock(tdb, -1, F_WRLCK);
+
+	if (rec_ptr == 0) {
+		goto fail;
+	}
+
+	/* Read hash top into next ptr */
+	if (tdb_ofs_read(tdb, TDB_HASH_TOP(hash), &rec.next) == -1)
+		goto fail;
+
+	rec.key_len = key.dsize;
+	rec.data_len = dbuf.dsize;
+	rec.full_hash = hash;
+	rec.magic = TDB_MAGIC;
+
+	/* write out and point the top of the hash chain at it */
+	if (tdb_rec_write(tdb, rec_ptr, &rec) == -1
+	    || tdb->methods->tdb_write(tdb, rec_ptr+sizeof(rec), p, key.dsize+dbuf.dsize)==-1
+	    || tdb_ofs_write(tdb, TDB_HASH_TOP(hash), &rec_ptr) == -1) {
+		/* Need to tdb_unallocate() here */
+		goto fail;
+	}
+
+ done:
+	ret = 0;
+ fail:
+	if (ret == 0) {
+		tdb_increment_seqnum(tdb);
+	}
+
+	SAFE_FREE(p);
+	tdb_unlock(tdb, BUCKET(hash), F_WRLCK);
+	return ret;
+}
+
+
+/* Append to an entry. Create if not exist. */
+int tdb_append(struct tdb_context *tdb, TDB_DATA key, TDB_DATA new_dbuf)
+{
+	u32 hash;
+	TDB_DATA dbuf;
+	int ret = -1;
+
+	/* find which hash bucket it is in */
+	hash = tdb->hash_fn(&key);
+	if (tdb_lock(tdb, BUCKET(hash), F_WRLCK) == -1)
+		return -1;
+
+	dbuf = tdb_fetch(tdb, key);
+
+	if (dbuf.dptr == NULL) {
+		dbuf.dptr = (unsigned char *)malloc(new_dbuf.dsize);
+	} else {
+		unsigned char *new_dptr = (unsigned char *)realloc(dbuf.dptr,
+						     dbuf.dsize + new_dbuf.dsize);
+		if (new_dptr == NULL) {
+			free(dbuf.dptr);
+		}
+		dbuf.dptr = new_dptr;
+	}
+
+	if (dbuf.dptr == NULL) {
+		tdb->ecode = TDB_ERR_OOM;
+		goto failed;
+	}
+
+	memcpy(dbuf.dptr + dbuf.dsize, new_dbuf.dptr, new_dbuf.dsize);
+	dbuf.dsize += new_dbuf.dsize;
+
+	ret = tdb_store(tdb, key, dbuf, 0);
+
+failed:
+	tdb_unlock(tdb, BUCKET(hash), F_WRLCK);
+	SAFE_FREE(dbuf.dptr);
+	return ret;
+}
+
+
+/*
+  return the name of the current tdb file
+  useful for external logging functions
+*/
+const char *tdb_name(struct tdb_context *tdb)
+{
+	return tdb->name;
+}
+
+/*
+  return the underlying file descriptor being used by tdb, or -1
+  useful for external routines that want to check the device/inode
+  of the fd
+*/
+int tdb_fd(struct tdb_context *tdb)
+{
+	return tdb->fd;
+}
+
+/*
+  return the current logging function
+  useful for external tdb routines that wish to log tdb errors
+*/
+tdb_log_func tdb_log_fn(struct tdb_context *tdb)
+{
+	return tdb->log.log_fn;
+}
+
+
+/*
+  get the tdb sequence number. Only makes sense if the writers opened
+  with TDB_SEQNUM set. Note that this sequence number will wrap quite
+  quickly, so it should only be used for a 'has something changed'
+  test, not for code that relies on the count of the number of changes
+  made. If you want a counter then use a tdb record.
+
+  The aim of this sequence number is to allow for a very lightweight
+  test of a possible tdb change.
+*/
+int tdb_get_seqnum(struct tdb_context *tdb)
+{
+	tdb_off_t seqnum=0;
+
+	if (tdb_ofs_read(tdb, TDB_SEQNUM_OFS, &seqnum) == -1)
+		return 0;
+	return seqnum;
+}
+
+int tdb_hash_size(struct tdb_context *tdb)
+{
+	return tdb->header.hash_size;
+}
+
+size_t tdb_map_size(struct tdb_context *tdb)
+{
+	return tdb->map_size;
+}
+
+int tdb_get_flags(struct tdb_context *tdb)
+{
+	return tdb->flags;
+}
+
+
+/*
+  enable sequence number handling on an open tdb
+*/
+void tdb_enable_seqnum(struct tdb_context *tdb)
+{
+	tdb->flags |= TDB_SEQNUM;
+}
+
+/* file: open.c */
+
+/* all contexts, to ensure no double-opens (fcntl locks don't nest!) */
+static struct tdb_context *tdbs = NULL;
+
+
+/* This is from a hash algorithm suggested by Rogier Wolff */
+static unsigned int default_tdb_hash(TDB_DATA *key)
+{
+	u32 value;	/* Used to compute the hash value.  */
+	u32   i;	/* Used to cycle through random values. */
+
+	/* Set the initial value from the key size. */
+	for (value = 0, i=0; i < key->dsize; i++)
+		value = value * 256 + key->dptr[i] + (value >> 24) * 241;
+
+	return value;
+}
+
+
+/* initialise a new database with a specified hash size */
+static int tdb_new_database(struct tdb_context *tdb, int hash_size)
+{
+	struct tdb_header *newdb;
+	int size, ret = -1;
+
+	/* We make it up in memory, then write it out if not internal */
+	size = sizeof(struct tdb_header) + (hash_size+1)*sizeof(tdb_off_t);
+	if (!(newdb = (struct tdb_header *)calloc(size, 1)))
+		return TDB_ERRCODE(TDB_ERR_OOM, -1);
+
+	/* Fill in the header */
+	newdb->version = TDB_VERSION;
+	newdb->hash_size = hash_size;
+	if (tdb->flags & TDB_INTERNAL) {
+		tdb->map_size = size;
+		tdb->map_ptr = (char *)newdb;
+		memcpy(&tdb->header, newdb, sizeof(tdb->header));
+		/* Convert the `ondisk' version if asked. */
+		CONVERT(*newdb);
+		return 0;
+	}
+	if (lseek(tdb->fd, 0, SEEK_SET) == -1)
+		goto fail;
+
+	if (ftruncate(tdb->fd, 0) == -1)
+		goto fail;
+
+	/* This creates an endian-converted header, as if read from disk */
+	CONVERT(*newdb);
+	memcpy(&tdb->header, newdb, sizeof(tdb->header));
+	/* Don't endian-convert the magic food! */
+	memcpy(newdb->magic_food, TDB_MAGIC_FOOD, strlen(TDB_MAGIC_FOOD)+1);
+	if (write(tdb->fd, newdb, size) != size) {
+		ret = -1;
+	} else {
+		ret = 0;
+	}
+
+  fail:
+	SAFE_FREE(newdb);
+	return ret;
+}
+
+
+
+static int tdb_already_open(dev_t device,
+			    ino_t ino)
+{
+	struct tdb_context *i;
+
+	for (i = tdbs; i; i = i->next) {
+		if (i->device == device && i->inode == ino) {
+			return 1;
+		}
+	}
+
+	return 0;
+}
+
+/* open the database, creating it if necessary
+
+   The open_flags and mode are passed straight to the open call on the
+   database file. A flags value of O_WRONLY is invalid. The hash size
+   is advisory, use zero for a default value.
+
+   Return is NULL on error, in which case errno is also set.  Don't
+   try to call tdb_error or tdb_errname, just do strerror(errno).
+
+   @param name may be NULL for internal databases. */
+struct tdb_context *tdb_open(const char *name, int hash_size, int tdb_flags,
+		      int open_flags, mode_t mode)
+{
+	return tdb_open_ex(name, hash_size, tdb_flags, open_flags, mode, NULL, NULL);
+}
+
+/* a default logging function */
+static void null_log_fn(struct tdb_context *tdb, enum tdb_debug_level level, const char *fmt, ...) PRINTF_ATTRIBUTE(3, 4);
+static void null_log_fn(struct tdb_context *tdb EXT2FS_ATTR((unused)),
+			enum tdb_debug_level level EXT2FS_ATTR((unused)),
+			const char *fmt EXT2FS_ATTR((unused)), ...)
+{
+}
+
+
+struct tdb_context *tdb_open_ex(const char *name, int hash_size, int tdb_flags,
+				int open_flags, mode_t mode,
+				const struct tdb_logging_context *log_ctx,
+				tdb_hash_func hash_fn)
+{
+	struct tdb_context *tdb;
+	struct stat st;
+	int rev = 0, locked = 0;
+	unsigned char *vp;
+	u32 vertest;
+
+	if (!(tdb = (struct tdb_context *)calloc(1, sizeof *tdb))) {
+		/* Can't log this */
+		errno = ENOMEM;
+		goto fail;
+	}
+	tdb_io_init(tdb);
+	tdb->fd = -1;
+	tdb->name = NULL;
+	tdb->map_ptr = NULL;
+	tdb->flags = tdb_flags;
+	tdb->open_flags = open_flags;
+	if (log_ctx) {
+		tdb->log = *log_ctx;
+	} else {
+		tdb->log.log_fn = null_log_fn;
+		tdb->log.log_private = NULL;
+	}
+	tdb->hash_fn = hash_fn ? hash_fn : default_tdb_hash;
+
+	/* cache the page size */
+	tdb->page_size = sysconf(_SC_PAGESIZE);
+	if (tdb->page_size <= 0) {
+		tdb->page_size = 0x2000;
+	}
+
+	if ((open_flags & O_ACCMODE) == O_WRONLY) {
+		TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_open_ex: can't open tdb %s write-only\n",
+			 name));
+		errno = EINVAL;
+		goto fail;
+	}
+
+	if (hash_size == 0)
+		hash_size = DEFAULT_HASH_SIZE;
+	if ((open_flags & O_ACCMODE) == O_RDONLY) {
+		tdb->read_only = 1;
+		/* read only databases don't do locking or clear if first */
+		tdb->flags |= TDB_NOLOCK;
+		tdb->flags &= ~TDB_CLEAR_IF_FIRST;
+	}
+
+	/* internal databases don't mmap or lock, and start off cleared */
+	if (tdb->flags & TDB_INTERNAL) {
+		tdb->flags |= (TDB_NOLOCK | TDB_NOMMAP);
+		tdb->flags &= ~TDB_CLEAR_IF_FIRST;
+		if (tdb_new_database(tdb, hash_size) != 0) {
+			TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_open_ex: tdb_new_database failed!"));
+			goto fail;
+		}
+		goto internal;
+	}
+
+	if ((tdb->fd = open(name, open_flags, mode)) == -1) {
+		TDB_LOG((tdb, TDB_DEBUG_WARNING, "tdb_open_ex: could not open file %s: %s\n",
+			 name, strerror(errno)));
+		goto fail;	/* errno set by open(2) */
+	}
+
+	/* ensure there is only one process initialising at once */
+	if (tdb->methods->tdb_brlock(tdb, GLOBAL_LOCK, F_WRLCK, F_SETLKW, 0, 1) == -1) {
+		TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_open_ex: failed to get global lock on %s: %s\n",
+			 name, strerror(errno)));
+		goto fail;	/* errno set by tdb_brlock */
+	}
+
+	/* we need to zero database if we are the only one with it open */
+	if ((tdb_flags & TDB_CLEAR_IF_FIRST) &&
+	    (locked = (tdb->methods->tdb_brlock(tdb, ACTIVE_LOCK, F_WRLCK, F_SETLK, 0, 1) == 0))) {
+		open_flags |= O_CREAT;
+		if (ftruncate(tdb->fd, 0) == -1) {
+			TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_open_ex: "
+				 "failed to truncate %s: %s\n",
+				 name, strerror(errno)));
+			goto fail; /* errno set by ftruncate */
+		}
+	}
+
+	if (read(tdb->fd, &tdb->header, sizeof(tdb->header)) != sizeof(tdb->header)
+	    || memcmp(tdb->header.magic_food, TDB_MAGIC_FOOD,
+		      sizeof(TDB_MAGIC_FOOD)) != 0
+	    || (tdb->header.version != TDB_VERSION
+		&& !(rev = (tdb->header.version==TDB_BYTEREV(TDB_VERSION))))) {
+		/* its not a valid database - possibly initialise it */
+		if (!(open_flags & O_CREAT) || tdb_new_database(tdb, hash_size) == -1) {
+			errno = EIO; /* ie bad format or something */
+			goto fail;
+		}
+		rev = (tdb->flags & TDB_CONVERT);
+	}
+	vp = (unsigned char *)&tdb->header.version;
+	vertest = (((u32)vp[0]) << 24) | (((u32)vp[1]) << 16) |
+		  (((u32)vp[2]) << 8) | (u32)vp[3];
+	tdb->flags |= (vertest==TDB_VERSION) ? TDB_BIGENDIAN : 0;
+	if (!rev)
+		tdb->flags &= ~TDB_CONVERT;
+	else {
+		tdb->flags |= TDB_CONVERT;
+		tdb_convert(&tdb->header, sizeof(tdb->header));
+	}
+	if (fstat(tdb->fd, &st) == -1)
+		goto fail;
+
+	if (tdb->header.rwlocks != 0) {
+		TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_open_ex: spinlocks no longer supported\n"));
+		goto fail;
+	}
+
+	/* Is it already in the open list?  If so, fail. */
+	if (tdb_already_open(st.st_dev, st.st_ino)) {
+		TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_open_ex: "
+			 "%s (%d,%d) is already open in this process\n",
+			 name, (int)st.st_dev, (int)st.st_ino));
+		errno = EBUSY;
+		goto fail;
+	}
+
+	if (!(tdb->name = (char *)strdup(name))) {
+		errno = ENOMEM;
+		goto fail;
+	}
+
+	tdb->map_size = st.st_size;
+	tdb->device = st.st_dev;
+	tdb->inode = st.st_ino;
+	tdb->max_dead_records = 0;
+	tdb_mmap(tdb);
+	if (locked) {
+		if (tdb->methods->tdb_brlock(tdb, ACTIVE_LOCK, F_UNLCK, F_SETLK, 0, 1) == -1) {
+			TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_open_ex: "
+				 "failed to take ACTIVE_LOCK on %s: %s\n",
+				 name, strerror(errno)));
+			goto fail;
+		}
+
+	}
+
+	/* We always need to do this if the CLEAR_IF_FIRST flag is set, even if
+	   we didn't get the initial exclusive lock as we need to let all other
+	   users know we're using it. */
+
+	if (tdb_flags & TDB_CLEAR_IF_FIRST) {
+		/* leave this lock in place to indicate it's in use */
+		if (tdb->methods->tdb_brlock(tdb, ACTIVE_LOCK, F_RDLCK, F_SETLKW, 0, 1) == -1)
+			goto fail;
+	}
+
+	/* if needed, run recovery */
+	if (tdb_transaction_recover(tdb) == -1) {
+		goto fail;
+	}
+
+ internal:
+	/* Internal (memory-only) databases skip all the code above to
+	 * do with disk files, and resume here by releasing their
+	 * global lock and hooking into the active list. */
+	if (tdb->methods->tdb_brlock(tdb, GLOBAL_LOCK, F_UNLCK, F_SETLKW, 0, 1) == -1)
+		goto fail;
+	tdb->next = tdbs;
+	tdbs = tdb;
+	return tdb;
+
+ fail:
+	{ int save_errno = errno;
+
+	if (!tdb)
+		return NULL;
+
+	if (tdb->map_ptr) {
+		if (tdb->flags & TDB_INTERNAL)
+			SAFE_FREE(tdb->map_ptr);
+		else
+			tdb_munmap(tdb);
+	}
+	SAFE_FREE(tdb->name);
+	if (tdb->fd != -1)
+		if (close(tdb->fd) != 0)
+			TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_open_ex: failed to close tdb->fd on error!\n"));
+	SAFE_FREE(tdb);
+	errno = save_errno;
+	return NULL;
+	}
+}
+
+/*
+ * Set the maximum number of dead records per hash chain
+ */
+
+void tdb_set_max_dead(struct tdb_context *tdb, int max_dead)
+{
+	tdb->max_dead_records = max_dead;
+}
+
+/**
+ * Close a database.
+ *
+ * @returns -1 for error; 0 for success.
+ **/
+int tdb_close(struct tdb_context *tdb)
+{
+	struct tdb_context **i;
+	int ret = 0;
+
+	if (tdb->transaction) {
+		tdb_transaction_cancel(tdb);
+	}
+
+	if (tdb->map_ptr) {
+		if (tdb->flags & TDB_INTERNAL)
+			SAFE_FREE(tdb->map_ptr);
+		else
+			tdb_munmap(tdb);
+	}
+	SAFE_FREE(tdb->name);
+	if (tdb->fd != -1)
+		ret = close(tdb->fd);
+	SAFE_FREE(tdb->lockrecs);
+
+	/* Remove from contexts list */
+	for (i = &tdbs; *i; i = &(*i)->next) {
+		if (*i == tdb) {
+			*i = tdb->next;
+			break;
+		}
+	}
+
+	memset(tdb, 0, sizeof(*tdb));
+	SAFE_FREE(tdb);
+
+	return ret;
+}
+
+/* register a logging function */
+void tdb_set_logging_function(struct tdb_context *tdb,
+                              const struct tdb_logging_context *log_ctx)
+{
+        tdb->log = *log_ctx;
+}
+
+void *tdb_get_logging_private(struct tdb_context *tdb)
+{
+	return tdb->log.log_private;
+}
+
+/* reopen a tdb - this can be used after a fork to ensure that we have an independent
+   seek pointer from our parent and to re-establish locks */
+int tdb_reopen(struct tdb_context *tdb)
+{
+	struct stat st;
+
+	if (tdb->flags & TDB_INTERNAL) {
+		return 0; /* Nothing to do. */
+	}
+
+	if (tdb->num_locks != 0 || tdb->global_lock.count) {
+		TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_reopen: reopen not allowed with locks held\n"));
+		goto fail;
+	}
+
+	if (tdb->transaction != 0) {
+		TDB_LOG((tdb, TDB_DEBUG_ERROR, "tdb_reopen: reopen not allowed inside a transaction\n"));
+		goto fail;
+	}
+
+	if (tdb_munmap(tdb) != 0) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_reopen: munmap failed (%s)\n", strerror(errno)));
+		goto fail;
+	}
+	if (close(tdb->fd) != 0)
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_reopen: WARNING closing tdb->fd failed!\n"));
+	tdb->fd = open(tdb->name, tdb->open_flags & ~(O_CREAT|O_TRUNC), 0);
+	if (tdb->fd == -1) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_reopen: open failed (%s)\n", strerror(errno)));
+		goto fail;
+	}
+	if ((tdb->flags & TDB_CLEAR_IF_FIRST) &&
+	    (tdb->methods->tdb_brlock(tdb, ACTIVE_LOCK, F_RDLCK, F_SETLKW, 0, 1) == -1)) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_reopen: failed to obtain active lock\n"));
+		goto fail;
+	}
+	if (fstat(tdb->fd, &st) != 0) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_reopen: fstat failed (%s)\n", strerror(errno)));
+		goto fail;
+	}
+	if (st.st_ino != tdb->inode || st.st_dev != tdb->device) {
+		TDB_LOG((tdb, TDB_DEBUG_FATAL, "tdb_reopen: file dev/inode has changed!\n"));
+		goto fail;
+	}
+	tdb_mmap(tdb);
+
+	return 0;
+
+fail:
+	tdb_close(tdb);
+	return -1;
+}
+
+/* reopen all tdb's */
+int tdb_reopen_all(int parent_longlived)
+{
+	struct tdb_context *tdb;
+
+	for (tdb=tdbs; tdb; tdb = tdb->next) {
+		/*
+		 * If the parent is longlived (ie. a
+		 * parent daemon architecture), we know
+		 * it will keep it's active lock on a
+		 * tdb opened with CLEAR_IF_FIRST. Thus
+		 * for child processes we don't have to
+		 * add an active lock. This is essential
+		 * to improve performance on systems that
+		 * keep POSIX locks as a non-scalable data
+		 * structure in the kernel.
+		 */
+		if (parent_longlived) {
+			/* Ensure no clear-if-first. */
+			tdb->flags &= ~TDB_CLEAR_IF_FIRST;
+		}
+
+		if (tdb_reopen(tdb) != 0)
+			return -1;
+	}
+
+	return 0;
+}
+
+/**
+ * Flush a database file from the page cache.
+ **/
+int tdb_flush(struct tdb_context *tdb)
+{
+	if (tdb->fd != -1)
+		return fsync(tdb->fd);
+	return 0;
+}
diff --git a/lib/ext2fs/tdb.h b/lib/ext2fs/tdb.h
new file mode 100644
index 0000000..de7aa33
--- /dev/null
+++ b/lib/ext2fs/tdb.h
@@ -0,0 +1,215 @@
+#ifndef __TDB_H__
+#define __TDB_H__
+
+/*
+   Unix SMB/CIFS implementation.
+
+   trivial database library
+
+   Copyright (C) Andrew Tridgell 1999-2004
+
+     ** NOTE! The following LGPL license applies to the tdb
+     ** library. This does NOT imply that all of Samba is released
+     ** under the LGPL
+
+   This library is free software; you can redistribute it and/or
+   modify it under the terms of the GNU Lesser General Public
+   License as published by the Free Software Foundation; either
+   version 2 of the License, or (at your option) any later version.
+
+   This library is distributed in the hope that it will be useful,
+   but WITHOUT ANY WARRANTY; without even the implied warranty of
+   MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+   Lesser General Public License for more details.
+
+   You should have received a copy of the GNU Lesser General Public
+   License along with this library; if not, write to the Free Software
+   Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301  USA
+*/
+
+#ifdef  __cplusplus
+extern "C" {
+#endif
+
+
+/* flags to tdb_store() */
+#define TDB_REPLACE 1
+#define TDB_INSERT 2
+#define TDB_MODIFY 3
+
+/* flags for tdb_open() */
+#define TDB_DEFAULT 0 /* just a readability place holder */
+#define TDB_CLEAR_IF_FIRST 1
+#define TDB_INTERNAL 2 /* don't store on disk */
+#define TDB_NOLOCK   4 /* don't do any locking */
+#define TDB_NOMMAP   8 /* don't use mmap */
+#define TDB_CONVERT 16 /* convert endian (internal use) */
+#define TDB_BIGENDIAN 32 /* header is big-endian (internal use) */
+#define TDB_NOSYNC   64 /* don't use synchronous transactions */
+#define TDB_SEQNUM   128 /* maintain a sequence number */
+
+#define TDB_ERRCODE(code, ret) ((tdb->ecode = (code)), ret)
+
+/* error codes */
+enum TDB_ERROR {TDB_SUCCESS=0, TDB_ERR_CORRUPT, TDB_ERR_IO, TDB_ERR_LOCK,
+		TDB_ERR_OOM, TDB_ERR_EXISTS, TDB_ERR_NOLOCK, TDB_ERR_LOCK_TIMEOUT,
+		TDB_ERR_NOEXIST, TDB_ERR_EINVAL, TDB_ERR_RDONLY};
+
+/* debugging uses one of the following levels */
+enum tdb_debug_level {TDB_DEBUG_FATAL = 0, TDB_DEBUG_ERROR,
+		      TDB_DEBUG_WARNING, TDB_DEBUG_TRACE};
+
+typedef struct TDB_DATA {
+	unsigned char *dptr;
+	size_t dsize;
+} TDB_DATA;
+
+#ifndef PRINTF_ATTRIBUTE
+#if (__GNUC__ >= 3)
+/** Use gcc attribute to check printf fns.  a1 is the 1-based index of
+ * the parameter containing the format, and a2 the index of the first
+ * argument. Note that some gcc 2.x versions don't handle this
+ * properly **/
+#define PRINTF_ATTRIBUTE(a1, a2) __attribute__ ((format (__printf__, a1, a2)))
+#else
+#define PRINTF_ATTRIBUTE(a1, a2)
+#endif
+#endif
+
+/* ext2fs tdb renames */
+#define tdb_open ext2fs_tdb_open
+#define tdb_open_ex ext2fs_tdb_open_ex
+#define tdb_set_max_dead ext2fs_tdb_set_max_dead
+#define tdb_reopen ext2fs_tdb_reopen
+#define tdb_reopen_all ext2fs_tdb_reopen_all
+#define tdb_set_logging_function ext2fs_tdb_set_logging_function
+#define tdb_error ext2fs_tdb_error
+#define tdb_errorstr ext2fs_tdb_errorstr
+#define tdb_fetch ext2fs_tdb_fetch
+#define tdb_parse_record ext2fs_tdb_parse_record
+#define tdb_delete ext2fs_tdb_delete
+#define tdb_store ext2fs_tdb_store
+#define tdb_append ext2fs_tdb_append
+#define tdb_close ext2fs_tdb_close
+#define tdb_firstkey ext2fs_tdb_firstkey
+#define tdb_nextkey ext2fs_tdb_nextkey
+#define tdb_traverse ext2fs_tdb_traverse
+#define tdb_traverse_read ext2fs_tdb_traverse_read
+#define tdb_exists ext2fs_tdb_exists
+#define tdb_lockall ext2fs_tdb_lockall
+#define tdb_unlockall ext2fs_tdb_unlockall
+#define tdb_lockall_read ext2fs_tdb_lockall_read
+#define tdb_unlockall_read ext2fs_tdb_unlockall_read
+#define tdb_name ext2fs_tdb_name
+#define tdb_fd ext2fs_tdb_fd
+#define tdb_log_fn ext2fs_tdb_log_fn
+#define tdb_get_logging_private ext2fs_tdb_get_logging_private
+#define tdb_transaction_start ext2fs_tdb_transaction_start
+#define tdb_transaction_commit ext2fs_tdb_transaction_commit
+#define tdb_transaction_cancel ext2fs_tdb_transaction_cancel
+#define tdb_transaction_recover ext2fs_tdb_transaction_recover
+#define tdb_get_seqnum ext2fs_tdb_get_seqnum
+#define tdb_hash_size ext2fs_tdb_hash_size
+#define tdb_map_size ext2fs_tdb_map_size
+#define tdb_get_flags ext2fs_tdb_get_flags
+#define tdb_chainlock ext2fs_tdb_chainlock
+#define tdb_chainunlock ext2fs_tdb_chainunlock
+#define tdb_chainlock_read ext2fs_tdb_chainlock_read
+#define tdb_chainunlock_read ext2fs_tdb_chainunlock_read
+#define tdb_dump_all ext2fs_tdb_dump_all
+#define tdb_printfreelist ext2fs_tdb_printfreelist
+#define tdb_validate_freelist ext2fs_tdb_validate_freelist
+#define tdb_chainlock_mark ext2fs_tdb_chainlock_mark
+#define tdb_chainlock_nonblock ext2fs_tdb_chainlock_nonblock
+#define tdb_chainlock_unmark ext2fs_tdb_chainlock_unmark
+#define tdb_enable_seqnum ext2fs_tdb_enable_seqnum
+#define tdb_increment_seqnum_nonblock ext2fs_tdb_increment_seqnum_nonblock
+#define tdb_lock_nonblock ext2fs_tdb_lock_nonblock
+#define tdb_lockall_mark ext2fs_tdb_lockall_mark
+#define tdb_lockall_nonblock ext2fs_tdb_lockall_nonblock
+#define tdb_lockall_read_nonblock ext2fs_tdb_lockall_read_nonblock
+#define tdb_lockall_unmark ext2fs_tdb_lockall_unmark
+#define tdb_flush ext2fs_tdb_flush
+
+/* this is the context structure that is returned from a db open */
+typedef struct tdb_context TDB_CONTEXT;
+
+typedef int (*tdb_traverse_func)(struct tdb_context *, TDB_DATA, TDB_DATA, void *);
+typedef void (*tdb_log_func)(struct tdb_context *, enum tdb_debug_level, const char *, ...) PRINTF_ATTRIBUTE(3, 4);
+typedef unsigned int (*tdb_hash_func)(TDB_DATA *key);
+
+struct tdb_logging_context {
+        tdb_log_func log_fn;
+        void *log_private;
+};
+
+struct tdb_context *tdb_open(const char *name, int hash_size, int tdb_flags,
+		      int open_flags, mode_t mode);
+struct tdb_context *tdb_open_ex(const char *name, int hash_size, int tdb_flags,
+			 int open_flags, mode_t mode,
+			 const struct tdb_logging_context *log_ctx,
+			 tdb_hash_func hash_fn);
+void tdb_set_max_dead(struct tdb_context *tdb, int max_dead);
+
+int tdb_reopen(struct tdb_context *tdb);
+int tdb_reopen_all(int parent_longlived);
+void tdb_set_logging_function(struct tdb_context *tdb, const struct tdb_logging_context *log_ctx);
+enum TDB_ERROR tdb_error(struct tdb_context *tdb);
+const char *tdb_errorstr(struct tdb_context *tdb);
+TDB_DATA tdb_fetch(struct tdb_context *tdb, TDB_DATA key);
+int tdb_parse_record(struct tdb_context *tdb, TDB_DATA key,
+		     int (*parser)(TDB_DATA key, TDB_DATA data,
+				   void *private_data),
+		     void *private_data);
+int tdb_delete(struct tdb_context *tdb, TDB_DATA key);
+int tdb_store(struct tdb_context *tdb, TDB_DATA key, TDB_DATA dbuf, int flag);
+int tdb_append(struct tdb_context *tdb, TDB_DATA key, TDB_DATA new_dbuf);
+int tdb_close(struct tdb_context *tdb);
+TDB_DATA tdb_firstkey(struct tdb_context *tdb);
+TDB_DATA tdb_nextkey(struct tdb_context *tdb, TDB_DATA key);
+int tdb_traverse(struct tdb_context *tdb, tdb_traverse_func fn, void *);
+int tdb_traverse_read(struct tdb_context *tdb, tdb_traverse_func fn, void *);
+int tdb_exists(struct tdb_context *tdb, TDB_DATA key);
+int tdb_lockall(struct tdb_context *tdb);
+int tdb_lockall_nonblock(struct tdb_context *tdb);
+int tdb_unlockall(struct tdb_context *tdb);
+int tdb_lockall_read(struct tdb_context *tdb);
+int tdb_lockall_read_nonblock(struct tdb_context *tdb);
+int tdb_unlockall_read(struct tdb_context *tdb);
+int tdb_lockall_mark(struct tdb_context *tdb);
+int tdb_lockall_unmark(struct tdb_context *tdb);
+const char *tdb_name(struct tdb_context *tdb);
+int tdb_fd(struct tdb_context *tdb);
+tdb_log_func tdb_log_fn(struct tdb_context *tdb);
+void *tdb_get_logging_private(struct tdb_context *tdb);
+int tdb_transaction_start(struct tdb_context *tdb);
+int tdb_transaction_commit(struct tdb_context *tdb);
+int tdb_transaction_cancel(struct tdb_context *tdb);
+int tdb_transaction_recover(struct tdb_context *tdb);
+int tdb_get_seqnum(struct tdb_context *tdb);
+int tdb_hash_size(struct tdb_context *tdb);
+size_t tdb_map_size(struct tdb_context *tdb);
+int tdb_get_flags(struct tdb_context *tdb);
+void tdb_enable_seqnum(struct tdb_context *tdb);
+void tdb_increment_seqnum_nonblock(struct tdb_context *tdb);
+int tdb_flush(struct tdb_context *tdb);
+
+/* Low level locking functions: use with care */
+int tdb_chainlock(struct tdb_context *tdb, TDB_DATA key);
+int tdb_chainlock_nonblock(struct tdb_context *tdb, TDB_DATA key);
+int tdb_chainunlock(struct tdb_context *tdb, TDB_DATA key);
+int tdb_chainlock_read(struct tdb_context *tdb, TDB_DATA key);
+int tdb_chainunlock_read(struct tdb_context *tdb, TDB_DATA key);
+int tdb_chainlock_mark(struct tdb_context *tdb, TDB_DATA key);
+int tdb_chainlock_unmark(struct tdb_context *tdb, TDB_DATA key);
+
+/* Debug functions. Not used in production. */
+void tdb_dump_all(struct tdb_context *tdb);
+int tdb_printfreelist(struct tdb_context *tdb);
+int tdb_validate_freelist(struct tdb_context *tdb, int *pnum_entries);
+
+#ifdef  __cplusplus
+}
+#endif
+
+#endif /* tdb.h */
diff --git a/lib/ext2fs/tdb/build-tdb b/lib/ext2fs/tdb/build-tdb
new file mode 100755
index 0000000..1cc18f7
--- /dev/null
+++ b/lib/ext2fs/tdb/build-tdb
@@ -0,0 +1,34 @@
+#!/bin/sh
+#
+# This file creates a stand-alone TDB based on a set of sources from 
+# Samba
+
+#BASE_DIR=/usr/projects/samba/samba-4.0.0tp4/source/lib/tdb
+BASE_DIR=/usr/projects/samba/tdb
+
+rm -rf .pc
+
+FILES="error.c lock.c io.c transaction.c freelist.c \
+	freelistcheck.c traverse.c dump.c tdb.c open.c"
+
+(cd $BASE_DIR/common; svn info ) > .svninfo
+echo "/*" > tdb.c
+grep ^URL .svninfo >> tdb.c
+grep "^Last Changed Rev" .svninfo | sed -e 's/Last Changed //' >> tdb.c
+grep "^Last Changed Date" .svninfo >> tdb.c
+echo "*/" >> tdb.c
+
+cat $BASE_DIR/common/tdb_private.h >> tdb.c
+for i in $FILES; do
+	if [ `tail -n 1 tdb.c | wc -c` -gt 1 ]; then
+		printf "\n" >> tdb.c
+	fi
+	echo "/* file: $i */" >> tdb.c
+	sed -e '1,/#include "tdb_private.h"/d' < $BASE_DIR/common/$i >> tdb.c
+done
+
+cp $BASE_DIR/include/tdb.h .
+cp $BASE_DIR/tools/tdbtool.c .
+
+quilt push -a
+
diff --git a/lib/ext2fs/tdb/patches/copyright b/lib/ext2fs/tdb/patches/copyright
new file mode 100644
index 0000000..d9d1d84
--- /dev/null
+++ b/lib/ext2fs/tdb/patches/copyright
@@ -0,0 +1,20 @@
+Index: tdbsa/tdb.c
+===================================================================
+--- tdbsa.orig/tdb.c
++++ tdbsa/tdb.c
+@@ -4,11 +4,11 @@ Rev: 23371
+ Last Changed Date: 2007-06-06 20:14:06 -0400 (Wed, 06 Jun 2007)
+ */
+  /* 
+-   Unix SMB/CIFS implementation.
++   trivial database library - standalone version
+ 
+-   trivial database library - private includes
+-
+-   Copyright (C) Andrew Tridgell              2005
++   Copyright (C) Andrew Tridgell              1999-2005
++   Copyright (C) Jeremy Allison               2000-2006
++   Copyright (C) Paul `Rusty' Russell         2000
+    
+      ** NOTE! The following LGPL license applies to the tdb
+      ** library. This does NOT imply that all of Samba is released
diff --git a/lib/ext2fs/tdb/patches/ext2tdb-rename b/lib/ext2fs/tdb/patches/ext2tdb-rename
new file mode 100644
index 0000000..15bf085
--- /dev/null
+++ b/lib/ext2fs/tdb/patches/ext2tdb-rename
@@ -0,0 +1,65 @@
+Index: tdb/tdb.h
+===================================================================
+--- tdb.orig/tdb.h
++++ tdb/tdb.h
+@@ -76,6 +76,60 @@ typedef struct TDB_DATA {
+ #endif
+ #endif
+ 
++/* ext2fs tdb renames */
++#define tdb_open ext2fs_tdb_open
++#define tdb_open_ex ext2fs_tdb_open_ex
++#define tdb_set_max_dead ext2fs_tdb_set_max_dead
++#define tdb_reopen ext2fs_tdb_reopen
++#define tdb_reopen_all ext2fs_tdb_reopen_all
++#define tdb_set_logging_function ext2fs_tdb_set_logging_function
++#define tdb_error ext2fs_tdb_error
++#define tdb_errorstr ext2fs_tdb_errorstr
++#define tdb_fetch ext2fs_tdb_fetch
++#define tdb_parse_record ext2fs_tdb_parse_record
++#define tdb_delete ext2fs_tdb_delete
++#define tdb_store ext2fs_tdb_store
++#define tdb_append ext2fs_tdb_append
++#define tdb_close ext2fs_tdb_close
++#define tdb_firstkey ext2fs_tdb_firstkey
++#define tdb_nextkey ext2fs_tdb_nextkey
++#define tdb_traverse ext2fs_tdb_traverse
++#define tdb_traverse_read ext2fs_tdb_traverse_read
++#define tdb_exists ext2fs_tdb_exists
++#define tdb_lockall ext2fs_tdb_lockall
++#define tdb_unlockall ext2fs_tdb_unlockall
++#define tdb_lockall_read ext2fs_tdb_lockall_read
++#define tdb_unlockall_read ext2fs_tdb_unlockall_read
++#define tdb_name ext2fs_tdb_name
++#define tdb_fd ext2fs_tdb_fd
++#define tdb_log_fn ext2fs_tdb_log_fn
++#define tdb_get_logging_private ext2fs_tdb_get_logging_private
++#define tdb_transaction_start ext2fs_tdb_transaction_start
++#define tdb_transaction_commit ext2fs_tdb_transaction_commit
++#define tdb_transaction_cancel ext2fs_tdb_transaction_cancel
++#define tdb_transaction_recover ext2fs_tdb_transaction_recover
++#define tdb_get_seqnum ext2fs_tdb_get_seqnum
++#define tdb_hash_size ext2fs_tdb_hash_size
++#define tdb_map_size ext2fs_tdb_map_size
++#define tdb_get_flags ext2fs_tdb_get_flags
++#define tdb_chainlock ext2fs_tdb_chainlock
++#define tdb_chainunlock ext2fs_tdb_chainunlock
++#define tdb_chainlock_read ext2fs_tdb_chainlock_read
++#define tdb_chainunlock_read ext2fs_tdb_chainunlock_read
++#define tdb_dump_all ext2fs_tdb_dump_all
++#define tdb_printfreelist ext2fs_tdb_printfreelist
++#define tdb_validate_freelist ext2fs_tdb_validate_freelist
++#define tdb_chainlock_mark ext2fs_tdb_chainlock_mark
++#define tdb_chainlock_nonblock ext2fs_tdb_chainlock_nonblock
++#define tdb_chainlock_unmark ext2fs_tdb_chainlock_unmark
++#define tdb_enable_seqnum ext2fs_tdb_enable_seqnum
++#define tdb_increment_seqnum_nonblock ext2fs_tdb_increment_seqnum_nonblock
++#define tdb_lock_nonblock ext2fs_tdb_lock_nonblock
++#define tdb_lockall_mark ext2fs_tdb_lockall_mark
++#define tdb_lockall_nonblock ext2fs_tdb_lockall_nonblock
++#define tdb_lockall_read_nonblock ext2fs_tdb_lockall_read_nonblock
++#define tdb_lockall_unmark ext2fs_tdb_lockall_unmark
++
+ /* this is the context structure that is returned from a db open */
+ typedef struct tdb_context TDB_CONTEXT;
+ 
diff --git a/lib/ext2fs/tdb/patches/replace-includes b/lib/ext2fs/tdb/patches/replace-includes
new file mode 100644
index 0000000..f4181c1
--- /dev/null
+++ b/lib/ext2fs/tdb/patches/replace-includes
@@ -0,0 +1,92 @@
+Index: tdb/tdb.c
+===================================================================
+--- tdb.orig/tdb.c
++++ tdb/tdb.c
+@@ -29,11 +29,82 @@ Last Changed Date: 2007-06-22 13:36:10 -
+    Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301  USA
+ */
+ 
+-#include "replace.h"
+-#include "system/filesys.h"
+-#include "system/time.h"
+-#include "system/shmem.h"
+-#include "system/select.h"
++#ifdef CONFIG_STAND_ALONE
++#define HAVE_MMAP
++#define HAVE_STRDUP
++#define HAVE_SYS_MMAN_H
++#define HAVE_UTIME_H
++#define HAVE_UTIME
++#endif
++#define _XOPEN_SOURCE 500
++
++#include <unistd.h>
++#include <stdio.h>
++#include <stdlib.h>
++#include <stdarg.h>
++#include <stddef.h>
++#include <errno.h>
++#include <string.h>
++#ifdef HAVE_SYS_SELECT_H
++#include <sys/select.h>
++#endif
++#include <sys/time.h>
++#include <sys/types.h>
++#include <time.h>
++#ifdef HAVE_UTIME_H
++#include <utime.h>
++#endif
++#include <sys/stat.h>
++#include <sys/file.h>
++#include <fcntl.h>
++
++#ifdef HAVE_SYS_MMAN_H
++#include <sys/mman.h>
++#endif
++
++#ifndef MAP_FILE
++#define MAP_FILE 0
++#endif
++
++#ifndef MAP_FAILED
++#define MAP_FAILED ((void *)-1)
++#endif
++
++#ifndef HAVE_STRDUP
++#define strdup rep_strdup
++static char *rep_strdup(const char *s)
++{
++	char *ret;
++	int length;
++	if (!s)
++		return NULL;
++
++	if (!length)
++		length = strlen(s);
++
++	ret = malloc(length + 1);
++	if (ret) {
++		strncpy(ret, s, length);
++		ret[length] = '\0';
++	}
++	return ret;
++}
++#endif
++
++#ifndef PRINTF_ATTRIBUTE
++#if (__GNUC__ >= 3) && (__GNUC_MINOR__ >= 1 )
++/** Use gcc attribute to check printf fns.  a1 is the 1-based index of
++ * the parameter containing the format, and a2 the index of the first
++ * argument. Note that some gcc 2.x versions don't handle this
++ * properly **/
++#define PRINTF_ATTRIBUTE(a1, a2) __attribute__ ((format (__printf__, a1, a2)))
++#else
++#define PRINTF_ATTRIBUTE(a1, a2)
++#endif
++#endif
++
++typedef int bool;
++
+ #include "tdb.h"
+ 
+ #ifndef u32
diff --git a/lib/ext2fs/tdb/patches/series b/lib/ext2fs/tdb/patches/series
new file mode 100644
index 0000000..722b921
--- /dev/null
+++ b/lib/ext2fs/tdb/patches/series
@@ -0,0 +1,6 @@
+copyright
+replace-includes
+static-prototypes
+static-functions
+tdbtool-includes
+ext2tdb-rename
diff --git a/lib/ext2fs/tdb/patches/static-functions b/lib/ext2fs/tdb/patches/static-functions
new file mode 100644
index 0000000..ab0fbef
--- /dev/null
+++ b/lib/ext2fs/tdb/patches/static-functions
@@ -0,0 +1,13 @@
+Index: tdbsa/tdb.c
+===================================================================
+--- tdbsa.orig/tdb.c
++++ tdbsa/tdb.c
+@@ -2254,7 +2254,7 @@ int tdb_transaction_recover(struct tdb_c
+ /* file: freelist.c */
+ 
+ /* read a freelist record and check for simple errors */
+-int tdb_rec_free_read(struct tdb_context *tdb, tdb_off_t off, struct list_struct *rec)
++static int tdb_rec_free_read(struct tdb_context *tdb, tdb_off_t off, struct list_struct *rec)
+ {
+ 	if (tdb->methods->tdb_read(tdb, off, rec, sizeof(*rec),DOCONV()) == -1)
+ 		return -1;
diff --git a/lib/ext2fs/tdb/patches/static-prototypes b/lib/ext2fs/tdb/patches/static-prototypes
new file mode 100644
index 0000000..cf8af61
--- /dev/null
+++ b/lib/ext2fs/tdb/patches/static-prototypes
@@ -0,0 +1,72 @@
+Index: tdbsa/tdb.c
+===================================================================
+--- tdbsa.orig/tdb.c
++++ tdbsa/tdb.c
+@@ -251,39 +251,39 @@ struct tdb_context {
+ /*
+   internal prototypes
+ */
+-int tdb_munmap(struct tdb_context *tdb);
+-void tdb_mmap(struct tdb_context *tdb);
+-int tdb_lock(struct tdb_context *tdb, int list, int ltype);
+-int tdb_unlock(struct tdb_context *tdb, int list, int ltype);
+-int tdb_brlock(struct tdb_context *tdb, tdb_off_t offset, int rw_type, int lck_type, int probe, size_t len);
+-int tdb_transaction_lock(struct tdb_context *tdb, int ltype);
+-int tdb_transaction_unlock(struct tdb_context *tdb);
+-int tdb_brlock_upgrade(struct tdb_context *tdb, tdb_off_t offset, size_t len);
+-int tdb_write_lock_record(struct tdb_context *tdb, tdb_off_t off);
+-int tdb_write_unlock_record(struct tdb_context *tdb, tdb_off_t off);
+-int tdb_ofs_read(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d);
+-int tdb_ofs_write(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d);
+-void *tdb_convert(void *buf, u32 size);
+-int tdb_free(struct tdb_context *tdb, tdb_off_t offset, struct list_struct *rec);
+-tdb_off_t tdb_allocate(struct tdb_context *tdb, tdb_len_t length, struct list_struct *rec);
+-int tdb_ofs_read(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d);
+-int tdb_ofs_write(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d);
+-int tdb_lock_record(struct tdb_context *tdb, tdb_off_t off);
+-int tdb_unlock_record(struct tdb_context *tdb, tdb_off_t off);
+-int tdb_rec_read(struct tdb_context *tdb, tdb_off_t offset, struct list_struct *rec);
+-int tdb_rec_write(struct tdb_context *tdb, tdb_off_t offset, struct list_struct *rec);
+-int tdb_do_delete(struct tdb_context *tdb, tdb_off_t rec_ptr, struct list_struct *rec);
+-unsigned char *tdb_alloc_read(struct tdb_context *tdb, tdb_off_t offset, tdb_len_t len);
+-int tdb_parse_data(struct tdb_context *tdb, TDB_DATA key,
++static int tdb_munmap(struct tdb_context *tdb);
++static void tdb_mmap(struct tdb_context *tdb);
++static int tdb_lock(struct tdb_context *tdb, int list, int ltype);
++static int tdb_unlock(struct tdb_context *tdb, int list, int ltype);
++static int tdb_brlock(struct tdb_context *tdb, tdb_off_t offset, int rw_type, int lck_type, int probe, size_t len);
++static int tdb_transaction_lock(struct tdb_context *tdb, int ltype);
++static int tdb_transaction_unlock(struct tdb_context *tdb);
++static int tdb_brlock_upgrade(struct tdb_context *tdb, tdb_off_t offset, size_t len);
++static int tdb_write_lock_record(struct tdb_context *tdb, tdb_off_t off);
++static int tdb_write_unlock_record(struct tdb_context *tdb, tdb_off_t off);
++static int tdb_ofs_read(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d);
++static int tdb_ofs_write(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d);
++static void *tdb_convert(void *buf, u32 size);
++static int tdb_free(struct tdb_context *tdb, tdb_off_t offset, struct list_struct *rec);
++static tdb_off_t tdb_allocate(struct tdb_context *tdb, tdb_len_t length, struct list_struct *rec);
++static int tdb_ofs_read(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d);
++static int tdb_ofs_write(struct tdb_context *tdb, tdb_off_t offset, tdb_off_t *d);
++static int tdb_lock_record(struct tdb_context *tdb, tdb_off_t off);
++static int tdb_unlock_record(struct tdb_context *tdb, tdb_off_t off);
++static int tdb_rec_read(struct tdb_context *tdb, tdb_off_t offset, struct list_struct *rec);
++static int tdb_rec_write(struct tdb_context *tdb, tdb_off_t offset, struct list_struct *rec);
++static int tdb_do_delete(struct tdb_context *tdb, tdb_off_t rec_ptr, struct list_struct *rec);
++static unsigned char *tdb_alloc_read(struct tdb_context *tdb, tdb_off_t offset, tdb_len_t len);
++static int tdb_parse_data(struct tdb_context *tdb, TDB_DATA key,
+ 		   tdb_off_t offset, tdb_len_t len,
+ 		   int (*parser)(TDB_DATA key, TDB_DATA data,
+ 				 void *private_data),
+ 		   void *private_data);
+-tdb_off_t tdb_find_lock_hash(struct tdb_context *tdb, TDB_DATA key, u32 hash, int locktype,
++static tdb_off_t tdb_find_lock_hash(struct tdb_context *tdb, TDB_DATA key, u32 hash, int locktype,
+ 			   struct list_struct *rec);
+-void tdb_io_init(struct tdb_context *tdb);
+-int tdb_expand(struct tdb_context *tdb, tdb_off_t size);
+-int tdb_rec_free_read(struct tdb_context *tdb, tdb_off_t off,
++static void tdb_io_init(struct tdb_context *tdb);
++static int tdb_expand(struct tdb_context *tdb, tdb_off_t size);
++static int tdb_rec_free_read(struct tdb_context *tdb, tdb_off_t off,
+ 		      struct list_struct *rec);
+ 
+ 
diff --git a/lib/ext2fs/tdb/patches/tdbtool-includes b/lib/ext2fs/tdb/patches/tdbtool-includes
new file mode 100644
index 0000000..c076c79
--- /dev/null
+++ b/lib/ext2fs/tdb/patches/tdbtool-includes
@@ -0,0 +1,30 @@
+Index: tdbsa/tdbtool.c
+===================================================================
+--- tdbsa.orig/tdbtool.c
++++ tdbsa/tdbtool.c
+@@ -21,10 +21,21 @@
+    Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA.
+ */
+ 
+-#include "replace.h"
+-#include "system/locale.h"
+-#include "system/time.h"
+-#include "system/filesys.h"
++#include <errno.h>
++#include <stdlib.h>
++#include <stdio.h>
++#include <fcntl.h>
++#include <unistd.h>
++#include <string.h>
++#include <fcntl.h>
++#include <time.h>
++#include <sys/mman.h>
++#include <sys/stat.h>
++#include <sys/time.h>
++#include <ctype.h>
++#include <signal.h>
++#include <stdarg.h>
++
+ #include "tdb.h"
+ 
+ static int do_command(void);
diff --git a/lib/ext2fs/tdbtool.c b/lib/ext2fs/tdbtool.c
new file mode 100644
index 0000000..eeac0c8
--- /dev/null
+++ b/lib/ext2fs/tdbtool.c
@@ -0,0 +1,621 @@
+/*
+   Unix SMB/CIFS implementation.
+   Samba database functions
+   Copyright (C) Andrew Tridgell              1999-2000
+   Copyright (C) Paul `Rusty' Russell		   2000
+   Copyright (C) Jeremy Allison			   2000
+   Copyright (C) Andrew Esh                        2001
+
+   This program is free software; you can redistribute it and/or modify
+   it under the terms of the GNU General Public License as published by
+   the Free Software Foundation; either version 2 of the License, or
+   (at your option) any later version.
+
+   This program is distributed in the hope that it will be useful,
+   but WITHOUT ANY WARRANTY; without even the implied warranty of
+   MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+   GNU General Public License for more details.
+
+   You should have received a copy of the GNU General Public License
+   along with this program; if not, write to the Free Software
+   Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA.
+*/
+
+#include "config.h"
+#include <errno.h>
+#include <stdlib.h>
+#include <stdio.h>
+#include <fcntl.h>
+#include <unistd.h>
+#include <string.h>
+#include <fcntl.h>
+#include <time.h>
+#include <sys/mman.h>
+#include <sys/stat.h>
+#include <sys/time.h>
+#include <ctype.h>
+#include <signal.h>
+#include <stdarg.h>
+
+#include "tdb.h"
+
+static int do_command(void);
+const char *cmdname;
+char *arg1, *arg2;
+size_t arg1len, arg2len;
+int bIterate = 0;
+char *line;
+TDB_DATA iterate_kbuf;
+char cmdline[1024];
+
+enum commands {
+	CMD_CREATE_TDB,
+	CMD_OPEN_TDB,
+	CMD_ERASE,
+	CMD_DUMP,
+	CMD_INSERT,
+	CMD_MOVE,
+	CMD_STORE,
+	CMD_SHOW,
+	CMD_KEYS,
+	CMD_HEXKEYS,
+	CMD_DELETE,
+	CMD_LIST_HASH_FREE,
+	CMD_LIST_FREE,
+	CMD_INFO,
+	CMD_FIRST,
+	CMD_NEXT,
+	CMD_SYSTEM,
+	CMD_QUIT,
+	CMD_HELP
+};
+
+typedef struct {
+	const char *name;
+	enum commands cmd;
+} COMMAND_TABLE;
+
+COMMAND_TABLE cmd_table[] = {
+	{"create",	CMD_CREATE_TDB},
+	{"open",	CMD_OPEN_TDB},
+	{"erase",	CMD_ERASE},
+	{"dump",	CMD_DUMP},
+	{"insert",	CMD_INSERT},
+	{"move",	CMD_MOVE},
+	{"store",	CMD_STORE},
+	{"show",	CMD_SHOW},
+	{"keys",	CMD_KEYS},
+	{"hexkeys",	CMD_HEXKEYS},
+	{"delete",	CMD_DELETE},
+	{"list",	CMD_LIST_HASH_FREE},
+	{"free",	CMD_LIST_FREE},
+	{"info",	CMD_INFO},
+	{"first",	CMD_FIRST},
+	{"1",		CMD_FIRST},
+	{"next",	CMD_NEXT},
+	{"n",		CMD_NEXT},
+	{"quit",	CMD_QUIT},
+	{"q",		CMD_QUIT},
+	{"!",		CMD_SYSTEM},
+	{NULL,		CMD_HELP}
+};
+
+/* a tdb tool for manipulating a tdb database */
+
+static TDB_CONTEXT *tdb;
+
+static int print_rec(TDB_CONTEXT *the_tdb, TDB_DATA key, TDB_DATA dbuf, void *state);
+static int print_key(TDB_CONTEXT *the_tdb, TDB_DATA key, TDB_DATA dbuf, void *state);
+static int print_hexkey(TDB_CONTEXT *the_tdb, TDB_DATA key, TDB_DATA dbuf, void *state);
+
+static void print_asc(const char *buf,int len)
+{
+	int i;
+
+	/* We're probably printing ASCII strings so don't try to display
+	   the trailing NULL character. */
+
+	if (buf[len - 1] == 0)
+	        len--;
+
+	for (i=0;i<len;i++)
+		printf("%c",isprint(buf[i])?buf[i]:'.');
+}
+
+static void print_data(const char *buf,int len)
+{
+	int i=0;
+	if (len<=0) return;
+	printf("[%03X] ",i);
+	for (i=0;i<len;) {
+		printf("%02X ",(int)buf[i]);
+		i++;
+		if (i%8 == 0) printf(" ");
+		if (i%16 == 0) {
+			print_asc(&buf[i-16],8); printf(" ");
+			print_asc(&buf[i-8],8); printf("\n");
+			if (i<len) printf("[%03X] ",i);
+		}
+	}
+	if (i%16) {
+		int n;
+
+		n = 16 - (i%16);
+		printf(" ");
+		if (n>8) printf(" ");
+		while (n--) printf("   ");
+
+		n = i%16;
+		if (n > 8) n = 8;
+		print_asc(&buf[i-(i%16)],n); printf(" ");
+		n = (i%16) - n;
+		if (n>0) print_asc(&buf[i-n],n);
+		printf("\n");
+	}
+}
+
+static void help(void)
+{
+	printf("\n"
+"tdbtool: \n"
+"  create    dbname     : create a database\n"
+"  open      dbname     : open an existing database\n"
+"  erase                : erase the database\n"
+"  dump                 : dump the database as strings\n"
+"  keys                 : dump the database keys as strings\n"
+"  hexkeys              : dump the database keys as hex values\n"
+"  info                 : print summary info about the database\n"
+"  insert    key  data  : insert a record\n"
+"  move      key  file  : move a record to a destination tdb\n"
+"  store     key  data  : store a record (replace)\n"
+"  show      key        : show a record by key\n"
+"  delete    key        : delete a record by key\n"
+"  list                 : print the database hash table and freelist\n"
+"  free                 : print the database freelist\n"
+"  ! command            : execute system command\n"
+"  1 | first            : print the first record\n"
+"  n | next             : print the next record\n"
+"  q | quit             : terminate\n"
+"  \\n                   : repeat 'next' command\n"
+"\n");
+}
+
+static void terror(const char *why)
+{
+	printf("%s\n", why);
+}
+
+static void create_tdb(const char *tdbname)
+{
+	if (tdb) tdb_close(tdb);
+	tdb = tdb_open(tdbname, 0, TDB_CLEAR_IF_FIRST,
+		       O_RDWR | O_CREAT | O_TRUNC, 0600);
+	if (!tdb) {
+		printf("Could not create %s: %s\n", tdbname, strerror(errno));
+	}
+}
+
+static void open_tdb(const char *tdbname)
+{
+	if (tdb) tdb_close(tdb);
+	tdb = tdb_open(tdbname, 0, 0, O_RDWR, 0600);
+	if (!tdb) {
+		printf("Could not open %s: %s\n", tdbname, strerror(errno));
+	}
+}
+
+static void insert_tdb(char *keyname, size_t keylen, char* data, size_t datalen)
+{
+	TDB_DATA key, dbuf;
+
+	if ((keyname == NULL) || (keylen == 0)) {
+		terror("need key");
+		return;
+	}
+
+	key.dptr = (unsigned char *)keyname;
+	key.dsize = keylen;
+	dbuf.dptr = (unsigned char *)data;
+	dbuf.dsize = datalen;
+
+	if (tdb_store(tdb, key, dbuf, TDB_INSERT) == -1) {
+		terror("insert failed");
+	}
+}
+
+static void store_tdb(char *keyname, size_t keylen, char* data, size_t datalen)
+{
+	TDB_DATA key, dbuf;
+
+	if ((keyname == NULL) || (keylen == 0)) {
+		terror("need key");
+		return;
+	}
+
+	if ((data == NULL) || (datalen == 0)) {
+		terror("need data");
+		return;
+	}
+
+	key.dptr = (unsigned char *)keyname;
+	key.dsize = keylen;
+	dbuf.dptr = (unsigned char *)data;
+	dbuf.dsize = datalen;
+
+	printf("Storing key:\n");
+	print_rec(tdb, key, dbuf, NULL);
+
+	if (tdb_store(tdb, key, dbuf, TDB_REPLACE) == -1) {
+		terror("store failed");
+	}
+}
+
+static void show_tdb(char *keyname, size_t keylen)
+{
+	TDB_DATA key, dbuf;
+
+	if ((keyname == NULL) || (keylen == 0)) {
+		terror("need key");
+		return;
+	}
+
+	key.dptr = (unsigned char *)keyname;
+	key.dsize = keylen;
+
+	dbuf = tdb_fetch(tdb, key);
+	if (!dbuf.dptr) {
+	    terror("fetch failed");
+	    return;
+	}
+
+	print_rec(tdb, key, dbuf, NULL);
+
+	free( dbuf.dptr );
+
+	return;
+}
+
+static void delete_tdb(char *keyname, size_t keylen)
+{
+	TDB_DATA key;
+
+	if ((keyname == NULL) || (keylen == 0)) {
+		terror("need key");
+		return;
+	}
+
+	key.dptr = (unsigned char *)keyname;
+	key.dsize = keylen;
+
+	if (tdb_delete(tdb, key) != 0) {
+		terror("delete failed");
+	}
+}
+
+static void move_rec(char *keyname, size_t keylen, char* tdbname)
+{
+	TDB_DATA key, dbuf;
+	TDB_CONTEXT *dst_tdb;
+
+	if ((keyname == NULL) || (keylen == 0)) {
+		terror("need key");
+		return;
+	}
+
+	if ( !tdbname ) {
+		terror("need destination tdb name");
+		return;
+	}
+
+	key.dptr = (unsigned char *)keyname;
+	key.dsize = keylen;
+
+	dbuf = tdb_fetch(tdb, key);
+	if (!dbuf.dptr) {
+		terror("fetch failed");
+		return;
+	}
+
+	print_rec(tdb, key, dbuf, NULL);
+
+	dst_tdb = tdb_open(tdbname, 0, 0, O_RDWR, 0600);
+	if ( !dst_tdb ) {
+		terror("unable to open destination tdb");
+		return;
+	}
+
+	if ( tdb_store( dst_tdb, key, dbuf, TDB_REPLACE ) == -1 ) {
+		terror("failed to move record");
+	}
+	else
+		printf("record moved\n");
+
+	tdb_close( dst_tdb );
+
+	return;
+}
+
+static int print_rec(TDB_CONTEXT *the_tdb, TDB_DATA key, TDB_DATA dbuf, void *state)
+{
+	printf("\nkey %d bytes\n", (int)key.dsize);
+	print_asc((const char *)key.dptr, key.dsize);
+	printf("\ndata %d bytes\n", (int)dbuf.dsize);
+	print_data((const char *)dbuf.dptr, dbuf.dsize);
+	return 0;
+}
+
+static int print_key(TDB_CONTEXT *the_tdb, TDB_DATA key, TDB_DATA dbuf, void *state)
+{
+	printf("key %d bytes: ", (int)key.dsize);
+	print_asc((const char *)key.dptr, key.dsize);
+	printf("\n");
+	return 0;
+}
+
+static int print_hexkey(TDB_CONTEXT *the_tdb, TDB_DATA key, TDB_DATA dbuf, void *state)
+{
+	printf("key %d bytes\n", (int)key.dsize);
+	print_data((const char *)key.dptr, key.dsize);
+	printf("\n");
+	return 0;
+}
+
+static int total_bytes;
+
+static int traverse_fn(TDB_CONTEXT *the_tdb, TDB_DATA key, TDB_DATA dbuf, void *state)
+{
+	total_bytes += dbuf.dsize;
+	return 0;
+}
+
+static void info_tdb(void)
+{
+	int count;
+	total_bytes = 0;
+	if ((count = tdb_traverse(tdb, traverse_fn, NULL)) == -1)
+		printf("Error = %s\n", tdb_errorstr(tdb));
+	else
+		printf("%d records totalling %d bytes\n", count, total_bytes);
+}
+
+static char *tdb_getline(const char *prompt)
+{
+	static char thisline[1024];
+	char *p;
+	fputs(prompt, stdout);
+	thisline[0] = 0;
+	p = fgets(thisline, sizeof(thisline)-1, stdin);
+	if (p) p = strchr(p, '\n');
+	if (p) *p = 0;
+	return p?thisline:NULL;
+}
+
+static int do_delete_fn(TDB_CONTEXT *the_tdb, TDB_DATA key, TDB_DATA dbuf,
+                     void *state)
+{
+    return tdb_delete(the_tdb, key);
+}
+
+static void first_record(TDB_CONTEXT *the_tdb, TDB_DATA *pkey)
+{
+	TDB_DATA dbuf;
+	*pkey = tdb_firstkey(the_tdb);
+
+	dbuf = tdb_fetch(the_tdb, *pkey);
+	if (!dbuf.dptr) terror("fetch failed");
+	else {
+		print_rec(the_tdb, *pkey, dbuf, NULL);
+	}
+}
+
+static void next_record(TDB_CONTEXT *the_tdb, TDB_DATA *pkey)
+{
+	TDB_DATA dbuf;
+	*pkey = tdb_nextkey(the_tdb, *pkey);
+
+	dbuf = tdb_fetch(the_tdb, *pkey);
+	if (!dbuf.dptr)
+		terror("fetch failed");
+	else
+		print_rec(the_tdb, *pkey, dbuf, NULL);
+}
+
+static int do_command(void)
+{
+	COMMAND_TABLE *ctp = cmd_table;
+	enum commands mycmd = CMD_HELP;
+	int cmd_len;
+
+	if (cmdname && strlen(cmdname) == 0) {
+	    mycmd = CMD_NEXT;
+	} else {
+	    while (ctp->name) {
+		cmd_len = strlen(ctp->name);
+		if (strncmp(ctp->name,cmdname,cmd_len) == 0) {
+			mycmd = ctp->cmd;
+			break;
+		}
+		ctp++;
+	    }
+	}
+
+	switch (mycmd) {
+	case CMD_CREATE_TDB:
+            bIterate = 0;
+            create_tdb(arg1);
+	    return 0;
+	case CMD_OPEN_TDB:
+            bIterate = 0;
+            open_tdb(arg1);
+            return 0;
+	case CMD_SYSTEM:
+	    /* Shell command */
+	    system(arg1);
+	    return 0;
+	case CMD_QUIT:
+	    return 1;
+	default:
+	    /* all the rest require a open database */
+	    if (!tdb) {
+		bIterate = 0;
+		terror("database not open");
+		help();
+		return 0;
+	    }
+	    switch (mycmd) {
+	    case CMD_ERASE:
+		bIterate = 0;
+		tdb_traverse(tdb, do_delete_fn, NULL);
+		return 0;
+	    case CMD_DUMP:
+		bIterate = 0;
+		tdb_traverse(tdb, print_rec, NULL);
+		return 0;
+	    case CMD_INSERT:
+		bIterate = 0;
+		insert_tdb(arg1, arg1len,arg2,arg2len);
+		return 0;
+	    case CMD_MOVE:
+		bIterate = 0;
+		move_rec(arg1,arg1len,arg2);
+		return 0;
+	    case CMD_STORE:
+		bIterate = 0;
+		store_tdb(arg1,arg1len,arg2,arg2len);
+		return 0;
+	    case CMD_SHOW:
+		bIterate = 0;
+		show_tdb(arg1, arg1len);
+		return 0;
+	    case CMD_KEYS:
+		tdb_traverse(tdb, print_key, NULL);
+		return 0;
+	    case CMD_HEXKEYS:
+		tdb_traverse(tdb, print_hexkey, NULL);
+		return 0;
+	    case CMD_DELETE:
+		bIterate = 0;
+		delete_tdb(arg1,arg1len);
+		return 0;
+	    case CMD_LIST_HASH_FREE:
+		tdb_dump_all(tdb);
+		return 0;
+	    case CMD_LIST_FREE:
+		tdb_printfreelist(tdb);
+		return 0;
+	    case CMD_INFO:
+		info_tdb();
+		return 0;
+	    case CMD_FIRST:
+		bIterate = 1;
+		first_record(tdb, &iterate_kbuf);
+		return 0;
+	    case CMD_NEXT:
+	       if (bIterate)
+		  next_record(tdb, &iterate_kbuf);
+		return 0;
+	    case CMD_HELP:
+		help();
+		return 0;
+            case CMD_CREATE_TDB:
+            case CMD_OPEN_TDB:
+            case CMD_SYSTEM:
+            case CMD_QUIT:
+                /*
+                 * unhandled commands.  cases included here to avoid compiler
+                 * warnings.
+                 */
+                return 0;
+	    }
+	}
+
+	return 0;
+}
+
+static char *convert_string(char *instring, size_t *sizep)
+{
+    size_t length = 0;
+    char *outp, *inp;
+    char temp[3];
+
+
+    outp = inp = instring;
+
+    while (*inp) {
+	if (*inp == '\\') {
+	    inp++;
+	    if (*inp && strchr("0123456789abcdefABCDEF",(int)*inp)) {
+		temp[0] = *inp++;
+		temp[1] = '\0';
+		if (*inp && strchr("0123456789abcdefABCDEF",(int)*inp)) {
+		    temp[1] = *inp++;
+		    temp[2] = '\0';
+		}
+		*outp++ = (char)strtol((const char *)temp,NULL,16);
+	    } else {
+		*outp++ = *inp++;
+	    }
+	} else {
+	    *outp++ = *inp++;
+	}
+	length++;
+    }
+    *sizep = length;
+    return instring;
+}
+
+int main(int argc, char *argv[])
+{
+    cmdname = "";
+    arg1 = NULL;
+    arg1len = 0;
+    arg2 = NULL;
+    arg2len = 0;
+
+    if (argv[1]) {
+	cmdname = "open";
+	arg1 = argv[1];
+        do_command();
+	cmdname =  "";
+	arg1 = NULL;
+    }
+
+    switch (argc) {
+	case 1:
+	case 2:
+	    /* Interactive mode */
+	    while ((cmdname = tdb_getline("tdb> "))) {
+		arg2 = arg1 = NULL;
+		if ((arg1 = strchr((const char *)cmdname,' ')) != NULL) {
+		    arg1++;
+		    arg2 = arg1;
+		    while (*arg2) {
+			if (*arg2 == ' ') {
+			    *arg2++ = '\0';
+			    break;
+			}
+			if ((*arg2++ == '\\') && (*arg2 == ' ')) {
+			    arg2++;
+			}
+		    }
+		}
+		if (arg1) arg1 = convert_string(arg1,&arg1len);
+		if (arg2) arg2 = convert_string(arg2,&arg2len);
+		if (do_command()) break;
+	    }
+	    break;
+	case 5:
+	    arg2 = convert_string(argv[4],&arg2len);
+	case 4:
+	    arg1 = convert_string(argv[3],&arg1len);
+	case 3:
+	    cmdname = argv[2];
+	default:
+	    do_command();
+	    break;
+    }
+
+    if (tdb) tdb_close(tdb);
+
+    return 0;
+}
diff --git a/lib/ext2fs/test_io.c b/lib/ext2fs/test_io.c
new file mode 100644
index 0000000..6843edb
--- /dev/null
+++ b/lib/ext2fs/test_io.c
@@ -0,0 +1,557 @@
+/*
+ * test_io.c --- This is the Test I/O interface.
+ *
+ * Copyright (C) 1996 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+#ifdef HAVE_SYS_PRCTL_H
+#include <sys/prctl.h>
+#else
+#define PR_GET_DUMPABLE 3
+#endif
+#if (!defined(HAVE_PRCTL) && defined(linux))
+#include <sys/syscall.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+/*
+ * For checking structure magic numbers...
+ */
+
+#define EXT2_CHECK_MAGIC(struct, code) \
+	  if ((struct)->magic != (code)) return (code)
+
+struct test_private_data {
+	int	magic;
+	io_channel real;
+	int flags;
+	FILE *outfile;
+	unsigned long block;
+	int read_abort_count, write_abort_count;
+	void (*read_blk)(unsigned long block, int count, errcode_t err);
+	void (*write_blk)(unsigned long block, int count, errcode_t err);
+	void (*set_blksize)(int blksize, errcode_t err);
+	void (*write_byte)(unsigned long block, int count, errcode_t err);
+	void (*read_blk64)(unsigned long long block, int count, errcode_t err);
+	void (*write_blk64)(unsigned long long block, int count, errcode_t err);
+};
+
+/*
+ * These global variable can be set by the test program as
+ * necessary *before* calling test_open
+ */
+io_manager test_io_backing_manager = 0;
+void (*test_io_cb_read_blk)
+	(unsigned long block, int count, errcode_t err) = 0;
+void (*test_io_cb_write_blk)
+	(unsigned long block, int count, errcode_t err) = 0;
+void (*test_io_cb_read_blk64)
+	(unsigned long long block, int count, errcode_t err) = 0;
+void (*test_io_cb_write_blk64)
+	(unsigned long long block, int count, errcode_t err) = 0;
+void (*test_io_cb_set_blksize)
+	(int blksize, errcode_t err) = 0;
+void (*test_io_cb_write_byte)
+	(unsigned long block, int count, errcode_t err) = 0;
+
+/*
+ * Test flags
+ */
+#define TEST_FLAG_READ			0x01
+#define TEST_FLAG_WRITE			0x02
+#define TEST_FLAG_SET_BLKSIZE		0x04
+#define TEST_FLAG_FLUSH			0x08
+#define TEST_FLAG_DUMP			0x10
+#define TEST_FLAG_SET_OPTION		0x20
+#define TEST_FLAG_DISCARD		0x40
+#define TEST_FLAG_READAHEAD		0x80
+#define TEST_FLAG_ZEROOUT		0x100
+
+static void test_dump_block(io_channel channel,
+			    struct test_private_data *data,
+			    unsigned long block, const void *buf)
+{
+	const unsigned char *cp;
+	FILE *f = data->outfile;
+	int	i;
+	unsigned long	cksum = 0;
+
+	for (i=0, cp = buf; i < channel->block_size; i++, cp++) {
+		cksum += *cp;
+	}
+	fprintf(f, "Contents of block %lu, checksum %08lu: \n", block, cksum);
+	for (i=0, cp = buf; i < channel->block_size; i++, cp++) {
+		if ((i % 16) == 0)
+			fprintf(f, "%04x: ", i);
+		fprintf(f, "%02x%c", *cp, ((i % 16) == 15) ? '\n' : ' ');
+	}
+}
+
+/*
+ * Flush data buffers to disk.
+ */
+static errcode_t test_flush(io_channel channel)
+{
+	struct test_private_data	*data;
+	errcode_t			retval = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct test_private_data *)channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL);
+
+	if (data->real)
+		retval = io_channel_flush(data->real);
+
+	if (data->flags & TEST_FLAG_FLUSH)
+		fprintf(data->outfile, "Test_io: flush() returned %s\n",
+			retval ? error_message(retval) : "OK");
+
+	return retval;
+}
+
+static void test_abort(io_channel channel, unsigned long block)
+{
+	struct test_private_data *data;
+	FILE *f;
+
+	data = (struct test_private_data *) channel->private_data;
+	f = data->outfile;
+	test_flush(channel);
+
+	fprintf(f, "Aborting due to I/O to block %lu\n", block);
+	fflush(f);
+	abort();
+}
+
+static char *safe_getenv(const char *arg)
+{
+#if !defined(_WIN32)
+	if ((getuid() != geteuid()) || (getgid() != getegid()))
+		return NULL;
+#endif
+#if HAVE_PRCTL
+	if (prctl(PR_GET_DUMPABLE, 0, 0, 0, 0) == 0)
+		return NULL;
+#else
+#if (defined(linux) && defined(SYS_prctl))
+	if (syscall(SYS_prctl, PR_GET_DUMPABLE, 0, 0, 0, 0) == 0)
+		return NULL;
+#endif
+#endif
+
+#if defined(HAVE_SECURE_GETENV)
+	return secure_getenv(arg);
+#elif defined(HAVE___SECURE_GETENV)
+	return __secure_getenv(arg);
+#else
+	return getenv(arg);
+#endif
+}
+
+static errcode_t test_open(const char *name, int flags, io_channel *channel)
+{
+	io_channel	io = NULL;
+	struct test_private_data *data = NULL;
+	errcode_t	retval;
+	char		*value;
+
+	if (name == 0)
+		return EXT2_ET_BAD_DEVICE_NAME;
+	retval = ext2fs_get_mem(sizeof(struct struct_io_channel), &io);
+	if (retval)
+		goto cleanup;
+	memset(io, 0, sizeof(struct struct_io_channel));
+	io->magic = EXT2_ET_MAGIC_IO_CHANNEL;
+	retval = ext2fs_get_mem(sizeof(struct test_private_data), &data);
+	if (retval)
+		goto cleanup;
+	io->manager = test_io_manager;
+	retval = ext2fs_get_mem(strlen(name)+1, &io->name);
+	if (retval)
+		goto cleanup;
+
+	strcpy(io->name, name);
+	io->private_data = data;
+	io->block_size = 1024;
+	io->read_error = 0;
+	io->write_error = 0;
+	io->refcount = 1;
+	io->flags = 0;
+
+	memset(data, 0, sizeof(struct test_private_data));
+	data->magic = EXT2_ET_MAGIC_TEST_IO_CHANNEL;
+	if (test_io_backing_manager) {
+		retval = test_io_backing_manager->open(name, flags,
+						       &data->real);
+		if (retval)
+			goto cleanup;
+	} else {
+		data->real = 0;
+	}
+	data->read_blk =	test_io_cb_read_blk;
+	data->write_blk =	test_io_cb_write_blk;
+	data->set_blksize =	test_io_cb_set_blksize;
+	data->write_byte =	test_io_cb_write_byte;
+	data->read_blk64 =	test_io_cb_read_blk64;
+	data->write_blk64 =	test_io_cb_write_blk64;
+
+	data->outfile = NULL;
+	if ((value = safe_getenv("TEST_IO_LOGFILE")) != NULL)
+		data->outfile = fopen(value, "w");
+	if (!data->outfile)
+		data->outfile = stderr;
+
+	data->flags = 0;
+	if ((value = safe_getenv("TEST_IO_FLAGS")) != NULL)
+		data->flags = strtoul(value, NULL, 0);
+
+	data->block = 0;
+	if ((value = safe_getenv("TEST_IO_BLOCK")) != NULL)
+		data->block = strtoul(value, NULL, 0);
+
+	data->read_abort_count = 0;
+	if ((value = safe_getenv("TEST_IO_READ_ABORT")) != NULL)
+		data->read_abort_count = strtoul(value, NULL, 0);
+
+	data->write_abort_count = 0;
+	if ((value = safe_getenv("TEST_IO_WRITE_ABORT")) != NULL)
+		data->write_abort_count = strtoul(value, NULL, 0);
+
+	if (data->real) {
+		io->align = data->real->align;
+		if (data->real->flags & CHANNEL_FLAGS_THREADS)
+			io->flags |= CHANNEL_FLAGS_THREADS;
+	}
+
+	*channel = io;
+	return 0;
+
+cleanup:
+	if (io && io->name)
+		ext2fs_free_mem(&io->name);
+	if (io)
+		ext2fs_free_mem(&io);
+	if (data)
+		ext2fs_free_mem(&data);
+	return retval;
+}
+
+static errcode_t test_close(io_channel channel)
+{
+	struct test_private_data *data;
+	errcode_t	retval = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct test_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL);
+
+	if (--channel->refcount > 0)
+		return 0;
+
+	if (data->real)
+		retval = io_channel_close(data->real);
+
+	if (data->outfile && data->outfile != stderr)
+		fclose(data->outfile);
+
+	ext2fs_free_mem(&channel->private_data);
+	if (channel->name)
+		ext2fs_free_mem(&channel->name);
+	ext2fs_free_mem(&channel);
+	return retval;
+}
+
+static errcode_t test_set_blksize(io_channel channel, int blksize)
+{
+	struct test_private_data *data;
+	errcode_t	retval = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct test_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL);
+
+	if (data->real) {
+		retval = io_channel_set_blksize(data->real, blksize);
+		channel->align = data->real->align;
+	}
+	if (data->set_blksize)
+		data->set_blksize(blksize, retval);
+	if (data->flags & TEST_FLAG_SET_BLKSIZE)
+		fprintf(data->outfile,
+			"Test_io: set_blksize(%d) returned %s\n",
+			blksize, retval ? error_message(retval) : "OK");
+	channel->block_size = blksize;
+	return retval;
+}
+
+
+static errcode_t test_read_blk(io_channel channel, unsigned long block,
+			       int count, void *buf)
+{
+	struct test_private_data *data;
+	errcode_t	retval = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct test_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL);
+
+	if (data->real)
+		retval = io_channel_read_blk(data->real, block, count, buf);
+	if (data->read_blk)
+		data->read_blk(block, count, retval);
+	if (data->flags & TEST_FLAG_READ)
+		fprintf(data->outfile,
+			"Test_io: read_blk(%lu, %d) returned %s\n",
+			block, count, retval ? error_message(retval) : "OK");
+	if (data->block && data->block == block) {
+		if (data->flags & TEST_FLAG_DUMP)
+			test_dump_block(channel, data, block, buf);
+		if (--data->read_abort_count == 0)
+			test_abort(channel, block);
+	}
+	return retval;
+}
+
+static errcode_t test_write_blk(io_channel channel, unsigned long block,
+			       int count, const void *buf)
+{
+	struct test_private_data *data;
+	errcode_t	retval = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct test_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL);
+
+	if (data->real)
+		retval = io_channel_write_blk(data->real, block, count, buf);
+	if (data->write_blk)
+		data->write_blk(block, count, retval);
+	if (data->flags & TEST_FLAG_WRITE)
+		fprintf(data->outfile,
+			"Test_io: write_blk(%lu, %d) returned %s\n",
+			block, count, retval ? error_message(retval) : "OK");
+	if (data->block && data->block == block) {
+		if (data->flags & TEST_FLAG_DUMP)
+			test_dump_block(channel, data, block, buf);
+		if (--data->write_abort_count == 0)
+			test_abort(channel, block);
+	}
+	return retval;
+}
+
+static errcode_t test_read_blk64(io_channel channel, unsigned long long block,
+			       int count, void *buf)
+{
+	struct test_private_data *data;
+	errcode_t	retval = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct test_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL);
+
+	if (data->real)
+		retval = io_channel_read_blk64(data->real, block, count, buf);
+	if (data->read_blk64)
+		data->read_blk64(block, count, retval);
+	if (data->flags & TEST_FLAG_READ)
+		fprintf(data->outfile,
+			"Test_io: read_blk64(%llu, %d) returned %s\n",
+			block, count, retval ? error_message(retval) : "OK");
+	if (data->block && data->block == block) {
+		if (data->flags & TEST_FLAG_DUMP)
+			test_dump_block(channel, data, block, buf);
+		if (--data->read_abort_count == 0)
+			test_abort(channel, block);
+	}
+	return retval;
+}
+
+static errcode_t test_write_blk64(io_channel channel, unsigned long long block,
+			       int count, const void *buf)
+{
+	struct test_private_data *data;
+	errcode_t	retval = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct test_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL);
+
+	if (data->real)
+		retval = io_channel_write_blk64(data->real, block, count, buf);
+	if (data->write_blk64)
+		data->write_blk64(block, count, retval);
+	if (data->flags & TEST_FLAG_WRITE)
+		fprintf(data->outfile,
+			"Test_io: write_blk64(%llu, %d) returned %s\n",
+			block, count, retval ? error_message(retval) : "OK");
+	if (data->block && data->block == block) {
+		if (data->flags & TEST_FLAG_DUMP)
+			test_dump_block(channel, data, block, buf);
+		if (--data->write_abort_count == 0)
+			test_abort(channel, block);
+	}
+	return retval;
+}
+
+static errcode_t test_write_byte(io_channel channel, unsigned long offset,
+			       int count, const void *buf)
+{
+	struct test_private_data *data;
+	errcode_t	retval = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct test_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL);
+
+	if (data->real && data->real->manager->write_byte)
+		retval = io_channel_write_byte(data->real, offset, count, buf);
+	if (data->write_byte)
+		data->write_byte(offset, count, retval);
+	if (data->flags & TEST_FLAG_WRITE)
+		fprintf(data->outfile,
+			"Test_io: write_byte(%lu, %d) returned %s\n",
+			offset, count, retval ? error_message(retval) : "OK");
+	return retval;
+}
+
+static errcode_t test_set_option(io_channel channel, const char *option,
+				 const char *arg)
+{
+	struct test_private_data *data;
+	errcode_t	retval = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct test_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL);
+
+
+	if (data->flags & TEST_FLAG_SET_OPTION)
+		fprintf(data->outfile, "Test_io: set_option(%s, %s) ",
+			option, arg);
+	if (data->real && data->real->manager->set_option) {
+		retval = (data->real->manager->set_option)(data->real,
+							   option, arg);
+		if (data->flags & TEST_FLAG_SET_OPTION)
+			fprintf(data->outfile, "returned %s\n",
+				retval ? error_message(retval) : "OK");
+	} else {
+		if (data->flags & TEST_FLAG_SET_OPTION)
+			fprintf(data->outfile, "not implemented\n");
+	}
+	return retval;
+}
+
+static errcode_t test_get_stats(io_channel channel, io_stats *stats)
+{
+	struct test_private_data *data;
+	errcode_t	retval = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct test_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL);
+
+	if (data->real && data->real->manager->get_stats) {
+		retval = (data->real->manager->get_stats)(data->real, stats);
+	}
+	return retval;
+}
+
+static errcode_t test_discard(io_channel channel, unsigned long long block,
+			      unsigned long long count)
+{
+	struct test_private_data *data;
+	errcode_t	retval = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct test_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL);
+
+	if (data->real)
+		retval = io_channel_discard(data->real, block, count);
+	if (data->flags & TEST_FLAG_DISCARD)
+		fprintf(data->outfile,
+			"Test_io: discard(%llu, %llu) returned %s\n",
+			block, count, retval ? error_message(retval) : "OK");
+	return retval;
+}
+
+static errcode_t test_cache_readahead(io_channel channel,
+				      unsigned long long block,
+				      unsigned long long count)
+{
+	struct test_private_data *data;
+	errcode_t	retval = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct test_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL);
+
+	if (data->real)
+		retval = io_channel_cache_readahead(data->real, block, count);
+	if (data->flags & TEST_FLAG_READAHEAD)
+		fprintf(data->outfile,
+			"Test_io: readahead(%llu, %llu) returned %s\n",
+			block, count, retval ? error_message(retval) : "OK");
+	return retval;
+}
+
+static errcode_t test_zeroout(io_channel channel, unsigned long long block,
+			      unsigned long long count)
+{
+	struct test_private_data *data;
+	errcode_t	retval = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct test_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_TEST_IO_CHANNEL);
+
+	if (data->real)
+		retval = io_channel_zeroout(data->real, block, count);
+	if (data->flags & TEST_FLAG_ZEROOUT)
+		fprintf(data->outfile,
+			"Test_io: zeroout(%llu, %llu) returned %s\n",
+			block, count, retval ? error_message(retval) : "OK");
+	return retval;
+}
+
+static struct struct_io_manager struct_test_manager = {
+	.magic		= EXT2_ET_MAGIC_IO_MANAGER,
+	.name		= "Test I/O Manager",
+	.open		= test_open,
+	.close		= test_close,
+	.set_blksize	= test_set_blksize,
+	.read_blk	= test_read_blk,
+	.write_blk	= test_write_blk,
+	.flush		= test_flush,
+	.write_byte	= test_write_byte,
+	.set_option	= test_set_option,
+	.get_stats	= test_get_stats,
+	.read_blk64	= test_read_blk64,
+	.write_blk64	= test_write_blk64,
+	.discard	= test_discard,
+	.cache_readahead	= test_cache_readahead,
+	.zeroout	= test_zeroout,
+};
+
+io_manager test_io_manager = &struct_test_manager;
diff --git a/lib/ext2fs/tst_badblocks.c b/lib/ext2fs/tst_badblocks.c
new file mode 100644
index 0000000..b6e766a
--- /dev/null
+++ b/lib/ext2fs/tst_badblocks.c
@@ -0,0 +1,369 @@
+/*
+ * This testing program makes sure the badblocks implementation works.
+ *
+ * Copyright (C) 1996 by Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#include <sys/stat.h>
+#include <sys/types.h>
+#if HAVE_ERRNO_H
+#include <errno.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+#define ADD_BLK	0x0001
+#define DEL_BLK	0x0002
+
+blk_t test1[] = { 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 0 };
+blk_t test2[] = { 11, 10, 9, 8, 7, 6, 5, 4, 3, 3, 2, 1, 0 };
+blk_t test3[] = { 3, 1, 4, 5, 9, 2, 7, 10, 5, 6, 10, 8, 0 };
+blk_t test4[] = { 20, 50, 12, 17, 13, 2, 66, 23, 56, 0 };
+blk_t test4a[] = {
+	20, 1,
+	50, 1,
+	3, 0,
+	17, 1,
+	18, 0,
+	16, 0,
+	11, 0,
+	12, 1,
+	13, 1,
+	14, 0,
+	80, 0,
+	45, 0,
+	66, 1,
+	0 };
+blk_t test5[] = { 31, 20, 17, 51, 23, 1, 56, 57, 0 };
+blk_t test5a[] = {
+	50, ADD_BLK,
+	51, DEL_BLK,
+	57, DEL_BLK,
+	66, ADD_BLK,
+	31, DEL_BLK,
+	12, ADD_BLK,
+	2, ADD_BLK,
+	13, ADD_BLK,
+	1, DEL_BLK,
+	0
+	};
+
+
+static int test_fail = 0;
+static int test_expected_fail = 0;
+
+static errcode_t create_test_list(blk_t *vec, badblocks_list *ret)
+{
+	errcode_t	retval;
+	badblocks_list	bb;
+	int		i;
+
+	retval = ext2fs_badblocks_list_create(&bb, 5);
+	if (retval) {
+		com_err("create_test_list", retval, "while creating list");
+		return retval;
+	}
+	for (i=0; vec[i]; i++) {
+		retval = ext2fs_badblocks_list_add(bb, vec[i]);
+		if (retval) {
+			com_err("create_test_list", retval,
+				"while adding test vector %d", i);
+			ext2fs_badblocks_list_free(bb);
+			return retval;
+		}
+	}
+	*ret = bb;
+	return 0;
+}
+
+static void print_list(badblocks_list bb, int verify)
+{
+	errcode_t	retval;
+	badblocks_iterate	iter;
+	blk_t			blk;
+	int			i, ok;
+
+	retval = ext2fs_badblocks_list_iterate_begin(bb, &iter);
+	if (retval) {
+		com_err("print_list", retval, "while setting up iterator");
+		return;
+	}
+	ok = i = 1;
+	while (ext2fs_badblocks_list_iterate(iter, &blk)) {
+		printf("%u ", blk);
+		if (i++ != blk)
+			ok = 0;
+	}
+	ext2fs_badblocks_list_iterate_end(iter);
+	if (verify) {
+		if (ok)
+			printf("--- OK");
+		else {
+			printf("--- NOT OK");
+			test_fail++;
+		}
+	}
+}
+
+static void validate_test_seq(badblocks_list bb, blk_t *vec)
+{
+	int	i, match, ok;
+
+	for (i = 0; vec[i]; i += 2) {
+		match = ext2fs_badblocks_list_test(bb, vec[i]);
+		if (match == vec[i+1])
+			ok = 1;
+		else {
+			ok = 0;
+			test_fail++;
+		}
+		printf("\tblock %u is %s --- %s\n", vec[i],
+		       match ? "present" : "absent",
+		       ok ? "OK" : "NOT OK");
+	}
+}
+
+static void do_test_seq(badblocks_list bb, blk_t *vec)
+{
+	int	i, match;
+
+	for (i = 0; vec[i]; i += 2) {
+		switch (vec[i+1]) {
+		case ADD_BLK:
+			ext2fs_badblocks_list_add(bb, vec[i]);
+			match = ext2fs_badblocks_list_test(bb, vec[i]);
+			printf("Adding block %u --- now %s\n", vec[i],
+			       match ? "present" : "absent");
+			if (!match) {
+				printf("FAILURE!\n");
+				test_fail++;
+			}
+			break;
+		case DEL_BLK:
+			ext2fs_badblocks_list_del(bb, vec[i]);
+			match = ext2fs_badblocks_list_test(bb, vec[i]);
+			printf("Removing block %u --- now %s\n", vec[i],
+			       ext2fs_badblocks_list_test(bb, vec[i]) ?
+			       "present" : "absent");
+			if (match) {
+				printf("FAILURE!\n");
+				test_fail++;
+			}
+			break;
+		}
+	}
+}
+
+
+int file_test(badblocks_list bb)
+{
+	badblocks_list new_bb = 0;
+	errcode_t	retval;
+	FILE	*f;
+
+	f = tmpfile();
+	if (!f) {
+		fprintf(stderr, "Error opening temp file: %s\n",
+			error_message(errno));
+		return 1;
+	}
+	retval = ext2fs_write_bb_FILE(bb, 0, f);
+	if (retval) {
+		com_err("file_test", retval, "while writing bad blocks");
+		return 1;
+	}
+
+	rewind(f);
+	retval = ext2fs_read_bb_FILE2(0, f, &new_bb, 0, 0);
+	if (retval) {
+		com_err("file_test", retval, "while reading bad blocks");
+		return 1;
+	}
+	fclose(f);
+
+	if (ext2fs_badblocks_equal(bb, new_bb)) {
+		printf("Block bitmap matched after reading and writing.\n");
+	} else {
+		printf("Block bitmap NOT matched.\n");
+		test_fail++;
+	}
+	ext2fs_badblocks_list_free(new_bb);
+	return 0;
+}
+
+static void invalid_proc(ext2_filsys fs, blk_t blk)
+{
+	if (blk == 34500) {
+		printf("Expected invalid block\n");
+		test_expected_fail++;
+	} else {
+		printf("Invalid block #: %u\n", blk);
+		test_fail++;
+	}
+}
+
+void file_test_invalid(badblocks_list bb)
+{
+	badblocks_list new_bb = 0;
+	errcode_t	retval;
+	ext2_filsys 	fs;
+	FILE	*f;
+
+	fs = malloc(sizeof(struct struct_ext2_filsys));
+	memset(fs, 0, sizeof(struct struct_ext2_filsys));
+	fs->magic = EXT2_ET_MAGIC_EXT2FS_FILSYS;
+	fs->super = malloc(SUPERBLOCK_SIZE);
+	memset(fs->super, 0, SUPERBLOCK_SIZE);
+	fs->super->s_first_data_block = 1;
+	ext2fs_blocks_count_set(fs->super, 100);
+
+	f = tmpfile();
+	if (!f) {
+		fprintf(stderr, "Error opening temp file: %s\n",
+			error_message(errno));
+		test_fail++;
+		goto out;
+	}
+	retval = ext2fs_write_bb_FILE(bb, 0, f);
+	if (retval) {
+		com_err("file_test", retval, "while writing bad blocks");
+		test_fail++;
+		goto out;
+	}
+	fprintf(f, "34500\n");
+
+	rewind(f);
+	test_expected_fail = 0;
+	retval = ext2fs_read_bb_FILE(fs, f, &new_bb, invalid_proc);
+	if (retval) {
+		com_err("file_test", retval, "while reading bad blocks");
+		test_fail++;
+		goto out;
+	}
+	fclose(f);
+	if (!test_expected_fail) {
+		printf("Expected test failure didn't happen!\n");
+		test_fail++;
+	}
+
+
+	if (ext2fs_badblocks_equal(bb, new_bb)) {
+		printf("Block bitmap matched after reading and writing.\n");
+	} else {
+		printf("Block bitmap NOT matched.\n");
+		test_fail++;
+	}
+	ext2fs_badblocks_list_free(new_bb);
+out:
+	free(fs->super);
+	free(fs);
+}
+
+int main(int argc, char **argv)
+{
+	badblocks_list bb1, bb2, bb3, bb4, bb5;
+	int	equal;
+	errcode_t	retval;
+
+	add_error_table(&et_ext2_error_table);
+
+	bb1 = bb2 = bb3 = bb4 = bb5 = 0;
+
+	printf("test1: ");
+	retval = create_test_list(test1, &bb1);
+	if (retval == 0)
+		print_list(bb1, 1);
+	printf("\n");
+
+	printf("test2: ");
+	retval = create_test_list(test2, &bb2);
+	if (retval == 0)
+		print_list(bb2, 1);
+	printf("\n");
+
+	printf("test3: ");
+	retval = create_test_list(test3, &bb3);
+	if (retval == 0)
+		print_list(bb3, 1);
+	printf("\n");
+
+	printf("test4: ");
+	retval = create_test_list(test4, &bb4);
+	if (retval == 0) {
+		print_list(bb4, 0);
+		printf("\n");
+		validate_test_seq(bb4, test4a);
+	}
+	printf("\n");
+
+	printf("test5: ");
+	retval = create_test_list(test5, &bb5);
+	if (retval == 0) {
+		print_list(bb5, 0);
+		printf("\n");
+		do_test_seq(bb5, test5a);
+		printf("After test5 sequence: ");
+		print_list(bb5, 0);
+		printf("\n");
+	}
+	printf("\n");
+
+	if (bb1 && bb2 && bb3 && bb4 && bb5) {
+		printf("Comparison tests:\n");
+		equal = ext2fs_badblocks_equal(bb1, bb2);
+		printf("bb1 and bb2 are %sequal.\n", equal ? "" : "NOT ");
+		if (equal)
+			test_fail++;
+
+		equal = ext2fs_badblocks_equal(bb1, bb3);
+		printf("bb1 and bb3 are %sequal.\n", equal ? "" : "NOT ");
+		if (!equal)
+			test_fail++;
+
+		equal = ext2fs_badblocks_equal(bb1, bb4);
+		printf("bb1 and bb4 are %sequal.\n", equal ? "" : "NOT ");
+		if (equal)
+			test_fail++;
+
+		equal = ext2fs_badblocks_equal(bb4, bb5);
+		printf("bb4 and bb5 are %sequal.\n", equal ? "" : "NOT ");
+		if (!equal)
+			test_fail++;
+		printf("\n");
+	}
+
+	file_test(bb4);
+
+	file_test_invalid(bb4);
+
+	if (test_fail == 0)
+		printf("ext2fs library badblocks tests checks out OK!\n");
+
+	if (bb1)
+		ext2fs_badblocks_list_free(bb1);
+	if (bb2)
+		ext2fs_badblocks_list_free(bb2);
+	if (bb3)
+		ext2fs_badblocks_list_free(bb3);
+	if (bb4)
+		ext2fs_badblocks_list_free(bb4);
+	if (bb5)
+		ext2fs_badblocks_list_free(bb5);
+
+	return test_fail;
+
+}
diff --git a/lib/ext2fs/tst_bitmaps.c b/lib/ext2fs/tst_bitmaps.c
new file mode 100644
index 0000000..cb3c70d
--- /dev/null
+++ b/lib/ext2fs/tst_bitmaps.c
@@ -0,0 +1,732 @@
+/*
+ * tst_bitmaps.c
+ *
+ * Copyright (C) 2011 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <unistd.h>
+#include <stdlib.h>
+#include <stdio.h>
+#ifdef HAVE_GETOPT_H
+#include <getopt.h>
+#endif
+#include <string.h>
+#include <fcntl.h>
+#include <time.h>
+#include <sys/stat.h>
+#include <sys/types.h>
+#include "ss/ss.h"
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+#include "ext2fsP.h"
+
+extern ss_request_table tst_bitmaps_cmds;
+
+static char subsystem_name[] = "tst_bitmaps";
+static char version[] = "1.0";
+
+ext2_filsys	test_fs;
+int		exit_status = 0;
+
+static int source_file(const char *cmd_file, int sci_idx)
+{
+	FILE		*f;
+	char		buf[256];
+	char		*cp;
+	int		retval;
+	int 		noecho;
+
+	if (strcmp(cmd_file, "-") == 0)
+		f = stdin;
+	else {
+		f = fopen(cmd_file, "r");
+		if (!f) {
+			perror(cmd_file);
+			exit(1);
+		}
+	}
+	fflush(stdout);
+	fflush(stderr);
+	setbuf(stdout, NULL);
+	setbuf(stderr, NULL);
+	while (!feof(f)) {
+		if (fgets(buf, sizeof(buf), f) == NULL)
+			break;
+		if (buf[0] == '#')
+			continue;
+		noecho = 0;
+		if (buf[0] == '-') {
+			noecho = 1;
+			buf[0] = ' ';
+		}
+		cp = strchr(buf, '\n');
+		if (cp)
+			*cp = 0;
+		cp = strchr(buf, '\r');
+		if (cp)
+			*cp = 0;
+		if (!noecho)
+			printf("%s: %s\n", subsystem_name, buf);
+		retval = ss_execute_line(sci_idx, buf);
+		if (retval) {
+			ss_perror(sci_idx, retval, buf);
+			exit_status++;
+		}
+	}
+	return exit_status;
+}
+
+
+/*
+ * This function resets the libc getopt() function, which keeps
+ * internal state.  Bad design!  Stupid libc API designers!  No
+ * biscuit!
+ *
+ * BSD-derived getopt() functions require that optind be reset to 1 in
+ * order to reset getopt() state.  This used to be generally accepted
+ * way of resetting getopt().  However, glibc's getopt()
+ * has additional getopt() state beyond optind, and requires that
+ * optind be set zero to reset its state.  So the unfortunate state of
+ * affairs is that BSD-derived versions of getopt() misbehave if
+ * optind is set to 0 in order to reset getopt(), and glibc's getopt()
+ * will core dump if optind is set 1 in order to reset getopt().
+ *
+ * More modern versions of BSD require that optreset be set to 1 in
+ * order to reset getopt().   Sigh.  Standards, anyone?
+ *
+ * We hide the hair here.
+ */
+void reset_getopt(void)
+{
+#if defined(__GLIBC__) || defined(__linux__)
+	optind = 0;
+#else
+	optind = 1;
+#endif
+#ifdef HAVE_OPTRESET
+	optreset = 1;		/* Makes BSD getopt happy */
+#endif
+}
+
+/*
+ * This function will convert a string to an unsigned long, printing
+ * an error message if it fails, and returning success or failure in err.
+ */
+unsigned long parse_ulong(const char *str, const char *cmd,
+			  const char *descr, int *err)
+{
+	char		*tmp;
+	unsigned long	ret;
+
+	ret = strtoul(str, &tmp, 0);
+	if (*tmp == 0) {
+		if (err)
+			*err = 0;
+		return ret;
+	}
+	com_err(cmd, 0, "Bad %s - %s", descr, str);
+	if (err)
+		*err = 1;
+	else
+		exit(1);
+	return 0;
+}
+
+
+int check_fs_open(char *name)
+{
+	if (!test_fs) {
+		com_err(name, 0, "Filesystem not open");
+		return 1;
+	}
+	return 0;
+}
+
+static void setup_filesystem(const char *name,
+			     unsigned int blocks, unsigned int inodes,
+			     unsigned int type, int flags)
+{
+	struct ext2_super_block param;
+	errcode_t retval;
+
+	memset(&param, 0, sizeof(param));
+	ext2fs_blocks_count_set(&param, blocks);
+	param.s_inodes_count = inodes;
+
+	retval = ext2fs_initialize("test fs", flags, &param,
+				   test_io_manager, &test_fs);
+
+	if (retval) {
+		com_err(name, retval, "while initializing filesystem");
+		return;
+	}
+	test_fs->default_bitmap_type = type;
+	ext2fs_free_block_bitmap(test_fs->block_map);
+	test_fs->block_map = 0;
+	ext2fs_free_inode_bitmap(test_fs->inode_map);
+	test_fs->inode_map = 0;
+	retval = ext2fs_allocate_block_bitmap(test_fs, "block bitmap",
+					      &test_fs->block_map);
+	if (retval) {
+		com_err(name, retval, "while allocating block bitmap");
+		goto errout;
+	}
+	retval = ext2fs_allocate_inode_bitmap(test_fs, "inode bitmap",
+					      &test_fs->inode_map);
+	if (retval) {
+		com_err(name, retval, "while allocating inode bitmap");
+		goto errout;
+	}
+	return;
+
+errout:
+	ext2fs_close_free(&test_fs);
+}
+
+void setup_cmd(int argc, char **argv, int sci_idx EXT2FS_ATTR((unused)),
+	       void *infop EXT2FS_ATTR((unused)))
+{
+	int		c, err;
+	unsigned int	blocks = 128;
+	unsigned int	inodes = 0;
+	unsigned int	type = EXT2FS_BMAP64_BITARRAY;
+	int		flags = EXT2_FLAG_64BITS;
+
+	if (test_fs)
+		ext2fs_close_free(&test_fs);
+
+	reset_getopt();
+	while ((c = getopt(argc, argv, "b:i:lt:")) != EOF) {
+		switch (c) {
+		case 'b':
+			blocks = parse_ulong(optarg, argv[0],
+					     "number of blocks", &err);
+			if (err)
+				return;
+			break;
+		case 'i':
+			inodes = parse_ulong(optarg, argv[0],
+					     "number of blocks", &err);
+			if (err)
+				return;
+			break;
+		case 'l':	/* Legacy bitmaps */
+			flags = 0;
+			break;
+		case 't':
+			type = parse_ulong(optarg, argv[0],
+					   "bitmap backend type", &err);
+			if (err)
+				return;
+			break;
+		default:
+			fprintf(stderr, "%s: usage: setup [-b blocks] "
+				"[-i inodes] [-t type]\n", argv[0]);
+			return;
+		}
+	}
+	setup_filesystem(argv[0], blocks, inodes, type, flags);
+}
+
+void close_cmd(int argc, char **argv, int sci_idx EXT2FS_ATTR((unused)),
+	       void *infop EXT2FS_ATTR((unused)))
+{
+	if (check_fs_open(argv[0]))
+		return;
+
+	ext2fs_close_free(&test_fs);
+}
+
+
+void dump_bitmap(ext2fs_generic_bitmap bmap, unsigned int start, unsigned num)
+{
+	unsigned char	*buf;
+	errcode_t	retval;
+	int		i, len = (num - start + 7) / 8;
+
+	buf = malloc(len);
+	if (!buf) {
+		com_err("dump_bitmap", 0, "couldn't allocate buffer");
+		return;
+	}
+	memset(buf, 0, len);
+	retval = ext2fs_get_generic_bmap_range(bmap, (__u64) start, num, buf);
+	if (retval) {
+		com_err("dump_bitmap", retval, 
+			"while calling ext2fs_generic_bmap_range");
+		free(buf);
+		return;
+	}
+	for (i=0; i < len; i++)
+		printf("%02x", buf[i]);
+	printf("\n");
+	printf("bits set: %u\n", ext2fs_bitcount(buf, len));
+	free(buf);
+}
+
+void dump_inode_bitmap_cmd(int argc, char **argv,
+			   int sci_idx EXT2FS_ATTR((unused)),
+			   void *infop EXT2FS_ATTR((unused)))
+{
+	if (check_fs_open(argv[0]))
+		return;
+
+	printf("inode bitmap: ");
+	dump_bitmap(test_fs->inode_map, 1, test_fs->super->s_inodes_count);
+}
+	
+void dump_block_bitmap_cmd(int argc, char **argv,
+			   int sci_idx EXT2FS_ATTR((unused)),
+			   void *infop EXT2FS_ATTR((unused)))
+{
+	if (check_fs_open(argv[0]))
+		return;
+
+	printf("block bitmap: ");
+	dump_bitmap(test_fs->block_map, test_fs->super->s_first_data_block,
+		    test_fs->super->s_blocks_count);
+}
+	
+void do_setb(int argc, char *argv[], int sci_idx EXT2FS_ATTR((unused)),
+	     void *infop EXT2FS_ATTR((unused)))
+{
+	unsigned int block, num;
+	int err;
+	int test_result, op_result;
+
+	if (check_fs_open(argv[0]))
+		return;
+
+	if (argc != 2 && argc != 3) {
+		com_err(argv[0], 0, "Usage: setb <block> [num]");
+		return;
+	}
+
+	block = parse_ulong(argv[1], argv[0], "block", &err);
+	if (err)
+		return;
+
+	if (argc == 3) {
+		num = parse_ulong(argv[2], argv[0], "num", &err);
+		if (err)
+			return;
+
+		ext2fs_mark_block_bitmap_range2(test_fs->block_map,
+						block, num);
+		printf("Marking blocks %u to %u\n", block, block + num - 1);
+		return;
+	}
+
+	test_result = ext2fs_test_block_bitmap2(test_fs->block_map, block);
+	op_result = ext2fs_mark_block_bitmap2(test_fs->block_map, block);
+	printf("Setting block %u, was %s before\n", block, op_result ?
+	       "set" : "clear");
+	if (!test_result != !op_result)
+		com_err(argv[0], 0, "*ERROR* test_result different! (%d, %d)",
+			test_result, op_result);
+}
+
+void do_clearb(int argc, char *argv[], int sci_idx EXT2FS_ATTR((unused)),
+	       void *infop EXT2FS_ATTR((unused)))
+{
+	unsigned int block, num;
+	int err;
+	int test_result, op_result;
+
+	if (check_fs_open(argv[0]))
+		return;
+
+	if (argc != 2 && argc != 3) {
+		com_err(argv[0], 0, "Usage: clearb <block> [num]");
+		return;
+	}
+
+	block = parse_ulong(argv[1], argv[0], "block", &err);
+	if (err)
+		return;
+
+	if (argc == 3) {
+		num = parse_ulong(argv[2], argv[0], "num", &err);
+		if (err)
+			return;
+
+		ext2fs_unmark_block_bitmap_range2(test_fs->block_map,
+						block, num);
+		printf("Clearing blocks %u to %u\n", block, block + num - 1);
+		return;
+	}
+
+	test_result = ext2fs_test_block_bitmap2(test_fs->block_map, block);
+	op_result = ext2fs_unmark_block_bitmap2(test_fs->block_map, block);
+	printf("Clearing block %u, was %s before\n", block, op_result ?
+	       "set" : "clear");
+	if (!test_result != !op_result)
+		com_err(argv[0], 0, "*ERROR* test_result different! (%d, %d)",
+			test_result, op_result);
+}
+
+void do_testb(int argc, char *argv[], int sci_idx EXT2FS_ATTR((unused)),
+	      void *infop EXT2FS_ATTR((unused)))
+{
+	unsigned int block, num;
+	int err;
+	int test_result;
+
+	if (check_fs_open(argv[0]))
+		return;
+
+	if (argc != 2 && argc != 3) {
+		com_err(argv[0], 0, "Usage: testb <block> [num]");
+		return;
+	}
+
+	block = parse_ulong(argv[1], argv[0], "block", &err);
+	if (err)
+		return;
+
+	if (argc == 3) {
+		num = parse_ulong(argv[2], argv[0], "num", &err);
+		if (err)
+			return;
+
+		test_result =
+			ext2fs_test_block_bitmap_range2(test_fs->block_map,
+							block, num);
+		printf("Blocks %u to %u are %sall clear.\n",
+		       block, block + num - 1, test_result ? "" : "NOT ");
+		return;
+	}
+
+	test_result = ext2fs_test_block_bitmap2(test_fs->block_map, block);
+	printf("Block %u is %s\n", block, test_result ? "set" : "clear");
+}
+
+void do_ffzb(int argc, char *argv[], int sci_idx EXT2FS_ATTR((unused)),
+	     void *infop EXT2FS_ATTR((unused)))
+{
+	unsigned int start, end;
+	int err;
+	errcode_t retval;
+	blk64_t out;
+
+	if (check_fs_open(argv[0]))
+		return;
+
+	if (argc != 3 && argc != 3) {
+		com_err(argv[0], 0, "Usage: ffzb <start> <end>");
+		return;
+	}
+
+	start = parse_ulong(argv[1], argv[0], "start", &err);
+	if (err)
+		return;
+
+	end = parse_ulong(argv[2], argv[0], "end", &err);
+	if (err)
+		return;
+
+	retval = ext2fs_find_first_zero_block_bitmap2(test_fs->block_map,
+						      start, end, &out);
+	if (retval) {
+		printf("ext2fs_find_first_zero_block_bitmap2() returned %s\n",
+		       error_message(retval));
+		return;
+	}
+	printf("First unmarked block is %llu\n", (unsigned long long) out);
+}
+
+void do_ffsb(int argc, char *argv[], int sci_idx EXT2FS_ATTR((unused)),
+	     void *infop EXT2FS_ATTR((unused)))
+{
+	unsigned int start, end;
+	int err;
+	errcode_t retval;
+	blk64_t out;
+
+	if (check_fs_open(argv[0]))
+		return;
+
+	if (argc != 3 && argc != 3) {
+		com_err(argv[0], 0, "Usage: ffsb <start> <end>");
+		return;
+	}
+
+	start = parse_ulong(argv[1], argv[0], "start", &err);
+	if (err)
+		return;
+
+	end = parse_ulong(argv[2], argv[0], "end", &err);
+	if (err)
+		return;
+
+	retval = ext2fs_find_first_set_block_bitmap2(test_fs->block_map,
+						      start, end, &out);
+	if (retval) {
+		printf("ext2fs_find_first_set_block_bitmap2() returned %s\n",
+		       error_message(retval));
+		return;
+	}
+	printf("First marked block is %llu\n", (unsigned long long) out);
+}
+
+
+void do_zerob(int argc, char *argv[], int sci_idx EXT2FS_ATTR((unused)),
+	      void *infop EXT2FS_ATTR((unused)))
+{
+	if (check_fs_open(argv[0]))
+		return;
+
+	printf("Clearing block bitmap.\n");
+	ext2fs_clear_block_bitmap(test_fs->block_map);
+}
+
+void do_seti(int argc, char *argv[], int sci_idx EXT2FS_ATTR((unused)),
+	     void *infop EXT2FS_ATTR((unused)))
+{
+	unsigned int inode;
+	int err;
+	int test_result, op_result;
+
+	if (check_fs_open(argv[0]))
+		return;
+
+	if (argc != 2) {
+		com_err(argv[0], 0, "Usage: seti <inode>");
+		return;
+	}
+
+	inode = parse_ulong(argv[1], argv[0], "inode", &err);
+	if (err)
+		return;
+
+	test_result = ext2fs_test_inode_bitmap2(test_fs->inode_map, inode);
+	op_result = ext2fs_mark_inode_bitmap2(test_fs->inode_map, inode);
+	printf("Setting inode %u, was %s before\n", inode, op_result ?
+	       "set" : "clear");
+	if (!test_result != !op_result) {
+		com_err(argv[0], 0, "*ERROR* test_result different! (%d, %d)",
+			test_result, op_result);
+		exit_status++;
+	}
+}
+
+void do_cleari(int argc, char *argv[], int sci_idx EXT2FS_ATTR((unused)),
+	       void *infop EXT2FS_ATTR((unused)))
+{
+	unsigned int inode;
+	int err;
+	int test_result, op_result;
+
+	if (check_fs_open(argv[0]))
+		return;
+
+	if (argc != 2) {
+		com_err(argv[0], 0, "Usage: clearb <inode>");
+		return;
+	}
+
+	inode = parse_ulong(argv[1], argv[0], "inode", &err);
+	if (err)
+		return;
+
+	test_result = ext2fs_test_inode_bitmap2(test_fs->inode_map, inode);
+	op_result = ext2fs_unmark_inode_bitmap2(test_fs->inode_map, inode);
+	printf("Clearing inode %u, was %s before\n", inode, op_result ?
+	       "set" : "clear");
+	if (!test_result != !op_result) {
+		com_err(argv[0], 0, "*ERROR* test_result different! (%d, %d)",
+			test_result, op_result);
+		exit_status++;
+	}
+}
+
+void do_testi(int argc, char *argv[], int sci_idx EXT2FS_ATTR((unused)),
+	      void *infop EXT2FS_ATTR((unused)))
+{
+	unsigned int inode;
+	int err;
+	int test_result;
+
+	if (check_fs_open(argv[0]))
+		return;
+
+	if (argc != 2) {
+		com_err(argv[0], 0, "Usage: testb <inode>");
+		return;
+	}
+
+	inode = parse_ulong(argv[1], argv[0], "inode", &err);
+	if (err)
+		return;
+
+	test_result = ext2fs_test_inode_bitmap2(test_fs->inode_map, inode);
+	printf("Inode %u is %s\n", inode, test_result ? "set" : "clear");
+}
+
+void do_ffzi(int argc, char *argv[], int sci_idx EXT2FS_ATTR((unused)),
+	     void *infop EXT2FS_ATTR((unused)))
+{
+	unsigned int start, end;
+	int err;
+	errcode_t retval;
+	ext2_ino_t out;
+
+	if (check_fs_open(argv[0]))
+		return;
+
+	if (argc != 3 && argc != 3) {
+		com_err(argv[0], 0, "Usage: ffzi <start> <end>");
+		return;
+	}
+
+	start = parse_ulong(argv[1], argv[0], "start", &err);
+	if (err)
+		return;
+
+	end = parse_ulong(argv[2], argv[0], "end", &err);
+	if (err)
+		return;
+
+	retval = ext2fs_find_first_zero_inode_bitmap2(test_fs->inode_map,
+						      start, end, &out);
+	if (retval) {
+		printf("ext2fs_find_first_zero_inode_bitmap2() returned %s\n",
+		       error_message(retval));
+		return;
+	}
+	printf("First unmarked inode is %u\n", out);
+}
+
+void do_ffsi(int argc, char *argv[], int sci_idx EXT2FS_ATTR((unused)),
+	     void *infop EXT2FS_ATTR((unused)))
+{
+	unsigned int start, end;
+	int err;
+	errcode_t retval;
+	ext2_ino_t out;
+
+	if (check_fs_open(argv[0]))
+		return;
+
+	if (argc != 3 && argc != 3) {
+		com_err(argv[0], 0, "Usage: ffsi <start> <end>");
+		return;
+	}
+
+	start = parse_ulong(argv[1], argv[0], "start", &err);
+	if (err)
+		return;
+
+	end = parse_ulong(argv[2], argv[0], "end", &err);
+	if (err)
+		return;
+
+	retval = ext2fs_find_first_set_inode_bitmap2(test_fs->inode_map,
+						     start, end, &out);
+	if (retval) {
+		printf("ext2fs_find_first_set_inode_bitmap2() returned %s\n",
+		       error_message(retval));
+		return;
+	}
+	printf("First marked inode is %u\n", out);
+}
+
+void do_zeroi(int argc, char *argv[], int sci_idx EXT2FS_ATTR((unused)),
+	      void *infop EXT2FS_ATTR((unused)))
+{
+	if (check_fs_open(argv[0]))
+		return;
+
+	printf("Clearing inode bitmap.\n");
+	ext2fs_clear_inode_bitmap(test_fs->inode_map);
+}
+
+int main(int argc, char **argv)
+{
+	unsigned int	blocks = 128;
+	unsigned int	inodes = 0;
+	unsigned int	type = EXT2FS_BMAP64_BITARRAY;
+	int		c, err, code;
+	char		*request = (char *)NULL;
+	char		*cmd_file = 0;
+	int		sci_idx;
+	int		flags = EXT2_FLAG_64BITS;
+
+	add_error_table(&et_ss_error_table);
+	add_error_table(&et_ext2_error_table);
+	while ((c = getopt (argc, argv, "b:i:lt:R:f:")) != EOF) {
+		switch (c) {
+		case 'b':
+			blocks = parse_ulong(optarg, argv[0],
+					     "number of blocks", &err);
+			if (err)
+				exit(1);
+			break;
+		case 'i':
+			inodes = parse_ulong(optarg, argv[0],
+					     "number of blocks", &err);
+			if (err)
+				exit(1);
+			break;
+		case 'l':	/* Legacy bitmaps */
+			flags = 0;
+			break;
+		case 't':
+			type = parse_ulong(optarg, argv[0],
+					   "bitmap backend type", &err);
+			if (err)
+				exit(1);
+			break;
+		case 'R':
+			request = optarg;
+			break;
+		case 'f':
+			cmd_file = optarg;
+			break;
+		default:
+			com_err(argv[0], 0, "Usage: %s [-R request] "
+				"[-f cmd_file]", subsystem_name);
+			exit(1);
+		}
+	}
+
+	sci_idx = ss_create_invocation(subsystem_name, version,
+				       (char *)NULL, &tst_bitmaps_cmds, &code);
+	if (code) {
+		ss_perror(sci_idx, code, "creating invocation");
+		exit(1);
+	}
+
+	(void) ss_add_request_table (sci_idx, &ss_std_requests, 1, &code);
+	if (code) {
+		ss_perror(sci_idx, code, "adding standard requests");
+		exit (1);
+	}
+
+	printf("%s %s.  Type '?' for a list of commands.\n\n",
+	       subsystem_name, version);
+
+	setup_filesystem(argv[0], blocks, inodes, type, flags);
+
+	if (request) {
+		code = ss_execute_line(sci_idx, request);
+		if (code) {
+			ss_perror(sci_idx, code, request);
+			exit_status++;
+		}
+	} else if (cmd_file) {
+		exit_status = source_file(cmd_file, sci_idx);
+	} else {
+		ss_listen(sci_idx);
+	}
+
+	exit(exit_status);
+}
+
diff --git a/lib/ext2fs/tst_bitmaps_cmd.ct b/lib/ext2fs/tst_bitmaps_cmd.ct
new file mode 100644
index 0000000..13b7fa7
--- /dev/null
+++ b/lib/ext2fs/tst_bitmaps_cmd.ct
@@ -0,0 +1,51 @@
+command_table tst_bitmaps_cmds;
+
+request setup_cmd, "Setup file system",
+	setup;
+
+request close_cmd, "Close file system",
+	close;
+
+request dump_inode_bitmap_cmd, "Dump the inode bitmap",
+	dump_inode_bitmap, dump_ib;
+
+request dump_block_bitmap_cmd, "Dump the block bitmap",
+	dump_block_bitmap, dump_bb;
+
+request do_setb, "Set block",
+	set_block, setb;
+
+request do_clearb, "Clear block",
+	clear_block, clearb;
+
+request do_testb, "Test block",
+	test_block, testb;
+
+request do_ffzb, "Find first zero block",
+	find_first_zero_block, ffzb;
+
+request do_ffsb, "Find first set block",
+	find_first_set_block, ffsb;
+
+request do_zerob, "Clear block bitmap",
+	clear_block_bitmap, zerob;
+
+request do_seti, "Set inode",
+	set_inode, seti;
+
+request do_cleari, "Clear inode",
+	clear_inode, cleari;
+
+request do_testi, "Test inode",
+	test_inode, testi;
+
+request do_ffzi, "Find first zero inode",
+	find_first_zero_inode, ffzi;
+
+request do_ffsi, "Find first set inode",
+	find_first_set_inode, ffsi;
+
+request do_zeroi, "Clear inode bitmap",
+	clear_inode_bitmap, zeroi;
+
+end;
diff --git a/lib/ext2fs/tst_bitmaps_cmds b/lib/ext2fs/tst_bitmaps_cmds
new file mode 100644
index 0000000..dc116b1
--- /dev/null
+++ b/lib/ext2fs/tst_bitmaps_cmds
@@ -0,0 +1,150 @@
+setb 12 0
+setb 12
+setb 12
+clearb 12
+clearb 12
+setb 12
+setb 14
+setb 16
+testb 13
+testb 15
+testb 12
+testb 14
+setb 13
+setb 15
+testb 12
+testb 11
+testb 15
+testb 16
+dump_bb
+ffzb 11 16
+ffzb 12 16
+ffzb 12 20
+ffsb 0 127
+ffsb 1 128
+ffsb 1 127
+ffsb 1 10
+ffsb 1 11
+ffsb 12 12
+ffsb 13 12
+ffsb 12 15
+clearb 13
+ffzb 12 20
+ffsb 13 18
+setb 13
+clearb 12 7
+testb 12 7
+setb 15
+testb 12 7
+clearb 15
+testb 12 7
+setb 12 0
+setb 12 7
+dump_bb
+seti 2
+seti 5
+seti 4
+seti 3
+seti 4
+seti 5
+testi 6
+testi 1
+dump_ib
+ffzi 1 6
+ffzi 2 5
+ffzi 2 6
+ffsi 0 31
+ffsi 1 33
+ffsi 1 32
+ffsi 2 32
+ffsi 6 32
+cleari 4
+ffzi 2 6
+ffsi 4 32
+ffsi 5 32
+zeroi
+testi 5
+seti 5
+seti 5
+cleari 5
+cleari 5
+testi 17
+testi 6
+testi 4
+clearb 7 12
+dump_bb
+setb 1
+dump_bb
+setb 2
+dump_bb
+setb 3
+dump_bb
+setb 4
+dump_bb
+setb 5
+dump_bb
+setb 6
+dump_bb
+setb 7
+dump_bb
+setb 8
+dump_bb
+setb 10
+setb 12
+setb 14
+setb 17
+setb 19
+setb 24
+setb 26
+setb 27
+setb 30
+setb 31
+setb 32
+setb 35
+setb 39
+setb 40
+setb 44
+setb 46
+setb 47
+setb 49
+setb 51
+setb 52
+clearb 2
+clearb 3
+clearb 7
+dump_bb
+ffsb 14 127
+ffsb 15 127
+ffsb 36 127
+ffsb 32 127
+ffsb 52 127
+ffsb 53 127
+ffsb 46 127
+ffsb 45 127
+ffsb 41 127
+ffsb 20 127
+ffsb 1 127
+ffsb 2 127
+ffsb 3 127
+ffsb 4 127
+ffsb 5 127
+ffsb 6 127
+ffsb 7 127
+ffsb 8 127
+ffzb 1 127
+ffzb 2 127
+ffzb 3 127
+ffzb 4 127
+ffzb 5 127
+ffzb 6 127
+ffzb 7 127
+ffzb 8 127
+ffzb 45 127
+ffzb 46 127
+ffzb 47 127
+ffzb 48 127
+ffzb 49 127
+ffzb 50 127
+ffzb 51 127
+quit
+
diff --git a/lib/ext2fs/tst_bitmaps_exp b/lib/ext2fs/tst_bitmaps_exp
new file mode 100644
index 0000000..9cfea13
--- /dev/null
+++ b/lib/ext2fs/tst_bitmaps_exp
@@ -0,0 +1,313 @@
+tst_bitmaps 1.0.  Type '?' for a list of commands.
+
+tst_bitmaps: setb 12 0
+Marking blocks 12 to 11
+tst_bitmaps: setb 12
+Setting block 12, was clear before
+tst_bitmaps: setb 12
+Setting block 12, was set before
+tst_bitmaps: clearb 12
+Clearing block 12, was set before
+tst_bitmaps: clearb 12
+Clearing block 12, was clear before
+tst_bitmaps: setb 12
+Setting block 12, was clear before
+tst_bitmaps: setb 14
+Setting block 14, was clear before
+tst_bitmaps: setb 16
+Setting block 16, was clear before
+tst_bitmaps: testb 13
+Block 13 is clear
+tst_bitmaps: testb 15
+Block 15 is clear
+tst_bitmaps: testb 12
+Block 12 is set
+tst_bitmaps: testb 14
+Block 14 is set
+tst_bitmaps: setb 13
+Setting block 13, was clear before
+tst_bitmaps: setb 15
+Setting block 15, was clear before
+tst_bitmaps: testb 12
+Block 12 is set
+tst_bitmaps: testb 11
+Block 11 is clear
+tst_bitmaps: testb 15
+Block 15 is set
+tst_bitmaps: testb 16
+Block 16 is set
+tst_bitmaps: dump_bb
+block bitmap: 00f80000000000000000000000000000
+bits set: 5
+tst_bitmaps: ffzb 11 16
+First unmarked block is 11
+tst_bitmaps: ffzb 12 16
+ext2fs_find_first_zero_block_bitmap2() returned No such file or directory
+tst_bitmaps: ffzb 12 20
+First unmarked block is 17
+tst_bitmaps: ffsb 0 127
+ext2fs_find_first_set_block_bitmap2() returned Invalid argument
+tst_bitmaps: ffsb 1 128
+ext2fs_find_first_set_block_bitmap2() returned Invalid argument
+tst_bitmaps: ffsb 1 127
+First marked block is 12
+tst_bitmaps: ffsb 1 10
+ext2fs_find_first_set_block_bitmap2() returned No such file or directory
+tst_bitmaps: ffsb 1 11
+ext2fs_find_first_set_block_bitmap2() returned No such file or directory
+tst_bitmaps: ffsb 12 12
+First marked block is 12
+tst_bitmaps: ffsb 13 12
+ext2fs_find_first_set_block_bitmap2() returned Invalid argument
+tst_bitmaps: ffsb 12 15
+First marked block is 12
+tst_bitmaps: clearb 13
+Clearing block 13, was set before
+tst_bitmaps: ffzb 12 20
+First unmarked block is 13
+tst_bitmaps: ffsb 13 18
+First marked block is 14
+tst_bitmaps: setb 13
+Setting block 13, was clear before
+tst_bitmaps: clearb 12 7
+Clearing blocks 12 to 18
+tst_bitmaps: testb 12 7
+Blocks 12 to 18 are all clear.
+tst_bitmaps: setb 15
+Setting block 15, was clear before
+tst_bitmaps: testb 12 7
+Blocks 12 to 18 are NOT all clear.
+tst_bitmaps: clearb 15
+Clearing block 15, was set before
+tst_bitmaps: testb 12 7
+Blocks 12 to 18 are all clear.
+tst_bitmaps: setb 12 0
+Marking blocks 12 to 11
+tst_bitmaps: setb 12 7
+Marking blocks 12 to 18
+tst_bitmaps: dump_bb
+block bitmap: 00f80300000000000000000000000000
+bits set: 7
+tst_bitmaps: seti 2
+Setting inode 2, was clear before
+tst_bitmaps: seti 5
+Setting inode 5, was clear before
+tst_bitmaps: seti 4
+Setting inode 4, was clear before
+tst_bitmaps: seti 3
+Setting inode 3, was clear before
+tst_bitmaps: seti 4
+Setting inode 4, was set before
+tst_bitmaps: seti 5
+Setting inode 5, was set before
+tst_bitmaps: testi 6
+Inode 6 is clear
+tst_bitmaps: testi 1
+Inode 1 is clear
+tst_bitmaps: dump_ib
+inode bitmap: 1e000000
+bits set: 4
+tst_bitmaps: ffzi 1 6
+First unmarked inode is 1
+tst_bitmaps: ffzi 2 5
+ext2fs_find_first_zero_inode_bitmap2() returned No such file or directory
+tst_bitmaps: ffzi 2 6
+First unmarked inode is 6
+tst_bitmaps: ffsi 0 31
+ext2fs_find_first_set_inode_bitmap2() returned Invalid argument
+tst_bitmaps: ffsi 1 33
+ext2fs_find_first_set_inode_bitmap2() returned Invalid argument
+tst_bitmaps: ffsi 1 32
+First marked inode is 2
+tst_bitmaps: ffsi 2 32
+First marked inode is 2
+tst_bitmaps: ffsi 6 32
+ext2fs_find_first_set_inode_bitmap2() returned No such file or directory
+tst_bitmaps: cleari 4
+Clearing inode 4, was set before
+tst_bitmaps: ffzi 2 6
+First unmarked inode is 4
+tst_bitmaps: ffsi 4 32
+First marked inode is 5
+tst_bitmaps: ffsi 5 32
+First marked inode is 5
+tst_bitmaps: zeroi
+Clearing inode bitmap.
+tst_bitmaps: testi 5
+Inode 5 is clear
+tst_bitmaps: seti 5
+Setting inode 5, was clear before
+tst_bitmaps: seti 5
+Setting inode 5, was set before
+tst_bitmaps: cleari 5
+Clearing inode 5, was set before
+tst_bitmaps: cleari 5
+Clearing inode 5, was clear before
+tst_bitmaps: testi 17
+Inode 17 is clear
+tst_bitmaps: testi 6
+Inode 6 is clear
+tst_bitmaps: testi 4
+Inode 4 is clear
+tst_bitmaps: clearb 7 12
+Clearing blocks 7 to 18
+tst_bitmaps: dump_bb
+block bitmap: 00000000000000000000000000000000
+bits set: 0
+tst_bitmaps: setb 1
+Setting block 1, was clear before
+tst_bitmaps: dump_bb
+block bitmap: 01000000000000000000000000000000
+bits set: 1
+tst_bitmaps: setb 2
+Setting block 2, was clear before
+tst_bitmaps: dump_bb
+block bitmap: 03000000000000000000000000000000
+bits set: 2
+tst_bitmaps: setb 3
+Setting block 3, was clear before
+tst_bitmaps: dump_bb
+block bitmap: 07000000000000000000000000000000
+bits set: 3
+tst_bitmaps: setb 4
+Setting block 4, was clear before
+tst_bitmaps: dump_bb
+block bitmap: 0f000000000000000000000000000000
+bits set: 4
+tst_bitmaps: setb 5
+Setting block 5, was clear before
+tst_bitmaps: dump_bb
+block bitmap: 1f000000000000000000000000000000
+bits set: 5
+tst_bitmaps: setb 6
+Setting block 6, was clear before
+tst_bitmaps: dump_bb
+block bitmap: 3f000000000000000000000000000000
+bits set: 6
+tst_bitmaps: setb 7
+Setting block 7, was clear before
+tst_bitmaps: dump_bb
+block bitmap: 7f000000000000000000000000000000
+bits set: 7
+tst_bitmaps: setb 8
+Setting block 8, was clear before
+tst_bitmaps: dump_bb
+block bitmap: ff000000000000000000000000000000
+bits set: 8
+tst_bitmaps: setb 10
+Setting block 10, was clear before
+tst_bitmaps: setb 12
+Setting block 12, was clear before
+tst_bitmaps: setb 14
+Setting block 14, was clear before
+tst_bitmaps: setb 17
+Setting block 17, was clear before
+tst_bitmaps: setb 19
+Setting block 19, was clear before
+tst_bitmaps: setb 24
+Setting block 24, was clear before
+tst_bitmaps: setb 26
+Setting block 26, was clear before
+tst_bitmaps: setb 27
+Setting block 27, was clear before
+tst_bitmaps: setb 30
+Setting block 30, was clear before
+tst_bitmaps: setb 31
+Setting block 31, was clear before
+tst_bitmaps: setb 32
+Setting block 32, was clear before
+tst_bitmaps: setb 35
+Setting block 35, was clear before
+tst_bitmaps: setb 39
+Setting block 39, was clear before
+tst_bitmaps: setb 40
+Setting block 40, was clear before
+tst_bitmaps: setb 44
+Setting block 44, was clear before
+tst_bitmaps: setb 46
+Setting block 46, was clear before
+tst_bitmaps: setb 47
+Setting block 47, was clear before
+tst_bitmaps: setb 49
+Setting block 49, was clear before
+tst_bitmaps: setb 51
+Setting block 51, was clear before
+tst_bitmaps: setb 52
+Setting block 52, was clear before
+tst_bitmaps: clearb 2
+Clearing block 2, was set before
+tst_bitmaps: clearb 3
+Clearing block 3, was set before
+tst_bitmaps: clearb 7
+Clearing block 7, was set before
+tst_bitmaps: dump_bb
+block bitmap: b92a85e6c4680d000000000000000000
+bits set: 25
+tst_bitmaps: ffsb 14 127
+First marked block is 14
+tst_bitmaps: ffsb 15 127
+First marked block is 17
+tst_bitmaps: ffsb 36 127
+First marked block is 39
+tst_bitmaps: ffsb 32 127
+First marked block is 32
+tst_bitmaps: ffsb 52 127
+First marked block is 52
+tst_bitmaps: ffsb 53 127
+ext2fs_find_first_set_block_bitmap2() returned No such file or directory
+tst_bitmaps: ffsb 46 127
+First marked block is 46
+tst_bitmaps: ffsb 45 127
+First marked block is 46
+tst_bitmaps: ffsb 41 127
+First marked block is 44
+tst_bitmaps: ffsb 20 127
+First marked block is 24
+tst_bitmaps: ffsb 1 127
+First marked block is 1
+tst_bitmaps: ffsb 2 127
+First marked block is 4
+tst_bitmaps: ffsb 3 127
+First marked block is 4
+tst_bitmaps: ffsb 4 127
+First marked block is 4
+tst_bitmaps: ffsb 5 127
+First marked block is 5
+tst_bitmaps: ffsb 6 127
+First marked block is 6
+tst_bitmaps: ffsb 7 127
+First marked block is 8
+tst_bitmaps: ffsb 8 127
+First marked block is 8
+tst_bitmaps: ffzb 1 127
+First unmarked block is 2
+tst_bitmaps: ffzb 2 127
+First unmarked block is 2
+tst_bitmaps: ffzb 3 127
+First unmarked block is 3
+tst_bitmaps: ffzb 4 127
+First unmarked block is 7
+tst_bitmaps: ffzb 5 127
+First unmarked block is 7
+tst_bitmaps: ffzb 6 127
+First unmarked block is 7
+tst_bitmaps: ffzb 7 127
+First unmarked block is 7
+tst_bitmaps: ffzb 8 127
+First unmarked block is 9
+tst_bitmaps: ffzb 45 127
+First unmarked block is 45
+tst_bitmaps: ffzb 46 127
+First unmarked block is 48
+tst_bitmaps: ffzb 47 127
+First unmarked block is 48
+tst_bitmaps: ffzb 48 127
+First unmarked block is 48
+tst_bitmaps: ffzb 49 127
+First unmarked block is 50
+tst_bitmaps: ffzb 50 127
+First unmarked block is 50
+tst_bitmaps: ffzb 51 127
+First unmarked block is 53
+tst_bitmaps: quit
+tst_bitmaps: 
diff --git a/lib/ext2fs/tst_bitops.c b/lib/ext2fs/tst_bitops.c
new file mode 100644
index 0000000..adef12d
--- /dev/null
+++ b/lib/ext2fs/tst_bitops.c
@@ -0,0 +1,288 @@
+/*
+ * This testing program makes sure the bitops functions work
+ *
+ * Copyright (C) 2001 by Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#include <sys/stat.h>
+#include <sys/types.h>
+#if HAVE_ERRNO_H
+#include <errno.h>
+#endif
+#include <sys/time.h>
+#include <sys/resource.h>
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+unsigned char bitarray[] = {
+	0x80, 0xF0, 0x40, 0x40, 0x0, 0x0, 0x0, 0x0, 0x10, 0x20, 0x00, 0x00
+	};
+
+int bits_list[] = {
+	7, 12, 13, 14,15, 22, 30, 68, 77, -1,
+};
+
+#define BIG_TEST_BIT   (((unsigned) 1 << 31) + 42)
+
+
+int main(int argc, char **argv)
+{
+	int	i, j, size;
+	unsigned char testarray[12];
+	unsigned char *bigarray;
+
+	size = sizeof(bitarray)*8;
+#if 0
+	i = ext2fs_find_first_bit_set(bitarray, size);
+	while (i < size) {
+		printf("Bit set: %d\n", i);
+		i = ext2fs_find_next_bit_set(bitarray, size, i+1);
+	}
+#endif
+
+	/* Test test_bit */
+	for (i=0,j=0; i < size; i++) {
+		if (ext2fs_test_bit(i, bitarray)) {
+			if (bits_list[j] == i) {
+				j++;
+			} else {
+				printf("Bit %d set, not expected\n", i);
+				exit(1);
+			}
+		} else {
+			if (bits_list[j] == i) {
+				printf("Expected bit %d to be clear.\n", i);
+				exit(1);
+			}
+		}
+	}
+	printf("ext2fs_test_bit appears to be correct\n");
+
+	/* Test ext2fs_set_bit */
+	memset(testarray, 0, sizeof(testarray));
+	for (i=0; bits_list[i] > 0; i++) {
+		ext2fs_set_bit(bits_list[i], testarray);
+	}
+	if (memcmp(testarray, bitarray, sizeof(testarray)) == 0) {
+		printf("ext2fs_set_bit test succeeded.\n");
+	} else {
+		printf("ext2fs_set_bit test failed.\n");
+		for (i=0; i < sizeof(testarray); i++) {
+			printf("%02x ", testarray[i]);
+		}
+		printf("\n");
+		exit(1);
+	}
+	for (i=0; bits_list[i] > 0; i++) {
+		ext2fs_clear_bit(bits_list[i], testarray);
+	}
+	for (i=0; i < sizeof(testarray); i++) {
+		if (testarray[i]) {
+			printf("ext2fs_clear_bit failed, "
+			       "testarray[%d] is %d\n", i, testarray[i]);
+			exit(1);
+		}
+	}
+	printf("ext2fs_clear_bit test succeed.\n");
+
+
+	/* Do bigarray test */
+	bigarray = malloc(1 << 29);
+	if (!bigarray) {
+		fprintf(stderr, "Failed to allocate scratch memory!\n");
+		exit(0);
+	}
+
+        bigarray[BIG_TEST_BIT >> 3] = 0;
+
+	ext2fs_set_bit(BIG_TEST_BIT, bigarray);
+	printf("big bit number (%u) test: %d, expected %d\n", BIG_TEST_BIT,
+	       bigarray[BIG_TEST_BIT >> 3], (1 << (BIG_TEST_BIT & 7)));
+	if (bigarray[BIG_TEST_BIT >> 3] != (1 << (BIG_TEST_BIT & 7)))
+		exit(1);
+
+	ext2fs_clear_bit(BIG_TEST_BIT, bigarray);
+
+	printf("big bit number (%u) test: %d, expected 0\n", BIG_TEST_BIT,
+	       bigarray[BIG_TEST_BIT >> 3]);
+	if (bigarray[BIG_TEST_BIT >> 3] != 0)
+		exit(1);
+
+	printf("ext2fs_set_bit big_test successful\n");
+
+
+	/* Now test ext2fs_fast_set_bit */
+	memset(testarray, 0, sizeof(testarray));
+	for (i=0; bits_list[i] > 0; i++) {
+		ext2fs_fast_set_bit(bits_list[i], testarray);
+	}
+	if (memcmp(testarray, bitarray, sizeof(testarray)) == 0) {
+		printf("ext2fs_fast_set_bit test succeeded.\n");
+	} else {
+		printf("ext2fs_fast_set_bit test failed.\n");
+		for (i=0; i < sizeof(testarray); i++) {
+			printf("%02x ", testarray[i]);
+		}
+		printf("\n");
+		exit(1);
+	}
+	for (i=0; bits_list[i] > 0; i++) {
+		ext2fs_clear_bit(bits_list[i], testarray);
+	}
+	for (i=0; i < sizeof(testarray); i++) {
+		if (testarray[i]) {
+			printf("ext2fs_clear_bit failed, "
+			       "testarray[%d] is %d\n", i, testarray[i]);
+			exit(1);
+		}
+	}
+	printf("ext2fs_clear_bit test succeed.\n");
+
+
+        bigarray[BIG_TEST_BIT >> 3] = 0;
+
+	ext2fs_fast_set_bit(BIG_TEST_BIT, bigarray);
+	printf("big bit number (%u) test: %d, expected %d\n", BIG_TEST_BIT,
+	       bigarray[BIG_TEST_BIT >> 3], (1 << (BIG_TEST_BIT & 7)));
+	if (bigarray[BIG_TEST_BIT >> 3] != (1 << (BIG_TEST_BIT & 7)))
+		exit(1);
+
+	ext2fs_fast_clear_bit(BIG_TEST_BIT, bigarray);
+
+	printf("big bit number (%u) test: %d, expected 0\n", BIG_TEST_BIT,
+	       bigarray[BIG_TEST_BIT >> 3]);
+	if (bigarray[BIG_TEST_BIT >> 3] != 0)
+		exit(1);
+
+	printf("ext2fs_fast_set_bit big_test successful\n");
+
+	/* Repeat foregoing tests for 64-bit bitops */
+
+	/* Test test_bit */
+	for (i=0,j=0; i < size; i++) {
+		if (ext2fs_test_bit64(i, bitarray)) {
+			if (bits_list[j] == i) {
+				j++;
+			} else {
+				printf("64-bit: Bit %d set, not expected\n",
+				       i);
+				exit(1);
+			}
+		} else {
+			if (bits_list[j] == i) {
+				printf("64-bit: "
+				       "Expected bit %d to be clear.\n", i);
+				exit(1);
+			}
+		}
+	}
+	printf("64-bit: ext2fs_test_bit appears to be correct\n");
+
+	/* Test ext2fs_set_bit */
+	memset(testarray, 0, sizeof(testarray));
+	for (i=0; bits_list[i] > 0; i++) {
+		ext2fs_set_bit64(bits_list[i], testarray);
+	}
+	if (memcmp(testarray, bitarray, sizeof(testarray)) == 0) {
+		printf("64-bit: ext2fs_set_bit test succeeded.\n");
+	} else {
+		printf("64-bit: ext2fs_set_bit test failed.\n");
+		for (i=0; i < sizeof(testarray); i++) {
+			printf("%02x ", testarray[i]);
+		}
+		printf("\n");
+		exit(1);
+	}
+	for (i=0; bits_list[i] > 0; i++) {
+		ext2fs_clear_bit64(bits_list[i], testarray);
+	}
+	for (i=0; i < sizeof(testarray); i++) {
+		if (testarray[i]) {
+			printf("64-bit: ext2fs_clear_bit failed, "
+			       "testarray[%d] is %d\n", i, testarray[i]);
+			exit(1);
+		}
+	}
+	printf("64-bit: ext2fs_clear_bit test succeed.\n");
+
+	/* Do bigarray test */
+        bigarray[BIG_TEST_BIT >> 3] = 0;
+
+	ext2fs_set_bit64(BIG_TEST_BIT, bigarray);
+	printf("64-bit: big bit number (%u) test: %d, expected %d\n",
+	       BIG_TEST_BIT, bigarray[BIG_TEST_BIT >> 3],
+	       (1 << (BIG_TEST_BIT & 7)));
+	if (bigarray[BIG_TEST_BIT >> 3] != (1 << (BIG_TEST_BIT & 7)))
+		exit(1);
+
+	ext2fs_clear_bit64(BIG_TEST_BIT, bigarray);
+
+	printf("64-bit: big bit number (%u) test: %d, expected 0\n",
+	       BIG_TEST_BIT,
+	       bigarray[BIG_TEST_BIT >> 3]);
+	if (bigarray[BIG_TEST_BIT >> 3] != 0)
+		exit(1);
+
+	printf("64-bit: ext2fs_set_bit big_test successful\n");
+
+	/* Now test ext2fs_fast_set_bit */
+	memset(testarray, 0, sizeof(testarray));
+	for (i=0; bits_list[i] > 0; i++) {
+		ext2fs_fast_set_bit64(bits_list[i], testarray);
+	}
+	if (memcmp(testarray, bitarray, sizeof(testarray)) == 0) {
+		printf("64-bit: ext2fs_fast_set_bit test succeeded.\n");
+	} else {
+		printf("64-bit: ext2fs_fast_set_bit test failed.\n");
+		for (i=0; i < sizeof(testarray); i++) {
+			printf("%02x ", testarray[i]);
+		}
+		printf("\n");
+		exit(1);
+	}
+	for (i=0; bits_list[i] > 0; i++) {
+		ext2fs_clear_bit64(bits_list[i], testarray);
+	}
+	for (i=0; i < sizeof(testarray); i++) {
+		if (testarray[i]) {
+			printf("64-bit: ext2fs_clear_bit failed, "
+			       "testarray[%d] is %d\n", i, testarray[i]);
+			exit(1);
+		}
+	}
+	printf("64-bit: ext2fs_clear_bit test succeed.\n");
+
+        bigarray[BIG_TEST_BIT >> 3] = 0;
+
+	ext2fs_fast_set_bit64(BIG_TEST_BIT, bigarray);
+	printf("64-bit: big bit number (%u) test: %d, expected %d\n",
+	       BIG_TEST_BIT, bigarray[BIG_TEST_BIT >> 3],
+	       (1 << (BIG_TEST_BIT & 7)));
+	if (bigarray[BIG_TEST_BIT >> 3] != (1 << (BIG_TEST_BIT & 7)))
+		exit(1);
+
+	ext2fs_fast_clear_bit64(BIG_TEST_BIT, bigarray);
+
+	printf("64-bit: big bit number (%u) test: %d, expected 0\n",
+	       BIG_TEST_BIT, bigarray[BIG_TEST_BIT >> 3]);
+	if (bigarray[BIG_TEST_BIT >> 3] != 0)
+		exit(1);
+
+	printf("64-bit: ext2fs_fast_set_bit big_test successful\n");
+	free(bigarray);
+	exit(0);
+}
diff --git a/lib/ext2fs/tst_byteswap.c b/lib/ext2fs/tst_byteswap.c
new file mode 100644
index 0000000..c500cae
--- /dev/null
+++ b/lib/ext2fs/tst_byteswap.c
@@ -0,0 +1,93 @@
+/*
+ * This testing program makes sure the byteswap functions work
+ *
+ * Copyright (C) 2000 by Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#include <sys/stat.h>
+#include <sys/types.h>
+#if HAVE_ERRNO_H
+#include <errno.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+__u16 test1[] = {
+	0x0001, 0x0100,
+	0x1234, 0x3412,
+	0xff00, 0x00ff,
+	0x4000, 0x0040,
+	0xfeff, 0xfffe,
+	0x0000, 0x0000
+	};
+
+__u32 test2[] = {
+	0x00000001, 0x01000000,
+	0x80000000, 0x00000080,
+	0x12345678, 0x78563412,
+	0xffff0000, 0x0000ffff,
+	0x00ff0000, 0x0000ff00,
+	0xff000000, 0x000000ff,
+	0x00000000, 0x00000000
+	};
+
+int main(int argc, char **argv)
+{
+	int	i;
+	int	errors = 0;
+
+	printf("Testing ext2fs_swab16\n");
+	i=0;
+	do {
+		printf("swab16(0x%04x) = 0x%04x\n", test1[i],
+		       ext2fs_swab16(test1[i]));
+		if (ext2fs_swab16(test1[i]) != test1[i+1]) {
+			printf("Error!!!   %04x != %04x\n",
+			       ext2fs_swab16(test1[i]), test1[i+1]);
+			errors++;
+		}
+		if (ext2fs_swab16(test1[i+1]) != test1[i]) {
+			printf("Error!!!   %04x != %04x\n",
+			       ext2fs_swab16(test1[i+1]), test1[i]);
+			errors++;
+		}
+		i += 2;
+	} while (test1[i] != 0);
+
+	printf("Testing ext2fs_swab32\n");
+	i = 0;
+	do {
+		printf("swab32(0x%08x) = 0x%08x\n", test2[i],
+		       ext2fs_swab32(test2[i]));
+		if (ext2fs_swab32(test2[i]) != test2[i+1]) {
+			printf("Error!!!   %04x != %04x\n",
+			       ext2fs_swab32(test2[i]), test2[i+1]);
+			errors++;
+		}
+		if (ext2fs_swab32(test2[i+1]) != test2[i]) {
+			printf("Error!!!   %04x != %04x\n",
+			       ext2fs_swab32(test2[i+1]), test2[i]);
+			errors++;
+		}
+		i += 2;
+	} while (test2[i] != 0);
+
+	if (!errors)
+		printf("No errors found in the byteswap implementation!\n");
+
+	return errors;
+}
diff --git a/lib/ext2fs/tst_cmds.ct b/lib/ext2fs/tst_cmds.ct
new file mode 100644
index 0000000..45a8594
--- /dev/null
+++ b/lib/ext2fs/tst_cmds.ct
@@ -0,0 +1,6 @@
+command_table libext2fs_cmds;
+
+request do_block_iterate, "block_iterate",
+	block_iterate;
+
+end;
diff --git a/lib/ext2fs/tst_fs_struct.c b/lib/ext2fs/tst_fs_struct.c
new file mode 100644
index 0000000..6f44df1
--- /dev/null
+++ b/lib/ext2fs/tst_fs_struct.c
@@ -0,0 +1,81 @@
+/*
+ * This testing program checks the offset of the ext2_filsys structure
+ *
+ * Copyright (C) 2007 by Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include <stdio.h>
+#include <unistd.h>
+#include <stdlib.h>
+
+#include "ext2fs.h"
+
+struct struct_ext2_filsys fs;
+
+#ifndef offsetof
+#define offsetof(type, member)  __builtin_offsetof (type, member)
+#endif
+#define check_field(x) cur_offset = do_field(#x, sizeof(fs.x),		\
+					offsetof(struct struct_ext2_filsys, x), \
+					cur_offset)
+
+static int do_field(const char *field, size_t size, int offset, int cur_offset)
+{
+	if (offset != cur_offset) {
+		printf("\t(padding %d bytes?)\n", offset - cur_offset);
+	}
+	printf("%8d %-30s %3u\n", offset, field, (unsigned) size);
+	return offset + size;
+}
+
+int main(int argc, char **argv)
+{
+#if (__GNUC__ >= 4)
+	int cur_offset = 0;
+
+	printf("%8s %-30s %3s\n", "offset", "field", "size");
+	check_field(magic);
+	check_field(io);
+	check_field(flags);
+	check_field(device_name);
+	check_field(super);
+	check_field(blocksize);
+	check_field(fragsize);
+	check_field(group_desc_count);
+	check_field(desc_blocks);
+	check_field(group_desc);
+	check_field(inode_blocks_per_group);
+	check_field(inode_map);
+	check_field(block_map);
+	check_field(get_blocks);
+	check_field(check_directory);
+	check_field(write_bitmaps);
+	check_field(read_inode);
+	check_field(write_inode);
+	check_field(badblocks);
+	check_field(dblist);
+	check_field(stride);
+	check_field(orig_super);
+	check_field(image_header);
+	check_field(umask);
+	check_field(now);
+	check_field(cluster_ratio_bits);
+	check_field(reserved);
+	check_field(priv_data);
+	check_field(icache);
+	check_field(image_io);
+	check_field(get_alloc_block);
+	check_field(block_alloc_stats);
+	check_field(mmp_buf);
+	check_field(mmp_cmp);
+	check_field(mmp_fd);
+	check_field(mmp_last_written);
+	printf("Ending offset is %d\n\n", cur_offset);
+#endif
+	exit(0);
+}
diff --git a/lib/ext2fs/tst_getsectsize.c b/lib/ext2fs/tst_getsectsize.c
new file mode 100644
index 0000000..d616965
--- /dev/null
+++ b/lib/ext2fs/tst_getsectsize.c
@@ -0,0 +1,63 @@
+/*
+ * tst_getsize.c --- this function tests the getsize function
+ *
+ * Copyright (C) 1997 by Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#include <sys/stat.h>
+#include <sys/types.h>
+#if HAVE_ERRNO_H
+#include <errno.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+int main(int argc, char **argv)
+{
+	int	lsectsize, psectsize;
+	int	retval;
+	int	fd;
+
+	if (argc < 2) {
+		fprintf(stderr, "Usage: %s device\n", argv[0]);
+		exit(1);
+	}
+
+	retval = ext2fs_get_device_sectsize(argv[1], &lsectsize);
+	if (retval) {
+		com_err(argv[0], retval,
+			"while calling ext2fs_get_device_sectsize");
+		exit(1);
+	}
+	retval = ext2fs_get_device_phys_sectsize(argv[1], &psectsize);
+	if (retval) {
+		com_err(argv[0], retval,
+			"while calling ext2fs_get_device_phys_sectsize");
+		exit(1);
+	}
+	printf("Device %s has logical/physical sector size of %d/%d.\n",
+	       argv[1], lsectsize, psectsize);
+	fd = open(argv[1], O_RDONLY);
+	if (fd < 0) {
+		perror("open");
+		exit(1);
+	}
+	printf("The device's DIO alignment is %d\n",
+	       ext2fs_get_dio_alignment(fd));
+	close(fd);
+	exit(0);
+}
diff --git a/lib/ext2fs/tst_getsize.c b/lib/ext2fs/tst_getsize.c
new file mode 100644
index 0000000..ba869dc
--- /dev/null
+++ b/lib/ext2fs/tst_getsize.c
@@ -0,0 +1,47 @@
+/*
+ * tst_getsize.c --- this function tests the getsize function
+ *
+ * Copyright (C) 1997 by Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#include <sys/stat.h>
+#include <sys/types.h>
+#if HAVE_ERRNO_H
+#include <errno.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+int main(int argc, const char *argv[])
+{
+	errcode_t	retval;
+	blk64_t		blocks;
+
+	if (argc < 2) {
+		fprintf(stderr, "%s device\n", argv[0]);
+		exit(1);
+	}
+	add_error_table(&et_ext2_error_table);
+	retval = ext2fs_get_device_size2(argv[1], 1024, &blocks);
+	if (retval) {
+		com_err(argv[0], retval, "while getting device size");
+		exit(1);
+	}
+	printf("%s is device has %llu blocks.\n", argv[1],
+	       (unsigned long long) blocks);
+	return 0;
+}
diff --git a/lib/ext2fs/tst_inode_size.c b/lib/ext2fs/tst_inode_size.c
new file mode 100644
index 0000000..cc5d165
--- /dev/null
+++ b/lib/ext2fs/tst_inode_size.c
@@ -0,0 +1,89 @@
+/*
+ * This testing program makes sure the ext2_inode structure is 1024 bytes long
+ *
+ * Copyright (C) 2007 by Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <unistd.h>
+#include <stdlib.h>
+
+#include "ext2_fs.h"
+
+struct ext2_inode_large inode;
+
+#ifndef offsetof
+#define offsetof(type, member)  __builtin_offsetof(type, member)
+#endif
+
+#define check_field(x, s) cur_offset = do_field(#x, s, sizeof(inode.x),	       \
+					offsetof(struct ext2_inode_large, x),  \
+					cur_offset)
+
+static int do_field(const char *field, unsigned size, unsigned cur_size,
+		    unsigned offset, unsigned cur_offset)
+{
+	if (size != cur_size) {
+		printf("error: %s size %u should be %u\n",
+		       field, cur_size, size);
+		exit(1);
+	}
+	if (offset != cur_offset) {
+		printf("error: %s offset %u should be %u\n",
+		       field, cur_offset, offset);
+		exit(1);
+	}
+	printf("%8d %-30s %3u\n", offset, field, (unsigned) size);
+	return offset + size;
+}
+
+int main(int argc, char **argv)
+{
+#if (__GNUC__ >= 4)
+	int cur_offset = 0;
+
+	printf("%8s %-30s %3s\n", "offset", "field", "size");
+	check_field(i_mode, 2);
+	check_field(i_uid, 2);
+	check_field(i_size, 4);
+	check_field(i_atime, 4);
+	check_field(i_ctime, 4);
+	check_field(i_mtime, 4);
+	check_field(i_dtime, 4);
+	check_field(i_gid, 2);
+	check_field(i_links_count, 2);
+	check_field(i_blocks, 4);
+	check_field(i_flags, 4);
+	check_field(osd1.linux1.l_i_version, 4);
+	check_field(i_block, 15 * 4);
+	check_field(i_generation, 4);
+	check_field(i_file_acl, 4);
+	check_field(i_size_high, 4);
+	check_field(i_faddr, 4);
+	check_field(osd2.linux2.l_i_blocks_hi, 2);
+	check_field(osd2.linux2.l_i_file_acl_high, 2);
+	check_field(osd2.linux2.l_i_uid_high, 2);
+	check_field(osd2.linux2.l_i_gid_high, 2);
+	check_field(osd2.linux2.l_i_checksum_lo, 2);
+	check_field(osd2.linux2.l_i_reserved, 2);
+	do_field("Small inode end", 0, 0, cur_offset, 128);
+	check_field(i_extra_isize, 2);
+	check_field(i_checksum_hi, 2);
+	check_field(i_ctime_extra, 4);
+	check_field(i_mtime_extra, 4);
+	check_field(i_atime_extra, 4);
+	check_field(i_crtime, 4);
+	check_field(i_crtime_extra, 4);
+	check_field(i_version_hi, 4);
+	check_field(i_projid, 4);
+	/* This size will change as new fields are added */
+	do_field("Large inode end", 0, 0, cur_offset, sizeof(inode));
+#endif
+	return 0;
+}
diff --git a/lib/ext2fs/tst_iscan.c b/lib/ext2fs/tst_iscan.c
new file mode 100644
index 0000000..76aaa9a
--- /dev/null
+++ b/lib/ext2fs/tst_iscan.c
@@ -0,0 +1,227 @@
+/*
+ * tst_inode.c --- this function tests the inode scan function
+ *
+ * Copyright (C) 1996 by Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#include <sys/stat.h>
+#include <sys/types.h>
+#if HAVE_ERRNO_H
+#include <errno.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+blk64_t test_vec[] = { 8, 12, 24, 34, 43, 44, 100, 0 };
+
+ext2_filsys	test_fs;
+ext2fs_block_bitmap bad_block_map, touched_map;
+ext2fs_inode_bitmap bad_inode_map;
+badblocks_list	test_badblocks;
+
+int first_no_comma = 1;
+int failed = 0;
+
+static void iscan_test_read_blk64(unsigned long long block, int count, errcode_t err)
+{
+	int	i;
+
+	if (first_no_comma)
+		first_no_comma = 0;
+	else
+		printf(", ");
+
+	if (count > 1)
+		printf("%llu-%llu", block, block+count-1);
+	else
+		printf("%llu", block);
+
+	for (i=0; i < count; i++, block++) {
+		if (ext2fs_test_block_bitmap2(touched_map, block)) {
+			printf("\nDuplicate block?!? --- %llu\n", block);
+			failed++;
+			first_no_comma = 1;
+		}
+		ext2fs_mark_block_bitmap2(touched_map, block);
+	}
+}
+
+static void iscan_test_read_blk(unsigned long block, int count, errcode_t err)
+{
+	iscan_test_read_blk64(block, count, err);
+}
+
+/*
+ * Setup the variables for doing the inode scan test.
+ */
+static void setup(void)
+{
+	errcode_t	retval;
+	int		i;
+	struct ext2_super_block param;
+
+	initialize_ext2_error_table();
+
+	memset(&param, 0, sizeof(param));
+	ext2fs_blocks_count_set(&param, 12000);
+
+
+	test_io_cb_read_blk = iscan_test_read_blk;
+	test_io_cb_read_blk64 = iscan_test_read_blk64;
+
+	retval = ext2fs_initialize("test fs", EXT2_FLAG_64BITS, &param,
+				   test_io_manager, &test_fs);
+	if (retval) {
+		com_err("setup", retval,
+			"While initializing filesystem");
+		exit(1);
+	}
+	retval = ext2fs_allocate_tables(test_fs);
+	if (retval) {
+		com_err("setup", retval,
+			"While allocating tables for test filesystem");
+		exit(1);
+	}
+	retval = ext2fs_allocate_block_bitmap(test_fs, "bad block map",
+					      &bad_block_map);
+	if (retval) {
+		com_err("setup", retval,
+			"While allocating bad_block bitmap");
+		exit(1);
+	}
+	retval = ext2fs_allocate_block_bitmap(test_fs, "touched map",
+					      &touched_map);
+	if (retval) {
+		com_err("setup", retval,
+			"While allocating touched block bitmap");
+		exit(1);
+	}
+	retval = ext2fs_allocate_inode_bitmap(test_fs, "bad inode map",
+					      &bad_inode_map);
+	if (retval) {
+		com_err("setup", retval,
+			"While allocating bad inode bitmap");
+		exit(1);
+	}
+
+	retval = ext2fs_badblocks_list_create(&test_badblocks, 5);
+	if (retval) {
+		com_err("setup", retval, "while creating badblocks list");
+		exit(1);
+	}
+	for (i=0; test_vec[i]; i++) {
+		retval = ext2fs_badblocks_list_add(test_badblocks, test_vec[i]);
+		if (retval) {
+			com_err("setup", retval,
+				"while adding test vector %d", i);
+			exit(1);
+		}
+		ext2fs_mark_block_bitmap2(bad_block_map, test_vec[i]);
+	}
+	test_fs->badblocks = test_badblocks;
+}
+
+/*
+ * Iterate using inode_scan
+ */
+static void iterate(void)
+{
+	struct ext2_inode inode;
+	ext2_inode_scan	scan;
+	errcode_t	retval;
+	ext2_ino_t	ino;
+
+	retval = ext2fs_open_inode_scan(test_fs, 8, &scan);
+	if (retval) {
+		com_err("iterate", retval, "While opening inode scan");
+		exit(1);
+	}
+	printf("Reading blocks: ");
+	retval = ext2fs_get_next_inode(scan, &ino, &inode);
+	if (retval) {
+		com_err("iterate", retval, "while reading first inode");
+		exit(1);
+	}
+	while (ino) {
+		retval = ext2fs_get_next_inode(scan, &ino, &inode);
+		if (retval == EXT2_ET_BAD_BLOCK_IN_INODE_TABLE) {
+			ext2fs_mark_inode_bitmap2(bad_inode_map, ino);
+			continue;
+		}
+		if (retval) {
+			com_err("iterate", retval,
+				"while getting next inode");
+			exit(1);
+		}
+	}
+	printf("\n");
+	ext2fs_close_inode_scan(scan);
+}
+
+/*
+ * Verify the touched map
+ */
+static void check_map(void)
+{
+	int	i, j, first=1;
+	blk64_t	blk;
+
+	for (i=0; test_vec[i]; i++) {
+		if (ext2fs_test_block_bitmap2(touched_map, test_vec[i])) {
+			printf("Bad block was touched --- %llu\n",
+			       (unsigned long long) test_vec[i]);
+			failed++;
+			first_no_comma = 1;
+		}
+		ext2fs_mark_block_bitmap2(touched_map, test_vec[i]);
+	}
+	for (i = 0; i < test_fs->group_desc_count; i++) {
+		for (j=0, blk = ext2fs_inode_table_loc(test_fs, i);
+		     j < test_fs->inode_blocks_per_group;
+		     j++, blk++) {
+			if (!ext2fs_test_block_bitmap2(touched_map, blk) &&
+			    !ext2fs_test_block_bitmap2(bad_block_map, blk)) {
+				printf("Missing block --- %llu\n",
+				       (unsigned long long) blk);
+				failed++;
+			}
+		}
+	}
+	printf("Bad inodes: ");
+	for (i=1; i <= test_fs->super->s_inodes_count; i++) {
+		if (ext2fs_test_inode_bitmap2(bad_inode_map, i)) {
+			if (first)
+				first = 0;
+			else
+				printf(", ");
+			printf("%u", i);
+		}
+	}
+	printf("\n");
+}
+
+
+int main(int argc, char **argv)
+{
+	setup();
+	iterate();
+	check_map();
+	if (!failed)
+		printf("Inode scan tested OK!\n");
+	return failed;
+}
+
diff --git a/lib/ext2fs/tst_libext2fs.c b/lib/ext2fs/tst_libext2fs.c
new file mode 100644
index 0000000..4c86464
--- /dev/null
+++ b/lib/ext2fs/tst_libext2fs.c
@@ -0,0 +1,72 @@
+/*
+ * tst_libext2fs.c
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#if HAVE_ERRNO_H
+#include <errno.h>
+#endif
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fsP.h"
+
+#include "ss/ss.h"
+#include "debugfs.h"
+
+/*
+ * Hook in new commands into debugfs
+ * Override debugfs's prompt
+ */
+const char *debug_prog_name = "tst_libext2fs";
+extern ss_request_table libext2fs_cmds;
+ss_request_table *extra_cmds = &libext2fs_cmds;
+
+static int print_blocks_proc(ext2_filsys fs EXT2FS_ATTR((unused)),
+			     blk64_t *blocknr, e2_blkcnt_t blockcnt,
+			     blk64_t ref_block, int ref_offset,
+			     void *private EXT2FS_ATTR((unused)))
+{
+	printf("%6lld %8llu (%d %llu)\n", (long long) blockcnt,
+	       (unsigned long long) *blocknr, ref_offset,
+	       (unsigned long long) ref_block);
+	return 0;
+}
+
+
+void do_block_iterate(int argc, char **argv, int sci_idx EXT2FS_ATTR((unused)),
+		      void *infop EXT2FS_ATTR((unused)))
+{
+	const char	*usage = "block_iterate <file> <flags";
+	ext2_ino_t	ino;
+	int		err = 0;
+	int		flags = 0;
+
+	if (common_args_process(argc, argv, 2, 3, argv[0], usage, 0))
+		return;
+
+	ino = string_to_inode(argv[1]);
+	if (!ino)
+		return;
+
+	if (argc > 2) {
+		flags = parse_ulong(argv[2], argv[0], "flags", &err);
+		if (err)
+			return;
+	}
+	flags |= BLOCK_FLAG_READ_ONLY;
+
+	ext2fs_block_iterate3(current_fs, ino, flags, NULL,
+			      print_blocks_proc, NULL);
+	putc('\n', stdout);
+}
diff --git a/lib/ext2fs/tst_super_size.c b/lib/ext2fs/tst_super_size.c
new file mode 100644
index 0000000..ad452de
--- /dev/null
+++ b/lib/ext2fs/tst_super_size.c
@@ -0,0 +1,161 @@
+/*
+ * This testing program makes sure superblock size is 1024 bytes long
+ *
+ * Copyright (C) 2007 by Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <unistd.h>
+#include <stdlib.h>
+
+#include "ext2_fs.h"
+
+#define sb_struct ext2_super_block
+#define sb_struct_name "ext2_super_block"
+
+struct sb_struct sb;
+
+#ifndef offsetof
+#define offsetof(type, member)  __builtin_offsetof (type, member)
+#endif
+
+#define check_field(x, s) cur_offset = do_field(#x, s, sizeof(sb.x),	       \
+						offsetof(struct sb_struct, x), \
+						cur_offset)
+
+static int do_field(const char *field, unsigned size, unsigned cur_size,
+		    unsigned offset, unsigned cur_offset)
+{
+	if (size != cur_size) {
+		printf("error: %s size %u should be %u\n",
+		       field, cur_size, size);
+		exit(1);
+	}
+	if (offset != cur_offset) {
+		printf("error: %s offset %u should be %u\n",
+		       field, cur_offset, offset);
+		exit(1);
+	}
+	printf("%8d %-30s %3u\n", offset, field, size);
+	return offset + size;
+}
+
+int main(int argc, char **argv)
+{
+#if (__GNUC__ >= 4)
+	int cur_offset = 0;
+
+	printf("%8s %-30s %3s\n", "offset", "field", "size");
+	check_field(s_inodes_count, 4);
+	check_field(s_blocks_count, 4);
+	check_field(s_r_blocks_count, 4);
+	check_field(s_free_blocks_count, 4);
+	check_field(s_free_inodes_count, 4);
+	check_field(s_first_data_block, 4);
+	check_field(s_log_block_size, 4);
+	check_field(s_log_cluster_size, 4);
+	check_field(s_blocks_per_group, 4);
+	check_field(s_clusters_per_group, 4);
+	check_field(s_inodes_per_group, 4);
+	check_field(s_mtime, 4);
+	check_field(s_wtime, 4);
+	check_field(s_mnt_count, 2);
+	check_field(s_max_mnt_count, 2);
+	check_field(s_magic, 2);
+	check_field(s_state, 2);
+	check_field(s_errors, 2);
+	check_field(s_minor_rev_level, 2);
+	check_field(s_lastcheck, 4);
+	check_field(s_checkinterval, 4);
+	check_field(s_creator_os, 4);
+	check_field(s_rev_level, 4);
+	check_field(s_def_resuid, 2);
+	check_field(s_def_resgid, 2);
+	check_field(s_first_ino, 4);
+	check_field(s_inode_size, 2);
+	check_field(s_block_group_nr, 2);
+	check_field(s_feature_compat, 4);
+	check_field(s_feature_incompat, 4);
+	check_field(s_feature_ro_compat, 4);
+	check_field(s_uuid, 16);
+	check_field(s_volume_name, 16);
+	check_field(s_last_mounted, 64);
+	check_field(s_algorithm_usage_bitmap, 4);
+	check_field(s_prealloc_blocks, 1);
+	check_field(s_prealloc_dir_blocks, 1);
+	check_field(s_reserved_gdt_blocks, 2);
+	check_field(s_journal_uuid, 16);
+	check_field(s_journal_inum, 4);
+	check_field(s_journal_dev, 4);
+	check_field(s_last_orphan, 4);
+	check_field(s_hash_seed, 4 * 4);
+	check_field(s_def_hash_version, 1);
+	check_field(s_jnl_backup_type, 1);
+	check_field(s_desc_size, 2);
+	check_field(s_default_mount_opts, 4);
+	check_field(s_first_meta_bg, 4);
+	check_field(s_mkfs_time, 4);
+	check_field(s_jnl_blocks, 17 * 4);
+	check_field(s_blocks_count_hi, 4);
+	check_field(s_r_blocks_count_hi, 4);
+	check_field(s_free_blocks_hi, 4);
+	check_field(s_min_extra_isize, 2);
+	check_field(s_want_extra_isize, 2);
+	check_field(s_flags, 4);
+	check_field(s_raid_stride, 2);
+	check_field(s_mmp_update_interval, 2);
+	check_field(s_mmp_block, 8);
+	check_field(s_raid_stripe_width, 4);
+	check_field(s_log_groups_per_flex, 1);
+	check_field(s_checksum_type, 1);
+	check_field(s_encryption_level, 1);
+	check_field(s_reserved_pad, 1);
+	check_field(s_kbytes_written, 8);
+	check_field(s_snapshot_inum, 4);
+	check_field(s_snapshot_id, 4);
+	check_field(s_snapshot_r_blocks_count, 8);
+	check_field(s_snapshot_list, 4);
+	check_field(s_error_count, 4);
+	check_field(s_first_error_time, 4);
+	check_field(s_first_error_ino, 4);
+	check_field(s_first_error_block, 8);
+	check_field(s_first_error_func, 32);
+	check_field(s_first_error_line, 4);
+	check_field(s_last_error_time, 4);
+	check_field(s_last_error_ino, 4);
+	check_field(s_last_error_line, 4);
+	check_field(s_last_error_block, 8);
+	check_field(s_last_error_func, 32);
+	check_field(s_mount_opts, 64);
+	check_field(s_usr_quota_inum, 4);
+	check_field(s_grp_quota_inum, 4);
+	check_field(s_overhead_clusters, 4);
+	check_field(s_backup_bgs, 8);
+	check_field(s_encrypt_algos, 4);
+	check_field(s_encrypt_pw_salt, 16);
+	check_field(s_lpf_ino, 4);
+	check_field(s_prj_quota_inum, 4);
+	check_field(s_checksum_seed, 4);
+	check_field(s_wtime_hi, 1);
+	check_field(s_mtime_hi, 1);
+	check_field(s_mkfs_time_hi, 1);
+	check_field(s_lastcheck_hi, 1);
+	check_field(s_first_error_time_hi, 1);
+	check_field(s_last_error_time_hi, 1);
+	check_field(s_first_error_errcode, 1);
+	check_field(s_last_error_errcode, 1);
+	check_field(s_encoding, 2);
+	check_field(s_encoding_flags, 2);
+	check_field(s_orphan_file_inum, 4);
+	check_field(s_reserved, 94 * 4);
+	check_field(s_checksum, 4);
+	do_field("Superblock end", 0, 0, cur_offset, 1024);
+#endif
+	return 0;
+}
diff --git a/lib/ext2fs/tst_types.c b/lib/ext2fs/tst_types.c
new file mode 100644
index 0000000..3e41128
--- /dev/null
+++ b/lib/ext2fs/tst_types.c
@@ -0,0 +1,64 @@
+/*
+ * This testing program makes sure the ext2_types header file
+ *
+ * Copyright (C) 2006 by Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <stdlib.h>
+#include <unistd.h>
+
+#include "ext2fs/ext2_types.h"
+
+int main(int argc, char **argv)
+{
+	if (sizeof(__u8) != 1) {
+		printf("Sizeof(__u8) is %d should be 1\n",
+		       (int)sizeof(__u8));
+		exit(1);
+	}
+	if (sizeof(__s8) != 1) {
+		printf("Sizeof(_s8) is %d should be 1\n",
+		       (int)sizeof(__s8));
+		exit(1);
+	}
+	if (sizeof(__u16) != 2) {
+		printf("Sizeof(__u16) is %d should be 2\n",
+		       (int)sizeof(__u16));
+		exit(1);
+	}
+	if (sizeof(__s16) != 2) {
+		printf("Sizeof(__s16) is %d should be 2\n",
+		       (int)sizeof(__s16));
+		exit(1);
+	}
+	if (sizeof(__u32) != 4) {
+		printf("Sizeof(__u32) is %d should be 4\n",
+		       (int)sizeof(__u32));
+		exit(1);
+	}
+	if (sizeof(__s32) != 4) {
+		printf("Sizeof(__s32) is %d should be 4\n",
+		       (int)sizeof(__s32));
+		exit(1);
+	}
+	if (sizeof(__u64) != 8) {
+		printf("Sizeof(__u64) is %d should be 8\n",
+		       (int)sizeof(__u64));
+		exit(1);
+	}
+	if (sizeof(__s64) != 8) {
+		printf("Sizeof(__s64) is %d should be 8\n",
+		       (int)sizeof(__s64));
+		exit(1);
+	}
+	printf("The ext2_types.h types are correct.\n");
+	exit(0);
+}
+
diff --git a/lib/ext2fs/undo_io.c b/lib/ext2fs/undo_io.c
new file mode 100644
index 0000000..f4a6d52
--- /dev/null
+++ b/lib/ext2fs/undo_io.c
@@ -0,0 +1,1108 @@
+/*
+ * undo_io.c --- This is the undo io manager that copies the old data that
+ * copies the old data being overwritten into a tdb database
+ *
+ * Copyright IBM Corporation, 2007
+ * Author Aneesh Kumar K.V <aneesh.kumar@linux.vnet.ibm.com>
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#ifndef _LARGEFILE_SOURCE
+#define _LARGEFILE_SOURCE
+#endif
+#ifndef _LARGEFILE64_SOURCE
+#define _LARGEFILE64_SOURCE
+#endif
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#if HAVE_ERRNO_H
+#include <errno.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#ifdef __linux__
+#include <sys/utsname.h>
+#endif
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+#if HAVE_SYS_RESOURCE_H
+#include <sys/resource.h>
+#endif
+#include <limits.h>
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+#include "ext2fsP.h"
+
+#ifdef __GNUC__
+#define ATTR(x) __attribute__(x)
+#else
+#define ATTR(x)
+#endif
+
+#undef DEBUG
+
+#ifdef DEBUG
+# define dbg_printf(f, a...)  do {printf(f, ## a); fflush(stdout); } while (0)
+#else
+# define dbg_printf(f, a...)
+#endif
+
+/*
+ * For checking structure magic numbers...
+ */
+
+#define EXT2_CHECK_MAGIC(struct, code) \
+	  if ((struct)->magic != (code)) return (code)
+/*
+ * Undo file format: The file is cut up into undo_header.block_size blocks.
+ * The first block contains the header.
+ * The second block contains the superblock.
+ * There is then a repeating series of blocks as follows:
+ *   A key block, which contains undo_keys to map the following data blocks.
+ *   Data blocks
+ * (Note that there are pointers to the first key block and the sb, so this
+ * order isn't strictly necessary.)
+ */
+#define E2UNDO_MAGIC "E2UNDO02"
+#define KEYBLOCK_MAGIC 0xCADECADE
+
+#define E2UNDO_STATE_FINISHED	0x1	/* undo file is complete */
+
+#define E2UNDO_MIN_BLOCK_SIZE	1024	/* undo blocks are no less than 1KB */
+#define E2UNDO_MAX_BLOCK_SIZE	1048576	/* undo blocks are no more than 1MB */
+
+struct undo_header {
+	char magic[8];		/* "E2UNDO02" */
+	__le64 num_keys;	/* how many keys? */
+	__le64 super_offset;	/* where in the file is the superblock copy? */
+	__le64 key_offset;	/* where do the key/data block chunks start? */
+	__le32 block_size;	/* block size of the undo file */
+	__le32 fs_block_size;	/* block size of the target device */
+	__le32 sb_crc;		/* crc32c of the superblock */
+	__le32 state;		/* e2undo state flags */
+	__le32 f_compat;	/* compatible features */
+	__le32 f_incompat;	/* incompatible features (none so far) */
+	__le32 f_rocompat;	/* ro compatible features (none so far) */
+	__le32 pad32;		/* padding for fs_offset */
+	__le64 fs_offset;	/* filesystem offset */
+	__u8 padding[436];	/* padding */
+	__le32 header_crc;	/* crc32c of this header (but not this field) */
+};
+
+#define E2UNDO_MAX_EXTENT_BLOCKS	512	/* max extent size, in blocks */
+
+struct undo_key {
+	__le64 fsblk;		/* where in the fs does the block go */
+	__le32 blk_crc;		/* crc32c of the block */
+	__le32 size;		/* how many bytes in this block? */
+};
+
+struct undo_key_block {
+	__le32 magic;		/* KEYBLOCK_MAGIC number */
+	__le32 crc;		/* block checksum */
+	__le64 reserved;	/* zero */
+
+#if __STDC_VERSION__ >= 199901L
+	struct undo_key keys[];		/* keys, which come immediately after */
+#else
+	struct undo_key keys[0];	/* keys, which come immediately after */
+#endif
+};
+
+struct undo_private_data {
+	int	magic;
+
+	/* the undo file io channel */
+	io_channel undo_file;
+	blk64_t undo_blk_num;			/* next free block */
+	blk64_t key_blk_num;			/* current key block location */
+	blk64_t super_blk_num;			/* superblock location */
+	blk64_t first_key_blk;			/* first key block location */
+	struct undo_key_block *keyb;
+	size_t num_keys, keys_in_block;
+
+	/* The backing io channel */
+	io_channel real;
+
+	unsigned long long tdb_data_size;
+	int tdb_written;
+
+	/* to support offset in unix I/O manager */
+	ext2_loff_t offset;
+
+	ext2fs_block_bitmap written_block_map;
+	struct struct_ext2_filsys fake_fs;
+	char *tdb_file;
+	struct undo_header hdr;
+};
+#define KEYS_PER_BLOCK(d) (((d)->tdb_data_size / sizeof(struct undo_key)) - 1)
+
+#define E2UNDO_FEATURE_COMPAT_FS_OFFSET 0x1	/* the filesystem offset */
+
+static inline void e2undo_set_feature_fs_offset(struct undo_header *header) {
+	header->f_compat |= ext2fs_le32_to_cpu(E2UNDO_FEATURE_COMPAT_FS_OFFSET);
+}
+
+static inline void e2undo_clear_feature_fs_offset(struct undo_header *header) {
+	header->f_compat &= ~ext2fs_le32_to_cpu(E2UNDO_FEATURE_COMPAT_FS_OFFSET);
+}
+
+static io_manager undo_io_backing_manager;
+static char *tdb_file;
+static int actual_size;
+
+errcode_t set_undo_io_backing_manager(io_manager manager)
+{
+	/*
+	 * We may want to do some validation later
+	 */
+	undo_io_backing_manager = manager;
+	return 0;
+}
+
+errcode_t set_undo_io_backup_file(char *file_name)
+{
+	tdb_file = strdup(file_name);
+
+	if (tdb_file == NULL) {
+		return EXT2_ET_NO_MEMORY;
+	}
+
+	return 0;
+}
+
+static errcode_t write_undo_indexes(struct undo_private_data *data, int flush)
+{
+	errcode_t retval;
+	struct ext2_super_block super;
+	io_channel channel;
+	int block_size;
+	__u32 sb_crc, hdr_crc;
+
+	/* Spit out a key block, if there's any data */
+	if (data->keys_in_block) {
+		data->keyb->magic = ext2fs_cpu_to_le32(KEYBLOCK_MAGIC);
+		data->keyb->crc = 0;
+		data->keyb->crc = ext2fs_cpu_to_le32(
+					 ext2fs_crc32c_le(~0,
+					 (unsigned char *)data->keyb,
+					 data->tdb_data_size));
+		dbg_printf("Writing keyblock to blk %llu\n", data->key_blk_num);
+		retval = io_channel_write_blk64(data->undo_file,
+						data->key_blk_num,
+						1, data->keyb);
+		if (retval)
+			return retval;
+		/* Move on to the next key block if it's full. */
+		if (data->keys_in_block == KEYS_PER_BLOCK(data)) {
+			memset(data->keyb, 0, data->tdb_data_size);
+			data->keys_in_block = 0;
+			data->key_blk_num = data->undo_blk_num;
+			data->undo_blk_num++;
+		}
+	}
+
+	/* Prepare superblock for write */
+	channel = data->real;
+	block_size = channel->block_size;
+
+	io_channel_set_blksize(channel, SUPERBLOCK_OFFSET);
+	retval = io_channel_read_blk64(channel, 1, -SUPERBLOCK_SIZE, &super);
+	if (retval)
+		goto err_out;
+	sb_crc = ext2fs_crc32c_le(~0, (unsigned char *)&super, SUPERBLOCK_SIZE);
+	super.s_magic = ~super.s_magic;
+
+	/* Write the undo header to disk. */
+	memcpy(data->hdr.magic, E2UNDO_MAGIC, sizeof(data->hdr.magic));
+	data->hdr.num_keys = ext2fs_cpu_to_le64(data->num_keys);
+	data->hdr.super_offset = ext2fs_cpu_to_le64(data->super_blk_num);
+	data->hdr.key_offset = ext2fs_cpu_to_le64(data->first_key_blk);
+	data->hdr.fs_block_size = ext2fs_cpu_to_le32(block_size);
+	data->hdr.sb_crc = ext2fs_cpu_to_le32(sb_crc);
+	data->hdr.fs_offset = ext2fs_cpu_to_le64(data->offset);
+	if (data->offset)
+		e2undo_set_feature_fs_offset(&data->hdr);
+	else
+		e2undo_clear_feature_fs_offset(&data->hdr);
+	hdr_crc = ext2fs_crc32c_le(~0, (unsigned char *)&data->hdr,
+				   sizeof(data->hdr) -
+				   sizeof(data->hdr.header_crc));
+	data->hdr.header_crc = ext2fs_cpu_to_le32(hdr_crc);
+	retval = io_channel_write_blk64(data->undo_file, 0,
+					-(int)sizeof(data->hdr),
+					&data->hdr);
+	if (retval)
+		goto err_out;
+
+	/*
+	 * Record the entire superblock (in FS byte order) so that we can't
+	 * apply e2undo files to the wrong FS or out of order.
+	 */
+	dbg_printf("Writing superblock to block %llu\n", data->super_blk_num);
+	retval = io_channel_write_blk64(data->undo_file, data->super_blk_num,
+					-SUPERBLOCK_SIZE, &super);
+	if (retval)
+		goto err_out;
+
+	if (flush)
+		retval = io_channel_flush(data->undo_file);
+err_out:
+	io_channel_set_blksize(channel, block_size);
+	return retval;
+}
+
+static errcode_t undo_setup_tdb(struct undo_private_data *data)
+{
+	int i;
+	errcode_t retval;
+
+	if (data->tdb_written == 1)
+		return 0;
+
+	data->tdb_written = 1;
+
+	/* Make a bitmap to track what we've written */
+	memset(&data->fake_fs, 0, sizeof(data->fake_fs));
+	data->fake_fs.blocksize = data->tdb_data_size;
+	retval = ext2fs_alloc_generic_bmap(&data->fake_fs,
+				EXT2_ET_MAGIC_BLOCK_BITMAP64,
+				EXT2FS_BMAP64_RBTREE,
+				0, ~1ULL, ~1ULL,
+				"undo block map", &data->written_block_map);
+	if (retval)
+		return retval;
+
+	/* Allocate key block */
+	retval = ext2fs_get_mem(data->tdb_data_size, &data->keyb);
+	if (retval)
+		return retval;
+	data->key_blk_num = data->first_key_blk;
+
+	/* Record block size */
+	dbg_printf("Undo block size %llu\n", data->tdb_data_size);
+	dbg_printf("Keys per block %llu\n", KEYS_PER_BLOCK(data));
+	data->hdr.block_size = ext2fs_cpu_to_le32(data->tdb_data_size);
+	io_channel_set_blksize(data->undo_file, data->tdb_data_size);
+
+	/* Ensure that we have space for header blocks */
+	for (i = 0; i <= 2; i++) {
+		retval = io_channel_read_blk64(data->undo_file, i, 1,
+					       data->keyb);
+		if (retval)
+			memset(data->keyb, 0, data->tdb_data_size);
+		retval = io_channel_write_blk64(data->undo_file, i, 1,
+						data->keyb);
+		if (retval)
+			return retval;
+		retval = io_channel_flush(data->undo_file);
+		if (retval)
+			return retval;
+	}
+	memset(data->keyb, 0, data->tdb_data_size);
+	return 0;
+}
+
+static errcode_t undo_write_tdb(io_channel channel,
+				unsigned long long block, int count)
+
+{
+	int size, sz;
+	unsigned long long block_num, backing_blk_num;
+	errcode_t retval = 0;
+	ext2_loff_t offset;
+	struct undo_private_data *data;
+	unsigned char *read_ptr;
+	unsigned long long end_block;
+	unsigned long long data_size;
+	struct undo_key *key;
+	__u32 blk_crc;
+
+	data = (struct undo_private_data *) channel->private_data;
+
+	if (data->undo_file == NULL) {
+		/*
+		 * Transaction database not initialized
+		 */
+		return 0;
+	}
+
+	if (count == 1)
+		size = channel->block_size;
+	else {
+		if (count < 0)
+			size = -count;
+		else
+			size = count * channel->block_size;
+	}
+
+	retval = undo_setup_tdb(data);
+	if (retval)
+		return retval;
+	/*
+	 * Data is stored in tdb database as blocks of tdb_data_size size
+	 * This helps in efficient lookup further.
+	 *
+	 * We divide the disk to blocks of tdb_data_size.
+	 */
+	offset = (block * channel->block_size) + data->offset ;
+	block_num = offset / data->tdb_data_size;
+	end_block = (offset + size - 1) / data->tdb_data_size;
+
+	while (block_num <= end_block) {
+		__u32 keysz;
+
+		/*
+		 * Check if we have the record already
+		 */
+		if (ext2fs_test_block_bitmap2(data->written_block_map,
+						   block_num)) {
+			/* Try the next block */
+			block_num++;
+			continue;
+		}
+		ext2fs_mark_block_bitmap2(data->written_block_map, block_num);
+
+		/*
+		 * Read one block using the backing I/O manager
+		 * The backing I/O manager block size may be
+		 * different from the tdb_data_size.
+		 * Also we need to recalculate the block number with respect
+		 * to the backing I/O manager.
+		 */
+		offset = block_num * data->tdb_data_size +
+				(data->offset % data->tdb_data_size);
+		backing_blk_num = (offset - data->offset) / channel->block_size;
+
+		retval = ext2fs_get_mem(data->tdb_data_size, &read_ptr);
+		if (retval) {
+			return retval;
+		}
+
+		memset(read_ptr, 0, data->tdb_data_size);
+		actual_size = 0;
+		if ((data->tdb_data_size % channel->block_size) == 0)
+			sz = data->tdb_data_size / channel->block_size;
+		else
+			sz = -data->tdb_data_size;
+		retval = io_channel_read_blk64(data->real, backing_blk_num,
+					     sz, read_ptr);
+		if (retval) {
+			if (retval != EXT2_ET_SHORT_READ) {
+				free(read_ptr);
+				return retval;
+			}
+			/*
+			 * short read so update the record size
+			 * accordingly
+			 */
+			data_size = actual_size;
+		} else {
+			data_size = data->tdb_data_size;
+		}
+		if (data_size == 0) {
+			free(read_ptr);
+			block_num++;
+			continue;
+		}
+		dbg_printf("Read %llu bytes from FS block %llu (blk=%llu cnt=%llu)\n",
+		       data_size, backing_blk_num, block, data->tdb_data_size);
+		if ((data_size % data->undo_file->block_size) == 0)
+			sz = data_size / data->undo_file->block_size;
+		else
+			sz = -data_size;;
+		/* extend this key? */
+		if (data->keys_in_block) {
+			key = data->keyb->keys + data->keys_in_block - 1;
+			keysz = ext2fs_le32_to_cpu(key->size);
+		} else {
+			key = NULL;
+			keysz = 0;
+		}
+		if (key != NULL &&
+		    (ext2fs_le64_to_cpu(key->fsblk) * channel->block_size +
+		     channel->block_size - 1 +
+		     keysz) / channel->block_size == backing_blk_num &&
+		    E2UNDO_MAX_EXTENT_BLOCKS * data->tdb_data_size >
+		    keysz + data_size) {
+			blk_crc = ext2fs_le32_to_cpu(key->blk_crc);
+			blk_crc = ext2fs_crc32c_le(blk_crc, read_ptr, data_size);
+			key->blk_crc = ext2fs_cpu_to_le32(blk_crc);
+			key->size = ext2fs_cpu_to_le32(keysz + data_size);
+		} else {
+			data->num_keys++;
+			key = data->keyb->keys + data->keys_in_block;
+			data->keys_in_block++;
+			key->fsblk = ext2fs_cpu_to_le64(backing_blk_num);
+			blk_crc = ext2fs_crc32c_le(~0, read_ptr, data_size);
+			key->blk_crc = ext2fs_cpu_to_le32(blk_crc);
+			key->size = ext2fs_cpu_to_le32(data_size);
+		}
+		dbg_printf("Writing block %llu to offset %llu size %d key %zu\n",
+		       block_num,
+		       data->undo_blk_num,
+		       sz, data->num_keys - 1);
+		retval = io_channel_write_blk64(data->undo_file,
+					data->undo_blk_num, sz, read_ptr);
+		if (retval) {
+			free(read_ptr);
+			return retval;
+		}
+		data->undo_blk_num++;
+		free(read_ptr);
+
+		/* Write out the key block */
+		retval = write_undo_indexes(data, 0);
+		if (retval)
+			return retval;
+
+		/* Next block */
+		block_num++;
+	}
+
+	return retval;
+}
+
+static errcode_t undo_io_read_error(io_channel channel ATTR((unused)),
+				    unsigned long block ATTR((unused)),
+				    int count ATTR((unused)),
+				    void *data ATTR((unused)),
+				    size_t size ATTR((unused)),
+				    int actual,
+				    errcode_t error ATTR((unused)))
+{
+	actual_size = actual;
+	return error;
+}
+
+static void undo_err_handler_init(io_channel channel)
+{
+	channel->read_error = undo_io_read_error;
+}
+
+static int check_filesystem(struct undo_header *hdr, io_channel undo_file,
+			    unsigned int blocksize, blk64_t super_block,
+			    io_channel channel)
+{
+	struct ext2_super_block super, *sb;
+	char *buf;
+	__u32 sb_crc;
+	errcode_t retval;
+
+	io_channel_set_blksize(channel, SUPERBLOCK_OFFSET);
+	retval = io_channel_read_blk64(channel, 1, -SUPERBLOCK_SIZE, &super);
+	if (retval)
+		return retval;
+
+	/*
+	 * Compare the FS and the undo file superblock so that we don't
+	 * append to something that doesn't match this FS.
+	 */
+	retval = ext2fs_get_mem(blocksize, &buf);
+	if (retval)
+		return retval;
+	retval = io_channel_read_blk64(undo_file, super_block,
+				       -SUPERBLOCK_SIZE, buf);
+	if (retval)
+		goto out;
+	sb = (struct ext2_super_block *)buf;
+	sb->s_magic = ~sb->s_magic;
+	if (memcmp(&super, buf, sizeof(super))) {
+		retval = -1;
+		goto out;
+	}
+	sb_crc = ext2fs_crc32c_le(~0, (unsigned char *)buf, SUPERBLOCK_SIZE);
+	if (ext2fs_le32_to_cpu(hdr->sb_crc) != sb_crc) {
+		retval = -1;
+		goto out;
+	}
+
+out:
+	ext2fs_free_mem(&buf);
+	return retval;
+}
+
+/*
+ * Try to re-open the undo file, so that we can resume where we left off.
+ * That way, the user can pass the same undo file to various programs as
+ * part of an FS upgrade instead of having to create multiple files and
+ * then apply them in correct order.
+ */
+static errcode_t try_reopen_undo_file(int undo_fd,
+				      struct undo_private_data *data)
+{
+	struct undo_header hdr;
+	struct undo_key *dkey;
+	ext2fs_struct_stat statbuf;
+	unsigned int blocksize, fs_blocksize;
+	blk64_t super_block, lblk;
+	size_t num_keys, keys_per_block, i;
+	__u32 hdr_crc, key_crc;
+	errcode_t retval;
+
+	/* Zero size already? */
+	retval = ext2fs_fstat(undo_fd, &statbuf);
+	if (retval)
+		goto bad_file;
+	if (statbuf.st_size == 0)
+		goto out;
+
+	/* check the file header */
+	retval = io_channel_read_blk64(data->undo_file, 0, -(int)sizeof(hdr),
+				       &hdr);
+	if (retval)
+		goto bad_file;
+
+	if (memcmp(hdr.magic, E2UNDO_MAGIC,
+		    sizeof(hdr.magic)))
+		goto bad_file;
+	hdr_crc = ext2fs_crc32c_le(~0, (unsigned char *)&hdr,
+				   sizeof(struct undo_header) -
+				   sizeof(__u32));
+	if (ext2fs_le32_to_cpu(hdr.header_crc) != hdr_crc)
+		goto bad_file;
+	blocksize = ext2fs_le32_to_cpu(hdr.block_size);
+	fs_blocksize = ext2fs_le32_to_cpu(hdr.fs_block_size);
+	if (blocksize > E2UNDO_MAX_BLOCK_SIZE ||
+	    blocksize < E2UNDO_MIN_BLOCK_SIZE ||
+	    !blocksize || !fs_blocksize)
+		goto bad_file;
+	super_block = ext2fs_le64_to_cpu(hdr.super_offset);
+	num_keys = ext2fs_le64_to_cpu(hdr.num_keys);
+	io_channel_set_blksize(data->undo_file, blocksize);
+	/*
+	 * Do not compare hdr.f_compat with the available compatible
+	 * features set, because a "missing" compatible feature should
+	 * not cause any problems.
+	 */
+	if (hdr.f_incompat || hdr.f_rocompat)
+		goto bad_file;
+
+	/* Superblock matches this FS? */
+	if (check_filesystem(&hdr, data->undo_file, blocksize, super_block,
+			     data->real) != 0) {
+		retval = EXT2_ET_UNDO_FILE_WRONG;
+		goto out;
+	}
+
+	/* Try to set ourselves up */
+	data->tdb_data_size = blocksize;
+	retval = undo_setup_tdb(data);
+	if (retval)
+		goto bad_file;
+	data->num_keys = num_keys;
+	data->super_blk_num = super_block;
+	data->first_key_blk = ext2fs_le64_to_cpu(hdr.key_offset);
+
+	/* load the written block map */
+	keys_per_block = KEYS_PER_BLOCK(data);
+	lblk = data->first_key_blk;
+	dbg_printf("nr_keys=%lu, kpb=%zu, blksz=%u\n",
+		   num_keys, keys_per_block, blocksize);
+	for (i = 0; i < num_keys; i += keys_per_block) {
+		size_t j, max_j;
+		__le32 crc;
+
+		data->key_blk_num = lblk;
+		retval = io_channel_read_blk64(data->undo_file,
+					       lblk, 1, data->keyb);
+		if (retval)
+			goto bad_key_replay;
+
+		/* check keys */
+		if (ext2fs_le32_to_cpu(data->keyb->magic) != KEYBLOCK_MAGIC) {
+			retval = EXT2_ET_UNDO_FILE_CORRUPT;
+			goto bad_key_replay;
+		}
+		crc = data->keyb->crc;
+		data->keyb->crc = 0;
+		key_crc = ext2fs_crc32c_le(~0, (unsigned char *)data->keyb,
+					   blocksize);
+		if (ext2fs_le32_to_cpu(crc) != key_crc) {
+			retval = EXT2_ET_UNDO_FILE_CORRUPT;
+			goto bad_key_replay;
+		}
+
+		/* load keys from key block */
+		lblk++;
+		max_j = data->num_keys - i;
+		if (max_j > keys_per_block)
+			max_j = keys_per_block;
+		for (j = 0, dkey = data->keyb->keys;
+		     j < max_j;
+		     j++, dkey++) {
+			blk64_t fsblk = ext2fs_le64_to_cpu(dkey->fsblk);
+			blk64_t undo_blk = fsblk * fs_blocksize / blocksize;
+			size_t size = ext2fs_le32_to_cpu(dkey->size);
+
+			ext2fs_mark_block_bitmap_range2(data->written_block_map,
+					 undo_blk,
+					(size + blocksize - 1) / blocksize);
+			lblk += (size + blocksize - 1) / blocksize;
+			data->undo_blk_num = lblk;
+			data->keys_in_block = j + 1;
+		}
+	}
+	dbg_printf("Reopen undo, keyblk=%llu undoblk=%llu nrkeys=%zu kib=%zu\n",
+		   data->key_blk_num, data->undo_blk_num, data->num_keys,
+		   data->keys_in_block);
+
+	data->hdr.state = hdr.state & ~E2UNDO_STATE_FINISHED;
+	data->hdr.f_compat = hdr.f_compat;
+	data->hdr.f_incompat = hdr.f_incompat;
+	data->hdr.f_rocompat = hdr.f_rocompat;
+	return retval;
+
+bad_key_replay:
+	data->key_blk_num = data->undo_blk_num = 0;
+	data->keys_in_block = 0;
+	ext2fs_free_mem(&data->keyb);
+	ext2fs_free_generic_bitmap(data->written_block_map);
+	data->tdb_written = 0;
+	goto out;
+bad_file:
+	retval = EXT2_ET_UNDO_FILE_CORRUPT;
+out:
+	return retval;
+}
+
+static void undo_atexit(void *p)
+{
+	struct undo_private_data *data = p;
+	errcode_t err;
+
+	err = write_undo_indexes(data, 1);
+	io_channel_close(data->undo_file);
+
+	com_err(data->tdb_file, err, "while force-closing undo file");
+}
+
+static errcode_t undo_open(const char *name, int flags, io_channel *channel)
+{
+	io_channel	io = NULL;
+	struct undo_private_data *data = NULL;
+	int		undo_fd = -1;
+	errcode_t	retval;
+
+	/* We don't support multi-threading, at least for now */
+	flags &= ~IO_FLAG_THREADS;
+	if (name == 0)
+		return EXT2_ET_BAD_DEVICE_NAME;
+	retval = ext2fs_get_mem(sizeof(struct struct_io_channel), &io);
+	if (retval)
+		goto cleanup;
+	memset(io, 0, sizeof(struct struct_io_channel));
+	io->magic = EXT2_ET_MAGIC_IO_CHANNEL;
+	retval = ext2fs_get_mem(sizeof(struct undo_private_data), &data);
+	if (retval)
+		goto cleanup;
+
+	io->manager = undo_io_manager;
+	retval = ext2fs_get_mem(strlen(name)+1, &io->name);
+	if (retval)
+		goto cleanup;
+
+	strcpy(io->name, name);
+	io->private_data = data;
+	io->block_size = 1024;
+	io->read_error = 0;
+	io->write_error = 0;
+	io->refcount = 1;
+
+	memset(data, 0, sizeof(struct undo_private_data));
+	data->magic = EXT2_ET_MAGIC_UNIX_IO_CHANNEL;
+	data->super_blk_num = 1;
+	data->first_key_blk = 2;
+	data->undo_blk_num = 3;
+
+	if (undo_io_backing_manager) {
+		retval = undo_io_backing_manager->open(name, flags,
+						       &data->real);
+		if (retval)
+			goto cleanup;
+
+		data->tdb_file = strdup(tdb_file);
+		if (data->tdb_file == NULL)
+			goto cleanup;
+		undo_fd = ext2fs_open_file(data->tdb_file, O_RDWR | O_CREAT,
+					   0600);
+		if (undo_fd < 0)
+			goto cleanup;
+
+		retval = undo_io_backing_manager->open(data->tdb_file,
+						       IO_FLAG_RW,
+						       &data->undo_file);
+		if (retval)
+			goto cleanup;
+	} else {
+		data->real = NULL;
+		data->undo_file = NULL;
+	}
+
+	if (data->real)
+		io->flags = (io->flags & ~CHANNEL_FLAGS_DISCARD_ZEROES) |
+			    (data->real->flags & CHANNEL_FLAGS_DISCARD_ZEROES);
+
+	/*
+	 * setup err handler for read so that we know
+	 * when the backing manager fails do short read
+	 */
+	if (data->real)
+		undo_err_handler_init(data->real);
+
+	if (data->undo_file) {
+		retval = try_reopen_undo_file(undo_fd, data);
+		if (retval)
+			goto cleanup;
+	}
+	retval = ext2fs_add_exit_fn(undo_atexit, data);
+	if (retval)
+		goto cleanup;
+
+	*channel = io;
+	if (undo_fd >= 0)
+		close(undo_fd);
+	return retval;
+
+cleanup:
+	ext2fs_remove_exit_fn(undo_atexit, data);
+	if (undo_fd >= 0)
+		close(undo_fd);
+	if (data && data->undo_file)
+		io_channel_close(data->undo_file);
+	if (data && data->tdb_file)
+		free(data->tdb_file);
+	if (data && data->real)
+		io_channel_close(data->real);
+	if (data)
+		ext2fs_free_mem(&data);
+	if (io && io->name)
+		ext2fs_free_mem(&io->name);
+	if (io)
+		ext2fs_free_mem(&io);
+	return retval;
+}
+
+static errcode_t undo_close(io_channel channel)
+{
+	struct undo_private_data *data;
+	errcode_t	err, retval = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct undo_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL);
+
+	if (--channel->refcount > 0)
+		return 0;
+	/* Before closing write the file system identity */
+	if (!getenv("UNDO_IO_SIMULATE_UNFINISHED"))
+		data->hdr.state = ext2fs_cpu_to_le32(E2UNDO_STATE_FINISHED);
+	err = write_undo_indexes(data, 1);
+	ext2fs_remove_exit_fn(undo_atexit, data);
+	if (data->real)
+		retval = io_channel_close(data->real);
+	if (data->tdb_file)
+		free(data->tdb_file);
+	if (data->undo_file)
+		io_channel_close(data->undo_file);
+	ext2fs_free_mem(&data->keyb);
+	if (data->written_block_map)
+		ext2fs_free_generic_bitmap(data->written_block_map);
+	ext2fs_free_mem(&channel->private_data);
+	if (channel->name)
+		ext2fs_free_mem(&channel->name);
+	ext2fs_free_mem(&channel);
+
+	if (err)
+		return err;
+	return retval;
+}
+
+static errcode_t undo_set_blksize(io_channel channel, int blksize)
+{
+	struct undo_private_data *data;
+	errcode_t		retval = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct undo_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL);
+
+	if (blksize > E2UNDO_MAX_BLOCK_SIZE || blksize < E2UNDO_MIN_BLOCK_SIZE)
+		return EXT2_ET_INVALID_ARGUMENT;
+
+	if (data->real)
+		retval = io_channel_set_blksize(data->real, blksize);
+	/*
+	 * Set the block size used for tdb
+	 */
+	if (!data->tdb_data_size || !data->tdb_written)
+		data->tdb_data_size = blksize;
+	channel->block_size = blksize;
+	return retval;
+}
+
+static errcode_t undo_read_blk64(io_channel channel, unsigned long long block,
+			       int count, void *buf)
+{
+	errcode_t	retval = 0;
+	struct undo_private_data *data;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct undo_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL);
+
+	if (data->real)
+		retval = io_channel_read_blk64(data->real, block, count, buf);
+
+	return retval;
+}
+
+static errcode_t undo_read_blk(io_channel channel, unsigned long block,
+			       int count, void *buf)
+{
+	return undo_read_blk64(channel, block, count, buf);
+}
+
+static errcode_t undo_write_blk64(io_channel channel, unsigned long long block,
+				int count, const void *buf)
+{
+	struct undo_private_data *data;
+	errcode_t	retval = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct undo_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL);
+	/*
+	 * First write the existing content into database
+	 */
+	retval = undo_write_tdb(channel, block, count);
+	if (retval)
+		 return retval;
+	if (data->real)
+		retval = io_channel_write_blk64(data->real, block, count, buf);
+
+	return retval;
+}
+
+static errcode_t undo_write_blk(io_channel channel, unsigned long block,
+				int count, const void *buf)
+{
+	return undo_write_blk64(channel, block, count, buf);
+}
+
+static errcode_t undo_write_byte(io_channel channel, unsigned long offset,
+				 int size, const void *buf)
+{
+	struct undo_private_data *data;
+	errcode_t	retval = 0;
+	ext2_loff_t	location;
+	unsigned long blk_num, count;;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct undo_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL);
+
+	location = offset + data->offset;
+	blk_num = location/channel->block_size;
+	/*
+	 * the size specified may spread across multiple blocks
+	 * also make sure we account for the fact that block start
+	 * offset for tdb is different from the backing I/O manager
+	 * due to possible different block size
+	 */
+	count = (size + (location % channel->block_size) +
+			channel->block_size  -1)/channel->block_size;
+	retval = undo_write_tdb(channel, blk_num, count);
+	if (retval)
+		return retval;
+	if (data->real && data->real->manager->write_byte)
+		retval = io_channel_write_byte(data->real, offset, size, buf);
+
+	return retval;
+}
+
+static errcode_t undo_discard(io_channel channel, unsigned long long block,
+			      unsigned long long count)
+{
+	struct undo_private_data *data;
+	errcode_t	retval = 0;
+	int icount;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct undo_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL);
+
+	if (count > INT_MAX)
+		return EXT2_ET_UNIMPLEMENTED;
+	icount = count;
+
+	/*
+	 * First write the existing content into database
+	 */
+	retval = undo_write_tdb(channel, block, icount);
+	if (retval)
+		return retval;
+	if (data->real)
+		retval = io_channel_discard(data->real, block, count);
+
+	return retval;
+}
+
+static errcode_t undo_zeroout(io_channel channel, unsigned long long block,
+			      unsigned long long count)
+{
+	struct undo_private_data *data;
+	errcode_t	retval = 0;
+	int icount;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct undo_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL);
+
+	if (count > INT_MAX)
+		return EXT2_ET_UNIMPLEMENTED;
+	icount = count;
+
+	/*
+	 * First write the existing content into database
+	 */
+	retval = undo_write_tdb(channel, block, icount);
+	if (retval)
+		return retval;
+	if (data->real)
+		retval = io_channel_zeroout(data->real, block, count);
+
+	return retval;
+}
+
+static errcode_t undo_cache_readahead(io_channel channel,
+				      unsigned long long block,
+				      unsigned long long count)
+{
+	struct undo_private_data *data;
+	errcode_t	retval = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct undo_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL);
+
+	if (data->real)
+		retval = io_channel_cache_readahead(data->real, block, count);
+
+	return retval;
+}
+
+/*
+ * Flush data buffers to disk.
+ */
+static errcode_t undo_flush(io_channel channel)
+{
+	errcode_t	retval = 0;
+	struct undo_private_data *data;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct undo_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL);
+
+	if (data->real)
+		retval = io_channel_flush(data->real);
+
+	return retval;
+}
+
+static errcode_t undo_set_option(io_channel channel, const char *option,
+				 const char *arg)
+{
+	errcode_t	retval = 0;
+	struct undo_private_data *data;
+	unsigned long tmp;
+	char *end;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct undo_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL);
+
+	if (!strcmp(option, "tdb_data_size")) {
+		if (!arg)
+			return EXT2_ET_INVALID_ARGUMENT;
+
+		tmp = strtoul(arg, &end, 0);
+		if (*end)
+			return EXT2_ET_INVALID_ARGUMENT;
+		if (tmp > E2UNDO_MAX_BLOCK_SIZE || tmp < E2UNDO_MIN_BLOCK_SIZE)
+			return EXT2_ET_INVALID_ARGUMENT;
+		if (!data->tdb_data_size || !data->tdb_written) {
+			data->tdb_written = -1;
+			data->tdb_data_size = tmp;
+		}
+		return 0;
+	}
+	/*
+	 * Need to support offset option to work with
+	 * Unix I/O manager
+	 */
+	if (data->real && data->real->manager->set_option) {
+		retval = data->real->manager->set_option(data->real,
+							option, arg);
+	}
+	if (!retval && !strcmp(option, "offset")) {
+		if (!arg)
+			return EXT2_ET_INVALID_ARGUMENT;
+
+		tmp = strtoul(arg, &end, 0);
+		if (*end)
+			return EXT2_ET_INVALID_ARGUMENT;
+		data->offset = tmp;
+	}
+	return retval;
+}
+
+static errcode_t undo_get_stats(io_channel channel, io_stats *stats)
+{
+	errcode_t	retval = 0;
+	struct undo_private_data *data;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct undo_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL);
+
+	if (data->real)
+		retval = (data->real->manager->get_stats)(data->real, stats);
+
+	return retval;
+}
+
+static struct struct_io_manager struct_undo_manager = {
+	.magic		= EXT2_ET_MAGIC_IO_MANAGER,
+	.name		= "Undo I/O Manager",
+	.open		= undo_open,
+	.close		= undo_close,
+	.set_blksize	= undo_set_blksize,
+	.read_blk	= undo_read_blk,
+	.write_blk	= undo_write_blk,
+	.flush		= undo_flush,
+	.write_byte	= undo_write_byte,
+	.set_option	= undo_set_option,
+	.get_stats	= undo_get_stats,
+	.read_blk64	= undo_read_blk64,
+	.write_blk64	= undo_write_blk64,
+	.discard	= undo_discard,
+	.zeroout	= undo_zeroout,
+	.cache_readahead	= undo_cache_readahead,
+};
+
+io_manager undo_io_manager = &struct_undo_manager;
diff --git a/lib/ext2fs/unix_io.c b/lib/ext2fs/unix_io.c
new file mode 100644
index 0000000..3171c73
--- /dev/null
+++ b/lib/ext2fs/unix_io.c
@@ -0,0 +1,1510 @@
+/*
+ * unix_io.c --- This is the Unix (well, really POSIX) implementation
+ *	of the I/O manager.
+ *
+ * Implements a one-block write-through cache.
+ *
+ * Includes support for Windows NT support under Cygwin.
+ *
+ * Copyright (C) 1993, 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001,
+ *	2002 by Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#if !defined(__FreeBSD__) && !defined(__NetBSD__) && !defined(__OpenBSD__)
+#define _XOPEN_SOURCE 600
+#define _DARWIN_C_SOURCE
+#define _FILE_OFFSET_BITS 64
+#ifndef _LARGEFILE_SOURCE
+#define _LARGEFILE_SOURCE
+#endif
+#ifndef _LARGEFILE64_SOURCE
+#define _LARGEFILE64_SOURCE
+#endif
+#ifndef _GNU_SOURCE
+#define _GNU_SOURCE
+#endif
+#endif
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#if HAVE_ERRNO_H
+#include <errno.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#ifdef __linux__
+#include <sys/utsname.h>
+#endif
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+#ifdef HAVE_SYS_IOCTL_H
+#include <sys/ioctl.h>
+#endif
+#ifdef HAVE_SYS_MOUNT_H
+#include <sys/mount.h>
+#endif
+#ifdef HAVE_SYS_PRCTL_H
+#include <sys/prctl.h>
+#else
+#define PR_GET_DUMPABLE 3
+#endif
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#if HAVE_SYS_RESOURCE_H
+#include <sys/resource.h>
+#endif
+#if HAVE_LINUX_FALLOC_H
+#include <linux/falloc.h>
+#endif
+#ifdef HAVE_PTHREAD
+#include <pthread.h>
+#endif
+
+#if defined(__linux__) && defined(_IO) && !defined(BLKROGET)
+#define BLKROGET   _IO(0x12, 94) /* Get read-only status (0 = read_write).  */
+#endif
+
+#undef ALIGN_DEBUG
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+#include "ext2fsP.h"
+
+/*
+ * For checking structure magic numbers...
+ */
+
+#define EXT2_CHECK_MAGIC(struct, code) \
+	  if ((struct)->magic != (code)) return (code)
+
+struct unix_cache {
+	char			*buf;
+	unsigned long long	block;
+	int			access_time;
+	unsigned		dirty:1;
+	unsigned		in_use:1;
+	unsigned		write_err:1;
+};
+
+#define CACHE_SIZE 8
+#define WRITE_DIRECT_SIZE 4	/* Must be smaller than CACHE_SIZE */
+#define READ_DIRECT_SIZE 4	/* Should be smaller than CACHE_SIZE */
+
+struct unix_private_data {
+	int	magic;
+	int	dev;
+	int	flags;
+	int	align;
+	int	access_time;
+	ext2_loff_t offset;
+	struct unix_cache cache[CACHE_SIZE];
+	void	*bounce;
+	struct struct_io_stats io_stats;
+#ifdef HAVE_PTHREAD
+	pthread_mutex_t cache_mutex;
+	pthread_mutex_t bounce_mutex;
+	pthread_mutex_t stats_mutex;
+#endif
+};
+
+#define IS_ALIGNED(n, align) ((((uintptr_t) n) & \
+			       ((uintptr_t) ((align)-1))) == 0)
+
+typedef enum lock_kind {
+	CACHE_MTX, BOUNCE_MTX, STATS_MTX
+} kind_t;
+
+#ifdef HAVE_PTHREAD
+static inline pthread_mutex_t *get_mutex(struct unix_private_data *data,
+					 kind_t kind)
+{
+	if (data->flags & IO_FLAG_THREADS) {
+		switch (kind) {
+		case CACHE_MTX:
+			return &data->cache_mutex;
+		case BOUNCE_MTX:
+			return &data->bounce_mutex;
+		case STATS_MTX:
+			return &data->stats_mutex;
+		}
+	}
+	return NULL;
+}
+#endif
+
+static inline void mutex_lock(struct unix_private_data *data, kind_t kind)
+{
+#ifdef HAVE_PTHREAD
+	pthread_mutex_t *mtx = get_mutex(data,kind);
+
+	if (mtx)
+		pthread_mutex_lock(mtx);
+#endif
+}
+
+static inline void mutex_unlock(struct unix_private_data *data, kind_t kind)
+{
+#ifdef HAVE_PTHREAD
+	pthread_mutex_t *mtx = get_mutex(data,kind);
+
+	if (mtx)
+		pthread_mutex_unlock(mtx);
+#endif
+}
+
+static errcode_t unix_get_stats(io_channel channel, io_stats *stats)
+{
+	errcode_t	retval = 0;
+
+	struct unix_private_data *data;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct unix_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL);
+
+	if (stats) {
+		mutex_lock(data, STATS_MTX);
+		*stats = &data->io_stats;
+		mutex_unlock(data, STATS_MTX);
+	}
+
+	return retval;
+}
+
+static char *safe_getenv(const char *arg)
+{
+	if ((getuid() != geteuid()) || (getgid() != getegid()))
+		return NULL;
+#ifdef HAVE_PRCTL
+	if (prctl(PR_GET_DUMPABLE, 0, 0, 0, 0) == 0)
+		return NULL;
+#else
+#if (defined(linux) && defined(SYS_prctl))
+	if (syscall(SYS_prctl, PR_GET_DUMPABLE, 0, 0, 0, 0) == 0)
+		return NULL;
+#endif
+#endif
+
+#if defined(HAVE_SECURE_GETENV)
+	return secure_getenv(arg);
+#elif defined(HAVE___SECURE_GETENV)
+	return __secure_getenv(arg);
+#else
+	return getenv(arg);
+#endif
+}
+
+/*
+ * Here are the raw I/O functions
+ */
+static errcode_t raw_read_blk(io_channel channel,
+			      struct unix_private_data *data,
+			      unsigned long long block,
+			      int count, void *bufv)
+{
+	errcode_t	retval;
+	ssize_t		size;
+	ext2_loff_t	location;
+	int		actual = 0;
+	unsigned char	*buf = bufv;
+	ssize_t		really_read = 0;
+	unsigned long long aligned_blk;
+	int		align_size, offset;
+
+	size = (count < 0) ? -count : (ext2_loff_t) count * channel->block_size;
+	mutex_lock(data, STATS_MTX);
+	data->io_stats.bytes_read += size;
+	mutex_unlock(data, STATS_MTX);
+	location = ((ext2_loff_t) block * channel->block_size) + data->offset;
+
+	if (data->flags & IO_FLAG_FORCE_BOUNCE)
+		goto bounce_read;
+
+#ifdef HAVE_PREAD64
+	/* Try an aligned pread */
+	if ((channel->align == 0) ||
+	    (IS_ALIGNED(buf, channel->align) &&
+	     IS_ALIGNED(location, channel->align) &&
+	     IS_ALIGNED(size, channel->align))) {
+		actual = pread64(data->dev, buf, size, location);
+		if (actual == size)
+			return 0;
+		actual = 0;
+	}
+#elif HAVE_PREAD
+	/* Try an aligned pread */
+	if ((sizeof(off_t) >= sizeof(ext2_loff_t)) &&
+	    ((channel->align == 0) ||
+	     (IS_ALIGNED(buf, channel->align) &&
+	      IS_ALIGNED(location, channel->align) &&
+	      IS_ALIGNED(size, channel->align)))) {
+		actual = pread(data->dev, buf, size, location);
+		if (actual == size)
+			return 0;
+		actual = 0;
+	}
+#endif /* HAVE_PREAD */
+
+	if ((channel->align == 0) ||
+	    (IS_ALIGNED(buf, channel->align) &&
+	     IS_ALIGNED(location, channel->align) &&
+	     IS_ALIGNED(size, channel->align))) {
+		mutex_lock(data, BOUNCE_MTX);
+		if (ext2fs_llseek(data->dev, location, SEEK_SET) < 0) {
+			retval = errno ? errno : EXT2_ET_LLSEEK_FAILED;
+			goto error_unlock;
+		}
+		actual = read(data->dev, buf, size);
+		if (actual != size) {
+		short_read:
+			if (actual < 0) {
+				retval = errno;
+				actual = 0;
+			} else
+				retval = EXT2_ET_SHORT_READ;
+			goto error_unlock;
+		}
+		goto success_unlock;
+	}
+
+#ifdef ALIGN_DEBUG
+	printf("raw_read_blk: O_DIRECT fallback: %p %lu\n", buf,
+	       (unsigned long) size);
+#endif
+
+	/*
+	 * The buffer or size which we're trying to read isn't aligned
+	 * to the O_DIRECT rules, so we need to do this the hard way...
+	 */
+bounce_read:
+	if (channel->align == 0)
+		channel->align = 1;
+	if ((channel->block_size > channel->align) &&
+	    (channel->block_size % channel->align) == 0)
+		align_size = channel->block_size;
+	else
+		align_size = channel->align;
+	aligned_blk = location / align_size;
+	offset = location % align_size;
+
+	mutex_lock(data, BOUNCE_MTX);
+	if (ext2fs_llseek(data->dev, aligned_blk * align_size, SEEK_SET) < 0) {
+		retval = errno ? errno : EXT2_ET_LLSEEK_FAILED;
+		goto error_unlock;
+	}
+	while (size > 0) {
+		actual = read(data->dev, data->bounce, align_size);
+		if (actual != align_size) {
+			actual = really_read;
+			buf -= really_read;
+			size += really_read;
+			goto short_read;
+		}
+		if ((actual + offset) > align_size)
+			actual = align_size - offset;
+		if (actual > size)
+			actual = size;
+		memcpy(buf, (char *)data->bounce + offset, actual);
+
+		really_read += actual;
+		size -= actual;
+		buf += actual;
+		offset = 0;
+		aligned_blk++;
+	}
+success_unlock:
+	mutex_unlock(data, BOUNCE_MTX);
+	return 0;
+
+error_unlock:
+	mutex_unlock(data, BOUNCE_MTX);
+	if (actual >= 0 && actual < size)
+		memset((char *) buf+actual, 0, size-actual);
+	if (channel->read_error)
+		retval = (channel->read_error)(channel, block, count, buf,
+					       size, actual, retval);
+	return retval;
+}
+
+#define RAW_WRITE_NO_HANDLER	1
+
+static errcode_t raw_write_blk(io_channel channel,
+			       struct unix_private_data *data,
+			       unsigned long long block,
+			       int count, const void *bufv,
+			       int flags)
+{
+	ssize_t		size;
+	ext2_loff_t	location;
+	int		actual = 0;
+	errcode_t	retval;
+	const unsigned char *buf = bufv;
+	unsigned long long aligned_blk;
+	int		align_size, offset;
+
+	if (count == 1)
+		size = channel->block_size;
+	else {
+		if (count < 0)
+			size = -count;
+		else
+			size = (ext2_loff_t) count * channel->block_size;
+	}
+	mutex_lock(data, STATS_MTX);
+	data->io_stats.bytes_written += size;
+	mutex_unlock(data, STATS_MTX);
+
+	location = ((ext2_loff_t) block * channel->block_size) + data->offset;
+
+	if (data->flags & IO_FLAG_FORCE_BOUNCE)
+		goto bounce_write;
+
+#ifdef HAVE_PWRITE64
+	/* Try an aligned pwrite */
+	if ((channel->align == 0) ||
+	    (IS_ALIGNED(buf, channel->align) &&
+	     IS_ALIGNED(location, channel->align) &&
+	     IS_ALIGNED(size, channel->align))) {
+		actual = pwrite64(data->dev, buf, size, location);
+		if (actual == size)
+			return 0;
+	}
+#elif HAVE_PWRITE
+	/* Try an aligned pwrite */
+	if ((sizeof(off_t) >= sizeof(ext2_loff_t)) &&
+	    ((channel->align == 0) ||
+	     (IS_ALIGNED(buf, channel->align) &&
+	      IS_ALIGNED(location, channel->align) &&
+	      IS_ALIGNED(size, channel->align)))) {
+		actual = pwrite(data->dev, buf, size, location);
+		if (actual == size)
+			return 0;
+	}
+#endif /* HAVE_PWRITE */
+
+	if ((channel->align == 0) ||
+	    (IS_ALIGNED(buf, channel->align) &&
+	     IS_ALIGNED(location, channel->align) &&
+	     IS_ALIGNED(size, channel->align))) {
+		mutex_lock(data, BOUNCE_MTX);
+		if (ext2fs_llseek(data->dev, location, SEEK_SET) < 0) {
+			retval = errno ? errno : EXT2_ET_LLSEEK_FAILED;
+			goto error_unlock;
+		}
+		actual = write(data->dev, buf, size);
+		mutex_unlock(data, BOUNCE_MTX);
+		if (actual < 0) {
+			retval = errno;
+			goto error_out;
+		}
+		if (actual != size) {
+		short_write:
+			retval = EXT2_ET_SHORT_WRITE;
+			goto error_out;
+		}
+		return 0;
+	}
+
+#ifdef ALIGN_DEBUG
+	printf("raw_write_blk: O_DIRECT fallback: %p %lu\n", buf,
+	       (unsigned long) size);
+#endif
+	/*
+	 * The buffer or size which we're trying to write isn't aligned
+	 * to the O_DIRECT rules, so we need to do this the hard way...
+	 */
+bounce_write:
+	if (channel->align == 0)
+		channel->align = 1;
+	if ((channel->block_size > channel->align) &&
+	    (channel->block_size % channel->align) == 0)
+		align_size = channel->block_size;
+	else
+		align_size = channel->align;
+	aligned_blk = location / align_size;
+	offset = location % align_size;
+
+	while (size > 0) {
+		int actual_w;
+
+		mutex_lock(data, BOUNCE_MTX);
+		if (size < align_size || offset) {
+			if (ext2fs_llseek(data->dev, aligned_blk * align_size,
+					  SEEK_SET) < 0) {
+				retval = errno ? errno : EXT2_ET_LLSEEK_FAILED;
+				goto error_unlock;
+			}
+			actual = read(data->dev, data->bounce,
+				      align_size);
+			if (actual != align_size) {
+				if (actual < 0) {
+					retval = errno;
+					goto error_unlock;
+				}
+				memset((char *) data->bounce + actual, 0,
+				       align_size - actual);
+			}
+		}
+		actual = size;
+		if ((actual + offset) > align_size)
+			actual = align_size - offset;
+		if (actual > size)
+			actual = size;
+		memcpy(((char *)data->bounce) + offset, buf, actual);
+		if (ext2fs_llseek(data->dev, aligned_blk * align_size, SEEK_SET) < 0) {
+			retval = errno ? errno : EXT2_ET_LLSEEK_FAILED;
+			goto error_unlock;
+		}
+		actual_w = write(data->dev, data->bounce, align_size);
+		mutex_unlock(data, BOUNCE_MTX);
+		if (actual_w < 0) {
+			retval = errno;
+			goto error_out;
+		}
+		if (actual_w != align_size)
+			goto short_write;
+		size -= actual;
+		buf += actual;
+		location += actual;
+		aligned_blk++;
+		offset = 0;
+	}
+	return 0;
+
+error_unlock:
+	mutex_unlock(data, BOUNCE_MTX);
+error_out:
+	if (((flags & RAW_WRITE_NO_HANDLER) == 0) && channel->write_error)
+		retval = (channel->write_error)(channel, block, count, buf,
+						size, actual, retval);
+	return retval;
+}
+
+
+/*
+ * Here we implement the cache functions
+ */
+
+/* Allocate the cache buffers */
+static errcode_t alloc_cache(io_channel channel,
+			     struct unix_private_data *data)
+{
+	errcode_t		retval;
+	struct unix_cache	*cache;
+	int			i;
+
+	data->access_time = 0;
+	for (i=0, cache = data->cache; i < CACHE_SIZE; i++, cache++) {
+		cache->block = 0;
+		cache->access_time = 0;
+		cache->dirty = 0;
+		cache->in_use = 0;
+		if (cache->buf)
+			ext2fs_free_mem(&cache->buf);
+		retval = io_channel_alloc_buf(channel, 0, &cache->buf);
+		if (retval)
+			return retval;
+	}
+	if (channel->align || data->flags & IO_FLAG_FORCE_BOUNCE) {
+		if (data->bounce)
+			ext2fs_free_mem(&data->bounce);
+		retval = io_channel_alloc_buf(channel, 0, &data->bounce);
+	}
+	return retval;
+}
+
+/* Free the cache buffers */
+static void free_cache(struct unix_private_data *data)
+{
+	struct unix_cache	*cache;
+	int			i;
+
+	data->access_time = 0;
+	for (i=0, cache = data->cache; i < CACHE_SIZE; i++, cache++) {
+		cache->block = 0;
+		cache->access_time = 0;
+		cache->dirty = 0;
+		cache->in_use = 0;
+		if (cache->buf)
+			ext2fs_free_mem(&cache->buf);
+	}
+	if (data->bounce)
+		ext2fs_free_mem(&data->bounce);
+}
+
+#ifndef NO_IO_CACHE
+/*
+ * Try to find a block in the cache.  If the block is not found, and
+ * eldest is a non-zero pointer, then fill in eldest with the cache
+ * entry to that should be reused.
+ */
+static struct unix_cache *find_cached_block(struct unix_private_data *data,
+					    unsigned long long block,
+					    struct unix_cache **eldest)
+{
+	struct unix_cache	*cache, *unused_cache, *oldest_cache;
+	int			i;
+
+	unused_cache = oldest_cache = 0;
+	for (i=0, cache = data->cache; i < CACHE_SIZE; i++, cache++) {
+		if (!cache->in_use) {
+			if (!unused_cache)
+				unused_cache = cache;
+			continue;
+		}
+		if (cache->block == block) {
+			cache->access_time = ++data->access_time;
+			return cache;
+		}
+		if (!oldest_cache ||
+		    (cache->access_time < oldest_cache->access_time))
+			oldest_cache = cache;
+	}
+	if (eldest)
+		*eldest = (unused_cache) ? unused_cache : oldest_cache;
+	return 0;
+}
+
+/*
+ * Reuse a particular cache entry for another block.
+ */
+static errcode_t reuse_cache(io_channel channel,
+		struct unix_private_data *data, struct unix_cache *cache,
+		unsigned long long block)
+{
+	if (cache->dirty && cache->in_use) {
+		errcode_t retval;
+
+		retval = raw_write_blk(channel, data, cache->block, 1,
+				       cache->buf, RAW_WRITE_NO_HANDLER);
+		if (retval) {
+			cache->write_err = 1;
+			return retval;
+		}
+	}
+
+	cache->in_use = 1;
+	cache->dirty = 0;
+	cache->write_err = 0;
+	cache->block = block;
+	cache->access_time = ++data->access_time;
+	return 0;
+}
+
+#define FLUSH_INVALIDATE	0x01
+#define FLUSH_NOLOCK		0x02
+
+/*
+ * Flush all of the blocks in the cache
+ */
+static errcode_t flush_cached_blocks(io_channel channel,
+				     struct unix_private_data *data,
+				     int flags)
+{
+	struct unix_cache	*cache;
+	errcode_t		retval, retval2 = 0;
+	int			i;
+	int			errors_found = 0;
+
+	if ((flags & FLUSH_NOLOCK) == 0)
+		mutex_lock(data, CACHE_MTX);
+	for (i=0, cache = data->cache; i < CACHE_SIZE; i++, cache++) {
+		if (!cache->in_use || !cache->dirty)
+			continue;
+		retval = raw_write_blk(channel, data,
+				       cache->block, 1, cache->buf,
+				       RAW_WRITE_NO_HANDLER);
+		if (retval) {
+			cache->write_err = 1;
+			errors_found = 1;
+			retval2 = retval;
+		} else {
+			cache->dirty = 0;
+			cache->write_err = 0;
+			if (flags & FLUSH_INVALIDATE)
+				cache->in_use = 0;
+		}
+	}
+	if ((flags & FLUSH_NOLOCK) == 0)
+		mutex_unlock(data, CACHE_MTX);
+retry:
+	while (errors_found) {
+		if ((flags & FLUSH_NOLOCK) == 0)
+			mutex_lock(data, CACHE_MTX);
+		errors_found = 0;
+		for (i=0, cache = data->cache; i < CACHE_SIZE; i++, cache++) {
+			if (!cache->in_use || !cache->write_err)
+				continue;
+			errors_found = 1;
+			if (cache->write_err && channel->write_error) {
+				char *err_buf = NULL;
+				unsigned long long err_block = cache->block;
+
+				cache->dirty = 0;
+				cache->in_use = 0;
+				cache->write_err = 0;
+				if (io_channel_alloc_buf(channel, 0,
+							 &err_buf))
+					err_buf = NULL;
+				else
+					memcpy(err_buf, cache->buf,
+					       channel->block_size);
+				mutex_unlock(data, CACHE_MTX);
+				(channel->write_error)(channel, err_block,
+					1, err_buf, channel->block_size, -1,
+					retval2);
+				if (err_buf)
+					ext2fs_free_mem(&err_buf);
+				goto retry;
+			} else
+				cache->write_err = 0;
+		}
+		if ((flags & FLUSH_NOLOCK) == 0)
+			mutex_unlock(data, CACHE_MTX);
+	}
+	return retval2;
+}
+#endif /* NO_IO_CACHE */
+
+#ifdef __linux__
+#ifndef BLKDISCARDZEROES
+#define BLKDISCARDZEROES _IO(0x12,124)
+#endif
+#endif
+
+int ext2fs_open_file(const char *pathname, int flags, mode_t mode)
+{
+	if (mode)
+#if defined(HAVE_OPEN64) && !defined(__OSX_AVAILABLE_BUT_DEPRECATED)
+		return open64(pathname, flags, mode);
+	else
+		return open64(pathname, flags);
+#else
+		return open(pathname, flags, mode);
+	else
+		return open(pathname, flags);
+#endif
+}
+
+int ext2fs_stat(const char *path, ext2fs_struct_stat *buf)
+{
+#if defined(HAVE_FSTAT64) && !defined(__OSX_AVAILABLE_BUT_DEPRECATED)
+	return stat64(path, buf);
+#else
+	return stat(path, buf);
+#endif
+}
+
+int ext2fs_fstat(int fd, ext2fs_struct_stat *buf)
+{
+#if defined(HAVE_FSTAT64) && !defined(__OSX_AVAILABLE_BUT_DEPRECATED)
+	return fstat64(fd, buf);
+#else
+	return fstat(fd, buf);
+#endif
+}
+
+
+static errcode_t unix_open_channel(const char *name, int fd,
+				   int flags, io_channel *channel,
+				   io_manager io_mgr)
+{
+	io_channel	io = NULL;
+	struct unix_private_data *data = NULL;
+	errcode_t	retval;
+	ext2fs_struct_stat st;
+#ifdef __linux__
+	struct		utsname ut;
+#endif
+
+	if (safe_getenv("UNIX_IO_FORCE_BOUNCE"))
+		flags |= IO_FLAG_FORCE_BOUNCE;
+
+#ifdef __linux__
+	/*
+	 * We need to make sure any previous errors in the block
+	 * device are thrown away, sigh.
+	 */
+	(void) fsync(fd);
+#endif
+
+	retval = ext2fs_get_mem(sizeof(struct struct_io_channel), &io);
+	if (retval)
+		goto cleanup;
+	memset(io, 0, sizeof(struct struct_io_channel));
+	io->magic = EXT2_ET_MAGIC_IO_CHANNEL;
+	retval = ext2fs_get_mem(sizeof(struct unix_private_data), &data);
+	if (retval)
+		goto cleanup;
+
+	io->manager = io_mgr;
+	retval = ext2fs_get_mem(strlen(name)+1, &io->name);
+	if (retval)
+		goto cleanup;
+
+	strcpy(io->name, name);
+	io->private_data = data;
+	io->block_size = 1024;
+	io->read_error = 0;
+	io->write_error = 0;
+	io->refcount = 1;
+	io->flags = 0;
+
+	memset(data, 0, sizeof(struct unix_private_data));
+	data->magic = EXT2_ET_MAGIC_UNIX_IO_CHANNEL;
+	data->io_stats.num_fields = 2;
+	data->flags = flags;
+	data->dev = fd;
+
+#if defined(O_DIRECT)
+	if (flags & IO_FLAG_DIRECT_IO)
+		io->align = ext2fs_get_dio_alignment(data->dev);
+#elif defined(F_NOCACHE)
+	if (flags & IO_FLAG_DIRECT_IO)
+		io->align = 4096;
+#endif
+
+	/*
+	 * If the device is really a block device, then set the
+	 * appropriate flag, otherwise we can set DISCARD_ZEROES flag
+	 * because we are going to use punch hole instead of discard
+	 * and if it succeed, subsequent read from sparse area returns
+	 * zero.
+	 */
+	if (ext2fs_fstat(data->dev, &st) == 0) {
+		if (ext2fsP_is_disk_device(st.st_mode))
+			io->flags |= CHANNEL_FLAGS_BLOCK_DEVICE;
+		else
+			io->flags |= CHANNEL_FLAGS_DISCARD_ZEROES;
+	}
+
+#ifdef BLKDISCARDZEROES
+	{
+		int zeroes = 0;
+		if (ioctl(data->dev, BLKDISCARDZEROES, &zeroes) == 0 &&
+		    zeroes)
+			io->flags |= CHANNEL_FLAGS_DISCARD_ZEROES;
+	}
+#endif
+
+#if defined(__CYGWIN__)
+	/*
+	 * Some operating systems require that the buffers be aligned,
+	 * regardless of O_DIRECT
+	 */
+	if (!io->align)
+		io->align = 512;
+#endif
+
+#if defined(__FreeBSD__) || defined(__FreeBSD_kernel__)
+	if (io->flags & CHANNEL_FLAGS_BLOCK_DEVICE) {
+		int dio_align = ext2fs_get_dio_alignment(fd);
+
+		if (io->align < dio_align)
+			io->align = dio_align;
+	}
+#endif
+
+	if ((retval = alloc_cache(io, data)))
+		goto cleanup;
+
+#ifdef BLKROGET
+	if (flags & IO_FLAG_RW) {
+		int error;
+		int readonly = 0;
+
+		/* Is the block device actually writable? */
+		error = ioctl(data->dev, BLKROGET, &readonly);
+		if (!error && readonly) {
+			retval = EPERM;
+			goto cleanup;
+		}
+	}
+#endif
+
+#ifdef __linux__
+#undef RLIM_INFINITY
+#if (defined(__alpha__) || ((defined(__sparc__) || defined(__mips__)) && (SIZEOF_LONG == 4)))
+#define RLIM_INFINITY	((unsigned long)(~0UL>>1))
+#else
+#define RLIM_INFINITY  (~0UL)
+#endif
+	/*
+	 * Work around a bug in 2.4.10-2.4.18 kernels where writes to
+	 * block devices are wrongly getting hit by the filesize
+	 * limit.  This workaround isn't perfect, since it won't work
+	 * if glibc wasn't built against 2.2 header files.  (Sigh.)
+	 *
+	 */
+	if ((flags & IO_FLAG_RW) &&
+	    (uname(&ut) == 0) &&
+	    ((ut.release[0] == '2') && (ut.release[1] == '.') &&
+	     (ut.release[2] == '4') && (ut.release[3] == '.') &&
+	     (ut.release[4] == '1') && (ut.release[5] >= '0') &&
+	     (ut.release[5] < '8')) &&
+	    (ext2fs_fstat(data->dev, &st) == 0) &&
+	    (ext2fsP_is_disk_device(st.st_mode))) {
+		struct rlimit	rlim;
+
+		rlim.rlim_cur = rlim.rlim_max = (unsigned long) RLIM_INFINITY;
+		setrlimit(RLIMIT_FSIZE, &rlim);
+		getrlimit(RLIMIT_FSIZE, &rlim);
+		if (((unsigned long) rlim.rlim_cur) <
+		    ((unsigned long) rlim.rlim_max)) {
+			rlim.rlim_cur = rlim.rlim_max;
+			setrlimit(RLIMIT_FSIZE, &rlim);
+		}
+	}
+#endif
+#ifdef HAVE_PTHREAD
+	if (flags & IO_FLAG_THREADS) {
+		io->flags |= CHANNEL_FLAGS_THREADS;
+		retval = pthread_mutex_init(&data->cache_mutex, NULL);
+		if (retval)
+			goto cleanup;
+		retval = pthread_mutex_init(&data->bounce_mutex, NULL);
+		if (retval) {
+			pthread_mutex_destroy(&data->cache_mutex);
+			goto cleanup;
+		}
+		retval = pthread_mutex_init(&data->stats_mutex, NULL);
+		if (retval) {
+			pthread_mutex_destroy(&data->cache_mutex);
+			pthread_mutex_destroy(&data->bounce_mutex);
+			goto cleanup;
+		}
+	}
+#endif
+	*channel = io;
+	return 0;
+
+cleanup:
+	if (data) {
+		if (data->dev >= 0)
+			close(data->dev);
+		free_cache(data);
+		ext2fs_free_mem(&data);
+	}
+	if (io) {
+		if (io->name) {
+			ext2fs_free_mem(&io->name);
+		}
+		ext2fs_free_mem(&io);
+	}
+	return retval;
+}
+
+static errcode_t unixfd_open(const char *str_fd, int flags,
+			     io_channel *channel)
+{
+	int fd;
+	int fd_flags;
+
+	fd = atoi(str_fd);
+#if defined(HAVE_FCNTL)
+	fd_flags = fcntl(fd, F_GETFD);
+	if (fd_flags == -1)
+		return EBADF;
+
+	flags = 0;
+	if (fd_flags & O_RDWR)
+		flags |= IO_FLAG_RW;
+	if (fd_flags & O_EXCL)
+		flags |= IO_FLAG_EXCLUSIVE;
+#if defined(O_DIRECT)
+	if (fd_flags & O_DIRECT)
+		flags |= IO_FLAG_DIRECT_IO;
+#endif
+#endif  /* HAVE_FCNTL */
+
+	return unix_open_channel(str_fd, fd, flags, channel, unixfd_io_manager);
+}
+
+static errcode_t unix_open(const char *name, int flags,
+			   io_channel *channel)
+{
+	int fd = -1;
+	int open_flags;
+
+	if (name == 0)
+		return EXT2_ET_BAD_DEVICE_NAME;
+
+	open_flags = (flags & IO_FLAG_RW) ? O_RDWR : O_RDONLY;
+	if (flags & IO_FLAG_EXCLUSIVE)
+		open_flags |= O_EXCL;
+#if defined(O_DIRECT)
+	if (flags & IO_FLAG_DIRECT_IO)
+		open_flags |= O_DIRECT;
+#endif
+	fd = ext2fs_open_file(name, open_flags, 0);
+	if (fd < 0)
+		return errno;
+#if defined(F_NOCACHE) && !defined(IO_DIRECT)
+	if (flags & IO_FLAG_DIRECT_IO) {
+		if (fcntl(fd, F_NOCACHE, 1) < 0)
+			return errno;
+	}
+#endif
+	return unix_open_channel(name, fd, flags, channel, unix_io_manager);
+}
+
+static errcode_t unix_close(io_channel channel)
+{
+	struct unix_private_data *data;
+	errcode_t	retval = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct unix_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL);
+
+	if (--channel->refcount > 0)
+		return 0;
+
+#ifndef NO_IO_CACHE
+	retval = flush_cached_blocks(channel, data, 0);
+#endif
+
+	if (close(data->dev) < 0)
+		retval = errno;
+	free_cache(data);
+#ifdef HAVE_PTHREAD
+	if (data->flags & IO_FLAG_THREADS) {
+		pthread_mutex_destroy(&data->cache_mutex);
+		pthread_mutex_destroy(&data->bounce_mutex);
+		pthread_mutex_destroy(&data->stats_mutex);
+	}
+#endif
+
+	ext2fs_free_mem(&channel->private_data);
+	if (channel->name)
+		ext2fs_free_mem(&channel->name);
+	ext2fs_free_mem(&channel);
+	return retval;
+}
+
+static errcode_t unix_set_blksize(io_channel channel, int blksize)
+{
+	struct unix_private_data *data;
+	errcode_t		retval = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct unix_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL);
+
+	if (channel->block_size != blksize) {
+		mutex_lock(data, CACHE_MTX);
+		mutex_lock(data, BOUNCE_MTX);
+#ifndef NO_IO_CACHE
+		if ((retval = flush_cached_blocks(channel, data, FLUSH_NOLOCK))){
+			mutex_unlock(data, BOUNCE_MTX);
+			mutex_unlock(data, CACHE_MTX);
+			return retval;
+		}
+#endif
+
+		channel->block_size = blksize;
+		free_cache(data);
+		retval = alloc_cache(channel, data);
+		mutex_unlock(data, BOUNCE_MTX);
+		mutex_unlock(data, CACHE_MTX);
+	}
+	return retval;
+}
+
+static errcode_t unix_read_blk64(io_channel channel, unsigned long long block,
+			       int count, void *buf)
+{
+	struct unix_private_data *data;
+	struct unix_cache *cache;
+	errcode_t	retval;
+	char		*cp;
+	int		i, j;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct unix_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL);
+
+#ifdef NO_IO_CACHE
+	return raw_read_blk(channel, data, block, count, buf);
+#else
+	if (data->flags & IO_FLAG_NOCACHE)
+		return raw_read_blk(channel, data, block, count, buf);
+	/*
+	 * If we're doing an odd-sized read or a very large read,
+	 * flush out the cache and then do a direct read.
+	 */
+	if (count < 0 || count > WRITE_DIRECT_SIZE) {
+		if ((retval = flush_cached_blocks(channel, data, 0)))
+			return retval;
+		return raw_read_blk(channel, data, block, count, buf);
+	}
+
+	cp = buf;
+	mutex_lock(data, CACHE_MTX);
+	while (count > 0) {
+		/* If it's in the cache, use it! */
+		if ((cache = find_cached_block(data, block, NULL))) {
+#ifdef DEBUG
+			printf("Using cached block %lu\n", block);
+#endif
+			memcpy(cp, cache->buf, channel->block_size);
+			count--;
+			block++;
+			cp += channel->block_size;
+			continue;
+		}
+
+		/*
+		 * Find the number of uncached blocks so we can do a
+		 * single read request
+		 */
+		for (i=1; i < count; i++)
+			if (find_cached_block(data, block+i, NULL))
+				break;
+#ifdef DEBUG
+		printf("Reading %d blocks starting at %lu\n", i, block);
+#endif
+		mutex_unlock(data, CACHE_MTX);
+		if ((retval = raw_read_blk(channel, data, block, i, cp)))
+			return retval;
+		mutex_lock(data, CACHE_MTX);
+
+		/* Save the results in the cache */
+		for (j=0; j < i; j++) {
+			if (!find_cached_block(data, block, &cache)) {
+				retval = reuse_cache(channel, data,
+						     cache, block);
+				if (retval)
+					goto call_write_handler;
+				memcpy(cache->buf, cp, channel->block_size);
+			}
+			count--;
+			block++;
+			cp += channel->block_size;
+		}
+	}
+	mutex_unlock(data, CACHE_MTX);
+	return 0;
+
+call_write_handler:
+	if (cache->write_err && channel->write_error) {
+		char *err_buf = NULL;
+		unsigned long long err_block = cache->block;
+
+		cache->dirty = 0;
+		cache->in_use = 0;
+		cache->write_err = 0;
+		if (io_channel_alloc_buf(channel, 0, &err_buf))
+			err_buf = NULL;
+		else
+			memcpy(err_buf, cache->buf, channel->block_size);
+		mutex_unlock(data, CACHE_MTX);
+		(channel->write_error)(channel, err_block, 1, err_buf,
+				       channel->block_size, -1,
+				       retval);
+		if (err_buf)
+			ext2fs_free_mem(&err_buf);
+	} else
+		mutex_unlock(data, CACHE_MTX);
+	return retval;
+#endif /* NO_IO_CACHE */
+}
+
+static errcode_t unix_read_blk(io_channel channel, unsigned long block,
+			       int count, void *buf)
+{
+	return unix_read_blk64(channel, block, count, buf);
+}
+
+static errcode_t unix_write_blk64(io_channel channel, unsigned long long block,
+				int count, const void *buf)
+{
+	struct unix_private_data *data;
+	struct unix_cache *cache, *reuse;
+	errcode_t	retval = 0;
+	const char	*cp;
+	int		writethrough;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct unix_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL);
+
+#ifdef NO_IO_CACHE
+	return raw_write_blk(channel, data, block, count, buf, 0);
+#else
+	if (data->flags & IO_FLAG_NOCACHE)
+		return raw_write_blk(channel, data, block, count, buf, 0);
+	/*
+	 * If we're doing an odd-sized write or a very large write,
+	 * flush out the cache completely and then do a direct write.
+	 */
+	if (count < 0 || count > WRITE_DIRECT_SIZE) {
+		if ((retval = flush_cached_blocks(channel, data,
+						  FLUSH_INVALIDATE)))
+			return retval;
+		return raw_write_blk(channel, data, block, count, buf, 0);
+	}
+
+	/*
+	 * For a moderate-sized multi-block write, first force a write
+	 * if we're in write-through cache mode, and then fill the
+	 * cache with the blocks.
+	 */
+	writethrough = channel->flags & CHANNEL_FLAGS_WRITETHROUGH;
+	if (writethrough)
+		retval = raw_write_blk(channel, data, block, count, buf, 0);
+
+	cp = buf;
+	mutex_lock(data, CACHE_MTX);
+	while (count > 0) {
+		cache = find_cached_block(data, block, &reuse);
+		if (!cache) {
+			errcode_t err;
+
+			cache = reuse;
+			err = reuse_cache(channel, data, cache, block);
+			if (err)
+				goto call_write_handler;
+		}
+		if (cache->buf != cp)
+			memcpy(cache->buf, cp, channel->block_size);
+		cache->dirty = !writethrough;
+		count--;
+		block++;
+		cp += channel->block_size;
+	}
+	mutex_unlock(data, CACHE_MTX);
+	return retval;
+
+call_write_handler:
+	if (cache->write_err && channel->write_error) {
+		char *err_buf = NULL;
+		unsigned long long err_block = cache->block;
+
+		cache->dirty = 0;
+		cache->in_use = 0;
+		cache->write_err = 0;
+		if (io_channel_alloc_buf(channel, 0, &err_buf))
+			err_buf = NULL;
+		else
+			memcpy(err_buf, cache->buf, channel->block_size);
+		mutex_unlock(data, CACHE_MTX);
+		(channel->write_error)(channel, err_block, 1, err_buf,
+				       channel->block_size, -1,
+				       retval);
+		if (err_buf)
+			ext2fs_free_mem(&err_buf);
+	} else
+		mutex_unlock(data, CACHE_MTX);
+	return retval;
+#endif /* NO_IO_CACHE */
+}
+
+static errcode_t unix_cache_readahead(io_channel channel,
+				      unsigned long long block,
+				      unsigned long long count)
+{
+#ifdef POSIX_FADV_WILLNEED
+	struct unix_private_data *data;
+
+	data = (struct unix_private_data *)channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL);
+	return posix_fadvise(data->dev,
+			     (ext2_loff_t)block * channel->block_size + data->offset,
+			     (ext2_loff_t)count * channel->block_size,
+			     POSIX_FADV_WILLNEED);
+#else
+	return EXT2_ET_OP_NOT_SUPPORTED;
+#endif
+}
+
+static errcode_t unix_write_blk(io_channel channel, unsigned long block,
+				int count, const void *buf)
+{
+	return unix_write_blk64(channel, block, count, buf);
+}
+
+static errcode_t unix_write_byte(io_channel channel, unsigned long offset,
+				 int size, const void *buf)
+{
+	struct unix_private_data *data;
+	errcode_t	retval = 0;
+	ssize_t		actual;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct unix_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL);
+
+	if (channel->align != 0) {
+#ifdef ALIGN_DEBUG
+		printf("unix_write_byte: O_DIRECT fallback\n");
+#endif
+		return EXT2_ET_UNIMPLEMENTED;
+	}
+
+#ifndef NO_IO_CACHE
+	/*
+	 * Flush out the cache completely
+	 */
+	if ((retval = flush_cached_blocks(channel, data, FLUSH_INVALIDATE)))
+		return retval;
+#endif
+
+	if (lseek(data->dev, offset + data->offset, SEEK_SET) < 0)
+		return errno;
+
+	actual = write(data->dev, buf, size);
+	if (actual < 0)
+		return errno;
+	if (actual != size)
+		return EXT2_ET_SHORT_WRITE;
+
+	return 0;
+}
+
+/*
+ * Flush data buffers to disk.
+ */
+static errcode_t unix_flush(io_channel channel)
+{
+	struct unix_private_data *data;
+	errcode_t retval = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct unix_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL);
+
+#ifndef NO_IO_CACHE
+	retval = flush_cached_blocks(channel, data, 0);
+#endif
+#ifdef HAVE_FSYNC
+	if (!retval && fsync(data->dev) != 0)
+		return errno;
+#endif
+	return retval;
+}
+
+static errcode_t unix_set_option(io_channel channel, const char *option,
+				 const char *arg)
+{
+	struct unix_private_data *data;
+	unsigned long long tmp;
+	errcode_t retval;
+	char *end;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct unix_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL);
+
+	if (!strcmp(option, "offset")) {
+		if (!arg)
+			return EXT2_ET_INVALID_ARGUMENT;
+
+		tmp = strtoull(arg, &end, 0);
+		if (*end)
+			return EXT2_ET_INVALID_ARGUMENT;
+		data->offset = tmp;
+		if (data->offset < 0)
+			return EXT2_ET_INVALID_ARGUMENT;
+		return 0;
+	}
+	if (!strcmp(option, "cache")) {
+		if (!arg)
+			return EXT2_ET_INVALID_ARGUMENT;
+		if (!strcmp(arg, "on")) {
+			data->flags &= ~IO_FLAG_NOCACHE;
+			return 0;
+		}
+		if (!strcmp(arg, "off")) {
+			retval = flush_cached_blocks(channel, data, 0);
+			data->flags |= IO_FLAG_NOCACHE;
+			return retval;
+		}
+		return EXT2_ET_INVALID_ARGUMENT;
+	}
+	return EXT2_ET_INVALID_ARGUMENT;
+}
+
+#if defined(__linux__) && !defined(BLKDISCARD)
+#define BLKDISCARD		_IO(0x12,119)
+#endif
+
+static errcode_t unix_discard(io_channel channel, unsigned long long block,
+			      unsigned long long count)
+{
+	struct unix_private_data *data;
+	int		ret;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct unix_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL);
+
+	if (channel->flags & CHANNEL_FLAGS_BLOCK_DEVICE) {
+#ifdef BLKDISCARD
+		__u64 range[2];
+
+		range[0] = (__u64)(block) * channel->block_size + data->offset;
+		range[1] = (__u64)(count) * channel->block_size;
+
+		ret = ioctl(data->dev, BLKDISCARD, &range);
+#else
+		goto unimplemented;
+#endif
+	} else {
+#if defined(HAVE_FALLOCATE) && defined(FALLOC_FL_PUNCH_HOLE)
+		/*
+		 * If we are not on block device, try to use punch hole
+		 * to reclaim free space.
+		 */
+		ret = fallocate(data->dev,
+				FALLOC_FL_PUNCH_HOLE | FALLOC_FL_KEEP_SIZE,
+				(off_t)(block) * channel->block_size + data->offset,
+				(off_t)(count) * channel->block_size);
+#else
+		goto unimplemented;
+#endif
+	}
+	if (ret < 0) {
+		if (errno == EOPNOTSUPP)
+			goto unimplemented;
+		return errno;
+	}
+	return 0;
+unimplemented:
+	return EXT2_ET_UNIMPLEMENTED;
+}
+
+/*
+ * If we know about ZERO_RANGE, try that before we try PUNCH_HOLE because
+ * ZERO_RANGE doesn't unmap preallocated blocks.  We prefer fallocate because
+ * it always invalidates page cache, and libext2fs requires that reads after
+ * ZERO_RANGE return zeroes.
+ */
+static int __unix_zeroout(int fd, off_t offset, off_t len)
+{
+	int ret = -1;
+
+#if defined(HAVE_FALLOCATE) && defined(FALLOC_FL_ZERO_RANGE)
+	ret = fallocate(fd, FALLOC_FL_ZERO_RANGE, offset, len);
+	if (ret == 0)
+		return 0;
+#endif
+#if defined(HAVE_FALLOCATE) && defined(FALLOC_FL_PUNCH_HOLE) && defined(FALLOC_FL_KEEP_SIZE)
+	ret = fallocate(fd, FALLOC_FL_PUNCH_HOLE | FALLOC_FL_KEEP_SIZE,
+			offset,  len);
+	if (ret == 0)
+		return 0;
+#endif
+	errno = EOPNOTSUPP;
+	return ret;
+}
+
+/* parameters might not be used if OS doesn't support zeroout */
+#if __GNUC_PREREQ (4, 6)
+#pragma GCC diagnostic push
+#pragma GCC diagnostic ignored "-Wunused-parameter"
+#endif
+static errcode_t unix_zeroout(io_channel channel, unsigned long long block,
+			      unsigned long long count)
+{
+	struct unix_private_data *data;
+	int		ret;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct unix_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_UNIX_IO_CHANNEL);
+
+	if (safe_getenv("UNIX_IO_NOZEROOUT"))
+		goto unimplemented;
+
+	if (!(channel->flags & CHANNEL_FLAGS_BLOCK_DEVICE)) {
+		/* Regular file, try to use truncate/punch/zero. */
+		struct stat statbuf;
+
+		if (count == 0)
+			return 0;
+		/*
+		 * If we're trying to zero a range past the end of the file,
+		 * extend the file size, then truncate everything.
+		 */
+		ret = fstat(data->dev, &statbuf);
+		if (ret)
+			goto err;
+		if ((unsigned long long) statbuf.st_size <
+			(block + count) * channel->block_size + data->offset) {
+			ret = ftruncate(data->dev,
+					(block + count) * channel->block_size + data->offset);
+			if (ret)
+				goto err;
+		}
+	}
+
+	ret = __unix_zeroout(data->dev,
+			(off_t)(block) * channel->block_size + data->offset,
+			(off_t)(count) * channel->block_size);
+err:
+	if (ret < 0) {
+		if (errno == EOPNOTSUPP)
+			goto unimplemented;
+		return errno;
+	}
+	return 0;
+unimplemented:
+	return EXT2_ET_UNIMPLEMENTED;
+}
+#if __GNUC_PREREQ (4, 6)
+#pragma GCC diagnostic pop
+#endif
+
+static struct struct_io_manager struct_unix_manager = {
+	.magic		= EXT2_ET_MAGIC_IO_MANAGER,
+	.name		= "Unix I/O Manager",
+	.open		= unix_open,
+	.close		= unix_close,
+	.set_blksize	= unix_set_blksize,
+	.read_blk	= unix_read_blk,
+	.write_blk	= unix_write_blk,
+	.flush		= unix_flush,
+	.write_byte	= unix_write_byte,
+	.set_option	= unix_set_option,
+	.get_stats	= unix_get_stats,
+	.read_blk64	= unix_read_blk64,
+	.write_blk64	= unix_write_blk64,
+	.discard	= unix_discard,
+	.cache_readahead	= unix_cache_readahead,
+	.zeroout	= unix_zeroout,
+};
+
+io_manager unix_io_manager = &struct_unix_manager;
+
+static struct struct_io_manager struct_unixfd_manager = {
+	.magic		= EXT2_ET_MAGIC_IO_MANAGER,
+	.name		= "Unix fd I/O Manager",
+	.open		= unixfd_open,
+	.close		= unix_close,
+	.set_blksize	= unix_set_blksize,
+	.read_blk	= unix_read_blk,
+	.write_blk	= unix_write_blk,
+	.flush		= unix_flush,
+	.write_byte	= unix_write_byte,
+	.set_option	= unix_set_option,
+	.get_stats	= unix_get_stats,
+	.read_blk64	= unix_read_blk64,
+	.write_blk64	= unix_write_blk64,
+	.discard	= unix_discard,
+	.cache_readahead	= unix_cache_readahead,
+	.zeroout	= unix_zeroout,
+};
+
+io_manager unixfd_io_manager = &struct_unixfd_manager;
diff --git a/lib/ext2fs/unlink.c b/lib/ext2fs/unlink.c
new file mode 100644
index 0000000..3ec04cf
--- /dev/null
+++ b/lib/ext2fs/unlink.c
@@ -0,0 +1,100 @@
+/*
+ * unlink.c --- delete links in a ext2fs directory
+ *
+ * Copyright (C) 1993, 1994, 1997 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+struct link_struct  {
+	const char	*name;
+	int		namelen;
+	ext2_ino_t	inode;
+	int		flags;
+	struct ext2_dir_entry *prev;
+	int		done;
+};
+
+#ifdef __TURBOC__
+ #pragma argsused
+#endif
+static int unlink_proc(struct ext2_dir_entry *dirent,
+		     int	offset,
+		     int	blocksize EXT2FS_ATTR((unused)),
+		     char	*buf EXT2FS_ATTR((unused)),
+		     void	*priv_data)
+{
+	struct link_struct *ls = (struct link_struct *) priv_data;
+	struct ext2_dir_entry *prev;
+
+	prev = ls->prev;
+	ls->prev = dirent;
+
+	if (ls->name) {
+		if (ext2fs_dirent_name_len(dirent) != ls->namelen)
+			return 0;
+		if (strncmp(ls->name, dirent->name, ext2fs_dirent_name_len(dirent)))
+			return 0;
+	}
+	if (!(ls->flags & EXT2FS_UNLINK_FORCE) && ls->inode) {
+		if (dirent->inode != ls->inode)
+			return 0;
+	} else {
+		if (!dirent->inode)
+			return 0;
+	}
+
+	if (offset)
+		prev->rec_len += dirent->rec_len;
+	else
+		dirent->inode = 0;
+	ls->done++;
+	return DIRENT_ABORT|DIRENT_CHANGED;
+}
+
+#ifdef __TURBOC__
+ #pragma argsused
+#endif
+errcode_t ext2fs_unlink(ext2_filsys fs, ext2_ino_t dir,
+			const char *name, ext2_ino_t ino,
+			int flags)
+{
+	errcode_t	retval;
+	struct link_struct ls;
+
+	EXT2_CHECK_MAGIC(fs, EXT2_ET_MAGIC_EXT2FS_FILSYS);
+
+	if (!name && !ino)
+		return EXT2_ET_INVALID_ARGUMENT;
+
+	if (!(fs->flags & EXT2_FLAG_RW))
+		return EXT2_ET_RO_FILSYS;
+
+	ls.name = name;
+	ls.namelen = name ? strlen(name) : 0;
+	ls.inode = ino;
+	ls.flags = flags;
+	ls.done = 0;
+	ls.prev = 0;
+
+	retval = ext2fs_dir_iterate(fs, dir, DIRENT_FLAG_INCLUDE_EMPTY,
+				    0, unlink_proc, &ls);
+	if (retval)
+		return retval;
+
+	return (ls.done) ? 0 : EXT2_ET_DIR_NO_SPACE;
+}
+
diff --git a/lib/ext2fs/utf8data.h b/lib/ext2fs/utf8data.h
new file mode 100644
index 0000000..76e4f0e
--- /dev/null
+++ b/lib/ext2fs/utf8data.h
@@ -0,0 +1,4109 @@
+/* This file is generated code, do not edit. */
+#ifndef __INCLUDED_FROM_UTF8NORM_C__
+#error Only nls_utf8-norm.c should include this file.
+#endif
+
+static const unsigned int utf8vers = 0xc0100;
+
+static const unsigned int utf8agetab[] = {
+	0,
+	0x10100,
+	0x20000,
+	0x20100,
+	0x30000,
+	0x30100,
+	0x30200,
+	0x40000,
+	0x40100,
+	0x50000,
+	0x50100,
+	0x50200,
+	0x60000,
+	0x60100,
+	0x60200,
+	0x60300,
+	0x70000,
+	0x80000,
+	0x90000,
+	0xa0000,
+	0xb0000,
+	0xc0000,
+	0xc0100
+};
+
+static const struct utf8data utf8nfdicfdata[] = {
+	{ 0, 0 },
+	{ 0x10100, 0 },
+	{ 0x20000, 0 },
+	{ 0x20100, 0 },
+	{ 0x30000, 0 },
+	{ 0x30100, 0 },
+	{ 0x30200, 1792 },
+	{ 0x40000, 3200 },
+	{ 0x40100, 3200 },
+	{ 0x50000, 3200 },
+	{ 0x50100, 3200 },
+	{ 0x50200, 3200 },
+	{ 0x60000, 3200 },
+	{ 0x60100, 3200 },
+	{ 0x60200, 3200 },
+	{ 0x60300, 3200 },
+	{ 0x70000, 3200 },
+	{ 0x80000, 3200 },
+	{ 0x90000, 3200 },
+	{ 0xa0000, 3200 },
+	{ 0xb0000, 3200 },
+	{ 0xc0000, 3200 },
+	{ 0xc0100, 3200 }
+};
+
+static const struct utf8data utf8nfdidata[] = {
+	{ 0, 896 },
+	{ 0x10100, 896 },
+	{ 0x20000, 896 },
+	{ 0x20100, 896 },
+	{ 0x30000, 896 },
+	{ 0x30100, 896 },
+	{ 0x30200, 2496 },
+	{ 0x40000, 20736 },
+	{ 0x40100, 20736 },
+	{ 0x50000, 20736 },
+	{ 0x50100, 20736 },
+	{ 0x50200, 20736 },
+	{ 0x60000, 20736 },
+	{ 0x60100, 20736 },
+	{ 0x60200, 20736 },
+	{ 0x60300, 20736 },
+	{ 0x70000, 20736 },
+	{ 0x80000, 20736 },
+	{ 0x90000, 20736 },
+	{ 0xa0000, 20736 },
+	{ 0xb0000, 20736 },
+	{ 0xc0000, 20736 },
+	{ 0xc0100, 20736 }
+};
+
+static const unsigned char utf8data[64256] = {
+	/* nfdicf_30100 */
+	0xd7,0x07,0x66,0x84,0x0c,0x01,0x00,0xc6,0xd5,0x16,0xe4,0x99,0x1a,0xe3,0x63,0x15,
+	0xe2,0x4c,0x0e,0xc1,0xe0,0x4e,0x0d,0xcf,0x86,0x65,0x2d,0x0d,0x01,0x00,0xd4,0xb8,
+	0xd3,0x27,0xe2,0x89,0xa3,0xe1,0xce,0x35,0xe0,0x2c,0x22,0xcf,0x86,0xc5,0xe4,0x15,
+	0x6d,0xe3,0x60,0x68,0xe2,0xf6,0x65,0xe1,0x29,0x65,0xe0,0xee,0x64,0xcf,0x86,0xe5,
+	0xb3,0x64,0x64,0x96,0x64,0x0b,0x00,0xd2,0x0e,0xe1,0xb5,0x3c,0xe0,0xba,0xa3,0xcf,
+	0x86,0xcf,0x06,0x01,0x00,0xd1,0x0c,0xe0,0x1e,0xa9,0xcf,0x86,0xcf,0x06,0x02,0xff,
+	0xff,0xd0,0x08,0xcf,0x86,0xcf,0x06,0x01,0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x01,
+	0x00,0xe4,0xe1,0x45,0xe3,0x3b,0x45,0xd2,0x06,0xcf,0x06,0x01,0x00,0xe1,0x87,0xad,
+	0xd0,0x21,0xcf,0x86,0xe5,0x81,0xaa,0xe4,0x00,0xaa,0xe3,0xbf,0xa9,0xe2,0x9e,0xa9,
+	0xe1,0x8d,0xa9,0x10,0x08,0x01,0xff,0xe8,0xb1,0x88,0x00,0x01,0xff,0xe6,0x9b,0xb4,
+	0x00,0xcf,0x86,0xe5,0x63,0xac,0xd4,0x19,0xe3,0xa2,0xab,0xe2,0x81,0xab,0xe1,0x70,
+	0xab,0x10,0x08,0x01,0xff,0xe9,0xb9,0xbf,0x00,0x01,0xff,0xe8,0xab,0x96,0x00,0xe3,
+	0x09,0xac,0xe2,0xe8,0xab,0xe1,0xd7,0xab,0x10,0x08,0x01,0xff,0xe7,0xb8,0xb7,0x00,
+	0x01,0xff,0xe9,0x9b,0xbb,0x00,0x83,0xe2,0x19,0xfa,0xe1,0xf2,0xf6,0xe0,0x6f,0xf5,
+	0xcf,0x86,0xd5,0x31,0xc4,0xe3,0x54,0x4e,0xe2,0xf5,0x4c,0xe1,0xa4,0xcc,0xe0,0x9c,
+	0x4b,0xcf,0x86,0xe5,0x8e,0x49,0xe4,0xaf,0x46,0xe3,0x11,0xbd,0xe2,0x68,0xbc,0xe1,
+	0x43,0xbc,0xe0,0x1c,0xbc,0xcf,0x86,0xe5,0xe9,0xbb,0x94,0x07,0x63,0xd4,0xbb,0x07,
+	0x00,0x07,0x00,0xe4,0xdb,0xf4,0xd3,0x08,0xcf,0x86,0xcf,0x06,0x05,0x00,0xd2,0x0b,
+	0xe1,0xea,0xe1,0xcf,0x86,0xcf,0x06,0x05,0x00,0xd1,0x0e,0xe0,0xd9,0xe2,0xcf,0x86,
+	0xe5,0x9e,0xe2,0xcf,0x06,0x11,0x00,0xd0,0x0b,0xcf,0x86,0xe5,0xd9,0xe2,0xcf,0x06,
+	0x13,0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xe4,0x74,0xf4,0xe3,0x5d,0xf3,
+	0xd2,0xa0,0xe1,0x13,0xe7,0xd0,0x21,0xcf,0x86,0xe5,0x14,0xe4,0xe4,0x90,0xe3,0xe3,
+	0x4e,0xe3,0xe2,0x2d,0xe3,0xe1,0x1b,0xe3,0x10,0x08,0x05,0xff,0xe4,0xb8,0xbd,0x00,
+	0x05,0xff,0xe4,0xb8,0xb8,0x00,0xcf,0x86,0xd5,0x1c,0xe4,0x70,0xe5,0xe3,0x2f,0xe5,
+	0xe2,0x0e,0xe5,0xe1,0xfd,0xe4,0x10,0x08,0x05,0xff,0xe5,0x92,0xa2,0x00,0x05,0xff,
+	0xe5,0x93,0xb6,0x00,0xd4,0x34,0xd3,0x18,0xe2,0xf7,0xe5,0xe1,0xe6,0xe5,0x10,0x09,
+	0x05,0xff,0xf0,0xa1,0x9a,0xa8,0x00,0x05,0xff,0xf0,0xa1,0x9b,0xaa,0x00,0xe2,0x17,
+	0xe6,0x91,0x11,0x10,0x09,0x05,0xff,0xf0,0xa1,0x8d,0xaa,0x00,0x05,0xff,0xe5,0xac,
+	0x88,0x00,0x05,0xff,0xe5,0xac,0xbe,0x00,0xe3,0x5d,0xe6,0xd2,0x14,0xe1,0x2c,0xe6,
+	0x10,0x08,0x05,0xff,0xe5,0xaf,0xb3,0x00,0x05,0xff,0xf0,0xa1,0xac,0x98,0x00,0xe1,
+	0x38,0xe6,0x10,0x08,0x05,0xff,0xe5,0xbc,0xb3,0x00,0x05,0xff,0xe5,0xb0,0xa2,0x00,
+	0xd1,0xd5,0xd0,0x6a,0xcf,0x86,0xe5,0x8d,0xeb,0xd4,0x19,0xe3,0xc6,0xea,0xe2,0xa4,
+	0xea,0xe1,0x93,0xea,0x10,0x08,0x05,0xff,0xe6,0xb4,0xbe,0x00,0x05,0xff,0xe6,0xb5,
+	0xb7,0x00,0xd3,0x18,0xe2,0x10,0xeb,0xe1,0xff,0xea,0x10,0x09,0x05,0xff,0xf0,0xa3,
+	0xbd,0x9e,0x00,0x05,0xff,0xf0,0xa3,0xbe,0x8e,0x00,0xd2,0x13,0xe1,0x28,0xeb,0x10,
+	0x08,0x05,0xff,0xe7,0x81,0xbd,0x00,0x05,0xff,0xe7,0x81,0xb7,0x00,0xd1,0x11,0x10,
+	0x08,0x05,0xff,0xe7,0x85,0x85,0x00,0x05,0xff,0xf0,0xa4,0x89,0xa3,0x00,0x10,0x08,
+	0x05,0xff,0xe7,0x86,0x9c,0x00,0x05,0xff,0xe4,0x8e,0xab,0x00,0xcf,0x86,0xe5,0x2a,
+	0xed,0xd4,0x1a,0xe3,0x62,0xec,0xe2,0x48,0xec,0xe1,0x35,0xec,0x10,0x08,0x05,0xff,
+	0xe7,0x9b,0xb4,0x00,0x05,0xff,0xf0,0xa5,0x83,0xb3,0x00,0xd3,0x16,0xe2,0xaa,0xec,
+	0xe1,0x98,0xec,0x10,0x08,0x05,0xff,0xe7,0xa3,0x8c,0x00,0x05,0xff,0xe4,0x83,0xa3,
+	0x00,0xd2,0x13,0xe1,0xc6,0xec,0x10,0x08,0x05,0xff,0xe4,0x84,0xaf,0x00,0x05,0xff,
+	0xe7,0xa9,0x80,0x00,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0xa5,0xa5,0xbc,0x00,0x05,
+	0xff,0xf0,0xa5,0xaa,0xa7,0x00,0x10,0x09,0x05,0xff,0xf0,0xa5,0xaa,0xa7,0x00,0x05,
+	0xff,0xe7,0xaa,0xae,0x00,0xe0,0xdc,0xef,0xcf,0x86,0xd5,0x1d,0xe4,0x51,0xee,0xe3,
+	0x0d,0xee,0xe2,0xeb,0xed,0xe1,0xda,0xed,0x10,0x09,0x05,0xff,0xf0,0xa3,0x8d,0x9f,
+	0x00,0x05,0xff,0xe4,0x8f,0x95,0x00,0xd4,0x19,0xe3,0xf8,0xee,0xe2,0xd4,0xee,0xe1,
+	0xc3,0xee,0x10,0x08,0x05,0xff,0xe8,0x8d,0x93,0x00,0x05,0xff,0xe8,0x8f,0x8a,0x00,
+	0xd3,0x18,0xe2,0x43,0xef,0xe1,0x32,0xef,0x10,0x09,0x05,0xff,0xf0,0xa6,0xbe,0xb1,
+	0x00,0x05,0xff,0xf0,0xa7,0x83,0x92,0x00,0xd2,0x13,0xe1,0x5b,0xef,0x10,0x08,0x05,
+	0xff,0xe8,0x9a,0x88,0x00,0x05,0xff,0xe8,0x9c,0x8e,0x00,0xd1,0x10,0x10,0x08,0x05,
+	0xff,0xe8,0x9c,0xa8,0x00,0x05,0xff,0xe8,0x9d,0xab,0x00,0x10,0x08,0x05,0xff,0xe8,
+	0x9e,0x86,0x00,0x05,0xff,0xe4,0xb5,0x97,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+	0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+	0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+	0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+	/* nfdi_30100 */
+	0x57,0x04,0x01,0x00,0xc6,0xd5,0x16,0xe4,0xc2,0x59,0xe3,0xfb,0x54,0xe2,0x74,0x4f,
+	0xc1,0xe0,0xa0,0x4d,0xcf,0x86,0x65,0x84,0x4d,0x01,0x00,0xd4,0xb8,0xd3,0x27,0xe2,
+	0x0c,0xa0,0xe1,0xdf,0x8d,0xe0,0x39,0x71,0xcf,0x86,0xc5,0xe4,0x98,0x69,0xe3,0xe3,
+	0x64,0xe2,0x79,0x62,0xe1,0xac,0x61,0xe0,0x71,0x61,0xcf,0x86,0xe5,0x36,0x61,0x64,
+	0x19,0x61,0x0b,0x00,0xd2,0x0e,0xe1,0xc2,0xa0,0xe0,0x3d,0xa0,0xcf,0x86,0xcf,0x06,
+	0x01,0x00,0xd1,0x0c,0xe0,0xa1,0xa5,0xcf,0x86,0xcf,0x06,0x02,0xff,0xff,0xd0,0x08,
+	0xcf,0x86,0xcf,0x06,0x01,0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x01,0x00,0xe4,0x9e,
+	0xb6,0xe3,0x18,0xae,0xd2,0x06,0xcf,0x06,0x01,0x00,0xe1,0x0a,0xaa,0xd0,0x21,0xcf,
+	0x86,0xe5,0x04,0xa7,0xe4,0x83,0xa6,0xe3,0x42,0xa6,0xe2,0x21,0xa6,0xe1,0x10,0xa6,
+	0x10,0x08,0x01,0xff,0xe8,0xb1,0x88,0x00,0x01,0xff,0xe6,0x9b,0xb4,0x00,0xcf,0x86,
+	0xe5,0xe6,0xa8,0xd4,0x19,0xe3,0x25,0xa8,0xe2,0x04,0xa8,0xe1,0xf3,0xa7,0x10,0x08,
+	0x01,0xff,0xe9,0xb9,0xbf,0x00,0x01,0xff,0xe8,0xab,0x96,0x00,0xe3,0x8c,0xa8,0xe2,
+	0x6b,0xa8,0xe1,0x5a,0xa8,0x10,0x08,0x01,0xff,0xe7,0xb8,0xb7,0x00,0x01,0xff,0xe9,
+	0x9b,0xbb,0x00,0x83,0xe2,0x9c,0xf6,0xe1,0x75,0xf3,0xe0,0xf2,0xf1,0xcf,0x86,0xd5,
+	0x31,0xc4,0xe3,0x6d,0xcc,0xe2,0x46,0xca,0xe1,0x27,0xc9,0xe0,0xb7,0xbf,0xcf,0x86,
+	0xe5,0xaa,0xbb,0xe4,0xa3,0xba,0xe3,0x94,0xb9,0xe2,0xeb,0xb8,0xe1,0xc6,0xb8,0xe0,
+	0x9f,0xb8,0xcf,0x86,0xe5,0x6c,0xb8,0x94,0x07,0x63,0x57,0xb8,0x07,0x00,0x07,0x00,
+	0xe4,0x5e,0xf1,0xd3,0x08,0xcf,0x86,0xcf,0x06,0x05,0x00,0xd2,0x0b,0xe1,0x6d,0xde,
+	0xcf,0x86,0xcf,0x06,0x05,0x00,0xd1,0x0e,0xe0,0x5c,0xdf,0xcf,0x86,0xe5,0x21,0xdf,
+	0xcf,0x06,0x11,0x00,0xd0,0x0b,0xcf,0x86,0xe5,0x5c,0xdf,0xcf,0x06,0x13,0x00,0xcf,
+	0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xe4,0xf7,0xf0,0xe3,0xe0,0xef,0xd2,0xa0,0xe1,
+	0x96,0xe3,0xd0,0x21,0xcf,0x86,0xe5,0x97,0xe0,0xe4,0x13,0xe0,0xe3,0xd1,0xdf,0xe2,
+	0xb0,0xdf,0xe1,0x9e,0xdf,0x10,0x08,0x05,0xff,0xe4,0xb8,0xbd,0x00,0x05,0xff,0xe4,
+	0xb8,0xb8,0x00,0xcf,0x86,0xd5,0x1c,0xe4,0xf3,0xe1,0xe3,0xb2,0xe1,0xe2,0x91,0xe1,
+	0xe1,0x80,0xe1,0x10,0x08,0x05,0xff,0xe5,0x92,0xa2,0x00,0x05,0xff,0xe5,0x93,0xb6,
+	0x00,0xd4,0x34,0xd3,0x18,0xe2,0x7a,0xe2,0xe1,0x69,0xe2,0x10,0x09,0x05,0xff,0xf0,
+	0xa1,0x9a,0xa8,0x00,0x05,0xff,0xf0,0xa1,0x9b,0xaa,0x00,0xe2,0x9a,0xe2,0x91,0x11,
+	0x10,0x09,0x05,0xff,0xf0,0xa1,0x8d,0xaa,0x00,0x05,0xff,0xe5,0xac,0x88,0x00,0x05,
+	0xff,0xe5,0xac,0xbe,0x00,0xe3,0xe0,0xe2,0xd2,0x14,0xe1,0xaf,0xe2,0x10,0x08,0x05,
+	0xff,0xe5,0xaf,0xb3,0x00,0x05,0xff,0xf0,0xa1,0xac,0x98,0x00,0xe1,0xbb,0xe2,0x10,
+	0x08,0x05,0xff,0xe5,0xbc,0xb3,0x00,0x05,0xff,0xe5,0xb0,0xa2,0x00,0xd1,0xd5,0xd0,
+	0x6a,0xcf,0x86,0xe5,0x10,0xe8,0xd4,0x19,0xe3,0x49,0xe7,0xe2,0x27,0xe7,0xe1,0x16,
+	0xe7,0x10,0x08,0x05,0xff,0xe6,0xb4,0xbe,0x00,0x05,0xff,0xe6,0xb5,0xb7,0x00,0xd3,
+	0x18,0xe2,0x93,0xe7,0xe1,0x82,0xe7,0x10,0x09,0x05,0xff,0xf0,0xa3,0xbd,0x9e,0x00,
+	0x05,0xff,0xf0,0xa3,0xbe,0x8e,0x00,0xd2,0x13,0xe1,0xab,0xe7,0x10,0x08,0x05,0xff,
+	0xe7,0x81,0xbd,0x00,0x05,0xff,0xe7,0x81,0xb7,0x00,0xd1,0x11,0x10,0x08,0x05,0xff,
+	0xe7,0x85,0x85,0x00,0x05,0xff,0xf0,0xa4,0x89,0xa3,0x00,0x10,0x08,0x05,0xff,0xe7,
+	0x86,0x9c,0x00,0x05,0xff,0xe4,0x8e,0xab,0x00,0xcf,0x86,0xe5,0xad,0xe9,0xd4,0x1a,
+	0xe3,0xe5,0xe8,0xe2,0xcb,0xe8,0xe1,0xb8,0xe8,0x10,0x08,0x05,0xff,0xe7,0x9b,0xb4,
+	0x00,0x05,0xff,0xf0,0xa5,0x83,0xb3,0x00,0xd3,0x16,0xe2,0x2d,0xe9,0xe1,0x1b,0xe9,
+	0x10,0x08,0x05,0xff,0xe7,0xa3,0x8c,0x00,0x05,0xff,0xe4,0x83,0xa3,0x00,0xd2,0x13,
+	0xe1,0x49,0xe9,0x10,0x08,0x05,0xff,0xe4,0x84,0xaf,0x00,0x05,0xff,0xe7,0xa9,0x80,
+	0x00,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0xa5,0xa5,0xbc,0x00,0x05,0xff,0xf0,0xa5,
+	0xaa,0xa7,0x00,0x10,0x09,0x05,0xff,0xf0,0xa5,0xaa,0xa7,0x00,0x05,0xff,0xe7,0xaa,
+	0xae,0x00,0xe0,0x5f,0xec,0xcf,0x86,0xd5,0x1d,0xe4,0xd4,0xea,0xe3,0x90,0xea,0xe2,
+	0x6e,0xea,0xe1,0x5d,0xea,0x10,0x09,0x05,0xff,0xf0,0xa3,0x8d,0x9f,0x00,0x05,0xff,
+	0xe4,0x8f,0x95,0x00,0xd4,0x19,0xe3,0x7b,0xeb,0xe2,0x57,0xeb,0xe1,0x46,0xeb,0x10,
+	0x08,0x05,0xff,0xe8,0x8d,0x93,0x00,0x05,0xff,0xe8,0x8f,0x8a,0x00,0xd3,0x18,0xe2,
+	0xc6,0xeb,0xe1,0xb5,0xeb,0x10,0x09,0x05,0xff,0xf0,0xa6,0xbe,0xb1,0x00,0x05,0xff,
+	0xf0,0xa7,0x83,0x92,0x00,0xd2,0x13,0xe1,0xde,0xeb,0x10,0x08,0x05,0xff,0xe8,0x9a,
+	0x88,0x00,0x05,0xff,0xe8,0x9c,0x8e,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe8,0x9c,
+	0xa8,0x00,0x05,0xff,0xe8,0x9d,0xab,0x00,0x10,0x08,0x05,0xff,0xe8,0x9e,0x86,0x00,
+	0x05,0xff,0xe4,0xb5,0x97,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+	0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+	0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+	0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+	/* nfdicf_30200 */
+	0xd7,0x07,0x66,0x84,0x05,0x01,0x00,0xc6,0xd5,0x16,0xe4,0x99,0x13,0xe3,0x63,0x0e,
+	0xe2,0x4c,0x07,0xc1,0xe0,0x4e,0x06,0xcf,0x86,0x65,0x2d,0x06,0x01,0x00,0xd4,0x2a,
+	0xe3,0xd0,0x35,0xe2,0x88,0x9c,0xe1,0xcd,0x2e,0xe0,0x2b,0x1b,0xcf,0x86,0xc5,0xe4,
+	0x14,0x66,0xe3,0x5f,0x61,0xe2,0xf5,0x5e,0xe1,0x28,0x5e,0xe0,0xed,0x5d,0xcf,0x86,
+	0xe5,0xb2,0x5d,0x64,0x95,0x5d,0x0b,0x00,0x83,0xe2,0xa7,0xf3,0xe1,0x80,0xf0,0xe0,
+	0xfd,0xee,0xcf,0x86,0xd5,0x31,0xc4,0xe3,0xe2,0x47,0xe2,0x83,0x46,0xe1,0x32,0xc6,
+	0xe0,0x2a,0x45,0xcf,0x86,0xe5,0x1c,0x43,0xe4,0x3d,0x40,0xe3,0x9f,0xb6,0xe2,0xf6,
+	0xb5,0xe1,0xd1,0xb5,0xe0,0xaa,0xb5,0xcf,0x86,0xe5,0x77,0xb5,0x94,0x07,0x63,0x62,
+	0xb5,0x07,0x00,0x07,0x00,0xe4,0x69,0xee,0xd3,0x08,0xcf,0x86,0xcf,0x06,0x05,0x00,
+	0xd2,0x0b,0xe1,0x78,0xdb,0xcf,0x86,0xcf,0x06,0x05,0x00,0xd1,0x0e,0xe0,0x67,0xdc,
+	0xcf,0x86,0xe5,0x2c,0xdc,0xcf,0x06,0x11,0x00,0xd0,0x0b,0xcf,0x86,0xe5,0x67,0xdc,
+	0xcf,0x06,0x13,0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xe4,0x02,0xee,0xe3,
+	0xeb,0xec,0xd2,0xa0,0xe1,0xa1,0xe0,0xd0,0x21,0xcf,0x86,0xe5,0xa2,0xdd,0xe4,0x1e,
+	0xdd,0xe3,0xdc,0xdc,0xe2,0xbb,0xdc,0xe1,0xa9,0xdc,0x10,0x08,0x05,0xff,0xe4,0xb8,
+	0xbd,0x00,0x05,0xff,0xe4,0xb8,0xb8,0x00,0xcf,0x86,0xd5,0x1c,0xe4,0xfe,0xde,0xe3,
+	0xbd,0xde,0xe2,0x9c,0xde,0xe1,0x8b,0xde,0x10,0x08,0x05,0xff,0xe5,0x92,0xa2,0x00,
+	0x05,0xff,0xe5,0x93,0xb6,0x00,0xd4,0x34,0xd3,0x18,0xe2,0x85,0xdf,0xe1,0x74,0xdf,
+	0x10,0x09,0x05,0xff,0xf0,0xa1,0x9a,0xa8,0x00,0x05,0xff,0xf0,0xa1,0x9b,0xaa,0x00,
+	0xe2,0xa5,0xdf,0x91,0x11,0x10,0x09,0x05,0xff,0xf0,0xa1,0x8d,0xaa,0x00,0x05,0xff,
+	0xe5,0xac,0x88,0x00,0x05,0xff,0xe5,0xac,0xbe,0x00,0xe3,0xeb,0xdf,0xd2,0x14,0xe1,
+	0xba,0xdf,0x10,0x08,0x05,0xff,0xe5,0xaf,0xb3,0x00,0x05,0xff,0xf0,0xa1,0xac,0x98,
+	0x00,0xe1,0xc6,0xdf,0x10,0x08,0x05,0xff,0xe5,0xbc,0xb3,0x00,0x05,0xff,0xe5,0xb0,
+	0xa2,0x00,0xd1,0xd5,0xd0,0x6a,0xcf,0x86,0xe5,0x1b,0xe5,0xd4,0x19,0xe3,0x54,0xe4,
+	0xe2,0x32,0xe4,0xe1,0x21,0xe4,0x10,0x08,0x05,0xff,0xe6,0xb4,0xbe,0x00,0x05,0xff,
+	0xe6,0xb5,0xb7,0x00,0xd3,0x18,0xe2,0x9e,0xe4,0xe1,0x8d,0xe4,0x10,0x09,0x05,0xff,
+	0xf0,0xa3,0xbd,0x9e,0x00,0x05,0xff,0xf0,0xa3,0xbe,0x8e,0x00,0xd2,0x13,0xe1,0xb6,
+	0xe4,0x10,0x08,0x05,0xff,0xe7,0x81,0xbd,0x00,0x05,0xff,0xe7,0x81,0xb7,0x00,0xd1,
+	0x11,0x10,0x08,0x05,0xff,0xe7,0x85,0x85,0x00,0x05,0xff,0xf0,0xa4,0x89,0xa3,0x00,
+	0x10,0x08,0x05,0xff,0xe7,0x86,0x9c,0x00,0x05,0xff,0xe4,0x8e,0xab,0x00,0xcf,0x86,
+	0xe5,0xb8,0xe6,0xd4,0x1a,0xe3,0xf0,0xe5,0xe2,0xd6,0xe5,0xe1,0xc3,0xe5,0x10,0x08,
+	0x05,0xff,0xe7,0x9b,0xb4,0x00,0x05,0xff,0xf0,0xa5,0x83,0xb3,0x00,0xd3,0x16,0xe2,
+	0x38,0xe6,0xe1,0x26,0xe6,0x10,0x08,0x05,0xff,0xe7,0xa3,0x8c,0x00,0x05,0xff,0xe4,
+	0x83,0xa3,0x00,0xd2,0x13,0xe1,0x54,0xe6,0x10,0x08,0x05,0xff,0xe4,0x84,0xaf,0x00,
+	0x05,0xff,0xe7,0xa9,0x80,0x00,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0xa5,0xa5,0xbc,
+	0x00,0x05,0xff,0xf0,0xa5,0xaa,0xa7,0x00,0x10,0x09,0x05,0xff,0xf0,0xa5,0xaa,0xa7,
+	0x00,0x05,0xff,0xe7,0xaa,0xae,0x00,0xe0,0x6a,0xe9,0xcf,0x86,0xd5,0x1d,0xe4,0xdf,
+	0xe7,0xe3,0x9b,0xe7,0xe2,0x79,0xe7,0xe1,0x68,0xe7,0x10,0x09,0x05,0xff,0xf0,0xa3,
+	0x8d,0x9f,0x00,0x05,0xff,0xe4,0x8f,0x95,0x00,0xd4,0x19,0xe3,0x86,0xe8,0xe2,0x62,
+	0xe8,0xe1,0x51,0xe8,0x10,0x08,0x05,0xff,0xe8,0x8d,0x93,0x00,0x05,0xff,0xe8,0x8f,
+	0x8a,0x00,0xd3,0x18,0xe2,0xd1,0xe8,0xe1,0xc0,0xe8,0x10,0x09,0x05,0xff,0xf0,0xa6,
+	0xbe,0xb1,0x00,0x05,0xff,0xf0,0xa7,0x83,0x92,0x00,0xd2,0x13,0xe1,0xe9,0xe8,0x10,
+	0x08,0x05,0xff,0xe8,0x9a,0x88,0x00,0x05,0xff,0xe8,0x9c,0x8e,0x00,0xd1,0x10,0x10,
+	0x08,0x05,0xff,0xe8,0x9c,0xa8,0x00,0x05,0xff,0xe8,0x9d,0xab,0x00,0x10,0x08,0x05,
+	0xff,0xe8,0x9e,0x86,0x00,0x05,0xff,0xe4,0xb5,0x97,0x00,0x00,0x00,0x00,0x00,0x00,
+	/* nfdi_30200 */
+	0x57,0x04,0x01,0x00,0xc6,0xd5,0x16,0xe4,0x82,0x53,0xe3,0xbb,0x4e,0xe2,0x34,0x49,
+	0xc1,0xe0,0x60,0x47,0xcf,0x86,0x65,0x44,0x47,0x01,0x00,0xd4,0x2a,0xe3,0x1c,0x9a,
+	0xe2,0xcb,0x99,0xe1,0x9e,0x87,0xe0,0xf8,0x6a,0xcf,0x86,0xc5,0xe4,0x57,0x63,0xe3,
+	0xa2,0x5e,0xe2,0x38,0x5c,0xe1,0x6b,0x5b,0xe0,0x30,0x5b,0xcf,0x86,0xe5,0xf5,0x5a,
+	0x64,0xd8,0x5a,0x0b,0x00,0x83,0xe2,0xea,0xf0,0xe1,0xc3,0xed,0xe0,0x40,0xec,0xcf,
+	0x86,0xd5,0x31,0xc4,0xe3,0xbb,0xc6,0xe2,0x94,0xc4,0xe1,0x75,0xc3,0xe0,0x05,0xba,
+	0xcf,0x86,0xe5,0xf8,0xb5,0xe4,0xf1,0xb4,0xe3,0xe2,0xb3,0xe2,0x39,0xb3,0xe1,0x14,
+	0xb3,0xe0,0xed,0xb2,0xcf,0x86,0xe5,0xba,0xb2,0x94,0x07,0x63,0xa5,0xb2,0x07,0x00,
+	0x07,0x00,0xe4,0xac,0xeb,0xd3,0x08,0xcf,0x86,0xcf,0x06,0x05,0x00,0xd2,0x0b,0xe1,
+	0xbb,0xd8,0xcf,0x86,0xcf,0x06,0x05,0x00,0xd1,0x0e,0xe0,0xaa,0xd9,0xcf,0x86,0xe5,
+	0x6f,0xd9,0xcf,0x06,0x11,0x00,0xd0,0x0b,0xcf,0x86,0xe5,0xaa,0xd9,0xcf,0x06,0x13,
+	0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xe4,0x45,0xeb,0xe3,0x2e,0xea,0xd2,
+	0xa0,0xe1,0xe4,0xdd,0xd0,0x21,0xcf,0x86,0xe5,0xe5,0xda,0xe4,0x61,0xda,0xe3,0x1f,
+	0xda,0xe2,0xfe,0xd9,0xe1,0xec,0xd9,0x10,0x08,0x05,0xff,0xe4,0xb8,0xbd,0x00,0x05,
+	0xff,0xe4,0xb8,0xb8,0x00,0xcf,0x86,0xd5,0x1c,0xe4,0x41,0xdc,0xe3,0x00,0xdc,0xe2,
+	0xdf,0xdb,0xe1,0xce,0xdb,0x10,0x08,0x05,0xff,0xe5,0x92,0xa2,0x00,0x05,0xff,0xe5,
+	0x93,0xb6,0x00,0xd4,0x34,0xd3,0x18,0xe2,0xc8,0xdc,0xe1,0xb7,0xdc,0x10,0x09,0x05,
+	0xff,0xf0,0xa1,0x9a,0xa8,0x00,0x05,0xff,0xf0,0xa1,0x9b,0xaa,0x00,0xe2,0xe8,0xdc,
+	0x91,0x11,0x10,0x09,0x05,0xff,0xf0,0xa1,0x8d,0xaa,0x00,0x05,0xff,0xe5,0xac,0x88,
+	0x00,0x05,0xff,0xe5,0xac,0xbe,0x00,0xe3,0x2e,0xdd,0xd2,0x14,0xe1,0xfd,0xdc,0x10,
+	0x08,0x05,0xff,0xe5,0xaf,0xb3,0x00,0x05,0xff,0xf0,0xa1,0xac,0x98,0x00,0xe1,0x09,
+	0xdd,0x10,0x08,0x05,0xff,0xe5,0xbc,0xb3,0x00,0x05,0xff,0xe5,0xb0,0xa2,0x00,0xd1,
+	0xd5,0xd0,0x6a,0xcf,0x86,0xe5,0x5e,0xe2,0xd4,0x19,0xe3,0x97,0xe1,0xe2,0x75,0xe1,
+	0xe1,0x64,0xe1,0x10,0x08,0x05,0xff,0xe6,0xb4,0xbe,0x00,0x05,0xff,0xe6,0xb5,0xb7,
+	0x00,0xd3,0x18,0xe2,0xe1,0xe1,0xe1,0xd0,0xe1,0x10,0x09,0x05,0xff,0xf0,0xa3,0xbd,
+	0x9e,0x00,0x05,0xff,0xf0,0xa3,0xbe,0x8e,0x00,0xd2,0x13,0xe1,0xf9,0xe1,0x10,0x08,
+	0x05,0xff,0xe7,0x81,0xbd,0x00,0x05,0xff,0xe7,0x81,0xb7,0x00,0xd1,0x11,0x10,0x08,
+	0x05,0xff,0xe7,0x85,0x85,0x00,0x05,0xff,0xf0,0xa4,0x89,0xa3,0x00,0x10,0x08,0x05,
+	0xff,0xe7,0x86,0x9c,0x00,0x05,0xff,0xe4,0x8e,0xab,0x00,0xcf,0x86,0xe5,0xfb,0xe3,
+	0xd4,0x1a,0xe3,0x33,0xe3,0xe2,0x19,0xe3,0xe1,0x06,0xe3,0x10,0x08,0x05,0xff,0xe7,
+	0x9b,0xb4,0x00,0x05,0xff,0xf0,0xa5,0x83,0xb3,0x00,0xd3,0x16,0xe2,0x7b,0xe3,0xe1,
+	0x69,0xe3,0x10,0x08,0x05,0xff,0xe7,0xa3,0x8c,0x00,0x05,0xff,0xe4,0x83,0xa3,0x00,
+	0xd2,0x13,0xe1,0x97,0xe3,0x10,0x08,0x05,0xff,0xe4,0x84,0xaf,0x00,0x05,0xff,0xe7,
+	0xa9,0x80,0x00,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0xa5,0xa5,0xbc,0x00,0x05,0xff,
+	0xf0,0xa5,0xaa,0xa7,0x00,0x10,0x09,0x05,0xff,0xf0,0xa5,0xaa,0xa7,0x00,0x05,0xff,
+	0xe7,0xaa,0xae,0x00,0xe0,0xad,0xe6,0xcf,0x86,0xd5,0x1d,0xe4,0x22,0xe5,0xe3,0xde,
+	0xe4,0xe2,0xbc,0xe4,0xe1,0xab,0xe4,0x10,0x09,0x05,0xff,0xf0,0xa3,0x8d,0x9f,0x00,
+	0x05,0xff,0xe4,0x8f,0x95,0x00,0xd4,0x19,0xe3,0xc9,0xe5,0xe2,0xa5,0xe5,0xe1,0x94,
+	0xe5,0x10,0x08,0x05,0xff,0xe8,0x8d,0x93,0x00,0x05,0xff,0xe8,0x8f,0x8a,0x00,0xd3,
+	0x18,0xe2,0x14,0xe6,0xe1,0x03,0xe6,0x10,0x09,0x05,0xff,0xf0,0xa6,0xbe,0xb1,0x00,
+	0x05,0xff,0xf0,0xa7,0x83,0x92,0x00,0xd2,0x13,0xe1,0x2c,0xe6,0x10,0x08,0x05,0xff,
+	0xe8,0x9a,0x88,0x00,0x05,0xff,0xe8,0x9c,0x8e,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,
+	0xe8,0x9c,0xa8,0x00,0x05,0xff,0xe8,0x9d,0xab,0x00,0x10,0x08,0x05,0xff,0xe8,0x9e,
+	0x86,0x00,0x05,0xff,0xe4,0xb5,0x97,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+	/* nfdicf_c0100 */
+	0xd7,0xb0,0x56,0x04,0x01,0x00,0x95,0xa8,0xd4,0x5e,0xd3,0x2e,0xd2,0x16,0xd1,0x0a,
+	0x10,0x04,0x01,0x00,0x01,0xff,0x61,0x00,0x10,0x06,0x01,0xff,0x62,0x00,0x01,0xff,
+	0x63,0x00,0xd1,0x0c,0x10,0x06,0x01,0xff,0x64,0x00,0x01,0xff,0x65,0x00,0x10,0x06,
+	0x01,0xff,0x66,0x00,0x01,0xff,0x67,0x00,0xd2,0x18,0xd1,0x0c,0x10,0x06,0x01,0xff,
+	0x68,0x00,0x01,0xff,0x69,0x00,0x10,0x06,0x01,0xff,0x6a,0x00,0x01,0xff,0x6b,0x00,
+	0xd1,0x0c,0x10,0x06,0x01,0xff,0x6c,0x00,0x01,0xff,0x6d,0x00,0x10,0x06,0x01,0xff,
+	0x6e,0x00,0x01,0xff,0x6f,0x00,0xd3,0x30,0xd2,0x18,0xd1,0x0c,0x10,0x06,0x01,0xff,
+	0x70,0x00,0x01,0xff,0x71,0x00,0x10,0x06,0x01,0xff,0x72,0x00,0x01,0xff,0x73,0x00,
+	0xd1,0x0c,0x10,0x06,0x01,0xff,0x74,0x00,0x01,0xff,0x75,0x00,0x10,0x06,0x01,0xff,
+	0x76,0x00,0x01,0xff,0x77,0x00,0x92,0x16,0xd1,0x0c,0x10,0x06,0x01,0xff,0x78,0x00,
+	0x01,0xff,0x79,0x00,0x10,0x06,0x01,0xff,0x7a,0x00,0x01,0x00,0x01,0x00,0x01,0x00,
+	0xc6,0xe5,0xf9,0x14,0xe4,0x6f,0x0d,0xe3,0x39,0x08,0xe2,0x22,0x01,0xc1,0xd0,0x24,
+	0xcf,0x86,0x55,0x04,0x01,0x00,0xd4,0x07,0x63,0xd8,0x43,0x01,0x00,0x93,0x13,0x52,
+	0x04,0x01,0x00,0x91,0x0b,0x10,0x04,0x01,0x00,0x01,0xff,0xce,0xbc,0x00,0x01,0x00,
+	0x01,0x00,0xcf,0x86,0xe5,0xb3,0x44,0xd4,0x7f,0xd3,0x3f,0xd2,0x20,0xd1,0x10,0x10,
+	0x08,0x01,0xff,0x61,0xcc,0x80,0x00,0x01,0xff,0x61,0xcc,0x81,0x00,0x10,0x08,0x01,
+	0xff,0x61,0xcc,0x82,0x00,0x01,0xff,0x61,0xcc,0x83,0x00,0xd1,0x10,0x10,0x08,0x01,
+	0xff,0x61,0xcc,0x88,0x00,0x01,0xff,0x61,0xcc,0x8a,0x00,0x10,0x07,0x01,0xff,0xc3,
+	0xa6,0x00,0x01,0xff,0x63,0xcc,0xa7,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,
+	0x65,0xcc,0x80,0x00,0x01,0xff,0x65,0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x65,0xcc,
+	0x82,0x00,0x01,0xff,0x65,0xcc,0x88,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x69,0xcc,
+	0x80,0x00,0x01,0xff,0x69,0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x69,0xcc,0x82,0x00,
+	0x01,0xff,0x69,0xcc,0x88,0x00,0xd3,0x3b,0xd2,0x1f,0xd1,0x0f,0x10,0x07,0x01,0xff,
+	0xc3,0xb0,0x00,0x01,0xff,0x6e,0xcc,0x83,0x00,0x10,0x08,0x01,0xff,0x6f,0xcc,0x80,
+	0x00,0x01,0xff,0x6f,0xcc,0x81,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x6f,0xcc,0x82,
+	0x00,0x01,0xff,0x6f,0xcc,0x83,0x00,0x10,0x08,0x01,0xff,0x6f,0xcc,0x88,0x00,0x01,
+	0x00,0xd2,0x1f,0xd1,0x0f,0x10,0x07,0x01,0xff,0xc3,0xb8,0x00,0x01,0xff,0x75,0xcc,
+	0x80,0x00,0x10,0x08,0x01,0xff,0x75,0xcc,0x81,0x00,0x01,0xff,0x75,0xcc,0x82,0x00,
+	0xd1,0x10,0x10,0x08,0x01,0xff,0x75,0xcc,0x88,0x00,0x01,0xff,0x79,0xcc,0x81,0x00,
+	0x10,0x07,0x01,0xff,0xc3,0xbe,0x00,0x01,0xff,0x73,0x73,0x00,0xe1,0xd4,0x03,0xe0,
+	0xeb,0x01,0xcf,0x86,0xd5,0xfb,0xd4,0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,
+	0x01,0xff,0x61,0xcc,0x84,0x00,0x01,0xff,0x61,0xcc,0x84,0x00,0x10,0x08,0x01,0xff,
+	0x61,0xcc,0x86,0x00,0x01,0xff,0x61,0xcc,0x86,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,
+	0x61,0xcc,0xa8,0x00,0x01,0xff,0x61,0xcc,0xa8,0x00,0x10,0x08,0x01,0xff,0x63,0xcc,
+	0x81,0x00,0x01,0xff,0x63,0xcc,0x81,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,
+	0x63,0xcc,0x82,0x00,0x01,0xff,0x63,0xcc,0x82,0x00,0x10,0x08,0x01,0xff,0x63,0xcc,
+	0x87,0x00,0x01,0xff,0x63,0xcc,0x87,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x63,0xcc,
+	0x8c,0x00,0x01,0xff,0x63,0xcc,0x8c,0x00,0x10,0x08,0x01,0xff,0x64,0xcc,0x8c,0x00,
+	0x01,0xff,0x64,0xcc,0x8c,0x00,0xd3,0x3b,0xd2,0x1b,0xd1,0x0b,0x10,0x07,0x01,0xff,
+	0xc4,0x91,0x00,0x01,0x00,0x10,0x08,0x01,0xff,0x65,0xcc,0x84,0x00,0x01,0xff,0x65,
+	0xcc,0x84,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x65,0xcc,0x86,0x00,0x01,0xff,0x65,
+	0xcc,0x86,0x00,0x10,0x08,0x01,0xff,0x65,0xcc,0x87,0x00,0x01,0xff,0x65,0xcc,0x87,
+	0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x65,0xcc,0xa8,0x00,0x01,0xff,0x65,
+	0xcc,0xa8,0x00,0x10,0x08,0x01,0xff,0x65,0xcc,0x8c,0x00,0x01,0xff,0x65,0xcc,0x8c,
+	0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x67,0xcc,0x82,0x00,0x01,0xff,0x67,0xcc,0x82,
+	0x00,0x10,0x08,0x01,0xff,0x67,0xcc,0x86,0x00,0x01,0xff,0x67,0xcc,0x86,0x00,0xd4,
+	0x7b,0xd3,0x3b,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x67,0xcc,0x87,0x00,0x01,
+	0xff,0x67,0xcc,0x87,0x00,0x10,0x08,0x01,0xff,0x67,0xcc,0xa7,0x00,0x01,0xff,0x67,
+	0xcc,0xa7,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x68,0xcc,0x82,0x00,0x01,0xff,0x68,
+	0xcc,0x82,0x00,0x10,0x07,0x01,0xff,0xc4,0xa7,0x00,0x01,0x00,0xd2,0x20,0xd1,0x10,
+	0x10,0x08,0x01,0xff,0x69,0xcc,0x83,0x00,0x01,0xff,0x69,0xcc,0x83,0x00,0x10,0x08,
+	0x01,0xff,0x69,0xcc,0x84,0x00,0x01,0xff,0x69,0xcc,0x84,0x00,0xd1,0x10,0x10,0x08,
+	0x01,0xff,0x69,0xcc,0x86,0x00,0x01,0xff,0x69,0xcc,0x86,0x00,0x10,0x08,0x01,0xff,
+	0x69,0xcc,0xa8,0x00,0x01,0xff,0x69,0xcc,0xa8,0x00,0xd3,0x37,0xd2,0x17,0xd1,0x0c,
+	0x10,0x08,0x01,0xff,0x69,0xcc,0x87,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xc4,0xb3,
+	0x00,0x01,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x6a,0xcc,0x82,0x00,0x01,0xff,0x6a,
+	0xcc,0x82,0x00,0x10,0x08,0x01,0xff,0x6b,0xcc,0xa7,0x00,0x01,0xff,0x6b,0xcc,0xa7,
+	0x00,0xd2,0x1c,0xd1,0x0c,0x10,0x04,0x01,0x00,0x01,0xff,0x6c,0xcc,0x81,0x00,0x10,
+	0x08,0x01,0xff,0x6c,0xcc,0x81,0x00,0x01,0xff,0x6c,0xcc,0xa7,0x00,0xd1,0x10,0x10,
+	0x08,0x01,0xff,0x6c,0xcc,0xa7,0x00,0x01,0xff,0x6c,0xcc,0x8c,0x00,0x10,0x08,0x01,
+	0xff,0x6c,0xcc,0x8c,0x00,0x01,0xff,0xc5,0x80,0x00,0xcf,0x86,0xd5,0xed,0xd4,0x72,
+	0xd3,0x37,0xd2,0x17,0xd1,0x0b,0x10,0x04,0x01,0x00,0x01,0xff,0xc5,0x82,0x00,0x10,
+	0x04,0x01,0x00,0x01,0xff,0x6e,0xcc,0x81,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x6e,
+	0xcc,0x81,0x00,0x01,0xff,0x6e,0xcc,0xa7,0x00,0x10,0x08,0x01,0xff,0x6e,0xcc,0xa7,
+	0x00,0x01,0xff,0x6e,0xcc,0x8c,0x00,0xd2,0x1b,0xd1,0x10,0x10,0x08,0x01,0xff,0x6e,
+	0xcc,0x8c,0x00,0x01,0xff,0xca,0xbc,0x6e,0x00,0x10,0x07,0x01,0xff,0xc5,0x8b,0x00,
+	0x01,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x6f,0xcc,0x84,0x00,0x01,0xff,0x6f,0xcc,
+	0x84,0x00,0x10,0x08,0x01,0xff,0x6f,0xcc,0x86,0x00,0x01,0xff,0x6f,0xcc,0x86,0x00,
+	0xd3,0x3b,0xd2,0x1b,0xd1,0x10,0x10,0x08,0x01,0xff,0x6f,0xcc,0x8b,0x00,0x01,0xff,
+	0x6f,0xcc,0x8b,0x00,0x10,0x07,0x01,0xff,0xc5,0x93,0x00,0x01,0x00,0xd1,0x10,0x10,
+	0x08,0x01,0xff,0x72,0xcc,0x81,0x00,0x01,0xff,0x72,0xcc,0x81,0x00,0x10,0x08,0x01,
+	0xff,0x72,0xcc,0xa7,0x00,0x01,0xff,0x72,0xcc,0xa7,0x00,0xd2,0x20,0xd1,0x10,0x10,
+	0x08,0x01,0xff,0x72,0xcc,0x8c,0x00,0x01,0xff,0x72,0xcc,0x8c,0x00,0x10,0x08,0x01,
+	0xff,0x73,0xcc,0x81,0x00,0x01,0xff,0x73,0xcc,0x81,0x00,0xd1,0x10,0x10,0x08,0x01,
+	0xff,0x73,0xcc,0x82,0x00,0x01,0xff,0x73,0xcc,0x82,0x00,0x10,0x08,0x01,0xff,0x73,
+	0xcc,0xa7,0x00,0x01,0xff,0x73,0xcc,0xa7,0x00,0xd4,0x7b,0xd3,0x3b,0xd2,0x20,0xd1,
+	0x10,0x10,0x08,0x01,0xff,0x73,0xcc,0x8c,0x00,0x01,0xff,0x73,0xcc,0x8c,0x00,0x10,
+	0x08,0x01,0xff,0x74,0xcc,0xa7,0x00,0x01,0xff,0x74,0xcc,0xa7,0x00,0xd1,0x10,0x10,
+	0x08,0x01,0xff,0x74,0xcc,0x8c,0x00,0x01,0xff,0x74,0xcc,0x8c,0x00,0x10,0x07,0x01,
+	0xff,0xc5,0xa7,0x00,0x01,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x75,0xcc,
+	0x83,0x00,0x01,0xff,0x75,0xcc,0x83,0x00,0x10,0x08,0x01,0xff,0x75,0xcc,0x84,0x00,
+	0x01,0xff,0x75,0xcc,0x84,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x75,0xcc,0x86,0x00,
+	0x01,0xff,0x75,0xcc,0x86,0x00,0x10,0x08,0x01,0xff,0x75,0xcc,0x8a,0x00,0x01,0xff,
+	0x75,0xcc,0x8a,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x75,0xcc,
+	0x8b,0x00,0x01,0xff,0x75,0xcc,0x8b,0x00,0x10,0x08,0x01,0xff,0x75,0xcc,0xa8,0x00,
+	0x01,0xff,0x75,0xcc,0xa8,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x77,0xcc,0x82,0x00,
+	0x01,0xff,0x77,0xcc,0x82,0x00,0x10,0x08,0x01,0xff,0x79,0xcc,0x82,0x00,0x01,0xff,
+	0x79,0xcc,0x82,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x79,0xcc,0x88,0x00,
+	0x01,0xff,0x7a,0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x7a,0xcc,0x81,0x00,0x01,0xff,
+	0x7a,0xcc,0x87,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x7a,0xcc,0x87,0x00,0x01,0xff,
+	0x7a,0xcc,0x8c,0x00,0x10,0x08,0x01,0xff,0x7a,0xcc,0x8c,0x00,0x01,0xff,0x73,0x00,
+	0xe0,0x65,0x01,0xcf,0x86,0xd5,0xb4,0xd4,0x5a,0xd3,0x2f,0xd2,0x16,0xd1,0x0b,0x10,
+	0x04,0x01,0x00,0x01,0xff,0xc9,0x93,0x00,0x10,0x07,0x01,0xff,0xc6,0x83,0x00,0x01,
+	0x00,0xd1,0x0b,0x10,0x07,0x01,0xff,0xc6,0x85,0x00,0x01,0x00,0x10,0x07,0x01,0xff,
+	0xc9,0x94,0x00,0x01,0xff,0xc6,0x88,0x00,0xd2,0x19,0xd1,0x0b,0x10,0x04,0x01,0x00,
+	0x01,0xff,0xc9,0x96,0x00,0x10,0x07,0x01,0xff,0xc9,0x97,0x00,0x01,0xff,0xc6,0x8c,
+	0x00,0x51,0x04,0x01,0x00,0x10,0x07,0x01,0xff,0xc7,0x9d,0x00,0x01,0xff,0xc9,0x99,
+	0x00,0xd3,0x32,0xd2,0x19,0xd1,0x0e,0x10,0x07,0x01,0xff,0xc9,0x9b,0x00,0x01,0xff,
+	0xc6,0x92,0x00,0x10,0x04,0x01,0x00,0x01,0xff,0xc9,0xa0,0x00,0xd1,0x0b,0x10,0x07,
+	0x01,0xff,0xc9,0xa3,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xc9,0xa9,0x00,0x01,0xff,
+	0xc9,0xa8,0x00,0xd2,0x0f,0x91,0x0b,0x10,0x07,0x01,0xff,0xc6,0x99,0x00,0x01,0x00,
+	0x01,0x00,0xd1,0x0e,0x10,0x07,0x01,0xff,0xc9,0xaf,0x00,0x01,0xff,0xc9,0xb2,0x00,
+	0x10,0x04,0x01,0x00,0x01,0xff,0xc9,0xb5,0x00,0xd4,0x5d,0xd3,0x34,0xd2,0x1b,0xd1,
+	0x10,0x10,0x08,0x01,0xff,0x6f,0xcc,0x9b,0x00,0x01,0xff,0x6f,0xcc,0x9b,0x00,0x10,
+	0x07,0x01,0xff,0xc6,0xa3,0x00,0x01,0x00,0xd1,0x0b,0x10,0x07,0x01,0xff,0xc6,0xa5,
+	0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xca,0x80,0x00,0x01,0xff,0xc6,0xa8,0x00,0xd2,
+	0x0f,0x91,0x0b,0x10,0x04,0x01,0x00,0x01,0xff,0xca,0x83,0x00,0x01,0x00,0xd1,0x0b,
+	0x10,0x07,0x01,0xff,0xc6,0xad,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xca,0x88,0x00,
+	0x01,0xff,0x75,0xcc,0x9b,0x00,0xd3,0x33,0xd2,0x1d,0xd1,0x0f,0x10,0x08,0x01,0xff,
+	0x75,0xcc,0x9b,0x00,0x01,0xff,0xca,0x8a,0x00,0x10,0x07,0x01,0xff,0xca,0x8b,0x00,
+	0x01,0xff,0xc6,0xb4,0x00,0xd1,0x0b,0x10,0x04,0x01,0x00,0x01,0xff,0xc6,0xb6,0x00,
+	0x10,0x04,0x01,0x00,0x01,0xff,0xca,0x92,0x00,0xd2,0x0f,0x91,0x0b,0x10,0x07,0x01,
+	0xff,0xc6,0xb9,0x00,0x01,0x00,0x01,0x00,0x91,0x0b,0x10,0x07,0x01,0xff,0xc6,0xbd,
+	0x00,0x01,0x00,0x01,0x00,0xcf,0x86,0xd5,0xd4,0xd4,0x44,0xd3,0x16,0x52,0x04,0x01,
+	0x00,0x51,0x07,0x01,0xff,0xc7,0x86,0x00,0x10,0x04,0x01,0x00,0x01,0xff,0xc7,0x89,
+	0x00,0xd2,0x12,0x91,0x0b,0x10,0x07,0x01,0xff,0xc7,0x89,0x00,0x01,0x00,0x01,0xff,
+	0xc7,0x8c,0x00,0xd1,0x0c,0x10,0x04,0x01,0x00,0x01,0xff,0x61,0xcc,0x8c,0x00,0x10,
+	0x08,0x01,0xff,0x61,0xcc,0x8c,0x00,0x01,0xff,0x69,0xcc,0x8c,0x00,0xd3,0x46,0xd2,
+	0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x69,0xcc,0x8c,0x00,0x01,0xff,0x6f,0xcc,0x8c,
+	0x00,0x10,0x08,0x01,0xff,0x6f,0xcc,0x8c,0x00,0x01,0xff,0x75,0xcc,0x8c,0x00,0xd1,
+	0x12,0x10,0x08,0x01,0xff,0x75,0xcc,0x8c,0x00,0x01,0xff,0x75,0xcc,0x88,0xcc,0x84,
+	0x00,0x10,0x0a,0x01,0xff,0x75,0xcc,0x88,0xcc,0x84,0x00,0x01,0xff,0x75,0xcc,0x88,
+	0xcc,0x81,0x00,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x75,0xcc,0x88,0xcc,0x81,
+	0x00,0x01,0xff,0x75,0xcc,0x88,0xcc,0x8c,0x00,0x10,0x0a,0x01,0xff,0x75,0xcc,0x88,
+	0xcc,0x8c,0x00,0x01,0xff,0x75,0xcc,0x88,0xcc,0x80,0x00,0xd1,0x0e,0x10,0x0a,0x01,
+	0xff,0x75,0xcc,0x88,0xcc,0x80,0x00,0x01,0x00,0x10,0x0a,0x01,0xff,0x61,0xcc,0x88,
+	0xcc,0x84,0x00,0x01,0xff,0x61,0xcc,0x88,0xcc,0x84,0x00,0xd4,0x87,0xd3,0x41,0xd2,
+	0x26,0xd1,0x14,0x10,0x0a,0x01,0xff,0x61,0xcc,0x87,0xcc,0x84,0x00,0x01,0xff,0x61,
+	0xcc,0x87,0xcc,0x84,0x00,0x10,0x09,0x01,0xff,0xc3,0xa6,0xcc,0x84,0x00,0x01,0xff,
+	0xc3,0xa6,0xcc,0x84,0x00,0xd1,0x0b,0x10,0x07,0x01,0xff,0xc7,0xa5,0x00,0x01,0x00,
+	0x10,0x08,0x01,0xff,0x67,0xcc,0x8c,0x00,0x01,0xff,0x67,0xcc,0x8c,0x00,0xd2,0x20,
+	0xd1,0x10,0x10,0x08,0x01,0xff,0x6b,0xcc,0x8c,0x00,0x01,0xff,0x6b,0xcc,0x8c,0x00,
+	0x10,0x08,0x01,0xff,0x6f,0xcc,0xa8,0x00,0x01,0xff,0x6f,0xcc,0xa8,0x00,0xd1,0x14,
+	0x10,0x0a,0x01,0xff,0x6f,0xcc,0xa8,0xcc,0x84,0x00,0x01,0xff,0x6f,0xcc,0xa8,0xcc,
+	0x84,0x00,0x10,0x09,0x01,0xff,0xca,0x92,0xcc,0x8c,0x00,0x01,0xff,0xca,0x92,0xcc,
+	0x8c,0x00,0xd3,0x38,0xd2,0x1a,0xd1,0x0f,0x10,0x08,0x01,0xff,0x6a,0xcc,0x8c,0x00,
+	0x01,0xff,0xc7,0xb3,0x00,0x10,0x07,0x01,0xff,0xc7,0xb3,0x00,0x01,0x00,0xd1,0x10,
+	0x10,0x08,0x01,0xff,0x67,0xcc,0x81,0x00,0x01,0xff,0x67,0xcc,0x81,0x00,0x10,0x07,
+	0x04,0xff,0xc6,0x95,0x00,0x04,0xff,0xc6,0xbf,0x00,0xd2,0x24,0xd1,0x10,0x10,0x08,
+	0x04,0xff,0x6e,0xcc,0x80,0x00,0x04,0xff,0x6e,0xcc,0x80,0x00,0x10,0x0a,0x01,0xff,
+	0x61,0xcc,0x8a,0xcc,0x81,0x00,0x01,0xff,0x61,0xcc,0x8a,0xcc,0x81,0x00,0xd1,0x12,
+	0x10,0x09,0x01,0xff,0xc3,0xa6,0xcc,0x81,0x00,0x01,0xff,0xc3,0xa6,0xcc,0x81,0x00,
+	0x10,0x09,0x01,0xff,0xc3,0xb8,0xcc,0x81,0x00,0x01,0xff,0xc3,0xb8,0xcc,0x81,0x00,
+	0xe2,0x31,0x02,0xe1,0xc3,0x44,0xe0,0xc8,0x01,0xcf,0x86,0xd5,0xfb,0xd4,0x80,0xd3,
+	0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x61,0xcc,0x8f,0x00,0x01,0xff,0x61,
+	0xcc,0x8f,0x00,0x10,0x08,0x01,0xff,0x61,0xcc,0x91,0x00,0x01,0xff,0x61,0xcc,0x91,
+	0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x65,0xcc,0x8f,0x00,0x01,0xff,0x65,0xcc,0x8f,
+	0x00,0x10,0x08,0x01,0xff,0x65,0xcc,0x91,0x00,0x01,0xff,0x65,0xcc,0x91,0x00,0xd2,
+	0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x69,0xcc,0x8f,0x00,0x01,0xff,0x69,0xcc,0x8f,
+	0x00,0x10,0x08,0x01,0xff,0x69,0xcc,0x91,0x00,0x01,0xff,0x69,0xcc,0x91,0x00,0xd1,
+	0x10,0x10,0x08,0x01,0xff,0x6f,0xcc,0x8f,0x00,0x01,0xff,0x6f,0xcc,0x8f,0x00,0x10,
+	0x08,0x01,0xff,0x6f,0xcc,0x91,0x00,0x01,0xff,0x6f,0xcc,0x91,0x00,0xd3,0x40,0xd2,
+	0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x72,0xcc,0x8f,0x00,0x01,0xff,0x72,0xcc,0x8f,
+	0x00,0x10,0x08,0x01,0xff,0x72,0xcc,0x91,0x00,0x01,0xff,0x72,0xcc,0x91,0x00,0xd1,
+	0x10,0x10,0x08,0x01,0xff,0x75,0xcc,0x8f,0x00,0x01,0xff,0x75,0xcc,0x8f,0x00,0x10,
+	0x08,0x01,0xff,0x75,0xcc,0x91,0x00,0x01,0xff,0x75,0xcc,0x91,0x00,0xd2,0x20,0xd1,
+	0x10,0x10,0x08,0x04,0xff,0x73,0xcc,0xa6,0x00,0x04,0xff,0x73,0xcc,0xa6,0x00,0x10,
+	0x08,0x04,0xff,0x74,0xcc,0xa6,0x00,0x04,0xff,0x74,0xcc,0xa6,0x00,0xd1,0x0b,0x10,
+	0x07,0x04,0xff,0xc8,0x9d,0x00,0x04,0x00,0x10,0x08,0x04,0xff,0x68,0xcc,0x8c,0x00,
+	0x04,0xff,0x68,0xcc,0x8c,0x00,0xd4,0x79,0xd3,0x31,0xd2,0x16,0xd1,0x0b,0x10,0x07,
+	0x06,0xff,0xc6,0x9e,0x00,0x07,0x00,0x10,0x07,0x04,0xff,0xc8,0xa3,0x00,0x04,0x00,
+	0xd1,0x0b,0x10,0x07,0x04,0xff,0xc8,0xa5,0x00,0x04,0x00,0x10,0x08,0x04,0xff,0x61,
+	0xcc,0x87,0x00,0x04,0xff,0x61,0xcc,0x87,0x00,0xd2,0x24,0xd1,0x10,0x10,0x08,0x04,
+	0xff,0x65,0xcc,0xa7,0x00,0x04,0xff,0x65,0xcc,0xa7,0x00,0x10,0x0a,0x04,0xff,0x6f,
+	0xcc,0x88,0xcc,0x84,0x00,0x04,0xff,0x6f,0xcc,0x88,0xcc,0x84,0x00,0xd1,0x14,0x10,
+	0x0a,0x04,0xff,0x6f,0xcc,0x83,0xcc,0x84,0x00,0x04,0xff,0x6f,0xcc,0x83,0xcc,0x84,
+	0x00,0x10,0x08,0x04,0xff,0x6f,0xcc,0x87,0x00,0x04,0xff,0x6f,0xcc,0x87,0x00,0xd3,
+	0x27,0xe2,0x21,0x43,0xd1,0x14,0x10,0x0a,0x04,0xff,0x6f,0xcc,0x87,0xcc,0x84,0x00,
+	0x04,0xff,0x6f,0xcc,0x87,0xcc,0x84,0x00,0x10,0x08,0x04,0xff,0x79,0xcc,0x84,0x00,
+	0x04,0xff,0x79,0xcc,0x84,0x00,0xd2,0x13,0x51,0x04,0x08,0x00,0x10,0x08,0x08,0xff,
+	0xe2,0xb1,0xa5,0x00,0x08,0xff,0xc8,0xbc,0x00,0xd1,0x0b,0x10,0x04,0x08,0x00,0x08,
+	0xff,0xc6,0x9a,0x00,0x10,0x08,0x08,0xff,0xe2,0xb1,0xa6,0x00,0x08,0x00,0xcf,0x86,
+	0x95,0x5f,0x94,0x5b,0xd3,0x2f,0xd2,0x16,0xd1,0x0b,0x10,0x04,0x08,0x00,0x08,0xff,
+	0xc9,0x82,0x00,0x10,0x04,0x09,0x00,0x09,0xff,0xc6,0x80,0x00,0xd1,0x0e,0x10,0x07,
+	0x09,0xff,0xca,0x89,0x00,0x09,0xff,0xca,0x8c,0x00,0x10,0x07,0x09,0xff,0xc9,0x87,
+	0x00,0x09,0x00,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x09,0xff,0xc9,0x89,0x00,0x09,0x00,
+	0x10,0x07,0x09,0xff,0xc9,0x8b,0x00,0x09,0x00,0xd1,0x0b,0x10,0x07,0x09,0xff,0xc9,
+	0x8d,0x00,0x09,0x00,0x10,0x07,0x09,0xff,0xc9,0x8f,0x00,0x09,0x00,0x01,0x00,0x01,
+	0x00,0xd1,0x8b,0xd0,0x0c,0xcf,0x86,0xe5,0x10,0x43,0x64,0xef,0x42,0x01,0xe6,0xcf,
+	0x86,0xd5,0x2a,0xe4,0x99,0x43,0xe3,0x7f,0x43,0xd2,0x11,0xe1,0x5e,0x43,0x10,0x07,
+	0x01,0xff,0xcc,0x80,0x00,0x01,0xff,0xcc,0x81,0x00,0xe1,0x65,0x43,0x10,0x09,0x01,
+	0xff,0xcc,0x88,0xcc,0x81,0x00,0x01,0xff,0xce,0xb9,0x00,0xd4,0x0f,0x93,0x0b,0x92,
+	0x07,0x61,0xab,0x43,0x01,0xea,0x06,0xe6,0x06,0xe6,0xd3,0x2c,0xd2,0x16,0xd1,0x0b,
+	0x10,0x07,0x0a,0xff,0xcd,0xb1,0x00,0x0a,0x00,0x10,0x07,0x0a,0xff,0xcd,0xb3,0x00,
+	0x0a,0x00,0xd1,0x0b,0x10,0x07,0x01,0xff,0xca,0xb9,0x00,0x01,0x00,0x10,0x07,0x0a,
+	0xff,0xcd,0xb7,0x00,0x0a,0x00,0xd2,0x07,0x61,0x97,0x43,0x00,0x00,0x51,0x04,0x09,
+	0x00,0x10,0x06,0x01,0xff,0x3b,0x00,0x10,0xff,0xcf,0xb3,0x00,0xe0,0x31,0x01,0xcf,
+	0x86,0xd5,0xd3,0xd4,0x5f,0xd3,0x21,0x52,0x04,0x00,0x00,0xd1,0x0d,0x10,0x04,0x01,
+	0x00,0x01,0xff,0xc2,0xa8,0xcc,0x81,0x00,0x10,0x09,0x01,0xff,0xce,0xb1,0xcc,0x81,
+	0x00,0x01,0xff,0xc2,0xb7,0x00,0xd2,0x1f,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xb5,
+	0xcc,0x81,0x00,0x01,0xff,0xce,0xb7,0xcc,0x81,0x00,0x10,0x09,0x01,0xff,0xce,0xb9,
+	0xcc,0x81,0x00,0x00,0x00,0xd1,0x0d,0x10,0x09,0x01,0xff,0xce,0xbf,0xcc,0x81,0x00,
+	0x00,0x00,0x10,0x09,0x01,0xff,0xcf,0x85,0xcc,0x81,0x00,0x01,0xff,0xcf,0x89,0xcc,
+	0x81,0x00,0xd3,0x3c,0xd2,0x20,0xd1,0x12,0x10,0x0b,0x01,0xff,0xce,0xb9,0xcc,0x88,
+	0xcc,0x81,0x00,0x01,0xff,0xce,0xb1,0x00,0x10,0x07,0x01,0xff,0xce,0xb2,0x00,0x01,
+	0xff,0xce,0xb3,0x00,0xd1,0x0e,0x10,0x07,0x01,0xff,0xce,0xb4,0x00,0x01,0xff,0xce,
+	0xb5,0x00,0x10,0x07,0x01,0xff,0xce,0xb6,0x00,0x01,0xff,0xce,0xb7,0x00,0xd2,0x1c,
+	0xd1,0x0e,0x10,0x07,0x01,0xff,0xce,0xb8,0x00,0x01,0xff,0xce,0xb9,0x00,0x10,0x07,
+	0x01,0xff,0xce,0xba,0x00,0x01,0xff,0xce,0xbb,0x00,0xd1,0x0e,0x10,0x07,0x01,0xff,
+	0xce,0xbc,0x00,0x01,0xff,0xce,0xbd,0x00,0x10,0x07,0x01,0xff,0xce,0xbe,0x00,0x01,
+	0xff,0xce,0xbf,0x00,0xe4,0x85,0x43,0xd3,0x35,0xd2,0x19,0xd1,0x0e,0x10,0x07,0x01,
+	0xff,0xcf,0x80,0x00,0x01,0xff,0xcf,0x81,0x00,0x10,0x04,0x00,0x00,0x01,0xff,0xcf,
+	0x83,0x00,0xd1,0x0e,0x10,0x07,0x01,0xff,0xcf,0x84,0x00,0x01,0xff,0xcf,0x85,0x00,
+	0x10,0x07,0x01,0xff,0xcf,0x86,0x00,0x01,0xff,0xcf,0x87,0x00,0xe2,0x2b,0x43,0xd1,
+	0x0e,0x10,0x07,0x01,0xff,0xcf,0x88,0x00,0x01,0xff,0xcf,0x89,0x00,0x10,0x09,0x01,
+	0xff,0xce,0xb9,0xcc,0x88,0x00,0x01,0xff,0xcf,0x85,0xcc,0x88,0x00,0xcf,0x86,0xd5,
+	0x94,0xd4,0x3c,0xd3,0x13,0x92,0x0f,0x51,0x04,0x01,0x00,0x10,0x07,0x01,0xff,0xcf,
+	0x83,0x00,0x01,0x00,0x01,0x00,0xd2,0x07,0x61,0x3a,0x43,0x01,0x00,0xd1,0x12,0x10,
+	0x09,0x01,0xff,0xce,0xbf,0xcc,0x81,0x00,0x01,0xff,0xcf,0x85,0xcc,0x81,0x00,0x10,
+	0x09,0x01,0xff,0xcf,0x89,0xcc,0x81,0x00,0x0a,0xff,0xcf,0x97,0x00,0xd3,0x2c,0xd2,
+	0x11,0xe1,0x46,0x43,0x10,0x07,0x01,0xff,0xce,0xb2,0x00,0x01,0xff,0xce,0xb8,0x00,
+	0xd1,0x10,0x10,0x09,0x01,0xff,0xcf,0x92,0xcc,0x88,0x00,0x01,0xff,0xcf,0x86,0x00,
+	0x10,0x07,0x01,0xff,0xcf,0x80,0x00,0x04,0x00,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x06,
+	0xff,0xcf,0x99,0x00,0x06,0x00,0x10,0x07,0x01,0xff,0xcf,0x9b,0x00,0x04,0x00,0xd1,
+	0x0b,0x10,0x07,0x01,0xff,0xcf,0x9d,0x00,0x04,0x00,0x10,0x07,0x01,0xff,0xcf,0x9f,
+	0x00,0x04,0x00,0xd4,0x58,0xd3,0x2c,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x01,0xff,0xcf,
+	0xa1,0x00,0x04,0x00,0x10,0x07,0x01,0xff,0xcf,0xa3,0x00,0x01,0x00,0xd1,0x0b,0x10,
+	0x07,0x01,0xff,0xcf,0xa5,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xcf,0xa7,0x00,0x01,
+	0x00,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x01,0xff,0xcf,0xa9,0x00,0x01,0x00,0x10,0x07,
+	0x01,0xff,0xcf,0xab,0x00,0x01,0x00,0xd1,0x0b,0x10,0x07,0x01,0xff,0xcf,0xad,0x00,
+	0x01,0x00,0x10,0x07,0x01,0xff,0xcf,0xaf,0x00,0x01,0x00,0xd3,0x2b,0xd2,0x12,0x91,
+	0x0e,0x10,0x07,0x01,0xff,0xce,0xba,0x00,0x01,0xff,0xcf,0x81,0x00,0x01,0x00,0xd1,
+	0x0e,0x10,0x07,0x05,0xff,0xce,0xb8,0x00,0x05,0xff,0xce,0xb5,0x00,0x10,0x04,0x06,
+	0x00,0x07,0xff,0xcf,0xb8,0x00,0xd2,0x16,0xd1,0x0b,0x10,0x04,0x07,0x00,0x07,0xff,
+	0xcf,0xb2,0x00,0x10,0x07,0x07,0xff,0xcf,0xbb,0x00,0x07,0x00,0xd1,0x0b,0x10,0x04,
+	0x08,0x00,0x08,0xff,0xcd,0xbb,0x00,0x10,0x07,0x08,0xff,0xcd,0xbc,0x00,0x08,0xff,
+	0xcd,0xbd,0x00,0xe3,0xed,0x46,0xe2,0x3d,0x05,0xe1,0x27,0x02,0xe0,0x66,0x01,0xcf,
+	0x86,0xd5,0xf0,0xd4,0x7e,0xd3,0x40,0xd2,0x22,0xd1,0x12,0x10,0x09,0x04,0xff,0xd0,
+	0xb5,0xcc,0x80,0x00,0x01,0xff,0xd0,0xb5,0xcc,0x88,0x00,0x10,0x07,0x01,0xff,0xd1,
+	0x92,0x00,0x01,0xff,0xd0,0xb3,0xcc,0x81,0x00,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd1,
+	0x94,0x00,0x01,0xff,0xd1,0x95,0x00,0x10,0x07,0x01,0xff,0xd1,0x96,0x00,0x01,0xff,
+	0xd1,0x96,0xcc,0x88,0x00,0xd2,0x1c,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd1,0x98,0x00,
+	0x01,0xff,0xd1,0x99,0x00,0x10,0x07,0x01,0xff,0xd1,0x9a,0x00,0x01,0xff,0xd1,0x9b,
+	0x00,0xd1,0x12,0x10,0x09,0x01,0xff,0xd0,0xba,0xcc,0x81,0x00,0x04,0xff,0xd0,0xb8,
+	0xcc,0x80,0x00,0x10,0x09,0x01,0xff,0xd1,0x83,0xcc,0x86,0x00,0x01,0xff,0xd1,0x9f,
+	0x00,0xd3,0x38,0xd2,0x1c,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd0,0xb0,0x00,0x01,0xff,
+	0xd0,0xb1,0x00,0x10,0x07,0x01,0xff,0xd0,0xb2,0x00,0x01,0xff,0xd0,0xb3,0x00,0xd1,
+	0x0e,0x10,0x07,0x01,0xff,0xd0,0xb4,0x00,0x01,0xff,0xd0,0xb5,0x00,0x10,0x07,0x01,
+	0xff,0xd0,0xb6,0x00,0x01,0xff,0xd0,0xb7,0x00,0xd2,0x1e,0xd1,0x10,0x10,0x07,0x01,
+	0xff,0xd0,0xb8,0x00,0x01,0xff,0xd0,0xb8,0xcc,0x86,0x00,0x10,0x07,0x01,0xff,0xd0,
+	0xba,0x00,0x01,0xff,0xd0,0xbb,0x00,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd0,0xbc,0x00,
+	0x01,0xff,0xd0,0xbd,0x00,0x10,0x07,0x01,0xff,0xd0,0xbe,0x00,0x01,0xff,0xd0,0xbf,
+	0x00,0xe4,0x25,0x42,0xd3,0x38,0xd2,0x1c,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd1,0x80,
+	0x00,0x01,0xff,0xd1,0x81,0x00,0x10,0x07,0x01,0xff,0xd1,0x82,0x00,0x01,0xff,0xd1,
+	0x83,0x00,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd1,0x84,0x00,0x01,0xff,0xd1,0x85,0x00,
+	0x10,0x07,0x01,0xff,0xd1,0x86,0x00,0x01,0xff,0xd1,0x87,0x00,0xd2,0x1c,0xd1,0x0e,
+	0x10,0x07,0x01,0xff,0xd1,0x88,0x00,0x01,0xff,0xd1,0x89,0x00,0x10,0x07,0x01,0xff,
+	0xd1,0x8a,0x00,0x01,0xff,0xd1,0x8b,0x00,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd1,0x8c,
+	0x00,0x01,0xff,0xd1,0x8d,0x00,0x10,0x07,0x01,0xff,0xd1,0x8e,0x00,0x01,0xff,0xd1,
+	0x8f,0x00,0xcf,0x86,0xd5,0x07,0x64,0xcf,0x41,0x01,0x00,0xd4,0x58,0xd3,0x2c,0xd2,
+	0x16,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd1,0xa1,0x00,0x01,0x00,0x10,0x07,0x01,0xff,
+	0xd1,0xa3,0x00,0x01,0x00,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd1,0xa5,0x00,0x01,0x00,
+	0x10,0x07,0x01,0xff,0xd1,0xa7,0x00,0x01,0x00,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x01,
+	0xff,0xd1,0xa9,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xd1,0xab,0x00,0x01,0x00,0xd1,
+	0x0b,0x10,0x07,0x01,0xff,0xd1,0xad,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xd1,0xaf,
+	0x00,0x01,0x00,0xd3,0x33,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd1,0xb1,0x00,
+	0x01,0x00,0x10,0x07,0x01,0xff,0xd1,0xb3,0x00,0x01,0x00,0xd1,0x0b,0x10,0x07,0x01,
+	0xff,0xd1,0xb5,0x00,0x01,0x00,0x10,0x09,0x01,0xff,0xd1,0xb5,0xcc,0x8f,0x00,0x01,
+	0xff,0xd1,0xb5,0xcc,0x8f,0x00,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd1,0xb9,
+	0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xd1,0xbb,0x00,0x01,0x00,0xd1,0x0b,0x10,0x07,
+	0x01,0xff,0xd1,0xbd,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xd1,0xbf,0x00,0x01,0x00,
+	0xe0,0x41,0x01,0xcf,0x86,0xd5,0x8e,0xd4,0x36,0xd3,0x11,0xe2,0x91,0x41,0xe1,0x88,
+	0x41,0x10,0x07,0x01,0xff,0xd2,0x81,0x00,0x01,0x00,0xd2,0x0f,0x51,0x04,0x04,0x00,
+	0x10,0x07,0x06,0xff,0xd2,0x8b,0x00,0x06,0x00,0xd1,0x0b,0x10,0x07,0x04,0xff,0xd2,
+	0x8d,0x00,0x04,0x00,0x10,0x07,0x04,0xff,0xd2,0x8f,0x00,0x04,0x00,0xd3,0x2c,0xd2,
+	0x16,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd2,0x91,0x00,0x01,0x00,0x10,0x07,0x01,0xff,
+	0xd2,0x93,0x00,0x01,0x00,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd2,0x95,0x00,0x01,0x00,
+	0x10,0x07,0x01,0xff,0xd2,0x97,0x00,0x01,0x00,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x01,
+	0xff,0xd2,0x99,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xd2,0x9b,0x00,0x01,0x00,0xd1,
+	0x0b,0x10,0x07,0x01,0xff,0xd2,0x9d,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xd2,0x9f,
+	0x00,0x01,0x00,0xd4,0x58,0xd3,0x2c,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd2,
+	0xa1,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xd2,0xa3,0x00,0x01,0x00,0xd1,0x0b,0x10,
+	0x07,0x01,0xff,0xd2,0xa5,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xd2,0xa7,0x00,0x01,
+	0x00,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd2,0xa9,0x00,0x01,0x00,0x10,0x07,
+	0x01,0xff,0xd2,0xab,0x00,0x01,0x00,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd2,0xad,0x00,
+	0x01,0x00,0x10,0x07,0x01,0xff,0xd2,0xaf,0x00,0x01,0x00,0xd3,0x2c,0xd2,0x16,0xd1,
+	0x0b,0x10,0x07,0x01,0xff,0xd2,0xb1,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xd2,0xb3,
+	0x00,0x01,0x00,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd2,0xb5,0x00,0x01,0x00,0x10,0x07,
+	0x01,0xff,0xd2,0xb7,0x00,0x01,0x00,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd2,
+	0xb9,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xd2,0xbb,0x00,0x01,0x00,0xd1,0x0b,0x10,
+	0x07,0x01,0xff,0xd2,0xbd,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xd2,0xbf,0x00,0x01,
+	0x00,0xcf,0x86,0xd5,0xdc,0xd4,0x5a,0xd3,0x36,0xd2,0x20,0xd1,0x10,0x10,0x07,0x01,
+	0xff,0xd3,0x8f,0x00,0x01,0xff,0xd0,0xb6,0xcc,0x86,0x00,0x10,0x09,0x01,0xff,0xd0,
+	0xb6,0xcc,0x86,0x00,0x01,0xff,0xd3,0x84,0x00,0xd1,0x0b,0x10,0x04,0x01,0x00,0x06,
+	0xff,0xd3,0x86,0x00,0x10,0x04,0x06,0x00,0x01,0xff,0xd3,0x88,0x00,0xd2,0x16,0xd1,
+	0x0b,0x10,0x04,0x01,0x00,0x06,0xff,0xd3,0x8a,0x00,0x10,0x04,0x06,0x00,0x01,0xff,
+	0xd3,0x8c,0x00,0xe1,0x69,0x40,0x10,0x04,0x01,0x00,0x06,0xff,0xd3,0x8e,0x00,0xd3,
+	0x41,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,0xff,0xd0,0xb0,0xcc,0x86,0x00,0x01,0xff,
+	0xd0,0xb0,0xcc,0x86,0x00,0x10,0x09,0x01,0xff,0xd0,0xb0,0xcc,0x88,0x00,0x01,0xff,
+	0xd0,0xb0,0xcc,0x88,0x00,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd3,0x95,0x00,0x01,0x00,
+	0x10,0x09,0x01,0xff,0xd0,0xb5,0xcc,0x86,0x00,0x01,0xff,0xd0,0xb5,0xcc,0x86,0x00,
+	0xd2,0x1d,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd3,0x99,0x00,0x01,0x00,0x10,0x09,0x01,
+	0xff,0xd3,0x99,0xcc,0x88,0x00,0x01,0xff,0xd3,0x99,0xcc,0x88,0x00,0xd1,0x12,0x10,
+	0x09,0x01,0xff,0xd0,0xb6,0xcc,0x88,0x00,0x01,0xff,0xd0,0xb6,0xcc,0x88,0x00,0x10,
+	0x09,0x01,0xff,0xd0,0xb7,0xcc,0x88,0x00,0x01,0xff,0xd0,0xb7,0xcc,0x88,0x00,0xd4,
+	0x82,0xd3,0x41,0xd2,0x1d,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd3,0xa1,0x00,0x01,0x00,
+	0x10,0x09,0x01,0xff,0xd0,0xb8,0xcc,0x84,0x00,0x01,0xff,0xd0,0xb8,0xcc,0x84,0x00,
+	0xd1,0x12,0x10,0x09,0x01,0xff,0xd0,0xb8,0xcc,0x88,0x00,0x01,0xff,0xd0,0xb8,0xcc,
+	0x88,0x00,0x10,0x09,0x01,0xff,0xd0,0xbe,0xcc,0x88,0x00,0x01,0xff,0xd0,0xbe,0xcc,
+	0x88,0x00,0xd2,0x1d,0xd1,0x0b,0x10,0x07,0x01,0xff,0xd3,0xa9,0x00,0x01,0x00,0x10,
+	0x09,0x01,0xff,0xd3,0xa9,0xcc,0x88,0x00,0x01,0xff,0xd3,0xa9,0xcc,0x88,0x00,0xd1,
+	0x12,0x10,0x09,0x04,0xff,0xd1,0x8d,0xcc,0x88,0x00,0x04,0xff,0xd1,0x8d,0xcc,0x88,
+	0x00,0x10,0x09,0x01,0xff,0xd1,0x83,0xcc,0x84,0x00,0x01,0xff,0xd1,0x83,0xcc,0x84,
+	0x00,0xd3,0x41,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,0xff,0xd1,0x83,0xcc,0x88,0x00,
+	0x01,0xff,0xd1,0x83,0xcc,0x88,0x00,0x10,0x09,0x01,0xff,0xd1,0x83,0xcc,0x8b,0x00,
+	0x01,0xff,0xd1,0x83,0xcc,0x8b,0x00,0xd1,0x12,0x10,0x09,0x01,0xff,0xd1,0x87,0xcc,
+	0x88,0x00,0x01,0xff,0xd1,0x87,0xcc,0x88,0x00,0x10,0x07,0x08,0xff,0xd3,0xb7,0x00,
+	0x08,0x00,0xd2,0x1d,0xd1,0x12,0x10,0x09,0x01,0xff,0xd1,0x8b,0xcc,0x88,0x00,0x01,
+	0xff,0xd1,0x8b,0xcc,0x88,0x00,0x10,0x07,0x09,0xff,0xd3,0xbb,0x00,0x09,0x00,0xd1,
+	0x0b,0x10,0x07,0x09,0xff,0xd3,0xbd,0x00,0x09,0x00,0x10,0x07,0x09,0xff,0xd3,0xbf,
+	0x00,0x09,0x00,0xe1,0x26,0x02,0xe0,0x78,0x01,0xcf,0x86,0xd5,0xb0,0xd4,0x58,0xd3,
+	0x2c,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x06,0xff,0xd4,0x81,0x00,0x06,0x00,0x10,0x07,
+	0x06,0xff,0xd4,0x83,0x00,0x06,0x00,0xd1,0x0b,0x10,0x07,0x06,0xff,0xd4,0x85,0x00,
+	0x06,0x00,0x10,0x07,0x06,0xff,0xd4,0x87,0x00,0x06,0x00,0xd2,0x16,0xd1,0x0b,0x10,
+	0x07,0x06,0xff,0xd4,0x89,0x00,0x06,0x00,0x10,0x07,0x06,0xff,0xd4,0x8b,0x00,0x06,
+	0x00,0xd1,0x0b,0x10,0x07,0x06,0xff,0xd4,0x8d,0x00,0x06,0x00,0x10,0x07,0x06,0xff,
+	0xd4,0x8f,0x00,0x06,0x00,0xd3,0x2c,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x09,0xff,0xd4,
+	0x91,0x00,0x09,0x00,0x10,0x07,0x09,0xff,0xd4,0x93,0x00,0x09,0x00,0xd1,0x0b,0x10,
+	0x07,0x0a,0xff,0xd4,0x95,0x00,0x0a,0x00,0x10,0x07,0x0a,0xff,0xd4,0x97,0x00,0x0a,
+	0x00,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x0a,0xff,0xd4,0x99,0x00,0x0a,0x00,0x10,0x07,
+	0x0a,0xff,0xd4,0x9b,0x00,0x0a,0x00,0xd1,0x0b,0x10,0x07,0x0a,0xff,0xd4,0x9d,0x00,
+	0x0a,0x00,0x10,0x07,0x0a,0xff,0xd4,0x9f,0x00,0x0a,0x00,0xd4,0x58,0xd3,0x2c,0xd2,
+	0x16,0xd1,0x0b,0x10,0x07,0x0a,0xff,0xd4,0xa1,0x00,0x0a,0x00,0x10,0x07,0x0a,0xff,
+	0xd4,0xa3,0x00,0x0a,0x00,0xd1,0x0b,0x10,0x07,0x0b,0xff,0xd4,0xa5,0x00,0x0b,0x00,
+	0x10,0x07,0x0c,0xff,0xd4,0xa7,0x00,0x0c,0x00,0xd2,0x16,0xd1,0x0b,0x10,0x07,0x10,
+	0xff,0xd4,0xa9,0x00,0x10,0x00,0x10,0x07,0x10,0xff,0xd4,0xab,0x00,0x10,0x00,0xd1,
+	0x0b,0x10,0x07,0x10,0xff,0xd4,0xad,0x00,0x10,0x00,0x10,0x07,0x10,0xff,0xd4,0xaf,
+	0x00,0x10,0x00,0xd3,0x35,0xd2,0x19,0xd1,0x0b,0x10,0x04,0x00,0x00,0x01,0xff,0xd5,
+	0xa1,0x00,0x10,0x07,0x01,0xff,0xd5,0xa2,0x00,0x01,0xff,0xd5,0xa3,0x00,0xd1,0x0e,
+	0x10,0x07,0x01,0xff,0xd5,0xa4,0x00,0x01,0xff,0xd5,0xa5,0x00,0x10,0x07,0x01,0xff,
+	0xd5,0xa6,0x00,0x01,0xff,0xd5,0xa7,0x00,0xd2,0x1c,0xd1,0x0e,0x10,0x07,0x01,0xff,
+	0xd5,0xa8,0x00,0x01,0xff,0xd5,0xa9,0x00,0x10,0x07,0x01,0xff,0xd5,0xaa,0x00,0x01,
+	0xff,0xd5,0xab,0x00,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd5,0xac,0x00,0x01,0xff,0xd5,
+	0xad,0x00,0x10,0x07,0x01,0xff,0xd5,0xae,0x00,0x01,0xff,0xd5,0xaf,0x00,0xcf,0x86,
+	0xe5,0x08,0x3f,0xd4,0x70,0xd3,0x38,0xd2,0x1c,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd5,
+	0xb0,0x00,0x01,0xff,0xd5,0xb1,0x00,0x10,0x07,0x01,0xff,0xd5,0xb2,0x00,0x01,0xff,
+	0xd5,0xb3,0x00,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd5,0xb4,0x00,0x01,0xff,0xd5,0xb5,
+	0x00,0x10,0x07,0x01,0xff,0xd5,0xb6,0x00,0x01,0xff,0xd5,0xb7,0x00,0xd2,0x1c,0xd1,
+	0x0e,0x10,0x07,0x01,0xff,0xd5,0xb8,0x00,0x01,0xff,0xd5,0xb9,0x00,0x10,0x07,0x01,
+	0xff,0xd5,0xba,0x00,0x01,0xff,0xd5,0xbb,0x00,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd5,
+	0xbc,0x00,0x01,0xff,0xd5,0xbd,0x00,0x10,0x07,0x01,0xff,0xd5,0xbe,0x00,0x01,0xff,
+	0xd5,0xbf,0x00,0xe3,0x87,0x3e,0xd2,0x1c,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd6,0x80,
+	0x00,0x01,0xff,0xd6,0x81,0x00,0x10,0x07,0x01,0xff,0xd6,0x82,0x00,0x01,0xff,0xd6,
+	0x83,0x00,0xd1,0x0e,0x10,0x07,0x01,0xff,0xd6,0x84,0x00,0x01,0xff,0xd6,0x85,0x00,
+	0x10,0x07,0x01,0xff,0xd6,0x86,0x00,0x00,0x00,0xe0,0x2f,0x3f,0xcf,0x86,0xe5,0xc0,
+	0x3e,0xe4,0x97,0x3e,0xe3,0x76,0x3e,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,
+	0x04,0x01,0x00,0x01,0xff,0xd5,0xa5,0xd6,0x82,0x00,0xe4,0x3e,0x25,0xe3,0xc3,0x1a,
+	0xe2,0x7b,0x81,0xe1,0xc0,0x13,0xd0,0x1e,0xcf,0x86,0xc5,0xe4,0x08,0x4b,0xe3,0x53,
+	0x46,0xe2,0xe9,0x43,0xe1,0x1c,0x43,0xe0,0xe1,0x42,0xcf,0x86,0xe5,0xa6,0x42,0x64,
+	0x89,0x42,0x0b,0x00,0xcf,0x86,0xe5,0xfa,0x01,0xe4,0x03,0x56,0xe3,0x76,0x01,0xe2,
+	0x8e,0x53,0xd1,0x0c,0xe0,0xef,0x52,0xcf,0x86,0x65,0x8d,0x52,0x04,0x00,0xe0,0x0d,
+	0x01,0xcf,0x86,0xd5,0x0a,0xe4,0x10,0x53,0x63,0xff,0x52,0x0a,0x00,0xd4,0x80,0xd3,
+	0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe2,0xb4,0x80,0x00,0x01,0xff,0xe2,
+	0xb4,0x81,0x00,0x10,0x08,0x01,0xff,0xe2,0xb4,0x82,0x00,0x01,0xff,0xe2,0xb4,0x83,
+	0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe2,0xb4,0x84,0x00,0x01,0xff,0xe2,0xb4,0x85,
+	0x00,0x10,0x08,0x01,0xff,0xe2,0xb4,0x86,0x00,0x01,0xff,0xe2,0xb4,0x87,0x00,0xd2,
+	0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe2,0xb4,0x88,0x00,0x01,0xff,0xe2,0xb4,0x89,
+	0x00,0x10,0x08,0x01,0xff,0xe2,0xb4,0x8a,0x00,0x01,0xff,0xe2,0xb4,0x8b,0x00,0xd1,
+	0x10,0x10,0x08,0x01,0xff,0xe2,0xb4,0x8c,0x00,0x01,0xff,0xe2,0xb4,0x8d,0x00,0x10,
+	0x08,0x01,0xff,0xe2,0xb4,0x8e,0x00,0x01,0xff,0xe2,0xb4,0x8f,0x00,0xd3,0x40,0xd2,
+	0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe2,0xb4,0x90,0x00,0x01,0xff,0xe2,0xb4,0x91,
+	0x00,0x10,0x08,0x01,0xff,0xe2,0xb4,0x92,0x00,0x01,0xff,0xe2,0xb4,0x93,0x00,0xd1,
+	0x10,0x10,0x08,0x01,0xff,0xe2,0xb4,0x94,0x00,0x01,0xff,0xe2,0xb4,0x95,0x00,0x10,
+	0x08,0x01,0xff,0xe2,0xb4,0x96,0x00,0x01,0xff,0xe2,0xb4,0x97,0x00,0xd2,0x20,0xd1,
+	0x10,0x10,0x08,0x01,0xff,0xe2,0xb4,0x98,0x00,0x01,0xff,0xe2,0xb4,0x99,0x00,0x10,
+	0x08,0x01,0xff,0xe2,0xb4,0x9a,0x00,0x01,0xff,0xe2,0xb4,0x9b,0x00,0xd1,0x10,0x10,
+	0x08,0x01,0xff,0xe2,0xb4,0x9c,0x00,0x01,0xff,0xe2,0xb4,0x9d,0x00,0x10,0x08,0x01,
+	0xff,0xe2,0xb4,0x9e,0x00,0x01,0xff,0xe2,0xb4,0x9f,0x00,0xcf,0x86,0xe5,0x42,0x52,
+	0x94,0x50,0xd3,0x3c,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe2,0xb4,0xa0,0x00,
+	0x01,0xff,0xe2,0xb4,0xa1,0x00,0x10,0x08,0x01,0xff,0xe2,0xb4,0xa2,0x00,0x01,0xff,
+	0xe2,0xb4,0xa3,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe2,0xb4,0xa4,0x00,0x01,0xff,
+	0xe2,0xb4,0xa5,0x00,0x10,0x04,0x00,0x00,0x0d,0xff,0xe2,0xb4,0xa7,0x00,0x52,0x04,
+	0x00,0x00,0x91,0x0c,0x10,0x04,0x00,0x00,0x0d,0xff,0xe2,0xb4,0xad,0x00,0x00,0x00,
+	0x01,0x00,0xd2,0x1b,0xe1,0xfc,0x52,0xe0,0xad,0x52,0xcf,0x86,0x95,0x0f,0x94,0x0b,
+	0x93,0x07,0x62,0x92,0x52,0x04,0x00,0x04,0x00,0x04,0x00,0x04,0x00,0xd1,0x13,0xe0,
+	0xd3,0x53,0xcf,0x86,0x95,0x0a,0xe4,0xa8,0x53,0x63,0x97,0x53,0x04,0x00,0x04,0x00,
+	0xd0,0x0d,0xcf,0x86,0x95,0x07,0x64,0x22,0x54,0x08,0x00,0x04,0x00,0xcf,0x86,0x55,
+	0x04,0x04,0x00,0x54,0x04,0x04,0x00,0xd3,0x07,0x62,0x2f,0x54,0x04,0x00,0xd2,0x20,
+	0xd1,0x10,0x10,0x08,0x11,0xff,0xe1,0x8f,0xb0,0x00,0x11,0xff,0xe1,0x8f,0xb1,0x00,
+	0x10,0x08,0x11,0xff,0xe1,0x8f,0xb2,0x00,0x11,0xff,0xe1,0x8f,0xb3,0x00,0x91,0x10,
+	0x10,0x08,0x11,0xff,0xe1,0x8f,0xb4,0x00,0x11,0xff,0xe1,0x8f,0xb5,0x00,0x00,0x00,
+	0xd4,0x1c,0xe3,0xe0,0x56,0xe2,0x17,0x56,0xe1,0xda,0x55,0xe0,0xbb,0x55,0xcf,0x86,
+	0x95,0x0a,0xe4,0xa4,0x55,0x63,0x88,0x55,0x04,0x00,0x04,0x00,0xe3,0xd2,0x01,0xe2,
+	0x2b,0x5a,0xd1,0x0c,0xe0,0x4c,0x59,0xcf,0x86,0x65,0x25,0x59,0x0a,0x00,0xe0,0x9c,
+	0x59,0xcf,0x86,0xd5,0xc5,0xd4,0x45,0xd3,0x31,0xd2,0x1c,0xd1,0x0e,0x10,0x07,0x12,
+	0xff,0xd0,0xb2,0x00,0x12,0xff,0xd0,0xb4,0x00,0x10,0x07,0x12,0xff,0xd0,0xbe,0x00,
+	0x12,0xff,0xd1,0x81,0x00,0x51,0x07,0x12,0xff,0xd1,0x82,0x00,0x10,0x07,0x12,0xff,
+	0xd1,0x8a,0x00,0x12,0xff,0xd1,0xa3,0x00,0x92,0x10,0x91,0x0c,0x10,0x08,0x12,0xff,
+	0xea,0x99,0x8b,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,
+	0x10,0x08,0x14,0xff,0xe1,0x83,0x90,0x00,0x14,0xff,0xe1,0x83,0x91,0x00,0x10,0x08,
+	0x14,0xff,0xe1,0x83,0x92,0x00,0x14,0xff,0xe1,0x83,0x93,0x00,0xd1,0x10,0x10,0x08,
+	0x14,0xff,0xe1,0x83,0x94,0x00,0x14,0xff,0xe1,0x83,0x95,0x00,0x10,0x08,0x14,0xff,
+	0xe1,0x83,0x96,0x00,0x14,0xff,0xe1,0x83,0x97,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,
+	0x14,0xff,0xe1,0x83,0x98,0x00,0x14,0xff,0xe1,0x83,0x99,0x00,0x10,0x08,0x14,0xff,
+	0xe1,0x83,0x9a,0x00,0x14,0xff,0xe1,0x83,0x9b,0x00,0xd1,0x10,0x10,0x08,0x14,0xff,
+	0xe1,0x83,0x9c,0x00,0x14,0xff,0xe1,0x83,0x9d,0x00,0x10,0x08,0x14,0xff,0xe1,0x83,
+	0x9e,0x00,0x14,0xff,0xe1,0x83,0x9f,0x00,0xd4,0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10,
+	0x10,0x08,0x14,0xff,0xe1,0x83,0xa0,0x00,0x14,0xff,0xe1,0x83,0xa1,0x00,0x10,0x08,
+	0x14,0xff,0xe1,0x83,0xa2,0x00,0x14,0xff,0xe1,0x83,0xa3,0x00,0xd1,0x10,0x10,0x08,
+	0x14,0xff,0xe1,0x83,0xa4,0x00,0x14,0xff,0xe1,0x83,0xa5,0x00,0x10,0x08,0x14,0xff,
+	0xe1,0x83,0xa6,0x00,0x14,0xff,0xe1,0x83,0xa7,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,
+	0x14,0xff,0xe1,0x83,0xa8,0x00,0x14,0xff,0xe1,0x83,0xa9,0x00,0x10,0x08,0x14,0xff,
+	0xe1,0x83,0xaa,0x00,0x14,0xff,0xe1,0x83,0xab,0x00,0xd1,0x10,0x10,0x08,0x14,0xff,
+	0xe1,0x83,0xac,0x00,0x14,0xff,0xe1,0x83,0xad,0x00,0x10,0x08,0x14,0xff,0xe1,0x83,
+	0xae,0x00,0x14,0xff,0xe1,0x83,0xaf,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,
+	0x14,0xff,0xe1,0x83,0xb0,0x00,0x14,0xff,0xe1,0x83,0xb1,0x00,0x10,0x08,0x14,0xff,
+	0xe1,0x83,0xb2,0x00,0x14,0xff,0xe1,0x83,0xb3,0x00,0xd1,0x10,0x10,0x08,0x14,0xff,
+	0xe1,0x83,0xb4,0x00,0x14,0xff,0xe1,0x83,0xb5,0x00,0x10,0x08,0x14,0xff,0xe1,0x83,
+	0xb6,0x00,0x14,0xff,0xe1,0x83,0xb7,0x00,0xd2,0x1c,0xd1,0x10,0x10,0x08,0x14,0xff,
+	0xe1,0x83,0xb8,0x00,0x14,0xff,0xe1,0x83,0xb9,0x00,0x10,0x08,0x14,0xff,0xe1,0x83,
+	0xba,0x00,0x00,0x00,0xd1,0x0c,0x10,0x04,0x00,0x00,0x14,0xff,0xe1,0x83,0xbd,0x00,
+	0x10,0x08,0x14,0xff,0xe1,0x83,0xbe,0x00,0x14,0xff,0xe1,0x83,0xbf,0x00,0xe2,0x9d,
+	0x08,0xe1,0x48,0x04,0xe0,0x1c,0x02,0xcf,0x86,0xe5,0x11,0x01,0xd4,0x84,0xd3,0x40,
+	0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x61,0xcc,0xa5,0x00,0x01,0xff,0x61,0xcc,
+	0xa5,0x00,0x10,0x08,0x01,0xff,0x62,0xcc,0x87,0x00,0x01,0xff,0x62,0xcc,0x87,0x00,
+	0xd1,0x10,0x10,0x08,0x01,0xff,0x62,0xcc,0xa3,0x00,0x01,0xff,0x62,0xcc,0xa3,0x00,
+	0x10,0x08,0x01,0xff,0x62,0xcc,0xb1,0x00,0x01,0xff,0x62,0xcc,0xb1,0x00,0xd2,0x24,
+	0xd1,0x14,0x10,0x0a,0x01,0xff,0x63,0xcc,0xa7,0xcc,0x81,0x00,0x01,0xff,0x63,0xcc,
+	0xa7,0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x64,0xcc,0x87,0x00,0x01,0xff,0x64,0xcc,
+	0x87,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x64,0xcc,0xa3,0x00,0x01,0xff,0x64,0xcc,
+	0xa3,0x00,0x10,0x08,0x01,0xff,0x64,0xcc,0xb1,0x00,0x01,0xff,0x64,0xcc,0xb1,0x00,
+	0xd3,0x48,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x64,0xcc,0xa7,0x00,0x01,0xff,
+	0x64,0xcc,0xa7,0x00,0x10,0x08,0x01,0xff,0x64,0xcc,0xad,0x00,0x01,0xff,0x64,0xcc,
+	0xad,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x65,0xcc,0x84,0xcc,0x80,0x00,0x01,0xff,
+	0x65,0xcc,0x84,0xcc,0x80,0x00,0x10,0x0a,0x01,0xff,0x65,0xcc,0x84,0xcc,0x81,0x00,
+	0x01,0xff,0x65,0xcc,0x84,0xcc,0x81,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,
+	0x65,0xcc,0xad,0x00,0x01,0xff,0x65,0xcc,0xad,0x00,0x10,0x08,0x01,0xff,0x65,0xcc,
+	0xb0,0x00,0x01,0xff,0x65,0xcc,0xb0,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x65,0xcc,
+	0xa7,0xcc,0x86,0x00,0x01,0xff,0x65,0xcc,0xa7,0xcc,0x86,0x00,0x10,0x08,0x01,0xff,
+	0x66,0xcc,0x87,0x00,0x01,0xff,0x66,0xcc,0x87,0x00,0xd4,0x84,0xd3,0x40,0xd2,0x20,
+	0xd1,0x10,0x10,0x08,0x01,0xff,0x67,0xcc,0x84,0x00,0x01,0xff,0x67,0xcc,0x84,0x00,
+	0x10,0x08,0x01,0xff,0x68,0xcc,0x87,0x00,0x01,0xff,0x68,0xcc,0x87,0x00,0xd1,0x10,
+	0x10,0x08,0x01,0xff,0x68,0xcc,0xa3,0x00,0x01,0xff,0x68,0xcc,0xa3,0x00,0x10,0x08,
+	0x01,0xff,0x68,0xcc,0x88,0x00,0x01,0xff,0x68,0xcc,0x88,0x00,0xd2,0x20,0xd1,0x10,
+	0x10,0x08,0x01,0xff,0x68,0xcc,0xa7,0x00,0x01,0xff,0x68,0xcc,0xa7,0x00,0x10,0x08,
+	0x01,0xff,0x68,0xcc,0xae,0x00,0x01,0xff,0x68,0xcc,0xae,0x00,0xd1,0x10,0x10,0x08,
+	0x01,0xff,0x69,0xcc,0xb0,0x00,0x01,0xff,0x69,0xcc,0xb0,0x00,0x10,0x0a,0x01,0xff,
+	0x69,0xcc,0x88,0xcc,0x81,0x00,0x01,0xff,0x69,0xcc,0x88,0xcc,0x81,0x00,0xd3,0x40,
+	0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x6b,0xcc,0x81,0x00,0x01,0xff,0x6b,0xcc,
+	0x81,0x00,0x10,0x08,0x01,0xff,0x6b,0xcc,0xa3,0x00,0x01,0xff,0x6b,0xcc,0xa3,0x00,
+	0xd1,0x10,0x10,0x08,0x01,0xff,0x6b,0xcc,0xb1,0x00,0x01,0xff,0x6b,0xcc,0xb1,0x00,
+	0x10,0x08,0x01,0xff,0x6c,0xcc,0xa3,0x00,0x01,0xff,0x6c,0xcc,0xa3,0x00,0xd2,0x24,
+	0xd1,0x14,0x10,0x0a,0x01,0xff,0x6c,0xcc,0xa3,0xcc,0x84,0x00,0x01,0xff,0x6c,0xcc,
+	0xa3,0xcc,0x84,0x00,0x10,0x08,0x01,0xff,0x6c,0xcc,0xb1,0x00,0x01,0xff,0x6c,0xcc,
+	0xb1,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x6c,0xcc,0xad,0x00,0x01,0xff,0x6c,0xcc,
+	0xad,0x00,0x10,0x08,0x01,0xff,0x6d,0xcc,0x81,0x00,0x01,0xff,0x6d,0xcc,0x81,0x00,
+	0xcf,0x86,0xe5,0x15,0x01,0xd4,0x88,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,
+	0xff,0x6d,0xcc,0x87,0x00,0x01,0xff,0x6d,0xcc,0x87,0x00,0x10,0x08,0x01,0xff,0x6d,
+	0xcc,0xa3,0x00,0x01,0xff,0x6d,0xcc,0xa3,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x6e,
+	0xcc,0x87,0x00,0x01,0xff,0x6e,0xcc,0x87,0x00,0x10,0x08,0x01,0xff,0x6e,0xcc,0xa3,
+	0x00,0x01,0xff,0x6e,0xcc,0xa3,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x6e,
+	0xcc,0xb1,0x00,0x01,0xff,0x6e,0xcc,0xb1,0x00,0x10,0x08,0x01,0xff,0x6e,0xcc,0xad,
+	0x00,0x01,0xff,0x6e,0xcc,0xad,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x6f,0xcc,0x83,
+	0xcc,0x81,0x00,0x01,0xff,0x6f,0xcc,0x83,0xcc,0x81,0x00,0x10,0x0a,0x01,0xff,0x6f,
+	0xcc,0x83,0xcc,0x88,0x00,0x01,0xff,0x6f,0xcc,0x83,0xcc,0x88,0x00,0xd3,0x48,0xd2,
+	0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x6f,0xcc,0x84,0xcc,0x80,0x00,0x01,0xff,0x6f,
+	0xcc,0x84,0xcc,0x80,0x00,0x10,0x0a,0x01,0xff,0x6f,0xcc,0x84,0xcc,0x81,0x00,0x01,
+	0xff,0x6f,0xcc,0x84,0xcc,0x81,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x70,0xcc,0x81,
+	0x00,0x01,0xff,0x70,0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x70,0xcc,0x87,0x00,0x01,
+	0xff,0x70,0xcc,0x87,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x72,0xcc,0x87,
+	0x00,0x01,0xff,0x72,0xcc,0x87,0x00,0x10,0x08,0x01,0xff,0x72,0xcc,0xa3,0x00,0x01,
+	0xff,0x72,0xcc,0xa3,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x72,0xcc,0xa3,0xcc,0x84,
+	0x00,0x01,0xff,0x72,0xcc,0xa3,0xcc,0x84,0x00,0x10,0x08,0x01,0xff,0x72,0xcc,0xb1,
+	0x00,0x01,0xff,0x72,0xcc,0xb1,0x00,0xd4,0x8c,0xd3,0x48,0xd2,0x20,0xd1,0x10,0x10,
+	0x08,0x01,0xff,0x73,0xcc,0x87,0x00,0x01,0xff,0x73,0xcc,0x87,0x00,0x10,0x08,0x01,
+	0xff,0x73,0xcc,0xa3,0x00,0x01,0xff,0x73,0xcc,0xa3,0x00,0xd1,0x14,0x10,0x0a,0x01,
+	0xff,0x73,0xcc,0x81,0xcc,0x87,0x00,0x01,0xff,0x73,0xcc,0x81,0xcc,0x87,0x00,0x10,
+	0x0a,0x01,0xff,0x73,0xcc,0x8c,0xcc,0x87,0x00,0x01,0xff,0x73,0xcc,0x8c,0xcc,0x87,
+	0x00,0xd2,0x24,0xd1,0x14,0x10,0x0a,0x01,0xff,0x73,0xcc,0xa3,0xcc,0x87,0x00,0x01,
+	0xff,0x73,0xcc,0xa3,0xcc,0x87,0x00,0x10,0x08,0x01,0xff,0x74,0xcc,0x87,0x00,0x01,
+	0xff,0x74,0xcc,0x87,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x74,0xcc,0xa3,0x00,0x01,
+	0xff,0x74,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,0x74,0xcc,0xb1,0x00,0x01,0xff,0x74,
+	0xcc,0xb1,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x74,0xcc,0xad,
+	0x00,0x01,0xff,0x74,0xcc,0xad,0x00,0x10,0x08,0x01,0xff,0x75,0xcc,0xa4,0x00,0x01,
+	0xff,0x75,0xcc,0xa4,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x75,0xcc,0xb0,0x00,0x01,
+	0xff,0x75,0xcc,0xb0,0x00,0x10,0x08,0x01,0xff,0x75,0xcc,0xad,0x00,0x01,0xff,0x75,
+	0xcc,0xad,0x00,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x75,0xcc,0x83,0xcc,0x81,
+	0x00,0x01,0xff,0x75,0xcc,0x83,0xcc,0x81,0x00,0x10,0x0a,0x01,0xff,0x75,0xcc,0x84,
+	0xcc,0x88,0x00,0x01,0xff,0x75,0xcc,0x84,0xcc,0x88,0x00,0xd1,0x10,0x10,0x08,0x01,
+	0xff,0x76,0xcc,0x83,0x00,0x01,0xff,0x76,0xcc,0x83,0x00,0x10,0x08,0x01,0xff,0x76,
+	0xcc,0xa3,0x00,0x01,0xff,0x76,0xcc,0xa3,0x00,0xe0,0x11,0x02,0xcf,0x86,0xd5,0xe2,
+	0xd4,0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x77,0xcc,0x80,0x00,
+	0x01,0xff,0x77,0xcc,0x80,0x00,0x10,0x08,0x01,0xff,0x77,0xcc,0x81,0x00,0x01,0xff,
+	0x77,0xcc,0x81,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x77,0xcc,0x88,0x00,0x01,0xff,
+	0x77,0xcc,0x88,0x00,0x10,0x08,0x01,0xff,0x77,0xcc,0x87,0x00,0x01,0xff,0x77,0xcc,
+	0x87,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x77,0xcc,0xa3,0x00,0x01,0xff,
+	0x77,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,0x78,0xcc,0x87,0x00,0x01,0xff,0x78,0xcc,
+	0x87,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x78,0xcc,0x88,0x00,0x01,0xff,0x78,0xcc,
+	0x88,0x00,0x10,0x08,0x01,0xff,0x79,0xcc,0x87,0x00,0x01,0xff,0x79,0xcc,0x87,0x00,
+	0xd3,0x33,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x7a,0xcc,0x82,0x00,0x01,0xff,
+	0x7a,0xcc,0x82,0x00,0x10,0x08,0x01,0xff,0x7a,0xcc,0xa3,0x00,0x01,0xff,0x7a,0xcc,
+	0xa3,0x00,0xe1,0x12,0x59,0x10,0x08,0x01,0xff,0x7a,0xcc,0xb1,0x00,0x01,0xff,0x7a,
+	0xcc,0xb1,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x77,0xcc,0x8a,0x00,0x01,
+	0xff,0x79,0xcc,0x8a,0x00,0x10,0x08,0x01,0xff,0x61,0xca,0xbe,0x00,0x02,0xff,0x73,
+	0xcc,0x87,0x00,0x51,0x04,0x0a,0x00,0x10,0x07,0x0a,0xff,0x73,0x73,0x00,0x0a,0x00,
+	0xd4,0x98,0xd3,0x48,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x61,0xcc,0xa3,0x00,
+	0x01,0xff,0x61,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,0x61,0xcc,0x89,0x00,0x01,0xff,
+	0x61,0xcc,0x89,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x61,0xcc,0x82,0xcc,0x81,0x00,
+	0x01,0xff,0x61,0xcc,0x82,0xcc,0x81,0x00,0x10,0x0a,0x01,0xff,0x61,0xcc,0x82,0xcc,
+	0x80,0x00,0x01,0xff,0x61,0xcc,0x82,0xcc,0x80,0x00,0xd2,0x28,0xd1,0x14,0x10,0x0a,
+	0x01,0xff,0x61,0xcc,0x82,0xcc,0x89,0x00,0x01,0xff,0x61,0xcc,0x82,0xcc,0x89,0x00,
+	0x10,0x0a,0x01,0xff,0x61,0xcc,0x82,0xcc,0x83,0x00,0x01,0xff,0x61,0xcc,0x82,0xcc,
+	0x83,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x61,0xcc,0xa3,0xcc,0x82,0x00,0x01,0xff,
+	0x61,0xcc,0xa3,0xcc,0x82,0x00,0x10,0x0a,0x01,0xff,0x61,0xcc,0x86,0xcc,0x81,0x00,
+	0x01,0xff,0x61,0xcc,0x86,0xcc,0x81,0x00,0xd3,0x50,0xd2,0x28,0xd1,0x14,0x10,0x0a,
+	0x01,0xff,0x61,0xcc,0x86,0xcc,0x80,0x00,0x01,0xff,0x61,0xcc,0x86,0xcc,0x80,0x00,
+	0x10,0x0a,0x01,0xff,0x61,0xcc,0x86,0xcc,0x89,0x00,0x01,0xff,0x61,0xcc,0x86,0xcc,
+	0x89,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x61,0xcc,0x86,0xcc,0x83,0x00,0x01,0xff,
+	0x61,0xcc,0x86,0xcc,0x83,0x00,0x10,0x0a,0x01,0xff,0x61,0xcc,0xa3,0xcc,0x86,0x00,
+	0x01,0xff,0x61,0xcc,0xa3,0xcc,0x86,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,
+	0x65,0xcc,0xa3,0x00,0x01,0xff,0x65,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,0x65,0xcc,
+	0x89,0x00,0x01,0xff,0x65,0xcc,0x89,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x65,0xcc,
+	0x83,0x00,0x01,0xff,0x65,0xcc,0x83,0x00,0x10,0x0a,0x01,0xff,0x65,0xcc,0x82,0xcc,
+	0x81,0x00,0x01,0xff,0x65,0xcc,0x82,0xcc,0x81,0x00,0xcf,0x86,0xe5,0x31,0x01,0xd4,
+	0x90,0xd3,0x50,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x65,0xcc,0x82,0xcc,0x80,
+	0x00,0x01,0xff,0x65,0xcc,0x82,0xcc,0x80,0x00,0x10,0x0a,0x01,0xff,0x65,0xcc,0x82,
+	0xcc,0x89,0x00,0x01,0xff,0x65,0xcc,0x82,0xcc,0x89,0x00,0xd1,0x14,0x10,0x0a,0x01,
+	0xff,0x65,0xcc,0x82,0xcc,0x83,0x00,0x01,0xff,0x65,0xcc,0x82,0xcc,0x83,0x00,0x10,
+	0x0a,0x01,0xff,0x65,0xcc,0xa3,0xcc,0x82,0x00,0x01,0xff,0x65,0xcc,0xa3,0xcc,0x82,
+	0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x69,0xcc,0x89,0x00,0x01,0xff,0x69,
+	0xcc,0x89,0x00,0x10,0x08,0x01,0xff,0x69,0xcc,0xa3,0x00,0x01,0xff,0x69,0xcc,0xa3,
+	0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x6f,0xcc,0xa3,0x00,0x01,0xff,0x6f,0xcc,0xa3,
+	0x00,0x10,0x08,0x01,0xff,0x6f,0xcc,0x89,0x00,0x01,0xff,0x6f,0xcc,0x89,0x00,0xd3,
+	0x50,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x6f,0xcc,0x82,0xcc,0x81,0x00,0x01,
+	0xff,0x6f,0xcc,0x82,0xcc,0x81,0x00,0x10,0x0a,0x01,0xff,0x6f,0xcc,0x82,0xcc,0x80,
+	0x00,0x01,0xff,0x6f,0xcc,0x82,0xcc,0x80,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x6f,
+	0xcc,0x82,0xcc,0x89,0x00,0x01,0xff,0x6f,0xcc,0x82,0xcc,0x89,0x00,0x10,0x0a,0x01,
+	0xff,0x6f,0xcc,0x82,0xcc,0x83,0x00,0x01,0xff,0x6f,0xcc,0x82,0xcc,0x83,0x00,0xd2,
+	0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x6f,0xcc,0xa3,0xcc,0x82,0x00,0x01,0xff,0x6f,
+	0xcc,0xa3,0xcc,0x82,0x00,0x10,0x0a,0x01,0xff,0x6f,0xcc,0x9b,0xcc,0x81,0x00,0x01,
+	0xff,0x6f,0xcc,0x9b,0xcc,0x81,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x6f,0xcc,0x9b,
+	0xcc,0x80,0x00,0x01,0xff,0x6f,0xcc,0x9b,0xcc,0x80,0x00,0x10,0x0a,0x01,0xff,0x6f,
+	0xcc,0x9b,0xcc,0x89,0x00,0x01,0xff,0x6f,0xcc,0x9b,0xcc,0x89,0x00,0xd4,0x98,0xd3,
+	0x48,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x6f,0xcc,0x9b,0xcc,0x83,0x00,0x01,
+	0xff,0x6f,0xcc,0x9b,0xcc,0x83,0x00,0x10,0x0a,0x01,0xff,0x6f,0xcc,0x9b,0xcc,0xa3,
+	0x00,0x01,0xff,0x6f,0xcc,0x9b,0xcc,0xa3,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x75,
+	0xcc,0xa3,0x00,0x01,0xff,0x75,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,0x75,0xcc,0x89,
+	0x00,0x01,0xff,0x75,0xcc,0x89,0x00,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x75,
+	0xcc,0x9b,0xcc,0x81,0x00,0x01,0xff,0x75,0xcc,0x9b,0xcc,0x81,0x00,0x10,0x0a,0x01,
+	0xff,0x75,0xcc,0x9b,0xcc,0x80,0x00,0x01,0xff,0x75,0xcc,0x9b,0xcc,0x80,0x00,0xd1,
+	0x14,0x10,0x0a,0x01,0xff,0x75,0xcc,0x9b,0xcc,0x89,0x00,0x01,0xff,0x75,0xcc,0x9b,
+	0xcc,0x89,0x00,0x10,0x0a,0x01,0xff,0x75,0xcc,0x9b,0xcc,0x83,0x00,0x01,0xff,0x75,
+	0xcc,0x9b,0xcc,0x83,0x00,0xd3,0x44,0xd2,0x24,0xd1,0x14,0x10,0x0a,0x01,0xff,0x75,
+	0xcc,0x9b,0xcc,0xa3,0x00,0x01,0xff,0x75,0xcc,0x9b,0xcc,0xa3,0x00,0x10,0x08,0x01,
+	0xff,0x79,0xcc,0x80,0x00,0x01,0xff,0x79,0xcc,0x80,0x00,0xd1,0x10,0x10,0x08,0x01,
+	0xff,0x79,0xcc,0xa3,0x00,0x01,0xff,0x79,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,0x79,
+	0xcc,0x89,0x00,0x01,0xff,0x79,0xcc,0x89,0x00,0xd2,0x1c,0xd1,0x10,0x10,0x08,0x01,
+	0xff,0x79,0xcc,0x83,0x00,0x01,0xff,0x79,0xcc,0x83,0x00,0x10,0x08,0x0a,0xff,0xe1,
+	0xbb,0xbb,0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xe1,0xbb,0xbd,0x00,0x0a,
+	0x00,0x10,0x08,0x0a,0xff,0xe1,0xbb,0xbf,0x00,0x0a,0x00,0xe1,0xbf,0x02,0xe0,0xa1,
+	0x01,0xcf,0x86,0xd5,0xc6,0xd4,0x6c,0xd3,0x18,0xe2,0x0e,0x59,0xe1,0xf7,0x58,0x10,
+	0x09,0x01,0xff,0xce,0xb1,0xcc,0x93,0x00,0x01,0xff,0xce,0xb1,0xcc,0x94,0x00,0xd2,
+	0x28,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xb1,0xcc,0x93,0x00,0x01,0xff,0xce,0xb1,
+	0xcc,0x94,0x00,0x10,0x0b,0x01,0xff,0xce,0xb1,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,
+	0xce,0xb1,0xcc,0x94,0xcc,0x80,0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,0xb1,0xcc,
+	0x93,0xcc,0x81,0x00,0x01,0xff,0xce,0xb1,0xcc,0x94,0xcc,0x81,0x00,0x10,0x0b,0x01,
+	0xff,0xce,0xb1,0xcc,0x93,0xcd,0x82,0x00,0x01,0xff,0xce,0xb1,0xcc,0x94,0xcd,0x82,
+	0x00,0xd3,0x18,0xe2,0x4a,0x59,0xe1,0x33,0x59,0x10,0x09,0x01,0xff,0xce,0xb5,0xcc,
+	0x93,0x00,0x01,0xff,0xce,0xb5,0xcc,0x94,0x00,0xd2,0x28,0xd1,0x12,0x10,0x09,0x01,
+	0xff,0xce,0xb5,0xcc,0x93,0x00,0x01,0xff,0xce,0xb5,0xcc,0x94,0x00,0x10,0x0b,0x01,
+	0xff,0xce,0xb5,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,0xce,0xb5,0xcc,0x94,0xcc,0x80,
+	0x00,0x91,0x16,0x10,0x0b,0x01,0xff,0xce,0xb5,0xcc,0x93,0xcc,0x81,0x00,0x01,0xff,
+	0xce,0xb5,0xcc,0x94,0xcc,0x81,0x00,0x00,0x00,0xd4,0x6c,0xd3,0x18,0xe2,0x74,0x59,
+	0xe1,0x5d,0x59,0x10,0x09,0x01,0xff,0xce,0xb7,0xcc,0x93,0x00,0x01,0xff,0xce,0xb7,
+	0xcc,0x94,0x00,0xd2,0x28,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xb7,0xcc,0x93,0x00,
+	0x01,0xff,0xce,0xb7,0xcc,0x94,0x00,0x10,0x0b,0x01,0xff,0xce,0xb7,0xcc,0x93,0xcc,
+	0x80,0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0xcc,0x80,0x00,0xd1,0x16,0x10,0x0b,0x01,
+	0xff,0xce,0xb7,0xcc,0x93,0xcc,0x81,0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0xcc,0x81,
+	0x00,0x10,0x0b,0x01,0xff,0xce,0xb7,0xcc,0x93,0xcd,0x82,0x00,0x01,0xff,0xce,0xb7,
+	0xcc,0x94,0xcd,0x82,0x00,0xd3,0x18,0xe2,0xb0,0x59,0xe1,0x99,0x59,0x10,0x09,0x01,
+	0xff,0xce,0xb9,0xcc,0x93,0x00,0x01,0xff,0xce,0xb9,0xcc,0x94,0x00,0xd2,0x28,0xd1,
+	0x12,0x10,0x09,0x01,0xff,0xce,0xb9,0xcc,0x93,0x00,0x01,0xff,0xce,0xb9,0xcc,0x94,
+	0x00,0x10,0x0b,0x01,0xff,0xce,0xb9,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,0xce,0xb9,
+	0xcc,0x94,0xcc,0x80,0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,0xb9,0xcc,0x93,0xcc,
+	0x81,0x00,0x01,0xff,0xce,0xb9,0xcc,0x94,0xcc,0x81,0x00,0x10,0x0b,0x01,0xff,0xce,
+	0xb9,0xcc,0x93,0xcd,0x82,0x00,0x01,0xff,0xce,0xb9,0xcc,0x94,0xcd,0x82,0x00,0xcf,
+	0x86,0xd5,0xac,0xd4,0x5a,0xd3,0x18,0xe2,0xed,0x59,0xe1,0xd6,0x59,0x10,0x09,0x01,
+	0xff,0xce,0xbf,0xcc,0x93,0x00,0x01,0xff,0xce,0xbf,0xcc,0x94,0x00,0xd2,0x28,0xd1,
+	0x12,0x10,0x09,0x01,0xff,0xce,0xbf,0xcc,0x93,0x00,0x01,0xff,0xce,0xbf,0xcc,0x94,
+	0x00,0x10,0x0b,0x01,0xff,0xce,0xbf,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,0xce,0xbf,
+	0xcc,0x94,0xcc,0x80,0x00,0x91,0x16,0x10,0x0b,0x01,0xff,0xce,0xbf,0xcc,0x93,0xcc,
+	0x81,0x00,0x01,0xff,0xce,0xbf,0xcc,0x94,0xcc,0x81,0x00,0x00,0x00,0xd3,0x18,0xe2,
+	0x17,0x5a,0xe1,0x00,0x5a,0x10,0x09,0x01,0xff,0xcf,0x85,0xcc,0x93,0x00,0x01,0xff,
+	0xcf,0x85,0xcc,0x94,0x00,0xd2,0x1c,0xd1,0x0d,0x10,0x04,0x00,0x00,0x01,0xff,0xcf,
+	0x85,0xcc,0x94,0x00,0x10,0x04,0x00,0x00,0x01,0xff,0xcf,0x85,0xcc,0x94,0xcc,0x80,
+	0x00,0xd1,0x0f,0x10,0x04,0x00,0x00,0x01,0xff,0xcf,0x85,0xcc,0x94,0xcc,0x81,0x00,
+	0x10,0x04,0x00,0x00,0x01,0xff,0xcf,0x85,0xcc,0x94,0xcd,0x82,0x00,0xe4,0xd3,0x5a,
+	0xd3,0x18,0xe2,0x52,0x5a,0xe1,0x3b,0x5a,0x10,0x09,0x01,0xff,0xcf,0x89,0xcc,0x93,
+	0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0x00,0xd2,0x28,0xd1,0x12,0x10,0x09,0x01,0xff,
+	0xcf,0x89,0xcc,0x93,0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0x00,0x10,0x0b,0x01,0xff,
+	0xcf,0x89,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0xcc,0x80,0x00,
+	0xd1,0x16,0x10,0x0b,0x01,0xff,0xcf,0x89,0xcc,0x93,0xcc,0x81,0x00,0x01,0xff,0xcf,
+	0x89,0xcc,0x94,0xcc,0x81,0x00,0x10,0x0b,0x01,0xff,0xcf,0x89,0xcc,0x93,0xcd,0x82,
+	0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0xcd,0x82,0x00,0xe0,0xd9,0x02,0xcf,0x86,0xe5,
+	0x91,0x01,0xd4,0xc8,0xd3,0x64,0xd2,0x30,0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,0xb1,
+	0xcc,0x93,0xce,0xb9,0x00,0x01,0xff,0xce,0xb1,0xcc,0x94,0xce,0xb9,0x00,0x10,0x0d,
+	0x01,0xff,0xce,0xb1,0xcc,0x93,0xcc,0x80,0xce,0xb9,0x00,0x01,0xff,0xce,0xb1,0xcc,
+	0x94,0xcc,0x80,0xce,0xb9,0x00,0xd1,0x1a,0x10,0x0d,0x01,0xff,0xce,0xb1,0xcc,0x93,
+	0xcc,0x81,0xce,0xb9,0x00,0x01,0xff,0xce,0xb1,0xcc,0x94,0xcc,0x81,0xce,0xb9,0x00,
+	0x10,0x0d,0x01,0xff,0xce,0xb1,0xcc,0x93,0xcd,0x82,0xce,0xb9,0x00,0x01,0xff,0xce,
+	0xb1,0xcc,0x94,0xcd,0x82,0xce,0xb9,0x00,0xd2,0x30,0xd1,0x16,0x10,0x0b,0x01,0xff,
+	0xce,0xb1,0xcc,0x93,0xce,0xb9,0x00,0x01,0xff,0xce,0xb1,0xcc,0x94,0xce,0xb9,0x00,
+	0x10,0x0d,0x01,0xff,0xce,0xb1,0xcc,0x93,0xcc,0x80,0xce,0xb9,0x00,0x01,0xff,0xce,
+	0xb1,0xcc,0x94,0xcc,0x80,0xce,0xb9,0x00,0xd1,0x1a,0x10,0x0d,0x01,0xff,0xce,0xb1,
+	0xcc,0x93,0xcc,0x81,0xce,0xb9,0x00,0x01,0xff,0xce,0xb1,0xcc,0x94,0xcc,0x81,0xce,
+	0xb9,0x00,0x10,0x0d,0x01,0xff,0xce,0xb1,0xcc,0x93,0xcd,0x82,0xce,0xb9,0x00,0x01,
+	0xff,0xce,0xb1,0xcc,0x94,0xcd,0x82,0xce,0xb9,0x00,0xd3,0x64,0xd2,0x30,0xd1,0x16,
+	0x10,0x0b,0x01,0xff,0xce,0xb7,0xcc,0x93,0xce,0xb9,0x00,0x01,0xff,0xce,0xb7,0xcc,
+	0x94,0xce,0xb9,0x00,0x10,0x0d,0x01,0xff,0xce,0xb7,0xcc,0x93,0xcc,0x80,0xce,0xb9,
+	0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0xcc,0x80,0xce,0xb9,0x00,0xd1,0x1a,0x10,0x0d,
+	0x01,0xff,0xce,0xb7,0xcc,0x93,0xcc,0x81,0xce,0xb9,0x00,0x01,0xff,0xce,0xb7,0xcc,
+	0x94,0xcc,0x81,0xce,0xb9,0x00,0x10,0x0d,0x01,0xff,0xce,0xb7,0xcc,0x93,0xcd,0x82,
+	0xce,0xb9,0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0xcd,0x82,0xce,0xb9,0x00,0xd2,0x30,
+	0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,0xb7,0xcc,0x93,0xce,0xb9,0x00,0x01,0xff,0xce,
+	0xb7,0xcc,0x94,0xce,0xb9,0x00,0x10,0x0d,0x01,0xff,0xce,0xb7,0xcc,0x93,0xcc,0x80,
+	0xce,0xb9,0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0xcc,0x80,0xce,0xb9,0x00,0xd1,0x1a,
+	0x10,0x0d,0x01,0xff,0xce,0xb7,0xcc,0x93,0xcc,0x81,0xce,0xb9,0x00,0x01,0xff,0xce,
+	0xb7,0xcc,0x94,0xcc,0x81,0xce,0xb9,0x00,0x10,0x0d,0x01,0xff,0xce,0xb7,0xcc,0x93,
+	0xcd,0x82,0xce,0xb9,0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0xcd,0x82,0xce,0xb9,0x00,
+	0xd4,0xc8,0xd3,0x64,0xd2,0x30,0xd1,0x16,0x10,0x0b,0x01,0xff,0xcf,0x89,0xcc,0x93,
+	0xce,0xb9,0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0xce,0xb9,0x00,0x10,0x0d,0x01,0xff,
+	0xcf,0x89,0xcc,0x93,0xcc,0x80,0xce,0xb9,0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0xcc,
+	0x80,0xce,0xb9,0x00,0xd1,0x1a,0x10,0x0d,0x01,0xff,0xcf,0x89,0xcc,0x93,0xcc,0x81,
+	0xce,0xb9,0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0xcc,0x81,0xce,0xb9,0x00,0x10,0x0d,
+	0x01,0xff,0xcf,0x89,0xcc,0x93,0xcd,0x82,0xce,0xb9,0x00,0x01,0xff,0xcf,0x89,0xcc,
+	0x94,0xcd,0x82,0xce,0xb9,0x00,0xd2,0x30,0xd1,0x16,0x10,0x0b,0x01,0xff,0xcf,0x89,
+	0xcc,0x93,0xce,0xb9,0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0xce,0xb9,0x00,0x10,0x0d,
+	0x01,0xff,0xcf,0x89,0xcc,0x93,0xcc,0x80,0xce,0xb9,0x00,0x01,0xff,0xcf,0x89,0xcc,
+	0x94,0xcc,0x80,0xce,0xb9,0x00,0xd1,0x1a,0x10,0x0d,0x01,0xff,0xcf,0x89,0xcc,0x93,
+	0xcc,0x81,0xce,0xb9,0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0xcc,0x81,0xce,0xb9,0x00,
+	0x10,0x0d,0x01,0xff,0xcf,0x89,0xcc,0x93,0xcd,0x82,0xce,0xb9,0x00,0x01,0xff,0xcf,
+	0x89,0xcc,0x94,0xcd,0x82,0xce,0xb9,0x00,0xd3,0x49,0xd2,0x26,0xd1,0x12,0x10,0x09,
+	0x01,0xff,0xce,0xb1,0xcc,0x86,0x00,0x01,0xff,0xce,0xb1,0xcc,0x84,0x00,0x10,0x0b,
+	0x01,0xff,0xce,0xb1,0xcc,0x80,0xce,0xb9,0x00,0x01,0xff,0xce,0xb1,0xce,0xb9,0x00,
+	0xd1,0x0f,0x10,0x0b,0x01,0xff,0xce,0xb1,0xcc,0x81,0xce,0xb9,0x00,0x00,0x00,0x10,
+	0x09,0x01,0xff,0xce,0xb1,0xcd,0x82,0x00,0x01,0xff,0xce,0xb1,0xcd,0x82,0xce,0xb9,
+	0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xb1,0xcc,0x86,0x00,0x01,0xff,
+	0xce,0xb1,0xcc,0x84,0x00,0x10,0x09,0x01,0xff,0xce,0xb1,0xcc,0x80,0x00,0x01,0xff,
+	0xce,0xb1,0xcc,0x81,0x00,0xe1,0xf3,0x5a,0x10,0x09,0x01,0xff,0xce,0xb1,0xce,0xb9,
+	0x00,0x01,0x00,0xcf,0x86,0xd5,0xbd,0xd4,0x7e,0xd3,0x44,0xd2,0x21,0xd1,0x0d,0x10,
+	0x04,0x01,0x00,0x01,0xff,0xc2,0xa8,0xcd,0x82,0x00,0x10,0x0b,0x01,0xff,0xce,0xb7,
+	0xcc,0x80,0xce,0xb9,0x00,0x01,0xff,0xce,0xb7,0xce,0xb9,0x00,0xd1,0x0f,0x10,0x0b,
+	0x01,0xff,0xce,0xb7,0xcc,0x81,0xce,0xb9,0x00,0x00,0x00,0x10,0x09,0x01,0xff,0xce,
+	0xb7,0xcd,0x82,0x00,0x01,0xff,0xce,0xb7,0xcd,0x82,0xce,0xb9,0x00,0xd2,0x24,0xd1,
+	0x12,0x10,0x09,0x01,0xff,0xce,0xb5,0xcc,0x80,0x00,0x01,0xff,0xce,0xb5,0xcc,0x81,
+	0x00,0x10,0x09,0x01,0xff,0xce,0xb7,0xcc,0x80,0x00,0x01,0xff,0xce,0xb7,0xcc,0x81,
+	0x00,0xe1,0x02,0x5b,0x10,0x09,0x01,0xff,0xce,0xb7,0xce,0xb9,0x00,0x01,0xff,0xe1,
+	0xbe,0xbf,0xcc,0x80,0x00,0xd3,0x18,0xe2,0x28,0x5b,0xe1,0x11,0x5b,0x10,0x09,0x01,
+	0xff,0xce,0xb9,0xcc,0x86,0x00,0x01,0xff,0xce,0xb9,0xcc,0x84,0x00,0xe2,0x4c,0x5b,
+	0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xb9,0xcc,0x86,0x00,0x01,0xff,0xce,0xb9,0xcc,
+	0x84,0x00,0x10,0x09,0x01,0xff,0xce,0xb9,0xcc,0x80,0x00,0x01,0xff,0xce,0xb9,0xcc,
+	0x81,0x00,0xd4,0x51,0xd3,0x18,0xe2,0x6f,0x5b,0xe1,0x58,0x5b,0x10,0x09,0x01,0xff,
+	0xcf,0x85,0xcc,0x86,0x00,0x01,0xff,0xcf,0x85,0xcc,0x84,0x00,0xd2,0x24,0xd1,0x12,
+	0x10,0x09,0x01,0xff,0xcf,0x85,0xcc,0x86,0x00,0x01,0xff,0xcf,0x85,0xcc,0x84,0x00,
+	0x10,0x09,0x01,0xff,0xcf,0x85,0xcc,0x80,0x00,0x01,0xff,0xcf,0x85,0xcc,0x81,0x00,
+	0xe1,0x8f,0x5b,0x10,0x09,0x01,0xff,0xcf,0x81,0xcc,0x94,0x00,0x01,0xff,0xc2,0xa8,
+	0xcc,0x80,0x00,0xd3,0x3b,0xd2,0x18,0x51,0x04,0x00,0x00,0x10,0x0b,0x01,0xff,0xcf,
+	0x89,0xcc,0x80,0xce,0xb9,0x00,0x01,0xff,0xcf,0x89,0xce,0xb9,0x00,0xd1,0x0f,0x10,
+	0x0b,0x01,0xff,0xcf,0x89,0xcc,0x81,0xce,0xb9,0x00,0x00,0x00,0x10,0x09,0x01,0xff,
+	0xcf,0x89,0xcd,0x82,0x00,0x01,0xff,0xcf,0x89,0xcd,0x82,0xce,0xb9,0x00,0xd2,0x24,
+	0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xbf,0xcc,0x80,0x00,0x01,0xff,0xce,0xbf,0xcc,
+	0x81,0x00,0x10,0x09,0x01,0xff,0xcf,0x89,0xcc,0x80,0x00,0x01,0xff,0xcf,0x89,0xcc,
+	0x81,0x00,0xe1,0x99,0x5b,0x10,0x09,0x01,0xff,0xcf,0x89,0xce,0xb9,0x00,0x01,0xff,
+	0xc2,0xb4,0x00,0xe0,0x0c,0x68,0xcf,0x86,0xe5,0x23,0x02,0xe4,0x25,0x01,0xe3,0x85,
+	0x5e,0xd2,0x2a,0xe1,0x5f,0x5c,0xe0,0xdd,0x5b,0xcf,0x86,0xe5,0xbb,0x5b,0x94,0x1b,
+	0xe3,0xa4,0x5b,0x92,0x14,0x91,0x10,0x10,0x08,0x01,0xff,0xe2,0x80,0x82,0x00,0x01,
+	0xff,0xe2,0x80,0x83,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd1,0xd6,0xd0,0x46,0xcf,
+	0x86,0x55,0x04,0x01,0x00,0xd4,0x29,0xd3,0x13,0x52,0x04,0x01,0x00,0x51,0x04,0x01,
+	0x00,0x10,0x07,0x01,0xff,0xcf,0x89,0x00,0x01,0x00,0x92,0x12,0x51,0x04,0x01,0x00,
+	0x10,0x06,0x01,0xff,0x6b,0x00,0x01,0xff,0x61,0xcc,0x8a,0x00,0x01,0x00,0xe3,0x25,
+	0x5d,0x92,0x10,0x51,0x04,0x01,0x00,0x10,0x08,0x01,0xff,0xe2,0x85,0x8e,0x00,0x01,
+	0x00,0x01,0x00,0xcf,0x86,0xd5,0x0a,0xe4,0x42,0x5d,0x63,0x2d,0x5d,0x06,0x00,0x94,
+	0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe2,0x85,0xb0,0x00,0x01,
+	0xff,0xe2,0x85,0xb1,0x00,0x10,0x08,0x01,0xff,0xe2,0x85,0xb2,0x00,0x01,0xff,0xe2,
+	0x85,0xb3,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe2,0x85,0xb4,0x00,0x01,0xff,0xe2,
+	0x85,0xb5,0x00,0x10,0x08,0x01,0xff,0xe2,0x85,0xb6,0x00,0x01,0xff,0xe2,0x85,0xb7,
+	0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe2,0x85,0xb8,0x00,0x01,0xff,0xe2,
+	0x85,0xb9,0x00,0x10,0x08,0x01,0xff,0xe2,0x85,0xba,0x00,0x01,0xff,0xe2,0x85,0xbb,
+	0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe2,0x85,0xbc,0x00,0x01,0xff,0xe2,0x85,0xbd,
+	0x00,0x10,0x08,0x01,0xff,0xe2,0x85,0xbe,0x00,0x01,0xff,0xe2,0x85,0xbf,0x00,0x01,
+	0x00,0xe0,0x34,0x5d,0xcf,0x86,0xe5,0x13,0x5d,0xe4,0xf2,0x5c,0xe3,0xe1,0x5c,0xe2,
+	0xd4,0x5c,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x04,0xff,0xe2,0x86,0x84,0x00,
+	0xe3,0x23,0x61,0xe2,0xf0,0x60,0xd1,0x0c,0xe0,0x9d,0x60,0xcf,0x86,0x65,0x7e,0x60,
+	0x01,0x00,0xd0,0x62,0xcf,0x86,0x55,0x04,0x01,0x00,0x54,0x04,0x01,0x00,0xd3,0x18,
+	0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x08,0x01,0xff,0xe2,0x93,0x90,0x00,
+	0x01,0xff,0xe2,0x93,0x91,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe2,0x93,
+	0x92,0x00,0x01,0xff,0xe2,0x93,0x93,0x00,0x10,0x08,0x01,0xff,0xe2,0x93,0x94,0x00,
+	0x01,0xff,0xe2,0x93,0x95,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe2,0x93,0x96,0x00,
+	0x01,0xff,0xe2,0x93,0x97,0x00,0x10,0x08,0x01,0xff,0xe2,0x93,0x98,0x00,0x01,0xff,
+	0xe2,0x93,0x99,0x00,0xcf,0x86,0xe5,0x57,0x60,0x94,0x80,0xd3,0x40,0xd2,0x20,0xd1,
+	0x10,0x10,0x08,0x01,0xff,0xe2,0x93,0x9a,0x00,0x01,0xff,0xe2,0x93,0x9b,0x00,0x10,
+	0x08,0x01,0xff,0xe2,0x93,0x9c,0x00,0x01,0xff,0xe2,0x93,0x9d,0x00,0xd1,0x10,0x10,
+	0x08,0x01,0xff,0xe2,0x93,0x9e,0x00,0x01,0xff,0xe2,0x93,0x9f,0x00,0x10,0x08,0x01,
+	0xff,0xe2,0x93,0xa0,0x00,0x01,0xff,0xe2,0x93,0xa1,0x00,0xd2,0x20,0xd1,0x10,0x10,
+	0x08,0x01,0xff,0xe2,0x93,0xa2,0x00,0x01,0xff,0xe2,0x93,0xa3,0x00,0x10,0x08,0x01,
+	0xff,0xe2,0x93,0xa4,0x00,0x01,0xff,0xe2,0x93,0xa5,0x00,0xd1,0x10,0x10,0x08,0x01,
+	0xff,0xe2,0x93,0xa6,0x00,0x01,0xff,0xe2,0x93,0xa7,0x00,0x10,0x08,0x01,0xff,0xe2,
+	0x93,0xa8,0x00,0x01,0xff,0xe2,0x93,0xa9,0x00,0x01,0x00,0xd4,0x0c,0xe3,0x33,0x62,
+	0xe2,0x2c,0x62,0xcf,0x06,0x04,0x00,0xe3,0x0c,0x65,0xe2,0xff,0x63,0xe1,0x2e,0x02,
+	0xe0,0x84,0x01,0xcf,0x86,0xe5,0x01,0x01,0xd4,0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10,
+	0x10,0x08,0x08,0xff,0xe2,0xb0,0xb0,0x00,0x08,0xff,0xe2,0xb0,0xb1,0x00,0x10,0x08,
+	0x08,0xff,0xe2,0xb0,0xb2,0x00,0x08,0xff,0xe2,0xb0,0xb3,0x00,0xd1,0x10,0x10,0x08,
+	0x08,0xff,0xe2,0xb0,0xb4,0x00,0x08,0xff,0xe2,0xb0,0xb5,0x00,0x10,0x08,0x08,0xff,
+	0xe2,0xb0,0xb6,0x00,0x08,0xff,0xe2,0xb0,0xb7,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,
+	0x08,0xff,0xe2,0xb0,0xb8,0x00,0x08,0xff,0xe2,0xb0,0xb9,0x00,0x10,0x08,0x08,0xff,
+	0xe2,0xb0,0xba,0x00,0x08,0xff,0xe2,0xb0,0xbb,0x00,0xd1,0x10,0x10,0x08,0x08,0xff,
+	0xe2,0xb0,0xbc,0x00,0x08,0xff,0xe2,0xb0,0xbd,0x00,0x10,0x08,0x08,0xff,0xe2,0xb0,
+	0xbe,0x00,0x08,0xff,0xe2,0xb0,0xbf,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,
+	0x08,0xff,0xe2,0xb1,0x80,0x00,0x08,0xff,0xe2,0xb1,0x81,0x00,0x10,0x08,0x08,0xff,
+	0xe2,0xb1,0x82,0x00,0x08,0xff,0xe2,0xb1,0x83,0x00,0xd1,0x10,0x10,0x08,0x08,0xff,
+	0xe2,0xb1,0x84,0x00,0x08,0xff,0xe2,0xb1,0x85,0x00,0x10,0x08,0x08,0xff,0xe2,0xb1,
+	0x86,0x00,0x08,0xff,0xe2,0xb1,0x87,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x08,0xff,
+	0xe2,0xb1,0x88,0x00,0x08,0xff,0xe2,0xb1,0x89,0x00,0x10,0x08,0x08,0xff,0xe2,0xb1,
+	0x8a,0x00,0x08,0xff,0xe2,0xb1,0x8b,0x00,0xd1,0x10,0x10,0x08,0x08,0xff,0xe2,0xb1,
+	0x8c,0x00,0x08,0xff,0xe2,0xb1,0x8d,0x00,0x10,0x08,0x08,0xff,0xe2,0xb1,0x8e,0x00,
+	0x08,0xff,0xe2,0xb1,0x8f,0x00,0x94,0x7c,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,
+	0x08,0xff,0xe2,0xb1,0x90,0x00,0x08,0xff,0xe2,0xb1,0x91,0x00,0x10,0x08,0x08,0xff,
+	0xe2,0xb1,0x92,0x00,0x08,0xff,0xe2,0xb1,0x93,0x00,0xd1,0x10,0x10,0x08,0x08,0xff,
+	0xe2,0xb1,0x94,0x00,0x08,0xff,0xe2,0xb1,0x95,0x00,0x10,0x08,0x08,0xff,0xe2,0xb1,
+	0x96,0x00,0x08,0xff,0xe2,0xb1,0x97,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x08,0xff,
+	0xe2,0xb1,0x98,0x00,0x08,0xff,0xe2,0xb1,0x99,0x00,0x10,0x08,0x08,0xff,0xe2,0xb1,
+	0x9a,0x00,0x08,0xff,0xe2,0xb1,0x9b,0x00,0xd1,0x10,0x10,0x08,0x08,0xff,0xe2,0xb1,
+	0x9c,0x00,0x08,0xff,0xe2,0xb1,0x9d,0x00,0x10,0x08,0x08,0xff,0xe2,0xb1,0x9e,0x00,
+	0x00,0x00,0x08,0x00,0xcf,0x86,0xd5,0x07,0x64,0xef,0x61,0x08,0x00,0xd4,0x63,0xd3,
+	0x32,0xd2,0x1b,0xd1,0x0c,0x10,0x08,0x09,0xff,0xe2,0xb1,0xa1,0x00,0x09,0x00,0x10,
+	0x07,0x09,0xff,0xc9,0xab,0x00,0x09,0xff,0xe1,0xb5,0xbd,0x00,0xd1,0x0b,0x10,0x07,
+	0x09,0xff,0xc9,0xbd,0x00,0x09,0x00,0x10,0x04,0x09,0x00,0x09,0xff,0xe2,0xb1,0xa8,
+	0x00,0xd2,0x18,0xd1,0x0c,0x10,0x04,0x09,0x00,0x09,0xff,0xe2,0xb1,0xaa,0x00,0x10,
+	0x04,0x09,0x00,0x09,0xff,0xe2,0xb1,0xac,0x00,0xd1,0x0b,0x10,0x04,0x09,0x00,0x0a,
+	0xff,0xc9,0x91,0x00,0x10,0x07,0x0a,0xff,0xc9,0xb1,0x00,0x0a,0xff,0xc9,0x90,0x00,
+	0xd3,0x27,0xd2,0x17,0xd1,0x0b,0x10,0x07,0x0b,0xff,0xc9,0x92,0x00,0x0a,0x00,0x10,
+	0x08,0x0a,0xff,0xe2,0xb1,0xb3,0x00,0x0a,0x00,0x91,0x0c,0x10,0x04,0x09,0x00,0x09,
+	0xff,0xe2,0xb1,0xb6,0x00,0x09,0x00,0x52,0x04,0x0a,0x00,0x51,0x04,0x0a,0x00,0x10,
+	0x07,0x0b,0xff,0xc8,0xbf,0x00,0x0b,0xff,0xc9,0x80,0x00,0xe0,0x83,0x01,0xcf,0x86,
+	0xd5,0xc0,0xd4,0x60,0xd3,0x30,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb2,
+	0x81,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb2,0x83,0x00,0x08,0x00,0xd1,0x0c,
+	0x10,0x08,0x08,0xff,0xe2,0xb2,0x85,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb2,
+	0x87,0x00,0x08,0x00,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb2,0x89,0x00,
+	0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb2,0x8b,0x00,0x08,0x00,0xd1,0x0c,0x10,0x08,
+	0x08,0xff,0xe2,0xb2,0x8d,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb2,0x8f,0x00,
+	0x08,0x00,0xd3,0x30,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb2,0x91,0x00,
+	0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb2,0x93,0x00,0x08,0x00,0xd1,0x0c,0x10,0x08,
+	0x08,0xff,0xe2,0xb2,0x95,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb2,0x97,0x00,
+	0x08,0x00,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb2,0x99,0x00,0x08,0x00,
+	0x10,0x08,0x08,0xff,0xe2,0xb2,0x9b,0x00,0x08,0x00,0xd1,0x0c,0x10,0x08,0x08,0xff,
+	0xe2,0xb2,0x9d,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb2,0x9f,0x00,0x08,0x00,
+	0xd4,0x60,0xd3,0x30,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb2,0xa1,0x00,
+	0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb2,0xa3,0x00,0x08,0x00,0xd1,0x0c,0x10,0x08,
+	0x08,0xff,0xe2,0xb2,0xa5,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb2,0xa7,0x00,
+	0x08,0x00,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb2,0xa9,0x00,0x08,0x00,
+	0x10,0x08,0x08,0xff,0xe2,0xb2,0xab,0x00,0x08,0x00,0xd1,0x0c,0x10,0x08,0x08,0xff,
+	0xe2,0xb2,0xad,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb2,0xaf,0x00,0x08,0x00,
+	0xd3,0x30,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb2,0xb1,0x00,0x08,0x00,
+	0x10,0x08,0x08,0xff,0xe2,0xb2,0xb3,0x00,0x08,0x00,0xd1,0x0c,0x10,0x08,0x08,0xff,
+	0xe2,0xb2,0xb5,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb2,0xb7,0x00,0x08,0x00,
+	0xd2,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb2,0xb9,0x00,0x08,0x00,0x10,0x08,
+	0x08,0xff,0xe2,0xb2,0xbb,0x00,0x08,0x00,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb2,
+	0xbd,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb2,0xbf,0x00,0x08,0x00,0xcf,0x86,
+	0xd5,0xc0,0xd4,0x60,0xd3,0x30,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb3,
+	0x81,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb3,0x83,0x00,0x08,0x00,0xd1,0x0c,
+	0x10,0x08,0x08,0xff,0xe2,0xb3,0x85,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb3,
+	0x87,0x00,0x08,0x00,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb3,0x89,0x00,
+	0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb3,0x8b,0x00,0x08,0x00,0xd1,0x0c,0x10,0x08,
+	0x08,0xff,0xe2,0xb3,0x8d,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb3,0x8f,0x00,
+	0x08,0x00,0xd3,0x30,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb3,0x91,0x00,
+	0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb3,0x93,0x00,0x08,0x00,0xd1,0x0c,0x10,0x08,
+	0x08,0xff,0xe2,0xb3,0x95,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb3,0x97,0x00,
+	0x08,0x00,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb3,0x99,0x00,0x08,0x00,
+	0x10,0x08,0x08,0xff,0xe2,0xb3,0x9b,0x00,0x08,0x00,0xd1,0x0c,0x10,0x08,0x08,0xff,
+	0xe2,0xb3,0x9d,0x00,0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb3,0x9f,0x00,0x08,0x00,
+	0xd4,0x3b,0xd3,0x1c,0x92,0x18,0xd1,0x0c,0x10,0x08,0x08,0xff,0xe2,0xb3,0xa1,0x00,
+	0x08,0x00,0x10,0x08,0x08,0xff,0xe2,0xb3,0xa3,0x00,0x08,0x00,0x08,0x00,0xd2,0x10,
+	0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x0b,0xff,0xe2,0xb3,0xac,0x00,0xe1,0x3b,
+	0x5f,0x10,0x04,0x0b,0x00,0x0b,0xff,0xe2,0xb3,0xae,0x00,0xe3,0x40,0x5f,0x92,0x10,
+	0x51,0x04,0x0b,0xe6,0x10,0x08,0x0d,0xff,0xe2,0xb3,0xb3,0x00,0x0d,0x00,0x00,0x00,
+	0xe2,0x98,0x08,0xd1,0x0b,0xe0,0x11,0x67,0xcf,0x86,0xcf,0x06,0x01,0x00,0xe0,0x65,
+	0x6c,0xcf,0x86,0xe5,0xa7,0x05,0xd4,0x06,0xcf,0x06,0x04,0x00,0xd3,0x0c,0xe2,0xf8,
+	0x67,0xe1,0x8f,0x67,0xcf,0x06,0x04,0x00,0xe2,0xdb,0x01,0xe1,0x26,0x01,0xd0,0x09,
+	0xcf,0x86,0x65,0xf4,0x67,0x0a,0x00,0xcf,0x86,0xd5,0xc0,0xd4,0x60,0xd3,0x30,0xd2,
+	0x18,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x99,0x81,0x00,0x0a,0x00,0x10,0x08,0x0a,
+	0xff,0xea,0x99,0x83,0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x99,0x85,
+	0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x99,0x87,0x00,0x0a,0x00,0xd2,0x18,0xd1,
+	0x0c,0x10,0x08,0x0a,0xff,0xea,0x99,0x89,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,
+	0x99,0x8b,0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x99,0x8d,0x00,0x0a,
+	0x00,0x10,0x08,0x0a,0xff,0xea,0x99,0x8f,0x00,0x0a,0x00,0xd3,0x30,0xd2,0x18,0xd1,
+	0x0c,0x10,0x08,0x0a,0xff,0xea,0x99,0x91,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,
+	0x99,0x93,0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x99,0x95,0x00,0x0a,
+	0x00,0x10,0x08,0x0a,0xff,0xea,0x99,0x97,0x00,0x0a,0x00,0xd2,0x18,0xd1,0x0c,0x10,
+	0x08,0x0a,0xff,0xea,0x99,0x99,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x99,0x9b,
+	0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x99,0x9d,0x00,0x0a,0x00,0x10,
+	0x08,0x0a,0xff,0xea,0x99,0x9f,0x00,0x0a,0x00,0xe4,0x5d,0x67,0xd3,0x30,0xd2,0x18,
+	0xd1,0x0c,0x10,0x08,0x0c,0xff,0xea,0x99,0xa1,0x00,0x0c,0x00,0x10,0x08,0x0a,0xff,
+	0xea,0x99,0xa3,0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x99,0xa5,0x00,
+	0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x99,0xa7,0x00,0x0a,0x00,0xd2,0x18,0xd1,0x0c,
+	0x10,0x08,0x0a,0xff,0xea,0x99,0xa9,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x99,
+	0xab,0x00,0x0a,0x00,0xe1,0x0c,0x67,0x10,0x08,0x0a,0xff,0xea,0x99,0xad,0x00,0x0a,
+	0x00,0xe0,0x35,0x67,0xcf,0x86,0x95,0xab,0xd4,0x60,0xd3,0x30,0xd2,0x18,0xd1,0x0c,
+	0x10,0x08,0x0a,0xff,0xea,0x9a,0x81,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9a,
+	0x83,0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9a,0x85,0x00,0x0a,0x00,
+	0x10,0x08,0x0a,0xff,0xea,0x9a,0x87,0x00,0x0a,0x00,0xd2,0x18,0xd1,0x0c,0x10,0x08,
+	0x0a,0xff,0xea,0x9a,0x89,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9a,0x8b,0x00,
+	0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9a,0x8d,0x00,0x0a,0x00,0x10,0x08,
+	0x0a,0xff,0xea,0x9a,0x8f,0x00,0x0a,0x00,0xd3,0x30,0xd2,0x18,0xd1,0x0c,0x10,0x08,
+	0x0a,0xff,0xea,0x9a,0x91,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9a,0x93,0x00,
+	0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9a,0x95,0x00,0x0a,0x00,0x10,0x08,
+	0x0a,0xff,0xea,0x9a,0x97,0x00,0x0a,0x00,0xe2,0x92,0x66,0xd1,0x0c,0x10,0x08,0x10,
+	0xff,0xea,0x9a,0x99,0x00,0x10,0x00,0x10,0x08,0x10,0xff,0xea,0x9a,0x9b,0x00,0x10,
+	0x00,0x0b,0x00,0xe1,0x10,0x02,0xd0,0xb9,0xcf,0x86,0xd5,0x07,0x64,0x9e,0x66,0x08,
+	0x00,0xd4,0x58,0xd3,0x28,0xd2,0x10,0x51,0x04,0x09,0x00,0x10,0x08,0x0a,0xff,0xea,
+	0x9c,0xa3,0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9c,0xa5,0x00,0x0a,
+	0x00,0x10,0x08,0x0a,0xff,0xea,0x9c,0xa7,0x00,0x0a,0x00,0xd2,0x18,0xd1,0x0c,0x10,
+	0x08,0x0a,0xff,0xea,0x9c,0xa9,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9c,0xab,
+	0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9c,0xad,0x00,0x0a,0x00,0x10,
+	0x08,0x0a,0xff,0xea,0x9c,0xaf,0x00,0x0a,0x00,0xd3,0x28,0xd2,0x10,0x51,0x04,0x0a,
+	0x00,0x10,0x08,0x0a,0xff,0xea,0x9c,0xb3,0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,
+	0xff,0xea,0x9c,0xb5,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9c,0xb7,0x00,0x0a,
+	0x00,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9c,0xb9,0x00,0x0a,0x00,0x10,
+	0x08,0x0a,0xff,0xea,0x9c,0xbb,0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,
+	0x9c,0xbd,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9c,0xbf,0x00,0x0a,0x00,0xcf,
+	0x86,0xd5,0xc0,0xd4,0x60,0xd3,0x30,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,
+	0x9d,0x81,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9d,0x83,0x00,0x0a,0x00,0xd1,
+	0x0c,0x10,0x08,0x0a,0xff,0xea,0x9d,0x85,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,
+	0x9d,0x87,0x00,0x0a,0x00,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9d,0x89,
+	0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9d,0x8b,0x00,0x0a,0x00,0xd1,0x0c,0x10,
+	0x08,0x0a,0xff,0xea,0x9d,0x8d,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9d,0x8f,
+	0x00,0x0a,0x00,0xd3,0x30,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9d,0x91,
+	0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9d,0x93,0x00,0x0a,0x00,0xd1,0x0c,0x10,
+	0x08,0x0a,0xff,0xea,0x9d,0x95,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9d,0x97,
+	0x00,0x0a,0x00,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9d,0x99,0x00,0x0a,
+	0x00,0x10,0x08,0x0a,0xff,0xea,0x9d,0x9b,0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,
+	0xff,0xea,0x9d,0x9d,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9d,0x9f,0x00,0x0a,
+	0x00,0xd4,0x60,0xd3,0x30,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9d,0xa1,
+	0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9d,0xa3,0x00,0x0a,0x00,0xd1,0x0c,0x10,
+	0x08,0x0a,0xff,0xea,0x9d,0xa5,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9d,0xa7,
+	0x00,0x0a,0x00,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9d,0xa9,0x00,0x0a,
+	0x00,0x10,0x08,0x0a,0xff,0xea,0x9d,0xab,0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,
+	0xff,0xea,0x9d,0xad,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9d,0xaf,0x00,0x0a,
+	0x00,0x53,0x04,0x0a,0x00,0xd2,0x18,0xd1,0x0c,0x10,0x04,0x0a,0x00,0x0a,0xff,0xea,
+	0x9d,0xba,0x00,0x10,0x04,0x0a,0x00,0x0a,0xff,0xea,0x9d,0xbc,0x00,0xd1,0x0c,0x10,
+	0x04,0x0a,0x00,0x0a,0xff,0xe1,0xb5,0xb9,0x00,0x10,0x08,0x0a,0xff,0xea,0x9d,0xbf,
+	0x00,0x0a,0x00,0xe0,0x71,0x01,0xcf,0x86,0xd5,0xa6,0xd4,0x4e,0xd3,0x30,0xd2,0x18,
+	0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9e,0x81,0x00,0x0a,0x00,0x10,0x08,0x0a,0xff,
+	0xea,0x9e,0x83,0x00,0x0a,0x00,0xd1,0x0c,0x10,0x08,0x0a,0xff,0xea,0x9e,0x85,0x00,
+	0x0a,0x00,0x10,0x08,0x0a,0xff,0xea,0x9e,0x87,0x00,0x0a,0x00,0xd2,0x10,0x51,0x04,
+	0x0a,0x00,0x10,0x04,0x0a,0x00,0x0a,0xff,0xea,0x9e,0x8c,0x00,0xe1,0x9a,0x64,0x10,
+	0x04,0x0a,0x00,0x0c,0xff,0xc9,0xa5,0x00,0xd3,0x28,0xd2,0x18,0xd1,0x0c,0x10,0x08,
+	0x0c,0xff,0xea,0x9e,0x91,0x00,0x0c,0x00,0x10,0x08,0x0d,0xff,0xea,0x9e,0x93,0x00,
+	0x0d,0x00,0x51,0x04,0x10,0x00,0x10,0x08,0x10,0xff,0xea,0x9e,0x97,0x00,0x10,0x00,
+	0xd2,0x18,0xd1,0x0c,0x10,0x08,0x10,0xff,0xea,0x9e,0x99,0x00,0x10,0x00,0x10,0x08,
+	0x10,0xff,0xea,0x9e,0x9b,0x00,0x10,0x00,0xd1,0x0c,0x10,0x08,0x10,0xff,0xea,0x9e,
+	0x9d,0x00,0x10,0x00,0x10,0x08,0x10,0xff,0xea,0x9e,0x9f,0x00,0x10,0x00,0xd4,0x63,
+	0xd3,0x30,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x0c,0xff,0xea,0x9e,0xa1,0x00,0x0c,0x00,
+	0x10,0x08,0x0c,0xff,0xea,0x9e,0xa3,0x00,0x0c,0x00,0xd1,0x0c,0x10,0x08,0x0c,0xff,
+	0xea,0x9e,0xa5,0x00,0x0c,0x00,0x10,0x08,0x0c,0xff,0xea,0x9e,0xa7,0x00,0x0c,0x00,
+	0xd2,0x1a,0xd1,0x0c,0x10,0x08,0x0c,0xff,0xea,0x9e,0xa9,0x00,0x0c,0x00,0x10,0x07,
+	0x0d,0xff,0xc9,0xa6,0x00,0x10,0xff,0xc9,0x9c,0x00,0xd1,0x0e,0x10,0x07,0x10,0xff,
+	0xc9,0xa1,0x00,0x10,0xff,0xc9,0xac,0x00,0x10,0x07,0x12,0xff,0xc9,0xaa,0x00,0x14,
+	0x00,0xd3,0x35,0xd2,0x1d,0xd1,0x0e,0x10,0x07,0x10,0xff,0xca,0x9e,0x00,0x10,0xff,
+	0xca,0x87,0x00,0x10,0x07,0x11,0xff,0xca,0x9d,0x00,0x11,0xff,0xea,0xad,0x93,0x00,
+	0xd1,0x0c,0x10,0x08,0x11,0xff,0xea,0x9e,0xb5,0x00,0x11,0x00,0x10,0x08,0x11,0xff,
+	0xea,0x9e,0xb7,0x00,0x11,0x00,0xd2,0x18,0xd1,0x0c,0x10,0x08,0x14,0xff,0xea,0x9e,
+	0xb9,0x00,0x14,0x00,0x10,0x08,0x15,0xff,0xea,0x9e,0xbb,0x00,0x15,0x00,0xd1,0x0c,
+	0x10,0x08,0x15,0xff,0xea,0x9e,0xbd,0x00,0x15,0x00,0x10,0x08,0x15,0xff,0xea,0x9e,
+	0xbf,0x00,0x15,0x00,0xcf,0x86,0xe5,0xd4,0x63,0x94,0x2f,0x93,0x2b,0xd2,0x10,0x51,
+	0x04,0x00,0x00,0x10,0x08,0x15,0xff,0xea,0x9f,0x83,0x00,0x15,0x00,0xd1,0x0f,0x10,
+	0x08,0x15,0xff,0xea,0x9e,0x94,0x00,0x15,0xff,0xca,0x82,0x00,0x10,0x08,0x15,0xff,
+	0xe1,0xb6,0x8e,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xe4,0xb4,0x66,0xd3,0x1d,0xe2,
+	0x5b,0x64,0xe1,0x0a,0x64,0xe0,0xf7,0x63,0xcf,0x86,0xe5,0xd8,0x63,0x94,0x0b,0x93,
+	0x07,0x62,0xc3,0x63,0x08,0x00,0x08,0x00,0x08,0x00,0xd2,0x0f,0xe1,0x5a,0x65,0xe0,
+	0x27,0x65,0xcf,0x86,0x65,0x0c,0x65,0x0a,0x00,0xd1,0xab,0xd0,0x1a,0xcf,0x86,0xe5,
+	0x17,0x66,0xe4,0xfa,0x65,0xe3,0xe1,0x65,0xe2,0xd4,0x65,0x91,0x08,0x10,0x04,0x00,
+	0x00,0x0c,0x00,0x0c,0x00,0xcf,0x86,0x55,0x04,0x10,0x00,0xd4,0x0b,0x93,0x07,0x62,
+	0x27,0x66,0x11,0x00,0x00,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x11,0xff,
+	0xe1,0x8e,0xa0,0x00,0x11,0xff,0xe1,0x8e,0xa1,0x00,0x10,0x08,0x11,0xff,0xe1,0x8e,
+	0xa2,0x00,0x11,0xff,0xe1,0x8e,0xa3,0x00,0xd1,0x10,0x10,0x08,0x11,0xff,0xe1,0x8e,
+	0xa4,0x00,0x11,0xff,0xe1,0x8e,0xa5,0x00,0x10,0x08,0x11,0xff,0xe1,0x8e,0xa6,0x00,
+	0x11,0xff,0xe1,0x8e,0xa7,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x11,0xff,0xe1,0x8e,
+	0xa8,0x00,0x11,0xff,0xe1,0x8e,0xa9,0x00,0x10,0x08,0x11,0xff,0xe1,0x8e,0xaa,0x00,
+	0x11,0xff,0xe1,0x8e,0xab,0x00,0xd1,0x10,0x10,0x08,0x11,0xff,0xe1,0x8e,0xac,0x00,
+	0x11,0xff,0xe1,0x8e,0xad,0x00,0x10,0x08,0x11,0xff,0xe1,0x8e,0xae,0x00,0x11,0xff,
+	0xe1,0x8e,0xaf,0x00,0xe0,0xb2,0x65,0xcf,0x86,0xe5,0x01,0x01,0xd4,0x80,0xd3,0x40,
+	0xd2,0x20,0xd1,0x10,0x10,0x08,0x11,0xff,0xe1,0x8e,0xb0,0x00,0x11,0xff,0xe1,0x8e,
+	0xb1,0x00,0x10,0x08,0x11,0xff,0xe1,0x8e,0xb2,0x00,0x11,0xff,0xe1,0x8e,0xb3,0x00,
+	0xd1,0x10,0x10,0x08,0x11,0xff,0xe1,0x8e,0xb4,0x00,0x11,0xff,0xe1,0x8e,0xb5,0x00,
+	0x10,0x08,0x11,0xff,0xe1,0x8e,0xb6,0x00,0x11,0xff,0xe1,0x8e,0xb7,0x00,0xd2,0x20,
+	0xd1,0x10,0x10,0x08,0x11,0xff,0xe1,0x8e,0xb8,0x00,0x11,0xff,0xe1,0x8e,0xb9,0x00,
+	0x10,0x08,0x11,0xff,0xe1,0x8e,0xba,0x00,0x11,0xff,0xe1,0x8e,0xbb,0x00,0xd1,0x10,
+	0x10,0x08,0x11,0xff,0xe1,0x8e,0xbc,0x00,0x11,0xff,0xe1,0x8e,0xbd,0x00,0x10,0x08,
+	0x11,0xff,0xe1,0x8e,0xbe,0x00,0x11,0xff,0xe1,0x8e,0xbf,0x00,0xd3,0x40,0xd2,0x20,
+	0xd1,0x10,0x10,0x08,0x11,0xff,0xe1,0x8f,0x80,0x00,0x11,0xff,0xe1,0x8f,0x81,0x00,
+	0x10,0x08,0x11,0xff,0xe1,0x8f,0x82,0x00,0x11,0xff,0xe1,0x8f,0x83,0x00,0xd1,0x10,
+	0x10,0x08,0x11,0xff,0xe1,0x8f,0x84,0x00,0x11,0xff,0xe1,0x8f,0x85,0x00,0x10,0x08,
+	0x11,0xff,0xe1,0x8f,0x86,0x00,0x11,0xff,0xe1,0x8f,0x87,0x00,0xd2,0x20,0xd1,0x10,
+	0x10,0x08,0x11,0xff,0xe1,0x8f,0x88,0x00,0x11,0xff,0xe1,0x8f,0x89,0x00,0x10,0x08,
+	0x11,0xff,0xe1,0x8f,0x8a,0x00,0x11,0xff,0xe1,0x8f,0x8b,0x00,0xd1,0x10,0x10,0x08,
+	0x11,0xff,0xe1,0x8f,0x8c,0x00,0x11,0xff,0xe1,0x8f,0x8d,0x00,0x10,0x08,0x11,0xff,
+	0xe1,0x8f,0x8e,0x00,0x11,0xff,0xe1,0x8f,0x8f,0x00,0xd4,0x80,0xd3,0x40,0xd2,0x20,
+	0xd1,0x10,0x10,0x08,0x11,0xff,0xe1,0x8f,0x90,0x00,0x11,0xff,0xe1,0x8f,0x91,0x00,
+	0x10,0x08,0x11,0xff,0xe1,0x8f,0x92,0x00,0x11,0xff,0xe1,0x8f,0x93,0x00,0xd1,0x10,
+	0x10,0x08,0x11,0xff,0xe1,0x8f,0x94,0x00,0x11,0xff,0xe1,0x8f,0x95,0x00,0x10,0x08,
+	0x11,0xff,0xe1,0x8f,0x96,0x00,0x11,0xff,0xe1,0x8f,0x97,0x00,0xd2,0x20,0xd1,0x10,
+	0x10,0x08,0x11,0xff,0xe1,0x8f,0x98,0x00,0x11,0xff,0xe1,0x8f,0x99,0x00,0x10,0x08,
+	0x11,0xff,0xe1,0x8f,0x9a,0x00,0x11,0xff,0xe1,0x8f,0x9b,0x00,0xd1,0x10,0x10,0x08,
+	0x11,0xff,0xe1,0x8f,0x9c,0x00,0x11,0xff,0xe1,0x8f,0x9d,0x00,0x10,0x08,0x11,0xff,
+	0xe1,0x8f,0x9e,0x00,0x11,0xff,0xe1,0x8f,0x9f,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,
+	0x10,0x08,0x11,0xff,0xe1,0x8f,0xa0,0x00,0x11,0xff,0xe1,0x8f,0xa1,0x00,0x10,0x08,
+	0x11,0xff,0xe1,0x8f,0xa2,0x00,0x11,0xff,0xe1,0x8f,0xa3,0x00,0xd1,0x10,0x10,0x08,
+	0x11,0xff,0xe1,0x8f,0xa4,0x00,0x11,0xff,0xe1,0x8f,0xa5,0x00,0x10,0x08,0x11,0xff,
+	0xe1,0x8f,0xa6,0x00,0x11,0xff,0xe1,0x8f,0xa7,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,
+	0x11,0xff,0xe1,0x8f,0xa8,0x00,0x11,0xff,0xe1,0x8f,0xa9,0x00,0x10,0x08,0x11,0xff,
+	0xe1,0x8f,0xaa,0x00,0x11,0xff,0xe1,0x8f,0xab,0x00,0xd1,0x10,0x10,0x08,0x11,0xff,
+	0xe1,0x8f,0xac,0x00,0x11,0xff,0xe1,0x8f,0xad,0x00,0x10,0x08,0x11,0xff,0xe1,0x8f,
+	0xae,0x00,0x11,0xff,0xe1,0x8f,0xaf,0x00,0xd1,0x0c,0xe0,0xeb,0x63,0xcf,0x86,0xcf,
+	0x06,0x02,0xff,0xff,0xd0,0x08,0xcf,0x86,0xcf,0x06,0x01,0x00,0xcf,0x86,0xd5,0x06,
+	0xcf,0x06,0x01,0x00,0xd4,0xae,0xd3,0x09,0xe2,0x54,0x64,0xcf,0x06,0x01,0x00,0xd2,
+	0x27,0xe1,0x1f,0x70,0xe0,0x26,0x6e,0xcf,0x86,0xe5,0x3f,0x6d,0xe4,0xce,0x6c,0xe3,
+	0x99,0x6c,0xe2,0x78,0x6c,0xe1,0x67,0x6c,0x10,0x08,0x01,0xff,0xe5,0x88,0x87,0x00,
+	0x01,0xff,0xe5,0xba,0xa6,0x00,0xe1,0x74,0x74,0xe0,0xe8,0x73,0xcf,0x86,0xe5,0x22,
+	0x73,0xd4,0x3b,0x93,0x37,0xd2,0x1d,0xd1,0x0e,0x10,0x07,0x01,0xff,0x66,0x66,0x00,
+	0x01,0xff,0x66,0x69,0x00,0x10,0x07,0x01,0xff,0x66,0x6c,0x00,0x01,0xff,0x66,0x66,
+	0x69,0x00,0xd1,0x0f,0x10,0x08,0x01,0xff,0x66,0x66,0x6c,0x00,0x01,0xff,0x73,0x74,
+	0x00,0x10,0x07,0x01,0xff,0x73,0x74,0x00,0x00,0x00,0x00,0x00,0xe3,0xc8,0x72,0xd2,
+	0x11,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x01,0xff,0xd5,0xb4,0xd5,0xb6,0x00,
+	0xd1,0x12,0x10,0x09,0x01,0xff,0xd5,0xb4,0xd5,0xa5,0x00,0x01,0xff,0xd5,0xb4,0xd5,
+	0xab,0x00,0x10,0x09,0x01,0xff,0xd5,0xbe,0xd5,0xb6,0x00,0x01,0xff,0xd5,0xb4,0xd5,
+	0xad,0x00,0xd3,0x09,0xe2,0x40,0x74,0xcf,0x06,0x01,0x00,0xd2,0x13,0xe1,0x30,0x75,
+	0xe0,0xc1,0x74,0xcf,0x86,0xe5,0x9e,0x74,0x64,0x8d,0x74,0x06,0xff,0x00,0xe1,0x96,
+	0x75,0xe0,0x63,0x75,0xcf,0x86,0xd5,0x18,0x94,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,
+	0x10,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd4,0x7c,
+	0xd3,0x3c,0xd2,0x1c,0xd1,0x0c,0x10,0x04,0x01,0x00,0x01,0xff,0xef,0xbd,0x81,0x00,
+	0x10,0x08,0x01,0xff,0xef,0xbd,0x82,0x00,0x01,0xff,0xef,0xbd,0x83,0x00,0xd1,0x10,
+	0x10,0x08,0x01,0xff,0xef,0xbd,0x84,0x00,0x01,0xff,0xef,0xbd,0x85,0x00,0x10,0x08,
+	0x01,0xff,0xef,0xbd,0x86,0x00,0x01,0xff,0xef,0xbd,0x87,0x00,0xd2,0x20,0xd1,0x10,
+	0x10,0x08,0x01,0xff,0xef,0xbd,0x88,0x00,0x01,0xff,0xef,0xbd,0x89,0x00,0x10,0x08,
+	0x01,0xff,0xef,0xbd,0x8a,0x00,0x01,0xff,0xef,0xbd,0x8b,0x00,0xd1,0x10,0x10,0x08,
+	0x01,0xff,0xef,0xbd,0x8c,0x00,0x01,0xff,0xef,0xbd,0x8d,0x00,0x10,0x08,0x01,0xff,
+	0xef,0xbd,0x8e,0x00,0x01,0xff,0xef,0xbd,0x8f,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,
+	0x10,0x08,0x01,0xff,0xef,0xbd,0x90,0x00,0x01,0xff,0xef,0xbd,0x91,0x00,0x10,0x08,
+	0x01,0xff,0xef,0xbd,0x92,0x00,0x01,0xff,0xef,0xbd,0x93,0x00,0xd1,0x10,0x10,0x08,
+	0x01,0xff,0xef,0xbd,0x94,0x00,0x01,0xff,0xef,0xbd,0x95,0x00,0x10,0x08,0x01,0xff,
+	0xef,0xbd,0x96,0x00,0x01,0xff,0xef,0xbd,0x97,0x00,0x92,0x1c,0xd1,0x10,0x10,0x08,
+	0x01,0xff,0xef,0xbd,0x98,0x00,0x01,0xff,0xef,0xbd,0x99,0x00,0x10,0x08,0x01,0xff,
+	0xef,0xbd,0x9a,0x00,0x01,0x00,0x01,0x00,0x83,0xe2,0x87,0xb3,0xe1,0x60,0xb0,0xe0,
+	0xdd,0xae,0xcf,0x86,0xe5,0x81,0x9b,0xc4,0xe3,0xc1,0x07,0xe2,0x62,0x06,0xe1,0x11,
+	0x86,0xe0,0x09,0x05,0xcf,0x86,0xe5,0xfb,0x02,0xd4,0x1c,0xe3,0x7f,0x76,0xe2,0xd6,
+	0x75,0xe1,0xb1,0x75,0xe0,0x8a,0x75,0xcf,0x86,0xe5,0x57,0x75,0x94,0x07,0x63,0x42,
+	0x75,0x07,0x00,0x07,0x00,0xe3,0x2b,0x78,0xe2,0xf0,0x77,0xe1,0x77,0x01,0xe0,0x88,
+	0x77,0xcf,0x86,0xe5,0x21,0x01,0xd4,0x90,0xd3,0x48,0xd2,0x24,0xd1,0x12,0x10,0x09,
+	0x05,0xff,0xf0,0x90,0x90,0xa8,0x00,0x05,0xff,0xf0,0x90,0x90,0xa9,0x00,0x10,0x09,
+	0x05,0xff,0xf0,0x90,0x90,0xaa,0x00,0x05,0xff,0xf0,0x90,0x90,0xab,0x00,0xd1,0x12,
+	0x10,0x09,0x05,0xff,0xf0,0x90,0x90,0xac,0x00,0x05,0xff,0xf0,0x90,0x90,0xad,0x00,
+	0x10,0x09,0x05,0xff,0xf0,0x90,0x90,0xae,0x00,0x05,0xff,0xf0,0x90,0x90,0xaf,0x00,
+	0xd2,0x24,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0x90,0x90,0xb0,0x00,0x05,0xff,0xf0,
+	0x90,0x90,0xb1,0x00,0x10,0x09,0x05,0xff,0xf0,0x90,0x90,0xb2,0x00,0x05,0xff,0xf0,
+	0x90,0x90,0xb3,0x00,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0x90,0x90,0xb4,0x00,0x05,
+	0xff,0xf0,0x90,0x90,0xb5,0x00,0x10,0x09,0x05,0xff,0xf0,0x90,0x90,0xb6,0x00,0x05,
+	0xff,0xf0,0x90,0x90,0xb7,0x00,0xd3,0x48,0xd2,0x24,0xd1,0x12,0x10,0x09,0x05,0xff,
+	0xf0,0x90,0x90,0xb8,0x00,0x05,0xff,0xf0,0x90,0x90,0xb9,0x00,0x10,0x09,0x05,0xff,
+	0xf0,0x90,0x90,0xba,0x00,0x05,0xff,0xf0,0x90,0x90,0xbb,0x00,0xd1,0x12,0x10,0x09,
+	0x05,0xff,0xf0,0x90,0x90,0xbc,0x00,0x05,0xff,0xf0,0x90,0x90,0xbd,0x00,0x10,0x09,
+	0x05,0xff,0xf0,0x90,0x90,0xbe,0x00,0x05,0xff,0xf0,0x90,0x90,0xbf,0x00,0xd2,0x24,
+	0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0x90,0x91,0x80,0x00,0x05,0xff,0xf0,0x90,0x91,
+	0x81,0x00,0x10,0x09,0x05,0xff,0xf0,0x90,0x91,0x82,0x00,0x05,0xff,0xf0,0x90,0x91,
+	0x83,0x00,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0x90,0x91,0x84,0x00,0x05,0xff,0xf0,
+	0x90,0x91,0x85,0x00,0x10,0x09,0x05,0xff,0xf0,0x90,0x91,0x86,0x00,0x05,0xff,0xf0,
+	0x90,0x91,0x87,0x00,0x94,0x4c,0x93,0x48,0xd2,0x24,0xd1,0x12,0x10,0x09,0x05,0xff,
+	0xf0,0x90,0x91,0x88,0x00,0x05,0xff,0xf0,0x90,0x91,0x89,0x00,0x10,0x09,0x05,0xff,
+	0xf0,0x90,0x91,0x8a,0x00,0x05,0xff,0xf0,0x90,0x91,0x8b,0x00,0xd1,0x12,0x10,0x09,
+	0x05,0xff,0xf0,0x90,0x91,0x8c,0x00,0x05,0xff,0xf0,0x90,0x91,0x8d,0x00,0x10,0x09,
+	0x07,0xff,0xf0,0x90,0x91,0x8e,0x00,0x07,0xff,0xf0,0x90,0x91,0x8f,0x00,0x05,0x00,
+	0x05,0x00,0xd0,0xa0,0xcf,0x86,0xd5,0x07,0x64,0x30,0x76,0x07,0x00,0xd4,0x07,0x63,
+	0x3d,0x76,0x07,0x00,0xd3,0x48,0xd2,0x24,0xd1,0x12,0x10,0x09,0x12,0xff,0xf0,0x90,
+	0x93,0x98,0x00,0x12,0xff,0xf0,0x90,0x93,0x99,0x00,0x10,0x09,0x12,0xff,0xf0,0x90,
+	0x93,0x9a,0x00,0x12,0xff,0xf0,0x90,0x93,0x9b,0x00,0xd1,0x12,0x10,0x09,0x12,0xff,
+	0xf0,0x90,0x93,0x9c,0x00,0x12,0xff,0xf0,0x90,0x93,0x9d,0x00,0x10,0x09,0x12,0xff,
+	0xf0,0x90,0x93,0x9e,0x00,0x12,0xff,0xf0,0x90,0x93,0x9f,0x00,0xd2,0x24,0xd1,0x12,
+	0x10,0x09,0x12,0xff,0xf0,0x90,0x93,0xa0,0x00,0x12,0xff,0xf0,0x90,0x93,0xa1,0x00,
+	0x10,0x09,0x12,0xff,0xf0,0x90,0x93,0xa2,0x00,0x12,0xff,0xf0,0x90,0x93,0xa3,0x00,
+	0xd1,0x12,0x10,0x09,0x12,0xff,0xf0,0x90,0x93,0xa4,0x00,0x12,0xff,0xf0,0x90,0x93,
+	0xa5,0x00,0x10,0x09,0x12,0xff,0xf0,0x90,0x93,0xa6,0x00,0x12,0xff,0xf0,0x90,0x93,
+	0xa7,0x00,0xcf,0x86,0xe5,0xc6,0x75,0xd4,0x90,0xd3,0x48,0xd2,0x24,0xd1,0x12,0x10,
+	0x09,0x12,0xff,0xf0,0x90,0x93,0xa8,0x00,0x12,0xff,0xf0,0x90,0x93,0xa9,0x00,0x10,
+	0x09,0x12,0xff,0xf0,0x90,0x93,0xaa,0x00,0x12,0xff,0xf0,0x90,0x93,0xab,0x00,0xd1,
+	0x12,0x10,0x09,0x12,0xff,0xf0,0x90,0x93,0xac,0x00,0x12,0xff,0xf0,0x90,0x93,0xad,
+	0x00,0x10,0x09,0x12,0xff,0xf0,0x90,0x93,0xae,0x00,0x12,0xff,0xf0,0x90,0x93,0xaf,
+	0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x12,0xff,0xf0,0x90,0x93,0xb0,0x00,0x12,0xff,
+	0xf0,0x90,0x93,0xb1,0x00,0x10,0x09,0x12,0xff,0xf0,0x90,0x93,0xb2,0x00,0x12,0xff,
+	0xf0,0x90,0x93,0xb3,0x00,0xd1,0x12,0x10,0x09,0x12,0xff,0xf0,0x90,0x93,0xb4,0x00,
+	0x12,0xff,0xf0,0x90,0x93,0xb5,0x00,0x10,0x09,0x12,0xff,0xf0,0x90,0x93,0xb6,0x00,
+	0x12,0xff,0xf0,0x90,0x93,0xb7,0x00,0x93,0x28,0x92,0x24,0xd1,0x12,0x10,0x09,0x12,
+	0xff,0xf0,0x90,0x93,0xb8,0x00,0x12,0xff,0xf0,0x90,0x93,0xb9,0x00,0x10,0x09,0x12,
+	0xff,0xf0,0x90,0x93,0xba,0x00,0x12,0xff,0xf0,0x90,0x93,0xbb,0x00,0x00,0x00,0x12,
+	0x00,0xd4,0x1f,0xe3,0xdf,0x76,0xe2,0x6a,0x76,0xe1,0x09,0x76,0xe0,0xea,0x75,0xcf,
+	0x86,0xe5,0xb7,0x75,0x94,0x0a,0xe3,0xa2,0x75,0x62,0x99,0x75,0x07,0x00,0x07,0x00,
+	0xe3,0xde,0x78,0xe2,0xaf,0x78,0xd1,0x09,0xe0,0x4c,0x78,0xcf,0x06,0x0b,0x00,0xe0,
+	0x7f,0x78,0xcf,0x86,0xe5,0x21,0x01,0xd4,0x90,0xd3,0x48,0xd2,0x24,0xd1,0x12,0x10,
+	0x09,0x11,0xff,0xf0,0x90,0xb3,0x80,0x00,0x11,0xff,0xf0,0x90,0xb3,0x81,0x00,0x10,
+	0x09,0x11,0xff,0xf0,0x90,0xb3,0x82,0x00,0x11,0xff,0xf0,0x90,0xb3,0x83,0x00,0xd1,
+	0x12,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0x84,0x00,0x11,0xff,0xf0,0x90,0xb3,0x85,
+	0x00,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0x86,0x00,0x11,0xff,0xf0,0x90,0xb3,0x87,
+	0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0x88,0x00,0x11,0xff,
+	0xf0,0x90,0xb3,0x89,0x00,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0x8a,0x00,0x11,0xff,
+	0xf0,0x90,0xb3,0x8b,0x00,0xd1,0x12,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0x8c,0x00,
+	0x11,0xff,0xf0,0x90,0xb3,0x8d,0x00,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0x8e,0x00,
+	0x11,0xff,0xf0,0x90,0xb3,0x8f,0x00,0xd3,0x48,0xd2,0x24,0xd1,0x12,0x10,0x09,0x11,
+	0xff,0xf0,0x90,0xb3,0x90,0x00,0x11,0xff,0xf0,0x90,0xb3,0x91,0x00,0x10,0x09,0x11,
+	0xff,0xf0,0x90,0xb3,0x92,0x00,0x11,0xff,0xf0,0x90,0xb3,0x93,0x00,0xd1,0x12,0x10,
+	0x09,0x11,0xff,0xf0,0x90,0xb3,0x94,0x00,0x11,0xff,0xf0,0x90,0xb3,0x95,0x00,0x10,
+	0x09,0x11,0xff,0xf0,0x90,0xb3,0x96,0x00,0x11,0xff,0xf0,0x90,0xb3,0x97,0x00,0xd2,
+	0x24,0xd1,0x12,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0x98,0x00,0x11,0xff,0xf0,0x90,
+	0xb3,0x99,0x00,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0x9a,0x00,0x11,0xff,0xf0,0x90,
+	0xb3,0x9b,0x00,0xd1,0x12,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0x9c,0x00,0x11,0xff,
+	0xf0,0x90,0xb3,0x9d,0x00,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0x9e,0x00,0x11,0xff,
+	0xf0,0x90,0xb3,0x9f,0x00,0xd4,0x90,0xd3,0x48,0xd2,0x24,0xd1,0x12,0x10,0x09,0x11,
+	0xff,0xf0,0x90,0xb3,0xa0,0x00,0x11,0xff,0xf0,0x90,0xb3,0xa1,0x00,0x10,0x09,0x11,
+	0xff,0xf0,0x90,0xb3,0xa2,0x00,0x11,0xff,0xf0,0x90,0xb3,0xa3,0x00,0xd1,0x12,0x10,
+	0x09,0x11,0xff,0xf0,0x90,0xb3,0xa4,0x00,0x11,0xff,0xf0,0x90,0xb3,0xa5,0x00,0x10,
+	0x09,0x11,0xff,0xf0,0x90,0xb3,0xa6,0x00,0x11,0xff,0xf0,0x90,0xb3,0xa7,0x00,0xd2,
+	0x24,0xd1,0x12,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0xa8,0x00,0x11,0xff,0xf0,0x90,
+	0xb3,0xa9,0x00,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0xaa,0x00,0x11,0xff,0xf0,0x90,
+	0xb3,0xab,0x00,0xd1,0x12,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0xac,0x00,0x11,0xff,
+	0xf0,0x90,0xb3,0xad,0x00,0x10,0x09,0x11,0xff,0xf0,0x90,0xb3,0xae,0x00,0x11,0xff,
+	0xf0,0x90,0xb3,0xaf,0x00,0x93,0x23,0x92,0x1f,0xd1,0x12,0x10,0x09,0x11,0xff,0xf0,
+	0x90,0xb3,0xb0,0x00,0x11,0xff,0xf0,0x90,0xb3,0xb1,0x00,0x10,0x09,0x11,0xff,0xf0,
+	0x90,0xb3,0xb2,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0xd5,0x15,0xe4,0x91,
+	0x7b,0xe3,0x9b,0x79,0xe2,0x94,0x78,0xe1,0xe4,0x77,0xe0,0x9d,0x77,0xcf,0x06,0x0c,
+	0x00,0xe4,0xeb,0x7e,0xe3,0x44,0x7e,0xe2,0xed,0x7d,0xd1,0x0c,0xe0,0xb2,0x7d,0xcf,
+	0x86,0x65,0x93,0x7d,0x14,0x00,0xe0,0xb6,0x7d,0xcf,0x86,0x55,0x04,0x00,0x00,0xd4,
+	0x90,0xd3,0x48,0xd2,0x24,0xd1,0x12,0x10,0x09,0x10,0xff,0xf0,0x91,0xa3,0x80,0x00,
+	0x10,0xff,0xf0,0x91,0xa3,0x81,0x00,0x10,0x09,0x10,0xff,0xf0,0x91,0xa3,0x82,0x00,
+	0x10,0xff,0xf0,0x91,0xa3,0x83,0x00,0xd1,0x12,0x10,0x09,0x10,0xff,0xf0,0x91,0xa3,
+	0x84,0x00,0x10,0xff,0xf0,0x91,0xa3,0x85,0x00,0x10,0x09,0x10,0xff,0xf0,0x91,0xa3,
+	0x86,0x00,0x10,0xff,0xf0,0x91,0xa3,0x87,0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x10,
+	0xff,0xf0,0x91,0xa3,0x88,0x00,0x10,0xff,0xf0,0x91,0xa3,0x89,0x00,0x10,0x09,0x10,
+	0xff,0xf0,0x91,0xa3,0x8a,0x00,0x10,0xff,0xf0,0x91,0xa3,0x8b,0x00,0xd1,0x12,0x10,
+	0x09,0x10,0xff,0xf0,0x91,0xa3,0x8c,0x00,0x10,0xff,0xf0,0x91,0xa3,0x8d,0x00,0x10,
+	0x09,0x10,0xff,0xf0,0x91,0xa3,0x8e,0x00,0x10,0xff,0xf0,0x91,0xa3,0x8f,0x00,0xd3,
+	0x48,0xd2,0x24,0xd1,0x12,0x10,0x09,0x10,0xff,0xf0,0x91,0xa3,0x90,0x00,0x10,0xff,
+	0xf0,0x91,0xa3,0x91,0x00,0x10,0x09,0x10,0xff,0xf0,0x91,0xa3,0x92,0x00,0x10,0xff,
+	0xf0,0x91,0xa3,0x93,0x00,0xd1,0x12,0x10,0x09,0x10,0xff,0xf0,0x91,0xa3,0x94,0x00,
+	0x10,0xff,0xf0,0x91,0xa3,0x95,0x00,0x10,0x09,0x10,0xff,0xf0,0x91,0xa3,0x96,0x00,
+	0x10,0xff,0xf0,0x91,0xa3,0x97,0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x10,0xff,0xf0,
+	0x91,0xa3,0x98,0x00,0x10,0xff,0xf0,0x91,0xa3,0x99,0x00,0x10,0x09,0x10,0xff,0xf0,
+	0x91,0xa3,0x9a,0x00,0x10,0xff,0xf0,0x91,0xa3,0x9b,0x00,0xd1,0x12,0x10,0x09,0x10,
+	0xff,0xf0,0x91,0xa3,0x9c,0x00,0x10,0xff,0xf0,0x91,0xa3,0x9d,0x00,0x10,0x09,0x10,
+	0xff,0xf0,0x91,0xa3,0x9e,0x00,0x10,0xff,0xf0,0x91,0xa3,0x9f,0x00,0xd1,0x11,0xe0,
+	0x12,0x81,0xcf,0x86,0xe5,0x09,0x81,0xe4,0xd2,0x80,0xcf,0x06,0x00,0x00,0xe0,0xdb,
+	0x82,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xd4,0x09,0xe3,0x10,0x81,0xcf,0x06,
+	0x0c,0x00,0xd3,0x06,0xcf,0x06,0x00,0x00,0xe2,0x3b,0x82,0xe1,0x16,0x82,0xd0,0x06,
+	0xcf,0x06,0x00,0x00,0xcf,0x86,0xa5,0x21,0x01,0xd4,0x90,0xd3,0x48,0xd2,0x24,0xd1,
+	0x12,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,0xa0,0x00,0x14,0xff,0xf0,0x96,0xb9,0xa1,
+	0x00,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,0xa2,0x00,0x14,0xff,0xf0,0x96,0xb9,0xa3,
+	0x00,0xd1,0x12,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,0xa4,0x00,0x14,0xff,0xf0,0x96,
+	0xb9,0xa5,0x00,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,0xa6,0x00,0x14,0xff,0xf0,0x96,
+	0xb9,0xa7,0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,0xa8,0x00,
+	0x14,0xff,0xf0,0x96,0xb9,0xa9,0x00,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,0xaa,0x00,
+	0x14,0xff,0xf0,0x96,0xb9,0xab,0x00,0xd1,0x12,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,
+	0xac,0x00,0x14,0xff,0xf0,0x96,0xb9,0xad,0x00,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,
+	0xae,0x00,0x14,0xff,0xf0,0x96,0xb9,0xaf,0x00,0xd3,0x48,0xd2,0x24,0xd1,0x12,0x10,
+	0x09,0x14,0xff,0xf0,0x96,0xb9,0xb0,0x00,0x14,0xff,0xf0,0x96,0xb9,0xb1,0x00,0x10,
+	0x09,0x14,0xff,0xf0,0x96,0xb9,0xb2,0x00,0x14,0xff,0xf0,0x96,0xb9,0xb3,0x00,0xd1,
+	0x12,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,0xb4,0x00,0x14,0xff,0xf0,0x96,0xb9,0xb5,
+	0x00,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,0xb6,0x00,0x14,0xff,0xf0,0x96,0xb9,0xb7,
+	0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,0xb8,0x00,0x14,0xff,
+	0xf0,0x96,0xb9,0xb9,0x00,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,0xba,0x00,0x14,0xff,
+	0xf0,0x96,0xb9,0xbb,0x00,0xd1,0x12,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,0xbc,0x00,
+	0x14,0xff,0xf0,0x96,0xb9,0xbd,0x00,0x10,0x09,0x14,0xff,0xf0,0x96,0xb9,0xbe,0x00,
+	0x14,0xff,0xf0,0x96,0xb9,0xbf,0x00,0x14,0x00,0xd2,0x14,0xe1,0x25,0x82,0xe0,0x1c,
+	0x82,0xcf,0x86,0xe5,0xdd,0x81,0xe4,0x9a,0x81,0xcf,0x06,0x12,0x00,0xd1,0x0b,0xe0,
+	0x51,0x83,0xcf,0x86,0xcf,0x06,0x00,0x00,0xe0,0x95,0x8b,0xcf,0x86,0xd5,0x22,0xe4,
+	0xd0,0x88,0xe3,0x93,0x88,0xe2,0x38,0x88,0xe1,0x31,0x88,0xe0,0x2a,0x88,0xcf,0x86,
+	0xe5,0xfb,0x87,0xe4,0xe2,0x87,0x93,0x07,0x62,0xd1,0x87,0x12,0xe6,0x12,0xe6,0xe4,
+	0x36,0x89,0xe3,0x2f,0x89,0xd2,0x09,0xe1,0xb8,0x88,0xcf,0x06,0x10,0x00,0xe1,0x1f,
+	0x89,0xe0,0xec,0x88,0xcf,0x86,0xe5,0x21,0x01,0xd4,0x90,0xd3,0x48,0xd2,0x24,0xd1,
+	0x12,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4,0xa2,0x00,0x12,0xff,0xf0,0x9e,0xa4,0xa3,
+	0x00,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4,0xa4,0x00,0x12,0xff,0xf0,0x9e,0xa4,0xa5,
+	0x00,0xd1,0x12,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4,0xa6,0x00,0x12,0xff,0xf0,0x9e,
+	0xa4,0xa7,0x00,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4,0xa8,0x00,0x12,0xff,0xf0,0x9e,
+	0xa4,0xa9,0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4,0xaa,0x00,
+	0x12,0xff,0xf0,0x9e,0xa4,0xab,0x00,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4,0xac,0x00,
+	0x12,0xff,0xf0,0x9e,0xa4,0xad,0x00,0xd1,0x12,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4,
+	0xae,0x00,0x12,0xff,0xf0,0x9e,0xa4,0xaf,0x00,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4,
+	0xb0,0x00,0x12,0xff,0xf0,0x9e,0xa4,0xb1,0x00,0xd3,0x48,0xd2,0x24,0xd1,0x12,0x10,
+	0x09,0x12,0xff,0xf0,0x9e,0xa4,0xb2,0x00,0x12,0xff,0xf0,0x9e,0xa4,0xb3,0x00,0x10,
+	0x09,0x12,0xff,0xf0,0x9e,0xa4,0xb4,0x00,0x12,0xff,0xf0,0x9e,0xa4,0xb5,0x00,0xd1,
+	0x12,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4,0xb6,0x00,0x12,0xff,0xf0,0x9e,0xa4,0xb7,
+	0x00,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4,0xb8,0x00,0x12,0xff,0xf0,0x9e,0xa4,0xb9,
+	0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4,0xba,0x00,0x12,0xff,
+	0xf0,0x9e,0xa4,0xbb,0x00,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4,0xbc,0x00,0x12,0xff,
+	0xf0,0x9e,0xa4,0xbd,0x00,0xd1,0x12,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa4,0xbe,0x00,
+	0x12,0xff,0xf0,0x9e,0xa4,0xbf,0x00,0x10,0x09,0x12,0xff,0xf0,0x9e,0xa5,0x80,0x00,
+	0x12,0xff,0xf0,0x9e,0xa5,0x81,0x00,0x94,0x1e,0x93,0x1a,0x92,0x16,0x91,0x12,0x10,
+	0x09,0x12,0xff,0xf0,0x9e,0xa5,0x82,0x00,0x12,0xff,0xf0,0x9e,0xa5,0x83,0x00,0x12,
+	0x00,0x12,0x00,0x12,0x00,0x12,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+	0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+	0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+	/* nfdi_c0100 */
+	0x57,0x04,0x01,0x00,0xc6,0xe5,0xac,0x13,0xe4,0x41,0x0c,0xe3,0x7a,0x07,0xe2,0xf3,
+	0x01,0xc1,0xd0,0x1f,0xcf,0x86,0x55,0x04,0x01,0x00,0x94,0x15,0x53,0x04,0x01,0x00,
+	0x52,0x04,0x01,0x00,0x91,0x09,0x10,0x04,0x01,0x00,0x01,0xff,0x00,0x01,0x00,0x01,
+	0x00,0xcf,0x86,0xd5,0xe4,0xd4,0x7c,0xd3,0x3c,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,
+	0xff,0x41,0xcc,0x80,0x00,0x01,0xff,0x41,0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x41,
+	0xcc,0x82,0x00,0x01,0xff,0x41,0xcc,0x83,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x41,
+	0xcc,0x88,0x00,0x01,0xff,0x41,0xcc,0x8a,0x00,0x10,0x04,0x01,0x00,0x01,0xff,0x43,
+	0xcc,0xa7,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x45,0xcc,0x80,0x00,0x01,
+	0xff,0x45,0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x45,0xcc,0x82,0x00,0x01,0xff,0x45,
+	0xcc,0x88,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x49,0xcc,0x80,0x00,0x01,0xff,0x49,
+	0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x49,0xcc,0x82,0x00,0x01,0xff,0x49,0xcc,0x88,
+	0x00,0xd3,0x38,0xd2,0x1c,0xd1,0x0c,0x10,0x04,0x01,0x00,0x01,0xff,0x4e,0xcc,0x83,
+	0x00,0x10,0x08,0x01,0xff,0x4f,0xcc,0x80,0x00,0x01,0xff,0x4f,0xcc,0x81,0x00,0xd1,
+	0x10,0x10,0x08,0x01,0xff,0x4f,0xcc,0x82,0x00,0x01,0xff,0x4f,0xcc,0x83,0x00,0x10,
+	0x08,0x01,0xff,0x4f,0xcc,0x88,0x00,0x01,0x00,0xd2,0x1c,0xd1,0x0c,0x10,0x04,0x01,
+	0x00,0x01,0xff,0x55,0xcc,0x80,0x00,0x10,0x08,0x01,0xff,0x55,0xcc,0x81,0x00,0x01,
+	0xff,0x55,0xcc,0x82,0x00,0x91,0x10,0x10,0x08,0x01,0xff,0x55,0xcc,0x88,0x00,0x01,
+	0xff,0x59,0xcc,0x81,0x00,0x01,0x00,0xd4,0x7c,0xd3,0x3c,0xd2,0x20,0xd1,0x10,0x10,
+	0x08,0x01,0xff,0x61,0xcc,0x80,0x00,0x01,0xff,0x61,0xcc,0x81,0x00,0x10,0x08,0x01,
+	0xff,0x61,0xcc,0x82,0x00,0x01,0xff,0x61,0xcc,0x83,0x00,0xd1,0x10,0x10,0x08,0x01,
+	0xff,0x61,0xcc,0x88,0x00,0x01,0xff,0x61,0xcc,0x8a,0x00,0x10,0x04,0x01,0x00,0x01,
+	0xff,0x63,0xcc,0xa7,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x65,0xcc,0x80,
+	0x00,0x01,0xff,0x65,0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x65,0xcc,0x82,0x00,0x01,
+	0xff,0x65,0xcc,0x88,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x69,0xcc,0x80,0x00,0x01,
+	0xff,0x69,0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x69,0xcc,0x82,0x00,0x01,0xff,0x69,
+	0xcc,0x88,0x00,0xd3,0x38,0xd2,0x1c,0xd1,0x0c,0x10,0x04,0x01,0x00,0x01,0xff,0x6e,
+	0xcc,0x83,0x00,0x10,0x08,0x01,0xff,0x6f,0xcc,0x80,0x00,0x01,0xff,0x6f,0xcc,0x81,
+	0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x6f,0xcc,0x82,0x00,0x01,0xff,0x6f,0xcc,0x83,
+	0x00,0x10,0x08,0x01,0xff,0x6f,0xcc,0x88,0x00,0x01,0x00,0xd2,0x1c,0xd1,0x0c,0x10,
+	0x04,0x01,0x00,0x01,0xff,0x75,0xcc,0x80,0x00,0x10,0x08,0x01,0xff,0x75,0xcc,0x81,
+	0x00,0x01,0xff,0x75,0xcc,0x82,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x75,0xcc,0x88,
+	0x00,0x01,0xff,0x79,0xcc,0x81,0x00,0x10,0x04,0x01,0x00,0x01,0xff,0x79,0xcc,0x88,
+	0x00,0xe1,0x9a,0x03,0xe0,0xd3,0x01,0xcf,0x86,0xd5,0xf4,0xd4,0x80,0xd3,0x40,0xd2,
+	0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x41,0xcc,0x84,0x00,0x01,0xff,0x61,0xcc,0x84,
+	0x00,0x10,0x08,0x01,0xff,0x41,0xcc,0x86,0x00,0x01,0xff,0x61,0xcc,0x86,0x00,0xd1,
+	0x10,0x10,0x08,0x01,0xff,0x41,0xcc,0xa8,0x00,0x01,0xff,0x61,0xcc,0xa8,0x00,0x10,
+	0x08,0x01,0xff,0x43,0xcc,0x81,0x00,0x01,0xff,0x63,0xcc,0x81,0x00,0xd2,0x20,0xd1,
+	0x10,0x10,0x08,0x01,0xff,0x43,0xcc,0x82,0x00,0x01,0xff,0x63,0xcc,0x82,0x00,0x10,
+	0x08,0x01,0xff,0x43,0xcc,0x87,0x00,0x01,0xff,0x63,0xcc,0x87,0x00,0xd1,0x10,0x10,
+	0x08,0x01,0xff,0x43,0xcc,0x8c,0x00,0x01,0xff,0x63,0xcc,0x8c,0x00,0x10,0x08,0x01,
+	0xff,0x44,0xcc,0x8c,0x00,0x01,0xff,0x64,0xcc,0x8c,0x00,0xd3,0x34,0xd2,0x14,0x51,
+	0x04,0x01,0x00,0x10,0x08,0x01,0xff,0x45,0xcc,0x84,0x00,0x01,0xff,0x65,0xcc,0x84,
+	0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x45,0xcc,0x86,0x00,0x01,0xff,0x65,0xcc,0x86,
+	0x00,0x10,0x08,0x01,0xff,0x45,0xcc,0x87,0x00,0x01,0xff,0x65,0xcc,0x87,0x00,0xd2,
+	0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x45,0xcc,0xa8,0x00,0x01,0xff,0x65,0xcc,0xa8,
+	0x00,0x10,0x08,0x01,0xff,0x45,0xcc,0x8c,0x00,0x01,0xff,0x65,0xcc,0x8c,0x00,0xd1,
+	0x10,0x10,0x08,0x01,0xff,0x47,0xcc,0x82,0x00,0x01,0xff,0x67,0xcc,0x82,0x00,0x10,
+	0x08,0x01,0xff,0x47,0xcc,0x86,0x00,0x01,0xff,0x67,0xcc,0x86,0x00,0xd4,0x74,0xd3,
+	0x34,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x47,0xcc,0x87,0x00,0x01,0xff,0x67,
+	0xcc,0x87,0x00,0x10,0x08,0x01,0xff,0x47,0xcc,0xa7,0x00,0x01,0xff,0x67,0xcc,0xa7,
+	0x00,0x91,0x10,0x10,0x08,0x01,0xff,0x48,0xcc,0x82,0x00,0x01,0xff,0x68,0xcc,0x82,
+	0x00,0x01,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x49,0xcc,0x83,0x00,0x01,
+	0xff,0x69,0xcc,0x83,0x00,0x10,0x08,0x01,0xff,0x49,0xcc,0x84,0x00,0x01,0xff,0x69,
+	0xcc,0x84,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x49,0xcc,0x86,0x00,0x01,0xff,0x69,
+	0xcc,0x86,0x00,0x10,0x08,0x01,0xff,0x49,0xcc,0xa8,0x00,0x01,0xff,0x69,0xcc,0xa8,
+	0x00,0xd3,0x30,0xd2,0x10,0x91,0x0c,0x10,0x08,0x01,0xff,0x49,0xcc,0x87,0x00,0x01,
+	0x00,0x01,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x4a,0xcc,0x82,0x00,0x01,0xff,0x6a,
+	0xcc,0x82,0x00,0x10,0x08,0x01,0xff,0x4b,0xcc,0xa7,0x00,0x01,0xff,0x6b,0xcc,0xa7,
+	0x00,0xd2,0x1c,0xd1,0x0c,0x10,0x04,0x01,0x00,0x01,0xff,0x4c,0xcc,0x81,0x00,0x10,
+	0x08,0x01,0xff,0x6c,0xcc,0x81,0x00,0x01,0xff,0x4c,0xcc,0xa7,0x00,0xd1,0x10,0x10,
+	0x08,0x01,0xff,0x6c,0xcc,0xa7,0x00,0x01,0xff,0x4c,0xcc,0x8c,0x00,0x10,0x08,0x01,
+	0xff,0x6c,0xcc,0x8c,0x00,0x01,0x00,0xcf,0x86,0xd5,0xd4,0xd4,0x60,0xd3,0x30,0xd2,
+	0x10,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x01,0xff,0x4e,0xcc,0x81,0x00,0xd1,
+	0x10,0x10,0x08,0x01,0xff,0x6e,0xcc,0x81,0x00,0x01,0xff,0x4e,0xcc,0xa7,0x00,0x10,
+	0x08,0x01,0xff,0x6e,0xcc,0xa7,0x00,0x01,0xff,0x4e,0xcc,0x8c,0x00,0xd2,0x10,0x91,
+	0x0c,0x10,0x08,0x01,0xff,0x6e,0xcc,0x8c,0x00,0x01,0x00,0x01,0x00,0xd1,0x10,0x10,
+	0x08,0x01,0xff,0x4f,0xcc,0x84,0x00,0x01,0xff,0x6f,0xcc,0x84,0x00,0x10,0x08,0x01,
+	0xff,0x4f,0xcc,0x86,0x00,0x01,0xff,0x6f,0xcc,0x86,0x00,0xd3,0x34,0xd2,0x14,0x91,
+	0x10,0x10,0x08,0x01,0xff,0x4f,0xcc,0x8b,0x00,0x01,0xff,0x6f,0xcc,0x8b,0x00,0x01,
+	0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x52,0xcc,0x81,0x00,0x01,0xff,0x72,0xcc,0x81,
+	0x00,0x10,0x08,0x01,0xff,0x52,0xcc,0xa7,0x00,0x01,0xff,0x72,0xcc,0xa7,0x00,0xd2,
+	0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x52,0xcc,0x8c,0x00,0x01,0xff,0x72,0xcc,0x8c,
+	0x00,0x10,0x08,0x01,0xff,0x53,0xcc,0x81,0x00,0x01,0xff,0x73,0xcc,0x81,0x00,0xd1,
+	0x10,0x10,0x08,0x01,0xff,0x53,0xcc,0x82,0x00,0x01,0xff,0x73,0xcc,0x82,0x00,0x10,
+	0x08,0x01,0xff,0x53,0xcc,0xa7,0x00,0x01,0xff,0x73,0xcc,0xa7,0x00,0xd4,0x74,0xd3,
+	0x34,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x53,0xcc,0x8c,0x00,0x01,0xff,0x73,
+	0xcc,0x8c,0x00,0x10,0x08,0x01,0xff,0x54,0xcc,0xa7,0x00,0x01,0xff,0x74,0xcc,0xa7,
+	0x00,0x91,0x10,0x10,0x08,0x01,0xff,0x54,0xcc,0x8c,0x00,0x01,0xff,0x74,0xcc,0x8c,
+	0x00,0x01,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x55,0xcc,0x83,0x00,0x01,
+	0xff,0x75,0xcc,0x83,0x00,0x10,0x08,0x01,0xff,0x55,0xcc,0x84,0x00,0x01,0xff,0x75,
+	0xcc,0x84,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x55,0xcc,0x86,0x00,0x01,0xff,0x75,
+	0xcc,0x86,0x00,0x10,0x08,0x01,0xff,0x55,0xcc,0x8a,0x00,0x01,0xff,0x75,0xcc,0x8a,
+	0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x55,0xcc,0x8b,0x00,0x01,
+	0xff,0x75,0xcc,0x8b,0x00,0x10,0x08,0x01,0xff,0x55,0xcc,0xa8,0x00,0x01,0xff,0x75,
+	0xcc,0xa8,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x57,0xcc,0x82,0x00,0x01,0xff,0x77,
+	0xcc,0x82,0x00,0x10,0x08,0x01,0xff,0x59,0xcc,0x82,0x00,0x01,0xff,0x79,0xcc,0x82,
+	0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x59,0xcc,0x88,0x00,0x01,0xff,0x5a,
+	0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x7a,0xcc,0x81,0x00,0x01,0xff,0x5a,0xcc,0x87,
+	0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x7a,0xcc,0x87,0x00,0x01,0xff,0x5a,0xcc,0x8c,
+	0x00,0x10,0x08,0x01,0xff,0x7a,0xcc,0x8c,0x00,0x01,0x00,0xd0,0x4a,0xcf,0x86,0x55,
+	0x04,0x01,0x00,0xd4,0x2c,0xd3,0x18,0x92,0x14,0x91,0x10,0x10,0x08,0x01,0xff,0x4f,
+	0xcc,0x9b,0x00,0x01,0xff,0x6f,0xcc,0x9b,0x00,0x01,0x00,0x01,0x00,0x52,0x04,0x01,
+	0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x01,0xff,0x55,0xcc,0x9b,0x00,0x93,
+	0x14,0x92,0x10,0x91,0x0c,0x10,0x08,0x01,0xff,0x75,0xcc,0x9b,0x00,0x01,0x00,0x01,
+	0x00,0x01,0x00,0x01,0x00,0xcf,0x86,0xd5,0xb4,0xd4,0x24,0x53,0x04,0x01,0x00,0x52,
+	0x04,0x01,0x00,0xd1,0x0c,0x10,0x04,0x01,0x00,0x01,0xff,0x41,0xcc,0x8c,0x00,0x10,
+	0x08,0x01,0xff,0x61,0xcc,0x8c,0x00,0x01,0xff,0x49,0xcc,0x8c,0x00,0xd3,0x46,0xd2,
+	0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x69,0xcc,0x8c,0x00,0x01,0xff,0x4f,0xcc,0x8c,
+	0x00,0x10,0x08,0x01,0xff,0x6f,0xcc,0x8c,0x00,0x01,0xff,0x55,0xcc,0x8c,0x00,0xd1,
+	0x12,0x10,0x08,0x01,0xff,0x75,0xcc,0x8c,0x00,0x01,0xff,0x55,0xcc,0x88,0xcc,0x84,
+	0x00,0x10,0x0a,0x01,0xff,0x75,0xcc,0x88,0xcc,0x84,0x00,0x01,0xff,0x55,0xcc,0x88,
+	0xcc,0x81,0x00,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x75,0xcc,0x88,0xcc,0x81,
+	0x00,0x01,0xff,0x55,0xcc,0x88,0xcc,0x8c,0x00,0x10,0x0a,0x01,0xff,0x75,0xcc,0x88,
+	0xcc,0x8c,0x00,0x01,0xff,0x55,0xcc,0x88,0xcc,0x80,0x00,0xd1,0x0e,0x10,0x0a,0x01,
+	0xff,0x75,0xcc,0x88,0xcc,0x80,0x00,0x01,0x00,0x10,0x0a,0x01,0xff,0x41,0xcc,0x88,
+	0xcc,0x84,0x00,0x01,0xff,0x61,0xcc,0x88,0xcc,0x84,0x00,0xd4,0x80,0xd3,0x3a,0xd2,
+	0x26,0xd1,0x14,0x10,0x0a,0x01,0xff,0x41,0xcc,0x87,0xcc,0x84,0x00,0x01,0xff,0x61,
+	0xcc,0x87,0xcc,0x84,0x00,0x10,0x09,0x01,0xff,0xc3,0x86,0xcc,0x84,0x00,0x01,0xff,
+	0xc3,0xa6,0xcc,0x84,0x00,0x51,0x04,0x01,0x00,0x10,0x08,0x01,0xff,0x47,0xcc,0x8c,
+	0x00,0x01,0xff,0x67,0xcc,0x8c,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x4b,
+	0xcc,0x8c,0x00,0x01,0xff,0x6b,0xcc,0x8c,0x00,0x10,0x08,0x01,0xff,0x4f,0xcc,0xa8,
+	0x00,0x01,0xff,0x6f,0xcc,0xa8,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x4f,0xcc,0xa8,
+	0xcc,0x84,0x00,0x01,0xff,0x6f,0xcc,0xa8,0xcc,0x84,0x00,0x10,0x09,0x01,0xff,0xc6,
+	0xb7,0xcc,0x8c,0x00,0x01,0xff,0xca,0x92,0xcc,0x8c,0x00,0xd3,0x24,0xd2,0x10,0x91,
+	0x0c,0x10,0x08,0x01,0xff,0x6a,0xcc,0x8c,0x00,0x01,0x00,0x01,0x00,0x91,0x10,0x10,
+	0x08,0x01,0xff,0x47,0xcc,0x81,0x00,0x01,0xff,0x67,0xcc,0x81,0x00,0x04,0x00,0xd2,
+	0x24,0xd1,0x10,0x10,0x08,0x04,0xff,0x4e,0xcc,0x80,0x00,0x04,0xff,0x6e,0xcc,0x80,
+	0x00,0x10,0x0a,0x01,0xff,0x41,0xcc,0x8a,0xcc,0x81,0x00,0x01,0xff,0x61,0xcc,0x8a,
+	0xcc,0x81,0x00,0xd1,0x12,0x10,0x09,0x01,0xff,0xc3,0x86,0xcc,0x81,0x00,0x01,0xff,
+	0xc3,0xa6,0xcc,0x81,0x00,0x10,0x09,0x01,0xff,0xc3,0x98,0xcc,0x81,0x00,0x01,0xff,
+	0xc3,0xb8,0xcc,0x81,0x00,0xe2,0x07,0x02,0xe1,0xae,0x01,0xe0,0x93,0x01,0xcf,0x86,
+	0xd5,0xf4,0xd4,0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x41,0xcc,
+	0x8f,0x00,0x01,0xff,0x61,0xcc,0x8f,0x00,0x10,0x08,0x01,0xff,0x41,0xcc,0x91,0x00,
+	0x01,0xff,0x61,0xcc,0x91,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x45,0xcc,0x8f,0x00,
+	0x01,0xff,0x65,0xcc,0x8f,0x00,0x10,0x08,0x01,0xff,0x45,0xcc,0x91,0x00,0x01,0xff,
+	0x65,0xcc,0x91,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x49,0xcc,0x8f,0x00,
+	0x01,0xff,0x69,0xcc,0x8f,0x00,0x10,0x08,0x01,0xff,0x49,0xcc,0x91,0x00,0x01,0xff,
+	0x69,0xcc,0x91,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x4f,0xcc,0x8f,0x00,0x01,0xff,
+	0x6f,0xcc,0x8f,0x00,0x10,0x08,0x01,0xff,0x4f,0xcc,0x91,0x00,0x01,0xff,0x6f,0xcc,
+	0x91,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x52,0xcc,0x8f,0x00,
+	0x01,0xff,0x72,0xcc,0x8f,0x00,0x10,0x08,0x01,0xff,0x52,0xcc,0x91,0x00,0x01,0xff,
+	0x72,0xcc,0x91,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x55,0xcc,0x8f,0x00,0x01,0xff,
+	0x75,0xcc,0x8f,0x00,0x10,0x08,0x01,0xff,0x55,0xcc,0x91,0x00,0x01,0xff,0x75,0xcc,
+	0x91,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x04,0xff,0x53,0xcc,0xa6,0x00,0x04,0xff,
+	0x73,0xcc,0xa6,0x00,0x10,0x08,0x04,0xff,0x54,0xcc,0xa6,0x00,0x04,0xff,0x74,0xcc,
+	0xa6,0x00,0x51,0x04,0x04,0x00,0x10,0x08,0x04,0xff,0x48,0xcc,0x8c,0x00,0x04,0xff,
+	0x68,0xcc,0x8c,0x00,0xd4,0x68,0xd3,0x20,0xd2,0x0c,0x91,0x08,0x10,0x04,0x06,0x00,
+	0x07,0x00,0x04,0x00,0x51,0x04,0x04,0x00,0x10,0x08,0x04,0xff,0x41,0xcc,0x87,0x00,
+	0x04,0xff,0x61,0xcc,0x87,0x00,0xd2,0x24,0xd1,0x10,0x10,0x08,0x04,0xff,0x45,0xcc,
+	0xa7,0x00,0x04,0xff,0x65,0xcc,0xa7,0x00,0x10,0x0a,0x04,0xff,0x4f,0xcc,0x88,0xcc,
+	0x84,0x00,0x04,0xff,0x6f,0xcc,0x88,0xcc,0x84,0x00,0xd1,0x14,0x10,0x0a,0x04,0xff,
+	0x4f,0xcc,0x83,0xcc,0x84,0x00,0x04,0xff,0x6f,0xcc,0x83,0xcc,0x84,0x00,0x10,0x08,
+	0x04,0xff,0x4f,0xcc,0x87,0x00,0x04,0xff,0x6f,0xcc,0x87,0x00,0x93,0x30,0xd2,0x24,
+	0xd1,0x14,0x10,0x0a,0x04,0xff,0x4f,0xcc,0x87,0xcc,0x84,0x00,0x04,0xff,0x6f,0xcc,
+	0x87,0xcc,0x84,0x00,0x10,0x08,0x04,0xff,0x59,0xcc,0x84,0x00,0x04,0xff,0x79,0xcc,
+	0x84,0x00,0x51,0x04,0x07,0x00,0x10,0x04,0x07,0x00,0x08,0x00,0x08,0x00,0xcf,0x86,
+	0x95,0x14,0x94,0x10,0x93,0x0c,0x92,0x08,0x11,0x04,0x08,0x00,0x09,0x00,0x09,0x00,
+	0x09,0x00,0x01,0x00,0x01,0x00,0xd0,0x22,0xcf,0x86,0x55,0x04,0x01,0x00,0x94,0x18,
+	0x53,0x04,0x01,0x00,0xd2,0x0c,0x91,0x08,0x10,0x04,0x01,0x00,0x04,0x00,0x04,0x00,
+	0x11,0x04,0x04,0x00,0x07,0x00,0x01,0x00,0xcf,0x86,0xd5,0x18,0x54,0x04,0x01,0x00,
+	0x53,0x04,0x01,0x00,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,
+	0x04,0x00,0x94,0x18,0x53,0x04,0x01,0x00,0xd2,0x08,0x11,0x04,0x01,0x00,0x04,0x00,
+	0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x07,0x00,0x07,0x00,0xe1,0x35,0x01,0xd0,
+	0x72,0xcf,0x86,0xd5,0x24,0x54,0x04,0x01,0xe6,0xd3,0x10,0x52,0x04,0x01,0xe6,0x91,
+	0x08,0x10,0x04,0x01,0xe6,0x01,0xe8,0x01,0xdc,0x92,0x0c,0x51,0x04,0x01,0xdc,0x10,
+	0x04,0x01,0xe8,0x01,0xd8,0x01,0xdc,0xd4,0x2c,0xd3,0x1c,0xd2,0x10,0xd1,0x08,0x10,
+	0x04,0x01,0xdc,0x01,0xca,0x10,0x04,0x01,0xca,0x01,0xdc,0x51,0x04,0x01,0xdc,0x10,
+	0x04,0x01,0xdc,0x01,0xca,0x92,0x0c,0x91,0x08,0x10,0x04,0x01,0xca,0x01,0xdc,0x01,
+	0xdc,0x01,0xdc,0xd3,0x08,0x12,0x04,0x01,0xdc,0x01,0x01,0xd2,0x0c,0x91,0x08,0x10,
+	0x04,0x01,0x01,0x01,0xdc,0x01,0xdc,0x91,0x08,0x10,0x04,0x01,0xdc,0x01,0xe6,0x01,
+	0xe6,0xcf,0x86,0xd5,0x7f,0xd4,0x47,0xd3,0x2e,0xd2,0x19,0xd1,0x0e,0x10,0x07,0x01,
+	0xff,0xcc,0x80,0x00,0x01,0xff,0xcc,0x81,0x00,0x10,0x04,0x01,0xe6,0x01,0xff,0xcc,
+	0x93,0x00,0xd1,0x0d,0x10,0x09,0x01,0xff,0xcc,0x88,0xcc,0x81,0x00,0x01,0xf0,0x10,
+	0x04,0x04,0xe6,0x04,0xdc,0xd2,0x08,0x11,0x04,0x04,0xdc,0x04,0xe6,0xd1,0x08,0x10,
+	0x04,0x04,0xe6,0x04,0xdc,0x10,0x04,0x04,0xdc,0x06,0xff,0x00,0xd3,0x18,0xd2,0x0c,
+	0x51,0x04,0x07,0xe6,0x10,0x04,0x07,0xe6,0x07,0xdc,0x51,0x04,0x07,0xdc,0x10,0x04,
+	0x07,0xdc,0x07,0xe6,0xd2,0x10,0xd1,0x08,0x10,0x04,0x08,0xe8,0x08,0xdc,0x10,0x04,
+	0x08,0xdc,0x08,0xe6,0xd1,0x08,0x10,0x04,0x08,0xe9,0x07,0xea,0x10,0x04,0x07,0xea,
+	0x07,0xe9,0xd4,0x14,0x93,0x10,0x92,0x0c,0x51,0x04,0x01,0xea,0x10,0x04,0x04,0xe9,
+	0x06,0xe6,0x06,0xe6,0x06,0xe6,0xd3,0x13,0x52,0x04,0x0a,0x00,0x91,0x0b,0x10,0x07,
+	0x01,0xff,0xca,0xb9,0x00,0x01,0x00,0x0a,0x00,0xd2,0x0c,0x51,0x04,0x00,0x00,0x10,
+	0x04,0x01,0x00,0x09,0x00,0x51,0x04,0x09,0x00,0x10,0x06,0x01,0xff,0x3b,0x00,0x10,
+	0x00,0xd0,0xe1,0xcf,0x86,0xd5,0x7a,0xd4,0x5f,0xd3,0x21,0x52,0x04,0x00,0x00,0xd1,
+	0x0d,0x10,0x04,0x01,0x00,0x01,0xff,0xc2,0xa8,0xcc,0x81,0x00,0x10,0x09,0x01,0xff,
+	0xce,0x91,0xcc,0x81,0x00,0x01,0xff,0xc2,0xb7,0x00,0xd2,0x1f,0xd1,0x12,0x10,0x09,
+	0x01,0xff,0xce,0x95,0xcc,0x81,0x00,0x01,0xff,0xce,0x97,0xcc,0x81,0x00,0x10,0x09,
+	0x01,0xff,0xce,0x99,0xcc,0x81,0x00,0x00,0x00,0xd1,0x0d,0x10,0x09,0x01,0xff,0xce,
+	0x9f,0xcc,0x81,0x00,0x00,0x00,0x10,0x09,0x01,0xff,0xce,0xa5,0xcc,0x81,0x00,0x01,
+	0xff,0xce,0xa9,0xcc,0x81,0x00,0x93,0x17,0x92,0x13,0x91,0x0f,0x10,0x0b,0x01,0xff,
+	0xce,0xb9,0xcc,0x88,0xcc,0x81,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd4,
+	0x4a,0xd3,0x10,0x92,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x00,0x00,0x01,0x00,0x01,
+	0x00,0xd2,0x16,0x51,0x04,0x01,0x00,0x10,0x09,0x01,0xff,0xce,0x99,0xcc,0x88,0x00,
+	0x01,0xff,0xce,0xa5,0xcc,0x88,0x00,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xb1,0xcc,
+	0x81,0x00,0x01,0xff,0xce,0xb5,0xcc,0x81,0x00,0x10,0x09,0x01,0xff,0xce,0xb7,0xcc,
+	0x81,0x00,0x01,0xff,0xce,0xb9,0xcc,0x81,0x00,0x93,0x17,0x92,0x13,0x91,0x0f,0x10,
+	0x0b,0x01,0xff,0xcf,0x85,0xcc,0x88,0xcc,0x81,0x00,0x01,0x00,0x01,0x00,0x01,0x00,
+	0x01,0x00,0xcf,0x86,0xd5,0x7b,0xd4,0x39,0x53,0x04,0x01,0x00,0xd2,0x16,0x51,0x04,
+	0x01,0x00,0x10,0x09,0x01,0xff,0xce,0xb9,0xcc,0x88,0x00,0x01,0xff,0xcf,0x85,0xcc,
+	0x88,0x00,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xbf,0xcc,0x81,0x00,0x01,0xff,0xcf,
+	0x85,0xcc,0x81,0x00,0x10,0x09,0x01,0xff,0xcf,0x89,0xcc,0x81,0x00,0x0a,0x00,0xd3,
+	0x26,0xd2,0x11,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x01,0xff,0xcf,0x92,0xcc,
+	0x81,0x00,0xd1,0x0d,0x10,0x09,0x01,0xff,0xcf,0x92,0xcc,0x88,0x00,0x01,0x00,0x10,
+	0x04,0x01,0x00,0x04,0x00,0xd2,0x0c,0x51,0x04,0x06,0x00,0x10,0x04,0x01,0x00,0x04,
+	0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x04,0x00,0x10,0x04,0x01,0x00,0x04,0x00,0xd4,
+	0x14,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x01,0x00,0x04,0x00,0x01,0x00,0x01,
+	0x00,0x01,0x00,0xd3,0x10,0x52,0x04,0x01,0x00,0x51,0x04,0x05,0x00,0x10,0x04,0x06,
+	0x00,0x07,0x00,0x12,0x04,0x07,0x00,0x08,0x00,0xe3,0x47,0x04,0xe2,0xbe,0x02,0xe1,
+	0x07,0x01,0xd0,0x8b,0xcf,0x86,0xd5,0x6c,0xd4,0x53,0xd3,0x30,0xd2,0x1f,0xd1,0x12,
+	0x10,0x09,0x04,0xff,0xd0,0x95,0xcc,0x80,0x00,0x01,0xff,0xd0,0x95,0xcc,0x88,0x00,
+	0x10,0x04,0x01,0x00,0x01,0xff,0xd0,0x93,0xcc,0x81,0x00,0x51,0x04,0x01,0x00,0x10,
+	0x04,0x01,0x00,0x01,0xff,0xd0,0x86,0xcc,0x88,0x00,0x52,0x04,0x01,0x00,0xd1,0x12,
+	0x10,0x09,0x01,0xff,0xd0,0x9a,0xcc,0x81,0x00,0x04,0xff,0xd0,0x98,0xcc,0x80,0x00,
+	0x10,0x09,0x01,0xff,0xd0,0xa3,0xcc,0x86,0x00,0x01,0x00,0x53,0x04,0x01,0x00,0x92,
+	0x11,0x91,0x0d,0x10,0x04,0x01,0x00,0x01,0xff,0xd0,0x98,0xcc,0x86,0x00,0x01,0x00,
+	0x01,0x00,0x54,0x04,0x01,0x00,0x53,0x04,0x01,0x00,0x92,0x11,0x91,0x0d,0x10,0x04,
+	0x01,0x00,0x01,0xff,0xd0,0xb8,0xcc,0x86,0x00,0x01,0x00,0x01,0x00,0xcf,0x86,0xd5,
+	0x57,0x54,0x04,0x01,0x00,0xd3,0x30,0xd2,0x1f,0xd1,0x12,0x10,0x09,0x04,0xff,0xd0,
+	0xb5,0xcc,0x80,0x00,0x01,0xff,0xd0,0xb5,0xcc,0x88,0x00,0x10,0x04,0x01,0x00,0x01,
+	0xff,0xd0,0xb3,0xcc,0x81,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x01,0xff,
+	0xd1,0x96,0xcc,0x88,0x00,0x52,0x04,0x01,0x00,0xd1,0x12,0x10,0x09,0x01,0xff,0xd0,
+	0xba,0xcc,0x81,0x00,0x04,0xff,0xd0,0xb8,0xcc,0x80,0x00,0x10,0x09,0x01,0xff,0xd1,
+	0x83,0xcc,0x86,0x00,0x01,0x00,0x54,0x04,0x01,0x00,0x93,0x1a,0x52,0x04,0x01,0x00,
+	0x51,0x04,0x01,0x00,0x10,0x09,0x01,0xff,0xd1,0xb4,0xcc,0x8f,0x00,0x01,0xff,0xd1,
+	0xb5,0xcc,0x8f,0x00,0x01,0x00,0xd0,0x2e,0xcf,0x86,0x95,0x28,0x94,0x24,0xd3,0x18,
+	0xd2,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x01,0xe6,0x51,0x04,0x01,0xe6,
+	0x10,0x04,0x01,0xe6,0x0a,0xe6,0x92,0x08,0x11,0x04,0x04,0x00,0x06,0x00,0x04,0x00,
+	0x01,0x00,0x01,0x00,0xcf,0x86,0xd5,0xbe,0xd4,0x4a,0xd3,0x2a,0xd2,0x1a,0xd1,0x0d,
+	0x10,0x04,0x01,0x00,0x01,0xff,0xd0,0x96,0xcc,0x86,0x00,0x10,0x09,0x01,0xff,0xd0,
+	0xb6,0xcc,0x86,0x00,0x01,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x06,0x00,0x10,0x04,
+	0x06,0x00,0x01,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,0x01,0x00,0x06,0x00,0x10,0x04,
+	0x06,0x00,0x01,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x06,0x00,0x10,0x04,0x06,0x00,
+	0x09,0x00,0xd3,0x3a,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,0xff,0xd0,0x90,0xcc,0x86,
+	0x00,0x01,0xff,0xd0,0xb0,0xcc,0x86,0x00,0x10,0x09,0x01,0xff,0xd0,0x90,0xcc,0x88,
+	0x00,0x01,0xff,0xd0,0xb0,0xcc,0x88,0x00,0x51,0x04,0x01,0x00,0x10,0x09,0x01,0xff,
+	0xd0,0x95,0xcc,0x86,0x00,0x01,0xff,0xd0,0xb5,0xcc,0x86,0x00,0xd2,0x16,0x51,0x04,
+	0x01,0x00,0x10,0x09,0x01,0xff,0xd3,0x98,0xcc,0x88,0x00,0x01,0xff,0xd3,0x99,0xcc,
+	0x88,0x00,0xd1,0x12,0x10,0x09,0x01,0xff,0xd0,0x96,0xcc,0x88,0x00,0x01,0xff,0xd0,
+	0xb6,0xcc,0x88,0x00,0x10,0x09,0x01,0xff,0xd0,0x97,0xcc,0x88,0x00,0x01,0xff,0xd0,
+	0xb7,0xcc,0x88,0x00,0xd4,0x74,0xd3,0x3a,0xd2,0x16,0x51,0x04,0x01,0x00,0x10,0x09,
+	0x01,0xff,0xd0,0x98,0xcc,0x84,0x00,0x01,0xff,0xd0,0xb8,0xcc,0x84,0x00,0xd1,0x12,
+	0x10,0x09,0x01,0xff,0xd0,0x98,0xcc,0x88,0x00,0x01,0xff,0xd0,0xb8,0xcc,0x88,0x00,
+	0x10,0x09,0x01,0xff,0xd0,0x9e,0xcc,0x88,0x00,0x01,0xff,0xd0,0xbe,0xcc,0x88,0x00,
+	0xd2,0x16,0x51,0x04,0x01,0x00,0x10,0x09,0x01,0xff,0xd3,0xa8,0xcc,0x88,0x00,0x01,
+	0xff,0xd3,0xa9,0xcc,0x88,0x00,0xd1,0x12,0x10,0x09,0x04,0xff,0xd0,0xad,0xcc,0x88,
+	0x00,0x04,0xff,0xd1,0x8d,0xcc,0x88,0x00,0x10,0x09,0x01,0xff,0xd0,0xa3,0xcc,0x84,
+	0x00,0x01,0xff,0xd1,0x83,0xcc,0x84,0x00,0xd3,0x3a,0xd2,0x24,0xd1,0x12,0x10,0x09,
+	0x01,0xff,0xd0,0xa3,0xcc,0x88,0x00,0x01,0xff,0xd1,0x83,0xcc,0x88,0x00,0x10,0x09,
+	0x01,0xff,0xd0,0xa3,0xcc,0x8b,0x00,0x01,0xff,0xd1,0x83,0xcc,0x8b,0x00,0x91,0x12,
+	0x10,0x09,0x01,0xff,0xd0,0xa7,0xcc,0x88,0x00,0x01,0xff,0xd1,0x87,0xcc,0x88,0x00,
+	0x08,0x00,0x92,0x16,0x91,0x12,0x10,0x09,0x01,0xff,0xd0,0xab,0xcc,0x88,0x00,0x01,
+	0xff,0xd1,0x8b,0xcc,0x88,0x00,0x09,0x00,0x09,0x00,0xd1,0x74,0xd0,0x36,0xcf,0x86,
+	0xd5,0x10,0x54,0x04,0x06,0x00,0x93,0x08,0x12,0x04,0x09,0x00,0x0a,0x00,0x0a,0x00,
+	0xd4,0x10,0x93,0x0c,0x52,0x04,0x0a,0x00,0x11,0x04,0x0b,0x00,0x0c,0x00,0x10,0x00,
+	0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x01,0x00,
+	0x01,0x00,0xcf,0x86,0xd5,0x24,0x54,0x04,0x01,0x00,0xd3,0x10,0x52,0x04,0x01,0x00,
+	0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x00,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,
+	0x00,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x94,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,
+	0x10,0x04,0x14,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd0,0xba,
+	0xcf,0x86,0xd5,0x4c,0xd4,0x24,0x53,0x04,0x01,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,
+	0x14,0x00,0x01,0x00,0x10,0x04,0x04,0x00,0x00,0x00,0xd1,0x08,0x10,0x04,0x00,0x00,
+	0x10,0x00,0x10,0x04,0x10,0x00,0x0d,0x00,0xd3,0x18,0xd2,0x0c,0x91,0x08,0x10,0x04,
+	0x00,0x00,0x02,0xdc,0x02,0xe6,0x51,0x04,0x02,0xe6,0x10,0x04,0x02,0xdc,0x02,0xe6,
+	0x92,0x0c,0x51,0x04,0x02,0xe6,0x10,0x04,0x02,0xde,0x02,0xdc,0x02,0xe6,0xd4,0x2c,
+	0xd3,0x10,0x92,0x0c,0x51,0x04,0x02,0xe6,0x10,0x04,0x08,0xdc,0x02,0xdc,0x02,0xdc,
+	0xd2,0x0c,0x51,0x04,0x02,0xe6,0x10,0x04,0x02,0xdc,0x02,0xe6,0xd1,0x08,0x10,0x04,
+	0x02,0xe6,0x02,0xde,0x10,0x04,0x02,0xe4,0x02,0xe6,0xd3,0x20,0xd2,0x10,0xd1,0x08,
+	0x10,0x04,0x01,0x0a,0x01,0x0b,0x10,0x04,0x01,0x0c,0x01,0x0d,0xd1,0x08,0x10,0x04,
+	0x01,0x0e,0x01,0x0f,0x10,0x04,0x01,0x10,0x01,0x11,0xd2,0x10,0xd1,0x08,0x10,0x04,
+	0x01,0x12,0x01,0x13,0x10,0x04,0x09,0x13,0x01,0x14,0xd1,0x08,0x10,0x04,0x01,0x15,
+	0x01,0x16,0x10,0x04,0x01,0x00,0x01,0x17,0xcf,0x86,0xd5,0x28,0x94,0x24,0x93,0x20,
+	0xd2,0x10,0xd1,0x08,0x10,0x04,0x01,0x00,0x01,0x18,0x10,0x04,0x01,0x19,0x01,0x00,
+	0xd1,0x08,0x10,0x04,0x02,0xe6,0x08,0xdc,0x10,0x04,0x08,0x00,0x08,0x12,0x00,0x00,
+	0x01,0x00,0xd4,0x1c,0x53,0x04,0x01,0x00,0xd2,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,
+	0x01,0x00,0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x14,0x00,0x93,0x10,
+	0x52,0x04,0x01,0x00,0x91,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+	0xe2,0xfb,0x01,0xe1,0x2b,0x01,0xd0,0xa8,0xcf,0x86,0xd5,0x55,0xd4,0x28,0xd3,0x10,
+	0x52,0x04,0x07,0x00,0x91,0x08,0x10,0x04,0x0d,0x00,0x10,0x00,0x0a,0x00,0xd2,0x0c,
+	0x51,0x04,0x0a,0x00,0x10,0x04,0x0a,0x00,0x08,0x00,0x91,0x08,0x10,0x04,0x01,0x00,
+	0x07,0x00,0x07,0x00,0xd3,0x0c,0x52,0x04,0x07,0xe6,0x11,0x04,0x07,0xe6,0x0a,0xe6,
+	0xd2,0x10,0xd1,0x08,0x10,0x04,0x0a,0x1e,0x0a,0x1f,0x10,0x04,0x0a,0x20,0x01,0x00,
+	0xd1,0x09,0x10,0x05,0x0f,0xff,0x00,0x00,0x00,0x10,0x04,0x08,0x00,0x01,0x00,0xd4,
+	0x3d,0x93,0x39,0xd2,0x1a,0xd1,0x08,0x10,0x04,0x0c,0x00,0x01,0x00,0x10,0x09,0x01,
+	0xff,0xd8,0xa7,0xd9,0x93,0x00,0x01,0xff,0xd8,0xa7,0xd9,0x94,0x00,0xd1,0x12,0x10,
+	0x09,0x01,0xff,0xd9,0x88,0xd9,0x94,0x00,0x01,0xff,0xd8,0xa7,0xd9,0x95,0x00,0x10,
+	0x09,0x01,0xff,0xd9,0x8a,0xd9,0x94,0x00,0x01,0x00,0x01,0x00,0x53,0x04,0x01,0x00,
+	0x92,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x0a,0x00,0x0a,0x00,0xcf,0x86,
+	0xd5,0x5c,0xd4,0x20,0x53,0x04,0x01,0x00,0xd2,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,
+	0x01,0x00,0x01,0x1b,0xd1,0x08,0x10,0x04,0x01,0x1c,0x01,0x1d,0x10,0x04,0x01,0x1e,
+	0x01,0x1f,0xd3,0x20,0xd2,0x10,0xd1,0x08,0x10,0x04,0x01,0x20,0x01,0x21,0x10,0x04,
+	0x01,0x22,0x04,0xe6,0xd1,0x08,0x10,0x04,0x04,0xe6,0x04,0xdc,0x10,0x04,0x07,0xdc,
+	0x07,0xe6,0xd2,0x0c,0x91,0x08,0x10,0x04,0x07,0xe6,0x08,0xe6,0x08,0xe6,0xd1,0x08,
+	0x10,0x04,0x08,0xdc,0x08,0xe6,0x10,0x04,0x08,0xe6,0x0c,0xdc,0xd4,0x10,0x53,0x04,
+	0x01,0x00,0x52,0x04,0x01,0x00,0x11,0x04,0x01,0x00,0x06,0x00,0x93,0x10,0x92,0x0c,
+	0x91,0x08,0x10,0x04,0x01,0x23,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd0,0x22,
+	0xcf,0x86,0x55,0x04,0x01,0x00,0x54,0x04,0x01,0x00,0x53,0x04,0x01,0x00,0xd2,0x08,
+	0x11,0x04,0x04,0x00,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x04,0x00,
+	0xcf,0x86,0xd5,0x5b,0xd4,0x2e,0xd3,0x1e,0x92,0x1a,0xd1,0x0d,0x10,0x09,0x01,0xff,
+	0xdb,0x95,0xd9,0x94,0x00,0x01,0x00,0x10,0x09,0x01,0xff,0xdb,0x81,0xd9,0x94,0x00,
+	0x01,0x00,0x01,0x00,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,
+	0x04,0x00,0xd3,0x19,0xd2,0x11,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x01,0xff,
+	0xdb,0x92,0xd9,0x94,0x00,0x11,0x04,0x01,0x00,0x01,0xe6,0x52,0x04,0x01,0xe6,0xd1,
+	0x08,0x10,0x04,0x01,0xe6,0x01,0x00,0x10,0x04,0x01,0x00,0x01,0xe6,0xd4,0x38,0xd3,
+	0x1c,0xd2,0x0c,0x51,0x04,0x01,0xe6,0x10,0x04,0x01,0xe6,0x01,0xdc,0xd1,0x08,0x10,
+	0x04,0x01,0xe6,0x01,0x00,0x10,0x04,0x01,0x00,0x01,0xe6,0xd2,0x10,0xd1,0x08,0x10,
+	0x04,0x01,0xe6,0x01,0x00,0x10,0x04,0x01,0xdc,0x01,0xe6,0x91,0x08,0x10,0x04,0x01,
+	0xe6,0x01,0xdc,0x07,0x00,0x53,0x04,0x01,0x00,0xd2,0x08,0x11,0x04,0x01,0x00,0x04,
+	0x00,0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x07,0x00,0xd1,0xc8,0xd0,0x76,0xcf,
+	0x86,0xd5,0x28,0xd4,0x14,0x53,0x04,0x04,0x00,0x52,0x04,0x04,0x00,0x51,0x04,0x04,
+	0x00,0x10,0x04,0x00,0x00,0x04,0x00,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x04,
+	0x00,0x04,0x24,0x04,0x00,0x04,0x00,0x04,0x00,0xd4,0x14,0x53,0x04,0x04,0x00,0x52,
+	0x04,0x04,0x00,0x91,0x08,0x10,0x04,0x04,0x00,0x07,0x00,0x07,0x00,0xd3,0x1c,0xd2,
+	0x0c,0x91,0x08,0x10,0x04,0x04,0xe6,0x04,0xdc,0x04,0xe6,0xd1,0x08,0x10,0x04,0x04,
+	0xdc,0x04,0xe6,0x10,0x04,0x04,0xe6,0x04,0xdc,0xd2,0x0c,0x51,0x04,0x04,0xdc,0x10,
+	0x04,0x04,0xe6,0x04,0xdc,0xd1,0x08,0x10,0x04,0x04,0xdc,0x04,0xe6,0x10,0x04,0x04,
+	0xdc,0x04,0xe6,0xcf,0x86,0xd5,0x3c,0x94,0x38,0xd3,0x1c,0xd2,0x0c,0x51,0x04,0x04,
+	0xe6,0x10,0x04,0x04,0xdc,0x04,0xe6,0xd1,0x08,0x10,0x04,0x04,0xdc,0x04,0xe6,0x10,
+	0x04,0x04,0xdc,0x04,0xe6,0xd2,0x10,0xd1,0x08,0x10,0x04,0x04,0xdc,0x04,0xe6,0x10,
+	0x04,0x04,0xe6,0x00,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x07,0x00,0x07,0x00,0x08,
+	0x00,0x94,0x10,0x53,0x04,0x08,0x00,0x52,0x04,0x08,0x00,0x11,0x04,0x08,0x00,0x0a,
+	0x00,0x0a,0x00,0xd0,0x1e,0xcf,0x86,0x55,0x04,0x04,0x00,0x54,0x04,0x04,0x00,0x93,
+	0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x04,0x00,0x06,0x00,0x00,0x00,0x00,0x00,0x00,
+	0x00,0xcf,0x86,0x55,0x04,0x09,0x00,0xd4,0x14,0x53,0x04,0x09,0x00,0x92,0x0c,0x51,
+	0x04,0x09,0x00,0x10,0x04,0x09,0x00,0x09,0xe6,0x09,0xe6,0xd3,0x10,0x92,0x0c,0x51,
+	0x04,0x09,0xe6,0x10,0x04,0x09,0xdc,0x09,0xe6,0x09,0x00,0xd2,0x0c,0x51,0x04,0x09,
+	0x00,0x10,0x04,0x09,0x00,0x00,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x14,0xdc,0x14,
+	0x00,0xe4,0xf8,0x57,0xe3,0x45,0x3f,0xe2,0xf4,0x3e,0xe1,0xc7,0x2c,0xe0,0x21,0x10,
+	0xcf,0x86,0xc5,0xe4,0x80,0x08,0xe3,0xcb,0x03,0xe2,0x61,0x01,0xd1,0x94,0xd0,0x5a,
+	0xcf,0x86,0xd5,0x20,0x54,0x04,0x0b,0x00,0xd3,0x0c,0x52,0x04,0x0b,0x00,0x11,0x04,
+	0x0b,0x00,0x0b,0xe6,0x92,0x0c,0x51,0x04,0x0b,0xe6,0x10,0x04,0x0b,0x00,0x0b,0xe6,
+	0x0b,0xe6,0xd4,0x24,0xd3,0x10,0x52,0x04,0x0b,0xe6,0x91,0x08,0x10,0x04,0x0b,0x00,
+	0x0b,0xe6,0x0b,0xe6,0xd2,0x0c,0x91,0x08,0x10,0x04,0x0b,0x00,0x0b,0xe6,0x0b,0xe6,
+	0x11,0x04,0x0b,0xe6,0x00,0x00,0x53,0x04,0x0b,0x00,0x52,0x04,0x0b,0x00,0x51,0x04,
+	0x0b,0x00,0x10,0x04,0x0b,0x00,0x00,0x00,0xcf,0x86,0xd5,0x20,0x54,0x04,0x0c,0x00,
+	0x53,0x04,0x0c,0x00,0xd2,0x0c,0x91,0x08,0x10,0x04,0x0c,0x00,0x0c,0xdc,0x0c,0xdc,
+	0x51,0x04,0x00,0x00,0x10,0x04,0x0c,0x00,0x00,0x00,0x94,0x14,0x53,0x04,0x13,0x00,
+	0x92,0x0c,0x51,0x04,0x13,0x00,0x10,0x04,0x13,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+	0xd0,0x4a,0xcf,0x86,0x55,0x04,0x00,0x00,0xd4,0x20,0xd3,0x10,0x92,0x0c,0x91,0x08,
+	0x10,0x04,0x0d,0x00,0x10,0x00,0x0d,0x00,0x0d,0x00,0x52,0x04,0x0d,0x00,0x91,0x08,
+	0x10,0x04,0x0d,0x00,0x10,0x00,0x10,0x00,0xd3,0x18,0xd2,0x0c,0x51,0x04,0x10,0x00,
+	0x10,0x04,0x10,0x00,0x11,0x00,0x91,0x08,0x10,0x04,0x11,0x00,0x00,0x00,0x12,0x00,
+	0x52,0x04,0x12,0x00,0x11,0x04,0x12,0x00,0x00,0x00,0xcf,0x86,0xd5,0x18,0x54,0x04,
+	0x00,0x00,0x93,0x10,0x92,0x0c,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x14,0xdc,
+	0x12,0xe6,0x12,0xe6,0xd4,0x30,0xd3,0x18,0xd2,0x0c,0x51,0x04,0x12,0xe6,0x10,0x04,
+	0x12,0x00,0x11,0xdc,0x51,0x04,0x0d,0xe6,0x10,0x04,0x0d,0xdc,0x0d,0xe6,0xd2,0x0c,
+	0x91,0x08,0x10,0x04,0x0d,0xe6,0x0d,0xdc,0x0d,0xe6,0x91,0x08,0x10,0x04,0x0d,0xe6,
+	0x0d,0xdc,0x0d,0xdc,0xd3,0x1c,0xd2,0x10,0xd1,0x08,0x10,0x04,0x0d,0x1b,0x0d,0x1c,
+	0x10,0x04,0x0d,0x1d,0x0d,0xe6,0x51,0x04,0x0d,0xe6,0x10,0x04,0x0d,0xdc,0x0d,0xe6,
+	0xd2,0x10,0xd1,0x08,0x10,0x04,0x0d,0xe6,0x0d,0xdc,0x10,0x04,0x0d,0xdc,0x0d,0xe6,
+	0x51,0x04,0x0d,0xe6,0x10,0x04,0x0d,0xe6,0x10,0xe6,0xe1,0x3a,0x01,0xd0,0x77,0xcf,
+	0x86,0xd5,0x20,0x94,0x1c,0x93,0x18,0xd2,0x0c,0x91,0x08,0x10,0x04,0x0b,0x00,0x01,
+	0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x07,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,
+	0x00,0xd4,0x1b,0x53,0x04,0x01,0x00,0x92,0x13,0x91,0x0f,0x10,0x04,0x01,0x00,0x01,
+	0xff,0xe0,0xa4,0xa8,0xe0,0xa4,0xbc,0x00,0x01,0x00,0x01,0x00,0xd3,0x26,0xd2,0x13,
+	0x91,0x0f,0x10,0x04,0x01,0x00,0x01,0xff,0xe0,0xa4,0xb0,0xe0,0xa4,0xbc,0x00,0x01,
+	0x00,0x91,0x0f,0x10,0x0b,0x01,0xff,0xe0,0xa4,0xb3,0xe0,0xa4,0xbc,0x00,0x01,0x00,
+	0x01,0x00,0xd2,0x08,0x11,0x04,0x01,0x00,0x0c,0x00,0x91,0x08,0x10,0x04,0x01,0x07,
+	0x01,0x00,0x01,0x00,0xcf,0x86,0xd5,0x8c,0xd4,0x18,0x53,0x04,0x01,0x00,0x52,0x04,
+	0x01,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x01,0x09,0x10,0x04,0x0b,0x00,0x0c,0x00,
+	0xd3,0x1c,0xd2,0x10,0xd1,0x08,0x10,0x04,0x01,0x00,0x01,0xe6,0x10,0x04,0x01,0xdc,
+	0x01,0xe6,0x91,0x08,0x10,0x04,0x01,0xe6,0x0b,0x00,0x0c,0x00,0xd2,0x2c,0xd1,0x16,
+	0x10,0x0b,0x01,0xff,0xe0,0xa4,0x95,0xe0,0xa4,0xbc,0x00,0x01,0xff,0xe0,0xa4,0x96,
+	0xe0,0xa4,0xbc,0x00,0x10,0x0b,0x01,0xff,0xe0,0xa4,0x97,0xe0,0xa4,0xbc,0x00,0x01,
+	0xff,0xe0,0xa4,0x9c,0xe0,0xa4,0xbc,0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xe0,0xa4,
+	0xa1,0xe0,0xa4,0xbc,0x00,0x01,0xff,0xe0,0xa4,0xa2,0xe0,0xa4,0xbc,0x00,0x10,0x0b,
+	0x01,0xff,0xe0,0xa4,0xab,0xe0,0xa4,0xbc,0x00,0x01,0xff,0xe0,0xa4,0xaf,0xe0,0xa4,
+	0xbc,0x00,0x54,0x04,0x01,0x00,0xd3,0x14,0x92,0x10,0xd1,0x08,0x10,0x04,0x01,0x00,
+	0x0a,0x00,0x10,0x04,0x0a,0x00,0x0c,0x00,0x0c,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,
+	0x10,0x00,0x0b,0x00,0x10,0x04,0x0b,0x00,0x09,0x00,0x91,0x08,0x10,0x04,0x09,0x00,
+	0x08,0x00,0x09,0x00,0xd0,0x86,0xcf,0x86,0xd5,0x44,0xd4,0x2c,0xd3,0x18,0xd2,0x0c,
+	0x91,0x08,0x10,0x04,0x10,0x00,0x01,0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x00,0x00,
+	0x01,0x00,0x01,0x00,0x52,0x04,0x01,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x00,0x00,
+	0x10,0x04,0x00,0x00,0x01,0x00,0x93,0x14,0x92,0x10,0xd1,0x08,0x10,0x04,0x01,0x00,
+	0x00,0x00,0x10,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd4,0x14,0x53,0x04,
+	0x01,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x01,0x00,
+	0xd3,0x18,0xd2,0x10,0xd1,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x10,0x04,0x01,0x00,
+	0x00,0x00,0x11,0x04,0x00,0x00,0x01,0x00,0xd2,0x08,0x11,0x04,0x01,0x00,0x00,0x00,
+	0x91,0x08,0x10,0x04,0x01,0x07,0x07,0x00,0x01,0x00,0xcf,0x86,0xd5,0x7b,0xd4,0x42,
+	0xd3,0x14,0x52,0x04,0x01,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x10,0x04,
+	0x00,0x00,0x01,0x00,0xd2,0x17,0xd1,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x10,0x04,
+	0x00,0x00,0x01,0xff,0xe0,0xa7,0x87,0xe0,0xa6,0xbe,0x00,0xd1,0x0f,0x10,0x0b,0x01,
+	0xff,0xe0,0xa7,0x87,0xe0,0xa7,0x97,0x00,0x01,0x09,0x10,0x04,0x08,0x00,0x00,0x00,
+	0xd3,0x10,0x52,0x04,0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x01,0x00,
+	0x52,0x04,0x00,0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xe0,0xa6,0xa1,0xe0,0xa6,0xbc,
+	0x00,0x01,0xff,0xe0,0xa6,0xa2,0xe0,0xa6,0xbc,0x00,0x10,0x04,0x00,0x00,0x01,0xff,
+	0xe0,0xa6,0xaf,0xe0,0xa6,0xbc,0x00,0xd4,0x10,0x93,0x0c,0x52,0x04,0x01,0x00,0x11,
+	0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x53,0x04,0x01,0x00,0xd2,0x0c,0x51,0x04,0x01,
+	0x00,0x10,0x04,0x01,0x00,0x0b,0x00,0x51,0x04,0x13,0x00,0x10,0x04,0x14,0xe6,0x00,
+	0x00,0xe2,0x48,0x02,0xe1,0x4f,0x01,0xd0,0xa4,0xcf,0x86,0xd5,0x4c,0xd4,0x34,0xd3,
+	0x1c,0xd2,0x10,0xd1,0x08,0x10,0x04,0x00,0x00,0x07,0x00,0x10,0x04,0x01,0x00,0x07,
+	0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0xd2,0x0c,0x51,0x04,0x01,
+	0x00,0x10,0x04,0x01,0x00,0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x01,
+	0x00,0x93,0x14,0x92,0x10,0xd1,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x10,0x04,0x00,
+	0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd4,0x14,0x53,0x04,0x01,0x00,0x92,0x0c,0x91,
+	0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x01,0x00,0xd3,0x2e,0xd2,0x17,0xd1,
+	0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x10,0x04,0x01,0x00,0x01,0xff,0xe0,0xa8,0xb2,
+	0xe0,0xa8,0xbc,0x00,0xd1,0x08,0x10,0x04,0x00,0x00,0x01,0x00,0x10,0x0b,0x01,0xff,
+	0xe0,0xa8,0xb8,0xe0,0xa8,0xbc,0x00,0x00,0x00,0xd2,0x08,0x11,0x04,0x01,0x00,0x00,
+	0x00,0x91,0x08,0x10,0x04,0x01,0x07,0x00,0x00,0x01,0x00,0xcf,0x86,0xd5,0x80,0xd4,
+	0x34,0xd3,0x18,0xd2,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x00,0x00,0x51,
+	0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x01,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,0x01,
+	0x00,0x00,0x00,0x10,0x04,0x00,0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x01,0x00,0x01,
+	0x09,0x00,0x00,0xd3,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x0a,0x00,0x00,
+	0x00,0x00,0x00,0xd2,0x25,0xd1,0x0f,0x10,0x04,0x00,0x00,0x01,0xff,0xe0,0xa8,0x96,
+	0xe0,0xa8,0xbc,0x00,0x10,0x0b,0x01,0xff,0xe0,0xa8,0x97,0xe0,0xa8,0xbc,0x00,0x01,
+	0xff,0xe0,0xa8,0x9c,0xe0,0xa8,0xbc,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x00,0x00,
+	0x10,0x0b,0x01,0xff,0xe0,0xa8,0xab,0xe0,0xa8,0xbc,0x00,0x00,0x00,0xd4,0x10,0x93,
+	0x0c,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x93,0x14,0x52,
+	0x04,0x01,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x0a,0x00,0x10,0x04,0x14,0x00,0x00,
+	0x00,0x00,0x00,0xd0,0x82,0xcf,0x86,0xd5,0x40,0xd4,0x2c,0xd3,0x18,0xd2,0x0c,0x91,
+	0x08,0x10,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x01,
+	0x00,0x01,0x00,0x52,0x04,0x01,0x00,0xd1,0x08,0x10,0x04,0x07,0x00,0x01,0x00,0x10,
+	0x04,0x00,0x00,0x01,0x00,0x93,0x10,0x92,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x00,
+	0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd4,0x14,0x53,0x04,0x01,0x00,0x92,0x0c,0x91,
+	0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x01,0x00,0xd3,0x18,0xd2,0x0c,0x91,
+	0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x01,
+	0x00,0x01,0x00,0xd2,0x08,0x11,0x04,0x01,0x00,0x00,0x00,0x91,0x08,0x10,0x04,0x01,
+	0x07,0x01,0x00,0x01,0x00,0xcf,0x86,0xd5,0x3c,0xd4,0x28,0xd3,0x10,0x52,0x04,0x01,
+	0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x00,0x00,0x01,0x00,0xd2,0x0c,0x51,0x04,0x01,
+	0x00,0x10,0x04,0x00,0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x01,0x00,0x01,0x09,0x00,
+	0x00,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x00,0x00,0x00,
+	0x00,0x00,0x00,0xd4,0x18,0x93,0x14,0xd2,0x0c,0x91,0x08,0x10,0x04,0x01,0x00,0x07,
+	0x00,0x07,0x00,0x11,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0xd3,0x10,0x92,0x0c,0x91,
+	0x08,0x10,0x04,0x0d,0x00,0x07,0x00,0x00,0x00,0x00,0x00,0x92,0x0c,0x91,0x08,0x10,
+	0x04,0x00,0x00,0x11,0x00,0x13,0x00,0x13,0x00,0xe1,0x24,0x01,0xd0,0x86,0xcf,0x86,
+	0xd5,0x44,0xd4,0x2c,0xd3,0x18,0xd2,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x01,0x00,
+	0x01,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x52,0x04,0x01,0x00,
+	0xd1,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x10,0x04,0x00,0x00,0x01,0x00,0x93,0x14,
+	0x92,0x10,0xd1,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x10,0x04,0x00,0x00,0x01,0x00,
+	0x01,0x00,0x01,0x00,0xd4,0x14,0x53,0x04,0x01,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,
+	0x01,0x00,0x00,0x00,0x01,0x00,0x01,0x00,0xd3,0x18,0xd2,0x0c,0x91,0x08,0x10,0x04,
+	0x01,0x00,0x00,0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x07,0x00,0x01,0x00,
+	0xd2,0x08,0x11,0x04,0x01,0x00,0x00,0x00,0x91,0x08,0x10,0x04,0x01,0x07,0x01,0x00,
+	0x01,0x00,0xcf,0x86,0xd5,0x73,0xd4,0x45,0xd3,0x14,0x52,0x04,0x01,0x00,0xd1,0x08,
+	0x10,0x04,0x0a,0x00,0x00,0x00,0x10,0x04,0x00,0x00,0x01,0x00,0xd2,0x1e,0xd1,0x0f,
+	0x10,0x0b,0x01,0xff,0xe0,0xad,0x87,0xe0,0xad,0x96,0x00,0x00,0x00,0x10,0x04,0x00,
+	0x00,0x01,0xff,0xe0,0xad,0x87,0xe0,0xac,0xbe,0x00,0x91,0x0f,0x10,0x0b,0x01,0xff,
+	0xe0,0xad,0x87,0xe0,0xad,0x97,0x00,0x01,0x09,0x00,0x00,0xd3,0x0c,0x52,0x04,0x00,
+	0x00,0x11,0x04,0x00,0x00,0x01,0x00,0x52,0x04,0x00,0x00,0xd1,0x16,0x10,0x0b,0x01,
+	0xff,0xe0,0xac,0xa1,0xe0,0xac,0xbc,0x00,0x01,0xff,0xe0,0xac,0xa2,0xe0,0xac,0xbc,
+	0x00,0x10,0x04,0x00,0x00,0x01,0x00,0xd4,0x14,0x93,0x10,0xd2,0x08,0x11,0x04,0x01,
+	0x00,0x0a,0x00,0x11,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x93,0x10,0x92,0x0c,0x91,
+	0x08,0x10,0x04,0x01,0x00,0x07,0x00,0x0c,0x00,0x0c,0x00,0x00,0x00,0xd0,0xb1,0xcf,
+	0x86,0xd5,0x63,0xd4,0x28,0xd3,0x14,0xd2,0x08,0x11,0x04,0x00,0x00,0x01,0x00,0x91,
+	0x08,0x10,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0xd2,0x0c,0x51,0x04,0x01,0x00,0x10,
+	0x04,0x01,0x00,0x00,0x00,0x11,0x04,0x00,0x00,0x01,0x00,0xd3,0x1f,0xd2,0x0c,0x91,
+	0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x91,0x0f,0x10,0x0b,0x01,0xff,0xe0,
+	0xae,0x92,0xe0,0xaf,0x97,0x00,0x01,0x00,0x00,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,
+	0x00,0x00,0x01,0x00,0x10,0x04,0x01,0x00,0x00,0x00,0x91,0x08,0x10,0x04,0x01,0x00,
+	0x00,0x00,0x01,0x00,0xd4,0x2c,0xd3,0x18,0xd2,0x0c,0x51,0x04,0x00,0x00,0x10,0x04,
+	0x00,0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x00,0x00,0xd2,0x0c,
+	0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x00,0x00,0x11,0x04,0x00,0x00,0x01,0x00,
+	0xd3,0x10,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x08,0x00,0x01,0x00,
+	0xd2,0x08,0x11,0x04,0x01,0x00,0x00,0x00,0x11,0x04,0x00,0x00,0x01,0x00,0xcf,0x86,
+	0xd5,0x61,0xd4,0x45,0xd3,0x14,0xd2,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,
+	0x00,0x00,0x11,0x04,0x00,0x00,0x01,0x00,0xd2,0x1e,0xd1,0x08,0x10,0x04,0x01,0x00,
+	0x00,0x00,0x10,0x0b,0x01,0xff,0xe0,0xaf,0x86,0xe0,0xae,0xbe,0x00,0x01,0xff,0xe0,
+	0xaf,0x87,0xe0,0xae,0xbe,0x00,0x91,0x0f,0x10,0x0b,0x01,0xff,0xe0,0xaf,0x86,0xe0,
+	0xaf,0x97,0x00,0x01,0x09,0x00,0x00,0x93,0x18,0xd2,0x0c,0x91,0x08,0x10,0x04,0x0a,
+	0x00,0x00,0x00,0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x01,0x00,0x00,
+	0x00,0xd4,0x14,0x93,0x10,0x52,0x04,0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x08,
+	0x00,0x01,0x00,0x01,0x00,0xd3,0x10,0x92,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x01,
+	0x00,0x07,0x00,0x07,0x00,0x92,0x0c,0x51,0x04,0x07,0x00,0x10,0x04,0x07,0x00,0x00,
+	0x00,0x00,0x00,0xe3,0x1c,0x04,0xe2,0x1a,0x02,0xd1,0xf3,0xd0,0x76,0xcf,0x86,0xd5,
+	0x3c,0xd4,0x28,0xd3,0x18,0xd2,0x0c,0x91,0x08,0x10,0x04,0x10,0x00,0x01,0x00,0x01,
+	0x00,0x91,0x08,0x10,0x04,0x14,0x00,0x01,0x00,0x01,0x00,0x52,0x04,0x01,0x00,0x91,
+	0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,
+	0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd4,0x14,0x53,0x04,0x01,
+	0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x01,0x00,0xd3,
+	0x10,0x52,0x04,0x01,0x00,0x91,0x08,0x10,0x04,0x10,0x00,0x01,0x00,0x01,0x00,0xd2,
+	0x08,0x11,0x04,0x01,0x00,0x00,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x0a,0x00,0x01,
+	0x00,0xcf,0x86,0xd5,0x53,0xd4,0x2f,0xd3,0x10,0x52,0x04,0x01,0x00,0x91,0x08,0x10,
+	0x04,0x01,0x00,0x00,0x00,0x01,0x00,0xd2,0x13,0x91,0x0f,0x10,0x0b,0x01,0xff,0xe0,
+	0xb1,0x86,0xe0,0xb1,0x96,0x00,0x00,0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x01,0x00,
+	0x01,0x09,0x00,0x00,0xd3,0x14,0x52,0x04,0x00,0x00,0xd1,0x08,0x10,0x04,0x00,0x00,
+	0x01,0x54,0x10,0x04,0x01,0x5b,0x00,0x00,0x92,0x0c,0x51,0x04,0x0a,0x00,0x10,0x04,
+	0x11,0x00,0x00,0x00,0x00,0x00,0xd4,0x14,0x93,0x10,0xd2,0x08,0x11,0x04,0x01,0x00,
+	0x0a,0x00,0x11,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x93,0x10,0x52,0x04,0x00,0x00,
+	0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x15,0x00,0x0a,0x00,0xd0,0x76,0xcf,0x86,
+	0xd5,0x3c,0xd4,0x28,0xd3,0x18,0xd2,0x0c,0x91,0x08,0x10,0x04,0x12,0x00,0x10,0x00,
+	0x01,0x00,0x91,0x08,0x10,0x04,0x14,0x00,0x01,0x00,0x01,0x00,0x52,0x04,0x01,0x00,
+	0x91,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x93,0x10,0x92,0x0c,0x91,0x08,
+	0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd4,0x14,0x53,0x04,
+	0x01,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x01,0x00,
+	0xd3,0x10,0x52,0x04,0x01,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x01,0x00,0x01,0x00,
+	0xd2,0x08,0x11,0x04,0x01,0x00,0x00,0x00,0x91,0x08,0x10,0x04,0x07,0x07,0x07,0x00,
+	0x01,0x00,0xcf,0x86,0xd5,0x82,0xd4,0x5e,0xd3,0x2a,0xd2,0x13,0x91,0x0f,0x10,0x0b,
+	0x01,0xff,0xe0,0xb2,0xbf,0xe0,0xb3,0x95,0x00,0x01,0x00,0x01,0x00,0xd1,0x08,0x10,
+	0x04,0x01,0x00,0x00,0x00,0x10,0x04,0x01,0x00,0x01,0xff,0xe0,0xb3,0x86,0xe0,0xb3,
+	0x95,0x00,0xd2,0x28,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe0,0xb3,0x86,0xe0,0xb3,0x96,
+	0x00,0x00,0x00,0x10,0x0b,0x01,0xff,0xe0,0xb3,0x86,0xe0,0xb3,0x82,0x00,0x01,0xff,
+	0xe0,0xb3,0x86,0xe0,0xb3,0x82,0xe0,0xb3,0x95,0x00,0x91,0x08,0x10,0x04,0x01,0x00,
+	0x01,0x09,0x00,0x00,0xd3,0x14,0x52,0x04,0x00,0x00,0xd1,0x08,0x10,0x04,0x00,0x00,
+	0x01,0x00,0x10,0x04,0x01,0x00,0x00,0x00,0x52,0x04,0x00,0x00,0x51,0x04,0x00,0x00,
+	0x10,0x04,0x01,0x00,0x00,0x00,0xd4,0x14,0x93,0x10,0xd2,0x08,0x11,0x04,0x01,0x00,
+	0x09,0x00,0x11,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x93,0x14,0x92,0x10,0xd1,0x08,
+	0x10,0x04,0x00,0x00,0x09,0x00,0x10,0x04,0x09,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+	0xe1,0x06,0x01,0xd0,0x6e,0xcf,0x86,0xd5,0x3c,0xd4,0x28,0xd3,0x18,0xd2,0x0c,0x91,
+	0x08,0x10,0x04,0x13,0x00,0x10,0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x01,
+	0x00,0x01,0x00,0x52,0x04,0x01,0x00,0x91,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x01,
+	0x00,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x01,
+	0x00,0x01,0x00,0xd4,0x14,0x53,0x04,0x01,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x01,
+	0x00,0x0c,0x00,0x01,0x00,0x01,0x00,0x53,0x04,0x01,0x00,0xd2,0x0c,0x51,0x04,0x01,
+	0x00,0x10,0x04,0x0c,0x00,0x13,0x09,0x91,0x08,0x10,0x04,0x13,0x09,0x0a,0x00,0x01,
+	0x00,0xcf,0x86,0xd5,0x65,0xd4,0x45,0xd3,0x10,0x52,0x04,0x01,0x00,0x91,0x08,0x10,
+	0x04,0x0a,0x00,0x00,0x00,0x01,0x00,0xd2,0x1e,0xd1,0x08,0x10,0x04,0x01,0x00,0x00,
+	0x00,0x10,0x0b,0x01,0xff,0xe0,0xb5,0x86,0xe0,0xb4,0xbe,0x00,0x01,0xff,0xe0,0xb5,
+	0x87,0xe0,0xb4,0xbe,0x00,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe0,0xb5,0x86,0xe0,0xb5,
+	0x97,0x00,0x01,0x09,0x10,0x04,0x0c,0x00,0x12,0x00,0xd3,0x10,0x52,0x04,0x00,0x00,
+	0x51,0x04,0x12,0x00,0x10,0x04,0x12,0x00,0x01,0x00,0x52,0x04,0x12,0x00,0x51,0x04,
+	0x12,0x00,0x10,0x04,0x12,0x00,0x11,0x00,0xd4,0x14,0x93,0x10,0xd2,0x08,0x11,0x04,
+	0x01,0x00,0x0a,0x00,0x11,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0xd3,0x0c,0x52,0x04,
+	0x0a,0x00,0x11,0x04,0x0a,0x00,0x12,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x12,0x00,
+	0x0a,0x00,0x0a,0x00,0x0a,0x00,0xd0,0x5a,0xcf,0x86,0xd5,0x34,0xd4,0x18,0x93,0x14,
+	0xd2,0x08,0x11,0x04,0x00,0x00,0x04,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x04,0x00,
+	0x04,0x00,0x04,0x00,0xd3,0x10,0x52,0x04,0x04,0x00,0x51,0x04,0x04,0x00,0x10,0x04,
+	0x04,0x00,0x00,0x00,0x92,0x08,0x11,0x04,0x00,0x00,0x04,0x00,0x04,0x00,0x54,0x04,
+	0x04,0x00,0xd3,0x10,0x92,0x0c,0x51,0x04,0x04,0x00,0x10,0x04,0x00,0x00,0x04,0x00,
+	0x04,0x00,0x52,0x04,0x04,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x04,0x00,0x00,0x00,
+	0xcf,0x86,0xd5,0x77,0xd4,0x28,0xd3,0x10,0x52,0x04,0x04,0x00,0x51,0x04,0x04,0x00,
+	0x10,0x04,0x04,0x00,0x00,0x00,0xd2,0x0c,0x51,0x04,0x00,0x00,0x10,0x04,0x04,0x09,
+	0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x04,0x00,0xd3,0x14,0x52,0x04,
+	0x04,0x00,0xd1,0x08,0x10,0x04,0x04,0x00,0x00,0x00,0x10,0x04,0x04,0x00,0x00,0x00,
+	0xd2,0x13,0x51,0x04,0x04,0x00,0x10,0x0b,0x04,0xff,0xe0,0xb7,0x99,0xe0,0xb7,0x8a,
+	0x00,0x04,0x00,0xd1,0x19,0x10,0x0b,0x04,0xff,0xe0,0xb7,0x99,0xe0,0xb7,0x8f,0x00,
+	0x04,0xff,0xe0,0xb7,0x99,0xe0,0xb7,0x8f,0xe0,0xb7,0x8a,0x00,0x10,0x0b,0x04,0xff,
+	0xe0,0xb7,0x99,0xe0,0xb7,0x9f,0x00,0x04,0x00,0xd4,0x10,0x93,0x0c,0x52,0x04,0x00,
+	0x00,0x11,0x04,0x00,0x00,0x10,0x00,0x10,0x00,0x93,0x14,0xd2,0x08,0x11,0x04,0x00,
+	0x00,0x04,0x00,0x91,0x08,0x10,0x04,0x04,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xe2,
+	0x31,0x01,0xd1,0x58,0xd0,0x3a,0xcf,0x86,0xd5,0x18,0x94,0x14,0x93,0x10,0x92,0x0c,
+	0x91,0x08,0x10,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,
+	0x54,0x04,0x01,0x00,0x53,0x04,0x01,0x00,0xd2,0x0c,0x51,0x04,0x01,0x67,0x10,0x04,
+	0x01,0x09,0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x01,0x00,0xcf,0x86,
+	0x95,0x18,0xd4,0x0c,0x53,0x04,0x01,0x00,0x12,0x04,0x01,0x6b,0x01,0x00,0x53,0x04,
+	0x01,0x00,0x12,0x04,0x01,0x00,0x00,0x00,0x00,0x00,0xd0,0x9e,0xcf,0x86,0xd5,0x54,
+	0xd4,0x3c,0xd3,0x20,0xd2,0x10,0xd1,0x08,0x10,0x04,0x00,0x00,0x01,0x00,0x10,0x04,
+	0x01,0x00,0x00,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x10,0x04,0x15,0x00,
+	0x01,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,0x01,0x00,0x15,0x00,0x10,0x04,0x01,0x00,
+	0x00,0x00,0x91,0x08,0x10,0x04,0x15,0x00,0x01,0x00,0x15,0x00,0xd3,0x08,0x12,0x04,
+	0x15,0x00,0x01,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x15,0x00,0x01,0x00,0x01,0x00,
+	0x01,0x00,0xd4,0x30,0xd3,0x1c,0xd2,0x0c,0x91,0x08,0x10,0x04,0x15,0x00,0x01,0x00,
+	0x01,0x00,0xd1,0x08,0x10,0x04,0x00,0x00,0x01,0x00,0x10,0x04,0x00,0x00,0x01,0x00,
+	0xd2,0x08,0x11,0x04,0x15,0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x15,0x00,0x01,0x00,
+	0x01,0x00,0x53,0x04,0x01,0x00,0xd2,0x0c,0x51,0x04,0x01,0x76,0x10,0x04,0x15,0x09,
+	0x01,0x00,0x11,0x04,0x01,0x00,0x00,0x00,0xcf,0x86,0x95,0x34,0xd4,0x20,0xd3,0x14,
+	0x52,0x04,0x01,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x10,0x04,0x01,0x00,
+	0x00,0x00,0x52,0x04,0x01,0x7a,0x11,0x04,0x01,0x00,0x00,0x00,0x53,0x04,0x01,0x00,
+	0xd2,0x08,0x11,0x04,0x01,0x00,0x00,0x00,0x11,0x04,0x01,0x00,0x0d,0x00,0x00,0x00,
+	0xe1,0x2b,0x01,0xd0,0x3e,0xcf,0x86,0xd5,0x14,0x54,0x04,0x02,0x00,0x53,0x04,0x02,
+	0x00,0x92,0x08,0x11,0x04,0x02,0xdc,0x02,0x00,0x02,0x00,0x54,0x04,0x02,0x00,0xd3,
+	0x14,0x52,0x04,0x02,0x00,0xd1,0x08,0x10,0x04,0x02,0x00,0x02,0xdc,0x10,0x04,0x02,
+	0x00,0x02,0xdc,0x92,0x0c,0x91,0x08,0x10,0x04,0x02,0x00,0x02,0xd8,0x02,0x00,0x02,
+	0x00,0xcf,0x86,0xd5,0x73,0xd4,0x36,0xd3,0x17,0x92,0x13,0x51,0x04,0x02,0x00,0x10,
+	0x04,0x02,0x00,0x02,0xff,0xe0,0xbd,0x82,0xe0,0xbe,0xb7,0x00,0x02,0x00,0xd2,0x0c,
+	0x91,0x08,0x10,0x04,0x00,0x00,0x02,0x00,0x02,0x00,0x91,0x0f,0x10,0x04,0x02,0x00,
+	0x02,0xff,0xe0,0xbd,0x8c,0xe0,0xbe,0xb7,0x00,0x02,0x00,0xd3,0x26,0xd2,0x13,0x51,
+	0x04,0x02,0x00,0x10,0x0b,0x02,0xff,0xe0,0xbd,0x91,0xe0,0xbe,0xb7,0x00,0x02,0x00,
+	0x51,0x04,0x02,0x00,0x10,0x04,0x02,0x00,0x02,0xff,0xe0,0xbd,0x96,0xe0,0xbe,0xb7,
+	0x00,0x52,0x04,0x02,0x00,0x91,0x0f,0x10,0x0b,0x02,0xff,0xe0,0xbd,0x9b,0xe0,0xbe,
+	0xb7,0x00,0x02,0x00,0x02,0x00,0xd4,0x27,0x53,0x04,0x02,0x00,0xd2,0x17,0xd1,0x0f,
+	0x10,0x04,0x02,0x00,0x02,0xff,0xe0,0xbd,0x80,0xe0,0xbe,0xb5,0x00,0x10,0x04,0x04,
+	0x00,0x0a,0x00,0x91,0x08,0x10,0x04,0x0a,0x00,0x00,0x00,0x00,0x00,0xd3,0x35,0xd2,
+	0x17,0xd1,0x08,0x10,0x04,0x00,0x00,0x02,0x81,0x10,0x04,0x02,0x82,0x02,0xff,0xe0,
+	0xbd,0xb1,0xe0,0xbd,0xb2,0x00,0xd1,0x0f,0x10,0x04,0x02,0x84,0x02,0xff,0xe0,0xbd,
+	0xb1,0xe0,0xbd,0xb4,0x00,0x10,0x0b,0x02,0xff,0xe0,0xbe,0xb2,0xe0,0xbe,0x80,0x00,
+	0x02,0x00,0xd2,0x13,0x91,0x0f,0x10,0x0b,0x02,0xff,0xe0,0xbe,0xb3,0xe0,0xbe,0x80,
+	0x00,0x02,0x00,0x02,0x82,0x11,0x04,0x02,0x82,0x02,0x00,0xd0,0xd3,0xcf,0x86,0xd5,
+	0x65,0xd4,0x27,0xd3,0x1f,0xd2,0x13,0x91,0x0f,0x10,0x04,0x02,0x82,0x02,0xff,0xe0,
+	0xbd,0xb1,0xe0,0xbe,0x80,0x00,0x02,0xe6,0x91,0x08,0x10,0x04,0x02,0x09,0x02,0x00,
+	0x02,0xe6,0x12,0x04,0x02,0x00,0x0c,0x00,0xd3,0x1f,0xd2,0x13,0x51,0x04,0x02,0x00,
+	0x10,0x04,0x02,0x00,0x02,0xff,0xe0,0xbe,0x92,0xe0,0xbe,0xb7,0x00,0x51,0x04,0x02,
+	0x00,0x10,0x04,0x04,0x00,0x02,0x00,0xd2,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x02,
+	0x00,0x02,0x00,0x91,0x0f,0x10,0x04,0x02,0x00,0x02,0xff,0xe0,0xbe,0x9c,0xe0,0xbe,
+	0xb7,0x00,0x02,0x00,0xd4,0x3d,0xd3,0x26,0xd2,0x13,0x51,0x04,0x02,0x00,0x10,0x0b,
+	0x02,0xff,0xe0,0xbe,0xa1,0xe0,0xbe,0xb7,0x00,0x02,0x00,0x51,0x04,0x02,0x00,0x10,
+	0x04,0x02,0x00,0x02,0xff,0xe0,0xbe,0xa6,0xe0,0xbe,0xb7,0x00,0x52,0x04,0x02,0x00,
+	0x91,0x0f,0x10,0x0b,0x02,0xff,0xe0,0xbe,0xab,0xe0,0xbe,0xb7,0x00,0x02,0x00,0x04,
+	0x00,0xd3,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x04,0x00,0x02,0x00,0x02,0x00,0x02,
+	0x00,0xd2,0x13,0x91,0x0f,0x10,0x04,0x04,0x00,0x02,0xff,0xe0,0xbe,0x90,0xe0,0xbe,
+	0xb5,0x00,0x04,0x00,0x91,0x08,0x10,0x04,0x04,0x00,0x00,0x00,0x04,0x00,0xcf,0x86,
+	0x95,0x4c,0xd4,0x24,0xd3,0x10,0x52,0x04,0x04,0x00,0x51,0x04,0x04,0x00,0x10,0x04,
+	0x04,0xdc,0x04,0x00,0x52,0x04,0x04,0x00,0xd1,0x08,0x10,0x04,0x04,0x00,0x00,0x00,
+	0x10,0x04,0x0a,0x00,0x04,0x00,0xd3,0x14,0xd2,0x08,0x11,0x04,0x08,0x00,0x0a,0x00,
+	0x91,0x08,0x10,0x04,0x0a,0x00,0x0b,0x00,0x0b,0x00,0x92,0x10,0xd1,0x08,0x10,0x04,
+	0x0b,0x00,0x0c,0x00,0x10,0x04,0x0c,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x86,
+	0xe5,0xf7,0x04,0xe4,0x79,0x03,0xe3,0x7b,0x01,0xe2,0x04,0x01,0xd1,0x7f,0xd0,0x65,
+	0xcf,0x86,0x55,0x04,0x04,0x00,0xd4,0x33,0xd3,0x1f,0xd2,0x0c,0x51,0x04,0x04,0x00,
+	0x10,0x04,0x0a,0x00,0x04,0x00,0x51,0x04,0x04,0x00,0x10,0x0b,0x04,0xff,0xe1,0x80,
+	0xa5,0xe1,0x80,0xae,0x00,0x04,0x00,0x92,0x10,0xd1,0x08,0x10,0x04,0x0a,0x00,0x04,
+	0x00,0x10,0x04,0x04,0x00,0x0a,0x00,0x04,0x00,0xd3,0x18,0xd2,0x0c,0x51,0x04,0x04,
+	0x00,0x10,0x04,0x04,0x00,0x0a,0x00,0x51,0x04,0x0a,0x00,0x10,0x04,0x04,0x00,0x04,
+	0x07,0x92,0x10,0xd1,0x08,0x10,0x04,0x04,0x00,0x04,0x09,0x10,0x04,0x0a,0x09,0x0a,
+	0x00,0x0a,0x00,0xcf,0x86,0x95,0x14,0x54,0x04,0x04,0x00,0x53,0x04,0x04,0x00,0x92,
+	0x08,0x11,0x04,0x04,0x00,0x0a,0x00,0x0a,0x00,0x0a,0x00,0xd0,0x2e,0xcf,0x86,0x95,
+	0x28,0xd4,0x14,0x53,0x04,0x0a,0x00,0x52,0x04,0x0a,0x00,0x91,0x08,0x10,0x04,0x0a,
+	0x00,0x0a,0xdc,0x0a,0x00,0x53,0x04,0x0a,0x00,0xd2,0x08,0x11,0x04,0x0a,0x00,0x0b,
+	0x00,0x11,0x04,0x0b,0x00,0x0a,0x00,0x01,0x00,0xcf,0x86,0xd5,0x24,0x94,0x20,0xd3,
+	0x10,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x00,0x00,0x0d,0x00,0x52,
+	0x04,0x00,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x0d,0x00,0x00,0x00,0x01,0x00,0x54,
+	0x04,0x01,0x00,0xd3,0x10,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,
+	0x00,0x06,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,0x06,0x00,0x08,0x00,0x10,0x04,0x08,
+	0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x08,0x00,0x0d,0x00,0x0d,0x00,0xd1,0x3e,0xd0,
+	0x06,0xcf,0x06,0x01,0x00,0xcf,0x86,0xd5,0x1d,0x54,0x04,0x01,0x00,0x53,0x04,0x01,
+	0x00,0xd2,0x08,0x11,0x04,0x01,0x00,0x0b,0x00,0x51,0x04,0x0b,0x00,0x10,0x04,0x0b,
+	0x00,0x01,0xff,0x00,0x94,0x15,0x93,0x11,0x92,0x0d,0x91,0x09,0x10,0x05,0x01,0xff,
+	0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd0,0x1e,0xcf,0x86,0x55,
+	0x04,0x01,0x00,0x94,0x14,0x93,0x10,0x92,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x01,
+	0x00,0x0b,0x00,0x0b,0x00,0x01,0x00,0x01,0x00,0xcf,0x86,0x55,0x04,0x01,0x00,0x54,
+	0x04,0x01,0x00,0x53,0x04,0x01,0x00,0x92,0x08,0x11,0x04,0x01,0x00,0x0b,0x00,0x0b,
+	0x00,0xe2,0x21,0x01,0xd1,0x6c,0xd0,0x1e,0xcf,0x86,0x95,0x18,0x94,0x14,0x93,0x10,
+	0x52,0x04,0x04,0x00,0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x08,0x00,0x04,0x00,
+	0x04,0x00,0x04,0x00,0xcf,0x86,0x95,0x48,0xd4,0x24,0xd3,0x10,0x52,0x04,0x04,0x00,
+	0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x08,0x00,0xd2,0x0c,0x91,0x08,0x10,0x04,
+	0x04,0x00,0x00,0x00,0x04,0x00,0x11,0x04,0x04,0x00,0x00,0x00,0xd3,0x10,0x52,0x04,
+	0x04,0x00,0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x00,0x00,0xd2,0x0c,0x91,0x08,
+	0x10,0x04,0x04,0x00,0x00,0x00,0x04,0x00,0x11,0x04,0x04,0x00,0x00,0x00,0x04,0x00,
+	0xd0,0x62,0xcf,0x86,0xd5,0x28,0x94,0x24,0xd3,0x10,0x52,0x04,0x04,0x00,0x51,0x04,
+	0x04,0x00,0x10,0x04,0x04,0x00,0x08,0x00,0xd2,0x0c,0x91,0x08,0x10,0x04,0x04,0x00,
+	0x00,0x00,0x04,0x00,0x11,0x04,0x04,0x00,0x00,0x00,0x04,0x00,0xd4,0x14,0x53,0x04,
+	0x04,0x00,0x52,0x04,0x04,0x00,0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x08,0x00,
+	0xd3,0x14,0xd2,0x0c,0x91,0x08,0x10,0x04,0x04,0x00,0x00,0x00,0x04,0x00,0x11,0x04,
+	0x04,0x00,0x00,0x00,0x52,0x04,0x04,0x00,0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,
+	0x00,0x00,0xcf,0x86,0xd5,0x38,0xd4,0x24,0xd3,0x14,0xd2,0x0c,0x91,0x08,0x10,0x04,
+	0x04,0x00,0x00,0x00,0x04,0x00,0x11,0x04,0x04,0x00,0x00,0x00,0x52,0x04,0x04,0x00,
+	0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x08,0x00,0x93,0x10,0x52,0x04,0x04,0x00,
+	0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x00,0x00,0x04,0x00,0x94,0x14,0x53,0x04,
+	0x04,0x00,0x52,0x04,0x04,0x00,0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x08,0x00,
+	0x04,0x00,0xd1,0x9c,0xd0,0x3e,0xcf,0x86,0x95,0x38,0xd4,0x14,0x53,0x04,0x04,0x00,
+	0x52,0x04,0x04,0x00,0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x08,0x00,0xd3,0x14,
+	0xd2,0x0c,0x91,0x08,0x10,0x04,0x04,0x00,0x00,0x00,0x04,0x00,0x11,0x04,0x04,0x00,
+	0x00,0x00,0x52,0x04,0x04,0x00,0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x08,0x00,
+	0x04,0x00,0xcf,0x86,0xd5,0x34,0xd4,0x14,0x93,0x10,0x52,0x04,0x04,0x00,0x51,0x04,
+	0x04,0x00,0x10,0x04,0x04,0x00,0x08,0x00,0x04,0x00,0x53,0x04,0x04,0x00,0xd2,0x0c,
+	0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x00,0x00,0xd1,0x08,0x10,0x04,0x00,0x00,
+	0x0c,0xe6,0x10,0x04,0x0c,0xe6,0x08,0xe6,0xd4,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,
+	0x10,0x04,0x08,0x00,0x04,0x00,0x04,0x00,0x04,0x00,0x04,0x00,0x53,0x04,0x04,0x00,
+	0x52,0x04,0x04,0x00,0x91,0x08,0x10,0x04,0x04,0x00,0x00,0x00,0x00,0x00,0xd0,0x1a,
+	0xcf,0x86,0x95,0x14,0x54,0x04,0x08,0x00,0x53,0x04,0x08,0x00,0x92,0x08,0x11,0x04,
+	0x08,0x00,0x00,0x00,0x00,0x00,0x04,0x00,0xcf,0x86,0x55,0x04,0x04,0x00,0x54,0x04,
+	0x04,0x00,0xd3,0x10,0x52,0x04,0x04,0x00,0x91,0x08,0x10,0x04,0x04,0x00,0x11,0x00,
+	0x00,0x00,0x52,0x04,0x11,0x00,0x11,0x04,0x11,0x00,0x00,0x00,0xd3,0x30,0xd2,0x2a,
+	0xd1,0x24,0xd0,0x1e,0xcf,0x86,0x95,0x18,0x94,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,
+	0x10,0x04,0x0b,0x00,0x04,0x00,0x04,0x00,0x04,0x00,0x04,0x00,0x04,0x00,0x04,0x00,
+	0xcf,0x06,0x04,0x00,0xcf,0x06,0x04,0x00,0xcf,0x06,0x04,0x00,0xd2,0x6c,0xd1,0x24,
+	0xd0,0x06,0xcf,0x06,0x04,0x00,0xcf,0x86,0x55,0x04,0x04,0x00,0x54,0x04,0x04,0x00,
+	0x93,0x10,0x52,0x04,0x04,0x00,0x51,0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x0b,0x00,
+	0x0b,0x00,0xd0,0x1e,0xcf,0x86,0x95,0x18,0x54,0x04,0x04,0x00,0x53,0x04,0x04,0x00,
+	0x52,0x04,0x04,0x00,0x91,0x08,0x10,0x04,0x04,0x00,0x00,0x00,0x00,0x00,0x04,0x00,
+	0xcf,0x86,0x55,0x04,0x04,0x00,0x54,0x04,0x04,0x00,0xd3,0x10,0x92,0x0c,0x91,0x08,
+	0x10,0x04,0x04,0x00,0x10,0x00,0x10,0x00,0x10,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,
+	0x10,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xd1,0x80,0xd0,0x46,0xcf,0x86,0xd5,0x28,
+	0xd4,0x14,0x53,0x04,0x06,0x00,0x52,0x04,0x06,0x00,0x91,0x08,0x10,0x04,0x06,0x00,
+	0x00,0x00,0x06,0x00,0x93,0x10,0x52,0x04,0x06,0x00,0x91,0x08,0x10,0x04,0x06,0x09,
+	0x00,0x00,0x00,0x00,0x00,0x00,0x54,0x04,0x06,0x00,0x93,0x14,0x52,0x04,0x06,0x00,
+	0xd1,0x08,0x10,0x04,0x06,0x09,0x06,0x00,0x10,0x04,0x06,0x00,0x00,0x00,0x00,0x00,
+	0xcf,0x86,0xd5,0x10,0x54,0x04,0x06,0x00,0x93,0x08,0x12,0x04,0x06,0x00,0x00,0x00,
+	0x00,0x00,0xd4,0x14,0x53,0x04,0x06,0x00,0x52,0x04,0x06,0x00,0x91,0x08,0x10,0x04,
+	0x06,0x00,0x00,0x00,0x06,0x00,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x06,0x00,
+	0x00,0x00,0x06,0x00,0x00,0x00,0x00,0x00,0xd0,0x1b,0xcf,0x86,0x55,0x04,0x04,0x00,
+	0x54,0x04,0x04,0x00,0x93,0x0d,0x52,0x04,0x04,0x00,0x11,0x05,0x04,0xff,0x00,0x04,
+	0x00,0x04,0x00,0xcf,0x86,0xd5,0x24,0x54,0x04,0x04,0x00,0xd3,0x10,0x92,0x0c,0x51,
+	0x04,0x04,0x00,0x10,0x04,0x04,0x09,0x04,0x00,0x04,0x00,0x52,0x04,0x04,0x00,0x91,
+	0x08,0x10,0x04,0x04,0x00,0x07,0xe6,0x00,0x00,0xd4,0x10,0x53,0x04,0x04,0x00,0x92,
+	0x08,0x11,0x04,0x04,0x00,0x00,0x00,0x00,0x00,0x53,0x04,0x07,0x00,0x92,0x08,0x11,
+	0x04,0x07,0x00,0x00,0x00,0x00,0x00,0xe4,0xb7,0x03,0xe3,0x58,0x01,0xd2,0x8f,0xd1,
+	0x53,0xd0,0x35,0xcf,0x86,0x95,0x2f,0xd4,0x1f,0x53,0x04,0x04,0x00,0xd2,0x0d,0x51,
+	0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x04,0xff,0x00,0x51,0x05,0x04,0xff,0x00,0x10,
+	0x05,0x04,0xff,0x00,0x00,0x00,0x53,0x04,0x04,0x00,0x92,0x08,0x11,0x04,0x04,0x00,
+	0x00,0x00,0x00,0x00,0x04,0x00,0xcf,0x86,0x55,0x04,0x04,0x00,0x54,0x04,0x04,0x00,
+	0x53,0x04,0x04,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x14,0x00,0x00,0x00,0x00,0x00,
+	0x00,0x00,0xd0,0x22,0xcf,0x86,0x55,0x04,0x04,0x00,0x94,0x18,0x53,0x04,0x04,0x00,
+	0x92,0x10,0xd1,0x08,0x10,0x04,0x04,0x00,0x04,0xe4,0x10,0x04,0x0a,0x00,0x00,0x00,
+	0x00,0x00,0x0b,0x00,0xcf,0x86,0x55,0x04,0x0b,0x00,0x54,0x04,0x0b,0x00,0x93,0x0c,
+	0x52,0x04,0x0b,0x00,0x11,0x04,0x0b,0x00,0x00,0x00,0x00,0x00,0xd1,0x80,0xd0,0x42,
+	0xcf,0x86,0xd5,0x1c,0x54,0x04,0x07,0x00,0x53,0x04,0x07,0x00,0x52,0x04,0x07,0x00,
+	0xd1,0x08,0x10,0x04,0x07,0x00,0x10,0x00,0x10,0x04,0x10,0x00,0x00,0x00,0xd4,0x0c,
+	0x53,0x04,0x07,0x00,0x12,0x04,0x07,0x00,0x00,0x00,0x53,0x04,0x07,0x00,0x92,0x10,
+	0xd1,0x08,0x10,0x04,0x07,0x00,0x07,0xde,0x10,0x04,0x07,0xe6,0x07,0xdc,0x00,0x00,
+	0xcf,0x86,0xd5,0x18,0x94,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x07,0x00,
+	0x00,0x00,0x00,0x00,0x07,0x00,0x07,0x00,0x07,0x00,0xd4,0x10,0x53,0x04,0x07,0x00,
+	0x52,0x04,0x07,0x00,0x11,0x04,0x07,0x00,0x00,0x00,0x93,0x10,0x52,0x04,0x07,0x00,
+	0x91,0x08,0x10,0x04,0x07,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xd0,0x1a,0xcf,0x86,
+	0x55,0x04,0x08,0x00,0x94,0x10,0x53,0x04,0x08,0x00,0x92,0x08,0x11,0x04,0x08,0x00,
+	0x0b,0x00,0x00,0x00,0x08,0x00,0xcf,0x86,0x95,0x28,0xd4,0x10,0x53,0x04,0x08,0x00,
+	0x92,0x08,0x11,0x04,0x08,0x00,0x00,0x00,0x00,0x00,0x53,0x04,0x08,0x00,0xd2,0x0c,
+	0x51,0x04,0x08,0x00,0x10,0x04,0x0b,0x00,0x00,0x00,0x11,0x04,0x00,0x00,0x08,0x00,
+	0x07,0x00,0xd2,0xe4,0xd1,0x80,0xd0,0x2e,0xcf,0x86,0x95,0x28,0x54,0x04,0x08,0x00,
+	0xd3,0x10,0x52,0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x08,0xe6,
+	0xd2,0x0c,0x91,0x08,0x10,0x04,0x08,0xdc,0x08,0x00,0x08,0x00,0x11,0x04,0x00,0x00,
+	0x08,0x00,0x0b,0x00,0xcf,0x86,0xd5,0x18,0x54,0x04,0x0b,0x00,0x53,0x04,0x0b,0x00,
+	0x52,0x04,0x0b,0x00,0x51,0x04,0x0b,0x00,0x10,0x04,0x0b,0x00,0x00,0x00,0xd4,0x14,
+	0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x0b,0x09,0x0b,0x00,0x0b,0x00,0x0b,0x00,
+	0x0b,0x00,0xd3,0x10,0x52,0x04,0x0b,0x00,0x91,0x08,0x10,0x04,0x0b,0x00,0x0b,0xe6,
+	0x0b,0xe6,0x52,0x04,0x0b,0xe6,0xd1,0x08,0x10,0x04,0x0b,0xe6,0x00,0x00,0x10,0x04,
+	0x00,0x00,0x0b,0xdc,0xd0,0x5e,0xcf,0x86,0xd5,0x20,0xd4,0x10,0x53,0x04,0x0b,0x00,
+	0x92,0x08,0x11,0x04,0x0b,0x00,0x00,0x00,0x00,0x00,0x53,0x04,0x0b,0x00,0x92,0x08,
+	0x11,0x04,0x0b,0x00,0x00,0x00,0x00,0x00,0xd4,0x10,0x53,0x04,0x0b,0x00,0x52,0x04,
+	0x0b,0x00,0x11,0x04,0x0b,0x00,0x00,0x00,0xd3,0x10,0x52,0x04,0x10,0xe6,0x91,0x08,
+	0x10,0x04,0x10,0xe6,0x10,0xdc,0x10,0xdc,0xd2,0x0c,0x51,0x04,0x10,0xdc,0x10,0x04,
+	0x10,0xdc,0x10,0xe6,0xd1,0x08,0x10,0x04,0x10,0xe6,0x10,0xdc,0x10,0x04,0x10,0x00,
+	0x00,0x00,0xcf,0x06,0x00,0x00,0xe1,0x1e,0x01,0xd0,0xaa,0xcf,0x86,0xd5,0x6e,0xd4,
+	0x53,0xd3,0x17,0x52,0x04,0x09,0x00,0x51,0x04,0x09,0x00,0x10,0x0b,0x09,0xff,0xe1,
+	0xac,0x85,0xe1,0xac,0xb5,0x00,0x09,0x00,0xd2,0x1e,0xd1,0x0f,0x10,0x0b,0x09,0xff,
+	0xe1,0xac,0x87,0xe1,0xac,0xb5,0x00,0x09,0x00,0x10,0x0b,0x09,0xff,0xe1,0xac,0x89,
+	0xe1,0xac,0xb5,0x00,0x09,0x00,0xd1,0x0f,0x10,0x0b,0x09,0xff,0xe1,0xac,0x8b,0xe1,
+	0xac,0xb5,0x00,0x09,0x00,0x10,0x0b,0x09,0xff,0xe1,0xac,0x8d,0xe1,0xac,0xb5,0x00,
+	0x09,0x00,0x93,0x17,0x92,0x13,0x51,0x04,0x09,0x00,0x10,0x0b,0x09,0xff,0xe1,0xac,
+	0x91,0xe1,0xac,0xb5,0x00,0x09,0x00,0x09,0x00,0x09,0x00,0x54,0x04,0x09,0x00,0xd3,
+	0x10,0x52,0x04,0x09,0x00,0x91,0x08,0x10,0x04,0x09,0x07,0x09,0x00,0x09,0x00,0xd2,
+	0x13,0x51,0x04,0x09,0x00,0x10,0x04,0x09,0x00,0x09,0xff,0xe1,0xac,0xba,0xe1,0xac,
+	0xb5,0x00,0x91,0x0f,0x10,0x04,0x09,0x00,0x09,0xff,0xe1,0xac,0xbc,0xe1,0xac,0xb5,
+	0x00,0x09,0x00,0xcf,0x86,0xd5,0x3d,0x94,0x39,0xd3,0x31,0xd2,0x25,0xd1,0x16,0x10,
+	0x0b,0x09,0xff,0xe1,0xac,0xbe,0xe1,0xac,0xb5,0x00,0x09,0xff,0xe1,0xac,0xbf,0xe1,
+	0xac,0xb5,0x00,0x10,0x04,0x09,0x00,0x09,0xff,0xe1,0xad,0x82,0xe1,0xac,0xb5,0x00,
+	0x91,0x08,0x10,0x04,0x09,0x09,0x09,0x00,0x09,0x00,0x12,0x04,0x09,0x00,0x00,0x00,
+	0x09,0x00,0xd4,0x1c,0x53,0x04,0x09,0x00,0xd2,0x0c,0x51,0x04,0x09,0x00,0x10,0x04,
+	0x09,0x00,0x09,0xe6,0x91,0x08,0x10,0x04,0x09,0xdc,0x09,0xe6,0x09,0xe6,0xd3,0x08,
+	0x12,0x04,0x09,0xe6,0x09,0x00,0x52,0x04,0x09,0x00,0x91,0x08,0x10,0x04,0x09,0x00,
+	0x00,0x00,0x00,0x00,0xd0,0x2e,0xcf,0x86,0x55,0x04,0x0a,0x00,0xd4,0x18,0x53,0x04,
+	0x0a,0x00,0xd2,0x0c,0x51,0x04,0x0a,0x00,0x10,0x04,0x0a,0x09,0x0d,0x09,0x11,0x04,
+	0x0d,0x00,0x0a,0x00,0x53,0x04,0x0a,0x00,0x92,0x08,0x11,0x04,0x0a,0x00,0x0d,0x00,
+	0x0d,0x00,0xcf,0x86,0x55,0x04,0x0c,0x00,0xd4,0x14,0x93,0x10,0x52,0x04,0x0c,0x00,
+	0x51,0x04,0x0c,0x00,0x10,0x04,0x0c,0x07,0x0c,0x00,0x0c,0x00,0xd3,0x0c,0x92,0x08,
+	0x11,0x04,0x0c,0x00,0x0c,0x09,0x00,0x00,0x12,0x04,0x00,0x00,0x0c,0x00,0xe3,0xb2,
+	0x01,0xe2,0x09,0x01,0xd1,0x4c,0xd0,0x2a,0xcf,0x86,0x55,0x04,0x0a,0x00,0x54,0x04,
+	0x0a,0x00,0xd3,0x10,0x52,0x04,0x0a,0x00,0x51,0x04,0x0a,0x00,0x10,0x04,0x0a,0x00,
+	0x0a,0x07,0x92,0x0c,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x0a,0x00,0x0a,0x00,
+	0xcf,0x86,0x95,0x1c,0x94,0x18,0x53,0x04,0x0a,0x00,0xd2,0x08,0x11,0x04,0x0a,0x00,
+	0x00,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x0a,0x00,0x0a,0x00,0x0a,0x00,0x0a,0x00,
+	0xd0,0x3a,0xcf,0x86,0xd5,0x18,0x94,0x14,0x53,0x04,0x12,0x00,0x92,0x0c,0x91,0x08,
+	0x10,0x04,0x12,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x14,0x00,0x54,0x04,0x14,0x00,
+	0x53,0x04,0x14,0x00,0xd2,0x0c,0x51,0x04,0x14,0x00,0x10,0x04,0x14,0x00,0x00,0x00,
+	0x91,0x08,0x10,0x04,0x00,0x00,0x14,0x00,0x14,0x00,0xcf,0x86,0xd5,0x2c,0xd4,0x08,
+	0x13,0x04,0x0d,0x00,0x00,0x00,0xd3,0x18,0xd2,0x0c,0x51,0x04,0x0b,0xe6,0x10,0x04,
+	0x0b,0xe6,0x0b,0x00,0x91,0x08,0x10,0x04,0x0b,0x01,0x0b,0xdc,0x0b,0xdc,0x92,0x08,
+	0x11,0x04,0x0b,0xdc,0x0b,0xe6,0x0b,0xdc,0xd4,0x28,0xd3,0x10,0x92,0x0c,0x91,0x08,
+	0x10,0x04,0x0b,0xe6,0x0b,0x00,0x0b,0x01,0x0b,0x01,0xd2,0x0c,0x91,0x08,0x10,0x04,
+	0x0b,0x01,0x0b,0x00,0x0b,0x00,0x91,0x08,0x10,0x04,0x0b,0x00,0x0b,0xdc,0x0b,0x00,
+	0xd3,0x1c,0xd2,0x0c,0x51,0x04,0x0b,0x00,0x10,0x04,0x0b,0x00,0x0d,0x00,0xd1,0x08,
+	0x10,0x04,0x0d,0xe6,0x0d,0x00,0x10,0x04,0x0d,0x00,0x13,0x00,0x92,0x0c,0x51,0x04,
+	0x10,0xe6,0x10,0x04,0x15,0x00,0x00,0x00,0x00,0x00,0xd1,0x1c,0xd0,0x06,0xcf,0x06,
+	0x07,0x00,0xcf,0x86,0x55,0x04,0x07,0x00,0x94,0x0c,0x53,0x04,0x07,0x00,0x12,0x04,
+	0x07,0x00,0x08,0x00,0x08,0x00,0xd0,0x06,0xcf,0x06,0x08,0x00,0xcf,0x86,0xd5,0x40,
+	0xd4,0x2c,0xd3,0x10,0x92,0x0c,0x51,0x04,0x08,0xe6,0x10,0x04,0x08,0xdc,0x08,0xe6,
+	0x09,0xe6,0xd2,0x0c,0x51,0x04,0x09,0xe6,0x10,0x04,0x09,0xdc,0x0a,0xe6,0xd1,0x08,
+	0x10,0x04,0x0a,0xe6,0x0a,0xea,0x10,0x04,0x0a,0xd6,0x0a,0xdc,0x93,0x10,0x92,0x0c,
+	0x91,0x08,0x10,0x04,0x0a,0xca,0x0a,0xe6,0x0a,0xe6,0x0a,0xe6,0x0a,0xe6,0xd4,0x14,
+	0x93,0x10,0x52,0x04,0x0a,0xe6,0x51,0x04,0x0a,0xe6,0x10,0x04,0x0a,0xe6,0x10,0xe6,
+	0x10,0xe6,0xd3,0x10,0x52,0x04,0x10,0xe6,0x51,0x04,0x10,0xe6,0x10,0x04,0x13,0xe8,
+	0x13,0xe4,0xd2,0x10,0xd1,0x08,0x10,0x04,0x13,0xe4,0x13,0xdc,0x10,0x04,0x00,0x00,
+	0x12,0xe6,0xd1,0x08,0x10,0x04,0x0c,0xe9,0x0b,0xdc,0x10,0x04,0x09,0xe6,0x09,0xdc,
+	0xe2,0x80,0x08,0xe1,0x48,0x04,0xe0,0x1c,0x02,0xcf,0x86,0xe5,0x11,0x01,0xd4,0x84,
+	0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x41,0xcc,0xa5,0x00,0x01,0xff,
+	0x61,0xcc,0xa5,0x00,0x10,0x08,0x01,0xff,0x42,0xcc,0x87,0x00,0x01,0xff,0x62,0xcc,
+	0x87,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x42,0xcc,0xa3,0x00,0x01,0xff,0x62,0xcc,
+	0xa3,0x00,0x10,0x08,0x01,0xff,0x42,0xcc,0xb1,0x00,0x01,0xff,0x62,0xcc,0xb1,0x00,
+	0xd2,0x24,0xd1,0x14,0x10,0x0a,0x01,0xff,0x43,0xcc,0xa7,0xcc,0x81,0x00,0x01,0xff,
+	0x63,0xcc,0xa7,0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x44,0xcc,0x87,0x00,0x01,0xff,
+	0x64,0xcc,0x87,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x44,0xcc,0xa3,0x00,0x01,0xff,
+	0x64,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,0x44,0xcc,0xb1,0x00,0x01,0xff,0x64,0xcc,
+	0xb1,0x00,0xd3,0x48,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x44,0xcc,0xa7,0x00,
+	0x01,0xff,0x64,0xcc,0xa7,0x00,0x10,0x08,0x01,0xff,0x44,0xcc,0xad,0x00,0x01,0xff,
+	0x64,0xcc,0xad,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x45,0xcc,0x84,0xcc,0x80,0x00,
+	0x01,0xff,0x65,0xcc,0x84,0xcc,0x80,0x00,0x10,0x0a,0x01,0xff,0x45,0xcc,0x84,0xcc,
+	0x81,0x00,0x01,0xff,0x65,0xcc,0x84,0xcc,0x81,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,
+	0x01,0xff,0x45,0xcc,0xad,0x00,0x01,0xff,0x65,0xcc,0xad,0x00,0x10,0x08,0x01,0xff,
+	0x45,0xcc,0xb0,0x00,0x01,0xff,0x65,0xcc,0xb0,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,
+	0x45,0xcc,0xa7,0xcc,0x86,0x00,0x01,0xff,0x65,0xcc,0xa7,0xcc,0x86,0x00,0x10,0x08,
+	0x01,0xff,0x46,0xcc,0x87,0x00,0x01,0xff,0x66,0xcc,0x87,0x00,0xd4,0x84,0xd3,0x40,
+	0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x47,0xcc,0x84,0x00,0x01,0xff,0x67,0xcc,
+	0x84,0x00,0x10,0x08,0x01,0xff,0x48,0xcc,0x87,0x00,0x01,0xff,0x68,0xcc,0x87,0x00,
+	0xd1,0x10,0x10,0x08,0x01,0xff,0x48,0xcc,0xa3,0x00,0x01,0xff,0x68,0xcc,0xa3,0x00,
+	0x10,0x08,0x01,0xff,0x48,0xcc,0x88,0x00,0x01,0xff,0x68,0xcc,0x88,0x00,0xd2,0x20,
+	0xd1,0x10,0x10,0x08,0x01,0xff,0x48,0xcc,0xa7,0x00,0x01,0xff,0x68,0xcc,0xa7,0x00,
+	0x10,0x08,0x01,0xff,0x48,0xcc,0xae,0x00,0x01,0xff,0x68,0xcc,0xae,0x00,0xd1,0x10,
+	0x10,0x08,0x01,0xff,0x49,0xcc,0xb0,0x00,0x01,0xff,0x69,0xcc,0xb0,0x00,0x10,0x0a,
+	0x01,0xff,0x49,0xcc,0x88,0xcc,0x81,0x00,0x01,0xff,0x69,0xcc,0x88,0xcc,0x81,0x00,
+	0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x4b,0xcc,0x81,0x00,0x01,0xff,
+	0x6b,0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x4b,0xcc,0xa3,0x00,0x01,0xff,0x6b,0xcc,
+	0xa3,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x4b,0xcc,0xb1,0x00,0x01,0xff,0x6b,0xcc,
+	0xb1,0x00,0x10,0x08,0x01,0xff,0x4c,0xcc,0xa3,0x00,0x01,0xff,0x6c,0xcc,0xa3,0x00,
+	0xd2,0x24,0xd1,0x14,0x10,0x0a,0x01,0xff,0x4c,0xcc,0xa3,0xcc,0x84,0x00,0x01,0xff,
+	0x6c,0xcc,0xa3,0xcc,0x84,0x00,0x10,0x08,0x01,0xff,0x4c,0xcc,0xb1,0x00,0x01,0xff,
+	0x6c,0xcc,0xb1,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x4c,0xcc,0xad,0x00,0x01,0xff,
+	0x6c,0xcc,0xad,0x00,0x10,0x08,0x01,0xff,0x4d,0xcc,0x81,0x00,0x01,0xff,0x6d,0xcc,
+	0x81,0x00,0xcf,0x86,0xe5,0x15,0x01,0xd4,0x88,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,
+	0x08,0x01,0xff,0x4d,0xcc,0x87,0x00,0x01,0xff,0x6d,0xcc,0x87,0x00,0x10,0x08,0x01,
+	0xff,0x4d,0xcc,0xa3,0x00,0x01,0xff,0x6d,0xcc,0xa3,0x00,0xd1,0x10,0x10,0x08,0x01,
+	0xff,0x4e,0xcc,0x87,0x00,0x01,0xff,0x6e,0xcc,0x87,0x00,0x10,0x08,0x01,0xff,0x4e,
+	0xcc,0xa3,0x00,0x01,0xff,0x6e,0xcc,0xa3,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,
+	0xff,0x4e,0xcc,0xb1,0x00,0x01,0xff,0x6e,0xcc,0xb1,0x00,0x10,0x08,0x01,0xff,0x4e,
+	0xcc,0xad,0x00,0x01,0xff,0x6e,0xcc,0xad,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x4f,
+	0xcc,0x83,0xcc,0x81,0x00,0x01,0xff,0x6f,0xcc,0x83,0xcc,0x81,0x00,0x10,0x0a,0x01,
+	0xff,0x4f,0xcc,0x83,0xcc,0x88,0x00,0x01,0xff,0x6f,0xcc,0x83,0xcc,0x88,0x00,0xd3,
+	0x48,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x4f,0xcc,0x84,0xcc,0x80,0x00,0x01,
+	0xff,0x6f,0xcc,0x84,0xcc,0x80,0x00,0x10,0x0a,0x01,0xff,0x4f,0xcc,0x84,0xcc,0x81,
+	0x00,0x01,0xff,0x6f,0xcc,0x84,0xcc,0x81,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x50,
+	0xcc,0x81,0x00,0x01,0xff,0x70,0xcc,0x81,0x00,0x10,0x08,0x01,0xff,0x50,0xcc,0x87,
+	0x00,0x01,0xff,0x70,0xcc,0x87,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x52,
+	0xcc,0x87,0x00,0x01,0xff,0x72,0xcc,0x87,0x00,0x10,0x08,0x01,0xff,0x52,0xcc,0xa3,
+	0x00,0x01,0xff,0x72,0xcc,0xa3,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x52,0xcc,0xa3,
+	0xcc,0x84,0x00,0x01,0xff,0x72,0xcc,0xa3,0xcc,0x84,0x00,0x10,0x08,0x01,0xff,0x52,
+	0xcc,0xb1,0x00,0x01,0xff,0x72,0xcc,0xb1,0x00,0xd4,0x8c,0xd3,0x48,0xd2,0x20,0xd1,
+	0x10,0x10,0x08,0x01,0xff,0x53,0xcc,0x87,0x00,0x01,0xff,0x73,0xcc,0x87,0x00,0x10,
+	0x08,0x01,0xff,0x53,0xcc,0xa3,0x00,0x01,0xff,0x73,0xcc,0xa3,0x00,0xd1,0x14,0x10,
+	0x0a,0x01,0xff,0x53,0xcc,0x81,0xcc,0x87,0x00,0x01,0xff,0x73,0xcc,0x81,0xcc,0x87,
+	0x00,0x10,0x0a,0x01,0xff,0x53,0xcc,0x8c,0xcc,0x87,0x00,0x01,0xff,0x73,0xcc,0x8c,
+	0xcc,0x87,0x00,0xd2,0x24,0xd1,0x14,0x10,0x0a,0x01,0xff,0x53,0xcc,0xa3,0xcc,0x87,
+	0x00,0x01,0xff,0x73,0xcc,0xa3,0xcc,0x87,0x00,0x10,0x08,0x01,0xff,0x54,0xcc,0x87,
+	0x00,0x01,0xff,0x74,0xcc,0x87,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x54,0xcc,0xa3,
+	0x00,0x01,0xff,0x74,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,0x54,0xcc,0xb1,0x00,0x01,
+	0xff,0x74,0xcc,0xb1,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x54,
+	0xcc,0xad,0x00,0x01,0xff,0x74,0xcc,0xad,0x00,0x10,0x08,0x01,0xff,0x55,0xcc,0xa4,
+	0x00,0x01,0xff,0x75,0xcc,0xa4,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x55,0xcc,0xb0,
+	0x00,0x01,0xff,0x75,0xcc,0xb0,0x00,0x10,0x08,0x01,0xff,0x55,0xcc,0xad,0x00,0x01,
+	0xff,0x75,0xcc,0xad,0x00,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x55,0xcc,0x83,
+	0xcc,0x81,0x00,0x01,0xff,0x75,0xcc,0x83,0xcc,0x81,0x00,0x10,0x0a,0x01,0xff,0x55,
+	0xcc,0x84,0xcc,0x88,0x00,0x01,0xff,0x75,0xcc,0x84,0xcc,0x88,0x00,0xd1,0x10,0x10,
+	0x08,0x01,0xff,0x56,0xcc,0x83,0x00,0x01,0xff,0x76,0xcc,0x83,0x00,0x10,0x08,0x01,
+	0xff,0x56,0xcc,0xa3,0x00,0x01,0xff,0x76,0xcc,0xa3,0x00,0xe0,0x10,0x02,0xcf,0x86,
+	0xd5,0xe1,0xd4,0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x57,0xcc,
+	0x80,0x00,0x01,0xff,0x77,0xcc,0x80,0x00,0x10,0x08,0x01,0xff,0x57,0xcc,0x81,0x00,
+	0x01,0xff,0x77,0xcc,0x81,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x57,0xcc,0x88,0x00,
+	0x01,0xff,0x77,0xcc,0x88,0x00,0x10,0x08,0x01,0xff,0x57,0xcc,0x87,0x00,0x01,0xff,
+	0x77,0xcc,0x87,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x57,0xcc,0xa3,0x00,
+	0x01,0xff,0x77,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,0x58,0xcc,0x87,0x00,0x01,0xff,
+	0x78,0xcc,0x87,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x58,0xcc,0x88,0x00,0x01,0xff,
+	0x78,0xcc,0x88,0x00,0x10,0x08,0x01,0xff,0x59,0xcc,0x87,0x00,0x01,0xff,0x79,0xcc,
+	0x87,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x5a,0xcc,0x82,0x00,
+	0x01,0xff,0x7a,0xcc,0x82,0x00,0x10,0x08,0x01,0xff,0x5a,0xcc,0xa3,0x00,0x01,0xff,
+	0x7a,0xcc,0xa3,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x5a,0xcc,0xb1,0x00,0x01,0xff,
+	0x7a,0xcc,0xb1,0x00,0x10,0x08,0x01,0xff,0x68,0xcc,0xb1,0x00,0x01,0xff,0x74,0xcc,
+	0x88,0x00,0x92,0x1d,0xd1,0x10,0x10,0x08,0x01,0xff,0x77,0xcc,0x8a,0x00,0x01,0xff,
+	0x79,0xcc,0x8a,0x00,0x10,0x04,0x01,0x00,0x02,0xff,0xc5,0xbf,0xcc,0x87,0x00,0x0a,
+	0x00,0xd4,0x98,0xd3,0x48,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x41,0xcc,0xa3,
+	0x00,0x01,0xff,0x61,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,0x41,0xcc,0x89,0x00,0x01,
+	0xff,0x61,0xcc,0x89,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x41,0xcc,0x82,0xcc,0x81,
+	0x00,0x01,0xff,0x61,0xcc,0x82,0xcc,0x81,0x00,0x10,0x0a,0x01,0xff,0x41,0xcc,0x82,
+	0xcc,0x80,0x00,0x01,0xff,0x61,0xcc,0x82,0xcc,0x80,0x00,0xd2,0x28,0xd1,0x14,0x10,
+	0x0a,0x01,0xff,0x41,0xcc,0x82,0xcc,0x89,0x00,0x01,0xff,0x61,0xcc,0x82,0xcc,0x89,
+	0x00,0x10,0x0a,0x01,0xff,0x41,0xcc,0x82,0xcc,0x83,0x00,0x01,0xff,0x61,0xcc,0x82,
+	0xcc,0x83,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x41,0xcc,0xa3,0xcc,0x82,0x00,0x01,
+	0xff,0x61,0xcc,0xa3,0xcc,0x82,0x00,0x10,0x0a,0x01,0xff,0x41,0xcc,0x86,0xcc,0x81,
+	0x00,0x01,0xff,0x61,0xcc,0x86,0xcc,0x81,0x00,0xd3,0x50,0xd2,0x28,0xd1,0x14,0x10,
+	0x0a,0x01,0xff,0x41,0xcc,0x86,0xcc,0x80,0x00,0x01,0xff,0x61,0xcc,0x86,0xcc,0x80,
+	0x00,0x10,0x0a,0x01,0xff,0x41,0xcc,0x86,0xcc,0x89,0x00,0x01,0xff,0x61,0xcc,0x86,
+	0xcc,0x89,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x41,0xcc,0x86,0xcc,0x83,0x00,0x01,
+	0xff,0x61,0xcc,0x86,0xcc,0x83,0x00,0x10,0x0a,0x01,0xff,0x41,0xcc,0xa3,0xcc,0x86,
+	0x00,0x01,0xff,0x61,0xcc,0xa3,0xcc,0x86,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,
+	0xff,0x45,0xcc,0xa3,0x00,0x01,0xff,0x65,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,0x45,
+	0xcc,0x89,0x00,0x01,0xff,0x65,0xcc,0x89,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x45,
+	0xcc,0x83,0x00,0x01,0xff,0x65,0xcc,0x83,0x00,0x10,0x0a,0x01,0xff,0x45,0xcc,0x82,
+	0xcc,0x81,0x00,0x01,0xff,0x65,0xcc,0x82,0xcc,0x81,0x00,0xcf,0x86,0xe5,0x31,0x01,
+	0xd4,0x90,0xd3,0x50,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x45,0xcc,0x82,0xcc,
+	0x80,0x00,0x01,0xff,0x65,0xcc,0x82,0xcc,0x80,0x00,0x10,0x0a,0x01,0xff,0x45,0xcc,
+	0x82,0xcc,0x89,0x00,0x01,0xff,0x65,0xcc,0x82,0xcc,0x89,0x00,0xd1,0x14,0x10,0x0a,
+	0x01,0xff,0x45,0xcc,0x82,0xcc,0x83,0x00,0x01,0xff,0x65,0xcc,0x82,0xcc,0x83,0x00,
+	0x10,0x0a,0x01,0xff,0x45,0xcc,0xa3,0xcc,0x82,0x00,0x01,0xff,0x65,0xcc,0xa3,0xcc,
+	0x82,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0x49,0xcc,0x89,0x00,0x01,0xff,
+	0x69,0xcc,0x89,0x00,0x10,0x08,0x01,0xff,0x49,0xcc,0xa3,0x00,0x01,0xff,0x69,0xcc,
+	0xa3,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0x4f,0xcc,0xa3,0x00,0x01,0xff,0x6f,0xcc,
+	0xa3,0x00,0x10,0x08,0x01,0xff,0x4f,0xcc,0x89,0x00,0x01,0xff,0x6f,0xcc,0x89,0x00,
+	0xd3,0x50,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x4f,0xcc,0x82,0xcc,0x81,0x00,
+	0x01,0xff,0x6f,0xcc,0x82,0xcc,0x81,0x00,0x10,0x0a,0x01,0xff,0x4f,0xcc,0x82,0xcc,
+	0x80,0x00,0x01,0xff,0x6f,0xcc,0x82,0xcc,0x80,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,
+	0x4f,0xcc,0x82,0xcc,0x89,0x00,0x01,0xff,0x6f,0xcc,0x82,0xcc,0x89,0x00,0x10,0x0a,
+	0x01,0xff,0x4f,0xcc,0x82,0xcc,0x83,0x00,0x01,0xff,0x6f,0xcc,0x82,0xcc,0x83,0x00,
+	0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x4f,0xcc,0xa3,0xcc,0x82,0x00,0x01,0xff,
+	0x6f,0xcc,0xa3,0xcc,0x82,0x00,0x10,0x0a,0x01,0xff,0x4f,0xcc,0x9b,0xcc,0x81,0x00,
+	0x01,0xff,0x6f,0xcc,0x9b,0xcc,0x81,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0x4f,0xcc,
+	0x9b,0xcc,0x80,0x00,0x01,0xff,0x6f,0xcc,0x9b,0xcc,0x80,0x00,0x10,0x0a,0x01,0xff,
+	0x4f,0xcc,0x9b,0xcc,0x89,0x00,0x01,0xff,0x6f,0xcc,0x9b,0xcc,0x89,0x00,0xd4,0x98,
+	0xd3,0x48,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0x4f,0xcc,0x9b,0xcc,0x83,0x00,
+	0x01,0xff,0x6f,0xcc,0x9b,0xcc,0x83,0x00,0x10,0x0a,0x01,0xff,0x4f,0xcc,0x9b,0xcc,
+	0xa3,0x00,0x01,0xff,0x6f,0xcc,0x9b,0xcc,0xa3,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,
+	0x55,0xcc,0xa3,0x00,0x01,0xff,0x75,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,0x55,0xcc,
+	0x89,0x00,0x01,0xff,0x75,0xcc,0x89,0x00,0xd2,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,
+	0x55,0xcc,0x9b,0xcc,0x81,0x00,0x01,0xff,0x75,0xcc,0x9b,0xcc,0x81,0x00,0x10,0x0a,
+	0x01,0xff,0x55,0xcc,0x9b,0xcc,0x80,0x00,0x01,0xff,0x75,0xcc,0x9b,0xcc,0x80,0x00,
+	0xd1,0x14,0x10,0x0a,0x01,0xff,0x55,0xcc,0x9b,0xcc,0x89,0x00,0x01,0xff,0x75,0xcc,
+	0x9b,0xcc,0x89,0x00,0x10,0x0a,0x01,0xff,0x55,0xcc,0x9b,0xcc,0x83,0x00,0x01,0xff,
+	0x75,0xcc,0x9b,0xcc,0x83,0x00,0xd3,0x44,0xd2,0x24,0xd1,0x14,0x10,0x0a,0x01,0xff,
+	0x55,0xcc,0x9b,0xcc,0xa3,0x00,0x01,0xff,0x75,0xcc,0x9b,0xcc,0xa3,0x00,0x10,0x08,
+	0x01,0xff,0x59,0xcc,0x80,0x00,0x01,0xff,0x79,0xcc,0x80,0x00,0xd1,0x10,0x10,0x08,
+	0x01,0xff,0x59,0xcc,0xa3,0x00,0x01,0xff,0x79,0xcc,0xa3,0x00,0x10,0x08,0x01,0xff,
+	0x59,0xcc,0x89,0x00,0x01,0xff,0x79,0xcc,0x89,0x00,0x92,0x14,0x91,0x10,0x10,0x08,
+	0x01,0xff,0x59,0xcc,0x83,0x00,0x01,0xff,0x79,0xcc,0x83,0x00,0x0a,0x00,0x0a,0x00,
+	0xe1,0xc0,0x04,0xe0,0x80,0x02,0xcf,0x86,0xe5,0x2d,0x01,0xd4,0xa8,0xd3,0x54,0xd2,
+	0x28,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xb1,0xcc,0x93,0x00,0x01,0xff,0xce,0xb1,
+	0xcc,0x94,0x00,0x10,0x0b,0x01,0xff,0xce,0xb1,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,
+	0xce,0xb1,0xcc,0x94,0xcc,0x80,0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,0xb1,0xcc,
+	0x93,0xcc,0x81,0x00,0x01,0xff,0xce,0xb1,0xcc,0x94,0xcc,0x81,0x00,0x10,0x0b,0x01,
+	0xff,0xce,0xb1,0xcc,0x93,0xcd,0x82,0x00,0x01,0xff,0xce,0xb1,0xcc,0x94,0xcd,0x82,
+	0x00,0xd2,0x28,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0x91,0xcc,0x93,0x00,0x01,0xff,
+	0xce,0x91,0xcc,0x94,0x00,0x10,0x0b,0x01,0xff,0xce,0x91,0xcc,0x93,0xcc,0x80,0x00,
+	0x01,0xff,0xce,0x91,0xcc,0x94,0xcc,0x80,0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,
+	0x91,0xcc,0x93,0xcc,0x81,0x00,0x01,0xff,0xce,0x91,0xcc,0x94,0xcc,0x81,0x00,0x10,
+	0x0b,0x01,0xff,0xce,0x91,0xcc,0x93,0xcd,0x82,0x00,0x01,0xff,0xce,0x91,0xcc,0x94,
+	0xcd,0x82,0x00,0xd3,0x42,0xd2,0x28,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xb5,0xcc,
+	0x93,0x00,0x01,0xff,0xce,0xb5,0xcc,0x94,0x00,0x10,0x0b,0x01,0xff,0xce,0xb5,0xcc,
+	0x93,0xcc,0x80,0x00,0x01,0xff,0xce,0xb5,0xcc,0x94,0xcc,0x80,0x00,0x91,0x16,0x10,
+	0x0b,0x01,0xff,0xce,0xb5,0xcc,0x93,0xcc,0x81,0x00,0x01,0xff,0xce,0xb5,0xcc,0x94,
+	0xcc,0x81,0x00,0x00,0x00,0xd2,0x28,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0x95,0xcc,
+	0x93,0x00,0x01,0xff,0xce,0x95,0xcc,0x94,0x00,0x10,0x0b,0x01,0xff,0xce,0x95,0xcc,
+	0x93,0xcc,0x80,0x00,0x01,0xff,0xce,0x95,0xcc,0x94,0xcc,0x80,0x00,0x91,0x16,0x10,
+	0x0b,0x01,0xff,0xce,0x95,0xcc,0x93,0xcc,0x81,0x00,0x01,0xff,0xce,0x95,0xcc,0x94,
+	0xcc,0x81,0x00,0x00,0x00,0xd4,0xa8,0xd3,0x54,0xd2,0x28,0xd1,0x12,0x10,0x09,0x01,
+	0xff,0xce,0xb7,0xcc,0x93,0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0x00,0x10,0x0b,0x01,
+	0xff,0xce,0xb7,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0xcc,0x80,
+	0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,0xb7,0xcc,0x93,0xcc,0x81,0x00,0x01,0xff,
+	0xce,0xb7,0xcc,0x94,0xcc,0x81,0x00,0x10,0x0b,0x01,0xff,0xce,0xb7,0xcc,0x93,0xcd,
+	0x82,0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0xcd,0x82,0x00,0xd2,0x28,0xd1,0x12,0x10,
+	0x09,0x01,0xff,0xce,0x97,0xcc,0x93,0x00,0x01,0xff,0xce,0x97,0xcc,0x94,0x00,0x10,
+	0x0b,0x01,0xff,0xce,0x97,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,0xce,0x97,0xcc,0x94,
+	0xcc,0x80,0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,0x97,0xcc,0x93,0xcc,0x81,0x00,
+	0x01,0xff,0xce,0x97,0xcc,0x94,0xcc,0x81,0x00,0x10,0x0b,0x01,0xff,0xce,0x97,0xcc,
+	0x93,0xcd,0x82,0x00,0x01,0xff,0xce,0x97,0xcc,0x94,0xcd,0x82,0x00,0xd3,0x54,0xd2,
+	0x28,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xb9,0xcc,0x93,0x00,0x01,0xff,0xce,0xb9,
+	0xcc,0x94,0x00,0x10,0x0b,0x01,0xff,0xce,0xb9,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,
+	0xce,0xb9,0xcc,0x94,0xcc,0x80,0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,0xb9,0xcc,
+	0x93,0xcc,0x81,0x00,0x01,0xff,0xce,0xb9,0xcc,0x94,0xcc,0x81,0x00,0x10,0x0b,0x01,
+	0xff,0xce,0xb9,0xcc,0x93,0xcd,0x82,0x00,0x01,0xff,0xce,0xb9,0xcc,0x94,0xcd,0x82,
+	0x00,0xd2,0x28,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0x99,0xcc,0x93,0x00,0x01,0xff,
+	0xce,0x99,0xcc,0x94,0x00,0x10,0x0b,0x01,0xff,0xce,0x99,0xcc,0x93,0xcc,0x80,0x00,
+	0x01,0xff,0xce,0x99,0xcc,0x94,0xcc,0x80,0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,
+	0x99,0xcc,0x93,0xcc,0x81,0x00,0x01,0xff,0xce,0x99,0xcc,0x94,0xcc,0x81,0x00,0x10,
+	0x0b,0x01,0xff,0xce,0x99,0xcc,0x93,0xcd,0x82,0x00,0x01,0xff,0xce,0x99,0xcc,0x94,
+	0xcd,0x82,0x00,0xcf,0x86,0xe5,0x13,0x01,0xd4,0x84,0xd3,0x42,0xd2,0x28,0xd1,0x12,
+	0x10,0x09,0x01,0xff,0xce,0xbf,0xcc,0x93,0x00,0x01,0xff,0xce,0xbf,0xcc,0x94,0x00,
+	0x10,0x0b,0x01,0xff,0xce,0xbf,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,0xce,0xbf,0xcc,
+	0x94,0xcc,0x80,0x00,0x91,0x16,0x10,0x0b,0x01,0xff,0xce,0xbf,0xcc,0x93,0xcc,0x81,
+	0x00,0x01,0xff,0xce,0xbf,0xcc,0x94,0xcc,0x81,0x00,0x00,0x00,0xd2,0x28,0xd1,0x12,
+	0x10,0x09,0x01,0xff,0xce,0x9f,0xcc,0x93,0x00,0x01,0xff,0xce,0x9f,0xcc,0x94,0x00,
+	0x10,0x0b,0x01,0xff,0xce,0x9f,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,0xce,0x9f,0xcc,
+	0x94,0xcc,0x80,0x00,0x91,0x16,0x10,0x0b,0x01,0xff,0xce,0x9f,0xcc,0x93,0xcc,0x81,
+	0x00,0x01,0xff,0xce,0x9f,0xcc,0x94,0xcc,0x81,0x00,0x00,0x00,0xd3,0x54,0xd2,0x28,
+	0xd1,0x12,0x10,0x09,0x01,0xff,0xcf,0x85,0xcc,0x93,0x00,0x01,0xff,0xcf,0x85,0xcc,
+	0x94,0x00,0x10,0x0b,0x01,0xff,0xcf,0x85,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,0xcf,
+	0x85,0xcc,0x94,0xcc,0x80,0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xcf,0x85,0xcc,0x93,
+	0xcc,0x81,0x00,0x01,0xff,0xcf,0x85,0xcc,0x94,0xcc,0x81,0x00,0x10,0x0b,0x01,0xff,
+	0xcf,0x85,0xcc,0x93,0xcd,0x82,0x00,0x01,0xff,0xcf,0x85,0xcc,0x94,0xcd,0x82,0x00,
+	0xd2,0x1c,0xd1,0x0d,0x10,0x04,0x00,0x00,0x01,0xff,0xce,0xa5,0xcc,0x94,0x00,0x10,
+	0x04,0x00,0x00,0x01,0xff,0xce,0xa5,0xcc,0x94,0xcc,0x80,0x00,0xd1,0x0f,0x10,0x04,
+	0x00,0x00,0x01,0xff,0xce,0xa5,0xcc,0x94,0xcc,0x81,0x00,0x10,0x04,0x00,0x00,0x01,
+	0xff,0xce,0xa5,0xcc,0x94,0xcd,0x82,0x00,0xd4,0xa8,0xd3,0x54,0xd2,0x28,0xd1,0x12,
+	0x10,0x09,0x01,0xff,0xcf,0x89,0xcc,0x93,0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0x00,
+	0x10,0x0b,0x01,0xff,0xcf,0x89,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,0xcf,0x89,0xcc,
+	0x94,0xcc,0x80,0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xcf,0x89,0xcc,0x93,0xcc,0x81,
+	0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0xcc,0x81,0x00,0x10,0x0b,0x01,0xff,0xcf,0x89,
+	0xcc,0x93,0xcd,0x82,0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0xcd,0x82,0x00,0xd2,0x28,
+	0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xa9,0xcc,0x93,0x00,0x01,0xff,0xce,0xa9,0xcc,
+	0x94,0x00,0x10,0x0b,0x01,0xff,0xce,0xa9,0xcc,0x93,0xcc,0x80,0x00,0x01,0xff,0xce,
+	0xa9,0xcc,0x94,0xcc,0x80,0x00,0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,0xa9,0xcc,0x93,
+	0xcc,0x81,0x00,0x01,0xff,0xce,0xa9,0xcc,0x94,0xcc,0x81,0x00,0x10,0x0b,0x01,0xff,
+	0xce,0xa9,0xcc,0x93,0xcd,0x82,0x00,0x01,0xff,0xce,0xa9,0xcc,0x94,0xcd,0x82,0x00,
+	0xd3,0x48,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xb1,0xcc,0x80,0x00,0x01,
+	0xff,0xce,0xb1,0xcc,0x81,0x00,0x10,0x09,0x01,0xff,0xce,0xb5,0xcc,0x80,0x00,0x01,
+	0xff,0xce,0xb5,0xcc,0x81,0x00,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xb7,0xcc,0x80,
+	0x00,0x01,0xff,0xce,0xb7,0xcc,0x81,0x00,0x10,0x09,0x01,0xff,0xce,0xb9,0xcc,0x80,
+	0x00,0x01,0xff,0xce,0xb9,0xcc,0x81,0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,0xff,
+	0xce,0xbf,0xcc,0x80,0x00,0x01,0xff,0xce,0xbf,0xcc,0x81,0x00,0x10,0x09,0x01,0xff,
+	0xcf,0x85,0xcc,0x80,0x00,0x01,0xff,0xcf,0x85,0xcc,0x81,0x00,0x91,0x12,0x10,0x09,
+	0x01,0xff,0xcf,0x89,0xcc,0x80,0x00,0x01,0xff,0xcf,0x89,0xcc,0x81,0x00,0x00,0x00,
+	0xe0,0xe1,0x02,0xcf,0x86,0xe5,0x91,0x01,0xd4,0xc8,0xd3,0x64,0xd2,0x30,0xd1,0x16,
+	0x10,0x0b,0x01,0xff,0xce,0xb1,0xcc,0x93,0xcd,0x85,0x00,0x01,0xff,0xce,0xb1,0xcc,
+	0x94,0xcd,0x85,0x00,0x10,0x0d,0x01,0xff,0xce,0xb1,0xcc,0x93,0xcc,0x80,0xcd,0x85,
+	0x00,0x01,0xff,0xce,0xb1,0xcc,0x94,0xcc,0x80,0xcd,0x85,0x00,0xd1,0x1a,0x10,0x0d,
+	0x01,0xff,0xce,0xb1,0xcc,0x93,0xcc,0x81,0xcd,0x85,0x00,0x01,0xff,0xce,0xb1,0xcc,
+	0x94,0xcc,0x81,0xcd,0x85,0x00,0x10,0x0d,0x01,0xff,0xce,0xb1,0xcc,0x93,0xcd,0x82,
+	0xcd,0x85,0x00,0x01,0xff,0xce,0xb1,0xcc,0x94,0xcd,0x82,0xcd,0x85,0x00,0xd2,0x30,
+	0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,0x91,0xcc,0x93,0xcd,0x85,0x00,0x01,0xff,0xce,
+	0x91,0xcc,0x94,0xcd,0x85,0x00,0x10,0x0d,0x01,0xff,0xce,0x91,0xcc,0x93,0xcc,0x80,
+	0xcd,0x85,0x00,0x01,0xff,0xce,0x91,0xcc,0x94,0xcc,0x80,0xcd,0x85,0x00,0xd1,0x1a,
+	0x10,0x0d,0x01,0xff,0xce,0x91,0xcc,0x93,0xcc,0x81,0xcd,0x85,0x00,0x01,0xff,0xce,
+	0x91,0xcc,0x94,0xcc,0x81,0xcd,0x85,0x00,0x10,0x0d,0x01,0xff,0xce,0x91,0xcc,0x93,
+	0xcd,0x82,0xcd,0x85,0x00,0x01,0xff,0xce,0x91,0xcc,0x94,0xcd,0x82,0xcd,0x85,0x00,
+	0xd3,0x64,0xd2,0x30,0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,0xb7,0xcc,0x93,0xcd,0x85,
+	0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0xcd,0x85,0x00,0x10,0x0d,0x01,0xff,0xce,0xb7,
+	0xcc,0x93,0xcc,0x80,0xcd,0x85,0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0xcc,0x80,0xcd,
+	0x85,0x00,0xd1,0x1a,0x10,0x0d,0x01,0xff,0xce,0xb7,0xcc,0x93,0xcc,0x81,0xcd,0x85,
+	0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0xcc,0x81,0xcd,0x85,0x00,0x10,0x0d,0x01,0xff,
+	0xce,0xb7,0xcc,0x93,0xcd,0x82,0xcd,0x85,0x00,0x01,0xff,0xce,0xb7,0xcc,0x94,0xcd,
+	0x82,0xcd,0x85,0x00,0xd2,0x30,0xd1,0x16,0x10,0x0b,0x01,0xff,0xce,0x97,0xcc,0x93,
+	0xcd,0x85,0x00,0x01,0xff,0xce,0x97,0xcc,0x94,0xcd,0x85,0x00,0x10,0x0d,0x01,0xff,
+	0xce,0x97,0xcc,0x93,0xcc,0x80,0xcd,0x85,0x00,0x01,0xff,0xce,0x97,0xcc,0x94,0xcc,
+	0x80,0xcd,0x85,0x00,0xd1,0x1a,0x10,0x0d,0x01,0xff,0xce,0x97,0xcc,0x93,0xcc,0x81,
+	0xcd,0x85,0x00,0x01,0xff,0xce,0x97,0xcc,0x94,0xcc,0x81,0xcd,0x85,0x00,0x10,0x0d,
+	0x01,0xff,0xce,0x97,0xcc,0x93,0xcd,0x82,0xcd,0x85,0x00,0x01,0xff,0xce,0x97,0xcc,
+	0x94,0xcd,0x82,0xcd,0x85,0x00,0xd4,0xc8,0xd3,0x64,0xd2,0x30,0xd1,0x16,0x10,0x0b,
+	0x01,0xff,0xcf,0x89,0xcc,0x93,0xcd,0x85,0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0xcd,
+	0x85,0x00,0x10,0x0d,0x01,0xff,0xcf,0x89,0xcc,0x93,0xcc,0x80,0xcd,0x85,0x00,0x01,
+	0xff,0xcf,0x89,0xcc,0x94,0xcc,0x80,0xcd,0x85,0x00,0xd1,0x1a,0x10,0x0d,0x01,0xff,
+	0xcf,0x89,0xcc,0x93,0xcc,0x81,0xcd,0x85,0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0xcc,
+	0x81,0xcd,0x85,0x00,0x10,0x0d,0x01,0xff,0xcf,0x89,0xcc,0x93,0xcd,0x82,0xcd,0x85,
+	0x00,0x01,0xff,0xcf,0x89,0xcc,0x94,0xcd,0x82,0xcd,0x85,0x00,0xd2,0x30,0xd1,0x16,
+	0x10,0x0b,0x01,0xff,0xce,0xa9,0xcc,0x93,0xcd,0x85,0x00,0x01,0xff,0xce,0xa9,0xcc,
+	0x94,0xcd,0x85,0x00,0x10,0x0d,0x01,0xff,0xce,0xa9,0xcc,0x93,0xcc,0x80,0xcd,0x85,
+	0x00,0x01,0xff,0xce,0xa9,0xcc,0x94,0xcc,0x80,0xcd,0x85,0x00,0xd1,0x1a,0x10,0x0d,
+	0x01,0xff,0xce,0xa9,0xcc,0x93,0xcc,0x81,0xcd,0x85,0x00,0x01,0xff,0xce,0xa9,0xcc,
+	0x94,0xcc,0x81,0xcd,0x85,0x00,0x10,0x0d,0x01,0xff,0xce,0xa9,0xcc,0x93,0xcd,0x82,
+	0xcd,0x85,0x00,0x01,0xff,0xce,0xa9,0xcc,0x94,0xcd,0x82,0xcd,0x85,0x00,0xd3,0x49,
+	0xd2,0x26,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0xb1,0xcc,0x86,0x00,0x01,0xff,0xce,
+	0xb1,0xcc,0x84,0x00,0x10,0x0b,0x01,0xff,0xce,0xb1,0xcc,0x80,0xcd,0x85,0x00,0x01,
+	0xff,0xce,0xb1,0xcd,0x85,0x00,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xce,0xb1,0xcc,0x81,
+	0xcd,0x85,0x00,0x00,0x00,0x10,0x09,0x01,0xff,0xce,0xb1,0xcd,0x82,0x00,0x01,0xff,
+	0xce,0xb1,0xcd,0x82,0xcd,0x85,0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,
+	0x91,0xcc,0x86,0x00,0x01,0xff,0xce,0x91,0xcc,0x84,0x00,0x10,0x09,0x01,0xff,0xce,
+	0x91,0xcc,0x80,0x00,0x01,0xff,0xce,0x91,0xcc,0x81,0x00,0xd1,0x0d,0x10,0x09,0x01,
+	0xff,0xce,0x91,0xcd,0x85,0x00,0x01,0x00,0x10,0x07,0x01,0xff,0xce,0xb9,0x00,0x01,
+	0x00,0xcf,0x86,0xe5,0x16,0x01,0xd4,0x8f,0xd3,0x44,0xd2,0x21,0xd1,0x0d,0x10,0x04,
+	0x01,0x00,0x01,0xff,0xc2,0xa8,0xcd,0x82,0x00,0x10,0x0b,0x01,0xff,0xce,0xb7,0xcc,
+	0x80,0xcd,0x85,0x00,0x01,0xff,0xce,0xb7,0xcd,0x85,0x00,0xd1,0x0f,0x10,0x0b,0x01,
+	0xff,0xce,0xb7,0xcc,0x81,0xcd,0x85,0x00,0x00,0x00,0x10,0x09,0x01,0xff,0xce,0xb7,
+	0xcd,0x82,0x00,0x01,0xff,0xce,0xb7,0xcd,0x82,0xcd,0x85,0x00,0xd2,0x24,0xd1,0x12,
+	0x10,0x09,0x01,0xff,0xce,0x95,0xcc,0x80,0x00,0x01,0xff,0xce,0x95,0xcc,0x81,0x00,
+	0x10,0x09,0x01,0xff,0xce,0x97,0xcc,0x80,0x00,0x01,0xff,0xce,0x97,0xcc,0x81,0x00,
+	0xd1,0x13,0x10,0x09,0x01,0xff,0xce,0x97,0xcd,0x85,0x00,0x01,0xff,0xe1,0xbe,0xbf,
+	0xcc,0x80,0x00,0x10,0x0a,0x01,0xff,0xe1,0xbe,0xbf,0xcc,0x81,0x00,0x01,0xff,0xe1,
+	0xbe,0xbf,0xcd,0x82,0x00,0xd3,0x40,0xd2,0x28,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,
+	0xb9,0xcc,0x86,0x00,0x01,0xff,0xce,0xb9,0xcc,0x84,0x00,0x10,0x0b,0x01,0xff,0xce,
+	0xb9,0xcc,0x88,0xcc,0x80,0x00,0x01,0xff,0xce,0xb9,0xcc,0x88,0xcc,0x81,0x00,0x51,
+	0x04,0x00,0x00,0x10,0x09,0x01,0xff,0xce,0xb9,0xcd,0x82,0x00,0x01,0xff,0xce,0xb9,
+	0xcc,0x88,0xcd,0x82,0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,0x99,0xcc,
+	0x86,0x00,0x01,0xff,0xce,0x99,0xcc,0x84,0x00,0x10,0x09,0x01,0xff,0xce,0x99,0xcc,
+	0x80,0x00,0x01,0xff,0xce,0x99,0xcc,0x81,0x00,0xd1,0x0e,0x10,0x04,0x00,0x00,0x01,
+	0xff,0xe1,0xbf,0xbe,0xcc,0x80,0x00,0x10,0x0a,0x01,0xff,0xe1,0xbf,0xbe,0xcc,0x81,
+	0x00,0x01,0xff,0xe1,0xbf,0xbe,0xcd,0x82,0x00,0xd4,0x93,0xd3,0x4e,0xd2,0x28,0xd1,
+	0x12,0x10,0x09,0x01,0xff,0xcf,0x85,0xcc,0x86,0x00,0x01,0xff,0xcf,0x85,0xcc,0x84,
+	0x00,0x10,0x0b,0x01,0xff,0xcf,0x85,0xcc,0x88,0xcc,0x80,0x00,0x01,0xff,0xcf,0x85,
+	0xcc,0x88,0xcc,0x81,0x00,0xd1,0x12,0x10,0x09,0x01,0xff,0xcf,0x81,0xcc,0x93,0x00,
+	0x01,0xff,0xcf,0x81,0xcc,0x94,0x00,0x10,0x09,0x01,0xff,0xcf,0x85,0xcd,0x82,0x00,
+	0x01,0xff,0xcf,0x85,0xcc,0x88,0xcd,0x82,0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,
+	0xff,0xce,0xa5,0xcc,0x86,0x00,0x01,0xff,0xce,0xa5,0xcc,0x84,0x00,0x10,0x09,0x01,
+	0xff,0xce,0xa5,0xcc,0x80,0x00,0x01,0xff,0xce,0xa5,0xcc,0x81,0x00,0xd1,0x12,0x10,
+	0x09,0x01,0xff,0xce,0xa1,0xcc,0x94,0x00,0x01,0xff,0xc2,0xa8,0xcc,0x80,0x00,0x10,
+	0x09,0x01,0xff,0xc2,0xa8,0xcc,0x81,0x00,0x01,0xff,0x60,0x00,0xd3,0x3b,0xd2,0x18,
+	0x51,0x04,0x00,0x00,0x10,0x0b,0x01,0xff,0xcf,0x89,0xcc,0x80,0xcd,0x85,0x00,0x01,
+	0xff,0xcf,0x89,0xcd,0x85,0x00,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xcf,0x89,0xcc,0x81,
+	0xcd,0x85,0x00,0x00,0x00,0x10,0x09,0x01,0xff,0xcf,0x89,0xcd,0x82,0x00,0x01,0xff,
+	0xcf,0x89,0xcd,0x82,0xcd,0x85,0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,0xff,0xce,
+	0x9f,0xcc,0x80,0x00,0x01,0xff,0xce,0x9f,0xcc,0x81,0x00,0x10,0x09,0x01,0xff,0xce,
+	0xa9,0xcc,0x80,0x00,0x01,0xff,0xce,0xa9,0xcc,0x81,0x00,0xd1,0x10,0x10,0x09,0x01,
+	0xff,0xce,0xa9,0xcd,0x85,0x00,0x01,0xff,0xc2,0xb4,0x00,0x10,0x04,0x01,0x00,0x00,
+	0x00,0xe0,0x7e,0x0c,0xcf,0x86,0xe5,0xbb,0x08,0xe4,0x14,0x06,0xe3,0xf7,0x02,0xe2,
+	0xbd,0x01,0xd1,0xd0,0xd0,0x4f,0xcf,0x86,0xd5,0x2e,0x94,0x2a,0xd3,0x18,0x92,0x14,
+	0x91,0x10,0x10,0x08,0x01,0xff,0xe2,0x80,0x82,0x00,0x01,0xff,0xe2,0x80,0x83,0x00,
+	0x01,0x00,0x01,0x00,0x92,0x0d,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x01,0xff,
+	0x00,0x01,0xff,0x00,0x01,0x00,0x94,0x1b,0x53,0x04,0x01,0x00,0xd2,0x09,0x11,0x04,
+	0x01,0x00,0x01,0xff,0x00,0x51,0x05,0x01,0xff,0x00,0x10,0x05,0x01,0xff,0x00,0x04,
+	0x00,0x01,0x00,0xcf,0x86,0xd5,0x48,0xd4,0x1c,0xd3,0x10,0x52,0x04,0x01,0x00,0x51,
+	0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x06,0x00,0x52,0x04,0x04,0x00,0x11,0x04,0x04,
+	0x00,0x06,0x00,0xd3,0x1c,0xd2,0x0c,0x51,0x04,0x06,0x00,0x10,0x04,0x06,0x00,0x07,
+	0x00,0xd1,0x08,0x10,0x04,0x07,0x00,0x08,0x00,0x10,0x04,0x08,0x00,0x06,0x00,0x52,
+	0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x06,0x00,0xd4,0x23,0xd3,
+	0x14,0x52,0x05,0x06,0xff,0x00,0x91,0x0a,0x10,0x05,0x0a,0xff,0x00,0x00,0xff,0x00,
+	0x0f,0xff,0x00,0x92,0x0a,0x11,0x05,0x0f,0xff,0x00,0x01,0xff,0x00,0x01,0xff,0x00,
+	0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x01,0x00,0x06,0x00,0x00,0x00,0x01,0x00,
+	0x01,0x00,0xd0,0x7e,0xcf,0x86,0xd5,0x34,0xd4,0x14,0x53,0x04,0x01,0x00,0x52,0x04,
+	0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x00,0x00,0xd3,0x10,0x52,0x04,
+	0x08,0x00,0x91,0x08,0x10,0x04,0x08,0x00,0x0c,0x00,0x0c,0x00,0x52,0x04,0x0c,0x00,
+	0x91,0x08,0x10,0x04,0x0c,0x00,0x00,0x00,0x00,0x00,0xd4,0x1c,0x53,0x04,0x01,0x00,
+	0xd2,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x02,0x00,0x91,0x08,0x10,0x04,
+	0x03,0x00,0x04,0x00,0x04,0x00,0xd3,0x10,0xd2,0x08,0x11,0x04,0x06,0x00,0x08,0x00,
+	0x11,0x04,0x08,0x00,0x0b,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,0x0b,0x00,0x0c,0x00,
+	0x10,0x04,0x0e,0x00,0x10,0x00,0x51,0x04,0x10,0x00,0x10,0x04,0x11,0x00,0x13,0x00,
+	0xcf,0x86,0xd5,0x28,0x54,0x04,0x00,0x00,0xd3,0x0c,0x92,0x08,0x11,0x04,0x01,0xe6,
+	0x01,0x01,0x01,0xe6,0xd2,0x0c,0x51,0x04,0x01,0x01,0x10,0x04,0x01,0x01,0x01,0xe6,
+	0x91,0x08,0x10,0x04,0x01,0xe6,0x01,0x00,0x01,0x00,0xd4,0x30,0xd3,0x1c,0xd2,0x0c,
+	0x91,0x08,0x10,0x04,0x01,0x00,0x01,0xe6,0x04,0x00,0xd1,0x08,0x10,0x04,0x06,0x00,
+	0x06,0x01,0x10,0x04,0x06,0x01,0x06,0xe6,0x92,0x10,0xd1,0x08,0x10,0x04,0x06,0xdc,
+	0x06,0xe6,0x10,0x04,0x06,0x01,0x08,0x01,0x09,0xdc,0x93,0x10,0x92,0x0c,0x91,0x08,
+	0x10,0x04,0x0a,0xe6,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xd1,0x81,0xd0,0x4f,
+	0xcf,0x86,0x55,0x04,0x01,0x00,0xd4,0x29,0xd3,0x13,0x52,0x04,0x01,0x00,0x51,0x04,
+	0x01,0x00,0x10,0x07,0x01,0xff,0xce,0xa9,0x00,0x01,0x00,0x92,0x12,0x51,0x04,0x01,
+	0x00,0x10,0x06,0x01,0xff,0x4b,0x00,0x01,0xff,0x41,0xcc,0x8a,0x00,0x01,0x00,0x53,
+	0x04,0x01,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,0x01,0x00,0x04,0x00,0x10,0x04,0x04,
+	0x00,0x07,0x00,0x91,0x08,0x10,0x04,0x08,0x00,0x06,0x00,0x06,0x00,0xcf,0x86,0x95,
+	0x2c,0xd4,0x18,0x53,0x04,0x06,0x00,0x52,0x04,0x06,0x00,0xd1,0x08,0x10,0x04,0x08,
+	0x00,0x09,0x00,0x10,0x04,0x09,0x00,0x0a,0x00,0x93,0x10,0x92,0x0c,0x51,0x04,0x0b,
+	0x00,0x10,0x04,0x0b,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd0,0x68,0xcf,
+	0x86,0xd5,0x48,0xd4,0x28,0xd3,0x18,0xd2,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x01,
+	0x00,0x04,0x00,0x91,0x08,0x10,0x04,0x09,0x00,0x0a,0x00,0x0a,0x00,0x92,0x0c,0x91,
+	0x08,0x10,0x04,0x0a,0x00,0x0b,0x00,0x11,0x00,0x00,0x00,0x53,0x04,0x01,0x00,0x92,
+	0x18,0x51,0x04,0x01,0x00,0x10,0x0a,0x01,0xff,0xe2,0x86,0x90,0xcc,0xb8,0x00,0x01,
+	0xff,0xe2,0x86,0x92,0xcc,0xb8,0x00,0x01,0x00,0x94,0x1a,0x53,0x04,0x01,0x00,0x52,
+	0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x0a,0x01,0xff,0xe2,0x86,0x94,0xcc,0xb8,
+	0x00,0x01,0x00,0x01,0x00,0xcf,0x86,0xd5,0x2e,0x94,0x2a,0x53,0x04,0x01,0x00,0x52,
+	0x04,0x01,0x00,0xd1,0x0e,0x10,0x04,0x01,0x00,0x01,0xff,0xe2,0x87,0x90,0xcc,0xb8,
+	0x00,0x10,0x0a,0x01,0xff,0xe2,0x87,0x94,0xcc,0xb8,0x00,0x01,0xff,0xe2,0x87,0x92,
+	0xcc,0xb8,0x00,0x01,0x00,0xd4,0x14,0x53,0x04,0x01,0x00,0x92,0x0c,0x51,0x04,0x01,
+	0x00,0x10,0x04,0x01,0x00,0x04,0x00,0x04,0x00,0x93,0x08,0x12,0x04,0x04,0x00,0x06,
+	0x00,0x06,0x00,0xe2,0x38,0x02,0xe1,0x3f,0x01,0xd0,0x68,0xcf,0x86,0xd5,0x3e,0x94,
+	0x3a,0xd3,0x16,0x52,0x04,0x01,0x00,0x91,0x0e,0x10,0x0a,0x01,0xff,0xe2,0x88,0x83,
+	0xcc,0xb8,0x00,0x01,0x00,0x01,0x00,0xd2,0x12,0x91,0x0e,0x10,0x04,0x01,0x00,0x01,
+	0xff,0xe2,0x88,0x88,0xcc,0xb8,0x00,0x01,0x00,0x91,0x0e,0x10,0x0a,0x01,0xff,0xe2,
+	0x88,0x8b,0xcc,0xb8,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x94,0x24,0x93,0x20,0x52,
+	0x04,0x01,0x00,0xd1,0x0e,0x10,0x0a,0x01,0xff,0xe2,0x88,0xa3,0xcc,0xb8,0x00,0x01,
+	0x00,0x10,0x0a,0x01,0xff,0xe2,0x88,0xa5,0xcc,0xb8,0x00,0x01,0x00,0x01,0x00,0x01,
+	0x00,0xcf,0x86,0xd5,0x48,0x94,0x44,0xd3,0x2e,0xd2,0x12,0x91,0x0e,0x10,0x04,0x01,
+	0x00,0x01,0xff,0xe2,0x88,0xbc,0xcc,0xb8,0x00,0x01,0x00,0xd1,0x0e,0x10,0x0a,0x01,
+	0xff,0xe2,0x89,0x83,0xcc,0xb8,0x00,0x01,0x00,0x10,0x04,0x01,0x00,0x01,0xff,0xe2,
+	0x89,0x85,0xcc,0xb8,0x00,0x92,0x12,0x91,0x0e,0x10,0x04,0x01,0x00,0x01,0xff,0xe2,
+	0x89,0x88,0xcc,0xb8,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd4,0x40,0xd3,0x1e,0x92,
+	0x1a,0xd1,0x0c,0x10,0x08,0x01,0xff,0x3d,0xcc,0xb8,0x00,0x01,0x00,0x10,0x0a,0x01,
+	0xff,0xe2,0x89,0xa1,0xcc,0xb8,0x00,0x01,0x00,0x01,0x00,0x52,0x04,0x01,0x00,0xd1,
+	0x0e,0x10,0x04,0x01,0x00,0x01,0xff,0xe2,0x89,0x8d,0xcc,0xb8,0x00,0x10,0x08,0x01,
+	0xff,0x3c,0xcc,0xb8,0x00,0x01,0xff,0x3e,0xcc,0xb8,0x00,0xd3,0x30,0xd2,0x18,0x91,
+	0x14,0x10,0x0a,0x01,0xff,0xe2,0x89,0xa4,0xcc,0xb8,0x00,0x01,0xff,0xe2,0x89,0xa5,
+	0xcc,0xb8,0x00,0x01,0x00,0x91,0x14,0x10,0x0a,0x01,0xff,0xe2,0x89,0xb2,0xcc,0xb8,
+	0x00,0x01,0xff,0xe2,0x89,0xb3,0xcc,0xb8,0x00,0x01,0x00,0x92,0x18,0x91,0x14,0x10,
+	0x0a,0x01,0xff,0xe2,0x89,0xb6,0xcc,0xb8,0x00,0x01,0xff,0xe2,0x89,0xb7,0xcc,0xb8,
+	0x00,0x01,0x00,0x01,0x00,0xd0,0x86,0xcf,0x86,0xd5,0x50,0x94,0x4c,0xd3,0x30,0xd2,
+	0x18,0x91,0x14,0x10,0x0a,0x01,0xff,0xe2,0x89,0xba,0xcc,0xb8,0x00,0x01,0xff,0xe2,
+	0x89,0xbb,0xcc,0xb8,0x00,0x01,0x00,0x91,0x14,0x10,0x0a,0x01,0xff,0xe2,0x8a,0x82,
+	0xcc,0xb8,0x00,0x01,0xff,0xe2,0x8a,0x83,0xcc,0xb8,0x00,0x01,0x00,0x92,0x18,0x91,
+	0x14,0x10,0x0a,0x01,0xff,0xe2,0x8a,0x86,0xcc,0xb8,0x00,0x01,0xff,0xe2,0x8a,0x87,
+	0xcc,0xb8,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x94,0x30,0x53,0x04,0x01,0x00,0x52,
+	0x04,0x01,0x00,0xd1,0x14,0x10,0x0a,0x01,0xff,0xe2,0x8a,0xa2,0xcc,0xb8,0x00,0x01,
+	0xff,0xe2,0x8a,0xa8,0xcc,0xb8,0x00,0x10,0x0a,0x01,0xff,0xe2,0x8a,0xa9,0xcc,0xb8,
+	0x00,0x01,0xff,0xe2,0x8a,0xab,0xcc,0xb8,0x00,0x01,0x00,0xcf,0x86,0x55,0x04,0x01,
+	0x00,0xd4,0x5c,0xd3,0x2c,0x92,0x28,0xd1,0x14,0x10,0x0a,0x01,0xff,0xe2,0x89,0xbc,
+	0xcc,0xb8,0x00,0x01,0xff,0xe2,0x89,0xbd,0xcc,0xb8,0x00,0x10,0x0a,0x01,0xff,0xe2,
+	0x8a,0x91,0xcc,0xb8,0x00,0x01,0xff,0xe2,0x8a,0x92,0xcc,0xb8,0x00,0x01,0x00,0xd2,
+	0x18,0x51,0x04,0x01,0x00,0x10,0x0a,0x01,0xff,0xe2,0x8a,0xb2,0xcc,0xb8,0x00,0x01,
+	0xff,0xe2,0x8a,0xb3,0xcc,0xb8,0x00,0x91,0x14,0x10,0x0a,0x01,0xff,0xe2,0x8a,0xb4,
+	0xcc,0xb8,0x00,0x01,0xff,0xe2,0x8a,0xb5,0xcc,0xb8,0x00,0x01,0x00,0x93,0x0c,0x92,
+	0x08,0x11,0x04,0x01,0x00,0x06,0x00,0x06,0x00,0x06,0x00,0xd1,0x64,0xd0,0x3e,0xcf,
+	0x86,0xd5,0x18,0x94,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x01,0x00,0x04,
+	0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x94,0x20,0x53,0x04,0x01,0x00,0x92,
+	0x18,0xd1,0x0c,0x10,0x04,0x01,0x00,0x01,0xff,0xe3,0x80,0x88,0x00,0x10,0x08,0x01,
+	0xff,0xe3,0x80,0x89,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xcf,0x86,0x55,0x04,0x01,
+	0x00,0x54,0x04,0x01,0x00,0x53,0x04,0x01,0x00,0xd2,0x0c,0x51,0x04,0x01,0x00,0x10,
+	0x04,0x01,0x00,0x04,0x00,0x91,0x08,0x10,0x04,0x06,0x00,0x04,0x00,0x04,0x00,0xd0,
+	0x1e,0xcf,0x86,0x95,0x18,0x54,0x04,0x04,0x00,0x53,0x04,0x04,0x00,0x92,0x0c,0x51,
+	0x04,0x04,0x00,0x10,0x04,0x04,0x00,0x06,0x00,0x06,0x00,0x06,0x00,0xcf,0x86,0xd5,
+	0x2c,0xd4,0x14,0x53,0x04,0x06,0x00,0x52,0x04,0x06,0x00,0x51,0x04,0x06,0x00,0x10,
+	0x04,0x06,0x00,0x07,0x00,0xd3,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x07,0x00,0x08,
+	0x00,0x08,0x00,0x08,0x00,0x12,0x04,0x08,0x00,0x09,0x00,0xd4,0x14,0x53,0x04,0x09,
+	0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x0b,0x00,0x0c,0x00,0x0c,0x00,0x0c,0x00,0xd3,
+	0x08,0x12,0x04,0x0c,0x00,0x10,0x00,0xd2,0x0c,0x51,0x04,0x10,0x00,0x10,0x04,0x10,
+	0x00,0x12,0x00,0x51,0x04,0x12,0x00,0x10,0x04,0x12,0x00,0x13,0x00,0xd3,0xa6,0xd2,
+	0x74,0xd1,0x40,0xd0,0x22,0xcf,0x86,0x55,0x04,0x01,0x00,0x94,0x18,0x93,0x14,0x52,
+	0x04,0x01,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x04,0x00,0x10,0x04,0x04,0x00,0x00,
+	0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0x95,0x18,0x94,0x14,0x53,0x04,0x01,0x00,0x92,
+	0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x01,
+	0x00,0xd0,0x06,0xcf,0x06,0x01,0x00,0xcf,0x86,0x55,0x04,0x01,0x00,0xd4,0x14,0x53,
+	0x04,0x01,0x00,0x92,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x06,0x00,0x06,
+	0x00,0x53,0x04,0x06,0x00,0x52,0x04,0x06,0x00,0x51,0x04,0x06,0x00,0x10,0x04,0x06,
+	0x00,0x07,0x00,0xd1,0x06,0xcf,0x06,0x01,0x00,0xd0,0x1a,0xcf,0x86,0x95,0x14,0x54,
+	0x04,0x01,0x00,0x93,0x0c,0x52,0x04,0x01,0x00,0x11,0x04,0x01,0x00,0x06,0x00,0x06,
+	0x00,0x01,0x00,0xcf,0x86,0x55,0x04,0x01,0x00,0x54,0x04,0x01,0x00,0x13,0x04,0x04,
+	0x00,0x06,0x00,0xd2,0xdc,0xd1,0x48,0xd0,0x26,0xcf,0x86,0x95,0x20,0x54,0x04,0x01,
+	0x00,0xd3,0x0c,0x52,0x04,0x01,0x00,0x11,0x04,0x07,0x00,0x06,0x00,0x92,0x0c,0x91,
+	0x08,0x10,0x04,0x08,0x00,0x04,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xcf,0x86,0x55,
+	0x04,0x01,0x00,0x54,0x04,0x01,0x00,0xd3,0x0c,0x92,0x08,0x11,0x04,0x04,0x00,0x06,
+	0x00,0x06,0x00,0x52,0x04,0x06,0x00,0x11,0x04,0x06,0x00,0x08,0x00,0xd0,0x5e,0xcf,
+	0x86,0xd5,0x2c,0xd4,0x10,0x53,0x04,0x06,0x00,0x92,0x08,0x11,0x04,0x06,0x00,0x07,
+	0x00,0x07,0x00,0xd3,0x0c,0x92,0x08,0x11,0x04,0x07,0x00,0x08,0x00,0x08,0x00,0x52,
+	0x04,0x08,0x00,0x91,0x08,0x10,0x04,0x08,0x00,0x0a,0x00,0x0b,0x00,0xd4,0x10,0x93,
+	0x0c,0x92,0x08,0x11,0x04,0x07,0x00,0x08,0x00,0x08,0x00,0x08,0x00,0xd3,0x10,0x92,
+	0x0c,0x51,0x04,0x08,0x00,0x10,0x04,0x09,0x00,0x0a,0x00,0x0a,0x00,0x52,0x04,0x0a,
+	0x00,0x91,0x08,0x10,0x04,0x0a,0x00,0x0b,0x00,0x0b,0x00,0xcf,0x86,0xd5,0x1c,0x94,
+	0x18,0xd3,0x08,0x12,0x04,0x0a,0x00,0x0b,0x00,0x52,0x04,0x0b,0x00,0x51,0x04,0x0b,
+	0x00,0x10,0x04,0x0c,0x00,0x0b,0x00,0x0b,0x00,0x94,0x14,0x93,0x10,0x92,0x0c,0x51,
+	0x04,0x0b,0x00,0x10,0x04,0x0c,0x00,0x0b,0x00,0x0c,0x00,0x0b,0x00,0x0b,0x00,0xd1,
+	0xa8,0xd0,0x42,0xcf,0x86,0xd5,0x28,0x94,0x24,0xd3,0x18,0xd2,0x0c,0x91,0x08,0x10,
+	0x04,0x10,0x00,0x01,0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x01,0x00,0x0c,0x00,0x01,
+	0x00,0x92,0x08,0x11,0x04,0x01,0x00,0x0c,0x00,0x01,0x00,0x01,0x00,0x94,0x14,0x53,
+	0x04,0x01,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x0c,0x00,0x01,0x00,0x01,0x00,0x01,
+	0x00,0x01,0x00,0xcf,0x86,0xd5,0x40,0xd4,0x18,0x53,0x04,0x01,0x00,0x52,0x04,0x01,
+	0x00,0xd1,0x08,0x10,0x04,0x0c,0x00,0x01,0x00,0x10,0x04,0x0c,0x00,0x01,0x00,0xd3,
+	0x18,0xd2,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x0c,0x00,0x51,0x04,0x0c,
+	0x00,0x10,0x04,0x01,0x00,0x0b,0x00,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,
+	0x04,0x01,0x00,0x0c,0x00,0xd4,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x0c,
+	0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x06,0x00,0x93,0x0c,0x52,0x04,0x06,0x00,0x11,
+	0x04,0x06,0x00,0x01,0x00,0x01,0x00,0xd0,0x3e,0xcf,0x86,0xd5,0x18,0x54,0x04,0x01,
+	0x00,0x93,0x10,0x52,0x04,0x01,0x00,0x91,0x08,0x10,0x04,0x01,0x00,0x0c,0x00,0x0c,
+	0x00,0x01,0x00,0x54,0x04,0x01,0x00,0xd3,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x0c,
+	0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,
+	0x04,0x01,0x00,0x0c,0x00,0xcf,0x86,0xd5,0x2c,0x94,0x28,0xd3,0x10,0x52,0x04,0x08,
+	0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x09,0x00,0xd2,0x0c,0x51,0x04,0x09,
+	0x00,0x10,0x04,0x09,0x00,0x0d,0x00,0x91,0x08,0x10,0x04,0x0a,0x00,0x0d,0x00,0x0c,
+	0x00,0x06,0x00,0x94,0x0c,0x53,0x04,0x06,0x00,0x12,0x04,0x06,0x00,0x0a,0x00,0x06,
+	0x00,0xe4,0x39,0x01,0xd3,0x0c,0xd2,0x06,0xcf,0x06,0x04,0x00,0xcf,0x06,0x06,0x00,
+	0xd2,0x30,0xd1,0x06,0xcf,0x06,0x06,0x00,0xd0,0x06,0xcf,0x06,0x06,0x00,0xcf,0x86,
+	0x95,0x1e,0x54,0x04,0x06,0x00,0x53,0x04,0x06,0x00,0x52,0x04,0x06,0x00,0x91,0x0e,
+	0x10,0x0a,0x06,0xff,0xe2,0xab,0x9d,0xcc,0xb8,0x00,0x06,0x00,0x06,0x00,0x06,0x00,
+	0xd1,0x80,0xd0,0x3a,0xcf,0x86,0xd5,0x28,0xd4,0x10,0x53,0x04,0x07,0x00,0x52,0x04,
+	0x07,0x00,0x11,0x04,0x07,0x00,0x08,0x00,0xd3,0x08,0x12,0x04,0x08,0x00,0x09,0x00,
+	0x92,0x0c,0x51,0x04,0x09,0x00,0x10,0x04,0x09,0x00,0x0a,0x00,0x0a,0x00,0x94,0x0c,
+	0x93,0x08,0x12,0x04,0x09,0x00,0x0a,0x00,0x0a,0x00,0x0a,0x00,0xcf,0x86,0xd5,0x30,
+	0xd4,0x14,0x53,0x04,0x0a,0x00,0x52,0x04,0x0a,0x00,0x91,0x08,0x10,0x04,0x0a,0x00,
+	0x10,0x00,0x10,0x00,0xd3,0x10,0x52,0x04,0x0a,0x00,0x91,0x08,0x10,0x04,0x0a,0x00,
+	0x0b,0x00,0x0b,0x00,0x92,0x08,0x11,0x04,0x0b,0x00,0x10,0x00,0x10,0x00,0x54,0x04,
+	0x10,0x00,0x93,0x0c,0x52,0x04,0x10,0x00,0x11,0x04,0x00,0x00,0x10,0x00,0x10,0x00,
+	0xd0,0x32,0xcf,0x86,0xd5,0x14,0x54,0x04,0x10,0x00,0x93,0x0c,0x52,0x04,0x10,0x00,
+	0x11,0x04,0x10,0x00,0x00,0x00,0x10,0x00,0x54,0x04,0x10,0x00,0x53,0x04,0x10,0x00,
+	0xd2,0x08,0x11,0x04,0x10,0x00,0x14,0x00,0x91,0x08,0x10,0x04,0x14,0x00,0x10,0x00,
+	0x10,0x00,0xcf,0x86,0xd5,0x28,0xd4,0x14,0x53,0x04,0x10,0x00,0x92,0x0c,0x91,0x08,
+	0x10,0x04,0x10,0x00,0x15,0x00,0x10,0x00,0x10,0x00,0x93,0x10,0x92,0x0c,0x51,0x04,
+	0x10,0x00,0x10,0x04,0x13,0x00,0x14,0x00,0x14,0x00,0x14,0x00,0xd4,0x0c,0x53,0x04,
+	0x14,0x00,0x12,0x04,0x14,0x00,0x11,0x00,0x53,0x04,0x14,0x00,0x52,0x04,0x14,0x00,
+	0x51,0x04,0x14,0x00,0x10,0x04,0x14,0x00,0x15,0x00,0xe3,0xb9,0x01,0xd2,0xac,0xd1,
+	0x68,0xd0,0x1e,0xcf,0x86,0x55,0x04,0x08,0x00,0x94,0x14,0x53,0x04,0x08,0x00,0x52,
+	0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x00,0x00,0x08,0x00,0xcf,
+	0x86,0xd5,0x18,0x54,0x04,0x08,0x00,0x53,0x04,0x08,0x00,0x52,0x04,0x08,0x00,0x51,
+	0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x00,0x00,0xd4,0x14,0x53,0x04,0x09,0x00,0x52,
+	0x04,0x09,0x00,0x91,0x08,0x10,0x04,0x09,0x00,0x0a,0x00,0x0a,0x00,0xd3,0x10,0x92,
+	0x0c,0x91,0x08,0x10,0x04,0x0b,0x00,0x0a,0x00,0x0a,0x00,0x09,0x00,0x52,0x04,0x0a,
+	0x00,0x11,0x04,0x0a,0x00,0x0b,0x00,0xd0,0x06,0xcf,0x06,0x08,0x00,0xcf,0x86,0x55,
+	0x04,0x08,0x00,0xd4,0x1c,0x53,0x04,0x08,0x00,0xd2,0x0c,0x51,0x04,0x08,0x00,0x10,
+	0x04,0x08,0x00,0x0b,0x00,0x51,0x04,0x0b,0x00,0x10,0x04,0x0b,0x00,0x0b,0xe6,0xd3,
+	0x0c,0x92,0x08,0x11,0x04,0x0b,0xe6,0x0d,0x00,0x00,0x00,0x92,0x0c,0x91,0x08,0x10,
+	0x04,0x00,0x00,0x08,0x00,0x08,0x00,0x08,0x00,0xd1,0x6c,0xd0,0x2a,0xcf,0x86,0x55,
+	0x04,0x08,0x00,0x94,0x20,0xd3,0x10,0x52,0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,
+	0x04,0x00,0x00,0x0d,0x00,0x52,0x04,0x00,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x0d,
+	0x00,0x00,0x00,0x08,0x00,0xcf,0x86,0x55,0x04,0x08,0x00,0xd4,0x1c,0xd3,0x0c,0x52,
+	0x04,0x08,0x00,0x11,0x04,0x08,0x00,0x0d,0x00,0x52,0x04,0x00,0x00,0x51,0x04,0x00,
+	0x00,0x10,0x04,0x00,0x00,0x08,0x00,0xd3,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x0c,
+	0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x52,0x04,0x00,0x00,0x51,0x04,0x00,0x00,0x10,
+	0x04,0x00,0x00,0x0c,0x09,0xd0,0x5a,0xcf,0x86,0xd5,0x18,0x54,0x04,0x08,0x00,0x93,
+	0x10,0x52,0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x00,0x00,0x00,
+	0x00,0xd4,0x20,0xd3,0x10,0x52,0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08,
+	0x00,0x00,0x00,0x52,0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x00,
+	0x00,0xd3,0x10,0x52,0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x00,
+	0x00,0x52,0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x00,0x00,0xcf,
+	0x86,0x95,0x40,0xd4,0x20,0xd3,0x10,0x52,0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,
+	0x04,0x08,0x00,0x00,0x00,0x52,0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08,
+	0x00,0x00,0x00,0xd3,0x10,0x52,0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08,
+	0x00,0x00,0x00,0x52,0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x00,
+	0x00,0x0a,0xe6,0xd2,0x9c,0xd1,0x68,0xd0,0x32,0xcf,0x86,0xd5,0x14,0x54,0x04,0x08,
+	0x00,0x53,0x04,0x08,0x00,0x52,0x04,0x0a,0x00,0x11,0x04,0x08,0x00,0x0a,0x00,0x54,
+	0x04,0x0a,0x00,0xd3,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x0a,0x00,0x0b,0x00,0x0d,
+	0x00,0x0d,0x00,0x12,0x04,0x0d,0x00,0x10,0x00,0xcf,0x86,0x95,0x30,0x94,0x2c,0xd3,
+	0x18,0xd2,0x0c,0x51,0x04,0x10,0x00,0x10,0x04,0x10,0x00,0x12,0x00,0x91,0x08,0x10,
+	0x04,0x12,0x00,0x13,0x00,0x13,0x00,0xd2,0x08,0x11,0x04,0x13,0x00,0x14,0x00,0x51,
+	0x04,0x14,0x00,0x10,0x04,0x14,0x00,0x15,0x00,0x00,0x00,0x00,0x00,0xd0,0x1e,0xcf,
+	0x86,0x95,0x18,0x54,0x04,0x04,0x00,0x53,0x04,0x04,0x00,0x92,0x0c,0x51,0x04,0x04,
+	0x00,0x10,0x04,0x00,0x00,0x04,0x00,0x04,0x00,0x04,0x00,0xcf,0x86,0x55,0x04,0x04,
+	0x00,0x54,0x04,0x04,0x00,0x93,0x08,0x12,0x04,0x04,0x00,0x00,0x00,0x00,0x00,0xd1,
+	0x06,0xcf,0x06,0x04,0x00,0xd0,0x06,0xcf,0x06,0x04,0x00,0xcf,0x86,0xd5,0x14,0x54,
+	0x04,0x04,0x00,0x93,0x0c,0x52,0x04,0x04,0x00,0x11,0x04,0x04,0x00,0x00,0x00,0x00,
+	0x00,0x54,0x04,0x00,0x00,0x53,0x04,0x04,0x00,0x12,0x04,0x04,0x00,0x00,0x00,0xcf,
+	0x86,0xe5,0xa6,0x05,0xe4,0x9f,0x05,0xe3,0x96,0x04,0xe2,0xe4,0x03,0xe1,0xc0,0x01,
+	0xd0,0x3e,0xcf,0x86,0x55,0x04,0x01,0x00,0xd4,0x1c,0x53,0x04,0x01,0x00,0xd2,0x0c,
+	0x51,0x04,0x01,0x00,0x10,0x04,0x01,0xda,0x01,0xe4,0x91,0x08,0x10,0x04,0x01,0xe8,
+	0x01,0xde,0x01,0xe0,0x53,0x04,0x01,0x00,0xd2,0x0c,0x51,0x04,0x04,0x00,0x10,0x04,
+	0x04,0x00,0x06,0x00,0x51,0x04,0x06,0x00,0x10,0x04,0x04,0x00,0x01,0x00,0xcf,0x86,
+	0xd5,0xaa,0xd4,0x32,0xd3,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x01,0x00,
+	0x01,0x00,0x01,0x00,0x52,0x04,0x01,0x00,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe3,0x81,
+	0x8b,0xe3,0x82,0x99,0x00,0x01,0x00,0x10,0x0b,0x01,0xff,0xe3,0x81,0x8d,0xe3,0x82,
+	0x99,0x00,0x01,0x00,0xd3,0x3c,0xd2,0x1e,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe3,0x81,
+	0x8f,0xe3,0x82,0x99,0x00,0x01,0x00,0x10,0x0b,0x01,0xff,0xe3,0x81,0x91,0xe3,0x82,
+	0x99,0x00,0x01,0x00,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe3,0x81,0x93,0xe3,0x82,0x99,
+	0x00,0x01,0x00,0x10,0x0b,0x01,0xff,0xe3,0x81,0x95,0xe3,0x82,0x99,0x00,0x01,0x00,
+	0xd2,0x1e,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe3,0x81,0x97,0xe3,0x82,0x99,0x00,0x01,
+	0x00,0x10,0x0b,0x01,0xff,0xe3,0x81,0x99,0xe3,0x82,0x99,0x00,0x01,0x00,0xd1,0x0f,
+	0x10,0x0b,0x01,0xff,0xe3,0x81,0x9b,0xe3,0x82,0x99,0x00,0x01,0x00,0x10,0x0b,0x01,
+	0xff,0xe3,0x81,0x9d,0xe3,0x82,0x99,0x00,0x01,0x00,0xd4,0x53,0xd3,0x3c,0xd2,0x1e,
+	0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe3,0x81,0x9f,0xe3,0x82,0x99,0x00,0x01,0x00,0x10,
+	0x0b,0x01,0xff,0xe3,0x81,0xa1,0xe3,0x82,0x99,0x00,0x01,0x00,0xd1,0x0f,0x10,0x04,
+	0x01,0x00,0x01,0xff,0xe3,0x81,0xa4,0xe3,0x82,0x99,0x00,0x10,0x04,0x01,0x00,0x01,
+	0xff,0xe3,0x81,0xa6,0xe3,0x82,0x99,0x00,0x92,0x13,0x91,0x0f,0x10,0x04,0x01,0x00,
+	0x01,0xff,0xe3,0x81,0xa8,0xe3,0x82,0x99,0x00,0x01,0x00,0x01,0x00,0xd3,0x4a,0xd2,
+	0x25,0xd1,0x16,0x10,0x0b,0x01,0xff,0xe3,0x81,0xaf,0xe3,0x82,0x99,0x00,0x01,0xff,
+	0xe3,0x81,0xaf,0xe3,0x82,0x9a,0x00,0x10,0x04,0x01,0x00,0x01,0xff,0xe3,0x81,0xb2,
+	0xe3,0x82,0x99,0x00,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe3,0x81,0xb2,0xe3,0x82,0x9a,
+	0x00,0x01,0x00,0x10,0x0b,0x01,0xff,0xe3,0x81,0xb5,0xe3,0x82,0x99,0x00,0x01,0xff,
+	0xe3,0x81,0xb5,0xe3,0x82,0x9a,0x00,0xd2,0x1e,0xd1,0x0f,0x10,0x04,0x01,0x00,0x01,
+	0xff,0xe3,0x81,0xb8,0xe3,0x82,0x99,0x00,0x10,0x0b,0x01,0xff,0xe3,0x81,0xb8,0xe3,
+	0x82,0x9a,0x00,0x01,0x00,0x91,0x16,0x10,0x0b,0x01,0xff,0xe3,0x81,0xbb,0xe3,0x82,
+	0x99,0x00,0x01,0xff,0xe3,0x81,0xbb,0xe3,0x82,0x9a,0x00,0x01,0x00,0xd0,0xee,0xcf,
+	0x86,0xd5,0x42,0x54,0x04,0x01,0x00,0xd3,0x1b,0x52,0x04,0x01,0x00,0xd1,0x0f,0x10,
+	0x0b,0x01,0xff,0xe3,0x81,0x86,0xe3,0x82,0x99,0x00,0x06,0x00,0x10,0x04,0x06,0x00,
+	0x00,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,0x00,0x00,0x01,0x08,0x10,0x04,0x01,0x08,
+	0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x0b,0x01,0xff,0xe3,0x82,0x9d,0xe3,0x82,0x99,
+	0x00,0x06,0x00,0xd4,0x32,0xd3,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x06,0x00,0x01,
+	0x00,0x01,0x00,0x01,0x00,0x52,0x04,0x01,0x00,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe3,
+	0x82,0xab,0xe3,0x82,0x99,0x00,0x01,0x00,0x10,0x0b,0x01,0xff,0xe3,0x82,0xad,0xe3,
+	0x82,0x99,0x00,0x01,0x00,0xd3,0x3c,0xd2,0x1e,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe3,
+	0x82,0xaf,0xe3,0x82,0x99,0x00,0x01,0x00,0x10,0x0b,0x01,0xff,0xe3,0x82,0xb1,0xe3,
+	0x82,0x99,0x00,0x01,0x00,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe3,0x82,0xb3,0xe3,0x82,
+	0x99,0x00,0x01,0x00,0x10,0x0b,0x01,0xff,0xe3,0x82,0xb5,0xe3,0x82,0x99,0x00,0x01,
+	0x00,0xd2,0x1e,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe3,0x82,0xb7,0xe3,0x82,0x99,0x00,
+	0x01,0x00,0x10,0x0b,0x01,0xff,0xe3,0x82,0xb9,0xe3,0x82,0x99,0x00,0x01,0x00,0xd1,
+	0x0f,0x10,0x0b,0x01,0xff,0xe3,0x82,0xbb,0xe3,0x82,0x99,0x00,0x01,0x00,0x10,0x0b,
+	0x01,0xff,0xe3,0x82,0xbd,0xe3,0x82,0x99,0x00,0x01,0x00,0xcf,0x86,0xd5,0xd5,0xd4,
+	0x53,0xd3,0x3c,0xd2,0x1e,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe3,0x82,0xbf,0xe3,0x82,
+	0x99,0x00,0x01,0x00,0x10,0x0b,0x01,0xff,0xe3,0x83,0x81,0xe3,0x82,0x99,0x00,0x01,
+	0x00,0xd1,0x0f,0x10,0x04,0x01,0x00,0x01,0xff,0xe3,0x83,0x84,0xe3,0x82,0x99,0x00,
+	0x10,0x04,0x01,0x00,0x01,0xff,0xe3,0x83,0x86,0xe3,0x82,0x99,0x00,0x92,0x13,0x91,
+	0x0f,0x10,0x04,0x01,0x00,0x01,0xff,0xe3,0x83,0x88,0xe3,0x82,0x99,0x00,0x01,0x00,
+	0x01,0x00,0xd3,0x4a,0xd2,0x25,0xd1,0x16,0x10,0x0b,0x01,0xff,0xe3,0x83,0x8f,0xe3,
+	0x82,0x99,0x00,0x01,0xff,0xe3,0x83,0x8f,0xe3,0x82,0x9a,0x00,0x10,0x04,0x01,0x00,
+	0x01,0xff,0xe3,0x83,0x92,0xe3,0x82,0x99,0x00,0xd1,0x0f,0x10,0x0b,0x01,0xff,0xe3,
+	0x83,0x92,0xe3,0x82,0x9a,0x00,0x01,0x00,0x10,0x0b,0x01,0xff,0xe3,0x83,0x95,0xe3,
+	0x82,0x99,0x00,0x01,0xff,0xe3,0x83,0x95,0xe3,0x82,0x9a,0x00,0xd2,0x1e,0xd1,0x0f,
+	0x10,0x04,0x01,0x00,0x01,0xff,0xe3,0x83,0x98,0xe3,0x82,0x99,0x00,0x10,0x0b,0x01,
+	0xff,0xe3,0x83,0x98,0xe3,0x82,0x9a,0x00,0x01,0x00,0x91,0x16,0x10,0x0b,0x01,0xff,
+	0xe3,0x83,0x9b,0xe3,0x82,0x99,0x00,0x01,0xff,0xe3,0x83,0x9b,0xe3,0x82,0x9a,0x00,
+	0x01,0x00,0x54,0x04,0x01,0x00,0xd3,0x22,0x52,0x04,0x01,0x00,0xd1,0x0f,0x10,0x0b,
+	0x01,0xff,0xe3,0x82,0xa6,0xe3,0x82,0x99,0x00,0x01,0x00,0x10,0x04,0x01,0x00,0x01,
+	0xff,0xe3,0x83,0xaf,0xe3,0x82,0x99,0x00,0xd2,0x25,0xd1,0x16,0x10,0x0b,0x01,0xff,
+	0xe3,0x83,0xb0,0xe3,0x82,0x99,0x00,0x01,0xff,0xe3,0x83,0xb1,0xe3,0x82,0x99,0x00,
+	0x10,0x0b,0x01,0xff,0xe3,0x83,0xb2,0xe3,0x82,0x99,0x00,0x01,0x00,0x51,0x04,0x01,
+	0x00,0x10,0x0b,0x01,0xff,0xe3,0x83,0xbd,0xe3,0x82,0x99,0x00,0x06,0x00,0xd1,0x65,
+	0xd0,0x46,0xcf,0x86,0xd5,0x18,0x94,0x14,0x93,0x10,0x52,0x04,0x00,0x00,0x91,0x08,
+	0x10,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd4,0x18,0x53,0x04,
+	0x01,0x00,0x52,0x04,0x01,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x0a,0x00,0x10,0x04,
+	0x13,0x00,0x14,0x00,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x01,0x00,
+	0x01,0x00,0x01,0x00,0x01,0x00,0xcf,0x86,0x55,0x04,0x01,0x00,0x94,0x15,0x93,0x11,
+	0x52,0x04,0x01,0x00,0x91,0x09,0x10,0x05,0x01,0xff,0x00,0x01,0x00,0x01,0x00,0x01,
+	0x00,0x01,0x00,0xd0,0x32,0xcf,0x86,0xd5,0x18,0x94,0x14,0x53,0x04,0x01,0x00,0x52,
+	0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x54,
+	0x04,0x04,0x00,0x53,0x04,0x04,0x00,0x92,0x0c,0x51,0x04,0x0c,0x00,0x10,0x04,0x0c,
+	0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0xd5,0x08,0x14,0x04,0x08,0x00,0x0a,0x00,0x94,
+	0x0c,0x93,0x08,0x12,0x04,0x0a,0x00,0x00,0x00,0x00,0x00,0x06,0x00,0xd2,0xa4,0xd1,
+	0x5c,0xd0,0x22,0xcf,0x86,0x95,0x1c,0x54,0x04,0x01,0x00,0x53,0x04,0x01,0x00,0x52,
+	0x04,0x01,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x07,0x00,0x10,0x04,0x07,0x00,0x00,
+	0x00,0x01,0x00,0xcf,0x86,0xd5,0x20,0xd4,0x0c,0x93,0x08,0x12,0x04,0x01,0x00,0x0b,
+	0x00,0x0b,0x00,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x07,0x00,0x06,0x00,0x06,
+	0x00,0x06,0x00,0x06,0x00,0x54,0x04,0x01,0x00,0x53,0x04,0x01,0x00,0x52,0x04,0x01,
+	0x00,0x51,0x04,0x07,0x00,0x10,0x04,0x08,0x00,0x01,0x00,0xd0,0x1e,0xcf,0x86,0x55,
+	0x04,0x01,0x00,0x54,0x04,0x01,0x00,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x01,
+	0x00,0x06,0x00,0x06,0x00,0x06,0x00,0x06,0x00,0xcf,0x86,0xd5,0x10,0x94,0x0c,0x53,
+	0x04,0x01,0x00,0x12,0x04,0x01,0x00,0x07,0x00,0x01,0x00,0x54,0x04,0x01,0x00,0x53,
+	0x04,0x01,0x00,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x16,
+	0x00,0xd1,0x30,0xd0,0x06,0xcf,0x06,0x01,0x00,0xcf,0x86,0x55,0x04,0x01,0x00,0x54,
+	0x04,0x01,0x00,0xd3,0x10,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,
+	0x00,0x07,0x00,0x92,0x0c,0x51,0x04,0x07,0x00,0x10,0x04,0x07,0x00,0x01,0x00,0x01,
+	0x00,0xd0,0x06,0xcf,0x06,0x01,0x00,0xcf,0x86,0xd5,0x14,0x54,0x04,0x01,0x00,0x53,
+	0x04,0x01,0x00,0x52,0x04,0x01,0x00,0x11,0x04,0x01,0x00,0x07,0x00,0x54,0x04,0x01,
+	0x00,0x53,0x04,0x01,0x00,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,
+	0x00,0x07,0x00,0xcf,0x06,0x04,0x00,0xcf,0x06,0x04,0x00,0xd1,0x48,0xd0,0x40,0xcf,
+	0x86,0xd5,0x06,0xcf,0x06,0x04,0x00,0xd4,0x06,0xcf,0x06,0x04,0x00,0xd3,0x2c,0xd2,
+	0x06,0xcf,0x06,0x04,0x00,0xd1,0x06,0xcf,0x06,0x04,0x00,0xd0,0x1a,0xcf,0x86,0x55,
+	0x04,0x04,0x00,0x54,0x04,0x04,0x00,0x93,0x0c,0x52,0x04,0x04,0x00,0x11,0x04,0x04,
+	0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x07,0x00,0xcf,0x06,0x01,0x00,0xcf,0x86,0xcf,
+	0x06,0x01,0x00,0xcf,0x86,0xcf,0x06,0x01,0x00,0xe2,0x71,0x05,0xd1,0x8c,0xd0,0x08,
+	0xcf,0x86,0xcf,0x06,0x01,0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x01,0x00,0xd4,0x06,
+	0xcf,0x06,0x01,0x00,0xd3,0x06,0xcf,0x06,0x01,0x00,0xd2,0x06,0xcf,0x06,0x01,0x00,
+	0xd1,0x06,0xcf,0x06,0x01,0x00,0xd0,0x22,0xcf,0x86,0x55,0x04,0x01,0x00,0xd4,0x10,
+	0x93,0x0c,0x52,0x04,0x01,0x00,0x11,0x04,0x01,0x00,0x08,0x00,0x08,0x00,0x53,0x04,
+	0x08,0x00,0x12,0x04,0x08,0x00,0x0a,0x00,0xcf,0x86,0xd5,0x28,0xd4,0x18,0xd3,0x08,
+	0x12,0x04,0x0a,0x00,0x0b,0x00,0x52,0x04,0x0b,0x00,0x91,0x08,0x10,0x04,0x0d,0x00,
+	0x11,0x00,0x11,0x00,0x93,0x0c,0x52,0x04,0x11,0x00,0x11,0x04,0x11,0x00,0x13,0x00,
+	0x13,0x00,0x94,0x14,0x53,0x04,0x13,0x00,0x92,0x0c,0x51,0x04,0x13,0x00,0x10,0x04,
+	0x13,0x00,0x14,0x00,0x14,0x00,0x00,0x00,0xe0,0xdb,0x04,0xcf,0x86,0xe5,0xdf,0x01,
+	0xd4,0x06,0xcf,0x06,0x04,0x00,0xd3,0x74,0xd2,0x6e,0xd1,0x06,0xcf,0x06,0x04,0x00,
+	0xd0,0x3e,0xcf,0x86,0xd5,0x18,0x94,0x14,0x53,0x04,0x04,0x00,0x52,0x04,0x04,0x00,
+	0x91,0x08,0x10,0x04,0x04,0x00,0x00,0x00,0x00,0x00,0x04,0x00,0xd4,0x10,0x93,0x0c,
+	0x92,0x08,0x11,0x04,0x04,0x00,0x06,0x00,0x04,0x00,0x04,0x00,0x93,0x10,0x52,0x04,
+	0x04,0x00,0x91,0x08,0x10,0x04,0x06,0x00,0x04,0x00,0x04,0x00,0x04,0x00,0xcf,0x86,
+	0x95,0x24,0x94,0x20,0x93,0x1c,0xd2,0x0c,0x91,0x08,0x10,0x04,0x04,0x00,0x06,0x00,
+	0x04,0x00,0xd1,0x08,0x10,0x04,0x04,0x00,0x06,0x00,0x10,0x04,0x04,0x00,0x00,0x00,
+	0x00,0x00,0x0b,0x00,0x0b,0x00,0xcf,0x06,0x0a,0x00,0xd2,0x84,0xd1,0x4c,0xd0,0x16,
+	0xcf,0x86,0x55,0x04,0x0a,0x00,0x94,0x0c,0x53,0x04,0x0a,0x00,0x12,0x04,0x0a,0x00,
+	0x00,0x00,0x00,0x00,0xcf,0x86,0x55,0x04,0x0a,0x00,0xd4,0x1c,0xd3,0x0c,0x92,0x08,
+	0x11,0x04,0x0c,0x00,0x0a,0x00,0x0a,0x00,0x52,0x04,0x0a,0x00,0x51,0x04,0x0a,0x00,
+	0x10,0x04,0x0a,0x00,0x0a,0xe6,0xd3,0x08,0x12,0x04,0x0a,0x00,0x0d,0xe6,0x52,0x04,
+	0x0d,0xe6,0x11,0x04,0x0a,0xe6,0x0a,0x00,0xd0,0x1e,0xcf,0x86,0x95,0x18,0x54,0x04,
+	0x0a,0x00,0x53,0x04,0x0a,0x00,0x52,0x04,0x10,0x00,0x51,0x04,0x10,0x00,0x10,0x04,
+	0x11,0xe6,0x0d,0xe6,0x0b,0x00,0xcf,0x86,0x55,0x04,0x0b,0x00,0x54,0x04,0x0b,0x00,
+	0x93,0x0c,0x92,0x08,0x11,0x04,0x0b,0xe6,0x0b,0x00,0x0b,0x00,0x00,0x00,0xd1,0x40,
+	0xd0,0x3a,0xcf,0x86,0xd5,0x24,0x54,0x04,0x08,0x00,0xd3,0x10,0x52,0x04,0x08,0x00,
+	0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x09,0x00,0x92,0x0c,0x51,0x04,0x09,0x00,
+	0x10,0x04,0x09,0x00,0x0a,0x00,0x0a,0x00,0x94,0x10,0x93,0x0c,0x92,0x08,0x11,0x04,
+	0x09,0x00,0x0a,0x00,0x0a,0x00,0x0a,0x00,0x0a,0x00,0xcf,0x06,0x0a,0x00,0xd0,0x5e,
+	0xcf,0x86,0xd5,0x28,0xd4,0x18,0x53,0x04,0x0a,0x00,0x52,0x04,0x0a,0x00,0xd1,0x08,
+	0x10,0x04,0x0a,0x00,0x0c,0x00,0x10,0x04,0x0c,0x00,0x11,0x00,0x93,0x0c,0x92,0x08,
+	0x11,0x04,0x0c,0x00,0x0d,0x00,0x10,0x00,0x10,0x00,0xd4,0x1c,0x53,0x04,0x0c,0x00,
+	0xd2,0x0c,0x51,0x04,0x0c,0x00,0x10,0x04,0x0d,0x00,0x10,0x00,0x51,0x04,0x10,0x00,
+	0x10,0x04,0x12,0x00,0x14,0x00,0xd3,0x0c,0x92,0x08,0x11,0x04,0x10,0x00,0x11,0x00,
+	0x11,0x00,0x92,0x08,0x11,0x04,0x14,0x00,0x15,0x00,0x15,0x00,0xcf,0x86,0xd5,0x1c,
+	0x94,0x18,0x93,0x14,0xd2,0x08,0x11,0x04,0x00,0x00,0x15,0x00,0x51,0x04,0x15,0x00,
+	0x10,0x04,0x15,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x54,0x04,0x00,0x00,0xd3,0x10,
+	0x52,0x04,0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x10,0x00,0x92,0x0c,
+	0x51,0x04,0x0d,0x00,0x10,0x04,0x0c,0x00,0x0a,0x00,0x0a,0x00,0xe4,0xf2,0x02,0xe3,
+	0x65,0x01,0xd2,0x98,0xd1,0x48,0xd0,0x36,0xcf,0x86,0xd5,0x18,0x94,0x14,0x93,0x10,
+	0x52,0x04,0x08,0x00,0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x09,0x08,0x00,0x08,0x00,
+	0x08,0x00,0xd4,0x0c,0x53,0x04,0x08,0x00,0x12,0x04,0x08,0x00,0x00,0x00,0x53,0x04,
+	0x0b,0x00,0x92,0x08,0x11,0x04,0x0b,0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0x55,0x04,
+	0x09,0x00,0x54,0x04,0x09,0x00,0x13,0x04,0x09,0x00,0x00,0x00,0xd0,0x06,0xcf,0x06,
+	0x0a,0x00,0xcf,0x86,0xd5,0x2c,0xd4,0x1c,0xd3,0x10,0x52,0x04,0x0a,0x00,0x91,0x08,
+	0x10,0x04,0x0a,0x09,0x12,0x00,0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,
+	0x0a,0x00,0x53,0x04,0x0a,0x00,0x92,0x08,0x11,0x04,0x0a,0x00,0x00,0x00,0x00,0x00,
+	0x54,0x04,0x0b,0xe6,0xd3,0x0c,0x92,0x08,0x11,0x04,0x0b,0xe6,0x0b,0x00,0x0b,0x00,
+	0x52,0x04,0x0b,0x00,0x11,0x04,0x11,0x00,0x14,0x00,0xd1,0x60,0xd0,0x22,0xcf,0x86,
+	0x55,0x04,0x0a,0x00,0x94,0x18,0x53,0x04,0x0a,0x00,0xd2,0x0c,0x51,0x04,0x0a,0x00,
+	0x10,0x04,0x0a,0x00,0x0a,0xdc,0x11,0x04,0x0a,0xdc,0x0a,0x00,0x0a,0x00,0xcf,0x86,
+	0xd5,0x24,0x54,0x04,0x0a,0x00,0xd3,0x10,0x92,0x0c,0x51,0x04,0x0a,0x00,0x10,0x04,
+	0x0a,0x00,0x0a,0x09,0x00,0x00,0x52,0x04,0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,
+	0x00,0x00,0x0a,0x00,0x54,0x04,0x0b,0x00,0x53,0x04,0x0b,0x00,0x52,0x04,0x0b,0x00,
+	0x91,0x08,0x10,0x04,0x0b,0x00,0x00,0x00,0x00,0x00,0xd0,0x1e,0xcf,0x86,0x55,0x04,
+	0x0b,0x00,0x54,0x04,0x0b,0x00,0x93,0x10,0x92,0x0c,0x51,0x04,0x0b,0x00,0x10,0x04,
+	0x0b,0x00,0x0b,0x07,0x0b,0x00,0x0b,0x00,0xcf,0x86,0xd5,0x34,0xd4,0x20,0xd3,0x10,
+	0x92,0x0c,0x91,0x08,0x10,0x04,0x0b,0x09,0x0b,0x00,0x0b,0x00,0x0b,0x00,0x52,0x04,
+	0x0b,0x00,0x51,0x04,0x0b,0x00,0x10,0x04,0x00,0x00,0x0b,0x00,0x53,0x04,0x0b,0x00,
+	0xd2,0x08,0x11,0x04,0x0b,0x00,0x00,0x00,0x11,0x04,0x00,0x00,0x0b,0x00,0x54,0x04,
+	0x10,0x00,0x53,0x04,0x10,0x00,0x52,0x04,0x10,0x00,0x51,0x04,0x10,0x00,0x10,0x04,
+	0x10,0x00,0x00,0x00,0xd2,0xd0,0xd1,0x50,0xd0,0x1e,0xcf,0x86,0x55,0x04,0x0a,0x00,
+	0x54,0x04,0x0a,0x00,0x93,0x10,0x52,0x04,0x0a,0x00,0x51,0x04,0x0a,0x00,0x10,0x04,
+	0x0a,0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0xd5,0x20,0xd4,0x10,0x53,0x04,0x0a,0x00,
+	0x52,0x04,0x0a,0x00,0x11,0x04,0x0a,0x00,0x00,0x00,0x53,0x04,0x0a,0x00,0x92,0x08,
+	0x11,0x04,0x0a,0x00,0x00,0x00,0x0a,0x00,0x54,0x04,0x0b,0x00,0x53,0x04,0x0b,0x00,
+	0x12,0x04,0x0b,0x00,0x10,0x00,0xd0,0x3a,0xcf,0x86,0x55,0x04,0x0b,0x00,0x54,0x04,
+	0x0b,0x00,0xd3,0x1c,0xd2,0x0c,0x91,0x08,0x10,0x04,0x0b,0xe6,0x0b,0x00,0x0b,0xe6,
+	0xd1,0x08,0x10,0x04,0x0b,0xdc,0x0b,0x00,0x10,0x04,0x0b,0x00,0x0b,0xe6,0xd2,0x0c,
+	0x91,0x08,0x10,0x04,0x0b,0xe6,0x0b,0x00,0x0b,0x00,0x11,0x04,0x0b,0x00,0x0b,0xe6,
+	0xcf,0x86,0xd5,0x2c,0xd4,0x18,0x93,0x14,0x92,0x10,0xd1,0x08,0x10,0x04,0x0b,0x00,
+	0x0b,0xe6,0x10,0x04,0x0b,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x53,0x04,0x00,0x00,
+	0x92,0x0c,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x0b,0x00,0x0b,0x00,0x54,0x04,
+	0x0d,0x00,0x93,0x10,0x52,0x04,0x0d,0x00,0x51,0x04,0x0d,0x00,0x10,0x04,0x0d,0x09,
+	0x00,0x00,0x00,0x00,0xd1,0x8c,0xd0,0x72,0xcf,0x86,0xd5,0x4c,0xd4,0x30,0xd3,0x18,
+	0xd2,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x0c,0x00,0x0c,0x00,0x51,0x04,0x0c,0x00,
+	0x10,0x04,0x0c,0x00,0x00,0x00,0xd2,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x0c,0x00,
+	0x0c,0x00,0x51,0x04,0x0c,0x00,0x10,0x04,0x0c,0x00,0x00,0x00,0x93,0x18,0xd2,0x0c,
+	0x91,0x08,0x10,0x04,0x00,0x00,0x0c,0x00,0x0c,0x00,0x51,0x04,0x0c,0x00,0x10,0x04,
+	0x0c,0x00,0x00,0x00,0x00,0x00,0x94,0x20,0xd3,0x10,0x52,0x04,0x0c,0x00,0x51,0x04,
+	0x0c,0x00,0x10,0x04,0x0c,0x00,0x00,0x00,0x52,0x04,0x0c,0x00,0x51,0x04,0x0c,0x00,
+	0x10,0x04,0x0c,0x00,0x00,0x00,0x10,0x00,0xcf,0x86,0x55,0x04,0x10,0x00,0x94,0x10,
+	0x93,0x0c,0x52,0x04,0x11,0x00,0x11,0x04,0x10,0x00,0x15,0x00,0x00,0x00,0x11,0x00,
+	0xd0,0x06,0xcf,0x06,0x11,0x00,0xcf,0x86,0x55,0x04,0x0b,0x00,0xd4,0x14,0x53,0x04,
+	0x0b,0x00,0x52,0x04,0x0b,0x00,0x91,0x08,0x10,0x04,0x0b,0x00,0x0b,0x09,0x00,0x00,
+	0x53,0x04,0x0b,0x00,0x92,0x08,0x11,0x04,0x0b,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,
+	0x02,0xff,0xff,0xcf,0x86,0xcf,0x06,0x02,0xff,0xff,0xd1,0x76,0xd0,0x09,0xcf,0x86,
+	0xcf,0x06,0x02,0xff,0xff,0xcf,0x86,0x85,0xd4,0x07,0xcf,0x06,0x02,0xff,0xff,0xd3,
+	0x07,0xcf,0x06,0x02,0xff,0xff,0xd2,0x07,0xcf,0x06,0x02,0xff,0xff,0xd1,0x07,0xcf,
+	0x06,0x02,0xff,0xff,0xd0,0x18,0xcf,0x86,0x55,0x05,0x02,0xff,0xff,0x94,0x0d,0x93,
+	0x09,0x12,0x05,0x02,0xff,0xff,0x00,0x00,0x00,0x00,0x0b,0x00,0xcf,0x86,0xd5,0x24,
+	0x94,0x20,0xd3,0x10,0x52,0x04,0x0b,0x00,0x51,0x04,0x0b,0x00,0x10,0x04,0x0b,0x00,
+	0x00,0x00,0x92,0x0c,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x0b,0x00,0x0b,0x00,
+	0x0b,0x00,0x54,0x04,0x0b,0x00,0x53,0x04,0x0b,0x00,0x12,0x04,0x0b,0x00,0x00,0x00,
+	0xd0,0x08,0xcf,0x86,0xcf,0x06,0x01,0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x01,0x00,
+	0xe4,0x9c,0x10,0xe3,0x16,0x08,0xd2,0x06,0xcf,0x06,0x01,0x00,0xe1,0x08,0x04,0xe0,
+	0x04,0x02,0xcf,0x86,0xe5,0x01,0x01,0xd4,0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,
+	0x08,0x01,0xff,0xe8,0xb1,0x88,0x00,0x01,0xff,0xe6,0x9b,0xb4,0x00,0x10,0x08,0x01,
+	0xff,0xe8,0xbb,0x8a,0x00,0x01,0xff,0xe8,0xb3,0x88,0x00,0xd1,0x10,0x10,0x08,0x01,
+	0xff,0xe6,0xbb,0x91,0x00,0x01,0xff,0xe4,0xb8,0xb2,0x00,0x10,0x08,0x01,0xff,0xe5,
+	0x8f,0xa5,0x00,0x01,0xff,0xe9,0xbe,0x9c,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,
+	0xff,0xe9,0xbe,0x9c,0x00,0x01,0xff,0xe5,0xa5,0x91,0x00,0x10,0x08,0x01,0xff,0xe9,
+	0x87,0x91,0x00,0x01,0xff,0xe5,0x96,0x87,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe5,
+	0xa5,0x88,0x00,0x01,0xff,0xe6,0x87,0xb6,0x00,0x10,0x08,0x01,0xff,0xe7,0x99,0xa9,
+	0x00,0x01,0xff,0xe7,0xbe,0x85,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,
+	0xff,0xe8,0x98,0xbf,0x00,0x01,0xff,0xe8,0x9e,0xba,0x00,0x10,0x08,0x01,0xff,0xe8,
+	0xa3,0xb8,0x00,0x01,0xff,0xe9,0x82,0x8f,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe6,
+	0xa8,0x82,0x00,0x01,0xff,0xe6,0xb4,0x9b,0x00,0x10,0x08,0x01,0xff,0xe7,0x83,0x99,
+	0x00,0x01,0xff,0xe7,0x8f,0x9e,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe8,
+	0x90,0xbd,0x00,0x01,0xff,0xe9,0x85,0xaa,0x00,0x10,0x08,0x01,0xff,0xe9,0xa7,0xb1,
+	0x00,0x01,0xff,0xe4,0xba,0x82,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe5,0x8d,0xb5,
+	0x00,0x01,0xff,0xe6,0xac,0x84,0x00,0x10,0x08,0x01,0xff,0xe7,0x88,0x9b,0x00,0x01,
+	0xff,0xe8,0x98,0xad,0x00,0xd4,0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,
+	0xff,0xe9,0xb8,0x9e,0x00,0x01,0xff,0xe5,0xb5,0x90,0x00,0x10,0x08,0x01,0xff,0xe6,
+	0xbf,0xab,0x00,0x01,0xff,0xe8,0x97,0x8d,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe8,
+	0xa5,0xa4,0x00,0x01,0xff,0xe6,0x8b,0x89,0x00,0x10,0x08,0x01,0xff,0xe8,0x87,0x98,
+	0x00,0x01,0xff,0xe8,0xa0,0x9f,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe5,
+	0xbb,0x8a,0x00,0x01,0xff,0xe6,0x9c,0x97,0x00,0x10,0x08,0x01,0xff,0xe6,0xb5,0xaa,
+	0x00,0x01,0xff,0xe7,0x8b,0xbc,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe9,0x83,0x8e,
+	0x00,0x01,0xff,0xe4,0xbe,0x86,0x00,0x10,0x08,0x01,0xff,0xe5,0x86,0xb7,0x00,0x01,
+	0xff,0xe5,0x8b,0x9e,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe6,
+	0x93,0x84,0x00,0x01,0xff,0xe6,0xab,0x93,0x00,0x10,0x08,0x01,0xff,0xe7,0x88,0x90,
+	0x00,0x01,0xff,0xe7,0x9b,0xa7,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe8,0x80,0x81,
+	0x00,0x01,0xff,0xe8,0x98,0x86,0x00,0x10,0x08,0x01,0xff,0xe8,0x99,0x9c,0x00,0x01,
+	0xff,0xe8,0xb7,0xaf,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe9,0x9c,0xb2,
+	0x00,0x01,0xff,0xe9,0xad,0xaf,0x00,0x10,0x08,0x01,0xff,0xe9,0xb7,0xba,0x00,0x01,
+	0xff,0xe7,0xa2,0x8c,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe7,0xa5,0xbf,0x00,0x01,
+	0xff,0xe7,0xb6,0xa0,0x00,0x10,0x08,0x01,0xff,0xe8,0x8f,0x89,0x00,0x01,0xff,0xe9,
+	0x8c,0x84,0x00,0xcf,0x86,0xe5,0x01,0x01,0xd4,0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10,
+	0x10,0x08,0x01,0xff,0xe9,0xb9,0xbf,0x00,0x01,0xff,0xe8,0xab,0x96,0x00,0x10,0x08,
+	0x01,0xff,0xe5,0xa3,0x9f,0x00,0x01,0xff,0xe5,0xbc,0x84,0x00,0xd1,0x10,0x10,0x08,
+	0x01,0xff,0xe7,0xb1,0xa0,0x00,0x01,0xff,0xe8,0x81,0xbe,0x00,0x10,0x08,0x01,0xff,
+	0xe7,0x89,0xa2,0x00,0x01,0xff,0xe7,0xa3,0x8a,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,
+	0x01,0xff,0xe8,0xb3,0x82,0x00,0x01,0xff,0xe9,0x9b,0xb7,0x00,0x10,0x08,0x01,0xff,
+	0xe5,0xa3,0x98,0x00,0x01,0xff,0xe5,0xb1,0xa2,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,
+	0xe6,0xa8,0x93,0x00,0x01,0xff,0xe6,0xb7,0x9a,0x00,0x10,0x08,0x01,0xff,0xe6,0xbc,
+	0x8f,0x00,0x01,0xff,0xe7,0xb4,0xaf,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,
+	0x01,0xff,0xe7,0xb8,0xb7,0x00,0x01,0xff,0xe9,0x99,0x8b,0x00,0x10,0x08,0x01,0xff,
+	0xe5,0x8b,0x92,0x00,0x01,0xff,0xe8,0x82,0x8b,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,
+	0xe5,0x87,0x9c,0x00,0x01,0xff,0xe5,0x87,0x8c,0x00,0x10,0x08,0x01,0xff,0xe7,0xa8,
+	0x9c,0x00,0x01,0xff,0xe7,0xb6,0xbe,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,
+	0xe8,0x8f,0xb1,0x00,0x01,0xff,0xe9,0x99,0xb5,0x00,0x10,0x08,0x01,0xff,0xe8,0xae,
+	0x80,0x00,0x01,0xff,0xe6,0x8b,0x8f,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe6,0xa8,
+	0x82,0x00,0x01,0xff,0xe8,0xab,0xbe,0x00,0x10,0x08,0x01,0xff,0xe4,0xb8,0xb9,0x00,
+	0x01,0xff,0xe5,0xaf,0xa7,0x00,0xd4,0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,
+	0x01,0xff,0xe6,0x80,0x92,0x00,0x01,0xff,0xe7,0x8e,0x87,0x00,0x10,0x08,0x01,0xff,
+	0xe7,0x95,0xb0,0x00,0x01,0xff,0xe5,0x8c,0x97,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,
+	0xe7,0xa3,0xbb,0x00,0x01,0xff,0xe4,0xbe,0xbf,0x00,0x10,0x08,0x01,0xff,0xe5,0xbe,
+	0xa9,0x00,0x01,0xff,0xe4,0xb8,0x8d,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,
+	0xe6,0xb3,0x8c,0x00,0x01,0xff,0xe6,0x95,0xb8,0x00,0x10,0x08,0x01,0xff,0xe7,0xb4,
+	0xa2,0x00,0x01,0xff,0xe5,0x8f,0x83,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe5,0xa1,
+	0x9e,0x00,0x01,0xff,0xe7,0x9c,0x81,0x00,0x10,0x08,0x01,0xff,0xe8,0x91,0x89,0x00,
+	0x01,0xff,0xe8,0xaa,0xaa,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,
+	0xe6,0xae,0xba,0x00,0x01,0xff,0xe8,0xbe,0xb0,0x00,0x10,0x08,0x01,0xff,0xe6,0xb2,
+	0x88,0x00,0x01,0xff,0xe6,0x8b,0xbe,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe8,0x8b,
+	0xa5,0x00,0x01,0xff,0xe6,0x8e,0xa0,0x00,0x10,0x08,0x01,0xff,0xe7,0x95,0xa5,0x00,
+	0x01,0xff,0xe4,0xba,0xae,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe5,0x85,
+	0xa9,0x00,0x01,0xff,0xe5,0x87,0x89,0x00,0x10,0x08,0x01,0xff,0xe6,0xa2,0x81,0x00,
+	0x01,0xff,0xe7,0xb3,0xa7,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe8,0x89,0xaf,0x00,
+	0x01,0xff,0xe8,0xab,0x92,0x00,0x10,0x08,0x01,0xff,0xe9,0x87,0x8f,0x00,0x01,0xff,
+	0xe5,0x8b,0xb5,0x00,0xe0,0x04,0x02,0xcf,0x86,0xe5,0x01,0x01,0xd4,0x80,0xd3,0x40,
+	0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe5,0x91,0x82,0x00,0x01,0xff,0xe5,0xa5,
+	0xb3,0x00,0x10,0x08,0x01,0xff,0xe5,0xbb,0xac,0x00,0x01,0xff,0xe6,0x97,0x85,0x00,
+	0xd1,0x10,0x10,0x08,0x01,0xff,0xe6,0xbf,0xbe,0x00,0x01,0xff,0xe7,0xa4,0xaa,0x00,
+	0x10,0x08,0x01,0xff,0xe9,0x96,0xad,0x00,0x01,0xff,0xe9,0xa9,0xaa,0x00,0xd2,0x20,
+	0xd1,0x10,0x10,0x08,0x01,0xff,0xe9,0xba,0x97,0x00,0x01,0xff,0xe9,0xbb,0x8e,0x00,
+	0x10,0x08,0x01,0xff,0xe5,0x8a,0x9b,0x00,0x01,0xff,0xe6,0x9b,0x86,0x00,0xd1,0x10,
+	0x10,0x08,0x01,0xff,0xe6,0xad,0xb7,0x00,0x01,0xff,0xe8,0xbd,0xa2,0x00,0x10,0x08,
+	0x01,0xff,0xe5,0xb9,0xb4,0x00,0x01,0xff,0xe6,0x86,0x90,0x00,0xd3,0x40,0xd2,0x20,
+	0xd1,0x10,0x10,0x08,0x01,0xff,0xe6,0x88,0x80,0x00,0x01,0xff,0xe6,0x92,0x9a,0x00,
+	0x10,0x08,0x01,0xff,0xe6,0xbc,0xa3,0x00,0x01,0xff,0xe7,0x85,0x89,0x00,0xd1,0x10,
+	0x10,0x08,0x01,0xff,0xe7,0x92,0x89,0x00,0x01,0xff,0xe7,0xa7,0x8a,0x00,0x10,0x08,
+	0x01,0xff,0xe7,0xb7,0xb4,0x00,0x01,0xff,0xe8,0x81,0xaf,0x00,0xd2,0x20,0xd1,0x10,
+	0x10,0x08,0x01,0xff,0xe8,0xbc,0xa6,0x00,0x01,0xff,0xe8,0x93,0xae,0x00,0x10,0x08,
+	0x01,0xff,0xe9,0x80,0xa3,0x00,0x01,0xff,0xe9,0x8d,0x8a,0x00,0xd1,0x10,0x10,0x08,
+	0x01,0xff,0xe5,0x88,0x97,0x00,0x01,0xff,0xe5,0x8a,0xa3,0x00,0x10,0x08,0x01,0xff,
+	0xe5,0x92,0xbd,0x00,0x01,0xff,0xe7,0x83,0x88,0x00,0xd4,0x80,0xd3,0x40,0xd2,0x20,
+	0xd1,0x10,0x10,0x08,0x01,0xff,0xe8,0xa3,0x82,0x00,0x01,0xff,0xe8,0xaa,0xaa,0x00,
+	0x10,0x08,0x01,0xff,0xe5,0xbb,0x89,0x00,0x01,0xff,0xe5,0xbf,0xb5,0x00,0xd1,0x10,
+	0x10,0x08,0x01,0xff,0xe6,0x8d,0xbb,0x00,0x01,0xff,0xe6,0xae,0xae,0x00,0x10,0x08,
+	0x01,0xff,0xe7,0xb0,0xbe,0x00,0x01,0xff,0xe7,0x8d,0xb5,0x00,0xd2,0x20,0xd1,0x10,
+	0x10,0x08,0x01,0xff,0xe4,0xbb,0xa4,0x00,0x01,0xff,0xe5,0x9b,0xb9,0x00,0x10,0x08,
+	0x01,0xff,0xe5,0xaf,0xa7,0x00,0x01,0xff,0xe5,0xb6,0xba,0x00,0xd1,0x10,0x10,0x08,
+	0x01,0xff,0xe6,0x80,0x9c,0x00,0x01,0xff,0xe7,0x8e,0xb2,0x00,0x10,0x08,0x01,0xff,
+	0xe7,0x91,0xa9,0x00,0x01,0xff,0xe7,0xbe,0x9a,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,
+	0x10,0x08,0x01,0xff,0xe8,0x81,0x86,0x00,0x01,0xff,0xe9,0x88,0xb4,0x00,0x10,0x08,
+	0x01,0xff,0xe9,0x9b,0xb6,0x00,0x01,0xff,0xe9,0x9d,0x88,0x00,0xd1,0x10,0x10,0x08,
+	0x01,0xff,0xe9,0xa0,0x98,0x00,0x01,0xff,0xe4,0xbe,0x8b,0x00,0x10,0x08,0x01,0xff,
+	0xe7,0xa6,0xae,0x00,0x01,0xff,0xe9,0x86,0xb4,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,
+	0x01,0xff,0xe9,0x9a,0xb8,0x00,0x01,0xff,0xe6,0x83,0xa1,0x00,0x10,0x08,0x01,0xff,
+	0xe4,0xba,0x86,0x00,0x01,0xff,0xe5,0x83,0x9a,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,
+	0xe5,0xaf,0xae,0x00,0x01,0xff,0xe5,0xb0,0xbf,0x00,0x10,0x08,0x01,0xff,0xe6,0x96,
+	0x99,0x00,0x01,0xff,0xe6,0xa8,0x82,0x00,0xcf,0x86,0xe5,0x01,0x01,0xd4,0x80,0xd3,
+	0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe7,0x87,0x8e,0x00,0x01,0xff,0xe7,
+	0x99,0x82,0x00,0x10,0x08,0x01,0xff,0xe8,0x93,0xbc,0x00,0x01,0xff,0xe9,0x81,0xbc,
+	0x00,0xd1,0x10,0x10,0x08,0x01,0xff,0xe9,0xbe,0x8d,0x00,0x01,0xff,0xe6,0x9a,0x88,
+	0x00,0x10,0x08,0x01,0xff,0xe9,0x98,0xae,0x00,0x01,0xff,0xe5,0x8a,0x89,0x00,0xd2,
+	0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe6,0x9d,0xbb,0x00,0x01,0xff,0xe6,0x9f,0xb3,
+	0x00,0x10,0x08,0x01,0xff,0xe6,0xb5,0x81,0x00,0x01,0xff,0xe6,0xba,0x9c,0x00,0xd1,
+	0x10,0x10,0x08,0x01,0xff,0xe7,0x90,0x89,0x00,0x01,0xff,0xe7,0x95,0x99,0x00,0x10,
+	0x08,0x01,0xff,0xe7,0xa1,0xab,0x00,0x01,0xff,0xe7,0xb4,0x90,0x00,0xd3,0x40,0xd2,
+	0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe9,0xa1,0x9e,0x00,0x01,0xff,0xe5,0x85,0xad,
+	0x00,0x10,0x08,0x01,0xff,0xe6,0x88,0xae,0x00,0x01,0xff,0xe9,0x99,0xb8,0x00,0xd1,
+	0x10,0x10,0x08,0x01,0xff,0xe5,0x80,0xab,0x00,0x01,0xff,0xe5,0xb4,0x99,0x00,0x10,
+	0x08,0x01,0xff,0xe6,0xb7,0xaa,0x00,0x01,0xff,0xe8,0xbc,0xaa,0x00,0xd2,0x20,0xd1,
+	0x10,0x10,0x08,0x01,0xff,0xe5,0xbe,0x8b,0x00,0x01,0xff,0xe6,0x85,0x84,0x00,0x10,
+	0x08,0x01,0xff,0xe6,0xa0,0x97,0x00,0x01,0xff,0xe7,0x8e,0x87,0x00,0xd1,0x10,0x10,
+	0x08,0x01,0xff,0xe9,0x9a,0x86,0x00,0x01,0xff,0xe5,0x88,0xa9,0x00,0x10,0x08,0x01,
+	0xff,0xe5,0x90,0x8f,0x00,0x01,0xff,0xe5,0xb1,0xa5,0x00,0xd4,0x80,0xd3,0x40,0xd2,
+	0x20,0xd1,0x10,0x10,0x08,0x01,0xff,0xe6,0x98,0x93,0x00,0x01,0xff,0xe6,0x9d,0x8e,
+	0x00,0x10,0x08,0x01,0xff,0xe6,0xa2,0xa8,0x00,0x01,0xff,0xe6,0xb3,0xa5,0x00,0xd1,
+	0x10,0x10,0x08,0x01,0xff,0xe7,0x90,0x86,0x00,0x01,0xff,0xe7,0x97,0xa2,0x00,0x10,
+	0x08,0x01,0xff,0xe7,0xbd,0xb9,0x00,0x01,0xff,0xe8,0xa3,0x8f,0x00,0xd2,0x20,0xd1,
+	0x10,0x10,0x08,0x01,0xff,0xe8,0xa3,0xa1,0x00,0x01,0xff,0xe9,0x87,0x8c,0x00,0x10,
+	0x08,0x01,0xff,0xe9,0x9b,0xa2,0x00,0x01,0xff,0xe5,0x8c,0xbf,0x00,0xd1,0x10,0x10,
+	0x08,0x01,0xff,0xe6,0xba,0xba,0x00,0x01,0xff,0xe5,0x90,0x9d,0x00,0x10,0x08,0x01,
+	0xff,0xe7,0x87,0x90,0x00,0x01,0xff,0xe7,0x92,0x98,0x00,0xd3,0x40,0xd2,0x20,0xd1,
+	0x10,0x10,0x08,0x01,0xff,0xe8,0x97,0xba,0x00,0x01,0xff,0xe9,0x9a,0xa3,0x00,0x10,
+	0x08,0x01,0xff,0xe9,0xb1,0x97,0x00,0x01,0xff,0xe9,0xba,0x9f,0x00,0xd1,0x10,0x10,
+	0x08,0x01,0xff,0xe6,0x9e,0x97,0x00,0x01,0xff,0xe6,0xb7,0x8b,0x00,0x10,0x08,0x01,
+	0xff,0xe8,0x87,0xa8,0x00,0x01,0xff,0xe7,0xab,0x8b,0x00,0xd2,0x20,0xd1,0x10,0x10,
+	0x08,0x01,0xff,0xe7,0xac,0xa0,0x00,0x01,0xff,0xe7,0xb2,0x92,0x00,0x10,0x08,0x01,
+	0xff,0xe7,0x8b,0x80,0x00,0x01,0xff,0xe7,0x82,0x99,0x00,0xd1,0x10,0x10,0x08,0x01,
+	0xff,0xe8,0xad,0x98,0x00,0x01,0xff,0xe4,0xbb,0x80,0x00,0x10,0x08,0x01,0xff,0xe8,
+	0x8c,0xb6,0x00,0x01,0xff,0xe5,0x88,0xba,0x00,0xe2,0xad,0x06,0xe1,0xc4,0x03,0xe0,
+	0xcb,0x01,0xcf,0x86,0xd5,0xe4,0xd4,0x74,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,
+	0x01,0xff,0xe5,0x88,0x87,0x00,0x01,0xff,0xe5,0xba,0xa6,0x00,0x10,0x08,0x01,0xff,
+	0xe6,0x8b,0x93,0x00,0x01,0xff,0xe7,0xb3,0x96,0x00,0xd1,0x10,0x10,0x08,0x01,0xff,
+	0xe5,0xae,0x85,0x00,0x01,0xff,0xe6,0xb4,0x9e,0x00,0x10,0x08,0x01,0xff,0xe6,0x9a,
+	0xb4,0x00,0x01,0xff,0xe8,0xbc,0xbb,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x01,0xff,
+	0xe8,0xa1,0x8c,0x00,0x01,0xff,0xe9,0x99,0x8d,0x00,0x10,0x08,0x01,0xff,0xe8,0xa6,
+	0x8b,0x00,0x01,0xff,0xe5,0xbb,0x93,0x00,0x91,0x10,0x10,0x08,0x01,0xff,0xe5,0x85,
+	0x80,0x00,0x01,0xff,0xe5,0x97,0x80,0x00,0x01,0x00,0xd3,0x34,0xd2,0x18,0xd1,0x0c,
+	0x10,0x08,0x01,0xff,0xe5,0xa1,0x9a,0x00,0x01,0x00,0x10,0x08,0x01,0xff,0xe6,0x99,
+	0xb4,0x00,0x01,0x00,0xd1,0x0c,0x10,0x04,0x01,0x00,0x01,0xff,0xe5,0x87,0x9e,0x00,
+	0x10,0x08,0x01,0xff,0xe7,0x8c,0xaa,0x00,0x01,0xff,0xe7,0x9b,0x8a,0x00,0xd2,0x20,
+	0xd1,0x10,0x10,0x08,0x01,0xff,0xe7,0xa4,0xbc,0x00,0x01,0xff,0xe7,0xa5,0x9e,0x00,
+	0x10,0x08,0x01,0xff,0xe7,0xa5,0xa5,0x00,0x01,0xff,0xe7,0xa6,0x8f,0x00,0xd1,0x10,
+	0x10,0x08,0x01,0xff,0xe9,0x9d,0x96,0x00,0x01,0xff,0xe7,0xb2,0xbe,0x00,0x10,0x08,
+	0x01,0xff,0xe7,0xbe,0xbd,0x00,0x01,0x00,0xd4,0x64,0xd3,0x30,0xd2,0x18,0xd1,0x0c,
+	0x10,0x08,0x01,0xff,0xe8,0x98,0x92,0x00,0x01,0x00,0x10,0x08,0x01,0xff,0xe8,0xab,
+	0xb8,0x00,0x01,0x00,0xd1,0x0c,0x10,0x04,0x01,0x00,0x01,0xff,0xe9,0x80,0xb8,0x00,
+	0x10,0x08,0x01,0xff,0xe9,0x83,0xbd,0x00,0x01,0x00,0xd2,0x14,0x51,0x04,0x01,0x00,
+	0x10,0x08,0x01,0xff,0xe9,0xa3,0xaf,0x00,0x01,0xff,0xe9,0xa3,0xbc,0x00,0xd1,0x10,
+	0x10,0x08,0x01,0xff,0xe9,0xa4,0xa8,0x00,0x01,0xff,0xe9,0xb6,0xb4,0x00,0x10,0x08,
+	0x0d,0xff,0xe9,0x83,0x9e,0x00,0x0d,0xff,0xe9,0x9a,0xb7,0x00,0xd3,0x40,0xd2,0x20,
+	0xd1,0x10,0x10,0x08,0x06,0xff,0xe4,0xbe,0xae,0x00,0x06,0xff,0xe5,0x83,0xa7,0x00,
+	0x10,0x08,0x06,0xff,0xe5,0x85,0x8d,0x00,0x06,0xff,0xe5,0x8b,0x89,0x00,0xd1,0x10,
+	0x10,0x08,0x06,0xff,0xe5,0x8b,0xa4,0x00,0x06,0xff,0xe5,0x8d,0x91,0x00,0x10,0x08,
+	0x06,0xff,0xe5,0x96,0x9d,0x00,0x06,0xff,0xe5,0x98,0x86,0x00,0xd2,0x20,0xd1,0x10,
+	0x10,0x08,0x06,0xff,0xe5,0x99,0xa8,0x00,0x06,0xff,0xe5,0xa1,0x80,0x00,0x10,0x08,
+	0x06,0xff,0xe5,0xa2,0xa8,0x00,0x06,0xff,0xe5,0xb1,0xa4,0x00,0xd1,0x10,0x10,0x08,
+	0x06,0xff,0xe5,0xb1,0xae,0x00,0x06,0xff,0xe6,0x82,0x94,0x00,0x10,0x08,0x06,0xff,
+	0xe6,0x85,0xa8,0x00,0x06,0xff,0xe6,0x86,0x8e,0x00,0xcf,0x86,0xe5,0x01,0x01,0xd4,
+	0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x06,0xff,0xe6,0x87,0xb2,0x00,0x06,
+	0xff,0xe6,0x95,0x8f,0x00,0x10,0x08,0x06,0xff,0xe6,0x97,0xa2,0x00,0x06,0xff,0xe6,
+	0x9a,0x91,0x00,0xd1,0x10,0x10,0x08,0x06,0xff,0xe6,0xa2,0x85,0x00,0x06,0xff,0xe6,
+	0xb5,0xb7,0x00,0x10,0x08,0x06,0xff,0xe6,0xb8,0x9a,0x00,0x06,0xff,0xe6,0xbc,0xa2,
+	0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x06,0xff,0xe7,0x85,0xae,0x00,0x06,0xff,0xe7,
+	0x88,0xab,0x00,0x10,0x08,0x06,0xff,0xe7,0x90,0xa2,0x00,0x06,0xff,0xe7,0xa2,0x91,
+	0x00,0xd1,0x10,0x10,0x08,0x06,0xff,0xe7,0xa4,0xbe,0x00,0x06,0xff,0xe7,0xa5,0x89,
+	0x00,0x10,0x08,0x06,0xff,0xe7,0xa5,0x88,0x00,0x06,0xff,0xe7,0xa5,0x90,0x00,0xd3,
+	0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x06,0xff,0xe7,0xa5,0x96,0x00,0x06,0xff,0xe7,
+	0xa5,0x9d,0x00,0x10,0x08,0x06,0xff,0xe7,0xa6,0x8d,0x00,0x06,0xff,0xe7,0xa6,0x8e,
+	0x00,0xd1,0x10,0x10,0x08,0x06,0xff,0xe7,0xa9,0x80,0x00,0x06,0xff,0xe7,0xaa,0x81,
+	0x00,0x10,0x08,0x06,0xff,0xe7,0xaf,0x80,0x00,0x06,0xff,0xe7,0xb7,0xb4,0x00,0xd2,
+	0x20,0xd1,0x10,0x10,0x08,0x06,0xff,0xe7,0xb8,0x89,0x00,0x06,0xff,0xe7,0xb9,0x81,
+	0x00,0x10,0x08,0x06,0xff,0xe7,0xbd,0xb2,0x00,0x06,0xff,0xe8,0x80,0x85,0x00,0xd1,
+	0x10,0x10,0x08,0x06,0xff,0xe8,0x87,0xad,0x00,0x06,0xff,0xe8,0x89,0xb9,0x00,0x10,
+	0x08,0x06,0xff,0xe8,0x89,0xb9,0x00,0x06,0xff,0xe8,0x91,0x97,0x00,0xd4,0x75,0xd3,
+	0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x06,0xff,0xe8,0xa4,0x90,0x00,0x06,0xff,0xe8,
+	0xa6,0x96,0x00,0x10,0x08,0x06,0xff,0xe8,0xac,0x81,0x00,0x06,0xff,0xe8,0xac,0xb9,
+	0x00,0xd1,0x10,0x10,0x08,0x06,0xff,0xe8,0xb3,0x93,0x00,0x06,0xff,0xe8,0xb4,0x88,
+	0x00,0x10,0x08,0x06,0xff,0xe8,0xbe,0xb6,0x00,0x06,0xff,0xe9,0x80,0xb8,0x00,0xd2,
+	0x20,0xd1,0x10,0x10,0x08,0x06,0xff,0xe9,0x9b,0xa3,0x00,0x06,0xff,0xe9,0x9f,0xbf,
+	0x00,0x10,0x08,0x06,0xff,0xe9,0xa0,0xbb,0x00,0x0b,0xff,0xe6,0x81,0xb5,0x00,0x91,
+	0x11,0x10,0x09,0x0b,0xff,0xf0,0xa4,0x8b,0xae,0x00,0x0b,0xff,0xe8,0x88,0x98,0x00,
+	0x00,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x08,0xff,0xe4,0xb8,0xa6,0x00,
+	0x08,0xff,0xe5,0x86,0xb5,0x00,0x10,0x08,0x08,0xff,0xe5,0x85,0xa8,0x00,0x08,0xff,
+	0xe4,0xbe,0x80,0x00,0xd1,0x10,0x10,0x08,0x08,0xff,0xe5,0x85,0x85,0x00,0x08,0xff,
+	0xe5,0x86,0x80,0x00,0x10,0x08,0x08,0xff,0xe5,0x8b,0x87,0x00,0x08,0xff,0xe5,0x8b,
+	0xba,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x08,0xff,0xe5,0x96,0x9d,0x00,0x08,0xff,
+	0xe5,0x95,0x95,0x00,0x10,0x08,0x08,0xff,0xe5,0x96,0x99,0x00,0x08,0xff,0xe5,0x97,
+	0xa2,0x00,0xd1,0x10,0x10,0x08,0x08,0xff,0xe5,0xa1,0x9a,0x00,0x08,0xff,0xe5,0xa2,
+	0xb3,0x00,0x10,0x08,0x08,0xff,0xe5,0xa5,0x84,0x00,0x08,0xff,0xe5,0xa5,0x94,0x00,
+	0xe0,0x04,0x02,0xcf,0x86,0xe5,0x01,0x01,0xd4,0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10,
+	0x10,0x08,0x08,0xff,0xe5,0xa9,0xa2,0x00,0x08,0xff,0xe5,0xac,0xa8,0x00,0x10,0x08,
+	0x08,0xff,0xe5,0xbb,0x92,0x00,0x08,0xff,0xe5,0xbb,0x99,0x00,0xd1,0x10,0x10,0x08,
+	0x08,0xff,0xe5,0xbd,0xa9,0x00,0x08,0xff,0xe5,0xbe,0xad,0x00,0x10,0x08,0x08,0xff,
+	0xe6,0x83,0x98,0x00,0x08,0xff,0xe6,0x85,0x8e,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,
+	0x08,0xff,0xe6,0x84,0x88,0x00,0x08,0xff,0xe6,0x86,0x8e,0x00,0x10,0x08,0x08,0xff,
+	0xe6,0x85,0xa0,0x00,0x08,0xff,0xe6,0x87,0xb2,0x00,0xd1,0x10,0x10,0x08,0x08,0xff,
+	0xe6,0x88,0xb4,0x00,0x08,0xff,0xe6,0x8f,0x84,0x00,0x10,0x08,0x08,0xff,0xe6,0x90,
+	0x9c,0x00,0x08,0xff,0xe6,0x91,0x92,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,
+	0x08,0xff,0xe6,0x95,0x96,0x00,0x08,0xff,0xe6,0x99,0xb4,0x00,0x10,0x08,0x08,0xff,
+	0xe6,0x9c,0x97,0x00,0x08,0xff,0xe6,0x9c,0x9b,0x00,0xd1,0x10,0x10,0x08,0x08,0xff,
+	0xe6,0x9d,0x96,0x00,0x08,0xff,0xe6,0xad,0xb9,0x00,0x10,0x08,0x08,0xff,0xe6,0xae,
+	0xba,0x00,0x08,0xff,0xe6,0xb5,0x81,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x08,0xff,
+	0xe6,0xbb,0x9b,0x00,0x08,0xff,0xe6,0xbb,0x8b,0x00,0x10,0x08,0x08,0xff,0xe6,0xbc,
+	0xa2,0x00,0x08,0xff,0xe7,0x80,0x9e,0x00,0xd1,0x10,0x10,0x08,0x08,0xff,0xe7,0x85,
+	0xae,0x00,0x08,0xff,0xe7,0x9e,0xa7,0x00,0x10,0x08,0x08,0xff,0xe7,0x88,0xb5,0x00,
+	0x08,0xff,0xe7,0x8a,0xaf,0x00,0xd4,0x80,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,
+	0x08,0xff,0xe7,0x8c,0xaa,0x00,0x08,0xff,0xe7,0x91,0xb1,0x00,0x10,0x08,0x08,0xff,
+	0xe7,0x94,0x86,0x00,0x08,0xff,0xe7,0x94,0xbb,0x00,0xd1,0x10,0x10,0x08,0x08,0xff,
+	0xe7,0x98,0x9d,0x00,0x08,0xff,0xe7,0x98,0x9f,0x00,0x10,0x08,0x08,0xff,0xe7,0x9b,
+	0x8a,0x00,0x08,0xff,0xe7,0x9b,0x9b,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x08,0xff,
+	0xe7,0x9b,0xb4,0x00,0x08,0xff,0xe7,0x9d,0x8a,0x00,0x10,0x08,0x08,0xff,0xe7,0x9d,
+	0x80,0x00,0x08,0xff,0xe7,0xa3,0x8c,0x00,0xd1,0x10,0x10,0x08,0x08,0xff,0xe7,0xaa,
+	0xb1,0x00,0x08,0xff,0xe7,0xaf,0x80,0x00,0x10,0x08,0x08,0xff,0xe7,0xb1,0xbb,0x00,
+	0x08,0xff,0xe7,0xb5,0x9b,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x08,0xff,
+	0xe7,0xb7,0xb4,0x00,0x08,0xff,0xe7,0xbc,0xbe,0x00,0x10,0x08,0x08,0xff,0xe8,0x80,
+	0x85,0x00,0x08,0xff,0xe8,0x8d,0x92,0x00,0xd1,0x10,0x10,0x08,0x08,0xff,0xe8,0x8f,
+	0xaf,0x00,0x08,0xff,0xe8,0x9d,0xb9,0x00,0x10,0x08,0x08,0xff,0xe8,0xa5,0x81,0x00,
+	0x08,0xff,0xe8,0xa6,0x86,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x08,0xff,0xe8,0xa6,
+	0x96,0x00,0x08,0xff,0xe8,0xaa,0xbf,0x00,0x10,0x08,0x08,0xff,0xe8,0xab,0xb8,0x00,
+	0x08,0xff,0xe8,0xab,0x8b,0x00,0xd1,0x10,0x10,0x08,0x08,0xff,0xe8,0xac,0x81,0x00,
+	0x08,0xff,0xe8,0xab,0xbe,0x00,0x10,0x08,0x08,0xff,0xe8,0xab,0xad,0x00,0x08,0xff,
+	0xe8,0xac,0xb9,0x00,0xcf,0x86,0x95,0xde,0xd4,0x81,0xd3,0x40,0xd2,0x20,0xd1,0x10,
+	0x10,0x08,0x08,0xff,0xe8,0xae,0x8a,0x00,0x08,0xff,0xe8,0xb4,0x88,0x00,0x10,0x08,
+	0x08,0xff,0xe8,0xbc,0xb8,0x00,0x08,0xff,0xe9,0x81,0xb2,0x00,0xd1,0x10,0x10,0x08,
+	0x08,0xff,0xe9,0x86,0x99,0x00,0x08,0xff,0xe9,0x89,0xb6,0x00,0x10,0x08,0x08,0xff,
+	0xe9,0x99,0xbc,0x00,0x08,0xff,0xe9,0x9b,0xa3,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,
+	0x08,0xff,0xe9,0x9d,0x96,0x00,0x08,0xff,0xe9,0x9f,0x9b,0x00,0x10,0x08,0x08,0xff,
+	0xe9,0x9f,0xbf,0x00,0x08,0xff,0xe9,0xa0,0x8b,0x00,0xd1,0x10,0x10,0x08,0x08,0xff,
+	0xe9,0xa0,0xbb,0x00,0x08,0xff,0xe9,0xac,0x92,0x00,0x10,0x08,0x08,0xff,0xe9,0xbe,
+	0x9c,0x00,0x08,0xff,0xf0,0xa2,0xa1,0x8a,0x00,0xd3,0x45,0xd2,0x22,0xd1,0x12,0x10,
+	0x09,0x08,0xff,0xf0,0xa2,0xa1,0x84,0x00,0x08,0xff,0xf0,0xa3,0x8f,0x95,0x00,0x10,
+	0x08,0x08,0xff,0xe3,0xae,0x9d,0x00,0x08,0xff,0xe4,0x80,0x98,0x00,0xd1,0x11,0x10,
+	0x08,0x08,0xff,0xe4,0x80,0xb9,0x00,0x08,0xff,0xf0,0xa5,0x89,0x89,0x00,0x10,0x09,
+	0x08,0xff,0xf0,0xa5,0xb3,0x90,0x00,0x08,0xff,0xf0,0xa7,0xbb,0x93,0x00,0x92,0x14,
+	0x91,0x10,0x10,0x08,0x08,0xff,0xe9,0xbd,0x83,0x00,0x08,0xff,0xe9,0xbe,0x8e,0x00,
+	0x00,0x00,0x00,0x00,0x00,0x00,0xe1,0x94,0x01,0xe0,0x08,0x01,0xcf,0x86,0xd5,0x42,
+	0xd4,0x14,0x93,0x10,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,
+	0x00,0x00,0x00,0x00,0xd3,0x10,0x92,0x0c,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,
+	0x01,0x00,0x01,0x00,0x52,0x04,0x00,0x00,0xd1,0x0d,0x10,0x04,0x00,0x00,0x04,0xff,
+	0xd7,0x99,0xd6,0xb4,0x00,0x10,0x04,0x01,0x1a,0x01,0xff,0xd7,0xb2,0xd6,0xb7,0x00,
+	0xd4,0x42,0x53,0x04,0x01,0x00,0xd2,0x16,0x51,0x04,0x01,0x00,0x10,0x09,0x01,0xff,
+	0xd7,0xa9,0xd7,0x81,0x00,0x01,0xff,0xd7,0xa9,0xd7,0x82,0x00,0xd1,0x16,0x10,0x0b,
+	0x01,0xff,0xd7,0xa9,0xd6,0xbc,0xd7,0x81,0x00,0x01,0xff,0xd7,0xa9,0xd6,0xbc,0xd7,
+	0x82,0x00,0x10,0x09,0x01,0xff,0xd7,0x90,0xd6,0xb7,0x00,0x01,0xff,0xd7,0x90,0xd6,
+	0xb8,0x00,0xd3,0x43,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,0xff,0xd7,0x90,0xd6,0xbc,
+	0x00,0x01,0xff,0xd7,0x91,0xd6,0xbc,0x00,0x10,0x09,0x01,0xff,0xd7,0x92,0xd6,0xbc,
+	0x00,0x01,0xff,0xd7,0x93,0xd6,0xbc,0x00,0xd1,0x12,0x10,0x09,0x01,0xff,0xd7,0x94,
+	0xd6,0xbc,0x00,0x01,0xff,0xd7,0x95,0xd6,0xbc,0x00,0x10,0x09,0x01,0xff,0xd7,0x96,
+	0xd6,0xbc,0x00,0x00,0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,0xff,0xd7,0x98,0xd6,
+	0xbc,0x00,0x01,0xff,0xd7,0x99,0xd6,0xbc,0x00,0x10,0x09,0x01,0xff,0xd7,0x9a,0xd6,
+	0xbc,0x00,0x01,0xff,0xd7,0x9b,0xd6,0xbc,0x00,0xd1,0x0d,0x10,0x09,0x01,0xff,0xd7,
+	0x9c,0xd6,0xbc,0x00,0x00,0x00,0x10,0x09,0x01,0xff,0xd7,0x9e,0xd6,0xbc,0x00,0x00,
+	0x00,0xcf,0x86,0x95,0x85,0x94,0x81,0xd3,0x3e,0xd2,0x1f,0xd1,0x12,0x10,0x09,0x01,
+	0xff,0xd7,0xa0,0xd6,0xbc,0x00,0x01,0xff,0xd7,0xa1,0xd6,0xbc,0x00,0x10,0x04,0x00,
+	0x00,0x01,0xff,0xd7,0xa3,0xd6,0xbc,0x00,0xd1,0x0d,0x10,0x09,0x01,0xff,0xd7,0xa4,
+	0xd6,0xbc,0x00,0x00,0x00,0x10,0x09,0x01,0xff,0xd7,0xa6,0xd6,0xbc,0x00,0x01,0xff,
+	0xd7,0xa7,0xd6,0xbc,0x00,0xd2,0x24,0xd1,0x12,0x10,0x09,0x01,0xff,0xd7,0xa8,0xd6,
+	0xbc,0x00,0x01,0xff,0xd7,0xa9,0xd6,0xbc,0x00,0x10,0x09,0x01,0xff,0xd7,0xaa,0xd6,
+	0xbc,0x00,0x01,0xff,0xd7,0x95,0xd6,0xb9,0x00,0xd1,0x12,0x10,0x09,0x01,0xff,0xd7,
+	0x91,0xd6,0xbf,0x00,0x01,0xff,0xd7,0x9b,0xd6,0xbf,0x00,0x10,0x09,0x01,0xff,0xd7,
+	0xa4,0xd6,0xbf,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd0,0x1a,0xcf,0x86,0x55,0x04,
+	0x01,0x00,0x54,0x04,0x01,0x00,0x93,0x0c,0x92,0x08,0x11,0x04,0x01,0x00,0x0c,0x00,
+	0x0c,0x00,0x0c,0x00,0xcf,0x86,0x95,0x24,0xd4,0x10,0x93,0x0c,0x92,0x08,0x11,0x04,
+	0x0c,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x93,0x10,0x92,0x0c,0x51,0x04,0x00,0x00,
+	0x10,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0xd3,0x5a,0xd2,0x06,
+	0xcf,0x06,0x01,0x00,0xd1,0x14,0xd0,0x06,0xcf,0x06,0x01,0x00,0xcf,0x86,0x95,0x08,
+	0x14,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0xd0,0x1a,0xcf,0x86,0x95,0x14,0x54,0x04,
+	0x01,0x00,0x93,0x0c,0x92,0x08,0x11,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x01,0x00,
+	0x01,0x00,0xcf,0x86,0xd5,0x0c,0x94,0x08,0x13,0x04,0x01,0x00,0x00,0x00,0x05,0x00,
+	0x54,0x04,0x05,0x00,0x53,0x04,0x01,0x00,0x52,0x04,0x01,0x00,0x91,0x08,0x10,0x04,
+	0x06,0x00,0x07,0x00,0x00,0x00,0xd2,0xce,0xd1,0xa5,0xd0,0x37,0xcf,0x86,0xd5,0x15,
+	0x54,0x05,0x06,0xff,0x00,0x53,0x04,0x08,0x00,0x92,0x08,0x11,0x04,0x08,0x00,0x00,
+	0x00,0x00,0x00,0x94,0x1c,0xd3,0x10,0x52,0x04,0x01,0xe6,0x51,0x04,0x0a,0xe6,0x10,
+	0x04,0x0a,0xe6,0x10,0xdc,0x52,0x04,0x10,0xdc,0x11,0x04,0x10,0xdc,0x11,0xe6,0x01,
+	0x00,0xcf,0x86,0xd5,0x38,0xd4,0x24,0xd3,0x14,0x52,0x04,0x01,0x00,0xd1,0x08,0x10,
+	0x04,0x01,0x00,0x06,0x00,0x10,0x04,0x06,0x00,0x07,0x00,0x92,0x0c,0x91,0x08,0x10,
+	0x04,0x07,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x93,0x10,0x92,0x0c,0x51,0x04,0x01,
+	0x00,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x01,0x00,0xd4,0x18,0xd3,0x10,0x52,
+	0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x00,0x00,0x12,0x04,0x01,
+	0x00,0x00,0x00,0x93,0x18,0xd2,0x0c,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x06,
+	0x00,0x91,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x01,0x00,0x01,0x00,0xd0,0x06,0xcf,
+	0x06,0x01,0x00,0xcf,0x86,0x55,0x04,0x01,0x00,0x54,0x04,0x01,0x00,0x53,0x04,0x01,
+	0x00,0x52,0x04,0x01,0x00,0xd1,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x10,0x04,0x00,
+	0x00,0x01,0xff,0x00,0xd1,0x50,0xd0,0x1e,0xcf,0x86,0x95,0x18,0x94,0x14,0x93,0x10,
+	0x92,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,0x00,
+	0x01,0x00,0x01,0x00,0xcf,0x86,0xd5,0x18,0x54,0x04,0x01,0x00,0x53,0x04,0x01,0x00,
+	0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x06,0x00,0x94,0x14,
+	0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x06,0x00,0x01,0x00,0x01,0x00,0x01,0x00,
+	0x01,0x00,0x01,0x00,0xd0,0x2f,0xcf,0x86,0x55,0x04,0x01,0x00,0xd4,0x15,0x93,0x11,
+	0x92,0x0d,0x91,0x09,0x10,0x05,0x01,0xff,0x00,0x01,0x00,0x01,0x00,0x01,0x00,0x01,
+	0x00,0x53,0x04,0x01,0x00,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,
+	0x00,0x00,0x00,0xcf,0x86,0xd5,0x38,0xd4,0x18,0xd3,0x0c,0x92,0x08,0x11,0x04,0x00,
+	0x00,0x01,0x00,0x01,0x00,0x92,0x08,0x11,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0xd3,
+	0x0c,0x92,0x08,0x11,0x04,0x00,0x00,0x01,0x00,0x01,0x00,0xd2,0x08,0x11,0x04,0x00,
+	0x00,0x01,0x00,0x91,0x08,0x10,0x04,0x01,0x00,0x00,0x00,0x00,0x00,0xd4,0x20,0xd3,
+	0x10,0x52,0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x00,0x00,0x52,
+	0x04,0x01,0x00,0x51,0x04,0x01,0x00,0x10,0x04,0x01,0x00,0x00,0x00,0x53,0x05,0x00,
+	0xff,0x00,0xd2,0x0d,0x91,0x09,0x10,0x05,0x00,0xff,0x00,0x04,0x00,0x04,0x00,0x91,
+	0x08,0x10,0x04,0x03,0x00,0x01,0x00,0x01,0x00,0x83,0xe2,0x46,0x3e,0xe1,0x1f,0x3b,
+	0xe0,0x9c,0x39,0xcf,0x86,0xe5,0x40,0x26,0xc4,0xe3,0x16,0x14,0xe2,0xef,0x11,0xe1,
+	0xd0,0x10,0xe0,0x60,0x07,0xcf,0x86,0xe5,0x53,0x03,0xe4,0x4c,0x02,0xe3,0x3d,0x01,
+	0xd2,0x94,0xd1,0x70,0xd0,0x4a,0xcf,0x86,0xd5,0x18,0x94,0x14,0x53,0x04,0x07,0x00,
+	0x52,0x04,0x07,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x07,0x00,0x07,0x00,0x07,0x00,
+	0xd4,0x14,0x93,0x10,0x52,0x04,0x07,0x00,0x51,0x04,0x07,0x00,0x10,0x04,0x07,0x00,
+	0x00,0x00,0x07,0x00,0x53,0x04,0x07,0x00,0xd2,0x0c,0x51,0x04,0x07,0x00,0x10,0x04,
+	0x07,0x00,0x00,0x00,0x51,0x04,0x07,0x00,0x10,0x04,0x00,0x00,0x07,0x00,0xcf,0x86,
+	0x95,0x20,0xd4,0x10,0x53,0x04,0x07,0x00,0x52,0x04,0x07,0x00,0x11,0x04,0x07,0x00,
+	0x00,0x00,0x53,0x04,0x07,0x00,0x52,0x04,0x07,0x00,0x11,0x04,0x07,0x00,0x00,0x00,
+	0x00,0x00,0xd0,0x06,0xcf,0x06,0x07,0x00,0xcf,0x86,0x55,0x04,0x07,0x00,0x54,0x04,
+	0x07,0x00,0x53,0x04,0x07,0x00,0x92,0x0c,0x51,0x04,0x07,0x00,0x10,0x04,0x07,0x00,
+	0x00,0x00,0x00,0x00,0xd1,0x40,0xd0,0x3a,0xcf,0x86,0xd5,0x20,0x94,0x1c,0x93,0x18,
+	0xd2,0x0c,0x51,0x04,0x07,0x00,0x10,0x04,0x07,0x00,0x00,0x00,0x51,0x04,0x00,0x00,
+	0x10,0x04,0x00,0x00,0x07,0x00,0x07,0x00,0x07,0x00,0x54,0x04,0x07,0x00,0x93,0x10,
+	0x52,0x04,0x07,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x07,0x00,0x07,0x00,
+	0xcf,0x06,0x08,0x00,0xd0,0x46,0xcf,0x86,0xd5,0x2c,0xd4,0x20,0x53,0x04,0x08,0x00,
+	0xd2,0x0c,0x51,0x04,0x08,0x00,0x10,0x04,0x08,0x00,0x10,0x00,0xd1,0x08,0x10,0x04,
+	0x10,0x00,0x12,0x00,0x10,0x04,0x12,0x00,0x00,0x00,0x53,0x04,0x0a,0x00,0x12,0x04,
+	0x0a,0x00,0x00,0x00,0x94,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x10,0x00,
+	0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0xd5,0x08,0x14,0x04,
+	0x00,0x00,0x0a,0x00,0x54,0x04,0x0a,0x00,0x53,0x04,0x0a,0x00,0x52,0x04,0x0a,0x00,
+	0x91,0x08,0x10,0x04,0x0a,0x00,0x0a,0xdc,0x00,0x00,0xd2,0x5e,0xd1,0x06,0xcf,0x06,
+	0x00,0x00,0xd0,0x1e,0xcf,0x86,0x95,0x18,0x54,0x04,0x0a,0x00,0x53,0x04,0x0a,0x00,
+	0x52,0x04,0x0a,0x00,0x91,0x08,0x10,0x04,0x0a,0x00,0x00,0x00,0x00,0x00,0x0a,0x00,
+	0xcf,0x86,0xd5,0x18,0x54,0x04,0x0a,0x00,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,
+	0x0a,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xd4,0x14,0x93,0x10,0x92,0x0c,
+	0x91,0x08,0x10,0x04,0x10,0xdc,0x10,0x00,0x10,0x00,0x10,0x00,0x10,0x00,0x53,0x04,
+	0x10,0x00,0x12,0x04,0x10,0x00,0x00,0x00,0xd1,0x70,0xd0,0x36,0xcf,0x86,0xd5,0x18,
+	0x54,0x04,0x05,0x00,0x53,0x04,0x05,0x00,0x52,0x04,0x05,0x00,0x51,0x04,0x05,0x00,
+	0x10,0x04,0x05,0x00,0x10,0x00,0x94,0x18,0xd3,0x08,0x12,0x04,0x05,0x00,0x00,0x00,
+	0x52,0x04,0x00,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x13,0x00,0x13,0x00,0x05,0x00,
+	0xcf,0x86,0xd5,0x18,0x94,0x14,0x53,0x04,0x05,0x00,0x92,0x0c,0x51,0x04,0x05,0x00,
+	0x10,0x04,0x05,0x00,0x00,0x00,0x00,0x00,0x10,0x00,0x54,0x04,0x10,0x00,0xd3,0x0c,
+	0x52,0x04,0x10,0x00,0x11,0x04,0x10,0x00,0x10,0xe6,0x92,0x0c,0x51,0x04,0x10,0xe6,
+	0x10,0x04,0x10,0xe6,0x00,0x00,0x00,0x00,0xd0,0x1e,0xcf,0x86,0x95,0x18,0x54,0x04,
+	0x07,0x00,0x53,0x04,0x07,0x00,0x52,0x04,0x07,0x00,0x51,0x04,0x07,0x00,0x10,0x04,
+	0x00,0x00,0x07,0x00,0x08,0x00,0xcf,0x86,0x95,0x1c,0xd4,0x0c,0x93,0x08,0x12,0x04,
+	0x08,0x00,0x00,0x00,0x08,0x00,0x93,0x0c,0x52,0x04,0x08,0x00,0x11,0x04,0x08,0x00,
+	0x00,0x00,0x00,0x00,0x00,0x00,0xd3,0xba,0xd2,0x80,0xd1,0x34,0xd0,0x1a,0xcf,0x86,
+	0x55,0x04,0x05,0x00,0x94,0x10,0x93,0x0c,0x52,0x04,0x05,0x00,0x11,0x04,0x05,0x00,
+	0x07,0x00,0x05,0x00,0x05,0x00,0xcf,0x86,0x95,0x14,0x94,0x10,0x53,0x04,0x05,0x00,
+	0x52,0x04,0x05,0x00,0x11,0x04,0x05,0x00,0x07,0x00,0x07,0x00,0x07,0x00,0xd0,0x2a,
+	0xcf,0x86,0xd5,0x14,0x54,0x04,0x07,0x00,0x53,0x04,0x07,0x00,0x52,0x04,0x07,0x00,
+	0x11,0x04,0x07,0x00,0x00,0x00,0x94,0x10,0x53,0x04,0x07,0x00,0x92,0x08,0x11,0x04,
+	0x07,0x00,0x00,0x00,0x00,0x00,0x12,0x00,0xcf,0x86,0xd5,0x10,0x54,0x04,0x12,0x00,
+	0x93,0x08,0x12,0x04,0x12,0x00,0x00,0x00,0x12,0x00,0x54,0x04,0x12,0x00,0x53,0x04,
+	0x12,0x00,0x12,0x04,0x12,0x00,0x00,0x00,0xd1,0x34,0xd0,0x12,0xcf,0x86,0x55,0x04,
+	0x10,0x00,0x94,0x08,0x13,0x04,0x10,0x00,0x00,0x00,0x10,0x00,0xcf,0x86,0x55,0x04,
+	0x10,0x00,0x94,0x18,0xd3,0x08,0x12,0x04,0x10,0x00,0x00,0x00,0x52,0x04,0x00,0x00,
+	0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x10,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,
+	0xd2,0x06,0xcf,0x06,0x10,0x00,0xd1,0x40,0xd0,0x1e,0xcf,0x86,0x55,0x04,0x10,0x00,
+	0x54,0x04,0x10,0x00,0x93,0x10,0x52,0x04,0x10,0x00,0x51,0x04,0x10,0x00,0x10,0x04,
+	0x10,0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0xd5,0x14,0x54,0x04,0x10,0x00,0x93,0x0c,
+	0x52,0x04,0x10,0x00,0x11,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0x94,0x08,0x13,0x04,
+	0x10,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xe4,0xce,0x02,0xe3,0x45,0x01,
+	0xd2,0xd0,0xd1,0x70,0xd0,0x52,0xcf,0x86,0xd5,0x20,0x94,0x1c,0xd3,0x0c,0x52,0x04,
+	0x07,0x00,0x11,0x04,0x07,0x00,0x00,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x07,0x00,
+	0x00,0x00,0x07,0x00,0x07,0x00,0x07,0x00,0x54,0x04,0x07,0x00,0xd3,0x10,0x52,0x04,
+	0x07,0x00,0x51,0x04,0x07,0x00,0x10,0x04,0x00,0x00,0x07,0x00,0xd2,0x0c,0x91,0x08,
+	0x10,0x04,0x07,0x00,0x00,0x00,0x00,0x00,0xd1,0x08,0x10,0x04,0x07,0x00,0x00,0x00,
+	0x10,0x04,0x00,0x00,0x07,0x00,0xcf,0x86,0x95,0x18,0x54,0x04,0x0b,0x00,0x93,0x10,
+	0x52,0x04,0x0b,0x00,0x51,0x04,0x0b,0x00,0x10,0x04,0x00,0x00,0x0b,0x00,0x0b,0x00,
+	0x10,0x00,0xd0,0x32,0xcf,0x86,0xd5,0x18,0x54,0x04,0x10,0x00,0x53,0x04,0x10,0x00,
+	0x52,0x04,0x10,0x00,0x51,0x04,0x10,0x00,0x10,0x04,0x10,0x00,0x00,0x00,0x94,0x14,
+	0x93,0x10,0x52,0x04,0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x10,0x00,
+	0x10,0x00,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x11,0x00,0xd3,0x14,
+	0xd2,0x0c,0x51,0x04,0x11,0x00,0x10,0x04,0x11,0x00,0x00,0x00,0x11,0x04,0x11,0x00,
+	0x00,0x00,0x92,0x0c,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x11,0x00,0x11,0x00,
+	0xd1,0x40,0xd0,0x3a,0xcf,0x86,0xd5,0x1c,0x54,0x04,0x09,0x00,0x53,0x04,0x09,0x00,
+	0xd2,0x08,0x11,0x04,0x09,0x00,0x0b,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,
+	0x09,0x00,0x54,0x04,0x0a,0x00,0x53,0x04,0x0a,0x00,0xd2,0x08,0x11,0x04,0x0a,0x00,
+	0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x0a,0x00,0xcf,0x06,0x00,0x00,
+	0xd0,0x1a,0xcf,0x86,0x55,0x04,0x0d,0x00,0x54,0x04,0x0d,0x00,0x53,0x04,0x0d,0x00,
+	0x52,0x04,0x00,0x00,0x11,0x04,0x11,0x00,0x0d,0x00,0xcf,0x86,0x95,0x14,0x54,0x04,
+	0x11,0x00,0x93,0x0c,0x92,0x08,0x11,0x04,0x00,0x00,0x11,0x00,0x11,0x00,0x11,0x00,
+	0x11,0x00,0xd2,0xec,0xd1,0xa4,0xd0,0x76,0xcf,0x86,0xd5,0x48,0xd4,0x28,0xd3,0x14,
+	0x52,0x04,0x08,0x00,0xd1,0x08,0x10,0x04,0x00,0x00,0x08,0x00,0x10,0x04,0x08,0x00,
+	0x00,0x00,0x52,0x04,0x00,0x00,0xd1,0x08,0x10,0x04,0x08,0x00,0x08,0xdc,0x10,0x04,
+	0x08,0x00,0x08,0xe6,0xd3,0x10,0x52,0x04,0x08,0x00,0x91,0x08,0x10,0x04,0x00,0x00,
+	0x08,0x00,0x08,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x08,0x00,0x08,0x00,
+	0x08,0x00,0x54,0x04,0x08,0x00,0xd3,0x0c,0x52,0x04,0x08,0x00,0x11,0x04,0x14,0x00,
+	0x00,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,0x08,0xe6,0x08,0x01,0x10,0x04,0x08,0xdc,
+	0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x08,0x09,0xcf,0x86,0x95,0x28,
+	0xd4,0x14,0x53,0x04,0x08,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x14,0x00,0x00,0x00,
+	0x00,0x00,0x00,0x00,0x53,0x04,0x08,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x08,0x00,
+	0x00,0x00,0x00,0x00,0x00,0x00,0x0b,0x00,0xd0,0x0a,0xcf,0x86,0x15,0x04,0x10,0x00,
+	0x00,0x00,0xcf,0x86,0x55,0x04,0x10,0x00,0xd4,0x24,0xd3,0x14,0x52,0x04,0x10,0x00,
+	0xd1,0x08,0x10,0x04,0x10,0x00,0x10,0xe6,0x10,0x04,0x10,0xdc,0x00,0x00,0x92,0x0c,
+	0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x10,0x00,0x10,0x00,0x93,0x10,0x52,0x04,
+	0x10,0x00,0x51,0x04,0x10,0x00,0x10,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0xd1,0x54,
+	0xd0,0x26,0xcf,0x86,0x55,0x04,0x0b,0x00,0x54,0x04,0x0b,0x00,0xd3,0x0c,0x52,0x04,
+	0x0b,0x00,0x11,0x04,0x0b,0x00,0x00,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,
+	0x0b,0x00,0x0b,0x00,0x0b,0x00,0xcf,0x86,0xd5,0x14,0x54,0x04,0x0b,0x00,0x93,0x0c,
+	0x52,0x04,0x0b,0x00,0x11,0x04,0x0b,0x00,0x00,0x00,0x0b,0x00,0x54,0x04,0x0b,0x00,
+	0x93,0x10,0x92,0x0c,0x51,0x04,0x0b,0x00,0x10,0x04,0x0b,0x00,0x00,0x00,0x00,0x00,
+	0x0b,0x00,0xd0,0x42,0xcf,0x86,0xd5,0x28,0x54,0x04,0x10,0x00,0xd3,0x0c,0x92,0x08,
+	0x11,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0xd2,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,
+	0x10,0x00,0x10,0x00,0x91,0x08,0x10,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0x94,0x14,
+	0x53,0x04,0x00,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x10,0x00,0x10,0x00,
+	0x10,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xd3,0x96,0xd2,0x68,0xd1,0x24,0xd0,0x06,
+	0xcf,0x06,0x0b,0x00,0xcf,0x86,0x95,0x18,0x94,0x14,0x53,0x04,0x0b,0x00,0x92,0x0c,
+	0x91,0x08,0x10,0x04,0x0b,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+	0xd0,0x1e,0xcf,0x86,0x55,0x04,0x11,0x00,0x54,0x04,0x11,0x00,0x93,0x10,0x92,0x0c,
+	0x51,0x04,0x11,0x00,0x10,0x04,0x11,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x86,
+	0x55,0x04,0x11,0x00,0x54,0x04,0x11,0x00,0xd3,0x10,0x92,0x0c,0x51,0x04,0x11,0x00,
+	0x10,0x04,0x11,0x00,0x00,0x00,0x00,0x00,0x92,0x08,0x11,0x04,0x00,0x00,0x11,0x00,
+	0x11,0x00,0xd1,0x28,0xd0,0x22,0xcf,0x86,0x55,0x04,0x14,0x00,0xd4,0x0c,0x93,0x08,
+	0x12,0x04,0x14,0x00,0x14,0xe6,0x00,0x00,0x53,0x04,0x14,0x00,0x92,0x08,0x11,0x04,
+	0x14,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xd2,0x2a,
+	0xd1,0x24,0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,
+	0x0b,0x00,0x53,0x04,0x0b,0x00,0x52,0x04,0x0b,0x00,0x51,0x04,0x0b,0x00,0x10,0x04,
+	0x0b,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xd1,0x58,0xd0,0x12,0xcf,0x86,0x55,0x04,
+	0x14,0x00,0x94,0x08,0x13,0x04,0x14,0x00,0x00,0x00,0x14,0x00,0xcf,0x86,0x95,0x40,
+	0xd4,0x24,0xd3,0x0c,0x52,0x04,0x14,0x00,0x11,0x04,0x14,0x00,0x14,0xdc,0xd2,0x0c,
+	0x51,0x04,0x14,0xe6,0x10,0x04,0x14,0xe6,0x14,0xdc,0x91,0x08,0x10,0x04,0x14,0xe6,
+	0x14,0xdc,0x14,0xdc,0xd3,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x14,0xdc,0x14,0x00,
+	0x14,0x00,0x14,0x00,0x92,0x08,0x11,0x04,0x14,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+	0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x15,0x00,
+	0x93,0x10,0x52,0x04,0x15,0x00,0x51,0x04,0x15,0x00,0x10,0x04,0x15,0x00,0x00,0x00,
+	0x00,0x00,0xcf,0x86,0xe5,0x0f,0x06,0xe4,0xf8,0x03,0xe3,0x02,0x02,0xd2,0xfb,0xd1,
+	0x4c,0xd0,0x06,0xcf,0x06,0x0c,0x00,0xcf,0x86,0xd5,0x2c,0xd4,0x1c,0xd3,0x10,0x52,
+	0x04,0x0c,0x00,0x51,0x04,0x0c,0x00,0x10,0x04,0x0c,0x09,0x0c,0x00,0x52,0x04,0x0c,
+	0x00,0x11,0x04,0x0c,0x00,0x00,0x00,0x93,0x0c,0x92,0x08,0x11,0x04,0x00,0x00,0x0c,
+	0x00,0x0c,0x00,0x0c,0x00,0x54,0x04,0x0c,0x00,0x53,0x04,0x00,0x00,0x52,0x04,0x00,
+	0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x10,0x09,0xd0,0x69,0xcf,0x86,0xd5,
+	0x32,0x54,0x04,0x0b,0x00,0x53,0x04,0x0b,0x00,0xd2,0x15,0x51,0x04,0x0b,0x00,0x10,
+	0x0d,0x0b,0xff,0xf0,0x91,0x82,0x99,0xf0,0x91,0x82,0xba,0x00,0x0b,0x00,0x91,0x11,
+	0x10,0x0d,0x0b,0xff,0xf0,0x91,0x82,0x9b,0xf0,0x91,0x82,0xba,0x00,0x0b,0x00,0x0b,
+	0x00,0xd4,0x1d,0x53,0x04,0x0b,0x00,0x92,0x15,0x51,0x04,0x0b,0x00,0x10,0x04,0x0b,
+	0x00,0x0b,0xff,0xf0,0x91,0x82,0xa5,0xf0,0x91,0x82,0xba,0x00,0x0b,0x00,0x53,0x04,
+	0x0b,0x00,0x92,0x10,0xd1,0x08,0x10,0x04,0x0b,0x00,0x0b,0x09,0x10,0x04,0x0b,0x07,
+	0x0b,0x00,0x0b,0x00,0xcf,0x86,0xd5,0x20,0x94,0x1c,0xd3,0x0c,0x92,0x08,0x11,0x04,
+	0x0b,0x00,0x00,0x00,0x00,0x00,0x52,0x04,0x00,0x00,0x91,0x08,0x10,0x04,0x00,0x00,
+	0x14,0x00,0x00,0x00,0x0d,0x00,0xd4,0x14,0x53,0x04,0x0d,0x00,0x92,0x0c,0x91,0x08,
+	0x10,0x04,0x0d,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x53,0x04,0x0d,0x00,0x92,0x08,
+	0x11,0x04,0x0d,0x00,0x00,0x00,0x00,0x00,0xd1,0x96,0xd0,0x5c,0xcf,0x86,0xd5,0x18,
+	0x94,0x14,0x93,0x10,0x92,0x0c,0x51,0x04,0x0d,0xe6,0x10,0x04,0x0d,0xe6,0x0d,0x00,
+	0x0d,0x00,0x0d,0x00,0x0d,0x00,0xd4,0x26,0x53,0x04,0x0d,0x00,0x52,0x04,0x0d,0x00,
+	0x51,0x04,0x0d,0x00,0x10,0x0d,0x0d,0xff,0xf0,0x91,0x84,0xb1,0xf0,0x91,0x84,0xa7,
+	0x00,0x0d,0xff,0xf0,0x91,0x84,0xb2,0xf0,0x91,0x84,0xa7,0x00,0x93,0x18,0xd2,0x0c,
+	0x51,0x04,0x0d,0x00,0x10,0x04,0x0d,0x00,0x0d,0x09,0x91,0x08,0x10,0x04,0x0d,0x09,
+	0x00,0x00,0x0d,0x00,0x0d,0x00,0xcf,0x86,0xd5,0x18,0x94,0x14,0x93,0x10,0x52,0x04,
+	0x0d,0x00,0x51,0x04,0x14,0x00,0x10,0x04,0x14,0x00,0x00,0x00,0x00,0x00,0x10,0x00,
+	0x54,0x04,0x10,0x00,0x93,0x18,0xd2,0x0c,0x51,0x04,0x10,0x00,0x10,0x04,0x10,0x00,
+	0x10,0x07,0x51,0x04,0x10,0x00,0x10,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0xd0,0x06,
+	0xcf,0x06,0x0d,0x00,0xcf,0x86,0xd5,0x40,0xd4,0x2c,0xd3,0x10,0x92,0x0c,0x91,0x08,
+	0x10,0x04,0x0d,0x09,0x0d,0x00,0x0d,0x00,0x0d,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,
+	0x0d,0x00,0x11,0x00,0x10,0x04,0x11,0x07,0x11,0x00,0x91,0x08,0x10,0x04,0x11,0x00,
+	0x10,0x00,0x00,0x00,0x53,0x04,0x0d,0x00,0x92,0x0c,0x51,0x04,0x0d,0x00,0x10,0x04,
+	0x10,0x00,0x11,0x00,0x11,0x00,0xd4,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,
+	0x00,0x00,0x10,0x00,0x10,0x00,0x10,0x00,0x10,0x00,0x93,0x10,0x52,0x04,0x10,0x00,
+	0x91,0x08,0x10,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xd2,0xc8,0xd1,0x48,
+	0xd0,0x42,0xcf,0x86,0xd5,0x18,0x54,0x04,0x10,0x00,0x93,0x10,0x92,0x0c,0x51,0x04,
+	0x10,0x00,0x10,0x04,0x00,0x00,0x10,0x00,0x10,0x00,0x10,0x00,0x54,0x04,0x10,0x00,
+	0xd3,0x14,0x52,0x04,0x10,0x00,0xd1,0x08,0x10,0x04,0x10,0x00,0x10,0x09,0x10,0x04,
+	0x10,0x07,0x10,0x00,0x52,0x04,0x10,0x00,0x51,0x04,0x10,0x00,0x10,0x04,0x12,0x00,
+	0x00,0x00,0xcf,0x06,0x00,0x00,0xd0,0x52,0xcf,0x86,0xd5,0x3c,0xd4,0x28,0xd3,0x10,
+	0x52,0x04,0x11,0x00,0x51,0x04,0x11,0x00,0x10,0x04,0x11,0x00,0x00,0x00,0xd2,0x0c,
+	0x91,0x08,0x10,0x04,0x11,0x00,0x00,0x00,0x11,0x00,0x51,0x04,0x11,0x00,0x10,0x04,
+	0x00,0x00,0x11,0x00,0x53,0x04,0x11,0x00,0x52,0x04,0x11,0x00,0x51,0x04,0x11,0x00,
+	0x10,0x04,0x00,0x00,0x11,0x00,0x94,0x10,0x53,0x04,0x11,0x00,0x92,0x08,0x11,0x04,
+	0x11,0x00,0x00,0x00,0x00,0x00,0x10,0x00,0xcf,0x86,0x55,0x04,0x10,0x00,0xd4,0x18,
+	0x53,0x04,0x10,0x00,0x92,0x10,0xd1,0x08,0x10,0x04,0x10,0x00,0x10,0x07,0x10,0x04,
+	0x10,0x09,0x00,0x00,0x00,0x00,0x53,0x04,0x10,0x00,0x92,0x08,0x11,0x04,0x10,0x00,
+	0x00,0x00,0x00,0x00,0xe1,0x27,0x01,0xd0,0x8a,0xcf,0x86,0xd5,0x44,0xd4,0x2c,0xd3,
+	0x18,0xd2,0x0c,0x91,0x08,0x10,0x04,0x11,0x00,0x10,0x00,0x10,0x00,0x91,0x08,0x10,
+	0x04,0x00,0x00,0x10,0x00,0x10,0x00,0x52,0x04,0x10,0x00,0xd1,0x08,0x10,0x04,0x10,
+	0x00,0x00,0x00,0x10,0x04,0x00,0x00,0x10,0x00,0x93,0x14,0x92,0x10,0xd1,0x08,0x10,
+	0x04,0x10,0x00,0x00,0x00,0x10,0x04,0x00,0x00,0x10,0x00,0x10,0x00,0x10,0x00,0xd4,
+	0x14,0x53,0x04,0x10,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x10,0x00,0x00,0x00,0x10,
+	0x00,0x10,0x00,0xd3,0x18,0xd2,0x0c,0x91,0x08,0x10,0x04,0x10,0x00,0x00,0x00,0x10,
+	0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x10,0x00,0x10,0x00,0xd2,0x0c,0x51,0x04,0x10,
+	0x00,0x10,0x04,0x00,0x00,0x14,0x07,0x91,0x08,0x10,0x04,0x10,0x07,0x10,0x00,0x10,
+	0x00,0xcf,0x86,0xd5,0x6a,0xd4,0x42,0xd3,0x14,0x52,0x04,0x10,0x00,0xd1,0x08,0x10,
+	0x04,0x10,0x00,0x00,0x00,0x10,0x04,0x00,0x00,0x10,0x00,0xd2,0x19,0xd1,0x08,0x10,
+	0x04,0x10,0x00,0x00,0x00,0x10,0x04,0x00,0x00,0x10,0xff,0xf0,0x91,0x8d,0x87,0xf0,
+	0x91,0x8c,0xbe,0x00,0x91,0x11,0x10,0x0d,0x10,0xff,0xf0,0x91,0x8d,0x87,0xf0,0x91,
+	0x8d,0x97,0x00,0x10,0x09,0x00,0x00,0xd3,0x18,0xd2,0x0c,0x91,0x08,0x10,0x04,0x11,
+	0x00,0x00,0x00,0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x10,0x00,0x52,
+	0x04,0x00,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x10,0x00,0x10,0x00,0xd4,0x1c,0xd3,
+	0x0c,0x52,0x04,0x10,0x00,0x11,0x04,0x00,0x00,0x10,0xe6,0x52,0x04,0x10,0xe6,0x91,
+	0x08,0x10,0x04,0x10,0xe6,0x00,0x00,0x00,0x00,0x93,0x10,0x52,0x04,0x10,0xe6,0x91,
+	0x08,0x10,0x04,0x10,0xe6,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xe3,
+	0x30,0x01,0xd2,0xb7,0xd1,0x48,0xd0,0x06,0xcf,0x06,0x12,0x00,0xcf,0x86,0x95,0x3c,
+	0xd4,0x1c,0x93,0x18,0xd2,0x0c,0x51,0x04,0x12,0x00,0x10,0x04,0x12,0x09,0x12,0x00,
+	0x51,0x04,0x12,0x00,0x10,0x04,0x12,0x07,0x12,0x00,0x12,0x00,0x53,0x04,0x12,0x00,
+	0xd2,0x0c,0x51,0x04,0x12,0x00,0x10,0x04,0x00,0x00,0x12,0x00,0xd1,0x08,0x10,0x04,
+	0x00,0x00,0x12,0x00,0x10,0x04,0x14,0xe6,0x15,0x00,0x00,0x00,0xd0,0x45,0xcf,0x86,
+	0x55,0x04,0x10,0x00,0x54,0x04,0x10,0x00,0x53,0x04,0x10,0x00,0xd2,0x15,0x51,0x04,
+	0x10,0x00,0x10,0x04,0x10,0x00,0x10,0xff,0xf0,0x91,0x92,0xb9,0xf0,0x91,0x92,0xba,
+	0x00,0xd1,0x11,0x10,0x0d,0x10,0xff,0xf0,0x91,0x92,0xb9,0xf0,0x91,0x92,0xb0,0x00,
+	0x10,0x00,0x10,0x0d,0x10,0xff,0xf0,0x91,0x92,0xb9,0xf0,0x91,0x92,0xbd,0x00,0x10,
+	0x00,0xcf,0x86,0x95,0x24,0xd4,0x14,0x93,0x10,0x92,0x0c,0x51,0x04,0x10,0x00,0x10,
+	0x04,0x10,0x09,0x10,0x07,0x10,0x00,0x00,0x00,0x53,0x04,0x10,0x00,0x92,0x08,0x11,
+	0x04,0x10,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xd1,0x06,0xcf,0x06,0x00,0x00,0xd0,
+	0x40,0xcf,0x86,0x55,0x04,0x10,0x00,0x54,0x04,0x10,0x00,0xd3,0x0c,0x52,0x04,0x10,
+	0x00,0x11,0x04,0x10,0x00,0x00,0x00,0xd2,0x1e,0x51,0x04,0x10,0x00,0x10,0x0d,0x10,
+	0xff,0xf0,0x91,0x96,0xb8,0xf0,0x91,0x96,0xaf,0x00,0x10,0xff,0xf0,0x91,0x96,0xb9,
+	0xf0,0x91,0x96,0xaf,0x00,0x51,0x04,0x10,0x00,0x10,0x04,0x10,0x00,0x10,0x09,0xcf,
+	0x86,0x95,0x2c,0xd4,0x1c,0xd3,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x10,0x07,0x10,
+	0x00,0x10,0x00,0x10,0x00,0x92,0x08,0x11,0x04,0x10,0x00,0x11,0x00,0x11,0x00,0x53,
+	0x04,0x11,0x00,0x52,0x04,0x11,0x00,0x11,0x04,0x11,0x00,0x00,0x00,0x00,0x00,0xd2,
+	0xa0,0xd1,0x5c,0xd0,0x1e,0xcf,0x86,0x55,0x04,0x10,0x00,0x54,0x04,0x10,0x00,0x53,
+	0x04,0x10,0x00,0x52,0x04,0x10,0x00,0x51,0x04,0x10,0x00,0x10,0x04,0x10,0x00,0x10,
+	0x09,0xcf,0x86,0xd5,0x24,0xd4,0x14,0x93,0x10,0x52,0x04,0x10,0x00,0x91,0x08,0x10,
+	0x04,0x10,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x53,0x04,0x10,0x00,0x92,0x08,0x11,
+	0x04,0x10,0x00,0x00,0x00,0x00,0x00,0x94,0x14,0x53,0x04,0x12,0x00,0x52,0x04,0x12,
+	0x00,0x91,0x08,0x10,0x04,0x12,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xd0,0x2a,0xcf,
+	0x86,0x55,0x04,0x0d,0x00,0x54,0x04,0x0d,0x00,0xd3,0x10,0x52,0x04,0x0d,0x00,0x51,
+	0x04,0x0d,0x00,0x10,0x04,0x0d,0x09,0x0d,0x07,0x92,0x0c,0x91,0x08,0x10,0x04,0x15,
+	0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0x95,0x14,0x94,0x10,0x53,0x04,0x0d,
+	0x00,0x92,0x08,0x11,0x04,0x0d,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xd1,
+	0x40,0xd0,0x3a,0xcf,0x86,0xd5,0x20,0x54,0x04,0x11,0x00,0x53,0x04,0x11,0x00,0xd2,
+	0x0c,0x51,0x04,0x11,0x00,0x10,0x04,0x14,0x00,0x00,0x00,0x91,0x08,0x10,0x04,0x00,
+	0x00,0x11,0x00,0x11,0x00,0x94,0x14,0x53,0x04,0x11,0x00,0x92,0x0c,0x51,0x04,0x11,
+	0x00,0x10,0x04,0x11,0x00,0x11,0x09,0x00,0x00,0x11,0x00,0xcf,0x06,0x00,0x00,0xcf,
+	0x06,0x00,0x00,0xe4,0x59,0x01,0xd3,0xb2,0xd2,0x5c,0xd1,0x28,0xd0,0x22,0xcf,0x86,
+	0x55,0x04,0x14,0x00,0x54,0x04,0x14,0x00,0x53,0x04,0x14,0x00,0x92,0x10,0xd1,0x08,
+	0x10,0x04,0x14,0x00,0x14,0x09,0x10,0x04,0x14,0x07,0x14,0x00,0x00,0x00,0xcf,0x06,
+	0x00,0x00,0xd0,0x0a,0xcf,0x86,0x15,0x04,0x00,0x00,0x10,0x00,0xcf,0x86,0x55,0x04,
+	0x10,0x00,0x54,0x04,0x10,0x00,0xd3,0x10,0x92,0x0c,0x51,0x04,0x10,0x00,0x10,0x04,
+	0x10,0x00,0x00,0x00,0x00,0x00,0x52,0x04,0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,
+	0x00,0x00,0x10,0x00,0xd1,0x06,0xcf,0x06,0x00,0x00,0xd0,0x1a,0xcf,0x86,0x55,0x04,
+	0x00,0x00,0x94,0x10,0x53,0x04,0x15,0x00,0x92,0x08,0x11,0x04,0x00,0x00,0x15,0x00,
+	0x15,0x00,0x15,0x00,0xcf,0x86,0xd5,0x14,0x54,0x04,0x15,0x00,0x53,0x04,0x15,0x00,
+	0x92,0x08,0x11,0x04,0x00,0x00,0x15,0x00,0x15,0x00,0x94,0x1c,0x93,0x18,0xd2,0x0c,
+	0x91,0x08,0x10,0x04,0x15,0x09,0x15,0x00,0x15,0x00,0x91,0x08,0x10,0x04,0x15,0x00,
+	0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xd2,0xa0,0xd1,0x3c,0xd0,0x1e,0xcf,0x86,
+	0x55,0x04,0x13,0x00,0x54,0x04,0x13,0x00,0x93,0x10,0x52,0x04,0x13,0x00,0x91,0x08,
+	0x10,0x04,0x13,0x09,0x13,0x00,0x13,0x00,0x13,0x00,0xcf,0x86,0x95,0x18,0x94,0x14,
+	0x93,0x10,0x52,0x04,0x13,0x00,0x51,0x04,0x13,0x00,0x10,0x04,0x13,0x00,0x13,0x09,
+	0x00,0x00,0x13,0x00,0x13,0x00,0xd0,0x46,0xcf,0x86,0xd5,0x2c,0xd4,0x10,0x93,0x0c,
+	0x52,0x04,0x13,0x00,0x11,0x04,0x15,0x00,0x13,0x00,0x13,0x00,0x53,0x04,0x13,0x00,
+	0xd2,0x0c,0x91,0x08,0x10,0x04,0x13,0x00,0x13,0x09,0x13,0x00,0x91,0x08,0x10,0x04,
+	0x13,0x00,0x14,0x00,0x13,0x00,0x94,0x14,0x93,0x10,0x92,0x0c,0x51,0x04,0x13,0x00,
+	0x10,0x04,0x13,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0x55,0x04,
+	0x10,0x00,0x54,0x04,0x10,0x00,0x53,0x04,0x10,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,
+	0x10,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xe3,0xa9,0x01,0xd2,
+	0xb0,0xd1,0x6c,0xd0,0x3e,0xcf,0x86,0xd5,0x18,0x94,0x14,0x53,0x04,0x12,0x00,0x92,
+	0x0c,0x91,0x08,0x10,0x04,0x12,0x00,0x00,0x00,0x12,0x00,0x12,0x00,0x12,0x00,0x54,
+	0x04,0x12,0x00,0xd3,0x10,0x52,0x04,0x12,0x00,0x51,0x04,0x12,0x00,0x10,0x04,0x12,
+	0x00,0x00,0x00,0x52,0x04,0x12,0x00,0x51,0x04,0x12,0x00,0x10,0x04,0x12,0x00,0x12,
+	0x09,0xcf,0x86,0xd5,0x14,0x94,0x10,0x93,0x0c,0x52,0x04,0x12,0x00,0x11,0x04,0x12,
+	0x00,0x00,0x00,0x00,0x00,0x12,0x00,0x94,0x14,0x53,0x04,0x12,0x00,0x52,0x04,0x12,
+	0x00,0x91,0x08,0x10,0x04,0x12,0x00,0x00,0x00,0x00,0x00,0x12,0x00,0xd0,0x3e,0xcf,
+	0x86,0xd5,0x14,0x54,0x04,0x12,0x00,0x93,0x0c,0x92,0x08,0x11,0x04,0x00,0x00,0x12,
+	0x00,0x12,0x00,0x12,0x00,0xd4,0x14,0x53,0x04,0x12,0x00,0x92,0x0c,0x91,0x08,0x10,
+	0x04,0x00,0x00,0x12,0x00,0x12,0x00,0x12,0x00,0x93,0x10,0x52,0x04,0x12,0x00,0x51,
+	0x04,0x12,0x00,0x10,0x04,0x12,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xd1,
+	0xa0,0xd0,0x52,0xcf,0x86,0xd5,0x24,0x94,0x20,0xd3,0x10,0x52,0x04,0x13,0x00,0x51,
+	0x04,0x13,0x00,0x10,0x04,0x13,0x00,0x00,0x00,0x92,0x0c,0x51,0x04,0x13,0x00,0x10,
+	0x04,0x00,0x00,0x13,0x00,0x13,0x00,0x13,0x00,0x54,0x04,0x13,0x00,0xd3,0x10,0x52,
+	0x04,0x13,0x00,0x51,0x04,0x13,0x00,0x10,0x04,0x13,0x00,0x00,0x00,0xd2,0x0c,0x51,
+	0x04,0x00,0x00,0x10,0x04,0x13,0x00,0x00,0x00,0x51,0x04,0x13,0x00,0x10,0x04,0x00,
+	0x00,0x13,0x00,0xcf,0x86,0xd5,0x28,0xd4,0x18,0x93,0x14,0xd2,0x0c,0x51,0x04,0x13,
+	0x00,0x10,0x04,0x13,0x07,0x13,0x00,0x11,0x04,0x13,0x09,0x13,0x00,0x00,0x00,0x53,
+	0x04,0x13,0x00,0x92,0x08,0x11,0x04,0x13,0x00,0x00,0x00,0x00,0x00,0x94,0x20,0xd3,
+	0x10,0x52,0x04,0x14,0x00,0x51,0x04,0x14,0x00,0x10,0x04,0x00,0x00,0x14,0x00,0x92,
+	0x0c,0x91,0x08,0x10,0x04,0x14,0x00,0x00,0x00,0x14,0x00,0x14,0x00,0x14,0x00,0xd0,
+	0x52,0xcf,0x86,0xd5,0x3c,0xd4,0x14,0x53,0x04,0x14,0x00,0x52,0x04,0x14,0x00,0x51,
+	0x04,0x14,0x00,0x10,0x04,0x14,0x00,0x00,0x00,0xd3,0x18,0xd2,0x0c,0x51,0x04,0x14,
+	0x00,0x10,0x04,0x00,0x00,0x14,0x00,0x51,0x04,0x14,0x00,0x10,0x04,0x14,0x00,0x14,
+	0x09,0x92,0x0c,0x91,0x08,0x10,0x04,0x14,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x94,
+	0x10,0x53,0x04,0x14,0x00,0x92,0x08,0x11,0x04,0x14,0x00,0x00,0x00,0x00,0x00,0x00,
+	0x00,0xcf,0x06,0x00,0x00,0xd2,0x2a,0xd1,0x06,0xcf,0x06,0x00,0x00,0xd0,0x06,0xcf,
+	0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x14,0x00,0x53,0x04,0x14,
+	0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x14,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xd1,
+	0x06,0xcf,0x06,0x00,0x00,0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x15,
+	0x00,0x54,0x04,0x15,0x00,0xd3,0x0c,0x92,0x08,0x11,0x04,0x15,0x00,0x00,0x00,0x00,
+	0x00,0x52,0x04,0x00,0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x15,0x00,0xd0,
+	0xca,0xcf,0x86,0xd5,0xc2,0xd4,0x54,0xd3,0x06,0xcf,0x06,0x09,0x00,0xd2,0x06,0xcf,
+	0x06,0x09,0x00,0xd1,0x24,0xd0,0x06,0xcf,0x06,0x09,0x00,0xcf,0x86,0x55,0x04,0x09,
+	0x00,0x94,0x14,0x53,0x04,0x09,0x00,0x52,0x04,0x09,0x00,0x51,0x04,0x09,0x00,0x10,
+	0x04,0x09,0x00,0x10,0x00,0x10,0x00,0xd0,0x1e,0xcf,0x86,0x95,0x18,0x54,0x04,0x10,
+	0x00,0x53,0x04,0x10,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x10,0x00,0x11,0x00,0x00,
+	0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xd3,0x68,0xd2,0x46,0xd1,0x40,0xd0,
+	0x06,0xcf,0x06,0x09,0x00,0xcf,0x86,0x55,0x04,0x09,0x00,0xd4,0x20,0xd3,0x10,0x92,
+	0x0c,0x51,0x04,0x09,0x00,0x10,0x04,0x09,0x00,0x10,0x00,0x10,0x00,0x52,0x04,0x10,
+	0x00,0x51,0x04,0x10,0x00,0x10,0x04,0x10,0x00,0x00,0x00,0x93,0x10,0x52,0x04,0x09,
+	0x00,0x91,0x08,0x10,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x11,
+	0x00,0xd1,0x1c,0xd0,0x06,0xcf,0x06,0x11,0x00,0xcf,0x86,0x95,0x10,0x94,0x0c,0x93,
+	0x08,0x12,0x04,0x11,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,
+	0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x86,0xd5,0x4c,0xd4,0x06,0xcf,
+	0x06,0x0b,0x00,0xd3,0x40,0xd2,0x3a,0xd1,0x34,0xd0,0x2e,0xcf,0x86,0x55,0x04,0x0b,
+	0x00,0xd4,0x14,0x53,0x04,0x0b,0x00,0x52,0x04,0x0b,0x00,0x51,0x04,0x0b,0x00,0x10,
+	0x04,0x0b,0x00,0x00,0x00,0x53,0x04,0x15,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x15,
+	0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,
+	0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xd1,0x4c,0xd0,0x44,0xcf,
+	0x86,0xd5,0x3c,0xd4,0x06,0xcf,0x06,0x00,0x00,0xd3,0x06,0xcf,0x06,0x11,0x00,0xd2,
+	0x2a,0xd1,0x24,0xd0,0x06,0xcf,0x06,0x11,0x00,0xcf,0x86,0x95,0x18,0x94,0x14,0x93,
+	0x10,0x52,0x04,0x11,0x00,0x51,0x04,0x11,0x00,0x10,0x04,0x11,0x00,0x00,0x00,0x00,
+	0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00,
+	0x00,0xcf,0x86,0xcf,0x06,0x00,0x00,0xe0,0xd2,0x01,0xcf,0x86,0xd5,0x06,0xcf,0x06,
+	0x00,0x00,0xe4,0x0b,0x01,0xd3,0x06,0xcf,0x06,0x0c,0x00,0xd2,0x84,0xd1,0x50,0xd0,
+	0x1e,0xcf,0x86,0x55,0x04,0x0c,0x00,0x54,0x04,0x0c,0x00,0x53,0x04,0x0c,0x00,0x92,
+	0x0c,0x91,0x08,0x10,0x04,0x0c,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0xd5,
+	0x18,0x54,0x04,0x10,0x00,0x53,0x04,0x10,0x00,0x52,0x04,0x10,0x00,0x51,0x04,0x10,
+	0x00,0x10,0x04,0x10,0x00,0x00,0x00,0x94,0x14,0x53,0x04,0x10,0x00,0xd2,0x08,0x11,
+	0x04,0x10,0x00,0x00,0x00,0x11,0x04,0x00,0x00,0x10,0x00,0x00,0x00,0xd0,0x06,0xcf,
+	0x06,0x00,0x00,0xcf,0x86,0xd5,0x08,0x14,0x04,0x00,0x00,0x10,0x00,0xd4,0x10,0x53,
+	0x04,0x10,0x00,0x52,0x04,0x10,0x00,0x11,0x04,0x10,0x00,0x00,0x00,0x93,0x10,0x52,
+	0x04,0x10,0x01,0x91,0x08,0x10,0x04,0x10,0x01,0x10,0x00,0x00,0x00,0x00,0x00,0xd1,
+	0x6c,0xd0,0x1e,0xcf,0x86,0x55,0x04,0x10,0x00,0x54,0x04,0x10,0x00,0x93,0x10,0x52,
+	0x04,0x10,0xe6,0x51,0x04,0x10,0xe6,0x10,0x04,0x10,0xe6,0x10,0x00,0x10,0x00,0xcf,
+	0x86,0xd5,0x24,0xd4,0x10,0x93,0x0c,0x52,0x04,0x10,0x00,0x11,0x04,0x10,0x00,0x00,
+	0x00,0x00,0x00,0x53,0x04,0x10,0x00,0x92,0x0c,0x51,0x04,0x10,0x00,0x10,0x04,0x00,
+	0x00,0x10,0x00,0x10,0x00,0xd4,0x14,0x93,0x10,0x92,0x0c,0x51,0x04,0x10,0x00,0x10,
+	0x04,0x00,0x00,0x10,0x00,0x10,0x00,0x10,0x00,0x53,0x04,0x10,0x00,0x52,0x04,0x00,
+	0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x10,0x00,0x10,0x00,0xd0,0x0e,0xcf,0x86,0x95,
+	0x08,0x14,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xd3,0x06,0xcf,
+	0x06,0x00,0x00,0xd2,0x30,0xd1,0x0c,0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x06,0x14,
+	0x00,0xd0,0x1e,0xcf,0x86,0x95,0x18,0x54,0x04,0x14,0x00,0x53,0x04,0x14,0x00,0x92,
+	0x0c,0x51,0x04,0x14,0x00,0x10,0x04,0x14,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,
+	0x06,0x00,0x00,0xd1,0x4c,0xd0,0x06,0xcf,0x06,0x0d,0x00,0xcf,0x86,0xd5,0x2c,0x94,
+	0x28,0xd3,0x10,0x52,0x04,0x0d,0x00,0x91,0x08,0x10,0x04,0x0d,0x00,0x15,0x00,0x15,
+	0x00,0xd2,0x0c,0x51,0x04,0x15,0x00,0x10,0x04,0x15,0x00,0x00,0x00,0x51,0x04,0x00,
+	0x00,0x10,0x04,0x00,0x00,0x15,0x00,0x0d,0x00,0x54,0x04,0x0d,0x00,0x53,0x04,0x0d,
+	0x00,0x52,0x04,0x0d,0x00,0x51,0x04,0x0d,0x00,0x10,0x04,0x0d,0x00,0x15,0x00,0xd0,
+	0x1e,0xcf,0x86,0x95,0x18,0x94,0x14,0x53,0x04,0x15,0x00,0x52,0x04,0x00,0x00,0x51,
+	0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x0d,0x00,0x0d,0x00,0x00,0x00,0xcf,0x86,0x55,
+	0x04,0x00,0x00,0x94,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x12,0x00,0x13,
+	0x00,0x15,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0xcf,0x06,0x12,0x00,0xe2,
+	0xc6,0x01,0xd1,0x8e,0xd0,0x86,0xcf,0x86,0xd5,0x48,0xd4,0x06,0xcf,0x06,0x12,0x00,
+	0xd3,0x06,0xcf,0x06,0x12,0x00,0xd2,0x06,0xcf,0x06,0x12,0x00,0xd1,0x06,0xcf,0x06,
+	0x12,0x00,0xd0,0x06,0xcf,0x06,0x12,0x00,0xcf,0x86,0x55,0x04,0x12,0x00,0xd4,0x14,
+	0x53,0x04,0x12,0x00,0x52,0x04,0x12,0x00,0x91,0x08,0x10,0x04,0x12,0x00,0x14,0x00,
+	0x14,0x00,0x93,0x0c,0x92,0x08,0x11,0x04,0x14,0x00,0x15,0x00,0x15,0x00,0x00,0x00,
+	0xd4,0x36,0xd3,0x06,0xcf,0x06,0x12,0x00,0xd2,0x2a,0xd1,0x06,0xcf,0x06,0x12,0x00,
+	0xd0,0x06,0xcf,0x06,0x12,0x00,0xcf,0x86,0x55,0x04,0x12,0x00,0x54,0x04,0x12,0x00,
+	0x93,0x10,0x92,0x0c,0x51,0x04,0x12,0x00,0x10,0x04,0x12,0x00,0x00,0x00,0x00,0x00,
+	0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x86,0xcf,0x06,0x00,0x00,
+	0xd0,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xcf,0x86,0xd5,0xa2,0xd4,0x9c,0xd3,0x74,
+	0xd2,0x26,0xd1,0x20,0xd0,0x1a,0xcf,0x86,0x95,0x14,0x94,0x10,0x93,0x0c,0x92,0x08,
+	0x11,0x04,0x0c,0x00,0x13,0x00,0x13,0x00,0x13,0x00,0x13,0x00,0x13,0x00,0xcf,0x06,
+	0x13,0x00,0xcf,0x06,0x13,0x00,0xd1,0x48,0xd0,0x1e,0xcf,0x86,0x95,0x18,0x54,0x04,
+	0x13,0x00,0x53,0x04,0x13,0x00,0x52,0x04,0x13,0x00,0x51,0x04,0x13,0x00,0x10,0x04,
+	0x13,0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0xd5,0x18,0x54,0x04,0x00,0x00,0x93,0x10,
+	0x92,0x0c,0x51,0x04,0x15,0x00,0x10,0x04,0x15,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+	0x94,0x0c,0x93,0x08,0x12,0x04,0x00,0x00,0x15,0x00,0x00,0x00,0x13,0x00,0xcf,0x06,
+	0x13,0x00,0xd2,0x22,0xd1,0x06,0xcf,0x06,0x13,0x00,0xd0,0x06,0xcf,0x06,0x13,0x00,
+	0xcf,0x86,0x55,0x04,0x13,0x00,0x54,0x04,0x13,0x00,0x53,0x04,0x13,0x00,0x12,0x04,
+	0x13,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf,0x06,
+	0x00,0x00,0xd3,0x7f,0xd2,0x79,0xd1,0x34,0xd0,0x06,0xcf,0x06,0x10,0x00,0xcf,0x86,
+	0x55,0x04,0x10,0x00,0xd4,0x14,0x53,0x04,0x10,0x00,0x92,0x0c,0x51,0x04,0x10,0x00,
+	0x10,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0x53,0x04,0x10,0x00,0x52,0x04,0x10,0x00,
+	0x91,0x08,0x10,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0xd0,0x3f,0xcf,0x86,0xd5,0x2c,
+	0xd4,0x14,0x53,0x04,0x10,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x10,0x00,0x00,0x00,
+	0x00,0x00,0x00,0x00,0x53,0x04,0x10,0x00,0xd2,0x08,0x11,0x04,0x10,0x00,0x00,0x00,
+	0x51,0x04,0x10,0x00,0x10,0x04,0x10,0x01,0x10,0x00,0x94,0x0d,0x93,0x09,0x12,0x05,
+	0x10,0xff,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00,
+	0x00,0xcf,0x06,0x00,0x00,0xe1,0x96,0x04,0xd0,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,
+	0xcf,0x86,0xe5,0x33,0x04,0xe4,0x83,0x02,0xe3,0xf8,0x01,0xd2,0x26,0xd1,0x06,0xcf,
+	0x06,0x05,0x00,0xd0,0x06,0xcf,0x06,0x05,0x00,0xcf,0x86,0x55,0x04,0x05,0x00,0x54,
+	0x04,0x05,0x00,0x93,0x0c,0x52,0x04,0x05,0x00,0x11,0x04,0x05,0x00,0x00,0x00,0x00,
+	0x00,0xd1,0xef,0xd0,0x2a,0xcf,0x86,0x55,0x04,0x05,0x00,0x94,0x20,0xd3,0x10,0x52,
+	0x04,0x05,0x00,0x51,0x04,0x05,0x00,0x10,0x04,0x05,0x00,0x00,0x00,0x92,0x0c,0x91,
+	0x08,0x10,0x04,0x00,0x00,0x0a,0x00,0x05,0x00,0x05,0x00,0x05,0x00,0xcf,0x86,0xd5,
+	0x2a,0x54,0x04,0x05,0x00,0x53,0x04,0x05,0x00,0x52,0x04,0x05,0x00,0x51,0x04,0x05,
+	0x00,0x10,0x0d,0x05,0xff,0xf0,0x9d,0x85,0x97,0xf0,0x9d,0x85,0xa5,0x00,0x05,0xff,
+	0xf0,0x9d,0x85,0x98,0xf0,0x9d,0x85,0xa5,0x00,0xd4,0x75,0xd3,0x61,0xd2,0x44,0xd1,
+	0x22,0x10,0x11,0x05,0xff,0xf0,0x9d,0x85,0x98,0xf0,0x9d,0x85,0xa5,0xf0,0x9d,0x85,
+	0xae,0x00,0x05,0xff,0xf0,0x9d,0x85,0x98,0xf0,0x9d,0x85,0xa5,0xf0,0x9d,0x85,0xaf,
+	0x00,0x10,0x11,0x05,0xff,0xf0,0x9d,0x85,0x98,0xf0,0x9d,0x85,0xa5,0xf0,0x9d,0x85,
+	0xb0,0x00,0x05,0xff,0xf0,0x9d,0x85,0x98,0xf0,0x9d,0x85,0xa5,0xf0,0x9d,0x85,0xb1,
+	0x00,0xd1,0x15,0x10,0x11,0x05,0xff,0xf0,0x9d,0x85,0x98,0xf0,0x9d,0x85,0xa5,0xf0,
+	0x9d,0x85,0xb2,0x00,0x05,0xd8,0x10,0x04,0x05,0xd8,0x05,0x01,0xd2,0x08,0x11,0x04,
+	0x05,0x01,0x05,0x00,0x91,0x08,0x10,0x04,0x05,0x00,0x05,0xe2,0x05,0xd8,0xd3,0x12,
+	0x92,0x0d,0x51,0x04,0x05,0xd8,0x10,0x04,0x05,0xd8,0x05,0xff,0x00,0x05,0xff,0x00,
+	0x92,0x0e,0x51,0x05,0x05,0xff,0x00,0x10,0x05,0x05,0xff,0x00,0x05,0xdc,0x05,0xdc,
+	0xd0,0x97,0xcf,0x86,0xd5,0x28,0x94,0x24,0xd3,0x18,0xd2,0x0c,0x51,0x04,0x05,0xdc,
+	0x10,0x04,0x05,0xdc,0x05,0x00,0x91,0x08,0x10,0x04,0x05,0x00,0x05,0xe6,0x05,0xe6,
+	0x92,0x08,0x11,0x04,0x05,0xe6,0x05,0xdc,0x05,0x00,0x05,0x00,0xd4,0x14,0x53,0x04,
+	0x05,0x00,0xd2,0x08,0x11,0x04,0x05,0x00,0x05,0xe6,0x11,0x04,0x05,0xe6,0x05,0x00,
+	0x53,0x04,0x05,0x00,0xd2,0x15,0x51,0x04,0x05,0x00,0x10,0x04,0x05,0x00,0x05,0xff,
+	0xf0,0x9d,0x86,0xb9,0xf0,0x9d,0x85,0xa5,0x00,0xd1,0x1e,0x10,0x0d,0x05,0xff,0xf0,
+	0x9d,0x86,0xba,0xf0,0x9d,0x85,0xa5,0x00,0x05,0xff,0xf0,0x9d,0x86,0xb9,0xf0,0x9d,
+	0x85,0xa5,0xf0,0x9d,0x85,0xae,0x00,0x10,0x11,0x05,0xff,0xf0,0x9d,0x86,0xba,0xf0,
+	0x9d,0x85,0xa5,0xf0,0x9d,0x85,0xae,0x00,0x05,0xff,0xf0,0x9d,0x86,0xb9,0xf0,0x9d,
+	0x85,0xa5,0xf0,0x9d,0x85,0xaf,0x00,0xcf,0x86,0xd5,0x31,0xd4,0x21,0x93,0x1d,0x92,
+	0x19,0x91,0x15,0x10,0x11,0x05,0xff,0xf0,0x9d,0x86,0xba,0xf0,0x9d,0x85,0xa5,0xf0,
+	0x9d,0x85,0xaf,0x00,0x05,0x00,0x05,0x00,0x05,0x00,0x05,0x00,0x53,0x04,0x05,0x00,
+	0x52,0x04,0x05,0x00,0x11,0x04,0x05,0x00,0x11,0x00,0x94,0x14,0x53,0x04,0x11,0x00,
+	0x92,0x0c,0x91,0x08,0x10,0x04,0x11,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+	0xd2,0x44,0xd1,0x28,0xd0,0x06,0xcf,0x06,0x08,0x00,0xcf,0x86,0x95,0x1c,0x94,0x18,
+	0x93,0x14,0xd2,0x08,0x11,0x04,0x08,0x00,0x08,0xe6,0x91,0x08,0x10,0x04,0x08,0xe6,
+	0x08,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xd0,0x06,0xcf,0x06,0x00,0x00,
+	0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x14,0x00,0x93,0x08,0x12,0x04,0x14,0x00,
+	0x00,0x00,0x00,0x00,0xd1,0x40,0xd0,0x06,0xcf,0x06,0x07,0x00,0xcf,0x86,0xd5,0x18,
+	0x54,0x04,0x07,0x00,0x93,0x10,0x52,0x04,0x07,0x00,0x51,0x04,0x07,0x00,0x10,0x04,
+	0x07,0x00,0x00,0x00,0x00,0x00,0x54,0x04,0x09,0x00,0xd3,0x0c,0x92,0x08,0x11,0x04,
+	0x09,0x00,0x14,0x00,0x14,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x14,0x00,0x00,0x00,
+	0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xe3,0x5f,0x01,0xd2,0xb4,0xd1,0x24,0xd0,
+	0x06,0xcf,0x06,0x05,0x00,0xcf,0x86,0x95,0x18,0x54,0x04,0x05,0x00,0x93,0x10,0x52,
+	0x04,0x05,0x00,0x91,0x08,0x10,0x04,0x05,0x00,0x00,0x00,0x05,0x00,0x05,0x00,0x05,
+	0x00,0xd0,0x6a,0xcf,0x86,0xd5,0x18,0x54,0x04,0x05,0x00,0x53,0x04,0x05,0x00,0x52,
+	0x04,0x05,0x00,0x91,0x08,0x10,0x04,0x05,0x00,0x00,0x00,0x05,0x00,0xd4,0x34,0xd3,
+	0x1c,0xd2,0x0c,0x51,0x04,0x00,0x00,0x10,0x04,0x05,0x00,0x00,0x00,0xd1,0x08,0x10,
+	0x04,0x00,0x00,0x05,0x00,0x10,0x04,0x05,0x00,0x00,0x00,0xd2,0x0c,0x91,0x08,0x10,
+	0x04,0x00,0x00,0x05,0x00,0x05,0x00,0x91,0x08,0x10,0x04,0x05,0x00,0x00,0x00,0x05,
+	0x00,0x53,0x04,0x05,0x00,0xd2,0x0c,0x51,0x04,0x05,0x00,0x10,0x04,0x00,0x00,0x05,
+	0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x05,0x00,0x05,0x00,0xcf,0x86,0x95,0x20,0x94,
+	0x1c,0x93,0x18,0xd2,0x0c,0x91,0x08,0x10,0x04,0x05,0x00,0x07,0x00,0x05,0x00,0x91,
+	0x08,0x10,0x04,0x00,0x00,0x05,0x00,0x05,0x00,0x05,0x00,0x05,0x00,0x05,0x00,0xd1,
+	0xa4,0xd0,0x6a,0xcf,0x86,0xd5,0x48,0xd4,0x28,0xd3,0x10,0x52,0x04,0x05,0x00,0x51,
+	0x04,0x05,0x00,0x10,0x04,0x00,0x00,0x05,0x00,0xd2,0x0c,0x51,0x04,0x05,0x00,0x10,
+	0x04,0x05,0x00,0x00,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x05,0x00,0x05,0x00,0xd3,
+	0x10,0x52,0x04,0x05,0x00,0x91,0x08,0x10,0x04,0x05,0x00,0x00,0x00,0x05,0x00,0x52,
+	0x04,0x05,0x00,0x91,0x08,0x10,0x04,0x05,0x00,0x00,0x00,0x05,0x00,0x54,0x04,0x05,
+	0x00,0x53,0x04,0x05,0x00,0xd2,0x0c,0x51,0x04,0x05,0x00,0x10,0x04,0x00,0x00,0x05,
+	0x00,0x51,0x04,0x05,0x00,0x10,0x04,0x05,0x00,0x00,0x00,0xcf,0x86,0x95,0x34,0xd4,
+	0x20,0xd3,0x14,0x52,0x04,0x05,0x00,0xd1,0x08,0x10,0x04,0x05,0x00,0x00,0x00,0x10,
+	0x04,0x05,0x00,0x00,0x00,0x92,0x08,0x11,0x04,0x00,0x00,0x05,0x00,0x05,0x00,0x93,
+	0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x05,0x00,0x00,0x00,0x05,0x00,0x05,0x00,0x05,
+	0x00,0x05,0x00,0xcf,0x06,0x05,0x00,0xd2,0x26,0xd1,0x06,0xcf,0x06,0x05,0x00,0xd0,
+	0x1a,0xcf,0x86,0x55,0x04,0x05,0x00,0x94,0x10,0x93,0x0c,0x52,0x04,0x05,0x00,0x11,
+	0x04,0x08,0x00,0x00,0x00,0x05,0x00,0x05,0x00,0xcf,0x06,0x05,0x00,0xd1,0x06,0xcf,
+	0x06,0x05,0x00,0xd0,0x06,0xcf,0x06,0x05,0x00,0xcf,0x86,0x95,0x18,0x94,0x14,0x53,
+	0x04,0x05,0x00,0xd2,0x08,0x11,0x04,0x05,0x00,0x09,0x00,0x11,0x04,0x00,0x00,0x05,
+	0x00,0x05,0x00,0x05,0x00,0xd4,0x52,0xd3,0x06,0xcf,0x06,0x11,0x00,0xd2,0x46,0xd1,
+	0x06,0xcf,0x06,0x11,0x00,0xd0,0x3a,0xcf,0x86,0xd5,0x20,0xd4,0x0c,0x53,0x04,0x11,
+	0x00,0x12,0x04,0x11,0x00,0x00,0x00,0x53,0x04,0x00,0x00,0x92,0x0c,0x51,0x04,0x00,
+	0x00,0x10,0x04,0x00,0x00,0x11,0x00,0x11,0x00,0x94,0x14,0x93,0x10,0x92,0x0c,0x91,
+	0x08,0x10,0x04,0x00,0x00,0x11,0x00,0x11,0x00,0x11,0x00,0x11,0x00,0x00,0x00,0xcf,
+	0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xe0,0xc2,0x03,0xcf,0x86,
+	0xe5,0x03,0x01,0xd4,0xfc,0xd3,0xc0,0xd2,0x66,0xd1,0x60,0xd0,0x5a,0xcf,0x86,0xd5,
+	0x2c,0xd4,0x14,0x93,0x10,0x52,0x04,0x12,0xe6,0x51,0x04,0x12,0xe6,0x10,0x04,0x12,
+	0xe6,0x00,0x00,0x12,0xe6,0x53,0x04,0x12,0xe6,0x92,0x10,0xd1,0x08,0x10,0x04,0x12,
+	0xe6,0x00,0x00,0x10,0x04,0x00,0x00,0x12,0xe6,0x12,0xe6,0x94,0x28,0xd3,0x18,0xd2,
+	0x0c,0x51,0x04,0x12,0xe6,0x10,0x04,0x00,0x00,0x12,0xe6,0x91,0x08,0x10,0x04,0x12,
+	0xe6,0x00,0x00,0x12,0xe6,0x92,0x0c,0x51,0x04,0x12,0xe6,0x10,0x04,0x12,0xe6,0x00,
+	0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xd1,0x54,0xd0,
+	0x36,0xcf,0x86,0x55,0x04,0x15,0x00,0xd4,0x14,0x53,0x04,0x15,0x00,0x52,0x04,0x15,
+	0x00,0x91,0x08,0x10,0x04,0x15,0x00,0x00,0x00,0x00,0x00,0xd3,0x10,0x52,0x04,0x15,
+	0xe6,0x51,0x04,0x15,0xe6,0x10,0x04,0x15,0xe6,0x15,0x00,0x52,0x04,0x15,0x00,0x11,
+	0x04,0x15,0x00,0x00,0x00,0xcf,0x86,0x95,0x18,0x94,0x14,0x53,0x04,0x15,0x00,0xd2,
+	0x08,0x11,0x04,0x15,0x00,0x00,0x00,0x11,0x04,0x00,0x00,0x15,0x00,0x00,0x00,0x00,
+	0x00,0xcf,0x06,0x00,0x00,0xd2,0x36,0xd1,0x06,0xcf,0x06,0x00,0x00,0xd0,0x06,0xcf,
+	0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x15,0x00,0xd4,0x0c,0x53,0x04,0x15,0x00,0x12,
+	0x04,0x15,0x00,0x15,0xe6,0x53,0x04,0x15,0x00,0xd2,0x08,0x11,0x04,0x15,0x00,0x00,
+	0x00,0x51,0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x15,0x00,0xcf,0x06,0x00,0x00,0xcf,
+	0x06,0x00,0x00,0xd4,0x82,0xd3,0x7c,0xd2,0x3e,0xd1,0x06,0xcf,0x06,0x10,0x00,0xd0,
+	0x06,0xcf,0x06,0x10,0x00,0xcf,0x86,0x95,0x2c,0xd4,0x18,0x93,0x14,0x52,0x04,0x10,
+	0x00,0xd1,0x08,0x10,0x04,0x10,0x00,0x00,0x00,0x10,0x04,0x00,0x00,0x10,0x00,0x10,
+	0x00,0x93,0x10,0x52,0x04,0x10,0xdc,0x51,0x04,0x10,0xdc,0x10,0x04,0x10,0xdc,0x00,
+	0x00,0x00,0x00,0x00,0x00,0xd1,0x38,0xd0,0x06,0xcf,0x06,0x12,0x00,0xcf,0x86,0x95,
+	0x2c,0xd4,0x18,0xd3,0x08,0x12,0x04,0x12,0x00,0x12,0xe6,0x92,0x0c,0x51,0x04,0x12,
+	0xe6,0x10,0x04,0x12,0x07,0x15,0x00,0x00,0x00,0x53,0x04,0x12,0x00,0xd2,0x08,0x11,
+	0x04,0x12,0x00,0x00,0x00,0x11,0x04,0x00,0x00,0x12,0x00,0x00,0x00,0xcf,0x06,0x00,
+	0x00,0xcf,0x06,0x00,0x00,0xd3,0x82,0xd2,0x48,0xd1,0x24,0xd0,0x06,0xcf,0x06,0x00,
+	0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x00,0x00,0x93,0x10,0x92,0x0c,0x91,
+	0x08,0x10,0x04,0x00,0x00,0x14,0x00,0x14,0x00,0x14,0x00,0x14,0x00,0xd0,0x1e,0xcf,
+	0x86,0x55,0x04,0x14,0x00,0x54,0x04,0x14,0x00,0x93,0x10,0x52,0x04,0x14,0x00,0x91,
+	0x08,0x10,0x04,0x14,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xd1,
+	0x34,0xd0,0x2e,0xcf,0x86,0xd5,0x18,0x94,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,
+	0x04,0x00,0x00,0x15,0x00,0x15,0x00,0x15,0x00,0x15,0x00,0x15,0x00,0x54,0x04,0x15,
+	0x00,0x53,0x04,0x15,0x00,0x52,0x04,0x15,0x00,0x11,0x04,0x15,0x00,0x00,0x00,0xcf,
+	0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xe2,0xb2,0x01,0xe1,0x41,0x01,0xd0,0x6e,0xcf,
+	0x86,0xd5,0x18,0x94,0x14,0x93,0x10,0x52,0x04,0x0d,0x00,0x91,0x08,0x10,0x04,0x00,
+	0x00,0x0d,0x00,0x0d,0x00,0x0d,0x00,0x0d,0x00,0xd4,0x30,0xd3,0x20,0xd2,0x10,0xd1,
+	0x08,0x10,0x04,0x00,0x00,0x0d,0x00,0x10,0x04,0x0d,0x00,0x00,0x00,0xd1,0x08,0x10,
+	0x04,0x0d,0x00,0x00,0x00,0x10,0x04,0x00,0x00,0x0d,0x00,0x92,0x0c,0x91,0x08,0x10,
+	0x04,0x00,0x00,0x0d,0x00,0x0d,0x00,0x0d,0x00,0xd3,0x10,0x92,0x0c,0x51,0x04,0x0d,
+	0x00,0x10,0x04,0x0d,0x00,0x00,0x00,0x0d,0x00,0x92,0x10,0xd1,0x08,0x10,0x04,0x00,
+	0x00,0x0d,0x00,0x10,0x04,0x00,0x00,0x0d,0x00,0x00,0x00,0xcf,0x86,0xd5,0x74,0xd4,
+	0x34,0xd3,0x18,0xd2,0x0c,0x51,0x04,0x00,0x00,0x10,0x04,0x0d,0x00,0x00,0x00,0x51,
+	0x04,0x00,0x00,0x10,0x04,0x00,0x00,0x0d,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,0x00,
+	0x00,0x0d,0x00,0x10,0x04,0x00,0x00,0x0d,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x0d,
+	0x00,0x0d,0x00,0xd3,0x20,0xd2,0x10,0xd1,0x08,0x10,0x04,0x00,0x00,0x0d,0x00,0x10,
+	0x04,0x0d,0x00,0x00,0x00,0xd1,0x08,0x10,0x04,0x0d,0x00,0x00,0x00,0x10,0x04,0x00,
+	0x00,0x0d,0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,0x00,0x00,0x0d,0x00,0x10,0x04,0x00,
+	0x00,0x0d,0x00,0xd1,0x08,0x10,0x04,0x00,0x00,0x0d,0x00,0x10,0x04,0x00,0x00,0x0d,
+	0x00,0xd4,0x30,0xd3,0x20,0xd2,0x10,0xd1,0x08,0x10,0x04,0x00,0x00,0x0d,0x00,0x10,
+	0x04,0x0d,0x00,0x00,0x00,0xd1,0x08,0x10,0x04,0x0d,0x00,0x00,0x00,0x10,0x04,0x00,
+	0x00,0x0d,0x00,0x92,0x0c,0x51,0x04,0x0d,0x00,0x10,0x04,0x0d,0x00,0x00,0x00,0x0d,
+	0x00,0xd3,0x10,0x92,0x0c,0x51,0x04,0x0d,0x00,0x10,0x04,0x0d,0x00,0x00,0x00,0x0d,
+	0x00,0xd2,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x0d,0x00,0x0d,0x00,0xd1,0x08,0x10,
+	0x04,0x0d,0x00,0x00,0x00,0x10,0x04,0x0d,0x00,0x00,0x00,0xd0,0x56,0xcf,0x86,0xd5,
+	0x20,0xd4,0x14,0x53,0x04,0x0d,0x00,0x92,0x0c,0x51,0x04,0x0d,0x00,0x10,0x04,0x00,
+	0x00,0x0d,0x00,0x0d,0x00,0x53,0x04,0x0d,0x00,0x12,0x04,0x0d,0x00,0x00,0x00,0xd4,
+	0x28,0xd3,0x18,0xd2,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x0d,0x00,0x0d,0x00,0x91,
+	0x08,0x10,0x04,0x00,0x00,0x0d,0x00,0x0d,0x00,0x92,0x0c,0x51,0x04,0x0d,0x00,0x10,
+	0x04,0x00,0x00,0x0d,0x00,0x0d,0x00,0x53,0x04,0x0d,0x00,0x12,0x04,0x0d,0x00,0x00,
+	0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x00,0x00,0x93,0x0c,0x92,0x08,0x11,
+	0x04,0x0d,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x86,0xe5,
+	0x96,0x05,0xe4,0x28,0x03,0xe3,0xed,0x01,0xd2,0xa0,0xd1,0x1c,0xd0,0x16,0xcf,0x86,
+	0x55,0x04,0x0a,0x00,0x94,0x0c,0x53,0x04,0x0a,0x00,0x12,0x04,0x0a,0x00,0x00,0x00,
+	0x0a,0x00,0xcf,0x06,0x0a,0x00,0xd0,0x46,0xcf,0x86,0xd5,0x10,0x54,0x04,0x0a,0x00,
+	0x93,0x08,0x12,0x04,0x0a,0x00,0x00,0x00,0x00,0x00,0xd4,0x14,0x53,0x04,0x0c,0x00,
+	0x52,0x04,0x0c,0x00,0x51,0x04,0x0c,0x00,0x10,0x04,0x0c,0x00,0x00,0x00,0xd3,0x10,
+	0x92,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x0c,0x00,0x0c,0x00,0x0c,0x00,0x52,0x04,
+	0x0c,0x00,0x51,0x04,0x0c,0x00,0x10,0x04,0x0c,0x00,0x10,0x00,0xcf,0x86,0xd5,0x28,
+	0xd4,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x0c,0x00,0x0c,0x00,
+	0x0c,0x00,0x0c,0x00,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x00,0x00,0x0c,0x00,
+	0x0c,0x00,0x0c,0x00,0x0c,0x00,0x54,0x04,0x10,0x00,0x93,0x0c,0x52,0x04,0x10,0x00,
+	0x11,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0xd1,0xe4,0xd0,0x5a,0xcf,0x86,0xd5,0x20,
+	0x94,0x1c,0x53,0x04,0x0b,0x00,0xd2,0x0c,0x51,0x04,0x0b,0x00,0x10,0x04,0x0b,0x00,
+	0x10,0x00,0x91,0x08,0x10,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0x0b,0x00,0xd4,0x14,
+	0x53,0x04,0x0b,0x00,0x52,0x04,0x0b,0x00,0x51,0x04,0x0b,0x00,0x10,0x04,0x0b,0x00,
+	0x14,0x00,0xd3,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x0c,0x00,0x0b,0x00,0x0c,0x00,
+	0x0c,0x00,0x52,0x04,0x0c,0x00,0xd1,0x08,0x10,0x04,0x0c,0x00,0x0b,0x00,0x10,0x04,
+	0x0c,0x00,0x0b,0x00,0xcf,0x86,0xd5,0x4c,0xd4,0x2c,0xd3,0x18,0xd2,0x0c,0x51,0x04,
+	0x0c,0x00,0x10,0x04,0x0b,0x00,0x0c,0x00,0x51,0x04,0x0c,0x00,0x10,0x04,0x0b,0x00,
+	0x0c,0x00,0xd2,0x08,0x11,0x04,0x0c,0x00,0x0b,0x00,0x51,0x04,0x0b,0x00,0x10,0x04,
+	0x0b,0x00,0x0c,0x00,0xd3,0x10,0x52,0x04,0x0c,0x00,0x51,0x04,0x0c,0x00,0x10,0x04,
+	0x0c,0x00,0x0b,0x00,0x52,0x04,0x0c,0x00,0x51,0x04,0x0c,0x00,0x10,0x04,0x0c,0x00,
+	0x0b,0x00,0xd4,0x18,0x53,0x04,0x0c,0x00,0xd2,0x08,0x11,0x04,0x0c,0x00,0x0d,0x00,
+	0x91,0x08,0x10,0x04,0x15,0x00,0x00,0x00,0x00,0x00,0x53,0x04,0x0c,0x00,0xd2,0x10,
+	0xd1,0x08,0x10,0x04,0x0c,0x00,0x0b,0x00,0x10,0x04,0x0c,0x00,0x0b,0x00,0xd1,0x08,
+	0x10,0x04,0x0b,0x00,0x0c,0x00,0x10,0x04,0x0c,0x00,0x0b,0x00,0xd0,0x4e,0xcf,0x86,
+	0xd5,0x34,0xd4,0x14,0x53,0x04,0x0c,0x00,0xd2,0x08,0x11,0x04,0x0c,0x00,0x0b,0x00,
+	0x11,0x04,0x0b,0x00,0x0c,0x00,0xd3,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x0b,0x00,
+	0x0c,0x00,0x0c,0x00,0x0c,0x00,0x92,0x0c,0x51,0x04,0x0c,0x00,0x10,0x04,0x0c,0x00,
+	0x12,0x00,0x12,0x00,0x94,0x14,0x53,0x04,0x12,0x00,0x52,0x04,0x12,0x00,0x91,0x08,
+	0x10,0x04,0x12,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,
+	0x94,0x10,0x93,0x0c,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x0c,0x00,0x0c,0x00,
+	0x0c,0x00,0xd2,0x7e,0xd1,0x78,0xd0,0x3e,0xcf,0x86,0xd5,0x1c,0x94,0x18,0x93,0x14,
+	0x92,0x10,0xd1,0x08,0x10,0x04,0x0b,0x00,0x0c,0x00,0x10,0x04,0x0c,0x00,0x00,0x00,
+	0x00,0x00,0x00,0x00,0x0b,0x00,0x54,0x04,0x0b,0x00,0xd3,0x0c,0x92,0x08,0x11,0x04,
+	0x0b,0x00,0x0c,0x00,0x0c,0x00,0x92,0x0c,0x51,0x04,0x0c,0x00,0x10,0x04,0x0c,0x00,
+	0x12,0x00,0x00,0x00,0xcf,0x86,0xd5,0x24,0xd4,0x14,0x53,0x04,0x0b,0x00,0x92,0x0c,
+	0x91,0x08,0x10,0x04,0x0b,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x93,0x0c,0x92,0x08,
+	0x11,0x04,0x0c,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x94,0x10,0x93,0x0c,0x52,0x04,
+	0x13,0x00,0x11,0x04,0x13,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,
+	0xd1,0x58,0xd0,0x3a,0xcf,0x86,0x55,0x04,0x0c,0x00,0xd4,0x20,0xd3,0x10,0x92,0x0c,
+	0x91,0x08,0x10,0x04,0x0c,0x00,0x10,0x00,0x10,0x00,0x10,0x00,0x52,0x04,0x10,0x00,
+	0x91,0x08,0x10,0x04,0x10,0x00,0x11,0x00,0x11,0x00,0x93,0x10,0x52,0x04,0x0c,0x00,
+	0x51,0x04,0x0c,0x00,0x10,0x04,0x10,0x00,0x0c,0x00,0x0c,0x00,0xcf,0x86,0x55,0x04,
+	0x0c,0x00,0x54,0x04,0x0c,0x00,0x53,0x04,0x0c,0x00,0x52,0x04,0x0c,0x00,0x91,0x08,
+	0x10,0x04,0x0c,0x00,0x10,0x00,0x11,0x00,0xd0,0x16,0xcf,0x86,0x95,0x10,0x54,0x04,
+	0x0c,0x00,0x93,0x08,0x12,0x04,0x0c,0x00,0x10,0x00,0x10,0x00,0x0c,0x00,0xcf,0x86,
+	0xd5,0x34,0xd4,0x28,0xd3,0x10,0x52,0x04,0x0c,0x00,0x91,0x08,0x10,0x04,0x0c,0x00,
+	0x10,0x00,0x0c,0x00,0xd2,0x0c,0x51,0x04,0x0c,0x00,0x10,0x04,0x0c,0x00,0x10,0x00,
+	0x51,0x04,0x10,0x00,0x10,0x04,0x10,0x00,0x11,0x00,0x93,0x08,0x12,0x04,0x11,0x00,
+	0x10,0x00,0x10,0x00,0x54,0x04,0x0c,0x00,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,
+	0x0c,0x00,0x10,0x00,0x10,0x00,0x10,0x00,0x11,0x00,0xd3,0xfc,0xd2,0x6c,0xd1,0x3c,
+	0xd0,0x1e,0xcf,0x86,0x55,0x04,0x0c,0x00,0x54,0x04,0x0c,0x00,0x53,0x04,0x0c,0x00,
+	0x52,0x04,0x0c,0x00,0x51,0x04,0x0c,0x00,0x10,0x04,0x0c,0x00,0x10,0x00,0xcf,0x86,
+	0x95,0x18,0x94,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x0c,0x00,0x10,0x00,
+	0x0c,0x00,0x0c,0x00,0x0c,0x00,0x0c,0x00,0x0c,0x00,0xd0,0x06,0xcf,0x06,0x0c,0x00,
+	0xcf,0x86,0x55,0x04,0x0c,0x00,0x54,0x04,0x0c,0x00,0x53,0x04,0x0c,0x00,0xd2,0x0c,
+	0x91,0x08,0x10,0x04,0x10,0x00,0x0c,0x00,0x0c,0x00,0xd1,0x08,0x10,0x04,0x0c,0x00,
+	0x10,0x00,0x10,0x04,0x10,0x00,0x11,0x00,0xd1,0x54,0xd0,0x1a,0xcf,0x86,0x55,0x04,
+	0x0c,0x00,0x54,0x04,0x0c,0x00,0x53,0x04,0x0c,0x00,0x52,0x04,0x0c,0x00,0x11,0x04,
+	0x0c,0x00,0x10,0x00,0xcf,0x86,0xd5,0x1c,0x94,0x18,0xd3,0x08,0x12,0x04,0x0d,0x00,
+	0x10,0x00,0x92,0x0c,0x51,0x04,0x10,0x00,0x10,0x04,0x10,0x00,0x11,0x00,0x11,0x00,
+	0x0c,0x00,0xd4,0x08,0x13,0x04,0x0c,0x00,0x10,0x00,0x53,0x04,0x10,0x00,0x92,0x0c,
+	0x51,0x04,0x10,0x00,0x10,0x04,0x12,0x00,0x10,0x00,0x10,0x00,0xd0,0x1e,0xcf,0x86,
+	0x55,0x04,0x10,0x00,0x94,0x14,0x93,0x10,0x52,0x04,0x10,0x00,0x91,0x08,0x10,0x04,
+	0x12,0x00,0x10,0x00,0x10,0x00,0x10,0x00,0x10,0x00,0xcf,0x86,0x55,0x04,0x10,0x00,
+	0x54,0x04,0x10,0x00,0x53,0x04,0x10,0x00,0x92,0x0c,0x51,0x04,0x10,0x00,0x10,0x04,
+	0x10,0x00,0x0c,0x00,0x0c,0x00,0xe2,0x19,0x01,0xd1,0xa8,0xd0,0x7e,0xcf,0x86,0xd5,
+	0x4c,0xd4,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x0d,0x00,0x0c,0x00,0x0c,
+	0x00,0x0c,0x00,0x0c,0x00,0xd3,0x1c,0xd2,0x0c,0x91,0x08,0x10,0x04,0x0c,0x00,0x0d,
+	0x00,0x0c,0x00,0xd1,0x08,0x10,0x04,0x0c,0x00,0x0d,0x00,0x10,0x04,0x0c,0x00,0x0d,
+	0x00,0xd2,0x10,0xd1,0x08,0x10,0x04,0x0c,0x00,0x0d,0x00,0x10,0x04,0x0c,0x00,0x0d,
+	0x00,0x51,0x04,0x0c,0x00,0x10,0x04,0x0c,0x00,0x0d,0x00,0xd4,0x1c,0xd3,0x0c,0x52,
+	0x04,0x0c,0x00,0x11,0x04,0x0c,0x00,0x0d,0x00,0x52,0x04,0x0c,0x00,0x91,0x08,0x10,
+	0x04,0x0d,0x00,0x0c,0x00,0x0d,0x00,0x93,0x10,0x52,0x04,0x0c,0x00,0x91,0x08,0x10,
+	0x04,0x0d,0x00,0x0c,0x00,0x0c,0x00,0x0c,0x00,0xcf,0x86,0x95,0x24,0x94,0x20,0x93,
+	0x1c,0xd2,0x10,0xd1,0x08,0x10,0x04,0x0c,0x00,0x10,0x00,0x10,0x04,0x10,0x00,0x11,
+	0x00,0x91,0x08,0x10,0x04,0x11,0x00,0x0c,0x00,0x0c,0x00,0x0c,0x00,0x10,0x00,0x10,
+	0x00,0xd0,0x06,0xcf,0x06,0x0c,0x00,0xcf,0x86,0xd5,0x30,0xd4,0x10,0x93,0x0c,0x52,
+	0x04,0x0c,0x00,0x11,0x04,0x0c,0x00,0x10,0x00,0x10,0x00,0x93,0x1c,0xd2,0x10,0xd1,
+	0x08,0x10,0x04,0x11,0x00,0x12,0x00,0x10,0x04,0x12,0x00,0x13,0x00,0x91,0x08,0x10,
+	0x04,0x13,0x00,0x15,0x00,0x00,0x00,0x00,0x00,0xd4,0x14,0x53,0x04,0x10,0x00,0x52,
+	0x04,0x10,0x00,0x91,0x08,0x10,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0xd3,0x10,0x52,
+	0x04,0x10,0x00,0x51,0x04,0x12,0x00,0x10,0x04,0x12,0x00,0x13,0x00,0x92,0x10,0xd1,
+	0x08,0x10,0x04,0x13,0x00,0x14,0x00,0x10,0x04,0x15,0x00,0x00,0x00,0x00,0x00,0xd1,
+	0x1c,0xd0,0x06,0xcf,0x06,0x0c,0x00,0xcf,0x86,0x55,0x04,0x0c,0x00,0x54,0x04,0x0c,
+	0x00,0x93,0x08,0x12,0x04,0x0c,0x00,0x00,0x00,0x00,0x00,0xd0,0x06,0xcf,0x06,0x10,
+	0x00,0xcf,0x86,0xd5,0x24,0x54,0x04,0x10,0x00,0xd3,0x10,0x52,0x04,0x10,0x00,0x91,
+	0x08,0x10,0x04,0x10,0x00,0x14,0x00,0x14,0x00,0x92,0x0c,0x91,0x08,0x10,0x04,0x14,
+	0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x94,0x0c,0x53,0x04,0x15,0x00,0x12,0x04,0x15,
+	0x00,0x00,0x00,0x00,0x00,0xe4,0x40,0x02,0xe3,0xc9,0x01,0xd2,0x5c,0xd1,0x34,0xd0,
+	0x16,0xcf,0x86,0x95,0x10,0x94,0x0c,0x53,0x04,0x10,0x00,0x12,0x04,0x10,0x00,0x00,
+	0x00,0x10,0x00,0x10,0x00,0xcf,0x86,0x95,0x18,0xd4,0x08,0x13,0x04,0x10,0x00,0x00,
+	0x00,0x53,0x04,0x10,0x00,0x92,0x08,0x11,0x04,0x10,0x00,0x00,0x00,0x00,0x00,0x10,
+	0x00,0xd0,0x22,0xcf,0x86,0xd5,0x0c,0x94,0x08,0x13,0x04,0x10,0x00,0x00,0x00,0x10,
+	0x00,0x94,0x10,0x53,0x04,0x10,0x00,0x52,0x04,0x10,0x00,0x11,0x04,0x10,0x00,0x00,
+	0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xd1,0xc0,0xd0,0x5e,0xcf,0x86,0xd5,0x30,0xd4,
+	0x14,0x53,0x04,0x13,0x00,0x52,0x04,0x13,0x00,0x91,0x08,0x10,0x04,0x00,0x00,0x15,
+	0x00,0x15,0x00,0x53,0x04,0x11,0x00,0xd2,0x0c,0x91,0x08,0x10,0x04,0x11,0x00,0x12,
+	0x00,0x12,0x00,0x51,0x04,0x12,0x00,0x10,0x04,0x12,0x00,0x13,0x00,0xd4,0x08,0x13,
+	0x04,0x12,0x00,0x13,0x00,0xd3,0x14,0x92,0x10,0xd1,0x08,0x10,0x04,0x12,0x00,0x13,
+	0x00,0x10,0x04,0x13,0x00,0x12,0x00,0x12,0x00,0x52,0x04,0x12,0x00,0x51,0x04,0x12,
+	0x00,0x10,0x04,0x12,0x00,0x15,0x00,0xcf,0x86,0xd5,0x28,0xd4,0x14,0x53,0x04,0x12,
+	0x00,0x52,0x04,0x12,0x00,0x91,0x08,0x10,0x04,0x13,0x00,0x14,0x00,0x14,0x00,0x53,
+	0x04,0x12,0x00,0x52,0x04,0x12,0x00,0x51,0x04,0x12,0x00,0x10,0x04,0x12,0x00,0x13,
+	0x00,0xd4,0x0c,0x53,0x04,0x13,0x00,0x12,0x04,0x13,0x00,0x14,0x00,0xd3,0x1c,0xd2,
+	0x10,0xd1,0x08,0x10,0x04,0x14,0x00,0x15,0x00,0x10,0x04,0x00,0x00,0x14,0x00,0x51,
+	0x04,0x14,0x00,0x10,0x04,0x14,0x00,0x00,0x00,0x92,0x0c,0x51,0x04,0x00,0x00,0x10,
+	0x04,0x14,0x00,0x15,0x00,0x14,0x00,0xd0,0x62,0xcf,0x86,0xd5,0x24,0xd4,0x14,0x93,
+	0x10,0x52,0x04,0x11,0x00,0x91,0x08,0x10,0x04,0x11,0x00,0x12,0x00,0x12,0x00,0x12,
+	0x00,0x93,0x0c,0x92,0x08,0x11,0x04,0x12,0x00,0x13,0x00,0x13,0x00,0x14,0x00,0xd4,
+	0x2c,0xd3,0x18,0xd2,0x0c,0x51,0x04,0x14,0x00,0x10,0x04,0x14,0x00,0x00,0x00,0x91,
+	0x08,0x10,0x04,0x00,0x00,0x15,0x00,0x15,0x00,0xd2,0x0c,0x51,0x04,0x15,0x00,0x10,
+	0x04,0x15,0x00,0x00,0x00,0x11,0x04,0x00,0x00,0x15,0x00,0x53,0x04,0x14,0x00,0x92,
+	0x08,0x11,0x04,0x14,0x00,0x15,0x00,0x15,0x00,0xcf,0x86,0xd5,0x30,0x94,0x2c,0xd3,
+	0x14,0x92,0x10,0xd1,0x08,0x10,0x04,0x11,0x00,0x14,0x00,0x10,0x04,0x14,0x00,0x15,
+	0x00,0x15,0x00,0xd2,0x0c,0x51,0x04,0x15,0x00,0x10,0x04,0x15,0x00,0x00,0x00,0x91,
+	0x08,0x10,0x04,0x00,0x00,0x15,0x00,0x15,0x00,0x13,0x00,0x94,0x14,0x93,0x10,0x52,
+	0x04,0x13,0x00,0x51,0x04,0x13,0x00,0x10,0x04,0x13,0x00,0x14,0x00,0x14,0x00,0x14,
+	0x00,0xd2,0x70,0xd1,0x40,0xd0,0x06,0xcf,0x06,0x15,0x00,0xcf,0x86,0xd5,0x10,0x54,
+	0x04,0x15,0x00,0x93,0x08,0x12,0x04,0x15,0x00,0x00,0x00,0x00,0x00,0xd4,0x10,0x53,
+	0x04,0x14,0x00,0x52,0x04,0x14,0x00,0x11,0x04,0x14,0x00,0x00,0x00,0xd3,0x08,0x12,
+	0x04,0x15,0x00,0x00,0x00,0x92,0x0c,0x51,0x04,0x15,0x00,0x10,0x04,0x15,0x00,0x00,
+	0x00,0x00,0x00,0xd0,0x2a,0xcf,0x86,0x95,0x24,0xd4,0x14,0x93,0x10,0x92,0x0c,0x51,
+	0x04,0x15,0x00,0x10,0x04,0x15,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x93,0x0c,0x52,
+	0x04,0x15,0x00,0x11,0x04,0x15,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,
+	0x00,0xcf,0x06,0x00,0x00,0xd3,0x06,0xcf,0x06,0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,
+	0x00,0xd1,0x06,0xcf,0x06,0x00,0x00,0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,
+	0x04,0x00,0x00,0x54,0x04,0x00,0x00,0x53,0x04,0x00,0x00,0x52,0x04,0x00,0x00,0x11,
+	0x04,0x00,0x00,0x02,0x00,0xe4,0xf9,0x12,0xd3,0x08,0xcf,0x86,0xcf,0x06,0x05,0x00,
+	0xd2,0xc2,0xd1,0x08,0xcf,0x86,0xcf,0x06,0x05,0x00,0xd0,0x44,0xcf,0x86,0xd5,0x3c,
+	0xd4,0x06,0xcf,0x06,0x05,0x00,0xd3,0x06,0xcf,0x06,0x05,0x00,0xd2,0x2a,0xd1,0x06,
+	0xcf,0x06,0x05,0x00,0xd0,0x06,0xcf,0x06,0x05,0x00,0xcf,0x86,0x95,0x18,0x54,0x04,
+	0x05,0x00,0x93,0x10,0x52,0x04,0x05,0x00,0x51,0x04,0x05,0x00,0x10,0x04,0x05,0x00,
+	0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x0b,0x00,0xcf,0x06,0x0b,0x00,0xcf,0x86,
+	0xd5,0x3c,0xd4,0x06,0xcf,0x06,0x0b,0x00,0xd3,0x06,0xcf,0x06,0x0b,0x00,0xd2,0x06,
+	0xcf,0x06,0x0b,0x00,0xd1,0x24,0xd0,0x1e,0xcf,0x86,0x55,0x04,0x0b,0x00,0x54,0x04,
+	0x0b,0x00,0x93,0x10,0x52,0x04,0x0b,0x00,0x91,0x08,0x10,0x04,0x0b,0x00,0x00,0x00,
+	0x00,0x00,0x00,0x00,0xcf,0x06,0x0c,0x00,0xcf,0x06,0x0c,0x00,0xd4,0x32,0xd3,0x2c,
+	0xd2,0x26,0xd1,0x20,0xd0,0x1a,0xcf,0x86,0x95,0x14,0x54,0x04,0x0c,0x00,0x53,0x04,
+	0x0c,0x00,0x52,0x04,0x0c,0x00,0x11,0x04,0x0c,0x00,0x00,0x00,0x11,0x00,0xcf,0x06,
+	0x11,0x00,0xcf,0x06,0x11,0x00,0xcf,0x06,0x11,0x00,0xcf,0x06,0x11,0x00,0xcf,0x06,
+	0x11,0x00,0xd1,0x48,0xd0,0x40,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x11,0x00,0xd4,0x06,
+	0xcf,0x06,0x11,0x00,0xd3,0x06,0xcf,0x06,0x11,0x00,0xd2,0x26,0xd1,0x06,0xcf,0x06,
+	0x11,0x00,0xd0,0x1a,0xcf,0x86,0x55,0x04,0x11,0x00,0x94,0x10,0x93,0x0c,0x92,0x08,
+	0x11,0x04,0x11,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x13,0x00,0xcf,0x06,0x13,0x00,
+	0xcf,0x06,0x13,0x00,0xcf,0x86,0xcf,0x06,0x13,0x00,0xd0,0x44,0xcf,0x86,0xd5,0x06,
+	0xcf,0x06,0x13,0x00,0xd4,0x36,0xd3,0x06,0xcf,0x06,0x13,0x00,0xd2,0x06,0xcf,0x06,
+	0x13,0x00,0xd1,0x06,0xcf,0x06,0x13,0x00,0xd0,0x06,0xcf,0x06,0x13,0x00,0xcf,0x86,
+	0x55,0x04,0x13,0x00,0x94,0x14,0x93,0x10,0x92,0x0c,0x91,0x08,0x10,0x04,0x13,0x00,
+	0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x86,
+	0xd5,0x06,0xcf,0x06,0x00,0x00,0xe4,0x68,0x11,0xe3,0x51,0x10,0xe2,0x17,0x08,0xe1,
+	0x06,0x04,0xe0,0x03,0x02,0xcf,0x86,0xe5,0x06,0x01,0xd4,0x82,0xd3,0x41,0xd2,0x21,
+	0xd1,0x10,0x10,0x08,0x05,0xff,0xe4,0xb8,0xbd,0x00,0x05,0xff,0xe4,0xb8,0xb8,0x00,
+	0x10,0x08,0x05,0xff,0xe4,0xb9,0x81,0x00,0x05,0xff,0xf0,0xa0,0x84,0xa2,0x00,0xd1,
+	0x10,0x10,0x08,0x05,0xff,0xe4,0xbd,0xa0,0x00,0x05,0xff,0xe4,0xbe,0xae,0x00,0x10,
+	0x08,0x05,0xff,0xe4,0xbe,0xbb,0x00,0x05,0xff,0xe5,0x80,0x82,0x00,0xd2,0x20,0xd1,
+	0x10,0x10,0x08,0x05,0xff,0xe5,0x81,0xba,0x00,0x05,0xff,0xe5,0x82,0x99,0x00,0x10,
+	0x08,0x05,0xff,0xe5,0x83,0xa7,0x00,0x05,0xff,0xe5,0x83,0x8f,0x00,0xd1,0x11,0x10,
+	0x08,0x05,0xff,0xe3,0x92,0x9e,0x00,0x05,0xff,0xf0,0xa0,0x98,0xba,0x00,0x10,0x08,
+	0x05,0xff,0xe5,0x85,0x8d,0x00,0x05,0xff,0xe5,0x85,0x94,0x00,0xd3,0x42,0xd2,0x21,
+	0xd1,0x10,0x10,0x08,0x05,0xff,0xe5,0x85,0xa4,0x00,0x05,0xff,0xe5,0x85,0xb7,0x00,
+	0x10,0x09,0x05,0xff,0xf0,0xa0,0x94,0x9c,0x00,0x05,0xff,0xe3,0x92,0xb9,0x00,0xd1,
+	0x10,0x10,0x08,0x05,0xff,0xe5,0x85,0xa7,0x00,0x05,0xff,0xe5,0x86,0x8d,0x00,0x10,
+	0x09,0x05,0xff,0xf0,0xa0,0x95,0x8b,0x00,0x05,0xff,0xe5,0x86,0x97,0x00,0xd2,0x20,
+	0xd1,0x10,0x10,0x08,0x05,0xff,0xe5,0x86,0xa4,0x00,0x05,0xff,0xe4,0xbb,0x8c,0x00,
+	0x10,0x08,0x05,0xff,0xe5,0x86,0xac,0x00,0x05,0xff,0xe5,0x86,0xb5,0x00,0xd1,0x11,
+	0x10,0x09,0x05,0xff,0xf0,0xa9,0x87,0x9f,0x00,0x05,0xff,0xe5,0x87,0xb5,0x00,0x10,
+	0x08,0x05,0xff,0xe5,0x88,0x83,0x00,0x05,0xff,0xe3,0x93,0x9f,0x00,0xd4,0x80,0xd3,
+	0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe5,0x88,0xbb,0x00,0x05,0xff,0xe5,
+	0x89,0x86,0x00,0x10,0x08,0x05,0xff,0xe5,0x89,0xb2,0x00,0x05,0xff,0xe5,0x89,0xb7,
+	0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe3,0x94,0x95,0x00,0x05,0xff,0xe5,0x8b,0x87,
+	0x00,0x10,0x08,0x05,0xff,0xe5,0x8b,0x89,0x00,0x05,0xff,0xe5,0x8b,0xa4,0x00,0xd2,
+	0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe5,0x8b,0xba,0x00,0x05,0xff,0xe5,0x8c,0x85,
+	0x00,0x10,0x08,0x05,0xff,0xe5,0x8c,0x86,0x00,0x05,0xff,0xe5,0x8c,0x97,0x00,0xd1,
+	0x10,0x10,0x08,0x05,0xff,0xe5,0x8d,0x89,0x00,0x05,0xff,0xe5,0x8d,0x91,0x00,0x10,
+	0x08,0x05,0xff,0xe5,0x8d,0x9a,0x00,0x05,0xff,0xe5,0x8d,0xb3,0x00,0xd3,0x39,0xd2,
+	0x18,0x91,0x10,0x10,0x08,0x05,0xff,0xe5,0x8d,0xbd,0x00,0x05,0xff,0xe5,0x8d,0xbf,
+	0x00,0x05,0xff,0xe5,0x8d,0xbf,0x00,0xd1,0x11,0x10,0x09,0x05,0xff,0xf0,0xa0,0xa8,
+	0xac,0x00,0x05,0xff,0xe7,0x81,0xb0,0x00,0x10,0x08,0x05,0xff,0xe5,0x8f,0x8a,0x00,
+	0x05,0xff,0xe5,0x8f,0x9f,0x00,0xd2,0x21,0xd1,0x11,0x10,0x09,0x05,0xff,0xf0,0xa0,
+	0xad,0xa3,0x00,0x05,0xff,0xe5,0x8f,0xab,0x00,0x10,0x08,0x05,0xff,0xe5,0x8f,0xb1,
+	0x00,0x05,0xff,0xe5,0x90,0x86,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe5,0x92,0x9e,
+	0x00,0x05,0xff,0xe5,0x90,0xb8,0x00,0x10,0x08,0x05,0xff,0xe5,0x91,0x88,0x00,0x05,
+	0xff,0xe5,0x91,0xa8,0x00,0xcf,0x86,0xe5,0x02,0x01,0xd4,0x80,0xd3,0x40,0xd2,0x20,
+	0xd1,0x10,0x10,0x08,0x05,0xff,0xe5,0x92,0xa2,0x00,0x05,0xff,0xe5,0x93,0xb6,0x00,
+	0x10,0x08,0x05,0xff,0xe5,0x94,0x90,0x00,0x05,0xff,0xe5,0x95,0x93,0x00,0xd1,0x10,
+	0x10,0x08,0x05,0xff,0xe5,0x95,0xa3,0x00,0x05,0xff,0xe5,0x96,0x84,0x00,0x10,0x08,
+	0x05,0xff,0xe5,0x96,0x84,0x00,0x05,0xff,0xe5,0x96,0x99,0x00,0xd2,0x20,0xd1,0x10,
+	0x10,0x08,0x05,0xff,0xe5,0x96,0xab,0x00,0x05,0xff,0xe5,0x96,0xb3,0x00,0x10,0x08,
+	0x05,0xff,0xe5,0x97,0x82,0x00,0x05,0xff,0xe5,0x9c,0x96,0x00,0xd1,0x10,0x10,0x08,
+	0x05,0xff,0xe5,0x98,0x86,0x00,0x05,0xff,0xe5,0x9c,0x97,0x00,0x10,0x08,0x05,0xff,
+	0xe5,0x99,0x91,0x00,0x05,0xff,0xe5,0x99,0xb4,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,
+	0x10,0x08,0x05,0xff,0xe5,0x88,0x87,0x00,0x05,0xff,0xe5,0xa3,0xae,0x00,0x10,0x08,
+	0x05,0xff,0xe5,0x9f,0x8e,0x00,0x05,0xff,0xe5,0x9f,0xb4,0x00,0xd1,0x10,0x10,0x08,
+	0x05,0xff,0xe5,0xa0,0x8d,0x00,0x05,0xff,0xe5,0x9e,0x8b,0x00,0x10,0x08,0x05,0xff,
+	0xe5,0xa0,0xb2,0x00,0x05,0xff,0xe5,0xa0,0xb1,0x00,0xd2,0x21,0xd1,0x11,0x10,0x08,
+	0x05,0xff,0xe5,0xa2,0xac,0x00,0x05,0xff,0xf0,0xa1,0x93,0xa4,0x00,0x10,0x08,0x05,
+	0xff,0xe5,0xa3,0xb2,0x00,0x05,0xff,0xe5,0xa3,0xb7,0x00,0xd1,0x10,0x10,0x08,0x05,
+	0xff,0xe5,0xa4,0x86,0x00,0x05,0xff,0xe5,0xa4,0x9a,0x00,0x10,0x08,0x05,0xff,0xe5,
+	0xa4,0xa2,0x00,0x05,0xff,0xe5,0xa5,0xa2,0x00,0xd4,0x7b,0xd3,0x42,0xd2,0x22,0xd1,
+	0x12,0x10,0x09,0x05,0xff,0xf0,0xa1,0x9a,0xa8,0x00,0x05,0xff,0xf0,0xa1,0x9b,0xaa,
+	0x00,0x10,0x08,0x05,0xff,0xe5,0xa7,0xac,0x00,0x05,0xff,0xe5,0xa8,0x9b,0x00,0xd1,
+	0x10,0x10,0x08,0x05,0xff,0xe5,0xa8,0xa7,0x00,0x05,0xff,0xe5,0xa7,0x98,0x00,0x10,
+	0x08,0x05,0xff,0xe5,0xa9,0xa6,0x00,0x05,0xff,0xe3,0x9b,0xae,0x00,0xd2,0x18,0x91,
+	0x10,0x10,0x08,0x05,0xff,0xe3,0x9b,0xbc,0x00,0x05,0xff,0xe5,0xac,0x88,0x00,0x05,
+	0xff,0xe5,0xac,0xbe,0x00,0xd1,0x11,0x10,0x09,0x05,0xff,0xf0,0xa1,0xa7,0x88,0x00,
+	0x05,0xff,0xe5,0xaf,0x83,0x00,0x10,0x08,0x05,0xff,0xe5,0xaf,0x98,0x00,0x05,0xff,
+	0xe5,0xaf,0xa7,0x00,0xd3,0x41,0xd2,0x21,0xd1,0x11,0x10,0x08,0x05,0xff,0xe5,0xaf,
+	0xb3,0x00,0x05,0xff,0xf0,0xa1,0xac,0x98,0x00,0x10,0x08,0x05,0xff,0xe5,0xaf,0xbf,
+	0x00,0x05,0xff,0xe5,0xb0,0x86,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe5,0xbd,0x93,
+	0x00,0x05,0xff,0xe5,0xb0,0xa2,0x00,0x10,0x08,0x05,0xff,0xe3,0x9e,0x81,0x00,0x05,
+	0xff,0xe5,0xb1,0xa0,0x00,0xd2,0x21,0xd1,0x10,0x10,0x08,0x05,0xff,0xe5,0xb1,0xae,
+	0x00,0x05,0xff,0xe5,0xb3,0x80,0x00,0x10,0x08,0x05,0xff,0xe5,0xb2,0x8d,0x00,0x05,
+	0xff,0xf0,0xa1,0xb7,0xa4,0x00,0xd1,0x11,0x10,0x08,0x05,0xff,0xe5,0xb5,0x83,0x00,
+	0x05,0xff,0xf0,0xa1,0xb7,0xa6,0x00,0x10,0x08,0x05,0xff,0xe5,0xb5,0xae,0x00,0x05,
+	0xff,0xe5,0xb5,0xab,0x00,0xe0,0x04,0x02,0xcf,0x86,0xd5,0xfe,0xd4,0x82,0xd3,0x40,
+	0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe5,0xb5,0xbc,0x00,0x05,0xff,0xe5,0xb7,
+	0xa1,0x00,0x10,0x08,0x05,0xff,0xe5,0xb7,0xa2,0x00,0x05,0xff,0xe3,0xa0,0xaf,0x00,
+	0xd1,0x10,0x10,0x08,0x05,0xff,0xe5,0xb7,0xbd,0x00,0x05,0xff,0xe5,0xb8,0xa8,0x00,
+	0x10,0x08,0x05,0xff,0xe5,0xb8,0xbd,0x00,0x05,0xff,0xe5,0xb9,0xa9,0x00,0xd2,0x21,
+	0xd1,0x11,0x10,0x08,0x05,0xff,0xe3,0xa1,0xa2,0x00,0x05,0xff,0xf0,0xa2,0x86,0x83,
+	0x00,0x10,0x08,0x05,0xff,0xe3,0xa1,0xbc,0x00,0x05,0xff,0xe5,0xba,0xb0,0x00,0xd1,
+	0x10,0x10,0x08,0x05,0xff,0xe5,0xba,0xb3,0x00,0x05,0xff,0xe5,0xba,0xb6,0x00,0x10,
+	0x08,0x05,0xff,0xe5,0xbb,0x8a,0x00,0x05,0xff,0xf0,0xaa,0x8e,0x92,0x00,0xd3,0x3b,
+	0xd2,0x22,0xd1,0x11,0x10,0x08,0x05,0xff,0xe5,0xbb,0xbe,0x00,0x05,0xff,0xf0,0xa2,
+	0x8c,0xb1,0x00,0x10,0x09,0x05,0xff,0xf0,0xa2,0x8c,0xb1,0x00,0x05,0xff,0xe8,0x88,
+	0x81,0x00,0x51,0x08,0x05,0xff,0xe5,0xbc,0xa2,0x00,0x10,0x08,0x05,0xff,0xe3,0xa3,
+	0x87,0x00,0x05,0xff,0xf0,0xa3,0x8a,0xb8,0x00,0xd2,0x21,0xd1,0x11,0x10,0x09,0x05,
+	0xff,0xf0,0xa6,0x87,0x9a,0x00,0x05,0xff,0xe5,0xbd,0xa2,0x00,0x10,0x08,0x05,0xff,
+	0xe5,0xbd,0xab,0x00,0x05,0xff,0xe3,0xa3,0xa3,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,
+	0xe5,0xbe,0x9a,0x00,0x05,0xff,0xe5,0xbf,0x8d,0x00,0x10,0x08,0x05,0xff,0xe5,0xbf,
+	0x97,0x00,0x05,0xff,0xe5,0xbf,0xb9,0x00,0xd4,0x81,0xd3,0x41,0xd2,0x20,0xd1,0x10,
+	0x10,0x08,0x05,0xff,0xe6,0x82,0x81,0x00,0x05,0xff,0xe3,0xa4,0xba,0x00,0x10,0x08,
+	0x05,0xff,0xe3,0xa4,0x9c,0x00,0x05,0xff,0xe6,0x82,0x94,0x00,0xd1,0x11,0x10,0x09,
+	0x05,0xff,0xf0,0xa2,0x9b,0x94,0x00,0x05,0xff,0xe6,0x83,0x87,0x00,0x10,0x08,0x05,
+	0xff,0xe6,0x85,0x88,0x00,0x05,0xff,0xe6,0x85,0x8c,0x00,0xd2,0x20,0xd1,0x10,0x10,
+	0x08,0x05,0xff,0xe6,0x85,0x8e,0x00,0x05,0xff,0xe6,0x85,0x8c,0x00,0x10,0x08,0x05,
+	0xff,0xe6,0x85,0xba,0x00,0x05,0xff,0xe6,0x86,0x8e,0x00,0xd1,0x10,0x10,0x08,0x05,
+	0xff,0xe6,0x86,0xb2,0x00,0x05,0xff,0xe6,0x86,0xa4,0x00,0x10,0x08,0x05,0xff,0xe6,
+	0x86,0xaf,0x00,0x05,0xff,0xe6,0x87,0x9e,0x00,0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,
+	0x08,0x05,0xff,0xe6,0x87,0xb2,0x00,0x05,0xff,0xe6,0x87,0xb6,0x00,0x10,0x08,0x05,
+	0xff,0xe6,0x88,0x90,0x00,0x05,0xff,0xe6,0x88,0x9b,0x00,0xd1,0x10,0x10,0x08,0x05,
+	0xff,0xe6,0x89,0x9d,0x00,0x05,0xff,0xe6,0x8a,0xb1,0x00,0x10,0x08,0x05,0xff,0xe6,
+	0x8b,0x94,0x00,0x05,0xff,0xe6,0x8d,0x90,0x00,0xd2,0x21,0xd1,0x11,0x10,0x09,0x05,
+	0xff,0xf0,0xa2,0xac,0x8c,0x00,0x05,0xff,0xe6,0x8c,0xbd,0x00,0x10,0x08,0x05,0xff,
+	0xe6,0x8b,0xbc,0x00,0x05,0xff,0xe6,0x8d,0xa8,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,
+	0xe6,0x8e,0x83,0x00,0x05,0xff,0xe6,0x8f,0xa4,0x00,0x10,0x09,0x05,0xff,0xf0,0xa2,
+	0xaf,0xb1,0x00,0x05,0xff,0xe6,0x90,0xa2,0x00,0xcf,0x86,0xe5,0x03,0x01,0xd4,0x81,
+	0xd3,0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0x8f,0x85,0x00,0x05,0xff,
+	0xe6,0x8e,0xa9,0x00,0x10,0x08,0x05,0xff,0xe3,0xa8,0xae,0x00,0x05,0xff,0xe6,0x91,
+	0xa9,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0x91,0xbe,0x00,0x05,0xff,0xe6,0x92,
+	0x9d,0x00,0x10,0x08,0x05,0xff,0xe6,0x91,0xb7,0x00,0x05,0xff,0xe3,0xa9,0xac,0x00,
+	0xd2,0x21,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0x95,0x8f,0x00,0x05,0xff,0xe6,0x95,
+	0xac,0x00,0x10,0x09,0x05,0xff,0xf0,0xa3,0x80,0x8a,0x00,0x05,0xff,0xe6,0x97,0xa3,
+	0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0x9b,0xb8,0x00,0x05,0xff,0xe6,0x99,0x89,
+	0x00,0x10,0x08,0x05,0xff,0xe3,0xac,0x99,0x00,0x05,0xff,0xe6,0x9a,0x91,0x00,0xd3,
+	0x40,0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe3,0xac,0x88,0x00,0x05,0xff,0xe3,
+	0xab,0xa4,0x00,0x10,0x08,0x05,0xff,0xe5,0x86,0x92,0x00,0x05,0xff,0xe5,0x86,0x95,
+	0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0x9c,0x80,0x00,0x05,0xff,0xe6,0x9a,0x9c,
+	0x00,0x10,0x08,0x05,0xff,0xe8,0x82,0xad,0x00,0x05,0xff,0xe4,0x8f,0x99,0x00,0xd2,
+	0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0x9c,0x97,0x00,0x05,0xff,0xe6,0x9c,0x9b,
+	0x00,0x10,0x08,0x05,0xff,0xe6,0x9c,0xa1,0x00,0x05,0xff,0xe6,0x9d,0x9e,0x00,0xd1,
+	0x11,0x10,0x08,0x05,0xff,0xe6,0x9d,0x93,0x00,0x05,0xff,0xf0,0xa3,0x8f,0x83,0x00,
+	0x10,0x08,0x05,0xff,0xe3,0xad,0x89,0x00,0x05,0xff,0xe6,0x9f,0xba,0x00,0xd4,0x82,
+	0xd3,0x41,0xd2,0x21,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0x9e,0x85,0x00,0x05,0xff,
+	0xe6,0xa1,0x92,0x00,0x10,0x08,0x05,0xff,0xe6,0xa2,0x85,0x00,0x05,0xff,0xf0,0xa3,
+	0x91,0xad,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0xa2,0x8e,0x00,0x05,0xff,0xe6,
+	0xa0,0x9f,0x00,0x10,0x08,0x05,0xff,0xe6,0xa4,0x94,0x00,0x05,0xff,0xe3,0xae,0x9d,
+	0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0xa5,0x82,0x00,0x05,0xff,0xe6,
+	0xa6,0xa3,0x00,0x10,0x08,0x05,0xff,0xe6,0xa7,0xaa,0x00,0x05,0xff,0xe6,0xaa,0xa8,
+	0x00,0xd1,0x11,0x10,0x09,0x05,0xff,0xf0,0xa3,0x9a,0xa3,0x00,0x05,0xff,0xe6,0xab,
+	0x9b,0x00,0x10,0x08,0x05,0xff,0xe3,0xb0,0x98,0x00,0x05,0xff,0xe6,0xac,0xa1,0x00,
+	0xd3,0x42,0xd2,0x21,0xd1,0x11,0x10,0x09,0x05,0xff,0xf0,0xa3,0xa2,0xa7,0x00,0x05,
+	0xff,0xe6,0xad,0x94,0x00,0x10,0x08,0x05,0xff,0xe3,0xb1,0x8e,0x00,0x05,0xff,0xe6,
+	0xad,0xb2,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0xae,0x9f,0x00,0x05,0xff,0xe6,
+	0xae,0xba,0x00,0x10,0x08,0x05,0xff,0xe6,0xae,0xbb,0x00,0x05,0xff,0xf0,0xa3,0xaa,
+	0x8d,0x00,0xd2,0x23,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0xa1,0xb4,0x8b,0x00,0x05,
+	0xff,0xf0,0xa3,0xab,0xba,0x00,0x10,0x08,0x05,0xff,0xe6,0xb1,0x8e,0x00,0x05,0xff,
+	0xf0,0xa3,0xb2,0xbc,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0xb2,0xbf,0x00,0x05,
+	0xff,0xe6,0xb3,0x8d,0x00,0x10,0x08,0x05,0xff,0xe6,0xb1,0xa7,0x00,0x05,0xff,0xe6,
+	0xb4,0x96,0x00,0xe1,0x1d,0x04,0xe0,0x0c,0x02,0xcf,0x86,0xe5,0x08,0x01,0xd4,0x82,
+	0xd3,0x41,0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0xb4,0xbe,0x00,0x05,0xff,
+	0xe6,0xb5,0xb7,0x00,0x10,0x08,0x05,0xff,0xe6,0xb5,0x81,0x00,0x05,0xff,0xe6,0xb5,
+	0xa9,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0xb5,0xb8,0x00,0x05,0xff,0xe6,0xb6,
+	0x85,0x00,0x10,0x09,0x05,0xff,0xf0,0xa3,0xb4,0x9e,0x00,0x05,0xff,0xe6,0xb4,0xb4,
+	0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe6,0xb8,0xaf,0x00,0x05,0xff,0xe6,
+	0xb9,0xae,0x00,0x10,0x08,0x05,0xff,0xe3,0xb4,0xb3,0x00,0x05,0xff,0xe6,0xbb,0x8b,
+	0x00,0xd1,0x11,0x10,0x08,0x05,0xff,0xe6,0xbb,0x87,0x00,0x05,0xff,0xf0,0xa3,0xbb,
+	0x91,0x00,0x10,0x08,0x05,0xff,0xe6,0xb7,0xb9,0x00,0x05,0xff,0xe6,0xbd,0xae,0x00,
+	0xd3,0x42,0xd2,0x22,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0xa3,0xbd,0x9e,0x00,0x05,
+	0xff,0xf0,0xa3,0xbe,0x8e,0x00,0x10,0x08,0x05,0xff,0xe6,0xbf,0x86,0x00,0x05,0xff,
+	0xe7,0x80,0xb9,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe7,0x80,0x9e,0x00,0x05,0xff,
+	0xe7,0x80,0x9b,0x00,0x10,0x08,0x05,0xff,0xe3,0xb6,0x96,0x00,0x05,0xff,0xe7,0x81,
+	0x8a,0x00,0xd2,0x21,0xd1,0x10,0x10,0x08,0x05,0xff,0xe7,0x81,0xbd,0x00,0x05,0xff,
+	0xe7,0x81,0xb7,0x00,0x10,0x08,0x05,0xff,0xe7,0x82,0xad,0x00,0x05,0xff,0xf0,0xa0,
+	0x94,0xa5,0x00,0xd1,0x11,0x10,0x08,0x05,0xff,0xe7,0x85,0x85,0x00,0x05,0xff,0xf0,
+	0xa4,0x89,0xa3,0x00,0x10,0x08,0x05,0xff,0xe7,0x86,0x9c,0x00,0x05,0xff,0xf0,0xa4,
+	0x8e,0xab,0x00,0xd4,0x7b,0xd3,0x43,0xd2,0x21,0xd1,0x10,0x10,0x08,0x05,0xff,0xe7,
+	0x88,0xa8,0x00,0x05,0xff,0xe7,0x88,0xb5,0x00,0x10,0x08,0x05,0xff,0xe7,0x89,0x90,
+	0x00,0x05,0xff,0xf0,0xa4,0x98,0x88,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe7,0x8a,
+	0x80,0x00,0x05,0xff,0xe7,0x8a,0x95,0x00,0x10,0x09,0x05,0xff,0xf0,0xa4,0x9c,0xb5,
+	0x00,0x05,0xff,0xf0,0xa4,0xa0,0x94,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,
+	0xe7,0x8d,0xba,0x00,0x05,0xff,0xe7,0x8e,0x8b,0x00,0x10,0x08,0x05,0xff,0xe3,0xba,
+	0xac,0x00,0x05,0xff,0xe7,0x8e,0xa5,0x00,0x51,0x08,0x05,0xff,0xe3,0xba,0xb8,0x00,
+	0x10,0x08,0x05,0xff,0xe7,0x91,0x87,0x00,0x05,0xff,0xe7,0x91,0x9c,0x00,0xd3,0x42,
+	0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe7,0x91,0xb1,0x00,0x05,0xff,0xe7,0x92,
+	0x85,0x00,0x10,0x08,0x05,0xff,0xe7,0x93,0x8a,0x00,0x05,0xff,0xe3,0xbc,0x9b,0x00,
+	0xd1,0x11,0x10,0x08,0x05,0xff,0xe7,0x94,0xa4,0x00,0x05,0xff,0xf0,0xa4,0xb0,0xb6,
+	0x00,0x10,0x08,0x05,0xff,0xe7,0x94,0xbe,0x00,0x05,0xff,0xf0,0xa4,0xb2,0x92,0x00,
+	0xd2,0x22,0xd1,0x11,0x10,0x08,0x05,0xff,0xe7,0x95,0xb0,0x00,0x05,0xff,0xf0,0xa2,
+	0x86,0x9f,0x00,0x10,0x08,0x05,0xff,0xe7,0x98,0x90,0x00,0x05,0xff,0xf0,0xa4,0xbe,
+	0xa1,0x00,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0xa4,0xbe,0xb8,0x00,0x05,0xff,0xf0,
+	0xa5,0x81,0x84,0x00,0x10,0x08,0x05,0xff,0xe3,0xbf,0xbc,0x00,0x05,0xff,0xe4,0x80,
+	0x88,0x00,0xcf,0x86,0xe5,0x04,0x01,0xd4,0x7d,0xd3,0x3c,0xd2,0x23,0xd1,0x11,0x10,
+	0x08,0x05,0xff,0xe7,0x9b,0xb4,0x00,0x05,0xff,0xf0,0xa5,0x83,0xb3,0x00,0x10,0x09,
+	0x05,0xff,0xf0,0xa5,0x83,0xb2,0x00,0x05,0xff,0xf0,0xa5,0x84,0x99,0x00,0x91,0x11,
+	0x10,0x09,0x05,0xff,0xf0,0xa5,0x84,0xb3,0x00,0x05,0xff,0xe7,0x9c,0x9e,0x00,0x05,
+	0xff,0xe7,0x9c,0x9f,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe7,0x9d,0x8a,
+	0x00,0x05,0xff,0xe4,0x80,0xb9,0x00,0x10,0x08,0x05,0xff,0xe7,0x9e,0x8b,0x00,0x05,
+	0xff,0xe4,0x81,0x86,0x00,0xd1,0x11,0x10,0x08,0x05,0xff,0xe4,0x82,0x96,0x00,0x05,
+	0xff,0xf0,0xa5,0x90,0x9d,0x00,0x10,0x08,0x05,0xff,0xe7,0xa1,0x8e,0x00,0x05,0xff,
+	0xe7,0xa2,0x8c,0x00,0xd3,0x43,0xd2,0x21,0xd1,0x10,0x10,0x08,0x05,0xff,0xe7,0xa3,
+	0x8c,0x00,0x05,0xff,0xe4,0x83,0xa3,0x00,0x10,0x09,0x05,0xff,0xf0,0xa5,0x98,0xa6,
+	0x00,0x05,0xff,0xe7,0xa5,0x96,0x00,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0xa5,0x9a,
+	0x9a,0x00,0x05,0xff,0xf0,0xa5,0x9b,0x85,0x00,0x10,0x08,0x05,0xff,0xe7,0xa6,0x8f,
+	0x00,0x05,0xff,0xe7,0xa7,0xab,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe4,
+	0x84,0xaf,0x00,0x05,0xff,0xe7,0xa9,0x80,0x00,0x10,0x08,0x05,0xff,0xe7,0xa9,0x8a,
+	0x00,0x05,0xff,0xe7,0xa9,0x8f,0x00,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0xa5,0xa5,
+	0xbc,0x00,0x05,0xff,0xf0,0xa5,0xaa,0xa7,0x00,0x10,0x09,0x05,0xff,0xf0,0xa5,0xaa,
+	0xa7,0x00,0x05,0xff,0xe7,0xab,0xae,0x00,0xd4,0x83,0xd3,0x42,0xd2,0x21,0xd1,0x11,
+	0x10,0x08,0x05,0xff,0xe4,0x88,0x82,0x00,0x05,0xff,0xf0,0xa5,0xae,0xab,0x00,0x10,
+	0x08,0x05,0xff,0xe7,0xaf,0x86,0x00,0x05,0xff,0xe7,0xaf,0x89,0x00,0xd1,0x11,0x10,
+	0x08,0x05,0xff,0xe4,0x88,0xa7,0x00,0x05,0xff,0xf0,0xa5,0xb2,0x80,0x00,0x10,0x08,
+	0x05,0xff,0xe7,0xb3,0x92,0x00,0x05,0xff,0xe4,0x8a,0xa0,0x00,0xd2,0x21,0xd1,0x10,
+	0x10,0x08,0x05,0xff,0xe7,0xb3,0xa8,0x00,0x05,0xff,0xe7,0xb3,0xa3,0x00,0x10,0x08,
+	0x05,0xff,0xe7,0xb4,0x80,0x00,0x05,0xff,0xf0,0xa5,0xbe,0x86,0x00,0xd1,0x10,0x10,
+	0x08,0x05,0xff,0xe7,0xb5,0xa3,0x00,0x05,0xff,0xe4,0x8c,0x81,0x00,0x10,0x08,0x05,
+	0xff,0xe7,0xb7,0x87,0x00,0x05,0xff,0xe7,0xb8,0x82,0x00,0xd3,0x44,0xd2,0x22,0xd1,
+	0x10,0x10,0x08,0x05,0xff,0xe7,0xb9,0x85,0x00,0x05,0xff,0xe4,0x8c,0xb4,0x00,0x10,
+	0x09,0x05,0xff,0xf0,0xa6,0x88,0xa8,0x00,0x05,0xff,0xf0,0xa6,0x89,0x87,0x00,0xd1,
+	0x11,0x10,0x08,0x05,0xff,0xe4,0x8d,0x99,0x00,0x05,0xff,0xf0,0xa6,0x8b,0x99,0x00,
+	0x10,0x08,0x05,0xff,0xe7,0xbd,0xba,0x00,0x05,0xff,0xf0,0xa6,0x8c,0xbe,0x00,0xd2,
+	0x21,0xd1,0x10,0x10,0x08,0x05,0xff,0xe7,0xbe,0x95,0x00,0x05,0xff,0xe7,0xbf,0xba,
+	0x00,0x10,0x08,0x05,0xff,0xe8,0x80,0x85,0x00,0x05,0xff,0xf0,0xa6,0x93,0x9a,0x00,
+	0xd1,0x11,0x10,0x09,0x05,0xff,0xf0,0xa6,0x94,0xa3,0x00,0x05,0xff,0xe8,0x81,0xa0,
+	0x00,0x10,0x09,0x05,0xff,0xf0,0xa6,0x96,0xa8,0x00,0x05,0xff,0xe8,0x81,0xb0,0x00,
+	0xe0,0x11,0x02,0xcf,0x86,0xe5,0x07,0x01,0xd4,0x85,0xd3,0x42,0xd2,0x21,0xd1,0x11,
+	0x10,0x09,0x05,0xff,0xf0,0xa3,0x8d,0x9f,0x00,0x05,0xff,0xe4,0x8f,0x95,0x00,0x10,
+	0x08,0x05,0xff,0xe8,0x82,0xb2,0x00,0x05,0xff,0xe8,0x84,0x83,0x00,0xd1,0x10,0x10,
+	0x08,0x05,0xff,0xe4,0x90,0x8b,0x00,0x05,0xff,0xe8,0x84,0xbe,0x00,0x10,0x08,0x05,
+	0xff,0xe5,0xaa,0xb5,0x00,0x05,0xff,0xf0,0xa6,0x9e,0xa7,0x00,0xd2,0x23,0xd1,0x12,
+	0x10,0x09,0x05,0xff,0xf0,0xa6,0x9e,0xb5,0x00,0x05,0xff,0xf0,0xa3,0x8e,0x93,0x00,
+	0x10,0x09,0x05,0xff,0xf0,0xa3,0x8e,0x9c,0x00,0x05,0xff,0xe8,0x88,0x81,0x00,0xd1,
+	0x10,0x10,0x08,0x05,0xff,0xe8,0x88,0x84,0x00,0x05,0xff,0xe8,0xbe,0x9e,0x00,0x10,
+	0x08,0x05,0xff,0xe4,0x91,0xab,0x00,0x05,0xff,0xe8,0x8a,0x91,0x00,0xd3,0x41,0xd2,
+	0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe8,0x8a,0x8b,0x00,0x05,0xff,0xe8,0x8a,0x9d,
+	0x00,0x10,0x08,0x05,0xff,0xe5,0x8a,0xb3,0x00,0x05,0xff,0xe8,0x8a,0xb1,0x00,0xd1,
+	0x10,0x10,0x08,0x05,0xff,0xe8,0x8a,0xb3,0x00,0x05,0xff,0xe8,0x8a,0xbd,0x00,0x10,
+	0x08,0x05,0xff,0xe8,0x8b,0xa6,0x00,0x05,0xff,0xf0,0xa6,0xac,0xbc,0x00,0xd2,0x20,
+	0xd1,0x10,0x10,0x08,0x05,0xff,0xe8,0x8b,0xa5,0x00,0x05,0xff,0xe8,0x8c,0x9d,0x00,
+	0x10,0x08,0x05,0xff,0xe8,0x8d,0xa3,0x00,0x05,0xff,0xe8,0x8e,0xad,0x00,0xd1,0x10,
+	0x10,0x08,0x05,0xff,0xe8,0x8c,0xa3,0x00,0x05,0xff,0xe8,0x8e,0xbd,0x00,0x10,0x08,
+	0x05,0xff,0xe8,0x8f,0xa7,0x00,0x05,0xff,0xe8,0x91,0x97,0x00,0xd4,0x85,0xd3,0x43,
+	0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe8,0x8d,0x93,0x00,0x05,0xff,0xe8,0x8f,
+	0x8a,0x00,0x10,0x08,0x05,0xff,0xe8,0x8f,0x8c,0x00,0x05,0xff,0xe8,0x8f,0x9c,0x00,
+	0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0xa6,0xb0,0xb6,0x00,0x05,0xff,0xf0,0xa6,0xb5,
+	0xab,0x00,0x10,0x09,0x05,0xff,0xf0,0xa6,0xb3,0x95,0x00,0x05,0xff,0xe4,0x94,0xab,
+	0x00,0xd2,0x21,0xd1,0x10,0x10,0x08,0x05,0xff,0xe8,0x93,0xb1,0x00,0x05,0xff,0xe8,
+	0x93,0xb3,0x00,0x10,0x08,0x05,0xff,0xe8,0x94,0x96,0x00,0x05,0xff,0xf0,0xa7,0x8f,
+	0x8a,0x00,0xd1,0x11,0x10,0x08,0x05,0xff,0xe8,0x95,0xa4,0x00,0x05,0xff,0xf0,0xa6,
+	0xbc,0xac,0x00,0x10,0x08,0x05,0xff,0xe4,0x95,0x9d,0x00,0x05,0xff,0xe4,0x95,0xa1,
+	0x00,0xd3,0x42,0xd2,0x22,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0xa6,0xbe,0xb1,0x00,
+	0x05,0xff,0xf0,0xa7,0x83,0x92,0x00,0x10,0x08,0x05,0xff,0xe4,0x95,0xab,0x00,0x05,
+	0xff,0xe8,0x99,0x90,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe8,0x99,0x9c,0x00,0x05,
+	0xff,0xe8,0x99,0xa7,0x00,0x10,0x08,0x05,0xff,0xe8,0x99,0xa9,0x00,0x05,0xff,0xe8,
+	0x9a,0xa9,0x00,0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe8,0x9a,0x88,0x00,0x05,
+	0xff,0xe8,0x9c,0x8e,0x00,0x10,0x08,0x05,0xff,0xe8,0x9b,0xa2,0x00,0x05,0xff,0xe8,
+	0x9d,0xb9,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe8,0x9c,0xa8,0x00,0x05,0xff,0xe8,
+	0x9d,0xab,0x00,0x10,0x08,0x05,0xff,0xe8,0x9e,0x86,0x00,0x05,0xff,0xe4,0x97,0x97,
+	0x00,0xcf,0x86,0xe5,0x08,0x01,0xd4,0x83,0xd3,0x41,0xd2,0x20,0xd1,0x10,0x10,0x08,
+	0x05,0xff,0xe8,0x9f,0xa1,0x00,0x05,0xff,0xe8,0xa0,0x81,0x00,0x10,0x08,0x05,0xff,
+	0xe4,0x97,0xb9,0x00,0x05,0xff,0xe8,0xa1,0xa0,0x00,0xd1,0x11,0x10,0x08,0x05,0xff,
+	0xe8,0xa1,0xa3,0x00,0x05,0xff,0xf0,0xa7,0x99,0xa7,0x00,0x10,0x08,0x05,0xff,0xe8,
+	0xa3,0x97,0x00,0x05,0xff,0xe8,0xa3,0x9e,0x00,0xd2,0x21,0xd1,0x10,0x10,0x08,0x05,
+	0xff,0xe4,0x98,0xb5,0x00,0x05,0xff,0xe8,0xa3,0xba,0x00,0x10,0x08,0x05,0xff,0xe3,
+	0x92,0xbb,0x00,0x05,0xff,0xf0,0xa7,0xa2,0xae,0x00,0xd1,0x11,0x10,0x09,0x05,0xff,
+	0xf0,0xa7,0xa5,0xa6,0x00,0x05,0xff,0xe4,0x9a,0xbe,0x00,0x10,0x08,0x05,0xff,0xe4,
+	0x9b,0x87,0x00,0x05,0xff,0xe8,0xaa,0xa0,0x00,0xd3,0x41,0xd2,0x21,0xd1,0x10,0x10,
+	0x08,0x05,0xff,0xe8,0xab,0xad,0x00,0x05,0xff,0xe8,0xae,0x8a,0x00,0x10,0x08,0x05,
+	0xff,0xe8,0xb1,0x95,0x00,0x05,0xff,0xf0,0xa7,0xb2,0xa8,0x00,0xd1,0x10,0x10,0x08,
+	0x05,0xff,0xe8,0xb2,0xab,0x00,0x05,0xff,0xe8,0xb3,0x81,0x00,0x10,0x08,0x05,0xff,
+	0xe8,0xb4,0x9b,0x00,0x05,0xff,0xe8,0xb5,0xb7,0x00,0xd2,0x22,0xd1,0x12,0x10,0x09,
+	0x05,0xff,0xf0,0xa7,0xbc,0xaf,0x00,0x05,0xff,0xf0,0xa0,0xa0,0x84,0x00,0x10,0x08,
+	0x05,0xff,0xe8,0xb7,0x8b,0x00,0x05,0xff,0xe8,0xb6,0xbc,0x00,0xd1,0x11,0x10,0x08,
+	0x05,0xff,0xe8,0xb7,0xb0,0x00,0x05,0xff,0xf0,0xa0,0xa3,0x9e,0x00,0x10,0x08,0x05,
+	0xff,0xe8,0xbb,0x94,0x00,0x05,0xff,0xe8,0xbc,0xb8,0x00,0xd4,0x84,0xd3,0x43,0xd2,
+	0x22,0xd1,0x12,0x10,0x09,0x05,0xff,0xf0,0xa8,0x97,0x92,0x00,0x05,0xff,0xf0,0xa8,
+	0x97,0xad,0x00,0x10,0x08,0x05,0xff,0xe9,0x82,0x94,0x00,0x05,0xff,0xe9,0x83,0xb1,
+	0x00,0xd1,0x11,0x10,0x08,0x05,0xff,0xe9,0x84,0x91,0x00,0x05,0xff,0xf0,0xa8,0x9c,
+	0xae,0x00,0x10,0x08,0x05,0xff,0xe9,0x84,0x9b,0x00,0x05,0xff,0xe9,0x88,0xb8,0x00,
+	0xd2,0x20,0xd1,0x10,0x10,0x08,0x05,0xff,0xe9,0x8b,0x97,0x00,0x05,0xff,0xe9,0x8b,
+	0x98,0x00,0x10,0x08,0x05,0xff,0xe9,0x89,0xbc,0x00,0x05,0xff,0xe9,0x8f,0xb9,0x00,
+	0xd1,0x11,0x10,0x08,0x05,0xff,0xe9,0x90,0x95,0x00,0x05,0xff,0xf0,0xa8,0xaf,0xba,
+	0x00,0x10,0x08,0x05,0xff,0xe9,0x96,0x8b,0x00,0x05,0xff,0xe4,0xa6,0x95,0x00,0xd3,
+	0x43,0xd2,0x21,0xd1,0x11,0x10,0x08,0x05,0xff,0xe9,0x96,0xb7,0x00,0x05,0xff,0xf0,
+	0xa8,0xb5,0xb7,0x00,0x10,0x08,0x05,0xff,0xe4,0xa7,0xa6,0x00,0x05,0xff,0xe9,0x9b,
+	0x83,0x00,0xd1,0x10,0x10,0x08,0x05,0xff,0xe5,0xb6,0xb2,0x00,0x05,0xff,0xe9,0x9c,
+	0xa3,0x00,0x10,0x09,0x05,0xff,0xf0,0xa9,0x85,0x85,0x00,0x05,0xff,0xf0,0xa9,0x88,
+	0x9a,0x00,0xd2,0x21,0xd1,0x10,0x10,0x08,0x05,0xff,0xe4,0xa9,0xae,0x00,0x05,0xff,
+	0xe4,0xa9,0xb6,0x00,0x10,0x08,0x05,0xff,0xe9,0x9f,0xa0,0x00,0x05,0xff,0xf0,0xa9,
+	0x90,0x8a,0x00,0x91,0x11,0x10,0x08,0x05,0xff,0xe4,0xaa,0xb2,0x00,0x05,0xff,0xf0,
+	0xa9,0x92,0x96,0x00,0x05,0xff,0xe9,0xa0,0x8b,0x00,0xe2,0x10,0x01,0xe1,0x09,0x01,
+	0xe0,0x02,0x01,0xcf,0x86,0x95,0xfb,0xd4,0x82,0xd3,0x41,0xd2,0x21,0xd1,0x11,0x10,
+	0x08,0x05,0xff,0xe9,0xa0,0xa9,0x00,0x05,0xff,0xf0,0xa9,0x96,0xb6,0x00,0x10,0x08,
+	0x05,0xff,0xe9,0xa3,0xa2,0x00,0x05,0xff,0xe4,0xac,0xb3,0x00,0xd1,0x10,0x10,0x08,
+	0x05,0xff,0xe9,0xa4,0xa9,0x00,0x05,0xff,0xe9,0xa6,0xa7,0x00,0x10,0x08,0x05,0xff,
+	0xe9,0xa7,0x82,0x00,0x05,0xff,0xe9,0xa7,0xbe,0x00,0xd2,0x21,0xd1,0x11,0x10,0x08,
+	0x05,0xff,0xe4,0xaf,0x8e,0x00,0x05,0xff,0xf0,0xa9,0xac,0xb0,0x00,0x10,0x08,0x05,
+	0xff,0xe9,0xac,0x92,0x00,0x05,0xff,0xe9,0xb1,0x80,0x00,0xd1,0x10,0x10,0x08,0x05,
+	0xff,0xe9,0xb3,0xbd,0x00,0x05,0xff,0xe4,0xb3,0x8e,0x00,0x10,0x08,0x05,0xff,0xe4,
+	0xb3,0xad,0x00,0x05,0xff,0xe9,0xb5,0xa7,0x00,0xd3,0x44,0xd2,0x23,0xd1,0x11,0x10,
+	0x09,0x05,0xff,0xf0,0xaa,0x83,0x8e,0x00,0x05,0xff,0xe4,0xb3,0xb8,0x00,0x10,0x09,
+	0x05,0xff,0xf0,0xaa,0x84,0x85,0x00,0x05,0xff,0xf0,0xaa,0x88,0x8e,0x00,0xd1,0x11,
+	0x10,0x09,0x05,0xff,0xf0,0xaa,0x8a,0x91,0x00,0x05,0xff,0xe9,0xba,0xbb,0x00,0x10,
+	0x08,0x05,0xff,0xe4,0xb5,0x96,0x00,0x05,0xff,0xe9,0xbb,0xb9,0x00,0xd2,0x20,0xd1,
+	0x10,0x10,0x08,0x05,0xff,0xe9,0xbb,0xbe,0x00,0x05,0xff,0xe9,0xbc,0x85,0x00,0x10,
+	0x08,0x05,0xff,0xe9,0xbc,0x8f,0x00,0x05,0xff,0xe9,0xbc,0x96,0x00,0x91,0x11,0x10,
+	0x08,0x05,0xff,0xe9,0xbc,0xbb,0x00,0x05,0xff,0xf0,0xaa,0x98,0x80,0x00,0x00,0x00,
+	0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xcf,0x06,0x00,0x00,0xd3,0x06,
+	0xcf,0x06,0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1,0x06,0xcf,0x06,0x00,0x00,
+	0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x00,0x00,
+	0x53,0x04,0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x02,0x00,0xd3,0x08,
+	0xcf,0x86,0xcf,0x06,0x00,0x00,0xd2,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd1,0x08,
+	0xcf,0x86,0xcf,0x06,0x00,0x00,0xd0,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xcf,0x86,
+	0xd5,0x06,0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf,0x06,0x00,0x00,0xd3,0x06,0xcf,0x06,
+	0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1,0x06,0xcf,0x06,0x00,0x00,0xd0,0x06,
+	0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x00,0x00,0x53,0x04,
+	0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x02,0x00,0xcf,0x86,0xd5,0xc0,
+	0xd4,0x60,0xd3,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd2,0x08,0xcf,0x86,0xcf,0x06,
+	0x00,0x00,0xd1,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd0,0x08,0xcf,0x86,0xcf,0x06,
+	0x00,0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf,0x06,0x00,0x00,
+	0xd3,0x06,0xcf,0x06,0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1,0x06,0xcf,0x06,
+	0x00,0x00,0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,
+	0x00,0x00,0x53,0x04,0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x02,0x00,
+	0xd3,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd2,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,
+	0xd1,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd0,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,
+	0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf,0x06,0x00,0x00,0xd3,0x06,
+	0xcf,0x06,0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1,0x06,0xcf,0x06,0x00,0x00,
+	0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x00,0x00,
+	0x53,0x04,0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x02,0x00,0xd4,0x60,
+	0xd3,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd2,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,
+	0xd1,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd0,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,
+	0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf,0x06,0x00,0x00,0xd3,0x06,
+	0xcf,0x06,0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1,0x06,0xcf,0x06,0x00,0x00,
+	0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x00,0x00,
+	0x53,0x04,0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x02,0x00,0xd3,0x08,
+	0xcf,0x86,0xcf,0x06,0x00,0x00,0xd2,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd1,0x08,
+	0xcf,0x86,0xcf,0x06,0x00,0x00,0xd0,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xcf,0x86,
+	0xd5,0x06,0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf,0x06,0x00,0x00,0xd3,0x06,0xcf,0x06,
+	0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1,0x06,0xcf,0x06,0x00,0x00,0xd0,0x06,
+	0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x00,0x00,0x53,0x04,
+	0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x02,0x00,0xe0,0x83,0x01,0xcf,
+	0x86,0xd5,0xc0,0xd4,0x60,0xd3,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd2,0x08,0xcf,
+	0x86,0xcf,0x06,0x00,0x00,0xd1,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd0,0x08,0xcf,
+	0x86,0xcf,0x06,0x00,0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf,
+	0x06,0x00,0x00,0xd3,0x06,0xcf,0x06,0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1,
+	0x06,0xcf,0x06,0x00,0x00,0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,
+	0x00,0x54,0x04,0x00,0x00,0x53,0x04,0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00,
+	0x00,0x02,0x00,0xd3,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd2,0x08,0xcf,0x86,0xcf,
+	0x06,0x00,0x00,0xd1,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd0,0x08,0xcf,0x86,0xcf,
+	0x06,0x00,0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf,0x06,0x00,
+	0x00,0xd3,0x06,0xcf,0x06,0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1,0x06,0xcf,
+	0x06,0x00,0x00,0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,
+	0x04,0x00,0x00,0x53,0x04,0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x02,
+	0x00,0xd4,0x60,0xd3,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd2,0x08,0xcf,0x86,0xcf,
+	0x06,0x00,0x00,0xd1,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd0,0x08,0xcf,0x86,0xcf,
+	0x06,0x00,0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf,0x06,0x00,
+	0x00,0xd3,0x06,0xcf,0x06,0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1,0x06,0xcf,
+	0x06,0x00,0x00,0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,
+	0x04,0x00,0x00,0x53,0x04,0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x02,
+	0x00,0xd3,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd2,0x08,0xcf,0x86,0xcf,0x06,0x00,
+	0x00,0xd1,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd0,0x08,0xcf,0x86,0xcf,0x06,0x00,
+	0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf,0x06,0x00,0x00,0xd3,
+	0x06,0xcf,0x06,0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1,0x06,0xcf,0x06,0x00,
+	0x00,0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x00,
+	0x00,0x53,0x04,0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x02,0x00,0xcf,
+	0x86,0xd5,0xc0,0xd4,0x60,0xd3,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd2,0x08,0xcf,
+	0x86,0xcf,0x06,0x00,0x00,0xd1,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd0,0x08,0xcf,
+	0x86,0xcf,0x06,0x00,0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf,
+	0x06,0x00,0x00,0xd3,0x06,0xcf,0x06,0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1,
+	0x06,0xcf,0x06,0x00,0x00,0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,
+	0x00,0x54,0x04,0x00,0x00,0x53,0x04,0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00,
+	0x00,0x02,0x00,0xd3,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd2,0x08,0xcf,0x86,0xcf,
+	0x06,0x00,0x00,0xd1,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd0,0x08,0xcf,0x86,0xcf,
+	0x06,0x00,0x00,0xcf,0x86,0xd5,0x06,0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf,0x06,0x00,
+	0x00,0xd3,0x06,0xcf,0x06,0x00,0x00,0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1,0x06,0xcf,
+	0x06,0x00,0x00,0xd0,0x06,0xcf,0x06,0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,
+	0x04,0x00,0x00,0x53,0x04,0x00,0x00,0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x02,
+	0x00,0xd4,0xd9,0xd3,0x81,0xd2,0x79,0xd1,0x71,0xd0,0x69,0xcf,0x86,0xd5,0x60,0xd4,
+	0x59,0xd3,0x52,0xd2,0x33,0xd1,0x2c,0xd0,0x25,0xcf,0x86,0x95,0x1e,0x94,0x19,0x93,
+	0x14,0x92,0x0f,0x91,0x0a,0x10,0x05,0x00,0xff,0x00,0x05,0xff,0x00,0x00,0xff,0x00,
+	0x00,0xff,0x00,0x00,0xff,0x00,0x00,0xff,0x00,0x05,0xff,0x00,0xcf,0x06,0x05,0xff,
+	0x00,0xcf,0x06,0x00,0xff,0x00,0xd1,0x07,0xcf,0x06,0x07,0xff,0x00,0xd0,0x07,0xcf,
+	0x06,0x07,0xff,0x00,0xcf,0x86,0x55,0x05,0x07,0xff,0x00,0x14,0x05,0x07,0xff,0x00,
+	0x00,0xff,0x00,0xcf,0x06,0x00,0xff,0x00,0xcf,0x06,0x00,0xff,0x00,0xcf,0x06,0x00,
+	0xff,0x00,0xcf,0x86,0xcf,0x06,0x00,0x00,0xcf,0x86,0xcf,0x06,0x00,0x00,0xcf,0x86,
+	0xcf,0x06,0x00,0x00,0xd2,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xd1,0x08,0xcf,0x86,
+	0xcf,0x06,0x00,0x00,0xd0,0x08,0xcf,0x86,0xcf,0x06,0x00,0x00,0xcf,0x86,0xd5,0x06,
+	0xcf,0x06,0x00,0x00,0xd4,0x06,0xcf,0x06,0x00,0x00,0xd3,0x06,0xcf,0x06,0x00,0x00,
+	0xd2,0x06,0xcf,0x06,0x00,0x00,0xd1,0x06,0xcf,0x06,0x00,0x00,0xd0,0x06,0xcf,0x06,
+	0x00,0x00,0xcf,0x86,0x55,0x04,0x00,0x00,0x54,0x04,0x00,0x00,0x53,0x04,0x00,0x00,
+	0x52,0x04,0x00,0x00,0x11,0x04,0x00,0x00,0x02,0x00,0xcf,0x86,0xcf,0x06,0x02,0x00,
+	0x81,0x80,0xcf,0x86,0x85,0x84,0xcf,0x86,0xcf,0x06,0x02,0x00,0x00,0x00,0x00,0x00
+};
diff --git a/lib/ext2fs/utf8n.h b/lib/ext2fs/utf8n.h
new file mode 100644
index 0000000..c214f58
--- /dev/null
+++ b/lib/ext2fs/utf8n.h
@@ -0,0 +1,120 @@
+/*
+ * Copyright (c) 2014 SGI.
+ * All rights reserved.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation.
+ *
+ * This program is distributed in the hope that it would be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ */
+
+/* This code is copied from the linux kernel.  We have a userspace
+ * version here to such that hashes will match that implementation.
+ */
+
+#ifndef UTF8NORM_H
+#define UTF8NORM_H
+
+#include <stdint.h>
+#include <unistd.h>
+#include <string.h>
+
+/* Encoding a unicode version number as a single unsigned int. */
+#define UNICODE_MAJ_SHIFT		(16)
+#define UNICODE_MIN_SHIFT		(8)
+
+#define UNICODE_AGE(MAJ, MIN, REV)			\
+	(((unsigned int)(MAJ) << UNICODE_MAJ_SHIFT) |	\
+	 ((unsigned int)(MIN) << UNICODE_MIN_SHIFT) |	\
+	 ((unsigned int)(REV)))
+
+/* Highest unicode version supported by the data tables. */
+extern int utf8version_is_supported(uint8_t maj, uint8_t min, uint8_t rev);
+extern int utf8version_latest(void);
+
+/*
+ * Look for the correct const struct utf8data for a unicode version.
+ * Returns NULL if the version requested is too new.
+ *
+ * Two normalization forms are supported: nfdi and nfdicf.
+ *
+ * nfdi:
+ *  - Apply unicode normalization form NFD.
+ *  - Remove any Default_Ignorable_Code_Point.
+ *
+ * nfdicf:
+ *  - Apply unicode normalization form NFD.
+ *  - Remove any Default_Ignorable_Code_Point.
+ *  - Apply a full casefold (C + F).
+ */
+extern const struct utf8data *utf8nfdi(unsigned int maxage);
+extern const struct utf8data *utf8nfdicf(unsigned int maxage);
+
+/*
+ * Determine the maximum age of any unicode character in the string.
+ * Returns 0 if only unassigned code points are present.
+ * Returns -1 if the input is not valid UTF-8.
+ */
+extern int utf8agemax(const struct utf8data *data, const char *s);
+extern int utf8nagemax(const struct utf8data *data, const char *s, size_t len);
+
+/*
+ * Determine the minimum age of any unicode character in the string.
+ * Returns 0 if any unassigned code points are present.
+ * Returns -1 if the input is not valid UTF-8.
+ */
+extern int utf8agemin(const struct utf8data *data, const char *s);
+extern int utf8nagemin(const struct utf8data *data, const char *s, size_t len);
+
+/*
+ * Determine the length of the normalized from of the string,
+ * excluding any terminating NULL byte.
+ * Returns 0 if only ignorable code points are present.
+ * Returns -1 if the input is not valid UTF-8.
+ */
+extern ssize_t utf8len(const struct utf8data *data, const char *s);
+extern ssize_t utf8nlen(const struct utf8data *data, const char *s, size_t len);
+
+/* Needed in struct utf8cursor below. */
+#define UTF8HANGULLEAF	(12)
+
+/*
+ * Cursor structure used by the normalizer.
+ */
+struct utf8cursor {
+	const struct utf8data	*data;
+	const char	*s;
+	const char	*p;
+	const char	*ss;
+	const char	*sp;
+	unsigned int	len;
+	unsigned int	slen;
+	short int	ccc;
+	short int	nccc;
+	unsigned char	hangul[UTF8HANGULLEAF];
+};
+
+/*
+ * Initialize a utf8cursor to normalize a string.
+ * Returns 0 on success.
+ * Returns -1 on failure.
+ */
+extern int utf8cursor(struct utf8cursor *u8c, const struct utf8data *data,
+		      const char *s);
+extern int utf8ncursor(struct utf8cursor *u8c, const struct utf8data *data,
+		       const char *s, size_t len);
+
+/*
+ * Get the next byte in the normalization.
+ * Returns a value > 0 && < 256 on success.
+ * Returns 0 when the end of the normalization is reached.
+ * Returns -1 if the string being normalized is not valid UTF-8.
+ */
+extern int utf8byte(struct utf8cursor *u8c);
+
+#endif /* UTF8NORM_H */
diff --git a/lib/ext2fs/valid_blk.c b/lib/ext2fs/valid_blk.c
new file mode 100644
index 0000000..db5d90a
--- /dev/null
+++ b/lib/ext2fs/valid_blk.c
@@ -0,0 +1,68 @@
+/*
+ * valid_blk.c --- does the inode have valid blocks?
+ *
+ * Copyright 1997 by Theodore Ts'o
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <string.h>
+#include <time.h>
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+/*
+ * This function returns 1 if the inode's block entries actually
+ * contain block entries.
+ */
+int ext2fs_inode_has_valid_blocks2(ext2_filsys fs, struct ext2_inode *inode)
+{
+	/*
+	 * Only directories, regular files, and some symbolic links
+	 * have valid block entries.
+	 */
+	if (!LINUX_S_ISDIR(inode->i_mode) && !LINUX_S_ISREG(inode->i_mode) &&
+	    !LINUX_S_ISLNK(inode->i_mode))
+		return 0;
+
+	/*
+	 * If the symbolic link is a "fast symlink", then the symlink
+	 * target is stored in the block entries.
+	 */
+	if (LINUX_S_ISLNK (inode->i_mode)) {
+		if (ext2fs_file_acl_block(fs, inode) == 0) {
+			/* With no EA block, we can rely on i_blocks */
+			if (inode->i_blocks == 0)
+				return 0;
+		} else {
+			/* With an EA block, life gets more tricky */
+			if (inode->i_size >= EXT2_N_BLOCKS*4)
+				return 1; /* definitely using i_block[] */
+			if (inode->i_size > 4 && inode->i_block[1] == 0)
+				return 1; /* definitely using i_block[] */
+			return 0; /* Probably a fast symlink */
+		}
+	}
+
+	/*
+	 * If this inode has inline data, it shouldn't have valid block
+	 * entries.
+	 */
+	if (inode->i_flags & EXT4_INLINE_DATA_FL)
+		return 0;
+	return 1;
+}
+
+int ext2fs_inode_has_valid_blocks(struct ext2_inode *inode)
+{
+	return ext2fs_inode_has_valid_blocks2(NULL, inode);
+}
diff --git a/lib/ext2fs/version.c b/lib/ext2fs/version.c
new file mode 100644
index 0000000..f8c8acf
--- /dev/null
+++ b/lib/ext2fs/version.c
@@ -0,0 +1,57 @@
+/*
+ * version.c --- Return the version of the ext2 library
+ *
+ * Copyright (C) 1997 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#include <string.h>
+#include <stdio.h>
+#include <ctype.h>
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+#include "../../version.h"
+
+static const char *lib_version = E2FSPROGS_VERSION;
+static const char *lib_date = E2FSPROGS_DATE;
+
+int ext2fs_parse_version_string(const char *ver_string)
+{
+	const char *cp;
+	int version = 0, dot_count = 0;
+
+	for (cp = ver_string; *cp; cp++) {
+		if (*cp == '.') {
+			if (dot_count++)
+				break;
+			else
+				continue;
+		}
+		if (!isdigit(*cp))
+			break;
+		version = (version * 10) + (*cp - '0');
+	}
+	return version;
+}
+
+
+int ext2fs_get_library_version(const char **ver_string,
+			       const char **date_string)
+{
+	if (ver_string)
+		*ver_string = lib_version;
+	if (date_string)
+		*date_string = lib_date;
+
+	return ext2fs_parse_version_string(lib_version);
+}
diff --git a/lib/ext2fs/windows_io.c b/lib/ext2fs/windows_io.c
new file mode 100644
index 0000000..83aea68
--- /dev/null
+++ b/lib/ext2fs/windows_io.c
@@ -0,0 +1,1031 @@
+/*
+ * windows_io.c --- This is the Windows implementation of the I/O manager.
+ *
+ * Implements a one-block write-through cache.
+ *
+ * Copyright (C) 1993, 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001,
+ *	2002 by Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include <windows.h>
+#include <winioctl.h>
+#include <io.h>
+
+#if !defined(__FreeBSD__) && !defined(__NetBSD__) && !defined(__OpenBSD__)
+#define _XOPEN_SOURCE 600
+#define _DARWIN_C_SOURCE
+#define _FILE_OFFSET_BITS 64
+#ifndef _LARGEFILE_SOURCE
+#define _LARGEFILE_SOURCE
+#endif
+#ifndef _LARGEFILE64_SOURCE
+#define _LARGEFILE64_SOURCE
+#endif
+#ifndef _GNU_SOURCE
+#define _GNU_SOURCE
+#endif
+#endif
+
+#include "config.h"
+#include <stdio.h>
+#include <string.h>
+#if HAVE_UNISTD_H
+#include <unistd.h>
+#endif
+#if HAVE_ERRNO_H
+#include <errno.h>
+#endif
+#include <fcntl.h>
+#include <time.h>
+#if HAVE_SYS_TYPES_H
+#include <sys/types.h>
+#endif
+#define PR_GET_DUMPABLE 3
+#if HAVE_SYS_STAT_H
+#include <sys/stat.h>
+#endif
+#include <fcntl.h>
+
+#undef ALIGN_DEBUG
+
+//#define DEBUG
+#ifdef DEBUG
+#define TRACE(...) {\
+		    char __log[256];\
+		    snprintf(__log, sizeof(__log), __VA_ARGS__);\
+		    __log[sizeof(__log)-1] = 0;\
+		    OutputDebugString(__log);\
+		}
+#else
+#define TRACE(...) do { } while (0);
+#endif
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+#include "ext2fsP.h"
+
+/*
+ * For checking structure magic numbers...
+ */
+
+#define EXT2_CHECK_MAGIC(struct, code) \
+	  if ((struct)->magic != (code)) return (code)
+#define EXT2_CHECK_MAGIC_RETURN(struct, code, ret) \
+	  if ((struct)->magic != (code)) return (ret)
+
+#define EXT2_ET_MAGIC_WINDOWS_IO_CHANNEL  0x10ed
+
+struct windows_cache {
+	char			*buf;
+	unsigned long long	block;
+	int			access_time;
+	unsigned		dirty:1;
+	unsigned		in_use:1;
+};
+
+#define CACHE_SIZE 8
+#define WRITE_DIRECT_SIZE 4	/* Must be smaller than CACHE_SIZE */
+#define READ_DIRECT_SIZE 4	/* Should be smaller than CACHE_SIZE */
+
+struct windows_private_data {
+	int	magic;
+	char	name[MAX_PATH];
+	HANDLE	handle;
+	char	dos_device[MAX_PATH];
+	char	cf_device[MAX_PATH];
+	int	dev;
+	int	flags;
+	int	align;
+	int	access_time;
+	ext2_loff_t offset;
+	struct windows_cache cache[CACHE_SIZE];
+	void	*bounce;
+	struct struct_io_stats io_stats;
+};
+
+#define IS_ALIGNED(n, align) ((((uintptr_t) n) & \
+			       ((uintptr_t) ((align)-1))) == 0)
+
+static int fake_dos_name_for_device(struct windows_private_data *data)
+{
+	if (strncmp(data->name, "\\\\", 2) == 0) {
+		data->dos_device[0] = 0;
+		strcpy(data->cf_device, data->name);
+		return 0;
+	}
+
+	_snprintf(data->dos_device, MAX_PATH, "fakedevice%lu", GetCurrentProcessId());
+
+	if (!DefineDosDevice(DDD_RAW_TARGET_PATH, data->dos_device, data->name))
+		return 1;
+
+	_snprintf(data->cf_device, MAX_PATH, "\\\\.\\%s", data->dos_device);
+	TRACE("e2fsprogs::fake_dos_name_for_device::DefineDosDevice(\"%s\")", data->dos_device);
+
+	return 0;
+}
+
+static void remove_fake_dos_name(struct windows_private_data *data)
+{
+	if (*data->dos_device) {
+		TRACE("e2fsprogs::remove_fake_dos_name::DefineDosDevice(\"%s\")", data->dos_device);
+		DefineDosDevice(DDD_RAW_TARGET_PATH | DDD_EXACT_MATCH_ON_REMOVE | DDD_REMOVE_DEFINITION, data->dos_device, data->name);
+	}
+}
+
+static errcode_t windows_get_stats(io_channel channel, io_stats *stats)
+{
+	errcode_t	retval = 0;
+
+	struct windows_private_data *data;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct windows_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_WINDOWS_IO_CHANNEL);
+
+	if (stats)
+		*stats = &data->io_stats;
+
+	return retval;
+}
+
+/*
+ * Here are the raw I/O functions
+ */
+static errcode_t raw_read_blk(io_channel channel,
+			      struct windows_private_data *data,
+			      unsigned long long block,
+			      int count, void *bufv)
+{
+	errcode_t	retval;
+	ssize_t	size;
+	ext2_loff_t	location;
+	DWORD		actual = 0;
+	unsigned char	*buf = bufv;
+	ssize_t		really_read = 0;
+
+	size = (count < 0) ? -count : count * channel->block_size;
+	data->io_stats.bytes_read += size;
+	location = ((ext2_loff_t) block * channel->block_size) + data->offset;
+
+	if (data->flags & IO_FLAG_FORCE_BOUNCE) {
+		if (SetFilePointer(data->handle, location, NULL, FILE_BEGIN) == INVALID_SET_FILE_POINTER) {
+			retval = GetLastError();
+			goto error_out;
+		}
+		goto bounce_read;
+	}
+
+	if (SetFilePointer(data->handle, location, NULL, FILE_BEGIN) == INVALID_SET_FILE_POINTER) {
+		retval = GetLastError();
+		goto error_out;
+	}
+	if ((channel->align == 0) || (IS_ALIGNED(buf, channel->align) && IS_ALIGNED(size, channel->align))) {
+		if (!ReadFile(data->handle, buf, size, &actual, NULL)) {
+			retval = GetLastError();
+			goto error_out;
+		}
+		if (actual != size) {
+	short_read:
+		if (actual < 0) {
+			retval = GetLastError();
+			actual = 0;
+		} else
+			retval = EXT2_ET_SHORT_READ;
+		goto error_out;
+		}
+	return 0;
+	}
+
+	/*
+	 * The buffer or size which we're trying to read isn't aligned
+	 * to the O_DIRECT rules, so we need to do this the hard way...
+	 */
+bounce_read:
+	while (size > 0) {
+		if (!ReadFile(data->handle, data->bounce, channel->block_size, &actual, NULL)) {
+			retval = GetLastError();
+			goto error_out;
+		}
+		if (actual != channel->block_size) {
+			actual = really_read;
+			buf -= really_read;
+			size += really_read;
+			goto short_read;
+		}
+		actual = size;
+		if (size > channel->block_size)
+			actual = channel->block_size;
+		memcpy(buf, data->bounce, actual);
+		really_read += actual;
+		size -= actual;
+		buf += actual;
+	}
+	return 0;
+
+error_out:
+	if (actual >= 0 && actual < size)
+		memset((char *) buf+actual, 0, size-actual);
+	if (channel->read_error)
+		retval = (channel->read_error)(channel, block, count, buf,
+					       size, actual, retval);
+	return retval;
+}
+
+static errcode_t raw_write_blk(io_channel channel,
+			       struct windows_private_data *data,
+			       unsigned long long block,
+			       int count, const void *bufv)
+{
+	ssize_t		size;
+	ext2_loff_t	location;
+	DWORD		actual = 0;
+	errcode_t	retval;
+	const unsigned char *buf = bufv;
+
+	if (count == 1)
+		size = channel->block_size;
+	else {
+		if (count < 0)
+			size = -count;
+		else
+			size = count * channel->block_size;
+	}
+	data->io_stats.bytes_written += size;
+
+	location = ((ext2_loff_t) block * channel->block_size) + data->offset;
+
+	if (data->flags & IO_FLAG_FORCE_BOUNCE) {
+		if (SetFilePointer(data->handle, location, NULL, FILE_BEGIN) == INVALID_SET_FILE_POINTER) {
+			retval = GetLastError();
+			goto error_out;
+		}
+	goto bounce_write;
+	}
+
+		if (SetFilePointer(data->handle, location, NULL, FILE_BEGIN) == INVALID_SET_FILE_POINTER) {
+			retval = GetLastError();
+		goto error_out;
+	}
+
+	SetLastError(0);
+
+	if ((channel->align == 0) || (IS_ALIGNED(buf, channel->align) && IS_ALIGNED(size, channel->align))) {
+		if (!WriteFile(data->handle, buf, size, &actual, NULL)) {
+			retval = GetLastError();
+			goto error_out;
+		}
+
+		if (actual != size) {
+		short_write:
+			retval = EXT2_ET_SHORT_WRITE;
+			goto error_out;
+		}
+		return 0;
+	}
+
+	/*
+	 * The buffer or size which we're trying to write isn't aligned
+	 * to the O_DIRECT rules, so we need to do this the hard way...
+	 */
+bounce_write:
+	while (size > 0) {
+		if (size < channel->block_size) {
+			if (!ReadFile(data->handle, data->bounce, channel->block_size, &actual, NULL)) {
+				retval = GetLastError();
+				goto error_out;
+			}
+			if (actual != channel->block_size) {
+				if (actual < 0) {
+					retval = GetLastError();
+					goto error_out;
+				}
+				memset((char *) data->bounce + actual, 0,
+				       channel->block_size - actual);
+			}
+		}
+		actual = size;
+		if (size > channel->block_size)
+			actual = channel->block_size;
+		memcpy(data->bounce, buf, actual);
+		if (SetFilePointer(data->handle, location, NULL, FILE_BEGIN) == INVALID_SET_FILE_POINTER) {
+			retval = GetLastError();
+			goto error_out;
+		}
+		if (!WriteFile(data->handle, data->bounce, channel->block_size, &actual, NULL)) {
+			retval = GetLastError();
+			goto error_out;
+		}
+
+		if (actual != channel->block_size)
+			goto short_write;
+		size -= actual;
+		buf += actual;
+		location += actual;
+	}
+	return 0;
+
+error_out:
+	if (channel->write_error)
+		retval = (channel->write_error)(channel, block, count, buf,
+						size, actual, retval);
+	return retval;
+}
+
+
+/*
+ * Here we implement the cache functions
+ */
+
+/* Allocate the cache buffers */
+static errcode_t alloc_cache(io_channel channel,
+			     struct windows_private_data *data)
+{
+	errcode_t		retval;
+	struct windows_cache	*cache;
+	int			i;
+
+	data->access_time = 0;
+	for (i=0, cache = data->cache; i < CACHE_SIZE; i++, cache++) {
+		cache->block = 0;
+		cache->access_time = 0;
+		cache->dirty = 0;
+		cache->in_use = 0;
+		if (cache->buf)
+			ext2fs_free_mem(&cache->buf);
+		retval = io_channel_alloc_buf(channel, 0, &cache->buf);
+		if (retval)
+			return retval;
+	}
+	if (channel->align || data->flags & IO_FLAG_FORCE_BOUNCE) {
+		if (data->bounce)
+			ext2fs_free_mem(&data->bounce);
+		retval = io_channel_alloc_buf(channel, 0, &data->bounce);
+	}
+	return retval;
+}
+
+/* Free the cache buffers */
+static void free_cache(struct windows_private_data *data)
+{
+	struct windows_cache    *cache;
+	int			i;
+
+	data->access_time = 0;
+	for (i=0, cache = data->cache; i < CACHE_SIZE; i++, cache++) {
+		cache->block = 0;
+		cache->access_time = 0;
+		cache->dirty = 0;
+		cache->in_use = 0;
+		if (cache->buf)
+			ext2fs_free_mem(&cache->buf);
+	}
+	if (data->bounce)
+		ext2fs_free_mem(&data->bounce);
+}
+
+#ifndef NO_IO_CACHE
+/*
+ * Try to find a block in the cache.  If the block is not found, and
+ * eldest is a non-zero pointer, then fill in eldest with the cache
+ * entry to that should be reused.
+ */
+static struct windows_cache *find_cached_block(struct windows_private_data *data,
+					    unsigned long long block,
+					    struct windows_cache **eldest)
+{
+	struct windows_cache	*cache, *unused_cache, *oldest_cache;
+	int			i;
+
+	unused_cache = oldest_cache = 0;
+	for (i=0, cache = data->cache; i < CACHE_SIZE; i++, cache++) {
+		if (!cache->in_use) {
+			if (!unused_cache)
+				unused_cache = cache;
+			continue;
+		}
+		if (cache->block == block) {
+			cache->access_time = ++data->access_time;
+			return cache;
+		}
+		if (!oldest_cache ||
+		   (cache->access_time < oldest_cache->access_time))
+			oldest_cache = cache;
+	}
+	if (eldest)
+		*eldest = (unused_cache) ? unused_cache : oldest_cache;
+	return 0;
+}
+
+/*
+ * Reuse a particular cache entry for another block.
+ */
+static void reuse_cache(io_channel channel, struct windows_private_data *data,
+		 struct windows_cache *cache, unsigned long long block)
+{
+	if (cache->dirty && cache->in_use)
+		raw_write_blk(channel, data, cache->block, 1, cache->buf);
+
+	cache->in_use = 1;
+	cache->dirty = 0;
+	cache->block = block;
+	cache->access_time = ++data->access_time;
+}
+
+/*
+ * Flush all of the blocks in the cache
+ */
+static errcode_t flush_cached_blocks(io_channel channel,
+				     struct windows_private_data *data,
+				     int invalidate)
+{
+	struct windows_cache	*cache;
+	errcode_t	retval, retval2;
+	int			i;
+
+	retval2 = 0;
+	for (i=0, cache = data->cache; i < CACHE_SIZE; i++, cache++) {
+		if (!cache->in_use)
+			continue;
+
+		if (invalidate)
+			cache->in_use = 0;
+
+		if (!cache->dirty)
+			continue;
+
+		retval = raw_write_blk(channel, data,
+				       cache->block, 1, cache->buf);
+		if (retval)
+			retval2 = retval;
+		else
+			cache->dirty = 0;
+	}
+	return retval2;
+}
+#endif /* NO_IO_CACHE */
+
+static errcode_t windows_open_channel(struct windows_private_data *data,
+				   int flags, io_channel *channel,
+				   io_manager io_mgr)
+{
+	io_channel	io = NULL;
+	errcode_t	retval;
+	ext2fs_struct_stat st;
+
+	retval = ext2fs_get_mem(sizeof(struct struct_io_channel), &io);
+	if (retval)
+		goto cleanup;
+	memset(io, 0, sizeof(struct struct_io_channel));
+	io->magic = EXT2_ET_MAGIC_IO_CHANNEL;
+
+	io->manager = io_mgr;
+	retval = ext2fs_get_mem(strlen(data->name)+1, &io->name);
+	if (retval)
+		goto cleanup;
+
+	strcpy(io->name, data->name);
+	io->private_data = data;
+	io->block_size = 1024;
+	io->read_error = 0;
+	io->write_error = 0;
+	io->refcount = 1;
+
+#if defined(O_DIRECT)
+	if (flags & IO_FLAG_DIRECT_IO)
+		io->align = ext2fs_get_dio_alignment(data->dev);
+#endif
+
+	/*
+	 * If the device is really a block device, then set the
+	 * appropriate flag, otherwise we can set DISCARD_ZEROES flag
+	 * because we are going to use punch hole instead of discard
+	 * and if it succeed, subsequent read from sparse area returns
+	 * zero.
+	 */
+	if (ext2fs_fstat(data->dev, &st) == 0) {
+		if (ext2fsP_is_disk_device(st.st_mode))
+			io->flags |= CHANNEL_FLAGS_BLOCK_DEVICE;
+		else
+			io->flags |= CHANNEL_FLAGS_DISCARD_ZEROES;
+	}
+
+	if ((retval = alloc_cache(io, data)))
+		goto cleanup;
+
+#ifdef BLKROGET
+	if (flags & IO_FLAG_RW) {
+		int error;
+		int readonly = 0;
+
+		/* Is the block device actually writable? */
+		error = ioctl(data->dev, BLKROGET, &readonly);
+		if (!error && readonly) {
+			retval = EPERM;
+			goto cleanup;
+		}
+	}
+#endif
+
+	*channel = io;
+	return 0;
+
+cleanup:
+	if (data) {
+		if (data->dev >= 0)
+			close(data->dev);
+		free_cache(data);
+		ext2fs_free_mem(&data);
+	}
+	if (io) {
+		if (io->name) {
+			ext2fs_free_mem(&io->name);
+		}
+		ext2fs_free_mem(&io);
+	}
+	return retval;
+}
+
+static DWORD windows_open_device(struct windows_private_data *data, int open_flags)
+{
+	DWORD ret = 0;
+
+	if (*data->name != '\\')
+		strcpy(data->cf_device, data->name);
+	else if (fake_dos_name_for_device(data))
+		return -1;
+
+	DWORD desired_access = GENERIC_READ | ((open_flags & O_RDWR) ? GENERIC_WRITE : 0);
+	DWORD share_mode = (open_flags & O_EXCL) ? 0 : FILE_SHARE_READ | ((open_flags & O_RDWR) ? FILE_SHARE_WRITE : 0);
+	DWORD flags_and_attributes =
+#if defined(O_DIRECT)
+	(open_flags & O_DIRECT) ? (FILE_FLAG_NO_BUFFERING | FILE_FLAG_WRITE_THROUGH) : FILE_ATTRIBUTE_NORMAL;
+#else
+	FILE_FLAG_NO_BUFFERING | FILE_FLAG_WRITE_THROUGH;
+#endif
+
+	data->handle = CreateFile(data->cf_device, desired_access, share_mode, NULL, OPEN_EXISTING,
+				  flags_and_attributes, NULL);
+
+	if (data->handle == INVALID_HANDLE_VALUE) {
+		ret = GetLastError();
+		goto invalid_handle;
+	}
+
+	TRACE("e2fsprogs::windows_open_device::CreateFile(\"%s\") = %p", data->cf_device, data->handle);
+
+	data->dev = _open_osfhandle((intptr_t)data->handle, 0);
+	if (data->dev < 0) {
+		ret = GetLastError() ? GetLastError() : 9999;
+		goto osfhandle_error;
+	}
+
+	TRACE("e2fsprogs::windows_open_device::_open_osfhandle(%p) = %d", data->handle, data->dev);
+
+	return 0;
+
+osfhandle_error:
+	TRACE("e2fsprogs::windows_open_device::CloseHandle(%p)", data->handle);
+	CloseHandle(data->handle);
+invalid_handle:
+	remove_fake_dos_name(data);
+	TRACE("e2fsprogs::windows_open_device() = %lu, errno = %d", ret, errno);
+	return ret;
+}
+
+static struct windows_private_data *init_private_data(const char *name, int flags)
+{
+	struct windows_private_data *data = NULL;
+
+	if (ext2fs_get_mem(sizeof(struct windows_private_data), &data))
+		return NULL;
+
+	memset(data, 0, sizeof(struct windows_private_data));
+	strncpy(data->name, name, sizeof(data->name) - 1);
+	data->magic = EXT2_ET_MAGIC_WINDOWS_IO_CHANNEL;
+	data->io_stats.num_fields = 2;
+	data->flags = flags;
+	data->handle = INVALID_HANDLE_VALUE;
+
+	return data;
+}
+
+static errcode_t windows_open(const char *name, int flags, io_channel *channel)
+{
+	int open_flags;
+	struct windows_private_data *data;
+
+	if (name == 0)
+		return EXT2_ET_BAD_DEVICE_NAME;
+
+	data = init_private_data(name, flags);
+	if (!data)
+		return EXT2_ET_NO_MEMORY;
+
+	open_flags = (flags & IO_FLAG_RW) ? O_RDWR : O_RDONLY;
+	if (flags & IO_FLAG_EXCLUSIVE)
+		open_flags |= O_EXCL;
+#if defined(O_DIRECT)
+	if (flags & IO_FLAG_DIRECT_IO)
+		open_flags |= O_DIRECT;
+#endif
+
+	if (windows_open_device(data, open_flags)) {
+		ext2fs_free_mem(&data);
+		return EXT2_ET_BAD_DEVICE_NAME;
+	}
+
+	return windows_open_channel(data, flags, channel, windows_io_manager);
+}
+
+static errcode_t windows_close(io_channel channel)
+{
+	struct windows_private_data *data;
+	errcode_t	retval = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct windows_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_WINDOWS_IO_CHANNEL);
+
+	if (--channel->refcount > 0)
+		return 0;
+
+#ifndef NO_IO_CACHE
+	retval = flush_cached_blocks(channel, data, 0);
+#endif
+
+	remove_fake_dos_name(data);
+
+	if (_close(data->dev) != 0)
+		retval = errno;
+
+	TRACE("e2fsprogs::windows_close::_close(%d)", data->dev);
+
+	free_cache(data);
+
+	ext2fs_free_mem(&channel->private_data);
+	if (channel->name)
+		ext2fs_free_mem(&channel->name);
+	ext2fs_free_mem(&channel);
+	return retval;
+}
+
+static errcode_t windows_set_blksize(io_channel channel, int blksize)
+{
+	struct windows_private_data *data;
+	errcode_t		retval;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct windows_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_WINDOWS_IO_CHANNEL);
+
+	if (channel->block_size != blksize) {
+#ifndef NO_IO_CACHE
+		if ((retval = flush_cached_blocks(channel, data, 0)))
+			return retval;
+#endif
+
+		channel->block_size = blksize;
+		free_cache(data);
+		if ((retval = alloc_cache(channel, data)))
+			return retval;
+	}
+	return 0;
+}
+
+static errcode_t windows_read_blk64(io_channel channel, unsigned long long block, int count, void *buf)
+{
+	struct windows_private_data *data;
+	struct windows_cache *cache, *reuse[READ_DIRECT_SIZE];
+	errcode_t	retval;
+	char		*cp;
+	int		i, j;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct windows_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_WINDOWS_IO_CHANNEL);
+
+#ifdef NO_IO_CACHE
+	return raw_read_blk(channel, data, block, count, buf);
+#else
+	/*
+	 * If we're doing an odd-sized read or a very large read,
+	 * flush out the cache and then do a direct read.
+	 */
+	if (count < 0 || count > WRITE_DIRECT_SIZE) {
+		if ((retval = flush_cached_blocks(channel, data, 0)))
+			return retval;
+		return raw_read_blk(channel, data, block, count, buf);
+	}
+
+	cp = buf;
+	while (count > 0) {
+		/* If it's in the cache, use it! */
+		if ((cache = find_cached_block(data, block, &reuse[0]))) {
+#ifdef DEBUG
+			printf("Using cached block %lu\n", block);
+#endif
+			memcpy(cp, cache->buf, channel->block_size);
+			count--;
+			block++;
+			cp += channel->block_size;
+			continue;
+		}
+		if (count == 1) {
+			/*
+			 * Special case where we read directly into the
+			 * cache buffer; important in the O_DIRECT case
+			 */
+			cache = reuse[0];
+			reuse_cache(channel, data, cache, block);
+			if ((retval = raw_read_blk(channel, data, block, 1,
+						   cache->buf))) {
+				cache->in_use = 0;
+				return retval;
+			}
+			memcpy(cp, cache->buf, channel->block_size);
+			return 0;
+		}
+
+		/*
+		 * Find the number of uncached blocks so we can do a
+		 * single read request
+		 */
+		for (i=1; i < count; i++)
+			if (find_cached_block(data, block+i, &reuse[i]))
+				break;
+#ifdef DEBUG
+		printf("Reading %d blocks starting at %lu\n", i, block);
+#endif
+		if ((retval = raw_read_blk(channel, data, block, i, cp)))
+			return retval;
+
+		/* Save the results in the cache */
+		for (j=0; j < i; j++) {
+			count--;
+			cache = reuse[j];
+			reuse_cache(channel, data, cache, block++);
+			memcpy(cache->buf, cp, channel->block_size);
+			cp += channel->block_size;
+		}
+	}
+	return 0;
+#endif /* NO_IO_CACHE */
+}
+
+static errcode_t windows_read_blk(io_channel channel, unsigned long block,
+			       int count, void *buf)
+{
+	return windows_read_blk64(channel, block, count, buf);
+}
+
+static errcode_t windows_write_blk64(io_channel channel,
+				unsigned long long block,
+				int count, const void *buf)
+{
+	struct windows_private_data *data;
+	struct windows_cache *cache, *reuse;
+	errcode_t	retval = 0;
+	const char	*cp;
+	int		writethrough;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct windows_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_WINDOWS_IO_CHANNEL);
+
+#ifdef NO_IO_CACHE
+	return raw_write_blk(channel, data, block, count, buf);
+#else
+	/*
+	 * If we're doing an odd-sized write or a very large write,
+	 * flush out the cache completely and then do a direct write.
+	 */
+	if (count < 0 || count > WRITE_DIRECT_SIZE) {
+		if ((retval = flush_cached_blocks(channel, data, 1)))
+			return retval;
+		return raw_write_blk(channel, data, block, count, buf);
+	}
+
+	/*
+	 * For a moderate-sized multi-block write, first force a write
+	 * if we're in write-through cache mode, and then fill the
+	 * cache with the blocks.
+	 */
+	writethrough = channel->flags & CHANNEL_FLAGS_WRITETHROUGH;
+	if (writethrough)
+		retval = raw_write_blk(channel, data, block, count, buf);
+
+	cp = buf;
+	while (count > 0) {
+		cache = find_cached_block(data, block, &reuse);
+		if (!cache) {
+			cache = reuse;
+			reuse_cache(channel, data, cache, block);
+		}
+		if (cache->buf != cp)
+			memcpy(cache->buf, cp, channel->block_size);
+		cache->dirty = !writethrough;
+		count--;
+		block++;
+		cp += channel->block_size;
+	}
+	return retval;
+#endif /* NO_IO_CACHE */
+}
+
+static errcode_t windows_cache_readahead(io_channel channel,
+				      unsigned long long block,
+				      unsigned long long count)
+{
+	return EXT2_ET_OP_NOT_SUPPORTED;
+}
+
+static errcode_t windows_write_blk(io_channel channel, unsigned long block,
+				int count, const void *buf)
+{
+	return windows_write_blk64(channel, block, count, buf);
+}
+
+static errcode_t windows_write_byte(io_channel channel, unsigned long offset,
+				 int size, const void *buf)
+{
+	return EXT2_ET_UNIMPLEMENTED;
+}
+
+HANDLE windows_get_handle(io_channel channel)
+{
+	struct windows_private_data *data;
+
+	EXT2_CHECK_MAGIC_RETURN(channel, EXT2_ET_MAGIC_IO_CHANNEL, INVALID_HANDLE_VALUE);
+	data = (struct windows_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC_RETURN(data, EXT2_ET_MAGIC_WINDOWS_IO_CHANNEL, INVALID_HANDLE_VALUE);
+
+	return data->handle;
+}
+
+/*
+ * Flush data buffers to disk.
+ */
+static errcode_t windows_flush(io_channel channel)
+{
+	struct windows_private_data *data;
+	errcode_t retval = 0;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct windows_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_WINDOWS_IO_CHANNEL);
+
+#ifndef NO_IO_CACHE
+	retval = flush_cached_blocks(channel, data, 0);
+#endif
+
+	return retval;
+}
+
+static errcode_t windows_set_option(io_channel channel, const char *option,
+				 const char *arg)
+{
+	struct windows_private_data *data;
+	unsigned long long tmp;
+	char *end;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct windows_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_WINDOWS_IO_CHANNEL);
+
+	if (!strcmp(option, "offset")) {
+		if (!arg)
+			return EXT2_ET_INVALID_ARGUMENT;
+
+		tmp = strtoull(arg, &end, 0);
+		if (*end)
+			return EXT2_ET_INVALID_ARGUMENT;
+		data->offset = tmp;
+		if (data->offset < 0)
+			return EXT2_ET_INVALID_ARGUMENT;
+		return 0;
+	}
+	return EXT2_ET_INVALID_ARGUMENT;
+}
+
+static errcode_t windows_discard(io_channel channel, unsigned long long block,
+				 unsigned long long count)
+{
+	TRACE("e2fsprogs::windows_discard::EXT2_ET_UNIMPLEMENTED");
+	return EXT2_ET_UNIMPLEMENTED;
+}
+
+/* parameters might not be used if OS doesn't support zeroout */
+#if __GNUC_PREREQ (4, 6)
+#pragma GCC diagnostic push
+#pragma GCC diagnostic ignored "-Wunused-parameter"
+#endif
+static errcode_t windows_zeroout(io_channel channel, unsigned long long block,
+			      unsigned long long count)
+{
+	struct windows_private_data *data;
+	int		ret;
+
+	EXT2_CHECK_MAGIC(channel, EXT2_ET_MAGIC_IO_CHANNEL);
+	data = (struct windows_private_data *) channel->private_data;
+	EXT2_CHECK_MAGIC(data, EXT2_ET_MAGIC_WINDOWS_IO_CHANNEL);
+
+	if (channel->flags & CHANNEL_FLAGS_BLOCK_DEVICE) {
+		/* Not implemented until the BLKZEROOUT mess is fixed */
+		goto unimplemented;
+	} else {
+		/* Regular file, try to use truncate/punch/zero. */
+		struct stat statbuf;
+
+		if (count == 0)
+			return 0;
+		/*
+		 * If we're trying to zero a range past the end of the file,
+		 * extend the file size, then truncate everything.
+		 */
+		ret = fstat(data->dev, &statbuf);
+		if (ret)
+			goto err;
+		if ((unsigned long long) statbuf.st_size <
+			(block + count) * channel->block_size + data->offset) {
+			ret = ftruncate(data->dev,
+					(block + count) * channel->block_size + data->offset);
+			if (ret)
+				goto err;
+		}
+		goto unimplemented;
+	}
+err:
+	if (ret < 0) {
+		if (errno == EOPNOTSUPP)
+			goto unimplemented;
+		return errno;
+	}
+	return 0;
+unimplemented:
+	return EXT2_ET_UNIMPLEMENTED;
+}
+
+int ext2fs_open_file(const char *pathname, int flags, mode_t mode)
+{
+	flags |= O_BINARY;
+
+	if (mode)
+#if defined(HAVE_OPEN64) && !defined(__OSX_AVAILABLE_BUT_DEPRECATED)
+		return open64(pathname, flags, mode);
+	else
+		return open64(pathname, flags);
+#else
+		return open(pathname, flags, mode);
+	else
+		return open(pathname, flags);
+#endif
+}
+
+int ext2fs_stat(const char *path, ext2fs_struct_stat *buf)
+{
+#if defined(HAVE_FSTAT64) && !defined(__OSX_AVAILABLE_BUT_DEPRECATED)
+	return stat64(path, buf);
+#else
+	return stat(path, buf);
+#endif
+}
+
+int ext2fs_fstat(int fd, ext2fs_struct_stat *buf)
+{
+#if defined(HAVE_FSTAT64) && !defined(__OSX_AVAILABLE_BUT_DEPRECATED)
+	return fstat64(fd, buf);
+#else
+	return fstat(fd, buf);
+#endif
+}
+
+#if __GNUC_PREREQ (4, 6)
+#pragma GCC diagnostic pop
+#endif
+
+static struct struct_io_manager struct_windows_manager = {
+	.magic		= EXT2_ET_MAGIC_IO_MANAGER,
+	.name		= "Windows I/O Manager",
+	.open		= windows_open,
+	.close		= windows_close,
+	.set_blksize	= windows_set_blksize,
+	.read_blk	= windows_read_blk,
+	.write_blk	= windows_write_blk,
+	.flush		= windows_flush,
+	.write_byte	= windows_write_byte,
+	.set_option	= windows_set_option,
+	.get_stats	= windows_get_stats,
+	.read_blk64	= windows_read_blk64,
+	.write_blk64	= windows_write_blk64,
+	.discard	= windows_discard,
+	.cache_readahead	= windows_cache_readahead,
+	.zeroout	= windows_zeroout,
+};
+
+io_manager windows_io_manager = &struct_windows_manager;
diff --git a/lib/ext2fs/write_bb_file.c b/lib/ext2fs/write_bb_file.c
new file mode 100644
index 0000000..5834340
--- /dev/null
+++ b/lib/ext2fs/write_bb_file.c
@@ -0,0 +1,35 @@
+/*
+ * write_bb_file.c --- write a list of bad blocks to a FILE *
+ *
+ * Copyright (C) 1994, 1995 Theodore Ts'o.
+ *
+ * %Begin-Header%
+ * This file may be redistributed under the terms of the GNU Library
+ * General Public License, version 2.
+ * %End-Header%
+ */
+
+#include "config.h"
+#include <stdio.h>
+
+#include "ext2_fs.h"
+#include "ext2fs.h"
+
+errcode_t ext2fs_write_bb_FILE(ext2_badblocks_list bb_list,
+			       unsigned int flags EXT2FS_ATTR((unused)),
+			       FILE *f)
+{
+	badblocks_iterate	bb_iter;
+	blk_t			blk;
+	errcode_t		retval;
+
+	retval = ext2fs_badblocks_list_iterate_begin(bb_list, &bb_iter);
+	if (retval)
+		return retval;
+
+	while (ext2fs_badblocks_list_iterate(bb_iter, &blk)) {
+		fprintf(f, "%u\n", blk);
+	}
+	ext2fs_badblocks_list_iterate_end(bb_iter);
+	return 0;
+}
-- 
cgit v1.2.3