Adding upstream version 124.0.1.upstream/124.0.1

Signed-off-by: Daniel Baumann <daniel.baumann@progress-linux.org>

219 files changed, 48379 insertions, 0 deletions

diff --git a/browser/components/preferences/containers.inc.xhtml b/browser/components/preferences/containers.inc.xhtml
new file mode 100644
index 0000000000..7e2a7172dd
--- /dev/null
+++ b/browser/components/preferences/containers.inc.xhtml
@@ -0,0 +1,42 @@
+# This Source Code Form is subject to the terms of the Mozilla Public
+# License, v. 2.0. If a copy of the MPL was not distributed with this
+# file, You can obtain one at http://mozilla.org/MPL/2.0/.
+
+<!-- Containers panel -->
+
+<script src="chrome://browser/content/preferences/containers.js"/>
+
+<hbox hidden="true"
+      class="container-header-links"
+      data-category="paneContainers">
+  <button id="backContainersButton" class="back-button" data-l10n-id="containers-back-button2"/>
+</hbox>
+
+<hbox id="header-containers"
+      class="header"
+      hidden="true"
+      data-category="paneContainers">
+  <html:h1 data-l10n-id="containers-header"/>
+</hbox>
+
+<!-- Containers -->
+<groupbox id="browserContainersGroupPane" data-category="paneContainers" hidden="true"
+          data-hidden-from-search="true" data-subpanel="true">
+  <vbox id="browserContainersbox">
+    <richlistbox id="containersView"/>
+  </vbox>
+  <vbox>
+    <hbox flex="1">
+      <button id="containersAdd"
+              is="highlightable-button"
+              data-l10n-id="containers-add-button"/>
+    </hbox>
+  </vbox>
+  <vbox>
+    <hbox flex="1">
+      <checkbox id="containersNewTabCheck"
+              data-l10n-id="containers-new-tab-check"
+              preference="privacy.userContext.newTabContainerOnLeftClick.enabled"/>
+    </hbox>
+  </vbox>
+</groupbox>
diff --git a/browser/components/preferences/containers.js b/browser/components/preferences/containers.js
new file mode 100644
index 0000000000..80d1ec7cc3
--- /dev/null
+++ b/browser/components/preferences/containers.js
@@ -0,0 +1,151 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this file,
+ * You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+/* import-globals-from preferences.js */
+
+const defaultContainerIcon = "fingerprint";
+const defaultContainerColor = "blue";
+
+let gContainersPane = {
+  init() {
+    this._list = document.getElementById("containersView");
+
+    document
+      .getElementById("backContainersButton")
+      .addEventListener("command", function () {
+        gotoPref("general");
+      });
+
+    document
+      .getElementById("containersAdd")
+      .addEventListener("command", function () {
+        gContainersPane.onAddButtonCommand();
+      });
+
+    this._rebuildView();
+  },
+
+  _rebuildView() {
+    const containers = ContextualIdentityService.getPublicIdentities();
+    while (this._list.firstChild) {
+      this._list.firstChild.remove();
+    }
+    for (let container of containers) {
+      let item = document.createXULElement("richlistitem");
+
+      let outer = document.createXULElement("hbox");
+      outer.setAttribute("flex", 1);
+      outer.setAttribute("align", "center");
+      item.appendChild(outer);
+
+      let userContextIcon = document.createXULElement("hbox");
+      userContextIcon.className = "userContext-icon";
+      userContextIcon.classList.add("userContext-icon-inprefs");
+      userContextIcon.classList.add("identity-icon-" + container.icon);
+      userContextIcon.classList.add("identity-color-" + container.color);
+      outer.appendChild(userContextIcon);
+
+      let label = document.createXULElement("label");
+      label.className = "userContext-label-inprefs";
+      label.setAttribute("flex", 1);
+      let containerName = ContextualIdentityService.getUserContextLabel(
+        container.userContextId
+      );
+      label.textContent = containerName;
+      label.setAttribute("tooltiptext", containerName);
+      outer.appendChild(label);
+
+      let containerButtons = document.createXULElement("hbox");
+      containerButtons.className = "container-buttons";
+      item.appendChild(containerButtons);
+
+      let prefsButton = document.createXULElement("button");
+      prefsButton.addEventListener("command", function (event) {
+        gContainersPane.onPreferenceCommand(event.originalTarget);
+      });
+      prefsButton.setAttribute("value", container.userContextId);
+      document.l10n.setAttributes(prefsButton, "containers-settings-button");
+      containerButtons.appendChild(prefsButton);
+
+      let removeButton = document.createXULElement("button");
+      removeButton.addEventListener("command", function (event) {
+        gContainersPane.onRemoveCommand(event.originalTarget);
+      });
+      removeButton.setAttribute("value", container.userContextId);
+      document.l10n.setAttributes(removeButton, "containers-remove-button");
+      containerButtons.appendChild(removeButton);
+
+      this._list.appendChild(item);
+    }
+  },
+
+  async onRemoveCommand(button) {
+    let userContextId = parseInt(button.getAttribute("value"), 10);
+
+    let count = ContextualIdentityService.countContainerTabs(userContextId);
+    if (count > 0) {
+      let [title, message, okButton, cancelButton] =
+        await document.l10n.formatValues([
+          { id: "containers-remove-alert-title" },
+          { id: "containers-remove-alert-msg", args: { count } },
+          { id: "containers-remove-ok-button" },
+          { id: "containers-remove-cancel-button" },
+        ]);
+
+      let buttonFlags =
+        Ci.nsIPrompt.BUTTON_TITLE_IS_STRING * Ci.nsIPrompt.BUTTON_POS_0 +
+        Ci.nsIPrompt.BUTTON_TITLE_IS_STRING * Ci.nsIPrompt.BUTTON_POS_1;
+
+      let rv = Services.prompt.confirmEx(
+        window,
+        title,
+        message,
+        buttonFlags,
+        okButton,
+        cancelButton,
+        null,
+        null,
+        {}
+      );
+      if (rv != 0) {
+        return;
+      }
+
+      await ContextualIdentityService.closeContainerTabs(userContextId);
+    }
+
+    ContextualIdentityService.remove(userContextId);
+    this._rebuildView();
+  },
+
+  onPreferenceCommand(button) {
+    this.openPreferenceDialog(button.getAttribute("value"));
+  },
+
+  onAddButtonCommand(button) {
+    this.openPreferenceDialog(null);
+  },
+
+  openPreferenceDialog(userContextId) {
+    let identity = {
+      name: "",
+      icon: defaultContainerIcon,
+      color: defaultContainerColor,
+    };
+    if (userContextId) {
+      identity =
+        ContextualIdentityService.getPublicIdentityFromId(userContextId);
+      identity.name = ContextualIdentityService.getUserContextLabel(
+        identity.userContextId
+      );
+    }
+
+    const params = { userContextId, identity };
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/containers.xhtml",
+      undefined,
+      params
+    );
+  },
+};
diff --git a/browser/components/preferences/dialogs/addEngine.css b/browser/components/preferences/dialogs/addEngine.css
new file mode 100644
index 0000000000..450e07f65f
--- /dev/null
+++ b/browser/components/preferences/dialogs/addEngine.css
@@ -0,0 +1,24 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+input {
+  flex: 1;
+}
+
+hbox {
+  width: 100%;
+}
+
+#engineNameLabel,
+#engineUrlLabel,
+#engineAliasLabel {
+  /* Align the labels with the inputs */
+  margin-inline-start: 4px;
+}
+
+#engineUrl {
+  /* Full URLs should always be displayed as LTR */
+  direction: ltr;
+  text-align: match-parent;
+}
diff --git a/browser/components/preferences/dialogs/addEngine.js b/browser/components/preferences/dialogs/addEngine.js
new file mode 100644
index 0000000000..1faf8622b3
--- /dev/null
+++ b/browser/components/preferences/dialogs/addEngine.js
@@ -0,0 +1,69 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+/* import-globals-from ../main.js */
+
+let gAddEngineDialog = {
+  _form: null,
+  _name: null,
+  _alias: null,
+
+  onLoad() {
+    document.mozSubdialogReady = this.init();
+  },
+
+  async init() {
+    this._dialog = document.querySelector("dialog");
+    this._form = document.getElementById("addEngineForm");
+    this._name = document.getElementById("engineName");
+    this._alias = document.getElementById("engineAlias");
+
+    this._name.addEventListener("input", this.onNameInput.bind(this));
+    this._alias.addEventListener("input", this.onAliasInput.bind(this));
+    this._form.addEventListener("input", this.onFormInput.bind(this));
+
+    document.addEventListener("dialogaccept", this.onAddEngine.bind(this));
+  },
+
+  async onAddEngine(event) {
+    let url = document
+      .getElementById("engineUrl")
+      .value.replace(/%s/, "{searchTerms}");
+    await Services.search.wrappedJSObject.addUserEngine(
+      this._name.value,
+      url,
+      this._alias.value
+    );
+  },
+
+  async onNameInput() {
+    if (this._name.value) {
+      let engine = Services.search.getEngineByName(this._name.value);
+      let validity = engine
+        ? document.getElementById("engineNameExists").textContent
+        : "";
+      this._name.setCustomValidity(validity);
+    }
+  },
+
+  async onAliasInput() {
+    let validity = "";
+    if (this._alias.value) {
+      let engine = await Services.search.getEngineByAlias(this._alias.value);
+      if (engine) {
+        engine = document.getElementById("engineAliasExists").textContent;
+      }
+    }
+    this._alias.setCustomValidity(validity);
+  },
+
+  async onFormInput() {
+    this._dialog.setAttribute(
+      "buttondisabledaccept",
+      !this._form.checkValidity()
+    );
+  },
+};
+
+window.addEventListener("load", () => gAddEngineDialog.onLoad());
diff --git a/browser/components/preferences/dialogs/addEngine.xhtml b/browser/components/preferences/dialogs/addEngine.xhtml
new file mode 100644
index 0000000000..d664fd8541
--- /dev/null
+++ b/browser/components/preferences/dialogs/addEngine.xhtml
@@ -0,0 +1,78 @@
+<?xml version="1.0"?>
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+
+<window
+  xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+  xmlns:html="http://www.w3.org/1999/xhtml"
+  data-l10n-id="add-engine-window2"
+  data-l10n-attrs="title, style"
+  persist="width height"
+>
+  <dialog
+    buttons="accept,cancel"
+    buttondisabledaccept="true"
+    data-l10n-id="add-engine-dialog"
+    data-l10n-attrs="buttonlabelaccept, buttonaccesskeyaccept"
+  >
+    <linkset>
+      <html:link rel="stylesheet" href="chrome://global/skin/global.css" />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/content/preferences/dialogs/addEngine.css"
+      />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/skin/preferences/preferences.css"
+      />
+
+      <html:link rel="localization" href="browser/preferences/addEngine.ftl" />
+    </linkset>
+
+    <script src="chrome://browser/content/preferences/dialogs/addEngine.js" />
+    <script src="chrome://global/content/globalOverlay.js" />
+    <script src="chrome://browser/content/utilityOverlay.js" />
+
+    <separator class="thin" />
+
+    <html:form id="addEngineForm">
+      <html:span
+        id="engineNameExists"
+        hidden="hidden"
+        data-l10n-id="engine-name-exists"
+      />
+      <html:label
+        id="engineNameLabel"
+        for="engineName"
+        data-l10n-id="add-engine-name"
+      />
+      <hbox>
+        <html:input id="engineName" type="text" required="required" />
+      </hbox>
+
+      <html:label
+        id="engineUrlLabel"
+        for="engineUrl"
+        data-l10n-id="add-engine-url"
+      />
+      <hbox>
+        <html:input id="engineUrl" type="url" required="required" />
+      </hbox>
+
+      <html:span
+        id="engineAliasExists"
+        hidden="hidden"
+        data-l10n-id="engine-alias-exists"
+      />
+      <html:label
+        id="engineAliasLabel"
+        for="engineAlias"
+        data-l10n-id="add-engine-alias"
+      />
+      <hbox>
+        <html:input id="engineAlias" type="text" />
+      </hbox>
+    </html:form>
+  </dialog>
+</window>
diff --git a/browser/components/preferences/dialogs/applicationManager.js b/browser/components/preferences/dialogs/applicationManager.js
new file mode 100644
index 0000000000..0c2105cbe4
--- /dev/null
+++ b/browser/components/preferences/dialogs/applicationManager.js
@@ -0,0 +1,129 @@
+// This Source Code Form is subject to the terms of the Mozilla Public
+// License, v. 2.0. If a copy of the MPL was not distributed with this
+// file, You can obtain one at http://mozilla.org/MPL/2.0/.
+
+/* import-globals-from ../main.js */
+
+var gAppManagerDialog = {
+  _removed: [],
+
+  onLoad() {
+    document.mozSubdialogReady = this.init();
+  },
+
+  async init() {
+    this.handlerInfo = window.arguments[0];
+
+    document.addEventListener("dialogaccept", function () {
+      gAppManagerDialog.onOK();
+    });
+
+    let gMainPane = window.parent.gMainPane;
+
+    const appDescElem = document.getElementById("appDescription");
+    if (this.handlerInfo.wrappedHandlerInfo instanceof Ci.nsIMIMEInfo) {
+      let { typeDescription } = this.handlerInfo;
+      let typeStr;
+      if (typeDescription.id) {
+        MozXULElement.insertFTLIfNeeded("browser/preferences/preferences.ftl");
+        typeStr = await document.l10n.formatValue(
+          typeDescription.id,
+          typeDescription.args
+        );
+      } else {
+        typeStr = typeDescription.raw;
+      }
+      document.l10n.setAttributes(appDescElem, "app-manager-handle-file", {
+        type: typeStr,
+      });
+    } else {
+      document.l10n.setAttributes(appDescElem, "app-manager-handle-protocol", {
+        type: this.handlerInfo.typeDescription.raw,
+      });
+    }
+
+    let list = document.getElementById("appList");
+    let listFragment = document.createDocumentFragment();
+    for (let app of this.handlerInfo.possibleApplicationHandlers.enumerate()) {
+      if (!gMainPane.isValidHandlerApp(app)) {
+        continue;
+      }
+
+      let item = document.createXULElement("richlistitem");
+      listFragment.append(item);
+      item.app = app;
+
+      let image = document.createXULElement("image");
+      image.setAttribute("src", gMainPane._getIconURLForHandlerApp(app));
+      item.appendChild(image);
+
+      let label = document.createXULElement("label");
+      label.setAttribute("value", app.name);
+      item.appendChild(label);
+    }
+    list.append(listFragment);
+
+    // Triggers onSelect which populates label
+    list.selectedIndex = 0;
+
+    // We want to block on those elements being localized because the
+    // result will impact the size of the subdialog.
+    await document.l10n.translateElements([
+      appDescElem,
+      document.getElementById("appType"),
+    ]);
+  },
+
+  onOK: function appManager_onOK() {
+    if (this._removed.length) {
+      for (var i = 0; i < this._removed.length; ++i) {
+        this.handlerInfo.removePossibleApplicationHandler(this._removed[i]);
+      }
+
+      this.handlerInfo.store();
+    }
+  },
+
+  remove: function appManager_remove() {
+    var list = document.getElementById("appList");
+    this._removed.push(list.selectedItem.app);
+    var index = list.selectedIndex;
+    var element = list.selectedItem;
+    list.removeItemFromSelection(element);
+    element.remove();
+    if (list.itemCount == 0) {
+      // The list is now empty, make the bottom part disappear
+      document.getElementById("appDetails").hidden = true;
+    } else {
+      // Select the item at the same index, if we removed the last
+      // item of the list, select the previous item
+      if (index == list.itemCount) {
+        --index;
+      }
+      list.selectedIndex = index;
+    }
+  },
+
+  onSelect: function appManager_onSelect() {
+    var list = document.getElementById("appList");
+    if (!list.selectedItem) {
+      document.getElementById("remove").disabled = true;
+      return;
+    }
+    document.getElementById("remove").disabled = false;
+    var app = list.selectedItem.app;
+    var address = "";
+    if (app instanceof Ci.nsILocalHandlerApp) {
+      address = app.executable.path;
+    } else if (app instanceof Ci.nsIWebHandlerApp) {
+      address = app.uriTemplate;
+    }
+    document.getElementById("appLocation").value = address;
+    const l10nId =
+      app instanceof Ci.nsILocalHandlerApp
+        ? "app-manager-local-app-info"
+        : "app-manager-web-app-info";
+    const appTypeElem = document.getElementById("appType");
+    document.l10n.setAttributes(appTypeElem, l10nId);
+  },
+};
diff --git a/browser/components/preferences/dialogs/applicationManager.xhtml b/browser/components/preferences/dialogs/applicationManager.xhtml
new file mode 100644
index 0000000000..f618543530
--- /dev/null
+++ b/browser/components/preferences/dialogs/applicationManager.xhtml
@@ -0,0 +1,71 @@
+<?xml version="1.0"?>
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+
+<window
+  xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+  xmlns:html="http://www.w3.org/1999/xhtml"
+  onload="gAppManagerDialog.onLoad();"
+  data-l10n-id="app-manager-window2"
+  data-l10n-attrs="title, style"
+>
+  <dialog id="appManager" buttons="accept,cancel">
+    <linkset>
+      <html:link rel="stylesheet" href="chrome://global/skin/global.css" />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/skin/preferences/applications.css"
+      />
+
+      <html:link
+        rel="localization"
+        href="browser/preferences/applicationManager.ftl"
+      />
+    </linkset>
+
+    <script src="chrome://browser/content/utilityOverlay.js" />
+    <script src="chrome://global/content/preferencesBindings.js" />
+    <script src="chrome://browser/content/preferences/dialogs/applicationManager.js" />
+
+    <commandset id="appManagerCommandSet">
+      <command
+        id="cmd_remove"
+        oncommand="gAppManagerDialog.remove();"
+        disabled="true"
+      />
+    </commandset>
+
+    <keyset id="appManagerKeyset">
+      <key id="delete" keycode="VK_DELETE" command="cmd_remove" />
+    </keyset>
+
+    <description id="appDescription" />
+    <separator class="thin" />
+    <hbox flex="1">
+      <richlistbox
+        id="appList"
+        onselect="gAppManagerDialog.onSelect();"
+        flex="1"
+      />
+      <vbox>
+        <button
+          id="remove"
+          data-l10n-id="app-manager-remove"
+          command="cmd_remove"
+        />
+        <spacer flex="1" />
+      </vbox>
+    </hbox>
+    <vbox id="appDetails">
+      <separator class="thin" />
+      <label id="appType" />
+      <html:input
+        type="text"
+        id="appLocation"
+        readonly="readonly"
+        style="margin-inline: 0"
+      />
+    </vbox>
+  </dialog>
+</window>
diff --git a/browser/components/preferences/dialogs/blocklists.js b/browser/components/preferences/dialogs/blocklists.js
new file mode 100644
index 0000000000..c28ee09f96
--- /dev/null
+++ b/browser/components/preferences/dialogs/blocklists.js
@@ -0,0 +1,175 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+const BASE_LIST_ID = "base";
+const CONTENT_LIST_ID = "content";
+const TRACK_SUFFIX = "-track-digest256";
+const TRACKING_TABLE_PREF = "urlclassifier.trackingTable";
+const LISTS_PREF_BRANCH = "browser.safebrowsing.provider.mozilla.lists.";
+
+var gBlocklistManager = {
+  _type: "",
+  _blockLists: [],
+  _tree: null,
+
+  _view: {
+    _rowCount: 0,
+    get rowCount() {
+      return this._rowCount;
+    },
+    getCellText(row, column) {
+      if (column.id == "listCol") {
+        let list = gBlocklistManager._blockLists[row];
+        return list.name;
+      }
+      return "";
+    },
+
+    isSeparator(index) {
+      return false;
+    },
+    isSorted() {
+      return false;
+    },
+    isContainer(index) {
+      return false;
+    },
+    setTree(tree) {},
+    getImageSrc(row, column) {},
+    getCellValue(row, column) {
+      if (column.id == "selectionCol") {
+        return gBlocklistManager._blockLists[row].selected;
+      }
+      return undefined;
+    },
+    cycleHeader(column) {},
+    getRowProperties(row) {
+      return "";
+    },
+    getColumnProperties(column) {
+      return "";
+    },
+    getCellProperties(row, column) {
+      if (column.id == "selectionCol") {
+        return "checkmark";
+      }
+
+      return "";
+    },
+  },
+
+  onLoad() {
+    this.init();
+    document.addEventListener("dialogaccept", () => this.onApplyChanges());
+  },
+
+  init() {
+    if (this._type) {
+      // reusing an open dialog, clear the old observer
+      this.uninit();
+    }
+
+    this._type = "tracking";
+
+    this._loadBlockLists();
+  },
+
+  uninit() {},
+
+  onListSelected() {
+    for (let list of this._blockLists) {
+      list.selected = false;
+    }
+    this._blockLists[this._tree.currentIndex].selected = true;
+
+    this._updateTree();
+  },
+
+  onApplyChanges() {
+    let activeList = this._getActiveList();
+    let selected = null;
+    for (let list of this._blockLists) {
+      if (list.selected) {
+        selected = list;
+        break;
+      }
+    }
+
+    if (activeList !== selected.id) {
+      let trackingTable = Services.prefs.getCharPref(TRACKING_TABLE_PREF);
+      if (selected.id != CONTENT_LIST_ID) {
+        trackingTable = trackingTable.replace(
+          "," + CONTENT_LIST_ID + TRACK_SUFFIX,
+          ""
+        );
+      } else {
+        trackingTable += "," + CONTENT_LIST_ID + TRACK_SUFFIX;
+      }
+      Services.prefs.setCharPref(TRACKING_TABLE_PREF, trackingTable);
+
+      // Force an update after changing the tracking protection table.
+      let listmanager = Cc[
+        "@mozilla.org/url-classifier/listmanager;1"
+      ].getService(Ci.nsIUrlListManager);
+      if (listmanager) {
+        listmanager.forceUpdates(trackingTable);
+      }
+    }
+  },
+
+  async _loadBlockLists() {
+    this._blockLists = [];
+
+    // Load blocklists into a table.
+    let branch = Services.prefs.getBranch(LISTS_PREF_BRANCH);
+    let itemArray = branch.getChildList("");
+    for (let itemName of itemArray) {
+      try {
+        let list = await this._createBlockList(itemName);
+        this._blockLists.push(list);
+      } catch (e) {
+        // Ignore bogus or missing list name.
+        continue;
+      }
+    }
+
+    this._updateTree();
+  },
+
+  async _createBlockList(id) {
+    let branch = Services.prefs.getBranch(LISTS_PREF_BRANCH);
+    let l10nKey = branch.getCharPref(id);
+
+    // eslint-disable-next-line mozilla/prefer-formatValues
+    let [listName, description] = await document.l10n.formatValues([
+      { id: `blocklist-item-${l10nKey}-listName` },
+      { id: `blocklist-item-${l10nKey}-description` },
+    ]);
+
+    // eslint-disable-next-line mozilla/prefer-formatValues
+    let name = await document.l10n.formatValue("blocklist-item-list-template", {
+      listName,
+      description,
+    });
+
+    return {
+      id,
+      name,
+      selected: this._getActiveList() === id,
+    };
+  },
+
+  _updateTree() {
+    this._tree = document.getElementById("blocklistsTree");
+    this._view._rowCount = this._blockLists.length;
+    this._tree.view = this._view;
+  },
+
+  _getActiveList() {
+    let trackingTable = Services.prefs.getCharPref(TRACKING_TABLE_PREF);
+    return trackingTable.includes(CONTENT_LIST_ID)
+      ? CONTENT_LIST_ID
+      : BASE_LIST_ID;
+  },
+};
diff --git a/browser/components/preferences/dialogs/blocklists.xhtml b/browser/components/preferences/dialogs/blocklists.xhtml
new file mode 100644
index 0000000000..8471847df2
--- /dev/null
+++ b/browser/components/preferences/dialogs/blocklists.xhtml
@@ -0,0 +1,83 @@
+<?xml version="1.0"?>
+
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+
+<window
+  id="BlocklistsDialog"
+  data-l10n-id="blocklist-window2"
+  data-l10n-attrs="title, style"
+  xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+  xmlns:html="http://www.w3.org/1999/xhtml"
+  onload="gBlocklistManager.onLoad();"
+  onunload="gBlocklistManager.uninit();"
+  persist="width height"
+>
+  <dialog
+    buttons="accept,cancel"
+    data-l10n-id="blocklist-dialog"
+    data-l10n-attrs="buttonlabelaccept, buttonaccesskeyaccept"
+  >
+    <linkset>
+      <html:link rel="stylesheet" href="chrome://global/skin/global.css" />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/skin/preferences/preferences.css"
+      />
+
+      <html:link rel="localization" href="branding/brand.ftl" />
+      <html:link rel="localization" href="browser/preferences/blocklists.ftl" />
+    </linkset>
+
+    <script src="chrome://browser/content/preferences/dialogs/blocklists.js" />
+
+    <keyset>
+      <key
+        data-l10n-id="blocklist-close-key"
+        modifiers="accel"
+        oncommand="window.close();"
+      />
+    </keyset>
+
+    <vbox class="contentPane">
+      <description
+        id="blocklistsText"
+        data-l10n-id="blocklist-description"
+        control="url"
+      >
+        <html:a
+          target="_blank"
+          class="text-link"
+          data-l10n-name="disconnect-link"
+          href="https://disconnect.me/"
+        />
+      </description>
+      <separator class="thin" />
+      <tree
+        id="blocklistsTree"
+        flex="1"
+        style="height: 18em"
+        hidecolumnpicker="true"
+        onselect="gBlocklistManager.onListSelected();"
+      >
+        <treecols>
+          <treecol
+            id="selectionCol"
+            label=""
+            style="flex: 1 auto"
+            sortable="false"
+            type="checkbox"
+          />
+          <treecol
+            id="listCol"
+            data-l10n-id="blocklist-treehead-list"
+            style="flex: 80 80 auto"
+            sortable="false"
+          />
+        </treecols>
+        <treechildren />
+      </tree>
+    </vbox>
+  </dialog>
+</window>
diff --git a/browser/components/preferences/dialogs/browserLanguages.js b/browser/components/preferences/dialogs/browserLanguages.js
new file mode 100644
index 0000000000..a54d9f299b
--- /dev/null
+++ b/browser/components/preferences/dialogs/browserLanguages.js
@@ -0,0 +1,728 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+/* import-globals-from /toolkit/content/preferencesBindings.js */
+
+// This is exported by preferences.js but we can't import that in a subdialog.
+let { LangPackMatcher } = window.top;
+
+ChromeUtils.defineESModuleGetters(this, {
+  AddonManager: "resource://gre/modules/AddonManager.sys.mjs",
+  AddonRepository: "resource://gre/modules/addons/AddonRepository.sys.mjs",
+  RemoteSettings: "resource://services-settings/remote-settings.sys.mjs",
+  SelectionChangedMenulist:
+    "resource:///modules/SelectionChangedMenulist.sys.mjs",
+});
+
+document
+  .getElementById("BrowserLanguagesDialog")
+  .addEventListener("dialoghelp", window.top.openPrefsHelp);
+
+/* This dialog provides an interface for managing what language the browser is
+ * displayed in.
+ *
+ * There is a list of "requested" locales and a list of "available" locales. The
+ * requested locales must be installed and enabled. Available locales could be
+ * installed and enabled, or fetched from the AMO language tools API.
+ *
+ * If a langpack is disabled, there is no way to determine what locale it is for and
+ * it will only be listed as available if that locale is also available on AMO and
+ * the user has opted to search for more languages.
+ */
+
+async function installFromUrl(url, hash, callback) {
+  let telemetryInfo = {
+    source: "about:preferences",
+  };
+  let install = await AddonManager.getInstallForURL(url, {
+    hash,
+    telemetryInfo,
+  });
+  if (callback) {
+    callback(install.installId.toString());
+  }
+  await install.install();
+  return install.addon;
+}
+
+async function dictionaryIdsForLocale(locale) {
+  let entries = await RemoteSettings("language-dictionaries").get({
+    filters: { id: locale },
+  });
+  if (entries.length) {
+    return entries[0].dictionaries;
+  }
+  return [];
+}
+
+class OrderedListBox {
+  constructor({
+    richlistbox,
+    upButton,
+    downButton,
+    removeButton,
+    onRemove,
+    onReorder,
+  }) {
+    this.richlistbox = richlistbox;
+    this.upButton = upButton;
+    this.downButton = downButton;
+    this.removeButton = removeButton;
+    this.onRemove = onRemove;
+    this.onReorder = onReorder;
+
+    this.items = [];
+
+    this.richlistbox.addEventListener("select", () => this.setButtonState());
+    this.upButton.addEventListener("command", () => this.moveUp());
+    this.downButton.addEventListener("command", () => this.moveDown());
+    this.removeButton.addEventListener("command", () => this.removeItem());
+  }
+
+  get selectedItem() {
+    return this.items[this.richlistbox.selectedIndex];
+  }
+
+  setButtonState() {
+    let { upButton, downButton, removeButton } = this;
+    let { selectedIndex, itemCount } = this.richlistbox;
+    upButton.disabled = selectedIndex <= 0;
+    downButton.disabled = selectedIndex == itemCount - 1;
+    removeButton.disabled = itemCount <= 1 || !this.selectedItem.canRemove;
+  }
+
+  moveUp() {
+    let { selectedIndex } = this.richlistbox;
+    if (selectedIndex == 0) {
+      return;
+    }
+    let { items } = this;
+    let selectedItem = items[selectedIndex];
+    let prevItem = items[selectedIndex - 1];
+    items[selectedIndex - 1] = items[selectedIndex];
+    items[selectedIndex] = prevItem;
+    let prevEl = document.getElementById(prevItem.id);
+    let selectedEl = document.getElementById(selectedItem.id);
+    this.richlistbox.insertBefore(selectedEl, prevEl);
+    this.richlistbox.ensureElementIsVisible(selectedEl);
+    this.setButtonState();
+
+    this.onReorder();
+  }
+
+  moveDown() {
+    let { selectedIndex } = this.richlistbox;
+    if (selectedIndex == this.items.length - 1) {
+      return;
+    }
+    let { items } = this;
+    let selectedItem = items[selectedIndex];
+    let nextItem = items[selectedIndex + 1];
+    items[selectedIndex + 1] = items[selectedIndex];
+    items[selectedIndex] = nextItem;
+    let nextEl = document.getElementById(nextItem.id);
+    let selectedEl = document.getElementById(selectedItem.id);
+    this.richlistbox.insertBefore(nextEl, selectedEl);
+    this.richlistbox.ensureElementIsVisible(selectedEl);
+    this.setButtonState();
+
+    this.onReorder();
+  }
+
+  removeItem() {
+    let { selectedIndex } = this.richlistbox;
+
+    if (selectedIndex == -1) {
+      return;
+    }
+
+    let [item] = this.items.splice(selectedIndex, 1);
+    this.richlistbox.selectedItem.remove();
+    this.richlistbox.selectedIndex = Math.min(
+      selectedIndex,
+      this.richlistbox.itemCount - 1
+    );
+    this.richlistbox.ensureElementIsVisible(this.richlistbox.selectedItem);
+    this.onRemove(item);
+  }
+
+  setItems(items) {
+    this.items = items;
+    this.populate();
+    this.setButtonState();
+  }
+
+  /**
+   * Add an item to the top of the ordered list.
+   *
+   * @param {object} item The item to insert.
+   */
+  addItem(item) {
+    this.items.unshift(item);
+    this.richlistbox.insertBefore(
+      this.createItem(item),
+      this.richlistbox.firstElementChild
+    );
+    this.richlistbox.selectedIndex = 0;
+    this.richlistbox.ensureElementIsVisible(this.richlistbox.selectedItem);
+  }
+
+  populate() {
+    this.richlistbox.textContent = "";
+
+    let frag = document.createDocumentFragment();
+    for (let item of this.items) {
+      frag.appendChild(this.createItem(item));
+    }
+    this.richlistbox.appendChild(frag);
+
+    this.richlistbox.selectedIndex = 0;
+    this.richlistbox.ensureElementIsVisible(this.richlistbox.selectedItem);
+  }
+
+  createItem({ id, label, value }) {
+    let listitem = document.createXULElement("richlistitem");
+    listitem.id = id;
+    listitem.setAttribute("value", value);
+
+    let labelEl = document.createXULElement("label");
+    labelEl.textContent = label;
+    listitem.appendChild(labelEl);
+
+    return listitem;
+  }
+}
+
+/**
+ * The sorted select list of Locales available for the app.
+ */
+class SortedItemSelectList {
+  constructor({ menulist, button, onSelect, onChange, compareFn }) {
+    /** @type {XULElement} */
+    this.menulist = menulist;
+
+    /** @type {XULElement} */
+    this.popup = menulist.menupopup;
+
+    /** @type {XULElement} */
+    this.button = button;
+
+    /** @type {(a: LocaleDisplayInfo, b: LocaleDisplayInfo) => number} */
+    this.compareFn = compareFn;
+
+    /** @type {Array<LocaleDisplayInfo>} */
+    this.items = [];
+
+    // This will register the "command" listener.
+    new SelectionChangedMenulist(this.menulist, () => {
+      button.disabled = !menulist.selectedItem;
+      if (menulist.selectedItem) {
+        onChange(this.items[menulist.selectedIndex]);
+      }
+    });
+    button.addEventListener("command", () => {
+      if (!menulist.selectedItem) {
+        return;
+      }
+
+      let [item] = this.items.splice(menulist.selectedIndex, 1);
+      menulist.selectedItem.remove();
+      menulist.setAttribute("label", menulist.getAttribute("placeholder"));
+      button.disabled = true;
+      menulist.disabled = menulist.itemCount == 0;
+      menulist.selectedIndex = -1;
+
+      onSelect(item);
+    });
+  }
+
+  /**
+   * @param {Array<LocaleDisplayInfo>} items
+   */
+  setItems(items) {
+    this.items = items.sort(this.compareFn);
+    this.populate();
+  }
+
+  populate() {
+    let { button, items, menulist, popup } = this;
+    popup.textContent = "";
+
+    let frag = document.createDocumentFragment();
+    for (let item of items) {
+      frag.appendChild(this.createItem(item));
+    }
+    popup.appendChild(frag);
+
+    menulist.setAttribute("label", menulist.getAttribute("placeholder"));
+    menulist.disabled = menulist.itemCount == 0;
+    menulist.selectedIndex = -1;
+    button.disabled = true;
+  }
+
+  /**
+   * Add an item to the list sorted by the label.
+   *
+   * @param {object} item The item to insert.
+   */
+  addItem(item) {
+    let { compareFn, items, menulist, popup } = this;
+
+    // Find the index of the item to insert before.
+    let i = items.findIndex(el => compareFn(el, item) >= 0);
+    items.splice(i, 0, item);
+    popup.insertBefore(this.createItem(item), menulist.getItemAtIndex(i));
+
+    menulist.disabled = menulist.itemCount == 0;
+  }
+
+  createItem({ label, value, className, disabled }) {
+    let item = document.createXULElement("menuitem");
+    item.setAttribute("label", label);
+    if (value) {
+      item.value = value;
+    }
+    if (className) {
+      item.classList.add(className);
+    }
+    if (disabled) {
+      item.setAttribute("disabled", "true");
+    }
+    return item;
+  }
+
+  /**
+   * Disable the inputs and set a data-l10n-id on the menulist. This can be
+   * reverted with `enableWithMessageId()`.
+   */
+  disableWithMessageId(messageId) {
+    document.l10n.setAttributes(this.menulist, messageId);
+    this.menulist.setAttribute(
+      "image",
+      "chrome://browser/skin/tabbrowser/tab-connecting.png"
+    );
+    this.menulist.disabled = true;
+    this.button.disabled = true;
+  }
+
+  /**
+   * Enable the inputs and set a data-l10n-id on the menulist. This can be
+   * reverted with `disableWithMessageId()`.
+   */
+  enableWithMessageId(messageId) {
+    document.l10n.setAttributes(this.menulist, messageId);
+    this.menulist.removeAttribute("image");
+    this.menulist.disabled = this.menulist.itemCount == 0;
+    this.button.disabled = !this.menulist.selectedItem;
+  }
+}
+
+/**
+ * @typedef LocaleDisplayInfo
+ * @type {object}
+ * @prop {string} id - A unique ID.
+ * @prop {string} label - The localized display name.
+ * @prop {string} value - The BCP 47 locale identifier or the word "search".
+ * @prop {boolean} canRemove - Locales that are part of the packaged locales cannot be
+ *                             removed.
+ * @prop {boolean} installed - Whether or not the locale is installed.
+ */
+
+/**
+ * @param {Array<string>} localeCodes - List of BCP 47 locale identifiers.
+ * @returns {Array<LocaleDisplayInfo>}
+ */
+async function getLocaleDisplayInfo(localeCodes) {
+  let availableLocales = new Set(await LangPackMatcher.getAvailableLocales());
+  let packagedLocales = new Set(Services.locale.packagedLocales);
+  let localeNames = Services.intl.getLocaleDisplayNames(
+    undefined,
+    localeCodes,
+    { preferNative: true }
+  );
+  return localeCodes.map((code, i) => {
+    return {
+      id: "locale-" + code,
+      label: localeNames[i],
+      value: code,
+      canRemove: !packagedLocales.has(code),
+      installed: availableLocales.has(code),
+    };
+  });
+}
+
+/**
+ * @param {LocaleDisplayInfo} a
+ * @param {LocaleDisplayInfo} b
+ * @returns {number}
+ */
+function compareItems(a, b) {
+  // Sort by installed.
+  if (a.installed != b.installed) {
+    return a.installed ? -1 : 1;
+
+    // The search label is always last.
+  } else if (a.value == "search") {
+    return 1;
+  } else if (b.value == "search") {
+    return -1;
+
+    // If both items are locales, sort by label.
+  } else if (a.value && b.value) {
+    return a.label.localeCompare(b.label);
+
+    // One of them is a label, put it first.
+  } else if (a.value) {
+    return 1;
+  }
+  return -1;
+}
+
+var gBrowserLanguagesDialog = {
+  /**
+   * The publicly readable list of selected locales. It is only set when the dialog is
+   * accepted, and can be retrieved elsewhere by directly reading the property
+   * on gBrowserLanguagesDialog.
+   *
+   *   let { selected } = gBrowserLanguagesDialog;
+   *
+   * @type {null | Array<string>}
+   */
+  selected: null,
+
+  /**
+   * @type {string | null} An ID used for telemetry pings. It is unique to the current
+   * opening of the browser language.
+   */
+  _telemetryId: null,
+
+  /**
+   * @type {SortedItemSelectList}
+   */
+  _availableLocalesUI: null,
+
+  /**
+   * @type {OrderedListBox}
+   */
+  _selectedLocalesUI: null,
+
+  get downloadEnabled() {
+    // Downloading langpacks isn't always supported, check the pref.
+    return Services.prefs.getBoolPref("intl.multilingual.downloadEnabled");
+  },
+
+  recordTelemetry(method, extra = null) {
+    Services.telemetry.recordEvent(
+      "intl.ui.browserLanguage",
+      method,
+      "dialog",
+      this._telemetryId,
+      extra
+    );
+  },
+
+  async onLoad() {
+    /**
+     * @typedef {Object} Options - Options passed in to configure the subdialog.
+     * @property {string} telemetryId,
+     * @property {Array<string>} [selectedLocalesForRestart] The optional list of
+     *   previously selected locales for when a restart is required. This list is
+     *   preserved between openings of the dialog.
+     * @property {boolean} search Whether the user opened this from "Search for more
+     *   languages" option.
+     */
+
+    /** @type {Options} */
+    let { telemetryId, selectedLocalesForRestart, search } =
+      window.arguments[0];
+
+    this._telemetryId = telemetryId;
+
+    // This is a list of available locales that the user selected. It's more
+    // restricted than the Intl notion of `requested` as it only contains
+    // locale codes for which we have matching locales available.
+    // The first time this dialog is opened, populate with appLocalesAsBCP47.
+    let selectedLocales =
+      selectedLocalesForRestart || Services.locale.appLocalesAsBCP47;
+    let selectedLocaleSet = new Set(selectedLocales);
+    let available = await LangPackMatcher.getAvailableLocales();
+    let availableSet = new Set(available);
+
+    // Filter selectedLocales since the user may select a locale when it is
+    // available and then disable it.
+    selectedLocales = selectedLocales.filter(locale =>
+      availableSet.has(locale)
+    );
+    // Nothing in available should be in selectedSet.
+    available = available.filter(locale => !selectedLocaleSet.has(locale));
+
+    await this.initSelectedLocales(selectedLocales);
+    await this.initAvailableLocales(available, search);
+
+    this.initialized = true;
+
+    // Now the component is initialized, it's safe to accept the results.
+    document
+      .getElementById("BrowserLanguagesDialog")
+      .addEventListener("beforeaccept", () => {
+        this.selected = this._selectedLocalesUI.items.map(item => item.value);
+      });
+  },
+
+  /**
+   * @param {string[]} selectedLocales - BCP 47 locale identifiers
+   */
+  async initSelectedLocales(selectedLocales) {
+    this._selectedLocalesUI = new OrderedListBox({
+      richlistbox: document.getElementById("selectedLocales"),
+      upButton: document.getElementById("up"),
+      downButton: document.getElementById("down"),
+      removeButton: document.getElementById("remove"),
+      onRemove: item => this.selectedLocaleRemoved(item),
+      onReorder: () => this.recordTelemetry("reorder"),
+    });
+    this._selectedLocalesUI.setItems(
+      await getLocaleDisplayInfo(selectedLocales)
+    );
+  },
+
+  /**
+   * @param {Set<string>} available - The set of available BCP 47 locale identifiers.
+   * @param {boolean} search - Whether the user opened this from "Search for more
+   *                           languages" option.
+   */
+  async initAvailableLocales(available, search) {
+    this._availableLocalesUI = new SortedItemSelectList({
+      menulist: document.getElementById("availableLocales"),
+      button: document.getElementById("add"),
+      compareFn: compareItems,
+      onSelect: item => this.availableLanguageSelected(item),
+      onChange: item => {
+        this.hideError();
+        if (item.value == "search") {
+          // Record the search event here so we don't track the search from
+          // the main preferences pane twice.
+          this.recordTelemetry("search");
+          this.loadLocalesFromAMO();
+        }
+      },
+    });
+
+    // Populate the list with the installed locales even if the user is
+    // searching in case the download fails.
+    await this.loadLocalesFromInstalled(available);
+
+    // If the user opened this from the "Search for more languages" option,
+    // search AMO for available locales.
+    if (search) {
+      return this.loadLocalesFromAMO();
+    }
+
+    return undefined;
+  },
+
+  async loadLocalesFromAMO() {
+    if (!this.downloadEnabled) {
+      return;
+    }
+
+    // Disable the dropdown while we hit the network.
+    this._availableLocalesUI.disableWithMessageId(
+      "browser-languages-searching"
+    );
+
+    // Fetch the available langpacks from AMO.
+    let availableLangpacks;
+    try {
+      availableLangpacks = await AddonRepository.getAvailableLangpacks();
+    } catch (e) {
+      this.showError();
+      return;
+    }
+
+    // Store the available langpack info for later use.
+    this.availableLangpacks = new Map();
+    for (let { target_locale, url, hash } of availableLangpacks) {
+      this.availableLangpacks.set(target_locale, { url, hash });
+    }
+
+    // Remove the installed locales from the available ones.
+    let installedLocales = new Set(await LangPackMatcher.getAvailableLocales());
+    let notInstalledLocales = availableLangpacks
+      .filter(({ target_locale }) => !installedLocales.has(target_locale))
+      .map(lang => lang.target_locale);
+
+    // Create the rows for the remote locales.
+    let availableItems = await getLocaleDisplayInfo(notInstalledLocales);
+    availableItems.push({
+      label: await document.l10n.formatValue(
+        "browser-languages-available-label"
+      ),
+      className: "label-item",
+      disabled: true,
+      installed: false,
+    });
+
+    // Remove the search option and add the remote locales.
+    let items = this._availableLocalesUI.items;
+    items.pop();
+    items = items.concat(availableItems);
+
+    // Update the dropdown and enable it again.
+    this._availableLocalesUI.setItems(items);
+    this._availableLocalesUI.enableWithMessageId(
+      "browser-languages-select-language"
+    );
+  },
+
+  /**
+   * @param {Set<string>} available - The set of available (BCP 47) locales.
+   */
+  async loadLocalesFromInstalled(available) {
+    let items;
+    if (available.length) {
+      items = await getLocaleDisplayInfo(available);
+      items.push(await this.createInstalledLabel());
+    } else {
+      items = [];
+    }
+    if (this.downloadEnabled) {
+      items.push({
+        label: await document.l10n.formatValue("browser-languages-search"),
+        value: "search",
+      });
+    }
+    this._availableLocalesUI.setItems(items);
+  },
+
+  /**
+   * @param {LocaleDisplayInfo} item
+   */
+  async availableLanguageSelected(item) {
+    if ((await LangPackMatcher.getAvailableLocales()).includes(item.value)) {
+      this.recordTelemetry("add");
+      await this.requestLocalLanguage(item);
+    } else if (this.availableLangpacks.has(item.value)) {
+      // Telemetry is tracked in requestRemoteLanguage.
+      await this.requestRemoteLanguage(item);
+    } else {
+      this.showError();
+    }
+  },
+
+  /**
+   * @param {LocaleDisplayInfo} item
+   */
+  async requestLocalLanguage(item) {
+    this._selectedLocalesUI.addItem(item);
+    let selectedCount = this._selectedLocalesUI.items.length;
+    let availableCount = (await LangPackMatcher.getAvailableLocales()).length;
+    if (selectedCount == availableCount) {
+      // Remove the installed label, they're all installed.
+      this._availableLocalesUI.items.shift();
+      this._availableLocalesUI.setItems(this._availableLocalesUI.items);
+    }
+    // The label isn't always reset when the selected item is removed, so set it again.
+    this._availableLocalesUI.enableWithMessageId(
+      "browser-languages-select-language"
+    );
+  },
+
+  /**
+   * @param {LocaleDisplayInfo} item
+   */
+  async requestRemoteLanguage(item) {
+    this._availableLocalesUI.disableWithMessageId(
+      "browser-languages-downloading"
+    );
+
+    let { url, hash } = this.availableLangpacks.get(item.value);
+    let addon;
+
+    try {
+      addon = await installFromUrl(url, hash, installId =>
+        this.recordTelemetry("add", { installId })
+      );
+    } catch (e) {
+      this.showError();
+      return;
+    }
+
+    // If the add-on was previously installed, it might be disabled still.
+    if (addon.userDisabled) {
+      await addon.enable();
+    }
+
+    item.installed = true;
+    this._selectedLocalesUI.addItem(item);
+    this._availableLocalesUI.enableWithMessageId(
+      "browser-languages-select-language"
+    );
+
+    // This is an async task that will install the recommended dictionaries for
+    // this locale. This will fail silently at least until a management UI is
+    // added in bug 1493705.
+    this.installDictionariesForLanguage(item.value);
+  },
+
+  /**
+   * @param {string} locale The BCP 47 locale identifier
+   */
+  async installDictionariesForLanguage(locale) {
+    try {
+      let ids = await dictionaryIdsForLocale(locale);
+      let addonInfos = await AddonRepository.getAddonsByIDs(ids);
+      await Promise.all(
+        addonInfos.map(info => installFromUrl(info.sourceURI.spec))
+      );
+    } catch (e) {
+      console.error(e);
+    }
+  },
+
+  showError() {
+    document.getElementById("warning-message").hidden = false;
+    this._availableLocalesUI.enableWithMessageId(
+      "browser-languages-select-language"
+    );
+
+    // The height has likely changed, find our SubDialog and tell it to resize.
+    requestAnimationFrame(() => {
+      let dialogs = window.opener.gSubDialog._dialogs;
+      let index = dialogs.findIndex(d => d._frame.contentDocument == document);
+      if (index != -1) {
+        dialogs[index].resizeDialog();
+      }
+    });
+  },
+
+  hideError() {
+    document.getElementById("warning-message").hidden = true;
+  },
+
+  /**
+   * @param {LocaleDisplayInfo} item
+   */
+  async selectedLocaleRemoved(item) {
+    this.recordTelemetry("remove");
+
+    this._availableLocalesUI.addItem(item);
+
+    // If the item we added is at the top of the list, it needs the label.
+    if (this._availableLocalesUI.items[0] == item) {
+      this._availableLocalesUI.addItem(await this.createInstalledLabel());
+    }
+  },
+
+  async createInstalledLabel() {
+    return {
+      label: await document.l10n.formatValue(
+        "browser-languages-installed-label"
+      ),
+      className: "label-item",
+      disabled: true,
+      installed: true,
+    };
+  },
+};
diff --git a/browser/components/preferences/dialogs/browserLanguages.xhtml b/browser/components/preferences/dialogs/browserLanguages.xhtml
new file mode 100644
index 0000000000..2a404f4aa8
--- /dev/null
+++ b/browser/components/preferences/dialogs/browserLanguages.xhtml
@@ -0,0 +1,87 @@
+<?xml version="1.0"?>
+
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+
+<window
+  type="child"
+  xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+  xmlns:html="http://www.w3.org/1999/xhtml"
+  data-l10n-id="browser-languages-window2"
+  data-l10n-attrs="title, style"
+  onload="gBrowserLanguagesDialog.onLoad();"
+>
+  <dialog
+    id="BrowserLanguagesDialog"
+    buttons="accept,cancel,help"
+    helpTopic="change-language"
+  >
+    <linkset>
+      <html:link rel="stylesheet" href="chrome://global/skin/global.css" />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/skin/preferences/preferences.css"
+      />
+
+      <html:link rel="localization" href="branding/brand.ftl" />
+      <html:link rel="localization" href="browser/preferences/languages.ftl" />
+    </linkset>
+
+    <script src="chrome://browser/content/utilityOverlay.js" />
+    <script src="chrome://global/content/preferencesBindings.js" />
+    <script src="chrome://browser/content/preferences/dialogs/browserLanguages.js" />
+
+    <description data-l10n-id="browser-languages-description" />
+
+    <box class="languages-grid">
+      <richlistbox id="selectedLocales" />
+      <vbox>
+        <button
+          id="up"
+          class="action-button"
+          disabled="true"
+          data-l10n-id="languages-customize-moveup"
+        />
+        <button
+          id="down"
+          class="action-button"
+          disabled="true"
+          data-l10n-id="languages-customize-movedown"
+        />
+        <button
+          id="remove"
+          class="action-button"
+          disabled="true"
+          data-l10n-id="languages-customize-remove"
+        />
+      </vbox>
+
+      <menulist
+        id="availableLocales"
+        class="available-locales-list"
+        data-l10n-id="browser-languages-select-language"
+        data-l10n-attrs="placeholder,label"
+      >
+        <menupopup />
+      </menulist>
+      <button
+        id="add"
+        class="add-browser-language action-button"
+        data-l10n-id="languages-customize-add"
+        disabled="true"
+      />
+    </box>
+    <hbox
+      id="warning-message"
+      class="message-bar message-bar-warning"
+      hidden="true"
+    >
+      <html:img class="message-bar-icon" />
+      <description
+        class="message-bar-description"
+        data-l10n-id="browser-languages-error"
+      />
+    </hbox>
+  </dialog>
+</window>
diff --git a/browser/components/preferences/dialogs/clearSiteData.css b/browser/components/preferences/dialogs/clearSiteData.css
new file mode 100644
index 0000000000..5b1f5bbe2d
--- /dev/null
+++ b/browser/components/preferences/dialogs/clearSiteData.css
@@ -0,0 +1,20 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+.options-container {
+  background-color: var(--in-content-box-background);
+  border: 1px solid var(--in-content-box-border-color);
+  border-radius: 2px;
+  color: var(--in-content-text-color);
+  padding: 0.5em;
+}
+
+.option {
+  padding-bottom: 8px;
+}
+
+.option-description {
+  color: var(--text-color-deemphasized);
+  margin-top: -0.5em !important;
+}
diff --git a/browser/components/preferences/dialogs/clearSiteData.js b/browser/components/preferences/dialogs/clearSiteData.js
new file mode 100644
index 0000000000..061534b52a
--- /dev/null
+++ b/browser/components/preferences/dialogs/clearSiteData.js
@@ -0,0 +1,96 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+const { SiteDataManager } = ChromeUtils.importESModule(
+  "resource:///modules/SiteDataManager.sys.mjs"
+);
+
+ChromeUtils.defineESModuleGetters(this, {
+  DownloadUtils: "resource://gre/modules/DownloadUtils.sys.mjs",
+});
+
+var gClearSiteDataDialog = {
+  _clearSiteDataCheckbox: null,
+  _clearCacheCheckbox: null,
+
+  onLoad() {
+    document.mozSubdialogReady = this.init();
+  },
+
+  async init() {
+    this._dialog = document.querySelector("dialog");
+    this._clearSiteDataCheckbox = document.getElementById("clearSiteData");
+    this._clearCacheCheckbox = document.getElementById("clearCache");
+
+    // We'll block init() on this because the result values may impact
+    // subdialog sizing.
+    await Promise.all([
+      SiteDataManager.getTotalUsage().then(bytes => {
+        let [amount, unit] = DownloadUtils.convertByteUnits(bytes);
+        document.l10n.setAttributes(
+          this._clearSiteDataCheckbox,
+          "clear-site-data-cookies-with-data",
+          { amount, unit }
+        );
+      }),
+      SiteDataManager.getCacheSize().then(bytes => {
+        let [amount, unit] = DownloadUtils.convertByteUnits(bytes);
+        document.l10n.setAttributes(
+          this._clearCacheCheckbox,
+          "clear-site-data-cache-with-data",
+          { amount, unit }
+        );
+      }),
+    ]);
+    await document.l10n.translateElements([
+      this._clearCacheCheckbox,
+      this._clearSiteDataCheckbox,
+    ]);
+
+    document.addEventListener("dialogaccept", event => this.onClear(event));
+
+    this._clearSiteDataCheckbox.addEventListener("command", e =>
+      this.onCheckboxCommand(e)
+    );
+    this._clearCacheCheckbox.addEventListener("command", e =>
+      this.onCheckboxCommand(e)
+    );
+  },
+
+  onCheckboxCommand(event) {
+    this._dialog.setAttribute(
+      "buttondisabledaccept",
+      !(this._clearSiteDataCheckbox.checked || this._clearCacheCheckbox.checked)
+    );
+  },
+
+  onClear(event) {
+    let clearSiteData = this._clearSiteDataCheckbox.checked;
+    let clearCache = this._clearCacheCheckbox.checked;
+
+    if (clearSiteData) {
+      // Ask for confirmation before clearing site data
+      if (!SiteDataManager.promptSiteDataRemoval(window)) {
+        clearSiteData = false;
+        // Prevent closing the dialog when the data removal wasn't allowed.
+        event.preventDefault();
+      }
+    }
+
+    if (clearSiteData) {
+      SiteDataManager.removeSiteData();
+    }
+    if (clearCache) {
+      SiteDataManager.removeCache();
+
+      // If we're not clearing site data, we need to tell the
+      // SiteDataManager to signal that it's updating.
+      if (!clearSiteData) {
+        SiteDataManager.updateSites();
+      }
+    }
+  },
+};
+
+window.addEventListener("load", () => gClearSiteDataDialog.onLoad());
diff --git a/browser/components/preferences/dialogs/clearSiteData.xhtml b/browser/components/preferences/dialogs/clearSiteData.xhtml
new file mode 100644
index 0000000000..784ffc8167
--- /dev/null
+++ b/browser/components/preferences/dialogs/clearSiteData.xhtml
@@ -0,0 +1,76 @@
+<?xml version="1.0"?>
+
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+
+<window
+  id="ClearSiteDataDialog"
+  xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+  xmlns:html="http://www.w3.org/1999/xhtml"
+  data-l10n-id="clear-site-data-window2"
+  data-l10n-attrs="title, style"
+  persist="width height"
+>
+  <dialog
+    buttons="accept,cancel"
+    data-l10n-id="clear-site-data-dialog"
+    data-l10n-attrs="buttonlabelaccept, buttonaccesskeyaccept"
+  >
+    <linkset>
+      <html:link rel="stylesheet" href="chrome://global/skin/global.css" />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/skin/preferences/preferences.css"
+      />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/content/preferences/dialogs/clearSiteData.css"
+      />
+
+      <html:link rel="localization" href="branding/brand.ftl" />
+      <html:link
+        rel="localization"
+        href="browser/preferences/clearSiteData.ftl"
+      />
+    </linkset>
+    <script src="chrome://browser/content/preferences/dialogs/clearSiteData.js" />
+
+    <keyset>
+      <key
+        data-l10n-id="clear-site-data-close-key"
+        modifiers="accel"
+        oncommand="window.close();"
+      />
+    </keyset>
+
+    <vbox class="contentPane">
+      <description control="url" data-l10n-id="clear-site-data-description" />
+      <separator class="thin" />
+      <vbox class="options-container">
+        <vbox class="option">
+          <checkbox
+            data-l10n-id="clear-site-data-cookies-empty"
+            id="clearSiteData"
+            checked="true"
+          />
+          <description
+            class="option-description indent"
+            data-l10n-id="clear-site-data-cookies-info"
+          />
+        </vbox>
+        <vbox class="option">
+          <checkbox
+            data-l10n-id="clear-site-data-cache-empty"
+            id="clearCache"
+            checked="true"
+          />
+          <description
+            class="option-description indent"
+            data-l10n-id="clear-site-data-cache-info"
+          />
+        </vbox>
+      </vbox>
+    </vbox>
+  </dialog>
+</window>
diff --git a/browser/components/preferences/dialogs/colors.js b/browser/components/preferences/dialogs/colors.js
new file mode 100644
index 0000000000..30b48b2ad0
--- /dev/null
+++ b/browser/components/preferences/dialogs/colors.js
@@ -0,0 +1,18 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+/* import-globals-from /toolkit/content/preferencesBindings.js */
+
+document
+  .getElementById("ColorsDialog")
+  .addEventListener("dialoghelp", window.top.openPrefsHelp);
+
+Preferences.addAll([
+  { id: "browser.display.document_color_use", type: "int" },
+  { id: "browser.anchor_color", type: "string" },
+  { id: "browser.visited_color", type: "string" },
+  { id: "browser.display.foreground_color", type: "string" },
+  { id: "browser.display.background_color", type: "string" },
+  { id: "browser.display.use_system_colors", type: "bool" },
+]);
diff --git a/browser/components/preferences/dialogs/colors.xhtml b/browser/components/preferences/dialogs/colors.xhtml
new file mode 100644
index 0000000000..1720cf3498
--- /dev/null
+++ b/browser/components/preferences/dialogs/colors.xhtml
@@ -0,0 +1,135 @@
+<?xml version="1.0"?>
+
+<!-- -*- Mode: Java; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- -->
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+
+<window
+  type="child"
+  xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+  xmlns:html="http://www.w3.org/1999/xhtml"
+  data-l10n-id="colors-dialog2"
+  data-l10n-attrs="title, style"
+  persist="lastSelected"
+>
+  <dialog
+    id="ColorsDialog"
+    buttons="accept,cancel,help"
+    helpTopic="prefs-fonts-and-colors"
+  >
+    <linkset>
+      <html:link rel="stylesheet" href="chrome://global/skin/global.css" />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/skin/preferences/preferences.css"
+      />
+
+      <html:link rel="localization" href="browser/preferences/colors.ftl" />
+    </linkset>
+
+    <script src="chrome://browser/content/utilityOverlay.js" />
+    <script src="chrome://global/content/preferencesBindings.js" />
+
+    <keyset>
+      <key
+        data-l10n-id="colors-close-key"
+        modifiers="accel"
+        oncommand="Preferences.close(event)"
+      />
+    </keyset>
+
+    <hbox>
+      <groupbox flex="1">
+        <label><html:h2 data-l10n-id="colors-text-and-background" /></label>
+        <hbox align="center">
+          <label
+            data-l10n-id="colors-text-header"
+            control="foregroundtextmenu"
+          />
+          <spacer flex="1" />
+          <html:input
+            type="color"
+            id="foregroundtextmenu"
+            preference="browser.display.foreground_color"
+          />
+        </hbox>
+        <hbox align="center" style="margin-top: 5px">
+          <label data-l10n-id="colors-background" control="backgroundmenu" />
+          <spacer flex="1" />
+          <html:input
+            type="color"
+            id="backgroundmenu"
+            preference="browser.display.background_color"
+          />
+        </hbox>
+        <separator class="thin" />
+        <hbox align="center">
+          <checkbox
+            id="browserUseSystemColors"
+            data-l10n-id="colors-use-system"
+            preference="browser.display.use_system_colors"
+          />
+        </hbox>
+      </groupbox>
+
+      <groupbox flex="1">
+        <label><html:h2 data-l10n-id="colors-links-header" /></label>
+        <hbox align="center">
+          <label
+            data-l10n-id="colors-unvisited-links"
+            control="unvisitedlinkmenu"
+          />
+          <spacer flex="1" />
+          <html:input
+            type="color"
+            id="unvisitedlinkmenu"
+            preference="browser.anchor_color"
+          />
+        </hbox>
+        <hbox align="center" style="margin-top: 5px">
+          <label
+            data-l10n-id="colors-visited-links"
+            control="visitedlinkmenu"
+          />
+          <spacer flex="1" />
+          <html:input
+            type="color"
+            id="visitedlinkmenu"
+            preference="browser.visited_color"
+          />
+        </hbox>
+      </groupbox>
+    </hbox>
+
+    <label data-l10n-id="colors-page-override" control="useDocumentColors" />
+    <hbox>
+      <menulist
+        id="useDocumentColors"
+        preference="browser.display.document_color_use"
+        flex="1"
+      >
+        <menupopup>
+          <menuitem
+            data-l10n-id="colors-page-override-option-always"
+            value="2"
+            id="documentColorAlways"
+          />
+          <menuitem
+            data-l10n-id="colors-page-override-option-auto"
+            value="0"
+            id="documentColorAutomatic"
+          />
+          <menuitem
+            data-l10n-id="colors-page-override-option-never"
+            value="1"
+            id="documentColorNever"
+          />
+        </menupopup>
+      </menulist>
+    </hbox>
+
+    <!-- Load the script after the elements for layout issues (bug 1501755). -->
+    <script src="chrome://browser/content/preferences/dialogs/colors.js" />
+  </dialog>
+</window>
diff --git a/browser/components/preferences/dialogs/connection.js b/browser/components/preferences/dialogs/connection.js
new file mode 100644
index 0000000000..0b21b1b5a5
--- /dev/null
+++ b/browser/components/preferences/dialogs/connection.js
@@ -0,0 +1,388 @@
+/* -*- indent-tabs-mode: nil; js-indent-level: 4 -*- */
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+/* import-globals-from /browser/base/content/utilityOverlay.js */
+/* import-globals-from /toolkit/content/preferencesBindings.js */
+/* import-globals-from ../extensionControlled.js */
+
+document
+  .getElementById("ConnectionsDialog")
+  .addEventListener("dialoghelp", window.top.openPrefsHelp);
+
+Preferences.addAll([
+  // Add network.proxy.autoconfig_url before network.proxy.type so they're
+  // both initialized when network.proxy.type initialization triggers a call to
+  // gConnectionsDialog.updateReloadButton().
+  { id: "network.proxy.autoconfig_url", type: "string" },
+  { id: "network.proxy.type", type: "int" },
+  { id: "network.proxy.http", type: "string" },
+  { id: "network.proxy.http_port", type: "int" },
+  { id: "network.proxy.ssl", type: "string" },
+  { id: "network.proxy.ssl_port", type: "int" },
+  { id: "network.proxy.socks", type: "string" },
+  { id: "network.proxy.socks_port", type: "int" },
+  { id: "network.proxy.socks_version", type: "int" },
+  { id: "network.proxy.socks_remote_dns", type: "bool" },
+  { id: "network.proxy.no_proxies_on", type: "string" },
+  { id: "network.proxy.share_proxy_settings", type: "bool" },
+  { id: "signon.autologin.proxy", type: "bool" },
+  { id: "pref.advanced.proxies.disable_button.reload", type: "bool" },
+  { id: "network.proxy.backup.ssl", type: "string" },
+  { id: "network.proxy.backup.ssl_port", type: "int" },
+]);
+
+window.addEventListener(
+  "DOMContentLoaded",
+  () => {
+    Preferences.get("network.proxy.type").on(
+      "change",
+      gConnectionsDialog.proxyTypeChanged.bind(gConnectionsDialog)
+    );
+    Preferences.get("network.proxy.socks_version").on(
+      "change",
+      gConnectionsDialog.updateDNSPref.bind(gConnectionsDialog)
+    );
+
+    document
+      .getElementById("disableProxyExtension")
+      .addEventListener(
+        "command",
+        makeDisableControllingExtension(PREF_SETTING_TYPE, PROXY_KEY).bind(
+          gConnectionsDialog
+        )
+      );
+    gConnectionsDialog.updateProxySettingsUI();
+    initializeProxyUI(gConnectionsDialog);
+    gConnectionsDialog.registerSyncPrefListeners();
+    document
+      .getElementById("ConnectionsDialog")
+      .addEventListener("beforeaccept", e =>
+        gConnectionsDialog.beforeAccept(e)
+      );
+  },
+  { once: true, capture: true }
+);
+
+var gConnectionsDialog = {
+  beforeAccept(event) {
+    var proxyTypePref = Preferences.get("network.proxy.type");
+    if (proxyTypePref.value == 2) {
+      this.doAutoconfigURLFixup();
+      return;
+    }
+
+    if (proxyTypePref.value != 1) {
+      return;
+    }
+
+    var httpProxyURLPref = Preferences.get("network.proxy.http");
+    var httpProxyPortPref = Preferences.get("network.proxy.http_port");
+    var shareProxiesPref = Preferences.get(
+      "network.proxy.share_proxy_settings"
+    );
+
+    // If the proxy server (when specified) is invalid or the port is set to 0 then cancel submission.
+    for (let prefName of ["http", "ssl", "socks"]) {
+      let proxyPortPref = Preferences.get(
+        "network.proxy." + prefName + "_port"
+      );
+      let proxyPref = Preferences.get("network.proxy." + prefName);
+      // Only worry about ports which are currently active. If the share option is on, then ignore
+      // all ports except the HTTP and SOCKS port
+      if (
+        proxyPref.value != "" &&
+        (prefName == "http" || prefName == "socks" || !shareProxiesPref.value)
+      ) {
+        if (proxyPortPref.value == 0) {
+          document
+            .getElementById("networkProxy" + prefName.toUpperCase() + "_Port")
+            .focus();
+          event.preventDefault();
+          return;
+        } else if (!Services.io.isValidHostname(proxyPref.value)) {
+          document
+            .getElementById("networkProxy" + prefName.toUpperCase())
+            .focus();
+          event.preventDefault();
+          return;
+        }
+      }
+    }
+
+    // In the case of a shared proxy preference, backup the current values and update with the HTTP value
+    if (shareProxiesPref.value) {
+      var proxyServerURLPref = Preferences.get("network.proxy.ssl");
+      var proxyPortPref = Preferences.get("network.proxy.ssl_port");
+      var backupServerURLPref = Preferences.get("network.proxy.backup.ssl");
+      var backupPortPref = Preferences.get("network.proxy.backup.ssl_port");
+      backupServerURLPref.value =
+        backupServerURLPref.value || proxyServerURLPref.value;
+      backupPortPref.value = backupPortPref.value || proxyPortPref.value;
+      proxyServerURLPref.value = httpProxyURLPref.value;
+      proxyPortPref.value = httpProxyPortPref.value;
+    }
+
+    this.sanitizeNoProxiesPref();
+  },
+
+  checkForSystemProxy() {
+    if ("@mozilla.org/system-proxy-settings;1" in Cc) {
+      document.getElementById("systemPref").removeAttribute("hidden");
+    }
+  },
+
+  proxyTypeChanged() {
+    var proxyTypePref = Preferences.get("network.proxy.type");
+
+    // Update http
+    var httpProxyURLPref = Preferences.get("network.proxy.http");
+    httpProxyURLPref.updateControlDisabledState(proxyTypePref.value != 1);
+    var httpProxyPortPref = Preferences.get("network.proxy.http_port");
+    httpProxyPortPref.updateControlDisabledState(proxyTypePref.value != 1);
+
+    // Now update the other protocols
+    this.updateProtocolPrefs();
+
+    var shareProxiesPref = Preferences.get(
+      "network.proxy.share_proxy_settings"
+    );
+    shareProxiesPref.updateControlDisabledState(proxyTypePref.value != 1);
+    var autologinProxyPref = Preferences.get("signon.autologin.proxy");
+    autologinProxyPref.updateControlDisabledState(proxyTypePref.value == 0);
+    var noProxiesPref = Preferences.get("network.proxy.no_proxies_on");
+    noProxiesPref.updateControlDisabledState(proxyTypePref.value == 0);
+
+    var autoconfigURLPref = Preferences.get("network.proxy.autoconfig_url");
+    autoconfigURLPref.updateControlDisabledState(proxyTypePref.value != 2);
+
+    this.updateReloadButton();
+
+    document.getElementById("networkProxyNoneLocalhost").hidden =
+      Services.prefs.getBoolPref(
+        "network.proxy.allow_hijacking_localhost",
+        false
+      );
+  },
+
+  updateDNSPref() {
+    var socksVersionPref = Preferences.get("network.proxy.socks_version");
+    var socksDNSPref = Preferences.get("network.proxy.socks_remote_dns");
+    var proxyTypePref = Preferences.get("network.proxy.type");
+    var isDefinitelySocks4 =
+      proxyTypePref.value == 1 && socksVersionPref.value == 4;
+    socksDNSPref.updateControlDisabledState(
+      isDefinitelySocks4 || proxyTypePref.value == 0
+    );
+    return undefined;
+  },
+
+  updateReloadButton() {
+    // Disable the "Reload PAC" button if the selected proxy type is not PAC or
+    // if the current value of the PAC input does not match the value stored
+    // in prefs.  Likewise, disable the reload button if PAC is not configured
+    // in prefs.
+
+    var typedURL = document.getElementById("networkProxyAutoconfigURL").value;
+    var proxyTypeCur = Preferences.get("network.proxy.type").value;
+
+    var pacURL = Services.prefs.getCharPref("network.proxy.autoconfig_url");
+    var proxyType = Services.prefs.getIntPref("network.proxy.type");
+
+    var disableReloadPref = Preferences.get(
+      "pref.advanced.proxies.disable_button.reload"
+    );
+    disableReloadPref.updateControlDisabledState(
+      proxyTypeCur != 2 || proxyType != 2 || typedURL != pacURL
+    );
+  },
+
+  readProxyType() {
+    this.proxyTypeChanged();
+    return undefined;
+  },
+
+  updateProtocolPrefs() {
+    var proxyTypePref = Preferences.get("network.proxy.type");
+    var shareProxiesPref = Preferences.get(
+      "network.proxy.share_proxy_settings"
+    );
+    var proxyPrefs = ["ssl", "socks"];
+    for (var i = 0; i < proxyPrefs.length; ++i) {
+      var proxyServerURLPref = Preferences.get(
+        "network.proxy." + proxyPrefs[i]
+      );
+      var proxyPortPref = Preferences.get(
+        "network.proxy." + proxyPrefs[i] + "_port"
+      );
+
+      // Restore previous per-proxy custom settings, if present.
+      if (proxyPrefs[i] != "socks" && !shareProxiesPref.value) {
+        var backupServerURLPref = Preferences.get(
+          "network.proxy.backup." + proxyPrefs[i]
+        );
+        var backupPortPref = Preferences.get(
+          "network.proxy.backup." + proxyPrefs[i] + "_port"
+        );
+        if (backupServerURLPref.hasUserValue) {
+          proxyServerURLPref.value = backupServerURLPref.value;
+          backupServerURLPref.reset();
+        }
+        if (backupPortPref.hasUserValue) {
+          proxyPortPref.value = backupPortPref.value;
+          backupPortPref.reset();
+        }
+      }
+
+      proxyServerURLPref.updateElements();
+      proxyPortPref.updateElements();
+      let prefIsShared = proxyPrefs[i] != "socks" && shareProxiesPref.value;
+      proxyServerURLPref.updateControlDisabledState(
+        proxyTypePref.value != 1 || prefIsShared
+      );
+      proxyPortPref.updateControlDisabledState(
+        proxyTypePref.value != 1 || prefIsShared
+      );
+    }
+    var socksVersionPref = Preferences.get("network.proxy.socks_version");
+    socksVersionPref.updateControlDisabledState(proxyTypePref.value != 1);
+    this.updateDNSPref();
+    return undefined;
+  },
+
+  readProxyProtocolPref(aProtocol, aIsPort) {
+    if (aProtocol != "socks") {
+      var shareProxiesPref = Preferences.get(
+        "network.proxy.share_proxy_settings"
+      );
+      if (shareProxiesPref.value) {
+        var pref = Preferences.get(
+          "network.proxy.http" + (aIsPort ? "_port" : "")
+        );
+        return pref.value;
+      }
+
+      var backupPref = Preferences.get(
+        "network.proxy.backup." + aProtocol + (aIsPort ? "_port" : "")
+      );
+      return backupPref.hasUserValue ? backupPref.value : undefined;
+    }
+    return undefined;
+  },
+
+  reloadPAC() {
+    Cc["@mozilla.org/network/protocol-proxy-service;1"]
+      .getService()
+      .reloadPAC();
+  },
+
+  doAutoconfigURLFixup() {
+    var autoURL = document.getElementById("networkProxyAutoconfigURL");
+    var autoURLPref = Preferences.get("network.proxy.autoconfig_url");
+    try {
+      autoURLPref.value = autoURL.value = Services.uriFixup.getFixupURIInfo(
+        autoURL.value
+      ).preferredURI.spec;
+    } catch (ex) {}
+  },
+
+  sanitizeNoProxiesPref() {
+    var noProxiesPref = Preferences.get("network.proxy.no_proxies_on");
+    // replace substrings of ; and \n with commas if they're neither immediately
+    // preceded nor followed by a valid separator character
+    noProxiesPref.value = noProxiesPref.value.replace(
+      /([^, \n;])[;\n]+(?![,\n;])/g,
+      "$1,"
+    );
+    // replace any remaining ; and \n since some may follow commas, etc.
+    noProxiesPref.value = noProxiesPref.value.replace(/[;\n]/g, "");
+  },
+
+  readHTTPProxyServer() {
+    var shareProxiesPref = Preferences.get(
+      "network.proxy.share_proxy_settings"
+    );
+    if (shareProxiesPref.value) {
+      this.updateProtocolPrefs();
+    }
+    return undefined;
+  },
+
+  readHTTPProxyPort() {
+    var shareProxiesPref = Preferences.get(
+      "network.proxy.share_proxy_settings"
+    );
+    if (shareProxiesPref.value) {
+      this.updateProtocolPrefs();
+    }
+    return undefined;
+  },
+
+  getProxyControls() {
+    let controlGroup = document.getElementById("networkProxyType");
+    return [
+      ...controlGroup.querySelectorAll(":scope > radio"),
+      ...controlGroup.querySelectorAll("label"),
+      ...controlGroup.querySelectorAll("input"),
+      ...controlGroup.querySelectorAll("checkbox"),
+      ...document.querySelectorAll("#networkProxySOCKSVersion > radio"),
+      ...document.querySelectorAll("#ConnectionsDialogPane > checkbox"),
+    ];
+  },
+
+  // Update the UI to show/hide the extension controlled message for
+  // proxy settings.
+  async updateProxySettingsUI() {
+    let isLocked = API_PROXY_PREFS.some(pref =>
+      Services.prefs.prefIsLocked(pref)
+    );
+
+    function setInputsDisabledState(isControlled) {
+      for (let element of gConnectionsDialog.getProxyControls()) {
+        element.disabled = isControlled;
+      }
+      gConnectionsDialog.proxyTypeChanged();
+    }
+
+    if (isLocked) {
+      // An extension can't control this setting if any pref is locked.
+      hideControllingExtension(PROXY_KEY);
+    } else {
+      handleControllingExtension(PREF_SETTING_TYPE, PROXY_KEY).then(
+        setInputsDisabledState
+      );
+    }
+  },
+
+  registerSyncPrefListeners() {
+    function setSyncFromPrefListener(element_id, callback) {
+      Preferences.addSyncFromPrefListener(
+        document.getElementById(element_id),
+        callback
+      );
+    }
+    setSyncFromPrefListener("networkProxyType", () => this.readProxyType());
+    setSyncFromPrefListener("networkProxyHTTP", () =>
+      this.readHTTPProxyServer()
+    );
+    setSyncFromPrefListener("networkProxyHTTP_Port", () =>
+      this.readHTTPProxyPort()
+    );
+    setSyncFromPrefListener("shareAllProxies", () =>
+      this.updateProtocolPrefs()
+    );
+    setSyncFromPrefListener("networkProxySSL", () =>
+      this.readProxyProtocolPref("ssl", false)
+    );
+    setSyncFromPrefListener("networkProxySSL_Port", () =>
+      this.readProxyProtocolPref("ssl", true)
+    );
+    setSyncFromPrefListener("networkProxySOCKS", () =>
+      this.readProxyProtocolPref("socks", false)
+    );
+    setSyncFromPrefListener("networkProxySOCKS_Port", () =>
+      this.readProxyProtocolPref("socks", true)
+    );
+  },
+};
diff --git a/browser/components/preferences/dialogs/connection.xhtml b/browser/components/preferences/dialogs/connection.xhtml
new file mode 100644
index 0000000000..2a1a3c0115
--- /dev/null
+++ b/browser/components/preferences/dialogs/connection.xhtml
@@ -0,0 +1,247 @@
+<?xml version="1.0"?>
+
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+
+<window
+  type="child"
+  xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+  xmlns:html="http://www.w3.org/1999/xhtml"
+  data-l10n-id="connection-window2"
+  data-l10n-attrs="title, style"
+  persist="lastSelected"
+  onload="gConnectionsDialog.checkForSystemProxy();"
+>
+  <dialog
+    id="ConnectionsDialog"
+    buttons="accept,cancel,help"
+    helpTopic="prefs-connection-settings"
+  >
+    <!-- Used for extension-controlled lockdown message -->
+    <linkset>
+      <html:link rel="stylesheet" href="chrome://global/skin/global.css" />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/skin/preferences/preferences.css"
+      />
+
+      <html:link rel="localization" href="browser/preferences/connection.ftl" />
+      <html:link
+        rel="localization"
+        href="browser/preferences/preferences.ftl"
+      />
+      <html:link rel="localization" href="branding/brand.ftl" />
+    </linkset>
+
+    <script src="chrome://browser/content/utilityOverlay.js" />
+    <script src="chrome://global/content/preferencesBindings.js" />
+    <script src="chrome://browser/content/preferences/extensionControlled.js" />
+
+    <keyset>
+      <key
+        data-l10n-id="connection-close-key"
+        modifiers="accel"
+        oncommand="Preferences.close(event)"
+      />
+    </keyset>
+
+    <script src="chrome://browser/content/preferences/dialogs/connection.js" />
+
+    <hbox
+      id="proxyExtensionContent"
+      align="start"
+      hidden="true"
+      class="extension-controlled"
+    >
+      <description control="disableProxyExtension" flex="1" />
+      <button
+        id="disableProxyExtension"
+        class="extension-controlled-button accessory-button"
+        data-l10n-id="connection-disable-extension"
+      />
+    </hbox>
+
+    <groupbox>
+      <label><html:h2 data-l10n-id="connection-proxy-configure" /></label>
+
+      <radiogroup id="networkProxyType" preference="network.proxy.type">
+        <radio value="0" data-l10n-id="connection-proxy-option-no" />
+        <radio value="4" data-l10n-id="connection-proxy-option-auto" />
+        <radio
+          value="5"
+          data-l10n-id="connection-proxy-option-system"
+          id="systemPref"
+          hidden="true"
+        />
+        <radio value="1" data-l10n-id="connection-proxy-option-manual" />
+        <box id="proxy-grid" class="indent" flex="1">
+          <html:div class="proxy-grid-row">
+            <hbox pack="end">
+              <label
+                data-l10n-id="connection-proxy-http"
+                control="networkProxyHTTP"
+              />
+            </hbox>
+            <hbox align="center">
+              <html:input
+                id="networkProxyHTTP"
+                type="text"
+                style="flex: 1"
+                preference="network.proxy.http"
+              />
+              <label
+                data-l10n-id="connection-proxy-http-port"
+                control="networkProxyHTTP_Port"
+              />
+              <html:input
+                id="networkProxyHTTP_Port"
+                class="proxy-port-input"
+                hidespinbuttons="true"
+                type="number"
+                min="0"
+                max="65535"
+                preference="network.proxy.http_port"
+              />
+            </hbox>
+          </html:div>
+          <html:div class="proxy-grid-row">
+            <hbox />
+            <hbox>
+              <checkbox
+                id="shareAllProxies"
+                data-l10n-id="connection-proxy-https-sharing"
+                preference="network.proxy.share_proxy_settings"
+              />
+            </hbox>
+          </html:div>
+          <html:div class="proxy-grid-row">
+            <hbox pack="end">
+              <label
+                data-l10n-id="connection-proxy-https"
+                control="networkProxySSL"
+              />
+            </hbox>
+            <hbox align="center">
+              <html:input
+                id="networkProxySSL"
+                type="text"
+                style="flex: 1"
+                preference="network.proxy.ssl"
+              />
+              <label
+                data-l10n-id="connection-proxy-ssl-port"
+                control="networkProxySSL_Port"
+              />
+              <html:input
+                id="networkProxySSL_Port"
+                class="proxy-port-input"
+                hidespinbuttons="true"
+                type="number"
+                min="0"
+                max="65535"
+                size="5"
+                preference="network.proxy.ssl_port"
+              />
+            </hbox>
+          </html:div>
+          <separator class="thin" />
+          <html:div class="proxy-grid-row">
+            <hbox pack="end">
+              <label
+                data-l10n-id="connection-proxy-socks"
+                control="networkProxySOCKS"
+              />
+            </hbox>
+            <hbox align="center">
+              <html:input
+                id="networkProxySOCKS"
+                type="text"
+                style="flex: 1"
+                preference="network.proxy.socks"
+              />
+              <label
+                data-l10n-id="connection-proxy-socks-port"
+                control="networkProxySOCKS_Port"
+              />
+              <html:input
+                id="networkProxySOCKS_Port"
+                class="proxy-port-input"
+                hidespinbuttons="true"
+                type="number"
+                min="0"
+                max="65535"
+                size="5"
+                preference="network.proxy.socks_port"
+              />
+            </hbox>
+          </html:div>
+          <html:div class="proxy-grid-row">
+            <spacer />
+            <box pack="start">
+              <radiogroup
+                id="networkProxySOCKSVersion"
+                orient="horizontal"
+                preference="network.proxy.socks_version"
+              >
+                <radio
+                  id="networkProxySOCKSVersion4"
+                  value="4"
+                  data-l10n-id="connection-proxy-socks4"
+                />
+                <radio
+                  id="networkProxySOCKSVersion5"
+                  value="5"
+                  data-l10n-id="connection-proxy-socks5"
+                />
+              </radiogroup>
+            </box>
+          </html:div>
+        </box>
+        <radio value="2" data-l10n-id="connection-proxy-autotype" />
+        <hbox class="indent" flex="1" align="center">
+          <html:input
+            id="networkProxyAutoconfigURL"
+            type="text"
+            style="flex: 1"
+            preference="network.proxy.autoconfig_url"
+            oninput="gConnectionsDialog.updateReloadButton();"
+          />
+          <button
+            id="autoReload"
+            data-l10n-id="connection-proxy-reload"
+            oncommand="gConnectionsDialog.reloadPAC();"
+            preference="pref.advanced.proxies.disable_button.reload"
+          />
+        </hbox>
+      </radiogroup>
+    </groupbox>
+    <separator class="thin" />
+    <label data-l10n-id="connection-proxy-noproxy" control="networkProxyNone" />
+    <html:textarea
+      id="networkProxyNone"
+      preference="network.proxy.no_proxies_on"
+      rows="2"
+    />
+    <label
+      control="networkProxyNone"
+      data-l10n-id="connection-proxy-noproxy-desc"
+    />
+    <label
+      id="networkProxyNoneLocalhost"
+      control="networkProxyNone"
+      data-l10n-id="connection-proxy-noproxy-localhost-desc-2"
+    />
+    <separator class="thin" />
+    <checkbox
+      id="autologinProxy"
+      data-l10n-id="connection-proxy-autologin-checkbox"
+      preference="signon.autologin.proxy"
+    />
+    <checkbox
+      id="networkProxySOCKSRemoteDNS"
+      preference="network.proxy.socks_remote_dns"
+      data-l10n-id="connection-proxy-socks-remote-dns"
+    />
+  </dialog>
+</window>
diff --git a/browser/components/preferences/dialogs/containers.js b/browser/components/preferences/dialogs/containers.js
new file mode 100644
index 0000000000..14526545b6
--- /dev/null
+++ b/browser/components/preferences/dialogs/containers.js
@@ -0,0 +1,167 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+const { ContextualIdentityService } = ChromeUtils.importESModule(
+  "resource://gre/modules/ContextualIdentityService.sys.mjs"
+);
+
+/**
+ * We want to set the window title immediately to prevent flickers.
+ */
+function setTitle() {
+  let params = window.arguments[0] || {};
+
+  let winElem = document.documentElement;
+  if (params.userContextId) {
+    document.l10n.setAttributes(winElem, "containers-window-update-settings2", {
+      name: params.identity.name,
+    });
+  } else {
+    document.l10n.setAttributes(winElem, "containers-window-new2");
+  }
+}
+setTitle();
+
+let gContainersManager = {
+  icons: [
+    "fingerprint",
+    "briefcase",
+    "dollar",
+    "cart",
+    "vacation",
+    "gift",
+    "food",
+    "fruit",
+    "pet",
+    "tree",
+    "chill",
+    "circle",
+    "fence",
+  ],
+
+  colors: [
+    "blue",
+    "turquoise",
+    "green",
+    "yellow",
+    "orange",
+    "red",
+    "pink",
+    "purple",
+    "toolbar",
+  ],
+
+  onLoad() {
+    let params = window.arguments[0] || {};
+    this.init(params);
+  },
+
+  init(aParams) {
+    this._dialog = document.querySelector("dialog");
+    this.userContextId = aParams.userContextId || null;
+    this.identity = aParams.identity;
+
+    const iconWrapper = document.getElementById("iconWrapper");
+    iconWrapper.appendChild(this.createIconButtons());
+
+    const colorWrapper = document.getElementById("colorWrapper");
+    colorWrapper.appendChild(this.createColorSwatches());
+
+    if (this.identity.name) {
+      const name = document.getElementById("name");
+      name.value = this.identity.name;
+      this.checkForm();
+    }
+
+    document.addEventListener("dialogaccept", () => this.onApplyChanges());
+
+    // This is to prevent layout jank caused by the svgs and outlines rendering at different times
+    document.getElementById("containers-content").removeAttribute("hidden");
+  },
+
+  uninit() {},
+
+  // Check if name is provided to determine if the form can be submitted
+  checkForm() {
+    const name = document.getElementById("name");
+    this._dialog.setAttribute("buttondisabledaccept", !name.value.trim());
+  },
+
+  createIconButtons(defaultIcon) {
+    let radiogroup = document.createXULElement("radiogroup");
+    radiogroup.setAttribute("id", "icon");
+    radiogroup.className = "icon-buttons radio-buttons";
+
+    for (let icon of this.icons) {
+      let iconSwatch = document.createXULElement("radio");
+      iconSwatch.id = "iconbutton-" + icon;
+      iconSwatch.name = "icon";
+      iconSwatch.type = "radio";
+      iconSwatch.value = icon;
+
+      if (this.identity.icon && this.identity.icon == icon) {
+        iconSwatch.setAttribute("selected", true);
+      }
+
+      document.l10n.setAttributes(iconSwatch, `containers-icon-${icon}`);
+      let iconElement = document.createXULElement("hbox");
+      iconElement.className = "userContext-icon";
+      iconElement.classList.add("identity-icon-" + icon);
+
+      iconSwatch.appendChild(iconElement);
+      radiogroup.appendChild(iconSwatch);
+    }
+
+    return radiogroup;
+  },
+
+  createColorSwatches(defaultColor) {
+    let radiogroup = document.createXULElement("radiogroup");
+    radiogroup.setAttribute("id", "color");
+    radiogroup.className = "radio-buttons";
+
+    for (let color of this.colors) {
+      let colorSwatch = document.createXULElement("radio");
+      colorSwatch.id = "colorswatch-" + color;
+      colorSwatch.name = "color";
+      colorSwatch.type = "radio";
+      colorSwatch.value = color;
+
+      if (this.identity.color && this.identity.color == color) {
+        colorSwatch.setAttribute("selected", true);
+      }
+
+      document.l10n.setAttributes(colorSwatch, `containers-color-${color}`);
+      let iconElement = document.createXULElement("hbox");
+      iconElement.className = "userContext-icon";
+      iconElement.classList.add("identity-icon-circle");
+      iconElement.classList.add("identity-color-" + color);
+
+      colorSwatch.appendChild(iconElement);
+      radiogroup.appendChild(colorSwatch);
+    }
+    return radiogroup;
+  },
+
+  onApplyChanges() {
+    let icon = document.getElementById("icon").value;
+    let color = document.getElementById("color").value;
+    let name = document.getElementById("name").value;
+
+    if (!this.icons.includes(icon)) {
+      throw new Error("Internal error. The icon value doesn't match.");
+    }
+
+    if (!this.colors.includes(color)) {
+      throw new Error("Internal error. The color value doesn't match.");
+    }
+
+    if (this.userContextId) {
+      ContextualIdentityService.update(this.userContextId, name, icon, color);
+    } else {
+      ContextualIdentityService.create(name, icon, color);
+    }
+    window.parent.location.reload();
+  },
+};
diff --git a/browser/components/preferences/dialogs/containers.xhtml b/browser/components/preferences/dialogs/containers.xhtml
new file mode 100644
index 0000000000..867463ee3a
--- /dev/null
+++ b/browser/components/preferences/dialogs/containers.xhtml
@@ -0,0 +1,75 @@
+<?xml version="1.0"?>
+
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+
+<window
+  id="ContainersDialog"
+  xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+  xmlns:html="http://www.w3.org/1999/xhtml"
+  data-l10n-attrs="title, style"
+  onload="gContainersManager.onLoad();"
+  onunload="gContainersManager.uninit();"
+  persist="width height"
+>
+  <dialog
+    buttons="accept"
+    buttondisabledaccept="true"
+    data-l10n-id="containers-dialog"
+    data-l10n-attrs="buttonlabelaccept, buttonaccesskeyaccept"
+  >
+    <linkset>
+      <html:link rel="stylesheet" href="chrome://global/skin/global.css" />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/skin/preferences/containers-dialog.css"
+      />
+
+      <html:link rel="localization" href="browser/preferences/containers.ftl" />
+    </linkset>
+
+    <script src="chrome://browser/content/preferences/dialogs/containers.js" />
+
+    <keyset>
+      <key
+        data-l10n-id="containers-window-close"
+        modifiers="accel"
+        oncommand="window.close();"
+      />
+    </keyset>
+
+    <vbox class="contentPane" hidden="true" id="containers-content">
+      <hbox align="start">
+        <label
+          id="nameLabel"
+          control="name"
+          data-l10n-id="containers-name-label"
+          data-l10n-attrs="style"
+        />
+        <html:input
+          id="name"
+          type="text"
+          data-l10n-id="containers-name-text"
+          oninput="gContainersManager.checkForm();"
+        />
+      </hbox>
+      <hbox align="center" id="colorWrapper">
+        <label
+          id="colorLabel"
+          control="color"
+          data-l10n-id="containers-color-label"
+          data-l10n-attrs="style"
+        />
+      </hbox>
+      <hbox align="center" id="iconWrapper">
+        <label
+          id="iconLabel"
+          control="icon"
+          data-l10n-id="containers-icon-label"
+          data-l10n-attrs="style"
+        />
+      </hbox>
+    </vbox>
+  </dialog>
+</window>
diff --git a/browser/components/preferences/dialogs/dohExceptions.js b/browser/components/preferences/dialogs/dohExceptions.js
new file mode 100644
index 0000000000..f4c1d4d80d
--- /dev/null
+++ b/browser/components/preferences/dialogs/dohExceptions.js
@@ -0,0 +1,287 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+const { AppConstants } = ChromeUtils.importESModule(
+  "resource://gre/modules/AppConstants.sys.mjs"
+);
+
+var gDoHExceptionsManager = {
+  _exceptions: new Set(),
+  _list: null,
+  _prefLocked: false,
+
+  init() {
+    document.addEventListener("dialogaccept", () => this.onApplyChanges());
+
+    this._btnAddException = document.getElementById("btnAddException");
+    this._removeButton = document.getElementById("removeException");
+    this._removeAllButton = document.getElementById("removeAllExceptions");
+    this._list = document.getElementById("permissionsBox");
+
+    this._urlField = document.getElementById("url");
+    this.onExceptionInput();
+
+    this._loadExceptions();
+    this.buildExceptionList();
+
+    this._urlField.focus();
+
+    this._prefLocked = Services.prefs.prefIsLocked(
+      "network.trr.excluded-domains"
+    );
+
+    this._btnAddException.disabled = this._prefLocked;
+    document.getElementById("exceptionDialog").getButton("accept").disabled =
+      this._prefLocked;
+    this._urlField.disabled = this._prefLocked;
+  },
+
+  _loadExceptions() {
+    let exceptionsFromPref = Services.prefs.getStringPref(
+      "network.trr.excluded-domains"
+    );
+
+    if (!exceptionsFromPref?.trim()) {
+      return;
+    }
+
+    let exceptions = exceptionsFromPref.trim().split(",");
+    for (let exception of exceptions) {
+      let trimmed = exception.trim();
+      if (trimmed) {
+        this._exceptions.add(trimmed);
+      }
+    }
+  },
+
+  addException() {
+    if (this._prefLocked) {
+      return;
+    }
+
+    let textbox = document.getElementById("url");
+    let inputValue = textbox.value.trim(); // trim any leading and trailing space
+    if (!inputValue.startsWith("http:") && !inputValue.startsWith("https:")) {
+      inputValue = `http://${inputValue}`;
+    }
+    let domain = "";
+    try {
+      let uri = Services.io.newURI(inputValue);
+      domain = uri.host;
+    } catch (ex) {
+      document.l10n
+        .formatValues([
+          { id: "permissions-invalid-uri-title" },
+          { id: "permissions-invalid-uri-label" },
+        ])
+        .then(([title, message]) => {
+          Services.prompt.alert(window, title, message);
+        });
+      return;
+    }
+
+    if (!this._exceptions.has(domain)) {
+      this._exceptions.add(domain);
+      this.buildExceptionList();
+    }
+
+    textbox.value = "";
+    textbox.focus();
+
+    // covers a case where the site exists already, so the buttons don't disable
+    this.onExceptionInput();
+
+    // enable "remove all" button as needed
+    this._setRemoveButtonState();
+  },
+
+  onExceptionInput() {
+    this._btnAddException.disabled = !this._urlField.value;
+  },
+
+  onExceptionKeyPress(event) {
+    if (event.keyCode == KeyEvent.DOM_VK_RETURN) {
+      this._btnAddException.click();
+      if (document.activeElement == this._urlField) {
+        event.preventDefault();
+      }
+    }
+  },
+
+  onListBoxKeyPress(event) {
+    if (!this._list.selectedItem) {
+      return;
+    }
+
+    if (this._prefLocked) {
+      return;
+    }
+
+    if (
+      event.keyCode == KeyEvent.DOM_VK_DELETE ||
+      (AppConstants.platform == "macosx" &&
+        event.keyCode == KeyEvent.DOM_VK_BACK_SPACE)
+    ) {
+      this.onExceptionDelete();
+      event.preventDefault();
+    }
+  },
+
+  onListBoxSelect() {
+    this._setRemoveButtonState();
+  },
+
+  _removeExceptionFromList(exception) {
+    this._exceptions.delete(exception);
+    let exceptionlistitem = document.getElementsByAttribute(
+      "domain",
+      exception
+    )[0];
+    if (exceptionlistitem) {
+      exceptionlistitem.remove();
+    }
+  },
+
+  onExceptionDelete() {
+    let richlistitem = this._list.selectedItem;
+    let exception = richlistitem.getAttribute("domain");
+
+    this._removeExceptionFromList(exception);
+
+    this._setRemoveButtonState();
+  },
+
+  onAllExceptionsDelete() {
+    for (let exception of this._exceptions.values()) {
+      this._removeExceptionFromList(exception);
+    }
+
+    this._setRemoveButtonState();
+  },
+
+  _createExceptionListItem(exception) {
+    let richlistitem = document.createXULElement("richlistitem");
+    richlistitem.setAttribute("domain", exception);
+    let row = document.createXULElement("hbox");
+    row.setAttribute("style", "flex: 1");
+
+    let hbox = document.createXULElement("hbox");
+    let website = document.createXULElement("label");
+    website.setAttribute("class", "website-name-value");
+    website.setAttribute("value", exception);
+    hbox.setAttribute("class", "website-name");
+    hbox.setAttribute("style", "flex: 3 3; width: 0");
+    hbox.appendChild(website);
+    row.appendChild(hbox);
+
+    richlistitem.appendChild(row);
+    return richlistitem;
+  },
+
+  _sortExceptions(list, frag, column) {
+    let sortDirection;
+
+    if (!column) {
+      column = document.querySelector("treecol[data-isCurrentSortCol=true]");
+      sortDirection =
+        column.getAttribute("data-last-sortDirection") || "ascending";
+    } else {
+      sortDirection = column.getAttribute("data-last-sortDirection");
+      sortDirection =
+        sortDirection === "ascending" ? "descending" : "ascending";
+    }
+
+    let sortFunc = (a, b) => {
+      return comp.compare(a.getAttribute("domain"), b.getAttribute("domain"));
+    };
+
+    let comp = new Services.intl.Collator(undefined, {
+      usage: "sort",
+    });
+
+    let items = Array.from(frag.querySelectorAll("richlistitem"));
+
+    if (sortDirection === "descending") {
+      items.sort((a, b) => sortFunc(b, a));
+    } else {
+      items.sort(sortFunc);
+    }
+
+    // Re-append items in the correct order:
+    items.forEach(item => frag.appendChild(item));
+
+    let cols = list.previousElementSibling.querySelectorAll("treecol");
+    cols.forEach(c => {
+      c.removeAttribute("data-isCurrentSortCol");
+      c.removeAttribute("sortDirection");
+    });
+    column.setAttribute("data-isCurrentSortCol", "true");
+    column.setAttribute("sortDirection", sortDirection);
+    column.setAttribute("data-last-sortDirection", sortDirection);
+  },
+
+  _setRemoveButtonState() {
+    if (!this._list) {
+      return;
+    }
+
+    if (this._prefLocked) {
+      this._removeAllButton.disabled = true;
+      this._removeButton.disabled = true;
+      return;
+    }
+
+    let hasSelection = this._list.selectedIndex >= 0;
+
+    this._removeButton.disabled = !hasSelection;
+    let disabledItems = this._list.querySelectorAll(
+      "label.website-name-value[disabled='true']"
+    );
+
+    this._removeAllButton.disabled =
+      this._list.itemCount == disabledItems.length;
+  },
+
+  onApplyChanges() {
+    if (this._exceptions.size == 0) {
+      Services.prefs.setStringPref("network.trr.excluded-domains", "");
+      return;
+    }
+
+    let exceptions = Array.from(this._exceptions);
+    let exceptionPrefString = exceptions.join(",");
+
+    Services.prefs.setStringPref(
+      "network.trr.excluded-domains",
+      exceptionPrefString
+    );
+  },
+
+  buildExceptionList(sortCol) {
+    // Clear old entries.
+    let oldItems = this._list.querySelectorAll("richlistitem");
+    for (let item of oldItems) {
+      item.remove();
+    }
+    let frag = document.createDocumentFragment();
+
+    let exceptions = Array.from(this._exceptions.values());
+
+    for (let exception of exceptions) {
+      let richlistitem = this._createExceptionListItem(exception);
+      frag.appendChild(richlistitem);
+    }
+
+    // Sort exceptions.
+    this._sortExceptions(this._list, frag, sortCol);
+
+    this._list.appendChild(frag);
+
+    this._setRemoveButtonState();
+  },
+};
+
+document.addEventListener("DOMContentLoaded", () => {
+  gDoHExceptionsManager.init();
+});
diff --git a/browser/components/preferences/dialogs/dohExceptions.xhtml b/browser/components/preferences/dialogs/dohExceptions.xhtml
new file mode 100644
index 0000000000..03a9c87992
--- /dev/null
+++ b/browser/components/preferences/dialogs/dohExceptions.xhtml
@@ -0,0 +1,110 @@
+<?xml version="1.0"?>
+
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+
+<window
+  id="DoHExceptionsDialog"
+  xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+  xmlns:html="http://www.w3.org/1999/xhtml"
+  data-l10n-id="permissions-exceptions-doh-window"
+  data-l10n-attrs="title, style"
+  persist="width height"
+>
+  <dialog
+    id="exceptionDialog"
+    buttons="accept,cancel"
+    data-l10n-id="permission-dialog"
+    data-l10n-attrs="buttonlabelaccept, buttonaccesskeyaccept"
+  >
+    <linkset>
+      <html:link rel="stylesheet" href="chrome://global/skin/global.css" />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/content/preferences/dialogs/sitePermissions.css"
+      />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/skin/preferences/preferences.css"
+      />
+
+      <html:link rel="localization" href="branding/brand.ftl" />
+      <html:link
+        rel="localization"
+        href="browser/preferences/permissions.ftl"
+      />
+    </linkset>
+
+    <script src="chrome://browser/content/preferences/dialogs/dohExceptions.js" />
+
+    <keyset>
+      <key
+        data-l10n-id="permissions-close-key"
+        modifiers="accel"
+        oncommand="window.close();"
+      />
+    </keyset>
+
+    <vbox class="contentPane">
+      <description
+        id="dohExceptionText"
+        control="url"
+        data-l10n-id="permissions-exceptions-manage-doh-desc"
+      />
+      <separator class="thin" />
+      <label
+        id="urlLabel"
+        control="url"
+        data-l10n-id="permissions-doh-entry-field"
+      />
+      <hbox align="start">
+        <html:input
+          id="url"
+          type="text"
+          style="flex: 1"
+          oninput="gDoHExceptionsManager.onExceptionInput();"
+          onkeypress="gDoHExceptionsManager.onExceptionKeyPress(event);"
+        />
+      </hbox>
+      <hbox pack="end">
+        <button
+          id="btnAddException"
+          disabled="true"
+          data-l10n-id="permissions-doh-add-exception"
+          oncommand="gDoHExceptionsManager.addException();"
+        />
+      </hbox>
+      <separator class="thin" />
+      <listheader>
+        <treecol
+          id="siteCol"
+          data-l10n-id="permissions-doh-col"
+          style="flex: 3 3 auto; width: 0"
+          data-isCurrentSortCol="true"
+          onclick="gDoHExceptionsManager.buildExceptionList(event.target)"
+        />
+      </listheader>
+      <richlistbox
+        id="permissionsBox"
+        selected="false"
+        onkeypress="gDoHExceptionsManager.onListBoxKeyPress(event);"
+        onselect="gDoHExceptionsManager.onListBoxSelect();"
+      />
+    </vbox>
+
+    <hbox class="actionButtons">
+      <button
+        id="removeException"
+        disabled="true"
+        data-l10n-id="permissions-doh-remove"
+        oncommand="gDoHExceptionsManager.onExceptionDelete();"
+      />
+      <button
+        id="removeAllExceptions"
+        data-l10n-id="permissions-doh-remove-all"
+        oncommand="gDoHExceptionsManager.onAllExceptionsDelete();"
+      />
+    </hbox>
+  </dialog>
+</window>
diff --git a/browser/components/preferences/dialogs/fonts.js b/browser/components/preferences/dialogs/fonts.js
new file mode 100644
index 0000000000..ccc2f8faca
--- /dev/null
+++ b/browser/components/preferences/dialogs/fonts.js
@@ -0,0 +1,173 @@
+/* -*- indent-tabs-mode: nil; js-indent-level: 4 -*- */
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+/* import-globals-from /browser/base/content/utilityOverlay.js */
+/* import-globals-from /toolkit/mozapps/preferences/fontbuilder.js */
+
+// browser.display.languageList LOCK ALL when LOCKED
+
+const kDefaultFontType = "font.default.%LANG%";
+const kFontNameFmtSerif = "font.name.serif.%LANG%";
+const kFontNameFmtSansSerif = "font.name.sans-serif.%LANG%";
+const kFontNameFmtMonospace = "font.name.monospace.%LANG%";
+const kFontNameListFmtSerif = "font.name-list.serif.%LANG%";
+const kFontNameListFmtSansSerif = "font.name-list.sans-serif.%LANG%";
+const kFontNameListFmtMonospace = "font.name-list.monospace.%LANG%";
+const kFontSizeFmtVariable = "font.size.variable.%LANG%";
+const kFontSizeFmtFixed = "font.size.monospace.%LANG%";
+const kFontMinSizeFmt = "font.minimum-size.%LANG%";
+
+document
+  .getElementById("FontsDialog")
+  .addEventListener("dialoghelp", window.top.openPrefsHelp);
+window.addEventListener("load", () => gFontsDialog.onLoad());
+
+Preferences.addAll([
+  { id: "font.language.group", type: "wstring" },
+  { id: "browser.display.use_document_fonts", type: "int" },
+]);
+
+var gFontsDialog = {
+  _selectLanguageGroupPromise: Promise.resolve(),
+
+  onLoad() {
+    Preferences.addSyncFromPrefListener(
+      document.getElementById("selectLangs"),
+      () => this.readFontLanguageGroup()
+    );
+    Preferences.addSyncFromPrefListener(
+      document.getElementById("useDocumentFonts"),
+      () => this.readUseDocumentFonts()
+    );
+    Preferences.addSyncToPrefListener(
+      document.getElementById("useDocumentFonts"),
+      () => this.writeUseDocumentFonts()
+    );
+    for (let id of ["serif", "sans-serif", "monospace"]) {
+      let el = document.getElementById(id);
+      Preferences.addSyncFromPrefListener(el, () =>
+        FontBuilder.readFontSelection(el)
+      );
+    }
+  },
+
+  _selectLanguageGroup(aLanguageGroup) {
+    this._selectLanguageGroupPromise = (async () => {
+      // Avoid overlapping language group selections by awaiting the resolution
+      // of the previous one.  We do this because this function is re-entrant,
+      // as inserting <preference> elements into the DOM sometimes triggers a call
+      // back into this function.  And since this function is also asynchronous,
+      // that call can enter this function before the previous run has completed,
+      // which would corrupt the font menulists.  Awaiting the previous call's
+      // resolution avoids that fate.
+      await this._selectLanguageGroupPromise;
+
+      var prefs = [
+        {
+          format: kDefaultFontType,
+          type: "string",
+          element: "defaultFontType",
+          fonttype: null,
+        },
+        {
+          format: kFontNameFmtSerif,
+          type: "fontname",
+          element: "serif",
+          fonttype: "serif",
+        },
+        {
+          format: kFontNameFmtSansSerif,
+          type: "fontname",
+          element: "sans-serif",
+          fonttype: "sans-serif",
+        },
+        {
+          format: kFontNameFmtMonospace,
+          type: "fontname",
+          element: "monospace",
+          fonttype: "monospace",
+        },
+        {
+          format: kFontNameListFmtSerif,
+          type: "unichar",
+          element: null,
+          fonttype: "serif",
+        },
+        {
+          format: kFontNameListFmtSansSerif,
+          type: "unichar",
+          element: null,
+          fonttype: "sans-serif",
+        },
+        {
+          format: kFontNameListFmtMonospace,
+          type: "unichar",
+          element: null,
+          fonttype: "monospace",
+        },
+        {
+          format: kFontSizeFmtVariable,
+          type: "int",
+          element: "sizeVar",
+          fonttype: null,
+        },
+        {
+          format: kFontSizeFmtFixed,
+          type: "int",
+          element: "sizeMono",
+          fonttype: null,
+        },
+        {
+          format: kFontMinSizeFmt,
+          type: "int",
+          element: "minSize",
+          fonttype: null,
+        },
+      ];
+      for (var i = 0; i < prefs.length; ++i) {
+        var name = prefs[i].format.replace(/%LANG%/, aLanguageGroup);
+        var preference = Preferences.get(name);
+        if (!preference) {
+          preference = Preferences.add({ id: name, type: prefs[i].type });
+        }
+
+        if (!prefs[i].element) {
+          continue;
+        }
+
+        var element = document.getElementById(prefs[i].element);
+        if (element) {
+          element.setAttribute("preference", preference.id);
+
+          if (prefs[i].fonttype) {
+            await FontBuilder.buildFontList(
+              aLanguageGroup,
+              prefs[i].fonttype,
+              element
+            );
+          }
+
+          preference.setElementValue(element);
+        }
+      }
+    })().catch(console.error);
+  },
+
+  readFontLanguageGroup() {
+    var languagePref = Preferences.get("font.language.group");
+    this._selectLanguageGroup(languagePref.value);
+    return undefined;
+  },
+
+  readUseDocumentFonts() {
+    var preference = Preferences.get("browser.display.use_document_fonts");
+    return preference.value == 1;
+  },
+
+  writeUseDocumentFonts() {
+    var useDocumentFonts = document.getElementById("useDocumentFonts");
+    return useDocumentFonts.checked ? 1 : 0;
+  },
+};
diff --git a/browser/components/preferences/dialogs/fonts.xhtml b/browser/components/preferences/dialogs/fonts.xhtml
new file mode 100644
index 0000000000..44dc473ccb
--- /dev/null
+++ b/browser/components/preferences/dialogs/fonts.xhtml
@@ -0,0 +1,254 @@
+<?xml version="1.0"?>
+
+<!-- -*- Mode: Java; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- -->
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+
+<window
+  type="child"
+  xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+  xmlns:html="http://www.w3.org/1999/xhtml"
+  data-l10n-id="fonts-window"
+  data-l10n-attrs="title"
+  persist="lastSelected"
+>
+  <dialog
+    id="FontsDialog"
+    buttons="accept,cancel,help"
+    helpTopic="prefs-fonts-and-colors"
+  >
+    <linkset>
+      <html:link rel="stylesheet" href="chrome://global/skin/global.css" />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/skin/preferences/preferences.css"
+      />
+
+      <html:link rel="localization" href="browser/preferences/fonts.ftl" />
+    </linkset>
+
+    <script src="chrome://browser/content/utilityOverlay.js" />
+    <script src="chrome://global/content/preferencesBindings.js" />
+
+    <keyset>
+      <key
+        data-l10n-id="fonts-window-close"
+        modifiers="accel"
+        oncommand="Preferences.close(event)"
+      />
+    </keyset>
+
+    <!-- Fonts for: [ Language ] -->
+    <groupbox>
+      <hbox align="center">
+        <label control="selectLangs"
+          ><html:h2 data-l10n-id="fonts-langgroup-header"
+        /></label>
+      </hbox>
+      <menulist id="selectLangs" preference="font.language.group">
+        <menupopup>
+          <menuitem value="ar" data-l10n-id="fonts-langgroup-arabic" />
+          <menuitem value="x-armn" data-l10n-id="fonts-langgroup-armenian" />
+          <menuitem value="x-beng" data-l10n-id="fonts-langgroup-bengali" />
+          <menuitem
+            value="zh-CN"
+            data-l10n-id="fonts-langgroup-simpl-chinese"
+          />
+          <menuitem
+            value="zh-HK"
+            data-l10n-id="fonts-langgroup-trad-chinese-hk"
+          />
+          <menuitem value="zh-TW" data-l10n-id="fonts-langgroup-trad-chinese" />
+          <menuitem
+            value="x-cyrillic"
+            data-l10n-id="fonts-langgroup-cyrillic"
+          />
+          <menuitem
+            value="x-devanagari"
+            data-l10n-id="fonts-langgroup-devanagari"
+          />
+          <menuitem value="x-ethi" data-l10n-id="fonts-langgroup-ethiopic" />
+          <menuitem value="x-geor" data-l10n-id="fonts-langgroup-georgian" />
+          <menuitem value="el" data-l10n-id="fonts-langgroup-el" />
+          <menuitem value="x-gujr" data-l10n-id="fonts-langgroup-gujarati" />
+          <menuitem value="x-guru" data-l10n-id="fonts-langgroup-gurmukhi" />
+          <menuitem value="he" data-l10n-id="fonts-langgroup-hebrew" />
+          <menuitem value="ja" data-l10n-id="fonts-langgroup-japanese" />
+          <menuitem value="x-knda" data-l10n-id="fonts-langgroup-kannada" />
+          <menuitem value="x-khmr" data-l10n-id="fonts-langgroup-khmer" />
+          <menuitem value="ko" data-l10n-id="fonts-langgroup-korean" />
+          <menuitem value="x-western" data-l10n-id="fonts-langgroup-latin" />
+          <menuitem value="x-mlym" data-l10n-id="fonts-langgroup-malayalam" />
+          <menuitem value="x-math" data-l10n-id="fonts-langgroup-math" />
+          <menuitem value="x-orya" data-l10n-id="fonts-langgroup-odia" />
+          <menuitem value="x-sinh" data-l10n-id="fonts-langgroup-sinhala" />
+          <menuitem value="x-tamil" data-l10n-id="fonts-langgroup-tamil" />
+          <menuitem value="x-telu" data-l10n-id="fonts-langgroup-telugu" />
+          <menuitem value="th" data-l10n-id="fonts-langgroup-thai" />
+          <menuitem value="x-tibt" data-l10n-id="fonts-langgroup-tibetan" />
+          <menuitem value="x-cans" data-l10n-id="fonts-langgroup-canadian" />
+          <menuitem value="x-unicode" data-l10n-id="fonts-langgroup-other" />
+        </menupopup>
+      </menulist>
+
+      <separator class="thin" />
+
+      <box id="font-chooser-group">
+        <!-- proportional row -->
+        <hbox align="center" pack="end">
+          <label
+            data-l10n-id="fonts-proportional-header"
+            control="defaultFontType"
+          />
+        </hbox>
+        <menulist id="defaultFontType">
+          <menupopup>
+            <menuitem value="serif" data-l10n-id="fonts-default-serif" />
+            <menuitem
+              value="sans-serif"
+              data-l10n-id="fonts-default-sans-serif"
+            />
+          </menupopup>
+        </menulist>
+        <hbox align="center" pack="end">
+          <label data-l10n-id="fonts-proportional-size" control="sizeVar" />
+        </hbox>
+        <menulist id="sizeVar" delayprefsave="true">
+          <menupopup>
+            <menuitem value="9" label="9" />
+            <menuitem value="10" label="10" />
+            <menuitem value="11" label="11" />
+            <menuitem value="12" label="12" />
+            <menuitem value="13" label="13" />
+            <menuitem value="14" label="14" />
+            <menuitem value="15" label="15" />
+            <menuitem value="16" label="16" />
+            <menuitem value="17" label="17" />
+            <menuitem value="18" label="18" />
+            <menuitem value="20" label="20" />
+            <menuitem value="22" label="22" />
+            <menuitem value="24" label="24" />
+            <menuitem value="26" label="26" />
+            <menuitem value="28" label="28" />
+            <menuitem value="30" label="30" />
+            <menuitem value="32" label="32" />
+            <menuitem value="34" label="34" />
+            <menuitem value="36" label="36" />
+            <menuitem value="40" label="40" />
+            <menuitem value="44" label="44" />
+            <menuitem value="48" label="48" />
+            <menuitem value="56" label="56" />
+            <menuitem value="64" label="64" />
+            <menuitem value="72" label="72" />
+          </menupopup>
+        </menulist>
+
+        <!-- serif row -->
+        <hbox align="center" pack="end">
+          <label data-l10n-id="fonts-serif" control="serif" />
+        </hbox>
+        <menulist id="serif" delayprefsave="true" />
+        <spacer />
+        <spacer />
+
+        <!-- sans-serif row -->
+        <hbox align="center" pack="end">
+          <label data-l10n-id="fonts-sans-serif" control="sans-serif" />
+        </hbox>
+        <menulist id="sans-serif" delayprefsave="true" />
+        <spacer />
+        <spacer />
+
+        <!-- monospace row -->
+        <hbox align="center" pack="end">
+          <label data-l10n-id="fonts-monospace" control="monospace" />
+        </hbox>
+        <!--
+          FIXME(emilio): Why is this the only menulist here with crop="end"?
+          This goes back to the beginning of time...
+      -->
+        <menulist id="monospace" crop="end" delayprefsave="true" />
+        <hbox align="center" pack="end">
+          <label data-l10n-id="fonts-monospace-size" control="sizeMono" />
+        </hbox>
+        <menulist id="sizeMono" delayprefsave="true">
+          <menupopup>
+            <menuitem value="9" label="9" />
+            <menuitem value="10" label="10" />
+            <menuitem value="11" label="11" />
+            <menuitem value="12" label="12" />
+            <menuitem value="13" label="13" />
+            <menuitem value="14" label="14" />
+            <menuitem value="15" label="15" />
+            <menuitem value="16" label="16" />
+            <menuitem value="17" label="17" />
+            <menuitem value="18" label="18" />
+            <menuitem value="20" label="20" />
+            <menuitem value="22" label="22" />
+            <menuitem value="24" label="24" />
+            <menuitem value="26" label="26" />
+            <menuitem value="28" label="28" />
+            <menuitem value="30" label="30" />
+            <menuitem value="32" label="32" />
+            <menuitem value="34" label="34" />
+            <menuitem value="36" label="36" />
+            <menuitem value="40" label="40" />
+            <menuitem value="44" label="44" />
+            <menuitem value="48" label="48" />
+            <menuitem value="56" label="56" />
+            <menuitem value="64" label="64" />
+            <menuitem value="72" label="72" />
+          </menupopup>
+        </menulist>
+      </box>
+      <separator class="thin" />
+      <hbox align="center" pack="end">
+        <label data-l10n-id="fonts-minsize" control="minSize" />
+        <menulist id="minSize">
+          <menupopup>
+            <menuitem value="0" data-l10n-id="fonts-minsize-none" />
+            <menuitem value="9" label="9" />
+            <menuitem value="10" label="10" />
+            <menuitem value="11" label="11" />
+            <menuitem value="12" label="12" />
+            <menuitem value="13" label="13" />
+            <menuitem value="14" label="14" />
+            <menuitem value="15" label="15" />
+            <menuitem value="16" label="16" />
+            <menuitem value="17" label="17" />
+            <menuitem value="18" label="18" />
+            <menuitem value="20" label="20" />
+            <menuitem value="22" label="22" />
+            <menuitem value="24" label="24" />
+            <menuitem value="26" label="26" />
+            <menuitem value="28" label="28" />
+            <menuitem value="30" label="30" />
+            <menuitem value="32" label="32" />
+            <menuitem value="34" label="34" />
+            <menuitem value="36" label="36" />
+            <menuitem value="40" label="40" />
+            <menuitem value="44" label="44" />
+            <menuitem value="48" label="48" />
+            <menuitem value="56" label="56" />
+            <menuitem value="64" label="64" />
+            <menuitem value="72" label="72" />
+          </menupopup>
+        </menulist>
+      </hbox>
+      <separator />
+      <separator class="groove" />
+      <hbox>
+        <checkbox
+          id="useDocumentFonts"
+          data-l10n-id="fonts-allow-own"
+          preference="browser.display.use_document_fonts"
+        />
+      </hbox>
+    </groupbox>
+
+    <!-- Load the script after the elements for layout issues (bug 1501755). -->
+    <script src="chrome://mozapps/content/preferences/fontbuilder.js" />
+    <script src="chrome://browser/content/preferences/dialogs/fonts.js" />
+  </dialog>
+</window>
diff --git a/browser/components/preferences/dialogs/handlers.css b/browser/components/preferences/dialogs/handlers.css
new file mode 100644
index 0000000000..b53963fa4d
--- /dev/null
+++ b/browser/components/preferences/dialogs/handlers.css
@@ -0,0 +1,21 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+/**
+ * Make the icons appear.
+ * Note: we display the icon box for every item whether or not it has an icon
+ * so the labels of all the items align vertically.
+ */
+.actionsMenu > menupopup > menuitem > .menu-iconic-left {
+  display: flex;
+  min-width: 16px;
+}
+
+/* Apply crisp rendering for favicons at exactly 2dppx resolution */
+@media (resolution: 2dppx) {
+  #handlersView > richlistitem,
+  .actionsMenu > menupopup > menuitem > .menu-iconic-left {
+    image-rendering: -moz-crisp-edges;
+  }
+}
diff --git a/browser/components/preferences/dialogs/jar.mn b/browser/components/preferences/dialogs/jar.mn
new file mode 100644
index 0000000000..a9f3dd1da2
--- /dev/null
+++ b/browser/components/preferences/dialogs/jar.mn
@@ -0,0 +1,49 @@
+# This Source Code Form is subject to the terms of the Mozilla Public
+# License, v. 2.0. If a copy of the MPL was not distributed with this
+# file, You can obtain one at http://mozilla.org/MPL/2.0/.
+
+browser.jar:
+   content/browser/preferences/dialogs/addEngine.xhtml
+   content/browser/preferences/dialogs/addEngine.js
+   content/browser/preferences/dialogs/addEngine.css
+   content/browser/preferences/dialogs/applicationManager.xhtml
+   content/browser/preferences/dialogs/applicationManager.js
+   content/browser/preferences/dialogs/blocklists.xhtml
+   content/browser/preferences/dialogs/blocklists.js
+   content/browser/preferences/dialogs/browserLanguages.xhtml
+   content/browser/preferences/dialogs/browserLanguages.js
+   content/browser/preferences/dialogs/clearSiteData.css
+   content/browser/preferences/dialogs/clearSiteData.js
+   content/browser/preferences/dialogs/clearSiteData.xhtml
+   content/browser/preferences/dialogs/colors.xhtml
+   content/browser/preferences/dialogs/colors.js
+   content/browser/preferences/dialogs/connection.xhtml
+   content/browser/preferences/dialogs/connection.js
+   content/browser/preferences/dialogs/dohExceptions.xhtml
+   content/browser/preferences/dialogs/dohExceptions.js
+   content/browser/preferences/dialogs/fonts.xhtml
+   content/browser/preferences/dialogs/fonts.js
+   content/browser/preferences/dialogs/handlers.css
+   content/browser/preferences/dialogs/languages.xhtml
+   content/browser/preferences/dialogs/languages.js
+   content/browser/preferences/dialogs/permissions.xhtml
+   content/browser/preferences/dialogs/sitePermissions.xhtml
+   content/browser/preferences/dialogs/sitePermissions.js
+   content/browser/preferences/dialogs/sitePermissions.css
+   content/browser/preferences/dialogs/containers.xhtml
+   content/browser/preferences/dialogs/containers.js
+   content/browser/preferences/dialogs/permissions.js
+   content/browser/preferences/dialogs/sanitize.xhtml
+   content/browser/preferences/dialogs/sanitize.js
+   content/browser/preferences/dialogs/selectBookmark.xhtml
+   content/browser/preferences/dialogs/selectBookmark.js
+   content/browser/preferences/dialogs/siteDataSettings.xhtml
+   content/browser/preferences/dialogs/siteDataSettings.js
+*  content/browser/preferences/dialogs/siteDataRemoveSelected.xhtml
+   content/browser/preferences/dialogs/siteDataRemoveSelected.js
+   content/browser/preferences/dialogs/syncChooseWhatToSync.xhtml
+   content/browser/preferences/dialogs/syncChooseWhatToSync.js
+   content/browser/preferences/dialogs/translationExceptions.xhtml
+   content/browser/preferences/dialogs/translationExceptions.js
+   content/browser/preferences/dialogs/translations.xhtml
+   content/browser/preferences/dialogs/translations.js
diff --git a/browser/components/preferences/dialogs/languages.js b/browser/components/preferences/dialogs/languages.js
new file mode 100644
index 0000000000..5e32e1c261
--- /dev/null
+++ b/browser/components/preferences/dialogs/languages.js
@@ -0,0 +1,386 @@
+/* -*- indent-tabs-mode: nil; js-indent-level: 4 -*- */
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+/* import-globals-from /toolkit/content/preferencesBindings.js */
+
+document
+  .getElementById("LanguagesDialog")
+  .addEventListener("dialoghelp", window.top.openPrefsHelp);
+
+Preferences.addAll([
+  { id: "intl.accept_languages", type: "wstring" },
+  { id: "pref.browser.language.disable_button.up", type: "bool" },
+  { id: "pref.browser.language.disable_button.down", type: "bool" },
+  { id: "pref.browser.language.disable_button.remove", type: "bool" },
+  { id: "privacy.spoof_english", type: "int" },
+]);
+
+var gLanguagesDialog = {
+  _availableLanguagesList: [],
+  _acceptLanguages: {},
+
+  _selectedItemID: null,
+
+  onLoad() {
+    let spoofEnglishElement = document.getElementById("spoofEnglish");
+    Preferences.addSyncFromPrefListener(spoofEnglishElement, () =>
+      gLanguagesDialog.readSpoofEnglish()
+    );
+    Preferences.addSyncToPrefListener(spoofEnglishElement, () =>
+      gLanguagesDialog.writeSpoofEnglish()
+    );
+
+    Preferences.get("intl.accept_languages").on("change", () =>
+      this._readAcceptLanguages().catch(console.error)
+    );
+
+    if (!this._availableLanguagesList.length) {
+      document.mozSubdialogReady = this._loadAvailableLanguages();
+    }
+  },
+
+  get _activeLanguages() {
+    return document.getElementById("activeLanguages");
+  },
+
+  get _availableLanguages() {
+    return document.getElementById("availableLanguages");
+  },
+
+  async _loadAvailableLanguages() {
+    // This is a parser for: resource://gre/res/language.properties
+    // The file is formatted like so:
+    // ab[-cd].accept=true|false
+    //  ab = language
+    //  cd = region
+    var bundleAccepted = document.getElementById("bundleAccepted");
+
+    function LocaleInfo(aLocaleName, aLocaleCode, aIsVisible) {
+      this.name = aLocaleName;
+      this.code = aLocaleCode;
+      this.isVisible = aIsVisible;
+    }
+
+    // 1) Read the available languages out of language.properties
+
+    let localeCodes = [];
+    let localeValues = [];
+    for (let currString of bundleAccepted.strings) {
+      var property = currString.key.split("."); // ab[-cd].accept
+      if (property[1] == "accept") {
+        localeCodes.push(property[0]);
+        localeValues.push(currString.value);
+      }
+    }
+
+    let localeNames = Services.intl.getLocaleDisplayNames(
+      undefined,
+      localeCodes
+    );
+
+    for (let i in localeCodes) {
+      let isVisible =
+        localeValues[i] == "true" &&
+        (!(localeCodes[i] in this._acceptLanguages) ||
+          !this._acceptLanguages[localeCodes[i]]);
+
+      let li = new LocaleInfo(localeNames[i], localeCodes[i], isVisible);
+      this._availableLanguagesList.push(li);
+    }
+
+    await this._buildAvailableLanguageList();
+    await this._readAcceptLanguages();
+  },
+
+  async _buildAvailableLanguageList() {
+    var availableLanguagesPopup = document.getElementById(
+      "availableLanguagesPopup"
+    );
+    while (availableLanguagesPopup.hasChildNodes()) {
+      availableLanguagesPopup.firstChild.remove();
+    }
+
+    let frag = document.createDocumentFragment();
+
+    // Load the UI with the data
+    for (var i = 0; i < this._availableLanguagesList.length; ++i) {
+      let locale = this._availableLanguagesList[i];
+      let localeCode = locale.code;
+      if (
+        locale.isVisible &&
+        (!(localeCode in this._acceptLanguages) ||
+          !this._acceptLanguages[localeCode])
+      ) {
+        var menuitem = document.createXULElement("menuitem");
+        menuitem.id = localeCode;
+        document.l10n.setAttributes(menuitem, "languages-code-format", {
+          locale: locale.name,
+          code: localeCode,
+        });
+        frag.appendChild(menuitem);
+      }
+    }
+
+    await document.l10n.translateFragment(frag);
+
+    // Sort the list of languages by name
+    let comp = new Services.intl.Collator(undefined, {
+      usage: "sort",
+    });
+
+    let items = Array.from(frag.children);
+
+    items.sort((a, b) => {
+      return comp.compare(a.getAttribute("label"), b.getAttribute("label"));
+    });
+
+    // Re-append items in the correct order:
+    items.forEach(item => frag.appendChild(item));
+
+    availableLanguagesPopup.appendChild(frag);
+
+    this._availableLanguages.setAttribute(
+      "label",
+      this._availableLanguages.getAttribute("placeholder")
+    );
+  },
+
+  async _readAcceptLanguages() {
+    while (this._activeLanguages.hasChildNodes()) {
+      this._activeLanguages.firstChild.remove();
+    }
+
+    var selectedIndex = 0;
+    var preference = Preferences.get("intl.accept_languages");
+    if (preference.value == "") {
+      this._activeLanguages.selectedIndex = -1;
+      this.onLanguageSelect();
+      return;
+    }
+    var languages = preference.value.toLowerCase().split(/\s*,\s*/);
+    for (var i = 0; i < languages.length; ++i) {
+      var listitem = document.createXULElement("richlistitem");
+      var label = document.createXULElement("label");
+      listitem.appendChild(label);
+      listitem.id = languages[i];
+      if (languages[i] == this._selectedItemID) {
+        selectedIndex = i;
+      }
+      this._activeLanguages.appendChild(listitem);
+      var localeName = this._getLocaleName(languages[i]);
+      document.l10n.setAttributes(label, "languages-active-code-format", {
+        locale: localeName,
+        code: languages[i],
+      });
+
+      // Hash this language as an "Active" language so we don't
+      // show it in the list that can be added.
+      this._acceptLanguages[languages[i]] = true;
+    }
+
+    // We're forcing an early localization here because otherwise
+    // the initial sizing of the dialog will happen before it and
+    // result in overflow.
+    await document.l10n.translateFragment(this._activeLanguages);
+
+    if (this._activeLanguages.childNodes.length) {
+      this._activeLanguages.ensureIndexIsVisible(selectedIndex);
+      this._activeLanguages.selectedIndex = selectedIndex;
+    }
+
+    // Update states of accept-language list and buttons according to
+    // privacy.resistFingerprinting and privacy.spoof_english.
+    this.readSpoofEnglish();
+  },
+
+  onAvailableLanguageSelect() {
+    var availableLanguages = this._availableLanguages;
+    var addButton = document.getElementById("addButton");
+    addButton.disabled =
+      availableLanguages.disabled || availableLanguages.selectedIndex < 0;
+
+    this._availableLanguages.removeAttribute("accesskey");
+  },
+
+  addLanguage() {
+    var selectedID = this._availableLanguages.selectedItem.id;
+    var preference = Preferences.get("intl.accept_languages");
+    var arrayOfPrefs = preference.value.toLowerCase().split(/\s*,\s*/);
+    for (var i = 0; i < arrayOfPrefs.length; ++i) {
+      if (arrayOfPrefs[i] == selectedID) {
+        return;
+      }
+    }
+
+    this._selectedItemID = selectedID;
+
+    if (preference.value == "") {
+      preference.value = selectedID;
+    } else {
+      arrayOfPrefs.unshift(selectedID);
+      preference.value = arrayOfPrefs.join(",");
+    }
+
+    this._acceptLanguages[selectedID] = true;
+    this._availableLanguages.selectedItem = null;
+
+    // Rebuild the available list with the added item removed...
+    this._buildAvailableLanguageList().catch(console.error);
+  },
+
+  removeLanguage() {
+    // Build the new preference value string.
+    var languagesArray = [];
+    for (var i = 0; i < this._activeLanguages.childNodes.length; ++i) {
+      var item = this._activeLanguages.childNodes[i];
+      if (!item.selected) {
+        languagesArray.push(item.id);
+      } else {
+        this._acceptLanguages[item.id] = false;
+      }
+    }
+    var string = languagesArray.join(",");
+
+    // Get the item to select after the remove operation completes.
+    var selection = this._activeLanguages.selectedItems;
+    var lastSelected = selection[selection.length - 1];
+    var selectItem = lastSelected.nextSibling || lastSelected.previousSibling;
+    selectItem = selectItem ? selectItem.id : null;
+
+    this._selectedItemID = selectItem;
+
+    // Update the preference and force a UI rebuild
+    var preference = Preferences.get("intl.accept_languages");
+    preference.value = string;
+
+    this._buildAvailableLanguageList().catch(console.error);
+  },
+
+  _getLocaleName(localeCode) {
+    if (!this._availableLanguagesList.length) {
+      this._loadAvailableLanguages();
+    }
+    let languageName = "";
+    for (var i = 0; i < this._availableLanguagesList.length; ++i) {
+      if (localeCode == this._availableLanguagesList[i].code) {
+        return this._availableLanguagesList[i].name;
+      }
+      // Try resolving the locale code without region code. Can't return
+      // directly because there might be a perfect match later.
+      if (localeCode.split("-")[0] == this._availableLanguagesList[i].code) {
+        languageName = this._availableLanguagesList[i].name;
+      }
+    }
+
+    return languageName;
+  },
+
+  moveUp() {
+    var selectedItem = this._activeLanguages.selectedItems[0];
+    var previousItem = selectedItem.previousSibling;
+
+    var string = "";
+    for (var i = 0; i < this._activeLanguages.childNodes.length; ++i) {
+      var item = this._activeLanguages.childNodes[i];
+      string += i == 0 ? "" : ",";
+      if (item.id == previousItem.id) {
+        string += selectedItem.id;
+      } else if (item.id == selectedItem.id) {
+        string += previousItem.id;
+      } else {
+        string += item.id;
+      }
+    }
+
+    this._selectedItemID = selectedItem.id;
+
+    // Update the preference and force a UI rebuild
+    var preference = Preferences.get("intl.accept_languages");
+    preference.value = string;
+  },
+
+  moveDown() {
+    var selectedItem = this._activeLanguages.selectedItems[0];
+    var nextItem = selectedItem.nextSibling;
+
+    var string = "";
+    for (var i = 0; i < this._activeLanguages.childNodes.length; ++i) {
+      var item = this._activeLanguages.childNodes[i];
+      string += i == 0 ? "" : ",";
+      if (item.id == nextItem.id) {
+        string += selectedItem.id;
+      } else if (item.id == selectedItem.id) {
+        string += nextItem.id;
+      } else {
+        string += item.id;
+      }
+    }
+
+    this._selectedItemID = selectedItem.id;
+
+    // Update the preference and force a UI rebuild
+    var preference = Preferences.get("intl.accept_languages");
+    preference.value = string;
+  },
+
+  onLanguageSelect() {
+    var upButton = document.getElementById("up");
+    var downButton = document.getElementById("down");
+    var removeButton = document.getElementById("remove");
+    switch (this._activeLanguages.selectedCount) {
+      case 0:
+        upButton.disabled = downButton.disabled = removeButton.disabled = true;
+        break;
+      case 1:
+        upButton.disabled = this._activeLanguages.selectedIndex == 0;
+        downButton.disabled =
+          this._activeLanguages.selectedIndex ==
+          this._activeLanguages.childNodes.length - 1;
+        removeButton.disabled = false;
+        break;
+      default:
+        upButton.disabled = true;
+        downButton.disabled = true;
+        removeButton.disabled = false;
+    }
+  },
+
+  readSpoofEnglish() {
+    var checkbox = document.getElementById("spoofEnglish");
+    var resistFingerprinting = Services.prefs.getBoolPref(
+      "privacy.resistFingerprinting"
+    );
+    if (!resistFingerprinting) {
+      checkbox.hidden = true;
+      return false;
+    }
+
+    var spoofEnglish = Preferences.get("privacy.spoof_english").value;
+    var activeLanguages = this._activeLanguages;
+    var availableLanguages = this._availableLanguages;
+    checkbox.hidden = false;
+    switch (spoofEnglish) {
+      case 1: // don't spoof intl.accept_languages
+        activeLanguages.disabled = false;
+        activeLanguages.selectItem(activeLanguages.firstChild);
+        availableLanguages.disabled = false;
+        this.onAvailableLanguageSelect();
+        return false;
+      case 2: // spoof intl.accept_languages
+        activeLanguages.clearSelection();
+        activeLanguages.disabled = true;
+        availableLanguages.disabled = true;
+        this.onAvailableLanguageSelect();
+        return true;
+      default:
+        // will prompt for spoofing intl.accept_languages if resisting fingerprinting
+        return false;
+    }
+  },
+
+  writeSpoofEnglish() {
+    return document.getElementById("spoofEnglish").checked ? 2 : 1;
+  },
+};
diff --git a/browser/components/preferences/dialogs/languages.xhtml b/browser/components/preferences/dialogs/languages.xhtml
new file mode 100644
index 0000000000..67717253a7
--- /dev/null
+++ b/browser/components/preferences/dialogs/languages.xhtml
@@ -0,0 +1,107 @@
+<?xml version="1.0"?>
+
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+
+<window
+  type="child"
+  xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+  xmlns:html="http://www.w3.org/1999/xhtml"
+  data-l10n-id="webpage-languages-window2"
+  data-l10n-attrs="title, style"
+  persist="lastSelected"
+  onload="gLanguagesDialog.onLoad();"
+>
+  <dialog
+    id="LanguagesDialog"
+    buttons="accept,cancel,help"
+    helpTopic="prefs-languages"
+  >
+    <linkset>
+      <html:link rel="stylesheet" href="chrome://global/skin/global.css" />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/skin/preferences/preferences.css"
+      />
+
+      <html:link rel="localization" href="browser/preferences/languages.ftl" />
+    </linkset>
+
+    <script src="chrome://browser/content/utilityOverlay.js" />
+    <script src="chrome://global/content/preferencesBindings.js" />
+    <script src="chrome://browser/content/preferences/dialogs/languages.js" />
+
+    <keyset>
+      <key
+        data-l10n-id="languages-close-key"
+        modifiers="accel"
+        oncommand="Preferences.close(event)"
+      />
+    </keyset>
+
+    <stringbundleset id="languageSet">
+      <stringbundle
+        id="bundleAccepted"
+        src="resource://gre/res/language.properties"
+      />
+    </stringbundleset>
+
+    <description data-l10n-id="languages-description" />
+    <checkbox
+      id="spoofEnglish"
+      data-l10n-id="languages-customize-spoof-english"
+      preference="privacy.spoof_english"
+    />
+    <box class="languages-grid">
+      <richlistbox
+        id="activeLanguages"
+        seltype="multiple"
+        onselect="gLanguagesDialog.onLanguageSelect();"
+      />
+      <vbox>
+        <button
+          id="up"
+          class="up"
+          oncommand="gLanguagesDialog.moveUp();"
+          disabled="true"
+          data-l10n-id="languages-customize-moveup"
+          preference="pref.browser.language.disable_button.up"
+        />
+        <button
+          id="down"
+          class="down"
+          oncommand="gLanguagesDialog.moveDown();"
+          disabled="true"
+          data-l10n-id="languages-customize-movedown"
+          preference="pref.browser.language.disable_button.down"
+        />
+        <button
+          id="remove"
+          oncommand="gLanguagesDialog.removeLanguage();"
+          disabled="true"
+          data-l10n-id="languages-customize-remove"
+          preference="pref.browser.language.disable_button.remove"
+        />
+      </vbox>
+      <!-- This <vbox> is needed to position search tooltips correctly. -->
+      <vbox>
+        <menulist
+          id="availableLanguages"
+          oncommand="gLanguagesDialog.onAvailableLanguageSelect();"
+          data-l10n-id="languages-customize-select-language"
+          data-l10n-attrs="placeholder"
+        >
+          <menupopup id="availableLanguagesPopup" />
+        </menulist>
+      </vbox>
+      <button
+        id="addButton"
+        class="add-web-language"
+        oncommand="gLanguagesDialog.addLanguage();"
+        disabled="true"
+        data-l10n-id="languages-customize-add"
+      />
+    </box>
+  </dialog>
+</window>
diff --git a/browser/components/preferences/dialogs/moz.build b/browser/components/preferences/dialogs/moz.build
new file mode 100644
index 0000000000..603c560505
--- /dev/null
+++ b/browser/components/preferences/dialogs/moz.build
@@ -0,0 +1,13 @@
+# -*- Mode: python; indent-tabs-mode: nil; tab-width: 40 -*-
+# vim: set filetype=python:
+# This Source Code Form is subject to the terms of the Mozilla Public
+# License, v. 2.0. If a copy of the MPL was not distributed with this
+# file, You can obtain one at http://mozilla.org/MPL/2.0/.
+
+for var in ("MOZ_APP_NAME", "MOZ_MACBUNDLE_NAME"):
+    DEFINES[var] = CONFIG[var]
+
+if CONFIG["MOZ_WIDGET_TOOLKIT"] in ("windows", "gtk", "cocoa"):
+    DEFINES["HAVE_SHELL_SERVICE"] = 1
+
+JAR_MANIFESTS += ["jar.mn"]
diff --git a/browser/components/preferences/dialogs/permissions.js b/browser/components/preferences/dialogs/permissions.js
new file mode 100644
index 0000000000..32ebeae128
--- /dev/null
+++ b/browser/components/preferences/dialogs/permissions.js
@@ -0,0 +1,673 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+var { AppConstants } = ChromeUtils.importESModule(
+  "resource://gre/modules/AppConstants.sys.mjs"
+);
+
+var { XPCOMUtils } = ChromeUtils.importESModule(
+  "resource://gre/modules/XPCOMUtils.sys.mjs"
+);
+
+const lazy = {};
+
+XPCOMUtils.defineLazyServiceGetter(
+  lazy,
+  "contentBlockingAllowList",
+  "@mozilla.org/content-blocking-allow-list;1",
+  "nsIContentBlockingAllowList"
+);
+
+const permissionExceptionsL10n = {
+  trackingprotection: {
+    window: "permissions-exceptions-etp-window2",
+    description: "permissions-exceptions-manage-etp-desc",
+  },
+  cookie: {
+    window: "permissions-exceptions-cookie-window2",
+    description: "permissions-exceptions-cookie-desc",
+  },
+  popup: {
+    window: "permissions-exceptions-popup-window2",
+    description: "permissions-exceptions-popup-desc",
+  },
+  "login-saving": {
+    window: "permissions-exceptions-saved-passwords-window",
+    description: "permissions-exceptions-saved-passwords-desc",
+  },
+  "https-only-load-insecure": {
+    window: "permissions-exceptions-https-only-window2",
+    description: "permissions-exceptions-https-only-desc2",
+  },
+  install: {
+    window: "permissions-exceptions-addons-window2",
+    description: "permissions-exceptions-addons-desc",
+  },
+};
+
+function Permission(principal, type, capability) {
+  this.principal = principal;
+  this.origin = principal.origin;
+  this.type = type;
+  this.capability = capability;
+}
+
+var gPermissionManager = {
+  _type: "",
+  _isObserving: false,
+  _permissions: new Map(),
+  _permissionsToAdd: new Map(),
+  _permissionsToDelete: new Map(),
+  _bundle: null,
+  _list: null,
+  _removeButton: null,
+  _removeAllButton: null,
+  _forcedHTTP: null,
+
+  onLoad() {
+    let params = window.arguments[0];
+    document.mozSubdialogReady = this.init(params);
+  },
+
+  /**
+   * @param {Object} params
+   * @param {string} params.permissionType Permission type for which the dialog should be shown
+   * @param {string} params.prefilledHost The value which the URL field should initially contain
+   * @param {boolean} params.blockVisible Display the "Block" button in the dialog
+   * @param {boolean} params.sessionVisible Display the "Allow for Session" button in the dialog (Only for Cookie & HTTPS-Only permissions)
+   * @param {boolean} params.allowVisible Display the "Allow" button in the dialog
+   * @param {boolean} params.disableETPVisible Display the "Add Exception" button in the dialog (Only for ETP permissions)
+   * @param {boolean} params.hideStatusColumn Hide the "Status" column in the dialog
+   * @param {boolean} params.forcedHTTP Save inputs whose URI has a HTTPS scheme with a HTTP scheme (Used by HTTPS-Only)
+   */
+  async init(params) {
+    if (!this._isObserving) {
+      Services.obs.addObserver(this, "perm-changed");
+      this._isObserving = true;
+    }
+
+    document.addEventListener("dialogaccept", () => this.onApplyChanges());
+
+    this._type = params.permissionType;
+    this._list = document.getElementById("permissionsBox");
+    this._removeButton = document.getElementById("removePermission");
+    this._removeAllButton = document.getElementById("removeAllPermissions");
+
+    this._btnCookieSession = document.getElementById("btnCookieSession");
+    this._btnBlock = document.getElementById("btnBlock");
+    this._btnDisableETP = document.getElementById("btnDisableETP");
+    this._btnAllow = document.getElementById("btnAllow");
+    this._btnHttpsOnlyOff = document.getElementById("btnHttpsOnlyOff");
+    this._btnHttpsOnlyOffTmp = document.getElementById("btnHttpsOnlyOffTmp");
+
+    let permissionsText = document.getElementById("permissionsText");
+
+    let l10n = permissionExceptionsL10n[this._type];
+    document.l10n.setAttributes(permissionsText, l10n.description);
+    document.l10n.setAttributes(document.documentElement, l10n.window);
+
+    let urlFieldVisible =
+      params.blockVisible ||
+      params.sessionVisible ||
+      params.allowVisible ||
+      params.disableETPVisible;
+
+    this._urlField = document.getElementById("url");
+    this._urlField.value = params.prefilledHost;
+    this._urlField.hidden = !urlFieldVisible;
+
+    this._forcedHTTP = params.forcedHTTP;
+
+    await document.l10n.translateElements([
+      permissionsText,
+      document.documentElement,
+    ]);
+
+    document.getElementById("btnDisableETP").hidden = !params.disableETPVisible;
+    document.getElementById("btnBlock").hidden = !params.blockVisible;
+    document.getElementById("btnCookieSession").hidden = !(
+      params.sessionVisible && this._type == "cookie"
+    );
+    document.getElementById("btnHttpsOnlyOff").hidden = !(
+      this._type == "https-only-load-insecure"
+    );
+    document.getElementById("btnHttpsOnlyOffTmp").hidden = !(
+      params.sessionVisible && this._type == "https-only-load-insecure"
+    );
+    document.getElementById("btnAllow").hidden = !params.allowVisible;
+
+    this.onHostInput(this._urlField);
+
+    let urlLabel = document.getElementById("urlLabel");
+    urlLabel.hidden = !urlFieldVisible;
+
+    this._hideStatusColumn = params.hideStatusColumn;
+    let statusCol = document.getElementById("statusCol");
+    statusCol.hidden = this._hideStatusColumn;
+    if (this._hideStatusColumn) {
+      statusCol.removeAttribute("data-isCurrentSortCol");
+      document
+        .getElementById("siteCol")
+        .setAttribute("data-isCurrentSortCol", "true");
+    }
+
+    Services.obs.notifyObservers(null, "flush-pending-permissions", this._type);
+
+    this._loadPermissions();
+    this.buildPermissionsList();
+
+    this._urlField.focus();
+  },
+
+  uninit() {
+    if (this._isObserving) {
+      Services.obs.removeObserver(this, "perm-changed");
+      this._isObserving = false;
+    }
+  },
+
+  observe(subject, topic, data) {
+    if (topic !== "perm-changed") {
+      return;
+    }
+
+    let permission = subject.QueryInterface(Ci.nsIPermission);
+
+    // Ignore unrelated permission types.
+    if (permission.type !== this._type) {
+      return;
+    }
+
+    if (data == "added") {
+      this._addPermissionToList(permission);
+      this.buildPermissionsList();
+    } else if (data == "changed") {
+      let p = this._permissions.get(permission.principal.origin);
+      // Maybe this item has been excluded before because it had an invalid capability.
+      if (p) {
+        p.capability = permission.capability;
+        this._handleCapabilityChange(p);
+      } else {
+        this._addPermissionToList(permission);
+      }
+      this.buildPermissionsList();
+    } else if (data == "deleted") {
+      this._removePermissionFromList(permission.principal.origin);
+    }
+  },
+
+  _handleCapabilityChange(perm) {
+    let permissionlistitem = document.getElementsByAttribute(
+      "origin",
+      perm.origin
+    )[0];
+    document.l10n.setAttributes(
+      permissionlistitem.querySelector(".website-capability-value"),
+      this._getCapabilityL10nId(perm.capability)
+    );
+  },
+
+  _isCapabilitySupported(capability) {
+    return (
+      capability == Ci.nsIPermissionManager.ALLOW_ACTION ||
+      capability == Ci.nsIPermissionManager.DENY_ACTION ||
+      capability == Ci.nsICookiePermission.ACCESS_SESSION ||
+      // Bug 1753600 there are still a few legacy cookies around that have the capability 9,
+      // _getCapabilityL10nId will throw if it receives a capability of 9
+      // that is not in combination with the type https-only-load-insecure
+      (capability ==
+        Ci.nsIHttpsOnlyModePermission.LOAD_INSECURE_ALLOW_SESSION &&
+        this._type == "https-only-load-insecure")
+    );
+  },
+
+  _getCapabilityL10nId(capability) {
+    // HTTPS-Only Mode phrases exceptions as turning it off
+    if (this._type == "https-only-load-insecure") {
+      return this._getHttpsOnlyCapabilityL10nId(capability);
+    }
+
+    switch (capability) {
+      case Ci.nsIPermissionManager.ALLOW_ACTION:
+        return "permissions-capabilities-listitem-allow";
+      case Ci.nsIPermissionManager.DENY_ACTION:
+        return "permissions-capabilities-listitem-block";
+      case Ci.nsICookiePermission.ACCESS_SESSION:
+        return "permissions-capabilities-listitem-allow-session";
+      default:
+        throw new Error(`Unknown capability: ${capability}`);
+    }
+  },
+
+  _getHttpsOnlyCapabilityL10nId(capability) {
+    switch (capability) {
+      case Ci.nsIPermissionManager.ALLOW_ACTION:
+        return "permissions-capabilities-listitem-off";
+      case Ci.nsIHttpsOnlyModePermission.LOAD_INSECURE_ALLOW_SESSION:
+        return "permissions-capabilities-listitem-off-temporarily";
+      default:
+        throw new Error(`Unknown HTTPS-Only Mode capability: ${capability}`);
+    }
+  },
+
+  _addPermissionToList(perm) {
+    if (perm.type !== this._type) {
+      return;
+    }
+    if (!this._isCapabilitySupported(perm.capability)) {
+      return;
+    }
+
+    // Skip private browsing session permissions.
+    if (
+      perm.principal.privateBrowsingId !==
+        Services.scriptSecurityManager.DEFAULT_PRIVATE_BROWSING_ID &&
+      perm.expireType === Services.perms.EXPIRE_SESSION
+    ) {
+      return;
+    }
+
+    let p = new Permission(perm.principal, perm.type, perm.capability);
+    this._permissions.set(p.origin, p);
+  },
+
+  _addOrModifyPermission(principal, capability) {
+    // check whether the permission already exists, if not, add it
+    let permissionParams = { principal, type: this._type, capability };
+    let existingPermission = this._permissions.get(principal.origin);
+    if (!existingPermission) {
+      this._permissionsToAdd.set(principal.origin, permissionParams);
+      this._addPermissionToList(permissionParams);
+      this.buildPermissionsList();
+    } else if (existingPermission.capability != capability) {
+      existingPermission.capability = capability;
+      this._permissionsToAdd.set(principal.origin, permissionParams);
+      this._handleCapabilityChange(existingPermission);
+    }
+  },
+
+  _addNewPrincipalToList(list, uri) {
+    list.push(Services.scriptSecurityManager.createContentPrincipal(uri, {}));
+    // If we have ended up with an unknown scheme, the following will throw.
+    list[list.length - 1].origin;
+  },
+
+  addPermission(capability) {
+    let textbox = document.getElementById("url");
+    let input_url = textbox.value.trim(); // trim any leading and trailing space
+    let principals = [];
+    try {
+      // The origin accessor on the principal object will throw if the
+      // principal doesn't have a canonical origin representation. This will
+      // help catch cases where the URI parser parsed something like
+      // `localhost:8080` as having the scheme `localhost`, rather than being
+      // an invalid URI. A canonical origin representation is required by the
+      // permission manager for storage, so this won't prevent any valid
+      // permissions from being entered by the user.
+      try {
+        let uri = Services.io.newURI(input_url);
+        if (this._forcedHTTP && uri.schemeIs("https")) {
+          uri = uri.mutate().setScheme("http").finalize();
+        }
+        let principal = Services.scriptSecurityManager.createContentPrincipal(
+          uri,
+          {}
+        );
+        if (principal.origin.startsWith("moz-nullprincipal:")) {
+          throw new Error("Null principal");
+        }
+        principals.push(principal);
+      } catch (ex) {
+        // If the `input_url` already starts with http:// or https://, it is
+        // definetely invalid here and can't be fixed by prefixing it with
+        // http:// or https://.
+        if (
+          input_url.startsWith("http://") ||
+          input_url.startsWith("https://")
+        ) {
+          throw ex;
+        }
+        this._addNewPrincipalToList(
+          principals,
+          Services.io.newURI("http://" + input_url)
+        );
+        if (!this._forcedHTTP) {
+          this._addNewPrincipalToList(
+            principals,
+            Services.io.newURI("https://" + input_url)
+          );
+        }
+      }
+    } catch (ex) {
+      document.l10n
+        .formatValues([
+          { id: "permissions-invalid-uri-title" },
+          { id: "permissions-invalid-uri-label" },
+        ])
+        .then(([title, message]) => {
+          Services.prompt.alert(window, title, message);
+        });
+      return;
+    }
+    // In case of an ETP exception we compute the contentBlockingAllowList principal
+    // to align with the allow list behavior triggered by the protections panel
+    if (this._type == "trackingprotection") {
+      principals = principals.map(
+        lazy.contentBlockingAllowList.computeContentBlockingAllowListPrincipal
+      );
+    }
+    for (let principal of principals) {
+      this._addOrModifyPermission(principal, capability);
+    }
+
+    textbox.value = "";
+    textbox.focus();
+
+    // covers a case where the site exists already, so the buttons don't disable
+    this.onHostInput(textbox);
+
+    // enable "remove all" button as needed
+    this._setRemoveButtonState();
+  },
+
+  _removePermission(permission) {
+    this._removePermissionFromList(permission.origin);
+
+    // If this permission was added during this session, let's remove
+    // it from the pending adds list to prevent calls to the
+    // permission manager.
+    let isNewPermission = this._permissionsToAdd.delete(permission.origin);
+    if (!isNewPermission) {
+      this._permissionsToDelete.set(permission.origin, permission);
+    }
+  },
+
+  _removePermissionFromList(origin) {
+    this._permissions.delete(origin);
+    let permissionlistitem = document.getElementsByAttribute(
+      "origin",
+      origin
+    )[0];
+    if (permissionlistitem) {
+      permissionlistitem.remove();
+    }
+  },
+
+  _loadPermissions() {
+    // load permissions into a table.
+    for (let nextPermission of Services.perms.all) {
+      this._addPermissionToList(nextPermission);
+    }
+  },
+
+  _createPermissionListItem(permission) {
+    let disabledByPolicy = this._permissionDisabledByPolicy(permission);
+    let richlistitem = document.createXULElement("richlistitem");
+    richlistitem.setAttribute("origin", permission.origin);
+    let row = document.createXULElement("hbox");
+    row.setAttribute("style", "flex: 1");
+
+    let hbox = document.createXULElement("hbox");
+    let website = document.createXULElement("label");
+    website.setAttribute("disabled", disabledByPolicy);
+    website.setAttribute("class", "website-name-value");
+    website.setAttribute("value", permission.origin);
+    hbox.setAttribute("class", "website-name");
+    hbox.setAttribute("style", "flex: 3 3; width: 0");
+    hbox.appendChild(website);
+    row.appendChild(hbox);
+
+    if (!this._hideStatusColumn) {
+      hbox = document.createXULElement("hbox");
+      let capability = document.createXULElement("label");
+      capability.setAttribute("disabled", disabledByPolicy);
+      capability.setAttribute("class", "website-capability-value");
+      document.l10n.setAttributes(
+        capability,
+        this._getCapabilityL10nId(permission.capability)
+      );
+      hbox.setAttribute("class", "website-name");
+      hbox.setAttribute("style", "flex: 1; width: 0");
+      hbox.appendChild(capability);
+      row.appendChild(hbox);
+    }
+
+    richlistitem.appendChild(row);
+    return richlistitem;
+  },
+
+  onWindowKeyPress(event) {
+    // Prevent dialog.js from closing the dialog when the user submits the input
+    // field via the return key.
+    if (
+      event.keyCode == KeyEvent.DOM_VK_RETURN &&
+      document.activeElement == this._urlField
+    ) {
+      event.preventDefault();
+    }
+  },
+
+  onPermissionKeyPress(event) {
+    if (!this._list.selectedItem) {
+      return;
+    }
+
+    if (
+      event.keyCode == KeyEvent.DOM_VK_DELETE ||
+      (AppConstants.platform == "macosx" &&
+        event.keyCode == KeyEvent.DOM_VK_BACK_SPACE)
+    ) {
+      this.onPermissionDelete();
+      event.preventDefault();
+    }
+  },
+
+  onHostKeyPress(event) {
+    if (event.keyCode == KeyEvent.DOM_VK_RETURN) {
+      if (!document.getElementById("btnAllow").hidden) {
+        document.getElementById("btnAllow").click();
+      } else if (!document.getElementById("btnBlock").hidden) {
+        document.getElementById("btnBlock").click();
+      } else if (!document.getElementById("btnHttpsOnlyOff").hidden) {
+        document.getElementById("btnHttpsOnlyOff").click();
+      } else if (!document.getElementById("btnDisableETP").hidden) {
+        document.getElementById("btnDisableETP").click();
+      }
+    }
+  },
+
+  onHostInput(siteField) {
+    this._btnCookieSession.disabled =
+      this._btnCookieSession.hidden || !siteField.value;
+    this._btnHttpsOnlyOff.disabled =
+      this._btnHttpsOnlyOff.hidden || !siteField.value;
+    this._btnHttpsOnlyOffTmp.disabled =
+      this._btnHttpsOnlyOffTmp.hidden || !siteField.value;
+    this._btnBlock.disabled = this._btnBlock.hidden || !siteField.value;
+    this._btnDisableETP.disabled =
+      this._btnDisableETP.hidden || !siteField.value;
+    this._btnAllow.disabled = this._btnAllow.hidden || !siteField.value;
+  },
+
+  _setRemoveButtonState() {
+    if (!this._list) {
+      return;
+    }
+
+    let hasSelection = this._list.selectedIndex >= 0;
+
+    let disabledByPolicy = false;
+    if (Services.policies.status === Services.policies.ACTIVE && hasSelection) {
+      let origin = this._list.selectedItem.getAttribute("origin");
+      disabledByPolicy = this._permissionDisabledByPolicy(
+        this._permissions.get(origin)
+      );
+    }
+
+    this._removeButton.disabled = !hasSelection || disabledByPolicy;
+    let disabledItems = this._list.querySelectorAll(
+      "label.website-name-value[disabled='true']"
+    );
+
+    this._removeAllButton.disabled =
+      this._list.itemCount == disabledItems.length;
+  },
+
+  onPermissionDelete() {
+    let richlistitem = this._list.selectedItem;
+    let origin = richlistitem.getAttribute("origin");
+    let permission = this._permissions.get(origin);
+    if (this._permissionDisabledByPolicy(permission)) {
+      return;
+    }
+
+    this._removePermission(permission);
+
+    this._setRemoveButtonState();
+  },
+
+  onAllPermissionsDelete() {
+    for (let permission of this._permissions.values()) {
+      if (this._permissionDisabledByPolicy(permission)) {
+        continue;
+      }
+      this._removePermission(permission);
+    }
+
+    this._setRemoveButtonState();
+  },
+
+  onPermissionSelect() {
+    this._setRemoveButtonState();
+  },
+
+  onApplyChanges() {
+    // Stop observing permission changes since we are about
+    // to write out the pending adds/deletes and don't need
+    // to update the UI
+    this.uninit();
+
+    for (let p of this._permissionsToDelete.values()) {
+      Services.perms.removeFromPrincipal(p.principal, p.type);
+    }
+
+    for (let p of this._permissionsToAdd.values()) {
+      // If this sets the HTTPS-Only exemption only for this
+      // session, then the expire-type has to be set.
+      if (
+        p.capability ==
+        Ci.nsIHttpsOnlyModePermission.LOAD_INSECURE_ALLOW_SESSION
+      ) {
+        Services.perms.addFromPrincipal(
+          p.principal,
+          p.type,
+          p.capability,
+          Ci.nsIPermissionManager.EXPIRE_SESSION
+        );
+      } else {
+        Services.perms.addFromPrincipal(p.principal, p.type, p.capability);
+      }
+    }
+  },
+
+  buildPermissionsList(sortCol) {
+    // Clear old entries.
+    let oldItems = this._list.querySelectorAll("richlistitem");
+    for (let item of oldItems) {
+      item.remove();
+    }
+    let frag = document.createDocumentFragment();
+
+    let permissions = Array.from(this._permissions.values());
+
+    for (let permission of permissions) {
+      let richlistitem = this._createPermissionListItem(permission);
+      frag.appendChild(richlistitem);
+    }
+
+    // Sort permissions.
+    this._sortPermissions(this._list, frag, sortCol);
+
+    this._list.appendChild(frag);
+
+    this._setRemoveButtonState();
+  },
+
+  _permissionDisabledByPolicy(permission) {
+    let permissionObject = Services.perms.getPermissionObject(
+      permission.principal,
+      this._type,
+      false
+    );
+    return (
+      permissionObject?.expireType == Ci.nsIPermissionManager.EXPIRE_POLICY
+    );
+  },
+
+  _sortPermissions(list, frag, column) {
+    let sortDirection;
+
+    if (!column) {
+      column = document.querySelector("treecol[data-isCurrentSortCol=true]");
+      sortDirection =
+        column.getAttribute("data-last-sortDirection") || "ascending";
+    } else {
+      sortDirection = column.getAttribute("data-last-sortDirection");
+      sortDirection =
+        sortDirection === "ascending" ? "descending" : "ascending";
+    }
+
+    let sortFunc = null;
+    switch (column.id) {
+      case "siteCol":
+        sortFunc = (a, b) => {
+          return comp.compare(
+            a.getAttribute("origin"),
+            b.getAttribute("origin")
+          );
+        };
+        break;
+
+      case "statusCol":
+        sortFunc = (a, b) => {
+          // The capabilities values ("Allow" and "Block") are localized asynchronously.
+          // Sort based on the guaranteed-present localization ID instead, note that the
+          // ascending/descending arrow may be pointing the wrong way.
+          return (
+            a
+              .querySelector(".website-capability-value")
+              .getAttribute("data-l10n-id") >
+            b
+              .querySelector(".website-capability-value")
+              .getAttribute("data-l10n-id")
+          );
+        };
+        break;
+    }
+
+    let comp = new Services.intl.Collator(undefined, {
+      usage: "sort",
+    });
+
+    let items = Array.from(frag.querySelectorAll("richlistitem"));
+
+    if (sortDirection === "descending") {
+      items.sort((a, b) => sortFunc(b, a));
+    } else {
+      items.sort(sortFunc);
+    }
+
+    // Re-append items in the correct order:
+    items.forEach(item => frag.appendChild(item));
+
+    let cols = list.previousElementSibling.querySelectorAll("treecol");
+    cols.forEach(c => {
+      c.removeAttribute("data-isCurrentSortCol");
+      c.removeAttribute("sortDirection");
+    });
+    column.setAttribute("data-isCurrentSortCol", "true");
+    column.setAttribute("sortDirection", sortDirection);
+    column.setAttribute("data-last-sortDirection", sortDirection);
+  },
+};
diff --git a/browser/components/preferences/dialogs/permissions.xhtml b/browser/components/preferences/dialogs/permissions.xhtml
new file mode 100644
index 0000000000..78c2461e2d
--- /dev/null
+++ b/browser/components/preferences/dialogs/permissions.xhtml
@@ -0,0 +1,140 @@
+<?xml version="1.0"?>
+
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+
+<window
+  id="PermissionsDialog"
+  xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+  xmlns:html="http://www.w3.org/1999/xhtml"
+  data-l10n-id="permissions-window2"
+  data-l10n-attrs="title, style"
+  onload="gPermissionManager.onLoad();"
+  onunload="gPermissionManager.uninit();"
+  persist="width height"
+  onkeypress="gPermissionManager.onWindowKeyPress(event);"
+>
+  <dialog
+    buttons="accept,cancel"
+    data-l10n-id="permission-dialog"
+    data-l10n-attrs="buttonlabelaccept, buttonaccesskeyaccept"
+  >
+    <linkset>
+      <html:link rel="stylesheet" href="chrome://global/skin/global.css" />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/content/preferences/dialogs/sitePermissions.css"
+      />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/skin/preferences/preferences.css"
+      />
+
+      <html:link rel="localization" href="branding/brand.ftl" />
+      <html:link
+        rel="localization"
+        href="browser/preferences/permissions.ftl"
+      />
+    </linkset>
+
+    <script src="chrome://browser/content/preferences/dialogs/permissions.js" />
+
+    <keyset>
+      <key
+        data-l10n-id="permissions-close-key"
+        modifiers="accel"
+        oncommand="window.close();"
+      />
+    </keyset>
+
+    <vbox class="contentPane">
+      <description id="permissionsText" control="url" />
+      <separator class="thin" />
+      <label id="urlLabel" control="url" data-l10n-id="permissions-address" />
+      <hbox align="start">
+        <html:input
+          id="url"
+          type="text"
+          style="flex: 1"
+          oninput="gPermissionManager.onHostInput(event.target);"
+          onkeypress="gPermissionManager.onHostKeyPress(event);"
+        />
+      </hbox>
+      <hbox pack="end">
+        <button
+          id="btnDisableETP"
+          disabled="true"
+          data-l10n-id="permissions-disable-etp"
+          oncommand="gPermissionManager.addPermission(Ci.nsIPermissionManager.ALLOW_ACTION);"
+        />
+        <button
+          id="btnBlock"
+          disabled="true"
+          data-l10n-id="permissions-block"
+          oncommand="gPermissionManager.addPermission(Ci.nsIPermissionManager.DENY_ACTION);"
+        />
+        <button
+          id="btnCookieSession"
+          disabled="true"
+          data-l10n-id="permissions-session"
+          oncommand="gPermissionManager.addPermission(Ci.nsICookiePermission.ACCESS_SESSION);"
+        />
+        <button
+          id="btnAllow"
+          disabled="true"
+          data-l10n-id="permissions-allow"
+          oncommand="gPermissionManager.addPermission(Ci.nsIPermissionManager.ALLOW_ACTION);"
+        />
+        <button
+          id="btnHttpsOnlyOff"
+          disabled="true"
+          data-l10n-id="permissions-button-off"
+          oncommand="gPermissionManager.addPermission(Ci.nsIPermissionManager.ALLOW_ACTION);"
+        />
+        <button
+          id="btnHttpsOnlyOffTmp"
+          disabled="true"
+          data-l10n-id="permissions-button-off-temporarily"
+          oncommand="gPermissionManager.addPermission(Ci.nsIHttpsOnlyModePermission.LOAD_INSECURE_ALLOW_SESSION);"
+        />
+      </hbox>
+      <separator class="thin" />
+      <listheader>
+        <treecol
+          id="siteCol"
+          data-l10n-id="permissions-site-name"
+          style="flex: 3 3 auto; width: 0"
+          onclick="gPermissionManager.buildPermissionsList(event.target)"
+        />
+        <treecol
+          id="statusCol"
+          data-l10n-id="permissions-status"
+          style="flex: 1 1 auto; width: 0"
+          data-isCurrentSortCol="true"
+          onclick="gPermissionManager.buildPermissionsList(event.target);"
+        />
+      </listheader>
+      <richlistbox
+        id="permissionsBox"
+        selected="false"
+        onkeypress="gPermissionManager.onPermissionKeyPress(event);"
+        onselect="gPermissionManager.onPermissionSelect();"
+      />
+    </vbox>
+
+    <hbox class="actionButtons">
+      <button
+        id="removePermission"
+        disabled="true"
+        data-l10n-id="permissions-remove"
+        oncommand="gPermissionManager.onPermissionDelete();"
+      />
+      <button
+        id="removeAllPermissions"
+        data-l10n-id="permissions-remove-all"
+        oncommand="gPermissionManager.onAllPermissionsDelete();"
+      />
+    </hbox>
+  </dialog>
+</window>
diff --git a/browser/components/preferences/dialogs/sanitize.js b/browser/components/preferences/dialogs/sanitize.js
new file mode 100644
index 0000000000..37f818e011
--- /dev/null
+++ b/browser/components/preferences/dialogs/sanitize.js
@@ -0,0 +1,38 @@
+/* -*- indent-tabs-mode: nil; js-indent-level: 4 -*- */
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+/* import-globals-from /toolkit/content/preferencesBindings.js */
+
+document
+  .querySelector("dialog")
+  .addEventListener("dialoghelp", window.top.openPrefsHelp);
+
+Preferences.addAll([
+  { id: "privacy.clearOnShutdown.history", type: "bool" },
+  { id: "privacy.clearOnShutdown.formdata", type: "bool" },
+  { id: "privacy.clearOnShutdown.downloads", type: "bool" },
+  { id: "privacy.clearOnShutdown.cookies", type: "bool" },
+  { id: "privacy.clearOnShutdown.cache", type: "bool" },
+  { id: "privacy.clearOnShutdown.offlineApps", type: "bool" },
+  { id: "privacy.clearOnShutdown.sessions", type: "bool" },
+  { id: "privacy.clearOnShutdown.siteSettings", type: "bool" },
+]);
+
+var gSanitizeDialog = Object.freeze({
+  init() {
+    this.onClearHistoryChanged();
+
+    Preferences.get("privacy.clearOnShutdown.history").on(
+      "change",
+      this.onClearHistoryChanged.bind(this)
+    );
+  },
+
+  onClearHistoryChanged() {
+    let downloadsPref = Preferences.get("privacy.clearOnShutdown.downloads");
+    let historyPref = Preferences.get("privacy.clearOnShutdown.history");
+    downloadsPref.value = historyPref.value;
+  },
+});
diff --git a/browser/components/preferences/dialogs/sanitize.xhtml b/browser/components/preferences/dialogs/sanitize.xhtml
new file mode 100644
index 0000000000..cd2bea0649
--- /dev/null
+++ b/browser/components/preferences/dialogs/sanitize.xhtml
@@ -0,0 +1,94 @@
+<?xml version="1.0"?>
+
+<!-- -*- Mode: Java; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- -->
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+
+<!DOCTYPE window>
+
+<window
+  id="SanitizeDialog"
+  type="child"
+  xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+  xmlns:html="http://www.w3.org/1999/xhtml"
+  persist="lastSelected"
+  data-l10n-id="sanitize-prefs2"
+  data-l10n-attrs="style"
+  onload="gSanitizeDialog.init();"
+>
+  <dialog buttons="accept,cancel,help" helpTopic="prefs-clear-private-data">
+    <linkset>
+      <html:link rel="stylesheet" href="chrome://global/skin/global.css" />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/skin/preferences/preferences.css"
+      />
+
+      <html:link rel="localization" href="browser/sanitize.ftl" />
+      <html:link rel="localization" href="branding/brand.ftl" />
+    </linkset>
+
+    <script src="chrome://browser/content/utilityOverlay.js" />
+    <script src="chrome://global/content/preferencesBindings.js" />
+
+    <keyset>
+      <key
+        data-l10n-id="window-close"
+        modifiers="accel"
+        oncommand="Preferences.close(event)"
+      />
+    </keyset>
+
+    <script src="chrome://browser/content/preferences/dialogs/sanitize.js" />
+
+    <description data-l10n-id="clear-data-settings-label"></description>
+
+    <groupbox>
+      <label><html:h2 data-l10n-id="history-section-label" /></label>
+      <hbox>
+        <vbox data-l10n-id="sanitize-prefs-style" data-l10n-attrs="style">
+          <checkbox
+            data-l10n-id="item-history-and-downloads"
+            preference="privacy.clearOnShutdown.history"
+          />
+          <checkbox
+            data-l10n-id="item-active-logins"
+            preference="privacy.clearOnShutdown.sessions"
+          />
+          <checkbox
+            data-l10n-id="item-form-search-history"
+            preference="privacy.clearOnShutdown.formdata"
+          />
+        </vbox>
+        <vbox>
+          <checkbox
+            data-l10n-id="item-cookies"
+            preference="privacy.clearOnShutdown.cookies"
+          />
+          <checkbox
+            data-l10n-id="item-cache"
+            preference="privacy.clearOnShutdown.cache"
+          />
+        </vbox>
+      </hbox>
+    </groupbox>
+    <groupbox>
+      <label><html:h2 data-l10n-id="data-section-label" /></label>
+      <hbox>
+        <vbox data-l10n-id="sanitize-prefs-style" data-l10n-attrs="style">
+          <checkbox
+            data-l10n-id="item-site-settings"
+            preference="privacy.clearOnShutdown.siteSettings"
+          />
+        </vbox>
+        <vbox flex="1">
+          <checkbox
+            data-l10n-id="item-offline-apps"
+            preference="privacy.clearOnShutdown.offlineApps"
+          />
+        </vbox>
+      </hbox>
+    </groupbox>
+  </dialog>
+</window>
diff --git a/browser/components/preferences/dialogs/selectBookmark.js b/browser/components/preferences/dialogs/selectBookmark.js
new file mode 100644
index 0000000000..5fe4c645e7
--- /dev/null
+++ b/browser/components/preferences/dialogs/selectBookmark.js
@@ -0,0 +1,119 @@
+//* -*- indent-tabs-mode: nil; js-indent-level: 2 -*- */
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+/* Shared Places Import - change other consumers if you change this: */
+var { XPCOMUtils } = ChromeUtils.importESModule(
+  "resource://gre/modules/XPCOMUtils.sys.mjs"
+);
+
+ChromeUtils.defineESModuleGetters(this, {
+  PlacesTransactions: "resource://gre/modules/PlacesTransactions.sys.mjs",
+  PlacesUIUtils: "resource:///modules/PlacesUIUtils.sys.mjs",
+  PlacesUtils: "resource://gre/modules/PlacesUtils.sys.mjs",
+  PrivateBrowsingUtils: "resource://gre/modules/PrivateBrowsingUtils.sys.mjs",
+});
+
+XPCOMUtils.defineLazyScriptGetter(
+  this,
+  "PlacesTreeView",
+  "chrome://browser/content/places/treeView.js"
+);
+XPCOMUtils.defineLazyScriptGetter(
+  this,
+  ["PlacesInsertionPoint", "PlacesController", "PlacesControllerDragHelper"],
+  "chrome://browser/content/places/controller.js"
+);
+/* End Shared Places Import */
+
+/**
+ * SelectBookmarkDialog controls the user interface for the "Use Bookmark for
+ * Home Page" dialog.
+ *
+ * The caller (gMainPane.setHomePageToBookmark in main.js) invokes this dialog
+ * with a single argument - a reference to an object with a .urls property and
+ * a .names property.  This dialog is responsible for updating the contents of
+ * the .urls property with an array of URLs to use as home pages and for
+ * updating the .names property with an array of names for those URLs before it
+ * closes.
+ */
+var SelectBookmarkDialog = {
+  init: function SBD_init() {
+    document.getElementById("bookmarks").place =
+      "place:type=" + Ci.nsINavHistoryQueryOptions.RESULTS_AS_ROOTS_QUERY;
+
+    // Initial update of the OK button.
+    this.selectionChanged();
+    document.addEventListener("dialogaccept", function () {
+      SelectBookmarkDialog.accept();
+    });
+  },
+
+  /**
+   * Update the disabled state of the OK button as the user changes the
+   * selection within the view.
+   */
+  selectionChanged: function SBD_selectionChanged() {
+    var accept = document
+      .getElementById("selectBookmarkDialog")
+      .getButton("accept");
+    var bookmarks = document.getElementById("bookmarks");
+    var disableAcceptButton = true;
+    if (bookmarks.hasSelection) {
+      if (!PlacesUtils.nodeIsSeparator(bookmarks.selectedNode)) {
+        disableAcceptButton = false;
+      }
+    }
+    accept.disabled = disableAcceptButton;
+  },
+
+  onItemDblClick: function SBD_onItemDblClick() {
+    var bookmarks = document.getElementById("bookmarks");
+    var selectedNode = bookmarks.selectedNode;
+    if (selectedNode && PlacesUtils.nodeIsURI(selectedNode)) {
+      /**
+       * The user has double clicked on a tree row that is a link. Take this to
+       * mean that they want that link to be their homepage, and close the dialog.
+       */
+      document
+        .getElementById("selectBookmarkDialog")
+        .getButton("accept")
+        .click();
+    }
+  },
+
+  /**
+   * User accepts their selection. Set all the selected URLs or the contents
+   * of the selected folder as the list of homepages.
+   */
+  accept: function SBD_accept() {
+    var bookmarks = document.getElementById("bookmarks");
+    if (!bookmarks.hasSelection) {
+      throw new Error(
+        "Should not be able to accept dialog if there is no selected URL!"
+      );
+    }
+    var urls = [];
+    var names = [];
+    var selectedNode = bookmarks.selectedNode;
+    if (PlacesUtils.nodeIsFolder(selectedNode)) {
+      let concreteGuid = PlacesUtils.getConcreteItemGuid(selectedNode);
+      var contents = PlacesUtils.getFolderContents(concreteGuid).root;
+      var cc = contents.childCount;
+      for (var i = 0; i < cc; ++i) {
+        var node = contents.getChild(i);
+        if (PlacesUtils.nodeIsURI(node)) {
+          urls.push(node.uri);
+          names.push(node.title);
+        }
+      }
+      contents.containerOpen = false;
+    } else {
+      urls.push(selectedNode.uri);
+      names.push(selectedNode.title);
+    }
+    window.arguments[0].urls = urls;
+    window.arguments[0].names = names;
+  },
+};
diff --git a/browser/components/preferences/dialogs/selectBookmark.xhtml b/browser/components/preferences/dialogs/selectBookmark.xhtml
new file mode 100644
index 0000000000..34317467bf
--- /dev/null
+++ b/browser/components/preferences/dialogs/selectBookmark.xhtml
@@ -0,0 +1,61 @@
+<?xml version="1.0"?>
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+
+<window
+  xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+  xmlns:html="http://www.w3.org/1999/xhtml"
+  data-l10n-id="select-bookmark-window2"
+  data-l10n-attrs="title, style"
+  persist="width height"
+  onload="SelectBookmarkDialog.init();"
+>
+  <dialog id="selectBookmarkDialog">
+    <linkset>
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/content/places/places.css"
+      />
+
+      <html:link rel="stylesheet" href="chrome://global/skin/global.css" />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/skin/places/tree-icons.css"
+      />
+
+      <html:link
+        rel="localization"
+        href="browser/preferences/selectBookmark.ftl"
+      />
+    </linkset>
+
+    <script src="chrome://browser/content/preferences/dialogs/selectBookmark.js" />
+    <script src="chrome://global/content/globalOverlay.js" />
+    <script src="chrome://browser/content/utilityOverlay.js" />
+    <script src="chrome://browser/content/places/places-tree.js" />
+
+    <description data-l10n-id="select-bookmark-desc" />
+
+    <separator class="thin" />
+
+    <tree
+      id="bookmarks"
+      flex="1"
+      is="places-tree"
+      style="height: 15em"
+      hidecolumnpicker="true"
+      seltype="single"
+      ondblclick="SelectBookmarkDialog.onItemDblClick();"
+      onselect="SelectBookmarkDialog.selectionChanged();"
+      disableUserActions="true"
+    >
+      <treecols>
+        <treecol id="title" flex="1" primary="true" hideheader="true" />
+      </treecols>
+      <treechildren id="bookmarksChildren" flex="1" />
+    </tree>
+
+    <separator class="thin" />
+  </dialog>
+</window>
diff --git a/browser/components/preferences/dialogs/siteDataRemoveSelected.js b/browser/components/preferences/dialogs/siteDataRemoveSelected.js
new file mode 100644
index 0000000000..e722a2d826
--- /dev/null
+++ b/browser/components/preferences/dialogs/siteDataRemoveSelected.js
@@ -0,0 +1,56 @@
+/* -*- indent-tabs-mode: nil; js-indent-level: 4 -*- */
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+"use strict";
+
+/**
+ * This dialog will ask the user to confirm that they really want to delete all
+ * site data for a number of hosts.
+ **/
+let gSiteDataRemoveSelected = {
+  init() {
+    document.addEventListener("dialogaccept", function () {
+      window.arguments[0].allowed = true;
+    });
+    document.addEventListener("dialogcancel", function () {
+      window.arguments[0].allowed = false;
+    });
+
+    let list = document.getElementById("removalList");
+
+    let hosts = window.arguments[0].hosts;
+
+    if (!hosts) {
+      throw new Error("Must specify hosts option in arguments.");
+    }
+    let dialog = document.getElementById("SiteDataRemoveSelectedDialog");
+    if (hosts.length == 1) {
+      dialog.classList.add("single-entry");
+      document.l10n.setAttributes(
+        document.getElementById("removing-description"),
+        "site-data-removing-single-desc",
+        {
+          baseDomain: hosts[0],
+        }
+      );
+      return;
+    }
+    dialog.classList.add("multi-entry");
+    hosts.sort();
+    let fragment = document.createDocumentFragment();
+    for (let host of hosts) {
+      let listItem = document.createXULElement("richlistitem");
+      let label = document.createXULElement("label");
+      if (host) {
+        label.setAttribute("value", host);
+      } else {
+        document.l10n.setAttributes(label, "site-data-local-file-host");
+      }
+      listItem.appendChild(label);
+      fragment.appendChild(listItem);
+    }
+    list.appendChild(fragment);
+  },
+};
diff --git a/browser/components/preferences/dialogs/siteDataRemoveSelected.xhtml b/browser/components/preferences/dialogs/siteDataRemoveSelected.xhtml
new file mode 100644
index 0000000000..7ab8391ce7
--- /dev/null
+++ b/browser/components/preferences/dialogs/siteDataRemoveSelected.xhtml
@@ -0,0 +1,51 @@
+<?xml version="1.0"?>
+
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+
+<window id="SiteDataRemoveSelectedDialog"
+        width="500"
+        data-l10n-id="site-data-removing-dialog"
+        data-l10n-attrs="title"
+        onload="gSiteDataRemoveSelected.init();"
+        xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+        xmlns:html="http://www.w3.org/1999/xhtml">
+<dialog data-l10n-id="site-data-removing-dialog"
+        data-l10n-attrs="buttonlabelaccept">
+
+  <linkset>
+    <html:link rel="stylesheet" href="chrome://global/skin/global.css" />
+    <html:link
+      rel="stylesheet"
+      href="chrome://browser/skin/preferences/siteDataSettings.css"
+    />
+
+    <html:link rel="localization" href="browser/preferences/siteDataSettings.ftl"/>
+  </linkset>
+
+  <hbox>
+    <vbox>
+      <image class="question-icon"/>
+    </vbox>
+    <vbox flex="1">
+      <!-- Only show this label on OS X because of no dialog title -->
+      <label id="removing-label"
+             data-l10n-id="site-data-removing-header"
+#ifndef XP_MACOSX
+             hidden="true"
+#endif
+      />
+      <separator class="thin"/>
+      <description id="removing-description" data-l10n-id="site-data-removing-desc"/>
+    </vbox>
+  </hbox>
+    <separator class="multi-site"/>
+
+    <label data-l10n-id="site-data-removing-table" class="multi-site"/>
+    <separator class="thin multi-site"/>
+    <richlistbox id="removalList" class="theme-listbox  multi-site" flex="1"/>
+  <!-- Load the script after the elements for layout issues (bug 1501755). -->
+  <script src="chrome://browser/content/preferences/dialogs/siteDataRemoveSelected.js"/>
+</dialog>
+</window>
diff --git a/browser/components/preferences/dialogs/siteDataSettings.js b/browser/components/preferences/dialogs/siteDataSettings.js
new file mode 100644
index 0000000000..5323a3cf3b
--- /dev/null
+++ b/browser/components/preferences/dialogs/siteDataSettings.js
@@ -0,0 +1,331 @@
+/* -*- indent-tabs-mode: nil; js-indent-level: 4 -*- */
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+"use strict";
+
+var { AppConstants } = ChromeUtils.importESModule(
+  "resource://gre/modules/AppConstants.sys.mjs"
+);
+
+ChromeUtils.defineESModuleGetters(this, {
+  DownloadUtils: "resource://gre/modules/DownloadUtils.sys.mjs",
+  SiteDataManager: "resource:///modules/SiteDataManager.sys.mjs",
+});
+
+let gSiteDataSettings = {
+  // Array of metadata of sites. Each array element is object holding:
+  // - uri: uri of site; instance of nsIURI
+  // - baseDomain: base domain of the site
+  // - cookies: array of cookies of that site
+  // - usage: disk usage which site uses
+  // - userAction: "remove" or "update-permission"; the action user wants to take.
+  _sites: null,
+
+  _list: null,
+  _searchBox: null,
+
+  _createSiteListItem(site) {
+    let item = document.createXULElement("richlistitem");
+    item.setAttribute("host", site.baseDomain);
+    let container = document.createXULElement("hbox");
+
+    // Creates a new column item with the specified relative width.
+    function addColumnItem(l10n, flexWidth, tooltipText) {
+      let box = document.createXULElement("hbox");
+      box.className = "item-box";
+      box.setAttribute("style", `flex: ${flexWidth} ${flexWidth};`);
+      let label = document.createXULElement("label");
+      label.setAttribute("crop", "end");
+      if (l10n) {
+        if (l10n.hasOwnProperty("raw")) {
+          box.setAttribute("tooltiptext", l10n.raw);
+          label.setAttribute("value", l10n.raw);
+        } else {
+          document.l10n.setAttributes(label, l10n.id, l10n.args);
+        }
+      }
+      if (tooltipText) {
+        box.setAttribute("tooltiptext", tooltipText);
+      }
+      box.appendChild(label);
+      container.appendChild(box);
+    }
+
+    // Add "Host" column.
+    let hostData = site.baseDomain
+      ? { raw: site.baseDomain }
+      : { id: "site-data-local-file-host" };
+    addColumnItem(hostData, "4");
+
+    // Add "Cookies" column.
+    addColumnItem({ raw: site.cookies.length }, "1");
+
+    // Add "Storage" column
+    if (site.usage > 0 || site.persisted) {
+      let [value, unit] = DownloadUtils.convertByteUnits(site.usage);
+      let strName = site.persisted
+        ? "site-storage-persistent"
+        : "site-storage-usage";
+      addColumnItem(
+        {
+          id: strName,
+          args: { value, unit },
+        },
+        "2"
+      );
+    } else {
+      // Pass null to avoid showing "0KB" when there is no site data stored.
+      addColumnItem(null, "2");
+    }
+
+    // Add "Last Used" column.
+    let formattedLastAccessed =
+      site.lastAccessed > 0
+        ? this._relativeTimeFormat.formatBestUnit(site.lastAccessed)
+        : null;
+    let formattedFullDate =
+      site.lastAccessed > 0
+        ? this._absoluteTimeFormat.format(site.lastAccessed)
+        : null;
+    addColumnItem(
+      site.lastAccessed > 0 ? { raw: formattedLastAccessed } : null,
+      "2",
+      formattedFullDate
+    );
+
+    item.appendChild(container);
+    return item;
+  },
+
+  init() {
+    function setEventListener(id, eventType, callback) {
+      document
+        .getElementById(id)
+        .addEventListener(eventType, callback.bind(gSiteDataSettings));
+    }
+
+    this._absoluteTimeFormat = new Services.intl.DateTimeFormat(undefined, {
+      dateStyle: "short",
+      timeStyle: "short",
+    });
+
+    this._relativeTimeFormat = new Services.intl.RelativeTimeFormat(
+      undefined,
+      {}
+    );
+
+    this._list = document.getElementById("sitesList");
+    this._searchBox = document.getElementById("searchBox");
+    SiteDataManager.getSites().then(sites => {
+      this._sites = sites;
+      let sortCol = document.querySelector(
+        "treecol[data-isCurrentSortCol=true]"
+      );
+      this._sortSites(this._sites, sortCol);
+      this._buildSitesList(this._sites);
+      Services.obs.notifyObservers(null, "sitedata-settings-init");
+    });
+
+    setEventListener("sitesList", "select", this.onSelect);
+    setEventListener("hostCol", "click", this.onClickTreeCol);
+    setEventListener("usageCol", "click", this.onClickTreeCol);
+    setEventListener("lastAccessedCol", "click", this.onClickTreeCol);
+    setEventListener("cookiesCol", "click", this.onClickTreeCol);
+    setEventListener("searchBox", "command", this.onCommandSearch);
+    setEventListener("removeAll", "command", this.onClickRemoveAll);
+    setEventListener("removeSelected", "command", this.removeSelected);
+
+    document.addEventListener("dialogaccept", e => this.saveChanges(e));
+  },
+
+  _updateButtonsState() {
+    let items = this._list.getElementsByTagName("richlistitem");
+    let removeSelectedBtn = document.getElementById("removeSelected");
+    let removeAllBtn = document.getElementById("removeAll");
+    removeSelectedBtn.disabled = !this._list.selectedItems.length;
+    removeAllBtn.disabled = !items.length;
+
+    let l10nId = this._searchBox.value
+      ? "site-data-remove-shown"
+      : "site-data-remove-all";
+    document.l10n.setAttributes(removeAllBtn, l10nId);
+  },
+
+  /**
+   * @param sites {Array}
+   * @param col {XULElement} the <treecol> being sorted on
+   */
+  _sortSites(sites, col) {
+    let isCurrentSortCol = col.getAttribute("data-isCurrentSortCol");
+    let sortDirection =
+      col.getAttribute("data-last-sortDirection") || "ascending";
+    if (isCurrentSortCol) {
+      // Sort on the current column, flip the sorting direction
+      sortDirection =
+        sortDirection === "ascending" ? "descending" : "ascending";
+    }
+
+    let sortFunc = null;
+    switch (col.id) {
+      case "hostCol":
+        sortFunc = (a, b) => {
+          let aHost = a.baseDomain.toLowerCase();
+          let bHost = b.baseDomain.toLowerCase();
+          return aHost.localeCompare(bHost);
+        };
+        break;
+
+      case "cookiesCol":
+        sortFunc = (a, b) => a.cookies.length - b.cookies.length;
+        break;
+
+      case "usageCol":
+        sortFunc = (a, b) => a.usage - b.usage;
+        break;
+
+      case "lastAccessedCol":
+        sortFunc = (a, b) => a.lastAccessed - b.lastAccessed;
+        break;
+    }
+    if (sortDirection === "descending") {
+      sites.sort((a, b) => sortFunc(b, a));
+    } else {
+      sites.sort(sortFunc);
+    }
+
+    let cols = this._list.previousElementSibling.querySelectorAll("treecol");
+    cols.forEach(c => {
+      c.removeAttribute("sortDirection");
+      c.removeAttribute("data-isCurrentSortCol");
+    });
+    col.setAttribute("data-isCurrentSortCol", true);
+    col.setAttribute("sortDirection", sortDirection);
+    col.setAttribute("data-last-sortDirection", sortDirection);
+  },
+
+  /**
+   * @param sites {Array} array of metadata of sites
+   */
+  _buildSitesList(sites) {
+    // Clear old entries.
+    let oldItems = this._list.querySelectorAll("richlistitem");
+    for (let item of oldItems) {
+      item.remove();
+    }
+
+    let keyword = this._searchBox.value.toLowerCase().trim();
+    let fragment = document.createDocumentFragment();
+    for (let site of sites) {
+      if (keyword && !site.baseDomain.includes(keyword)) {
+        continue;
+      }
+
+      if (site.userAction === "remove") {
+        continue;
+      }
+
+      let item = this._createSiteListItem(site);
+      fragment.appendChild(item);
+    }
+    this._list.appendChild(fragment);
+    this._updateButtonsState();
+  },
+
+  _removeSiteItems(items) {
+    for (let i = items.length - 1; i >= 0; --i) {
+      let item = items[i];
+      let baseDomain = item.getAttribute("host");
+      let siteForBaseDomain = this._sites.find(
+        site => site.baseDomain == baseDomain
+      );
+      if (siteForBaseDomain) {
+        siteForBaseDomain.userAction = "remove";
+      }
+      item.remove();
+    }
+    this._updateButtonsState();
+  },
+
+  async saveChanges(event) {
+    let removals = this._sites
+      .filter(site => site.userAction == "remove")
+      .map(site => site.baseDomain);
+
+    if (removals.length) {
+      let removeAll = removals.length == this._sites.length;
+      let promptArg = removeAll ? undefined : removals;
+      if (!SiteDataManager.promptSiteDataRemoval(window, promptArg)) {
+        // If the user cancelled the confirm dialog keep the site data window open,
+        // they can still press cancel again to exit.
+        event.preventDefault();
+        return;
+      }
+      try {
+        if (removeAll) {
+          await SiteDataManager.removeAll();
+        } else {
+          await SiteDataManager.remove(removals);
+        }
+      } catch (e) {
+        console.error(e);
+      }
+    }
+  },
+
+  removeSelected() {
+    let lastIndex = this._list.selectedItems.length - 1;
+    let lastSelectedItem = this._list.selectedItems[lastIndex];
+    let lastSelectedItemPosition = this._list.getIndexOfItem(lastSelectedItem);
+    let nextSelectedItem = this._list.getItemAtIndex(
+      lastSelectedItemPosition + 1
+    );
+
+    this._removeSiteItems(this._list.selectedItems);
+    this._list.clearSelection();
+
+    if (nextSelectedItem) {
+      this._list.selectedItem = nextSelectedItem;
+    } else {
+      this._list.selectedIndex = this._list.itemCount - 1;
+    }
+  },
+
+  onClickTreeCol(e) {
+    this._sortSites(this._sites, e.target);
+    this._buildSitesList(this._sites);
+    this._list.clearSelection();
+  },
+
+  onCommandSearch() {
+    this._buildSitesList(this._sites);
+    this._list.clearSelection();
+  },
+
+  onClickRemoveAll() {
+    let siteItems = this._list.getElementsByTagName("richlistitem");
+    if (siteItems.length) {
+      this._removeSiteItems(siteItems);
+    }
+  },
+
+  onKeyPress(e) {
+    if (
+      e.keyCode == KeyEvent.DOM_VK_DELETE ||
+      (AppConstants.platform == "macosx" &&
+        e.keyCode == KeyEvent.DOM_VK_BACK_SPACE)
+    ) {
+      if (!e.target.closest("#sitesList")) {
+        // The user is typing or has not selected an item from the list to remove
+        return;
+      }
+      // The users intention is to delete site data
+      this.removeSelected();
+    }
+  },
+
+  onSelect() {
+    this._updateButtonsState();
+  },
+};
diff --git a/browser/components/preferences/dialogs/siteDataSettings.xhtml b/browser/components/preferences/dialogs/siteDataSettings.xhtml
new file mode 100644
index 0000000000..56c8238864
--- /dev/null
+++ b/browser/components/preferences/dialogs/siteDataSettings.xhtml
@@ -0,0 +1,92 @@
+<?xml version="1.0"?>
+
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+
+<window
+  id="SiteDataSettingsDialog"
+  data-l10n-id="site-data-settings-window"
+  data-l10n-attrs="title"
+  xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+  xmlns:html="http://www.w3.org/1999/xhtml"
+  style="min-width: 45em"
+  onload="gSiteDataSettings.init();"
+  onkeypress="gSiteDataSettings.onKeyPress(event);"
+  persist="width height"
+>
+  <dialog
+    buttons="accept,cancel"
+    data-l10n-id="site-data-settings-dialog"
+    data-l10n-attrs="buttonlabelaccept, buttonaccesskeyaccept"
+  >
+    <linkset>
+      <html:link rel="stylesheet" href="chrome://global/skin/global.css" />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/skin/preferences/preferences.css"
+      />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/skin/preferences/siteDataSettings.css"
+      />
+
+      <html:link rel="localization" href="branding/brand.ftl" />
+      <html:link
+        rel="localization"
+        href="browser/preferences/siteDataSettings.ftl"
+      />
+    </linkset>
+
+    <script src="chrome://browser/content/preferences/dialogs/siteDataSettings.js" />
+
+    <vbox flex="1" class="contentPane">
+      <description
+        id="settingsDescription"
+        data-l10n-id="site-data-settings-description"
+      />
+      <separator class="thin" />
+
+      <hbox id="searchBoxContainer">
+        <search-textbox
+          id="searchBox"
+          flex="1"
+          data-l10n-id="site-data-search-textbox"
+          data-l10n-attrs="placeholder"
+        />
+      </hbox>
+      <separator class="thin" />
+
+      <listheader>
+        <treecol
+          style="flex: 4 4 auto; width: 50px"
+          data-l10n-id="site-data-column-host"
+          id="hostCol"
+        />
+        <treecol
+          style="flex: 1 auto; width: 50px"
+          data-l10n-id="site-data-column-cookies"
+          id="cookiesCol"
+        />
+        <!-- Sorted by usage so the user can quickly see which sites use the most data. -->
+        <treecol
+          style="flex: 2 2 auto; width: 50px"
+          data-l10n-id="site-data-column-storage"
+          id="usageCol"
+          data-isCurrentSortCol="true"
+        />
+        <treecol
+          style="flex: 2 2 auto; width: 50px"
+          data-l10n-id="site-data-column-last-used"
+          id="lastAccessedCol"
+        />
+      </listheader>
+      <richlistbox seltype="multiple" id="sitesList" orient="vertical" />
+    </vbox>
+
+    <hbox align="start">
+      <button id="removeSelected" data-l10n-id="site-data-remove-selected" />
+      <button id="removeAll" />
+    </hbox>
+  </dialog>
+</window>
diff --git a/browser/components/preferences/dialogs/sitePermissions.css b/browser/components/preferences/dialogs/sitePermissions.css
new file mode 100644
index 0000000000..f9b7b447c7
--- /dev/null
+++ b/browser/components/preferences/dialogs/sitePermissions.css
@@ -0,0 +1,58 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+.website-name,
+label.website-status {
+  overflow: hidden;
+  text-overflow: ellipsis;
+  padding-inline-start: 7px;
+}
+
+#permissionsBox {
+  flex: 1 auto;
+  height: 18em;
+  min-height: 70px; /* 2 * 35px, which is the min row height specified below */
+}
+
+#siteCol,
+#statusCol,
+#permissionsBox > richlistitem {
+  min-height: 35px;
+}
+
+#permissionsBox > richlistitem > hbox {
+  flex: 1;
+  align-items: center;
+}
+
+#siteCol,
+.website-name {
+  flex: 1;
+  width: 0; /* Don't make our intrinsic size affect our final size */
+}
+
+#statusCol,
+.website-status {
+  width: 35%;
+}
+
+menulist.website-status {
+  margin-block: 1px;
+  margin-inline: 0 5px;
+  width: calc(35% - 5px);
+}
+
+#browserNotificationsPermissionExtensionContent,
+#permissionsDisableDescription {
+  margin-inline-start: 32px;
+}
+
+#permissionsDisableDescription {
+  color: var(--text-color-deemphasized);
+}
+
+#permissionsDisableCheckbox {
+  margin-inline-start: 4px;
+  padding-top: 10px;
+}
diff --git a/browser/components/preferences/dialogs/sitePermissions.js b/browser/components/preferences/dialogs/sitePermissions.js
new file mode 100644
index 0000000000..e23706a01d
--- /dev/null
+++ b/browser/components/preferences/dialogs/sitePermissions.js
@@ -0,0 +1,679 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+/* import-globals-from ../extensionControlled.js */
+
+var { AppConstants } = ChromeUtils.importESModule(
+  "resource://gre/modules/AppConstants.sys.mjs"
+);
+const { SitePermissions } = ChromeUtils.importESModule(
+  "resource:///modules/SitePermissions.sys.mjs"
+);
+
+const sitePermissionsL10n = {
+  "desktop-notification": {
+    window: "permissions-site-notification-window2",
+    description: "permissions-site-notification-desc",
+    disableLabel: "permissions-site-notification-disable-label",
+    disableDescription: "permissions-site-notification-disable-desc",
+  },
+  geo: {
+    window: "permissions-site-location-window2",
+    description: "permissions-site-location-desc",
+    disableLabel: "permissions-site-location-disable-label",
+    disableDescription: "permissions-site-location-disable-desc",
+  },
+  xr: {
+    window: "permissions-site-xr-window2",
+    description: "permissions-site-xr-desc",
+    disableLabel: "permissions-site-xr-disable-label",
+    disableDescription: "permissions-site-xr-disable-desc",
+  },
+  camera: {
+    window: "permissions-site-camera-window2",
+    description: "permissions-site-camera-desc",
+    disableLabel: "permissions-site-camera-disable-label",
+    disableDescription: "permissions-site-camera-disable-desc",
+  },
+  microphone: {
+    window: "permissions-site-microphone-window2",
+    description: "permissions-site-microphone-desc",
+    disableLabel: "permissions-site-microphone-disable-label",
+    disableDescription: "permissions-site-microphone-disable-desc",
+  },
+  speaker: {
+    window: "permissions-site-speaker-window",
+    description: "permissions-site-speaker-desc",
+  },
+  "autoplay-media": {
+    window: "permissions-site-autoplay-window2",
+    description: "permissions-site-autoplay-desc",
+  },
+};
+
+const sitePermissionsConfig = {
+  "autoplay-media": {
+    _getCapabilityString(capability) {
+      switch (capability) {
+        case SitePermissions.ALLOW:
+          return "permissions-capabilities-autoplay-allow";
+        case SitePermissions.BLOCK:
+          return "permissions-capabilities-autoplay-block";
+        case SitePermissions.AUTOPLAY_BLOCKED_ALL:
+          return "permissions-capabilities-autoplay-blockall";
+      }
+      throw new Error(`Unknown capability: ${capability}`);
+    },
+  },
+};
+
+// A set of permissions for a single origin.  One PermissionGroup instance
+// corresponds to one row in the gSitePermissionsManager._list richlistbox.
+// Permissions may be single or double keyed, but the primary key of all
+// permissions matches the permission type of the dialog.
+class PermissionGroup {
+  #changedCapability;
+
+  constructor(perm) {
+    this.principal = perm.principal;
+    this.origin = perm.principal.origin;
+    this.perms = [perm];
+  }
+  addPermission(perm) {
+    this.perms.push(perm);
+  }
+  removePermission(perm) {
+    this.perms = this.perms.filter(p => p.type != perm.type);
+  }
+  set capability(cap) {
+    this.#changedCapability = cap;
+  }
+  get capability() {
+    if (this.#changedCapability) {
+      return this.#changedCapability;
+    }
+    return this.savedCapability;
+  }
+  revert() {
+    this.#changedCapability = null;
+  }
+  get savedCapability() {
+    // This logic to present a single capability for permissions of different
+    // keys and capabilities caters for speaker-selection, where a block
+    // permission may be set for all devices with no second key, which would
+    // override any device-specific double-keyed allow permissions.
+    let cap;
+    for (let perm of this.perms) {
+      let [type] = perm.type.split(SitePermissions.PERM_KEY_DELIMITER);
+      if (type == perm.type) {
+        // No second key.  This overrides double-keyed perms.
+        return perm.capability;
+      }
+      // Double-keyed perms are not expected to have different capabilities.
+      cap = perm.capability;
+    }
+    return cap;
+  }
+}
+
+const PERMISSION_STATES = [
+  SitePermissions.ALLOW,
+  SitePermissions.BLOCK,
+  SitePermissions.PROMPT,
+  SitePermissions.AUTOPLAY_BLOCKED_ALL,
+];
+
+const NOTIFICATIONS_PERMISSION_OVERRIDE_KEY = "webNotificationsDisabled";
+const NOTIFICATIONS_PERMISSION_PREF =
+  "permissions.default.desktop-notification";
+
+const AUTOPLAY_PREF = "media.autoplay.default";
+
+var gSitePermissionsManager = {
+  _type: "",
+  _isObserving: false,
+  _permissionGroups: new Map(),
+  _permissionsToChange: new Map(),
+  _permissionsToDelete: new Map(),
+  _list: null,
+  _removeButton: null,
+  _removeAllButton: null,
+  _searchBox: null,
+  _checkbox: null,
+  _currentDefaultPermissionsState: null,
+  _defaultPermissionStatePrefName: null,
+
+  onLoad() {
+    let params = window.arguments[0];
+    document.mozSubdialogReady = this.init(params);
+  },
+
+  async init(params) {
+    if (!this._isObserving) {
+      Services.obs.addObserver(this, "perm-changed");
+      this._isObserving = true;
+    }
+
+    document.addEventListener("dialogaccept", () => this.onApplyChanges());
+
+    this._type = params.permissionType;
+    this._list = document.getElementById("permissionsBox");
+    this._removeButton = document.getElementById("removePermission");
+    this._removeAllButton = document.getElementById("removeAllPermissions");
+    this._searchBox = document.getElementById("searchBox");
+    this._checkbox = document.getElementById("permissionsDisableCheckbox");
+    this._disableExtensionButton = document.getElementById(
+      "disableNotificationsPermissionExtension"
+    );
+    this._permissionsDisableDescription = document.getElementById(
+      "permissionsDisableDescription"
+    );
+    this._setAutoplayPref = document.getElementById("setAutoplayPref");
+
+    let permissionsText = document.getElementById("permissionsText");
+
+    document.l10n.pauseObserving();
+    let l10n = sitePermissionsL10n[this._type];
+    document.l10n.setAttributes(permissionsText, l10n.description);
+    if (l10n.disableLabel) {
+      document.l10n.setAttributes(this._checkbox, l10n.disableLabel);
+    }
+    if (l10n.disableDescription) {
+      document.l10n.setAttributes(
+        this._permissionsDisableDescription,
+        l10n.disableDescription
+      );
+    }
+    document.l10n.setAttributes(document.documentElement, l10n.window);
+
+    await document.l10n.translateElements([
+      permissionsText,
+      this._checkbox,
+      this._permissionsDisableDescription,
+      document.documentElement,
+    ]);
+    document.l10n.resumeObserving();
+
+    // Initialize the checkbox state and handle showing notification permission UI
+    // when it is disabled by an extension.
+    this._defaultPermissionStatePrefName = "permissions.default." + this._type;
+    this._watchPermissionPrefChange();
+
+    this._loadPermissions();
+    this.buildPermissionsList();
+
+    if (params.permissionType == "autoplay-media") {
+      await this.buildAutoplayMenulist();
+      this._setAutoplayPref.hidden = false;
+    }
+
+    this._searchBox.focus();
+  },
+
+  uninit() {
+    if (this._isObserving) {
+      Services.obs.removeObserver(this, "perm-changed");
+      this._isObserving = false;
+    }
+    if (this._setAutoplayPref) {
+      this._setAutoplayPref.hidden = true;
+    }
+  },
+
+  observe(subject, topic, data) {
+    if (topic !== "perm-changed") {
+      return;
+    }
+
+    let permission = subject.QueryInterface(Ci.nsIPermission);
+    let [type] = permission.type.split(SitePermissions.PERM_KEY_DELIMITER);
+
+    // Ignore unrelated permission types and permissions with unknown states.
+    if (
+      type !== this._type ||
+      !PERMISSION_STATES.includes(permission.capability)
+    ) {
+      return;
+    }
+
+    if (data == "added") {
+      this._addPermissionToList(permission);
+    } else {
+      let group = this._permissionGroups.get(permission.principal.origin);
+      if (!group) {
+        // already moved to _permissionsToDelete
+        // or private browsing session permission
+        return;
+      }
+      if (data == "changed") {
+        group.removePermission(permission);
+        group.addPermission(permission);
+      } else if (data == "deleted") {
+        group.removePermission(permission);
+        if (!group.perms.length) {
+          this._removePermissionFromList(permission.principal.origin);
+          return;
+        }
+      }
+    }
+    this.buildPermissionsList();
+  },
+
+  _handleCheckboxUIUpdates() {
+    let pref = Services.prefs.getPrefType(this._defaultPermissionStatePrefName);
+    if (pref != Services.prefs.PREF_INVALID) {
+      this._currentDefaultPermissionsState = Services.prefs.getIntPref(
+        this._defaultPermissionStatePrefName
+      );
+    }
+
+    if (this._currentDefaultPermissionsState === null) {
+      this._checkbox.hidden = true;
+      this._permissionsDisableDescription.hidden = true;
+    } else if (this._currentDefaultPermissionsState == SitePermissions.BLOCK) {
+      this._checkbox.checked = true;
+    } else {
+      this._checkbox.checked = false;
+    }
+
+    if (Services.prefs.prefIsLocked(this._defaultPermissionStatePrefName)) {
+      this._checkbox.disabled = true;
+    }
+  },
+
+  /**
+   * Listen for changes to the permissions.default.* pref and make
+   * necessary changes to the UI.
+   */
+  _watchPermissionPrefChange() {
+    this._handleCheckboxUIUpdates();
+
+    if (this._type == "desktop-notification") {
+      this._handleWebNotificationsDisable();
+
+      this._disableExtensionButton.addEventListener(
+        "command",
+        makeDisableControllingExtension(
+          PREF_SETTING_TYPE,
+          NOTIFICATIONS_PERMISSION_OVERRIDE_KEY
+        )
+      );
+    }
+
+    let observer = () => {
+      this._handleCheckboxUIUpdates();
+      if (this._type == "desktop-notification") {
+        this._handleWebNotificationsDisable();
+      }
+    };
+    Services.prefs.addObserver(this._defaultPermissionStatePrefName, observer);
+    window.addEventListener("unload", () => {
+      Services.prefs.removeObserver(
+        this._defaultPermissionStatePrefName,
+        observer
+      );
+    });
+  },
+
+  /**
+   * Handles the UI update for web notifications disable by extensions.
+   */
+  async _handleWebNotificationsDisable() {
+    let prefLocked = Services.prefs.prefIsLocked(NOTIFICATIONS_PERMISSION_PREF);
+    if (prefLocked) {
+      // An extension can't control these settings if they're locked.
+      hideControllingExtension(NOTIFICATIONS_PERMISSION_OVERRIDE_KEY);
+    } else {
+      let isControlled = await handleControllingExtension(
+        PREF_SETTING_TYPE,
+        NOTIFICATIONS_PERMISSION_OVERRIDE_KEY
+      );
+      this._checkbox.disabled = isControlled;
+    }
+  },
+
+  _getCapabilityL10nId(element, type, capability) {
+    if (
+      type in sitePermissionsConfig &&
+      sitePermissionsConfig[type]._getCapabilityString
+    ) {
+      return sitePermissionsConfig[type]._getCapabilityString(capability);
+    }
+    switch (element.tagName) {
+      case "menuitem":
+        switch (capability) {
+          case Services.perms.ALLOW_ACTION:
+            return "permissions-capabilities-allow";
+          case Services.perms.DENY_ACTION:
+            return "permissions-capabilities-block";
+          case Services.perms.PROMPT_ACTION:
+            return "permissions-capabilities-prompt";
+          default:
+            throw new Error(`Unknown capability: ${capability}`);
+        }
+      case "label":
+        switch (capability) {
+          case Services.perms.ALLOW_ACTION:
+            return "permissions-capabilities-listitem-allow";
+          case Services.perms.DENY_ACTION:
+            return "permissions-capabilities-listitem-block";
+          default:
+            throw new Error(`Unexpected capability: ${capability}`);
+        }
+      default:
+        throw new Error(`Unexpected tag: ${element.tagName}`);
+    }
+  },
+
+  _addPermissionToList(perm) {
+    let [type] = perm.type.split(SitePermissions.PERM_KEY_DELIMITER);
+    // Ignore unrelated permission types and permissions with unknown states.
+    if (
+      type !== this._type ||
+      !PERMISSION_STATES.includes(perm.capability) ||
+      // Skip private browsing session permissions
+      (perm.principal.privateBrowsingId !==
+        Services.scriptSecurityManager.DEFAULT_PRIVATE_BROWSING_ID &&
+        perm.expireType === Services.perms.EXPIRE_SESSION)
+    ) {
+      return;
+    }
+    let group = this._permissionGroups.get(perm.principal.origin);
+    if (group) {
+      group.addPermission(perm);
+    } else {
+      group = new PermissionGroup(perm);
+      this._permissionGroups.set(group.origin, group);
+    }
+  },
+
+  _removePermissionFromList(origin) {
+    this._permissionGroups.delete(origin);
+    this._permissionsToChange.delete(origin);
+    let permissionlistitem = document.getElementsByAttribute(
+      "origin",
+      origin
+    )[0];
+    if (permissionlistitem) {
+      permissionlistitem.remove();
+    }
+  },
+
+  _loadPermissions() {
+    // load permissions into a table.
+    for (let nextPermission of Services.perms.all) {
+      this._addPermissionToList(nextPermission);
+    }
+  },
+
+  _createPermissionListItem(permissionGroup) {
+    let richlistitem = document.createXULElement("richlistitem");
+    richlistitem.setAttribute("origin", permissionGroup.origin);
+    let row = document.createXULElement("hbox");
+
+    let website = document.createXULElement("label");
+    website.textContent = permissionGroup.origin;
+    website.className = "website-name";
+
+    let states = SitePermissions.getAvailableStates(this._type).filter(
+      state => state != SitePermissions.UNKNOWN
+    );
+    // Handle the cases of a double-keyed ALLOW permission or a PROMPT
+    // permission after the default has been changed back to UNKNOWN.
+    if (!states.includes(permissionGroup.savedCapability)) {
+      states.unshift(permissionGroup.savedCapability);
+    }
+    let siteStatus;
+    if (states.length == 1) {
+      // Only a single state is available.  Show a label.
+      siteStatus = document.createXULElement("label");
+      document.l10n.setAttributes(
+        siteStatus,
+        this._getCapabilityL10nId(
+          siteStatus,
+          this._type,
+          permissionGroup.capability
+        )
+      );
+    } else {
+      // Multiple states are available.  Show a menulist.
+      siteStatus = document.createXULElement("menulist");
+      for (let state of states) {
+        let m = siteStatus.appendItem(undefined, state);
+        document.l10n.setAttributes(
+          m,
+          this._getCapabilityL10nId(m, this._type, state)
+        );
+      }
+      siteStatus.addEventListener("select", () => {
+        this.onPermissionChange(permissionGroup, Number(siteStatus.value));
+      });
+    }
+    siteStatus.className = "website-status";
+    siteStatus.value = permissionGroup.capability;
+
+    row.appendChild(website);
+    row.appendChild(siteStatus);
+    richlistitem.appendChild(row);
+    return richlistitem;
+  },
+
+  onPermissionKeyPress(event) {
+    if (!this._list.selectedItem) {
+      return;
+    }
+
+    if (
+      event.keyCode == KeyEvent.DOM_VK_DELETE ||
+      (AppConstants.platform == "macosx" &&
+        event.keyCode == KeyEvent.DOM_VK_BACK_SPACE)
+    ) {
+      this.onPermissionDelete();
+      event.preventDefault();
+    }
+  },
+
+  _setRemoveButtonState() {
+    if (!this._list) {
+      return;
+    }
+
+    let hasSelection = this._list.selectedIndex >= 0;
+    let hasRows = this._list.itemCount > 0;
+    this._removeButton.disabled = !hasSelection;
+    this._removeAllButton.disabled = !hasRows;
+  },
+
+  onPermissionDelete() {
+    let richlistitem = this._list.selectedItem;
+    let origin = richlistitem.getAttribute("origin");
+    let permissionGroup = this._permissionGroups.get(origin);
+
+    this._removePermissionFromList(origin);
+    this._permissionsToDelete.set(permissionGroup.origin, permissionGroup);
+
+    this._setRemoveButtonState();
+  },
+
+  onAllPermissionsDelete() {
+    for (let permissionGroup of this._permissionGroups.values()) {
+      this._removePermissionFromList(permissionGroup.origin);
+      this._permissionsToDelete.set(permissionGroup.origin, permissionGroup);
+    }
+
+    this._setRemoveButtonState();
+  },
+
+  onPermissionSelect() {
+    this._setRemoveButtonState();
+  },
+
+  onPermissionChange(perm, capability) {
+    let group = this._permissionGroups.get(perm.origin);
+    if (group.capability == capability) {
+      return;
+    }
+    if (capability == group.savedCapability) {
+      group.revert();
+      this._permissionsToChange.delete(group.origin);
+    } else {
+      group.capability = capability;
+      this._permissionsToChange.set(group.origin, group);
+    }
+
+    // enable "remove all" button as needed
+    this._setRemoveButtonState();
+  },
+
+  onApplyChanges() {
+    // Stop observing permission changes since we are about
+    // to write out the pending adds/deletes and don't need
+    // to update the UI
+    this.uninit();
+
+    // Delete even _permissionsToChange to clear out double-keyed permissions
+    for (let group of [
+      ...this._permissionsToDelete.values(),
+      ...this._permissionsToChange.values(),
+    ]) {
+      for (let perm of group.perms) {
+        SitePermissions.removeFromPrincipal(perm.principal, perm.type);
+      }
+    }
+
+    for (let group of this._permissionsToChange.values()) {
+      SitePermissions.setForPrincipal(
+        group.principal,
+        this._type,
+        group.capability
+      );
+    }
+
+    if (this._checkbox.checked) {
+      Services.prefs.setIntPref(
+        this._defaultPermissionStatePrefName,
+        SitePermissions.BLOCK
+      );
+    } else if (this._currentDefaultPermissionsState == SitePermissions.BLOCK) {
+      Services.prefs.setIntPref(
+        this._defaultPermissionStatePrefName,
+        SitePermissions.UNKNOWN
+      );
+    }
+  },
+
+  buildPermissionsList(sortCol) {
+    // Clear old entries.
+    let oldItems = this._list.querySelectorAll("richlistitem");
+    for (let item of oldItems) {
+      item.remove();
+    }
+    let frag = document.createDocumentFragment();
+
+    let permissionGroups = Array.from(this._permissionGroups.values());
+
+    let keyword = this._searchBox.value.toLowerCase().trim();
+    for (let permissionGroup of permissionGroups) {
+      if (keyword && !permissionGroup.origin.includes(keyword)) {
+        continue;
+      }
+
+      let richlistitem = this._createPermissionListItem(permissionGroup);
+      frag.appendChild(richlistitem);
+    }
+
+    // Sort permissions.
+    this._sortPermissions(this._list, frag, sortCol);
+
+    this._list.appendChild(frag);
+
+    this._setRemoveButtonState();
+  },
+
+  async buildAutoplayMenulist() {
+    let menulist = document.createXULElement("menulist");
+    let states = SitePermissions.getAvailableStates("autoplay-media");
+    document.l10n.pauseObserving();
+    for (let state of states) {
+      let m = menulist.appendItem(undefined, state);
+      document.l10n.setAttributes(
+        m,
+        this._getCapabilityL10nId(m, "autoplay-media", state)
+      );
+    }
+
+    menulist.value = SitePermissions.getDefault("autoplay-media");
+
+    menulist.addEventListener("select", () => {
+      SitePermissions.setDefault("autoplay-media", Number(menulist.value));
+    });
+
+    menulist.menupopup.setAttribute("incontentshell", "false");
+
+    menulist.disabled = Services.prefs.prefIsLocked(AUTOPLAY_PREF);
+
+    document.getElementById("setAutoplayPref").appendChild(menulist);
+    await document.l10n.translateFragment(menulist);
+    document.l10n.resumeObserving();
+  },
+
+  _sortPermissions(list, frag, column) {
+    let sortDirection;
+
+    if (!column) {
+      column = document.querySelector("treecol[data-isCurrentSortCol=true]");
+      sortDirection =
+        column.getAttribute("data-last-sortDirection") || "ascending";
+    } else {
+      sortDirection = column.getAttribute("data-last-sortDirection");
+      sortDirection =
+        sortDirection === "ascending" ? "descending" : "ascending";
+    }
+
+    let sortFunc = null;
+    switch (column.id) {
+      case "siteCol":
+        sortFunc = (a, b) => {
+          return comp.compare(
+            a.getAttribute("origin"),
+            b.getAttribute("origin")
+          );
+        };
+        break;
+
+      case "statusCol":
+        sortFunc = (a, b) => {
+          return (
+            parseInt(a.querySelector(".website-status").value) >
+            parseInt(b.querySelector(".website-status").value)
+          );
+        };
+        break;
+    }
+
+    let comp = new Services.intl.Collator(undefined, {
+      usage: "sort",
+    });
+
+    let items = Array.from(frag.querySelectorAll("richlistitem"));
+
+    if (sortDirection === "descending") {
+      items.sort((a, b) => sortFunc(b, a));
+    } else {
+      items.sort(sortFunc);
+    }
+
+    // Re-append items in the correct order:
+    items.forEach(item => frag.appendChild(item));
+
+    let cols = list.previousElementSibling.querySelectorAll("treecol");
+    cols.forEach(c => {
+      c.removeAttribute("data-isCurrentSortCol");
+      c.removeAttribute("sortDirection");
+    });
+    column.setAttribute("data-isCurrentSortCol", "true");
+    column.setAttribute("sortDirection", sortDirection);
+    column.setAttribute("data-last-sortDirection", sortDirection);
+  },
+};
diff --git a/browser/components/preferences/dialogs/sitePermissions.xhtml b/browser/components/preferences/dialogs/sitePermissions.xhtml
new file mode 100644
index 0000000000..e17d701dc6
--- /dev/null
+++ b/browser/components/preferences/dialogs/sitePermissions.xhtml
@@ -0,0 +1,121 @@
+<?xml version="1.0"?>
+
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+
+<window
+  id="SitePermissionsDialog"
+  xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+  xmlns:html="http://www.w3.org/1999/xhtml"
+  data-l10n-id="permissions-window2"
+  data-l10n-attrs="title, style"
+  onload="gSitePermissionsManager.onLoad();"
+  onunload="gSitePermissionsManager.uninit();"
+  persist="width height"
+>
+  <dialog
+    buttons="accept,cancel"
+    data-l10n-id="permission-dialog"
+    data-l10n-attrs="buttonlabelaccept, buttonaccesskeyaccept"
+  >
+    <linkset>
+      <html:link rel="stylesheet" href="chrome://global/skin/global.css" />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/content/preferences/dialogs/sitePermissions.css"
+      />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/skin/preferences/preferences.css"
+      />
+
+      <html:link
+        rel="localization"
+        href="browser/preferences/preferences.ftl"
+      />
+      <html:link
+        rel="localization"
+        href="browser/preferences/permissions.ftl"
+      />
+    </linkset>
+
+    <script src="chrome://browser/content/preferences/dialogs/sitePermissions.js" />
+    <script src="chrome://browser/content/preferences/extensionControlled.js" />
+
+    <keyset>
+      <key
+        data-l10n-id="permissions-close-key"
+        modifiers="accel"
+        oncommand="window.close();"
+      />
+    </keyset>
+
+    <vbox class="contentPane">
+      <hbox align="center" id="setAutoplayPref" hidden="true">
+        <label data-l10n-id="permissions-autoplay-menu" />
+      </hbox>
+      <description id="permissionsText" control="url" />
+      <separator class="thin" />
+      <hbox align="start">
+        <search-textbox
+          id="searchBox"
+          flex="1"
+          data-l10n-id="permissions-searchbox"
+          data-l10n-attrs="placeholder"
+          oncommand="gSitePermissionsManager.buildPermissionsList();"
+        />
+      </hbox>
+      <separator class="thin" />
+      <listheader>
+        <treecol
+          id="siteCol"
+          data-l10n-id="permissions-site-name"
+          onclick="gSitePermissionsManager.buildPermissionsList(event.target)"
+        />
+        <treecol
+          id="statusCol"
+          data-l10n-id="permissions-status"
+          data-isCurrentSortCol="true"
+          onclick="gSitePermissionsManager.buildPermissionsList(event.target);"
+        />
+      </listheader>
+      <richlistbox
+        id="permissionsBox"
+        selected="false"
+        onkeypress="gSitePermissionsManager.onPermissionKeyPress(event);"
+        onselect="gSitePermissionsManager.onPermissionSelect();"
+      />
+    </vbox>
+
+    <hbox class="actionButtons">
+      <button
+        id="removePermission"
+        disabled="true"
+        data-l10n-id="permissions-remove"
+        oncommand="gSitePermissionsManager.onPermissionDelete();"
+      />
+      <button
+        id="removeAllPermissions"
+        data-l10n-id="permissions-remove-all"
+        oncommand="gSitePermissionsManager.onAllPermissionsDelete();"
+      />
+    </hbox>
+
+    <checkbox id="permissionsDisableCheckbox" />
+    <description id="permissionsDisableDescription" />
+    <hbox
+      id="browserNotificationsPermissionExtensionContent"
+      class="extension-controlled"
+      align="center"
+      hidden="true"
+    >
+      <description control="disableNotificationsPermissionExtension" flex="1" />
+      <button
+        id="disableNotificationsPermissionExtension"
+        class="extension-controlled-button accessory-button"
+        data-l10n-id="disable-extension"
+      />
+    </hbox>
+  </dialog>
+</window>
diff --git a/browser/components/preferences/dialogs/syncChooseWhatToSync.js b/browser/components/preferences/dialogs/syncChooseWhatToSync.js
new file mode 100644
index 0000000000..2cc965b4e1
--- /dev/null
+++ b/browser/components/preferences/dialogs/syncChooseWhatToSync.js
@@ -0,0 +1,60 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this file,
+ * You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+/* import-globals-from /toolkit/content/preferencesBindings.js */
+
+Preferences.addAll([
+  { id: "services.sync.engine.addons", type: "bool" },
+  { id: "services.sync.engine.bookmarks", type: "bool" },
+  { id: "services.sync.engine.history", type: "bool" },
+  { id: "services.sync.engine.tabs", type: "bool" },
+  { id: "services.sync.engine.prefs", type: "bool" },
+  { id: "services.sync.engine.passwords", type: "bool" },
+  { id: "services.sync.engine.addresses", type: "bool" },
+  { id: "services.sync.engine.creditcards", type: "bool" },
+]);
+
+let gSyncChooseWhatToSync = {
+  init() {
+    this._adjustForPrefs();
+    let options = window.arguments[0];
+    if (options.disconnectFun) {
+      // We offer 'disconnect'
+      document.addEventListener("dialogextra2", function () {
+        options.disconnectFun().then(disconnected => {
+          if (disconnected) {
+            window.close();
+          }
+        });
+      });
+    } else {
+      // no "disconnect" - hide the button.
+      document
+        .getElementById("syncChooseOptions")
+        .getButton("extra2").hidden = true;
+    }
+  },
+
+  // make whatever tweaks we need based on preferences.
+  _adjustForPrefs() {
+    // These 2 engines are unique in that there are prefs that make the
+    // entire engine unavailable (which is distinct from "disabled").
+    let enginePrefs = [
+      ["services.sync.engine.addresses", ".sync-engine-addresses"],
+      ["services.sync.engine.creditcards", ".sync-engine-creditcards"],
+    ];
+    for (let [enabledPref, className] of enginePrefs) {
+      let availablePref = enabledPref + ".available";
+      // If the engine is enabled we force it to be available, otherwise we see
+      // spooky things happen (like it magically re-appear later)
+      if (Services.prefs.getBoolPref(enabledPref, false)) {
+        Services.prefs.setBoolPref(availablePref, true);
+      }
+      if (!Services.prefs.getBoolPref(availablePref)) {
+        let elt = document.querySelector(className);
+        elt.hidden = true;
+      }
+    }
+  },
+};
diff --git a/browser/components/preferences/dialogs/syncChooseWhatToSync.xhtml b/browser/components/preferences/dialogs/syncChooseWhatToSync.xhtml
new file mode 100644
index 0000000000..2b041c4802
--- /dev/null
+++ b/browser/components/preferences/dialogs/syncChooseWhatToSync.xhtml
@@ -0,0 +1,88 @@
+<?xml version="1.0"?>
+
+<!-- -*- Mode: Java; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- -->
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+
+<window
+  type="child"
+  xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+  xmlns:html="http://www.w3.org/1999/xhtml"
+  onload="gSyncChooseWhatToSync.init();"
+  data-l10n-id="sync-choose-what-to-sync-dialog3"
+  data-l10n-attrs="title, style"
+>
+  <dialog
+    id="syncChooseOptions"
+    buttons="accept,cancel,extra2"
+    data-l10n-id="sync-choose-what-to-sync-dialog3"
+    data-l10n-attrs="buttonlabelaccept, buttonlabelextra2"
+  >
+    <linkset>
+      <html:link rel="stylesheet" href="chrome://global/skin/global.css" />
+
+      <html:link
+        rel="localization"
+        href="browser/preferences/preferences.ftl"
+      />
+      <html:link rel="localization" href="toolkit/branding/accounts.ftl" />
+    </linkset>
+    <script src="chrome://global/content/preferencesBindings.js" />
+    <script src="chrome://browser/content/preferences/dialogs/syncChooseWhatToSync.js" />
+    <description
+      class="sync-choose-dialog-description"
+      data-l10n-id="sync-choose-dialog-subtitle"
+    />
+    <html:div class="sync-engines-list">
+      <html:div class="sync-engine-bookmarks">
+        <checkbox
+          data-l10n-id="sync-engine-bookmarks"
+          preference="services.sync.engine.bookmarks"
+        />
+      </html:div>
+      <html:div class="sync-engine-history">
+        <checkbox
+          data-l10n-id="sync-engine-history"
+          preference="services.sync.engine.history"
+        />
+      </html:div>
+      <html:div class="sync-engine-tabs">
+        <checkbox
+          data-l10n-id="sync-engine-tabs"
+          preference="services.sync.engine.tabs"
+        />
+      </html:div>
+      <html:div class="sync-engine-passwords">
+        <checkbox
+          data-l10n-id="sync-engine-passwords"
+          preference="services.sync.engine.passwords"
+        />
+      </html:div>
+      <html:div class="sync-engine-addresses">
+        <checkbox
+          data-l10n-id="sync-engine-addresses"
+          preference="services.sync.engine.addresses"
+        />
+      </html:div>
+      <html:div class="sync-engine-creditcards">
+        <checkbox
+          data-l10n-id="sync-engine-payment-methods2"
+          preference="services.sync.engine.creditcards"
+        />
+      </html:div>
+      <html:div class="sync-engine-addons">
+        <checkbox
+          data-l10n-id="sync-engine-addons"
+          preference="services.sync.engine.addons"
+        />
+      </html:div>
+      <html:div class="sync-engine-prefs">
+        <checkbox
+          data-l10n-id="sync-engine-settings"
+          preference="services.sync.engine.prefs"
+        />
+      </html:div>
+    </html:div>
+  </dialog>
+</window>
diff --git a/browser/components/preferences/dialogs/translationExceptions.js b/browser/components/preferences/dialogs/translationExceptions.js
new file mode 100644
index 0000000000..27579594c9
--- /dev/null
+++ b/browser/components/preferences/dialogs/translationExceptions.js
@@ -0,0 +1,256 @@
+/* -*- indent-tabs-mode: nil; js-indent-level: 4 -*- */
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+// TODO (Bug 1817084) Remove this file when we disable the extension
+
+"use strict";
+
+const kPermissionType = "translate";
+const kLanguagesPref = "browser.translation.neverForLanguages";
+
+function Tree(aId, aData) {
+  this._data = aData;
+  this._tree = document.getElementById(aId);
+  this._tree.view = this;
+}
+
+Tree.prototype = {
+  get tree() {
+    return this._tree;
+  },
+  get isEmpty() {
+    return !this._data.length;
+  },
+  get hasSelection() {
+    return this.selection.count > 0;
+  },
+  getSelectedItems() {
+    let result = [];
+
+    let rc = this.selection.getRangeCount();
+    for (let i = 0; i < rc; ++i) {
+      let min = {},
+        max = {};
+      this.selection.getRangeAt(i, min, max);
+      for (let j = min.value; j <= max.value; ++j) {
+        result.push(this._data[j]);
+      }
+    }
+
+    return result;
+  },
+
+  // nsITreeView implementation
+  get rowCount() {
+    return this._data.length;
+  },
+  getCellText(aRow, aColumn) {
+    return this._data[aRow];
+  },
+  isSeparator(aIndex) {
+    return false;
+  },
+  isSorted() {
+    return false;
+  },
+  isContainer(aIndex) {
+    return false;
+  },
+  setTree(aTree) {},
+  getImageSrc(aRow, aColumn) {},
+  getCellValue(aRow, aColumn) {},
+  cycleHeader(column) {},
+  getRowProperties(row) {
+    return "";
+  },
+  getColumnProperties(column) {
+    return "";
+  },
+  getCellProperties(row, column) {
+    return "";
+  },
+  QueryInterface: ChromeUtils.generateQI(["nsITreeView"]),
+};
+
+function Lang(aCode, label) {
+  this.langCode = aCode;
+  this._label = label;
+}
+
+Lang.prototype = {
+  toString() {
+    return this._label;
+  },
+};
+
+var gTranslationExceptions = {
+  onLoad() {
+    if (this._siteTree) {
+      // Re-using an open dialog, clear the old observers.
+      this.uninit();
+    }
+
+    // Load site permissions into an array.
+    this._sites = [];
+    for (let perm of Services.perms.all) {
+      if (
+        perm.type == kPermissionType &&
+        perm.capability == Services.perms.DENY_ACTION
+      ) {
+        this._sites.push(perm.principal.origin);
+      }
+    }
+    Services.obs.addObserver(this, "perm-changed");
+    this._sites.sort();
+
+    this._siteTree = new Tree("sitesTree", this._sites);
+    this.onSiteSelected();
+
+    this._langs = this.getLanguageExceptions();
+    Services.prefs.addObserver(kLanguagesPref, this);
+    this._langTree = new Tree("languagesTree", this._langs);
+    this.onLanguageSelected();
+  },
+
+  // Get the list of languages we don't translate as an array.
+  getLanguageExceptions() {
+    let langs = Services.prefs.getCharPref(kLanguagesPref);
+    if (!langs) {
+      return [];
+    }
+
+    let langArr = langs.split(",");
+    let displayNames = Services.intl.getLanguageDisplayNames(
+      undefined,
+      langArr
+    );
+    let result = langArr.map((lang, i) => new Lang(lang, displayNames[i]));
+    result.sort();
+
+    return result;
+  },
+
+  observe(aSubject, aTopic, aData) {
+    if (aTopic == "perm-changed") {
+      if (aData == "cleared") {
+        if (!this._sites.length) {
+          return;
+        }
+        let removed = this._sites.splice(0, this._sites.length);
+        this._siteTree.tree.rowCountChanged(0, -removed.length);
+      } else {
+        let perm = aSubject.QueryInterface(Ci.nsIPermission);
+        if (perm.type != kPermissionType) {
+          return;
+        }
+
+        if (aData == "added") {
+          if (perm.capability != Services.perms.DENY_ACTION) {
+            return;
+          }
+          this._sites.push(perm.principal.origin);
+          this._sites.sort();
+          let tree = this._siteTree.tree;
+          tree.rowCountChanged(0, 1);
+          tree.invalidate();
+        } else if (aData == "deleted") {
+          let index = this._sites.indexOf(perm.principal.origin);
+          if (index == -1) {
+            return;
+          }
+          this._sites.splice(index, 1);
+          this._siteTree.tree.rowCountChanged(index, -1);
+          this.onSiteSelected();
+          return;
+        }
+      }
+      this.onSiteSelected();
+    } else if (aTopic == "nsPref:changed") {
+      this._langs = this.getLanguageExceptions();
+      let change = this._langs.length - this._langTree.rowCount;
+      this._langTree._data = this._langs;
+      let tree = this._langTree.tree;
+      if (change) {
+        tree.rowCountChanged(0, change);
+      }
+      tree.invalidate();
+      this.onLanguageSelected();
+    }
+  },
+
+  _handleButtonDisabling(aTree, aIdPart) {
+    let empty = aTree.isEmpty;
+    document.getElementById("removeAll" + aIdPart + "s").disabled = empty;
+    document.getElementById("remove" + aIdPart).disabled =
+      empty || !aTree.hasSelection;
+  },
+
+  onLanguageSelected() {
+    this._handleButtonDisabling(this._langTree, "Language");
+  },
+
+  onSiteSelected() {
+    this._handleButtonDisabling(this._siteTree, "Site");
+  },
+
+  onLanguageDeleted() {
+    let langs = Services.prefs.getCharPref(kLanguagesPref);
+    if (!langs) {
+      return;
+    }
+
+    let removed = this._langTree.getSelectedItems().map(l => l.langCode);
+
+    langs = langs.split(",").filter(l => !removed.includes(l));
+    Services.prefs.setCharPref(kLanguagesPref, langs.join(","));
+  },
+
+  onAllLanguagesDeleted() {
+    Services.prefs.setCharPref(kLanguagesPref, "");
+  },
+
+  onSiteDeleted() {
+    let removedSites = this._siteTree.getSelectedItems();
+    for (let origin of removedSites) {
+      let principal =
+        Services.scriptSecurityManager.createContentPrincipalFromOrigin(origin);
+      Services.perms.removeFromPrincipal(principal, kPermissionType);
+    }
+  },
+
+  onAllSitesDeleted() {
+    if (this._siteTree.isEmpty) {
+      return;
+    }
+
+    let removedSites = this._sites.splice(0, this._sites.length);
+    this._siteTree.tree.rowCountChanged(0, -removedSites.length);
+
+    for (let origin of removedSites) {
+      let principal =
+        Services.scriptSecurityManager.createContentPrincipalFromOrigin(origin);
+      Services.perms.removeFromPrincipal(principal, kPermissionType);
+    }
+
+    this.onSiteSelected();
+  },
+
+  onSiteKeyPress(aEvent) {
+    if (aEvent.keyCode == KeyEvent.DOM_VK_DELETE) {
+      this.onSiteDeleted();
+    }
+  },
+
+  onLanguageKeyPress(aEvent) {
+    if (aEvent.keyCode == KeyEvent.DOM_VK_DELETE) {
+      this.onLanguageDeleted();
+    }
+  },
+
+  uninit() {
+    Services.obs.removeObserver(this, "perm-changed");
+    Services.prefs.removeObserver(kLanguagesPref, this);
+  },
+};
diff --git a/browser/components/preferences/dialogs/translationExceptions.xhtml b/browser/components/preferences/dialogs/translationExceptions.xhtml
new file mode 100644
index 0000000000..1417595676
--- /dev/null
+++ b/browser/components/preferences/dialogs/translationExceptions.xhtml
@@ -0,0 +1,130 @@
+<?xml version="1.0"?>
+
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+
+<!-- TODO (Bug 1817084) Remove this file when we disable the extension -->
+
+<window
+  id="TranslationDialog"
+  data-l10n-id="translation-window2"
+  data-l10n-attrs="title, style"
+  xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+  xmlns:html="http://www.w3.org/1999/xhtml"
+  onload="gTranslationExceptions.onLoad();"
+  onunload="gTranslationExceptions.uninit();"
+  persist="width height"
+>
+  <dialog
+    buttons="accept"
+    data-l10n-id="translation-dialog"
+    data-l10n-attrs="buttonlabelaccept, buttonaccesskeyaccept"
+  >
+    <linkset>
+      <html:link rel="stylesheet" href="chrome://global/skin/global.css" />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/skin/preferences/preferences.css"
+      />
+
+      <html:link
+        rel="localization"
+        href="browser/preferences/translation.ftl"
+      />
+    </linkset>
+
+    <script src="chrome://browser/content/preferences/dialogs/translationExceptions.js" />
+
+    <keyset>
+      <key
+        data-l10n-id="translation-close-key"
+        modifiers="accel"
+        oncommand="window.close();"
+      />
+    </keyset>
+
+    <vbox class="contentPane">
+      <vbox flex="1">
+        <label
+          id="languagesLabel"
+          data-l10n-id="translation-languages-disabled-desc"
+          control="permissionsTree"
+        />
+        <separator class="thin" />
+        <tree
+          id="languagesTree"
+          flex="1"
+          style="height: 12em"
+          hidecolumnpicker="true"
+          onkeypress="gTranslationExceptions.onLanguageKeyPress(event)"
+          onselect="gTranslationExceptions.onLanguageSelected();"
+        >
+          <treecols>
+            <treecol
+              id="languageCol"
+              data-l10n-id="translation-languages-column"
+              flex="1"
+            />
+          </treecols>
+          <treechildren />
+        </tree>
+      </vbox>
+      <hbox class="actionButtons" pack="end">
+        <button
+          id="removeLanguage"
+          disabled="true"
+          data-l10n-id="translation-languages-button-remove"
+          oncommand="gTranslationExceptions.onLanguageDeleted();"
+        />
+        <button
+          id="removeAllLanguages"
+          data-l10n-id="translation-languages-button-remove-all"
+          oncommand="gTranslationExceptions.onAllLanguagesDeleted();"
+        />
+        <spacer flex="1" />
+      </hbox>
+      <separator />
+      <vbox flex="1">
+        <label
+          id="languagesLabel"
+          data-l10n-id="translation-sites-disabled-desc"
+          control="permissionsTree"
+        />
+        <separator class="thin" />
+        <tree
+          id="sitesTree"
+          flex="1"
+          style="height: 12em"
+          hidecolumnpicker="true"
+          onkeypress="gTranslationExceptions.onSiteKeyPress(event)"
+          onselect="gTranslationExceptions.onSiteSelected();"
+        >
+          <treecols>
+            <treecol
+              id="siteCol"
+              data-l10n-id="translation-sites-column"
+              flex="1"
+            />
+          </treecols>
+          <treechildren />
+        </tree>
+      </vbox>
+    </vbox>
+
+    <hbox class="actionButtons" pack="end">
+      <button
+        id="removeSite"
+        disabled="true"
+        data-l10n-id="translation-sites-button-remove"
+        oncommand="gTranslationExceptions.onSiteDeleted();"
+      />
+      <button
+        id="removeAllSites"
+        data-l10n-id="translation-sites-button-remove-all"
+        oncommand="gTranslationExceptions.onAllSitesDeleted();"
+      />
+      <spacer flex="1" />
+    </hbox>
+  </dialog>
+</window>
diff --git a/browser/components/preferences/dialogs/translations.js b/browser/components/preferences/dialogs/translations.js
new file mode 100644
index 0000000000..826e6efb4b
--- /dev/null
+++ b/browser/components/preferences/dialogs/translations.js
@@ -0,0 +1,454 @@
+/* -*- indent-tabs-mode: nil; js-indent-level: 4 -*- */
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+"use strict";
+
+/**
+ * The permission type to give to Services.perms for Translations.
+ */
+const TRANSLATIONS_PERMISSION = "translations";
+/**
+ * The list of BCP-47 language tags that will trigger auto-translate.
+ */
+const ALWAYS_TRANSLATE_LANGS_PREF =
+  "browser.translations.alwaysTranslateLanguages";
+/**
+ * The list of BCP-47 language tags that will prevent showing Translations UI.
+ */
+const NEVER_TRANSLATE_LANGS_PREF =
+  "browser.translations.neverTranslateLanguages";
+
+ChromeUtils.defineESModuleGetters(this, {
+  TranslationsParent: "resource://gre/actors/TranslationsParent.sys.mjs",
+});
+
+function Tree(aId, aData) {
+  this._data = aData;
+  this._tree = document.getElementById(aId);
+  this._tree.view = this;
+}
+
+Tree.prototype = {
+  get tree() {
+    return this._tree;
+  },
+  get isEmpty() {
+    return !this._data.length;
+  },
+  get hasSelection() {
+    return this.selection.count > 0;
+  },
+  getSelectedItems() {
+    let result = [];
+
+    let rc = this.selection.getRangeCount();
+    for (let i = 0; i < rc; ++i) {
+      let min = {},
+        max = {};
+      this.selection.getRangeAt(i, min, max);
+      for (let j = min.value; j <= max.value; ++j) {
+        result.push(this._data[j]);
+      }
+    }
+
+    return result;
+  },
+
+  // nsITreeView implementation
+  get rowCount() {
+    return this._data.length;
+  },
+  getCellText(aRow, aColumn) {
+    return this._data[aRow];
+  },
+  isSeparator(aIndex) {
+    return false;
+  },
+  isSorted() {
+    return false;
+  },
+  isContainer(aIndex) {
+    return false;
+  },
+  setTree(aTree) {},
+  getImageSrc(aRow, aColumn) {},
+  getCellValue(aRow, aColumn) {},
+  cycleHeader(column) {},
+  getRowProperties(row) {
+    return "";
+  },
+  getColumnProperties(column) {
+    return "";
+  },
+  getCellProperties(row, column) {
+    return "";
+  },
+  QueryInterface: ChromeUtils.generateQI(["nsITreeView"]),
+};
+
+function Lang(aCode, label) {
+  this.langCode = aCode;
+  this._label = label;
+}
+
+Lang.prototype = {
+  toString() {
+    return this._label;
+  },
+};
+
+var gTranslationsSettings = {
+  onLoad() {
+    if (this._neverTranslateSiteTree) {
+      // Re-using an open dialog, clear the old observers.
+      this.removeObservers();
+    }
+
+    // Load site permissions into an array.
+    this._neverTranslateSites = TranslationsParent.listNeverTranslateSites();
+
+    // Load language tags into arrays.
+    this._alwaysTranslateLangs = this.getAlwaysTranslateLanguages();
+    this._neverTranslateLangs = this.getNeverTranslateLanguages();
+
+    // Add observers for relevant prefs and permissions.
+    Services.obs.addObserver(this, "perm-changed");
+    Services.prefs.addObserver(ALWAYS_TRANSLATE_LANGS_PREF, this);
+    Services.prefs.addObserver(NEVER_TRANSLATE_LANGS_PREF, this);
+
+    // Build trees from the arrays.
+    this._alwaysTranslateLangsTree = new Tree(
+      "alwaysTranslateLanguagesTree",
+      this._alwaysTranslateLangs
+    );
+    this._neverTranslateLangsTree = new Tree(
+      "neverTranslateLanguagesTree",
+      this._neverTranslateLangs
+    );
+    this._neverTranslateSiteTree = new Tree(
+      "neverTranslateSitesTree",
+      this._neverTranslateSites
+    );
+
+    // Ensure the UI for each group is in the correct state.
+    this.onSelectAlwaysTranslateLanguage();
+    this.onSelectNeverTranslateLanguage();
+    this.onSelectNeverTranslateSite();
+  },
+
+  /**
+   * Retrieves the value of a char-pref splits its value into an
+   * array delimited by commas.
+   *
+   * This is used for the translations preferences which are comma-
+   * separated lists of BCP-47 language tags.
+   *
+   * @param {string} pref
+   * @returns {Array<string>}
+   */
+  getLangsFromPref(pref) {
+    let rawLangs = Services.prefs.getCharPref(pref);
+    if (!rawLangs) {
+      return [];
+    }
+
+    let langArr = rawLangs.split(",");
+    let displayNames = Services.intl.getLanguageDisplayNames(
+      undefined,
+      langArr
+    );
+    let langs = langArr.map((lang, i) => new Lang(lang, displayNames[i]));
+    langs.sort();
+
+    return langs;
+  },
+
+  /**
+   * Retrieves the always-translate language tags as an array.
+   * @returns {Array<string>}
+   */
+  getAlwaysTranslateLanguages() {
+    return this.getLangsFromPref(ALWAYS_TRANSLATE_LANGS_PREF);
+  },
+
+  /**
+   * Retrieves the never-translate language tags as an array.
+   * @returns {Array<string>}
+   */
+  getNeverTranslateLanguages() {
+    return this.getLangsFromPref(NEVER_TRANSLATE_LANGS_PREF);
+  },
+
+  /**
+   * Handles updating the UI components on pref or permission changes.
+   */
+  observe(aSubject, aTopic, aData) {
+    if (aTopic === "perm-changed") {
+      if (aData === "cleared") {
+        // Permissions have been cleared
+        if (!this._neverTranslateSites.length) {
+          // There were no sites with permissions set, nothing to do.
+          return;
+        }
+        // Update the tree based on the amount of permissions removed.
+        let removed = this._neverTranslateSites.splice(
+          0,
+          this._neverTranslateSites.length
+        );
+        this._neverTranslateSiteTree.tree.rowCountChanged(0, -removed.length);
+      } else {
+        let perm = aSubject.QueryInterface(Ci.nsIPermission);
+        if (perm.type != TRANSLATIONS_PERMISSION) {
+          // The updated permission was not for Translations, nothing to do.
+          return;
+        }
+        if (aData === "added") {
+          if (perm.capability != Services.perms.DENY_ACTION) {
+            // We are only showing data for sites we should never translate.
+            // If the permission is not DENY_ACTION, we don't care about it here.
+            return;
+          }
+          this._neverTranslateSites.push(perm.principal.origin);
+          this._neverTranslateSites.sort();
+          let tree = this._neverTranslateSiteTree.tree;
+          tree.rowCountChanged(0, 1);
+          tree.invalidate();
+        } else if (aData == "deleted") {
+          let index = this._neverTranslateSites.indexOf(perm.principal.origin);
+          if (index == -1) {
+            // The deleted permission was not in the tree, nothing to do.
+            return;
+          }
+          this._neverTranslateSites.splice(index, 1);
+          this._neverTranslateSiteTree.tree.rowCountChanged(index, -1);
+        }
+      }
+      // Ensure the UI updates to the changes.
+      this.onSelectNeverTranslateSite();
+    } else if (aTopic === "nsPref:changed") {
+      switch (aData) {
+        case ALWAYS_TRANSLATE_LANGS_PREF: {
+          this._alwaysTranslateLangs = this.getAlwaysTranslateLanguages();
+
+          let alwaysTranslateLangsChange =
+            this._alwaysTranslateLangs.length -
+            this._alwaysTranslateLangsTree.rowCount;
+
+          this._alwaysTranslateLangsTree._data = this._alwaysTranslateLangs;
+          let alwaysTranslateLangsTree = this._alwaysTranslateLangsTree.tree;
+
+          if (alwaysTranslateLangsChange) {
+            alwaysTranslateLangsTree.rowCountChanged(
+              0,
+              alwaysTranslateLangsChange
+            );
+          }
+
+          alwaysTranslateLangsTree.invalidate();
+
+          // Ensure the UI updates to the changes.
+          this.onSelectAlwaysTranslateLanguage();
+          break;
+        }
+        case NEVER_TRANSLATE_LANGS_PREF: {
+          this._neverTranslateLangs = this.getNeverTranslateLanguages();
+
+          let neverTranslateLangsChange =
+            this._neverTranslateLangs.length -
+            this._neverTranslateLangsTree.rowCount;
+
+          this._neverTranslateLangsTree._data = this._neverTranslateLangs;
+          let neverTranslateLangsTree = this._neverTranslateLangsTree.tree;
+
+          if (neverTranslateLangsChange) {
+            neverTranslateLangsTree.rowCountChanged(
+              0,
+              neverTranslateLangsChange
+            );
+          }
+
+          neverTranslateLangsTree.invalidate();
+
+          // Ensure the UI updates to the changes.
+          this.onSelectNeverTranslateLanguage();
+          break;
+        }
+      }
+    }
+  },
+
+  /**
+   * Ensures that buttons states are enabled/disabled accordingly based on the
+   * content of the trees.
+   *
+   * The remove button should be enabled only if an item is selected.
+   * The removeAll button should be enabled any time the tree has content.
+   *
+   * @param {Tree} aTree
+   * @param {string} aIdPart
+   */
+  _handleButtonDisabling(aTree, aIdPart) {
+    let empty = aTree.isEmpty;
+    document.getElementById("removeAll" + aIdPart + "s").disabled = empty;
+    document.getElementById("remove" + aIdPart).disabled =
+      empty || !aTree.hasSelection;
+  },
+
+  /**
+   * Updates the UI state for the always-translate languages section.
+   */
+  onSelectAlwaysTranslateLanguage() {
+    this._handleButtonDisabling(
+      this._alwaysTranslateLangsTree,
+      "AlwaysTranslateLanguage"
+    );
+  },
+
+  /**
+   * Updates the UI state for the never-translate languages section.
+   */
+  onSelectNeverTranslateLanguage() {
+    this._handleButtonDisabling(
+      this._neverTranslateLangsTree,
+      "NeverTranslateLanguage"
+    );
+  },
+
+  /**
+   * Updates the UI state for the never-translate sites section.
+   */
+  onSelectNeverTranslateSite() {
+    this._handleButtonDisabling(
+      this._neverTranslateSiteTree,
+      "NeverTranslateSite"
+    );
+  },
+
+  /**
+   * Updates the value of a language pref to match when a language is removed
+   * through the UI.
+   *
+   * @param {string} pref
+   * @param {Tree} tree
+   */
+  _onRemoveLanguage(pref, tree) {
+    let langs = Services.prefs.getCharPref(pref);
+    if (!langs) {
+      return;
+    }
+
+    let removed = tree.getSelectedItems().map(l => l.langCode);
+
+    langs = langs.split(",").filter(l => !removed.includes(l));
+    Services.prefs.setCharPref(pref, langs.join(","));
+  },
+
+  /**
+   * Updates the never-translate language pref when a never-translate language
+   * is removed via the UI.
+   */
+  onRemoveAlwaysTranslateLanguage() {
+    this._onRemoveLanguage(
+      ALWAYS_TRANSLATE_LANGS_PREF,
+      this._alwaysTranslateLangsTree
+    );
+  },
+
+  /**
+   * Updates the always-translate language pref when a always-translate language
+   * is removed via the UI.
+   */
+  onRemoveNeverTranslateLanguage() {
+    this._onRemoveLanguage(
+      NEVER_TRANSLATE_LANGS_PREF,
+      this._neverTranslateLangsTree
+    );
+  },
+
+  /**
+   * Updates the permissions for a never-translate site when it is removed via the UI.
+   */
+  onRemoveNeverTranslateSite() {
+    let removedNeverTranslateSites =
+      this._neverTranslateSiteTree.getSelectedItems();
+    for (let origin of removedNeverTranslateSites) {
+      TranslationsParent.setNeverTranslateSiteByOrigin(false, origin);
+    }
+  },
+
+  /**
+   * Clears the always-translate languages pref when the list is cleared in the UI.
+   */
+  onRemoveAllAlwaysTranslateLanguages() {
+    Services.prefs.setCharPref(ALWAYS_TRANSLATE_LANGS_PREF, "");
+  },
+
+  /**
+   * Clears the never-translate languages pref when the list is cleared in the UI.
+   */
+  onRemoveAllNeverTranslateLanguages() {
+    Services.prefs.setCharPref(NEVER_TRANSLATE_LANGS_PREF, "");
+  },
+
+  /**
+   * Clears the never-translate sites pref when the list is cleared in the UI.
+   */
+  onRemoveAllNeverTranslateSites() {
+    if (this._neverTranslateSiteTree.isEmpty) {
+      return;
+    }
+
+    let removedNeverTranslateSites = this._neverTranslateSites.splice(
+      0,
+      this._neverTranslateSites.length
+    );
+    this._neverTranslateSiteTree.tree.rowCountChanged(
+      0,
+      -removedNeverTranslateSites.length
+    );
+
+    for (let origin of removedNeverTranslateSites) {
+      TranslationsParent.setNeverTranslateSiteByOrigin(false, origin);
+    }
+
+    this.onSelectNeverTranslateSite();
+  },
+
+  /**
+   * Handles removing a selected always-translate language via the keyboard.
+   */
+  onAlwaysTranslateLanguageKeyPress(aEvent) {
+    if (aEvent.keyCode == KeyEvent.DOM_VK_DELETE) {
+      this.onRemoveAlwaysTranslateLanguage();
+    }
+  },
+
+  /**
+   * Handles removing a selected never-translate language via the keyboard.
+   */
+  onNeverTranslateLanguageKeyPress(aEvent) {
+    if (aEvent.keyCode == KeyEvent.DOM_VK_DELETE) {
+      this.onRemoveNeverTranslateLanguage();
+    }
+  },
+
+  /**
+   * Handles removing a selected never-translate site via the keyboard.
+   */
+  onNeverTranslateSiteKeyPress(aEvent) {
+    if (aEvent.keyCode == KeyEvent.DOM_VK_DELETE) {
+      this.onRemoveNeverTranslateSite();
+    }
+  },
+
+  /**
+   * Removes any active preference and permissions observers.
+   */
+  removeObservers() {
+    Services.obs.removeObserver(this, "perm-changed");
+    Services.prefs.removeObserver(ALWAYS_TRANSLATE_LANGS_PREF, this);
+    Services.prefs.removeObserver(NEVER_TRANSLATE_LANGS_PREF, this);
+  },
+};
diff --git a/browser/components/preferences/dialogs/translations.xhtml b/browser/components/preferences/dialogs/translations.xhtml
new file mode 100644
index 0000000000..1a55631b0c
--- /dev/null
+++ b/browser/components/preferences/dialogs/translations.xhtml
@@ -0,0 +1,161 @@
+<?xml version="1.0"?>
+
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+
+<window
+  id="TranslationsDialog"
+  data-l10n-id="translations-settings-title"
+  data-l10n-attrs="title, style"
+  xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+  xmlns:html="http://www.w3.org/1999/xhtml"
+  onload="gTranslationsSettings.onLoad();"
+  onunload="gTranslationsSettings.removeObservers();"
+  persist="width height"
+>
+  <dialog
+    buttons="accept"
+    data-l10n-id="translations-settings-close-dialog"
+    data-l10n-attrs="buttonlabelaccept, buttonaccesskeyaccept"
+  >
+    <linkset>
+      <html:link rel="stylesheet" href="chrome://global/skin/global.css" />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/skin/preferences/preferences.css"
+      />
+
+      <html:link rel="localization" href="browser/translations.ftl" />
+    </linkset>
+
+    <script src="chrome://browser/content/preferences/dialogs/translations.js" />
+
+    <keyset>
+      <key
+        data-l10n-id="translations-settings-close-key"
+        modifiers="accel"
+        oncommand="window.close();"
+      />
+    </keyset>
+
+    <vbox class="contentPane">
+      <vbox flex="1">
+        <label
+          id="alwaysTranslateLanguagesLabel"
+          data-l10n-id="translations-settings-always-translate-langs-description"
+          control="permissionsTree"
+        />
+        <separator class="thin" />
+        <tree
+          id="alwaysTranslateLanguagesTree"
+          flex="1"
+          style="height: 12em"
+          hidecolumnpicker="true"
+          onkeypress="gTranslationsSettings.onAlwaysTranslateLanguageKeyPress(event)"
+          onselect="gTranslationsSettings.onSelectAlwaysTranslateLanguage();"
+        >
+          <treecols>
+            <treecol
+              id="languageCol"
+              data-l10n-id="translations-settings-languages-column"
+              flex="1"
+            />
+          </treecols>
+          <treechildren />
+        </tree>
+      </vbox>
+      <hbox class="actionButtons" pack="start">
+        <button
+          id="removeAlwaysTranslateLanguage"
+          disabled="true"
+          data-l10n-id="translations-settings-remove-language-button"
+          oncommand="gTranslationsSettings.onRemoveAlwaysTranslateLanguage();"
+        />
+        <button
+          id="removeAllAlwaysTranslateLanguages"
+          data-l10n-id="translations-settings-remove-all-languages-button"
+          oncommand="gTranslationsSettings.onRemoveAllAlwaysTranslateLanguages();"
+        />
+      </hbox>
+      <separator />
+      <vbox flex="1">
+        <label
+          id="neverTranslateLanguagesLabel"
+          data-l10n-id="translations-settings-never-translate-langs-description"
+          control="permissionsTree"
+        />
+        <separator class="thin" />
+        <tree
+          id="neverTranslateLanguagesTree"
+          flex="1"
+          style="height: 12em"
+          hidecolumnpicker="true"
+          onkeypress="gTranslationsSettings.onNeverTranslateLanguageKeyPress(event)"
+          onselect="gTranslationsSettings.onSelectNeverTranslateLanguage();"
+        >
+          <treecols>
+            <treecol
+              id="languageCol"
+              data-l10n-id="translations-settings-languages-column"
+              flex="1"
+            />
+          </treecols>
+          <treechildren />
+        </tree>
+      </vbox>
+      <hbox class="actionButtons" pack="start">
+        <button
+          id="removeNeverTranslateLanguage"
+          disabled="true"
+          data-l10n-id="translations-settings-remove-language-button"
+          oncommand="gTranslationsSettings.onRemoveNeverTranslateLanguage();"
+        />
+        <button
+          id="removeAllNeverTranslateLanguages"
+          data-l10n-id="translations-settings-remove-all-languages-button"
+          oncommand="gTranslationsSettings.onRemoveAllNeverTranslateLanguages();"
+        />
+      </hbox>
+      <separator />
+      <vbox flex="1">
+        <label
+          id="neverTranslateSitesLabel"
+          data-l10n-id="translations-settings-never-translate-sites-description"
+          control="permissionsTree"
+        />
+        <separator class="thin" />
+        <tree
+          id="neverTranslateSitesTree"
+          flex="1"
+          style="height: 12em"
+          hidecolumnpicker="true"
+          onkeypress="gTranslationsSettings.onNeverTranslateSiteKeyPress(event)"
+          onselect="gTranslationsSettings.onSelectNeverTranslateSite();"
+        >
+          <treecols>
+            <treecol
+              id="siteCol"
+              data-l10n-id="translations-settings-sites-column"
+              flex="1"
+            />
+          </treecols>
+          <treechildren />
+        </tree>
+      </vbox>
+      <hbox class="actionButtons" pack="start">
+        <button
+          id="removeNeverTranslateSite"
+          disabled="true"
+          data-l10n-id="translations-settings-remove-site-button"
+          oncommand="gTranslationsSettings.onRemoveNeverTranslateSite();"
+        />
+        <button
+          id="removeAllNeverTranslateSites"
+          data-l10n-id="translations-settings-remove-all-sites-button"
+          oncommand="gTranslationsSettings.onRemoveAllNeverTranslateSites();"
+        />
+      </hbox>
+    </vbox>
+  </dialog>
+</window>
diff --git a/browser/components/preferences/experimental.inc.xhtml b/browser/components/preferences/experimental.inc.xhtml
new file mode 100644
index 0000000000..260d4e31ba
--- /dev/null
+++ b/browser/components/preferences/experimental.inc.xhtml
@@ -0,0 +1,38 @@
+# This Source Code Form is subject to the terms of the Mozilla Public
+# License, v. 2.0. If a copy of the MPL was not distributed with this
+# file, You can obtain one at http://mozilla.org/MPL/2.0/.
+
+<!-- Experimental panel -->
+
+<script src="chrome://browser/content/preferences/experimental.js"/>
+<html:template id="template-paneExperimental">
+<vbox id="firefoxExperimentalCategory"
+      class="subcategory"
+      hidden="true"
+      data-category="paneExperimental">
+  <html:h1 style="flex: 1;" data-l10n-id="pane-experimental-title"/>
+  <label><html:h2 id="pane-experimental-subtitle" data-l10n-id="pane-experimental-subtitle"/></label>
+  <html:p data-l10n-id="pane-experimental-description2" class="description-deemphasized"/>
+  <hbox pack="end">
+    <button id="experimentalCategory-reset"
+            class="accessory-button"
+            data-l10n-id="pane-experimental-reset"/>
+  </hbox>
+</vbox>
+
+<groupbox data-category="paneExperimental"
+          id="pane-experimental-featureGates"
+          hidden="true">
+  <label class="search-header" hidden="true">
+    <html:h2 id="pane-experimental-search-results-header" data-l10n-id="pane-experimental-search-results-header"/>
+  </label>
+  <html:p data-l10n-id="pane-experimental-description2" class="description-deemphasized"/>
+</groupbox>
+</html:template>
+
+<html:template id="template-featureGate">
+    <html:div class="featureGate">
+        <checkbox class="featureGateCheckbox"/>
+        <description class="text-deemphasized featureGateDescription"/>
+    </html:div>
+</html:template>
diff --git a/browser/components/preferences/experimental.js b/browser/components/preferences/experimental.js
new file mode 100644
index 0000000000..266aeabc4f
--- /dev/null
+++ b/browser/components/preferences/experimental.js
@@ -0,0 +1,163 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this file,
+ * You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+/* import-globals-from preferences.js */
+
+var gExperimentalPane = {
+  inited: false,
+  _template: null,
+  _featureGatesContainer: null,
+  _boundRestartObserver: null,
+  _observedPrefs: [],
+  _shouldPromptForRestart: true,
+
+  _featureGatePrefTypeToPrefServiceType(featureGatePrefType) {
+    if (featureGatePrefType != "boolean") {
+      throw new Error("Only boolean FeatureGates are supported");
+    }
+    return "bool";
+  },
+
+  async _observeRestart(aSubject, aTopic, aData) {
+    if (!this._shouldPromptForRestart) {
+      return;
+    }
+    let prefValue = Services.prefs.getBoolPref(aData);
+    let buttonIndex = await confirmRestartPrompt(prefValue, 1, true, false);
+    if (buttonIndex == CONFIRM_RESTART_PROMPT_RESTART_NOW) {
+      Services.startup.quit(
+        Ci.nsIAppStartup.eAttemptQuit | Ci.nsIAppStartup.eRestart
+      );
+      return;
+    }
+    this._shouldPromptForRestart = false;
+    Services.prefs.setBoolPref(aData, !prefValue);
+    this._shouldPromptForRestart = true;
+  },
+
+  addPrefObserver(name, fn) {
+    this._observedPrefs.push({ name, fn });
+    Services.prefs.addObserver(name, fn);
+  },
+
+  removePrefObservers() {
+    for (let { name, fn } of this._observedPrefs) {
+      Services.prefs.removeObserver(name, fn);
+    }
+    this._observedPrefs = [];
+  },
+
+  // Reset the features to their default values
+  async resetAllFeatures() {
+    let features = await gExperimentalPane.getFeatures();
+    for (let feature of features) {
+      Services.prefs.setBoolPref(feature.preference, feature.defaultValue);
+    }
+  },
+
+  async getFeatures() {
+    let searchParams = new URLSearchParams(document.documentURIObject.query);
+    let definitionsUrl = searchParams.get("definitionsUrl");
+    let features = await FeatureGate.all(definitionsUrl);
+    return features.filter(f => f.isPublic);
+  },
+
+  async _sortFeatures(features) {
+    // Sort the features alphabetically by their title
+    let titles = await document.l10n.formatMessages(
+      features.map(f => {
+        return { id: f.title };
+      })
+    );
+    titles = titles.map((title, index) => [title.attributes[0].value, index]);
+    titles.sort((a, b) => a[0].toLowerCase().localeCompare(b[0].toLowerCase()));
+    // Get the features in order of sorted titles.
+    return titles.map(([, index]) => features[index]);
+  },
+
+  async init() {
+    if (this.inited) {
+      return;
+    }
+    this.inited = true;
+
+    let features = await this.getFeatures();
+    let shouldHide = !features.length;
+    document.getElementById("category-experimental").hidden = shouldHide;
+    // Cache the visibility so we can show it quicker in subsequent loads.
+    Services.prefs.setBoolPref(
+      "browser.preferences.experimental.hidden",
+      shouldHide
+    );
+    if (shouldHide) {
+      // Remove the 'experimental' category if there are no available features
+      document.getElementById("firefoxExperimentalCategory").remove();
+      if (
+        document.getElementById("categories").selectedItem?.id ==
+        "category-experimental"
+      ) {
+        // Leave the 'experimental' category if there are no available features
+        gotoPref("general");
+        return;
+      }
+    }
+
+    features = await this._sortFeatures(features);
+
+    setEventListener(
+      "experimentalCategory-reset",
+      "command",
+      gExperimentalPane.resetAllFeatures
+    );
+
+    window.addEventListener("unload", () => this.removePrefObservers());
+    this._template = document.getElementById("template-featureGate");
+    this._featureGatesContainer = document.getElementById(
+      "pane-experimental-featureGates"
+    );
+    this._boundRestartObserver = this._observeRestart.bind(this);
+    let frag = document.createDocumentFragment();
+    for (let feature of features) {
+      if (Preferences.get(feature.preference)) {
+        console.error(
+          "Preference control already exists for experimental feature '" +
+            feature.id +
+            "' with preference '" +
+            feature.preference +
+            "'"
+        );
+        continue;
+      }
+      if (feature.restartRequired) {
+        this.addPrefObserver(feature.preference, this._boundRestartObserver);
+      }
+      let template = this._template.content.cloneNode(true);
+      let description = template.querySelector(".featureGateDescription");
+      description.id = feature.id + "-description";
+      let descriptionLinks = feature.descriptionLinks || {};
+      for (let [key, value] of Object.entries(descriptionLinks)) {
+        let link = document.createElement("a");
+        link.setAttribute("data-l10n-name", key);
+        link.setAttribute("href", value);
+        link.setAttribute("target", "_blank");
+        description.append(link);
+      }
+      document.l10n.setAttributes(description, feature.description);
+      let checkbox = template.querySelector(".featureGateCheckbox");
+      checkbox.setAttribute("preference", feature.preference);
+      checkbox.id = feature.id;
+      checkbox.setAttribute("aria-describedby", description.id);
+      document.l10n.setAttributes(checkbox, feature.title);
+      frag.appendChild(template);
+      let preference = Preferences.add({
+        id: feature.preference,
+        type: gExperimentalPane._featureGatePrefTypeToPrefServiceType(
+          feature.type
+        ),
+      });
+      preference.setElementValue(checkbox);
+    }
+    this._featureGatesContainer.appendChild(frag);
+  },
+};
diff --git a/browser/components/preferences/extensionControlled.js b/browser/components/preferences/extensionControlled.js
new file mode 100644
index 0000000000..3c6f78ab42
--- /dev/null
+++ b/browser/components/preferences/extensionControlled.js
@@ -0,0 +1,309 @@
+/* - This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this file,
+   - You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+/* import-globals-from preferences.js */
+
+"use strict";
+
+var { XPCOMUtils } = ChromeUtils.importESModule(
+  "resource://gre/modules/XPCOMUtils.sys.mjs"
+);
+
+// Note: we get loaded in dialogs so we need to define our
+// own getters, separate from preferences.js .
+ChromeUtils.defineESModuleGetters(this, {
+  AddonManager: "resource://gre/modules/AddonManager.sys.mjs",
+  BrowserUtils: "resource://gre/modules/BrowserUtils.sys.mjs",
+  DeferredTask: "resource://gre/modules/DeferredTask.sys.mjs",
+
+  ExtensionPreferencesManager:
+    "resource://gre/modules/ExtensionPreferencesManager.sys.mjs",
+
+  ExtensionSettingsStore:
+    "resource://gre/modules/ExtensionSettingsStore.sys.mjs",
+
+  Management: "resource://gre/modules/Extension.sys.mjs",
+});
+
+const PREF_SETTING_TYPE = "prefs";
+const PROXY_KEY = "proxy.settings";
+const API_PROXY_PREFS = [
+  "network.proxy.type",
+  "network.proxy.http",
+  "network.proxy.http_port",
+  "network.proxy.share_proxy_settings",
+  "network.proxy.ssl",
+  "network.proxy.ssl_port",
+  "network.proxy.socks",
+  "network.proxy.socks_port",
+  "network.proxy.socks_version",
+  "network.proxy.socks_remote_dns",
+  "network.proxy.no_proxies_on",
+  "network.proxy.autoconfig_url",
+  "signon.autologin.proxy",
+];
+
+let extensionControlledContentIds = {
+  "privacy.containers": "browserContainersExtensionContent",
+  webNotificationsDisabled: "browserNotificationsPermissionExtensionContent",
+  "services.passwordSavingEnabled": "passwordManagerExtensionContent",
+  "proxy.settings": "proxyExtensionContent",
+  get "websites.trackingProtectionMode"() {
+    return {
+      button: "contentBlockingDisableTrackingProtectionExtension",
+      section: "contentBlockingTrackingProtectionExtensionContentLabel",
+    };
+  },
+};
+
+const extensionControlledL10nKeys = {
+  webNotificationsDisabled: "web-notifications",
+  "services.passwordSavingEnabled": "password-saving",
+  "privacy.containers": "privacy-containers",
+  "websites.trackingProtectionMode": "websites-content-blocking-all-trackers",
+  "proxy.settings": "proxy-config",
+};
+
+let extensionControlledIds = {};
+
+/**
+ * Check if a pref is being managed by an extension.
+ */
+async function getControllingExtensionInfo(type, settingName) {
+  await ExtensionSettingsStore.initialize();
+  return ExtensionSettingsStore.getSetting(type, settingName);
+}
+
+function getControllingExtensionEls(settingName) {
+  let idInfo = extensionControlledContentIds[settingName];
+  let section = document.getElementById(idInfo.section || idInfo);
+  let button = idInfo.button
+    ? document.getElementById(idInfo.button)
+    : section.querySelector("button");
+  return {
+    section,
+    button,
+    description: section.querySelector("description"),
+  };
+}
+
+async function getControllingExtension(type, settingName) {
+  let info = await getControllingExtensionInfo(type, settingName);
+  let addon = info && info.id && (await AddonManager.getAddonByID(info.id));
+  return addon;
+}
+
+async function handleControllingExtension(type, settingName) {
+  let addon = await getControllingExtension(type, settingName);
+
+  // Sometimes the ExtensionSettingsStore gets in a bad state where it thinks
+  // an extension is controlling a setting but the extension has been uninstalled
+  // outside of the regular lifecycle. If the extension isn't currently installed
+  // then we should treat the setting as not being controlled.
+  // See https://bugzilla.mozilla.org/show_bug.cgi?id=1411046 for an example.
+  if (addon) {
+    extensionControlledIds[settingName] = addon.id;
+    showControllingExtension(settingName, addon);
+  } else {
+    let elements = getControllingExtensionEls(settingName);
+    if (
+      extensionControlledIds[settingName] &&
+      !document.hidden &&
+      elements.button
+    ) {
+      showEnableExtensionMessage(settingName);
+    } else {
+      hideControllingExtension(settingName);
+    }
+    delete extensionControlledIds[settingName];
+  }
+
+  return !!addon;
+}
+
+function settingNameToL10nID(settingName) {
+  if (!extensionControlledL10nKeys.hasOwnProperty(settingName)) {
+    throw new Error(
+      `Unknown extension controlled setting name: ${settingName}`
+    );
+  }
+  return `extension-controlling-${extensionControlledL10nKeys[settingName]}`;
+}
+
+/**
+ * Set the localization data for the description of the controlling extension.
+ *
+ * The function alters the inner DOM structure of the fragment to, depending
+ * on the `addon` argument, remove the `<img/>` element or ensure it's
+ * set to the correct src.
+ * This allows Fluent DOM Overlays to localize the fragment.
+ *
+ * @param elem {Element}
+ *        <description> element to be annotated
+ * @param addon {Object?}
+ *        Addon object with meta information about the addon (or null)
+ * @param settingName {String}
+ *        If `addon` is set this handled the name of the setting that will be used
+ *        to fetch the l10n id for the given message.
+ *        If `addon` is set to null, this will be the full l10n-id assigned to the
+ *        element.
+ */
+function setControllingExtensionDescription(elem, addon, settingName) {
+  const existingImg = elem.querySelector("img");
+  if (addon === null) {
+    // If the element has an image child element,
+    // remove it.
+    if (existingImg) {
+      existingImg.remove();
+    }
+    document.l10n.setAttributes(elem, settingName);
+    return;
+  }
+
+  const defaultIcon = "chrome://mozapps/skin/extensions/extensionGeneric.svg";
+  const src = addon.iconURL || defaultIcon;
+
+  if (!existingImg) {
+    // If an element doesn't have an image child
+    // node, add it.
+    let image = document.createElementNS("http://www.w3.org/1999/xhtml", "img");
+    image.setAttribute("src", src);
+    image.setAttribute("data-l10n-name", "icon");
+    image.setAttribute("role", "presentation");
+    image.classList.add("extension-controlled-icon");
+    elem.appendChild(image);
+  } else if (existingImg.getAttribute("src") !== src) {
+    existingImg.setAttribute("src", src);
+  }
+
+  const l10nId = settingNameToL10nID(settingName);
+  document.l10n.setAttributes(elem, l10nId, {
+    name: addon.name,
+  });
+}
+
+async function showControllingExtension(settingName, addon) {
+  // Tell the user what extension is controlling the setting.
+  let elements = getControllingExtensionEls(settingName);
+
+  elements.section.classList.remove("extension-controlled-disabled");
+  let description = elements.description;
+
+  setControllingExtensionDescription(description, addon, settingName);
+
+  if (elements.button) {
+    elements.button.hidden = false;
+  }
+
+  // Show the controlling extension row and hide the old label.
+  elements.section.hidden = false;
+}
+
+function hideControllingExtension(settingName) {
+  let elements = getControllingExtensionEls(settingName);
+  elements.section.hidden = true;
+  if (elements.button) {
+    elements.button.hidden = true;
+  }
+}
+
+function showEnableExtensionMessage(settingName) {
+  let elements = getControllingExtensionEls(settingName);
+
+  elements.button.hidden = true;
+  elements.section.classList.add("extension-controlled-disabled");
+
+  elements.description.textContent = "";
+
+  // We replace localization of the <description> with a DOM Fragment containing
+  // the enable-extension-enable message. That means a change from:
+  //
+  // <description data-l10n-id="..."/>
+  //
+  // to:
+  //
+  // <description>
+  //   <img/>
+  //   <label data-l10n-id="..."/>
+  // </description>
+  //
+  // We need to remove the l10n-id annotation from the <description> to prevent
+  // Fluent from overwriting the element in case of any retranslation.
+  elements.description.removeAttribute("data-l10n-id");
+
+  let icon = (url, name) => {
+    let img = document.createElementNS("http://www.w3.org/1999/xhtml", "img");
+    img.src = url;
+    img.setAttribute("data-l10n-name", name);
+    img.setAttribute("role", "presentation");
+    img.className = "extension-controlled-icon";
+    return img;
+  };
+  let label = document.createXULElement("label");
+  let addonIcon = icon(
+    "chrome://mozapps/skin/extensions/extensionGeneric.svg",
+    "addons-icon"
+  );
+  let toolbarIcon = icon("chrome://browser/skin/menu.svg", "menu-icon");
+  label.appendChild(addonIcon);
+  label.appendChild(toolbarIcon);
+  document.l10n.setAttributes(label, "extension-controlled-enable");
+  elements.description.appendChild(label);
+  let dismissButton = document.createXULElement("image");
+  dismissButton.setAttribute("class", "extension-controlled-icon close-icon");
+  dismissButton.addEventListener("click", function dismissHandler() {
+    hideControllingExtension(settingName);
+    dismissButton.removeEventListener("click", dismissHandler);
+  });
+  elements.description.appendChild(dismissButton);
+}
+
+function makeDisableControllingExtension(type, settingName) {
+  return async function disableExtension() {
+    let { id } = await getControllingExtensionInfo(type, settingName);
+    let addon = await AddonManager.getAddonByID(id);
+    await addon.disable();
+  };
+}
+
+/**
+ *  Initialize listeners though the Management API to update the UI
+ *  when an extension is controlling a pref.
+ * @param {string} type
+ * @param {string} prefId The unique id of the setting
+ * @param {HTMLElement} controlledElement
+ */
+async function initListenersForPrefChange(type, prefId, controlledElement) {
+  await Management.asyncLoadSettingsModules();
+
+  let managementObserver = async () => {
+    let managementControlled = await handleControllingExtension(type, prefId);
+    // Enterprise policy may have locked the pref, so we need to preserve that
+    controlledElement.disabled =
+      managementControlled || Services.prefs.prefIsLocked(prefId);
+  };
+  managementObserver();
+  Management.on(`extension-setting-changed:${prefId}`, managementObserver);
+
+  window.addEventListener("unload", () => {
+    Management.off(`extension-setting-changed:${prefId}`, managementObserver);
+  });
+}
+
+function initializeProxyUI(container) {
+  let deferredUpdate = new DeferredTask(() => {
+    container.updateProxySettingsUI();
+  }, 10);
+  let proxyObserver = {
+    observe: (subject, topic, data) => {
+      if (API_PROXY_PREFS.includes(data)) {
+        deferredUpdate.arm();
+      }
+    },
+  };
+  Services.prefs.addObserver("", proxyObserver);
+  window.addEventListener("unload", () => {
+    Services.prefs.removeObserver("", proxyObserver);
+  });
+}
diff --git a/browser/components/preferences/findInPage.js b/browser/components/preferences/findInPage.js
new file mode 100644
index 0000000000..9fcd7b629b
--- /dev/null
+++ b/browser/components/preferences/findInPage.js
@@ -0,0 +1,776 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this file,
+ * You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+/* import-globals-from extensionControlled.js */
+/* import-globals-from preferences.js */
+
+// A tweak to the standard <button> CE to use textContent on the <label>
+// inside the button, which allows the text to be highlighted when the user
+// is searching.
+
+const MozButton = customElements.get("button");
+class HighlightableButton extends MozButton {
+  static get inheritedAttributes() {
+    return Object.assign({}, super.inheritedAttributes, {
+      ".button-text": "text=label,accesskey,crop",
+    });
+  }
+}
+customElements.define("highlightable-button", HighlightableButton, {
+  extends: "button",
+});
+
+var gSearchResultsPane = {
+  listSearchTooltips: new Set(),
+  listSearchMenuitemIndicators: new Set(),
+  searchInput: null,
+  // A map of DOM Elements to a string of keywords used in search
+  // XXX: We should invalidate this cache on `intl:app-locales-changed`
+  searchKeywords: new WeakMap(),
+  inited: false,
+
+  // A (node -> boolean) map of subitems to be made visible or hidden.
+  subItems: new Map(),
+
+  searchResultsHighlighted: false,
+
+  init() {
+    if (this.inited) {
+      return;
+    }
+    this.inited = true;
+    this.searchInput = document.getElementById("searchInput");
+    this.searchInput.hidden = !Services.prefs.getBoolPref(
+      "browser.preferences.search"
+    );
+
+    window.addEventListener("resize", () => {
+      this._recomputeTooltipPositions();
+    });
+
+    if (!this.searchInput.hidden) {
+      this.searchInput.addEventListener("input", this);
+      this.searchInput.addEventListener("command", this);
+      window.addEventListener("DOMContentLoaded", () => {
+        this.searchInput.focus();
+        // Initialize other panes in an idle callback.
+        window.requestIdleCallback(() => this.initializeCategories());
+      });
+    }
+    ensureScrollPadding();
+  },
+
+  async handleEvent(event) {
+    // Ensure categories are initialized if idle callback didn't run sooo enough.
+    await this.initializeCategories();
+    this.searchFunction(event);
+  },
+
+  /**
+   * This stops the search input from moving, when typing in it
+   * changes which items in the prefs are visible.
+   */
+  fixInputPosition() {
+    let innerContainer = document.querySelector(".sticky-inner-container");
+    let width =
+      window.windowUtils.getBoundsWithoutFlushing(innerContainer).width;
+    innerContainer.style.maxWidth = width + "px";
+  },
+
+  /**
+   * Check that the text content contains the query string.
+   *
+   * @param String content
+   *    the text content to be searched
+   * @param String query
+   *    the query string
+   * @returns boolean
+   *    true when the text content contains the query string else false
+   */
+  queryMatchesContent(content, query) {
+    if (!content || !query) {
+      return false;
+    }
+    return content.toLowerCase().includes(query.toLowerCase());
+  },
+
+  categoriesInitialized: false,
+
+  /**
+   * Will attempt to initialize all uninitialized categories
+   */
+  async initializeCategories() {
+    //  Initializing all the JS for all the tabs
+    if (!this.categoriesInitialized) {
+      this.categoriesInitialized = true;
+      // Each element of gCategoryInits is a name
+      for (let category of gCategoryInits.values()) {
+        category.init();
+      }
+      if (document.hasPendingL10nMutations) {
+        await new Promise(r =>
+          document.addEventListener("L10nMutationsFinished", r, { once: true })
+        );
+      }
+    }
+  },
+
+  /**
+   * Finds and returns text nodes within node and all descendants
+   * Iterates through all the sibilings of the node object and adds the sibilings
+   * to an array if sibiling is a TEXT_NODE else checks the text nodes with in current node
+   * Source - http://stackoverflow.com/questions/10730309/find-all-text-nodes-in-html-page
+   *
+   * @param Node nodeObject
+   *    DOM element
+   * @returns array of text nodes
+   */
+  textNodeDescendants(node) {
+    if (!node) {
+      return [];
+    }
+    let all = [];
+    for (node = node.firstChild; node; node = node.nextSibling) {
+      if (node.nodeType === node.TEXT_NODE) {
+        all.push(node);
+      } else {
+        all = all.concat(this.textNodeDescendants(node));
+      }
+    }
+    return all;
+  },
+
+  /**
+   * This function is used to find words contained within the text nodes.
+   * We pass in the textNodes because they contain the text to be highlighted.
+   * We pass in the nodeSizes to tell exactly where highlighting need be done.
+   * When creating the range for highlighting, if the nodes are section is split
+   * by an access key, it is important to have the size of each of the nodes summed.
+   * @param Array textNodes
+   *    List of DOM elements
+   * @param Array nodeSizes
+   *    Running size of text nodes. This will contain the same number of elements as textNodes.
+   *    The first element is the size of first textNode element.
+   *    For any nodes after, they will contain the summation of the nodes thus far in the array.
+   *    Example:
+   *    textNodes = [[This is ], [a], [n example]]
+   *    nodeSizes = [[8], [9], [18]]
+   *    This is used to determine the offset when highlighting
+   * @param String textSearch
+   *    Concatination of textNodes's text content
+   *    Example:
+   *    textNodes = [[This is ], [a], [n example]]
+   *    nodeSizes = "This is an example"
+   *    This is used when executing the regular expression
+   * @param String searchPhrase
+   *    word or words to search for
+   * @returns boolean
+   *      Returns true when atleast one instance of search phrase is found, otherwise false
+   */
+  highlightMatches(textNodes, nodeSizes, textSearch, searchPhrase) {
+    if (!searchPhrase) {
+      return false;
+    }
+
+    let indices = [];
+    let i = -1;
+    while ((i = textSearch.indexOf(searchPhrase, i + 1)) >= 0) {
+      indices.push(i);
+    }
+
+    // Looping through each spot the searchPhrase is found in the concatenated string
+    for (let startValue of indices) {
+      let endValue = startValue + searchPhrase.length;
+      let startNode = null;
+      let endNode = null;
+      let nodeStartIndex = null;
+
+      // Determining the start and end node to highlight from
+      for (let index = 0; index < nodeSizes.length; index++) {
+        let lengthNodes = nodeSizes[index];
+        // Determining the start node
+        if (!startNode && lengthNodes >= startValue) {
+          startNode = textNodes[index];
+          nodeStartIndex = index;
+          // Calculating the offset when found query is not in the first node
+          if (index > 0) {
+            startValue -= nodeSizes[index - 1];
+          }
+        }
+        // Determining the end node
+        if (!endNode && lengthNodes >= endValue) {
+          endNode = textNodes[index];
+          // Calculating the offset when endNode is different from startNode
+          // or when endNode is not the first node
+          if (index != nodeStartIndex || index > 0) {
+            endValue -= nodeSizes[index - 1];
+          }
+        }
+      }
+      let range = document.createRange();
+      range.setStart(startNode, startValue);
+      range.setEnd(endNode, endValue);
+      this.getFindSelection(startNode.ownerGlobal).addRange(range);
+
+      this.searchResultsHighlighted = true;
+    }
+
+    return !!indices.length;
+  },
+
+  /**
+   * Get the selection instance from given window
+   *
+   * @param Object win
+   *   The window object points to frame's window
+   */
+  getFindSelection(win) {
+    // Yuck. See bug 138068.
+    let docShell = win.docShell;
+
+    let controller = docShell
+      .QueryInterface(Ci.nsIInterfaceRequestor)
+      .getInterface(Ci.nsISelectionDisplay)
+      .QueryInterface(Ci.nsISelectionController);
+
+    let selection = controller.getSelection(
+      Ci.nsISelectionController.SELECTION_FIND
+    );
+    selection.setColors("currentColor", "#ffe900", "currentColor", "#003eaa");
+
+    return selection;
+  },
+
+  /**
+   * Shows or hides content according to search input
+   *
+   * @param String event
+   *    to search for filted query in
+   */
+  async searchFunction(event) {
+    let query = event.target.value.trim().toLowerCase();
+    if (this.query == query) {
+      return;
+    }
+
+    let firstQuery = !this.query && query;
+    let endQuery = !query && this.query;
+    let subQuery = this.query && query.includes(this.query);
+    this.query = query;
+
+    // If there is a query, don't reshow the existing hidden subitems yet
+    // to avoid them flickering into view only to be hidden again by
+    // this next search.
+    this.removeAllSearchIndicators(window, !query.length);
+
+    // Clear telemetry request if user types very frequently.
+    if (this.telemetryTimer) {
+      clearTimeout(this.telemetryTimer);
+    }
+
+    let srHeader = document.getElementById("header-searchResults");
+    let noResultsEl = document.getElementById("no-results-message");
+    if (this.query) {
+      // If this is the first query, fix the search input in place.
+      if (firstQuery) {
+        this.fixInputPosition();
+      }
+      // Showing the Search Results Tag
+      await gotoPref("paneSearchResults");
+      srHeader.hidden = false;
+
+      let resultsFound = false;
+
+      // Building the range for highlighted areas
+      let rootPreferencesChildren = [
+        ...document.querySelectorAll(
+          "#mainPrefPane > *:not([data-hidden-from-search], script, stringbundle)"
+        ),
+      ];
+
+      if (subQuery) {
+        // Since the previous query is a subset of the current query,
+        // there is no need to check elements that is hidden already.
+        rootPreferencesChildren = rootPreferencesChildren.filter(
+          el => !el.hidden
+        );
+      }
+
+      // Attach the bindings for all children if they were not already visible.
+      for (let child of rootPreferencesChildren) {
+        if (child.hidden) {
+          child.classList.add("visually-hidden");
+          child.hidden = false;
+        }
+      }
+
+      let ts = performance.now();
+      let FRAME_THRESHOLD = 1000 / 60;
+
+      // Showing or Hiding specific section depending on if words in query are found
+      for (let child of rootPreferencesChildren) {
+        if (performance.now() - ts > FRAME_THRESHOLD) {
+          // Creating tooltips for all the instances found
+          for (let anchorNode of this.listSearchTooltips) {
+            this.createSearchTooltip(anchorNode, this.query);
+          }
+          ts = await new Promise(resolve =>
+            window.requestAnimationFrame(resolve)
+          );
+          if (query !== this.query) {
+            return;
+          }
+        }
+
+        if (
+          !child.classList.contains("header") &&
+          !child.classList.contains("subcategory") &&
+          (await this.searchWithinNode(child, this.query))
+        ) {
+          child.classList.remove("visually-hidden");
+
+          // Show the preceding search-header if one exists.
+          let groupbox = child.closest("groupbox");
+          let groupHeader =
+            groupbox && groupbox.querySelector(".search-header");
+          if (groupHeader) {
+            groupHeader.hidden = false;
+          }
+
+          resultsFound = true;
+        } else {
+          child.classList.add("visually-hidden");
+        }
+      }
+
+      // Hide any subitems that don't match the search term and show
+      // only those that do.
+      if (this.subItems.size) {
+        for (let [subItem, matches] of this.subItems) {
+          subItem.classList.toggle("visually-hidden", !matches);
+        }
+      }
+
+      noResultsEl.hidden = !!resultsFound;
+      noResultsEl.setAttribute("query", this.query);
+      // XXX: This is potentially racy in case where Fluent retranslates the
+      // message and ereases the query within.
+      // The feature is not yet supported, but we should fix for it before
+      // we enable it. See bug 1446389 for details.
+      let msgQueryElem = document.getElementById("sorry-message-query");
+      msgQueryElem.textContent = this.query;
+      if (resultsFound) {
+        // Creating tooltips for all the instances found
+        for (let anchorNode of this.listSearchTooltips) {
+          this.createSearchTooltip(anchorNode, this.query);
+        }
+
+        // Implant search telemetry probe after user stops typing for a while
+        if (this.query.length >= 2) {
+          this.telemetryTimer = setTimeout(() => {
+            Services.telemetry.keyedScalarAdd(
+              "preferences.search_query",
+              this.query,
+              1
+            );
+          }, 1000);
+        }
+      }
+    } else {
+      if (endQuery) {
+        document
+          .querySelector(".sticky-inner-container")
+          .style.removeProperty("max-width");
+      }
+      noResultsEl.hidden = true;
+      document.getElementById("sorry-message-query").textContent = "";
+      // Going back to General when cleared
+      await gotoPref("paneGeneral");
+      srHeader.hidden = true;
+
+      // Hide some special second level headers in normal view
+      for (let element of document.querySelectorAll(".search-header")) {
+        element.hidden = true;
+      }
+    }
+
+    window.dispatchEvent(
+      new CustomEvent("PreferencesSearchCompleted", { detail: query })
+    );
+  },
+
+  /**
+   * Finding leaf nodes and checking their content for words to search,
+   * It is a recursive function
+   *
+   * @param Node nodeObject
+   *    DOM Element
+   * @param String searchPhrase
+   * @returns boolean
+   *    Returns true when found in at least one childNode, false otherwise
+   */
+  async searchWithinNode(nodeObject, searchPhrase) {
+    let matchesFound = false;
+    if (
+      nodeObject.childElementCount == 0 ||
+      nodeObject.tagName == "button" ||
+      nodeObject.tagName == "label" ||
+      nodeObject.tagName == "description" ||
+      nodeObject.tagName == "menulist" ||
+      nodeObject.tagName == "menuitem" ||
+      nodeObject.tagName == "checkbox"
+    ) {
+      let simpleTextNodes = this.textNodeDescendants(nodeObject);
+      for (let node of simpleTextNodes) {
+        let result = this.highlightMatches(
+          [node],
+          [node.length],
+          node.textContent.toLowerCase(),
+          searchPhrase
+        );
+        matchesFound = matchesFound || result;
+      }
+
+      // Collecting data from anonymous content / label / description
+      let nodeSizes = [];
+      let allNodeText = "";
+      let runningSize = 0;
+
+      let accessKeyTextNodes = [];
+
+      if (
+        nodeObject.tagName == "label" ||
+        nodeObject.tagName == "description"
+      ) {
+        accessKeyTextNodes.push(...simpleTextNodes);
+      }
+
+      for (let node of accessKeyTextNodes) {
+        runningSize += node.textContent.length;
+        allNodeText += node.textContent;
+        nodeSizes.push(runningSize);
+      }
+
+      // Access key are presented
+      let complexTextNodesResult = this.highlightMatches(
+        accessKeyTextNodes,
+        nodeSizes,
+        allNodeText.toLowerCase(),
+        searchPhrase
+      );
+
+      // Searching some elements, such as xul:button, have a 'label' attribute that contains the user-visible text.
+      let labelResult = this.queryMatchesContent(
+        nodeObject.getAttribute("label"),
+        searchPhrase
+      );
+
+      // Searching some elements, such as xul:label, store their user-visible text in a "value" attribute.
+      // Value will be skipped for menuitem since value in menuitem could represent index number to distinct each item.
+      let valueResult =
+        nodeObject.tagName !== "menuitem" && nodeObject.tagName !== "radio"
+          ? this.queryMatchesContent(
+              nodeObject.getAttribute("value"),
+              searchPhrase
+            )
+          : false;
+
+      // Searching some elements, such as xul:button, buttons to open subdialogs
+      // using l10n ids.
+      let keywordsResult =
+        nodeObject.hasAttribute("search-l10n-ids") &&
+        (await this.matchesSearchL10nIDs(nodeObject, searchPhrase));
+
+      if (!keywordsResult) {
+        // Searching some elements, such as xul:button, buttons to open subdialogs
+        // using searchkeywords attribute.
+        keywordsResult =
+          !keywordsResult &&
+          nodeObject.hasAttribute("searchkeywords") &&
+          this.queryMatchesContent(
+            nodeObject.getAttribute("searchkeywords"),
+            searchPhrase
+          );
+      }
+
+      // Creating tooltips for buttons
+      if (
+        keywordsResult &&
+        (nodeObject.tagName === "button" || nodeObject.tagName == "menulist")
+      ) {
+        this.listSearchTooltips.add(nodeObject);
+      }
+
+      if (keywordsResult && nodeObject.tagName === "menuitem") {
+        nodeObject.setAttribute("indicator", "true");
+        this.listSearchMenuitemIndicators.add(nodeObject);
+        let menulist = nodeObject.closest("menulist");
+
+        menulist.setAttribute("indicator", "true");
+        this.listSearchMenuitemIndicators.add(menulist);
+      }
+
+      if (
+        (nodeObject.tagName == "menulist" ||
+          nodeObject.tagName == "menuitem") &&
+        (labelResult || valueResult || keywordsResult)
+      ) {
+        nodeObject.setAttribute("highlightable", "true");
+      }
+
+      matchesFound =
+        matchesFound ||
+        complexTextNodesResult ||
+        labelResult ||
+        valueResult ||
+        keywordsResult;
+    }
+
+    // Should not search unselected child nodes of a <xul:deck> element
+    // except the "historyPane" <xul:deck> element.
+    if (nodeObject.tagName == "deck" && nodeObject.id != "historyPane") {
+      let index = nodeObject.selectedIndex;
+      if (index != -1) {
+        let result = await this.searchChildNodeIfVisible(
+          nodeObject,
+          index,
+          searchPhrase
+        );
+        matchesFound = matchesFound || result;
+      }
+    } else {
+      for (let i = 0; i < nodeObject.childNodes.length; i++) {
+        let result = await this.searchChildNodeIfVisible(
+          nodeObject,
+          i,
+          searchPhrase
+        );
+        matchesFound = matchesFound || result;
+      }
+    }
+    return matchesFound;
+  },
+
+  /**
+   * Search for a phrase within a child node if it is visible.
+   *
+   * @param Node nodeObject
+   *    The parent DOM Element
+   * @param Number index
+   *    The index for the childNode
+   * @param String searchPhrase
+   * @returns boolean
+   *    Returns true when found the specific childNode, false otherwise
+   */
+  async searchChildNodeIfVisible(nodeObject, index, searchPhrase) {
+    let result = false;
+    let child = nodeObject.childNodes[index];
+    if (
+      !child.hidden &&
+      nodeObject.getAttribute("data-hidden-from-search") !== "true"
+    ) {
+      result = await this.searchWithinNode(child, searchPhrase);
+      // Creating tooltips for menulist element
+      if (result && nodeObject.tagName === "menulist") {
+        this.listSearchTooltips.add(nodeObject);
+      }
+
+      // If this is a node for an experimental feature option or a Mozilla product item,
+      // add it to the list of subitems. The items that don't match the search term
+      // will be hidden.
+      if (
+        Element.isInstance(child) &&
+        (child.classList.contains("featureGate") ||
+          child.classList.contains("mozilla-product-item"))
+      ) {
+        this.subItems.set(child, result);
+      }
+    }
+    return result;
+  },
+
+  /**
+   * Search for a phrase in l10n messages associated with the element.
+   *
+   * @param Node nodeObject
+   *    The parent DOM Element
+   * @param String searchPhrase
+   * @returns boolean
+   *    true when the text content contains the query string else false
+   */
+  async matchesSearchL10nIDs(nodeObject, searchPhrase) {
+    if (!this.searchKeywords.has(nodeObject)) {
+      // The `search-l10n-ids` attribute is a comma-separated list of
+      // l10n ids. It may also uses a dot notation to specify an attribute
+      // of the message to be used.
+      //
+      // Example: "containers-add-button.label, user-context-personal"
+      //
+      // The result is an array of arrays of l10n ids and optionally attribute names.
+      //
+      // Example: [["containers-add-button", "label"], ["user-context-personal"]]
+      const refs = nodeObject
+        .getAttribute("search-l10n-ids")
+        .split(",")
+        .map(s => s.trim().split("."))
+        .filter(s => !!s[0].length);
+
+      const messages = await document.l10n.formatMessages(
+        refs.map(ref => ({ id: ref[0] }))
+      );
+
+      // Map the localized messages taking value or a selected attribute and
+      // building a string of concatenated translated strings out of it.
+      let keywords = messages
+        .map((msg, i) => {
+          let [refId, refAttr] = refs[i];
+          if (!msg) {
+            console.error(`Missing search l10n id "${refId}"`);
+            return null;
+          }
+          if (refAttr) {
+            let attr =
+              msg.attributes && msg.attributes.find(a => a.name === refAttr);
+            if (!attr) {
+              console.error(`Missing search l10n id "${refId}.${refAttr}"`);
+              return null;
+            }
+            if (attr.value === "") {
+              console.error(
+                `Empty value added to search-l10n-ids "${refId}.${refAttr}"`
+              );
+            }
+            return attr.value;
+          }
+          if (msg.value === "") {
+            console.error(`Empty value added to search-l10n-ids "${refId}"`);
+          }
+          return msg.value;
+        })
+        .filter(keyword => keyword !== null)
+        .join(" ");
+
+      this.searchKeywords.set(nodeObject, keywords);
+      return this.queryMatchesContent(keywords, searchPhrase);
+    }
+
+    return this.queryMatchesContent(
+      this.searchKeywords.get(nodeObject),
+      searchPhrase
+    );
+  },
+
+  /**
+   * Inserting a div structure infront of the DOM element matched textContent.
+   * Then calculation the offsets to position the tooltip in the correct place.
+   *
+   * @param Node anchorNode
+   *    DOM Element
+   * @param String query
+   *    Word or words that are being searched for
+   */
+  createSearchTooltip(anchorNode, query) {
+    if (anchorNode.tooltipNode) {
+      return;
+    }
+    let searchTooltip = anchorNode.ownerDocument.createElement("span");
+    let searchTooltipText = anchorNode.ownerDocument.createElement("span");
+    searchTooltip.className = "search-tooltip";
+    searchTooltipText.textContent = query;
+    searchTooltip.appendChild(searchTooltipText);
+
+    // Set tooltipNode property to track corresponded tooltip node.
+    anchorNode.tooltipNode = searchTooltip;
+    anchorNode.parentElement.classList.add("search-tooltip-parent");
+    anchorNode.parentElement.appendChild(searchTooltip);
+
+    this._applyTooltipPosition(
+      searchTooltip,
+      this._computeTooltipPosition(anchorNode, searchTooltip)
+    );
+  },
+
+  _recomputeTooltipPositions() {
+    let positions = [];
+    for (let anchorNode of this.listSearchTooltips) {
+      let searchTooltip = anchorNode.tooltipNode;
+      if (!searchTooltip) {
+        continue;
+      }
+      let position = this._computeTooltipPosition(anchorNode, searchTooltip);
+      positions.push({ searchTooltip, position });
+    }
+    for (let { searchTooltip, position } of positions) {
+      this._applyTooltipPosition(searchTooltip, position);
+    }
+  },
+
+  _applyTooltipPosition(searchTooltip, position) {
+    searchTooltip.style.left = position.left + "px";
+    searchTooltip.style.top = position.top + "px";
+  },
+
+  _computeTooltipPosition(anchorNode, searchTooltip) {
+    // In order to get the up-to-date position of each of the nodes that we're
+    // putting tooltips on, we have to flush layout intentionally. Once
+    // menulists don't use XUL layout we can remove this and use plain CSS to
+    // position them, see bug 1363730.
+    let anchorRect = anchorNode.getBoundingClientRect();
+    let containerRect = anchorNode.parentElement.getBoundingClientRect();
+    let tooltipRect = searchTooltip.getBoundingClientRect();
+
+    let left =
+      anchorRect.left -
+      containerRect.left +
+      anchorRect.width / 2 -
+      tooltipRect.width / 2;
+    let top = anchorRect.top - containerRect.top;
+    return { left, top };
+  },
+
+  /**
+   * Remove all search indicators. This would be called when switching away from
+   * a search to another preference category.
+   */
+  removeAllSearchIndicators(window, showSubItems) {
+    if (this.searchResultsHighlighted) {
+      this.getFindSelection(window).removeAllRanges();
+      this.searchResultsHighlighted = false;
+    }
+    this.removeAllSearchTooltips();
+    this.removeAllSearchMenuitemIndicators();
+
+    // Make any previously hidden subitems visible again for the next search.
+    if (showSubItems && this.subItems.size) {
+      for (let subItem of this.subItems.keys()) {
+        subItem.classList.remove("visually-hidden");
+      }
+      this.subItems.clear();
+    }
+  },
+
+  /**
+   * Remove all search tooltips.
+   */
+  removeAllSearchTooltips() {
+    for (let anchorNode of this.listSearchTooltips) {
+      anchorNode.parentElement.classList.remove("search-tooltip-parent");
+      if (anchorNode.tooltipNode) {
+        anchorNode.tooltipNode.remove();
+      }
+      anchorNode.tooltipNode = null;
+    }
+    this.listSearchTooltips.clear();
+  },
+
+  /**
+   * Remove all indicators on menuitem.
+   */
+  removeAllSearchMenuitemIndicators() {
+    for (let node of this.listSearchMenuitemIndicators) {
+      node.removeAttribute("indicator");
+    }
+    this.listSearchMenuitemIndicators.clear();
+  },
+};
diff --git a/browser/components/preferences/fxaPairDevice.js b/browser/components/preferences/fxaPairDevice.js
new file mode 100644
index 0000000000..8f5c26734d
--- /dev/null
+++ b/browser/components/preferences/fxaPairDevice.js
@@ -0,0 +1,144 @@
+// This Source Code Form is subject to the terms of the Mozilla Public
+// License, v. 2.0. If a copy of the MPL was not distributed with this
+// file, You can obtain one at http://mozilla.org/MPL/2.0/.
+
+const { XPCOMUtils } = ChromeUtils.importESModule(
+  "resource://gre/modules/XPCOMUtils.sys.mjs"
+);
+const { FxAccounts } = ChromeUtils.importESModule(
+  "resource://gre/modules/FxAccounts.sys.mjs"
+);
+const { Weave } = ChromeUtils.importESModule(
+  "resource://services-sync/main.sys.mjs"
+);
+
+ChromeUtils.defineESModuleGetters(this, {
+  EventEmitter: "resource://gre/modules/EventEmitter.sys.mjs",
+  FxAccountsPairingFlow: "resource://gre/modules/FxAccountsPairing.sys.mjs",
+});
+
+const { require } = ChromeUtils.importESModule(
+  "resource://devtools/shared/loader/Loader.sys.mjs"
+);
+const QR = require("devtools/shared/qrcode/index");
+
+// This is only for "labor illusion", see
+// https://www.fastcompany.com/3061519/the-ux-secret-that-will-ruin-apps-for-you
+const MIN_PAIRING_LOADING_TIME_MS = 1000;
+
+/**
+ * Communication between FxAccountsPairingFlow and gFxaPairDeviceDialog
+ * is done using an emitter via the following messages:
+ * <- [view:SwitchToWebContent] - Notifies the view to navigate to a specific URL.
+ * <- [view:Error] - Notifies the view something went wrong during the pairing process.
+ * -> [view:Closed] - Notifies the pairing module the view was closed.
+ */
+var gFxaPairDeviceDialog = {
+  init() {
+    this._resetBackgroundQR();
+    // We let the modal show itself before eventually showing a primary-password dialog later.
+    Services.tm.dispatchToMainThread(() => this.startPairingFlow());
+  },
+
+  uninit() {
+    // When the modal closes we want to remove any query params
+    // To prevent refreshes/restores from reopening the dialog
+    const browser = window.docShell.chromeEventHandler;
+    browser.loadURI(Services.io.newURI("about:preferences#sync"), {
+      triggeringPrincipal: Services.scriptSecurityManager.getSystemPrincipal(),
+    });
+
+    this.teardownListeners();
+    this._emitter.emit("view:Closed");
+  },
+
+  async startPairingFlow() {
+    this._resetBackgroundQR();
+    document
+      .getElementById("qrWrapper")
+      .setAttribute("pairing-status", "loading");
+    this._emitter = new EventEmitter();
+    this.setupListeners();
+    try {
+      if (!Weave.Utils.ensureMPUnlocked()) {
+        throw new Error("Master-password locked.");
+      }
+      // To keep consistent with our accounts.firefox.com counterpart
+      // we restyle the parent dialog this is contained in
+      this._styleParentDialog();
+
+      const [, uri] = await Promise.all([
+        new Promise(res => setTimeout(res, MIN_PAIRING_LOADING_TIME_MS)),
+        FxAccountsPairingFlow.start({ emitter: this._emitter }),
+      ]);
+      const imgData = QR.encodeToDataURI(uri, "L");
+      document.getElementById(
+        "qrContainer"
+      ).style.backgroundImage = `url("${imgData.src}")`;
+      document
+        .getElementById("qrWrapper")
+        .setAttribute("pairing-status", "ready");
+    } catch (e) {
+      this.onError(e);
+    }
+  },
+
+  _styleParentDialog() {
+    // Since the dialog title is in the above document, we can't query the
+    // document in this level and need to go up one
+    let dialogParent = window.parent.document;
+
+    // To allow the firefox icon to go over the dialog
+    let dialogBox = dialogParent.querySelector(".dialogBox");
+    dialogBox.style.overflow = "visible";
+    dialogBox.style.borderRadius = "12px";
+
+    let dialogTitle = dialogParent.querySelector(".dialogTitleBar");
+    dialogTitle.style.borderBottom = "none";
+    dialogTitle.classList.add("fxaPairDeviceIcon");
+  },
+
+  _resetBackgroundQR() {
+    // The text we encode doesn't really matter as it is un-scannable (blurry and very transparent).
+    const imgData = QR.encodeToDataURI(
+      "https://accounts.firefox.com/pair",
+      "L"
+    );
+    document.getElementById(
+      "qrContainer"
+    ).style.backgroundImage = `url("${imgData.src}")`;
+  },
+
+  onError(err) {
+    console.error(err);
+    this.teardownListeners();
+    document
+      .getElementById("qrWrapper")
+      .setAttribute("pairing-status", "error");
+  },
+
+  _switchToUrl(url) {
+    const browser = window.docShell.chromeEventHandler;
+    browser.fixupAndLoadURIString(url, {
+      triggeringPrincipal: Services.scriptSecurityManager.createNullPrincipal(
+        {}
+      ),
+    });
+  },
+
+  setupListeners() {
+    this._switchToWebContent = (_, url) => this._switchToUrl(url);
+    this._onError = (_, error) => this.onError(error);
+    this._emitter.once("view:SwitchToWebContent", this._switchToWebContent);
+    this._emitter.on("view:Error", this._onError);
+  },
+
+  teardownListeners() {
+    try {
+      this._emitter.off("view:SwitchToWebContent", this._switchToWebContent);
+      this._emitter.off("view:Error", this._onError);
+    } catch (e) {
+      console.warn("Error while tearing down listeners.", e);
+    }
+  },
+};
diff --git a/browser/components/preferences/fxaPairDevice.xhtml b/browser/components/preferences/fxaPairDevice.xhtml
new file mode 100644
index 0000000000..ad068b143d
--- /dev/null
+++ b/browser/components/preferences/fxaPairDevice.xhtml
@@ -0,0 +1,78 @@
+<?xml version="1.0"?>
+
+<!-- -*- Mode: Java; tab-width: 4; indent-tabs-mode: nil; c-basic-offset: 4 -*- -->
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+
+<window
+  id="fxaPairDeviceDialog"
+  type="child"
+  xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+  xmlns:html="http://www.w3.org/1999/xhtml"
+  onload="gFxaPairDeviceDialog.init();"
+  onunload="gFxaPairDeviceDialog.uninit()"
+  data-l10n-id="fxa-pair-device-dialog-sync2"
+  data-l10n-attrs="style"
+>
+  <dialog id="fxaPairDeviceDialog1" buttons="accept">
+    <linkset>
+      <html:link rel="stylesheet" href="chrome://global/skin/global.css" />
+      <html:link
+        rel="stylesheet"
+        href="chrome://browser/skin/preferences/fxaPairDevice.css"
+      />
+
+      <html:link rel="localization" href="branding/brand.ftl" />
+      <html:link
+        rel="localization"
+        href="browser/preferences/fxaPairDevice.ftl"
+      />
+      <html:link rel="localization" href="toolkit/branding/accounts.ftl" />
+    </linkset>
+    <script src="chrome://browser/content/preferences/fxaPairDevice.js" />
+
+    <description id="pairTitle" data-l10n-id="fxa-qrcode-pair-title">
+    </description>
+    <vbox id="qrCodeDisplay">
+      <description class="pairHeading" data-l10n-id="fxa-qrcode-pair-step1">
+      </description>
+      <description
+        class="pairHeading"
+        data-l10n-id="fxa-qrcode-pair-step2-signin"
+      >
+        <html:img
+          src="chrome://browser/skin/preferences/ios-menu.svg"
+          data-l10n-name="ios-menu-icon"
+          class="menu-icon"
+        />
+        <html:img
+          src="chrome://browser/skin/preferences/android-menu.svg"
+          data-l10n-name="android-menu-icon"
+          class="menu-icon"
+        />
+      </description>
+      <description
+        class="pairHeading"
+        data-l10n-id="fxa-qrcode-pair-step3"
+      ></description>
+      <vbox>
+        <vbox align="center" id="qrWrapper" pairing-status="loading">
+          <box id="qrContainer"></box>
+          <box id="qrSpinner"></box>
+          <vbox id="qrError" onclick="gFxaPairDeviceDialog.startPairingFlow();">
+            <image id="refresh-qr" />
+            <label
+              class="qr-error-text"
+              data-l10n-id="fxa-qrcode-error-title"
+            ></label>
+            <label
+              class="qr-error-text"
+              data-l10n-id="fxa-qrcode-error-body"
+            ></label>
+          </vbox>
+        </vbox>
+      </vbox>
+    </vbox>
+  </dialog>
+</window>
diff --git a/browser/components/preferences/home.inc.xhtml b/browser/components/preferences/home.inc.xhtml
new file mode 100644
index 0000000000..611e82a909
--- /dev/null
+++ b/browser/components/preferences/home.inc.xhtml
@@ -0,0 +1,92 @@
+# This Source Code Form is subject to the terms of the Mozilla Public
+# License, v. 2.0. If a copy of the MPL was not distributed with this
+# file, You can obtain one at http://mozilla.org/MPL/2.0/.
+
+<!-- Home panel -->
+
+<script src="chrome://browser/content/preferences/home.js"/>
+<html:template id="template-paneHome">
+<hbox id="firefoxHomeCategory"
+      class="subcategory"
+      hidden="true"
+      data-category="paneHome">
+  <html:h1 style="flex: 1;" data-l10n-id="pane-home-title"/>
+  <button id="restoreDefaultHomePageBtn"
+          is="highlightable-button"
+          class="homepage-button check-home-page-controlled"
+          data-preference-related="browser.startup.homepage"
+          data-l10n-id="home-restore-defaults"
+          preference="pref.browser.homepage.disable_button.restore_default"/>
+</hbox>
+
+<groupbox id="homepageGroup"
+          data-category="paneHome"
+          hidden="true">
+  <label><html:h2 data-l10n-id="home-new-windows-tabs-header"/></label>
+  <description class="description-deemphasized" data-l10n-id="home-new-windows-tabs-description2" />
+
+  <hbox id="homepageAndNewWindowsOption" align="center" data-subcategory="homeOverride">
+    <label control="homeMode" data-l10n-id="home-homepage-mode-label" flex="1" />
+
+    <vbox flex="1">
+      <menulist id="homeMode"
+                class="check-home-page-controlled"
+                data-preference-related="browser.startup.homepage">
+        <menupopup>
+          <menuitem value="0" data-l10n-id="home-mode-choice-default-fx" />
+          <menuitem value="2" data-l10n-id="home-mode-choice-custom" />
+          <menuitem value="1" data-l10n-id="home-mode-choice-blank" />
+        </menupopup>
+      </menulist>
+
+      <vbox id="customSettings" hidden="true">
+        <box role="combobox">
+          <html:input id="homePageUrl"
+                      type="text"
+                      is="autocomplete-input"
+                      class="uri-element check-home-page-controlled"
+                      style="flex: 1;"
+                      data-preference-related="browser.startup.homepage"
+                      data-l10n-id="home-homepage-custom-url"
+                      autocompletepopup="homePageUrlAutocomplete" />
+          <popupset>
+            <panel id="homePageUrlAutocomplete"
+                   is="autocomplete-richlistbox-popup"
+                   type="autocomplete-richlistbox"
+                   noautofocus="true"/>
+          </popupset>
+        </box>
+        <hbox class="homepage-buttons">
+          <button id="useCurrentBtn"
+                  is="highlightable-button"
+                  class="homepage-button check-home-page-controlled"
+                  data-l10n-id="use-current-pages"
+                  data-l10n-args='{"tabCount": 0}'
+                  disabled="true"
+                  preference="pref.browser.homepage.disable_button.current_page"/>
+          <button id="useBookmarkBtn"
+                  is="highlightable-button"
+                  class="homepage-button check-home-page-controlled"
+                  data-l10n-id="choose-bookmark"
+                  preference="pref.browser.homepage.disable_button.bookmark_page"
+                  search-l10n-ids="select-bookmark-window2.title, select-bookmark-desc"/>
+        </hbox>
+      </vbox>
+    </vbox>
+  </hbox>
+  <hbox id="newTabsOption" data-subcategory="newtabOverride" align="center">
+    <label control="newTabMode" data-l10n-id="home-newtabs-mode-label" flex="1" />
+
+    <vbox flex="1">
+      <!-- This can be set to an extension value which is managed outside of
+        Preferences so we need to handle setting the pref manually.-->
+      <menulist id="newTabMode" flex="1" data-preference-related="browser.newtabpage.enabled">
+        <menupopup>
+          <menuitem value="0" data-l10n-id="home-mode-choice-default-fx" />
+          <menuitem value="1" data-l10n-id="home-mode-choice-blank" />
+        </menupopup>
+      </menulist>
+    </vbox>
+  </hbox>
+</groupbox>
+</html:template>
diff --git a/browser/components/preferences/home.js b/browser/components/preferences/home.js
new file mode 100644
index 0000000000..6aa72b84b8
--- /dev/null
+++ b/browser/components/preferences/home.js
@@ -0,0 +1,694 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this file,
+ * You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+/* import-globals-from extensionControlled.js */
+/* import-globals-from preferences.js */
+/* import-globals-from main.js */
+
+// HOME PAGE
+
+/*
+ * Preferences:
+ *
+ * browser.startup.homepage
+ * - the user's home page, as a string; if the home page is a set of tabs,
+ *   this will be those URLs separated by the pipe character "|"
+ * browser.newtabpage.enabled
+ * - determines that is shown on the user's new tab page.
+ *   true = Activity Stream is shown,
+ *   false = about:blank is shown
+ */
+
+Preferences.addAll([
+  { id: "browser.startup.homepage", type: "wstring" },
+  { id: "pref.browser.homepage.disable_button.current_page", type: "bool" },
+  { id: "pref.browser.homepage.disable_button.bookmark_page", type: "bool" },
+  { id: "pref.browser.homepage.disable_button.restore_default", type: "bool" },
+  { id: "browser.newtabpage.enabled", type: "bool" },
+]);
+
+const HOMEPAGE_OVERRIDE_KEY = "homepage_override";
+const URL_OVERRIDES_TYPE = "url_overrides";
+const NEW_TAB_KEY = "newTabURL";
+
+const BLANK_HOMEPAGE_URL = "chrome://browser/content/blanktab.html";
+
+var gHomePane = {
+  HOME_MODE_FIREFOX_HOME: "0",
+  HOME_MODE_BLANK: "1",
+  HOME_MODE_CUSTOM: "2",
+  HOMEPAGE_PREF: "browser.startup.homepage",
+  NEWTAB_ENABLED_PREF: "browser.newtabpage.enabled",
+  ACTIVITY_STREAM_PREF_BRANCH: "browser.newtabpage.activity-stream.",
+
+  get homePanePrefs() {
+    return Preferences.getAll().filter(pref =>
+      pref.id.includes(this.ACTIVITY_STREAM_PREF_BRANCH)
+    );
+  },
+
+  get isPocketNewtabEnabled() {
+    const value = Services.prefs.getStringPref(
+      "browser.newtabpage.activity-stream.discoverystream.config",
+      ""
+    );
+    if (value) {
+      try {
+        return JSON.parse(value).enabled;
+      } catch (e) {
+        console.error("Failed to parse Discovery Stream pref.");
+      }
+    }
+
+    return false;
+  },
+
+  async syncToNewTabPref() {
+    let menulist = document.getElementById("newTabMode");
+
+    if (["0", "1"].includes(menulist.value)) {
+      let newtabEnabledPref = Services.prefs.getBoolPref(
+        this.NEWTAB_ENABLED_PREF,
+        true
+      );
+      let newValue = menulist.value !== this.HOME_MODE_BLANK;
+      // Only set this if the pref has changed, otherwise the pref change will trigger other listeners to repeat.
+      if (newtabEnabledPref !== newValue) {
+        Services.prefs.setBoolPref(this.NEWTAB_ENABLED_PREF, newValue);
+      }
+      let selectedAddon = ExtensionSettingsStore.getSetting(
+        URL_OVERRIDES_TYPE,
+        NEW_TAB_KEY
+      );
+      if (selectedAddon) {
+        ExtensionSettingsStore.select(null, URL_OVERRIDES_TYPE, NEW_TAB_KEY);
+      }
+    } else {
+      let addon = await AddonManager.getAddonByID(menulist.value);
+      if (addon && addon.isActive) {
+        ExtensionSettingsStore.select(
+          addon.id,
+          URL_OVERRIDES_TYPE,
+          NEW_TAB_KEY
+        );
+      }
+    }
+  },
+
+  async syncFromNewTabPref() {
+    let menulist = document.getElementById("newTabMode");
+
+    // If the new tab url was changed to about:blank or about:newtab
+    if (
+      AboutNewTab.newTabURL === "about:newtab" ||
+      AboutNewTab.newTabURL === "about:blank" ||
+      AboutNewTab.newTabURL === BLANK_HOMEPAGE_URL
+    ) {
+      let newtabEnabledPref = Services.prefs.getBoolPref(
+        this.NEWTAB_ENABLED_PREF,
+        true
+      );
+      let newValue = newtabEnabledPref
+        ? this.HOME_MODE_FIREFOX_HOME
+        : this.HOME_MODE_BLANK;
+      if (newValue !== menulist.value) {
+        menulist.value = newValue;
+      }
+      menulist.disabled = Preferences.get(this.NEWTAB_ENABLED_PREF).locked;
+      // If change was triggered by installing an addon we need to update
+      // the value of the menulist to be that addon.
+    } else {
+      let selectedAddon = ExtensionSettingsStore.getSetting(
+        URL_OVERRIDES_TYPE,
+        NEW_TAB_KEY
+      );
+      if (selectedAddon && menulist.value !== selectedAddon.id) {
+        menulist.value = selectedAddon.id;
+      }
+    }
+  },
+
+  /**
+   *  _updateMenuInterface: adds items to or removes them from the menulists
+   * @param {string} selectId Optional Id of the menulist to add or remove items from.
+   *                          If not included this will update both home and newtab menus.
+   */
+  async _updateMenuInterface(selectId) {
+    let selects;
+    if (selectId) {
+      selects = [document.getElementById(selectId)];
+    } else {
+      let newTabSelect = document.getElementById("newTabMode");
+      let homeSelect = document.getElementById("homeMode");
+      selects = [homeSelect, newTabSelect];
+    }
+
+    for (let select of selects) {
+      // Remove addons from the menu popup which are no longer installed, or disabled.
+      // let menuOptions = select.menupopup.childNodes;
+      let menuOptions = Array.from(select.menupopup.childNodes);
+
+      for (let option of menuOptions) {
+        // If the value is not a number, assume it is an addon ID
+        if (!/^\d+$/.test(option.value)) {
+          let addon = await AddonManager.getAddonByID(option.value);
+          if (option && (!addon || !addon.isActive)) {
+            option.remove();
+          }
+        }
+      }
+
+      let extensionOptions;
+      if (select.id === "homeMode") {
+        extensionOptions = await ExtensionSettingsStore.getAllSettings(
+          PREF_SETTING_TYPE,
+          HOMEPAGE_OVERRIDE_KEY
+        );
+      } else {
+        extensionOptions = await ExtensionSettingsStore.getAllSettings(
+          URL_OVERRIDES_TYPE,
+          NEW_TAB_KEY
+        );
+      }
+      let addons = await AddonManager.getAddonsByIDs(
+        extensionOptions.map(a => a.id)
+      );
+
+      // Add addon options to the menu popups
+      let menupopup = select.querySelector("menupopup");
+      for (let addon of addons) {
+        if (!addon || !addon.id || !addon.isActive) {
+          continue;
+        }
+        let currentOption = select.querySelector(
+          `[value="${CSS.escape(addon.id)}"]`
+        );
+        if (!currentOption) {
+          let option = document.createXULElement("menuitem");
+          option.classList.add("addon-with-favicon");
+          option.value = addon.id;
+          option.label = addon.name;
+          menupopup.append(option);
+          option.querySelector("image").src = addon.iconURL;
+        }
+        let setting = extensionOptions.find(o => o.id == addon.id);
+        if (
+          (select.id === "homeMode" && setting.value == HomePage.get()) ||
+          (select.id === "newTabMode" && setting.value == AboutNewTab.newTabURL)
+        ) {
+          select.value = addon.id;
+        }
+      }
+    }
+  },
+
+  /**
+   * watchNewTab: Listen for changes to the new tab url and enable/disable appropriate
+   * areas of the UI.
+   */
+  watchNewTab() {
+    let newTabObserver = () => {
+      this.syncFromNewTabPref();
+      this._updateMenuInterface("newTabMode");
+    };
+    Services.obs.addObserver(newTabObserver, "newtab-url-changed");
+    window.addEventListener("unload", () => {
+      Services.obs.removeObserver(newTabObserver, "newtab-url-changed");
+    });
+  },
+
+  /**
+   * watchHomePrefChange: Listen for preferences changes on the Home Tab in order to
+   * show the appropriate home menu selection.
+   */
+  watchHomePrefChange() {
+    const homePrefObserver = (subject, topic, data) => {
+      // only update this UI if it is exactly the HOMEPAGE_PREF, not other prefs with the same root.
+      if (data && data != this.HOMEPAGE_PREF) {
+        return;
+      }
+      this._updateUseCurrentButton();
+      this._renderCustomSettings();
+      this._handleHomePageOverrides();
+      this._updateMenuInterface("homeMode");
+    };
+
+    Services.prefs.addObserver(this.HOMEPAGE_PREF, homePrefObserver);
+    window.addEventListener("unload", () => {
+      Services.prefs.removeObserver(this.HOMEPAGE_PREF, homePrefObserver);
+    });
+  },
+
+  /**
+   * Listen extension changes on the New Tab and Home Tab
+   * in order to update the UI and show or hide the Restore Defaults button.
+   */
+  watchExtensionPrefChange() {
+    const extensionSettingChanged = (evt, setting) => {
+      if (setting.key == "homepage_override" && setting.type == "prefs") {
+        this._updateMenuInterface("homeMode");
+      } else if (
+        setting.key == "newTabURL" &&
+        setting.type == "url_overrides"
+      ) {
+        this._updateMenuInterface("newTabMode");
+      }
+    };
+
+    Management.on("extension-setting-changed", extensionSettingChanged);
+    window.addEventListener("unload", () => {
+      Management.off("extension-setting-changed", extensionSettingChanged);
+    });
+  },
+
+  /**
+   * Listen for all preferences changes on the Home Tab in order to show or
+   * hide the Restore Defaults button.
+   */
+  watchHomeTabPrefChange() {
+    const observer = () => this.toggleRestoreDefaultsBtn();
+    Services.prefs.addObserver(this.ACTIVITY_STREAM_PREF_BRANCH, observer);
+    Services.prefs.addObserver(this.HOMEPAGE_PREF, observer);
+    Services.prefs.addObserver(this.NEWTAB_ENABLED_PREF, observer);
+
+    window.addEventListener("unload", () => {
+      Services.prefs.removeObserver(this.ACTIVITY_STREAM_PREF_BRANCH, observer);
+      Services.prefs.removeObserver(this.HOMEPAGE_PREF, observer);
+      Services.prefs.removeObserver(this.NEWTAB_ENABLED_PREF, observer);
+    });
+  },
+
+  /**
+   * _renderCustomSettings: Hides or shows the UI for setting a custom
+   * homepage URL
+   * @param {obj} options
+   * @param {bool} options.shouldShow Should the custom UI be shown?
+   * @param {bool} options.isControlled Is an extension controlling the home page?
+   */
+  _renderCustomSettings(options = {}) {
+    let { shouldShow, isControlled } = options;
+    const customSettingsContainerEl = document.getElementById("customSettings");
+    const customUrlEl = document.getElementById("homePageUrl");
+    const homePage = HomePage.get();
+    const isHomePageCustom =
+      (!this._isHomePageDefaultValue() &&
+        !this.isHomePageBlank() &&
+        !isControlled) ||
+      homePage.locked;
+
+    if (typeof shouldShow === "undefined") {
+      shouldShow = isHomePageCustom;
+    }
+    customSettingsContainerEl.hidden = !shouldShow;
+
+    // We can't use isHomePageDefaultValue and isHomePageBlank here because we want to disregard the blank
+    // possibility triggered by the browser.startup.page being 0.
+    // We also skip when HomePage is locked because it might be locked to a default that isn't "about:home"
+    // (and it makes existing tests happy).
+    let newValue;
+    if (
+      this._isBlankPage(homePage) ||
+      (HomePage.isDefault && !HomePage.locked)
+    ) {
+      newValue = "";
+    } else {
+      newValue = homePage;
+    }
+    if (customUrlEl.value !== newValue) {
+      customUrlEl.value = newValue;
+    }
+  },
+
+  /**
+   * _isHomePageDefaultValue
+   * @returns {bool} Is the homepage set to the default pref value?
+   */
+  _isHomePageDefaultValue() {
+    const startupPref = Preferences.get("browser.startup.page");
+    return (
+      startupPref.value !== gMainPane.STARTUP_PREF_BLANK && HomePage.isDefault
+    );
+  },
+
+  /**
+   * isHomePageBlank
+   * @returns {bool} Is the homepage set to about:blank?
+   */
+  isHomePageBlank() {
+    const startupPref = Preferences.get("browser.startup.page");
+    return (
+      ["about:blank", BLANK_HOMEPAGE_URL, ""].includes(HomePage.get()) ||
+      startupPref.value === gMainPane.STARTUP_PREF_BLANK
+    );
+  },
+
+  /**
+   * _isTabAboutPreferences: Is a given tab set to about:preferences?
+   * @param {Element} aTab A tab element
+   * @returns {bool} Is the linkedBrowser of aElement set to about:preferences?
+   */
+  _isTabAboutPreferences(aTab) {
+    return aTab.linkedBrowser.currentURI.spec.startsWith("about:preferences");
+  },
+
+  /**
+   * _getTabsForHomePage
+   * @returns {Array} An array of current tabs
+   */
+  _getTabsForHomePage() {
+    let tabs = [];
+    let win = Services.wm.getMostRecentWindow("navigator:browser");
+
+    // We should only include visible & non-pinned tabs
+    if (
+      win &&
+      win.document.documentElement.getAttribute("windowtype") ===
+        "navigator:browser"
+    ) {
+      tabs = win.gBrowser.visibleTabs.slice(win.gBrowser._numPinnedTabs);
+      tabs = tabs.filter(tab => !this._isTabAboutPreferences(tab));
+      // XXX: Bug 1441637 - Fix tabbrowser to report tab.closing before it blurs it
+      tabs = tabs.filter(tab => !tab.closing);
+    }
+
+    return tabs;
+  },
+
+  _renderHomepageMode(controllingExtension) {
+    const isDefault = this._isHomePageDefaultValue();
+    const isBlank = this.isHomePageBlank();
+    const el = document.getElementById("homeMode");
+    let newValue;
+
+    if (controllingExtension && controllingExtension.id) {
+      newValue = controllingExtension.id;
+    } else if (isDefault) {
+      newValue = this.HOME_MODE_FIREFOX_HOME;
+    } else if (isBlank) {
+      newValue = this.HOME_MODE_BLANK;
+    } else {
+      newValue = this.HOME_MODE_CUSTOM;
+    }
+    if (el.value !== newValue) {
+      el.value = newValue;
+    }
+  },
+
+  _setInputDisabledStates(isControlled) {
+    let tabCount = this._getTabsForHomePage().length;
+
+    // Disable or enable the inputs based on if this is controlled by an extension.
+    document
+      .querySelectorAll(".check-home-page-controlled")
+      .forEach(element => {
+        let isDisabled;
+        let pref =
+          element.getAttribute("preference") ||
+          element.getAttribute("data-preference-related");
+        if (!pref) {
+          throw new Error(
+            `Element with id ${element.id} did not have preference or data-preference-related attribute defined.`
+          );
+        }
+
+        if (pref === this.HOMEPAGE_PREF) {
+          isDisabled = HomePage.locked;
+        } else {
+          isDisabled = Preferences.get(pref).locked || isControlled;
+        }
+
+        if (pref === "pref.browser.disable_button.current_page") {
+          // Special case for current_page to disable it if tabCount is 0
+          isDisabled = isDisabled || tabCount < 1;
+        }
+
+        element.disabled = isDisabled;
+      });
+  },
+
+  async _handleHomePageOverrides() {
+    let controllingExtension;
+    if (HomePage.locked) {
+      // Disable inputs if they are locked.
+      this._renderCustomSettings();
+      this._setInputDisabledStates(false);
+    } else {
+      if (HomePage.get().startsWith("moz-extension:")) {
+        controllingExtension = await getControllingExtension(
+          PREF_SETTING_TYPE,
+          HOMEPAGE_OVERRIDE_KEY
+        );
+      }
+      this._setInputDisabledStates();
+      this._renderCustomSettings({
+        isControlled: !!controllingExtension,
+      });
+    }
+    this._renderHomepageMode(controllingExtension);
+  },
+
+  onMenuChange(event) {
+    const { value } = event.target;
+    const startupPref = Preferences.get("browser.startup.page");
+    let selectedAddon = ExtensionSettingsStore.getSetting(
+      PREF_SETTING_TYPE,
+      HOMEPAGE_OVERRIDE_KEY
+    );
+
+    switch (value) {
+      case this.HOME_MODE_FIREFOX_HOME:
+        if (startupPref.value === gMainPane.STARTUP_PREF_BLANK) {
+          startupPref.value = gMainPane.STARTUP_PREF_HOMEPAGE;
+        }
+        if (!HomePage.isDefault) {
+          HomePage.reset();
+        } else {
+          this._renderCustomSettings({ shouldShow: false });
+        }
+        if (selectedAddon) {
+          ExtensionSettingsStore.select(
+            null,
+            PREF_SETTING_TYPE,
+            HOMEPAGE_OVERRIDE_KEY
+          );
+        }
+        break;
+      case this.HOME_MODE_BLANK:
+        if (!this._isBlankPage(HomePage.get())) {
+          HomePage.safeSet(BLANK_HOMEPAGE_URL);
+        } else {
+          this._renderCustomSettings({ shouldShow: false });
+        }
+        if (selectedAddon) {
+          ExtensionSettingsStore.select(
+            null,
+            PREF_SETTING_TYPE,
+            HOMEPAGE_OVERRIDE_KEY
+          );
+        }
+        break;
+      case this.HOME_MODE_CUSTOM:
+        if (startupPref.value === gMainPane.STARTUP_PREF_BLANK) {
+          Services.prefs.clearUserPref(startupPref.id);
+        }
+        if (HomePage.getDefault() != HomePage.getOriginalDefault()) {
+          HomePage.clear();
+        }
+        this._renderCustomSettings({ shouldShow: true });
+        if (selectedAddon) {
+          ExtensionSettingsStore.select(
+            null,
+            PREF_SETTING_TYPE,
+            HOMEPAGE_OVERRIDE_KEY
+          );
+        }
+        break;
+      // extensions will have a variety of values as their ID, so treat it as default
+      default:
+        AddonManager.getAddonByID(value).then(addon => {
+          if (addon && addon.isActive) {
+            ExtensionPreferencesManager.selectSetting(
+              addon.id,
+              HOMEPAGE_OVERRIDE_KEY
+            );
+          }
+          this._renderCustomSettings({ shouldShow: false });
+        });
+    }
+  },
+
+  /**
+   * Switches the "Use Current Page" button between its singular and plural
+   * forms.
+   */
+  async _updateUseCurrentButton() {
+    let useCurrent = document.getElementById("useCurrentBtn");
+    let tabs = this._getTabsForHomePage();
+    const tabCount = tabs.length;
+    document.l10n.setAttributes(useCurrent, "use-current-pages", { tabCount });
+
+    // If the homepage is controlled by an extension then you can't use this.
+    if (
+      await getControllingExtensionInfo(
+        PREF_SETTING_TYPE,
+        HOMEPAGE_OVERRIDE_KEY
+      )
+    ) {
+      return;
+    }
+
+    // In this case, the button's disabled state is set by preferences.xml.
+    let prefName = "pref.browser.homepage.disable_button.current_page";
+    if (Preferences.get(prefName).locked) {
+      return;
+    }
+
+    useCurrent.disabled = tabCount < 1;
+  },
+
+  /**
+   * Sets the home page to the URL(s) of any currently opened tab(s),
+   * updating about:preferences#home UI to reflect this.
+   */
+  setHomePageToCurrent() {
+    let tabs = this._getTabsForHomePage();
+    function getTabURI(t) {
+      return t.linkedBrowser.currentURI.spec;
+    }
+
+    // FIXME Bug 244192: using dangerous "|" joiner!
+    if (tabs.length) {
+      HomePage.set(tabs.map(getTabURI).join("|")).catch(console.error);
+    }
+  },
+
+  _setHomePageToBookmarkClosed(rv, aEvent) {
+    if (aEvent.detail.button != "accept") {
+      return;
+    }
+    if (rv.urls && rv.names) {
+      // XXX still using dangerous "|" joiner!
+      HomePage.set(rv.urls.join("|")).catch(console.error);
+    }
+  },
+
+  /**
+   * Displays a dialog in which the user can select a bookmark to use as home
+   * page.  If the user selects a bookmark, that bookmark's name is displayed in
+   * UI and the bookmark's address is stored to the home page preference.
+   */
+  setHomePageToBookmark() {
+    const rv = { urls: null, names: null };
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/selectBookmark.xhtml",
+      {
+        features: "resizable=yes, modal=yes",
+        closingCallback: this._setHomePageToBookmarkClosed.bind(this, rv),
+      },
+      rv
+    );
+  },
+
+  restoreDefaultHomePage() {
+    HomePage.reset();
+    this._handleHomePageOverrides();
+    Services.prefs.clearUserPref(this.NEWTAB_ENABLED_PREF);
+    AboutNewTab.resetNewTabURL();
+  },
+
+  onCustomHomePageChange(event) {
+    const value = event.target.value || HomePage.getDefault();
+    HomePage.set(value).catch(console.error);
+  },
+
+  /**
+   * Check all Home Tab preferences for user set values.
+   */
+  _changedHomeTabDefaultPrefs() {
+    // If Discovery Stream is enabled Firefox Home Content preference options are hidden
+    const homeContentChanged =
+      !this.isPocketNewtabEnabled &&
+      this.homePanePrefs.some(pref => pref.hasUserValue);
+    const newtabPref = Preferences.get(this.NEWTAB_ENABLED_PREF);
+    const extensionControlled = Preferences.get(
+      "browser.startup.homepage_override.extensionControlled"
+    );
+
+    return (
+      homeContentChanged ||
+      HomePage.overridden ||
+      newtabPref.hasUserValue ||
+      AboutNewTab.newTabURLOverridden ||
+      extensionControlled
+    );
+  },
+
+  _isBlankPage(url) {
+    return url == "about:blank" || url == BLANK_HOMEPAGE_URL;
+  },
+
+  /**
+   * Show the Restore Defaults button if any preference on the Home tab was
+   * changed, or hide it otherwise.
+   */
+  toggleRestoreDefaultsBtn() {
+    const btn = document.getElementById("restoreDefaultHomePageBtn");
+    const prefChanged = this._changedHomeTabDefaultPrefs();
+    if (prefChanged) {
+      btn.style.removeProperty("visibility");
+    } else {
+      btn.style.visibility = "hidden";
+    }
+  },
+
+  /**
+   * Set all prefs on the Home tab back to their default values.
+   */
+  restoreDefaultPrefsForHome() {
+    this.restoreDefaultHomePage();
+    // If Discovery Stream is enabled Firefox Home Content preference options are hidden
+    if (!this.isPocketNewtabEnabled) {
+      this.homePanePrefs.forEach(pref => Services.prefs.clearUserPref(pref.id));
+    }
+  },
+
+  init() {
+    // Event Listeners
+    document
+      .getElementById("homePageUrl")
+      .addEventListener("change", this.onCustomHomePageChange.bind(this));
+    document
+      .getElementById("useCurrentBtn")
+      .addEventListener("command", this.setHomePageToCurrent.bind(this));
+    document
+      .getElementById("useBookmarkBtn")
+      .addEventListener("command", this.setHomePageToBookmark.bind(this));
+    document
+      .getElementById("restoreDefaultHomePageBtn")
+      .addEventListener("command", this.restoreDefaultPrefsForHome.bind(this));
+
+    // Setup the add-on options for the new tab section before registering the
+    // listener.
+    this._updateMenuInterface();
+    document
+      .getElementById("newTabMode")
+      .addEventListener("command", this.syncToNewTabPref.bind(this));
+    document
+      .getElementById("homeMode")
+      .addEventListener("command", this.onMenuChange.bind(this));
+
+    this._updateUseCurrentButton();
+    this._handleHomePageOverrides();
+    this.syncFromNewTabPref();
+    window.addEventListener("focus", this._updateUseCurrentButton.bind(this));
+
+    // Extension/override-related events
+    this.watchNewTab();
+    this.watchHomePrefChange();
+    this.watchExtensionPrefChange();
+    this.watchHomeTabPrefChange();
+    // Notify observers that the UI is now ready
+    Services.obs.notifyObservers(window, "home-pane-loaded");
+  },
+};
diff --git a/browser/components/preferences/jar.mn b/browser/components/preferences/jar.mn
new file mode 100644
index 0000000000..3b60d18e48
--- /dev/null
+++ b/browser/components/preferences/jar.mn
@@ -0,0 +1,25 @@
+# This Source Code Form is subject to the terms of the Mozilla Public
+# License, v. 2.0. If a copy of the MPL was not distributed with this
+# file, You can obtain one at http://mozilla.org/MPL/2.0/.
+
+browser.jar:
+   content/browser/preferences/preferences.js
+   content/browser/preferences/extensionControlled.js
+*  content/browser/preferences/preferences.xhtml
+
+   content/browser/preferences/main.js
+   content/browser/preferences/home.js
+   content/browser/preferences/search.js
+   content/browser/preferences/privacy.js
+   content/browser/preferences/containers.js
+   content/browser/preferences/translations.js
+   content/browser/preferences/sync.js
+   content/browser/preferences/experimental.js
+   content/browser/preferences/moreFromMozilla.js
+   content/browser/preferences/fxaPairDevice.xhtml
+   content/browser/preferences/fxaPairDevice.js
+   content/browser/preferences/findInPage.js
+   content/browser/preferences/more-from-mozilla-qr-code-simple.svg
+   content/browser/preferences/more-from-mozilla-qr-code-simple-cn.svg
+   content/browser/preferences/web-appearance-dark.svg
+   content/browser/preferences/web-appearance-light.svg
diff --git a/browser/components/preferences/main.inc.xhtml b/browser/components/preferences/main.inc.xhtml
new file mode 100644
index 0000000000..aaacdb6d97
--- /dev/null
+++ b/browser/components/preferences/main.inc.xhtml
@@ -0,0 +1,837 @@
+# This Source Code Form is subject to the terms of the Mozilla Public
+# License, v. 2.0. If a copy of the MPL was not distributed with this
+# file, You can obtain one at http://mozilla.org/MPL/2.0/.
+
+<!-- General panel -->
+
+<script src="chrome://browser/content/preferences/main.js"/>
+
+#ifdef MOZ_UPDATER
+  <script src="chrome://browser/content/aboutDialog-appUpdater.js"/>
+#endif
+
+<script src="chrome://mozapps/content/preferences/fontbuilder.js"/>
+
+<html:template id="template-paneGeneral">
+<hbox id="generalCategory"
+      class="subcategory"
+      hidden="true"
+      data-category="paneGeneral">
+  <html:h1 data-l10n-id="pane-general-title"/>
+</hbox>
+
+<!-- Startup -->
+<groupbox id="startupGroup"
+          data-category="paneGeneral"
+          hidden="true">
+  <label><html:h2 data-l10n-id="startup-header"/></label>
+
+  <vbox id="startupPageBox">
+    <checkbox id="browserRestoreSession"
+              data-l10n-id="startup-restore-windows-and-tabs"/>
+#ifdef XP_WIN
+    <hbox id="windowsLaunchOnLoginBox" align="center" hidden="true">
+      <checkbox id="windowsLaunchOnLogin"
+                data-l10n-id="windows-launch-on-login"/>
+    </hbox>
+    <hbox id="windowsLaunchOnLoginDisabledBox" align="center" class="indent" hidden="true">
+      <hbox class="info-icon-container">
+        <html:img class="info-icon"/>
+      </hbox>
+      <html:div data-l10n-id="windows-launch-on-login-disabled">
+        <html:a id="windowsAutostartLink" class="text-link" data-l10n-name="startup-link" href="ms-settings:startupapps" target="_self" />
+      </html:div>
+    </hbox>
+#endif
+  </vbox>
+
+#ifdef HAVE_SHELL_SERVICE
+  <vbox id="defaultBrowserBox">
+    <checkbox id="alwaysCheckDefault" preference="browser.shell.checkDefaultBrowser"
+              disabled="true"
+              data-l10n-id="always-check-default"/>
+    <stack id="setDefaultPane">
+      <hbox id="isNotDefaultPane" align="center" class="indent">
+        <label class="face-sad" id="isNotDefaultLabel" flex="1" data-l10n-id="is-not-default"/>
+        <button id="setDefaultButton"
+                is="highlightable-button"
+                class="accessory-button"
+                data-l10n-id="set-as-my-default-browser"
+                preference="pref.general.disable_button.default_browser"/>
+      </hbox>
+      <hbox id="isDefaultPane" align="center" class="indent">
+        <label class="face-smile" id="isDefaultLabel" flex="1" data-l10n-id="is-default"/>
+      </hbox>
+    </stack>
+  </vbox>
+#endif
+
+</groupbox>
+
+<!-- Data migration -->
+<groupbox id="dataMigrationGroup" data-category="paneGeneral" hidden="true">
+  <label><html:h2 data-l10n-id="preferences-data-migration-header"/></label>
+
+  <hbox id="dataMigration" flex="1">
+    <description flex="1" control="data-migration" data-l10n-id="preferences-data-migration-description"/>
+    <button id="data-migration"
+            is="highlightable-button"
+            class="accessory-button"
+            data-l10n-id="preferences-data-migration-button"/>
+  </hbox>
+</groupbox>
+
+<!-- Tab preferences -->
+<groupbox data-category="paneGeneral"
+          hidden="true">
+    <label><html:h2 data-l10n-id="tabs-group-header"/></label>
+
+    <checkbox id="ctrlTabRecentlyUsedOrder" data-l10n-id="ctrl-tab-recently-used-order"
+              preference="browser.ctrlTab.sortByRecentlyUsed"/>
+
+    <checkbox id="linkTargeting" data-l10n-id="open-new-link-as-tabs"
+              preference="browser.link.open_newwindow"/>
+
+    <checkbox id="warnOpenMany" data-l10n-id="warn-on-open-many-tabs"
+              preference="browser.tabs.warnOnOpen"/>
+
+    <checkbox id="switchToNewTabs" data-l10n-id="switch-to-new-tabs"
+              preference="browser.tabs.loadInBackground"/>
+
+    <checkbox id="warnCloseMultiple" data-l10n-id="confirm-on-close-multiple-tabs"
+              preference="browser.tabs.warnOnClose"/>
+
+#ifndef XP_WIN
+    <checkbox id="warnOnQuitKey" preference="browser.warnOnQuitShortcut"/>
+#endif
+
+#ifdef XP_WIN
+    <checkbox id="showTabsInTaskbar" data-l10n-id="show-tabs-in-taskbar"
+              preference="browser.taskbar.previews.enable"/>
+#endif
+
+    <checkbox id="tabPreviewShowThumbnails" data-l10n-id="settings-tabs-show-image-in-preview"
+              preference="browser.tabs.cardPreview.showThumbnails" hidden="true"/>
+
+    <vbox id="browserContainersbox" hidden="true">
+      <hbox id="browserContainersExtensionContent"
+            align="center" class="extension-controlled info-box-container">
+        <hbox flex="1">
+          <description control="disableContainersExtension" class="description-with-side-element" flex="1" />
+        </hbox>
+        <button id="disableContainersExtension"
+                is="highlightable-button"
+                class="extension-controlled-button accessory-button"
+                data-l10n-id="disable-extension" />
+      </hbox>
+      <hbox align="center">
+        <checkbox id="browserContainersCheckbox"
+                  class="tail-with-learn-more"
+                  data-l10n-id="browser-containers-enabled"
+                  preference="privacy.userContext.enabled"/>
+        <html:a
+          is="moz-support-link"
+          support-page="containers"
+          data-l10n-id="browser-containers-learn-more"
+        />
+        <spacer flex="1"/>
+        <button id="browserContainersSettings"
+                is="highlightable-button"
+                class="accessory-button"
+                data-l10n-id="browser-containers-settings"
+                search-l10n-ids="containers-add-button.label,
+                  containers-settings-button.label,
+                  containers-remove-button.label"
+                />
+      </hbox>
+    </vbox>
+</groupbox>
+
+<hbox id="languageAndAppearanceCategory"
+      class="subcategory"
+      hidden="true"
+      data-category="paneGeneral">
+  <html:h1 data-l10n-id="language-and-appearance-header"/>
+</hbox>
+
+<!-- Website appearance -->
+<groupbox id="webAppearanceGroup" data-category="paneGeneral" hidden="true">
+  <html:h2 data-l10n-id="preferences-web-appearance-header"/>
+  <html:div id="webAppearanceSettings">
+    <description class="description-deemphasized" data-l10n-id="preferences-web-appearance-description"/>
+    <html:div id="web-appearance-override-warning" class="info-box-container">
+      <html:div class="info-icon-container">
+        <html:img class="info-icon"/>
+      </html:div>
+      <description data-l10n-id="preferences-web-appearance-override-warning">
+        <html:a class="text-link" data-l10n-name="colors-link" id="web-appearance-manage-colors-link" href="#"/>
+      </description>
+    </html:div>
+    <form xmlns="http://www.w3.org/1999/xhtml" id="web-appearance-chooser" autocomplete="off">
+      <label class="web-appearance-choice" data-l10n-id="preferences-web-appearance-choice-tooltip-auto">
+        <div class="web-appearance-choice-image-container"><img role="presentation" alt="" width="54" height="42" /></div>
+        <div class="web-appearance-choice-footer">
+          <input type="radio" name="web-appearance" value="auto" data-l10n-id="preferences-web-appearance-choice-input-auto"
+          /><span data-l10n-id="preferences-web-appearance-choice-auto" />
+        </div>
+      </label>
+      <label class="web-appearance-choice" data-l10n-id="preferences-web-appearance-choice-tooltip-light">
+        <div class="web-appearance-choice-image-container"><img role="presentation" alt="" width="54" height="42" /></div>
+        <div class="web-appearance-choice-footer">
+          <input type="radio" name="web-appearance" value="light" data-l10n-id="preferences-web-appearance-choice-input-light"
+          /><span data-l10n-id="preferences-web-appearance-choice-light" />
+        </div>
+      </label>
+      <label class="web-appearance-choice" data-l10n-id="preferences-web-appearance-choice-tooltip-dark">
+        <div class="web-appearance-choice-image-container"><img role="presentation" alt="" width="54" height="42" /></div>
+        <div class="web-appearance-choice-footer">
+          <input type="radio" name="web-appearance" value="dark" data-l10n-id="preferences-web-appearance-choice-input-dark"
+          /><span data-l10n-id="preferences-web-appearance-choice-dark" />
+        </div>
+      </label>
+    </form>
+    <html:div data-l10n-id="preferences-web-appearance-footer">
+      <html:a id="web-appearance-manage-themes-link" class="text-link" data-l10n-name="themes-link" href="about:addons" target="_blank" />
+    </html:div>
+  </html:div>
+</groupbox>
+
+<!-- Colors -->
+<groupbox id="colorsGroup" data-category="paneGeneral" hidden="true">
+  <label><html:h2 data-l10n-id="preferences-colors-header"/></label>
+
+  <hbox id="colorsSettings" align="center" flex="1">
+    <description flex="1" control="colors" data-l10n-id="preferences-colors-description"/>
+    <button id="colors"
+            is="highlightable-button"
+            class="accessory-button"
+            data-l10n-id="preferences-colors-manage-button"
+            search-l10n-ids="
+              colors-page-override,
+              colors-page-override-option-always.label,
+              colors-page-override-option-auto.label,
+              colors-page-override-option-never.label,
+              colors-text-and-background,
+              colors-text-header,
+              colors-background,
+              colors-use-system,
+              colors-links-header,
+              colors-unvisited-links,
+              colors-visited-links
+            "/>
+  </hbox>
+</groupbox>
+
+<!-- Fonts -->
+<groupbox id="fontsGroup" data-category="paneGeneral" hidden="true">
+  <label><html:h2 data-l10n-id="preferences-fonts-header"/></label>
+
+  <hbox id="fontSettings">
+    <hbox align="center" flex="1">
+      <label control="defaultFont" data-l10n-id="default-font"/>
+      <menulist id="defaultFont" delayprefsave="true"/>
+      <label id="defaultFontSizeLabel" control="defaultFontSize" data-l10n-id="default-font-size"></label>
+      <menulist id="defaultFontSize" delayprefsave="true">
+        <menupopup>
+          <menuitem value="9" label="9"/>
+          <menuitem value="10" label="10"/>
+          <menuitem value="11" label="11"/>
+          <menuitem value="12" label="12"/>
+          <menuitem value="13" label="13"/>
+          <menuitem value="14" label="14"/>
+          <menuitem value="15" label="15"/>
+          <menuitem value="16" label="16"/>
+          <menuitem value="17" label="17"/>
+          <menuitem value="18" label="18"/>
+          <menuitem value="20" label="20"/>
+          <menuitem value="22" label="22"/>
+          <menuitem value="24" label="24"/>
+          <menuitem value="26" label="26"/>
+          <menuitem value="28" label="28"/>
+          <menuitem value="30" label="30"/>
+          <menuitem value="32" label="32"/>
+          <menuitem value="34" label="34"/>
+          <menuitem value="36" label="36"/>
+          <menuitem value="40" label="40"/>
+          <menuitem value="44" label="44"/>
+          <menuitem value="48" label="48"/>
+          <menuitem value="56" label="56"/>
+          <menuitem value="64" label="64"/>
+          <menuitem value="72" label="72"/>
+        </menupopup>
+      </menulist>
+    </hbox>
+
+    <button id="advancedFonts"
+            is="highlightable-button"
+            class="accessory-button"
+            data-l10n-id="advanced-fonts"
+            search-l10n-ids="
+              fonts-window.title,
+              fonts-langgroup-header,
+              fonts-proportional-size,
+              fonts-proportional-header,
+              fonts-serif,
+              fonts-sans-serif,
+              fonts-monospace,
+              fonts-langgroup-arabic.label,
+              fonts-langgroup-armenian.label,
+              fonts-langgroup-bengali.label,
+              fonts-langgroup-simpl-chinese.label,
+              fonts-langgroup-trad-chinese-hk.label,
+              fonts-langgroup-trad-chinese.label,
+              fonts-langgroup-cyrillic.label,
+              fonts-langgroup-devanagari.label,
+              fonts-langgroup-ethiopic.label,
+              fonts-langgroup-georgian.label,
+              fonts-langgroup-el.label,
+              fonts-langgroup-gujarati.label,
+              fonts-langgroup-gurmukhi.label,
+              fonts-langgroup-japanese.label,
+              fonts-langgroup-hebrew.label,
+              fonts-langgroup-kannada.label,
+              fonts-langgroup-khmer.label,
+              fonts-langgroup-korean.label,
+              fonts-langgroup-latin.label,
+              fonts-langgroup-malayalam.label,
+              fonts-langgroup-math.label,
+              fonts-langgroup-odia.label,
+              fonts-langgroup-sinhala.label,
+              fonts-langgroup-tamil.label,
+              fonts-langgroup-telugu.label,
+              fonts-langgroup-thai.label,
+              fonts-langgroup-tibetan.label,
+              fonts-langgroup-canadian.label,
+              fonts-langgroup-other.label,
+              fonts-minsize,
+              fonts-minsize-none.label,
+              fonts-default-serif.label,
+              fonts-default-sans-serif.label,
+              fonts-allow-own.label,
+            " />
+  </hbox>
+</groupbox>
+
+<!-- Zoom -->
+<groupbox id="zoomGroup" data-category="paneGeneral" hidden="true">
+  <label><html:h2 data-l10n-id="preferences-zoom-header"/></label>
+  <hbox id="zoomBox" align="center" hidden="true">
+    <label control="defaultZoom" data-l10n-id="preferences-default-zoom"/>
+    <menulist id="defaultZoom">
+      <menupopup/>
+    </menulist>
+  </hbox>
+  <html:moz-message-bar id="text-zoom-override-warning" data-l10n-id="preferences-text-zoom-override-warning"
+    data-l10n-attrs="message" />
+  <checkbox id="zoomText"
+    data-l10n-id="preferences-zoom-text-only"/>
+
+</groupbox>
+
+<!-- Languages -->
+<groupbox id="languagesGroup" data-category="paneGeneral" hidden="true">
+  <label><html:h2 data-l10n-id="language-header"/></label>
+
+  <vbox id="browserLanguagesBox" align="start" hidden="true">
+    <description flex="1" controls="chooseBrowserLanguage" data-l10n-id="choose-browser-language-description"/>
+    <hbox>
+      <menulist id="primaryBrowserLocale">
+        <menupopup/>
+      </menulist>
+      <button id="manageBrowserLanguagesButton"
+              is="highlightable-button"
+              class="accessory-button"
+              data-l10n-id="manage-browser-languages-button"/>
+    </hbox>
+  </vbox>
+  <hbox id="confirmBrowserLanguage" class="message-bar" align="center" hidden="true">
+    <html:img class="message-bar-icon"/>
+    <vbox class="message-bar-content-container" align="stretch" flex="1"/>
+  </hbox>
+
+  <hbox id="languagesBox" align="center">
+    <description flex="1" control="chooseLanguage" data-l10n-id="choose-language-description"/>
+    <button id="chooseLanguage"
+            is="highlightable-button"
+            class="accessory-button"
+            data-l10n-id="choose-button"
+            search-l10n-ids="
+              webpage-languages-window2.title,
+              languages-description,
+              languages-customize-moveup.label,
+              languages-customize-movedown.label,
+              languages-customize-remove.label,
+              languages-customize-select-language.placeholder,
+              languages-customize-add.label,
+            " />
+  </hbox>
+
+  <checkbox id="useSystemLocale" hidden="true"
+            data-l10n-id="use-system-locale"
+            data-l10n-args='{"localeName": "und"}'
+            preference="intl.regional_prefs.use_os_locales"/>
+
+  <!-- This Firefox Translations UI manages the prefs for the addon only. -->
+  <hbox id="fxtranslationsBox" hidden="true" data-subcategory="fxtranslations">
+    <description flex="1" control="fxtranslateButton" data-l10n-id="fx-translate-web-pages"/>
+    <button id="fxtranslateButton"
+            is="highlightable-button"
+            class="accessory-button"
+            data-l10n-id="translate-exceptions"/>
+  </hbox>
+
+  <checkbox id="checkSpelling"
+          data-l10n-id="check-user-spelling"
+          preference="layout.spellcheckDefault"/>
+
+  <!-- Translations -->
+  <vbox id="translationsGroup" hidden="true" data-subcategory="translations">
+    <label><html:h2 data-l10n-id="translations-manage-header"/></label>
+    <hbox id="translations-manage-description" align="center">
+      <description flex="1" data-l10n-id="translations-manage-intro"/>
+      <button id="translations-manage-settings-button"
+              is="highlightable-button"
+              class="accessory-button"
+              data-l10n-id="translations-manage-settings-button"/>
+    </hbox>
+    <vbox>
+      <html:div id="translations-manage-install-list" hidden="true">
+        <hbox class="translations-manage-language">
+          <label data-l10n-id="translations-manage-install-description"></label>
+          <button id="translations-manage-install-all"
+                  data-l10n-id="translations-manage-language-install-all-button"></button>
+          <button id="translations-manage-delete-all"
+                  data-l10n-id="translations-manage-language-remove-all-button"></button>
+        </hbox>
+        <!-- The downloadable languages will be listed here. -->
+      </html:div>
+      <description id="translations-manage-error" hidden="true"></description>
+    </vbox>
+  </vbox>
+</groupbox>
+
+<!-- Files and Applications -->
+<hbox id="filesAndApplicationsCategory"
+      class="subcategory"
+      hidden="true"
+      data-category="paneGeneral">
+  <html:h1 data-l10n-id="files-and-applications-title"/>
+</hbox>
+
+<!--Downloads-->
+<groupbox id="downloadsGroup" data-category="paneGeneral" hidden="true">
+  <label><html:h2 data-l10n-id="download-header"/></label>
+
+  <hbox id="saveWhere">
+    <label id="saveTo"
+           control="downloadFolder"
+           data-l10n-id="download-save-where"/>
+    <html:input id="downloadFolder"
+                type="text"
+                readonly="readonly"
+                aria-labelledby="saveTo"/>
+    <button id="chooseFolder"
+            is="highlightable-button"
+            class="accessory-button"
+            data-l10n-id="download-choose-folder"/>
+  </hbox>
+  <checkbox id="alwaysAsk"
+            data-l10n-id="download-always-ask-where"
+            preference="browser.download.useDownloadDir"/>
+</groupbox>
+
+<groupbox id="applicationsGroup" data-category="paneGeneral" hidden="true">
+  <label><html:h2 data-l10n-id="applications-header"/></label>
+  <description class="description-deemphasized" data-l10n-id="applications-description"/>
+  <search-textbox id="filter" flex="1"
+                  data-l10n-id="applications-filter"
+                  data-l10n-attrs="placeholder"
+                  aria-controls="handlersView"/>
+
+  <listheader id="handlersViewHeader">
+    <treecol id="typeColumn" data-l10n-id="applications-type-column" value="type"
+             persist="sortDirection"
+             style="flex: 1 50%" sortDirection="ascending"/>
+    <treecol id="actionColumn" data-l10n-id="applications-action-column" value="action"
+             persist="sortDirection"
+             style="flex: 1 50%"/>
+  </listheader>
+  <richlistbox id="handlersView"
+               preference="pref.downloads.disable_button.edit_actions"/>
+  <label id="handleNewFileTypesDesc"
+         data-l10n-id="applications-handle-new-file-types-description"/>
+  <radiogroup id="handleNewFileTypes"
+              preference="browser.download.always_ask_before_handling_new_types">
+    <radio id="saveForNewTypes"
+           value="false"
+           data-l10n-id="applications-save-for-new-types"/>
+    <radio id="askBeforeHandling"
+           value="true"
+           data-l10n-id="applications-ask-before-handling"/>
+  </radiogroup>
+</groupbox>
+
+
+<!-- DRM Content -->
+<groupbox id="drmGroup" data-category="paneGeneral" data-subcategory="drm" hidden="true">
+  <label><html:h2 data-l10n-id="drm-content-header"/></label>
+  <hbox align="center">
+    <checkbox id="playDRMContent" preference="media.eme.enabled"
+              class="tail-with-learn-more" data-l10n-id="play-drm-content" />
+    <html:a is="moz-support-link"
+      data-l10n-id="play-drm-content-learn-more"
+      support-page="drm-content"
+    />
+  </hbox>
+</groupbox>
+
+<hbox id="updatesCategory"
+      class="subcategory"
+      hidden="true"
+      data-category="paneGeneral">
+  <html:h1 data-l10n-id="update-application-title"/>
+</hbox>
+
+<!-- Update -->
+<groupbox id="updateApp" data-category="paneGeneral" hidden="true">
+  <label class="search-header" hidden="true"><html:h2 data-l10n-id="update-application-title"/></label>
+
+  <description class="description-deemphasized" data-l10n-id="update-application-description"/>
+  <hbox align="center">
+    <vbox flex="1">
+      <html:span id="updateAppInfo">
+        <html:a id="releasenotes" target="_blank" data-l10n-name="learn-more" class="learnMore text-link" hidden="true"/>
+      </html:span>
+      <description id="distribution" class="text-blurb" hidden="true"/>
+      <description id="distributionId" class="text-blurb" hidden="true"/>
+    </vbox>
+#ifdef MOZ_UPDATER
+    <button id="showUpdateHistory"
+            is="highlightable-button"
+            class="accessory-button"
+            data-l10n-id="update-history"
+            preference="app.update.disable_button.showUpdateHistory"
+            search-l10n-ids="
+              history-title,
+              history-intro
+            "/>
+#endif
+  </hbox>
+#ifdef MOZ_UPDATER
+  <vbox id="updateBox">
+    <deck id="updateDeck" orient="vertical">
+      <hbox id="checkForUpdates" align="start">
+        <spacer flex="1"/>
+        <button id="checkForUpdatesButton"
+                is="highlightable-button"
+                data-l10n-id="update-checkForUpdatesButton"/>
+      </hbox>
+      <hbox id="downloadAndInstall" align="start">
+        <spacer flex="1"/>
+        <button id="downloadAndInstallButton"
+                is="highlightable-button"/>
+                <!-- label and accesskey will be filled by JS -->
+      </hbox>
+      <hbox id="apply" align="start">
+        <spacer flex="1"/>
+        <button id="updateButton"
+                is="highlightable-button"
+                data-l10n-id="update-updateButton"/>
+      </hbox>
+      <hbox id="checkingForUpdates" align="start">
+        <html:img class="update-throbber"/>
+        <label data-l10n-id="update-checkingForUpdates"/>
+        <button data-l10n-id="update-checkForUpdatesButton"
+                is="highlightable-button"
+                disabled="true"/>
+      </hbox>
+      <description id="downloading" data-l10n-id="settings-update-downloading" data-l10n-args='{"transfer":""}'>
+        <html:img class="update-throbber" data-l10n-name="icon"/>
+        <label data-l10n-name="download-status"/>
+      </description>
+      <hbox id="applying" align="start">
+        <html:img class="update-throbber"/>
+        <label data-l10n-id="update-applying"/>
+      </hbox>
+      <hbox id="downloadFailed" align="start">
+        <label data-l10n-id="update-failed-main">
+          <html:a id="failedLink" target="_blank" class="learnMore text-link" data-l10n-name="failed-link-main"></html:a>
+        </label>
+        <button id="checkForUpdatesButton2"
+                data-l10n-id="update-checkForUpdatesButton"
+                is="highlightable-button"/>
+      </hbox>
+      <hbox id="policyDisabled" align="start">
+        <label data-l10n-id="update-policy-disabled"/>
+        <button data-l10n-id="update-checkForUpdatesButton"
+                is="highlightable-button"
+                disabled="true"/>
+      </hbox>
+      <hbox id="noUpdatesFound" align="start">
+        <label class="face-smile" data-l10n-id="update-noUpdatesFound"/>
+        <button id="checkForUpdatesButton3"
+                data-l10n-id="update-checkForUpdatesButton"
+                is="highlightable-button"/>
+      </hbox>
+      <hbox id="checkingFailed" align="start">
+        <label class="face-sad" data-l10n-id="aboutdialog-update-checking-failed"/>
+        <button id="checkForUpdatesButton4"
+                data-l10n-id="update-checkForUpdatesButton"
+                is="highlightable-button"/>
+      </hbox>
+      <hbox id="otherInstanceHandlingUpdates" align="start">
+        <label data-l10n-id="update-otherInstanceHandlingUpdates"/>
+        <button data-l10n-id="update-checkForUpdatesButton"
+                is="highlightable-button"
+                disabled="true"/>
+      </hbox>
+      <hbox id="manualUpdate" align="start">
+        <description class="face-sad" data-l10n-id="settings-update-manual-with-link" data-l10n-args='{"displayUrl":""}'>
+          <html:a class="manualLink" data-l10n-name="manual-link" target="_blank"/>
+        </description>
+        <button data-l10n-id="update-checkForUpdatesButton"
+                is="highlightable-button"
+                disabled="true"/>
+      </hbox>
+      <hbox id="unsupportedSystem" align="start">
+        <description flex="1" data-l10n-id="update-unsupported">
+          <label id="unsupportedLink" class="learnMore" data-l10n-name="unsupported-link" is="text-link"></label>
+        </description>
+        <button data-l10n-id="update-checkForUpdatesButton"
+                is="highlightable-button"
+                disabled="true"/>
+      </hbox>
+      <hbox id="restarting" align="start">
+        <html:img class="update-throbber"/>
+        <label data-l10n-id="update-restarting"/>
+        <button data-l10n-id="update-updateButton"
+                is="highlightable-button"
+                disabled="true"/>
+      </hbox>
+      <hbox id="internalError" align="start">
+        <description class="face-sad" flex="1" data-l10n-id="update-internal-error2" data-l10n-args='{"displayUrl":""}'>
+          <label class="manualLink" data-l10n-name="manual-link" is="text-link"/>
+        </description>
+        <button data-l10n-id="update-checkForUpdatesButton"
+                is="highlightable-button"
+                disabled="true"/>
+      </hbox>
+    </deck>
+  </vbox>
+#endif
+
+#ifdef MOZ_UPDATER
+  <label id="updateAllowDescription" data-l10n-id="update-application-allow-description"></label>
+  <vbox id="updateSettingsContainer" class="info-box-container">
+    <radiogroup id="updateRadioGroup">
+      <radio id="autoDesktop"
+             value="true"
+             data-l10n-id="update-application-auto"/>
+#ifdef MOZ_UPDATE_AGENT
+      <checkbox id="backgroundUpdate"
+                class="indent"
+                hidden="true"
+                data-l10n-id="update-application-background-enabled"/>
+#endif
+      <radio id="manualDesktop"
+             value="false"
+             data-l10n-id="update-application-check-choose"/>
+    </radiogroup>
+    <hbox id="updateSettingCrossUserWarningDesc" hidden="true">
+      <hbox class="info-icon-container">
+        <html:img class="info-icon"/>
+      </hbox>
+      <description id="updateSettingCrossUserWarning"
+                   flex="1"
+                   data-l10n-id="update-application-warning-cross-user-setting">
+      </description>
+    </hbox>
+  </vbox>
+#ifdef NIGHTLY_BUILD
+  <checkbox id="showUpdatePrompts"
+            data-l10n-id="update-application-suppress-prompts"
+            preference="app.update.suppressPrompts"/>
+#endif
+#endif
+</groupbox>
+
+<hbox id="performanceCategory"
+      class="subcategory"
+      hidden="true"
+      data-category="paneGeneral">
+  <html:h1 data-l10n-id="performance-title"/>
+</hbox>
+
+<!-- Performance -->
+<groupbox id="performanceGroup" data-category="paneGeneral" hidden="true">
+  <label class="search-header" hidden="true"><html:h2 data-l10n-id="performance-title"/></label>
+
+  <hbox align="center">
+    <checkbox id="useRecommendedPerformanceSettings"
+              class="tail-with-learn-more"
+              data-l10n-id="performance-use-recommended-settings-checkbox"
+              preference="browser.preferences.defaultPerformanceSettings.enabled"/>
+    <html:a is="moz-support-link"
+      data-l10n-id="performance-settings-learn-more"
+      support-page="performance"
+      />
+  </hbox>
+  <description class="indent tip-caption" data-l10n-id="performance-use-recommended-settings-desc"/>
+
+  <vbox id="performanceSettings" class="indent" hidden="true">
+    <checkbox id="allowHWAccel"
+              data-l10n-id="performance-allow-hw-accel"
+              preference="layers.acceleration.disabled"/>
+    <hbox align="center">
+      <label id="limitContentProcess" data-l10n-id="performance-limit-content-process-option" control="contentProcessCount"/>
+      <menulist id="contentProcessCount" preference="dom.ipc.processCount">
+        <menupopup>
+          <menuitem label="1" value="1"/>
+          <menuitem label="2" value="2"/>
+          <menuitem label="3" value="3"/>
+          <menuitem label="4" value="4"/>
+          <menuitem label="5" value="5"/>
+          <menuitem label="6" value="6"/>
+          <menuitem label="7" value="7"/>
+          <menuitem label="8" value="8"/>
+        </menupopup>
+      </menulist>
+    </hbox>
+    <description id="contentProcessCountEnabledDescription" class="tip-caption" data-l10n-id="performance-limit-content-process-enabled-desc"/>
+    <description id="contentProcessCountDisabledDescription" class="tip-caption" data-l10n-id="performance-limit-content-process-blocked-desc">
+      <html:a class="text-link" data-l10n-name="learn-more" href="https://wiki.mozilla.org/Electrolysis"/>
+    </description>
+  </vbox>
+</groupbox>
+
+<hbox id="browsingCategory"
+      class="subcategory"
+      hidden="true"
+      data-category="paneGeneral">
+  <html:h1 data-l10n-id="browsing-title"/>
+</hbox>
+
+<!-- Browsing -->
+<groupbox id="browsingGroup" data-category="paneGeneral" hidden="true">
+  <label class="search-header" hidden="true"><html:h2 data-l10n-id="browsing-title"/></label>
+
+  <checkbox id="useAutoScroll"
+            data-l10n-id="browsing-use-autoscroll"
+            preference="general.autoScroll"/>
+  <checkbox id="useSmoothScrolling"
+            data-l10n-id="browsing-use-smooth-scrolling"
+            preference="general.smoothScroll"/>
+#ifdef MOZ_WIDGET_GTK
+  <checkbox id="useOverlayScrollbars"
+            data-l10n-id="browsing-gtk-use-non-overlay-scrollbars"
+            preference="widget.gtk.overlay-scrollbars.enabled"/>
+#endif
+#ifdef XP_WIN
+  <checkbox id="useOnScreenKeyboard"
+            data-l10n-id="browsing-use-onscreen-keyboard"
+            preference="ui.osk.enabled"/>
+#endif
+  <checkbox id="useCursorNavigation"
+            data-l10n-id="browsing-use-cursor-navigation"
+            preference="accessibility.browsewithcaret"/>
+#ifdef XP_MACOSX
+  <checkbox id="useFullKeyboardNavigation"
+            data-l10n-id="browsing-use-full-keyboard-navigation"
+            preference="accessibility.tabfocus" />
+#endif
+  <checkbox id="alwaysUnderlineLinks"
+            data-l10n-id="browsing-always-underline-links"
+            preference="layout.css.always_underline_links"/>
+  <checkbox id="searchStartTyping"
+            data-l10n-id="browsing-search-on-start-typing"
+            preference="accessibility.typeaheadfind"/>
+  <hbox id="pictureInPictureBox" align="center" hidden="true">
+    <checkbox id="pictureInPictureToggleEnabled"
+            class="tail-with-learn-more"
+            data-l10n-id="browsing-picture-in-picture-toggle-enabled"
+            preference="media.videocontrols.picture-in-picture.video-toggle.enabled"/>
+    <html:a is="moz-support-link"
+          data-l10n-id="browsing-picture-in-picture-learn-more"
+          support-page="picture-in-picture"
+    />
+  </hbox>
+  <hbox id="mediaControlBox" align="center" hidden="true">
+    <checkbox id="mediaControlToggleEnabled"
+            class="tail-with-learn-more"
+            data-l10n-id="browsing-media-control"
+            preference="media.hardwaremediakeys.enabled"/>
+    <html:a is="moz-support-link"
+          data-l10n-id="browsing-media-control-learn-more"
+          support-page="media-keyboard-control"
+    />
+  </hbox>
+  <hbox align="center" data-subcategory="cfraddons">
+    <checkbox id="cfrRecommendations"
+            class="tail-with-learn-more"
+            data-l10n-id="browsing-cfr-recommendations"
+            preference="browser.newtabpage.activity-stream.asrouter.userprefs.cfr.addons"/>
+    <html:a is="moz-support-link"
+          data-l10n-id="browsing-cfr-recommendations-learn-more"
+          support-page="extensionrecommendations"
+    />
+  </hbox>
+  <hbox align="center" data-subcategory="cfrfeatures">
+    <checkbox id="cfrRecommendations-features"
+            class="tail-with-learn-more"
+            data-l10n-id="browsing-cfr-features"
+            preference="browser.newtabpage.activity-stream.asrouter.userprefs.cfr.features"/>
+    <html:a is="moz-support-link"
+          data-l10n-id="browsing-cfr-recommendations-learn-more"
+          support-page="extensionrecommendations"
+    />
+  </hbox>
+</groupbox>
+
+<hbox id="networkProxyCategory"
+      class="subcategory"
+      hidden="true"
+      data-category="paneGeneral">
+  <html:h1 data-l10n-id="network-settings-title"/>
+</hbox>
+
+<!-- Network Settings-->
+<groupbox id="connectionGroup" data-category="paneGeneral" hidden="true">
+  <label class="search-header" hidden="true"><html:h2 data-l10n-id="network-settings-title"/></label>
+
+  <hbox align="center"
+      data-subcategory="netsettings">
+    <description flex="1" control="connectionSettings">
+      <html:span id="connectionSettingsDescription"/>
+      <html:a is="moz-support-link"
+            data-l10n-id="network-proxy-connection-learn-more"
+            support-page="prefs-connection-settings"
+      />
+    </description>
+    <separator orient="vertical"/>
+    <button id="connectionSettings"
+            is="highlightable-button"
+            class="accessory-button"
+            data-l10n-id="network-proxy-connection-settings"
+            search-l10n-ids="
+              connection-window2.title,
+              connection-proxy-option-no.label,
+              connection-proxy-option-auto.label,
+              connection-proxy-option-system.label,
+              connection-proxy-option-manual.label,
+              connection-proxy-http,
+              connection-proxy-https,
+              connection-proxy-http-port,
+              connection-proxy-socks,
+              connection-proxy-socks4,
+              connection-proxy-socks5,
+              connection-proxy-noproxy,
+              connection-proxy-noproxy-desc,
+              connection-proxy-https-sharing.label,
+              connection-proxy-autotype.label,
+              connection-proxy-reload.label,
+              connection-proxy-autologin-checkbox.label,
+              connection-proxy-socks-remote-dns.label,
+          " />
+  </hbox>
+</groupbox>
+</html:template>
diff --git a/browser/components/preferences/main.js b/browser/components/preferences/main.js
new file mode 100644
index 0000000000..b9487ece26
--- /dev/null
+++ b/browser/components/preferences/main.js
@@ -0,0 +1,4255 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this file,
+ * You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+/* import-globals-from extensionControlled.js */
+/* import-globals-from preferences.js */
+/* import-globals-from /toolkit/mozapps/preferences/fontbuilder.js */
+/* import-globals-from /browser/base/content/aboutDialog-appUpdater.js */
+/* global MozXULElement */
+
+ChromeUtils.defineESModuleGetters(this, {
+  BackgroundUpdate: "resource://gre/modules/BackgroundUpdate.sys.mjs",
+  MigrationUtils: "resource:///modules/MigrationUtils.sys.mjs",
+  TranslationsParent: "resource://gre/actors/TranslationsParent.sys.mjs",
+  WindowsLaunchOnLogin: "resource://gre/modules/WindowsLaunchOnLogin.sys.mjs",
+  NimbusFeatures: "resource://nimbus/ExperimentAPI.sys.mjs",
+});
+
+// Constants & Enumeration Values
+const TYPE_PDF = "application/pdf";
+
+const PREF_PDFJS_DISABLED = "pdfjs.disabled";
+
+// Pref for when containers is being controlled
+const PREF_CONTAINERS_EXTENSION = "privacy.userContext.extension";
+
+// Strings to identify ExtensionSettingsStore overrides
+const CONTAINERS_KEY = "privacy.containers";
+
+const PREF_USE_SYSTEM_COLORS = "browser.display.use_system_colors";
+const PREF_CONTENT_APPEARANCE =
+  "layout.css.prefers-color-scheme.content-override";
+const FORCED_COLORS_QUERY = matchMedia("(forced-colors)");
+
+const AUTO_UPDATE_CHANGED_TOPIC =
+  UpdateUtils.PER_INSTALLATION_PREFS["app.update.auto"].observerTopic;
+const BACKGROUND_UPDATE_CHANGED_TOPIC =
+  UpdateUtils.PER_INSTALLATION_PREFS["app.update.background.enabled"]
+    .observerTopic;
+
+const ICON_URL_APP =
+  AppConstants.platform == "linux"
+    ? "moz-icon://dummy.exe?size=16"
+    : "chrome://browser/skin/preferences/application.png";
+
+// For CSS. Can be one of "ask", "save" or "handleInternally". If absent, the icon URL
+// was set by us to a custom handler icon and CSS should not try to override it.
+const APP_ICON_ATTR_NAME = "appHandlerIcon";
+
+Preferences.addAll([
+  // Startup
+  { id: "browser.startup.page", type: "int" },
+  { id: "browser.privatebrowsing.autostart", type: "bool" },
+
+  // Downloads
+  { id: "browser.download.useDownloadDir", type: "bool", inverted: true },
+  { id: "browser.download.always_ask_before_handling_new_types", type: "bool" },
+  { id: "browser.download.folderList", type: "int" },
+  { id: "browser.download.dir", type: "file" },
+
+  /* Tab preferences
+  Preferences:
+
+  browser.link.open_newwindow
+      1 opens such links in the most recent window or tab,
+      2 opens such links in a new window,
+      3 opens such links in a new tab
+  browser.tabs.loadInBackground
+  - true if display should switch to a new tab which has been opened from a
+    link, false if display shouldn't switch
+  browser.tabs.warnOnClose
+  - true if when closing a window with multiple tabs the user is warned and
+    allowed to cancel the action, false to just close the window
+  browser.tabs.warnOnOpen
+  - true if the user should be warned if he attempts to open a lot of tabs at
+    once (e.g. a large folder of bookmarks), false otherwise
+  browser.warnOnQuitShortcut
+  - true if the user should be warned if they quit using the keyboard shortcut
+  browser.taskbar.previews.enable
+  - true if tabs are to be shown in the Windows 7 taskbar
+  */
+
+  { id: "browser.link.open_newwindow", type: "int" },
+  { id: "browser.tabs.loadInBackground", type: "bool", inverted: true },
+  { id: "browser.tabs.warnOnClose", type: "bool" },
+  { id: "browser.warnOnQuitShortcut", type: "bool" },
+  { id: "browser.tabs.warnOnOpen", type: "bool" },
+  { id: "browser.ctrlTab.sortByRecentlyUsed", type: "bool" },
+  { id: "browser.tabs.cardPreview.enabled", type: "bool" },
+  { id: "browser.tabs.cardPreview.showThumbnails", type: "bool" },
+
+  // CFR
+  {
+    id: "browser.newtabpage.activity-stream.asrouter.userprefs.cfr.addons",
+    type: "bool",
+  },
+  {
+    id: "browser.newtabpage.activity-stream.asrouter.userprefs.cfr.features",
+    type: "bool",
+  },
+
+  // Fonts
+  { id: "font.language.group", type: "wstring" },
+
+  // Languages
+  { id: "intl.regional_prefs.use_os_locales", type: "bool" },
+
+  // General tab
+
+  /* Accessibility
+   * accessibility.browsewithcaret
+     - true enables keyboard navigation and selection within web pages using a
+       visible caret, false uses normal keyboard navigation with no caret
+   * accessibility.typeaheadfind
+     - when set to true, typing outside text areas and input boxes will
+       automatically start searching for what's typed within the current
+       document; when set to false, no search action happens */
+  { id: "accessibility.browsewithcaret", type: "bool" },
+  { id: "accessibility.typeaheadfind", type: "bool" },
+  { id: "accessibility.blockautorefresh", type: "bool" },
+
+  /* Browsing
+   * general.autoScroll
+     - when set to true, clicking the scroll wheel on the mouse activates a
+       mouse mode where moving the mouse down scrolls the document downward with
+       speed correlated with the distance of the cursor from the original
+       position at which the click occurred (and likewise with movement upward);
+       if false, this behavior is disabled
+   * general.smoothScroll
+     - set to true to enable finer page scrolling than line-by-line on page-up,
+       page-down, and other such page movements */
+  { id: "general.autoScroll", type: "bool" },
+  { id: "general.smoothScroll", type: "bool" },
+  { id: "widget.gtk.overlay-scrollbars.enabled", type: "bool", inverted: true },
+  { id: "layout.css.always_underline_links", type: "bool" },
+  { id: "layout.spellcheckDefault", type: "int" },
+  { id: "accessibility.tabfocus", type: "int" },
+
+  {
+    id: "browser.preferences.defaultPerformanceSettings.enabled",
+    type: "bool",
+  },
+  { id: "dom.ipc.processCount", type: "int" },
+  { id: "dom.ipc.processCount.web", type: "int" },
+  { id: "layers.acceleration.disabled", type: "bool", inverted: true },
+
+  // Files and Applications
+  { id: "pref.downloads.disable_button.edit_actions", type: "bool" },
+
+  // DRM content
+  { id: "media.eme.enabled", type: "bool" },
+
+  // Update
+  { id: "browser.preferences.advanced.selectedTabIndex", type: "int" },
+  { id: "browser.search.update", type: "bool" },
+
+  { id: "privacy.userContext.enabled", type: "bool" },
+  {
+    id: "privacy.userContext.newTabContainerOnLeftClick.enabled",
+    type: "bool",
+  },
+
+  // Picture-in-Picture
+  {
+    id: "media.videocontrols.picture-in-picture.video-toggle.enabled",
+    type: "bool",
+  },
+
+  // Media
+  { id: "media.hardwaremediakeys.enabled", type: "bool" },
+]);
+
+if (AppConstants.HAVE_SHELL_SERVICE) {
+  Preferences.addAll([
+    { id: "browser.shell.checkDefaultBrowser", type: "bool" },
+    { id: "pref.general.disable_button.default_browser", type: "bool" },
+  ]);
+}
+
+if (AppConstants.platform === "win") {
+  Preferences.addAll([
+    { id: "browser.taskbar.previews.enable", type: "bool" },
+    { id: "ui.osk.enabled", type: "bool" },
+  ]);
+}
+
+if (AppConstants.MOZ_UPDATER) {
+  Preferences.addAll([
+    { id: "app.update.disable_button.showUpdateHistory", type: "bool" },
+  ]);
+
+  if (AppConstants.NIGHTLY_BUILD) {
+    Preferences.addAll([{ id: "app.update.suppressPrompts", type: "bool" }]);
+  }
+}
+
+ChromeUtils.defineLazyGetter(this, "gIsPackagedApp", () => {
+  return Services.sysinfo.getProperty("isPackagedApp");
+});
+
+// A promise that resolves when the list of application handlers is loaded.
+// We store this in a global so tests can await it.
+var promiseLoadHandlersList;
+
+// Load the preferences string bundle for other locales with fallbacks.
+function getBundleForLocales(newLocales) {
+  let locales = Array.from(
+    new Set([
+      ...newLocales,
+      ...Services.locale.requestedLocales,
+      Services.locale.lastFallbackLocale,
+    ])
+  );
+  return new Localization(
+    ["browser/preferences/preferences.ftl", "branding/brand.ftl"],
+    false,
+    undefined,
+    locales
+  );
+}
+
+var gNodeToObjectMap = new WeakMap();
+
+var gMainPane = {
+  // The set of types the app knows how to handle.  A hash of HandlerInfoWrapper
+  // objects, indexed by type.
+  _handledTypes: {},
+
+  // The list of types we can show, sorted by the sort column/direction.
+  // An array of HandlerInfoWrapper objects.  We build this list when we first
+  // load the data and then rebuild it when users change a pref that affects
+  // what types we can show or change the sort column/direction.
+  // Note: this isn't necessarily the list of types we *will* show; if the user
+  // provides a filter string, we'll only show the subset of types in this list
+  // that match that string.
+  _visibleTypes: [],
+
+  // browser.startup.page values
+  STARTUP_PREF_BLANK: 0,
+  STARTUP_PREF_HOMEPAGE: 1,
+  STARTUP_PREF_RESTORE_SESSION: 3,
+
+  // Convenience & Performance Shortcuts
+
+  get _list() {
+    delete this._list;
+    return (this._list = document.getElementById("handlersView"));
+  },
+
+  get _filter() {
+    delete this._filter;
+    return (this._filter = document.getElementById("filter"));
+  },
+
+  _backoffIndex: 0,
+
+  /**
+   * Initialization of gMainPane.
+   */
+  init() {
+    function setEventListener(aId, aEventType, aCallback) {
+      document
+        .getElementById(aId)
+        .addEventListener(aEventType, aCallback.bind(gMainPane));
+    }
+
+    if (AppConstants.HAVE_SHELL_SERVICE) {
+      this.updateSetDefaultBrowser();
+      let win = Services.wm.getMostRecentWindow("navigator:browser");
+
+      // Exponential backoff mechanism will delay the polling times if user doesn't
+      // trigger SetDefaultBrowser for a long time.
+      let backoffTimes = [
+        1000, 1000, 1000, 1000, 2000, 2000, 2000, 5000, 5000, 10000,
+      ];
+
+      let pollForDefaultBrowser = () => {
+        let uri = win.gBrowser.currentURI.spec;
+
+        if (
+          (uri == "about:preferences" || uri == "about:preferences#general") &&
+          document.visibilityState == "visible"
+        ) {
+          this.updateSetDefaultBrowser();
+        }
+
+        // approximately a "requestIdleInterval"
+        window.setTimeout(() => {
+          window.requestIdleCallback(pollForDefaultBrowser);
+        }, backoffTimes[this._backoffIndex + 1 < backoffTimes.length ? this._backoffIndex++ : backoffTimes.length - 1]);
+      };
+
+      window.setTimeout(() => {
+        window.requestIdleCallback(pollForDefaultBrowser);
+      }, backoffTimes[this._backoffIndex]);
+    }
+
+    this.initBrowserContainers();
+    this.buildContentProcessCountMenuList();
+
+    this.updateDefaultPerformanceSettingsPref();
+
+    let defaultPerformancePref = Preferences.get(
+      "browser.preferences.defaultPerformanceSettings.enabled"
+    );
+    defaultPerformancePref.on("change", () => {
+      this.updatePerformanceSettingsBox({ duringChangeEvent: true });
+    });
+    this.updatePerformanceSettingsBox({ duringChangeEvent: false });
+    this.displayUseSystemLocale();
+    this.updateProxySettingsUI();
+    initializeProxyUI(gMainPane);
+
+    if (Services.prefs.getBoolPref("intl.multilingual.enabled")) {
+      gMainPane.initPrimaryBrowserLanguageUI();
+    }
+
+    // We call `initDefaultZoomValues` to set and unhide the
+    // default zoom preferences menu, and to establish a
+    // listener for future menu changes.
+    gMainPane.initDefaultZoomValues();
+
+    gMainPane.initTranslations();
+
+    if (
+      Services.prefs.getBoolPref(
+        "media.videocontrols.picture-in-picture.enabled"
+      )
+    ) {
+      document.getElementById("pictureInPictureBox").hidden = false;
+      setEventListener(
+        "pictureInPictureToggleEnabled",
+        "command",
+        function (event) {
+          if (!event.target.checked) {
+            Services.telemetry.recordEvent(
+              "pictureinpicture.settings",
+              "disable",
+              "settings"
+            );
+          }
+        }
+      );
+    }
+
+    if (AppConstants.platform == "win") {
+      // Functionality for "Show tabs in taskbar" on Windows 7 and up.
+      try {
+        let ver = parseFloat(Services.sysinfo.getProperty("version"));
+        let showTabsInTaskbar = document.getElementById("showTabsInTaskbar");
+        showTabsInTaskbar.hidden = ver < 6.1;
+      } catch (ex) {}
+    }
+
+    let thumbsCheckbox = document.getElementById("tabPreviewShowThumbnails");
+    let cardPreviewEnabledPref = Preferences.get(
+      "browser.tabs.cardPreview.enabled"
+    );
+    let maybeShowThumbsCheckbox = () =>
+      (thumbsCheckbox.hidden = !cardPreviewEnabledPref.value);
+    cardPreviewEnabledPref.on("change", maybeShowThumbsCheckbox);
+    maybeShowThumbsCheckbox();
+
+    // The "opening multiple tabs might slow down Firefox" warning provides
+    // an option for not showing this warning again. When the user disables it,
+    // we provide checkboxes to re-enable the warning.
+    if (!TransientPrefs.prefShouldBeVisible("browser.tabs.warnOnOpen")) {
+      document.getElementById("warnOpenMany").hidden = true;
+    }
+
+    if (AppConstants.platform != "win") {
+      let quitKeyElement =
+        window.browsingContext.topChromeWindow.document.getElementById(
+          "key_quitApplication"
+        );
+      if (quitKeyElement) {
+        let quitKey = ShortcutUtils.prettifyShortcut(quitKeyElement);
+        document.l10n.setAttributes(
+          document.getElementById("warnOnQuitKey"),
+          "confirm-on-quit-with-key",
+          { quitKey }
+        );
+      } else {
+        // If the quit key element does not exist, then the quit key has
+        // been disabled, so just hide the checkbox.
+        document.getElementById("warnOnQuitKey").hidden = true;
+      }
+    }
+
+    setEventListener("ctrlTabRecentlyUsedOrder", "command", function () {
+      Services.prefs.clearUserPref("browser.ctrlTab.migrated");
+    });
+    setEventListener("manageBrowserLanguagesButton", "command", function () {
+      gMainPane.showBrowserLanguagesSubDialog({ search: false });
+    });
+    if (AppConstants.MOZ_UPDATER) {
+      // These elements are only compiled in when the updater is enabled
+      setEventListener("checkForUpdatesButton", "command", function () {
+        gAppUpdater.checkForUpdates();
+      });
+      setEventListener("downloadAndInstallButton", "command", function () {
+        gAppUpdater.startDownload();
+      });
+      setEventListener("updateButton", "command", function () {
+        gAppUpdater.buttonRestartAfterDownload();
+      });
+      setEventListener("checkForUpdatesButton2", "command", function () {
+        gAppUpdater.checkForUpdates();
+      });
+      setEventListener("checkForUpdatesButton3", "command", function () {
+        gAppUpdater.checkForUpdates();
+      });
+      setEventListener("checkForUpdatesButton4", "command", function () {
+        gAppUpdater.checkForUpdates();
+      });
+    }
+
+    // Startup pref
+    setEventListener(
+      "browserRestoreSession",
+      "command",
+      gMainPane.onBrowserRestoreSessionChange
+    );
+    if (AppConstants.platform == "win") {
+      setEventListener(
+        "windowsLaunchOnLogin",
+        "command",
+        gMainPane.onWindowsLaunchOnLoginChange
+      );
+      NimbusFeatures.windowsLaunchOnLogin.recordExposureEvent({
+        once: true,
+      });
+      // We do a check here for startWithLastProfile as we could
+      // have disabled the pref for the user before they're ever
+      // exposed to the experiment on a new profile.
+      if (
+        NimbusFeatures.windowsLaunchOnLogin.getVariable("enabled") &&
+        Cc["@mozilla.org/toolkit/profile-service;1"].getService(
+          Ci.nsIToolkitProfileService
+        ).startWithLastProfile
+      ) {
+        document.getElementById("windowsLaunchOnLoginBox").hidden = false;
+      }
+    }
+    gMainPane.updateBrowserStartupUI =
+      gMainPane.updateBrowserStartupUI.bind(gMainPane);
+    Preferences.get("browser.privatebrowsing.autostart").on(
+      "change",
+      gMainPane.updateBrowserStartupUI
+    );
+    Preferences.get("browser.startup.page").on(
+      "change",
+      gMainPane.updateBrowserStartupUI
+    );
+    Preferences.get("browser.startup.homepage").on(
+      "change",
+      gMainPane.updateBrowserStartupUI
+    );
+    gMainPane.updateBrowserStartupUI();
+
+    if (AppConstants.HAVE_SHELL_SERVICE) {
+      setEventListener(
+        "setDefaultButton",
+        "command",
+        gMainPane.setDefaultBrowser
+      );
+    }
+    setEventListener(
+      "disableContainersExtension",
+      "command",
+      makeDisableControllingExtension(PREF_SETTING_TYPE, CONTAINERS_KEY)
+    );
+    setEventListener("chooseLanguage", "command", gMainPane.showLanguages);
+    // TODO (Bug 1817084) Remove this code when we disable the extension
+    setEventListener(
+      "fxtranslateButton",
+      "command",
+      gMainPane.showTranslationExceptions
+    );
+    Preferences.get("font.language.group").on(
+      "change",
+      gMainPane._rebuildFonts.bind(gMainPane)
+    );
+    setEventListener("advancedFonts", "command", gMainPane.configureFonts);
+    setEventListener("colors", "command", gMainPane.configureColors);
+    Preferences.get("layers.acceleration.disabled").on(
+      "change",
+      gMainPane.updateHardwareAcceleration.bind(gMainPane)
+    );
+    setEventListener(
+      "connectionSettings",
+      "command",
+      gMainPane.showConnections
+    );
+    setEventListener(
+      "browserContainersCheckbox",
+      "command",
+      gMainPane.checkBrowserContainers
+    );
+    setEventListener(
+      "browserContainersSettings",
+      "command",
+      gMainPane.showContainerSettings
+    );
+    setEventListener(
+      "data-migration",
+      "command",
+      gMainPane.onMigrationButtonCommand
+    );
+
+    document
+      .getElementById("migrationWizardDialog")
+      .addEventListener("MigrationWizard:Close", function (e) {
+        e.currentTarget.close();
+      });
+
+    if (Services.policies && !Services.policies.isAllowed("profileImport")) {
+      document.getElementById("dataMigrationGroup").remove();
+    }
+
+    // For media control toggle button, we support it on Windows, macOS and
+    // gtk-based Linux.
+    if (
+      AppConstants.platform == "win" ||
+      AppConstants.platform == "macosx" ||
+      AppConstants.MOZ_WIDGET_GTK
+    ) {
+      document.getElementById("mediaControlBox").hidden = false;
+    }
+
+    // Initializes the fonts dropdowns displayed in this pane.
+    this._rebuildFonts();
+
+    // Firefox Translations settings panel
+    // TODO (Bug 1817084) Remove this code when we disable the extension
+    const fxtranslationsDisabledPrefName = "extensions.translations.disabled";
+    if (!Services.prefs.getBoolPref(fxtranslationsDisabledPrefName, true)) {
+      let fxtranslationRow = document.getElementById("fxtranslationsBox");
+      fxtranslationRow.hidden = false;
+    }
+
+    let emeUIEnabled = Services.prefs.getBoolPref("browser.eme.ui.enabled");
+    // Force-disable/hide on WinXP:
+    if (navigator.platform.toLowerCase().startsWith("win")) {
+      emeUIEnabled =
+        emeUIEnabled && parseFloat(Services.sysinfo.get("version")) >= 6;
+    }
+    if (!emeUIEnabled) {
+      // Don't want to rely on .hidden for the toplevel groupbox because
+      // of the pane hiding/showing code potentially interfering:
+      document
+        .getElementById("drmGroup")
+        .setAttribute("style", "display: none !important");
+    }
+    // Initialize the Firefox Updates section.
+    let version = AppConstants.MOZ_APP_VERSION_DISPLAY;
+
+    // Include the build ID if this is an "a#" (nightly) build
+    if (/a\d+$/.test(version)) {
+      let buildID = Services.appinfo.appBuildID;
+      let year = buildID.slice(0, 4);
+      let month = buildID.slice(4, 6);
+      let day = buildID.slice(6, 8);
+      version += ` (${year}-${month}-${day})`;
+    }
+
+    // Append "(32-bit)" or "(64-bit)" build architecture to the version number:
+    let bundle = Services.strings.createBundle(
+      "chrome://browser/locale/browser.properties"
+    );
+    let archResource = Services.appinfo.is64Bit
+      ? "aboutDialog.architecture.sixtyFourBit"
+      : "aboutDialog.architecture.thirtyTwoBit";
+    let arch = bundle.GetStringFromName(archResource);
+    version += ` (${arch})`;
+
+    document.l10n.setAttributes(
+      document.getElementById("updateAppInfo"),
+      "update-application-version",
+      { version }
+    );
+
+    // Show a release notes link if we have a URL.
+    let relNotesLink = document.getElementById("releasenotes");
+    let relNotesPrefType = Services.prefs.getPrefType("app.releaseNotesURL");
+    if (relNotesPrefType != Services.prefs.PREF_INVALID) {
+      let relNotesURL = Services.urlFormatter.formatURLPref(
+        "app.releaseNotesURL"
+      );
+      if (relNotesURL != "about:blank") {
+        relNotesLink.href = relNotesURL;
+        relNotesLink.hidden = false;
+      }
+    }
+
+    let defaults = Services.prefs.getDefaultBranch(null);
+    let distroId = defaults.getCharPref("distribution.id", "");
+    if (distroId) {
+      let distroString = distroId;
+
+      let distroVersion = defaults.getCharPref("distribution.version", "");
+      if (distroVersion) {
+        distroString += " - " + distroVersion;
+      }
+
+      let distroIdField = document.getElementById("distributionId");
+      distroIdField.value = distroString;
+      distroIdField.hidden = false;
+
+      let distroAbout = defaults.getStringPref("distribution.about", "");
+      if (distroAbout) {
+        let distroField = document.getElementById("distribution");
+        distroField.value = distroAbout;
+        distroField.hidden = false;
+      }
+    }
+
+    if (AppConstants.MOZ_UPDATER) {
+      gAppUpdater = new appUpdater();
+      setEventListener("showUpdateHistory", "command", gMainPane.showUpdates);
+
+      let updateDisabled =
+        Services.policies && !Services.policies.isAllowed("appUpdate");
+
+      if (gIsPackagedApp) {
+        // When we're running inside an app package, there's no point in
+        // displaying any update content here, and it would get confusing if we
+        // did, because our updater is not enabled.
+        // We can't rely on the hidden attribute for the toplevel elements,
+        // because of the pane hiding/showing code interfering.
+        document
+          .getElementById("updatesCategory")
+          .setAttribute("style", "display: none !important");
+        document
+          .getElementById("updateApp")
+          .setAttribute("style", "display: none !important");
+      } else if (
+        updateDisabled ||
+        UpdateUtils.appUpdateAutoSettingIsLocked() ||
+        gApplicationUpdateService.manualUpdateOnly
+      ) {
+        document.getElementById("updateAllowDescription").hidden = true;
+        document.getElementById("updateSettingsContainer").hidden = true;
+      } else {
+        // Start with no option selected since we are still reading the value
+        document.getElementById("autoDesktop").removeAttribute("selected");
+        document.getElementById("manualDesktop").removeAttribute("selected");
+        // Start reading the correct value from the disk
+        this.readUpdateAutoPref();
+        setEventListener("updateRadioGroup", "command", event => {
+          if (event.target.id == "backgroundUpdate") {
+            this.writeBackgroundUpdatePref();
+          } else {
+            this.writeUpdateAutoPref();
+          }
+        });
+        if (this.isBackgroundUpdateUIAvailable()) {
+          document.getElementById("backgroundUpdate").hidden = false;
+          // Start reading the background update pref's value from the disk.
+          this.readBackgroundUpdatePref();
+        }
+      }
+
+      if (AppConstants.platform == "win") {
+        // Check for a launch on login registry key
+        // This accounts for if a user manually changes it in the registry
+        // Disabling in Task Manager works outside of just deleting the registry key
+        // in HKEY_CURRENT_USER\Software\Microsoft\Windows\CurrentVersion\Explorer\StartupApproved\Run
+        // but it is not possible to change it back to enabled as the disabled value is just a random
+        // hexadecimal number
+        let launchOnLoginCheckbox = document.getElementById(
+          "windowsLaunchOnLogin"
+        );
+        launchOnLoginCheckbox.checked =
+          WindowsLaunchOnLogin.getLaunchOnLoginEnabled();
+        let approvedByWindows = WindowsLaunchOnLogin.getLaunchOnLoginApproved();
+        launchOnLoginCheckbox.disabled = !approvedByWindows;
+        document.getElementById("windowsLaunchOnLoginDisabledBox").hidden =
+          approvedByWindows;
+
+        // On Windows, the Application Update setting is an installation-
+        // specific preference, not a profile-specific one. Show a warning to
+        // inform users of this.
+        let updateContainer = document.getElementById(
+          "updateSettingsContainer"
+        );
+        updateContainer.classList.add("updateSettingCrossUserWarningContainer");
+        document.getElementById(
+          "updateSettingCrossUserWarningDesc"
+        ).hidden = false;
+      }
+    }
+
+    // Initilize Application section.
+
+    // Observe preferences that influence what we display so we can rebuild
+    // the view when they change.
+    Services.obs.addObserver(this, AUTO_UPDATE_CHANGED_TOPIC);
+    Services.obs.addObserver(this, BACKGROUND_UPDATE_CHANGED_TOPIC);
+
+    setEventListener("filter", "command", gMainPane.filter);
+    setEventListener("typeColumn", "click", gMainPane.sort);
+    setEventListener("actionColumn", "click", gMainPane.sort);
+    setEventListener("chooseFolder", "command", gMainPane.chooseFolder);
+    Preferences.get("browser.download.folderList").on(
+      "change",
+      gMainPane.displayDownloadDirPref.bind(gMainPane)
+    );
+    Preferences.get("browser.download.dir").on(
+      "change",
+      gMainPane.displayDownloadDirPref.bind(gMainPane)
+    );
+    gMainPane.displayDownloadDirPref();
+
+    // Listen for window unload so we can remove our preference observers.
+    window.addEventListener("unload", this);
+
+    // Figure out how we should be sorting the list.  We persist sort settings
+    // across sessions, so we can't assume the default sort column/direction.
+    // XXX should we be using the XUL sort service instead?
+    if (document.getElementById("actionColumn").hasAttribute("sortDirection")) {
+      this._sortColumn = document.getElementById("actionColumn");
+      // The typeColumn element always has a sortDirection attribute,
+      // either because it was persisted or because the default value
+      // from the xul file was used.  If we are sorting on the other
+      // column, we should remove it.
+      document.getElementById("typeColumn").removeAttribute("sortDirection");
+    } else {
+      this._sortColumn = document.getElementById("typeColumn");
+    }
+
+    appendSearchKeywords(
+      "browserContainersSettings",
+      [
+        "user-context-personal",
+        "user-context-work",
+        "user-context-banking",
+        "user-context-shopping",
+      ].map(ContextualIdentityService.formatContextLabel)
+    );
+
+    AppearanceChooser.init();
+
+    // Notify observers that the UI is now ready
+    Services.obs.notifyObservers(window, "main-pane-loaded");
+
+    Preferences.addSyncFromPrefListener(
+      document.getElementById("defaultFont"),
+      element => FontBuilder.readFontSelection(element)
+    );
+    if (AppConstants.platform == "macosx") {
+      // We only expose this control on macOS, so don't try
+      // to add listeners if it doesn't exist.
+      Preferences.addSyncFromPrefListener(
+        document.getElementById("useFullKeyboardNavigation"),
+        () => this.readUseFullKeyboardNavigation()
+      );
+      Preferences.addSyncToPrefListener(
+        document.getElementById("useFullKeyboardNavigation"),
+        () => this.writeUseFullKeyboardNavigation()
+      );
+    }
+    Preferences.addSyncFromPrefListener(
+      document.getElementById("checkSpelling"),
+      () => this.readCheckSpelling()
+    );
+    Preferences.addSyncToPrefListener(
+      document.getElementById("checkSpelling"),
+      () => this.writeCheckSpelling()
+    );
+    Preferences.addSyncFromPrefListener(
+      document.getElementById("alwaysAsk"),
+      () => this.readUseDownloadDir()
+    );
+    Preferences.addSyncFromPrefListener(
+      document.getElementById("linkTargeting"),
+      () => this.readLinkTarget()
+    );
+    Preferences.addSyncToPrefListener(
+      document.getElementById("linkTargeting"),
+      () => this.writeLinkTarget()
+    );
+    Preferences.addSyncFromPrefListener(
+      document.getElementById("browserContainersCheckbox"),
+      () => this.readBrowserContainersCheckbox()
+    );
+
+    this.setInitialized();
+  },
+
+  preInit() {
+    promiseLoadHandlersList = new Promise((resolve, reject) => {
+      // Load the data and build the list of handlers for applications pane.
+      // By doing this after pageshow, we ensure it doesn't delay painting
+      // of the preferences page.
+      window.addEventListener(
+        "pageshow",
+        async () => {
+          await this.initialized;
+          try {
+            this._initListEventHandlers();
+            this._loadData();
+            await this._rebuildVisibleTypes();
+            await this._rebuildView();
+            await this._sortListView();
+            resolve();
+          } catch (ex) {
+            reject(ex);
+          }
+        },
+        { once: true }
+      );
+    });
+  },
+
+  handleSubcategory(subcategory) {
+    if (Services.policies && !Services.policies.isAllowed("profileImport")) {
+      return false;
+    }
+    if (subcategory == "migrate") {
+      this.showMigrationWizardDialog();
+      return true;
+    }
+
+    if (subcategory == "migrate-autoclose") {
+      this.showMigrationWizardDialog({ closeTabWhenDone: true });
+    }
+
+    return false;
+  },
+
+  // CONTAINERS
+
+  /*
+   * preferences:
+   *
+   * privacy.userContext.enabled
+   * - true if containers is enabled
+   */
+
+  /**
+   * Enables/disables the Settings button used to configure containers
+   */
+  readBrowserContainersCheckbox() {
+    const pref = Preferences.get("privacy.userContext.enabled");
+    const settings = document.getElementById("browserContainersSettings");
+
+    settings.disabled = !pref.value;
+    const containersEnabled = Services.prefs.getBoolPref(
+      "privacy.userContext.enabled"
+    );
+    const containersCheckbox = document.getElementById(
+      "browserContainersCheckbox"
+    );
+    containersCheckbox.checked = containersEnabled;
+    handleControllingExtension(PREF_SETTING_TYPE, CONTAINERS_KEY).then(
+      isControlled => {
+        containersCheckbox.disabled = isControlled;
+      }
+    );
+  },
+
+  /**
+   * Show the Containers UI depending on the privacy.userContext.ui.enabled pref.
+   */
+  initBrowserContainers() {
+    if (!Services.prefs.getBoolPref("privacy.userContext.ui.enabled")) {
+      // The browserContainersGroup element has its own internal padding that
+      // is visible even if the browserContainersbox is visible, so hide the whole
+      // groupbox if the feature is disabled to prevent a gap in the preferences.
+      document
+        .getElementById("browserContainersbox")
+        .setAttribute("data-hidden-from-search", "true");
+      return;
+    }
+    Services.prefs.addObserver(PREF_CONTAINERS_EXTENSION, this);
+
+    document.getElementById("browserContainersbox").hidden = false;
+    this.readBrowserContainersCheckbox();
+  },
+
+  async onGetStarted(aEvent) {
+    if (!AppConstants.MOZ_DEV_EDITION) {
+      return;
+    }
+    const win = Services.wm.getMostRecentWindow("navigator:browser");
+    if (!win) {
+      return;
+    }
+    const user = await fxAccounts.getSignedInUser();
+    if (user) {
+      // We have a user, open Sync preferences in the same tab
+      win.openTrustedLinkIn("about:preferences#sync", "current");
+      return;
+    }
+    if (!(await FxAccounts.canConnectAccount())) {
+      return;
+    }
+    let url = await FxAccounts.config.promiseConnectAccountURI(
+      "dev-edition-setup"
+    );
+    let accountsTab = win.gBrowser.addWebTab(url);
+    win.gBrowser.selectedTab = accountsTab;
+  },
+
+  // HOME PAGE
+  /*
+   * Preferences:
+   *
+   * browser.startup.page
+   * - what page(s) to show when the user starts the application, as an integer:
+   *
+   *     0: a blank page (DEPRECATED - this can be set via browser.startup.homepage)
+   *     1: the home page (as set by the browser.startup.homepage pref)
+   *     2: the last page the user visited (DEPRECATED)
+   *     3: windows and tabs from the last session (a.k.a. session restore)
+   *
+   *   The deprecated option is not exposed in UI; however, if the user has it
+   *   selected and doesn't change the UI for this preference, the deprecated
+   *   option is preserved.
+   */
+
+  /**
+   * Utility function to enable/disable the button specified by aButtonID based
+   * on the value of the Boolean preference specified by aPreferenceID.
+   */
+  updateButtons(aButtonID, aPreferenceID) {
+    var button = document.getElementById(aButtonID);
+    var preference = Preferences.get(aPreferenceID);
+    button.disabled = !preference.value;
+    return undefined;
+  },
+
+  /**
+   * Hide/show the "Show my windows and tabs from last time" option based
+   * on the value of the browser.privatebrowsing.autostart pref.
+   */
+  updateBrowserStartupUI() {
+    const pbAutoStartPref = Preferences.get(
+      "browser.privatebrowsing.autostart"
+    );
+    const startupPref = Preferences.get("browser.startup.page");
+
+    let newValue;
+    let checkbox = document.getElementById("browserRestoreSession");
+    checkbox.disabled = pbAutoStartPref.value || startupPref.locked;
+    newValue = pbAutoStartPref.value
+      ? false
+      : startupPref.value === this.STARTUP_PREF_RESTORE_SESSION;
+    if (checkbox.checked !== newValue) {
+      checkbox.checked = newValue;
+    }
+  },
+  /**
+   * Fetch the existing default zoom value, initialise and unhide
+   * the preferences menu. This method also establishes a listener
+   * to ensure handleDefaultZoomChange is called on future menu
+   * changes.
+   */
+  async initDefaultZoomValues() {
+    let win = window.browsingContext.topChromeWindow;
+    let selected = await win.ZoomUI.getGlobalValue();
+    let menulist = document.getElementById("defaultZoom");
+
+    new SelectionChangedMenulist(menulist, event => {
+      let parsedZoom = parseFloat((event.target.value / 100).toFixed(2));
+      gMainPane.handleDefaultZoomChange(parsedZoom);
+    });
+
+    setEventListener("zoomText", "command", function () {
+      win.ZoomManager.toggleZoom();
+      document.getElementById("text-zoom-override-warning").hidden =
+        !document.getElementById("zoomText").checked;
+    });
+
+    let zoomValues = win.ZoomManager.zoomValues.map(a => {
+      return Math.round(a * 100);
+    });
+
+    let fragment = document.createDocumentFragment();
+    for (let zoomLevel of zoomValues) {
+      let menuitem = document.createXULElement("menuitem");
+      document.l10n.setAttributes(menuitem, "preferences-default-zoom-value", {
+        percentage: zoomLevel,
+      });
+      menuitem.setAttribute("value", zoomLevel);
+      fragment.appendChild(menuitem);
+    }
+
+    let menupopup = menulist.querySelector("menupopup");
+    menupopup.appendChild(fragment);
+    menulist.value = Math.round(selected * 100);
+
+    let checkbox = document.getElementById("zoomText");
+    checkbox.checked = !win.ZoomManager.useFullZoom;
+    document.getElementById("text-zoom-override-warning").hidden =
+      !checkbox.checked;
+    document.getElementById("zoomBox").hidden = false;
+  },
+
+  /**
+   * Initialize the translations view.
+   */
+  async initTranslations() {
+    if (!Services.prefs.getBoolPref("browser.translations.enable")) {
+      return;
+    }
+
+    /**
+     * Which phase a language download is in.
+     *
+     * @typedef {"downloaded" | "loading" | "uninstalled"} DownloadPhase
+     */
+
+    // Immediately show the group so that the async load of the component does
+    // not cause the layout to jump. The group will be empty initially.
+    document.getElementById("translationsGroup").hidden = false;
+
+    class TranslationsState {
+      /**
+       * The fully initialized state.
+       *
+       * @param {Object} supportedLanguages
+       * @param {Array<{ langTag: string, displayName: string}} languageList
+       * @param {Map<string, DownloadPhase>} downloadPhases
+       */
+      constructor(supportedLanguages, languageList, downloadPhases) {
+        this.supportedLanguages = supportedLanguages;
+        this.languageList = languageList;
+        this.downloadPhases = downloadPhases;
+      }
+
+      /**
+       * Handles all of the async initialization logic.
+       */
+      static async create() {
+        const supportedLanguages =
+          await TranslationsParent.getSupportedLanguages();
+        const languageList =
+          TranslationsParent.getLanguageList(supportedLanguages);
+        const downloadPhases = await TranslationsState.createDownloadPhases(
+          languageList
+        );
+
+        if (supportedLanguages.languagePairs.length === 0) {
+          throw new Error(
+            "The supported languages list was empty. RemoteSettings may not be available at the moment."
+          );
+        }
+
+        return new TranslationsState(
+          supportedLanguages,
+          languageList,
+          downloadPhases
+        );
+      }
+
+      /**
+       * Determine the download phase of each language file.
+       *
+       * @param {Array<{ langTag: string, displayName: string}} languageList.
+       * @returns {Map<string, DownloadPhase>} Map the language tag to whether it is downloaded.
+       */
+      static async createDownloadPhases(languageList) {
+        const downloadPhases = new Map();
+        for (const { langTag } of languageList) {
+          downloadPhases.set(
+            langTag,
+            (await TranslationsParent.hasAllFilesForLanguage(langTag))
+              ? "downloaded"
+              : "uninstalled"
+          );
+        }
+        return downloadPhases;
+      }
+    }
+
+    class TranslationsView {
+      /** @type {Map<string, XULButton>} */
+      deleteButtons = new Map();
+      /** @type {Map<string, XULButton>} */
+      downloadButtons = new Map();
+
+      /**
+       * @param {TranslationsState} state
+       */
+      constructor(state) {
+        this.state = state;
+        this.elements = {
+          settingsButton: document.getElementById(
+            "translations-manage-settings-button"
+          ),
+          installList: document.getElementById(
+            "translations-manage-install-list"
+          ),
+          installAll: document.getElementById(
+            "translations-manage-install-all"
+          ),
+          deleteAll: document.getElementById("translations-manage-delete-all"),
+          error: document.getElementById("translations-manage-error"),
+        };
+        this.setup();
+      }
+
+      setup() {
+        this.buildLanguageList();
+
+        this.elements.settingsButton.addEventListener(
+          "command",
+          gMainPane.showTranslationsSettings
+        );
+        this.elements.installAll.addEventListener(
+          "command",
+          this.handleInstallAll
+        );
+        this.elements.deleteAll.addEventListener(
+          "command",
+          this.handleDeleteAll
+        );
+      }
+
+      handleInstallAll = async () => {
+        this.hideError();
+        this.disableButtons(true);
+        try {
+          await TranslationsParent.downloadAllFiles();
+          this.markAllDownloadPhases("downloaded");
+        } catch (error) {
+          TranslationsView.showError(
+            "translations-manage-error-install",
+            error
+          );
+          await this.reloadDownloadPhases();
+          this.updateAllButtons();
+        }
+        this.disableButtons(false);
+      };
+
+      handleDeleteAll = async () => {
+        this.hideError();
+        this.disableButtons(true);
+        try {
+          await TranslationsParent.deleteAllLanguageFiles();
+          this.markAllDownloadPhases("uninstalled");
+        } catch (error) {
+          TranslationsView.showError("translations-manage-error-remove", error);
+          // The download phases are invalidated with the error and must be reloaded.
+          await this.reloadDownloadPhases();
+          console.error(error);
+        }
+        this.disableButtons(false);
+      };
+
+      /**
+       * @param {string} langTag
+       * @returns {Function}
+       */
+      getDownloadButtonHandler(langTag) {
+        return async () => {
+          this.hideError();
+          this.updateDownloadPhase(langTag, "loading");
+          try {
+            await TranslationsParent.downloadLanguageFiles(langTag);
+            this.updateDownloadPhase(langTag, "downloaded");
+          } catch (error) {
+            TranslationsView.showError(
+              "translations-manage-error-install",
+              error
+            );
+            this.updateDownloadPhase(langTag, "uninstalled");
+          }
+        };
+      }
+
+      /**
+       * @param {string} langTag
+       * @returns {Function}
+       */
+      getDeleteButtonHandler(langTag) {
+        return async () => {
+          this.hideError();
+          this.updateDownloadPhase(langTag, "loading");
+          try {
+            await TranslationsParent.deleteLanguageFiles(langTag);
+            this.updateDownloadPhase(langTag, "uninstalled");
+          } catch (error) {
+            TranslationsView.showError(
+              "translations-manage-error-remove",
+              error
+            );
+            // The download phases are invalidated with the error and must be reloaded.
+            await this.reloadDownloadPhases();
+          }
+        };
+      }
+
+      buildLanguageList() {
+        const listFragment = document.createDocumentFragment();
+
+        for (const { langTag, displayName } of this.state.languageList) {
+          const hboxRow = document.createXULElement("hbox");
+          hboxRow.classList.add("translations-manage-language");
+
+          const languageLabel = document.createXULElement("label");
+          languageLabel.textContent = displayName; // The display name is already localized.
+
+          const downloadButton = document.createXULElement("button");
+          const deleteButton = document.createXULElement("button");
+
+          downloadButton.addEventListener(
+            "command",
+            this.getDownloadButtonHandler(langTag)
+          );
+          deleteButton.addEventListener(
+            "command",
+            this.getDeleteButtonHandler(langTag)
+          );
+
+          document.l10n.setAttributes(
+            downloadButton,
+            "translations-manage-language-install-button"
+          );
+          document.l10n.setAttributes(
+            deleteButton,
+            "translations-manage-language-remove-button"
+          );
+
+          downloadButton.hidden = true;
+          deleteButton.hidden = true;
+
+          this.deleteButtons.set(langTag, deleteButton);
+          this.downloadButtons.set(langTag, downloadButton);
+
+          hboxRow.appendChild(languageLabel);
+          hboxRow.appendChild(downloadButton);
+          hboxRow.appendChild(deleteButton);
+          listFragment.appendChild(hboxRow);
+        }
+        this.updateAllButtons();
+        this.elements.installList.appendChild(listFragment);
+        this.elements.installList.hidden = false;
+      }
+
+      /**
+       * Update the DownloadPhase for a single langTag.
+       * @param {string} langTag
+       * @param {DownloadPhase} downloadPhase
+       */
+      updateDownloadPhase(langTag, downloadPhase) {
+        this.state.downloadPhases.set(langTag, downloadPhase);
+        this.updateButton(langTag, downloadPhase);
+        this.updateHeaderButtons();
+      }
+
+      /**
+       * Recreates the download map when the state is invalidated.
+       */
+      async reloadDownloadPhases() {
+        this.state.downloadPhases =
+          await TranslationsState.createDownloadPhases(this.state.languageList);
+        this.updateAllButtons();
+      }
+
+      /**
+       * Set all the downloads.
+       * @param {DownloadPhase} downloadPhase
+       */
+      markAllDownloadPhases(downloadPhase) {
+        const { downloadPhases } = this.state;
+        for (const key of downloadPhases.keys()) {
+          downloadPhases.set(key, downloadPhase);
+        }
+        this.updateAllButtons();
+      }
+
+      /**
+       * If all languages are downloaded, or no languages are downloaded then
+       * the visibility of the buttons need to change.
+       */
+      updateHeaderButtons() {
+        let allDownloaded = true;
+        let allUninstalled = true;
+        for (const downloadPhase of this.state.downloadPhases.values()) {
+          if (downloadPhase === "loading") {
+            // Don't count loading towards this calculation.
+            continue;
+          }
+          allDownloaded &&= downloadPhase === "downloaded";
+          allUninstalled &&= downloadPhase === "uninstalled";
+        }
+
+        this.elements.installAll.hidden = allDownloaded;
+        this.elements.deleteAll.hidden = allUninstalled;
+      }
+
+      /**
+       * Update the buttons according to their download state.
+       */
+      updateAllButtons() {
+        this.updateHeaderButtons();
+        for (const [langTag, downloadPhase] of this.state.downloadPhases) {
+          this.updateButton(langTag, downloadPhase);
+        }
+      }
+
+      /**
+       * @param {string} langTag
+       * @param {DownloadPhase} downloadPhase
+       */
+      updateButton(langTag, downloadPhase) {
+        const downloadButton = this.downloadButtons.get(langTag);
+        const deleteButton = this.deleteButtons.get(langTag);
+        switch (downloadPhase) {
+          case "downloaded":
+            downloadButton.hidden = true;
+            deleteButton.hidden = false;
+            downloadButton.removeAttribute("disabled");
+            break;
+          case "uninstalled":
+            downloadButton.hidden = false;
+            deleteButton.hidden = true;
+            downloadButton.removeAttribute("disabled");
+            break;
+          case "loading":
+            downloadButton.hidden = false;
+            deleteButton.hidden = true;
+            downloadButton.setAttribute("disabled", true);
+            break;
+        }
+      }
+
+      /**
+       * @param {boolean} isDisabled
+       */
+      disableButtons(isDisabled) {
+        this.elements.installAll.disabled = isDisabled;
+        this.elements.deleteAll.disabled = isDisabled;
+        for (const button of this.downloadButtons.values()) {
+          button.disabled = isDisabled;
+        }
+        for (const button of this.deleteButtons.values()) {
+          button.disabled = isDisabled;
+        }
+      }
+
+      /**
+       * This method is static in case an error happens during the creation of the
+       * TranslationsState.
+       *
+       * @param {string} l10nId
+       * @param {Error} error
+       */
+      static showError(l10nId, error) {
+        console.error(error);
+        const errorMessage = document.getElementById(
+          "translations-manage-error"
+        );
+        errorMessage.hidden = false;
+        document.l10n.setAttributes(errorMessage, l10nId);
+      }
+
+      hideError() {
+        this.elements.error.hidden = true;
+      }
+    }
+
+    TranslationsState.create().then(
+      state => {
+        new TranslationsView(state);
+      },
+      error => {
+        // This error can happen when a user is not connected to the internet, or
+        // RemoteSettings is down for some reason.
+        TranslationsView.showError("translations-manage-error-list", error);
+      }
+    );
+  },
+
+  initPrimaryBrowserLanguageUI() {
+    // Enable telemetry.
+    Services.telemetry.setEventRecordingEnabled(
+      "intl.ui.browserLanguage",
+      true
+    );
+
+    // This will register the "command" listener.
+    let menulist = document.getElementById("primaryBrowserLocale");
+    new SelectionChangedMenulist(menulist, event => {
+      gMainPane.onPrimaryBrowserLanguageMenuChange(event);
+    });
+
+    gMainPane.updatePrimaryBrowserLanguageUI(Services.locale.appLocaleAsBCP47);
+  },
+
+  /**
+   * Update the available list of locales and select the locale that the user
+   * is "selecting". This could be the currently requested locale or a locale
+   * that the user would like to switch to after confirmation.
+   *
+   * @param {string} selected - The selected BCP 47 locale.
+   */
+  async updatePrimaryBrowserLanguageUI(selected) {
+    let available = await LangPackMatcher.getAvailableLocales();
+    let localeNames = Services.intl.getLocaleDisplayNames(
+      undefined,
+      available,
+      { preferNative: true }
+    );
+    let locales = available.map((code, i) => ({ code, name: localeNames[i] }));
+    locales.sort((a, b) => a.name > b.name);
+
+    let fragment = document.createDocumentFragment();
+    for (let { code, name } of locales) {
+      let menuitem = document.createXULElement("menuitem");
+      menuitem.setAttribute("value", code);
+      menuitem.setAttribute("label", name);
+      fragment.appendChild(menuitem);
+    }
+
+    // Add an option to search for more languages if downloading is supported.
+    if (Services.prefs.getBoolPref("intl.multilingual.downloadEnabled")) {
+      let menuitem = document.createXULElement("menuitem");
+      menuitem.id = "primaryBrowserLocaleSearch";
+      menuitem.setAttribute(
+        "label",
+        await document.l10n.formatValue("browser-languages-search")
+      );
+      menuitem.setAttribute("value", "search");
+      fragment.appendChild(menuitem);
+    }
+
+    let menulist = document.getElementById("primaryBrowserLocale");
+    let menupopup = menulist.querySelector("menupopup");
+    menupopup.textContent = "";
+    menupopup.appendChild(fragment);
+    menulist.value = selected;
+
+    document.getElementById("browserLanguagesBox").hidden = false;
+  },
+
+  /* Show the confirmation message bar to allow a restart into the new locales. */
+  async showConfirmLanguageChangeMessageBar(locales) {
+    let messageBar = document.getElementById("confirmBrowserLanguage");
+
+    // Get the bundle for the new locale.
+    let newBundle = getBundleForLocales(locales);
+
+    // Find the messages and labels.
+    let messages = await Promise.all(
+      [newBundle, document.l10n].map(async bundle =>
+        bundle.formatValue("confirm-browser-language-change-description")
+      )
+    );
+    let buttonLabels = await Promise.all(
+      [newBundle, document.l10n].map(async bundle =>
+        bundle.formatValue("confirm-browser-language-change-button")
+      )
+    );
+
+    // If both the message and label are the same, just include one row.
+    if (messages[0] == messages[1] && buttonLabels[0] == buttonLabels[1]) {
+      messages.pop();
+      buttonLabels.pop();
+    }
+
+    let contentContainer = messageBar.querySelector(
+      ".message-bar-content-container"
+    );
+    contentContainer.textContent = "";
+
+    for (let i = 0; i < messages.length; i++) {
+      let messageContainer = document.createXULElement("hbox");
+      messageContainer.classList.add("message-bar-content");
+      messageContainer.style.flex = "1 50%";
+      messageContainer.setAttribute("align", "center");
+
+      let description = document.createXULElement("description");
+      description.classList.add("message-bar-description");
+
+      if (i == 0 && Services.intl.getScriptDirection(locales[0]) === "rtl") {
+        description.classList.add("rtl-locale");
+      }
+      description.setAttribute("flex", "1");
+      description.textContent = messages[i];
+      messageContainer.appendChild(description);
+
+      let button = document.createXULElement("button");
+      button.addEventListener(
+        "command",
+        gMainPane.confirmBrowserLanguageChange
+      );
+      button.classList.add("message-bar-button");
+      button.setAttribute("locales", locales.join(","));
+      button.setAttribute("label", buttonLabels[i]);
+      messageContainer.appendChild(button);
+
+      contentContainer.appendChild(messageContainer);
+    }
+
+    messageBar.hidden = false;
+    gMainPane.selectedLocalesForRestart = locales;
+  },
+
+  hideConfirmLanguageChangeMessageBar() {
+    let messageBar = document.getElementById("confirmBrowserLanguage");
+    messageBar.hidden = true;
+    let contentContainer = messageBar.querySelector(
+      ".message-bar-content-container"
+    );
+    contentContainer.textContent = "";
+    gMainPane.requestingLocales = null;
+  },
+
+  /* Confirm the locale change and restart the browser in the new locale. */
+  confirmBrowserLanguageChange(event) {
+    let localesString = (event.target.getAttribute("locales") || "").trim();
+    if (!localesString || !localesString.length) {
+      return;
+    }
+    let locales = localesString.split(",");
+    Services.locale.requestedLocales = locales;
+
+    // Record the change in telemetry before we restart.
+    gMainPane.recordBrowserLanguagesTelemetry("apply");
+
+    // Restart with the new locale.
+    let cancelQuit = Cc["@mozilla.org/supports-PRBool;1"].createInstance(
+      Ci.nsISupportsPRBool
+    );
+    Services.obs.notifyObservers(
+      cancelQuit,
+      "quit-application-requested",
+      "restart"
+    );
+    if (!cancelQuit.data) {
+      Services.startup.quit(
+        Services.startup.eAttemptQuit | Services.startup.eRestart
+      );
+    }
+  },
+
+  /* Show or hide the confirm change message bar based on the new locale. */
+  onPrimaryBrowserLanguageMenuChange(event) {
+    let locale = event.target.value;
+
+    if (locale == "search") {
+      gMainPane.showBrowserLanguagesSubDialog({ search: true });
+      return;
+    } else if (locale == Services.locale.appLocaleAsBCP47) {
+      this.hideConfirmLanguageChangeMessageBar();
+      return;
+    }
+
+    let newLocales = Array.from(
+      new Set([locale, ...Services.locale.requestedLocales]).values()
+    );
+
+    gMainPane.recordBrowserLanguagesTelemetry("reorder");
+
+    switch (gMainPane.getLanguageSwitchTransitionType(newLocales)) {
+      case "requires-restart":
+        // Prepare to change the locales, as they were different.
+        gMainPane.showConfirmLanguageChangeMessageBar(newLocales);
+        gMainPane.updatePrimaryBrowserLanguageUI(newLocales[0]);
+        break;
+      case "live-reload":
+        Services.locale.requestedLocales = newLocales;
+        gMainPane.updatePrimaryBrowserLanguageUI(
+          Services.locale.appLocaleAsBCP47
+        );
+        gMainPane.hideConfirmLanguageChangeMessageBar();
+        break;
+      case "locales-match":
+        // They matched, so we can reset the UI.
+        gMainPane.updatePrimaryBrowserLanguageUI(
+          Services.locale.appLocaleAsBCP47
+        );
+        gMainPane.hideConfirmLanguageChangeMessageBar();
+        break;
+      default:
+        throw new Error("Unhandled transition type.");
+    }
+  },
+
+  /**
+   * Takes as newZoom a floating point value representing the
+   * new default zoom. This value should not be a string, and
+   * should not carry a percentage sign/other localisation
+   * characteristics.
+   */
+  handleDefaultZoomChange(newZoom) {
+    let cps2 = Cc["@mozilla.org/content-pref/service;1"].getService(
+      Ci.nsIContentPrefService2
+    );
+    let nonPrivateLoadContext = Cu.createLoadContext();
+    /* Because our setGlobal function takes in a browsing context, and
+     * because we want to keep this property consistent across both private
+     * and non-private contexts, we crate a non-private context and use that
+     * to set the property, regardless of our actual context.
+     */
+
+    let win = window.browsingContext.topChromeWindow;
+    cps2.setGlobal(win.FullZoom.name, newZoom, nonPrivateLoadContext);
+  },
+
+  onBrowserRestoreSessionChange(event) {
+    const value = event.target.checked;
+    const startupPref = Preferences.get("browser.startup.page");
+    let newValue;
+
+    if (value) {
+      // We need to restore the blank homepage setting in our other pref
+      if (startupPref.value === this.STARTUP_PREF_BLANK) {
+        HomePage.safeSet("about:blank");
+      }
+      newValue = this.STARTUP_PREF_RESTORE_SESSION;
+    } else {
+      newValue = this.STARTUP_PREF_HOMEPAGE;
+    }
+    startupPref.value = newValue;
+  },
+
+  async onWindowsLaunchOnLoginChange(event) {
+    if (AppConstants.platform !== "win") {
+      return;
+    }
+    if (event.target.checked) {
+      // windowsLaunchOnLogin has been checked: create registry key
+      WindowsLaunchOnLogin.createLaunchOnLoginRegistryKey();
+      Services.prefs.setBoolPref(
+        "browser.startup.windowsLaunchOnLogin.disableLaunchOnLoginPrompt",
+        true
+      );
+    } else {
+      // windowsLaunchOnLogin has been unchecked: delete registry key and shortcut
+      WindowsLaunchOnLogin.removeLaunchOnLoginRegistryKey();
+      await WindowsLaunchOnLogin.removeLaunchOnLoginShortcuts();
+    }
+  },
+
+  // TABS
+
+  /*
+   * Preferences:
+   *
+   * browser.link.open_newwindow - int
+   *   Determines where links targeting new windows should open.
+   *   Values:
+   *     1 - Open in the current window or tab.
+   *     2 - Open in a new window.
+   *     3 - Open in a new tab in the most recent window.
+   * browser.tabs.loadInBackground - bool
+   *   True - Whether browser should switch to a new tab opened from a link.
+   * browser.tabs.warnOnClose - bool
+   *   True - If when closing a window with multiple tabs the user is warned and
+   *          allowed to cancel the action, false to just close the window.
+   * browser.warnOnQuitShortcut - bool
+   *   True - If the keyboard shortcut (Ctrl/Cmd+Q) is pressed, the user should
+   *          be warned, false to just quit without prompting.
+   * browser.tabs.warnOnOpen - bool
+   *   True - Whether the user should be warned when trying to open a lot of
+   *          tabs at once (e.g. a large folder of bookmarks), allowing to
+   *          cancel the action.
+   * browser.taskbar.previews.enable - bool
+   *   True - Tabs are to be shown in Windows 7 taskbar.
+   *   False - Only the window is to be shown in Windows 7 taskbar.
+   */
+
+  /**
+   * Determines where a link which opens a new window will open.
+   *
+   * @returns |true| if such links should be opened in new tabs
+   */
+  readLinkTarget() {
+    var openNewWindow = Preferences.get("browser.link.open_newwindow");
+    return openNewWindow.value != 2;
+  },
+
+  /**
+   * Determines where a link which opens a new window will open.
+   *
+   * @returns 2 if such links should be opened in new windows,
+   *          3 if such links should be opened in new tabs
+   */
+  writeLinkTarget() {
+    var linkTargeting = document.getElementById("linkTargeting");
+    return linkTargeting.checked ? 3 : 2;
+  },
+  /*
+   * Preferences:
+   *
+   * browser.shell.checkDefault
+   * - true if a default-browser check (and prompt to make it so if necessary)
+   *   occurs at startup, false otherwise
+   */
+
+  /**
+   * Show button for setting browser as default browser or information that
+   * browser is already the default browser.
+   */
+  updateSetDefaultBrowser() {
+    if (AppConstants.HAVE_SHELL_SERVICE) {
+      let shellSvc = getShellService();
+      let defaultBrowserBox = document.getElementById("defaultBrowserBox");
+      let isInFlatpak = gGIOService?.isRunningUnderFlatpak;
+      // Flatpak does not support setting nor detection of default browser
+      if (!shellSvc || isInFlatpak) {
+        defaultBrowserBox.hidden = true;
+        return;
+      }
+      let isDefault = shellSvc.isDefaultBrowser(false, true);
+      let setDefaultPane = document.getElementById("setDefaultPane");
+      setDefaultPane.classList.toggle("is-default", isDefault);
+      let alwaysCheck = document.getElementById("alwaysCheckDefault");
+      let alwaysCheckPref = Preferences.get(
+        "browser.shell.checkDefaultBrowser"
+      );
+      alwaysCheck.disabled = alwaysCheckPref.locked || isDefault;
+    }
+  },
+
+  /**
+   * Set browser as the operating system default browser.
+   */
+  async setDefaultBrowser() {
+    if (AppConstants.HAVE_SHELL_SERVICE) {
+      let alwaysCheckPref = Preferences.get(
+        "browser.shell.checkDefaultBrowser"
+      );
+      alwaysCheckPref.value = true;
+
+      // Reset exponential backoff delay time in order to do visual update in pollForDefaultBrowser.
+      this._backoffIndex = 0;
+
+      let shellSvc = getShellService();
+      if (!shellSvc) {
+        return;
+      }
+
+      // Disable the set default button, so that the user doesn't try to hit it again
+      // while awaiting on setDefaultBrowser
+      let setDefaultButton = document.getElementById("setDefaultButton");
+      setDefaultButton.disabled = true;
+
+      try {
+        await shellSvc.setDefaultBrowser(false);
+      } catch (ex) {
+        console.error(ex);
+        return;
+      } finally {
+        // Make sure to re-enable the default button when we're finished, regardless of the outcome
+        setDefaultButton.disabled = false;
+      }
+
+      let isDefault = shellSvc.isDefaultBrowser(false, true);
+      let setDefaultPane = document.getElementById("setDefaultPane");
+      setDefaultPane.classList.toggle("is-default", isDefault);
+    }
+  },
+
+  /**
+   * Shows a dialog in which the preferred language for web content may be set.
+   */
+  showLanguages() {
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/languages.xhtml"
+    );
+  },
+
+  recordBrowserLanguagesTelemetry(method, value = null) {
+    Services.telemetry.recordEvent(
+      "intl.ui.browserLanguage",
+      method,
+      "main",
+      value
+    );
+  },
+
+  /**
+   * Open the browser languages sub dialog in either the normal mode, or search mode.
+   * The search mode is only available from the menu to change the primary browser
+   * language.
+   *
+   * @param {{ search: boolean }}
+   */
+  showBrowserLanguagesSubDialog({ search }) {
+    // Record the telemetry event with an id to associate related actions.
+    let telemetryId = parseInt(
+      Services.telemetry.msSinceProcessStart(),
+      10
+    ).toString();
+    let method = search ? "search" : "manage";
+    gMainPane.recordBrowserLanguagesTelemetry(method, telemetryId);
+
+    let opts = {
+      selectedLocalesForRestart: gMainPane.selectedLocalesForRestart,
+      search,
+      telemetryId,
+    };
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/browserLanguages.xhtml",
+      { closingCallback: this.browserLanguagesClosed },
+      opts
+    );
+  },
+
+  /**
+   * Determine the transition strategy for switching the locale based on prefs
+   * and the switched locales.
+   *
+   * @param {Array<string>} newLocales - List of BCP 47 locale identifiers.
+   * @returns {"locales-match" | "requires-restart" | "live-reload"}
+   */
+  getLanguageSwitchTransitionType(newLocales) {
+    const { appLocalesAsBCP47 } = Services.locale;
+    if (appLocalesAsBCP47.join(",") === newLocales.join(",")) {
+      // The selected locales match, the order matters.
+      return "locales-match";
+    }
+
+    if (Services.prefs.getBoolPref("intl.multilingual.liveReload")) {
+      if (
+        Services.intl.getScriptDirection(newLocales[0]) !==
+          Services.intl.getScriptDirection(appLocalesAsBCP47[0]) &&
+        !Services.prefs.getBoolPref("intl.multilingual.liveReloadBidirectional")
+      ) {
+        // Bug 1750852: The directionality of the text changed, which requires a restart
+        // until the quality of the switch can be improved.
+        return "requires-restart";
+      }
+
+      return "live-reload";
+    }
+
+    return "requires-restart";
+  },
+
+  /* Show or hide the confirm change message bar based on the updated ordering. */
+  browserLanguagesClosed() {
+    // When the subdialog is closed, settings are stored on gBrowserLanguagesDialog.
+    // The next time the dialog is opened, a new gBrowserLanguagesDialog is created.
+    let { selected } = this.gBrowserLanguagesDialog;
+
+    this.gBrowserLanguagesDialog.recordTelemetry(
+      selected ? "accept" : "cancel"
+    );
+
+    if (!selected) {
+      // No locales were selected. Cancel the operation.
+      return;
+    }
+
+    switch (gMainPane.getLanguageSwitchTransitionType(selected)) {
+      case "requires-restart":
+        gMainPane.showConfirmLanguageChangeMessageBar(selected);
+        gMainPane.updatePrimaryBrowserLanguageUI(selected[0]);
+        break;
+      case "live-reload":
+        Services.locale.requestedLocales = selected;
+
+        gMainPane.updatePrimaryBrowserLanguageUI(
+          Services.locale.appLocaleAsBCP47
+        );
+        gMainPane.hideConfirmLanguageChangeMessageBar();
+        break;
+      case "locales-match":
+        // They matched, so we can reset the UI.
+        gMainPane.updatePrimaryBrowserLanguageUI(
+          Services.locale.appLocaleAsBCP47
+        );
+        gMainPane.hideConfirmLanguageChangeMessageBar();
+        break;
+      default:
+        throw new Error("Unhandled transition type.");
+    }
+  },
+
+  displayUseSystemLocale() {
+    let appLocale = Services.locale.appLocaleAsBCP47;
+    let regionalPrefsLocales = Services.locale.regionalPrefsLocales;
+    if (!regionalPrefsLocales.length) {
+      return;
+    }
+    let systemLocale = regionalPrefsLocales[0];
+    let localeDisplayname = Services.intl.getLocaleDisplayNames(
+      undefined,
+      [systemLocale],
+      { preferNative: true }
+    );
+    if (!localeDisplayname.length) {
+      return;
+    }
+    let localeName = localeDisplayname[0];
+    if (appLocale.split("-u-")[0] != systemLocale.split("-u-")[0]) {
+      let checkbox = document.getElementById("useSystemLocale");
+      document.l10n.setAttributes(checkbox, "use-system-locale", {
+        localeName,
+      });
+      checkbox.hidden = false;
+    }
+  },
+
+  /**
+   * Displays the translation exceptions dialog where specific site and language
+   * translation preferences can be set.
+   */
+  // TODO (Bug 1817084) Remove this code when we disable the extension
+  showTranslationExceptions() {
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/translationExceptions.xhtml"
+    );
+  },
+
+  showTranslationsSettings() {
+    if (
+      Services.prefs.getBoolPref("browser.translations.newSettingsUI.enable")
+    ) {
+      gotoPref("translations");
+    } else {
+      gSubDialog.open(
+        "chrome://browser/content/preferences/dialogs/translations.xhtml"
+      );
+    }
+  },
+
+  /**
+   * Displays the fonts dialog, where web page font names and sizes can be
+   * configured.
+   */
+  configureFonts() {
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/fonts.xhtml",
+      { features: "resizable=no" }
+    );
+  },
+
+  /**
+   * Displays the colors dialog, where default web page/link/etc. colors can be
+   * configured.
+   */
+  configureColors() {
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/colors.xhtml",
+      { features: "resizable=no" }
+    );
+  },
+
+  // NETWORK
+  /**
+   * Displays a dialog in which proxy settings may be changed.
+   */
+  showConnections() {
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/connection.xhtml",
+      { closingCallback: this.updateProxySettingsUI.bind(this) }
+    );
+  },
+
+  // Update the UI to show the proper description depending on whether an
+  // extension is in control or not.
+  async updateProxySettingsUI() {
+    let controllingExtension = await getControllingExtension(
+      PREF_SETTING_TYPE,
+      PROXY_KEY
+    );
+    let description = document.getElementById("connectionSettingsDescription");
+
+    if (controllingExtension) {
+      setControllingExtensionDescription(
+        description,
+        controllingExtension,
+        "proxy.settings"
+      );
+    } else {
+      setControllingExtensionDescription(
+        description,
+        null,
+        "network-proxy-connection-description"
+      );
+    }
+  },
+
+  async checkBrowserContainers(event) {
+    let checkbox = document.getElementById("browserContainersCheckbox");
+    if (checkbox.checked) {
+      Services.prefs.setBoolPref("privacy.userContext.enabled", true);
+      return;
+    }
+
+    let count = ContextualIdentityService.countContainerTabs();
+    if (count == 0) {
+      Services.prefs.setBoolPref("privacy.userContext.enabled", false);
+      return;
+    }
+
+    let [title, message, okButton, cancelButton] =
+      await document.l10n.formatValues([
+        { id: "containers-disable-alert-title" },
+        { id: "containers-disable-alert-desc", args: { tabCount: count } },
+        { id: "containers-disable-alert-ok-button", args: { tabCount: count } },
+        { id: "containers-disable-alert-cancel-button" },
+      ]);
+
+    let buttonFlags =
+      Ci.nsIPrompt.BUTTON_TITLE_IS_STRING * Ci.nsIPrompt.BUTTON_POS_0 +
+      Ci.nsIPrompt.BUTTON_TITLE_IS_STRING * Ci.nsIPrompt.BUTTON_POS_1;
+
+    let rv = Services.prompt.confirmEx(
+      window,
+      title,
+      message,
+      buttonFlags,
+      okButton,
+      cancelButton,
+      null,
+      null,
+      {}
+    );
+    if (rv == 0) {
+      Services.prefs.setBoolPref("privacy.userContext.enabled", false);
+      return;
+    }
+
+    checkbox.checked = true;
+  },
+
+  /**
+   * Displays container panel for customising and adding containers.
+   */
+  showContainerSettings() {
+    gotoPref("containers");
+  },
+
+  updateHardwareAcceleration() {
+    // Placeholder for restart on change
+  },
+
+  // FONTS
+
+  /**
+   * Populates the default font list in UI.
+   */
+  _rebuildFonts() {
+    var langGroupPref = Preferences.get("font.language.group");
+    var isSerif =
+      this._readDefaultFontTypeForLanguage(langGroupPref.value) == "serif";
+    this._selectDefaultLanguageGroup(langGroupPref.value, isSerif);
+  },
+
+  /**
+   * Returns the type of the current default font for the language denoted by
+   * aLanguageGroup.
+   */
+  _readDefaultFontTypeForLanguage(aLanguageGroup) {
+    const kDefaultFontType = "font.default.%LANG%";
+    var defaultFontTypePref = kDefaultFontType.replace(
+      /%LANG%/,
+      aLanguageGroup
+    );
+    var preference = Preferences.get(defaultFontTypePref);
+    if (!preference) {
+      preference = Preferences.add({ id: defaultFontTypePref, type: "string" });
+      preference.on("change", gMainPane._rebuildFonts.bind(gMainPane));
+    }
+    return preference.value;
+  },
+
+  _selectDefaultLanguageGroupPromise: Promise.resolve(),
+
+  _selectDefaultLanguageGroup(aLanguageGroup, aIsSerif) {
+    this._selectDefaultLanguageGroupPromise = (async () => {
+      // Avoid overlapping language group selections by awaiting the resolution
+      // of the previous one.  We do this because this function is re-entrant,
+      // as inserting <preference> elements into the DOM sometimes triggers a call
+      // back into this function.  And since this function is also asynchronous,
+      // that call can enter this function before the previous run has completed,
+      // which would corrupt the font menulists.  Awaiting the previous call's
+      // resolution avoids that fate.
+      await this._selectDefaultLanguageGroupPromise;
+
+      const kFontNameFmtSerif = "font.name.serif.%LANG%";
+      const kFontNameFmtSansSerif = "font.name.sans-serif.%LANG%";
+      const kFontNameListFmtSerif = "font.name-list.serif.%LANG%";
+      const kFontNameListFmtSansSerif = "font.name-list.sans-serif.%LANG%";
+      const kFontSizeFmtVariable = "font.size.variable.%LANG%";
+
+      var prefs = [
+        {
+          format: aIsSerif ? kFontNameFmtSerif : kFontNameFmtSansSerif,
+          type: "fontname",
+          element: "defaultFont",
+          fonttype: aIsSerif ? "serif" : "sans-serif",
+        },
+        {
+          format: aIsSerif ? kFontNameListFmtSerif : kFontNameListFmtSansSerif,
+          type: "unichar",
+          element: null,
+          fonttype: aIsSerif ? "serif" : "sans-serif",
+        },
+        {
+          format: kFontSizeFmtVariable,
+          type: "int",
+          element: "defaultFontSize",
+          fonttype: null,
+        },
+      ];
+      for (var i = 0; i < prefs.length; ++i) {
+        var preference = Preferences.get(
+          prefs[i].format.replace(/%LANG%/, aLanguageGroup)
+        );
+        if (!preference) {
+          var name = prefs[i].format.replace(/%LANG%/, aLanguageGroup);
+          preference = Preferences.add({ id: name, type: prefs[i].type });
+        }
+
+        if (!prefs[i].element) {
+          continue;
+        }
+
+        var element = document.getElementById(prefs[i].element);
+        if (element) {
+          element.setAttribute("preference", preference.id);
+
+          if (prefs[i].fonttype) {
+            await FontBuilder.buildFontList(
+              aLanguageGroup,
+              prefs[i].fonttype,
+              element
+            );
+          }
+
+          preference.setElementValue(element);
+        }
+      }
+    })().catch(console.error);
+  },
+
+  onMigrationButtonCommand(command) {
+    // Even though we're going to be showing the migration wizard here in
+    // about:preferences, we'll delegate the call to
+    // `MigrationUtils.showMigrationWizard`, as this will allow us to
+    // properly measure entering the dialog from the PREFERENCES entrypoint.
+    const browserWindow = window.browsingContext.topChromeWindow;
+
+    MigrationUtils.showMigrationWizard(browserWindow, {
+      entrypoint: MigrationUtils.MIGRATION_ENTRYPOINTS.PREFERENCES,
+    });
+  },
+
+  /**
+   * Displays the migration wizard dialog in an HTML dialog.
+   */
+  async showMigrationWizardDialog({ closeTabWhenDone = false } = {}) {
+    let migrationWizardDialog = document.getElementById(
+      "migrationWizardDialog"
+    );
+
+    if (migrationWizardDialog.open) {
+      return;
+    }
+
+    await customElements.whenDefined("migration-wizard");
+
+    // If we've been opened before, remove the old wizard and insert a
+    // new one to put it back into its starting state.
+    if (!migrationWizardDialog.firstElementChild) {
+      let wizard = document.createElement("migration-wizard");
+      wizard.toggleAttribute("dialog-mode", true);
+      migrationWizardDialog.appendChild(wizard);
+    }
+    migrationWizardDialog.firstElementChild.requestState();
+
+    migrationWizardDialog.addEventListener(
+      "close",
+      () => {
+        // Let others know that the wizard is closed -- potentially because of a
+        // user action within the dialog that dispatches "MigrationWizard:Close"
+        // but this also covers cases like hitting Escape.
+        Services.obs.notifyObservers(
+          migrationWizardDialog,
+          "MigrationWizard:Closed"
+        );
+        if (closeTabWhenDone) {
+          window.close();
+        }
+      },
+      { once: true }
+    );
+
+    migrationWizardDialog.showModal();
+  },
+
+  /**
+   * Stores the original value of the tabfocus preference to enable proper
+   * restoration if unchanged (since we're mapping an int pref onto a checkbox).
+   */
+  _storedFullKeyboardNavigation: Preferences.get("accessibility.tabfocus"),
+
+  /**
+   * Returns true if any full keyboard nav is enabled and false otherwise, caching
+   * the current value to enable proper pref restoration if the checkbox is
+   * never changed.
+   *
+   * accessibility.tabfocus
+   * - an integer controlling the focusability of:
+   *     1  text controls
+   *     2  form elements
+   *     4  links
+   *     7  all of the above
+   */
+  readUseFullKeyboardNavigation() {
+    var pref = Preferences.get("accessibility.tabfocus");
+    this._storedFullKeyboardNavigation = pref.value;
+
+    return pref.value == 7;
+  },
+
+  /**
+   * Returns the value of the full keyboard nav preference represented by UI,
+   * preserving the preference's "hidden" value if the preference is
+   * unchanged and represents a value not strictly allowed in UI.
+   */
+  writeUseFullKeyboardNavigation() {
+    var checkbox = document.getElementById("useFullKeyboardNavigation");
+    if (checkbox.checked) {
+      return 7;
+    }
+    if (this._storedFullKeyboardNavigation != 7) {
+      // 1/2/4 values set via about:config should persist
+      return this._storedFullKeyboardNavigation;
+    }
+    // When the checkbox is unchecked, this pref shouldn't exist
+    // at all.
+    return undefined;
+  },
+
+  /**
+   * Stores the original value of the spellchecking preference to enable proper
+   * restoration if unchanged (since we're mapping a tristate onto a checkbox).
+   */
+  _storedSpellCheck: 0,
+
+  /**
+   * Returns true if any spellchecking is enabled and false otherwise, caching
+   * the current value to enable proper pref restoration if the checkbox is
+   * never changed.
+   *
+   * layout.spellcheckDefault
+   * - an integer:
+   *     0  disables spellchecking
+   *     1  enables spellchecking, but only for multiline text fields
+   *     2  enables spellchecking for all text fields
+   */
+  readCheckSpelling() {
+    var pref = Preferences.get("layout.spellcheckDefault");
+    this._storedSpellCheck = pref.value;
+
+    return pref.value != 0;
+  },
+
+  /**
+   * Returns the value of the spellchecking preference represented by UI,
+   * preserving the preference's "hidden" value if the preference is
+   * unchanged and represents a value not strictly allowed in UI.
+   */
+  writeCheckSpelling() {
+    var checkbox = document.getElementById("checkSpelling");
+    if (checkbox.checked) {
+      if (this._storedSpellCheck == 2) {
+        return 2;
+      }
+      return 1;
+    }
+    return 0;
+  },
+
+  updateDefaultPerformanceSettingsPref() {
+    let defaultPerformancePref = Preferences.get(
+      "browser.preferences.defaultPerformanceSettings.enabled"
+    );
+    let processCountPref = Preferences.get("dom.ipc.processCount");
+    let accelerationPref = Preferences.get("layers.acceleration.disabled");
+    if (
+      processCountPref.value != processCountPref.defaultValue ||
+      accelerationPref.value != accelerationPref.defaultValue
+    ) {
+      defaultPerformancePref.value = false;
+    }
+  },
+
+  updatePerformanceSettingsBox({ duringChangeEvent }) {
+    let defaultPerformancePref = Preferences.get(
+      "browser.preferences.defaultPerformanceSettings.enabled"
+    );
+    let performanceSettings = document.getElementById("performanceSettings");
+    let processCountPref = Preferences.get("dom.ipc.processCount");
+    if (defaultPerformancePref.value) {
+      let accelerationPref = Preferences.get("layers.acceleration.disabled");
+      // Unset the value so process count will be decided by the platform.
+      processCountPref.value = processCountPref.defaultValue;
+      accelerationPref.value = accelerationPref.defaultValue;
+      performanceSettings.hidden = true;
+    } else {
+      performanceSettings.hidden = false;
+    }
+  },
+
+  buildContentProcessCountMenuList() {
+    if (Services.appinfo.fissionAutostart) {
+      document.getElementById("limitContentProcess").hidden = true;
+      document.getElementById("contentProcessCount").hidden = true;
+      document.getElementById(
+        "contentProcessCountEnabledDescription"
+      ).hidden = true;
+      document.getElementById(
+        "contentProcessCountDisabledDescription"
+      ).hidden = true;
+      return;
+    }
+    if (Services.appinfo.browserTabsRemoteAutostart) {
+      let processCountPref = Preferences.get("dom.ipc.processCount");
+      let defaultProcessCount = processCountPref.defaultValue;
+
+      let contentProcessCount =
+        document.querySelector(`#contentProcessCount > menupopup >
+                                menuitem[value="${defaultProcessCount}"]`);
+
+      document.l10n.setAttributes(
+        contentProcessCount,
+        "performance-default-content-process-count",
+        { num: defaultProcessCount }
+      );
+
+      document.getElementById("limitContentProcess").disabled = false;
+      document.getElementById("contentProcessCount").disabled = false;
+      document.getElementById(
+        "contentProcessCountEnabledDescription"
+      ).hidden = false;
+      document.getElementById(
+        "contentProcessCountDisabledDescription"
+      ).hidden = true;
+    } else {
+      document.getElementById("limitContentProcess").disabled = true;
+      document.getElementById("contentProcessCount").disabled = true;
+      document.getElementById(
+        "contentProcessCountEnabledDescription"
+      ).hidden = true;
+      document.getElementById(
+        "contentProcessCountDisabledDescription"
+      ).hidden = false;
+    }
+  },
+
+  _minUpdatePrefDisableTime: 1000,
+  /**
+   * Selects the correct item in the update radio group
+   */
+  async readUpdateAutoPref() {
+    if (
+      AppConstants.MOZ_UPDATER &&
+      (!Services.policies || Services.policies.isAllowed("appUpdate")) &&
+      !gIsPackagedApp
+    ) {
+      let radiogroup = document.getElementById("updateRadioGroup");
+
+      radiogroup.disabled = true;
+      let enabled = await UpdateUtils.getAppUpdateAutoEnabled();
+      radiogroup.value = enabled;
+      radiogroup.disabled = false;
+
+      this.maybeDisableBackgroundUpdateControls();
+    }
+  },
+
+  /**
+   * Writes the value of the automatic update radio group to the disk
+   */
+  async writeUpdateAutoPref() {
+    if (
+      AppConstants.MOZ_UPDATER &&
+      (!Services.policies || Services.policies.isAllowed("appUpdate")) &&
+      !gIsPackagedApp
+    ) {
+      let radiogroup = document.getElementById("updateRadioGroup");
+      let updateAutoValue = radiogroup.value == "true";
+      let _disableTimeOverPromise = new Promise(r =>
+        setTimeout(r, this._minUpdatePrefDisableTime)
+      );
+      radiogroup.disabled = true;
+      try {
+        await UpdateUtils.setAppUpdateAutoEnabled(updateAutoValue);
+        await _disableTimeOverPromise;
+        radiogroup.disabled = false;
+      } catch (error) {
+        console.error(error);
+        await Promise.all([
+          this.readUpdateAutoPref(),
+          this.reportUpdatePrefWriteError(),
+        ]);
+        return;
+      }
+
+      this.maybeDisableBackgroundUpdateControls();
+
+      // If the value was changed to false the user should be given the option
+      // to discard an update if there is one.
+      if (!updateAutoValue) {
+        await this.checkUpdateInProgress();
+      }
+      // For tests:
+      radiogroup.dispatchEvent(new CustomEvent("ProcessedUpdatePrefChange"));
+    }
+  },
+
+  isBackgroundUpdateUIAvailable() {
+    return (
+      AppConstants.MOZ_UPDATE_AGENT &&
+      // This UI controls a per-installation pref. It won't necessarily work
+      // properly if per-installation prefs aren't supported.
+      UpdateUtils.PER_INSTALLATION_PREFS_SUPPORTED &&
+      (!Services.policies || Services.policies.isAllowed("appUpdate")) &&
+      !gIsPackagedApp &&
+      !UpdateUtils.appUpdateSettingIsLocked("app.update.background.enabled")
+    );
+  },
+
+  maybeDisableBackgroundUpdateControls() {
+    if (this.isBackgroundUpdateUIAvailable()) {
+      let radiogroup = document.getElementById("updateRadioGroup");
+      let updateAutoEnabled = radiogroup.value == "true";
+
+      // This control is only active if auto update is enabled.
+      document.getElementById("backgroundUpdate").disabled = !updateAutoEnabled;
+    }
+  },
+
+  async readBackgroundUpdatePref() {
+    const prefName = "app.update.background.enabled";
+    if (this.isBackgroundUpdateUIAvailable()) {
+      let backgroundCheckbox = document.getElementById("backgroundUpdate");
+
+      // When the page first loads, the checkbox is unchecked until we finish
+      // reading the config file from the disk. But, ideally, we don't want to
+      // give the user the impression that this setting has somehow gotten
+      // turned off and they need to turn it back on. We also don't want the
+      // user interacting with the control, expecting a particular behavior, and
+      // then have the read complete and change the control in an unexpected
+      // way. So we disable the control while we are reading.
+      // The only entry points for this function are page load and user
+      // interaction with the control. By disabling the control to prevent
+      // further user interaction, we prevent the possibility of entering this
+      // function a second time while we are still reading.
+      backgroundCheckbox.disabled = true;
+
+      // If we haven't already done this, it might result in the effective value
+      // of the Background Update pref changing. Thus, we should do it before
+      // we tell the user what value this pref has.
+      await BackgroundUpdate.ensureExperimentToRolloutTransitionPerformed();
+
+      let enabled = await UpdateUtils.readUpdateConfigSetting(prefName);
+      backgroundCheckbox.checked = enabled;
+      this.maybeDisableBackgroundUpdateControls();
+    }
+  },
+
+  async writeBackgroundUpdatePref() {
+    const prefName = "app.update.background.enabled";
+    if (this.isBackgroundUpdateUIAvailable()) {
+      let backgroundCheckbox = document.getElementById("backgroundUpdate");
+      backgroundCheckbox.disabled = true;
+      let backgroundUpdateEnabled = backgroundCheckbox.checked;
+      try {
+        await UpdateUtils.writeUpdateConfigSetting(
+          prefName,
+          backgroundUpdateEnabled
+        );
+      } catch (error) {
+        console.error(error);
+        await this.readBackgroundUpdatePref();
+        await this.reportUpdatePrefWriteError();
+        return;
+      }
+
+      this.maybeDisableBackgroundUpdateControls();
+    }
+  },
+
+  async reportUpdatePrefWriteError() {
+    let [title, message] = await document.l10n.formatValues([
+      { id: "update-setting-write-failure-title2" },
+      {
+        id: "update-setting-write-failure-message2",
+        args: { path: UpdateUtils.configFilePath },
+      },
+    ]);
+
+    // Set up the Ok Button
+    let buttonFlags =
+      Services.prompt.BUTTON_POS_0 * Services.prompt.BUTTON_TITLE_OK;
+    Services.prompt.confirmEx(
+      window,
+      title,
+      message,
+      buttonFlags,
+      null,
+      null,
+      null,
+      null,
+      {}
+    );
+  },
+
+  async checkUpdateInProgress() {
+    let um = Cc["@mozilla.org/updates/update-manager;1"].getService(
+      Ci.nsIUpdateManager
+    );
+    if (!um.readyUpdate && !um.downloadingUpdate) {
+      return;
+    }
+
+    let [title, message, okButton, cancelButton] =
+      await document.l10n.formatValues([
+        { id: "update-in-progress-title" },
+        { id: "update-in-progress-message" },
+        { id: "update-in-progress-ok-button" },
+        { id: "update-in-progress-cancel-button" },
+      ]);
+
+    // Continue is the cancel button which is BUTTON_POS_1 and is set as the
+    // default so pressing escape or using a platform standard method of closing
+    // the UI will not discard the update.
+    let buttonFlags =
+      Ci.nsIPrompt.BUTTON_TITLE_IS_STRING * Ci.nsIPrompt.BUTTON_POS_0 +
+      Ci.nsIPrompt.BUTTON_TITLE_IS_STRING * Ci.nsIPrompt.BUTTON_POS_1 +
+      Ci.nsIPrompt.BUTTON_POS_1_DEFAULT;
+
+    let rv = Services.prompt.confirmEx(
+      window,
+      title,
+      message,
+      buttonFlags,
+      okButton,
+      cancelButton,
+      null,
+      null,
+      {}
+    );
+    if (rv != 1) {
+      let aus = Cc["@mozilla.org/updates/update-service;1"].getService(
+        Ci.nsIApplicationUpdateService
+      );
+      await aus.stopDownload();
+      um.cleanupReadyUpdate();
+      um.cleanupDownloadingUpdate();
+    }
+  },
+
+  /**
+   * Displays the history of installed updates.
+   */
+  showUpdates() {
+    gSubDialog.open("chrome://mozapps/content/update/history.xhtml");
+  },
+
+  destroy() {
+    window.removeEventListener("unload", this);
+    Services.prefs.removeObserver(PREF_CONTAINERS_EXTENSION, this);
+    Services.obs.removeObserver(this, AUTO_UPDATE_CHANGED_TOPIC);
+    Services.obs.removeObserver(this, BACKGROUND_UPDATE_CHANGED_TOPIC);
+    AppearanceChooser.destroy();
+  },
+
+  // nsISupports
+
+  QueryInterface: ChromeUtils.generateQI(["nsIObserver"]),
+
+  // nsIObserver
+
+  async observe(aSubject, aTopic, aData) {
+    if (aTopic == "nsPref:changed") {
+      if (aData == PREF_CONTAINERS_EXTENSION) {
+        this.readBrowserContainersCheckbox();
+        return;
+      }
+      // Rebuild the list when there are changes to preferences that influence
+      // whether or not to show certain entries in the list.
+      if (!this._storingAction) {
+        await this._rebuildView();
+      }
+    } else if (aTopic == AUTO_UPDATE_CHANGED_TOPIC) {
+      if (!AppConstants.MOZ_UPDATER) {
+        return;
+      }
+      if (aData != "true" && aData != "false") {
+        throw new Error("Invalid preference value for app.update.auto");
+      }
+      document.getElementById("updateRadioGroup").value = aData;
+      this.maybeDisableBackgroundUpdateControls();
+    } else if (aTopic == BACKGROUND_UPDATE_CHANGED_TOPIC) {
+      if (!AppConstants.MOZ_UPDATE_AGENT) {
+        return;
+      }
+      if (aData != "true" && aData != "false") {
+        throw new Error(
+          "Invalid preference value for app.update.background.enabled"
+        );
+      }
+      document.getElementById("backgroundUpdate").checked = aData == "true";
+    }
+  },
+
+  // EventListener
+
+  handleEvent(aEvent) {
+    if (aEvent.type == "unload") {
+      this.destroy();
+      if (AppConstants.MOZ_UPDATER) {
+        onUnload();
+      }
+    }
+  },
+
+  // Composed Model Construction
+
+  _loadData() {
+    this._loadInternalHandlers();
+    this._loadApplicationHandlers();
+  },
+
+  /**
+   * Load higher level internal handlers so they can be turned on/off in the
+   * applications menu.
+   */
+  _loadInternalHandlers() {
+    let internalHandlers = [new PDFHandlerInfoWrapper()];
+
+    let enabledHandlers = Services.prefs
+      .getCharPref("browser.download.viewableInternally.enabledTypes", "")
+      .trim();
+    if (enabledHandlers) {
+      for (let ext of enabledHandlers.split(",")) {
+        internalHandlers.push(
+          new ViewableInternallyHandlerInfoWrapper(null, ext.trim())
+        );
+      }
+    }
+    for (let internalHandler of internalHandlers) {
+      if (internalHandler.enabled) {
+        this._handledTypes[internalHandler.type] = internalHandler;
+      }
+    }
+  },
+
+  /**
+   * Load the set of handlers defined by the application datastore.
+   */
+  _loadApplicationHandlers() {
+    for (let wrappedHandlerInfo of gHandlerService.enumerate()) {
+      let type = wrappedHandlerInfo.type;
+
+      let handlerInfoWrapper;
+      if (type in this._handledTypes) {
+        handlerInfoWrapper = this._handledTypes[type];
+      } else {
+        if (DownloadIntegration.shouldViewDownloadInternally(type)) {
+          handlerInfoWrapper = new ViewableInternallyHandlerInfoWrapper(type);
+        } else {
+          handlerInfoWrapper = new HandlerInfoWrapper(type, wrappedHandlerInfo);
+        }
+        this._handledTypes[type] = handlerInfoWrapper;
+      }
+    }
+  },
+
+  // View Construction
+
+  selectedHandlerListItem: null,
+
+  _initListEventHandlers() {
+    this._list.addEventListener("select", event => {
+      if (event.target != this._list) {
+        return;
+      }
+
+      let handlerListItem =
+        this._list.selectedItem &&
+        HandlerListItem.forNode(this._list.selectedItem);
+      if (this.selectedHandlerListItem == handlerListItem) {
+        return;
+      }
+
+      if (this.selectedHandlerListItem) {
+        this.selectedHandlerListItem.showActionsMenu = false;
+      }
+      this.selectedHandlerListItem = handlerListItem;
+      if (handlerListItem) {
+        this.rebuildActionsMenu();
+        handlerListItem.showActionsMenu = true;
+      }
+    });
+  },
+
+  async _rebuildVisibleTypes() {
+    this._visibleTypes = [];
+
+    // Map whose keys are string descriptions and values are references to the
+    // first visible HandlerInfoWrapper that has this description. We use this
+    // to determine whether or not to annotate descriptions with their types to
+    // distinguish duplicate descriptions from each other.
+    let visibleDescriptions = new Map();
+    for (let type in this._handledTypes) {
+      // Yield before processing each handler info object to avoid monopolizing
+      // the main thread, as the objects are retrieved lazily, and retrieval
+      // can be expensive on Windows.
+      await new Promise(resolve => Services.tm.dispatchToMainThread(resolve));
+
+      let handlerInfo = this._handledTypes[type];
+
+      // We couldn't find any reason to exclude the type, so include it.
+      this._visibleTypes.push(handlerInfo);
+
+      let key = JSON.stringify(handlerInfo.description);
+      let otherHandlerInfo = visibleDescriptions.get(key);
+      if (!otherHandlerInfo) {
+        // This is the first type with this description that we encountered
+        // while rebuilding the _visibleTypes array this time. Make sure the
+        // flag is reset so we won't add the type to the description.
+        handlerInfo.disambiguateDescription = false;
+        visibleDescriptions.set(key, handlerInfo);
+      } else {
+        // There is at least another type with this description. Make sure we
+        // add the type to the description on both HandlerInfoWrapper objects.
+        handlerInfo.disambiguateDescription = true;
+        otherHandlerInfo.disambiguateDescription = true;
+      }
+    }
+  },
+
+  async _rebuildView() {
+    let lastSelectedType =
+      this.selectedHandlerListItem &&
+      this.selectedHandlerListItem.handlerInfoWrapper.type;
+    this.selectedHandlerListItem = null;
+
+    // Clear the list of entries.
+    this._list.textContent = "";
+
+    var visibleTypes = this._visibleTypes;
+
+    let items = visibleTypes.map(
+      visibleType => new HandlerListItem(visibleType)
+    );
+    let itemsFragment = document.createDocumentFragment();
+    let lastSelectedItem;
+    for (let item of items) {
+      item.createNode(itemsFragment);
+      if (item.handlerInfoWrapper.type == lastSelectedType) {
+        lastSelectedItem = item;
+      }
+    }
+
+    for (let item of items) {
+      item.setupNode();
+      this.rebuildActionsMenu(item.node, item.handlerInfoWrapper);
+      item.refreshAction();
+    }
+
+    // If the user is filtering the list, then only show matching types.
+    // If we filter, we need to first localize the fragment, to
+    // be able to filter by localized values.
+    if (this._filter.value) {
+      await document.l10n.translateFragment(itemsFragment);
+
+      this._filterView(itemsFragment);
+
+      document.l10n.pauseObserving();
+      this._list.appendChild(itemsFragment);
+      document.l10n.resumeObserving();
+    } else {
+      // Otherwise we can just append the fragment and it'll
+      // get localized via the Mutation Observer.
+      this._list.appendChild(itemsFragment);
+    }
+
+    if (lastSelectedItem) {
+      this._list.selectedItem = lastSelectedItem.node;
+    }
+  },
+
+  /**
+   * Whether or not the given handler app is valid.
+   *
+   * @param aHandlerApp {nsIHandlerApp} the handler app in question
+   *
+   * @returns {boolean} whether or not it's valid
+   */
+  isValidHandlerApp(aHandlerApp) {
+    if (!aHandlerApp) {
+      return false;
+    }
+
+    if (aHandlerApp instanceof Ci.nsILocalHandlerApp) {
+      return this._isValidHandlerExecutable(aHandlerApp.executable);
+    }
+
+    if (aHandlerApp instanceof Ci.nsIWebHandlerApp) {
+      return aHandlerApp.uriTemplate;
+    }
+
+    if (aHandlerApp instanceof Ci.nsIGIOMimeApp) {
+      return aHandlerApp.command;
+    }
+
+    return false;
+  },
+
+  _isValidHandlerExecutable(aExecutable) {
+    let leafName;
+    if (AppConstants.platform == "win") {
+      leafName = `${AppConstants.MOZ_APP_NAME}.exe`;
+    } else if (AppConstants.platform == "macosx") {
+      leafName = AppConstants.MOZ_MACBUNDLE_NAME;
+    } else {
+      leafName = `${AppConstants.MOZ_APP_NAME}-bin`;
+    }
+    return (
+      aExecutable &&
+      aExecutable.exists() &&
+      aExecutable.isExecutable() &&
+      // XXXben - we need to compare this with the running instance executable
+      //          just don't know how to do that via script...
+      // XXXmano TBD: can probably add this to nsIShellService
+      aExecutable.leafName != leafName
+    );
+  },
+
+  /**
+   * Rebuild the actions menu for the selected entry.  Gets called by
+   * the richlistitem constructor when an entry in the list gets selected.
+   */
+  rebuildActionsMenu(
+    typeItem = this._list.selectedItem,
+    handlerInfo = this.selectedHandlerListItem.handlerInfoWrapper
+  ) {
+    var menu = typeItem.querySelector(".actionsMenu");
+    var menuPopup = menu.menupopup;
+
+    // Clear out existing items.
+    while (menuPopup.hasChildNodes()) {
+      menuPopup.removeChild(menuPopup.lastChild);
+    }
+
+    let internalMenuItem;
+    // Add the "Open in Firefox" option for optional internal handlers.
+    if (
+      handlerInfo instanceof InternalHandlerInfoWrapper &&
+      !handlerInfo.preventInternalViewing
+    ) {
+      internalMenuItem = document.createXULElement("menuitem");
+      internalMenuItem.setAttribute(
+        "action",
+        Ci.nsIHandlerInfo.handleInternally
+      );
+      document.l10n.setAttributes(internalMenuItem, "applications-open-inapp");
+      internalMenuItem.setAttribute(APP_ICON_ATTR_NAME, "handleInternally");
+      menuPopup.appendChild(internalMenuItem);
+    }
+
+    var askMenuItem = document.createXULElement("menuitem");
+    askMenuItem.setAttribute("action", Ci.nsIHandlerInfo.alwaysAsk);
+    document.l10n.setAttributes(askMenuItem, "applications-always-ask");
+    askMenuItem.setAttribute(APP_ICON_ATTR_NAME, "ask");
+    menuPopup.appendChild(askMenuItem);
+
+    // Create a menu item for saving to disk.
+    // Note: this option isn't available to protocol types, since we don't know
+    // what it means to save a URL having a certain scheme to disk.
+    if (handlerInfo.wrappedHandlerInfo instanceof Ci.nsIMIMEInfo) {
+      var saveMenuItem = document.createXULElement("menuitem");
+      saveMenuItem.setAttribute("action", Ci.nsIHandlerInfo.saveToDisk);
+      document.l10n.setAttributes(saveMenuItem, "applications-action-save");
+      saveMenuItem.setAttribute(APP_ICON_ATTR_NAME, "save");
+      menuPopup.appendChild(saveMenuItem);
+    }
+
+    // Add a separator to distinguish these items from the helper app items
+    // that follow them.
+    let menuseparator = document.createXULElement("menuseparator");
+    menuPopup.appendChild(menuseparator);
+
+    // Create a menu item for the OS default application, if any.
+    if (handlerInfo.hasDefaultHandler) {
+      var defaultMenuItem = document.createXULElement("menuitem");
+      defaultMenuItem.setAttribute(
+        "action",
+        Ci.nsIHandlerInfo.useSystemDefault
+      );
+      // If an internal option is available, don't show the application
+      // name for the OS default to prevent two options from appearing
+      // that may both say "Firefox".
+      if (internalMenuItem) {
+        document.l10n.setAttributes(
+          defaultMenuItem,
+          "applications-use-os-default"
+        );
+        defaultMenuItem.setAttribute("image", ICON_URL_APP);
+      } else {
+        document.l10n.setAttributes(
+          defaultMenuItem,
+          "applications-use-app-default",
+          {
+            "app-name": handlerInfo.defaultDescription,
+          }
+        );
+        defaultMenuItem.setAttribute(
+          "image",
+          handlerInfo.iconURLForSystemDefault
+        );
+      }
+
+      menuPopup.appendChild(defaultMenuItem);
+    }
+
+    // Create menu items for possible handlers.
+    let preferredApp = handlerInfo.preferredApplicationHandler;
+    var possibleAppMenuItems = [];
+    for (let possibleApp of handlerInfo.possibleApplicationHandlers.enumerate()) {
+      if (!this.isValidHandlerApp(possibleApp)) {
+        continue;
+      }
+
+      let menuItem = document.createXULElement("menuitem");
+      menuItem.setAttribute("action", Ci.nsIHandlerInfo.useHelperApp);
+      let label;
+      if (possibleApp instanceof Ci.nsILocalHandlerApp) {
+        label = getFileDisplayName(possibleApp.executable);
+      } else {
+        label = possibleApp.name;
+      }
+      document.l10n.setAttributes(menuItem, "applications-use-app", {
+        "app-name": label,
+      });
+      menuItem.setAttribute(
+        "image",
+        this._getIconURLForHandlerApp(possibleApp)
+      );
+
+      // Attach the handler app object to the menu item so we can use it
+      // to make changes to the datastore when the user selects the item.
+      menuItem.handlerApp = possibleApp;
+
+      menuPopup.appendChild(menuItem);
+      possibleAppMenuItems.push(menuItem);
+    }
+    // Add gio handlers
+    if (gGIOService) {
+      var gioApps = gGIOService.getAppsForURIScheme(handlerInfo.type);
+      let possibleHandlers = handlerInfo.possibleApplicationHandlers;
+      for (let handler of gioApps.enumerate(Ci.nsIHandlerApp)) {
+        // OS handler share the same name, it's most likely the same app, skipping...
+        if (handler.name == handlerInfo.defaultDescription) {
+          continue;
+        }
+        // Check if the handler is already in possibleHandlers
+        let appAlreadyInHandlers = false;
+        for (let i = possibleHandlers.length - 1; i >= 0; --i) {
+          let app = possibleHandlers.queryElementAt(i, Ci.nsIHandlerApp);
+          // nsGIOMimeApp::Equals is able to compare with nsILocalHandlerApp
+          if (handler.equals(app)) {
+            appAlreadyInHandlers = true;
+            break;
+          }
+        }
+        if (!appAlreadyInHandlers) {
+          let menuItem = document.createXULElement("menuitem");
+          menuItem.setAttribute("action", Ci.nsIHandlerInfo.useHelperApp);
+          document.l10n.setAttributes(menuItem, "applications-use-app", {
+            "app-name": handler.name,
+          });
+          menuItem.setAttribute(
+            "image",
+            this._getIconURLForHandlerApp(handler)
+          );
+
+          // Attach the handler app object to the menu item so we can use it
+          // to make changes to the datastore when the user selects the item.
+          menuItem.handlerApp = handler;
+
+          menuPopup.appendChild(menuItem);
+          possibleAppMenuItems.push(menuItem);
+        }
+      }
+    }
+
+    // Create a menu item for selecting a local application.
+    let canOpenWithOtherApp = true;
+    if (AppConstants.platform == "win") {
+      // On Windows, selecting an application to open another application
+      // would be meaningless so we special case executables.
+      let executableType = Cc["@mozilla.org/mime;1"]
+        .getService(Ci.nsIMIMEService)
+        .getTypeFromExtension("exe");
+      canOpenWithOtherApp = handlerInfo.type != executableType;
+    }
+    if (canOpenWithOtherApp) {
+      let menuItem = document.createXULElement("menuitem");
+      menuItem.className = "choose-app-item";
+      menuItem.addEventListener("command", function (e) {
+        gMainPane.chooseApp(e);
+      });
+      document.l10n.setAttributes(menuItem, "applications-use-other");
+      menuPopup.appendChild(menuItem);
+    }
+
+    // Create a menu item for managing applications.
+    if (possibleAppMenuItems.length) {
+      let menuItem = document.createXULElement("menuseparator");
+      menuPopup.appendChild(menuItem);
+      menuItem = document.createXULElement("menuitem");
+      menuItem.className = "manage-app-item";
+      menuItem.addEventListener("command", function (e) {
+        gMainPane.manageApp(e);
+      });
+      document.l10n.setAttributes(menuItem, "applications-manage-app");
+      menuPopup.appendChild(menuItem);
+    }
+
+    // Select the item corresponding to the preferred action.  If the always
+    // ask flag is set, it overrides the preferred action.  Otherwise we pick
+    // the item identified by the preferred action (when the preferred action
+    // is to use a helper app, we have to pick the specific helper app item).
+    if (handlerInfo.alwaysAskBeforeHandling) {
+      menu.selectedItem = askMenuItem;
+    } else {
+      // The nsHandlerInfoAction enumeration values in nsIHandlerInfo identify
+      // the actions the application can take with content of various types.
+      // But since we've stopped support for plugins, there's no value
+      // identifying the "use plugin" action, so we use this constant instead.
+      const kActionUsePlugin = 5;
+
+      switch (handlerInfo.preferredAction) {
+        case Ci.nsIHandlerInfo.handleInternally:
+          if (internalMenuItem) {
+            menu.selectedItem = internalMenuItem;
+          } else {
+            console.error("No menu item defined to set!");
+          }
+          break;
+        case Ci.nsIHandlerInfo.useSystemDefault:
+          // We might not have a default item if we're not aware of an
+          // OS-default handler for this type:
+          menu.selectedItem = defaultMenuItem || askMenuItem;
+          break;
+        case Ci.nsIHandlerInfo.useHelperApp:
+          if (preferredApp) {
+            let preferredItem = possibleAppMenuItems.find(v =>
+              v.handlerApp.equals(preferredApp)
+            );
+            if (preferredItem) {
+              menu.selectedItem = preferredItem;
+            } else {
+              // This shouldn't happen, but let's make sure we end up with a
+              // selected item:
+              let possible = possibleAppMenuItems
+                .map(v => v.handlerApp && v.handlerApp.name)
+                .join(", ");
+              console.error(
+                new Error(
+                  `Preferred handler for ${handlerInfo.type} not in list of possible handlers!? (List: ${possible})`
+                )
+              );
+              menu.selectedItem = askMenuItem;
+            }
+          }
+          break;
+        case kActionUsePlugin:
+          // We no longer support plugins, select "ask" instead:
+          menu.selectedItem = askMenuItem;
+          break;
+        case Ci.nsIHandlerInfo.saveToDisk:
+          menu.selectedItem = saveMenuItem;
+          break;
+      }
+    }
+  },
+
+  // Sorting & Filtering
+
+  _sortColumn: null,
+
+  /**
+   * Sort the list when the user clicks on a column header.
+   */
+  sort(event) {
+    if (event.button != 0) {
+      return;
+    }
+    var column = event.target;
+
+    // If the user clicked on a new sort column, remove the direction indicator
+    // from the old column.
+    if (this._sortColumn && this._sortColumn != column) {
+      this._sortColumn.removeAttribute("sortDirection");
+    }
+
+    this._sortColumn = column;
+
+    // Set (or switch) the sort direction indicator.
+    if (column.getAttribute("sortDirection") == "ascending") {
+      column.setAttribute("sortDirection", "descending");
+    } else {
+      column.setAttribute("sortDirection", "ascending");
+    }
+
+    this._sortListView();
+  },
+
+  async _sortListView() {
+    if (!this._sortColumn) {
+      return;
+    }
+    let comp = new Services.intl.Collator(undefined, {
+      usage: "sort",
+    });
+
+    await document.l10n.translateFragment(this._list);
+    let items = Array.from(this._list.children);
+
+    let textForNode;
+    if (this._sortColumn.getAttribute("value") === "type") {
+      textForNode = n => n.querySelector(".typeDescription").textContent;
+    } else {
+      textForNode = n => n.querySelector(".actionsMenu").getAttribute("label");
+    }
+
+    let sortDir = this._sortColumn.getAttribute("sortDirection");
+    let multiplier = sortDir == "descending" ? -1 : 1;
+    items.sort(
+      (a, b) => multiplier * comp.compare(textForNode(a), textForNode(b))
+    );
+
+    // Re-append items in the correct order:
+    items.forEach(item => this._list.appendChild(item));
+  },
+
+  _filterView(frag = this._list) {
+    const filterValue = this._filter.value.toLowerCase();
+    for (let elem of frag.children) {
+      const typeDescription =
+        elem.querySelector(".typeDescription").textContent;
+      const actionDescription = elem
+        .querySelector(".actionDescription")
+        .getAttribute("value");
+      elem.hidden =
+        !typeDescription.toLowerCase().includes(filterValue) &&
+        !actionDescription.toLowerCase().includes(filterValue);
+    }
+  },
+
+  /**
+   * Filter the list when the user enters a filter term into the filter field.
+   */
+  filter() {
+    this._rebuildView(); // FIXME: Should this be await since bug 1508156?
+  },
+
+  focusFilterBox() {
+    this._filter.focus();
+    this._filter.select();
+  },
+
+  // Changes
+
+  // Whether or not we are currently storing the action selected by the user.
+  // We use this to suppress notification-triggered updates to the list when
+  // we make changes that may spawn such updates.
+  // XXXgijs: this was definitely necessary when we changed feed preferences
+  // from within _storeAction and its calltree. Now, it may still be
+  // necessary, to avoid calling _rebuildView. bug 1499350 has more details.
+  _storingAction: false,
+
+  onSelectAction(aActionItem) {
+    this._storingAction = true;
+
+    try {
+      this._storeAction(aActionItem);
+    } finally {
+      this._storingAction = false;
+    }
+  },
+
+  _storeAction(aActionItem) {
+    var handlerInfo = this.selectedHandlerListItem.handlerInfoWrapper;
+
+    let action = parseInt(aActionItem.getAttribute("action"));
+
+    // Set the preferred application handler.
+    // We leave the existing preferred app in the list when we set
+    // the preferred action to something other than useHelperApp so that
+    // legacy datastores that don't have the preferred app in the list
+    // of possible apps still include the preferred app in the list of apps
+    // the user can choose to handle the type.
+    if (action == Ci.nsIHandlerInfo.useHelperApp) {
+      handlerInfo.preferredApplicationHandler = aActionItem.handlerApp;
+    }
+
+    // Set the "always ask" flag.
+    if (action == Ci.nsIHandlerInfo.alwaysAsk) {
+      handlerInfo.alwaysAskBeforeHandling = true;
+    } else {
+      handlerInfo.alwaysAskBeforeHandling = false;
+    }
+
+    // Set the preferred action.
+    handlerInfo.preferredAction = action;
+
+    handlerInfo.store();
+
+    // Update the action label and image to reflect the new preferred action.
+    this.selectedHandlerListItem.refreshAction();
+  },
+
+  manageApp(aEvent) {
+    // Don't let the normal "on select action" handler get this event,
+    // as we handle it specially ourselves.
+    aEvent.stopPropagation();
+
+    var handlerInfo = this.selectedHandlerListItem.handlerInfoWrapper;
+
+    let onComplete = () => {
+      // Rebuild the actions menu so that we revert to the previous selection,
+      // or "Always ask" if the previous default application has been removed
+      this.rebuildActionsMenu();
+
+      // update the richlistitem too. Will be visible when selecting another row
+      this.selectedHandlerListItem.refreshAction();
+    };
+
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/applicationManager.xhtml",
+      { features: "resizable=no", closingCallback: onComplete },
+      handlerInfo
+    );
+  },
+
+  async chooseApp(aEvent) {
+    // Don't let the normal "on select action" handler get this event,
+    // as we handle it specially ourselves.
+    aEvent.stopPropagation();
+
+    var handlerApp;
+    let chooseAppCallback = aHandlerApp => {
+      // Rebuild the actions menu whether the user picked an app or canceled.
+      // If they picked an app, we want to add the app to the menu and select it.
+      // If they canceled, we want to go back to their previous selection.
+      this.rebuildActionsMenu();
+
+      // If the user picked a new app from the menu, select it.
+      if (aHandlerApp) {
+        let typeItem = this._list.selectedItem;
+        let actionsMenu = typeItem.querySelector(".actionsMenu");
+        let menuItems = actionsMenu.menupopup.childNodes;
+        for (let i = 0; i < menuItems.length; i++) {
+          let menuItem = menuItems[i];
+          if (menuItem.handlerApp && menuItem.handlerApp.equals(aHandlerApp)) {
+            actionsMenu.selectedIndex = i;
+            this.onSelectAction(menuItem);
+            break;
+          }
+        }
+      }
+    };
+
+    if (AppConstants.platform == "win") {
+      var params = {};
+      var handlerInfo = this.selectedHandlerListItem.handlerInfoWrapper;
+
+      params.mimeInfo = handlerInfo.wrappedHandlerInfo;
+      params.title = await document.l10n.formatValue(
+        "applications-select-helper"
+      );
+      if ("id" in handlerInfo.description) {
+        params.description = await document.l10n.formatValue(
+          handlerInfo.description.id,
+          handlerInfo.description.args
+        );
+      } else {
+        params.description = handlerInfo.typeDescription.raw;
+      }
+      params.filename = null;
+      params.handlerApp = null;
+
+      let onAppSelected = () => {
+        if (this.isValidHandlerApp(params.handlerApp)) {
+          handlerApp = params.handlerApp;
+
+          // Add the app to the type's list of possible handlers.
+          handlerInfo.addPossibleApplicationHandler(handlerApp);
+        }
+
+        chooseAppCallback(handlerApp);
+      };
+
+      gSubDialog.open(
+        "chrome://global/content/appPicker.xhtml",
+        { closingCallback: onAppSelected },
+        params
+      );
+    } else {
+      let winTitle = await document.l10n.formatValue(
+        "applications-select-helper"
+      );
+      let fp = Cc["@mozilla.org/filepicker;1"].createInstance(Ci.nsIFilePicker);
+      let fpCallback = aResult => {
+        if (
+          aResult == Ci.nsIFilePicker.returnOK &&
+          fp.file &&
+          this._isValidHandlerExecutable(fp.file)
+        ) {
+          handlerApp = Cc[
+            "@mozilla.org/uriloader/local-handler-app;1"
+          ].createInstance(Ci.nsILocalHandlerApp);
+          handlerApp.name = getFileDisplayName(fp.file);
+          handlerApp.executable = fp.file;
+
+          // Add the app to the type's list of possible handlers.
+          let handler = this.selectedHandlerListItem.handlerInfoWrapper;
+          handler.addPossibleApplicationHandler(handlerApp);
+
+          chooseAppCallback(handlerApp);
+        }
+      };
+
+      // Prompt the user to pick an app.  If they pick one, and it's a valid
+      // selection, then add it to the list of possible handlers.
+      fp.init(window, winTitle, Ci.nsIFilePicker.modeOpen);
+      fp.appendFilters(Ci.nsIFilePicker.filterApps);
+      fp.open(fpCallback);
+    }
+  },
+
+  _getIconURLForHandlerApp(aHandlerApp) {
+    if (aHandlerApp instanceof Ci.nsILocalHandlerApp) {
+      return this._getIconURLForFile(aHandlerApp.executable);
+    }
+
+    if (aHandlerApp instanceof Ci.nsIWebHandlerApp) {
+      return this._getIconURLForWebApp(aHandlerApp.uriTemplate);
+    }
+
+    // We know nothing about other kinds of handler apps.
+    return "";
+  },
+
+  _getIconURLForFile(aFile) {
+    var fph = Services.io
+      .getProtocolHandler("file")
+      .QueryInterface(Ci.nsIFileProtocolHandler);
+    var urlSpec = fph.getURLSpecFromActualFile(aFile);
+
+    return "moz-icon://" + urlSpec + "?size=16";
+  },
+
+  _getIconURLForWebApp(aWebAppURITemplate) {
+    var uri = Services.io.newURI(aWebAppURITemplate);
+
+    // Unfortunately we can't use the favicon service to get the favicon,
+    // because the service looks in the annotations table for a record with
+    // the exact URL we give it, and users won't have such records for URLs
+    // they don't visit, and users won't visit the web app's URL template,
+    // they'll only visit URLs derived from that template (i.e. with %s
+    // in the template replaced by the URL of the content being handled).
+
+    if (
+      /^https?$/.test(uri.scheme) &&
+      Services.prefs.getBoolPref("browser.chrome.site_icons")
+    ) {
+      return uri.prePath + "/favicon.ico";
+    }
+
+    return "";
+  },
+
+  // DOWNLOADS
+
+  /*
+   * Preferences:
+   *
+   * browser.download.useDownloadDir - bool
+   *   True - Save files directly to the folder configured via the
+   *   browser.download.folderList preference.
+   *   False - Always ask the user where to save a file and default to
+   *   browser.download.lastDir when displaying a folder picker dialog.
+   * browser.download.always_ask_before_handling_new_types - bool
+   *   Defines the default behavior for new file handlers.
+   *   True - When downloading a file that doesn't match any existing
+   *   handlers, ask the user whether to save or open the file.
+   *   False - Save the file. The user can change the default action in
+   *   the Applications section in the preferences UI.
+   * browser.download.dir - local file handle
+   *   A local folder the user may have selected for downloaded files to be
+   *   saved. Migration of other browser settings may also set this path.
+   *   This folder is enabled when folderList equals 2.
+   * browser.download.lastDir - local file handle
+   *   May contain the last folder path accessed when the user browsed
+   *   via the file save-as dialog. (see contentAreaUtils.js)
+   * browser.download.folderList - int
+   *   Indicates the location users wish to save downloaded files too.
+   *   It is also used to display special file labels when the default
+   *   download location is either the Desktop or the Downloads folder.
+   *   Values:
+   *     0 - The desktop is the default download location.
+   *     1 - The system's downloads folder is the default download location.
+   *     2 - The default download location is elsewhere as specified in
+   *         browser.download.dir.
+   * browser.download.downloadDir
+   *   deprecated.
+   * browser.download.defaultFolder
+   *   deprecated.
+   */
+
+  /**
+   * Disables the downloads folder field and Browse button if the default
+   * download directory pref is locked (e.g., by the DownloadDirectory or
+   * DefaultDownloadDirectory policies)
+   */
+  readUseDownloadDir() {
+    document.getElementById("downloadFolder").disabled =
+      document.getElementById("chooseFolder").disabled =
+      document.getElementById("saveTo").disabled =
+        Preferences.get("browser.download.dir").locked ||
+        Preferences.get("browser.download.folderList").locked;
+    // don't override the preference's value in UI
+    return undefined;
+  },
+
+  /**
+   * Displays a file picker in which the user can choose the location where
+   * downloads are automatically saved, updating preferences and UI in
+   * response to the choice, if one is made.
+   */
+  chooseFolder() {
+    return this.chooseFolderTask().catch(console.error);
+  },
+  async chooseFolderTask() {
+    let [title] = await document.l10n.formatValues([
+      { id: "choose-download-folder-title" },
+    ]);
+    let folderListPref = Preferences.get("browser.download.folderList");
+    let currentDirPref = await this._indexToFolder(folderListPref.value);
+    let defDownloads = await this._indexToFolder(1);
+    let fp = Cc["@mozilla.org/filepicker;1"].createInstance(Ci.nsIFilePicker);
+
+    fp.init(window, title, Ci.nsIFilePicker.modeGetFolder);
+    fp.appendFilters(Ci.nsIFilePicker.filterAll);
+    // First try to open what's currently configured
+    if (currentDirPref && currentDirPref.exists()) {
+      fp.displayDirectory = currentDirPref;
+    } else if (defDownloads && defDownloads.exists()) {
+      // Try the system's download dir
+      fp.displayDirectory = defDownloads;
+    } else {
+      // Fall back to Desktop
+      fp.displayDirectory = await this._indexToFolder(0);
+    }
+
+    let result = await new Promise(resolve => fp.open(resolve));
+    if (result != Ci.nsIFilePicker.returnOK) {
+      return;
+    }
+
+    let downloadDirPref = Preferences.get("browser.download.dir");
+    downloadDirPref.value = fp.file;
+    folderListPref.value = await this._folderToIndex(fp.file);
+    // Note, the real prefs will not be updated yet, so dnld manager's
+    // userDownloadsDirectory may not return the right folder after
+    // this code executes. displayDownloadDirPref will be called on
+    // the assignment above to update the UI.
+  },
+
+  /**
+   * Initializes the download folder display settings based on the user's
+   * preferences.
+   */
+  displayDownloadDirPref() {
+    this.displayDownloadDirPrefTask().catch(console.error);
+
+    // don't override the preference's value in UI
+    return undefined;
+  },
+
+  async displayDownloadDirPrefTask() {
+    // We're async for localization reasons, and we can get called several
+    // times in the same turn of the event loop (!) because of how the
+    // preferences bindings work... but the speed of localization
+    // shouldn't impact what gets displayed to the user in the end - the
+    // last call should always win.
+    // To accomplish this, store a unique object when we enter this function,
+    // and if by the end of the function that stored object has been
+    // overwritten, don't update the UI but leave it to the last
+    // caller to this function to do.
+    let token = {};
+    this._downloadDisplayToken = token;
+
+    var downloadFolder = document.getElementById("downloadFolder");
+
+    let folderIndex = Preferences.get("browser.download.folderList").value;
+    // For legacy users using cloudstorage pref with folderIndex as 3 (See bug 1751093),
+    // compute folderIndex using the current directory pref
+    if (folderIndex == 3) {
+      let currentDirPref = Preferences.get("browser.download.dir");
+      folderIndex = currentDirPref.value
+        ? await this._folderToIndex(currentDirPref.value)
+        : 1;
+    }
+
+    // Display a 'pretty' label or the path in the UI.
+    let { folderDisplayName, file } =
+      await this._getSystemDownloadFolderDetails(folderIndex);
+    // Figure out an icon url:
+    let fph = Services.io
+      .getProtocolHandler("file")
+      .QueryInterface(Ci.nsIFileProtocolHandler);
+    let iconUrlSpec = fph.getURLSpecFromDir(file);
+
+    // Ensure that the last entry to this function always wins
+    // (see comment at the start of this method):
+    if (this._downloadDisplayToken != token) {
+      return;
+    }
+    // note: downloadFolder.value is not read elsewhere in the code, its only purpose is to display to the user
+    downloadFolder.value = folderDisplayName;
+    downloadFolder.style.backgroundImage =
+      "url(moz-icon://" + iconUrlSpec + "?size=16)";
+  },
+
+  async _getSystemDownloadFolderDetails(folderIndex) {
+    let downloadsDir = await this._getDownloadsFolder("Downloads");
+    let desktopDir = await this._getDownloadsFolder("Desktop");
+    let currentDirPref = Preferences.get("browser.download.dir");
+
+    let file;
+    let firefoxLocalizedName;
+    if (folderIndex == 2 && currentDirPref.value) {
+      file = currentDirPref.value;
+      if (file.equals(downloadsDir)) {
+        folderIndex = 1;
+      } else if (file.equals(desktopDir)) {
+        folderIndex = 0;
+      }
+    }
+    switch (folderIndex) {
+      case 2: // custom path, handled above.
+        break;
+
+      case 1: {
+        // downloads
+        file = downloadsDir;
+        firefoxLocalizedName = await document.l10n.formatValues([
+          { id: "downloads-folder-name" },
+        ]);
+        break;
+      }
+
+      case 0:
+      // fall through
+      default: {
+        file = desktopDir;
+        firefoxLocalizedName = await document.l10n.formatValues([
+          { id: "desktop-folder-name" },
+        ]);
+      }
+    }
+    if (firefoxLocalizedName) {
+      let folderDisplayName, leafName;
+      // Either/both of these can throw, so check for failures in both cases
+      // so we don't just break display of the download pref:
+      try {
+        folderDisplayName = file.displayName;
+      } catch (ex) {
+        /* ignored */
+      }
+      try {
+        leafName = file.leafName;
+      } catch (ex) {
+        /* ignored */
+      }
+
+      // If we found a localized name that's different from the leaf name,
+      // use that:
+      if (folderDisplayName && folderDisplayName != leafName) {
+        return { file, folderDisplayName };
+      }
+
+      // Otherwise, check if we've got a localized name ourselves.
+      if (firefoxLocalizedName) {
+        // You can't move the system download or desktop dir on macOS,
+        // so if those are in use just display them. On other platforms
+        // only do so if the folder matches the localized name.
+        if (
+          AppConstants.platform == "macosx" ||
+          leafName == firefoxLocalizedName
+        ) {
+          return { file, folderDisplayName: firefoxLocalizedName };
+        }
+      }
+    }
+    // If we get here, attempts to use a "pretty" name failed. Just display
+    // the full path:
+    if (file) {
+      // Force the left-to-right direction when displaying a custom path.
+      return { file, folderDisplayName: `\u2066${file.path}\u2069` };
+    }
+    // Don't even have a file - fall back to desktop directory for the
+    // use of the icon, and an empty label:
+    file = desktopDir;
+    return { file, folderDisplayName: "" };
+  },
+
+  /**
+   * Returns the Downloads folder.  If aFolder is "Desktop", then the Downloads
+   * folder returned is the desktop folder; otherwise, it is a folder whose name
+   * indicates that it is a download folder and whose path is as determined by
+   * the XPCOM directory service via the download manager's attribute
+   * defaultDownloadsDirectory.
+   *
+   * @throws if aFolder is not "Desktop" or "Downloads"
+   */
+  async _getDownloadsFolder(aFolder) {
+    switch (aFolder) {
+      case "Desktop":
+        return Services.dirsvc.get("Desk", Ci.nsIFile);
+      case "Downloads":
+        let downloadsDir = await Downloads.getSystemDownloadsDirectory();
+        return new FileUtils.File(downloadsDir);
+    }
+    throw new Error(
+      "ASSERTION FAILED: folder type should be 'Desktop' or 'Downloads'"
+    );
+  },
+
+  /**
+   * Determines the type of the given folder.
+   *
+   * @param   aFolder
+   *          the folder whose type is to be determined
+   * @returns integer
+   *          0 if aFolder is the Desktop or is unspecified,
+   *          1 if aFolder is the Downloads folder,
+   *          2 otherwise
+   */
+  async _folderToIndex(aFolder) {
+    if (!aFolder || aFolder.equals(await this._getDownloadsFolder("Desktop"))) {
+      return 0;
+    } else if (aFolder.equals(await this._getDownloadsFolder("Downloads"))) {
+      return 1;
+    }
+    return 2;
+  },
+
+  /**
+   * Converts an integer into the corresponding folder.
+   *
+   * @param   aIndex
+   *          an integer
+   * @returns the Desktop folder if aIndex == 0,
+   *          the Downloads folder if aIndex == 1,
+   *          the folder stored in browser.download.dir
+   */
+  _indexToFolder(aIndex) {
+    switch (aIndex) {
+      case 0:
+        return this._getDownloadsFolder("Desktop");
+      case 1:
+        return this._getDownloadsFolder("Downloads");
+    }
+    var currentDirPref = Preferences.get("browser.download.dir");
+    return currentDirPref.value;
+  },
+};
+
+gMainPane.initialized = new Promise(res => {
+  gMainPane.setInitialized = res;
+});
+
+// Utilities
+
+function getFileDisplayName(file) {
+  if (AppConstants.platform == "win") {
+    if (file instanceof Ci.nsILocalFileWin) {
+      try {
+        return file.getVersionInfoField("FileDescription");
+      } catch (e) {}
+    }
+  }
+  if (AppConstants.platform == "macosx") {
+    if (file instanceof Ci.nsILocalFileMac) {
+      try {
+        return file.bundleDisplayName;
+      } catch (e) {}
+    }
+  }
+  return file.leafName;
+}
+
+function getLocalHandlerApp(aFile) {
+  var localHandlerApp = Cc[
+    "@mozilla.org/uriloader/local-handler-app;1"
+  ].createInstance(Ci.nsILocalHandlerApp);
+  localHandlerApp.name = getFileDisplayName(aFile);
+  localHandlerApp.executable = aFile;
+
+  return localHandlerApp;
+}
+
+// eslint-disable-next-line no-undef
+let gHandlerListItemFragment = MozXULElement.parseXULToFragment(`
+  <richlistitem>
+    <hbox class="typeContainer" flex="1" align="center">
+      <image class="typeIcon" width="16" height="16"
+              src="moz-icon://goat?size=16"/>
+      <label class="typeDescription" flex="1" crop="end"/>
+    </hbox>
+    <hbox class="actionContainer" flex="1" align="center">
+      <image class="actionIcon" width="16" height="16"/>
+      <label class="actionDescription" flex="1" crop="end"/>
+    </hbox>
+    <hbox class="actionsMenuContainer" flex="1">
+      <menulist class="actionsMenu" flex="1" crop="end" selectedIndex="1" aria-labelledby="actionColumn">
+        <menupopup/>
+      </menulist>
+    </hbox>
+  </richlistitem>
+`);
+
+/**
+ * This is associated to <richlistitem> elements in the handlers view.
+ */
+class HandlerListItem {
+  static forNode(node) {
+    return gNodeToObjectMap.get(node);
+  }
+
+  constructor(handlerInfoWrapper) {
+    this.handlerInfoWrapper = handlerInfoWrapper;
+  }
+
+  setOrRemoveAttributes(iterable) {
+    for (let [selector, name, value] of iterable) {
+      let node = selector ? this.node.querySelector(selector) : this.node;
+      if (value) {
+        node.setAttribute(name, value);
+      } else {
+        node.removeAttribute(name);
+      }
+    }
+  }
+
+  createNode(list) {
+    list.appendChild(document.importNode(gHandlerListItemFragment, true));
+    this.node = list.lastChild;
+    gNodeToObjectMap.set(this.node, this);
+  }
+
+  setupNode() {
+    this.node
+      .querySelector(".actionsMenu")
+      .addEventListener("command", event =>
+        gMainPane.onSelectAction(event.originalTarget)
+      );
+
+    let typeDescription = this.handlerInfoWrapper.typeDescription;
+    this.setOrRemoveAttributes([
+      [null, "type", this.handlerInfoWrapper.type],
+      [".typeIcon", "src", this.handlerInfoWrapper.smallIcon],
+    ]);
+    localizeElement(
+      this.node.querySelector(".typeDescription"),
+      typeDescription
+    );
+    this.showActionsMenu = false;
+  }
+
+  refreshAction() {
+    let { actionIconClass } = this.handlerInfoWrapper;
+    this.setOrRemoveAttributes([
+      [null, APP_ICON_ATTR_NAME, actionIconClass],
+      [
+        ".actionIcon",
+        "src",
+        actionIconClass ? null : this.handlerInfoWrapper.actionIcon,
+      ],
+    ]);
+    const selectedItem = this.node.querySelector("[selected=true]");
+    if (!selectedItem) {
+      console.error("No selected item for " + this.handlerInfoWrapper.type);
+      return;
+    }
+    const { id, args } = document.l10n.getAttributes(selectedItem);
+    localizeElement(this.node.querySelector(".actionDescription"), {
+      id: id + "-label",
+      args,
+    });
+    localizeElement(this.node.querySelector(".actionsMenu"), { id, args });
+  }
+
+  set showActionsMenu(value) {
+    this.setOrRemoveAttributes([
+      [".actionContainer", "hidden", value],
+      [".actionsMenuContainer", "hidden", !value],
+    ]);
+  }
+}
+
+/**
+ * This API facilitates dual-model of some localization APIs which
+ * may operate on raw strings of l10n id/args pairs.
+ *
+ * The l10n can be:
+ *
+ * {raw: string} - raw strings to be used as text value of the element
+ * {id: string} - l10n-id
+ * {id: string, args: object} - l10n-id + l10n-args
+ */
+function localizeElement(node, l10n) {
+  if (l10n.hasOwnProperty("raw")) {
+    node.removeAttribute("data-l10n-id");
+    node.textContent = l10n.raw;
+  } else {
+    document.l10n.setAttributes(node, l10n.id, l10n.args);
+  }
+}
+
+/**
+ * This object wraps nsIHandlerInfo with some additional functionality
+ * the Applications prefpane needs to display and allow modification of
+ * the list of handled types.
+ *
+ * We create an instance of this wrapper for each entry we might display
+ * in the prefpane, and we compose the instances from various sources,
+ * including the handler service.
+ *
+ * We don't implement all the original nsIHandlerInfo functionality,
+ * just the stuff that the prefpane needs.
+ */
+class HandlerInfoWrapper {
+  constructor(type, handlerInfo) {
+    this.type = type;
+    this.wrappedHandlerInfo = handlerInfo;
+    this.disambiguateDescription = false;
+  }
+
+  get description() {
+    if (this.wrappedHandlerInfo.description) {
+      return { raw: this.wrappedHandlerInfo.description };
+    }
+
+    if (this.primaryExtension) {
+      var extension = this.primaryExtension.toUpperCase();
+      return { id: "applications-file-ending", args: { extension } };
+    }
+
+    return { raw: this.type };
+  }
+
+  /**
+   * Describe, in a human-readable fashion, the type represented by the given
+   * handler info object.  Normally this is just the description, but if more
+   * than one object presents the same description, "disambiguateDescription"
+   * is set and we annotate the duplicate descriptions with the type itself
+   * to help users distinguish between those types.
+   */
+  get typeDescription() {
+    if (this.disambiguateDescription) {
+      const description = this.description;
+      if (description.id) {
+        // Pass through the arguments:
+        let { args = {} } = description;
+        args.type = this.type;
+        return {
+          id: description.id + "-with-type",
+          args,
+        };
+      }
+
+      return {
+        id: "applications-type-description-with-type",
+        args: {
+          "type-description": description.raw,
+          type: this.type,
+        },
+      };
+    }
+
+    return this.description;
+  }
+
+  get actionIconClass() {
+    if (this.alwaysAskBeforeHandling) {
+      return "ask";
+    }
+
+    switch (this.preferredAction) {
+      case Ci.nsIHandlerInfo.saveToDisk:
+        return "save";
+
+      case Ci.nsIHandlerInfo.handleInternally:
+        if (this instanceof InternalHandlerInfoWrapper) {
+          return "handleInternally";
+        }
+        break;
+    }
+
+    return "";
+  }
+
+  get actionIcon() {
+    switch (this.preferredAction) {
+      case Ci.nsIHandlerInfo.useSystemDefault:
+        return this.iconURLForSystemDefault;
+
+      case Ci.nsIHandlerInfo.useHelperApp:
+        let preferredApp = this.preferredApplicationHandler;
+        if (gMainPane.isValidHandlerApp(preferredApp)) {
+          return gMainPane._getIconURLForHandlerApp(preferredApp);
+        }
+
+      // This should never happen, but if preferredAction is set to some weird
+      // value, then fall back to the generic application icon.
+      // Explicit fall-through
+      default:
+        return ICON_URL_APP;
+    }
+  }
+
+  get iconURLForSystemDefault() {
+    // Handler info objects for MIME types on some OSes implement a property bag
+    // interface from which we can get an icon for the default app, so if we're
+    // dealing with a MIME type on one of those OSes, then try to get the icon.
+    if (
+      this.wrappedHandlerInfo instanceof Ci.nsIMIMEInfo &&
+      this.wrappedHandlerInfo instanceof Ci.nsIPropertyBag
+    ) {
+      try {
+        let url = this.wrappedHandlerInfo.getProperty(
+          "defaultApplicationIconURL"
+        );
+        if (url) {
+          return url + "?size=16";
+        }
+      } catch (ex) {}
+    }
+
+    // If this isn't a MIME type object on an OS that supports retrieving
+    // the icon, or if we couldn't retrieve the icon for some other reason,
+    // then use a generic icon.
+    return ICON_URL_APP;
+  }
+
+  get preferredApplicationHandler() {
+    return this.wrappedHandlerInfo.preferredApplicationHandler;
+  }
+
+  set preferredApplicationHandler(aNewValue) {
+    this.wrappedHandlerInfo.preferredApplicationHandler = aNewValue;
+
+    // Make sure the preferred handler is in the set of possible handlers.
+    if (aNewValue) {
+      this.addPossibleApplicationHandler(aNewValue);
+    }
+  }
+
+  get possibleApplicationHandlers() {
+    return this.wrappedHandlerInfo.possibleApplicationHandlers;
+  }
+
+  addPossibleApplicationHandler(aNewHandler) {
+    for (let app of this.possibleApplicationHandlers.enumerate()) {
+      if (app.equals(aNewHandler)) {
+        return;
+      }
+    }
+    this.possibleApplicationHandlers.appendElement(aNewHandler);
+  }
+
+  removePossibleApplicationHandler(aHandler) {
+    var defaultApp = this.preferredApplicationHandler;
+    if (defaultApp && aHandler.equals(defaultApp)) {
+      // If the app we remove was the default app, we must make sure
+      // it won't be used anymore
+      this.alwaysAskBeforeHandling = true;
+      this.preferredApplicationHandler = null;
+    }
+
+    var handlers = this.possibleApplicationHandlers;
+    for (var i = 0; i < handlers.length; ++i) {
+      var handler = handlers.queryElementAt(i, Ci.nsIHandlerApp);
+      if (handler.equals(aHandler)) {
+        handlers.removeElementAt(i);
+        break;
+      }
+    }
+  }
+
+  get hasDefaultHandler() {
+    return this.wrappedHandlerInfo.hasDefaultHandler;
+  }
+
+  get defaultDescription() {
+    return this.wrappedHandlerInfo.defaultDescription;
+  }
+
+  // What to do with content of this type.
+  get preferredAction() {
+    // If the action is to use a helper app, but we don't have a preferred
+    // handler app, then switch to using the system default, if any; otherwise
+    // fall back to saving to disk, which is the default action in nsMIMEInfo.
+    // Note: "save to disk" is an invalid value for protocol info objects,
+    // but the alwaysAskBeforeHandling getter will detect that situation
+    // and always return true in that case to override this invalid value.
+    if (
+      this.wrappedHandlerInfo.preferredAction ==
+        Ci.nsIHandlerInfo.useHelperApp &&
+      !gMainPane.isValidHandlerApp(this.preferredApplicationHandler)
+    ) {
+      if (this.wrappedHandlerInfo.hasDefaultHandler) {
+        return Ci.nsIHandlerInfo.useSystemDefault;
+      }
+      return Ci.nsIHandlerInfo.saveToDisk;
+    }
+
+    return this.wrappedHandlerInfo.preferredAction;
+  }
+
+  set preferredAction(aNewValue) {
+    this.wrappedHandlerInfo.preferredAction = aNewValue;
+  }
+
+  get alwaysAskBeforeHandling() {
+    // If this is a protocol type and the preferred action is "save to disk",
+    // which is invalid for such types, then return true here to override that
+    // action.  This could happen when the preferred action is to use a helper
+    // app, but the preferredApplicationHandler is invalid, and there isn't
+    // a default handler, so the preferredAction getter returns save to disk
+    // instead.
+    if (
+      !(this.wrappedHandlerInfo instanceof Ci.nsIMIMEInfo) &&
+      this.preferredAction == Ci.nsIHandlerInfo.saveToDisk
+    ) {
+      return true;
+    }
+
+    return this.wrappedHandlerInfo.alwaysAskBeforeHandling;
+  }
+
+  set alwaysAskBeforeHandling(aNewValue) {
+    this.wrappedHandlerInfo.alwaysAskBeforeHandling = aNewValue;
+  }
+
+  // The primary file extension associated with this type, if any.
+  get primaryExtension() {
+    try {
+      if (
+        this.wrappedHandlerInfo instanceof Ci.nsIMIMEInfo &&
+        this.wrappedHandlerInfo.primaryExtension
+      ) {
+        return this.wrappedHandlerInfo.primaryExtension;
+      }
+    } catch (ex) {}
+
+    return null;
+  }
+
+  store() {
+    gHandlerService.store(this.wrappedHandlerInfo);
+  }
+
+  get smallIcon() {
+    return this._getIcon(16);
+  }
+
+  _getIcon(aSize) {
+    if (this.primaryExtension) {
+      return "moz-icon://goat." + this.primaryExtension + "?size=" + aSize;
+    }
+
+    if (this.wrappedHandlerInfo instanceof Ci.nsIMIMEInfo) {
+      return "moz-icon://goat?size=" + aSize + "&contentType=" + this.type;
+    }
+
+    // FIXME: consider returning some generic icon when we can't get a URL for
+    // one (for example in the case of protocol schemes).  Filed as bug 395141.
+    return null;
+  }
+}
+
+/**
+ * InternalHandlerInfoWrapper provides a basic mechanism to create an internal
+ * mime type handler that can be enabled/disabled in the applications preference
+ * menu.
+ */
+class InternalHandlerInfoWrapper extends HandlerInfoWrapper {
+  constructor(mimeType, extension) {
+    let type = gMIMEService.getFromTypeAndExtension(mimeType, extension);
+    super(mimeType || type.type, type);
+  }
+
+  // Override store so we so we can notify any code listening for registration
+  // or unregistration of this handler.
+  store() {
+    super.store();
+  }
+
+  get preventInternalViewing() {
+    return false;
+  }
+
+  get enabled() {
+    throw Components.Exception("", Cr.NS_ERROR_NOT_IMPLEMENTED);
+  }
+}
+
+class PDFHandlerInfoWrapper extends InternalHandlerInfoWrapper {
+  constructor() {
+    super(TYPE_PDF, null);
+  }
+
+  get preventInternalViewing() {
+    return Services.prefs.getBoolPref(PREF_PDFJS_DISABLED);
+  }
+
+  // PDF is always shown in the list, but the 'show internally' option is
+  // hidden when the internal PDF viewer is disabled.
+  get enabled() {
+    return true;
+  }
+}
+
+class ViewableInternallyHandlerInfoWrapper extends InternalHandlerInfoWrapper {
+  get enabled() {
+    return DownloadIntegration.shouldViewDownloadInternally(this.type);
+  }
+}
+
+const AppearanceChooser = {
+  // NOTE: This order must match the values of the
+  // layout.css.prefers-color-scheme.content-override
+  // preference.
+  choices: ["dark", "light", "auto"],
+  chooser: null,
+  radios: null,
+  warning: null,
+
+  init() {
+    this.chooser = document.getElementById("web-appearance-chooser");
+    this.radios = [...this.chooser.querySelectorAll("input")];
+    for (let radio of this.radios) {
+      radio.addEventListener("change", e => {
+        let index = this.choices.indexOf(e.target.value);
+        // The pref change callback will update state if needed.
+        if (index >= 0) {
+          Services.prefs.setIntPref(PREF_CONTENT_APPEARANCE, index);
+        } else {
+          // Shouldn't happen but let's do something sane...
+          Services.prefs.clearUserPref(PREF_CONTENT_APPEARANCE);
+        }
+      });
+    }
+
+    let webAppearanceSettings = document.getElementById(
+      "webAppearanceSettings"
+    );
+    webAppearanceSettings.addEventListener("click", this);
+
+    this.warning = document.getElementById("web-appearance-override-warning");
+
+    FORCED_COLORS_QUERY.addEventListener("change", this);
+    Services.prefs.addObserver(PREF_USE_SYSTEM_COLORS, this);
+    Services.obs.addObserver(this, "look-and-feel-changed");
+    this._update();
+  },
+
+  _update() {
+    this._updateWarning();
+    this._updateOptions();
+  },
+
+  handleEvent(e) {
+    if (e.type == "click") {
+      switch (e.target.id) {
+        // Forward the click to the "colors" button.
+        case "web-appearance-manage-colors-link":
+          document.getElementById("colors").click();
+          e.preventDefault();
+          break;
+        case "web-appearance-manage-themes-link":
+          window.browsingContext.topChromeWindow.BrowserOpenAddonsMgr(
+            "addons://list/theme"
+          );
+          e.preventDefault();
+          break;
+        default:
+          break;
+      }
+    }
+    this._update();
+  },
+
+  observe(subject, topic, data) {
+    this._update();
+  },
+
+  destroy() {
+    Services.prefs.removeObserver(PREF_USE_SYSTEM_COLORS, this);
+    Services.obs.removeObserver(this, "look-and-feel-changed");
+    FORCED_COLORS_QUERY.removeEventListener("change", this);
+  },
+
+  _isValueDark(value) {
+    switch (value) {
+      case "light":
+        return false;
+      case "dark":
+        return true;
+      case "auto":
+        return Services.appinfo.contentThemeDerivedColorSchemeIsDark;
+    }
+    throw new Error("Unknown value");
+  },
+
+  _updateOptions() {
+    let index = Services.prefs.getIntPref(PREF_CONTENT_APPEARANCE);
+    if (index < 0 || index >= this.choices.length) {
+      index = Services.prefs
+        .getDefaultBranch(null)
+        .getIntPref(PREF_CONTENT_APPEARANCE);
+    }
+    let value = this.choices[index];
+    for (let radio of this.radios) {
+      let checked = radio.value == value;
+      let isDark = this._isValueDark(radio.value);
+
+      radio.checked = checked;
+      radio.closest("label").classList.toggle("dark", isDark);
+    }
+  },
+
+  _updateWarning() {
+    let forcingColorsAndNoColorSchemeSupport =
+      FORCED_COLORS_QUERY.matches &&
+      (AppConstants.platform == "win" ||
+        !Services.prefs.getBoolPref(PREF_USE_SYSTEM_COLORS));
+    this.warning.hidden = !forcingColorsAndNoColorSchemeSupport;
+  },
+};
diff --git a/browser/components/preferences/metrics.yaml b/browser/components/preferences/metrics.yaml
new file mode 100644
index 0000000000..e7e78cb8ed
--- /dev/null
+++ b/browser/components/preferences/metrics.yaml
@@ -0,0 +1,53 @@
+# This Source Code Form is subject to the terms of the Mozilla Public
+# License, v. 2.0. If a copy of the MPL was not distributed with this
+# file, You can obtain one at http://mozilla.org/MPL/2.0/.
+
+# Adding a new metric? We have docs for that!
+# https://firefox-source-docs.mozilla.org/toolkit/components/glean/user/new_definitions_file.html
+
+---
+$schema: moz://mozilla.org/schemas/glean/metrics/2-0-0
+$tags:
+  - 'Firefox :: Settings UI'
+
+privacy.ui.fpp.click:
+  checkbox:
+    type: event
+    description: >
+      User interaction by click events on fingerprinting protection checkbox in
+      the ETP Custom subpanel.
+    bugs:
+      - https://bugzilla.mozilla.org/1841097
+    data_reviews:
+      - https://bugzilla.mozilla.org/show_bug.cgi?id=1841097#c8
+    notification_emails:
+      - tom@mozilla.com
+      - tschuster@mozilla.com
+      - tihuang@mozilla.com
+      - seceng-telemetry@mozilla.com
+    expires: never
+    extra_keys:
+      checked:
+        description: The checked state of the fingerprinting protection checkbox
+        type: boolean
+    telemetry_mirror: PrivacyUiFpp_Click_Checkbox
+  menu:
+    type: event
+    description: >
+      User interaction by click events on fingerprinting protection menulist in
+      the ETP Custom subpanel.
+    bugs:
+      - https://bugzilla.mozilla.org/1841097
+    data_reviews:
+      - https://bugzilla.mozilla.org/show_bug.cgi?id=1841097#c8
+    notification_emails:
+      - tom@mozilla.com
+      - tschuster@mozilla.com
+      - tihuang@mozilla.com
+      - seceng-telemetry@mozilla.com
+    expires: never
+    extra_keys:
+      value:
+        description: The value of the clicked menu item of the menulist.
+        type: string
+    telemetry_mirror: PrivacyUiFpp_Click_Menu
diff --git a/browser/components/preferences/more-from-mozilla-qr-code-simple-cn.svg b/browser/components/preferences/more-from-mozilla-qr-code-simple-cn.svg
new file mode 100644
index 0000000000..5052db9702
--- /dev/null
+++ b/browser/components/preferences/more-from-mozilla-qr-code-simple-cn.svg
@@ -0,0 +1,4 @@
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+<svg width="80" height="80" fill="context-fill" xmlns="http://www.w3.org/2000/svg"><path fill-rule="evenodd" clip-rule="evenodd" d="M4 2h72a2 2 0 0 1 2 2v72a2 2 0 0 1-2 2H4a2 2 0 0 1-2-2V4a2 2 0 0 1 2-2ZM0 4a4 4 0 0 1 4-4h72a4 4 0 0 1 4 4v72a4 4 0 0 1-4 4H4a4 4 0 0 1-4-4V4Zm7.08 3.08h15.892v15.892H7.08V7.08Zm4.54 2.27H9.35V20.701H20.701V9.35h-9.08Zm18.163-2.27h4.541v2.27h2.27v2.27h-2.27v2.27h-2.27v2.271h4.54v-4.54h2.27V9.35h2.271v6.811h-2.27v2.27h2.27v4.541h-2.27v-2.27h-2.27v-2.27h-2.27v2.27h-2.271v-2.27h-2.27V7.08Zm0 13.622v-2.27h-2.27V9.35h-2.27v13.622h2.27v2.27h-9.081v2.271h-2.27v2.27H13.89v-4.54h-2.27v2.27H7.08v2.27h2.27v2.27h2.27v2.271h9.081v2.27h2.271v2.27h-2.27v2.271h-2.27v-2.27h-2.27v-2.27H7.08v2.27h4.54v2.27H9.35v2.27h6.811v-2.27h2.27v4.54h6.811v-2.27h2.271v2.27h2.27v-4.54h-4.54v-2.27h2.27v-4.54h2.27v-2.271h-4.54v-2.27h2.27v-2.271h2.27v-4.54h2.27v2.27h4.541v2.27h-2.27v2.27h2.27v-2.27h2.27v-4.54h-2.27v-2.271h-2.27v2.27h-2.27v-2.27h-2.27Zm0 0h-2.27v2.27h2.27v-2.27Zm-9.081 11.352v2.27h2.27v2.27h2.27v-4.54h-4.54Zm4.54 9.081h-4.54v2.27h4.54v-2.27Zm-4.54-9.081v-2.27h2.27v-2.271h-4.54v4.54h2.27Zm-9.082 0v-2.27h2.27v2.27h-2.27ZM41.135 9.35V7.08h2.27v2.27h-2.27Zm2.27 20.433h-2.27v-4.54h2.27v2.27h2.27v-2.27h2.271v-4.541h2.27v2.27h2.271v-4.54h2.27V25.242h2.27v2.271h-4.54v-2.27h-2.27v4.54h-6.811Zm9.082 2.27v-2.27h-2.27v2.27h2.27Zm2.27 0h-2.27v4.541h-2.27v4.541h2.27v4.54h-2.27v4.541h-4.541v2.271h-2.27v-2.27h-2.27v2.27h2.27v2.27h-4.541v-4.54h-6.811v2.27h-2.27v-4.54h-4.541v2.27h-2.27v-2.27h-2.271v2.27h2.27v2.27h-4.54v-4.54H13.89v2.27h-2.27v-4.541H9.35v2.27H7.08v2.27h4.54v2.271H7.08v2.27h4.54v-2.27h2.27v2.27h2.271v-2.27h2.27v2.27h6.811v6.811h2.271v2.27h2.27v2.271h-4.54v2.27h2.27v2.271h2.27v-4.54h2.27v-2.271h-2.27v-4.54h4.541v2.27h2.27v2.27h-2.27v2.27h2.27v4.541h-2.27v2.27h2.27v-2.27h2.27v2.27h6.811v-2.27h4.541v-4.54h4.541v2.27h-2.27v4.54h2.27v-2.27h2.27v2.27h9.082V66.11h2.27v2.27h4.541v-2.27h-2.27v-6.811h2.27V45.675h-2.27v13.622h-2.27v-2.27h-2.27v-4.541h-6.811v-2.27h-4.541v-6.811h2.27v4.54h4.54v-4.54h-2.27v-2.27h-6.811v-2.271h2.27v-2.27h2.27v2.27h2.271v-4.54h4.54v9.08h2.271v-2.27h2.27v-2.27h-2.27v-6.811h2.27v-2.27h2.271v2.27h2.27v-4.541h-2.27v-2.27H59.299v2.27h-2.271v2.27h-2.27v2.27Zm2.27 0v2.271h-2.27v-2.27h2.27Zm2.271-2.27h2.27v2.27h2.27v-4.54h-4.54v2.27Zm0 0v2.27h-2.27v-2.27h2.27Zm9.082 29.515h-2.27v2.27h-2.271v2.27h4.54v-4.54ZM54.757 66.11h2.27v2.27h2.271v2.271h4.54v-2.27h-2.27v-2.27h-2.27v-2.271h-4.54v2.27Zm-6.81-2.27v2.27h2.27v-2.27h-2.27Zm-2.271 0v-2.27h-6.811v-2.27h2.27v-2.271h2.27v-2.27h9.082v4.54h-4.54v-2.27h-2.271v2.27h2.27v4.54h-2.27Zm0 0h-9.081v2.27h2.27v2.27h2.27v2.271h2.27v-2.27h2.27v-4.541Zm-9.082-6.811v2.27h-2.27v-2.27h2.27Zm0-2.27h2.27v2.27h-2.27v-2.27Zm0 0h-2.27v-2.271h2.27v2.27Zm-6.81 4.54v-6.811h-2.271v6.811h2.27ZM47.945 7.08h4.541v4.54h-2.27V9.35h-2.27V7.08Zm0 2.27v2.27h2.27v2.27h4.541v2.271h-4.54v2.27h-6.811v-2.27h2.27v-2.27h-2.27v-2.27h2.27V9.35h2.27Zm9.082-2.27H72.92v15.892H57.028V7.08Zm4.54 2.27h-2.27V20.701H70.65V9.35h-9.081ZM11.62 11.62h6.811v6.811H11.621V11.621Zm49.949 0H68.379v6.811H61.57V11.621Zm-18.163 9.082h2.27v2.27h-2.27v-2.27ZM68.38 34.324h2.27v2.27h-2.27v-2.27Zm2.27 2.27h2.27v4.541h-2.27v-4.54Zm-4.54 11.352h2.27v2.27h-2.27v-2.27Zm-9.082 6.811h-2.27v6.811H61.567V54.758h-4.54ZM7.08 57.027h15.892V72.92H7.08V57.028Zm4.54 2.271H9.35V70.65H20.701V59.299h-9.08Zm45.408-2.27h2.27v2.27h-2.27v-2.27Zm-45.408 4.54h6.811v6.811H11.621V61.57Zm59.03 9.082h2.27v2.27h-2.27v-2.27Z"/><path d="M46.066 37.552c-.285-.686-.863-1.426-1.316-1.66.323.625.547 1.296.664 1.99l.002.01c-.742-1.847-1.998-2.593-3.025-4.215-.052-.082-.104-.164-.154-.25a2.078 2.078 0 0 1-.073-.136 1.193 1.193 0 0 1-.102-.271.017.017 0 0 0-.01-.006.024.024 0 0 0-.013 0l-.003.002-.005.003.003-.005c-1.647.964-2.206 2.749-2.256 3.642a3.28 3.28 0 0 0-1.805.696 1.953 1.953 0 0 0-.17-.129 3.04 3.04 0 0 1-.018-1.602 4.856 4.856 0 0 0-1.578 1.22h-.003c-.26-.33-.242-1.416-.227-1.643-.077.031-.15.07-.219.117-.229.163-.444.347-.64.549-.225.227-.43.473-.613.735a5.537 5.537 0 0 0-.88 1.986l-.009.043c-.012.057-.056.346-.064.41l-.002.014c-.057.298-.093.6-.106.903v.034a6.556 6.556 0 0 0 13.017 1.109l.03-.254a6.742 6.742 0 0 0-.426-3.293Zm-7.556 5.132c.03.015.059.03.09.044l.005.003a3.257 3.257 0 0 1-.095-.047Zm6.906-4.79v-.006.007Z" fill="url(#a)"/><path d="M46.066 37.552c-.285-.685-.863-1.426-1.316-1.66.323.625.547 1.296.664 1.99v.006l.002.007a5.937 5.937 0 0 1-.204 4.425c-.752 1.612-2.57 3.265-5.417 3.184-3.075-.088-5.785-2.37-6.29-5.36-.093-.47 0-.71.046-1.093-.064.298-.099.6-.106.905v.034a6.557 6.557 0 0 0 13.017 1.108l.03-.254a6.743 6.743 0 0 0-.426-3.293Z" fill="url(#b)"/><path d="M46.066 37.552c-.285-.685-.863-1.426-1.316-1.66.323.625.547 1.296.664 1.99v.006l.002.007a5.937 5.937 0 0 1-.204 4.425c-.752 1.612-2.57 3.265-5.417 3.184-3.075-.088-5.785-2.37-6.29-5.36-.093-.47 0-.71.046-1.093-.064.298-.099.6-.106.905v.034a6.557 6.557 0 0 0 13.017 1.108l.03-.254a6.743 6.743 0 0 0-.426-3.293Z" fill="url(#c)"/><path d="m42.879 38.322.04.03a3.57 3.57 0 0 0-.608-.795c-2.039-2.038-.535-4.418-.28-4.54l.002-.004c-1.647.965-2.206 2.75-2.257 3.642.077-.005.152-.011.23-.011a3.307 3.307 0 0 1 2.873 1.677Z" fill="url(#d)"/><path d="M40.01 38.73c-.01.162-.587.725-.788.725-1.865 0-2.167 1.127-2.167 1.127.082.95.744 1.733 1.544 2.145.036.02.073.036.11.053.065.029.129.055.193.079.274.097.562.152.853.164 3.268.154 3.9-3.907 1.542-5.086a2.263 2.263 0 0 1 1.581.384 3.309 3.309 0 0 0-2.872-1.678c-.078 0-.154.007-.23.012a3.28 3.28 0 0 0-1.805.695c.1.085.213.198.45.432.445.439 1.586.893 1.589.946v.001Z" fill="url(#e)"/><path d="M40.01 38.73c-.01.162-.587.725-.788.725-1.865 0-2.167 1.127-2.167 1.127.082.95.744 1.733 1.544 2.145.036.02.073.036.11.053.065.029.129.055.193.079.274.097.562.152.853.164 3.268.154 3.9-3.907 1.542-5.086a2.263 2.263 0 0 1 1.581.384 3.309 3.309 0 0 0-2.872-1.678c-.078 0-.154.007-.23.012a3.28 3.28 0 0 0-1.805.695c.1.085.213.198.45.432.445.439 1.586.893 1.589.946v.001Z" fill="url(#f)"/><path d="m37.665 37.134.136.09a3.04 3.04 0 0 1-.019-1.602 4.854 4.854 0 0 0-1.578 1.22c.032-.002.983-.019 1.461.292Z" fill="url(#g)"/><path d="M33.503 40.145c.506 2.989 3.216 5.272 6.291 5.359 2.847.08 4.665-1.572 5.416-3.184a5.937 5.937 0 0 0 .204-4.425v-.012l.002.01c.232 1.52-.54 2.99-1.748 3.986l-.004.008c-2.352 1.917-4.604 1.156-5.059.846a3.524 3.524 0 0 1-.095-.047c-1.372-.656-1.939-1.905-1.817-2.977a1.683 1.683 0 0 1-1.553-.977 2.474 2.474 0 0 1 2.41-.097c.777.352 1.66.387 2.462.097-.003-.054-1.144-.508-1.589-.946-.238-.234-.35-.347-.45-.432a1.987 1.987 0 0 0-.17-.128 9.602 9.602 0 0 0-.135-.09c-.478-.31-1.429-.294-1.46-.293h-.003c-.26-.33-.242-1.415-.227-1.642-.077.03-.15.07-.219.116-.23.164-.444.348-.64.55a5.712 5.712 0 0 0-.616.733 5.536 5.536 0 0 0-.88 1.986c-.003.013-.236 1.031-.121 1.56l.001-.001Z" fill="url(#h)"/><path d="M42.31 37.557c.24.235.445.503.61.795.035.027.07.054.098.08 1.486 1.37.707 3.307.65 3.444 1.207-.994 1.978-2.466 1.747-3.985-.742-1.849-2-2.595-3.025-4.217a7.809 7.809 0 0 1-.154-.25 2.078 2.078 0 0 1-.073-.136 1.193 1.193 0 0 1-.102-.271.017.017 0 0 0-.01-.006.024.024 0 0 0-.013 0l-.003.002-.004.003c-.254.12-1.758 2.501.28 4.538v.003Z" fill="url(#i)"/><path d="M43.017 38.433a1.349 1.349 0 0 0-.098-.08l-.04-.03a2.263 2.263 0 0 0-1.581-.384c2.358 1.179 1.725 5.239-1.543 5.086a2.915 2.915 0 0 1-.853-.164 3.434 3.434 0 0 1-.303-.132l.005.003c.455.311 2.706 1.071 5.059-.846l.004-.008c.058-.137.837-2.074-.65-3.444Z" fill="url(#j)"/><path d="M37.055 40.581s.302-1.127 2.167-1.127c.201 0 .778-.563.788-.726a3.265 3.265 0 0 1-2.461-.097 2.471 2.471 0 0 0-2.41.097 1.683 1.683 0 0 0 1.552.977c-.121 1.072.446 2.32 1.817 2.977l.091.045c-.8-.414-1.462-1.196-1.544-2.145Z" fill="url(#k)"/><path d="M46.066 37.552c-.285-.686-.863-1.426-1.316-1.66.323.625.547 1.296.664 1.99l.002.01c-.742-1.847-1.998-2.593-3.025-4.215a8.036 8.036 0 0 1-.154-.25 2.078 2.078 0 0 1-.073-.136 1.193 1.193 0 0 1-.102-.271.017.017 0 0 0-.01-.006.024.024 0 0 0-.013 0l-.003.002-.005.003.003-.005c-1.647.964-2.206 2.749-2.256 3.642.076-.005.152-.011.23-.011a3.308 3.308 0 0 1 2.872 1.677 2.263 2.263 0 0 0-1.58-.384c2.357 1.18 1.725 5.239-1.543 5.087a2.916 2.916 0 0 1-.853-.165 3.432 3.432 0 0 1-.303-.132l.004.003a3.524 3.524 0 0 1-.095-.047l.09.044c-.8-.413-1.461-1.195-1.544-2.144 0 0 .303-1.128 2.167-1.128.202 0 .778-.563.789-.726-.003-.053-1.144-.507-1.589-.945-.237-.234-.35-.347-.45-.432a1.987 1.987 0 0 0-.17-.128 3.04 3.04 0 0 1-.018-1.603 4.854 4.854 0 0 0-1.578 1.22h-.003c-.26-.33-.241-1.415-.226-1.642-.077.03-.15.07-.22.116-.229.164-.443.347-.64.549-.224.227-.43.473-.613.735v.001-.001a5.536 5.536 0 0 0-.88 1.986l-.008.043c-.013.058-.068.35-.076.414-.05.302-.083.607-.097.914v.034a6.557 6.557 0 0 0 13.017 1.108l.03-.253a6.743 6.743 0 0 0-.426-3.294Zm-.65.337v.006-.007Z" fill="url(#l)"/><defs><radialGradient id="b" cx="0" cy="0" r="1" gradientUnits="userSpaceOnUse" gradientTransform="translate(44.777 34.536) scale(13.6677)"><stop offset=".129" stop-color="#FFBD4F"/><stop offset=".186" stop-color="#FFAC31"/><stop offset=".247" stop-color="#FF9D17"/><stop offset=".283" stop-color="#FF980E"/><stop offset=".403" stop-color="#FF563B"/><stop offset=".467" stop-color="#FF3750"/><stop offset=".71" stop-color="#F5156C"/><stop offset=".782" stop-color="#EB0878"/><stop offset=".86" stop-color="#E50080"/></radialGradient><radialGradient id="c" cx="0" cy="0" r="1" gradientUnits="userSpaceOnUse" gradientTransform="translate(39.702 40.118) scale(13.6677)"><stop offset=".3" stop-color="#960E18"/><stop offset=".351" stop-color="#B11927" stop-opacity=".74"/><stop offset=".435" stop-color="#DB293D" stop-opacity=".343"/><stop offset=".497" stop-color="#F5334B" stop-opacity=".094"/><stop offset=".53" stop-color="#FF3750" stop-opacity="0"/></radialGradient><radialGradient id="d" cx="0" cy="0" r="1" gradientUnits="userSpaceOnUse" gradientTransform="translate(41.394 31.491) scale(9.90066)"><stop offset=".132" stop-color="#FFF44F"/><stop offset=".252" stop-color="#FFDC3E"/><stop offset=".506" stop-color="#FF9D12"/><stop offset=".526" stop-color="#FF980E"/></radialGradient><radialGradient id="e" cx="0" cy="0" r="1" gradientUnits="userSpaceOnUse" gradientTransform="translate(38.18 43.67) scale(6.5074)"><stop offset=".353" stop-color="#3A8EE6"/><stop offset=".472" stop-color="#5C79F0"/><stop offset=".669" stop-color="#9059FF"/><stop offset="1" stop-color="#C139E6"/></radialGradient><radialGradient id="f" cx="0" cy="0" r="1" gradientUnits="userSpaceOnUse" gradientTransform="matrix(3.35414 -.81093 .9494 3.92687 40.363 38.945)"><stop offset=".206" stop-color="#9059FF" stop-opacity="0"/><stop offset=".278" stop-color="#8C4FF3" stop-opacity=".064"/><stop offset=".747" stop-color="#7716A8" stop-opacity=".45"/><stop offset=".975" stop-color="#6E008B" stop-opacity=".6"/></radialGradient><radialGradient id="g" cx="0" cy="0" r="1" gradientUnits="userSpaceOnUse" gradientTransform="translate(39.533 34.028) scale(4.68222)"><stop stop-color="#FFE226"/><stop offset=".121" stop-color="#FFDB27"/><stop offset=".295" stop-color="#FFC82A"/><stop offset=".502" stop-color="#FFA930"/><stop offset=".732" stop-color="#FF7E37"/><stop offset=".792" stop-color="#FF7139"/></radialGradient><radialGradient id="h" cx="0" cy="0" r="1" gradientUnits="userSpaceOnUse" gradientTransform="translate(43.254 30.983) scale(19.9772)"><stop offset=".113" stop-color="#FFF44F"/><stop offset=".456" stop-color="#FF980E"/><stop offset=".622" stop-color="#FF5634"/><stop offset=".716" stop-color="#FF3647"/><stop offset=".904" stop-color="#E31587"/></radialGradient><radialGradient id="i" cx="0" cy="0" r="1" gradientUnits="userSpaceOnUse" gradientTransform="rotate(83.976 2.969 39.153) scale(14.6396 9.60783)"><stop stop-color="#FFF44F"/><stop offset=".06" stop-color="#FFE847"/><stop offset=".168" stop-color="#FFC830"/><stop offset=".304" stop-color="#FF980E"/><stop offset=".356" stop-color="#FF8B16"/><stop offset=".455" stop-color="#FF672A"/><stop offset=".57" stop-color="#FF3647"/><stop offset=".737" stop-color="#E31587"/></radialGradient><radialGradient id="j" cx="0" cy="0" r="1" gradientUnits="userSpaceOnUse" gradientTransform="translate(39.533 35.72) scale(12.4701)"><stop offset=".137" stop-color="#FFF44F"/><stop offset=".48" stop-color="#FF980E"/><stop offset=".592" stop-color="#FF5634"/><stop offset=".655" stop-color="#FF3647"/><stop offset=".904" stop-color="#E31587"/></radialGradient><radialGradient id="k" cx="0" cy="0" r="1" gradientUnits="userSpaceOnUse" gradientTransform="translate(42.747 36.397) scale(13.6491)"><stop offset=".094" stop-color="#FFF44F"/><stop offset=".231" stop-color="#FFE141"/><stop offset=".509" stop-color="#FFAF1E"/><stop offset=".626" stop-color="#FF980E"/></radialGradient><linearGradient id="a" x1="45.198" y1="35.108" x2="34.314" y2="45.609" gradientUnits="userSpaceOnUse"><stop offset=".048" stop-color="#FFF44F"/><stop offset=".111" stop-color="#FFE847"/><stop offset=".225" stop-color="#FFC830"/><stop offset=".368" stop-color="#FF980E"/><stop offset=".401" stop-color="#FF8B16"/><stop offset=".462" stop-color="#FF672A"/><stop offset=".534" stop-color="#FF3647"/><stop offset=".705" stop-color="#E31587"/></linearGradient><linearGradient id="l" x1="45.066" y1="35.053" x2="35.806" y2="44.314" gradientUnits="userSpaceOnUse"><stop offset=".167" stop-color="#FFF44F" stop-opacity=".8"/><stop offset=".266" stop-color="#FFF44F" stop-opacity=".634"/><stop offset=".489" stop-color="#FFF44F" stop-opacity=".217"/><stop offset=".6" stop-color="#FFF44F" stop-opacity="0"/></linearGradient></defs></svg>
diff --git a/browser/components/preferences/more-from-mozilla-qr-code-simple.svg b/browser/components/preferences/more-from-mozilla-qr-code-simple.svg
new file mode 100644
index 0000000000..279595db10
--- /dev/null
+++ b/browser/components/preferences/more-from-mozilla-qr-code-simple.svg
@@ -0,0 +1,4 @@
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+<svg width="80" height="80" fill="context-fill" xmlns="http://www.w3.org/2000/svg"><path fill-rule="evenodd" clip-rule="evenodd" d="M76 2H4a2 2 0 0 0-2 2v72a2 2 0 0 0 2 2h72a2 2 0 0 0 2-2V4a2 2 0 0 0-2-2ZM4 0a4 4 0 0 0-4 4v72a4 4 0 0 0 4 4h72a4 4 0 0 0 4-4V4a4 4 0 0 0-4-4H4Zm3.08 7.08h15.892v15.892H7.08V7.08Zm4.54 2.27H9.35V20.701H20.701V9.35h-9.08Zm20.434-2.27h2.27v2.27h2.27V7.08h4.541v2.27h2.27v2.27H36.596v2.27h-4.541v2.271h-2.27v-2.27h-2.271v-2.27h2.27V9.35h2.27V7.08Zm-4.541 4.54h-2.27V9.35h2.27v2.27Zm2.27 11.352v-4.54h2.27v-2.27h4.541V13.89h4.541v2.27h4.54v2.27h-2.27v2.27h-2.27v-2.27h-2.27v2.27h-2.27v-2.27h-2.27v2.27h-2.271v2.271h-2.27Zm-4.54 2.27V18.433h2.27v4.54h2.27v2.27h-4.54Zm0 0v2.271h-9.081v-2.27h9.08Zm11.351-2.27h-2.27v-2.27h2.27v2.27Zm2.27 0h-2.27v4.541h-2.27v-2.27h-2.27v2.27h2.27v2.27h4.54V22.973Zm2.271 0v-2.27h-2.27v2.27h2.27Zm2.27 0h-2.27v6.811h4.54v-2.27h-2.27v-4.54Zm2.27 0h-2.27v-2.27h2.27v2.27Zm4.542-6.81h-2.27V22.971h-2.271v2.27h2.27v2.271h2.27v2.27h-2.27v2.27h2.27v-2.27h2.271v2.27h2.27v2.271h2.27v-4.54h2.271v2.27h2.27v2.27h-2.27v2.27h-2.27v2.27h-4.541v6.811h2.27v2.271h4.541v4.541h-6.811v-2.27h-2.27v2.27h-2.27v-2.27h-4.541v2.27h-4.541v-2.27h-4.54v2.27h2.27v2.27h2.27v2.27H45.675v4.541h2.271v2.27h-2.27v2.271h-2.27v-4.54h-4.541v-2.27h-2.27v-2.271h-2.27v2.27h2.27v2.27h-2.27v2.27h-2.271v-2.27h-2.27v-2.27h-2.271v-4.54h2.27v2.27h2.27v-2.27h-2.27v-2.271h2.27v-2.27h-4.54v-2.27h2.27v-2.271h-2.27v-4.54h2.27v-2.271h-2.27v-6.811h2.27v-2.27h-2.27v2.27h-4.54v-2.27h-2.271v2.27h2.27v2.27h-4.54v-4.54h-2.27V36.593H13.89v-4.54h-2.27v-2.27h2.27v-2.271H7.08v6.811h2.27v4.54h4.54v2.271h-2.27v2.27H9.35v-2.27H7.08v2.27h2.27v2.27H7.08v2.271h2.27v-2.27h2.27v2.27h2.27v-4.54h4.541v-2.27h-2.27v-4.541h2.27v2.27h2.27v2.27h2.271v2.27h-2.27v2.27h-2.27v2.271h-2.27v2.27H11.62v2.271H7.08v2.27h4.54v-2.27h4.541v2.27h9.081v9.081h4.541v4.541h-2.27v4.541h4.54v-2.27h2.271v2.27h2.27v-4.54h-4.54v-2.27h2.27v-2.271h2.27v-2.27h2.27v2.27h2.271v2.27h-2.27v6.811H45.675v-4.54h2.271v4.54h2.27v-4.54h2.271v4.54h6.811v-2.27h2.27v2.27h2.27v-2.27h-2.27v-2.27h-4.54v-2.27h-9.081v-2.271H59.297v2.27h2.27v-2.27h2.27v4.54h4.541v4.541h2.271v-2.27h2.27v-4.54h-2.27v-2.271h2.27v-2.27h-2.27v-2.27h2.27v-4.541h-2.27v-4.541h2.27V27.513h-2.27v-2.27h-2.27v2.27h-6.811v-2.27h-4.541v2.27h-2.27v-2.27h-2.271v-2.27h2.27v-4.541h-4.54v-2.27Zm2.27-6.812h2.27v4.54h-2.27v2.271h-2.27v-4.54h2.27V9.35Zm0 0h-6.811V7.08h6.811v2.27Zm0 13.622v-2.27h-2.27v2.27h2.27Zm9.081 6.811v2.27h2.27v2.271h-2.27v2.27h-2.27v4.541h-4.54v2.27h2.27v2.27h4.54v-2.27h2.27v4.541h-2.27v4.541h2.27v6.811h2.271v2.27h-2.27v2.27h4.54v-4.54h2.271v-4.54h-2.27v-4.541h2.27v-4.541h-2.27v-4.54h2.27v-6.811h-2.27v-2.271h2.27v-2.27h-4.54v2.27h-2.271v-2.27h-2.27Zm6.812 24.974h-2.27v2.27h2.27v-2.27Zm0-4.54h-4.541v-2.27h4.54v2.27Zm-4.541-9.082h2.27v2.27h-2.27v-2.27Zm-2.27 0v-4.54h2.27v4.54h-2.27Zm4.54-4.54v-2.27h-2.27v2.27h2.27Zm0 0h2.27v2.27h-2.27v-2.27Zm-4.54 4.54v2.27h-2.27v-2.27h2.27Zm0-11.352v-2.27h-2.27v2.27h2.27ZM57.028 68.38h-2.27v2.27h2.27v-2.27Zm-24.974 0h-2.27v2.27h2.27v-2.27ZM20.702 47.946v2.27h2.27v2.271h-4.54v-4.54h2.27Zm2.27-2.27v2.27h-2.27v-2.27h2.27Zm2.27 0v2.27h2.271v-2.27h-2.27Zm0 0h-2.27v-2.27h2.27v2.27Zm-2.27-9.082v2.27h-2.27v-2.27h2.27Zm0 0h2.27v-2.27h-2.27v2.27ZM9.35 34.324v-2.27h2.27v2.27H9.35Zm15.893 20.433h2.27v-2.27h-2.27v2.27ZM41.135 66.11v4.541h2.27v-4.54h-2.27Zm6.811-4.54v-2.27h2.27v2.27h-2.27Zm-2.27-6.812h-2.27v-2.27h2.27v2.27Zm0 0v2.27h2.27v-2.27h-2.27Zm4.54-20.433v2.27h2.271v-2.27h-2.27Zm2.271-9.081h-2.27v2.27h2.27v-2.27Zm4.54-18.163H72.92v15.892H57.028V7.08Zm4.541 2.27h-2.27V20.701H70.65V9.35h-9.081ZM11.62 11.62h6.811v6.811H11.621V11.621Zm34.056 0h2.27v2.27h-2.27v-2.27Zm15.892 0h6.811v6.811H61.57V11.621Zm-4.54 43.137h-2.27v6.811H61.567V54.758h-4.54ZM7.08 57.027h15.892V72.92H7.08V57.028Zm4.54 2.271H9.35V70.65H20.701V59.299h-9.08Zm45.408-2.27h2.27v2.27h-2.27v-2.27Zm-45.408 4.54h6.811v6.811H11.621V61.57Z"/><path d="M46.066 37.552c-.285-.686-.863-1.426-1.315-1.66a6.81 6.81 0 0 1 .663 1.99l.002.01c-.741-1.847-1.998-2.593-3.025-4.215a8.23 8.23 0 0 1-.154-.25 2.078 2.078 0 0 1-.072-.136 1.193 1.193 0 0 1-.102-.271.017.017 0 0 0-.011-.006.024.024 0 0 0-.013 0l-.003.002-.004.003.002-.005c-1.647.964-2.206 2.749-2.256 3.642a3.28 3.28 0 0 0-1.805.696 1.967 1.967 0 0 0-.17-.129 3.04 3.04 0 0 1-.018-1.602 4.855 4.855 0 0 0-1.578 1.22h-.003c-.26-.33-.242-1.416-.227-1.643-.076.031-.15.07-.218.117-.23.163-.444.347-.641.549a5.73 5.73 0 0 0-.613.735 5.535 5.535 0 0 0-.88 1.986l-.008.043c-.013.057-.057.346-.065.41l-.002.014c-.057.298-.092.6-.106.903v.034a6.556 6.556 0 0 0 13.017 1.109l.03-.254a6.743 6.743 0 0 0-.426-3.293Zm-7.556 5.132c.03.015.059.03.09.044l.005.003a3.257 3.257 0 0 1-.095-.047Zm6.906-4.79v-.006l.001.007h-.001Z" fill="url(#a)"/><path d="M46.066 37.552c-.285-.685-.863-1.426-1.315-1.66a6.81 6.81 0 0 1 .664 1.99V37.895a5.937 5.937 0 0 1-.203 4.425c-.752 1.612-2.57 3.265-5.417 3.184-3.075-.088-5.785-2.37-6.29-5.36-.093-.47 0-.71.046-1.093a4.88 4.88 0 0 0-.105.905v.034a6.557 6.557 0 0 0 13.016 1.108c.011-.084.02-.168.03-.254a6.742 6.742 0 0 0-.425-3.293h-.001Z" fill="url(#b)"/><path d="M46.066 37.552c-.285-.685-.863-1.426-1.315-1.66a6.81 6.81 0 0 1 .664 1.99V37.895a5.937 5.937 0 0 1-.203 4.425c-.752 1.612-2.57 3.265-5.417 3.184-3.075-.088-5.785-2.37-6.29-5.36-.093-.47 0-.71.046-1.093a4.88 4.88 0 0 0-.105.905v.034a6.557 6.557 0 0 0 13.016 1.108c.011-.084.02-.168.03-.254a6.742 6.742 0 0 0-.425-3.293h-.001Z" fill="url(#c)"/><path d="m42.879 38.322.04.03a3.567 3.567 0 0 0-.608-.795c-2.038-2.038-.534-4.418-.28-4.54l.002-.004c-1.647.965-2.206 2.75-2.257 3.642.077-.005.153-.011.23-.011a3.308 3.308 0 0 1 2.873 1.677Z" fill="url(#d)"/><path d="M40.01 38.73c-.01.162-.587.725-.788.725-1.864 0-2.167 1.127-2.167 1.127.082.95.744 1.733 1.544 2.145.036.02.074.036.11.053.065.029.129.055.193.079.275.097.562.152.853.164 3.268.154 3.9-3.907 1.543-5.086a2.263 2.263 0 0 1 1.58.384 3.309 3.309 0 0 0-2.872-1.678c-.078 0-.154.007-.23.012a3.28 3.28 0 0 0-1.805.695c.1.085.213.198.45.432.445.439 1.586.893 1.589.946v.001Z" fill="url(#e)"/><path d="M40.01 38.73c-.01.162-.587.725-.788.725-1.864 0-2.167 1.127-2.167 1.127.082.95.744 1.733 1.544 2.145.036.02.074.036.11.053.065.029.129.055.193.079.275.097.562.152.853.164 3.268.154 3.9-3.907 1.543-5.086a2.263 2.263 0 0 1 1.58.384 3.309 3.309 0 0 0-2.872-1.678c-.078 0-.154.007-.23.012a3.28 3.28 0 0 0-1.805.695c.1.085.213.198.45.432.445.439 1.586.893 1.589.946v.001Z" fill="url(#f)"/><path d="M37.666 37.134c.053.034.096.063.135.09a3.04 3.04 0 0 1-.019-1.602 4.854 4.854 0 0 0-1.578 1.22c.032-.002.983-.019 1.462.292Z" fill="url(#g)"/><path d="M33.503 40.145c.506 2.989 3.216 5.272 6.291 5.359 2.847.08 4.665-1.572 5.416-3.184a5.937 5.937 0 0 0 .204-4.425v-.012l.002.01c.232 1.52-.54 2.99-1.748 3.986l-.004.008c-2.352 1.917-4.604 1.156-5.059.846a3.524 3.524 0 0 1-.095-.047c-1.372-.656-1.939-1.905-1.817-2.977a1.684 1.684 0 0 1-1.553-.977 2.474 2.474 0 0 1 2.41-.097c.777.352 1.66.387 2.462.097-.003-.054-1.144-.508-1.589-.946-.237-.234-.35-.347-.45-.432a1.973 1.973 0 0 0-.17-.128 9.602 9.602 0 0 0-.135-.09c-.478-.31-1.429-.294-1.46-.293h-.003c-.26-.33-.242-1.415-.227-1.642-.077.03-.15.07-.219.116-.23.164-.444.348-.64.55a5.72 5.72 0 0 0-.616.733 5.538 5.538 0 0 0-.88 1.986c-.003.013-.236 1.031-.121 1.56l.001-.001Z" fill="url(#h)"/><path d="M42.31 37.557c.24.235.445.503.61.795.035.027.07.054.098.08 1.486 1.37.707 3.307.65 3.444 1.207-.994 1.978-2.466 1.747-3.985-.742-1.849-2-2.595-3.025-4.217a7.809 7.809 0 0 1-.154-.25 2.078 2.078 0 0 1-.072-.136 1.193 1.193 0 0 1-.102-.271.017.017 0 0 0-.011-.006.023.023 0 0 0-.013 0l-.003.002-.004.003c-.254.12-1.758 2.501.28 4.538v.003Z" fill="url(#i)"/><path d="M43.018 38.433a1.351 1.351 0 0 0-.099-.08l-.04-.03a2.263 2.263 0 0 0-1.581-.384c2.358 1.179 1.725 5.239-1.543 5.086a2.916 2.916 0 0 1-.853-.164 3.497 3.497 0 0 1-.192-.08c-.037-.016-.074-.033-.11-.052l.004.003c.455.311 2.706 1.071 5.06-.846l.003-.008c.058-.137.837-2.074-.65-3.444Z" fill="url(#j)"/><path d="M37.055 40.581s.302-1.127 2.167-1.127c.201 0 .778-.563.788-.726a3.265 3.265 0 0 1-2.461-.097 2.471 2.471 0 0 0-2.41.097 1.684 1.684 0 0 0 1.552.977c-.121 1.072.446 2.32 1.817 2.977l.091.045c-.8-.414-1.462-1.196-1.544-2.145Z" fill="url(#k)"/><path d="M46.066 37.552c-.285-.686-.863-1.426-1.316-1.66a6.81 6.81 0 0 1 .664 1.99l.002.01c-.742-1.847-1.998-2.593-3.025-4.215a8.23 8.23 0 0 1-.154-.25 2.078 2.078 0 0 1-.073-.136 1.193 1.193 0 0 1-.102-.271.017.017 0 0 0-.01-.006.023.023 0 0 0-.013 0l-.003.002-.005.003.003-.005c-1.647.964-2.206 2.749-2.256 3.642.076-.005.152-.011.23-.011a3.307 3.307 0 0 1 2.872 1.677 2.263 2.263 0 0 0-1.58-.384c2.357 1.18 1.725 5.239-1.543 5.087a2.916 2.916 0 0 1-.853-.165 3.495 3.495 0 0 1-.193-.079c-.037-.017-.074-.033-.11-.053l.004.003a3.524 3.524 0 0 1-.095-.047l.09.044c-.8-.413-1.461-1.195-1.544-2.144 0 0 .303-1.128 2.167-1.128.202 0 .779-.563.789-.726-.003-.053-1.144-.507-1.589-.945-.237-.234-.35-.347-.45-.432a1.988 1.988 0 0 0-.17-.128 3.04 3.04 0 0 1-.018-1.603 4.854 4.854 0 0 0-1.578 1.22h-.003c-.26-.33-.241-1.415-.226-1.642-.077.03-.15.07-.22.116-.229.164-.443.347-.64.549-.224.227-.43.473-.613.735v.001-.001a5.538 5.538 0 0 0-.88 1.986l-.008.043c-.013.058-.068.35-.076.414-.05.302-.083.607-.097.914v.034a6.557 6.557 0 0 0 13.017 1.108l.03-.253a6.742 6.742 0 0 0-.426-3.294Zm-.65.337v.006-.007Z" fill="url(#l)"/><defs><radialGradient id="b" cx="0" cy="0" r="1" gradientUnits="userSpaceOnUse" gradientTransform="translate(44.777 34.536) scale(13.6677)"><stop offset=".129" stop-color="#FFBD4F"/><stop offset=".186" stop-color="#FFAC31"/><stop offset=".247" stop-color="#FF9D17"/><stop offset=".283" stop-color="#FF980E"/><stop offset=".403" stop-color="#FF563B"/><stop offset=".467" stop-color="#FF3750"/><stop offset=".71" stop-color="#F5156C"/><stop offset=".782" stop-color="#EB0878"/><stop offset=".86" stop-color="#E50080"/></radialGradient><radialGradient id="c" cx="0" cy="0" r="1" gradientUnits="userSpaceOnUse" gradientTransform="translate(39.702 40.118) scale(13.6677)"><stop offset=".3" stop-color="#960E18"/><stop offset=".351" stop-color="#B11927" stop-opacity=".74"/><stop offset=".435" stop-color="#DB293D" stop-opacity=".343"/><stop offset=".497" stop-color="#F5334B" stop-opacity=".094"/><stop offset=".53" stop-color="#FF3750" stop-opacity="0"/></radialGradient><radialGradient id="d" cx="0" cy="0" r="1" gradientUnits="userSpaceOnUse" gradientTransform="translate(41.394 31.491) scale(9.90066)"><stop offset=".132" stop-color="#FFF44F"/><stop offset=".252" stop-color="#FFDC3E"/><stop offset=".506" stop-color="#FF9D12"/><stop offset=".526" stop-color="#FF980E"/></radialGradient><radialGradient id="e" cx="0" cy="0" r="1" gradientUnits="userSpaceOnUse" gradientTransform="translate(38.18 43.67) scale(6.50741)"><stop offset=".353" stop-color="#3A8EE6"/><stop offset=".472" stop-color="#5C79F0"/><stop offset=".669" stop-color="#9059FF"/><stop offset="1" stop-color="#C139E6"/></radialGradient><radialGradient id="f" cx="0" cy="0" r="1" gradientUnits="userSpaceOnUse" gradientTransform="matrix(3.35414 -.81093 .9494 3.92687 40.363 38.945)"><stop offset=".206" stop-color="#9059FF" stop-opacity="0"/><stop offset=".278" stop-color="#8C4FF3" stop-opacity=".064"/><stop offset=".747" stop-color="#7716A8" stop-opacity=".45"/><stop offset=".975" stop-color="#6E008B" stop-opacity=".6"/></radialGradient><radialGradient id="g" cx="0" cy="0" r="1" gradientUnits="userSpaceOnUse" gradientTransform="translate(39.533 34.028) scale(4.68221)"><stop stop-color="#FFE226"/><stop offset=".121" stop-color="#FFDB27"/><stop offset=".295" stop-color="#FFC82A"/><stop offset=".502" stop-color="#FFA930"/><stop offset=".732" stop-color="#FF7E37"/><stop offset=".792" stop-color="#FF7139"/></radialGradient><radialGradient id="h" cx="0" cy="0" r="1" gradientUnits="userSpaceOnUse" gradientTransform="translate(43.254 30.983) scale(19.9772)"><stop offset=".113" stop-color="#FFF44F"/><stop offset=".456" stop-color="#FF980E"/><stop offset=".622" stop-color="#FF5634"/><stop offset=".716" stop-color="#FF3647"/><stop offset=".904" stop-color="#E31587"/></radialGradient><radialGradient id="i" cx="0" cy="0" r="1" gradientUnits="userSpaceOnUse" gradientTransform="matrix(1.53635 14.55876 -9.55479 1.0083 41.594 32.091)"><stop stop-color="#FFF44F"/><stop offset=".06" stop-color="#FFE847"/><stop offset=".168" stop-color="#FFC830"/><stop offset=".304" stop-color="#FF980E"/><stop offset=".356" stop-color="#FF8B16"/><stop offset=".455" stop-color="#FF672A"/><stop offset=".57" stop-color="#FF3647"/><stop offset=".737" stop-color="#E31587"/></radialGradient><radialGradient id="j" cx="0" cy="0" r="1" gradientUnits="userSpaceOnUse" gradientTransform="translate(39.533 35.72) scale(12.4701)"><stop offset=".137" stop-color="#FFF44F"/><stop offset=".48" stop-color="#FF980E"/><stop offset=".592" stop-color="#FF5634"/><stop offset=".655" stop-color="#FF3647"/><stop offset=".904" stop-color="#E31587"/></radialGradient><radialGradient id="k" cx="0" cy="0" r="1" gradientUnits="userSpaceOnUse" gradientTransform="translate(42.747 36.397) scale(13.6491)"><stop offset=".094" stop-color="#FFF44F"/><stop offset=".231" stop-color="#FFE141"/><stop offset=".509" stop-color="#FFAF1E"/><stop offset=".626" stop-color="#FF980E"/></radialGradient><linearGradient id="a" x1="45.198" y1="35.108" x2="34.314" y2="45.609" gradientUnits="userSpaceOnUse"><stop offset=".048" stop-color="#FFF44F"/><stop offset=".111" stop-color="#FFE847"/><stop offset=".225" stop-color="#FFC830"/><stop offset=".368" stop-color="#FF980E"/><stop offset=".401" stop-color="#FF8B16"/><stop offset=".462" stop-color="#FF672A"/><stop offset=".534" stop-color="#FF3647"/><stop offset=".705" stop-color="#E31587"/></linearGradient><linearGradient id="l" x1="45.066" y1="35.053" x2="35.806" y2="44.314" gradientUnits="userSpaceOnUse"><stop offset=".167" stop-color="#FFF44F" stop-opacity=".8"/><stop offset=".266" stop-color="#FFF44F" stop-opacity=".634"/><stop offset=".489" stop-color="#FFF44F" stop-opacity=".217"/><stop offset=".6" stop-color="#FFF44F" stop-opacity="0"/></linearGradient></defs></svg>
\ No newline at end of file
diff --git a/browser/components/preferences/moreFromMozilla.inc.xhtml b/browser/components/preferences/moreFromMozilla.inc.xhtml
new file mode 100644
index 0000000000..54120873ff
--- /dev/null
+++ b/browser/components/preferences/moreFromMozilla.inc.xhtml
@@ -0,0 +1,44 @@
+# This Source Code Form is subject to the terms of the Mozilla Public
+# License, v. 2.0. If a copy of the MPL was not distributed with this
+# file, You can obtain one at http://mozilla.org/MPL/2.0/.
+
+<!-- More From Mozilla panel -->
+
+<script src="chrome://browser/content/preferences/moreFromMozilla.js"/>
+<html:template xmlns="http://www.w3.org/1999/xhtml" id="template-paneMoreFromMozilla">
+  <div id="moreFromMozillaCategory-header"
+    class="subcategory"
+    data-hidden-from-search="true"
+    hidden="true"
+    data-category="paneMoreFromMozilla">
+    <h1 class="title" data-l10n-id="more-from-moz-title"/>
+    <p class="subtitle description-deemphasized" data-l10n-id="more-from-moz-subtitle"/>
+  </div>
+  <div id="moreFromMozillaCategory"
+    data-category="paneMoreFromMozilla"
+    hidden="true"
+    data-hidden-from-search="true">
+  </div>
+</html:template>
+
+<html:template xmlns="http://www.w3.org/1999/xhtml" id="simple">
+  <article class="mozilla-product-item simple">
+
+    <div>
+      <h2 class="product-title"/>
+      <div class="product-description-box">
+        <div class="description description-deemphasized"/>
+        <a class="text-link" target="_blank" hidden="true"/>
+      </div>
+    </div>
+
+    <button type="button" class="primary small-button" hidden="true"/>
+
+    <div class="qr-code-box" hidden="true">
+      <h3 class="qr-code-box-title"/>
+      <img class="qr-code-box-image"/>
+      <a class="qr-code-link text-link" target="_blank" hidden="true"/>
+    </div>
+
+  </article>
+</html:template>
diff --git a/browser/components/preferences/moreFromMozilla.js b/browser/components/preferences/moreFromMozilla.js
new file mode 100644
index 0000000000..bf97580d81
--- /dev/null
+++ b/browser/components/preferences/moreFromMozilla.js
@@ -0,0 +1,285 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this file,
+ * You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+/* import-globals-from preferences.js */
+
+var gMoreFromMozillaPane = {
+  initialized: false,
+
+  /**
+   * "default" is whatever template is the default, as defined by the code
+   * in this file (currently in `getTemplateName`).  Setting option to an
+   * invalid value will leave it unchanged.
+   */
+  _option: "default",
+  set option(value) {
+    if (!value) {
+      this._option = "default";
+      return;
+    }
+
+    if (value === "default" || value === "simple") {
+      this._option = value;
+    }
+  },
+
+  get option() {
+    return this._option;
+  },
+
+  getTemplateName() {
+    if (!this._option || this._option == "default") {
+      return "simple";
+    }
+    return this._option;
+  },
+
+  getURL(url, region, option, hasEmail) {
+    const URL_PARAMS = {
+      utm_source: "about-prefs",
+      utm_campaign: "morefrommozilla",
+      utm_medium: "firefox-desktop",
+    };
+    // UTM content param used in analytics to record
+    // UI template used to open URL
+    const utm_content = {
+      default: "default",
+      simple: "fxvt-113-a",
+    };
+
+    const experiment_params = {
+      entrypoint_experiment: "morefrommozilla-experiment-1846",
+    };
+
+    let pageUrl = new URL(url);
+    for (let [key, val] of Object.entries(URL_PARAMS)) {
+      pageUrl.searchParams.append(key, val);
+    }
+
+    // Append region by product to utm_content and also
+    // append '-email' when URL is opened
+    // from send email link in QRCode box
+    if (option) {
+      pageUrl.searchParams.set(
+        "utm_content",
+        `${utm_content[option]}-${region}${hasEmail ? "-email" : ""}`
+      );
+    }
+
+    // Add experiments params when user is shown an experimental UI
+    // with template value as 'simple' set via Nimbus
+    if (option !== "default") {
+      pageUrl.searchParams.set(
+        "entrypoint_experiment",
+        experiment_params.entrypoint_experiment
+      );
+      pageUrl.searchParams.set("entrypoint_variation", `treatment-${option}`);
+    }
+    return pageUrl.toString();
+  },
+
+  renderProducts() {
+    const isRegionUS = Region.home.toLowerCase() === "us";
+    let products = [
+      {
+        id: "firefox-mobile",
+        title_string_id: "more-from-moz-firefox-mobile-title",
+        description_string_id: "more-from-moz-firefox-mobile-description",
+        region: "global",
+        button: {
+          id: "fxMobile",
+          type: "link",
+          label_string_id: "more-from-moz-learn-more-link",
+          actionURL: AppConstants.isChinaRepack()
+            ? "https://www.firefox.com.cn/browsers/mobile/"
+            : "https://www.mozilla.org/firefox/browsers/mobile/",
+        },
+        qrcode: {
+          title: {
+            string_id: "more-from-moz-qr-code-box-firefox-mobile-title",
+          },
+          image_src_prefix:
+            "chrome://browser/content/preferences/more-from-mozilla-qr-code",
+          button: {
+            id: "qr-code-send-email",
+            label: {
+              string_id: "more-from-moz-qr-code-box-firefox-mobile-button",
+            },
+            actionURL: AppConstants.isChinaRepack()
+              ? "https://www.firefox.com.cn/mobile/get-app/"
+              : "https://www.mozilla.org/firefox/mobile/get-app/?v=mfm",
+          },
+        },
+      },
+      {
+        id: "mozilla-monitor",
+        title_string_id: "more-from-moz-mozilla-monitor-title",
+        description_string_id: isRegionUS
+          ? "more-from-moz-mozilla-monitor-us-description"
+          : "more-from-moz-mozilla-monitor-global-description",
+        region: isRegionUS ? "us" : "global",
+        button: {
+          id: "mozillaMonitor",
+          label_string_id: "more-from-moz-mozilla-monitor-button",
+          actionURL: "https://monitor.mozilla.org/",
+        },
+      },
+    ];
+
+    if (BrowserUtils.shouldShowVPNPromo()) {
+      const vpn = {
+        id: "mozilla-vpn",
+        title_string_id: "more-from-moz-mozilla-vpn-title",
+        description_string_id: "more-from-moz-mozilla-vpn-description",
+        region: "global",
+        button: {
+          id: "mozillaVPN",
+          label_string_id: "more-from-moz-button-mozilla-vpn-2",
+          actionURL: "https://www.mozilla.org/products/vpn/",
+        },
+      };
+      products.push(vpn);
+    }
+
+    if (BrowserUtils.shouldShowPromo(BrowserUtils.PromoType.RELAY)) {
+      const relay = {
+        id: "firefox-relay",
+        title_string_id: "more-from-moz-firefox-relay-title",
+        description_string_id: "more-from-moz-firefox-relay-description",
+        region: "global",
+        button: {
+          id: "firefoxRelay",
+          label_string_id: "more-from-moz-firefox-relay-button",
+          actionURL: "https://relay.firefox.com/",
+        },
+      };
+      products.push(relay);
+    }
+
+    this._productsContainer = document.getElementById(
+      "moreFromMozillaCategory"
+    );
+    let frag = document.createDocumentFragment();
+    this._template = document.getElementById(this.getTemplateName());
+
+    // Exit when internal data is incomplete
+    if (!this._template) {
+      return;
+    }
+
+    for (let product of products) {
+      let template = this._template.content.cloneNode(true);
+      let title = template.querySelector(".product-title");
+      let desc = template.querySelector(".description");
+
+      document.l10n.setAttributes(title, product.title_string_id);
+      title.id = product.id;
+
+      document.l10n.setAttributes(desc, product.description_string_id);
+
+      let isLink = product.button.type === "link";
+      let actionElement = template.querySelector(
+        isLink ? ".text-link" : ".small-button"
+      );
+
+      if (actionElement) {
+        actionElement.hidden = false;
+        actionElement.id = `${this.option}-${product.button.id}`;
+        document.l10n.setAttributes(
+          actionElement,
+          product.button.label_string_id
+        );
+
+        if (isLink) {
+          actionElement.setAttribute(
+            "href",
+            this.getURL(product.button.actionURL, product.region, this.option)
+          );
+        } else {
+          actionElement.addEventListener("click", function () {
+            let mainWindow = window.windowRoot.ownerGlobal;
+            mainWindow.openTrustedLinkIn(
+              gMoreFromMozillaPane.getURL(
+                product.button.actionURL,
+                product.region,
+                gMoreFromMozillaPane.option
+              ),
+              "tab"
+            );
+          });
+        }
+      }
+
+      if (product.qrcode) {
+        let qrcode = template.querySelector(".qr-code-box");
+        qrcode.setAttribute("hidden", "false");
+
+        let qrcode_title = template.querySelector(".qr-code-box-title");
+        document.l10n.setAttributes(
+          qrcode_title,
+          product.qrcode.title.string_id
+        );
+
+        let img = template.querySelector(".qr-code-box-image");
+        // Append QRCode image source by template. For CN region
+        // simple template, we want a CN specific QRCode
+        img.src =
+          product.qrcode.image_src_prefix +
+          "-" +
+          this.getTemplateName() +
+          `${
+            AppConstants.isChinaRepack() &&
+            this.getTemplateName().includes("simple")
+              ? "-cn"
+              : ""
+          }` +
+          ".svg";
+        // Add image a11y attributes
+        document.l10n.setAttributes(
+          img,
+          "more-from-moz-qr-code-firefox-mobile-img"
+        );
+
+        let qrc_link = template.querySelector(".qr-code-link");
+
+        // So the telemetry includes info about which option is being used
+        qrc_link.id = `${this.option}-${product.qrcode.button.id}`;
+
+        // For supported locales, this link allows users to send themselves a
+        // download link by email. It should be hidden for unsupported locales.
+        if (BrowserUtils.sendToDeviceEmailsSupported()) {
+          document.l10n.setAttributes(
+            qrc_link,
+            product.qrcode.button.label.string_id
+          );
+          qrc_link.href = this.getURL(
+            product.qrcode.button.actionURL,
+            product.region,
+            this.option,
+            true
+          );
+          qrc_link.hidden = false;
+        }
+      }
+
+      frag.appendChild(template);
+    }
+    this._productsContainer.appendChild(frag);
+  },
+
+  async init() {
+    if (this.initialized) {
+      return;
+    }
+    this.initialized = true;
+    document
+      .getElementById("moreFromMozillaCategory")
+      .removeAttribute("data-hidden-from-search");
+    document
+      .getElementById("moreFromMozillaCategory-header")
+      .removeAttribute("data-hidden-from-search");
+
+    this.renderProducts();
+  },
+};
diff --git a/browser/components/preferences/moz.build b/browser/components/preferences/moz.build
new file mode 100644
index 0000000000..153dcca94b
--- /dev/null
+++ b/browser/components/preferences/moz.build
@@ -0,0 +1,23 @@
+# -*- Mode: python; indent-tabs-mode: nil; tab-width: 40 -*-
+# vim: set filetype=python:
+# This Source Code Form is subject to the terms of the Mozilla Public
+# License, v. 2.0. If a copy of the MPL was not distributed with this
+# file, You can obtain one at http://mozilla.org/MPL/2.0/.
+
+DIRS += ["dialogs"]
+
+BROWSER_CHROME_MANIFESTS += ["tests/browser.toml", "tests/siteData/browser.toml"]
+
+for var in ("MOZ_APP_NAME", "MOZ_MACBUNDLE_NAME"):
+    DEFINES[var] = CONFIG[var]
+
+if CONFIG["MOZ_WIDGET_TOOLKIT"] in ("windows", "gtk", "cocoa"):
+    DEFINES["HAVE_SHELL_SERVICE"] = 1
+
+if CONFIG["MOZ_UPDATE_AGENT"]:
+    DEFINES["MOZ_UPDATE_AGENT"] = True
+
+JAR_MANIFESTS += ["jar.mn"]
+
+with Files("**"):
+    BUG_COMPONENT = ("Firefox", "Settings UI")
diff --git a/browser/components/preferences/preferences.js b/browser/components/preferences/preferences.js
new file mode 100644
index 0000000000..31ae84f382
--- /dev/null
+++ b/browser/components/preferences/preferences.js
@@ -0,0 +1,663 @@
+/* - This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this file,
+   - You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+// Import globals from the files imported by the .xul files.
+/* import-globals-from main.js */
+/* import-globals-from home.js */
+/* import-globals-from search.js */
+/* import-globals-from containers.js */
+/* import-globals-from translations.js */
+/* import-globals-from privacy.js */
+/* import-globals-from sync.js */
+/* import-globals-from experimental.js */
+/* import-globals-from moreFromMozilla.js */
+/* import-globals-from findInPage.js */
+/* import-globals-from /browser/base/content/utilityOverlay.js */
+/* import-globals-from /toolkit/content/preferencesBindings.js */
+
+"use strict";
+
+var { AppConstants } = ChromeUtils.importESModule(
+  "resource://gre/modules/AppConstants.sys.mjs"
+);
+
+var { Downloads } = ChromeUtils.importESModule(
+  "resource://gre/modules/Downloads.sys.mjs"
+);
+var { Integration } = ChromeUtils.importESModule(
+  "resource://gre/modules/Integration.sys.mjs"
+);
+/* global DownloadIntegration */
+Integration.downloads.defineESModuleGetter(
+  this,
+  "DownloadIntegration",
+  "resource://gre/modules/DownloadIntegration.sys.mjs"
+);
+
+var { PrivateBrowsingUtils } = ChromeUtils.importESModule(
+  "resource://gre/modules/PrivateBrowsingUtils.sys.mjs"
+);
+
+var { Weave } = ChromeUtils.importESModule(
+  "resource://services-sync/main.sys.mjs"
+);
+
+var { FirefoxRelayTelemetry } = ChromeUtils.importESModule(
+  "resource://gre/modules/FirefoxRelayTelemetry.mjs"
+);
+
+var { FxAccounts, getFxAccountsSingleton } = ChromeUtils.importESModule(
+  "resource://gre/modules/FxAccounts.sys.mjs"
+);
+var fxAccounts = getFxAccountsSingleton();
+
+XPCOMUtils.defineLazyServiceGetters(this, {
+  gApplicationUpdateService: [
+    "@mozilla.org/updates/update-service;1",
+    "nsIApplicationUpdateService",
+  ],
+
+  listManager: [
+    "@mozilla.org/url-classifier/listmanager;1",
+    "nsIUrlListManager",
+  ],
+  gHandlerService: [
+    "@mozilla.org/uriloader/handler-service;1",
+    "nsIHandlerService",
+  ],
+  gMIMEService: ["@mozilla.org/mime;1", "nsIMIMEService"],
+});
+
+if (Cc["@mozilla.org/gio-service;1"]) {
+  XPCOMUtils.defineLazyServiceGetter(
+    this,
+    "gGIOService",
+    "@mozilla.org/gio-service;1",
+    "nsIGIOService"
+  );
+} else {
+  this.gGIOService = null;
+}
+
+ChromeUtils.defineESModuleGetters(this, {
+  BrowserUtils: "resource://gre/modules/BrowserUtils.sys.mjs",
+  ContextualIdentityService:
+    "resource://gre/modules/ContextualIdentityService.sys.mjs",
+  DownloadUtils: "resource://gre/modules/DownloadUtils.sys.mjs",
+  ExtensionPreferencesManager:
+    "resource://gre/modules/ExtensionPreferencesManager.sys.mjs",
+  ExtensionSettingsStore:
+    "resource://gre/modules/ExtensionSettingsStore.sys.mjs",
+  FeatureGate: "resource://featuregates/FeatureGate.sys.mjs",
+  FileUtils: "resource://gre/modules/FileUtils.sys.mjs",
+  FirefoxRelay: "resource://gre/modules/FirefoxRelay.sys.mjs",
+  HomePage: "resource:///modules/HomePage.sys.mjs",
+  LangPackMatcher: "resource://gre/modules/LangPackMatcher.sys.mjs",
+  LoginHelper: "resource://gre/modules/LoginHelper.sys.mjs",
+  NimbusFeatures: "resource://nimbus/ExperimentAPI.sys.mjs",
+  OSKeyStore: "resource://gre/modules/OSKeyStore.sys.mjs",
+  PlacesUtils: "resource://gre/modules/PlacesUtils.sys.mjs",
+  QuickSuggest: "resource:///modules/QuickSuggest.sys.mjs",
+  Region: "resource://gre/modules/Region.sys.mjs",
+  SelectionChangedMenulist:
+    "resource:///modules/SelectionChangedMenulist.sys.mjs",
+  ShortcutUtils: "resource://gre/modules/ShortcutUtils.sys.mjs",
+  SiteDataManager: "resource:///modules/SiteDataManager.sys.mjs",
+  TransientPrefs: "resource:///modules/TransientPrefs.sys.mjs",
+  UIState: "resource://services-sync/UIState.sys.mjs",
+  UpdateUtils: "resource://gre/modules/UpdateUtils.sys.mjs",
+  UrlbarPrefs: "resource:///modules/UrlbarPrefs.sys.mjs",
+  UrlbarProviderQuickActions:
+    "resource:///modules/UrlbarProviderQuickActions.sys.mjs",
+  UrlbarUtils: "resource:///modules/UrlbarUtils.sys.mjs",
+});
+
+ChromeUtils.defineLazyGetter(this, "gSubDialog", function () {
+  const { SubDialogManager } = ChromeUtils.importESModule(
+    "resource://gre/modules/SubDialog.sys.mjs"
+  );
+  return new SubDialogManager({
+    dialogStack: document.getElementById("dialogStack"),
+    dialogTemplate: document.getElementById("dialogTemplate"),
+    dialogOptions: {
+      styleSheets: [
+        "chrome://browser/skin/preferences/dialog.css",
+        "chrome://browser/skin/preferences/preferences.css",
+      ],
+      resizeCallback: async ({ title, frame }) => {
+        // Search within main document and highlight matched keyword.
+        await gSearchResultsPane.searchWithinNode(
+          title,
+          gSearchResultsPane.query
+        );
+
+        // Search within sub-dialog document and highlight matched keyword.
+        await gSearchResultsPane.searchWithinNode(
+          frame.contentDocument.firstElementChild,
+          gSearchResultsPane.query
+        );
+
+        // Creating tooltips for all the instances found
+        for (let node of gSearchResultsPane.listSearchTooltips) {
+          if (!node.tooltipNode) {
+            gSearchResultsPane.createSearchTooltip(
+              node,
+              gSearchResultsPane.query
+            );
+          }
+        }
+      },
+    },
+  });
+});
+
+var gLastCategory = { category: undefined, subcategory: undefined };
+const gXULDOMParser = new DOMParser();
+var gCategoryModules = new Map();
+var gCategoryInits = new Map();
+
+function register_module(categoryName, categoryObject) {
+  gCategoryModules.set(categoryName, categoryObject);
+  gCategoryInits.set(categoryName, {
+    _initted: false,
+    init() {
+      let startTime = performance.now();
+      if (this._initted) {
+        return;
+      }
+      this._initted = true;
+      let template = document.getElementById("template-" + categoryName);
+      if (template) {
+        // Replace the template element with the nodes inside of it.
+        template.replaceWith(template.content);
+
+        // We've inserted elements that rely on 'preference' attributes.
+        // So we need to update those by reading from the prefs.
+        // The bindings will do this using idle dispatch and avoid
+        // repeated runs if called multiple times before the task runs.
+        Preferences.queueUpdateOfAllElements();
+      }
+
+      categoryObject.init();
+      ChromeUtils.addProfilerMarker(
+        "Preferences",
+        { startTime },
+        categoryName + " init"
+      );
+    },
+  });
+}
+
+document.addEventListener("DOMContentLoaded", init_all, { once: true });
+
+function init_all() {
+  Preferences.forceEnableInstantApply();
+
+  // Asks Preferences to queue an update of the attribute values of
+  // the entire document.
+  Preferences.queueUpdateOfAllElements();
+  Services.telemetry.setEventRecordingEnabled("aboutpreferences", true);
+
+  register_module("paneGeneral", gMainPane);
+  register_module("paneHome", gHomePane);
+  register_module("paneSearch", gSearchPane);
+  register_module("panePrivacy", gPrivacyPane);
+  register_module("paneContainers", gContainersPane);
+  register_module("paneTranslations", gTranslationsPane);
+  if (Services.prefs.getBoolPref("browser.preferences.experimental")) {
+    // Set hidden based on previous load's hidden value.
+    document.getElementById("category-experimental").hidden =
+      Services.prefs.getBoolPref(
+        "browser.preferences.experimental.hidden",
+        false
+      );
+    register_module("paneExperimental", gExperimentalPane);
+  }
+
+  NimbusFeatures.moreFromMozilla.recordExposureEvent({ once: true });
+  if (NimbusFeatures.moreFromMozilla.getVariable("enabled")) {
+    document.getElementById("category-more-from-mozilla").hidden = false;
+    gMoreFromMozillaPane.option =
+      NimbusFeatures.moreFromMozilla.getVariable("template");
+    register_module("paneMoreFromMozilla", gMoreFromMozillaPane);
+  }
+  // The Sync category needs to be the last of the "real" categories
+  // registered and inititalized since many tests wait for the
+  // "sync-pane-loaded" observer notification before starting the test.
+  if (Services.prefs.getBoolPref("identity.fxaccounts.enabled")) {
+    document.getElementById("category-sync").hidden = false;
+    register_module("paneSync", gSyncPane);
+  }
+  register_module("paneSearchResults", gSearchResultsPane);
+  gSearchResultsPane.init();
+  gMainPane.preInit();
+
+  let categories = document.getElementById("categories");
+  categories.addEventListener("select", event => gotoPref(event.target.value));
+
+  document.documentElement.addEventListener("keydown", function (event) {
+    if (event.keyCode == KeyEvent.DOM_VK_TAB) {
+      categories.setAttribute("keyboard-navigation", "true");
+    }
+  });
+  categories.addEventListener("mousedown", function () {
+    this.removeAttribute("keyboard-navigation");
+  });
+
+  maybeDisplayPoliciesNotice();
+
+  window.addEventListener("hashchange", onHashChange);
+
+  document.getElementById("focusSearch1").addEventListener("command", () => {
+    gSearchResultsPane.searchInput.focus();
+  });
+
+  gotoPref().then(() => {
+    document.getElementById("addonsButton").addEventListener("click", e => {
+      e.preventDefault();
+      if (e.button >= 2) {
+        // Ignore right clicks.
+        return;
+      }
+      let mainWindow = window.browsingContext.topChromeWindow;
+      mainWindow.BrowserOpenAddonsMgr();
+    });
+
+    document.dispatchEvent(
+      new CustomEvent("Initialized", {
+        bubbles: true,
+        cancelable: true,
+      })
+    );
+  });
+}
+
+function telemetryBucketForCategory(category) {
+  category = category.toLowerCase();
+  switch (category) {
+    case "containers":
+    case "general":
+    case "home":
+    case "privacy":
+    case "search":
+    case "sync":
+    case "searchresults":
+      return category;
+    default:
+      return "unknown";
+  }
+}
+
+function onHashChange() {
+  gotoPref(null, "hash");
+}
+
+async function gotoPref(
+  aCategory,
+  aShowReason = aCategory ? "click" : "initial"
+) {
+  let categories = document.getElementById("categories");
+  const kDefaultCategoryInternalName = "paneGeneral";
+  const kDefaultCategory = "general";
+  let hash = document.location.hash;
+  let category = aCategory || hash.substr(1) || kDefaultCategoryInternalName;
+
+  let breakIndex = category.indexOf("-");
+  // Subcategories allow for selecting smaller sections of the preferences
+  // until proper search support is enabled (bug 1353954).
+  let subcategory = breakIndex != -1 && category.substring(breakIndex + 1);
+  if (subcategory) {
+    category = category.substring(0, breakIndex);
+  }
+  category = friendlyPrefCategoryNameToInternalName(category);
+  if (category != "paneSearchResults") {
+    gSearchResultsPane.query = null;
+    gSearchResultsPane.searchInput.value = "";
+    gSearchResultsPane.removeAllSearchIndicators(window, true);
+  } else if (!gSearchResultsPane.searchInput.value) {
+    // Something tried to send us to the search results pane without
+    // a query string. Default to the General pane instead.
+    category = kDefaultCategoryInternalName;
+    document.location.hash = kDefaultCategory;
+    gSearchResultsPane.query = null;
+  }
+
+  // Updating the hash (below) or changing the selected category
+  // will re-enter gotoPref.
+  if (gLastCategory.category == category && !subcategory) {
+    return;
+  }
+
+  let item;
+  if (category != "paneSearchResults") {
+    // Hide second level headers in normal view
+    for (let element of document.querySelectorAll(".search-header")) {
+      element.hidden = true;
+    }
+
+    item = categories.querySelector(".category[value=" + category + "]");
+    if (!item || item.hidden) {
+      category = kDefaultCategoryInternalName;
+      item = categories.querySelector(".category[value=" + category + "]");
+    }
+  }
+
+  if (
+    gLastCategory.category ||
+    category != kDefaultCategoryInternalName ||
+    subcategory
+  ) {
+    let friendlyName = internalPrefCategoryNameToFriendlyName(category);
+    // Overwrite the hash, unless there is no hash and we're switching to the
+    // default category, e.g. by using the 'back' button after navigating to
+    // a different category.
+    if (
+      !(!document.location.hash && category == kDefaultCategoryInternalName)
+    ) {
+      document.location.hash = friendlyName;
+    }
+  }
+  // Need to set the gLastCategory before setting categories.selectedItem since
+  // the categories 'select' event will re-enter the gotoPref codepath.
+  gLastCategory.category = category;
+  gLastCategory.subcategory = subcategory;
+  if (item) {
+    categories.selectedItem = item;
+  } else {
+    categories.clearSelection();
+  }
+  window.history.replaceState(category, document.title);
+
+  let categoryInfo = gCategoryInits.get(category);
+  if (!categoryInfo) {
+    let err = new Error(
+      "Unknown in-content prefs category! Can't init " + category
+    );
+    console.error(err);
+    throw err;
+  }
+  categoryInfo.init();
+
+  if (document.hasPendingL10nMutations) {
+    await new Promise(r =>
+      document.addEventListener("L10nMutationsFinished", r, { once: true })
+    );
+    // Bail out of this goToPref if the category
+    // or subcategory changed during async operation.
+    if (
+      gLastCategory.category !== category ||
+      gLastCategory.subcategory !== subcategory
+    ) {
+      return;
+    }
+  }
+
+  search(category, "data-category");
+
+  if (aShowReason != "initial") {
+    document.querySelector(".main-content").scrollTop = 0;
+  }
+
+  // Check to see if the category module wants to do any special
+  // handling of the subcategory - for example, opening a SubDialog.
+  //
+  // If not, just do a normal spotlight on the subcategory.
+  let categoryModule = gCategoryModules.get(category);
+  if (!categoryModule.handleSubcategory?.(subcategory)) {
+    spotlight(subcategory, category);
+  }
+
+  // Record which category is shown
+  Services.telemetry.recordEvent(
+    "aboutpreferences",
+    "show",
+    aShowReason,
+    category
+  );
+
+  document.dispatchEvent(
+    new CustomEvent("paneshown", {
+      bubbles: true,
+      cancelable: true,
+      detail: {
+        category,
+      },
+    })
+  );
+}
+
+function search(aQuery, aAttribute) {
+  let mainPrefPane = document.getElementById("mainPrefPane");
+  let elements = mainPrefPane.children;
+  for (let element of elements) {
+    // If the "data-hidden-from-search" is "true", the
+    // element will not get considered during search.
+    if (
+      element.getAttribute("data-hidden-from-search") != "true" ||
+      element.getAttribute("data-subpanel") == "true"
+    ) {
+      let attributeValue = element.getAttribute(aAttribute);
+      if (attributeValue == aQuery) {
+        element.hidden = false;
+      } else {
+        element.hidden = true;
+      }
+    } else if (
+      element.getAttribute("data-hidden-from-search") == "true" &&
+      !element.hidden
+    ) {
+      element.hidden = true;
+    }
+    element.classList.remove("visually-hidden");
+  }
+
+  let keysets = mainPrefPane.getElementsByTagName("keyset");
+  for (let element of keysets) {
+    let attributeValue = element.getAttribute(aAttribute);
+    if (attributeValue == aQuery) {
+      element.removeAttribute("disabled");
+    } else {
+      element.setAttribute("disabled", true);
+    }
+  }
+}
+
+async function spotlight(subcategory, category) {
+  let highlightedElements = document.querySelectorAll(".spotlight");
+  if (highlightedElements.length) {
+    for (let element of highlightedElements) {
+      element.classList.remove("spotlight");
+    }
+  }
+  if (subcategory) {
+    scrollAndHighlight(subcategory, category);
+  }
+}
+
+async function scrollAndHighlight(subcategory, category) {
+  let element = document.querySelector(`[data-subcategory="${subcategory}"]`);
+  if (!element) {
+    return;
+  }
+  let header = getClosestDisplayedHeader(element);
+
+  scrollContentTo(header);
+  element.classList.add("spotlight");
+}
+
+/**
+ * If there is no visible second level header it will return first level header,
+ * otherwise return second level header.
+ * @returns {Element} - The closest displayed header.
+ */
+function getClosestDisplayedHeader(element) {
+  let header = element.closest("groupbox");
+  let searchHeader = header.querySelector(".search-header");
+  if (
+    searchHeader &&
+    searchHeader.hidden &&
+    header.previousElementSibling.classList.contains("subcategory")
+  ) {
+    header = header.previousElementSibling;
+  }
+  return header;
+}
+
+function scrollContentTo(element) {
+  const STICKY_CONTAINER_HEIGHT =
+    document.querySelector(".sticky-container").clientHeight;
+  let mainContent = document.querySelector(".main-content");
+  let top = element.getBoundingClientRect().top - STICKY_CONTAINER_HEIGHT;
+  mainContent.scroll({
+    top,
+    behavior: "smooth",
+  });
+}
+
+function friendlyPrefCategoryNameToInternalName(aName) {
+  if (aName.startsWith("pane")) {
+    return aName;
+  }
+  return "pane" + aName.substring(0, 1).toUpperCase() + aName.substr(1);
+}
+
+// This function is duplicated inside of utilityOverlay.js's openPreferences.
+function internalPrefCategoryNameToFriendlyName(aName) {
+  return (aName || "").replace(/^pane./, function (toReplace) {
+    return toReplace[4].toLowerCase();
+  });
+}
+
+// Put up a confirm dialog with "ok to restart", "revert without restarting"
+// and "restart later" buttons and returns the index of the button chosen.
+// We can choose not to display the "restart later", or "revert" buttons,
+// altough the later still lets us revert by using the escape key.
+//
+// The constants are useful to interpret the return value of the function.
+const CONFIRM_RESTART_PROMPT_RESTART_NOW = 0;
+const CONFIRM_RESTART_PROMPT_CANCEL = 1;
+const CONFIRM_RESTART_PROMPT_RESTART_LATER = 2;
+async function confirmRestartPrompt(
+  aRestartToEnable,
+  aDefaultButtonIndex,
+  aWantRevertAsCancelButton,
+  aWantRestartLaterButton
+) {
+  let [
+    msg,
+    title,
+    restartButtonText,
+    noRestartButtonText,
+    restartLaterButtonText,
+  ] = await document.l10n.formatValues([
+    {
+      id: aRestartToEnable
+        ? "feature-enable-requires-restart"
+        : "feature-disable-requires-restart",
+    },
+    { id: "should-restart-title" },
+    { id: "should-restart-ok" },
+    { id: "cancel-no-restart-button" },
+    { id: "restart-later" },
+  ]);
+
+  // Set up the first (index 0) button:
+  let buttonFlags =
+    Services.prompt.BUTTON_POS_0 * Services.prompt.BUTTON_TITLE_IS_STRING;
+
+  // Set up the second (index 1) button:
+  if (aWantRevertAsCancelButton) {
+    buttonFlags +=
+      Services.prompt.BUTTON_POS_1 * Services.prompt.BUTTON_TITLE_IS_STRING;
+  } else {
+    noRestartButtonText = null;
+    buttonFlags +=
+      Services.prompt.BUTTON_POS_1 * Services.prompt.BUTTON_TITLE_CANCEL;
+  }
+
+  // Set up the third (index 2) button:
+  if (aWantRestartLaterButton) {
+    buttonFlags +=
+      Services.prompt.BUTTON_POS_2 * Services.prompt.BUTTON_TITLE_IS_STRING;
+  } else {
+    restartLaterButtonText = null;
+  }
+
+  switch (aDefaultButtonIndex) {
+    case 0:
+      buttonFlags += Services.prompt.BUTTON_POS_0_DEFAULT;
+      break;
+    case 1:
+      buttonFlags += Services.prompt.BUTTON_POS_1_DEFAULT;
+      break;
+    case 2:
+      buttonFlags += Services.prompt.BUTTON_POS_2_DEFAULT;
+      break;
+    default:
+      break;
+  }
+
+  let buttonIndex = Services.prompt.confirmEx(
+    window,
+    title,
+    msg,
+    buttonFlags,
+    restartButtonText,
+    noRestartButtonText,
+    restartLaterButtonText,
+    null,
+    {}
+  );
+
+  // If we have the second confirmation dialog for restart, see if the user
+  // cancels out at that point.
+  if (buttonIndex == CONFIRM_RESTART_PROMPT_RESTART_NOW) {
+    let cancelQuit = Cc["@mozilla.org/supports-PRBool;1"].createInstance(
+      Ci.nsISupportsPRBool
+    );
+    Services.obs.notifyObservers(
+      cancelQuit,
+      "quit-application-requested",
+      "restart"
+    );
+    if (cancelQuit.data) {
+      buttonIndex = CONFIRM_RESTART_PROMPT_CANCEL;
+    }
+  }
+  return buttonIndex;
+}
+
+// This function is used to append search keywords found
+// in the related subdialog to the button that will activate the subdialog.
+function appendSearchKeywords(aId, keywords) {
+  let element = document.getElementById(aId);
+  let searchKeywords = element.getAttribute("searchkeywords");
+  if (searchKeywords) {
+    keywords.push(searchKeywords);
+  }
+  element.setAttribute("searchkeywords", keywords.join(" "));
+}
+
+async function ensureScrollPadding() {
+  let stickyContainer = document.querySelector(".sticky-container");
+  let height = await window.browsingContext.topChromeWindow
+    .promiseDocumentFlushed(() => stickyContainer.clientHeight)
+    .catch(err => Cu.reportError); // Can reject if the window goes away.
+
+  // Make it a bit more, to ensure focus rectangles etc. don't get cut off.
+  // This being 8px causes us to end up with 90px if the policies container
+  // is not visible (the common case), which matches the CSS and thus won't
+  // cause a style change, repaint, or other changes.
+  height += 8;
+  stickyContainer
+    .closest(".main-content")
+    .style.setProperty("scroll-padding-top", height + "px");
+}
+
+function maybeDisplayPoliciesNotice() {
+  if (Services.policies.status == Services.policies.ACTIVE) {
+    document.getElementById("policies-container").removeAttribute("hidden");
+    ensureScrollPadding();
+  }
+}
diff --git a/browser/components/preferences/preferences.xhtml b/browser/components/preferences/preferences.xhtml
new file mode 100644
index 0000000000..38fba9a726
--- /dev/null
+++ b/browser/components/preferences/preferences.xhtml
@@ -0,0 +1,275 @@
+<?xml version="1.0"?>
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this file,
+   - You can obtain one at http://mozilla.org/MPL/2.0/. -->
+
+<!DOCTYPE html>
+
+<html xmlns="http://www.w3.org/1999/xhtml"
+        xmlns:html="http://www.w3.org/1999/xhtml"
+        role="document"
+        id="preferences-root">
+
+<head>
+  <!-- @CSP: We should remove 'unsafe-inline' from style-src, see Bug 1579160 -->
+  <meta http-equiv="Content-Security-Policy" content="default-src chrome:; img-src chrome: moz-icon: https: data:; style-src chrome: data: 'unsafe-inline'; object-src 'none'" />
+
+  <title data-l10n-id="settings-page-title"></title>
+
+  <meta name="color-scheme" content="light dark" />
+  <link rel="stylesheet" href="chrome://global/skin/global.css" />
+
+  <link rel="stylesheet" href="chrome://global/skin/in-content/common.css" />
+  <link
+    rel="stylesheet"
+    href="chrome://browser/skin/preferences/preferences.css"
+  />
+  <link
+    rel="stylesheet"
+    href="chrome://browser/skin/preferences/translations.css"
+  />
+  <link
+    rel="stylesheet"
+    href="chrome://browser/content/preferences/dialogs/handlers.css"
+  />
+  <link
+    rel="stylesheet"
+    href="chrome://browser/skin/preferences/applications.css"
+  />
+  <link rel="stylesheet" href="chrome://browser/skin/preferences/search.css" />
+  <link
+    rel="stylesheet"
+    href="chrome://browser/skin/preferences/containers.css"
+  />
+  <link rel="stylesheet" href="chrome://browser/skin/preferences/privacy.css" />
+
+  <link rel="localization" href="branding/brand.ftl"/>
+  <link rel="localization" href="browser/browser.ftl"/>
+    <!-- Used by fontbuilder.js -->
+  <link rel="localization" href="browser/preferences/fonts.ftl"/>
+  <link rel="localization" href="browser/preferences/moreFromMozilla.ftl"/>
+  <link rel="localization" href="browser/preferences/preferences.ftl"/>
+  <link rel="localization" href="toolkit/branding/accounts.ftl"/>
+  <link rel="localization" href="toolkit/branding/brandings.ftl"/>
+  <link rel="localization" href="toolkit/featuregates/features.ftl"/>
+
+  <!-- Links below are only used for search-l10n-ids into subdialogs -->
+  <link rel="localization" href="browser/aboutDialog.ftl"/>
+  <link rel="localization" href="browser/preferences/addEngine.ftl"/>
+  <link rel="localization" href="browser/preferences/blocklists.ftl"/>
+  <link rel="localization" href="browser/preferences/clearSiteData.ftl"/>
+  <link rel="localization" href="browser/preferences/colors.ftl"/>
+  <link rel="localization" href="browser/preferences/connection.ftl"/>
+  <link rel="localization" href="browser/preferences/formAutofill.ftl"/>
+  <link rel="localization" href="browser/preferences/languages.ftl"/>
+  <link rel="localization" href="browser/preferences/permissions.ftl"/>
+  <link rel="localization" href="browser/preferences/selectBookmark.ftl"/>
+  <link rel="localization" href="browser/preferences/siteDataSettings.ftl"/>
+  <link rel="localization" href="browser/sanitize.ftl"/>
+  <link rel="localization" href="browser/translations.ftl"/>
+  <link rel="localization" href="preview/translations.ftl"/>
+  <link rel="localization" href="preview/enUS-searchFeatures.ftl"/>
+  <link rel="localization" href="security/certificates/certManager.ftl"/>
+  <link rel="localization" href="security/certificates/deviceManager.ftl"/>
+  <link rel="localization" href="toolkit/updates/history.ftl"/>
+
+  <link rel="shortcut icon" href="chrome://global/skin/icons/settings.svg"/>
+
+  <script src="chrome://browser/content/utilityOverlay.js"/>
+  <script src="chrome://global/content/preferencesBindings.js"/>
+  <script src="chrome://browser/content/preferences/preferences.js"/>
+  <script src="chrome://browser/content/preferences/extensionControlled.js"/>
+  <script src="chrome://browser/content/preferences/findInPage.js"/>
+  <script type="module" src="chrome://global/content/elements/moz-support-link.mjs"/>
+  <script src="chrome://browser/content/migration/migration-wizard.mjs" type="module"></script>
+  <script type="module" src="chrome://global/content/elements/moz-toggle.mjs"/>
+  <script type="module" src="chrome://global/content/elements/moz-message-bar.mjs" />
+</head>
+
+<html:body xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+           id="preferences-body">
+
+  <stringbundle id="pkiBundle"
+                src="chrome://pippki/locale/pippki.properties"/>
+  <stringbundle id="browserBundle"
+                src="chrome://browser/locale/browser.properties"/>
+
+  <stack id="preferences-stack" flex="1">
+  <hbox flex="1">
+
+    <vbox class="navigation">
+      <!-- category list -->
+      <richlistbox id="categories" data-l10n-id="category-list" data-l10n-attrs="aria-label">
+        <richlistitem id="category-general"
+                      class="category"
+                      value="paneGeneral"
+                      helpTopic="prefs-main"
+                      data-l10n-id="category-general"
+                      data-l10n-attrs="tooltiptext"
+                      align="center">
+          <image class="category-icon"/>
+          <label class="category-name" flex="1" data-l10n-id="pane-general-title"></label>
+        </richlistitem>
+
+        <richlistitem id="category-home"
+                      class="category"
+                      value="paneHome"
+                      helpTopic="prefs-home"
+                      data-l10n-id="category-home"
+                      data-l10n-attrs="tooltiptext"
+                      align="center">
+          <image class="category-icon"/>
+          <label class="category-name" flex="1" data-l10n-id="pane-home-title"></label>
+        </richlistitem>
+
+        <richlistitem id="category-search"
+                      class="category"
+                      value="paneSearch"
+                      helpTopic="prefs-search"
+                      data-l10n-id="category-search"
+                      data-l10n-attrs="tooltiptext"
+                      align="center">
+          <image class="category-icon"/>
+          <label class="category-name" flex="1" data-l10n-id="pane-search-title"></label>
+        </richlistitem>
+
+        <richlistitem id="category-privacy"
+                      class="category"
+                      value="panePrivacy"
+                      helpTopic="prefs-privacy"
+                      data-l10n-id="category-privacy"
+                      data-l10n-attrs="tooltiptext"
+                      align="center">
+          <image class="category-icon"/>
+          <label class="category-name" flex="1" data-l10n-id="pane-privacy-title"></label>
+        </richlistitem>
+
+        <richlistitem id="category-sync"
+                      class="category"
+                      hidden="true"
+                      value="paneSync"
+                      helpTopic="prefs-weave"
+                      data-l10n-id="category-sync3"
+                      data-l10n-attrs="tooltiptext"
+                      align="center">
+          <image class="category-icon"/>
+          <label class="category-name" flex="1" data-l10n-id="pane-sync-title3"></label>
+        </richlistitem>
+
+        <richlistitem id="category-experimental"
+                      class="category"
+                      hidden="true"
+                      value="paneExperimental"
+                      helpTopic="prefs-experimental"
+                      data-l10n-id="category-experimental"
+                      data-l10n-attrs="tooltiptext"
+                      align="center">
+          <image class="category-icon"/>
+          <label class="category-name" flex="1" data-l10n-id="pane-experimental-title"></label>
+        </richlistitem>
+        <richlistitem id="category-more-from-mozilla"
+                      class="category"
+                      hidden="true"
+                      data-l10n-id="more-from-moz-category"
+                      data-l10n-attrs="tooltiptext"
+                      value="paneMoreFromMozilla"
+                      align="center">
+          <image class="category-icon"/>
+          <label class="category-name" flex="1" data-l10n-id="more-from-moz-title"></label>
+        </richlistitem>
+
+        <!-- The following <richlistitem> elements are hidden from the list of items via the hidden-category class.
+            The intent is that they act as sub-pages, accessible from the UI of one of the main pages, but are
+            not listed as primary pages themselves via the selector.
+            These elements need to be hidden with CSS, rather than the "hidden" property, otherwise their
+            functionality will be disabled.
+            In the future, we may want to determine a way to support sub-pages in a first-class fashion, rather
+            than creating them as hidden primary pages like this. For now, any further pages of this kind should
+            be added in this fashion. -->
+        <richlistitem
+                      class="category hidden-category"
+                      value="paneContainers"
+                      helpTopic="prefs-containers"/>
+
+        <richlistitem
+                      class="category hidden-category"
+                      value="paneTranslations"
+                      helpTopic="prefs-translations"/>
+
+      </richlistbox>
+
+      <spacer flex="1"/>
+
+      <vbox class="sidebar-footer-list">
+        <html:a id="addonsButton" class="sidebar-footer-link" href="about:addons">
+          <image class="sidebar-footer-icon addons-icon"/>
+          <label class="sidebar-footer-label" flex="1" data-l10n-id="addons-button-label"></label>
+        </html:a>
+        <html:a id="helpButton" class="sidebar-footer-link" target="_blank"
+                is="moz-support-link" support-page="preferences">
+          <image class="sidebar-footer-icon help-icon"/>
+          <label class="sidebar-footer-label" flex="1" data-l10n-id="help-button-label"></label>
+        </html:a>
+      </vbox>
+    </vbox>
+
+    <keyset>
+      <key data-l10n-id="focus-search" key="" modifiers="accel" id="focusSearch1"/>
+    </keyset>
+
+    <vbox class="main-content" flex="1" align="start">
+      <vbox class="pane-container">
+        <hbox class="sticky-container">
+          <hbox class="sticky-inner-container" pack="end" align="start">
+            <hbox id="policies-container" class="info-box-container smaller-font-size" flex="1" hidden="true">
+              <hbox class="info-icon-container">
+                <html:img class="info-icon"></html:img>
+              </hbox>
+              <hbox align="center" flex="1">
+                <html:a href="about:policies" target="_blank" data-l10n-id="managed-notice"/>
+              </hbox>
+            </hbox>
+            <search-textbox
+              id="searchInput"
+              data-l10n-id="search-input-box2"
+              data-l10n-attrs="placeholder, style"
+              hidden="true"/>
+          </hbox>
+        </hbox>
+        <vbox id="mainPrefPane">
+#include searchResults.inc.xhtml
+#include main.inc.xhtml
+#include home.inc.xhtml
+#include search.inc.xhtml
+#include privacy.inc.xhtml
+#include containers.inc.xhtml
+#include translations.inc.xhtml
+#include sync.inc.xhtml
+#include experimental.inc.xhtml
+#include moreFromMozilla.inc.xhtml
+        </vbox>
+      </vbox>
+    </vbox>
+  </hbox>
+
+  <stack id="dialogStack" hidden="true"/>
+  <vbox id="dialogTemplate" class="dialogOverlay" align="center" pack="center" topmost="true" hidden="true">
+    <vbox class="dialogBox"
+          pack="end"
+          role="dialog"
+          aria-labelledby="dialogTitle">
+      <hbox class="dialogTitleBar" align="center">
+        <label class="dialogTitle" flex="1"/>
+        <button class="dialogClose close-icon"
+                data-l10n-id="close-button"/>
+      </hbox>
+      <browser class="dialogFrame"
+               autoscroll="false"
+               disablehistory="true"/>
+    </vbox>
+  </vbox>
+  </stack>
+
+  <html:dialog id="migrationWizardDialog"></html:dialog>
+</html:body>
+</html>
diff --git a/browser/components/preferences/privacy.inc.xhtml b/browser/components/preferences/privacy.inc.xhtml
new file mode 100644
index 0000000000..a81764e34f
--- /dev/null
+++ b/browser/components/preferences/privacy.inc.xhtml
@@ -0,0 +1,1348 @@
+# This Source Code Form is subject to the terms of the Mozilla Public
+# License, v. 2.0. If a copy of the MPL was not distributed with this
+# file, You can obtain one at http://mozilla.org/MPL/2.0/.
+
+<!-- Privacy panel -->
+
+<script src="chrome://browser/content/preferences/privacy.js"/>
+<stringbundle id="signonBundle" src="chrome://passwordmgr/locale/passwordmgr.properties"/>
+<html:template id="template-panePrivacy">
+<hbox id="browserPrivacyCategory"
+      class="subcategory"
+      hidden="true"
+      data-category="panePrivacy">
+  <html:h1 data-l10n-id="privacy-header"/>
+</hbox>
+
+<!-- Tracking / Content Blocking -->
+<groupbox id="trackingGroup" data-category="panePrivacy" hidden="true" aria-describedby="contentBlockingDescription" class="highlighting-group">
+  <label id="contentBlockingHeader"><html:h2 data-l10n-id="content-blocking-enhanced-tracking-protection"/></label>
+  <vbox data-subcategory="trackingprotection">
+    <hbox align="start">
+      <image id="trackingProtectionShield"/>
+      <description class="description-with-side-element" flex="1">
+        <html:span id="contentBlockingDescription" class="tail-with-learn-more" data-l10n-id="content-blocking-section-top-level-description"></html:span>
+        <html:a is="moz-support-link"
+                id="contentBlockingLearnMore"
+                class="learnMore"
+                data-l10n-id="content-blocking-learn-more"
+                support-page="enhanced-tracking-protection"
+        />
+      </description>
+      <button id="trackingProtectionExceptions"
+              is="highlightable-button"
+              class="accessory-button"
+              data-l10n-id="tracking-manage-exceptions"
+              preference="pref.privacy.disable_button.tracking_protection_exceptions"
+              search-l10n-ids="
+                permissions-address,
+                permissions-disable-etp,
+                permissions-remove.label,
+                permissions-remove-all.label,
+                permissions-exceptions-etp-window2.title,
+                permissions-exceptions-manage-etp-desc,
+              "/>
+    </hbox>
+    <hbox id="rfpIncompatibilityWarning" class="info-box-container" hidden="true">
+      <vbox class="info-icon-container">
+        <html:img class="info-icon"></html:img>
+      </vbox>
+      <vbox flex="1">
+        <description>
+          <html:span class="tail-with-learn-more" data-l10n-id="content-blocking-rfp-incompatibility-warning"/>
+          <html:a is="moz-support-link"
+                  class="learnMore"
+                  support-page="firefox-protection-against-fingerprinting"
+          />
+        </description>
+      </vbox>
+    </hbox>
+    <hbox id="fpiIncompatibilityWarning" class="info-box-container" hidden="true">
+      <vbox class="info-icon-container">
+        <html:img class="info-icon"></html:img>
+      </vbox>
+      <vbox flex="1">
+        <description>
+          <html:span data-l10n-id="content-blocking-fpi-incompatibility-warning"/>
+        </description>
+      </vbox>
+    </hbox>
+    <vbox id="contentBlockingCategories">
+      <radiogroup id="contentBlockingCategoryRadio"
+                  preference="browser.contentblocking.category"
+                  aria-labelledby="trackingProtectionMenuDesc">
+        <vbox id="contentBlockingOptionStandard" class="privacy-detailedoption info-box-container">
+          <hbox>
+            <radio id="standardRadio"
+                   value="standard"
+                   data-l10n-id="enhanced-tracking-protection-setting-standard"
+                   flex="1"/>
+            <button id="standardArrow"
+                    is="highlightable-button"
+                    class="arrowhead"
+                    data-l10n-id="content-blocking-expand-section"
+                    aria-expanded="false"/>
+          </hbox>
+          <vbox class="indent">
+            <description data-l10n-id="content-blocking-etp-standard-desc"></description>
+            <vbox class="privacy-extra-information">
+              <label class="content-blocking-extra-blocking-desc" data-l10n-id="content-blocking-etp-blocking-desc"/>
+              <vbox class="indent">
+                <hbox class="extra-information-label social-media-option" hidden="true">
+                  <label class="content-blocking-label" data-l10n-id="content-blocking-social-media-trackers"/>
+                </hbox>
+                <hbox class="extra-information-label cross-site-cookies-option" hidden="true">
+                  <label class="content-blocking-label" data-l10n-id="content-blocking-cross-site-cookies-in-all-windows2"/>
+                </hbox>
+                <hbox class="extra-information-label third-party-tracking-cookies-option" hidden="true">
+                  <label class="content-blocking-label" data-l10n-id="content-blocking-cross-site-tracking-cookies"/>
+                </hbox>
+                <hbox class="extra-information-label all-third-party-cookies-private-windows-option" hidden="true">
+                  <label class="content-blocking-label" data-l10n-id="content-blocking-all-cross-site-cookies-private-windows"/>
+                </hbox>
+                <hbox class="extra-information-label third-party-tracking-cookies-plus-isolate-option" hidden="true">
+                  <label class="content-blocking-label" data-l10n-id="content-blocking-cross-site-tracking-cookies-plus-isolate"/>
+                </hbox>
+                <hbox class="extra-information-label pb-trackers-option" hidden="true">
+                  <label class="content-blocking-label" data-l10n-id="content-blocking-private-windows"/>
+                </hbox>
+                <hbox class="extra-information-label trackers-option" hidden="true">
+                  <label class="content-blocking-label" data-l10n-id="content-blocking-all-windows-tracking-content"/>
+                </hbox>
+                <hbox class="extra-information-label all-third-party-cookies-option" hidden="true">
+                  <label class="content-blocking-label" data-l10n-id="content-blocking-all-cross-site-cookies"/>
+                </hbox>
+                <hbox class="extra-information-label all-cookies-option" hidden="true">
+                  <label class="content-blocking-label" data-l10n-id="content-blocking-all-cookies"/>
+                </hbox>
+                <hbox class="extra-information-label unvisited-cookies-option" hidden="true">
+                  <label class="content-blocking-label" data-l10n-id="content-blocking-unvisited-cookies"/>
+                </hbox>
+                <hbox class="extra-information-label cryptominers-option" hidden="true">
+                  <label class="content-blocking-label" data-l10n-id="content-blocking-cryptominers"/>
+                </hbox>
+                <hbox class="extra-information-label fingerprinters-option" hidden="true">
+                  <label class="content-blocking-label" data-l10n-id="content-blocking-fingerprinters"/>
+                </hbox>
+              </vbox>
+              <vbox id="etpStandardTCPBox" class="content-blocking-warning info-box-container">
+                <label class="content-blocking-warning-title" data-l10n-id="content-blocking-etp-standard-tcp-title"/>
+                <description>
+                  <html:span class="tail-with-learn-more" data-l10n-id="content-blocking-etp-standard-tcp-rollout-description"></html:span>
+                  <html:a is="moz-support-link"
+                          id="tcp-learn-more-link"
+                          class="learnMore"
+                          data-l10n-id="content-blocking-etp-standard-tcp-rollout-learn-more"
+                          support-page="total-cookie-protection"
+                  />
+                </description>
+              </vbox>
+              <html:div class="content-blocking-warning info-box-container reload-tabs" hidden="true">
+                <html:div class="content-blocking-reload-desc-container">
+                  <html:div class="info-icon-container">
+                    <html:img class="info-icon"/>
+                  </html:div>
+                  <html:span data-l10n-id="content-blocking-reload-description"
+                             class="content-blocking-reload-description" />
+                </html:div>
+                <button class="accessory-button reload-tabs-button primary"
+                        is="highlightable-button"
+                        data-l10n-id="content-blocking-reload-tabs-button"/>
+              </html:div>
+            </vbox>
+          </vbox>
+        </vbox>
+        <vbox id="contentBlockingOptionStrict" class="privacy-detailedoption info-box-container">
+          <hbox>
+            <radio id="strictRadio"
+                   value="strict"
+                   data-l10n-id="enhanced-tracking-protection-setting-strict"
+                   flex="1"/>
+            <button id="strictArrow"
+                    is="highlightable-button"
+                    class="arrowhead"
+                    data-l10n-id="content-blocking-expand-section"
+                    aria-expanded="false"/>
+          </hbox>
+          <vbox class="indent">
+            <label data-l10n-id="content-blocking-etp-strict-desc"></label>
+            <vbox class="privacy-extra-information">
+              <label class="content-blocking-extra-blocking-desc" data-l10n-id="content-blocking-etp-blocking-desc"/>
+              <vbox class="indent">
+                <hbox class="extra-information-label social-media-option" hidden="true">
+                  <label class="content-blocking-label" data-l10n-id="content-blocking-social-media-trackers"/>
+                </hbox>
+                <hbox class="extra-information-label third-party-tracking-cookies-option" hidden="true">
+                  <label class="content-blocking-label" data-l10n-id="content-blocking-cross-site-tracking-cookies"/>
+                </hbox>
+                <hbox class="extra-information-label all-third-party-cookies-private-windows-option" hidden="true">
+                  <label class="content-blocking-label" data-l10n-id="content-blocking-all-cross-site-cookies-private-windows"/>
+                </hbox>
+                <hbox class="extra-information-label cross-site-cookies-option" hidden="true">
+                  <label class="content-blocking-label" data-l10n-id="content-blocking-cross-site-cookies-in-all-windows2"/>
+                </hbox>
+                <hbox class="extra-information-label pb-trackers-option" hidden="true">
+                  <label class="content-blocking-label" data-l10n-id="content-blocking-private-windows"/>
+                </hbox>
+                <hbox class="extra-information-label trackers-option" hidden="true">
+                  <label class="content-blocking-label" data-l10n-id="content-blocking-all-windows-tracking-content"/>
+                </hbox>
+                <hbox class="extra-information-label all-third-party-cookies-option" hidden="true">
+                  <label class="content-blocking-label" data-l10n-id="content-blocking-all-cross-site-cookies"/>
+                </hbox>
+                <hbox class="extra-information-label all-cookies-option" hidden="true">
+                  <label class="content-blocking-label" data-l10n-id="content-blocking-all-cookies"/>
+                </hbox>
+                <hbox class="extra-information-label unvisited-cookies-option" hidden="true">
+                  <label class="content-blocking-label" data-l10n-id="content-blocking-unvisited-cookies"/>
+                </hbox>
+                <hbox class="extra-information-label third-party-tracking-cookies-plus-isolate-option" hidden="true">
+                  <label class="content-blocking-label" data-l10n-id="content-blocking-cross-site-tracking-cookies-plus-isolate"/>
+                </hbox>
+                <hbox class="extra-information-label cryptominers-option" hidden="true">
+                  <label class="content-blocking-label" data-l10n-id="content-blocking-cryptominers"/>
+                </hbox>
+                <hbox class="extra-information-label fingerprinters-option" hidden="true">
+                  <label class="content-blocking-label" data-l10n-id="content-blocking-known-and-suspected-fingerprinters"/>
+                </hbox>
+              </vbox>
+              <html:div class="content-blocking-warning info-box-container reload-tabs" hidden="true">
+                <html:div class="content-blocking-reload-desc-container">
+                  <html:div class="info-icon-container">
+                    <html:img class="info-icon"/>
+                  </html:div>
+                  <html:span data-l10n-id="content-blocking-reload-description"
+                             class="content-blocking-reload-description" />
+                </html:div>
+                <button class="accessory-button reload-tabs-button primary"
+                        is="highlightable-button"
+                        data-l10n-id="content-blocking-reload-tabs-button"/>
+              </html:div>
+              <vbox class="content-blocking-warning info-box-container">
+                <hbox>
+                  <image class="content-blocking-warning-image"/>
+                  <label class="content-blocking-warning-title" data-l10n-id="content-blocking-warning-title"/>
+                </hbox>
+                <description class="indent">
+                  <html:span class="tail-with-learn-more content-blocking-warning-description" data-l10n-id="content-blocking-and-isolating-etp-warning-description-2"></html:span>
+                  <html:a is="moz-support-link"
+                          class="learnMore"
+                          data-l10n-id="content-blocking-warning-learn-how"
+                          support-page="turn-off-etp-desktop"
+                  />
+                </description>
+              </vbox>
+            </vbox>
+          </vbox>
+        </vbox>
+        <vbox id="contentBlockingOptionCustom" class="privacy-detailedoption info-box-container">
+          <hbox>
+            <radio id="customRadio"
+                   value="custom"
+                   data-l10n-id="enhanced-tracking-protection-setting-custom"
+                   flex="1"/>
+            <button id="customArrow"
+                    is="highlightable-button"
+                    class="arrowhead"
+                    data-l10n-id="content-blocking-expand-section"
+                    aria-expanded="false"/>
+          </hbox>
+          <vbox class="indent">
+            <description id="contentBlockingCustomDesc" data-l10n-id="content-blocking-etp-custom-desc"></description>
+            <vbox class="privacy-extra-information">
+                <hbox class="reject-trackers-ui custom-option">
+                  <checkbox id="contentBlockingBlockCookiesCheckbox"
+                            class="content-blocking-checkbox" flex="1"
+                            data-l10n-id="content-blocking-cookies-label"
+                            aria-describedby="contentBlockingCustomDesc"
+                            preference="network.cookie.cookieBehavior"/>
+                  <vbox>
+                    <menulist id="blockCookiesMenu"
+                              sizetopopup="none"
+                              preference="network.cookie.cookieBehavior">
+                      <menupopup>
+                        <menuitem id="blockCookiesSocialMedia" data-l10n-id="sitedata-option-block-cross-site-trackers" value="trackers"/>
+                        <menuitem id="isolateCookiesSocialMedia" data-l10n-id="sitedata-option-block-cross-site-cookies" value="trackers-plus-isolate"/>
+                        <menuitem data-l10n-id="sitedata-option-block-unvisited" value="unvisited"/>
+                        <menuitem data-l10n-id="sitedata-option-block-all-cross-site-cookies" value="all-third-parties"/>
+                        <menuitem data-l10n-id="sitedata-option-block-all" value="always"/>
+                      </menupopup>
+                    </menulist>
+                  </vbox>
+                </hbox>
+                <hbox id="contentBlockingTrackingProtectionExtensionContentLabel"
+                      align="center" hidden="true" class="extension-controlled">
+                  <description control="contentBlockingDisableTrackingProtectionExtension" flex="1"/>
+                  <button id="contentBlockingDisableTrackingProtectionExtension"
+                          is="highlightable-button"
+                          class="extension-controlled-button accessory-button"
+                          data-l10n-id="disable-extension" hidden="true"/>
+                </hbox>
+                  <hbox class="custom-option">
+                    <checkbox id="contentBlockingTrackingProtectionCheckbox"
+                              class="content-blocking-checkbox" flex="1"
+                              data-l10n-id="content-blocking-tracking-content-label"
+                              aria-describedby="contentBlockingCustomDesc"/>
+                    <vbox>
+                      <menulist id="trackingProtectionMenu">
+                        <menupopup>
+                          <menuitem data-l10n-id="content-blocking-option-private" value="private"/>
+                          <menuitem data-l10n-id="content-blocking-tracking-protection-option-all-windows" value="always"/>
+                        </menupopup>
+                      </menulist>
+                    </vbox>
+                  </hbox>
+                  <label id="changeBlockListLink"
+                         data-l10n-id="content-blocking-tracking-protection-change-block-list"
+                         is="text-link"
+                         search-l10n-ids="blocklist-window2.title, blocklist-description, blocklist-dialog.buttonlabelaccept"/>
+
+                <hbox class="custom-option" id="contentBlockingCryptominersOption">
+                  <checkbox id="contentBlockingCryptominersCheckbox"
+                            class="content-blocking-checkbox" flex="1"
+                            preference="privacy.trackingprotection.cryptomining.enabled"
+                            data-l10n-id="content-blocking-cryptominers-label"
+                            aria-describedby="contentBlockingCustomDesc"/>
+                </hbox>
+                <hbox class="custom-option" id="contentBlockingFingerprintersOption">
+                  <checkbox id="contentBlockingFingerprintersCheckbox"
+                            class="content-blocking-checkbox" flex="1"
+                            preference="privacy.trackingprotection.fingerprinting.enabled"
+                            data-l10n-id="content-blocking-known-fingerprinters-label"
+                            aria-describedby="contentBlockingCustomDesc"/>
+                </hbox>
+                <hbox class="custom-option">
+                    <checkbox id="contentBlockingFingerprintingProtectionCheckbox"
+                              class="content-blocking-checkbox" flex="1"
+                              data-l10n-id="content-blocking-suspected-fingerprinters-label"
+                              aria-describedby="contentBlockingCustomDesc"/>
+                    <vbox>
+                      <menulist id="fingerprintingProtectionMenu">
+                        <menupopup>
+                          <menuitem data-l10n-id="content-blocking-option-private" value="private"/>
+                          <menuitem data-l10n-id="content-blocking-tracking-protection-option-all-windows" value="always"/>
+                        </menupopup>
+                      </menulist>
+                    </vbox>
+                  </hbox>
+              <html:div class="content-blocking-warning info-box-container reload-tabs" hidden="true">
+                <html:div class="content-blocking-reload-desc-container">
+                  <html:div class="info-icon-container">
+                    <html:img class="info-icon"/>
+                  </html:div>
+                  <html:span data-l10n-id="content-blocking-reload-description"
+                             class="content-blocking-reload-description" />
+                </html:div>
+                <button class="accessory-button reload-tabs-button primary"
+                        is="highlightable-button"
+                        data-l10n-id="content-blocking-reload-tabs-button"/>
+              </html:div>
+              <vbox class="content-blocking-warning info-box-container">
+                <hbox>
+                  <image class="content-blocking-warning-image"/>
+                  <label class="content-blocking-warning-title" data-l10n-id="content-blocking-warning-title"/>
+                </hbox>
+                <description class="indent">
+                  <html:span class="tail-with-learn-more content-blocking-warning-description" data-l10n-id="content-blocking-and-isolating-etp-warning-description-2"></html:span>
+                  <html:a is="moz-support-link"
+                          class="learnMore"
+                          data-l10n-id="content-blocking-warning-learn-how"
+                          support-page="turn-off-etp-desktop"
+                  />
+                </description>
+              </vbox>
+            </vbox>
+          </vbox>
+        </vbox>
+      </radiogroup>
+    </vbox>
+  </vbox>
+</groupbox>
+<groupbox id="nonTechnicalPrivacyGroup" data-category="panePrivacy" data-subcategory="nontechnicalprivacy" hidden="true">
+  <label id="nonTechnicalPrivacyHeader"><html:h2 data-l10n-id="non-technical-privacy-header"/></label>
+  <vbox id="nonTechnicalPrivacyBox">
+    <hbox id="globalPrivacyControlBox" flex="1" align="center" hidden="true">
+      <checkbox id="globalPrivacyControlCheckbox"
+              class="tail-with-learn-more"
+              preference="privacy.globalprivacycontrol.enabled"
+              data-l10n-id="global-privacy-control-description"
+              search-l10n-ids="global-privacy-control-search" />
+      <html:a is="moz-support-link"
+          id="globalPrivacyControlLearnMoreLink"
+          support-page="global-privacy-control" />
+    </hbox>
+    <vbox id="legacyDoNotTrackBox">
+      <label>
+        <label class="tail-with-learn-more" data-l10n-id="do-not-track-description" id="doNotTrackDesc"></label>
+      <html:a is="moz-support-link"
+              class="learnMore"
+              support-page="how-do-i-turn-do-not-track-feature"
+      />
+      </label>
+      <radiogroup id="doNotTrackRadioGroup" aria-labelledby="doNotTrackDesc" preference="privacy.donottrackheader.enabled">
+        <radio value="true" data-l10n-id="do-not-track-option-always"/>
+        <radio value="false" data-l10n-id="do-not-track-option-default-content-blocking-known"/>
+      </radiogroup>
+    </vbox>
+    <hbox id="doNotTrackBox" flex="1" align="center">
+      <checkbox id="doNotTrackCheckbox"
+              class="tail-with-learn-more"
+              preference="privacy.donottrackheader.enabled"
+              data-l10n-id="do-not-track-description2" />
+      <html:a is="moz-support-link"
+          id="doNotTrackLearnMoreLink"
+          support-page="how-do-i-turn-do-not-track-feature" />
+    </hbox>
+  </vbox>
+</groupbox>
+
+<!-- Site Data -->
+<groupbox id="siteDataGroup" data-category="panePrivacy" hidden="true" aria-describedby="totalSiteDataSize">
+  <label><html:h2 data-l10n-id="sitedata-header"/></label>
+
+  <hbox data-subcategory="sitedata" align="baseline">
+    <vbox flex="1">
+      <description class="description-with-side-element description-deemphasized" flex="1">
+        <html:span id="totalSiteDataSize" class="tail-with-learn-more"></html:span>
+        <html:a is="moz-support-link"
+                id="siteDataLearnMoreLink"
+                data-l10n-id="sitedata-learn-more"
+                support-page="storage-permissions"
+        />
+      </description>
+      <hbox flex="1" id="deleteOnCloseNote" class="info-box-container smaller-font-size">
+        <hbox class="info-icon-container">
+          <html:img class="info-icon"></html:img>
+        </hbox>
+        <description flex="1" data-l10n-id="sitedata-delete-on-close-private-browsing2" />
+      </hbox>
+      <hbox id="keepRow"
+            align="center">
+        <checkbox id="deleteOnClose"
+                  data-l10n-id="sitedata-delete-on-close"
+                  flex="1" />
+      </hbox>
+    </vbox>
+    <vbox align="end">
+      <button id="clearSiteDataButton"
+          is="highlightable-button"
+          class="accessory-button"
+          search-l10n-ids="clear-site-data-cookies-empty.label, clear-site-data-cache-empty.label"
+          data-l10n-id="sitedata-clear"/>
+      <button id="siteDataSettings"
+              is="highlightable-button"
+              class="accessory-button"
+              data-l10n-id="sitedata-settings"
+              search-l10n-ids="
+                site-data-settings-window.title,
+                site-data-column-host.label,
+                site-data-column-cookies.label,
+                site-data-column-storage.label,
+                site-data-settings-description,
+                site-data-remove-all.label,
+              "/>
+      <button id="cookieExceptions"
+              is="highlightable-button"
+              class="accessory-button"
+              data-l10n-id="sitedata-cookies-exceptions"
+              preference="pref.privacy.disable_button.cookie_exceptions"
+              search-l10n-ids="
+                permissions-address,
+                permissions-block.label,
+                permissions-allow.label,
+                permissions-remove.label,
+                permissions-remove-all.label,
+                permissions-exceptions-cookie-desc,
+              " />
+    </vbox>
+  </hbox>
+</groupbox>
+
+<!-- Cookie Banner Handling -->
+<groupbox id="cookieBannerHandlingGroup" data-category="panePrivacy" data-subcategory="cookiebanner" hidden="true">
+  <label><html:h2 data-l10n-id="cookie-banner-blocker-header" /></label>
+  <vbox flex="1">
+    <hbox>
+      <description class="description-deemphasized">
+        <html:span id="cookieBannerReductionExplanation" class="tail-with-learn-more" data-l10n-id="cookie-banner-blocker-description" ></html:span>
+        <html:a is="moz-support-link" id="cookieBannerHandlingLearnMore" class="learnMore"  data-l10n-id="cookie-banner-learn-more" support-page="cookie-banner-reduction"/>
+      </description>
+    </hbox>
+    <hbox>
+      <checkbox id="handleCookieBanners"
+                preference="cookiebanners.service.mode.privateBrowsing"
+                data-l10n-id="cookie-banner-blocker-checkbox-label"
+                flex="1" />
+    </hbox>
+  </vbox>
+</groupbox>
+
+<!-- Passwords -->
+<groupbox id="passwordsGroup" orient="vertical" data-category="panePrivacy" data-subcategory="logins" hidden="true">
+  <label><html:h2 data-l10n-id="pane-privacy-passwords-header" data-l10n-attrs="searchkeywords"/></label>
+
+  <vbox id="passwordSettings">
+    <hbox id="passwordManagerExtensionContent"
+          class="extension-controlled"
+          align="center"
+          hidden="true">
+          <description control="disablePasswordManagerExtension"
+                       flex="1"/>
+          <button id="disablePasswordManagerExtension"
+                  class="extension-controlled-button accessory-button"
+                  data-l10n-id="disable-extension"
+                  hidden="true" />
+    </hbox>
+    <hbox>
+      <vbox flex="1">
+        <hbox>
+          <checkbox id="savePasswords"
+                    data-l10n-id="forms-ask-to-save-passwords"
+                    preference="signon.rememberSignons"
+                    flex="1" />
+        </hbox>
+        <hbox class="indent" flex="1">
+          <checkbox id="passwordAutofillCheckbox"
+                    data-l10n-id="forms-fill-usernames-and-passwords"
+                    preference="signon.autofillForms"
+                    flex="1" />
+        </hbox>
+        <hbox class="indent" id="generatePasswordsBox" flex="1">
+          <checkbox id="generatePasswords"
+                    data-l10n-id="forms-suggest-passwords"
+                    preference="signon.generation.enabled"
+                    flex="1" />
+        </hbox>
+      </vbox>
+      <vbox align="end">
+        <button id="passwordExceptions"
+                is="highlightable-button"
+                class="accessory-button"
+                data-l10n-id="forms-exceptions"
+                preference="pref.privacy.disable_button.view_passwords_exceptions"
+                search-l10n-ids="
+                  permissions-address,
+                  permissions-exceptions-saved-passwords-window.title,
+                  permissions-exceptions-saved-passwords-desc,
+                "/>
+        <button id="showPasswords"
+                is="highlightable-button"
+                class="accessory-button"
+                data-l10n-id="forms-saved-passwords"
+                preference="pref.privacy.disable_button.view_passwords"/>
+      </vbox>
+    </hbox>
+    <hbox class="indent" id="relayIntegrationBox" flex="1" align="center">
+      <checkbox id="relayIntegration"
+                class="tail-with-learn-more"
+                data-l10n-id="preferences-relay-integration-checkbox2"/>
+      <html:a id="relayIntegrationLearnMoreLink" class="learnMore"
+             data-l10n-id="relay-integration-learn-more-link"/>
+    </hbox>
+    <hbox class="indent" id="breachAlertsBox" flex="1" align="center">
+      <checkbox id="breachAlerts"
+                class="tail-with-learn-more"
+                data-l10n-id="forms-breach-alerts"
+                preference="signon.management.page.breach-alerts.enabled"/>
+      <html:a is="moz-support-link"
+              id="breachAlertsLearnMoreLink"
+              data-l10n-id="forms-breach-alerts-learn-more-link"
+              support-page="lockwise-alerts"
+      />
+    </hbox>
+  </vbox>
+  <vbox>
+    <hbox id="masterPasswordRow" align="center">
+      <checkbox id="useMasterPassword"
+                data-l10n-id="forms-primary-pw-use"
+                class="tail-with-learn-more"/>
+      <html:a is="moz-support-link"
+              id="primaryPasswordLearnMoreLink"
+              data-l10n-id="forms-primary-pw-learn-more-link"
+              support-page="primary-password-stored-logins"
+      />
+      <spacer flex="1"/>
+      <button id="changeMasterPassword"
+              is="highlightable-button"
+              class="accessory-button"
+              search-l10n-ids="forms-master-pw-change.label"
+              data-l10n-id="forms-primary-pw-change"/>
+    </hbox>
+    <description class="indent tip-caption"
+                 data-l10n-id="forms-primary-pw-former-name"
+                 data-l10n-attrs="hidden"
+                 flex="1"/>
+#ifdef XP_WIN
+    <hbox id="windows-sso" align="center">
+      <checkbox data-l10n-id="forms-windows-sso"
+                preference="network.http.windows-sso.enabled"
+                class="tail-with-learn-more"/>
+      <html:a is="moz-support-link"
+              id="windowsSSOLearnMoreLink"
+              data-l10n-id="forms-windows-sso-learn-more-link"
+              support-page="windows-sso"
+      />
+    </hbox>
+    <description id="windows-sso-caption" class="indent tip-caption"
+           data-l10n-id="forms-windows-sso-desc"/>
+#endif
+  </vbox>
+
+  <label id="openWindowsPasskeySettings">
+    <html:a class="text-link" data-l10n-id="windows-passkey-settings-label" href="ms-settings:savedpasskeys" />
+  </label>
+  <!--
+    Those two strings are meant to be invisible and will be used exclusively to provide
+    localization for an alert window.
+  -->
+  <label id="fips-title" hidden="true" data-l10n-id="forms-primary-pw-fips-title"></label>
+  <label id="fips-desc" hidden="true" data-l10n-id="forms-master-pw-fips-desc"></label>
+</groupbox>
+
+<!-- The form autofill section is inserted in to this box
+     after the form autofill extension has initialized. -->
+<groupbox id="formAutofillGroupBox"
+          data-category="panePrivacy"
+          data-subcategory="form-autofill" hidden="true"></groupbox>
+
+<!-- History -->
+<groupbox id="historyGroup" data-category="panePrivacy" hidden="true">
+  <label><html:h2 data-l10n-id="history-header"/></label>
+  <hbox align="center">
+    <label id="historyModeLabel"
+           control="historyMode"
+           data-l10n-id="history-remember-label"/>
+    <menulist id="historyMode">
+      <menupopup>
+        <menuitem data-l10n-id="history-remember-option-all"
+                  value="remember"
+                  search-l10n-ids="history-remember-description"/>
+        <menuitem data-l10n-id="history-remember-option-never"
+                  value="dontremember"
+                  search-l10n-ids="history-dontremember-description"/>
+        <menuitem data-l10n-id="history-remember-option-custom"
+                  value="custom"
+                  search-l10n-ids="
+                    history-private-browsing-permanent.label,
+                    history-remember-browser-option.label,
+                    history-remember-search-option.label,
+                    history-clear-on-close-option.label,
+                    history-clear-on-close-settings.label"/>
+      </menupopup>
+    </menulist>
+  </hbox>
+  <hbox>
+    <deck id="historyPane" flex="1">
+      <vbox id="historyRememberPane">
+        <hbox align="center" flex="1">
+          <vbox flex="1">
+            <description
+              class="description-with-side-element"
+              data-l10n-id="history-remember-description"/>
+          </vbox>
+        </hbox>
+      </vbox>
+      <vbox id="historyDontRememberPane">
+        <hbox align="center" flex="1">
+          <vbox flex="1">
+            <description
+              class="description-with-side-element"
+              data-l10n-id="history-dontremember-description"/>
+          </vbox>
+        </hbox>
+      </vbox>
+      <vbox id="historyCustomPane">
+        <vbox>
+          <checkbox id="privateBrowsingAutoStart"
+                    data-l10n-id="history-private-browsing-permanent"
+                    preference="browser.privatebrowsing.autostart"/>
+          <vbox class="indent">
+            <checkbox id="rememberHistory"
+                      data-l10n-id="history-remember-browser-option"
+                      preference="places.history.enabled"/>
+            <checkbox id="rememberForms"
+                      data-l10n-id="history-remember-search-option"
+                      preference="browser.formfill.enable"/>
+            <hbox id="clearDataBox"
+                  align="center">
+              <checkbox id="alwaysClear"
+                        preference="privacy.sanitize.sanitizeOnShutdown"
+                        data-l10n-id="history-clear-on-close-option"
+                        flex="1" />
+            </hbox>
+          </vbox>
+        </vbox>
+      </vbox>
+    </deck>
+    <vbox id="historyButtons" align="end">
+      <button id="clearHistoryButton"
+              is="highlightable-button"
+              class="accessory-button"
+              data-l10n-id="history-clear-button"/>
+      <button id="clearDataSettings"
+              is="highlightable-button"
+              class="accessory-button"
+              data-l10n-id="history-clear-on-close-settings"
+              search-l10n-ids="
+                clear-data-settings-label,
+                history-section-label,
+                item-history-and-downloads.label,
+                item-cookies.label,
+                item-active-logins.label,
+                item-cache.label,
+                item-form-search-history.label,
+                data-section-label,
+                item-site-settings.label,
+                item-offline-apps.label
+              "/>
+    </vbox>
+  </hbox>
+</groupbox>
+
+<hbox id="permissionsCategory"
+      class="subcategory"
+      hidden="true"
+      data-category="panePrivacy">
+  <html:h1 data-l10n-id="permissions-header"/>
+</hbox>
+
+<!-- Permissions -->
+<groupbox id="permissionsGroup" data-category="panePrivacy" hidden="true" data-subcategory="permissions">
+  <label class="search-header" hidden="true"><html:h2 data-l10n-id="permissions-header"/></label>
+
+  <!-- The hbox around the buttons is to compute the search tooltip position properly -->
+  <vbox>
+    <hbox id="locationSettingsRow" align="center" role="group" aria-labelledby="locationPermissionsLabel">
+      <hbox flex="1">
+        <image class="geo-icon permission-icon" />
+        <label id="locationPermissionsLabel" data-l10n-id="permissions-location"/>
+      </hbox>
+      <hbox pack="end">
+        <button id="locationSettingsButton"
+                is="highlightable-button"
+                class="accessory-button"
+                data-l10n-id="permissions-location-settings"
+                search-l10n-ids="
+                  permissions-remove.label,
+                  permissions-remove-all.label,
+                  permissions-site-location-window2.title,
+                  permissions-site-location-desc,
+                  permissions-site-location-disable-label,
+                  permissions-site-location-disable-desc,
+                " />
+      </hbox>
+    </hbox>
+
+    <hbox id="cameraSettingsRow" align="center" role="group" aria-labelledby="cameraPermissionsLabel">
+      <hbox flex="1">
+        <image class="camera-icon permission-icon" />
+        <label id="cameraPermissionsLabel" data-l10n-id="permissions-camera"/>
+      </hbox>
+      <hbox pack="end">
+        <button id="cameraSettingsButton"
+                is="highlightable-button"
+                class="accessory-button"
+                data-l10n-id="permissions-camera-settings"
+                search-l10n-ids="
+                  permissions-remove.label,
+                  permissions-remove-all.label,
+                  permissions-site-camera-window2.title,
+                  permissions-site-camera-desc,
+                  permissions-site-camera-disable-label,
+                  permissions-site-camera-disable-desc,
+                " />
+      </hbox>
+    </hbox>
+
+    <hbox id="microphoneSettingsRow" align="center" role="group" aria-labelledby="microphonePermissionsLabel">
+      <hbox flex="1">
+        <image class="microphone-icon permission-icon" />
+        <label id="microphonePermissionsLabel" data-l10n-id="permissions-microphone"/>
+      </hbox>
+      <hbox pack="end">
+        <button id="microphoneSettingsButton"
+                is="highlightable-button"
+                class="accessory-button"
+                data-l10n-id="permissions-microphone-settings"
+                search-l10n-ids="
+                  permissions-remove.label,
+                  permissions-remove-all.label,
+                  permissions-site-microphone-window2.title,
+                  permissions-site-microphone-desc,
+                  permissions-site-microphone-disable-label,
+                  permissions-site-microphone-disable-desc,
+                " />
+      </hbox>
+    </hbox>
+
+    <hbox id="speakerSettingsRow" align="center" role="group" aria-labelledby="speakerPermissionsLabel">
+      <hbox flex="1">
+        <image class="speaker-icon permission-icon" />
+        <label id="speakerPermissionsLabel" data-l10n-id="permissions-speaker"/>
+      </hbox>
+      <hbox pack="end">
+        <button id="speakerSettingsButton"
+                is="highlightable-button"
+                class="accessory-button"
+                data-l10n-id="permissions-speaker-settings"
+                search-l10n-ids="
+                  permissions-remove.label,
+                  permissions-remove-all.label,
+                  permissions-site-speaker-window.title,
+                  permissions-site-speaker-desc,
+                " />
+      </hbox>
+    </hbox>
+
+    <hbox id="notificationSettingsRow" align="center" role="group" aria-labelledby="notificationPermissionsLabel">
+      <hbox flex="1">
+        <image class="desktop-notification-icon permission-icon" />
+        <label id="notificationPermissionsLabel"
+               class="tail-with-learn-more"
+               data-l10n-id="permissions-notification"/>
+        <html:a is="moz-support-link"
+                id="notificationPermissionsLearnMore"
+                class="learnMore"
+                data-l10n-id="permissions-notification-link"
+                support-page="push"
+        />
+      </hbox>
+      <hbox pack="end">
+        <button id="notificationSettingsButton"
+                is="highlightable-button"
+                class="accessory-button"
+                data-l10n-id="permissions-notification-settings"
+                search-l10n-ids="
+                  permissions-remove.label,
+                  permissions-remove-all.label,
+                  permissions-site-notification-window2.title,
+                  permissions-site-notification-desc,
+                  permissions-site-notification-disable-label,
+                  permissions-site-notification-disable-desc,
+                " />
+      </hbox>
+    </hbox>
+
+    <vbox id="notificationsDoNotDisturbBox" hidden="true">
+      <checkbox id="notificationsDoNotDisturb" class="indent"/>
+    </vbox>
+
+    <hbox id="autoplaySettingsRow" align="center" role="group" aria-labelledby="autoplayPermissionsLabel">
+      <hbox flex="1">
+        <image class="autoplay-icon permission-icon" />
+        <label id="autoplayPermissionsLabel"
+               data-l10n-id="permissions-autoplay"/>
+      </hbox>
+      <hbox pack="end">
+        <button id="autoplaySettingsButton"
+                is="highlightable-button"
+                class="accessory-button"
+                data-l10n-id="permissions-autoplay-settings"
+                search-l10n-ids="
+                  permissions-remove.label,
+                  permissions-remove-all.label,
+                  permissions-site-autoplay-window2.title,
+                  permissions-site-autoplay-desc,
+                " />
+      </hbox>
+    </hbox>
+
+    <hbox id="xrSettingsRow" align="center" role="group" aria-labelledby="xrPermissionsLabel">
+      <hbox flex="1">
+        <image class="xr-icon permission-icon" />
+        <label id="xrPermissionsLabel" data-l10n-id="permissions-xr"/>
+      </hbox>
+      <hbox pack="end">
+        <button id="xrSettingsButton"
+                is="highlightable-button"
+                class="accessory-button"
+                data-l10n-id="permissions-xr-settings"
+                search-l10n-ids="
+                  permissions-remove.label,
+                  permissions-remove-all.label,
+                  permissions-site-xr-window2.title,
+                  permissions-site-xr-desc,
+                  permissions-site-xr-disable-label,
+                  permissions-site-xr-disable-desc,
+                " />
+      </hbox>
+    </hbox>
+  </vbox>
+
+  <separator />
+
+  <hbox data-subcategory="permissions-block-popups">
+    <checkbox id="popupPolicy" preference="dom.disable_open_during_load"
+              data-l10n-id="permissions-block-popups"
+              flex="1" />
+    <button id="popupPolicyButton"
+            is="highlightable-button"
+            class="accessory-button"
+            data-l10n-id="permissions-block-popups-exceptions-button"
+            data-l10n-attrs="searchkeywords"
+            search-l10n-ids="
+              permissions-address,
+              permissions-exceptions-popup-window2.title,
+              permissions-exceptions-popup-desc,
+            " />
+  </hbox>
+
+  <hbox id="addonInstallBox">
+    <checkbox id="warnAddonInstall"
+              data-l10n-id="permissions-addon-install-warning"
+              preference="xpinstall.whitelist.required"
+              flex="1" />
+    <button id="addonExceptions"
+            is="highlightable-button"
+            class="accessory-button"
+            data-l10n-id="permissions-addon-exceptions"
+            search-l10n-ids="
+              permissions-address,
+              permissions-allow.label,
+              permissions-remove.label,
+              permissions-remove-all.label,
+              permissions-exceptions-addons-window2.title,
+              permissions-exceptions-addons-desc,
+            " />
+  </hbox>
+
+</groupbox>
+
+<!-- Firefox Data Collection and Use -->
+<hbox id="dataCollectionCategory"
+      class="subcategory"
+      hidden="true"
+      data-category="panePrivacy">
+  <html:h1 data-l10n-id="collection-header2" data-l10n-attrs="searchkeywords"/>
+</hbox>
+
+<groupbox id="dataCollectionGroup" data-category="panePrivacy" hidden="true">
+  <label class="search-header" hidden="true"><html:h2 data-l10n-id="collection-header2" data-l10n-attrs="searchkeywords"/></label>
+
+  <description class="description-deemphasized">
+    <html:span class="tail-with-learn-more" data-l10n-id="collection-description"/>
+    <html:a id="dataCollectionPrivacyNotice"
+           class="learnMore"
+           data-l10n-id="collection-privacy-notice"/>
+  </description>
+#ifdef MOZ_DATA_REPORTING
+  <hbox id="telemetry-container" class="info-box-container smaller-font-size" hidden="true">
+    <hbox class="info-icon-container">
+      <html:img class="info-icon"></html:img>
+    </hbox>
+    <description>
+      <html:span id="telemetryDisabledDescription" class="tail-with-learn-more"
+                 data-l10n-id="collection-health-report-telemetry-disabled"/>
+      <html:a is="moz-support-link"
+              id="telemetryDataDeletionLearnMore"
+              class="learnMore"
+              data-l10n-id="collection-health-report-telemetry-disabled-link"/>
+    </description>
+  </hbox>
+  <vbox data-subcategory="reports">
+    <html:span flex="1">
+      <checkbox id="submitHealthReportBox"
+                data-l10n-id="collection-health-report"
+                class="tail-with-learn-more"/>
+      <html:a id="FHRLearnMore"
+             class="learnMore"
+             data-l10n-id="collection-health-report-link"/>
+      <vbox class="indent">
+        <hbox align="center">
+          <checkbox id="addonRecommendationEnabled"
+                    class="tail-with-learn-more"
+                    data-l10n-id="addon-recommendations"/>
+          <html:a is="moz-support-link"
+                  id="addonRecommendationLearnMore"
+                  class="learnMore"
+                  data-l10n-id="addon-recommendations-link"
+                  support-page="personalized-addons"
+          />
+        </hbox>
+      </vbox>
+    </html:span>
+#ifndef MOZ_TELEMETRY_REPORTING
+  <description id="TelemetryDisabledDesc"
+    class="indent tip-caption" control="telemetryGroup"
+    data-l10n-id="collection-health-report-disabled"/>
+#endif
+
+#ifdef MOZ_NORMANDY
+    <hbox align="center">
+      <checkbox id="optOutStudiesEnabled"
+                class="tail-with-learn-more"
+                data-l10n-id="collection-studies"/>
+      <html:a id="viewShieldStudies"
+              href="about:studies"
+              useoriginprincipal="true"
+              class="learnMore"
+              data-l10n-id="collection-studies-link"/>
+    </hbox>
+#endif
+
+#ifdef MOZ_CRASHREPORTER
+    <hbox align="center" class="checkbox-row">
+      <html:input type="checkbox"
+                id="automaticallySubmitCrashesBox"
+                preference="browser.crashReports.unsubmittedCheck.autoSubmit2"/>
+      <label for="automaticallySubmitCrashesBox"
+                id="crashReporterLabel"
+                data-l10n-id="collection-backlogged-crash-reports-with-link">
+        <html:a data-l10n-name="crash-reports-link" id="crashReporterLearnMore" target="_blank"/>
+      </label>
+    </hbox>
+#endif
+  </vbox>
+#endif
+  <vbox class="firefoxSuggestOptionBox" id="firefoxSuggestPrivacyContainer" hidden="true">
+    <html:moz-toggle id="firefoxSuggestDataCollectionPrivacyToggle"
+                     preference="browser.urlbar.quicksuggest.dataCollection.enabled"
+                     data-l10n-id="addressbar-firefox-suggest-data-collection"
+                     data-l10n-attrs="label, description">
+      <html:a slot="support-link"
+              is="moz-support-link"
+              id="firefoxSuggestDataCollectionLearnMorePrivacy"
+              class="learnMore firefoxSuggestLearnMore"
+              data-l10n-id="addressbar-locbar-firefox-suggest-learn-more"
+              support-page="firefox-suggest"
+      />
+    </html:moz-toggle>
+  </vbox>
+  <vbox id="privacySegmentationSection" data-subcategory="privacy-segmentation" hidden="true">
+    <label>
+      <html:h2 data-l10n-id="privacy-segmentation-section-header"/>
+    </label>
+    <label data-l10n-id="privacy-segmentation-section-description"/>
+    <radiogroup id="privacyDataFeatureRecommendationRadioGroup" preference="browser.dataFeatureRecommendations.enabled">
+        <radio id="privacyDataFeatureRecommendationEnabled"
+               data-l10n-id="privacy-segmentation-radio-off"
+               value="true"/>
+        <radio id="privacyDataFeatureRecommendationDisabled"
+               data-l10n-id="privacy-segmentation-radio-on"
+               value="false"/>
+    </radiogroup>
+  </vbox>
+</groupbox>
+
+<hbox id="securityCategory"
+      class="subcategory"
+      hidden="true"
+      data-category="panePrivacy">
+  <html:h1 data-l10n-id="security-header"/>
+</hbox>
+
+<!-- addons, forgery (phishing) UI Security -->
+<groupbox id="browsingProtectionGroup" data-category="panePrivacy" hidden="true">
+  <label><html:h2 data-l10n-id="security-browsing-protection"/></label>
+  <hbox align = "center">
+    <checkbox id="enableSafeBrowsing"
+              data-l10n-id="security-enable-safe-browsing"
+              class="tail-with-learn-more"/>
+    <html:a is="moz-support-link"
+            id="enableSafeBrowsingLearnMore"
+            class="learnMore"
+            data-l10n-id="security-enable-safe-browsing-link"
+            support-page="phishing-malware"
+    />
+  </hbox>
+  <vbox class="indent">
+    <checkbox id="blockDownloads"
+              data-l10n-id="security-block-downloads"/>
+    <checkbox id="blockUncommonUnwanted"
+              data-l10n-id="security-block-uncommon-software"/>
+  </vbox>
+</groupbox>
+
+<!-- Certificates -->
+<groupbox id="certSelection" data-category="panePrivacy" hidden="true">
+  <label><html:h2 data-l10n-id="certs-header"/></label>
+  <hbox align="start">
+    <checkbox id="enableOCSP"
+              data-l10n-id="certs-enable-ocsp"
+              preference="security.OCSP.enabled"
+              flex="1" />
+    <vbox align="end">
+      <button id="viewCertificatesButton"
+              is="highlightable-button"
+              class="accessory-button"
+              data-l10n-id="certs-view"
+              preference="security.disable_button.openCertManager"
+              search-l10n-ids="
+                certmgr-tab-mine.label,
+                certmgr-tab-people.label,
+                certmgr-tab-servers.label,
+                certmgr-tab-ca.label,
+                certmgr-mine,
+                certmgr-people,
+                certmgr-server,
+                certmgr-ca,
+                certmgr-cert-name.label,
+                certmgr-token-name.label,
+                certmgr-view.label,
+                certmgr-export.label,
+                certmgr-delete.label
+              "/>
+      <button id="viewSecurityDevicesButton"
+              is="highlightable-button"
+              class="accessory-button"
+              data-l10n-id="certs-devices"
+              preference="security.disable_button.openDeviceManager"
+              search-l10n-ids="
+                devmgr-window.title,
+                devmgr-devlist.label,
+                devmgr-header-details.label,
+                devmgr-header-value.label,
+                devmgr-button-login.label,
+                devmgr-button-logout.label,
+                devmgr-button-changepw.label,
+                devmgr-button-load.label,
+                devmgr-button-unload.label
+              "/>
+    </vbox>
+  </hbox>
+
+  <hbox id="certEnableThirdPartyToggleBox" align="center">
+    <checkbox id="certEnableThirdPartyToggle"
+              data-l10n-id="certs-thirdparty-toggle"
+              preference="security.enterprise_roots.enabled"
+              class="tail-with-learn-more"
+    />
+    <html:a is="moz-support-link"
+            class="learnMore"
+            support-page="automatically-trust-third-party-certificates"
+    />
+  </hbox>
+</groupbox>
+
+<!-- HTTPS-ONLY Mode -->
+<groupbox id="httpsOnlyBox" data-category="panePrivacy" hidden="true">
+  <label><html:h2 data-l10n-id="httpsonly-header"/></label>
+  <vbox data-subcategory="httpsonly" flex="1">
+    <description id="httpsOnlyDescription" class="description-deemphasized" data-l10n-id="httpsonly-description"/>
+    <html:a is="moz-support-link"
+            id="httpsOnlyLearnMore"
+            class="learnMore"
+            data-l10n-id="httpsonly-learn-more"
+            support-page="https-only-prefs"
+    />
+  </vbox>
+  <hbox>
+    <radiogroup flex="1" id="httpsOnlyRadioGroup">
+      <radio id="httpsOnlyRadioEnabled"
+              data-l10n-id="httpsonly-radio-enabled"
+              value="enabled"/>
+      <radio id="httpsOnlyRadioEnabledPBM"
+              data-l10n-id="httpsonly-radio-enabled-pbm"
+              value="privateOnly"/>
+      <radio id="httpsOnlyRadioDisabled"
+              data-l10n-id="httpsonly-radio-disabled"
+              value="disabled"/>
+    </radiogroup>
+    <vbox>
+      <button id="httpsOnlyExceptionButton" is="highlightable-button" class="accessory-button" disabled="true"
+        data-l10n-id="sitedata-cookies-exceptions" search-l10n-ids="
+                      permissions-address,
+                      permissions-allow.label,
+                      permissions-remove.label,
+                      permissions-remove-all.label,
+                      permissions-exceptions-https-only-desc2,
+                    " />
+    </vbox>
+  </hbox>
+</groupbox>
+
+<!-- DoH -->
+<hbox id="DoHCategory"
+      class="subcategory"
+      hidden="true"
+      data-category="panePrivacy">
+  <html:h1 data-l10n-id="preferences-doh-header"/>
+</hbox>
+
+<groupbox id="dohBox" data-category="panePrivacy" data-subcategory="doh" hidden="true" class="highlighting-group">
+  <label class="search-header" searchkeywords="doh trr" hidden="true"><html:h2 data-l10n-id="preferences-doh-header"/></label>
+  <vbox flex="1">
+    <description id="dohDescription" class="tail-with-learn-more description-deemphasized" data-l10n-id="preferences-doh-description2"></description>
+    <html:a is="moz-support-link"
+            id="dohLearnMore"
+            class="learnMore"
+            support-page="dns-over-https"
+    />
+  </vbox>
+  <vbox id="dohStatusSection" class="privacy-detailedoption info-box-container">
+    <hbox>
+      <label id="dohStatus" class="doh-status-label tail-with-learn-more"/>
+      <html:a is="moz-support-link"
+            id="dohStatusLearnMore"
+            class="learnMore"
+            support-page="doh-status"
+            hidden="true"/>
+    </hbox>
+    <label class="doh-status-label" id="dohResolver"/>
+    <label class="doh-status-label" id="dohSteeringStatus" data-l10n-id="preferences-doh-steering-status" hidden="true"/>
+  </vbox>
+  <hbox id="dohExceptionBox">
+    <label flex="1" data-l10n-id="preferences-doh-exceptions-description"/>
+    <button id="dohExceptionsButton"
+            is="highlightable-button"
+            class="accessory-button"
+            data-l10n-id="preferences-doh-manage-exceptions"
+            search-l10n-ids="
+              permissions-doh-entry-field,
+              permissions-doh-add-exception.label,
+              permissions-doh-remove.label,
+              permissions-doh-remove-all.label,
+              permissions-exceptions-doh-window.title,
+              permissions-exceptions-manage-doh-desc,
+            "/>
+  </hbox>
+  <vbox>
+    <label><html:h2 id="dohGroupMessage" data-l10n-id="preferences-doh-group-message2"/></label>
+    <vbox id="dohCategories">
+      <radiogroup id="dohCategoryRadioGroup"
+                  preference="network.trr.mode" aria-labelledby="dohGroupMessage">
+        <vbox id="dohOptionDefault" class="privacy-detailedoption info-box-container">
+          <hbox>
+            <radio id="dohDefaultRadio"
+                   value="0"
+                   data-l10n-id="preferences-doh-setting-default"
+                   flex="1"/>
+            <button id="dohDefaultArrow"
+                    is="highlightable-button"
+                    class="arrowhead doh-expand-section"
+                    data-l10n-id="preferences-doh-expand-section"
+                    aria-expanded="false"/>
+          </hbox>
+          <vbox class="indent">
+            <label data-l10n-id="preferences-doh-default-desc"></label>
+            <vbox class="privacy-extra-information">
+              <vbox class="indent">
+                <hbox class="extra-information-label">
+                  <label class="doh-label" data-l10n-id="preferences-doh-default-detailed-desc-1"/>
+                </hbox>
+                <hbox class="extra-information-label">
+                  <label class="doh-label" data-l10n-id="preferences-doh-default-detailed-desc-2"/>
+                </hbox>
+                <hbox class="extra-information-label">
+                  <label class="doh-label tail-with-learn-more" data-l10n-id="preferences-doh-default-detailed-desc-3"/>
+                  <html:a is="moz-support-link"
+                          id="default-desc-3-learn-more"
+                          class="learnMore"
+                          support-page="doh-local-provider"
+                  />
+                </hbox>
+                <hbox class="extra-information-label">
+                  <label class="doh-label" data-l10n-id="preferences-doh-default-detailed-desc-4"/>
+                </hbox>
+                <hbox class="extra-information-label">
+                  <label class="doh-label tail-with-learn-more" data-l10n-id="preferences-doh-default-detailed-desc-5"/>
+                  <html:a is="moz-support-link"
+                          id="default-desc-5-learn-more"
+                          class="learnMore"
+                          support-page="firefox-turn-off-secure-dns"
+                  />
+                </hbox>
+              </vbox>
+              <hbox id="dohWarningBox1" class="extra-information-label" hidden="true">
+                <checkbox id="dohWarnCheckbox1"
+                          flex="1"
+                          data-l10n-id="preferences-doh-checkbox-warn"
+                          preference="network.trr.display_fallback_warning"/>
+              </hbox>
+            </vbox>
+          </vbox>
+        </vbox>
+        <vbox id="dohOptionEnabled" class="privacy-detailedoption info-box-container">
+          <hbox>
+            <radio id="dohEnabledRadio"
+                   value="2"
+                   data-l10n-id="preferences-doh-setting-enabled"
+                   flex="1"/>
+            <button id="dohEnabledArrow"
+                    is="highlightable-button"
+                    class="arrowhead doh-expand-section"
+                    data-l10n-id="preferences-doh-expand-section"
+                    aria-expanded="false"/>
+          </hbox>
+          <vbox class="indent">
+            <label data-l10n-id="preferences-doh-enabled-desc"></label>
+            <vbox class="privacy-extra-information">
+              <vbox class="indent">
+                <hbox class="extra-information-label">
+                  <label class="doh-label" data-l10n-id="preferences-doh-enabled-detailed-desc-1"/>
+                </hbox>
+                <hbox class="extra-information-label">
+                  <label class="doh-label" data-l10n-id="preferences-doh-enabled-detailed-desc-2"/>
+                </hbox>
+              </vbox>
+              <hbox id="dohWarningBox2" class="extra-information-label" hidden="true">
+                <checkbox id="dohWarnCheckbox2"
+                          flex="1"
+                          data-l10n-id="preferences-doh-checkbox-warn"
+                          preference="network.trr.display_fallback_warning"/>
+              </hbox>
+              <vbox class="extra-information-label">
+                <label data-l10n-id="preferences-doh-select-resolver"/>
+                <menulist id="dohEnabledResolverChoices"
+                          sizetopopup="none">
+                </menulist>
+                <html:input id="dohEnabledInputField" type="text" style="flex: 1;"
+                    preference="network.trr.custom_uri" hidden="true"/>
+              </vbox>
+            </vbox>
+          </vbox>
+        </vbox>
+        <vbox id="dohOptionStrict" class="privacy-detailedoption info-box-container">
+          <hbox>
+            <radio id="dohStrictRadio"
+                   value="3"
+                   data-l10n-id="preferences-doh-setting-strict"
+                   flex="1"/>
+            <button id="dohStrictArrow"
+                    is="highlightable-button"
+                    class="arrowhead doh-expand-section"
+                    data-l10n-id="preferences-doh-expand-section"
+                    aria-expanded="false"/>
+          </hbox>
+          <vbox class="indent">
+            <label data-l10n-id="preferences-doh-strict-desc"></label>
+            <vbox class="privacy-extra-information">
+              <vbox class="indent">
+                <hbox class="extra-information-label">
+                  <label class="doh-label" data-l10n-id="preferences-doh-strict-detailed-desc-1"/>
+                </hbox>
+                <hbox class="extra-information-label">
+                  <label class="doh-label" data-l10n-id="preferences-doh-strict-detailed-desc-2"/>
+                </hbox>
+                <hbox class="extra-information-label">
+                  <label class="doh-label" data-l10n-id="preferences-doh-strict-detailed-desc-3"/>
+                </hbox>
+              </vbox>
+              <vbox class="extra-information-label">
+                <label data-l10n-id="preferences-doh-select-resolver"/>
+                <menulist id="dohStrictResolverChoices"
+                          sizetopopup="none">
+                </menulist>
+                <html:input id="dohStrictInputField" type="text" style="flex: 1;"
+                    preference="network.trr.custom_uri" hidden="true"/>
+              </vbox>
+            </vbox>
+          </vbox>
+        </vbox>
+        <vbox id="dohOptionOff" class="privacy-detailedoption info-box-container">
+          <hbox>
+            <radio id="dohOffRadio"
+                   value="5"
+                   data-l10n-id="preferences-doh-setting-off"
+                   flex="1"/>
+          </hbox>
+          <vbox class="indent">
+            <label data-l10n-id="preferences-doh-off-desc"></label>
+          </vbox>
+        </vbox>
+      </radiogroup>
+    </vbox>
+  </vbox>
+</groupbox>
+
+</html:template>
diff --git a/browser/components/preferences/privacy.js b/browser/components/preferences/privacy.js
new file mode 100644
index 0000000000..178bc560c7
--- /dev/null
+++ b/browser/components/preferences/privacy.js
@@ -0,0 +1,3385 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this file,
+ * You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+/* import-globals-from extensionControlled.js */
+/* import-globals-from preferences.js */
+
+const PREF_UPLOAD_ENABLED = "datareporting.healthreport.uploadEnabled";
+
+const TRACKING_PROTECTION_KEY = "websites.trackingProtectionMode";
+const TRACKING_PROTECTION_PREFS = [
+  "privacy.trackingprotection.enabled",
+  "privacy.trackingprotection.pbmode.enabled",
+];
+const CONTENT_BLOCKING_PREFS = [
+  "privacy.trackingprotection.enabled",
+  "privacy.trackingprotection.pbmode.enabled",
+  "network.cookie.cookieBehavior",
+  "privacy.trackingprotection.fingerprinting.enabled",
+  "privacy.trackingprotection.cryptomining.enabled",
+  "privacy.firstparty.isolate",
+  "privacy.trackingprotection.emailtracking.enabled",
+  "privacy.trackingprotection.emailtracking.pbmode.enabled",
+  "privacy.fingerprintingProtection",
+  "privacy.fingerprintingProtection.pbmode",
+];
+
+/*
+ * Prefs that are unique to sanitizeOnShutdown and are not shared
+ * with the deleteOnClose mechanism like privacy.clearOnShutdown.cookies, -cache and -offlineApps
+ */
+const SANITIZE_ON_SHUTDOWN_PREFS_ONLY = [
+  "privacy.clearOnShutdown.history",
+  "privacy.clearOnShutdown.downloads",
+  "privacy.clearOnShutdown.sessions",
+  "privacy.clearOnShutdown.formdata",
+  "privacy.clearOnShutdown.siteSettings",
+];
+
+const PREF_OPT_OUT_STUDIES_ENABLED = "app.shield.optoutstudies.enabled";
+const PREF_NORMANDY_ENABLED = "app.normandy.enabled";
+
+const PREF_ADDON_RECOMMENDATIONS_ENABLED = "browser.discovery.enabled";
+
+const PREF_PASSWORD_GENERATION_AVAILABLE = "signon.generation.available";
+const { BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN } = Ci.nsICookieService;
+
+const PASSWORD_MANAGER_PREF_ID = "services.passwordSavingEnabled";
+
+ChromeUtils.defineLazyGetter(this, "AlertsServiceDND", function () {
+  try {
+    let alertsService = Cc["@mozilla.org/alerts-service;1"]
+      .getService(Ci.nsIAlertsService)
+      .QueryInterface(Ci.nsIAlertsDoNotDisturb);
+    // This will throw if manualDoNotDisturb isn't implemented.
+    alertsService.manualDoNotDisturb;
+    return alertsService;
+  } catch (ex) {
+    return undefined;
+  }
+});
+
+XPCOMUtils.defineLazyPreferenceGetter(
+  this,
+  "OS_AUTH_ENABLED",
+  "signon.management.page.os-auth.enabled",
+  true
+);
+
+XPCOMUtils.defineLazyPreferenceGetter(
+  this,
+  "gIsFirstPartyIsolated",
+  "privacy.firstparty.isolate",
+  false
+);
+
+XPCOMUtils.defineLazyPreferenceGetter(
+  this,
+  "useOldClearHistoryDialog",
+  "privacy.sanitize.useOldClearHistoryDialog",
+  false
+);
+
+ChromeUtils.defineESModuleGetters(this, {
+  DoHConfigController: "resource:///modules/DoHConfig.sys.mjs",
+});
+
+Preferences.addAll([
+  // Content blocking / Tracking Protection
+  { id: "privacy.trackingprotection.enabled", type: "bool" },
+  { id: "privacy.trackingprotection.pbmode.enabled", type: "bool" },
+  { id: "privacy.trackingprotection.fingerprinting.enabled", type: "bool" },
+  { id: "privacy.trackingprotection.cryptomining.enabled", type: "bool" },
+  { id: "privacy.trackingprotection.emailtracking.enabled", type: "bool" },
+  {
+    id: "privacy.trackingprotection.emailtracking.pbmode.enabled",
+    type: "bool",
+  },
+
+  // Fingerprinting Protection
+  { id: "privacy.fingerprintingProtection", type: "bool" },
+  { id: "privacy.fingerprintingProtection.pbmode", type: "bool" },
+
+  // Resist Fingerprinting
+  { id: "privacy.resistFingerprinting", type: "bool" },
+  { id: "privacy.resistFingerprinting.pbmode", type: "bool" },
+
+  // Social tracking
+  { id: "privacy.trackingprotection.socialtracking.enabled", type: "bool" },
+  { id: "privacy.socialtracking.block_cookies.enabled", type: "bool" },
+
+  // Tracker list
+  { id: "urlclassifier.trackingTable", type: "string" },
+
+  // Button prefs
+  { id: "pref.privacy.disable_button.cookie_exceptions", type: "bool" },
+  {
+    id: "pref.privacy.disable_button.tracking_protection_exceptions",
+    type: "bool",
+  },
+
+  // Location Bar
+  { id: "browser.urlbar.suggest.bookmark", type: "bool" },
+  { id: "browser.urlbar.suggest.clipboard", type: "bool" },
+  { id: "browser.urlbar.suggest.history", type: "bool" },
+  { id: "browser.urlbar.suggest.openpage", type: "bool" },
+  { id: "browser.urlbar.suggest.topsites", type: "bool" },
+  { id: "browser.urlbar.suggest.engines", type: "bool" },
+  { id: "browser.urlbar.suggest.quicksuggest.nonsponsored", type: "bool" },
+  { id: "browser.urlbar.suggest.quicksuggest.sponsored", type: "bool" },
+  { id: "browser.urlbar.quicksuggest.dataCollection.enabled", type: "bool" },
+  { id: PREF_URLBAR_QUICKSUGGEST_BLOCKLIST, type: "string" },
+  { id: PREF_URLBAR_WEATHER_USER_ENABLED, type: "bool" },
+
+  // History
+  { id: "places.history.enabled", type: "bool" },
+  { id: "browser.formfill.enable", type: "bool" },
+  { id: "privacy.history.custom", type: "bool" },
+
+  // Cookies
+  { id: "network.cookie.cookieBehavior", type: "int" },
+  { id: "network.cookie.blockFutureCookies", type: "bool" },
+  // Content blocking category
+  { id: "browser.contentblocking.category", type: "string" },
+  { id: "browser.contentblocking.features.strict", type: "string" },
+
+  // Clear Private Data
+  { id: "privacy.sanitize.sanitizeOnShutdown", type: "bool" },
+  { id: "privacy.sanitize.timeSpan", type: "int" },
+  { id: "privacy.clearOnShutdown.cookies", type: "bool" },
+  { id: "privacy.clearOnShutdown.cache", type: "bool" },
+  { id: "privacy.clearOnShutdown.offlineApps", type: "bool" },
+  { id: "privacy.clearOnShutdown.history", type: "bool" },
+  { id: "privacy.clearOnShutdown.downloads", type: "bool" },
+  { id: "privacy.clearOnShutdown.sessions", type: "bool" },
+  { id: "privacy.clearOnShutdown.formdata", type: "bool" },
+  { id: "privacy.clearOnShutdown.siteSettings", type: "bool" },
+
+  // Do not track
+  { id: "privacy.donottrackheader.enabled", type: "bool" },
+
+  // Global Privacy Control
+  { id: "privacy.globalprivacycontrol.enabled", type: "bool" },
+
+  // Media
+  { id: "media.autoplay.default", type: "int" },
+
+  // Popups
+  { id: "dom.disable_open_during_load", type: "bool" },
+  // Passwords
+  { id: "signon.rememberSignons", type: "bool" },
+  { id: "signon.generation.enabled", type: "bool" },
+  { id: "signon.autofillForms", type: "bool" },
+  { id: "signon.management.page.breach-alerts.enabled", type: "bool" },
+  { id: "signon.firefoxRelay.feature", type: "string" },
+
+  // Buttons
+  { id: "pref.privacy.disable_button.view_passwords", type: "bool" },
+  { id: "pref.privacy.disable_button.view_passwords_exceptions", type: "bool" },
+
+  /* Certificates tab
+   * security.default_personal_cert
+   *   - a string:
+   *       "Select Automatically"   select a certificate automatically when a site
+   *                                requests one
+   *       "Ask Every Time"         present a dialog to the user so he can select
+   *                                the certificate to use on a site which
+   *                                requests one
+   */
+  { id: "security.default_personal_cert", type: "string" },
+
+  { id: "security.disable_button.openCertManager", type: "bool" },
+
+  { id: "security.disable_button.openDeviceManager", type: "bool" },
+
+  { id: "security.OCSP.enabled", type: "int" },
+
+  { id: "security.enterprise_roots.enabled", type: "bool" },
+
+  // Add-ons, malware, phishing
+  { id: "xpinstall.whitelist.required", type: "bool" },
+
+  { id: "browser.safebrowsing.malware.enabled", type: "bool" },
+  { id: "browser.safebrowsing.phishing.enabled", type: "bool" },
+
+  { id: "browser.safebrowsing.downloads.enabled", type: "bool" },
+
+  { id: "urlclassifier.malwareTable", type: "string" },
+
+  {
+    id: "browser.safebrowsing.downloads.remote.block_potentially_unwanted",
+    type: "bool",
+  },
+  { id: "browser.safebrowsing.downloads.remote.block_uncommon", type: "bool" },
+
+  // First-Party Isolation
+  { id: "privacy.firstparty.isolate", type: "bool" },
+
+  // HTTPS-Only
+  { id: "dom.security.https_only_mode", type: "bool" },
+  { id: "dom.security.https_only_mode_pbm", type: "bool" },
+  { id: "dom.security.https_first", type: "bool" },
+  { id: "dom.security.https_first_pbm", type: "bool" },
+
+  // Windows SSO
+  { id: "network.http.windows-sso.enabled", type: "bool" },
+
+  // Quick Actions
+  { id: "browser.urlbar.quickactions.showPrefs", type: "bool" },
+  { id: "browser.urlbar.suggest.quickactions", type: "bool" },
+
+  // Cookie Banner Handling
+  { id: "cookiebanners.ui.desktop.enabled", type: "bool" },
+  { id: "cookiebanners.service.mode.privateBrowsing", type: "int" },
+
+  // DoH
+  { id: "network.trr.mode", type: "int" },
+  { id: "network.trr.uri", type: "string" },
+  { id: "network.trr.default_provider_uri", type: "string" },
+  { id: "network.trr.custom_uri", type: "string" },
+  { id: "network.trr_ui.show_fallback_warning_option", type: "bool" },
+  { id: "network.trr.display_fallback_warning", type: "bool" },
+  { id: "doh-rollout.disable-heuristics", type: "bool" },
+]);
+
+// Study opt out
+if (AppConstants.MOZ_DATA_REPORTING) {
+  Preferences.addAll([
+    // Preference instances for prefs that we need to monitor while the page is open.
+    { id: PREF_OPT_OUT_STUDIES_ENABLED, type: "bool" },
+    { id: PREF_ADDON_RECOMMENDATIONS_ENABLED, type: "bool" },
+    { id: PREF_UPLOAD_ENABLED, type: "bool" },
+  ]);
+}
+// Privacy segmentation section
+Preferences.add({
+  id: "browser.dataFeatureRecommendations.enabled",
+  type: "bool",
+});
+
+// Data Choices tab
+if (AppConstants.MOZ_CRASHREPORTER) {
+  Preferences.add({
+    id: "browser.crashReports.unsubmittedCheck.autoSubmit2",
+    type: "bool",
+  });
+}
+
+function setEventListener(aId, aEventType, aCallback) {
+  document
+    .getElementById(aId)
+    .addEventListener(aEventType, aCallback.bind(gPrivacyPane));
+}
+
+function setSyncFromPrefListener(aId, aCallback) {
+  Preferences.addSyncFromPrefListener(document.getElementById(aId), aCallback);
+}
+
+function setSyncToPrefListener(aId, aCallback) {
+  Preferences.addSyncToPrefListener(document.getElementById(aId), aCallback);
+}
+
+function dataCollectionCheckboxHandler({
+  checkbox,
+  pref,
+  matchPref = () => true,
+  isDisabled = () => false,
+}) {
+  function updateCheckbox() {
+    let collectionEnabled = Services.prefs.getBoolPref(
+      PREF_UPLOAD_ENABLED,
+      false
+    );
+
+    if (collectionEnabled && matchPref()) {
+      if (Services.prefs.getBoolPref(pref, false)) {
+        checkbox.setAttribute("checked", "true");
+      } else {
+        checkbox.removeAttribute("checked");
+      }
+      checkbox.setAttribute("preference", pref);
+    } else {
+      checkbox.removeAttribute("preference");
+      checkbox.removeAttribute("checked");
+    }
+
+    checkbox.disabled =
+      !collectionEnabled || Services.prefs.prefIsLocked(pref) || isDisabled();
+  }
+
+  Preferences.get(PREF_UPLOAD_ENABLED).on("change", updateCheckbox);
+  updateCheckbox();
+}
+
+// Sets the "Learn how" SUMO link in the Strict/Custom options of Content Blocking.
+function setUpContentBlockingWarnings() {
+  document.getElementById("fpiIncompatibilityWarning").hidden =
+    !gIsFirstPartyIsolated;
+
+  document.getElementById("rfpIncompatibilityWarning").hidden =
+    !Preferences.get("privacy.resistFingerprinting").value &&
+    !Preferences.get("privacy.resistFingerprinting.pbmode").value;
+}
+
+function initTCPStandardSection() {
+  let cookieBehaviorPref = Preferences.get("network.cookie.cookieBehavior");
+  let updateTCPSectionVisibilityState = () => {
+    document.getElementById("etpStandardTCPBox").hidden =
+      cookieBehaviorPref.value !=
+      Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN;
+  };
+
+  cookieBehaviorPref.on("change", updateTCPSectionVisibilityState);
+
+  updateTCPSectionVisibilityState();
+}
+
+var gPrivacyPane = {
+  _pane: null,
+
+  /**
+   * Whether the prompt to restart Firefox should appear when changing the autostart pref.
+   */
+  _shouldPromptForRestart: true,
+
+  /**
+   * Update the tracking protection UI to deal with extension control.
+   */
+  _updateTrackingProtectionUI() {
+    let cBPrefisLocked = CONTENT_BLOCKING_PREFS.some(pref =>
+      Services.prefs.prefIsLocked(pref)
+    );
+    let tPPrefisLocked = TRACKING_PROTECTION_PREFS.some(pref =>
+      Services.prefs.prefIsLocked(pref)
+    );
+
+    function setInputsDisabledState(isControlled) {
+      let tpDisabled = tPPrefisLocked || isControlled;
+      let disabled = cBPrefisLocked || isControlled;
+      let tpCheckbox = document.getElementById(
+        "contentBlockingTrackingProtectionCheckbox"
+      );
+      // Only enable the TP menu if Detect All Trackers is enabled.
+      document.getElementById("trackingProtectionMenu").disabled =
+        tpDisabled || !tpCheckbox.checked;
+      tpCheckbox.disabled = tpDisabled;
+
+      document.getElementById("standardRadio").disabled = disabled;
+      document.getElementById("strictRadio").disabled = disabled;
+      document
+        .getElementById("contentBlockingOptionStrict")
+        .classList.toggle("disabled", disabled);
+      document
+        .getElementById("contentBlockingOptionStandard")
+        .classList.toggle("disabled", disabled);
+      let arrowButtons = document.querySelectorAll("button.arrowhead");
+      for (let button of arrowButtons) {
+        button.disabled = disabled;
+      }
+
+      // Notify observers that the TP UI has been updated.
+      // This is needed since our tests need to be notified about the
+      // trackingProtectionMenu element getting disabled/enabled at the right time.
+      Services.obs.notifyObservers(window, "privacy-pane-tp-ui-updated");
+    }
+
+    let policy = Services.policies.getActivePolicies();
+    if (
+      policy &&
+      ((policy.EnableTrackingProtection &&
+        policy.EnableTrackingProtection.Locked) ||
+        (policy.Cookies && policy.Cookies.Locked))
+    ) {
+      setInputsDisabledState(true);
+    }
+    if (tPPrefisLocked) {
+      // An extension can't control this setting if either pref is locked.
+      hideControllingExtension(TRACKING_PROTECTION_KEY);
+      setInputsDisabledState(false);
+    } else {
+      handleControllingExtension(
+        PREF_SETTING_TYPE,
+        TRACKING_PROTECTION_KEY
+      ).then(setInputsDisabledState);
+    }
+  },
+
+  /**
+   * Hide the "Change Block List" link for trackers/tracking content in the
+   * custom Content Blocking/ETP panel. By default, it will not be visible.
+   */
+  _showCustomBlockList() {
+    let prefValue = Services.prefs.getBoolPref(
+      "browser.contentblocking.customBlockList.preferences.ui.enabled"
+    );
+    if (!prefValue) {
+      document.getElementById("changeBlockListLink").style.display = "none";
+    } else {
+      setEventListener("changeBlockListLink", "click", this.showBlockLists);
+    }
+  },
+
+  /**
+   * Set up handlers for showing and hiding controlling extension info
+   * for tracking protection.
+   */
+  _initTrackingProtectionExtensionControl() {
+    setEventListener(
+      "contentBlockingDisableTrackingProtectionExtension",
+      "command",
+      makeDisableControllingExtension(
+        PREF_SETTING_TYPE,
+        TRACKING_PROTECTION_KEY
+      )
+    );
+
+    let trackingProtectionObserver = {
+      observe(subject, topic, data) {
+        gPrivacyPane._updateTrackingProtectionUI();
+      },
+    };
+
+    for (let pref of TRACKING_PROTECTION_PREFS) {
+      Services.prefs.addObserver(pref, trackingProtectionObserver);
+    }
+    window.addEventListener("unload", () => {
+      for (let pref of TRACKING_PROTECTION_PREFS) {
+        Services.prefs.removeObserver(pref, trackingProtectionObserver);
+      }
+    });
+  },
+
+  _initThirdPartyCertsToggle() {
+    // Third-party certificate import is only implemented for Windows and Mac,
+    // and we should not expose this as a user-configurable setting if there's
+    // an enterprise policy controlling it (either to enable _or_ disable it).
+    let canConfigureThirdPartyCerts =
+      (AppConstants.platform == "win" || AppConstants.platform == "macosx") &&
+      typeof Services.policies.getActivePolicies()?.Certificates
+        ?.ImportEnterpriseRoots == "undefined";
+
+    document.getElementById("certEnableThirdPartyToggleBox").hidden =
+      !canConfigureThirdPartyCerts;
+  },
+
+  syncFromHttpsOnlyPref() {
+    let httpsOnlyOnPref = Services.prefs.getBoolPref(
+      "dom.security.https_only_mode"
+    );
+    let httpsOnlyOnPBMPref = Services.prefs.getBoolPref(
+      "dom.security.https_only_mode_pbm"
+    );
+    let httpsFirstOnPref = Services.prefs.getBoolPref(
+      "dom.security.https_first"
+    );
+    let httpsFirstOnPBMPref = Services.prefs.getBoolPref(
+      "dom.security.https_first_pbm"
+    );
+    let httpsOnlyRadioGroup = document.getElementById("httpsOnlyRadioGroup");
+    let httpsOnlyExceptionButton = document.getElementById(
+      "httpsOnlyExceptionButton"
+    );
+
+    if (httpsOnlyOnPref) {
+      httpsOnlyRadioGroup.value = "enabled";
+    } else if (httpsOnlyOnPBMPref) {
+      httpsOnlyRadioGroup.value = "privateOnly";
+    } else {
+      httpsOnlyRadioGroup.value = "disabled";
+    }
+
+    httpsOnlyExceptionButton.disabled =
+      !httpsOnlyOnPref &&
+      !httpsFirstOnPref &&
+      !httpsOnlyOnPBMPref &&
+      !httpsFirstOnPBMPref;
+
+    if (
+      Services.prefs.prefIsLocked("dom.security.https_only_mode") ||
+      Services.prefs.prefIsLocked("dom.security.https_only_mode_pbm")
+    ) {
+      httpsOnlyRadioGroup.disabled = true;
+    }
+  },
+
+  syncToHttpsOnlyPref() {
+    let value = document.getElementById("httpsOnlyRadioGroup").value;
+    Services.prefs.setBoolPref(
+      "dom.security.https_only_mode_pbm",
+      value == "privateOnly"
+    );
+    Services.prefs.setBoolPref(
+      "dom.security.https_only_mode",
+      value == "enabled"
+    );
+  },
+
+  /**
+   * Init HTTPS-Only mode and corresponding prefs
+   */
+  initHttpsOnly() {
+    // Set radio-value based on the pref value
+    this.syncFromHttpsOnlyPref();
+
+    // Create event listener for when the user clicks
+    // on one of the radio buttons
+    setEventListener(
+      "httpsOnlyRadioGroup",
+      "command",
+      this.syncToHttpsOnlyPref
+    );
+    // Update radio-value when the pref changes
+    Preferences.get("dom.security.https_only_mode").on("change", () =>
+      this.syncFromHttpsOnlyPref()
+    );
+    Preferences.get("dom.security.https_only_mode_pbm").on("change", () =>
+      this.syncFromHttpsOnlyPref()
+    );
+    Preferences.get("dom.security.https_first").on("change", () =>
+      this.syncFromHttpsOnlyPref()
+    );
+    Preferences.get("dom.security.https_first_pbm").on("change", () =>
+      this.syncFromHttpsOnlyPref()
+    );
+  },
+
+  get dnsOverHttpsResolvers() {
+    let providers = DoHConfigController.currentConfig.providerList;
+    // if there's no default, we'll hold its position with an empty string
+    let defaultURI = DoHConfigController.currentConfig.fallbackProviderURI;
+    let defaultIndex = providers.findIndex(p => p.uri == defaultURI);
+    if (defaultIndex == -1 && defaultURI) {
+      // the default value for the pref isn't included in the resolvers list
+      // so we'll make a stub for it. Without an id, we'll have to use the url as the label
+      providers.unshift({ uri: defaultURI });
+    }
+    return providers;
+  },
+
+  updateDoHResolverList(mode) {
+    let resolvers = this.dnsOverHttpsResolvers;
+    let currentURI = Preferences.get("network.trr.uri").value;
+    if (!currentURI) {
+      currentURI = Preferences.get("network.trr.default_provider_uri").value;
+    }
+    let menu = document.getElementById(`${mode}ResolverChoices`);
+
+    let selectedIndex = currentURI
+      ? resolvers.findIndex(r => r.uri == currentURI)
+      : 0;
+    if (selectedIndex == -1) {
+      // select the last "Custom" item
+      selectedIndex = menu.itemCount - 1;
+    }
+    menu.selectedIndex = selectedIndex;
+
+    let customInput = document.getElementById(`${mode}InputField`);
+    customInput.hidden = menu.value != "custom";
+  },
+
+  populateDoHResolverList(mode) {
+    let resolvers = this.dnsOverHttpsResolvers;
+    let defaultURI = DoHConfigController.currentConfig.fallbackProviderURI;
+    let menu = document.getElementById(`${mode}ResolverChoices`);
+
+    // populate the DNS-Over-HTTPS resolver list
+    menu.removeAllItems();
+    for (let resolver of resolvers) {
+      let item = menu.appendItem(undefined, resolver.uri);
+      if (resolver.uri == defaultURI) {
+        document.l10n.setAttributes(
+          item,
+          "connection-dns-over-https-url-item-default",
+          {
+            name: resolver.UIName || resolver.uri,
+          }
+        );
+      } else {
+        item.label = resolver.UIName || resolver.uri;
+      }
+    }
+    let lastItem = menu.appendItem(undefined, "custom");
+    document.l10n.setAttributes(
+      lastItem,
+      "connection-dns-over-https-url-custom"
+    );
+
+    // set initial selection in the resolver provider picker
+    this.updateDoHResolverList(mode);
+
+    let customInput = document.getElementById(`${mode}InputField`);
+
+    function updateURIPref() {
+      if (customInput.value == "") {
+        // Setting the pref to empty string will make it have the default
+        // pref value which makes us fallback to using the default TRR
+        // resolver in network.trr.default_provider_uri.
+        // If the input is empty we set it to "(space)" which is essentially
+        // the same.
+        Services.prefs.setStringPref("network.trr.uri", " ");
+      } else {
+        Services.prefs.setStringPref("network.trr.uri", customInput.value);
+      }
+    }
+
+    menu.addEventListener("command", () => {
+      if (menu.value == "custom") {
+        customInput.hidden = false;
+        updateURIPref();
+      } else {
+        customInput.hidden = true;
+        Services.prefs.setStringPref("network.trr.uri", menu.value);
+      }
+      Services.telemetry.recordEvent(
+        "security.doh.settings",
+        "provider_choice",
+        "value",
+        menu.value
+      );
+
+      // Update other menu too.
+      let otherMode = mode == "dohEnabled" ? "dohStrict" : "dohEnabled";
+      let otherMenu = document.getElementById(`${otherMode}ResolverChoices`);
+      let otherInput = document.getElementById(`${otherMode}InputField`);
+      otherMenu.value = menu.value;
+      otherInput.hidden = otherMenu.value != "custom";
+    });
+
+    // Change the URL when you press ENTER in the input field it or loses focus
+    customInput.addEventListener("change", () => {
+      updateURIPref();
+    });
+  },
+
+  async updateDoHStatus() {
+    let trrURI = Services.dns.currentTrrURI;
+    let hostname = "";
+    try {
+      hostname = new URL(trrURI).hostname;
+    } catch (e) {
+      hostname = await document.l10n.formatValue("preferences-doh-bad-url");
+    }
+
+    let steering = document.getElementById("dohSteeringStatus");
+    steering.hidden = true;
+
+    let dohResolver = document.getElementById("dohResolver");
+    dohResolver.hidden = true;
+
+    let status = document.getElementById("dohStatus");
+
+    async function setStatus(localizedStringName, options) {
+      let opts = options || {};
+      let statusString = await document.l10n.formatValue(
+        localizedStringName,
+        opts
+      );
+      document.l10n.setAttributes(status, "preferences-doh-status", {
+        status: statusString,
+      });
+    }
+
+    function computeStatus() {
+      let mode = Services.dns.currentTrrMode;
+      let confirmationState = Services.dns.currentTrrConfirmationState;
+      if (
+        mode == Ci.nsIDNSService.MODE_TRRFIRST ||
+        mode == Ci.nsIDNSService.MODE_TRRONLY
+      ) {
+        switch (confirmationState) {
+          case Ci.nsIDNSService.CONFIRM_TRYING_OK:
+          case Ci.nsIDNSService.CONFIRM_OK:
+          case Ci.nsIDNSService.CONFIRM_DISABLED:
+            return "preferences-doh-status-active";
+          default:
+            return "preferences-doh-status-not-active";
+        }
+      }
+
+      return "preferences-doh-status-disabled";
+    }
+
+    let errReason = "";
+    let confirmationStatus = Services.dns.lastConfirmationStatus;
+    if (confirmationStatus != Cr.NS_OK) {
+      errReason = ChromeUtils.getXPCOMErrorName(confirmationStatus);
+    } else {
+      errReason = Services.dns.getTRRSkipReasonName(
+        Services.dns.lastConfirmationSkipReason
+      );
+    }
+    let statusLabel = computeStatus();
+    // setStatus will format and set the statusLabel asynchronously.
+    setStatus(statusLabel, { reason: errReason });
+    dohResolver.hidden = statusLabel == "preferences-doh-status-disabled";
+
+    let statusLearnMore = document.getElementById("dohStatusLearnMore");
+    statusLearnMore.hidden = statusLabel != "preferences-doh-status-not-active";
+
+    // No need to set the resolver name since we're not going to show it.
+    if (statusLabel == "preferences-doh-status-disabled") {
+      return;
+    }
+
+    function nameOrDomain() {
+      for (let resolver of DoHConfigController.currentConfig.providerList) {
+        if (resolver.uri == trrURI) {
+          return resolver.UIName || hostname || trrURI;
+        }
+      }
+
+      // Also check if this is a steering provider.
+      for (let resolver of DoHConfigController.currentConfig.providerSteering
+        .providerList) {
+        if (resolver.uri == trrURI) {
+          steering.hidden = false;
+          return resolver.UIName || hostname || trrURI;
+        }
+      }
+
+      return hostname;
+    }
+
+    let resolverNameOrDomain = nameOrDomain();
+    document.l10n.setAttributes(dohResolver, "preferences-doh-resolver", {
+      name: resolverNameOrDomain,
+    });
+  },
+
+  highlightDoHCategoryAndUpdateStatus() {
+    let value = Preferences.get("network.trr.mode").value;
+    let defaultOption = document.getElementById("dohOptionDefault");
+    let enabledOption = document.getElementById("dohOptionEnabled");
+    let strictOption = document.getElementById("dohOptionStrict");
+    let offOption = document.getElementById("dohOptionOff");
+    defaultOption.classList.remove("selected");
+    enabledOption.classList.remove("selected");
+    strictOption.classList.remove("selected");
+    offOption.classList.remove("selected");
+
+    switch (value) {
+      case Ci.nsIDNSService.MODE_NATIVEONLY:
+        defaultOption.classList.add("selected");
+        break;
+      case Ci.nsIDNSService.MODE_TRRFIRST:
+        enabledOption.classList.add("selected");
+        break;
+      case Ci.nsIDNSService.MODE_TRRONLY:
+        strictOption.classList.add("selected");
+        break;
+      case Ci.nsIDNSService.MODE_TRROFF:
+        offOption.classList.add("selected");
+        break;
+      default:
+        // The pref is set to a random value.
+        // This shouldn't happen, but let's make sure off is selected.
+        offOption.classList.add("selected");
+        document.getElementById("dohCategoryRadioGroup").selectedIndex = 3;
+        break;
+    }
+
+    // When the mode is set to 0 we need to clear the URI so
+    // doh-rollout can kick in.
+    if (value == Ci.nsIDNSService.MODE_NATIVEONLY) {
+      Services.prefs.clearUserPref("network.trr.uri");
+      Services.prefs.clearUserPref("doh-rollout.disable-heuristics");
+    }
+
+    gPrivacyPane.updateDoHStatus();
+  },
+
+  /**
+   * Init DoH corresponding prefs
+   */
+  initDoH() {
+    Services.telemetry.setEventRecordingEnabled("security.doh.settings", true);
+
+    setEventListener("dohDefaultArrow", "command", this.toggleExpansion);
+    setEventListener("dohEnabledArrow", "command", this.toggleExpansion);
+    setEventListener("dohStrictArrow", "command", this.toggleExpansion);
+
+    function modeButtonPressed(e) {
+      // Clicking the active mode again should not generate another event
+      if (
+        parseInt(e.target.value) == Preferences.get("network.trr.mode").value
+      ) {
+        return;
+      }
+      Services.telemetry.recordEvent(
+        "security.doh.settings",
+        "mode_changed",
+        "button",
+        e.target.id
+      );
+    }
+
+    setEventListener("dohDefaultRadio", "command", modeButtonPressed);
+    setEventListener("dohEnabledRadio", "command", modeButtonPressed);
+    setEventListener("dohStrictRadio", "command", modeButtonPressed);
+    setEventListener("dohOffRadio", "command", modeButtonPressed);
+
+    function warnCheckboxClicked(e) {
+      Services.telemetry.recordEvent(
+        "security.doh.settings",
+        "warn_checkbox",
+        "checkbox",
+        `${e.target.checked}`
+      );
+    }
+
+    setEventListener("dohWarnCheckbox1", "command", warnCheckboxClicked);
+    setEventListener("dohWarnCheckbox2", "command", warnCheckboxClicked);
+
+    this.populateDoHResolverList("dohEnabled");
+    this.populateDoHResolverList("dohStrict");
+
+    Preferences.get("network.trr.uri").on("change", () => {
+      gPrivacyPane.updateDoHResolverList("dohEnabled");
+      gPrivacyPane.updateDoHResolverList("dohStrict");
+      gPrivacyPane.updateDoHStatus();
+    });
+
+    // Update status box and hightlightling when the pref changes
+    Preferences.get("network.trr.mode").on(
+      "change",
+      gPrivacyPane.highlightDoHCategoryAndUpdateStatus
+    );
+    this.highlightDoHCategoryAndUpdateStatus();
+
+    Services.obs.addObserver(this, "network:trr-uri-changed");
+    Services.obs.addObserver(this, "network:trr-mode-changed");
+    Services.obs.addObserver(this, "network:trr-confirmation");
+    let unload = () => {
+      Services.obs.removeObserver(this, "network:trr-uri-changed");
+      Services.obs.removeObserver(this, "network:trr-mode-changed");
+      Services.obs.removeObserver(this, "network:trr-confirmation");
+    };
+    window.addEventListener("unload", unload, { once: true });
+
+    if (Preferences.get("network.trr_ui.show_fallback_warning_option").value) {
+      document.getElementById("dohWarningBox1").hidden = false;
+      document.getElementById("dohWarningBox2").hidden = false;
+    }
+
+    let uriPref = Services.prefs.getStringPref("network.trr.uri");
+    // If the value isn't one of the providers, we need to update the
+    // custom_uri pref to make sure the input box contains the correct URL.
+    if (uriPref && !this.dnsOverHttpsResolvers.some(e => e.uri == uriPref)) {
+      Services.prefs.setStringPref(
+        "network.trr.custom_uri",
+        Services.prefs.getStringPref("network.trr.uri")
+      );
+    }
+
+    if (Services.prefs.prefIsLocked("network.trr.mode")) {
+      document.getElementById("dohCategoryRadioGroup").disabled = true;
+      Services.prefs.setStringPref("network.trr.custom_uri", uriPref);
+    }
+  },
+
+  initWebAuthn() {
+    document.getElementById("openWindowsPasskeySettings").hidden =
+      !Services.prefs.getBoolPref(
+        "security.webauthn.show_ms_settings_link",
+        true
+      );
+  },
+
+  /**
+   * Sets up the UI for the number of days of history to keep, and updates the
+   * label of the "Clear Now..." button.
+   */
+  init() {
+    this._updateSanitizeSettingsButton();
+    this.initDeleteOnCloseBox();
+    this.syncSanitizationPrefsWithDeleteOnClose();
+    this.initializeHistoryMode();
+    this.updateHistoryModePane();
+    this.updatePrivacyMicroControls();
+    this.initAutoStartPrivateBrowsingReverter();
+
+    /* Initialize Content Blocking */
+    this.initContentBlocking();
+
+    this._showCustomBlockList();
+    this.trackingProtectionReadPrefs();
+    this.fingerprintingProtectionReadPrefs();
+    this.networkCookieBehaviorReadPrefs();
+    this._initTrackingProtectionExtensionControl();
+    this._initThirdPartyCertsToggle();
+
+    Services.telemetry.setEventRecordingEnabled("privacy.ui.fpp", true);
+
+    Services.telemetry.setEventRecordingEnabled("pwmgr", true);
+
+    Preferences.get("privacy.trackingprotection.enabled").on(
+      "change",
+      gPrivacyPane.trackingProtectionReadPrefs.bind(gPrivacyPane)
+    );
+    Preferences.get("privacy.trackingprotection.pbmode.enabled").on(
+      "change",
+      gPrivacyPane.trackingProtectionReadPrefs.bind(gPrivacyPane)
+    );
+
+    // Watch all of the prefs that the new Cookies & Site Data UI depends on
+    Preferences.get("network.cookie.cookieBehavior").on(
+      "change",
+      gPrivacyPane.networkCookieBehaviorReadPrefs.bind(gPrivacyPane)
+    );
+    Preferences.get("browser.privatebrowsing.autostart").on(
+      "change",
+      gPrivacyPane.networkCookieBehaviorReadPrefs.bind(gPrivacyPane)
+    );
+    Preferences.get("privacy.firstparty.isolate").on(
+      "change",
+      gPrivacyPane.networkCookieBehaviorReadPrefs.bind(gPrivacyPane)
+    );
+
+    Preferences.get("privacy.fingerprintingProtection").on(
+      "change",
+      gPrivacyPane.fingerprintingProtectionReadPrefs.bind(gPrivacyPane)
+    );
+    Preferences.get("privacy.fingerprintingProtection.pbmode").on(
+      "change",
+      gPrivacyPane.fingerprintingProtectionReadPrefs.bind(gPrivacyPane)
+    );
+
+    setEventListener(
+      "trackingProtectionExceptions",
+      "command",
+      gPrivacyPane.showTrackingProtectionExceptions
+    );
+
+    Preferences.get("privacy.sanitize.sanitizeOnShutdown").on(
+      "change",
+      gPrivacyPane._updateSanitizeSettingsButton.bind(gPrivacyPane)
+    );
+    Preferences.get("browser.privatebrowsing.autostart").on(
+      "change",
+      gPrivacyPane.updatePrivacyMicroControls.bind(gPrivacyPane)
+    );
+    setEventListener("historyMode", "command", function () {
+      gPrivacyPane.updateHistoryModePane();
+      gPrivacyPane.updateHistoryModePrefs();
+      gPrivacyPane.updatePrivacyMicroControls();
+      gPrivacyPane.updateAutostart();
+    });
+    setEventListener("clearHistoryButton", "command", function () {
+      let historyMode = document.getElementById("historyMode");
+      // Select "everything" in the clear history dialog if the
+      // user has set their history mode to never remember history.
+      gPrivacyPane.clearPrivateDataNow(historyMode.value == "dontremember");
+    });
+    setEventListener(
+      "privateBrowsingAutoStart",
+      "command",
+      gPrivacyPane.updateAutostart
+    );
+    setEventListener(
+      "cookieExceptions",
+      "command",
+      gPrivacyPane.showCookieExceptions
+    );
+    setEventListener(
+      "httpsOnlyExceptionButton",
+      "command",
+      gPrivacyPane.showHttpsOnlyModeExceptions
+    );
+    setEventListener(
+      "dohExceptionsButton",
+      "command",
+      gPrivacyPane.showDoHExceptions
+    );
+    setEventListener(
+      "clearDataSettings",
+      "command",
+      gPrivacyPane.showClearPrivateDataSettings
+    );
+    setEventListener(
+      "passwordExceptions",
+      "command",
+      gPrivacyPane.showPasswordExceptions
+    );
+    setEventListener(
+      "useMasterPassword",
+      "command",
+      gPrivacyPane.updateMasterPasswordButton
+    );
+    setEventListener(
+      "changeMasterPassword",
+      "command",
+      gPrivacyPane.changeMasterPassword
+    );
+    setEventListener("showPasswords", "command", gPrivacyPane.showPasswords);
+    setEventListener(
+      "addonExceptions",
+      "command",
+      gPrivacyPane.showAddonExceptions
+    );
+    setEventListener(
+      "viewCertificatesButton",
+      "command",
+      gPrivacyPane.showCertificates
+    );
+    setEventListener(
+      "viewSecurityDevicesButton",
+      "command",
+      gPrivacyPane.showSecurityDevices
+    );
+
+    this._pane = document.getElementById("panePrivacy");
+
+    this._initGlobalPrivacyControlUI();
+    this._initPasswordGenerationUI();
+    this._initRelayIntegrationUI();
+    this._initMasterPasswordUI();
+
+    this.initListenersForExtensionControllingPasswordManager();
+
+    this._initSafeBrowsing();
+
+    setEventListener(
+      "autoplaySettingsButton",
+      "command",
+      gPrivacyPane.showAutoplayMediaExceptions
+    );
+    setEventListener(
+      "notificationSettingsButton",
+      "command",
+      gPrivacyPane.showNotificationExceptions
+    );
+    setEventListener(
+      "locationSettingsButton",
+      "command",
+      gPrivacyPane.showLocationExceptions
+    );
+    setEventListener(
+      "xrSettingsButton",
+      "command",
+      gPrivacyPane.showXRExceptions
+    );
+    setEventListener(
+      "cameraSettingsButton",
+      "command",
+      gPrivacyPane.showCameraExceptions
+    );
+    setEventListener(
+      "microphoneSettingsButton",
+      "command",
+      gPrivacyPane.showMicrophoneExceptions
+    );
+    document.getElementById("speakerSettingsRow").hidden =
+      !Services.prefs.getBoolPref("media.setsinkid.enabled", false);
+    setEventListener(
+      "speakerSettingsButton",
+      "command",
+      gPrivacyPane.showSpeakerExceptions
+    );
+    setEventListener(
+      "popupPolicyButton",
+      "command",
+      gPrivacyPane.showPopupExceptions
+    );
+    setEventListener(
+      "notificationsDoNotDisturb",
+      "command",
+      gPrivacyPane.toggleDoNotDisturbNotifications
+    );
+
+    setSyncFromPrefListener("contentBlockingBlockCookiesCheckbox", () =>
+      this.readBlockCookies()
+    );
+    setSyncToPrefListener("contentBlockingBlockCookiesCheckbox", () =>
+      this.writeBlockCookies()
+    );
+    setSyncFromPrefListener("blockCookiesMenu", () =>
+      this.readBlockCookiesFrom()
+    );
+    setSyncToPrefListener("blockCookiesMenu", () =>
+      this.writeBlockCookiesFrom()
+    );
+
+    setSyncFromPrefListener("savePasswords", () => this.readSavePasswords());
+
+    let microControlHandler = el =>
+      this.ensurePrivacyMicroControlUncheckedWhenDisabled(el);
+    setSyncFromPrefListener("rememberHistory", microControlHandler);
+    setSyncFromPrefListener("rememberForms", microControlHandler);
+    setSyncFromPrefListener("alwaysClear", microControlHandler);
+
+    setSyncFromPrefListener("popupPolicy", () =>
+      this.updateButtons("popupPolicyButton", "dom.disable_open_during_load")
+    );
+    setSyncFromPrefListener("warnAddonInstall", () =>
+      this.readWarnAddonInstall()
+    );
+    setSyncFromPrefListener("enableOCSP", () => this.readEnableOCSP());
+    setSyncToPrefListener("enableOCSP", () => this.writeEnableOCSP());
+
+    if (AlertsServiceDND) {
+      let notificationsDoNotDisturbBox = document.getElementById(
+        "notificationsDoNotDisturbBox"
+      );
+      notificationsDoNotDisturbBox.removeAttribute("hidden");
+      let checkbox = document.getElementById("notificationsDoNotDisturb");
+      document.l10n.setAttributes(checkbox, "permissions-notification-pause");
+      if (AlertsServiceDND.manualDoNotDisturb) {
+        let notificationsDoNotDisturb = document.getElementById(
+          "notificationsDoNotDisturb"
+        );
+        notificationsDoNotDisturb.setAttribute("checked", true);
+      }
+    }
+
+    let onNimbus = () => this._updateFirefoxSuggestToggle();
+    NimbusFeatures.urlbar.onUpdate(onNimbus);
+    this._updateFirefoxSuggestToggle(true);
+    window.addEventListener("unload", () => {
+      NimbusFeatures.urlbar.offUpdate(onNimbus);
+    });
+
+    this.initSiteDataControls();
+    setEventListener(
+      "clearSiteDataButton",
+      "command",
+      gPrivacyPane.clearSiteData
+    );
+    setEventListener(
+      "siteDataSettings",
+      "command",
+      gPrivacyPane.showSiteDataSettings
+    );
+
+    this.initCookieBannerHandling();
+
+    this.initDataCollection();
+
+    if (AppConstants.MOZ_DATA_REPORTING) {
+      if (AppConstants.MOZ_CRASHREPORTER) {
+        this.initSubmitCrashes();
+      }
+      this.initSubmitHealthReport();
+      setEventListener(
+        "submitHealthReportBox",
+        "command",
+        gPrivacyPane.updateSubmitHealthReport
+      );
+      setEventListener(
+        "telemetryDataDeletionLearnMore",
+        "click",
+        gPrivacyPane.showDataDeletion
+      );
+      if (AppConstants.MOZ_NORMANDY) {
+        this.initOptOutStudyCheckbox();
+      }
+      this.initAddonRecommendationsCheckbox();
+    }
+
+    let signonBundle = document.getElementById("signonBundle");
+    let pkiBundle = document.getElementById("pkiBundle");
+    appendSearchKeywords("showPasswords", [
+      signonBundle.getString("loginsDescriptionAll2"),
+    ]);
+    appendSearchKeywords("viewSecurityDevicesButton", [
+      pkiBundle.getString("enable_fips"),
+    ]);
+
+    if (!PrivateBrowsingUtils.enabled) {
+      document.getElementById("privateBrowsingAutoStart").hidden = true;
+      document.querySelector("menuitem[value='dontremember']").hidden = true;
+    }
+
+    /* init HTTPS-Only mode */
+    this.initHttpsOnly();
+
+    this.initDoH();
+
+    this.initWebAuthn();
+
+    // Notify observers that the UI is now ready
+    Services.obs.notifyObservers(window, "privacy-pane-loaded");
+  },
+
+  initSiteDataControls() {
+    Services.obs.addObserver(this, "sitedatamanager:sites-updated");
+    Services.obs.addObserver(this, "sitedatamanager:updating-sites");
+    let unload = () => {
+      window.removeEventListener("unload", unload);
+      Services.obs.removeObserver(this, "sitedatamanager:sites-updated");
+      Services.obs.removeObserver(this, "sitedatamanager:updating-sites");
+    };
+    window.addEventListener("unload", unload);
+    SiteDataManager.updateSites();
+  },
+
+  // CONTENT BLOCKING
+
+  /**
+   * Initializes the content blocking section.
+   */
+  initContentBlocking() {
+    setEventListener(
+      "contentBlockingTrackingProtectionCheckbox",
+      "command",
+      this.trackingProtectionWritePrefs
+    );
+    setEventListener(
+      "contentBlockingTrackingProtectionCheckbox",
+      "command",
+      this._updateTrackingProtectionUI
+    );
+    setEventListener(
+      "contentBlockingCryptominersCheckbox",
+      "command",
+      this.updateCryptominingLists
+    );
+    setEventListener(
+      "contentBlockingFingerprintersCheckbox",
+      "command",
+      this.updateFingerprintingLists
+    );
+    setEventListener(
+      "trackingProtectionMenu",
+      "command",
+      this.trackingProtectionWritePrefs
+    );
+    setEventListener(
+      "contentBlockingFingerprintingProtectionCheckbox",
+      "command",
+      e => {
+        const extra = { checked: e.target.checked };
+        Glean.privacyUiFppClick.checkbox.record(extra);
+        this.fingerprintingProtectionWritePrefs();
+      }
+    );
+    setEventListener("fingerprintingProtectionMenu", "command", e => {
+      const extra = { value: e.target.value };
+      Glean.privacyUiFppClick.menu.record(extra);
+      this.fingerprintingProtectionWritePrefs();
+    });
+    setEventListener("standardArrow", "command", this.toggleExpansion);
+    setEventListener("strictArrow", "command", this.toggleExpansion);
+    setEventListener("customArrow", "command", this.toggleExpansion);
+
+    Preferences.get("network.cookie.cookieBehavior").on(
+      "change",
+      gPrivacyPane.readBlockCookies.bind(gPrivacyPane)
+    );
+    Preferences.get("browser.contentblocking.category").on(
+      "change",
+      gPrivacyPane.highlightCBCategory
+    );
+
+    // If any relevant content blocking pref changes, show a warning that the changes will
+    // not be implemented until they refresh their tabs.
+    for (let pref of CONTENT_BLOCKING_PREFS) {
+      Preferences.get(pref).on("change", gPrivacyPane.maybeNotifyUserToReload);
+      // If the value changes, run populateCategoryContents, since that change might have been
+      // triggered by a default value changing in the standard category.
+      Preferences.get(pref).on("change", gPrivacyPane.populateCategoryContents);
+    }
+    Preferences.get("urlclassifier.trackingTable").on(
+      "change",
+      gPrivacyPane.maybeNotifyUserToReload
+    );
+    for (let button of document.querySelectorAll(".reload-tabs-button")) {
+      button.addEventListener("command", gPrivacyPane.reloadAllOtherTabs);
+    }
+
+    let cryptoMinersOption = document.getElementById(
+      "contentBlockingCryptominersOption"
+    );
+    let fingerprintersOption = document.getElementById(
+      "contentBlockingFingerprintersOption"
+    );
+    let trackingAndIsolateOption = document.querySelector(
+      "#blockCookiesMenu menuitem[value='trackers-plus-isolate']"
+    );
+    cryptoMinersOption.hidden = !Services.prefs.getBoolPref(
+      "browser.contentblocking.cryptomining.preferences.ui.enabled"
+    );
+    fingerprintersOption.hidden = !Services.prefs.getBoolPref(
+      "browser.contentblocking.fingerprinting.preferences.ui.enabled"
+    );
+    let updateTrackingAndIsolateOption = () => {
+      trackingAndIsolateOption.hidden =
+        !Services.prefs.getBoolPref(
+          "browser.contentblocking.reject-and-isolate-cookies.preferences.ui.enabled",
+          false
+        ) || gIsFirstPartyIsolated;
+    };
+    Preferences.get("privacy.firstparty.isolate").on(
+      "change",
+      updateTrackingAndIsolateOption
+    );
+    updateTrackingAndIsolateOption();
+
+    Preferences.get("browser.contentblocking.features.strict").on(
+      "change",
+      this.populateCategoryContents
+    );
+    this.populateCategoryContents();
+    this.highlightCBCategory();
+    this.readBlockCookies();
+
+    // Toggles the text "Cross-site and social media trackers" based on the
+    // social tracking pref. If the pref is false, the text reads
+    // "Cross-site trackers".
+    const STP_COOKIES_PREF = "privacy.socialtracking.block_cookies.enabled";
+    if (Services.prefs.getBoolPref(STP_COOKIES_PREF)) {
+      let contentBlockOptionSocialMedia = document.getElementById(
+        "blockCookiesSocialMedia"
+      );
+
+      document.l10n.setAttributes(
+        contentBlockOptionSocialMedia,
+        "sitedata-option-block-cross-site-tracking-cookies"
+      );
+    }
+
+    Preferences.get("privacy.resistFingerprinting").on(
+      "change",
+      setUpContentBlockingWarnings
+    );
+    Preferences.get("privacy.resistFingerprinting.pbmode").on(
+      "change",
+      setUpContentBlockingWarnings
+    );
+
+    setUpContentBlockingWarnings();
+
+    initTCPStandardSection();
+  },
+
+  populateCategoryContents() {
+    for (let type of ["strict", "standard"]) {
+      let rulesArray = [];
+      let selector;
+      if (type == "strict") {
+        selector = "#contentBlockingOptionStrict";
+        rulesArray = Services.prefs
+          .getStringPref("browser.contentblocking.features.strict")
+          .split(",");
+        if (gIsFirstPartyIsolated) {
+          let idx = rulesArray.indexOf("cookieBehavior5");
+          if (idx != -1) {
+            rulesArray[idx] = "cookieBehavior4";
+          }
+        }
+      } else {
+        selector = "#contentBlockingOptionStandard";
+        // In standard show/hide UI items based on the default values of the relevant prefs.
+        let defaults = Services.prefs.getDefaultBranch("");
+
+        let cookieBehavior = defaults.getIntPref(
+          "network.cookie.cookieBehavior"
+        );
+        switch (cookieBehavior) {
+          case Ci.nsICookieService.BEHAVIOR_ACCEPT:
+            rulesArray.push("cookieBehavior0");
+            break;
+          case Ci.nsICookieService.BEHAVIOR_REJECT_FOREIGN:
+            rulesArray.push("cookieBehavior1");
+            break;
+          case Ci.nsICookieService.BEHAVIOR_REJECT:
+            rulesArray.push("cookieBehavior2");
+            break;
+          case Ci.nsICookieService.BEHAVIOR_LIMIT_FOREIGN:
+            rulesArray.push("cookieBehavior3");
+            break;
+          case Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER:
+            rulesArray.push("cookieBehavior4");
+            break;
+          case BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN:
+            rulesArray.push(
+              gIsFirstPartyIsolated ? "cookieBehavior4" : "cookieBehavior5"
+            );
+            break;
+        }
+        let cookieBehaviorPBM = defaults.getIntPref(
+          "network.cookie.cookieBehavior.pbmode"
+        );
+        switch (cookieBehaviorPBM) {
+          case Ci.nsICookieService.BEHAVIOR_ACCEPT:
+            rulesArray.push("cookieBehaviorPBM0");
+            break;
+          case Ci.nsICookieService.BEHAVIOR_REJECT_FOREIGN:
+            rulesArray.push("cookieBehaviorPBM1");
+            break;
+          case Ci.nsICookieService.BEHAVIOR_REJECT:
+            rulesArray.push("cookieBehaviorPBM2");
+            break;
+          case Ci.nsICookieService.BEHAVIOR_LIMIT_FOREIGN:
+            rulesArray.push("cookieBehaviorPBM3");
+            break;
+          case Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER:
+            rulesArray.push("cookieBehaviorPBM4");
+            break;
+          case BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN:
+            rulesArray.push(
+              gIsFirstPartyIsolated
+                ? "cookieBehaviorPBM4"
+                : "cookieBehaviorPBM5"
+            );
+            break;
+        }
+        rulesArray.push(
+          defaults.getBoolPref(
+            "privacy.trackingprotection.cryptomining.enabled"
+          )
+            ? "cm"
+            : "-cm"
+        );
+        rulesArray.push(
+          defaults.getBoolPref(
+            "privacy.trackingprotection.fingerprinting.enabled"
+          )
+            ? "fp"
+            : "-fp"
+        );
+        rulesArray.push(
+          Services.prefs.getBoolPref(
+            "privacy.socialtracking.block_cookies.enabled"
+          )
+            ? "stp"
+            : "-stp"
+        );
+        rulesArray.push(
+          defaults.getBoolPref("privacy.trackingprotection.enabled")
+            ? "tp"
+            : "-tp"
+        );
+        rulesArray.push(
+          defaults.getBoolPref("privacy.trackingprotection.pbmode.enabled")
+            ? "tpPrivate"
+            : "-tpPrivate"
+        );
+      }
+
+      // Hide all cookie options first, until we learn which one should be showing.
+      document.querySelector(selector + " .all-cookies-option").hidden = true;
+      document.querySelector(
+        selector + " .unvisited-cookies-option"
+      ).hidden = true;
+      document.querySelector(
+        selector + " .cross-site-cookies-option"
+      ).hidden = true;
+      document.querySelector(
+        selector + " .third-party-tracking-cookies-option"
+      ).hidden = true;
+      document.querySelector(
+        selector + " .all-third-party-cookies-private-windows-option"
+      ).hidden = true;
+      document.querySelector(
+        selector + " .all-third-party-cookies-option"
+      ).hidden = true;
+      document.querySelector(selector + " .social-media-option").hidden = true;
+
+      for (let item of rulesArray) {
+        // Note "cookieBehavior0", will result in no UI changes, so is not listed here.
+        switch (item) {
+          case "tp":
+            document.querySelector(
+              selector + " .trackers-option"
+            ).hidden = false;
+            break;
+          case "-tp":
+            document.querySelector(
+              selector + " .trackers-option"
+            ).hidden = true;
+            break;
+          case "tpPrivate":
+            document.querySelector(
+              selector + " .pb-trackers-option"
+            ).hidden = false;
+            break;
+          case "-tpPrivate":
+            document.querySelector(
+              selector + " .pb-trackers-option"
+            ).hidden = true;
+            break;
+          case "fp":
+            document.querySelector(
+              selector + " .fingerprinters-option"
+            ).hidden = false;
+            break;
+          case "-fp":
+            document.querySelector(
+              selector + " .fingerprinters-option"
+            ).hidden = true;
+            break;
+          case "cm":
+            document.querySelector(
+              selector + " .cryptominers-option"
+            ).hidden = false;
+            break;
+          case "-cm":
+            document.querySelector(
+              selector + " .cryptominers-option"
+            ).hidden = true;
+            break;
+          case "stp":
+            // Store social tracking cookies pref
+            const STP_COOKIES_PREF =
+              "privacy.socialtracking.block_cookies.enabled";
+
+            if (Services.prefs.getBoolPref(STP_COOKIES_PREF)) {
+              document.querySelector(
+                selector + " .social-media-option"
+              ).hidden = false;
+            }
+            break;
+          case "-stp":
+            // Store social tracking cookies pref
+            document.querySelector(
+              selector + " .social-media-option"
+            ).hidden = true;
+            break;
+          case "cookieBehavior1":
+            document.querySelector(
+              selector + " .all-third-party-cookies-option"
+            ).hidden = false;
+            break;
+          case "cookieBehavior2":
+            document.querySelector(
+              selector + " .all-cookies-option"
+            ).hidden = false;
+            break;
+          case "cookieBehavior3":
+            document.querySelector(
+              selector + " .unvisited-cookies-option"
+            ).hidden = false;
+            break;
+          case "cookieBehavior4":
+            document.querySelector(
+              selector + " .third-party-tracking-cookies-option"
+            ).hidden = false;
+            break;
+          case "cookieBehavior5":
+            document.querySelector(
+              selector + " .cross-site-cookies-option"
+            ).hidden = false;
+            break;
+          case "cookieBehaviorPBM5":
+            // We only need to show the cookie option for private windows if the
+            // cookieBehaviors are different between regular windows and private
+            // windows.
+            if (!rulesArray.includes("cookieBehavior5")) {
+              document.querySelector(
+                selector + " .all-third-party-cookies-private-windows-option"
+              ).hidden = false;
+            }
+            break;
+        }
+      }
+      // Hide the "tracking protection in private browsing" list item
+      // if the "tracking protection enabled in all windows" list item is showing.
+      if (!document.querySelector(selector + " .trackers-option").hidden) {
+        document.querySelector(selector + " .pb-trackers-option").hidden = true;
+      }
+    }
+  },
+
+  highlightCBCategory() {
+    let value = Preferences.get("browser.contentblocking.category").value;
+    let standardEl = document.getElementById("contentBlockingOptionStandard");
+    let strictEl = document.getElementById("contentBlockingOptionStrict");
+    let customEl = document.getElementById("contentBlockingOptionCustom");
+    standardEl.classList.remove("selected");
+    strictEl.classList.remove("selected");
+    customEl.classList.remove("selected");
+
+    switch (value) {
+      case "strict":
+        strictEl.classList.add("selected");
+        break;
+      case "custom":
+        customEl.classList.add("selected");
+        break;
+      case "standard":
+      /* fall through */
+      default:
+        standardEl.classList.add("selected");
+        break;
+    }
+  },
+
+  updateCryptominingLists() {
+    let listPrefs = [
+      "urlclassifier.features.cryptomining.blacklistTables",
+      "urlclassifier.features.cryptomining.whitelistTables",
+    ];
+
+    let listValue = listPrefs
+      .map(l => Services.prefs.getStringPref(l))
+      .join(",");
+    listManager.forceUpdates(listValue);
+  },
+
+  updateFingerprintingLists() {
+    let listPrefs = [
+      "urlclassifier.features.fingerprinting.blacklistTables",
+      "urlclassifier.features.fingerprinting.whitelistTables",
+    ];
+
+    let listValue = listPrefs
+      .map(l => Services.prefs.getStringPref(l))
+      .join(",");
+    listManager.forceUpdates(listValue);
+  },
+
+  // TRACKING PROTECTION MODE
+
+  /**
+   * Selects the right item of the Tracking Protection menulist and checkbox.
+   */
+  trackingProtectionReadPrefs() {
+    let enabledPref = Preferences.get("privacy.trackingprotection.enabled");
+    let pbmPref = Preferences.get("privacy.trackingprotection.pbmode.enabled");
+    let tpMenu = document.getElementById("trackingProtectionMenu");
+    let tpCheckbox = document.getElementById(
+      "contentBlockingTrackingProtectionCheckbox"
+    );
+
+    this._updateTrackingProtectionUI();
+
+    // Global enable takes precedence over enabled in Private Browsing.
+    if (enabledPref.value) {
+      tpMenu.value = "always";
+      tpCheckbox.checked = true;
+    } else if (pbmPref.value) {
+      tpMenu.value = "private";
+      tpCheckbox.checked = true;
+    } else {
+      tpMenu.value = "never";
+      tpCheckbox.checked = false;
+    }
+  },
+
+  /**
+   * Selects the right item of the Fingerprinting Protection menulist and
+   * checkbox.
+   */
+  fingerprintingProtectionReadPrefs() {
+    let enabledPref = Preferences.get("privacy.fingerprintingProtection");
+    let pbmPref = Preferences.get("privacy.fingerprintingProtection.pbmode");
+    let fppMenu = document.getElementById("fingerprintingProtectionMenu");
+    let fppCheckbox = document.getElementById(
+      "contentBlockingFingerprintingProtectionCheckbox"
+    );
+
+    // Global enable takes precedence over enabled in Private Browsing.
+    if (enabledPref.value) {
+      fppMenu.value = "always";
+      fppCheckbox.checked = true;
+    } else if (pbmPref.value) {
+      fppMenu.value = "private";
+      fppCheckbox.checked = true;
+    } else {
+      fppMenu.value = "never";
+      fppCheckbox.checked = false;
+    }
+    fppMenu.disabled = !fppCheckbox.checked;
+  },
+
+  /**
+   * Selects the right items of the new Cookies & Site Data UI.
+   */
+  networkCookieBehaviorReadPrefs() {
+    let behavior = Services.cookies.getCookieBehavior(false);
+    let blockCookiesMenu = document.getElementById("blockCookiesMenu");
+    let deleteOnCloseCheckbox = document.getElementById("deleteOnClose");
+    let deleteOnCloseNote = document.getElementById("deleteOnCloseNote");
+    let blockCookies = behavior != Ci.nsICookieService.BEHAVIOR_ACCEPT;
+    let cookieBehaviorLocked = Services.prefs.prefIsLocked(
+      "network.cookie.cookieBehavior"
+    );
+    let blockCookiesControlsDisabled = !blockCookies || cookieBehaviorLocked;
+    blockCookiesMenu.disabled = blockCookiesControlsDisabled;
+
+    let completelyBlockCookies =
+      behavior == Ci.nsICookieService.BEHAVIOR_REJECT;
+    let privateBrowsing = Preferences.get(
+      "browser.privatebrowsing.autostart"
+    ).value;
+    deleteOnCloseCheckbox.disabled = privateBrowsing || completelyBlockCookies;
+    deleteOnCloseNote.hidden = !privateBrowsing;
+
+    switch (behavior) {
+      case Ci.nsICookieService.BEHAVIOR_ACCEPT:
+        break;
+      case Ci.nsICookieService.BEHAVIOR_REJECT_FOREIGN:
+        blockCookiesMenu.value = "all-third-parties";
+        break;
+      case Ci.nsICookieService.BEHAVIOR_REJECT:
+        blockCookiesMenu.value = "always";
+        break;
+      case Ci.nsICookieService.BEHAVIOR_LIMIT_FOREIGN:
+        blockCookiesMenu.value = "unvisited";
+        break;
+      case Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER:
+        blockCookiesMenu.value = "trackers";
+        break;
+      case BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN:
+        blockCookiesMenu.value = "trackers-plus-isolate";
+        break;
+    }
+  },
+
+  /**
+   * Sets the pref values based on the selected item of the radiogroup.
+   */
+  trackingProtectionWritePrefs() {
+    let enabledPref = Preferences.get("privacy.trackingprotection.enabled");
+    let pbmPref = Preferences.get("privacy.trackingprotection.pbmode.enabled");
+    let stpPref = Preferences.get(
+      "privacy.trackingprotection.socialtracking.enabled"
+    );
+    let stpCookiePref = Preferences.get(
+      "privacy.socialtracking.block_cookies.enabled"
+    );
+    // Currently, we don't expose the email tracking protection setting on our
+    // privacy UI. Instead, we use the existing tracking protection checkbox to
+    // control the email tracking protection.
+    let emailTPPref = Preferences.get(
+      "privacy.trackingprotection.emailtracking.enabled"
+    );
+    let emailTPPBMPref = Preferences.get(
+      "privacy.trackingprotection.emailtracking.pbmode.enabled"
+    );
+    let tpMenu = document.getElementById("trackingProtectionMenu");
+    let tpCheckbox = document.getElementById(
+      "contentBlockingTrackingProtectionCheckbox"
+    );
+
+    let value;
+    if (tpCheckbox.checked) {
+      if (tpMenu.value == "never") {
+        tpMenu.value = "private";
+      }
+      value = tpMenu.value;
+    } else {
+      tpMenu.value = "never";
+      value = "never";
+    }
+
+    switch (value) {
+      case "always":
+        enabledPref.value = true;
+        pbmPref.value = true;
+        emailTPPref.value = true;
+        emailTPPBMPref.value = true;
+        if (stpCookiePref.value) {
+          stpPref.value = true;
+        }
+        break;
+      case "private":
+        enabledPref.value = false;
+        pbmPref.value = true;
+        emailTPPref.value = false;
+        emailTPPBMPref.value = true;
+        if (stpCookiePref.value) {
+          stpPref.value = false;
+        }
+        break;
+      case "never":
+        enabledPref.value = false;
+        pbmPref.value = false;
+        emailTPPref.value = false;
+        emailTPPBMPref.value = false;
+        if (stpCookiePref.value) {
+          stpPref.value = false;
+        }
+        break;
+    }
+  },
+
+  fingerprintingProtectionWritePrefs() {
+    let enabledPref = Preferences.get("privacy.fingerprintingProtection");
+    let pbmPref = Preferences.get("privacy.fingerprintingProtection.pbmode");
+    let fppMenu = document.getElementById("fingerprintingProtectionMenu");
+    let fppCheckbox = document.getElementById(
+      "contentBlockingFingerprintingProtectionCheckbox"
+    );
+
+    let value;
+    if (fppCheckbox.checked) {
+      if (fppMenu.value == "never") {
+        fppMenu.value = "private";
+      }
+      value = fppMenu.value;
+    } else {
+      fppMenu.value = "never";
+      value = "never";
+    }
+
+    fppMenu.disabled = !fppCheckbox.checked;
+
+    switch (value) {
+      case "always":
+        enabledPref.value = true;
+        pbmPref.value = true;
+        break;
+      case "private":
+        enabledPref.value = false;
+        pbmPref.value = true;
+        break;
+      case "never":
+        enabledPref.value = false;
+        pbmPref.value = false;
+        break;
+    }
+  },
+
+  toggleExpansion(e) {
+    let carat = e.target;
+    carat.classList.toggle("up");
+    carat.closest(".privacy-detailedoption").classList.toggle("expanded");
+    carat.setAttribute(
+      "aria-expanded",
+      carat.getAttribute("aria-expanded") === "false"
+    );
+  },
+
+  // HISTORY MODE
+
+  /**
+   * The list of preferences which affect the initial history mode settings.
+   * If the auto start private browsing mode pref is active, the initial
+   * history mode would be set to "Don't remember anything".
+   * If ALL of these preferences are set to the values that correspond
+   * to keeping some part of history, and the auto-start
+   * private browsing mode is not active, the initial history mode would be
+   * set to "Remember everything".
+   * Otherwise, the initial history mode would be set to "Custom".
+   *
+   * Extensions adding their own preferences can set values here if needed.
+   */
+  prefsForKeepingHistory: {
+    "places.history.enabled": true, // History is enabled
+    "browser.formfill.enable": true, // Form information is saved
+    "privacy.sanitize.sanitizeOnShutdown": false, // Private date is NOT cleared on shutdown
+  },
+
+  /**
+   * The list of control IDs which are dependent on the auto-start private
+   * browsing setting, such that in "Custom" mode they would be disabled if
+   * the auto-start private browsing checkbox is checked, and enabled otherwise.
+   *
+   * Extensions adding their own controls can append their IDs to this array if needed.
+   */
+  dependentControls: [
+    "rememberHistory",
+    "rememberForms",
+    "alwaysClear",
+    "clearDataSettings",
+  ],
+
+  /**
+   * Check whether preferences values are set to keep history
+   *
+   * @param aPrefs an array of pref names to check for
+   * @returns boolean true if all of the prefs are set to keep history,
+   *                  false otherwise
+   */
+  _checkHistoryValues(aPrefs) {
+    for (let pref of Object.keys(aPrefs)) {
+      if (Preferences.get(pref).value != aPrefs[pref]) {
+        return false;
+      }
+    }
+    return true;
+  },
+
+  /**
+   * Initialize the history mode menulist based on the privacy preferences
+   */
+  initializeHistoryMode() {
+    let mode;
+    let getVal = aPref => Preferences.get(aPref).value;
+
+    if (getVal("privacy.history.custom")) {
+      mode = "custom";
+    } else if (this._checkHistoryValues(this.prefsForKeepingHistory)) {
+      if (getVal("browser.privatebrowsing.autostart")) {
+        mode = "dontremember";
+      } else {
+        mode = "remember";
+      }
+    } else {
+      mode = "custom";
+    }
+
+    document.getElementById("historyMode").value = mode;
+  },
+
+  /**
+   * Update the selected pane based on the history mode menulist
+   */
+  updateHistoryModePane() {
+    let selectedIndex = -1;
+    switch (document.getElementById("historyMode").value) {
+      case "remember":
+        selectedIndex = 0;
+        break;
+      case "dontremember":
+        selectedIndex = 1;
+        break;
+      case "custom":
+        selectedIndex = 2;
+        break;
+    }
+    document.getElementById("historyPane").selectedIndex = selectedIndex;
+    Preferences.get("privacy.history.custom").value = selectedIndex == 2;
+  },
+
+  /**
+   * Update the private browsing auto-start pref and the history mode
+   * micro-management prefs based on the history mode menulist
+   */
+  updateHistoryModePrefs() {
+    let pref = Preferences.get("browser.privatebrowsing.autostart");
+    switch (document.getElementById("historyMode").value) {
+      case "remember":
+        if (pref.value) {
+          pref.value = false;
+        }
+
+        // select the remember history option if needed
+        Preferences.get("places.history.enabled").value = true;
+
+        // select the remember forms history option
+        Preferences.get("browser.formfill.enable").value = true;
+
+        // select the clear on close option
+        Preferences.get("privacy.sanitize.sanitizeOnShutdown").value = false;
+        break;
+      case "dontremember":
+        if (!pref.value) {
+          pref.value = true;
+        }
+        break;
+    }
+  },
+
+  /**
+   * Update the privacy micro-management controls based on the
+   * value of the private browsing auto-start preference.
+   */
+  updatePrivacyMicroControls() {
+    let clearDataSettings = document.getElementById("clearDataSettings");
+
+    if (document.getElementById("historyMode").value == "custom") {
+      let disabled = Preferences.get("browser.privatebrowsing.autostart").value;
+      this.dependentControls.forEach(aElement => {
+        let control = document.getElementById(aElement);
+        let preferenceId = control.getAttribute("preference");
+        if (!preferenceId) {
+          let dependentControlId = control.getAttribute("control");
+          if (dependentControlId) {
+            let dependentControl = document.getElementById(dependentControlId);
+            preferenceId = dependentControl.getAttribute("preference");
+          }
+        }
+
+        let preference = preferenceId ? Preferences.get(preferenceId) : {};
+        control.disabled = disabled || preference.locked;
+        if (control != clearDataSettings) {
+          this.ensurePrivacyMicroControlUncheckedWhenDisabled(control);
+        }
+      });
+
+      clearDataSettings.removeAttribute("hidden");
+
+      if (!disabled) {
+        // adjust the Settings button for sanitizeOnShutdown
+        this._updateSanitizeSettingsButton();
+      }
+    } else {
+      clearDataSettings.hidden = true;
+    }
+  },
+
+  ensurePrivacyMicroControlUncheckedWhenDisabled(el) {
+    if (Preferences.get("browser.privatebrowsing.autostart").value) {
+      // Set checked to false when called from updatePrivacyMicroControls
+      el.checked = false;
+      // return false for the onsyncfrompreference case:
+      return false;
+    }
+    return undefined; // tell preferencesBindings to assign the 'right' value.
+  },
+
+  // CLEAR PRIVATE DATA
+
+  /*
+   * Preferences:
+   *
+   * privacy.sanitize.sanitizeOnShutdown
+   * - true if the user's private data is cleared on startup according to the
+   *   Clear Private Data settings, false otherwise
+   */
+
+  /**
+   * Displays the Clear Private Data settings dialog.
+   */
+  showClearPrivateDataSettings() {
+    let dialogFile = useOldClearHistoryDialog
+      ? "chrome://browser/content/preferences/dialogs/sanitize.xhtml"
+      : "chrome://browser/content/sanitize_v2.xhtml";
+
+    gSubDialog.open(
+      dialogFile,
+      {
+        features: "resizable=no",
+      },
+      {
+        mode: "clearOnShutdown",
+      }
+    );
+  },
+
+  /**
+   * Displays a dialog from which individual parts of private data may be
+   * cleared.
+   */
+  clearPrivateDataNow(aClearEverything) {
+    var ts = Preferences.get("privacy.sanitize.timeSpan");
+    var timeSpanOrig = ts.value;
+
+    if (aClearEverything) {
+      ts.value = 0;
+    }
+
+    // Bug 1856418 We intend to remove the old dialog box
+    let dialogFile = useOldClearHistoryDialog
+      ? "chrome://browser/content/sanitize.xhtml"
+      : "chrome://browser/content/sanitize_v2.xhtml";
+
+    gSubDialog.open(dialogFile, {
+      features: "resizable=no",
+      closingCallback: () => {
+        // reset the timeSpan pref
+        if (aClearEverything) {
+          ts.value = timeSpanOrig;
+        }
+
+        Services.obs.notifyObservers(null, "clear-private-data");
+      },
+    });
+  },
+
+  /*
+   * On loading the page, assigns the state to the deleteOnClose checkbox that fits the pref selection
+   */
+  initDeleteOnCloseBox() {
+    let deleteOnCloseBox = document.getElementById("deleteOnClose");
+    deleteOnCloseBox.checked =
+      (Preferences.get("privacy.sanitize.sanitizeOnShutdown").value &&
+        Preferences.get("privacy.clearOnShutdown.cookies").value &&
+        Preferences.get("privacy.clearOnShutdown.cache").value &&
+        Preferences.get("privacy.clearOnShutdown.offlineApps").value) ||
+      Preferences.get("browser.privatebrowsing.autostart").value;
+  },
+
+  /*
+   * Keeps the state of the deleteOnClose checkbox in sync with the pref selection
+   */
+  syncSanitizationPrefsWithDeleteOnClose() {
+    let deleteOnCloseBox = document.getElementById("deleteOnClose");
+    let historyMode = Preferences.get("privacy.history.custom");
+    let sanitizeOnShutdownPref = Preferences.get(
+      "privacy.sanitize.sanitizeOnShutdown"
+    );
+    // ClearOnClose cleaning categories
+    let cookiePref = Preferences.get("privacy.clearOnShutdown.cookies");
+    let cachePref = Preferences.get("privacy.clearOnShutdown.cache");
+    let offlineAppsPref = Preferences.get(
+      "privacy.clearOnShutdown.offlineApps"
+    );
+
+    // Sync the cleaning prefs with the deleteOnClose box
+    deleteOnCloseBox.addEventListener("command", () => {
+      let { checked } = deleteOnCloseBox;
+      cookiePref.value = checked;
+      cachePref.value = checked;
+      offlineAppsPref.value = checked;
+      // Forget the current pref selection if sanitizeOnShutdown is disabled,
+      // to not over clear when it gets enabled by the sync mechanism
+      if (!sanitizeOnShutdownPref.value) {
+        this._resetCleaningPrefs();
+      }
+      // If no other cleaning category is selected, sanitizeOnShutdown gets synced with deleteOnClose
+      sanitizeOnShutdownPref.value =
+        this._isCustomCleaningPrefPresent() || checked;
+
+      // Update the view of the history settings
+      if (checked && !historyMode.value) {
+        historyMode.value = "custom";
+        this.initializeHistoryMode();
+        this.updateHistoryModePane();
+        this.updatePrivacyMicroControls();
+      }
+    });
+
+    cookiePref.on("change", this._onSanitizePrefChangeSyncClearOnClose);
+    cachePref.on("change", this._onSanitizePrefChangeSyncClearOnClose);
+    offlineAppsPref.on("change", this._onSanitizePrefChangeSyncClearOnClose);
+    sanitizeOnShutdownPref.on(
+      "change",
+      this._onSanitizePrefChangeSyncClearOnClose
+    );
+  },
+
+  /*
+   * Sync the deleteOnClose box to its cleaning prefs
+   */
+  _onSanitizePrefChangeSyncClearOnClose() {
+    let deleteOnCloseBox = document.getElementById("deleteOnClose");
+    deleteOnCloseBox.checked =
+      Preferences.get("privacy.clearOnShutdown.cookies").value &&
+      Preferences.get("privacy.clearOnShutdown.cache").value &&
+      Preferences.get("privacy.clearOnShutdown.offlineApps").value &&
+      Preferences.get("privacy.sanitize.sanitizeOnShutdown").value;
+  },
+
+  /*
+   * Unsets cleaning prefs that do not belong to DeleteOnClose
+   */
+  _resetCleaningPrefs() {
+    SANITIZE_ON_SHUTDOWN_PREFS_ONLY.forEach(
+      pref => (Preferences.get(pref).value = false)
+    );
+  },
+
+  /*
+   Checks if the user set cleaning prefs that do not belong to DeleteOnClose
+   */
+  _isCustomCleaningPrefPresent() {
+    return SANITIZE_ON_SHUTDOWN_PREFS_ONLY.some(
+      pref => Preferences.get(pref).value
+    );
+  },
+
+  /**
+   * Enables or disables the "Settings..." button depending
+   * on the privacy.sanitize.sanitizeOnShutdown preference value
+   */
+  _updateSanitizeSettingsButton() {
+    var settingsButton = document.getElementById("clearDataSettings");
+    var sanitizeOnShutdownPref = Preferences.get(
+      "privacy.sanitize.sanitizeOnShutdown"
+    );
+
+    settingsButton.disabled = !sanitizeOnShutdownPref.value;
+  },
+
+  toggleDoNotDisturbNotifications(event) {
+    AlertsServiceDND.manualDoNotDisturb = event.target.checked;
+  },
+
+  // PRIVATE BROWSING
+
+  /**
+   * Initialize the starting state for the auto-start private browsing mode pref reverter.
+   */
+  initAutoStartPrivateBrowsingReverter() {
+    // We determine the mode in initializeHistoryMode, which is guaranteed to have been
+    // called before now, so this is up-to-date.
+    let mode = document.getElementById("historyMode");
+    this._lastMode = mode.selectedIndex;
+    // The value of the autostart pref, on the other hand, is gotten from Preferences,
+    // which updates the DOM asynchronously, so we can't rely on the DOM. Get it directly
+    // from the prefs.
+    this._lastCheckState = Preferences.get(
+      "browser.privatebrowsing.autostart"
+    ).value;
+  },
+
+  _lastMode: null,
+  _lastCheckState: null,
+  async updateAutostart() {
+    let mode = document.getElementById("historyMode");
+    let autoStart = document.getElementById("privateBrowsingAutoStart");
+    let pref = Preferences.get("browser.privatebrowsing.autostart");
+    if (
+      (mode.value == "custom" && this._lastCheckState == autoStart.checked) ||
+      (mode.value == "remember" && !this._lastCheckState) ||
+      (mode.value == "dontremember" && this._lastCheckState)
+    ) {
+      // These are all no-op changes, so we don't need to prompt.
+      this._lastMode = mode.selectedIndex;
+      this._lastCheckState = autoStart.hasAttribute("checked");
+      return;
+    }
+
+    if (!this._shouldPromptForRestart) {
+      // We're performing a revert. Just let it happen.
+      return;
+    }
+
+    let buttonIndex = await confirmRestartPrompt(
+      autoStart.checked,
+      1,
+      true,
+      false
+    );
+    if (buttonIndex == CONFIRM_RESTART_PROMPT_RESTART_NOW) {
+      pref.value = autoStart.hasAttribute("checked");
+      Services.startup.quit(
+        Ci.nsIAppStartup.eAttemptQuit | Ci.nsIAppStartup.eRestart
+      );
+      return;
+    }
+
+    this._shouldPromptForRestart = false;
+
+    if (this._lastCheckState) {
+      autoStart.checked = "checked";
+    } else {
+      autoStart.removeAttribute("checked");
+    }
+    pref.value = autoStart.hasAttribute("checked");
+    mode.selectedIndex = this._lastMode;
+    mode.doCommand();
+
+    this._shouldPromptForRestart = true;
+  },
+
+  /**
+   * Displays fine-grained, per-site preferences for tracking protection.
+   */
+  showTrackingProtectionExceptions() {
+    let params = {
+      permissionType: "trackingprotection",
+      disableETPVisible: true,
+      prefilledHost: "",
+      hideStatusColumn: true,
+    };
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/permissions.xhtml",
+      undefined,
+      params
+    );
+  },
+
+  /**
+   * Displays the available block lists for tracking protection.
+   */
+  showBlockLists() {
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/blocklists.xhtml"
+    );
+  },
+
+  // COOKIES AND SITE DATA
+
+  /*
+   * Preferences:
+   *
+   * network.cookie.cookieBehavior
+   * - determines how the browser should handle cookies:
+   *     0   means enable all cookies
+   *     1   means reject all third party cookies
+   *     2   means disable all cookies
+   *     3   means reject third party cookies unless at least one is already set for the eTLD
+   *     4   means reject all trackers
+   *     5   means reject all trackers and partition third-party cookies
+   *         see netwerk/cookie/src/CookieService.cpp for details
+   */
+
+  /**
+   * Reads the network.cookie.cookieBehavior preference value and
+   * enables/disables the "blockCookiesMenu" menulist accordingly.
+   */
+  readBlockCookies() {
+    let bcControl = document.getElementById("blockCookiesMenu");
+    bcControl.disabled =
+      Services.cookies.getCookieBehavior(false) ==
+      Ci.nsICookieService.BEHAVIOR_ACCEPT;
+  },
+
+  /**
+   * Updates the "accept third party cookies" menu based on whether the
+   * "contentBlockingBlockCookiesCheckbox" checkbox is checked.
+   */
+  writeBlockCookies() {
+    let block = document.getElementById("contentBlockingBlockCookiesCheckbox");
+    let blockCookiesMenu = document.getElementById("blockCookiesMenu");
+
+    if (block.checked) {
+      // Automatically select 'third-party trackers' as the default.
+      blockCookiesMenu.selectedIndex = 0;
+      return this.writeBlockCookiesFrom();
+    }
+    return Ci.nsICookieService.BEHAVIOR_ACCEPT;
+  },
+
+  readBlockCookiesFrom() {
+    switch (Services.cookies.getCookieBehavior(false)) {
+      case Ci.nsICookieService.BEHAVIOR_REJECT_FOREIGN:
+        return "all-third-parties";
+      case Ci.nsICookieService.BEHAVIOR_REJECT:
+        return "always";
+      case Ci.nsICookieService.BEHAVIOR_LIMIT_FOREIGN:
+        return "unvisited";
+      case Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER:
+        return "trackers";
+      case BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN:
+        return "trackers-plus-isolate";
+      default:
+        return undefined;
+    }
+  },
+
+  writeBlockCookiesFrom() {
+    let block = document.getElementById("blockCookiesMenu").selectedItem;
+    switch (block.value) {
+      case "trackers":
+        return Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER;
+      case "unvisited":
+        return Ci.nsICookieService.BEHAVIOR_LIMIT_FOREIGN;
+      case "always":
+        return Ci.nsICookieService.BEHAVIOR_REJECT;
+      case "all-third-parties":
+        return Ci.nsICookieService.BEHAVIOR_REJECT_FOREIGN;
+      case "trackers-plus-isolate":
+        return Ci.nsICookieService
+          .BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN;
+      default:
+        return undefined;
+    }
+  },
+
+  /**
+   * Discard the browsers of all tabs in all windows. Pinned tabs, as
+   * well as tabs for which discarding doesn't succeed (e.g. selected
+   * tabs, tabs with beforeunload listeners), are reloaded.
+   */
+  reloadAllOtherTabs() {
+    let ourTab = BrowserWindowTracker.getTopWindow().gBrowser.selectedTab;
+    BrowserWindowTracker.orderedWindows.forEach(win => {
+      let otherGBrowser = win.gBrowser;
+      for (let tab of otherGBrowser.tabs) {
+        if (tab == ourTab) {
+          // Don't reload our preferences tab.
+          continue;
+        }
+
+        if (tab.pinned || tab.selected) {
+          otherGBrowser.reloadTab(tab);
+        } else {
+          otherGBrowser.discardBrowser(tab);
+        }
+      }
+    });
+
+    for (let notification of document.querySelectorAll(".reload-tabs")) {
+      notification.hidden = true;
+    }
+  },
+
+  /**
+   * If there are more tabs than just the preferences tab, show a warning to the user that
+   * they need to reload their tabs to apply the setting.
+   */
+  maybeNotifyUserToReload() {
+    let shouldShow = false;
+    if (window.BrowserWindowTracker.orderedWindows.length > 1) {
+      shouldShow = true;
+    } else {
+      let tabbrowser = window.BrowserWindowTracker.getTopWindow().gBrowser;
+      if (tabbrowser.tabs.length > 1) {
+        shouldShow = true;
+      }
+    }
+    if (shouldShow) {
+      for (let notification of document.querySelectorAll(".reload-tabs")) {
+        notification.hidden = false;
+      }
+    }
+  },
+
+  /**
+   * Displays fine-grained, per-site preferences for cookies.
+   */
+  showCookieExceptions() {
+    var params = {
+      blockVisible: true,
+      sessionVisible: true,
+      allowVisible: true,
+      prefilledHost: "",
+      permissionType: "cookie",
+    };
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/permissions.xhtml",
+      undefined,
+      params
+    );
+  },
+
+  /**
+   * Displays per-site preferences for HTTPS-Only Mode exceptions.
+   */
+  showHttpsOnlyModeExceptions() {
+    var params = {
+      blockVisible: false,
+      sessionVisible: true,
+      allowVisible: false,
+      prefilledHost: "",
+      permissionType: "https-only-load-insecure",
+      forcedHTTP: true,
+    };
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/permissions.xhtml",
+      undefined,
+      params
+    );
+  },
+
+  showDoHExceptions() {
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/dohExceptions.xhtml",
+      undefined
+    );
+  },
+
+  showSiteDataSettings() {
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/siteDataSettings.xhtml"
+    );
+  },
+
+  toggleSiteData(shouldShow) {
+    let clearButton = document.getElementById("clearSiteDataButton");
+    let settingsButton = document.getElementById("siteDataSettings");
+    clearButton.disabled = !shouldShow;
+    settingsButton.disabled = !shouldShow;
+  },
+
+  showSiteDataLoading() {
+    let totalSiteDataSizeLabel = document.getElementById("totalSiteDataSize");
+    document.l10n.setAttributes(
+      totalSiteDataSizeLabel,
+      "sitedata-total-size-calculating"
+    );
+  },
+
+  updateTotalDataSizeLabel(siteDataUsage) {
+    SiteDataManager.getCacheSize().then(function (cacheUsage) {
+      let totalSiteDataSizeLabel = document.getElementById("totalSiteDataSize");
+      let totalUsage = siteDataUsage + cacheUsage;
+      let [value, unit] = DownloadUtils.convertByteUnits(totalUsage);
+      document.l10n.setAttributes(
+        totalSiteDataSizeLabel,
+        "sitedata-total-size",
+        {
+          value,
+          unit,
+        }
+      );
+    });
+  },
+
+  clearSiteData() {
+    // We have to use the full path name to avoid getting errors in
+    // browser/base/content/test/static/browser_all_files_referenced.js
+    let dialogFile = useOldClearHistoryDialog
+      ? "chrome://browser/content/preferences/dialogs/clearSiteData.xhtml"
+      : "chrome://browser/content/sanitize_v2.xhtml";
+
+    gSubDialog.open(
+      dialogFile,
+      {
+        features: "resizable=no",
+      },
+      {
+        mode: "clearSiteData",
+      }
+    );
+  },
+
+  /**
+   * Initializes the cookie banner handling subgroup on the privacy pane.
+   *
+   * This UI is shown if the "cookiebanners.ui.desktop.enabled" pref is true.
+   *
+   * The cookie banner handling checkbox reflects the cookie banner feature
+   * state. It is enabled when the service enabled via the
+   * cookiebanners.service.mode pref. If detection-only mode is enabled the
+   * checkbox is unchecked, since in this mode no banners are handled. It is
+   * only used for detection for banners which means we may prompt the user to
+   * enable the feature via other UI surfaces such as the onboarding doorhanger.
+   *
+   * If the user checks the checkbox, the pref value is set to
+   * nsICookieBannerService.MODE_REJECT_OR_ACCEPT.
+   *
+   * If the user unchecks the checkbox, the mode pref value is set to
+   * nsICookieBannerService.MODE_DISABLED.
+   *
+   * Advanced users can choose other int-valued modes via about:config.
+   */
+  initCookieBannerHandling() {
+    setSyncFromPrefListener("handleCookieBanners", () =>
+      this.readCookieBannerMode()
+    );
+    setSyncToPrefListener("handleCookieBanners", () =>
+      this.writeCookieBannerMode()
+    );
+
+    let preference = Preferences.get("cookiebanners.ui.desktop.enabled");
+    preference.on("change", () => this.updateCookieBannerHandlingVisibility());
+
+    this.updateCookieBannerHandlingVisibility();
+  },
+
+  /**
+   * Reads the cookiebanners.service.mode.privateBrowsing pref,
+   * interpreting the multiple modes as a true/false value
+   */
+  readCookieBannerMode() {
+    return (
+      Preferences.get("cookiebanners.service.mode.privateBrowsing").value !=
+      Ci.nsICookieBannerService.MODE_DISABLED
+    );
+  },
+
+  /**
+   * Translates user clicks on the cookie banner handling checkbox to the
+   * corresponding integer-valued cookie banner mode preference.
+   */
+  writeCookieBannerMode() {
+    let checkbox = document.getElementById("handleCookieBanners");
+    if (!checkbox.checked) {
+      /* because we removed UI control for the non-PBM pref, disabling it here
+         provides an off-ramp for profiles where it had previously been enabled from the UI */
+      Services.prefs.setIntPref(
+        "cookiebanners.service.mode",
+        Ci.nsICookieBannerService.MODE_DISABLED
+      );
+      return Ci.nsICookieBannerService.MODE_DISABLED;
+    }
+    return Ci.nsICookieBannerService.MODE_REJECT;
+  },
+
+  /**
+   * Shows or hides the cookie banner handling section based on the value of
+   * the "cookiebanners.ui.desktop.enabled" pref.
+   */
+  updateCookieBannerHandlingVisibility() {
+    let groupbox = document.getElementById("cookieBannerHandlingGroup");
+    let isEnabled = Preferences.get("cookiebanners.ui.desktop.enabled").value;
+
+    // Because the top-level pane showing code unsets the hidden attribute, we
+    // manually hide the section when cookie banner handling is preffed off.
+    if (isEnabled) {
+      groupbox.removeAttribute("style");
+    } else {
+      groupbox.setAttribute("style", "display: none !important");
+    }
+  },
+
+  /**
+   * Updates the visibility of the Firefox Suggest Privacy Container
+   * based on the user's Quick Suggest settings.
+   *
+   * @param {boolean} [onInit]
+   *   Pass true when calling this when initializing the pane.
+   */
+  _updateFirefoxSuggestToggle(onInit = false) {
+    let container = document.getElementById("firefoxSuggestPrivacyContainer");
+
+    if (UrlbarPrefs.get("quickSuggestEnabled")) {
+      container.removeAttribute("hidden");
+    } else if (!onInit) {
+      container.setAttribute("hidden", "true");
+    }
+  },
+
+  // GEOLOCATION
+
+  /**
+   * Displays the location exceptions dialog where specific site location
+   * preferences can be set.
+   */
+  showLocationExceptions() {
+    let params = { permissionType: "geo" };
+
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/sitePermissions.xhtml",
+      { features: "resizable=yes" },
+      params
+    );
+  },
+
+  // XR
+
+  /**
+   * Displays the XR exceptions dialog where specific site XR
+   * preferences can be set.
+   */
+  showXRExceptions() {
+    let params = { permissionType: "xr" };
+
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/sitePermissions.xhtml",
+      { features: "resizable=yes" },
+      params
+    );
+  },
+
+  // CAMERA
+
+  /**
+   * Displays the camera exceptions dialog where specific site camera
+   * preferences can be set.
+   */
+  showCameraExceptions() {
+    let params = { permissionType: "camera" };
+
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/sitePermissions.xhtml",
+      { features: "resizable=yes" },
+      params
+    );
+  },
+
+  // MICROPHONE
+
+  /**
+   * Displays the microphone exceptions dialog where specific site microphone
+   * preferences can be set.
+   */
+  showMicrophoneExceptions() {
+    let params = { permissionType: "microphone" };
+
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/sitePermissions.xhtml",
+      { features: "resizable=yes" },
+      params
+    );
+  },
+
+  // SPEAKER
+
+  /**
+   * Displays the speaker exceptions dialog where specific site speaker
+   * preferences can be set.
+   */
+  showSpeakerExceptions() {
+    let params = { permissionType: "speaker" };
+
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/sitePermissions.xhtml",
+      { features: "resizable=yes" },
+      params
+    );
+  },
+
+  // NOTIFICATIONS
+
+  /**
+   * Displays the notifications exceptions dialog where specific site notification
+   * preferences can be set.
+   */
+  showNotificationExceptions() {
+    let params = { permissionType: "desktop-notification" };
+
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/sitePermissions.xhtml",
+      { features: "resizable=yes" },
+      params
+    );
+  },
+
+  // MEDIA
+
+  showAutoplayMediaExceptions() {
+    var params = { permissionType: "autoplay-media" };
+
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/sitePermissions.xhtml",
+      { features: "resizable=yes" },
+      params
+    );
+  },
+
+  // POP-UPS
+
+  /**
+   * Displays the popup exceptions dialog where specific site popup preferences
+   * can be set.
+   */
+  showPopupExceptions() {
+    var params = {
+      blockVisible: false,
+      sessionVisible: false,
+      allowVisible: true,
+      prefilledHost: "",
+      permissionType: "popup",
+    };
+
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/permissions.xhtml",
+      { features: "resizable=yes" },
+      params
+    );
+  },
+
+  // UTILITY FUNCTIONS
+
+  /**
+   * Utility function to enable/disable the button specified by aButtonID based
+   * on the value of the Boolean preference specified by aPreferenceID.
+   */
+  updateButtons(aButtonID, aPreferenceID) {
+    var button = document.getElementById(aButtonID);
+    var preference = Preferences.get(aPreferenceID);
+    button.disabled = !preference.value || preference.locked;
+    return undefined;
+  },
+
+  // BEGIN UI CODE
+
+  /*
+   * Preferences:
+   *
+   * dom.disable_open_during_load
+   * - true if popups are blocked by default, false otherwise
+   */
+
+  // POP-UPS
+
+  /**
+   * Displays a dialog in which the user can view and modify the list of sites
+   * where passwords are never saved.
+   */
+  showPasswordExceptions() {
+    var params = {
+      blockVisible: true,
+      sessionVisible: false,
+      allowVisible: false,
+      hideStatusColumn: true,
+      prefilledHost: "",
+      permissionType: "login-saving",
+    };
+
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/permissions.xhtml",
+      undefined,
+      params
+    );
+  },
+
+  /**
+   * Initializes master password UI: the "use master password" checkbox, selects
+   * the master password button to show, and enables/disables it as necessary.
+   * The master password is controlled by various bits of NSS functionality, so
+   * the UI for it can't be controlled by the normal preference bindings.
+   */
+  _initMasterPasswordUI() {
+    var noMP = !LoginHelper.isPrimaryPasswordSet();
+
+    var button = document.getElementById("changeMasterPassword");
+    button.disabled = noMP;
+
+    var checkbox = document.getElementById("useMasterPassword");
+    checkbox.checked = !noMP;
+    checkbox.disabled =
+      (noMP && !Services.policies.isAllowed("createMasterPassword")) ||
+      (!noMP && !Services.policies.isAllowed("removeMasterPassword"));
+  },
+
+  /**
+   * Enables/disables the master password button depending on the state of the
+   * "use master password" checkbox, and prompts for master password removal if
+   * one is set.
+   */
+  async updateMasterPasswordButton() {
+    var checkbox = document.getElementById("useMasterPassword");
+    var button = document.getElementById("changeMasterPassword");
+    button.disabled = !checkbox.checked;
+
+    // unchecking the checkbox should try to immediately remove the master
+    // password, because it's impossible to non-destructively remove the master
+    // password used to encrypt all the passwords without providing it (by
+    // design), and it would be extremely odd to pop up that dialog when the
+    // user closes the prefwindow and saves his settings
+    if (!checkbox.checked) {
+      await this._removeMasterPassword();
+    } else {
+      await this.changeMasterPassword();
+    }
+
+    this._initMasterPasswordUI();
+  },
+
+  /**
+   * Displays the "remove master password" dialog to allow the user to remove
+   * the current master password.  When the dialog is dismissed, master password
+   * UI is automatically updated.
+   */
+  async _removeMasterPassword() {
+    var secmodDB = Cc["@mozilla.org/security/pkcs11moduledb;1"].getService(
+      Ci.nsIPKCS11ModuleDB
+    );
+    if (secmodDB.isFIPSEnabled) {
+      let title = document.getElementById("fips-title").textContent;
+      let desc = document.getElementById("fips-desc").textContent;
+      Services.prompt.alert(window, title, desc);
+      this._initMasterPasswordUI();
+    } else {
+      gSubDialog.open("chrome://mozapps/content/preferences/removemp.xhtml", {
+        closingCallback: this._initMasterPasswordUI.bind(this),
+      });
+    }
+  },
+
+  /**
+   * Displays a dialog in which the primary password may be changed.
+   */
+  async changeMasterPassword() {
+    // Require OS authentication before the user can set a Primary Password.
+    // OS reauthenticate functionality is not available on Linux yet (bug 1527745)
+    if (
+      !LoginHelper.isPrimaryPasswordSet() &&
+      OS_AUTH_ENABLED &&
+      OSKeyStore.canReauth()
+    ) {
+      // Uses primary-password-os-auth-dialog-message-win and
+      // primary-password-os-auth-dialog-message-macosx via concatenation:
+      let messageId =
+        "primary-password-os-auth-dialog-message-" + AppConstants.platform;
+      let [messageText, captionText] = await document.l10n.formatMessages([
+        {
+          id: messageId,
+        },
+        {
+          id: "master-password-os-auth-dialog-caption",
+        },
+      ]);
+      let win = Services.wm.getMostRecentBrowserWindow();
+      let loggedIn = await OSKeyStore.ensureLoggedIn(
+        messageText.value,
+        captionText.value,
+        win,
+        false
+      );
+      if (!loggedIn.authenticated) {
+        return;
+      }
+    }
+
+    gSubDialog.open("chrome://mozapps/content/preferences/changemp.xhtml", {
+      features: "resizable=no",
+      closingCallback: this._initMasterPasswordUI.bind(this),
+    });
+  },
+
+  /**
+   * Set up the initial state for the GPC/DNT UI.
+   * The GPC part should only appear if the functionality is
+   * enabled.
+   */
+  _initGlobalPrivacyControlUI() {
+    let gpcEnabledPrefValue = Services.prefs.getBoolPref(
+      "privacy.globalprivacycontrol.functionality.enabled",
+      false
+    );
+    document.getElementById("globalPrivacyControlBox").hidden =
+      !gpcEnabledPrefValue;
+    document.getElementById("doNotTrackBox").hidden = !gpcEnabledPrefValue;
+    document.getElementById("legacyDoNotTrackBox").hidden = gpcEnabledPrefValue;
+  },
+
+  /**
+   * Set up the initial state for the password generation UI.
+   * It will be hidden unless the .available pref is true
+   */
+  _initPasswordGenerationUI() {
+    // we don't watch the .available pref for runtime changes
+    let prefValue = Services.prefs.getBoolPref(
+      PREF_PASSWORD_GENERATION_AVAILABLE,
+      false
+    );
+    document.getElementById("generatePasswordsBox").hidden = !prefValue;
+  },
+
+  toggleRelayIntegration() {
+    const checkbox = document.getElementById("relayIntegration");
+    if (checkbox.checked) {
+      FirefoxRelay.markAsAvailable();
+      FirefoxRelayTelemetry.recordRelayPrefEvent("enabled");
+    } else {
+      FirefoxRelay.markAsDisabled();
+      FirefoxRelayTelemetry.recordRelayPrefEvent("disabled");
+    }
+  },
+
+  _updateRelayIntegrationUI() {
+    document.getElementById("relayIntegrationBox").hidden =
+      !FirefoxRelay.isAvailable;
+    document.getElementById("relayIntegration").checked =
+      FirefoxRelay.isAvailable && !FirefoxRelay.isDisabled;
+  },
+
+  _initRelayIntegrationUI() {
+    document
+      .getElementById("relayIntegrationLearnMoreLink")
+      .setAttribute("href", FirefoxRelay.learnMoreUrl);
+
+    setEventListener(
+      "relayIntegration",
+      "command",
+      gPrivacyPane.toggleRelayIntegration.bind(gPrivacyPane)
+    );
+    Preferences.get("signon.firefoxRelay.feature").on(
+      "change",
+      gPrivacyPane._updateRelayIntegrationUI.bind(gPrivacyPane)
+    );
+
+    this._updateRelayIntegrationUI();
+  },
+
+  /**
+   * Shows the sites where the user has saved passwords and the associated login
+   * information.
+   */
+  showPasswords() {
+    let loginManager = window.windowGlobalChild.getActor("LoginManager");
+    loginManager.sendAsyncMessage("PasswordManager:OpenPreferences", {
+      entryPoint: "preferences",
+    });
+  },
+
+  /**
+   * Enables/disables dependent controls related to password saving
+   * When password saving is not enabled, we need to also disable the password generation checkbox
+   * The Exceptions button is used to configure sites where passwords are never saved.
+   */
+  readSavePasswords() {
+    var prefValue = Preferences.get("signon.rememberSignons").value;
+    document.getElementById("passwordExceptions").disabled = !prefValue;
+    document.getElementById("generatePasswords").disabled = !prefValue;
+    document.getElementById("passwordAutofillCheckbox").disabled = !prefValue;
+    document.getElementById("relayIntegration").disabled =
+      !prefValue || Services.prefs.prefIsLocked("signon.firefoxRelay.feature");
+    // don't override pref value in UI
+    return undefined;
+  },
+
+  /**
+   * Initalizes pref listeners for the password manager.
+   *
+   * This ensures that the user is always notified if an extension is controlling the password manager.
+   */
+  initListenersForExtensionControllingPasswordManager() {
+    this._passwordManagerCheckbox = document.getElementById("savePasswords");
+    this._disableExtensionButton = document.getElementById(
+      "disablePasswordManagerExtension"
+    );
+
+    this._disableExtensionButton.addEventListener(
+      "command",
+      makeDisableControllingExtension(
+        PREF_SETTING_TYPE,
+        PASSWORD_MANAGER_PREF_ID
+      )
+    );
+
+    initListenersForPrefChange(
+      PREF_SETTING_TYPE,
+      PASSWORD_MANAGER_PREF_ID,
+      this._passwordManagerCheckbox
+    );
+  },
+
+  /**
+   * Enables/disables the add-ons Exceptions button depending on whether
+   * or not add-on installation warnings are displayed.
+   */
+  readWarnAddonInstall() {
+    var warn = Preferences.get("xpinstall.whitelist.required");
+    var exceptions = document.getElementById("addonExceptions");
+
+    exceptions.disabled = !warn.value || warn.locked;
+
+    // don't override the preference value
+    return undefined;
+  },
+
+  _initSafeBrowsing() {
+    let enableSafeBrowsing = document.getElementById("enableSafeBrowsing");
+    let blockDownloads = document.getElementById("blockDownloads");
+    let blockUncommonUnwanted = document.getElementById(
+      "blockUncommonUnwanted"
+    );
+
+    let safeBrowsingPhishingPref = Preferences.get(
+      "browser.safebrowsing.phishing.enabled"
+    );
+    let safeBrowsingMalwarePref = Preferences.get(
+      "browser.safebrowsing.malware.enabled"
+    );
+
+    let blockDownloadsPref = Preferences.get(
+      "browser.safebrowsing.downloads.enabled"
+    );
+    let malwareTable = Preferences.get("urlclassifier.malwareTable");
+
+    let blockUnwantedPref = Preferences.get(
+      "browser.safebrowsing.downloads.remote.block_potentially_unwanted"
+    );
+    let blockUncommonPref = Preferences.get(
+      "browser.safebrowsing.downloads.remote.block_uncommon"
+    );
+
+    enableSafeBrowsing.addEventListener("command", function () {
+      safeBrowsingPhishingPref.value = enableSafeBrowsing.checked;
+      safeBrowsingMalwarePref.value = enableSafeBrowsing.checked;
+
+      blockDownloads.disabled =
+        !enableSafeBrowsing.checked || blockDownloadsPref.locked;
+      blockUncommonUnwanted.disabled =
+        !blockDownloads.checked ||
+        !enableSafeBrowsing.checked ||
+        blockUnwantedPref.locked ||
+        blockUncommonPref.locked;
+    });
+
+    blockDownloads.addEventListener("command", function () {
+      blockDownloadsPref.value = blockDownloads.checked;
+      blockUncommonUnwanted.disabled =
+        !blockDownloads.checked ||
+        blockUnwantedPref.locked ||
+        blockUncommonPref.locked;
+    });
+
+    blockUncommonUnwanted.addEventListener("command", function () {
+      blockUnwantedPref.value = blockUncommonUnwanted.checked;
+      blockUncommonPref.value = blockUncommonUnwanted.checked;
+
+      let malware = malwareTable.value
+        .split(",")
+        .filter(
+          x =>
+            x !== "goog-unwanted-proto" &&
+            x !== "goog-unwanted-shavar" &&
+            x !== "moztest-unwanted-simple"
+        );
+
+      if (blockUncommonUnwanted.checked) {
+        if (malware.includes("goog-malware-shavar")) {
+          malware.push("goog-unwanted-shavar");
+        } else {
+          malware.push("goog-unwanted-proto");
+        }
+
+        malware.push("moztest-unwanted-simple");
+      }
+
+      // sort alphabetically to keep the pref consistent
+      malware.sort();
+
+      malwareTable.value = malware.join(",");
+
+      // Force an update after changing the malware table.
+      listManager.forceUpdates(malwareTable.value);
+    });
+
+    // set initial values
+
+    enableSafeBrowsing.checked =
+      safeBrowsingPhishingPref.value && safeBrowsingMalwarePref.value;
+    if (!enableSafeBrowsing.checked) {
+      blockDownloads.setAttribute("disabled", "true");
+      blockUncommonUnwanted.setAttribute("disabled", "true");
+    }
+
+    blockDownloads.checked = blockDownloadsPref.value;
+    if (!blockDownloadsPref.value) {
+      blockUncommonUnwanted.setAttribute("disabled", "true");
+    }
+    blockUncommonUnwanted.checked =
+      blockUnwantedPref.value && blockUncommonPref.value;
+
+    if (safeBrowsingPhishingPref.locked || safeBrowsingMalwarePref.locked) {
+      enableSafeBrowsing.disabled = true;
+    }
+    if (blockDownloadsPref.locked) {
+      blockDownloads.disabled = true;
+    }
+    if (blockUnwantedPref.locked || blockUncommonPref.locked) {
+      blockUncommonUnwanted.disabled = true;
+    }
+  },
+
+  /**
+   * Displays the exceptions lists for add-on installation warnings.
+   */
+  showAddonExceptions() {
+    var params = this._addonParams;
+
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/permissions.xhtml",
+      undefined,
+      params
+    );
+  },
+
+  /**
+   * Parameters for the add-on install permissions dialog.
+   */
+  _addonParams: {
+    blockVisible: false,
+    sessionVisible: false,
+    allowVisible: true,
+    prefilledHost: "",
+    permissionType: "install",
+  },
+
+  /**
+   * readEnableOCSP is used by the preferences UI to determine whether or not
+   * the checkbox for OCSP fetching should be checked (it returns true if it
+   * should be checked and false otherwise). The about:config preference
+   * "security.OCSP.enabled" is an integer rather than a boolean, so it can't be
+   * directly mapped from {true,false} to {checked,unchecked}. The possible
+   * values for "security.OCSP.enabled" are:
+   * 0: fetching is disabled
+   * 1: fetch for all certificates
+   * 2: fetch only for EV certificates
+   * Hence, if "security.OCSP.enabled" is non-zero, the checkbox should be
+   * checked. Otherwise, it should be unchecked.
+   */
+  readEnableOCSP() {
+    var preference = Preferences.get("security.OCSP.enabled");
+    // This is the case if the preference is the default value.
+    if (preference.value === undefined) {
+      return true;
+    }
+    return preference.value != 0;
+  },
+
+  /**
+   * writeEnableOCSP is used by the preferences UI to map the checked/unchecked
+   * state of the OCSP fetching checkbox to the value that the preference
+   * "security.OCSP.enabled" should be set to (it returns that value). See the
+   * readEnableOCSP documentation for more background. We unfortunately don't
+   * have enough information to map from {true,false} to all possible values for
+   * "security.OCSP.enabled", but a reasonable alternative is to map from
+   * {true,false} to {<the default value>,0}. That is, if the box is checked,
+   * "security.OCSP.enabled" will be set to whatever default it should be, given
+   * the platform and channel. If the box is unchecked, the preference will be
+   * set to 0. Obviously this won't work if the default is 0, so we will have to
+   * revisit this if we ever set it to 0.
+   */
+  writeEnableOCSP() {
+    var checkbox = document.getElementById("enableOCSP");
+    var defaults = Services.prefs.getDefaultBranch(null);
+    var defaultValue = defaults.getIntPref("security.OCSP.enabled");
+    return checkbox.checked ? defaultValue : 0;
+  },
+
+  /**
+   * Displays the user's certificates and associated options.
+   */
+  showCertificates() {
+    gSubDialog.open("chrome://pippki/content/certManager.xhtml");
+  },
+
+  /**
+   * Displays a dialog from which the user can manage his security devices.
+   */
+  showSecurityDevices() {
+    gSubDialog.open("chrome://pippki/content/device_manager.xhtml");
+  },
+
+  /**
+   * Displays the learn more health report page when a user opts out of data collection.
+   */
+  showDataDeletion() {
+    let url =
+      Services.urlFormatter.formatURLPref("app.support.baseURL") +
+      "telemetry-clientid";
+    window.open(url, "_blank");
+  },
+
+  initDataCollection() {
+    if (
+      !AppConstants.MOZ_DATA_REPORTING &&
+      !NimbusFeatures.majorRelease2022.getVariable(
+        "feltPrivacyShowPreferencesSection"
+      )
+    ) {
+      // Nothing to control in the data collection section, remove it.
+      document.getElementById("dataCollectionCategory").remove();
+      document.getElementById("dataCollectionGroup").remove();
+      return;
+    }
+
+    this._setupLearnMoreLink(
+      "toolkit.datacollection.infoURL",
+      "dataCollectionPrivacyNotice"
+    );
+    this.initPrivacySegmentation();
+  },
+
+  initSubmitCrashes() {
+    this._setupLearnMoreLink(
+      "toolkit.crashreporter.infoURL",
+      "crashReporterLearnMore"
+    );
+    setEventListener("crashReporterLabel", "click", function (event) {
+      if (event.target.localName == "a") {
+        return;
+      }
+      const checkboxId = event.target.getAttribute("for");
+      document.getElementById(checkboxId).click();
+    });
+  },
+
+  initPrivacySegmentation() {
+    // Section visibility
+    let section = document.getElementById("privacySegmentationSection");
+    let updatePrivacySegmentationSectionVisibilityState = () => {
+      section.hidden = !NimbusFeatures.majorRelease2022.getVariable(
+        "feltPrivacyShowPreferencesSection"
+      );
+    };
+
+    NimbusFeatures.majorRelease2022.onUpdate(
+      updatePrivacySegmentationSectionVisibilityState
+    );
+    window.addEventListener("unload", () => {
+      NimbusFeatures.majorRelease2022.offUpdate(
+        updatePrivacySegmentationSectionVisibilityState
+      );
+    });
+
+    updatePrivacySegmentationSectionVisibilityState();
+  },
+
+  /**
+   * Set up or hide the Learn More links for various data collection options
+   */
+  _setupLearnMoreLink(pref, element) {
+    // set up the Learn More link with the correct URL
+    let url = Services.urlFormatter.formatURLPref(pref);
+    let el = document.getElementById(element);
+
+    if (url) {
+      el.setAttribute("href", url);
+    } else {
+      el.hidden = true;
+    }
+  },
+
+  /**
+   * Initialize the health report service reference and checkbox.
+   */
+  initSubmitHealthReport() {
+    this._setupLearnMoreLink(
+      "datareporting.healthreport.infoURL",
+      "FHRLearnMore"
+    );
+
+    let checkbox = document.getElementById("submitHealthReportBox");
+
+    // Telemetry is only sending data if MOZ_TELEMETRY_REPORTING is defined.
+    // We still want to display the preferences panel if that's not the case, but
+    // we want it to be disabled and unchecked.
+    if (
+      Services.prefs.prefIsLocked(PREF_UPLOAD_ENABLED) ||
+      !AppConstants.MOZ_TELEMETRY_REPORTING
+    ) {
+      checkbox.setAttribute("disabled", "true");
+      return;
+    }
+
+    checkbox.checked =
+      Services.prefs.getBoolPref(PREF_UPLOAD_ENABLED) &&
+      AppConstants.MOZ_TELEMETRY_REPORTING;
+  },
+
+  /**
+   * Update the health report preference with state from checkbox.
+   */
+  updateSubmitHealthReport() {
+    let checkbox = document.getElementById("submitHealthReportBox");
+    let telemetryContainer = document.getElementById("telemetry-container");
+
+    Services.prefs.setBoolPref(PREF_UPLOAD_ENABLED, checkbox.checked);
+    telemetryContainer.hidden = checkbox.checked;
+  },
+
+  /**
+   * Initialize the opt-out-study preference checkbox into about:preferences and
+   * handles events coming from the UI for it.
+   */
+  initOptOutStudyCheckbox(doc) {
+    // The checkbox should be disabled if any of the below are true. This
+    // prevents the user from changing the value in the box.
+    //
+    // * the policy forbids shield
+    // * Normandy is disabled
+    //
+    // The checkbox should match the value of the preference only if all of
+    // these are true. Otherwise, the checkbox should remain unchecked. This
+    // is because in these situations, Shield studies are always disabled, and
+    // so showing a checkbox would be confusing.
+    //
+    // * the policy allows Shield
+    // * Normandy is enabled
+
+    const allowedByPolicy = Services.policies.isAllowed("Shield");
+    const checkbox = document.getElementById("optOutStudiesEnabled");
+
+    if (
+      allowedByPolicy &&
+      Services.prefs.getBoolPref(PREF_NORMANDY_ENABLED, false)
+    ) {
+      if (Services.prefs.getBoolPref(PREF_OPT_OUT_STUDIES_ENABLED, false)) {
+        checkbox.setAttribute("checked", "true");
+      } else {
+        checkbox.removeAttribute("checked");
+      }
+      checkbox.setAttribute("preference", PREF_OPT_OUT_STUDIES_ENABLED);
+      checkbox.removeAttribute("disabled");
+    } else {
+      checkbox.removeAttribute("preference");
+      checkbox.removeAttribute("checked");
+      checkbox.setAttribute("disabled", "true");
+    }
+  },
+
+  initAddonRecommendationsCheckbox() {
+    // Setup the checkbox.
+    dataCollectionCheckboxHandler({
+      checkbox: document.getElementById("addonRecommendationEnabled"),
+      pref: PREF_ADDON_RECOMMENDATIONS_ENABLED,
+    });
+  },
+
+  observe(aSubject, aTopic, aData) {
+    switch (aTopic) {
+      case "sitedatamanager:updating-sites":
+        // While updating, we want to disable this section and display loading message until updated
+        this.toggleSiteData(false);
+        this.showSiteDataLoading();
+        break;
+
+      case "sitedatamanager:sites-updated":
+        this.toggleSiteData(true);
+        SiteDataManager.getTotalUsage().then(
+          this.updateTotalDataSizeLabel.bind(this)
+        );
+        break;
+      case "network:trr-uri-changed":
+      case "network:trr-mode-changed":
+      case "network:trr-confirmation":
+        gPrivacyPane.updateDoHStatus();
+        break;
+    }
+  },
+};
diff --git a/browser/components/preferences/search.inc.xhtml b/browser/components/preferences/search.inc.xhtml
new file mode 100644
index 0000000000..9c46c503fd
--- /dev/null
+++ b/browser/components/preferences/search.inc.xhtml
@@ -0,0 +1,209 @@
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this file,
+   - You can obtain one at http://mozilla.org/MPL/2.0/. -->
+
+    <script src="chrome://browser/content/preferences/search.js"/>
+    <html:template id="template-paneSearch">
+    <hbox id="searchCategory"
+          class="subcategory"
+          hidden="true"
+          data-category="paneSearch">
+      <html:h1 data-l10n-id="pane-search-title"/>
+    </hbox>
+
+    <!-- Default Search Engine -->
+    <groupbox id="defaultEngineGroup" data-category="paneSearch" hidden="true">
+      <label><html:h2 data-l10n-id="search-engine-default-header" id="search-engine-default-header" /></label>
+      <description class="description-deemphasized" data-l10n-id="search-engine-default-desc-2" id="search-engine-default-desc-2" />
+      <hbox>
+        <menulist id="defaultEngine" aria-labelledby="search-engine-default-header" aria-describedby="search-engine-default-desc-2">
+          <menupopup/>
+        </menulist>
+      </hbox>
+      <checkbox id="searchShowSearchTermCheckbox"
+                data-l10n-id="search-show-search-term-option"
+                preference="browser.urlbar.showSearchTerms.enabled"
+                hidden="true" />
+      <checkbox id="browserSeparateDefaultEngine"
+                data-l10n-id="search-separate-default-engine"
+                hidden="true"/>
+      <vbox id="browserPrivateEngineSelection" class="indent" hidden="true">
+        <description data-l10n-id="search-engine-default-private-desc-2" id="search-engine-default-private-desc-2" />
+        <hbox>
+          <menulist id="defaultPrivateEngine" aria-labelledby="search-engine-default-private-desc-2">
+            <menupopup/>
+          </menulist>
+        </hbox>
+      </vbox>
+    </groupbox>
+
+    <groupbox id="searchSuggestionsGroup" data-category="paneSearch" hidden="true">
+      <label><html:h2 data-l10n-id="search-suggestions-header" /></label>
+      <description id="searchSuggestionsDesc"
+                   class="description-deemphasized"
+                   data-l10n-id="search-suggestions-desc" />
+
+      <checkbox id="suggestionsInSearchFieldsCheckbox"
+                data-l10n-id="search-show-suggestions-option" />
+      <vbox class="indent">
+        <checkbox id="urlBarSuggestion" data-l10n-id="search-show-suggestions-url-bar-option" />
+        <checkbox id="showSearchSuggestionsFirstCheckbox"
+                  data-l10n-id="search-show-suggestions-above-history-option"
+                  preference="browser.urlbar.showSearchSuggestionsFirst"/>
+        <checkbox id="showSearchSuggestionsPrivateWindows"
+                  data-l10n-id="search-show-suggestions-private-windows"/>
+        <hbox align="center" id="showTrendingSuggestionsBox">
+          <checkbox id="showTrendingSuggestions" data-l10n-id="search-show-trending-suggestions" preference="browser.urlbar.suggest.trending" class="tail-with-learn-more" />
+          <html:a is="moz-support-link" support-page="google-trending-searches-on-awesomebar" />
+        </hbox>
+        <hbox id="urlBarSuggestionPermanentPBLabel"
+              align="center" class="indent">
+          <label flex="1" data-l10n-id="search-suggestions-cant-show" />
+        </hbox>
+      </vbox>
+      <checkbox id="enableRecentSearches" data-l10n-id="addressbar-locbar-showrecentsearches-option" hidden="true"
+            preference="browser.urlbar.suggest.recentsearches" />
+    </groupbox>
+
+    <!-- Address Bar -->
+    <groupbox id="locationBarGroup"
+              data-category="paneSearch"
+              hidden="true"
+              data-subcategory="locationBar">
+      <label><html:h2 id="locationBarGroupHeader" data-l10n-id="addressbar-header"/></label>
+      <label id="locationBarSuggestionLabel" class="description-deemphasized" data-l10n-id="addressbar-suggest"/>
+      <checkbox id="historySuggestion" data-l10n-id="addressbar-locbar-history-option"
+                preference="browser.urlbar.suggest.history"/>
+      <checkbox id="bookmarkSuggestion" data-l10n-id="addressbar-locbar-bookmarks-option"
+                preference="browser.urlbar.suggest.bookmark"/>
+      <checkbox id="clipboardSuggestion" data-l10n-id="addressbar-locbar-clipboard-option" hidden="true"
+                preference="browser.urlbar.suggest.clipboard"/>
+      <checkbox id="openpageSuggestion" data-l10n-id="addressbar-locbar-openpage-option"
+                preference="browser.urlbar.suggest.openpage"/>
+      <checkbox id="topSitesSuggestion"
+                data-l10n-id="addressbar-locbar-shortcuts-option"
+                preference="browser.urlbar.suggest.topsites"/>
+      <checkbox id="enginesSuggestion" data-l10n-id="addressbar-locbar-engines-option"
+                preference="browser.urlbar.suggest.engines"/>
+      <hbox id="quickActionsBox" align="center" hidden="true">
+        <checkbox id="enableQuickActions"
+                  class="tail-with-learn-more"
+                  data-l10n-id="addressbar-locbar-quickactions-option"
+                  preference="browser.urlbar.suggest.quickactions" />
+        <html:a is="moz-support-link"
+                id="quickActionsLink"
+                data-l10n-id="addressbar-quickactions-learn-more"
+                support-page="quick-actions-firefox-search-bar"
+        />
+      </hbox>
+      <vbox id="firefoxSuggestContainer" hidden="true">
+        <checkbox id="firefoxSuggestNonsponsored"
+                  data-l10n-id="addressbar-firefox-suggest-nonsponsored"
+                  preference="browser.urlbar.suggest.quicksuggest.nonsponsored"
+        />
+        <description class="indent tip-caption"
+                      data-l10n-id="addressbar-firefox-suggest-nonsponsored-desc"
+        />
+        <checkbox id="firefoxSuggestSponsored"
+                  data-l10n-id="addressbar-firefox-suggest-sponsored"
+                  preference="browser.urlbar.suggest.quicksuggest.sponsored"
+        />
+        <description class="indent tip-caption"
+                      data-l10n-id="addressbar-firefox-suggest-sponsored-desc"
+        />
+        <hbox id="firefoxSuggestInfoBox" class="info-box-container smaller-font-size" align="start"
+              hidden="true">
+          <html:img class="info-icon"/>
+          <description flex="1">
+            <html:span id="firefoxSuggestInfoText" class="tail-with-learn-more"/>
+            <html:a is="moz-support-link"
+                    id="firefoxSuggestInfoBoxLearnMore"
+                    class="learnMore firefoxSuggestLearnMore"
+                    data-l10n-id="addressbar-locbar-firefox-suggest-learn-more"
+                    support-page="firefox-suggest"
+            />
+          </description>
+        </hbox>
+        <vbox class="firefoxSuggestOptionBox">
+            <html:moz-toggle id="firefoxSuggestDataCollectionSearchToggle"
+                             preference="browser.urlbar.quicksuggest.dataCollection.enabled"
+                             data-l10n-id="addressbar-firefox-suggest-data-collection"
+                             data-l10n-attrs="label, description">
+              <html:a slot="support-link"
+                      is="moz-support-link"
+                      id="firefoxSuggestDataCollectionLearnMoreSearch"
+                      class="learnMore firefoxSuggestLearnMore"
+                      data-l10n-id="addressbar-locbar-firefox-suggest-learn-more"
+                      support-page="firefox-suggest"
+              />
+            </html:moz-toggle>
+        </vbox>
+        <hbox id="dismissedSuggestions" align="center">
+          <vbox flex="1">
+            <label data-l10n-id="addressbar-dismissed-suggestions-label"/>
+            <description class="tip-caption">
+              <html:span id="dismissedSuggestionsDescription"
+                        class="tail-with-learn-more"
+                        data-l10n-id="addressbar-restore-dismissed-suggestions-description"/>
+              <html:a is="moz-support-link"
+                      id="dismissedSuggestionsLearnMore"
+                      class="learnMore firefoxSuggestLearnMore"
+                      data-l10n-id="addressbar-restore-dismissed-suggestions-learn-more"
+                      support-page="firefox-suggest"
+              />
+            </description>
+          </vbox>
+          <button id="restoreDismissedSuggestions"
+                  is="highlightable-button"
+                  class="accessory-button"
+                  data-l10n-id="addressbar-restore-dismissed-suggestions-button"
+                  aria-describedby="dismissedSuggestionsDescription"/>
+        </hbox>
+      </vbox>
+    </groupbox>
+
+    <groupbox id="oneClickSearchProvidersGroup" data-category="paneSearch" hidden="true">
+      <label><html:h2 data-l10n-id="search-one-click-header2" /></label>
+      <description class="description-deemphasized" data-l10n-id="search-one-click-desc" />
+
+      <tree id="engineList" flex="1" rows="11" hidecolumnpicker="true" editable="true"
+            seltype="single" allowunderflowscroll="true">
+        <treechildren id="engineChildren" flex="1"/>
+        <treecols>
+          <treecol id="engineShown" type="checkbox" editable="true" sortable="false"/>
+          <treecol id="engineName" flex="1" data-l10n-id="search-choose-engine-column" sortable="false"/>
+          <treecol id="engineKeyword" flex="1" data-l10n-id="search-choose-keyword-column" sortable="false"/>
+        </treecols>
+      </tree>
+
+      <hbox>
+        <button id="restoreDefaultSearchEngines"
+                is="highlightable-button"
+                data-l10n-id="search-restore-default"
+                />
+        <spacer flex="1"/>
+        <button id="removeEngineButton"
+                is="highlightable-button"
+                class="searchEngineAction"
+                data-l10n-id="search-remove-engine"
+                disabled="true"
+                />
+        <button id="addEngineButton"
+                is="highlightable-button"
+                class="searchEngineAction"
+                hidden="true"
+                data-l10n-id="search-add-engine"
+                search-l10n-ids="
+                  add-engine-button,
+                  add-engine-name,
+                  add-engine-alias,
+                  add-engine-url,
+                  add-engine-dialog.buttonlabelaccept,
+                "
+                />
+      </hbox>
+      <hbox id="addEnginesBox" pack="start">
+        <label id="addEngines" data-l10n-id="search-find-more-link" is="text-link"></label>
+      </hbox>
+    </groupbox>
+    </html:template>
diff --git a/browser/components/preferences/search.js b/browser/components/preferences/search.js
new file mode 100644
index 0000000000..42776cfa96
--- /dev/null
+++ b/browser/components/preferences/search.js
@@ -0,0 +1,1319 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+/* import-globals-from extensionControlled.js */
+/* import-globals-from preferences.js */
+
+const lazy = {};
+
+ChromeUtils.defineESModuleGetters(lazy, {
+  SearchUIUtils: "resource:///modules/SearchUIUtils.sys.mjs",
+});
+
+const PREF_URLBAR_QUICKSUGGEST_BLOCKLIST =
+  "browser.urlbar.quicksuggest.blockedDigests";
+const PREF_URLBAR_WEATHER_USER_ENABLED = "browser.urlbar.suggest.weather";
+
+Preferences.addAll([
+  { id: "browser.search.suggest.enabled", type: "bool" },
+  { id: "browser.urlbar.suggest.searches", type: "bool" },
+  { id: "browser.search.suggest.enabled.private", type: "bool" },
+  { id: "browser.search.widget.inNavBar", type: "bool" },
+  { id: "browser.urlbar.showSearchSuggestionsFirst", type: "bool" },
+  { id: "browser.urlbar.showSearchTerms.enabled", type: "bool" },
+  { id: "browser.search.separatePrivateDefault", type: "bool" },
+  { id: "browser.search.separatePrivateDefault.ui.enabled", type: "bool" },
+  { id: "browser.urlbar.suggest.trending", type: "bool" },
+  { id: "browser.urlbar.trending.featureGate", type: "bool" },
+  { id: "browser.urlbar.recentsearches.featureGate", type: "bool" },
+  { id: "browser.urlbar.suggest.recentsearches", type: "bool" },
+]);
+
+const ENGINE_FLAVOR = "text/x-moz-search-engine";
+const SEARCH_TYPE = "default_search";
+const SEARCH_KEY = "defaultSearch";
+
+// The name of in built engines that support trending results.
+const TRENDING_ENGINES = ["Google", "Bing"];
+
+var gEngineView = null;
+
+var gSearchPane = {
+  init() {
+    gEngineView = new EngineView(new EngineStore());
+    document.getElementById("engineList").view = gEngineView;
+    this.buildDefaultEngineDropDowns().catch(console.error);
+
+    if (
+      Services.policies &&
+      !Services.policies.isAllowed("installSearchEngine")
+    ) {
+      document.getElementById("addEnginesBox").hidden = true;
+    } else {
+      let addEnginesLink = document.getElementById("addEngines");
+      addEnginesLink.setAttribute("href", lazy.SearchUIUtils.searchEnginesURL);
+    }
+
+    window.addEventListener("click", this);
+    window.addEventListener("command", this);
+    window.addEventListener("dragstart", this);
+    window.addEventListener("keypress", this);
+    window.addEventListener("select", this);
+    window.addEventListener("dblclick", this);
+
+    Services.obs.addObserver(this, "browser-search-engine-modified");
+    Services.obs.addObserver(this, "intl:app-locales-changed");
+    window.addEventListener("unload", () => {
+      Services.obs.removeObserver(this, "browser-search-engine-modified");
+      Services.obs.removeObserver(this, "intl:app-locales-changed");
+    });
+
+    let suggestsPref = Preferences.get("browser.search.suggest.enabled");
+    let urlbarSuggestsPref = Preferences.get("browser.urlbar.suggest.searches");
+    let searchBarPref = Preferences.get("browser.search.widget.inNavBar");
+    let privateSuggestsPref = Preferences.get(
+      "browser.search.suggest.enabled.private"
+    );
+
+    let updateSuggestionCheckboxes =
+      this._updateSuggestionCheckboxes.bind(this);
+    suggestsPref.on("change", updateSuggestionCheckboxes);
+    urlbarSuggestsPref.on("change", updateSuggestionCheckboxes);
+    searchBarPref.on("change", updateSuggestionCheckboxes);
+    let urlbarSuggests = document.getElementById("urlBarSuggestion");
+    urlbarSuggests.addEventListener("command", () => {
+      urlbarSuggestsPref.value = urlbarSuggests.checked;
+    });
+    let suggestionsInSearchFieldsCheckbox = document.getElementById(
+      "suggestionsInSearchFieldsCheckbox"
+    );
+    // We only want to call _updateSuggestionCheckboxes once after updating
+    // all prefs.
+    suggestionsInSearchFieldsCheckbox.addEventListener("command", () => {
+      this._skipUpdateSuggestionCheckboxesFromPrefChanges = true;
+      if (!searchBarPref.value) {
+        urlbarSuggestsPref.value = suggestionsInSearchFieldsCheckbox.checked;
+      }
+      suggestsPref.value = suggestionsInSearchFieldsCheckbox.checked;
+      this._skipUpdateSuggestionCheckboxesFromPrefChanges = false;
+      this._updateSuggestionCheckboxes();
+    });
+    let privateWindowCheckbox = document.getElementById(
+      "showSearchSuggestionsPrivateWindows"
+    );
+    privateWindowCheckbox.addEventListener("command", () => {
+      privateSuggestsPref.value = privateWindowCheckbox.checked;
+    });
+
+    setEventListener(
+      "browserSeparateDefaultEngine",
+      "command",
+      this._onBrowserSeparateDefaultEngineChange.bind(this)
+    );
+
+    this._initDefaultEngines();
+    this._initShowSearchTermsCheckbox();
+    this._updateSuggestionCheckboxes();
+    this._showAddEngineButton();
+    this._initRecentSeachesCheckbox();
+    this._initAddressBar();
+  },
+
+  /**
+   * Initialize the default engine handling. This will hide the private default
+   * options if they are not enabled yet.
+   */
+  _initDefaultEngines() {
+    this._separatePrivateDefaultEnabledPref = Preferences.get(
+      "browser.search.separatePrivateDefault.ui.enabled"
+    );
+
+    this._separatePrivateDefaultPref = Preferences.get(
+      "browser.search.separatePrivateDefault"
+    );
+
+    const checkbox = document.getElementById("browserSeparateDefaultEngine");
+    checkbox.checked = !this._separatePrivateDefaultPref.value;
+
+    this._updatePrivateEngineDisplayBoxes();
+
+    const listener = () => {
+      this._updatePrivateEngineDisplayBoxes();
+      this.buildDefaultEngineDropDowns().catch(console.error);
+    };
+
+    this._separatePrivateDefaultEnabledPref.on("change", listener);
+    this._separatePrivateDefaultPref.on("change", listener);
+  },
+
+  _initShowSearchTermsCheckbox() {
+    let checkbox = document.getElementById("searchShowSearchTermCheckbox");
+
+    // Add Nimbus event to show/hide checkbox.
+    let onNimbus = () => {
+      checkbox.hidden = !UrlbarPrefs.get("showSearchTermsFeatureGate");
+    };
+    NimbusFeatures.urlbar.onUpdate(onNimbus);
+
+    // Add observer of Search Bar preference as showSearchTerms
+    // can't be shown/hidden while Search Bar is enabled.
+    let searchBarPref = Preferences.get("browser.search.widget.inNavBar");
+    let updateCheckboxHidden = () => {
+      checkbox.hidden =
+        !UrlbarPrefs.get("showSearchTermsFeatureGate") || searchBarPref.value;
+    };
+    searchBarPref.on("change", updateCheckboxHidden);
+
+    // Fire once to initialize.
+    onNimbus();
+    updateCheckboxHidden();
+
+    window.addEventListener("unload", () => {
+      NimbusFeatures.urlbar.offUpdate(onNimbus);
+    });
+  },
+
+  _updatePrivateEngineDisplayBoxes() {
+    const separateEnabled = this._separatePrivateDefaultEnabledPref.value;
+    document.getElementById("browserSeparateDefaultEngine").hidden =
+      !separateEnabled;
+
+    const separateDefault = this._separatePrivateDefaultPref.value;
+
+    const vbox = document.getElementById("browserPrivateEngineSelection");
+    vbox.hidden = !separateEnabled || !separateDefault;
+  },
+
+  _onBrowserSeparateDefaultEngineChange(event) {
+    this._separatePrivateDefaultPref.value = !event.target.checked;
+  },
+
+  _updateSuggestionCheckboxes() {
+    if (this._skipUpdateSuggestionCheckboxesFromPrefChanges) {
+      return;
+    }
+    let suggestsPref = Preferences.get("browser.search.suggest.enabled");
+    let permanentPB = Services.prefs.getBoolPref(
+      "browser.privatebrowsing.autostart"
+    );
+    let urlbarSuggests = document.getElementById("urlBarSuggestion");
+    let suggestionsInSearchFieldsCheckbox = document.getElementById(
+      "suggestionsInSearchFieldsCheckbox"
+    );
+    let positionCheckbox = document.getElementById(
+      "showSearchSuggestionsFirstCheckbox"
+    );
+    let privateWindowCheckbox = document.getElementById(
+      "showSearchSuggestionsPrivateWindows"
+    );
+    let urlbarSuggestsPref = Preferences.get("browser.urlbar.suggest.searches");
+    let searchBarPref = Preferences.get("browser.search.widget.inNavBar");
+
+    suggestionsInSearchFieldsCheckbox.checked =
+      suggestsPref.value &&
+      (searchBarPref.value ? true : urlbarSuggestsPref.value);
+
+    urlbarSuggests.disabled = !suggestsPref.value || permanentPB;
+    urlbarSuggests.hidden = !searchBarPref.value;
+
+    privateWindowCheckbox.disabled = !suggestsPref.value;
+    privateWindowCheckbox.checked = Preferences.get(
+      "browser.search.suggest.enabled.private"
+    ).value;
+    if (privateWindowCheckbox.disabled) {
+      privateWindowCheckbox.checked = false;
+    }
+
+    urlbarSuggests.checked = urlbarSuggestsPref.value;
+    if (urlbarSuggests.disabled) {
+      urlbarSuggests.checked = false;
+    }
+    if (urlbarSuggests.checked) {
+      positionCheckbox.disabled = false;
+      // Update the checked state of the show-suggestions-first checkbox.  Note
+      // that this does *not* also update its pref, it only checks the box.
+      positionCheckbox.checked = Preferences.get(
+        positionCheckbox.getAttribute("preference")
+      ).value;
+    } else {
+      positionCheckbox.disabled = true;
+      positionCheckbox.checked = false;
+    }
+    if (
+      suggestionsInSearchFieldsCheckbox.checked &&
+      !searchBarPref.value &&
+      !urlbarSuggests.checked
+    ) {
+      urlbarSuggestsPref.value = true;
+    }
+
+    let permanentPBLabel = document.getElementById(
+      "urlBarSuggestionPermanentPBLabel"
+    );
+    permanentPBLabel.hidden = urlbarSuggests.hidden || !permanentPB;
+
+    this._updateTrendingCheckbox(!suggestsPref.value || permanentPB);
+  },
+
+  _showAddEngineButton() {
+    let aliasRefresh = Services.prefs.getBoolPref(
+      "browser.urlbar.update2.engineAliasRefresh",
+      false
+    );
+    if (aliasRefresh) {
+      let addButton = document.getElementById("addEngineButton");
+      addButton.hidden = false;
+    }
+  },
+
+  _initRecentSeachesCheckbox() {
+    this._recentSearchesEnabledPref = Preferences.get(
+      "browser.urlbar.recentsearches.featureGate"
+    );
+    let recentSearchesCheckBox = document.getElementById(
+      "enableRecentSearches"
+    );
+    const listener = () => {
+      recentSearchesCheckBox.hidden = !this._recentSearchesEnabledPref.value;
+    };
+
+    this._recentSearchesEnabledPref.on("change", listener);
+    listener();
+  },
+
+  async _updateTrendingCheckbox(suggestDisabled) {
+    let trendingBox = document.getElementById("showTrendingSuggestionsBox");
+    let trendingCheckBox = document.getElementById("showTrendingSuggestions");
+    let trendingSupported = TRENDING_ENGINES.includes(
+      (await Services.search.getDefault()).name
+    );
+    trendingBox.hidden = !Preferences.get("browser.urlbar.trending.featureGate")
+      .value;
+    trendingCheckBox.disabled = suggestDisabled || !trendingSupported;
+  },
+
+  /**
+   * Builds the default and private engines drop down lists. This is called
+   * each time something affects the list of engines.
+   */
+  async buildDefaultEngineDropDowns() {
+    await this._buildEngineDropDown(
+      document.getElementById("defaultEngine"),
+      (
+        await Services.search.getDefault()
+      ).name,
+      false
+    );
+
+    if (this._separatePrivateDefaultEnabledPref.value) {
+      await this._buildEngineDropDown(
+        document.getElementById("defaultPrivateEngine"),
+        (
+          await Services.search.getDefaultPrivate()
+        ).name,
+        true
+      );
+    }
+  },
+
+  // ADDRESS BAR
+
+  /**
+   * Initializes the address bar section.
+   */
+  _initAddressBar() {
+    // Update the Firefox Suggest section when its Nimbus config changes.
+    let onNimbus = () => this._updateFirefoxSuggestSection();
+    NimbusFeatures.urlbar.onUpdate(onNimbus);
+    window.addEventListener("unload", () => {
+      NimbusFeatures.urlbar.offUpdate(onNimbus);
+    });
+
+    // The Firefox Suggest info box potentially needs updating when any of the
+    // toggles change.
+    let infoBoxPrefs = [
+      "browser.urlbar.suggest.quicksuggest.nonsponsored",
+      "browser.urlbar.suggest.quicksuggest.sponsored",
+      "browser.urlbar.quicksuggest.dataCollection.enabled",
+    ];
+    for (let pref of infoBoxPrefs) {
+      Preferences.get(pref).on("change", () =>
+        this._updateFirefoxSuggestInfoBox()
+      );
+    }
+
+    document.getElementById("clipboardSuggestion").hidden = !UrlbarPrefs.get(
+      "clipboard.featureGate"
+    );
+
+    this._updateFirefoxSuggestSection(true);
+    this._initQuickActionsSection();
+  },
+
+  /**
+   * Updates the Firefox Suggest section (in the address bar section) depending
+   * on whether the user is enrolled in a Firefox Suggest rollout.
+   *
+   * @param {boolean} [onInit]
+   *   Pass true when calling this when initializing the pane.
+   */
+  _updateFirefoxSuggestSection(onInit = false) {
+    let container = document.getElementById("firefoxSuggestContainer");
+
+    if (UrlbarPrefs.get("quickSuggestEnabled")) {
+      // Update the l10n IDs of text elements.
+      let l10nIdByElementId = {
+        locationBarGroupHeader: "addressbar-header-firefox-suggest",
+        locationBarSuggestionLabel: "addressbar-suggest-firefox-suggest",
+      };
+      for (let [elementId, l10nId] of Object.entries(l10nIdByElementId)) {
+        let element = document.getElementById(elementId);
+        element.dataset.l10nIdOriginal ??= element.dataset.l10nId;
+        element.dataset.l10nId = l10nId;
+      }
+
+      // Show the container.
+      this._updateFirefoxSuggestInfoBox();
+
+      this._updateDismissedSuggestionsStatus();
+      Preferences.get(PREF_URLBAR_QUICKSUGGEST_BLOCKLIST).on("change", () =>
+        this._updateDismissedSuggestionsStatus()
+      );
+      Preferences.get(PREF_URLBAR_WEATHER_USER_ENABLED).on("change", () =>
+        this._updateDismissedSuggestionsStatus()
+      );
+      setEventListener("restoreDismissedSuggestions", "command", () =>
+        this.restoreDismissedSuggestions()
+      );
+
+      container.removeAttribute("hidden");
+    } else if (!onInit) {
+      // Firefox Suggest is not enabled. This is the default, so to avoid
+      // accidentally messing anything up, only modify the doc if we're being
+      // called due to a change in the rollout-enabled status (!onInit).
+      container.setAttribute("hidden", "true");
+      let elementIds = ["locationBarGroupHeader", "locationBarSuggestionLabel"];
+      for (let id of elementIds) {
+        let element = document.getElementById(id);
+        element.dataset.l10nId = element.dataset.l10nIdOriginal;
+        delete element.dataset.l10nIdOriginal;
+        document.l10n.translateElements([element]);
+      }
+    }
+  },
+
+  /**
+   * Updates the Firefox Suggest info box (in the address bar section) depending
+   * on the states of the Firefox Suggest toggles.
+   */
+  _updateFirefoxSuggestInfoBox() {
+    let nonsponsored = Preferences.get(
+      "browser.urlbar.suggest.quicksuggest.nonsponsored"
+    ).value;
+    let sponsored = Preferences.get(
+      "browser.urlbar.suggest.quicksuggest.sponsored"
+    ).value;
+    let dataCollection = Preferences.get(
+      "browser.urlbar.quicksuggest.dataCollection.enabled"
+    ).value;
+
+    // Get the l10n ID of the appropriate text based on the values of the three
+    // prefs.
+    let l10nId;
+    if (nonsponsored && sponsored && dataCollection) {
+      l10nId = "addressbar-firefox-suggest-info-all";
+    } else if (nonsponsored && sponsored && !dataCollection) {
+      l10nId = "addressbar-firefox-suggest-info-nonsponsored-sponsored";
+    } else if (nonsponsored && !sponsored && dataCollection) {
+      l10nId = "addressbar-firefox-suggest-info-nonsponsored-data";
+    } else if (nonsponsored && !sponsored && !dataCollection) {
+      l10nId = "addressbar-firefox-suggest-info-nonsponsored";
+    } else if (!nonsponsored && sponsored && dataCollection) {
+      l10nId = "addressbar-firefox-suggest-info-sponsored-data";
+    } else if (!nonsponsored && sponsored && !dataCollection) {
+      l10nId = "addressbar-firefox-suggest-info-sponsored";
+    } else if (!nonsponsored && !sponsored && dataCollection) {
+      l10nId = "addressbar-firefox-suggest-info-data";
+    }
+
+    let instance = (this._firefoxSuggestInfoBoxInstance = {});
+    let infoBox = document.getElementById("firefoxSuggestInfoBox");
+    if (!l10nId) {
+      infoBox.hidden = true;
+    } else {
+      let infoText = document.getElementById("firefoxSuggestInfoText");
+      infoText.dataset.l10nId = l10nId;
+
+      // If the info box is currently hidden and we unhide it immediately, it
+      // will show its old text until the new text is asyncly fetched and shown.
+      // That's ugly, so wait for the fetch to finish before unhiding it.
+      document.l10n.translateElements([infoText]).then(() => {
+        if (instance == this._firefoxSuggestInfoBoxInstance) {
+          infoBox.hidden = false;
+        }
+      });
+    }
+  },
+
+  _initQuickActionsSection() {
+    let showPref = Preferences.get("browser.urlbar.quickactions.showPrefs");
+    let showQuickActionsGroup = () => {
+      document.getElementById("quickActionsBox").hidden = !showPref.value;
+    };
+    showPref.on("change", showQuickActionsGroup);
+    showQuickActionsGroup();
+  },
+
+  /**
+   * Enables/disables the "Restore" button for dismissed Firefox Suggest
+   * suggestions.
+   */
+  _updateDismissedSuggestionsStatus() {
+    document.getElementById("restoreDismissedSuggestions").disabled =
+      !Services.prefs.prefHasUserValue(PREF_URLBAR_QUICKSUGGEST_BLOCKLIST) &&
+      !(
+        Services.prefs.prefHasUserValue(PREF_URLBAR_WEATHER_USER_ENABLED) &&
+        !Services.prefs.getBoolPref(PREF_URLBAR_WEATHER_USER_ENABLED)
+      );
+  },
+
+  /**
+   * Restores Firefox Suggest suggestions dismissed by the user.
+   */
+  restoreDismissedSuggestions() {
+    Services.prefs.clearUserPref(PREF_URLBAR_QUICKSUGGEST_BLOCKLIST);
+    Services.prefs.clearUserPref(PREF_URLBAR_WEATHER_USER_ENABLED);
+  },
+
+  /**
+   * Builds a drop down menu of search engines.
+   *
+   * @param {DOMMenuList} list
+   *   The menu list element to attach the list of engines.
+   * @param {string} currentEngine
+   *   The name of the current default engine.
+   * @param {boolean} isPrivate
+   *   True if we are dealing with the default engine for private mode.
+   */
+  async _buildEngineDropDown(list, currentEngine, isPrivate) {
+    // If the current engine isn't in the list any more, select the first item.
+    let engines = gEngineView._engineStore._engines;
+    if (!engines.length) {
+      return;
+    }
+    if (!engines.some(e => e.name == currentEngine)) {
+      currentEngine = engines[0].name;
+    }
+
+    // Now clean-up and rebuild the list.
+    list.removeAllItems();
+    gEngineView._engineStore._engines.forEach(e => {
+      let item = list.appendItem(e.name);
+      item.setAttribute(
+        "class",
+        "menuitem-iconic searchengine-menuitem menuitem-with-favicon"
+      );
+      if (e.iconURL) {
+        item.setAttribute("image", e.iconURL);
+      }
+      item.engine = e;
+      if (e.name == currentEngine) {
+        list.selectedItem = item;
+      }
+    });
+  },
+
+  handleEvent(aEvent) {
+    switch (aEvent.type) {
+      case "dblclick":
+        if (aEvent.target.id == "engineChildren") {
+          let cell = aEvent.target.parentNode.getCellAt(
+            aEvent.clientX,
+            aEvent.clientY
+          );
+          if (cell.col?.id == "engineKeyword") {
+            this.startEditingAlias(gEngineView.selectedIndex);
+          }
+        }
+        break;
+      case "click":
+        if (
+          aEvent.target.id != "engineChildren" &&
+          !aEvent.target.classList.contains("searchEngineAction")
+        ) {
+          let engineList = document.getElementById("engineList");
+          // We don't want to toggle off selection while editing keyword
+          // so proceed only when the input field is hidden.
+          // We need to check that engineList.view is defined here
+          // because the "click" event listener is on <window> and the
+          // view might have been destroyed if the pane has been navigated
+          // away from.
+          if (engineList.inputField.hidden && engineList.view) {
+            let selection = engineList.view.selection;
+            if (selection?.count > 0) {
+              selection.toggleSelect(selection.currentIndex);
+            }
+            engineList.blur();
+          }
+        }
+        break;
+      case "command":
+        switch (aEvent.target.id) {
+          case "":
+            if (
+              aEvent.target.parentNode &&
+              aEvent.target.parentNode.parentNode
+            ) {
+              if (aEvent.target.parentNode.parentNode.id == "defaultEngine") {
+                gSearchPane.setDefaultEngine();
+              } else if (
+                aEvent.target.parentNode.parentNode.id == "defaultPrivateEngine"
+              ) {
+                gSearchPane.setDefaultPrivateEngine();
+              }
+            }
+            break;
+          case "restoreDefaultSearchEngines":
+            gSearchPane.onRestoreDefaults();
+            break;
+          case "removeEngineButton":
+            Services.search.removeEngine(
+              gEngineView.selectedEngine.originalEngine
+            );
+            break;
+          case "addEngineButton":
+            gSubDialog.open(
+              "chrome://browser/content/preferences/dialogs/addEngine.xhtml",
+              { features: "resizable=no, modal=yes" }
+            );
+            break;
+        }
+        break;
+      case "dragstart":
+        if (aEvent.target.id == "engineChildren") {
+          onDragEngineStart(aEvent);
+        }
+        break;
+      case "keypress":
+        if (aEvent.target.id == "engineList") {
+          gSearchPane.onTreeKeyPress(aEvent);
+        }
+        break;
+      case "select":
+        if (aEvent.target.id == "engineList") {
+          gSearchPane.onTreeSelect();
+        }
+        break;
+    }
+  },
+
+  /**
+   * Handle when the app locale is changed.
+   */
+  async appLocalesChanged() {
+    await document.l10n.ready;
+    await gEngineView.loadL10nNames();
+  },
+
+  /**
+   * Update the default engine UI and engine tree view as appropriate when engine changes
+   * or locale changes occur.
+   *
+   * @param {Object} engine
+   * @param {string} data
+   */
+  browserSearchEngineModified(engine, data) {
+    engine.QueryInterface(Ci.nsISearchEngine);
+    switch (data) {
+      case "engine-added":
+        gEngineView._engineStore.addEngine(engine);
+        gEngineView.rowCountChanged(gEngineView.lastEngineIndex, 1);
+        gSearchPane.buildDefaultEngineDropDowns();
+        break;
+      case "engine-changed":
+        gSearchPane.buildDefaultEngineDropDowns();
+        gEngineView._engineStore.updateEngine(engine);
+        gEngineView.invalidate();
+        break;
+      case "engine-removed":
+        gSearchPane.remove(engine);
+        break;
+      case "engine-default": {
+        // If the user is going through the drop down using up/down keys, the
+        // dropdown may still be open (eg. on Windows) when engine-default is
+        // fired, so rebuilding the list unconditionally would get in the way.
+        let selectedEngine =
+          document.getElementById("defaultEngine").selectedItem.engine;
+        if (selectedEngine.name != engine.name) {
+          gSearchPane.buildDefaultEngineDropDowns();
+        }
+        gSearchPane._updateSuggestionCheckboxes();
+        break;
+      }
+      case "engine-default-private": {
+        if (
+          this._separatePrivateDefaultEnabledPref.value &&
+          this._separatePrivateDefaultPref.value
+        ) {
+          // If the user is going through the drop down using up/down keys, the
+          // dropdown may still be open (eg. on Windows) when engine-default is
+          // fired, so rebuilding the list unconditionally would get in the way.
+          const selectedEngine = document.getElementById("defaultPrivateEngine")
+            .selectedItem.engine;
+          if (selectedEngine.name != engine.name) {
+            gSearchPane.buildDefaultEngineDropDowns();
+          }
+        }
+        break;
+      }
+    }
+  },
+
+  /**
+   * nsIObserver implementation.
+   */
+  observe(subject, topic, data) {
+    switch (topic) {
+      case "intl:app-locales-changed": {
+        this.appLocalesChanged();
+        break;
+      }
+      case "browser-search-engine-modified": {
+        this.browserSearchEngineModified(subject, data);
+        break;
+      }
+    }
+  },
+
+  onTreeSelect() {
+    document.getElementById("removeEngineButton").disabled =
+      !gEngineView.isEngineSelectedAndRemovable();
+  },
+
+  onTreeKeyPress(aEvent) {
+    let index = gEngineView.selectedIndex;
+    let tree = document.getElementById("engineList");
+    if (tree.hasAttribute("editing")) {
+      return;
+    }
+
+    if (aEvent.charCode == KeyEvent.DOM_VK_SPACE) {
+      // Space toggles the checkbox.
+      let newValue = !gEngineView.getCellValue(
+        index,
+        tree.columns.getNamedColumn("engineShown")
+      );
+      gEngineView.setCellValue(
+        index,
+        tree.columns.getFirstColumn(),
+        newValue.toString()
+      );
+      // Prevent page from scrolling on the space key.
+      aEvent.preventDefault();
+    } else {
+      let isMac = Services.appinfo.OS == "Darwin";
+      if (
+        (isMac && aEvent.keyCode == KeyEvent.DOM_VK_RETURN) ||
+        (!isMac && aEvent.keyCode == KeyEvent.DOM_VK_F2)
+      ) {
+        this.startEditingAlias(index);
+      } else if (
+        aEvent.keyCode == KeyEvent.DOM_VK_DELETE ||
+        (isMac &&
+          aEvent.shiftKey &&
+          aEvent.keyCode == KeyEvent.DOM_VK_BACK_SPACE &&
+          gEngineView.isEngineSelectedAndRemovable())
+      ) {
+        // Delete and Shift+Backspace (Mac) removes selected engine.
+        Services.search.removeEngine(gEngineView.selectedEngine.originalEngine);
+      }
+    }
+  },
+
+  startEditingAlias(index) {
+    // Local shortcut aliases can't be edited.
+    if (gEngineView._getLocalShortcut(index)) {
+      return;
+    }
+
+    let tree = document.getElementById("engineList");
+    let engine = gEngineView._engineStore.engines[index];
+    tree.startEditing(index, tree.columns.getLastColumn());
+    tree.inputField.value = engine.alias || "";
+    tree.inputField.select();
+  },
+
+  async onRestoreDefaults() {
+    let num = await gEngineView._engineStore.restoreDefaultEngines();
+    gEngineView.rowCountChanged(0, num);
+    gEngineView.invalidate();
+  },
+
+  showRestoreDefaults(aEnable) {
+    document.getElementById("restoreDefaultSearchEngines").disabled = !aEnable;
+  },
+
+  remove(aEngine) {
+    let index = gEngineView._engineStore.removeEngine(aEngine);
+    if (!gEngineView.tree) {
+      // Only update the selection if it's visible in the UI.
+      return;
+    }
+
+    gEngineView.rowCountChanged(index, -1);
+    gEngineView.invalidate();
+
+    gEngineView.selection.select(Math.min(index, gEngineView.rowCount - 1));
+    gEngineView.ensureRowIsVisible(gEngineView.currentIndex);
+
+    document.getElementById("engineList").focus();
+  },
+
+  async editKeyword(aEngine, aNewKeyword) {
+    let keyword = aNewKeyword.trim();
+    if (keyword) {
+      let eduplicate = false;
+      let dupName = "";
+
+      // Check for duplicates in Places keywords.
+      let bduplicate = !!(await PlacesUtils.keywords.fetch(keyword));
+
+      // Check for duplicates in changes we haven't committed yet
+      let engines = gEngineView._engineStore.engines;
+      let lc_keyword = keyword.toLocaleLowerCase();
+      for (let engine of engines) {
+        if (
+          engine.alias &&
+          engine.alias.toLocaleLowerCase() == lc_keyword &&
+          engine.name != aEngine.name
+        ) {
+          eduplicate = true;
+          dupName = engine.name;
+          break;
+        }
+      }
+
+      // Notify the user if they have chosen an existing engine/bookmark keyword
+      if (eduplicate || bduplicate) {
+        let msgids = [{ id: "search-keyword-warning-title" }];
+        if (eduplicate) {
+          msgids.push({
+            id: "search-keyword-warning-engine",
+            args: { name: dupName },
+          });
+        } else {
+          msgids.push({ id: "search-keyword-warning-bookmark" });
+        }
+
+        let [dtitle, msg] = await document.l10n.formatValues(msgids);
+
+        Services.prompt.alert(window, dtitle, msg);
+        return false;
+      }
+    }
+
+    gEngineView._engineStore.changeEngine(aEngine, "alias", keyword);
+    gEngineView.invalidate();
+    return true;
+  },
+
+  async setDefaultEngine() {
+    await Services.search.setDefault(
+      document.getElementById("defaultEngine").selectedItem.engine,
+      Ci.nsISearchService.CHANGE_REASON_USER
+    );
+    if (ExtensionSettingsStore.getSetting(SEARCH_TYPE, SEARCH_KEY) !== null) {
+      ExtensionSettingsStore.select(
+        ExtensionSettingsStore.SETTING_USER_SET,
+        SEARCH_TYPE,
+        SEARCH_KEY
+      );
+    }
+  },
+
+  async setDefaultPrivateEngine() {
+    await Services.search.setDefaultPrivate(
+      document.getElementById("defaultPrivateEngine").selectedItem.engine,
+      Ci.nsISearchService.CHANGE_REASON_USER
+    );
+  },
+};
+
+function onDragEngineStart(event) {
+  var selectedIndex = gEngineView.selectedIndex;
+
+  // Local shortcut rows can't be dragged or re-ordered.
+  if (gEngineView._getLocalShortcut(selectedIndex)) {
+    event.preventDefault();
+    return;
+  }
+
+  var tree = document.getElementById("engineList");
+  let cell = tree.getCellAt(event.clientX, event.clientY);
+  if (selectedIndex >= 0 && !gEngineView.isCheckBox(cell.row, cell.col)) {
+    event.dataTransfer.setData(ENGINE_FLAVOR, selectedIndex.toString());
+    event.dataTransfer.effectAllowed = "move";
+  }
+}
+
+function EngineStore() {
+  this._engines = [];
+  this._defaultEngines = [];
+  Promise.all([
+    Services.search.getVisibleEngines(),
+    Services.search.getAppProvidedEngines(),
+  ]).then(([visibleEngines, defaultEngines]) => {
+    for (let engine of visibleEngines) {
+      this.addEngine(engine);
+      gEngineView.rowCountChanged(gEngineView.lastEngineIndex, 1);
+    }
+    this._defaultEngines = defaultEngines.map(this._cloneEngine, this);
+    gSearchPane.buildDefaultEngineDropDowns();
+
+    // check if we need to disable the restore defaults button
+    var someHidden = this._defaultEngines.some(e => e.hidden);
+    gSearchPane.showRestoreDefaults(someHidden);
+  });
+}
+EngineStore.prototype = {
+  _engines: null,
+  _defaultEngines: null,
+
+  get engines() {
+    return this._engines;
+  },
+  set engines(val) {
+    this._engines = val;
+  },
+
+  _getIndexForEngine(aEngine) {
+    return this._engines.indexOf(aEngine);
+  },
+
+  _getEngineByName(aName) {
+    return this._engines.find(engine => engine.name == aName);
+  },
+
+  _cloneEngine(aEngine) {
+    var clonedObj = {
+      iconURL: aEngine.getIconURL(),
+    };
+    for (let i of ["id", "name", "alias", "hidden"]) {
+      clonedObj[i] = aEngine[i];
+    }
+    clonedObj.originalEngine = aEngine;
+    return clonedObj;
+  },
+
+  // Callback for Array's some(). A thisObj must be passed to some()
+  _isSameEngine(aEngineClone) {
+    return aEngineClone.originalEngine.id == this.originalEngine.id;
+  },
+
+  addEngine(aEngine) {
+    this._engines.push(this._cloneEngine(aEngine));
+  },
+
+  updateEngine(newEngine) {
+    let engineToUpdate = this._engines.findIndex(
+      e => e.originalEngine.id == newEngine.id
+    );
+    if (engineToUpdate != -1) {
+      this.engines[engineToUpdate] = this._cloneEngine(newEngine);
+    }
+  },
+
+  moveEngine(aEngine, aNewIndex) {
+    if (aNewIndex < 0 || aNewIndex > this._engines.length - 1) {
+      throw new Error("ES_moveEngine: invalid aNewIndex!");
+    }
+    var index = this._getIndexForEngine(aEngine);
+    if (index == -1) {
+      throw new Error("ES_moveEngine: invalid engine?");
+    }
+
+    if (index == aNewIndex) {
+      return Promise.resolve();
+    } // nothing to do
+
+    // Move the engine in our internal store
+    var removedEngine = this._engines.splice(index, 1)[0];
+    this._engines.splice(aNewIndex, 0, removedEngine);
+
+    return Services.search.moveEngine(aEngine.originalEngine, aNewIndex);
+  },
+
+  removeEngine(aEngine) {
+    if (this._engines.length == 1) {
+      throw new Error("Cannot remove last engine!");
+    }
+
+    let engineName = aEngine.name;
+    let index = this._engines.findIndex(element => element.name == engineName);
+
+    if (index == -1) {
+      throw new Error("invalid engine?");
+    }
+
+    this._engines.splice(index, 1)[0];
+
+    if (aEngine.isAppProvided) {
+      gSearchPane.showRestoreDefaults(true);
+    }
+    gSearchPane.buildDefaultEngineDropDowns();
+    return index;
+  },
+
+  async restoreDefaultEngines() {
+    var added = 0;
+
+    for (var i = 0; i < this._defaultEngines.length; ++i) {
+      var e = this._defaultEngines[i];
+
+      // If the engine is already in the list, just move it.
+      if (this._engines.some(this._isSameEngine, e)) {
+        await this.moveEngine(this._getEngineByName(e.name), i);
+      } else {
+        // Otherwise, add it back to our internal store
+
+        // The search service removes the alias when an engine is hidden,
+        // so clear any alias we may have cached before unhiding the engine.
+        e.alias = "";
+
+        this._engines.splice(i, 0, e);
+        let engine = e.originalEngine;
+        engine.hidden = false;
+        await Services.search.moveEngine(engine, i);
+        added++;
+      }
+    }
+
+    // We can't do this as part of the loop above because the indices are
+    // used for moving engines.
+    let policyRemovedEngineNames =
+      Services.policies.getActivePolicies()?.SearchEngines?.Remove || [];
+    for (let engineName of policyRemovedEngineNames) {
+      let engine = Services.search.getEngineByName(engineName);
+      if (engine) {
+        try {
+          await Services.search.removeEngine(engine);
+        } catch (ex) {
+          // Engine might not exist
+        }
+      }
+    }
+
+    Services.search.resetToAppDefaultEngine();
+    gSearchPane.showRestoreDefaults(false);
+    gSearchPane.buildDefaultEngineDropDowns();
+    return added;
+  },
+
+  changeEngine(aEngine, aProp, aNewValue) {
+    var index = this._getIndexForEngine(aEngine);
+    if (index == -1) {
+      throw new Error("invalid engine?");
+    }
+
+    this._engines[index][aProp] = aNewValue;
+    aEngine.originalEngine[aProp] = aNewValue;
+  },
+};
+
+function EngineView(aEngineStore) {
+  this._engineStore = aEngineStore;
+
+  UrlbarPrefs.addObserver(this);
+
+  this.loadL10nNames();
+}
+
+EngineView.prototype = {
+  _engineStore: null,
+  tree: null,
+
+  loadL10nNames() {
+    // This maps local shortcut sources to their l10n names.  The names are needed
+    // by getCellText.  Getting the names is async but getCellText is not, so we
+    // cache them here to retrieve them syncronously in getCellText.
+    this._localShortcutL10nNames = new Map();
+    return document.l10n
+      .formatValues(
+        UrlbarUtils.LOCAL_SEARCH_MODES.map(mode => {
+          let name = UrlbarUtils.getResultSourceName(mode.source);
+          return { id: `urlbar-search-mode-${name}` };
+        })
+      )
+      .then(names => {
+        for (let { source } of UrlbarUtils.LOCAL_SEARCH_MODES) {
+          this._localShortcutL10nNames.set(source, names.shift());
+        }
+        // Invalidate the tree now that we have the names in case getCellText was
+        // called before name retrieval finished.
+        this.invalidate();
+      });
+  },
+
+  get lastEngineIndex() {
+    return this._engineStore.engines.length - 1;
+  },
+
+  get selectedIndex() {
+    var seln = this.selection;
+    if (seln.getRangeCount() > 0) {
+      var min = {};
+      seln.getRangeAt(0, min, {});
+      return min.value;
+    }
+    return -1;
+  },
+
+  get selectedEngine() {
+    return this._engineStore.engines[this.selectedIndex];
+  },
+
+  // Helpers
+  rowCountChanged(index, count) {
+    if (this.tree) {
+      this.tree.rowCountChanged(index, count);
+    }
+  },
+
+  invalidate() {
+    this.tree?.invalidate();
+  },
+
+  ensureRowIsVisible(index) {
+    this.tree.ensureRowIsVisible(index);
+  },
+
+  getSourceIndexFromDrag(dataTransfer) {
+    return parseInt(dataTransfer.getData(ENGINE_FLAVOR));
+  },
+
+  isCheckBox(index, column) {
+    return column.id == "engineShown";
+  },
+
+  isEngineSelectedAndRemovable() {
+    let defaultEngine = Services.search.defaultEngine;
+    let defaultPrivateEngine = Services.search.defaultPrivateEngine;
+    // We don't allow the last remaining engine to be removed, thus the
+    // `this.lastEngineIndex != 0` check.
+    // We don't allow the default engine to be removed.
+    return (
+      this.selectedIndex != -1 &&
+      this.lastEngineIndex != 0 &&
+      !this._getLocalShortcut(this.selectedIndex) &&
+      this.selectedEngine.name != defaultEngine.name &&
+      this.selectedEngine.name != defaultPrivateEngine.name
+    );
+  },
+
+  /**
+   * Returns the local shortcut corresponding to a tree row, or null if the row
+   * is not a local shortcut.
+   *
+   * @param {number} index
+   *   The tree row index.
+   * @returns {object}
+   *   The local shortcut object or null if the row is not a local shortcut.
+   */
+  _getLocalShortcut(index) {
+    let engineCount = this._engineStore.engines.length;
+    if (index < engineCount) {
+      return null;
+    }
+    return UrlbarUtils.LOCAL_SEARCH_MODES[index - engineCount];
+  },
+
+  /**
+   * Called by UrlbarPrefs when a urlbar pref changes.
+   *
+   * @param {string} pref
+   *   The name of the pref relative to the browser.urlbar branch.
+   */
+  onPrefChanged(pref) {
+    // If one of the local shortcut prefs was toggled, toggle its row's
+    // checkbox.
+    let parts = pref.split(".");
+    if (parts[0] == "shortcuts" && parts[1] && parts.length == 2) {
+      this.invalidate();
+    }
+  },
+
+  // nsITreeView
+  get rowCount() {
+    return (
+      this._engineStore.engines.length + UrlbarUtils.LOCAL_SEARCH_MODES.length
+    );
+  },
+
+  getImageSrc(index, column) {
+    if (column.id == "engineName") {
+      let shortcut = this._getLocalShortcut(index);
+      if (shortcut) {
+        return shortcut.icon;
+      }
+
+      if (this._engineStore.engines[index].iconURL) {
+        return this._engineStore.engines[index].iconURL;
+      }
+
+      if (window.devicePixelRatio > 1) {
+        return "chrome://browser/skin/search-engine-placeholder@2x.png";
+      }
+      return "chrome://browser/skin/search-engine-placeholder.png";
+    }
+
+    return "";
+  },
+
+  getCellText(index, column) {
+    if (column.id == "engineName") {
+      let shortcut = this._getLocalShortcut(index);
+      if (shortcut) {
+        return this._localShortcutL10nNames.get(shortcut.source) || "";
+      }
+      return this._engineStore.engines[index].name;
+    } else if (column.id == "engineKeyword") {
+      let shortcut = this._getLocalShortcut(index);
+      if (shortcut) {
+        return shortcut.restrict;
+      }
+      return this._engineStore.engines[index].originalEngine.aliases.join(", ");
+    }
+    return "";
+  },
+
+  setTree(tree) {
+    this.tree = tree;
+  },
+
+  canDrop(targetIndex, orientation, dataTransfer) {
+    var sourceIndex = this.getSourceIndexFromDrag(dataTransfer);
+    return (
+      sourceIndex != -1 &&
+      sourceIndex != targetIndex &&
+      sourceIndex != targetIndex + orientation &&
+      // Local shortcut rows can't be dragged or dropped on.
+      targetIndex < this._engineStore.engines.length
+    );
+  },
+
+  async drop(dropIndex, orientation, dataTransfer) {
+    // Local shortcut rows can't be dragged or dropped on.  This can sometimes
+    // be reached even though canDrop returns false for these rows.
+    if (this._engineStore.engines.length <= dropIndex) {
+      return;
+    }
+
+    var sourceIndex = this.getSourceIndexFromDrag(dataTransfer);
+    var sourceEngine = this._engineStore.engines[sourceIndex];
+
+    const nsITreeView = Ci.nsITreeView;
+    if (dropIndex > sourceIndex) {
+      if (orientation == nsITreeView.DROP_BEFORE) {
+        dropIndex--;
+      }
+    } else if (orientation == nsITreeView.DROP_AFTER) {
+      dropIndex++;
+    }
+
+    await this._engineStore.moveEngine(sourceEngine, dropIndex);
+    gSearchPane.showRestoreDefaults(true);
+    gSearchPane.buildDefaultEngineDropDowns();
+
+    // Redraw, and adjust selection
+    this.invalidate();
+    this.selection.select(dropIndex);
+  },
+
+  selection: null,
+  getRowProperties(index) {
+    return "";
+  },
+  getCellProperties(index, column) {
+    if (column.id == "engineName") {
+      // For local shortcut rows, return the result source name so we can style
+      // the icons in CSS.
+      let shortcut = this._getLocalShortcut(index);
+      if (shortcut) {
+        return UrlbarUtils.getResultSourceName(shortcut.source);
+      }
+    }
+    return "";
+  },
+  getColumnProperties(column) {
+    return "";
+  },
+  isContainer(index) {
+    return false;
+  },
+  isContainerOpen(index) {
+    return false;
+  },
+  isContainerEmpty(index) {
+    return false;
+  },
+  isSeparator(index) {
+    return false;
+  },
+  isSorted(index) {
+    return false;
+  },
+  getParentIndex(index) {
+    return -1;
+  },
+  hasNextSibling(parentIndex, index) {
+    return false;
+  },
+  getLevel(index) {
+    return 0;
+  },
+  getCellValue(index, column) {
+    if (column.id == "engineShown") {
+      let shortcut = this._getLocalShortcut(index);
+      if (shortcut) {
+        return UrlbarPrefs.get(shortcut.pref);
+      }
+      return !this._engineStore.engines[index].originalEngine.hideOneOffButton;
+    }
+    return undefined;
+  },
+  toggleOpenState(index) {},
+  cycleHeader(column) {},
+  selectionChanged() {},
+  cycleCell(row, column) {},
+  isEditable(index, column) {
+    return (
+      column.id != "engineName" &&
+      (column.id == "engineShown" || !this._getLocalShortcut(index))
+    );
+  },
+  setCellValue(index, column, value) {
+    if (column.id == "engineShown") {
+      let shortcut = this._getLocalShortcut(index);
+      if (shortcut) {
+        UrlbarPrefs.set(shortcut.pref, value == "true");
+        this.invalidate();
+        return;
+      }
+      this._engineStore.engines[index].originalEngine.hideOneOffButton =
+        value != "true";
+      gEngineView.invalidate();
+    }
+  },
+  setCellText(index, column, value) {
+    if (column.id == "engineKeyword") {
+      gSearchPane
+        .editKeyword(this._engineStore.engines[index], value)
+        .then(valid => {
+          if (!valid) {
+            gSearchPane.startEditingAlias(index);
+          }
+        });
+    }
+  },
+};
diff --git a/browser/components/preferences/searchResults.inc.xhtml b/browser/components/preferences/searchResults.inc.xhtml
new file mode 100644
index 0000000000..48dbeb9a54
--- /dev/null
+++ b/browser/components/preferences/searchResults.inc.xhtml
@@ -0,0 +1,25 @@
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this file,
+   - You can obtain one at http://mozilla.org/MPL/2.0/. -->
+
+<hbox id="header-searchResults"
+      class="subcategory"
+      hidden="true"
+      data-hidden-from-search="true"
+      data-category="paneSearchResults">
+  <html:h1 data-l10n-id="search-results-header"/>
+</hbox>
+
+<groupbox id="no-results-message"
+          data-hidden-from-search="true"
+          data-category="paneSearchResults"
+          hidden="true">
+  <vbox class="no-results-container">
+    <label id="sorry-message" data-l10n-id="search-results-empty-message2">
+      <html:span data-l10n-name="query" id="sorry-message-query"/>
+    </label>
+    <label id="need-help" data-l10n-id="search-results-help-link">
+      <html:a is="moz-support-link" class="text-link" data-l10n-name="url" target="_blank" support-page="preferences"/>
+    </label>
+  </vbox>
+</groupbox>
diff --git a/browser/components/preferences/sync.inc.xhtml b/browser/components/preferences/sync.inc.xhtml
new file mode 100644
index 0000000000..d3af690b93
--- /dev/null
+++ b/browser/components/preferences/sync.inc.xhtml
@@ -0,0 +1,243 @@
+# This Source Code Form is subject to the terms of the Mozilla Public
+# License, v. 2.0. If a copy of the MPL was not distributed with this
+# file, You can obtain one at http://mozilla.org/MPL/2.0/.
+
+<!-- Sync panel -->
+
+<script src="chrome://browser/content/preferences/sync.js"/>
+<html:template id="template-paneSync">
+<hbox id="firefoxAccountCategory"
+      class="subcategory"
+      hidden="true"
+      data-category="paneSync">
+  <html:h1 data-l10n-id="pane-sync-title3"/>
+</hbox>
+
+<deck id="weavePrefsDeck" data-category="paneSync" hidden="true"
+      data-hidden-from-search="true">
+  <groupbox id="noFxaAccount">
+    <hbox>
+      <vbox flex="1">
+        <label id="noFxaCaption"><html:h2 data-l10n-id="sync-signedout-caption"/></label>
+        <description id="noFxaDescription" class="description-deemphasized" flex="1" data-l10n-id="sync-signedout-description2"/>
+      </vbox>
+      <vbox>
+        <image class="fxaSyncIllustration"/>
+      </vbox>
+    </hbox>
+    <hbox id="fxaNoLoginStatus" align="center" flex="1">
+      <vbox flex="1">
+        <hbox align="center" flex="1">
+          <button id="noFxaSignIn"
+                  is="highlightable-button"
+                  class="accessory-button"
+                  data-l10n-id="sync-signedout-account-signin3"/>
+        </hbox>
+      </vbox>
+    </hbox>
+    <label class="fxaMobilePromo" data-l10n-id="sync-mobile-promo">
+      <html:img
+        src="chrome://browser/skin/logo-android.svg"
+        data-l10n-name="android-icon"
+        class="androidIcon"/>
+      <html:a
+        data-l10n-name="android-link"
+        class="fxaMobilePromo-android text-link" target="_blank"/>
+      <html:img
+        src="chrome://browser/skin/logo-ios.svg"
+        data-l10n-name="ios-icon"
+        class="iOSIcon"/>
+      <html:a
+        data-l10n-name="ios-link"
+        class="fxaMobilePromo-ios text-link" target="_blank"/>
+    </label>
+  </groupbox>
+
+  <vbox id="hasFxaAccount">
+    <hbox>
+      <vbox id="fxaContentWrapper" flex="1">
+        <groupbox id="fxaGroup">
+          <label class="search-header" hidden="true"><html:h2 data-l10n-id="pane-sync-title3"/></label>
+
+          <deck id="fxaLoginStatus" flex="1">
+
+            <!-- logged in and verified and all is good -->
+            <hbox id="fxaLoginVerified" align="center" flex="1">
+              <image id="openChangeProfileImage"
+                     class="fxaProfileImage actionable"
+                     role="button"
+                     data-l10n-id="sync-profile-picture"/>
+              <vbox flex="1" pack="center">
+                <hbox flex="1" align="baseline">
+                  <label id="fxaDisplayName" hidden="true">
+                    <html:h2 id="fxaDisplayNameHeading"/>
+                  </label>
+                  <label id="fxaEmailAddress" flex="1" crop="end"/>
+                  <button id="fxaUnlinkButton"
+                          is="highlightable-button"
+                          class="accessory-button"
+                          data-l10n-id="sync-sign-out"/>
+                </hbox>
+                <hbox>
+                  <html:a id="verifiedManage" class="openLink" target="_blank"
+                          data-l10n-id="sync-manage-account"/>
+                </hbox>
+              </vbox>
+            </hbox>
+
+            <!-- logged in to an unverified account -->
+            <hbox id="fxaLoginUnverified">
+              <vbox>
+                <image class="fxaProfileImage"/>
+              </vbox>
+              <vbox flex="1" pack="center">
+                <hbox align="center">
+                  <image class="fxaLoginRejectedWarning"/>
+                  <description flex="1"
+                    class="l10nArgsEmailAddress"
+                    data-l10n-id="sync-signedin-unverified"
+                    data-l10n-args='{"email": ""}'/>
+                </hbox>
+                <hbox class="fxaAccountBoxButtons">
+                  <button id="verifyFxaAccount"
+                          is="highlightable-button"
+                          data-l10n-id="sync-verify-account"/>
+                  <button id="unverifiedUnlinkFxaAccount"
+                          is="highlightable-button"
+                          data-l10n-id="sync-remove-account"/>
+                </hbox>
+              </vbox>
+            </hbox>
+
+            <!-- logged in locally but server rejected credentials -->
+            <hbox id="fxaLoginRejected">
+              <vbox>
+                <image class="fxaProfileImage"/>
+              </vbox>
+              <vbox flex="1" pack="center">
+                <hbox align="center">
+                  <image class="fxaLoginRejectedWarning"/>
+                  <description flex="1"
+                    class="l10nArgsEmailAddress"
+                    data-l10n-id="sync-signedin-login-failure"
+                    data-l10n-args='{"email": ""}'/>
+                </hbox>
+                <hbox class="fxaAccountBoxButtons">
+                  <button id="rejectReSignIn"
+                          is="highlightable-button"
+                          data-l10n-id="sync-sign-in"/>
+                  <button id="rejectUnlinkFxaAccount"
+                          is="highlightable-button"
+                          data-l10n-id="sync-remove-account"/>
+                </hbox>
+              </vbox>
+            </hbox>
+          </deck>
+        </groupbox>
+
+        <groupbox>
+          <label control="fxaSyncComputerName">
+            <html:h2 data-l10n-id="sync-device-name-header"/>
+          </label>
+          <hbox id="fxaDeviceName">
+            <html:input id="fxaSyncComputerName" type="text" disabled="true"/>
+            <button id="fxaChangeDeviceName"
+                    is="highlightable-button"
+                    class="needs-account-ready"
+                    data-l10n-id="sync-device-name-change"/>
+            <button id="fxaCancelChangeDeviceName"
+                    is="highlightable-button"
+                    data-l10n-id="sync-device-name-cancel"
+                    hidden="true"/>
+            <button id="fxaSaveChangeDeviceName"
+                    is="highlightable-button"
+                    data-l10n-id="sync-device-name-save"
+                    hidden="true"/>
+          </hbox>
+        </groupbox>
+
+        <groupbox>
+          <deck id="syncStatus" flex="1">
+            <!-- sync not yet configured. -->
+            <vbox id="syncNotConfigured">
+              <label>
+                <html:h2 data-l10n-id="prefs-syncing-off"/>
+              </label>
+              <hbox class="sync-group info-box-container">
+                <vbox flex="1">
+                  <label data-l10n-id="prefs-sync-offer-setup-label2"/>
+                </vbox>
+                <vbox>
+                  <button id="syncSetup"
+                          is="highlightable-button"
+                          class="accessory-button needs-account-ready"
+                          data-l10n-id="prefs-sync-turn-on-syncing"/>
+                </vbox>
+              </hbox>
+            </vbox>
+
+            <vbox id="syncConfigured">
+              <hbox>
+                <html:h2 data-l10n-id="prefs-syncing-on"/>
+                <spacer flex="1"/>
+                <button id="syncNow"
+                        class="accessory-button needs-account-ready"/>
+              </hbox>
+              <vbox class="sync-group info-box-container sync-configured">
+                <label data-l10n-id="sync-syncing-across-devices-heading"/>
+                <html:div class="sync-engines-list">
+                  <html:div engine_preference="services.sync.engine.bookmarks">
+                    <image class="sync-engine-image sync-engine-bookmarks"/>
+                    <label data-l10n-id="sync-currently-syncing-bookmarks"/>
+                  </html:div>
+                  <html:div engine_preference="services.sync.engine.history">
+                    <image class="sync-engine-image sync-engine-history"/>
+                    <label data-l10n-id="sync-currently-syncing-history"/>
+                  </html:div>
+                  <html:div engine_preference="services.sync.engine.tabs">
+                    <image class="sync-engine-image sync-engine-tabs"/>
+                    <label data-l10n-id="sync-currently-syncing-tabs"/>
+                  </html:div>
+                  <html:div engine_preference="services.sync.engine.passwords">
+                    <image class="sync-engine-image sync-engine-passwords"/>
+                    <label data-l10n-id="sync-currently-syncing-passwords"/>
+                  </html:div>
+                  <html:div engine_preference="services.sync.engine.addresses">
+                    <image class="sync-engine-image sync-engine-addresses"/>
+                    <label data-l10n-id="sync-currently-syncing-addresses"/>
+                  </html:div>
+                  <html:div engine_preference="services.sync.engine.creditcards">
+                    <image class="sync-engine-image sync-engine-creditcards"/>
+                    <label data-l10n-id="sync-currently-syncing-payment-methods"/>
+                  </html:div>
+                  <html:div engine_preference="services.sync.engine.addons">
+                    <image class="sync-engine-image sync-engine-addons"/>
+                    <label data-l10n-id="sync-currently-syncing-addons"/>
+                  </html:div>
+                  <html:div engine_preference="services.sync.engine.prefs">
+                    <image class="sync-engine-image sync-engine-prefs"/>
+                    <label data-l10n-id="sync-currently-syncing-settings"/>
+                  </html:div>
+                </html:div>
+                <hbox>
+                  <button id="syncChangeOptions"
+                          is="highlightable-button"
+                          data-l10n-id="sync-change-options"/>
+                  <spacer flex="1"/>
+                </hbox>
+              </vbox>
+            </vbox>
+          </deck>
+        </groupbox>
+      </vbox>
+    </hbox>
+    <vbox align="start">
+      <html:a id="connect-another-device"
+             is="text-link"
+             class="fxaMobilePromo"
+             target="_blank"
+             data-l10n-id="sync-connect-another-device"/>
+    </vbox>
+  </vbox>
+</deck>
+</html:template>
diff --git a/browser/components/preferences/sync.js b/browser/components/preferences/sync.js
new file mode 100644
index 0000000000..11a6a42e2e
--- /dev/null
+++ b/browser/components/preferences/sync.js
@@ -0,0 +1,547 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this file,
+ * You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+/* import-globals-from preferences.js */
+
+const FXA_PAGE_LOGGED_OUT = 0;
+const FXA_PAGE_LOGGED_IN = 1;
+
+// Indexes into the "login status" deck.
+// We are in a successful verified state - everything should work!
+const FXA_LOGIN_VERIFIED = 0;
+// We have logged in to an unverified account.
+const FXA_LOGIN_UNVERIFIED = 1;
+// We are logged in locally, but the server rejected our credentials.
+const FXA_LOGIN_FAILED = 2;
+
+// Indexes into the "sync status" deck.
+const SYNC_DISCONNECTED = 0;
+const SYNC_CONNECTED = 1;
+
+var gSyncPane = {
+  get page() {
+    return document.getElementById("weavePrefsDeck").selectedIndex;
+  },
+
+  set page(val) {
+    document.getElementById("weavePrefsDeck").selectedIndex = val;
+  },
+
+  init() {
+    this._setupEventListeners();
+    this.setupEnginesUI();
+
+    document
+      .getElementById("weavePrefsDeck")
+      .removeAttribute("data-hidden-from-search");
+
+    // If the Service hasn't finished initializing, wait for it.
+    let xps = Cc["@mozilla.org/weave/service;1"].getService(
+      Ci.nsISupports
+    ).wrappedJSObject;
+
+    if (xps.ready) {
+      this._init();
+      return;
+    }
+
+    // it may take some time before all the promises we care about resolve, so
+    // pre-load what we can from synchronous sources.
+    this._showLoadPage(xps);
+
+    let onUnload = function () {
+      window.removeEventListener("unload", onUnload);
+      try {
+        Services.obs.removeObserver(onReady, "weave:service:ready");
+      } catch (e) {}
+    };
+
+    let onReady = () => {
+      Services.obs.removeObserver(onReady, "weave:service:ready");
+      window.removeEventListener("unload", onUnload);
+      this._init();
+    };
+
+    Services.obs.addObserver(onReady, "weave:service:ready");
+    window.addEventListener("unload", onUnload);
+
+    xps.ensureLoaded();
+  },
+
+  _showLoadPage(xps) {
+    let maybeAcct = false;
+    let username = Services.prefs.getCharPref("services.sync.username", "");
+    if (username) {
+      document.getElementById("fxaEmailAddress").textContent = username;
+      maybeAcct = true;
+    }
+
+    let cachedComputerName = Services.prefs.getStringPref(
+      "identity.fxaccounts.account.device.name",
+      ""
+    );
+    if (cachedComputerName) {
+      maybeAcct = true;
+      this._populateComputerName(cachedComputerName);
+    }
+    this.page = maybeAcct ? FXA_PAGE_LOGGED_IN : FXA_PAGE_LOGGED_OUT;
+  },
+
+  _init() {
+    Weave.Svc.Obs.add(UIState.ON_UPDATE, this.updateWeavePrefs, this);
+
+    window.addEventListener("unload", () => {
+      Weave.Svc.Obs.remove(UIState.ON_UPDATE, this.updateWeavePrefs, this);
+    });
+
+    FxAccounts.config
+      .promiseConnectDeviceURI(this._getEntryPoint())
+      .then(connectURI => {
+        document
+          .getElementById("connect-another-device")
+          .setAttribute("href", connectURI);
+      });
+    // Links for mobile devices.
+    for (let platform of ["android", "ios"]) {
+      let url =
+        Services.prefs.getCharPref(`identity.mobilepromo.${platform}`) +
+        "sync-preferences";
+      for (let elt of document.querySelectorAll(
+        `.fxaMobilePromo-${platform}`
+      )) {
+        elt.setAttribute("href", url);
+      }
+    }
+
+    this.updateWeavePrefs();
+
+    // Notify observers that the UI is now ready
+    Services.obs.notifyObservers(window, "sync-pane-loaded");
+
+    if (
+      location.hash == "#sync" &&
+      UIState.get().status == UIState.STATUS_SIGNED_IN
+    ) {
+      if (location.href.includes("action=pair")) {
+        gSyncPane.pairAnotherDevice();
+      } else if (location.href.includes("action=choose-what-to-sync")) {
+        gSyncPane._chooseWhatToSync(false);
+      }
+    }
+  },
+
+  _toggleComputerNameControls(editMode) {
+    let textbox = document.getElementById("fxaSyncComputerName");
+    textbox.disabled = !editMode;
+    document.getElementById("fxaChangeDeviceName").hidden = editMode;
+    document.getElementById("fxaCancelChangeDeviceName").hidden = !editMode;
+    document.getElementById("fxaSaveChangeDeviceName").hidden = !editMode;
+  },
+
+  _focusComputerNameTextbox() {
+    let textbox = document.getElementById("fxaSyncComputerName");
+    let valLength = textbox.value.length;
+    textbox.focus();
+    textbox.setSelectionRange(valLength, valLength);
+  },
+
+  _blurComputerNameTextbox() {
+    document.getElementById("fxaSyncComputerName").blur();
+  },
+
+  _focusAfterComputerNameTextbox() {
+    // Focus the most appropriate element that's *not* the "computer name" box.
+    Services.focus.moveFocus(
+      window,
+      document.getElementById("fxaSyncComputerName"),
+      Services.focus.MOVEFOCUS_FORWARD,
+      0
+    );
+  },
+
+  _updateComputerNameValue(save) {
+    if (save) {
+      let textbox = document.getElementById("fxaSyncComputerName");
+      Weave.Service.clientsEngine.localName = textbox.value;
+    }
+    this._populateComputerName(Weave.Service.clientsEngine.localName);
+  },
+
+  _setupEventListeners() {
+    function setEventListener(aId, aEventType, aCallback) {
+      document
+        .getElementById(aId)
+        .addEventListener(aEventType, aCallback.bind(gSyncPane));
+    }
+
+    setEventListener("openChangeProfileImage", "click", function (event) {
+      gSyncPane.openChangeProfileImage(event);
+    });
+    setEventListener("openChangeProfileImage", "keypress", function (event) {
+      gSyncPane.openChangeProfileImage(event);
+    });
+    setEventListener("fxaChangeDeviceName", "command", function () {
+      this._toggleComputerNameControls(true);
+      this._focusComputerNameTextbox();
+    });
+    setEventListener("fxaCancelChangeDeviceName", "command", function () {
+      // We explicitly blur the textbox because of bug 75324, then after
+      // changing the state of the buttons, force focus to whatever the focus
+      // manager thinks should be next (which on the mac, depends on an OSX
+      // keyboard access preference)
+      this._blurComputerNameTextbox();
+      this._toggleComputerNameControls(false);
+      this._updateComputerNameValue(false);
+      this._focusAfterComputerNameTextbox();
+    });
+    setEventListener("fxaSaveChangeDeviceName", "command", function () {
+      // Work around bug 75324 - see above.
+      this._blurComputerNameTextbox();
+      this._toggleComputerNameControls(false);
+      this._updateComputerNameValue(true);
+      this._focusAfterComputerNameTextbox();
+    });
+    setEventListener("noFxaSignIn", "command", function () {
+      gSyncPane.signIn();
+      return false;
+    });
+    setEventListener("fxaUnlinkButton", "command", function () {
+      gSyncPane.unlinkFirefoxAccount(true);
+    });
+    setEventListener(
+      "verifyFxaAccount",
+      "command",
+      gSyncPane.verifyFirefoxAccount
+    );
+    setEventListener("unverifiedUnlinkFxaAccount", "command", function () {
+      /* no warning as account can't have previously synced */
+      gSyncPane.unlinkFirefoxAccount(false);
+    });
+    setEventListener("rejectReSignIn", "command", function () {
+      gSyncPane.reSignIn(this._getEntryPoint());
+    });
+    setEventListener("rejectUnlinkFxaAccount", "command", function () {
+      gSyncPane.unlinkFirefoxAccount(true);
+    });
+    setEventListener("fxaSyncComputerName", "keypress", function (e) {
+      if (e.keyCode == KeyEvent.DOM_VK_RETURN) {
+        document.getElementById("fxaSaveChangeDeviceName").click();
+      } else if (e.keyCode == KeyEvent.DOM_VK_ESCAPE) {
+        document.getElementById("fxaCancelChangeDeviceName").click();
+      }
+    });
+    setEventListener("syncSetup", "command", function () {
+      this._chooseWhatToSync(false);
+    });
+    setEventListener("syncChangeOptions", "command", function () {
+      this._chooseWhatToSync(true);
+    });
+    setEventListener("syncNow", "command", function () {
+      // syncing can take a little time to send the "started" notification, so
+      // pretend we already got it.
+      this._updateSyncNow(true);
+      Weave.Service.sync({ why: "aboutprefs" });
+    });
+    setEventListener("syncNow", "mouseover", function () {
+      const state = UIState.get();
+      // If we are currently syncing, just set the tooltip to the same as the
+      // button label (ie, "Syncing...")
+      let tooltiptext = state.syncing
+        ? document.getElementById("syncNow").getAttribute("label")
+        : window.browsingContext.topChromeWindow.gSync.formatLastSyncDate(
+            state.lastSync
+          );
+      document
+        .getElementById("syncNow")
+        .setAttribute("tooltiptext", tooltiptext);
+    });
+  },
+
+  async _chooseWhatToSync(isAlreadySyncing) {
+    // Assuming another device is syncing and we're not,
+    // we update the engines selection so the correct
+    // checkboxes are pre-filed.
+    if (!isAlreadySyncing) {
+      try {
+        await Weave.Service.updateLocalEnginesState();
+      } catch (err) {
+        console.error("Error updating the local engines state", err);
+      }
+    }
+    let params = {};
+    if (isAlreadySyncing) {
+      // If we are already syncing then we also offer to disconnect.
+      params.disconnectFun = () => this.disconnectSync();
+    }
+    gSubDialog.open(
+      "chrome://browser/content/preferences/dialogs/syncChooseWhatToSync.xhtml",
+      {
+        closingCallback: event => {
+          if (!isAlreadySyncing && event.detail.button == "accept") {
+            // We weren't syncing but the user has accepted the dialog - so we
+            // want to start!
+            fxAccounts.telemetry
+              .recordConnection(["sync"], "ui")
+              .then(() => {
+                return Weave.Service.configure();
+              })
+              .catch(err => {
+                console.error("Failed to enable sync", err);
+              });
+          }
+        },
+      },
+      params /* aParams */
+    );
+  },
+
+  _updateSyncNow(syncing) {
+    let butSyncNow = document.getElementById("syncNow");
+    let fluentID = syncing ? "prefs-syncing-button" : "prefs-sync-now-button";
+    if (document.l10n.getAttributes(butSyncNow).id != fluentID) {
+      // Only one of the two strings has an accesskey, and fluent won't
+      // remove it if we switch to the string that doesn't, so just force
+      // removal here.
+      butSyncNow.removeAttribute("accesskey");
+      document.l10n.setAttributes(butSyncNow, fluentID);
+    }
+    butSyncNow.disabled = syncing;
+  },
+
+  updateWeavePrefs() {
+    let service = Cc["@mozilla.org/weave/service;1"].getService(
+      Ci.nsISupports
+    ).wrappedJSObject;
+
+    let displayNameLabel = document.getElementById("fxaDisplayName");
+    let fxaEmailAddressLabels = document.querySelectorAll(
+      ".l10nArgsEmailAddress"
+    );
+    displayNameLabel.hidden = true;
+
+    // while we determine the fxa status pre-load what we can.
+    this._showLoadPage(service);
+
+    let state = UIState.get();
+    if (state.status == UIState.STATUS_NOT_CONFIGURED) {
+      this.page = FXA_PAGE_LOGGED_OUT;
+      return;
+    }
+    this.page = FXA_PAGE_LOGGED_IN;
+    // We are logged in locally, but maybe we are in a state where the
+    // server rejected our credentials (eg, password changed on the server)
+    let fxaLoginStatus = document.getElementById("fxaLoginStatus");
+    let syncReady = false; // Is sync able to actually sync?
+    // We need to check error states that need a re-authenticate to resolve
+    // themselves first.
+    if (state.status == UIState.STATUS_LOGIN_FAILED) {
+      fxaLoginStatus.selectedIndex = FXA_LOGIN_FAILED;
+    } else if (state.status == UIState.STATUS_NOT_VERIFIED) {
+      fxaLoginStatus.selectedIndex = FXA_LOGIN_UNVERIFIED;
+    } else {
+      // We must be golden (or in an error state we expect to magically
+      // resolve itself)
+      fxaLoginStatus.selectedIndex = FXA_LOGIN_VERIFIED;
+      syncReady = true;
+    }
+    fxaEmailAddressLabels.forEach(label => {
+      let l10nAttrs = document.l10n.getAttributes(label);
+      document.l10n.setAttributes(label, l10nAttrs.id, { email: state.email });
+    });
+    document.getElementById("fxaEmailAddress").textContent = state.email;
+
+    this._populateComputerName(Weave.Service.clientsEngine.localName);
+    for (let elt of document.querySelectorAll(".needs-account-ready")) {
+      elt.disabled = !syncReady;
+    }
+
+    // Clear the profile image (if any) of the previously logged in account.
+    document
+      .querySelector("#fxaLoginVerified > .fxaProfileImage")
+      .style.removeProperty("list-style-image");
+
+    if (state.displayName) {
+      fxaLoginStatus.setAttribute("hasName", true);
+      displayNameLabel.hidden = false;
+      document.getElementById("fxaDisplayNameHeading").textContent =
+        state.displayName;
+    } else {
+      fxaLoginStatus.removeAttribute("hasName");
+    }
+    if (state.avatarURL && !state.avatarIsDefault) {
+      let bgImage = 'url("' + state.avatarURL + '")';
+      let profileImageElement = document.querySelector(
+        "#fxaLoginVerified > .fxaProfileImage"
+      );
+      profileImageElement.style.listStyleImage = bgImage;
+
+      let img = new Image();
+      img.onerror = () => {
+        // Clear the image if it has trouble loading. Since this callback is asynchronous
+        // we check to make sure the image is still the same before we clear it.
+        if (profileImageElement.style.listStyleImage === bgImage) {
+          profileImageElement.style.removeProperty("list-style-image");
+        }
+      };
+      img.src = state.avatarURL;
+    }
+    // The "manage account" link embeds the uid, so we need to update this
+    // if the account state changes.
+    FxAccounts.config
+      .promiseManageURI(this._getEntryPoint())
+      .then(accountsManageURI => {
+        document
+          .getElementById("verifiedManage")
+          .setAttribute("href", accountsManageURI);
+      });
+    // and the actual sync state.
+    let eltSyncStatus = document.getElementById("syncStatus");
+    eltSyncStatus.hidden = !syncReady;
+    eltSyncStatus.selectedIndex = state.syncEnabled
+      ? SYNC_CONNECTED
+      : SYNC_DISCONNECTED;
+    this._updateSyncNow(state.syncing);
+  },
+
+  _getEntryPoint() {
+    let params = new URLSearchParams(
+      document.URL.split("#")[0].split("?")[1] || ""
+    );
+    return params.get("entrypoint") || "preferences";
+  },
+
+  openContentInBrowser(url, options) {
+    let win = Services.wm.getMostRecentWindow("navigator:browser");
+    if (!win) {
+      openTrustedLinkIn(url, "tab");
+      return;
+    }
+    win.switchToTabHavingURI(url, true, options);
+  },
+
+  // Replace the current tab with the specified URL.
+  replaceTabWithUrl(url) {
+    // Get the <browser> element hosting us.
+    let browser = window.docShell.chromeEventHandler;
+    // And tell it to load our URL.
+    browser.loadURI(Services.io.newURI(url), {
+      triggeringPrincipal: Services.scriptSecurityManager.createNullPrincipal(
+        {}
+      ),
+    });
+  },
+
+  async signIn() {
+    if (!(await FxAccounts.canConnectAccount())) {
+      return;
+    }
+    const url = await FxAccounts.config.promiseConnectAccountURI(
+      this._getEntryPoint()
+    );
+    this.replaceTabWithUrl(url);
+  },
+
+  /**
+   * Attempts to take the user through the sign in flow by opening the web content
+   * with the given entrypoint as a query parameter
+   * @param entrypoint: An string appended to the query parameters, used in telemtry to differentiate
+   * different entrypoints to accounts
+   * */
+  async reSignIn(entrypoint) {
+    // There's a bit of an edge-case here - we might be forcing reauth when we've
+    // lost the FxA account data - in which case we'll not get a URL as the re-auth
+    // URL embeds account info and the server endpoint complains if we don't
+    // supply it - So we just use the regular "sign in" URL in that case.
+    if (!(await FxAccounts.canConnectAccount())) {
+      return;
+    }
+
+    const url =
+      (await FxAccounts.config.promiseForceSigninURI(entrypoint)) ||
+      (await FxAccounts.config.promiseConnectAccountURI(entrypoint));
+    this.replaceTabWithUrl(url);
+  },
+
+  clickOrSpaceOrEnterPressed(event) {
+    // Note: charCode is deprecated, but 'char' not yet implemented.
+    // Replace charCode with char when implemented, see Bug 680830
+    return (
+      (event.type == "click" && event.button == 0) ||
+      (event.type == "keypress" &&
+        (event.charCode == KeyEvent.DOM_VK_SPACE ||
+          event.keyCode == KeyEvent.DOM_VK_RETURN))
+    );
+  },
+
+  openChangeProfileImage(event) {
+    if (this.clickOrSpaceOrEnterPressed(event)) {
+      FxAccounts.config
+        .promiseChangeAvatarURI(this._getEntryPoint())
+        .then(url => {
+          this.openContentInBrowser(url, {
+            replaceQueryString: true,
+            triggeringPrincipal:
+              Services.scriptSecurityManager.getSystemPrincipal(),
+          });
+        });
+      // Prevent page from scrolling on the space key.
+      event.preventDefault();
+    }
+  },
+
+  async verifyFirefoxAccount() {
+    return this.reSignIn("preferences-reverify");
+  },
+
+  // Disconnect the account, including everything linked.
+  unlinkFirefoxAccount(confirm) {
+    window.browsingContext.topChromeWindow.gSync.disconnect({
+      confirm,
+    });
+  },
+
+  // Disconnect sync, leaving the account connected.
+  disconnectSync() {
+    return window.browsingContext.topChromeWindow.gSync.disconnect({
+      confirm: true,
+      disconnectAccount: false,
+    });
+  },
+
+  pairAnotherDevice() {
+    gSubDialog.open(
+      "chrome://browser/content/preferences/fxaPairDevice.xhtml",
+      { features: "resizable=no" }
+    );
+  },
+
+  _populateComputerName(value) {
+    let textbox = document.getElementById("fxaSyncComputerName");
+    if (!textbox.hasAttribute("placeholder")) {
+      textbox.setAttribute(
+        "placeholder",
+        fxAccounts.device.getDefaultLocalName()
+      );
+    }
+    textbox.value = value;
+  },
+
+  // arranges to dynamically show or hide sync engine name elements based on the
+  // preferences used for this engines.
+  setupEnginesUI() {
+    let observe = (elt, prefName) => {
+      elt.hidden = !Services.prefs.getBoolPref(prefName, false);
+    };
+
+    for (let elt of document.querySelectorAll("[engine_preference]")) {
+      let prefName = elt.getAttribute("engine_preference");
+      let obs = observe.bind(null, elt, prefName);
+      obs();
+      Services.prefs.addObserver(prefName, obs);
+      window.addEventListener("unload", () => {
+        Services.prefs.removeObserver(prefName, obs);
+      });
+    }
+  },
+};
diff --git a/browser/components/preferences/tests/addons/pl-dictionary.xpi b/browser/components/preferences/tests/addons/pl-dictionary.xpi
new file mode 100644
index 0000000000..cc4da1fa83
--- /dev/null
+++ b/browser/components/preferences/tests/addons/pl-dictionary.xpi
diff --git a/browser/components/preferences/tests/addons/set_homepage.xpi b/browser/components/preferences/tests/addons/set_homepage.xpi
new file mode 100644
index 0000000000..9aff671021
--- /dev/null
+++ b/browser/components/preferences/tests/addons/set_homepage.xpi
diff --git a/browser/components/preferences/tests/addons/set_newtab.xpi b/browser/components/preferences/tests/addons/set_newtab.xpi
new file mode 100644
index 0000000000..f11db0b6a8
--- /dev/null
+++ b/browser/components/preferences/tests/addons/set_newtab.xpi
diff --git a/browser/components/preferences/tests/browser.toml b/browser/components/preferences/tests/browser.toml
new file mode 100644
index 0000000000..fe523bde94
--- /dev/null
+++ b/browser/components/preferences/tests/browser.toml
@@ -0,0 +1,288 @@
+[DEFAULT]
+prefs = [
+  "extensions.formautofill.addresses.available='on'",
+  "signon.management.page.os-auth.enabled=true",
+]
+support-files = [
+  "head.js",
+  "privacypane_tests_perwindow.js",
+  "addons/pl-dictionary.xpi",
+  "addons/set_homepage.xpi",
+  "addons/set_newtab.xpi",
+]
+
+["browser_advanced_update.js"]
+skip-if = ["!updater"]
+
+["browser_application_xml_handle_internally.js"]
+
+["browser_applications_selection.js"]
+
+["browser_basic_rebuild_fonts_test.js"]
+
+["browser_browser_languages_subdialog.js"]
+skip-if = [
+  "tsan",
+  "!debug && os == 'win'", # Bug 1518370
+]
+
+["browser_bug410900.js"]
+
+["browser_bug731866.js"]
+
+["browser_bug795764_cachedisabled.js"]
+
+["browser_bug1018066_resetScrollPosition.js"]
+
+["browser_bug1020245_openPreferences_to_paneContent.js"]
+
+["browser_bug1184989_prevent_scrolling_when_preferences_flipped.js"]
+skip-if = [
+  "os == 'mac'", # Bug 1664576
+]
+support-files = ["browser_bug1184989_prevent_scrolling_when_preferences_flipped.xhtml"]
+
+["browser_bug1547020_lockedDownloadDir.js"]
+
+["browser_bug1579418.js"]
+
+["browser_cert_export.js"]
+
+["browser_change_app_handler.js"]
+run-if = ["os == 'win'"] # Windows-specific handler application selection dialog
+
+["browser_checkspelling.js"]
+
+["browser_connection.js"]
+
+["browser_connection_bug388287.js"]
+
+["browser_connection_bug1445991.js"]
+
+["browser_connection_bug1505330.js"]
+skip-if = [
+  "verify && debug && os == 'linux'",
+  "verify && debug && os == 'mac'",
+]
+
+["browser_connection_valid_hostname.js"]
+
+["browser_containers_name_input.js"]
+
+["browser_contentblocking.js"]
+skip-if = ["socketprocess_networking"]
+
+["browser_contentblocking_categories.js"]
+
+["browser_contentblocking_standard_tcp_section.js"]
+
+["browser_cookie_exceptions_addRemove.js"]
+
+["browser_cookies_exceptions.js"]
+
+["browser_defaultbrowser_alwayscheck.js"]
+
+["browser_engines.js"]
+fail-if = ["a11y_checks"] # Bug 1854636 clicked treechildren#engineChildren may not be focusable
+
+["browser_ensure_prefs_bindings_initted.js"]
+
+["browser_etp_exceptions_dialog.js"]
+
+["browser_experimental_features.js"]
+
+["browser_experimental_features_filter.js"]
+
+["browser_experimental_features_hidden_when_not_public.js"]
+skip-if = [
+  "os == 'mac' && debug", # Bug 1723854
+  "os == 'linux' && os_version == '18.04' && debug", # Bug 1723854
+]
+
+["browser_experimental_features_resetall.js"]
+
+["browser_extension_controlled.js"]
+skip-if = [
+  "tsan",
+  "ccov && os == 'linux'", # Linux: bug 1613530
+  "ccov && os == 'win'", # Windows: bug 1437051
+]
+
+["browser_filetype_dialog.js"]
+
+["browser_fluent.js"]
+
+["browser_homepage_default.js"]
+
+["browser_homepages_filter_aboutpreferences.js"]
+
+["browser_homepages_use_bookmark.js"]
+
+["browser_hometab_restore_defaults.js"]
+https_first_disabled = true
+
+["browser_https_only_exceptions.js"]
+
+["browser_https_only_section.js"]
+
+["browser_ignore_invalid_capability.js"]
+
+["browser_keyboardfocus.js"]
+skip-if = ["os != 'mac'"]
+
+["browser_languages_subdialog.js"]
+
+["browser_layersacceleration.js"]
+
+["browser_localSearchShortcuts.js"]
+fail-if = ["a11y_checks"] # Bug 1854636 clicked treechildren#engineChildren may not be focusable
+
+["browser_moreFromMozilla.js"]
+
+["browser_moreFromMozilla_locales.js"]
+
+["browser_newtab_menu.js"]
+
+["browser_notifications_do_not_disturb.js"]
+
+["browser_open_download_preferences.js"]
+support-files = ["empty_pdf_file.pdf"]
+
+["browser_open_migration_wizard.js"]
+
+["browser_password_management.js"]
+
+["browser_pdf_disabled.js"]
+
+["browser_performance.js"]
+
+["browser_performance_content_process_limit.js"]
+
+["browser_performance_e10srollout.js"]
+
+["browser_performance_non_e10s.js"]
+skip-if = ["true"]
+
+["browser_permissions_checkPermissionsWereAdded.js"]
+
+["browser_permissions_dialog.js"]
+
+["browser_permissions_dialog_default_perm.js"]
+
+["browser_permissions_urlFieldHidden.js"]
+
+["browser_primaryPassword.js"]
+
+["browser_privacy_cookieBannerHandling.js"]
+
+["browser_privacy_dnsoverhttps.js"]
+
+["browser_privacy_firefoxSuggest.js"]
+
+["browser_privacy_gpc.js"]
+
+["browser_privacy_passwordGenerationAndAutofill.js"]
+
+["browser_privacy_relayIntegration.js"]
+
+["browser_privacy_segmentation_pref.js"]
+
+["browser_privacy_syncDataClearing.js"]
+
+["browser_privacypane_2.js"]
+
+["browser_privacypane_3.js"]
+
+["browser_proxy_backup.js"]
+
+["browser_sanitizeOnShutdown_prefLocked.js"]
+
+["browser_searchChangedEngine.js"]
+
+["browser_searchDefaultEngine.js"]
+support-files = [
+  "engine1/manifest.json",
+  "engine2/manifest.json",
+]
+
+["browser_searchFindMoreLink.js"]
+
+["browser_searchRestoreDefaults.js"]
+
+["browser_searchScroll.js"]
+support-files = ["!/gfx/layers/apz/test/mochitest/apz_test_native_event_utils.js"]
+
+["browser_searchShowSuggestionsFirst.js"]
+
+["browser_search_firefoxSuggest.js"]
+
+["browser_search_no_results_change_category.js"]
+
+["browser_search_quickactions.js"]
+
+["browser_search_searchTerms.js"]
+
+["browser_search_subdialog_tooltip_saved_addresses.js"]
+
+["browser_search_subdialogs_within_preferences_1.js"]
+skip-if = ["tsan"] # Bug 1678829
+
+["browser_search_subdialogs_within_preferences_2.js"]
+
+["browser_search_subdialogs_within_preferences_3.js"]
+
+["browser_search_subdialogs_within_preferences_4.js"]
+
+["browser_search_subdialogs_within_preferences_5.js"]
+
+["browser_search_subdialogs_within_preferences_6.js"]
+
+["browser_search_subdialogs_within_preferences_7.js"]
+
+["browser_search_subdialogs_within_preferences_8.js"]
+
+["browser_search_subdialogs_within_preferences_site_data.js"]
+
+["browser_search_within_preferences_1.js"]
+
+["browser_search_within_preferences_2.js"]
+
+["browser_search_within_preferences_command.js"]
+
+["browser_searchsuggestions.js"]
+
+["browser_security-1.js"]
+
+["browser_security-2.js"]
+
+["browser_security-3.js"]
+
+["browser_site_login_exceptions.js"]
+
+["browser_site_login_exceptions_policy.js"]
+
+["browser_spotlight.js"]
+
+["browser_statePartitioning_PBM_strings.js"]
+
+["browser_statePartitioning_strings.js"]
+
+["browser_subdialogs.js"]
+support-files = [
+  "subdialog.xhtml",
+  "subdialog2.xhtml",
+]
+fail-if = ["a11y_checks"] # Bug 1854636 clicked label.dialogTitle, vbox#dialogTemplate.dialogOverlay may not be focusable
+
+["browser_sync_chooseWhatToSync.js"]
+
+["browser_sync_disabled.js"]
+
+["browser_sync_pairing.js"]
+
+["browser_trendingsuggestions.js"]
+
+["browser_warning_permanent_private_browsing.js"]
+
+["browser_windows_launch_on_login.js"]
+run-if = ["os == 'win'"]
diff --git a/browser/components/preferences/tests/browser_advanced_update.js b/browser/components/preferences/tests/browser_advanced_update.js
new file mode 100644
index 0000000000..0d89607842
--- /dev/null
+++ b/browser/components/preferences/tests/browser_advanced_update.js
@@ -0,0 +1,182 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+const Cm = Components.manager;
+
+const uuidGenerator = Services.uuid;
+
+const mockUpdateManager = {
+  contractId: "@mozilla.org/updates/update-manager;1",
+
+  _mockClassId: uuidGenerator.generateUUID(),
+
+  _originalClassId: "",
+
+  QueryInterface: ChromeUtils.generateQI(["nsIUpdateManager"]),
+
+  createInstance(iiD) {
+    return this.QueryInterface(iiD);
+  },
+
+  register() {
+    let registrar = Cm.QueryInterface(Ci.nsIComponentRegistrar);
+    if (!registrar.isCIDRegistered(this._mockClassId)) {
+      this._originalClassId = registrar.contractIDToCID(this.contractId);
+      registrar.registerFactory(
+        this._mockClassId,
+        "Unregister after testing",
+        this.contractId,
+        this
+      );
+    }
+  },
+
+  unregister() {
+    let registrar = Cm.QueryInterface(Ci.nsIComponentRegistrar);
+    registrar.unregisterFactory(this._mockClassId, this);
+    registrar.registerFactory(this._originalClassId, "", this.contractId, null);
+  },
+
+  getUpdateCount() {
+    return this._updates.length;
+  },
+
+  getUpdateAt(index) {
+    return this._updates[index];
+  },
+
+  _updates: [
+    {
+      name: "Firefox Developer Edition 49.0a2",
+      statusText: "The Update was successfully installed",
+      buildID: "20160728004010",
+      installDate: 1469763105156,
+      detailsURL: "https://www.mozilla.org/firefox/aurora/",
+    },
+    {
+      name: "Firefox Developer Edition 43.0a2",
+      statusText: "The Update was successfully installed",
+      buildID: "20150929004011",
+      installDate: 1443585886224,
+      detailsURL: "https://www.mozilla.org/firefox/aurora/",
+    },
+    {
+      name: "Firefox Developer Edition 42.0a2",
+      statusText: "The Update was successfully installed",
+      buildID: "20150920004018",
+      installDate: 1442818147544,
+      detailsURL: "https://www.mozilla.org/firefox/aurora/",
+    },
+  ],
+};
+
+function formatInstallDate(sec) {
+  var date = new Date(sec);
+  const dtOptions = {
+    year: "numeric",
+    month: "long",
+    day: "numeric",
+    hour: "numeric",
+    minute: "numeric",
+    second: "numeric",
+  };
+  return date.toLocaleString(undefined, dtOptions);
+}
+
+add_task(async function () {
+  await openPreferencesViaOpenPreferencesAPI("general", { leaveOpen: true });
+  let doc = gBrowser.selectedBrowser.contentDocument;
+
+  let showBtn = doc.getElementById("showUpdateHistory");
+  let dialogOverlay = content.gSubDialog._preloadDialog._overlay;
+
+  // XXX: For unknown reasons, this mock cannot be loaded by
+  // XPCOMUtils.defineLazyServiceGetter() called in aboutDialog-appUpdater.js.
+  // It is registered here so that we could assert update history subdialog
+  // without stopping the preferences advanced pane from loading.
+  // See bug 1361929.
+  mockUpdateManager.register();
+
+  // Test the dialog window opens
+  ok(
+    BrowserTestUtils.isHidden(dialogOverlay),
+    "The dialog should be invisible"
+  );
+  let promiseSubDialogLoaded = promiseLoadSubDialog(
+    "chrome://mozapps/content/update/history.xhtml"
+  );
+  showBtn.doCommand();
+  await promiseSubDialogLoaded;
+  ok(!BrowserTestUtils.isHidden(dialogOverlay), "The dialog should be visible");
+
+  let dialogFrame = dialogOverlay.querySelector(".dialogFrame");
+  let frameDoc = dialogFrame.contentDocument;
+  let updates = frameDoc.querySelectorAll("richlistitem.update");
+
+  // Test the update history numbers are correct
+  is(
+    updates.length,
+    mockUpdateManager.getUpdateCount(),
+    "The update count is incorrect."
+  );
+
+  // Test the updates are displayed correctly
+  let update = null;
+  let updateData = null;
+  for (let i = 0; i < updates.length; ++i) {
+    update = updates[i];
+    updateData = mockUpdateManager.getUpdateAt(i);
+
+    let testcases = [
+      {
+        selector: ".update-name",
+        id: "update-full-build-name",
+        args: { name: updateData.name, buildID: updateData.buildID },
+      },
+      {
+        selector: ".update-installedOn-label",
+        id: "update-installed-on",
+        args: { date: formatInstallDate(updateData.installDate) },
+      },
+      {
+        selector: ".update-status-label",
+        id: "update-status",
+        args: { status: updateData.statusText },
+      },
+    ];
+
+    for (let { selector, id, args } of testcases) {
+      const element = update.querySelector(selector);
+      const l10nAttrs = frameDoc.l10n.getAttributes(element);
+      Assert.deepEqual(
+        l10nAttrs,
+        {
+          id,
+          args,
+        },
+        "Wrong " + id
+      );
+    }
+
+    if (update.detailsURL) {
+      is(
+        update.detailsURL,
+        update.querySelector(".text-link").href,
+        "Wrong detailsURL"
+      );
+    }
+  }
+
+  // Test the dialog window closes
+  let closeBtn = dialogOverlay.querySelector(".dialogClose");
+  closeBtn.doCommand();
+  ok(
+    BrowserTestUtils.isHidden(dialogOverlay),
+    "The dialog should be invisible"
+  );
+
+  mockUpdateManager.unregister();
+  gBrowser.removeCurrentTab();
+});
diff --git a/browser/components/preferences/tests/browser_application_xml_handle_internally.js b/browser/components/preferences/tests/browser_application_xml_handle_internally.js
new file mode 100644
index 0000000000..edb4a4c0ec
--- /dev/null
+++ b/browser/components/preferences/tests/browser_application_xml_handle_internally.js
@@ -0,0 +1,49 @@
+/* Any copyright is dedicated to the Public Domain.
+   http://creativecommons.org/publicdomain/zero/1.0/ */
+
+const HandlerService = Cc[
+  "@mozilla.org/uriloader/handler-service;1"
+].getService(Ci.nsIHandlerService);
+
+const MIMEService = Cc["@mozilla.org/mime;1"].getService(Ci.nsIMIMEService);
+
+// This test checks that application/xml has the handle internally option.
+add_task(async function applicationXmlHandleInternally() {
+  const mimeInfo = MIMEService.getFromTypeAndExtension(
+    "application/xml",
+    "xml"
+  );
+  HandlerService.store(mimeInfo);
+  registerCleanupFunction(() => {
+    HandlerService.remove(mimeInfo);
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("general", { leaveOpen: true });
+
+  let win = gBrowser.selectedBrowser.contentWindow;
+
+  let container = win.document.getElementById("handlersView");
+
+  // First, find the application/xml item.
+  let xmlItem = container.querySelector("richlistitem[type='application/xml']");
+  Assert.ok(xmlItem, "application/xml is present in handlersView");
+  if (xmlItem) {
+    xmlItem.scrollIntoView({ block: "center" });
+    xmlItem.closest("richlistbox").selectItem(xmlItem);
+
+    // Open its menu
+    let list = xmlItem.querySelector(".actionsMenu");
+    let popup = list.menupopup;
+    let popupShown = BrowserTestUtils.waitForEvent(popup, "popupshown");
+    EventUtils.synthesizeMouseAtCenter(list, {}, win);
+    await popupShown;
+
+    let handleInternallyItem = list.querySelector(
+      `menuitem[action='${Ci.nsIHandlerInfo.handleInternally}']`
+    );
+
+    ok(!!handleInternallyItem, "handle internally is present");
+  }
+
+  gBrowser.removeCurrentTab();
+});
diff --git a/browser/components/preferences/tests/browser_applications_selection.js b/browser/components/preferences/tests/browser_applications_selection.js
new file mode 100644
index 0000000000..683ce76a89
--- /dev/null
+++ b/browser/components/preferences/tests/browser_applications_selection.js
@@ -0,0 +1,403 @@
+SimpleTest.requestCompleteLog();
+const { HandlerServiceTestUtils } = ChromeUtils.importESModule(
+  "resource://testing-common/HandlerServiceTestUtils.sys.mjs"
+);
+
+let gHandlerService = Cc["@mozilla.org/uriloader/handler-service;1"].getService(
+  Ci.nsIHandlerService
+);
+
+let gOldMailHandlers = [];
+let gDummyHandlers = [];
+let gOriginalPreferredMailHandler;
+let gOriginalPreferredPDFHandler;
+
+registerCleanupFunction(function () {
+  function removeDummyHandlers(handlers) {
+    // Remove any of the dummy handlers we created.
+    for (let i = handlers.Count() - 1; i >= 0; i--) {
+      try {
+        if (
+          gDummyHandlers.some(
+            h =>
+              h.uriTemplate ==
+              handlers.queryElementAt(i, Ci.nsIWebHandlerApp).uriTemplate
+          )
+        ) {
+          handlers.removeElementAt(i);
+        }
+      } catch (ex) {
+        /* ignore non-web-app handlers */
+      }
+    }
+  }
+  // Re-add the original protocol handlers:
+  let mailHandlerInfo = HandlerServiceTestUtils.getHandlerInfo("mailto");
+  let mailHandlers = mailHandlerInfo.possibleApplicationHandlers;
+  for (let h of gOldMailHandlers) {
+    mailHandlers.appendElement(h);
+  }
+  removeDummyHandlers(mailHandlers);
+  mailHandlerInfo.preferredApplicationHandler = gOriginalPreferredMailHandler;
+  gHandlerService.store(mailHandlerInfo);
+
+  let pdfHandlerInfo =
+    HandlerServiceTestUtils.getHandlerInfo("application/pdf");
+  removeDummyHandlers(pdfHandlerInfo.possibleApplicationHandlers);
+  pdfHandlerInfo.preferredApplicationHandler = gOriginalPreferredPDFHandler;
+  gHandlerService.store(pdfHandlerInfo);
+
+  gBrowser.removeCurrentTab();
+});
+
+function scrubMailtoHandlers(handlerInfo) {
+  // Remove extant web handlers because they have icons that
+  // we fetch from the web, which isn't allowed in tests.
+  let handlers = handlerInfo.possibleApplicationHandlers;
+  for (let i = handlers.Count() - 1; i >= 0; i--) {
+    try {
+      let handler = handlers.queryElementAt(i, Ci.nsIWebHandlerApp);
+      gOldMailHandlers.push(handler);
+      // If we get here, this is a web handler app. Remove it:
+      handlers.removeElementAt(i);
+    } catch (ex) {}
+  }
+}
+
+add_setup(async function () {
+  // Create our dummy handlers
+  let handler1 = Cc["@mozilla.org/uriloader/web-handler-app;1"].createInstance(
+    Ci.nsIWebHandlerApp
+  );
+  handler1.name = "Handler 1";
+  handler1.uriTemplate = "https://example.com/first/%s";
+
+  let handler2 = Cc["@mozilla.org/uriloader/web-handler-app;1"].createInstance(
+    Ci.nsIWebHandlerApp
+  );
+  handler2.name = "Handler 2";
+  handler2.uriTemplate = "http://example.org/second/%s";
+  gDummyHandlers.push(handler1, handler2);
+
+  function substituteWebHandlers(handlerInfo) {
+    // Append the dummy handlers to replace them:
+    let handlers = handlerInfo.possibleApplicationHandlers;
+    handlers.appendElement(handler1);
+    handlers.appendElement(handler2);
+    gHandlerService.store(handlerInfo);
+  }
+  // Set up our mailto handler test infrastructure.
+  let mailtoHandlerInfo = HandlerServiceTestUtils.getHandlerInfo("mailto");
+  scrubMailtoHandlers(mailtoHandlerInfo);
+  gOriginalPreferredMailHandler = mailtoHandlerInfo.preferredApplicationHandler;
+  substituteWebHandlers(mailtoHandlerInfo);
+
+  // Now do the same for pdf handler:
+  let pdfHandlerInfo =
+    HandlerServiceTestUtils.getHandlerInfo("application/pdf");
+  // PDF doesn't have built-in web handlers, so no need to scrub.
+  gOriginalPreferredPDFHandler = pdfHandlerInfo.preferredApplicationHandler;
+  substituteWebHandlers(pdfHandlerInfo);
+
+  await openPreferencesViaOpenPreferencesAPI("general", { leaveOpen: true });
+  info("Preferences page opened on the general pane.");
+
+  await gBrowser.selectedBrowser.contentWindow.promiseLoadHandlersList;
+  info("Apps list loaded.");
+});
+
+async function selectStandardOptions(itemToUse) {
+  async function selectItemInPopup(item) {
+    let popupShown = BrowserTestUtils.waitForEvent(popup, "popupshown");
+    // Synthesizing the mouse on the .actionsMenu menulist somehow just selects
+    // the top row. Probably something to do with the multiple layers of anon
+    // content - workaround by using the `.open` setter instead.
+    list.open = true;
+    await popupShown;
+    let popupHidden = BrowserTestUtils.waitForEvent(popup, "popuphidden");
+    if (typeof item == "function") {
+      item = item();
+    }
+    popup.activateItem(item);
+    await popupHidden;
+    return item;
+  }
+
+  let itemType = itemToUse.getAttribute("type");
+  // Center the item. Center rather than top so it doesn't get blocked by
+  // the search header.
+  itemToUse.scrollIntoView({ block: "center" });
+  itemToUse.closest("richlistbox").selectItem(itemToUse);
+  Assert.ok(itemToUse.selected, "Should be able to select our item.");
+  // Force reflow to make sure it's visible and the container dropdown isn't
+  // hidden.
+  itemToUse.getBoundingClientRect().top;
+  let list = itemToUse.querySelector(".actionsMenu");
+  let popup = list.menupopup;
+
+  // select one of our test cases:
+  let handlerItem = list.querySelector("menuitem[data-l10n-args*='Handler 1']");
+  await selectItemInPopup(handlerItem);
+  let { preferredAction, alwaysAskBeforeHandling } =
+    HandlerServiceTestUtils.getHandlerInfo(itemType);
+  Assert.notEqual(
+    preferredAction,
+    Ci.nsIHandlerInfo.alwaysAsk,
+    "Should have selected something other than 'always ask' (" + itemType + ")"
+  );
+  Assert.ok(
+    !alwaysAskBeforeHandling,
+    "Should have turned off asking before handling (" + itemType + ")"
+  );
+
+  // Test the alwaysAsk option
+  let alwaysAskItem = list.getElementsByAttribute(
+    "action",
+    Ci.nsIHandlerInfo.alwaysAsk
+  )[0];
+  await selectItemInPopup(alwaysAskItem);
+  Assert.equal(
+    list.selectedItem,
+    alwaysAskItem,
+    "Should have selected always ask item (" + itemType + ")"
+  );
+  alwaysAskBeforeHandling =
+    HandlerServiceTestUtils.getHandlerInfo(itemType).alwaysAskBeforeHandling;
+  Assert.ok(
+    alwaysAskBeforeHandling,
+    "Should have turned on asking before handling (" + itemType + ")"
+  );
+
+  let useDefaultItem = list.getElementsByAttribute(
+    "action",
+    Ci.nsIHandlerInfo.useSystemDefault
+  );
+  useDefaultItem = useDefaultItem && useDefaultItem[0];
+  if (useDefaultItem) {
+    await selectItemInPopup(useDefaultItem);
+    Assert.equal(
+      list.selectedItem,
+      useDefaultItem,
+      "Should have selected 'use default' item (" + itemType + ")"
+    );
+    preferredAction =
+      HandlerServiceTestUtils.getHandlerInfo(itemType).preferredAction;
+    Assert.equal(
+      preferredAction,
+      Ci.nsIHandlerInfo.useSystemDefault,
+      "Should have selected 'use default' (" + itemType + ")"
+    );
+  } else {
+    // Whether there's a "use default" item depends on the OS, so it's not
+    // possible to rely on it being the case or not.
+    info("No 'Use default' item, so not testing (" + itemType + ")");
+  }
+
+  // Select a web app item.
+  let webAppItems = Array.from(
+    popup.getElementsByAttribute("action", Ci.nsIHandlerInfo.useHelperApp)
+  );
+  webAppItems = webAppItems.filter(
+    item => item.handlerApp instanceof Ci.nsIWebHandlerApp
+  );
+  Assert.equal(
+    webAppItems.length,
+    2,
+    "Should have 2 web application handler. (" + itemType + ")"
+  );
+  Assert.notEqual(
+    webAppItems[0].label,
+    webAppItems[1].label,
+    "Should have 2 different web app handlers"
+  );
+  let selectedItem = await selectItemInPopup(webAppItems[0]);
+
+  // Test that the selected item label is the same as the label
+  // of the menu item.
+  let win = gBrowser.selectedBrowser.contentWindow;
+  await win.document.l10n.translateFragment(selectedItem);
+  await win.document.l10n.translateFragment(itemToUse);
+  Assert.equal(
+    selectedItem.label,
+    itemToUse.querySelector(".actionContainer label").value,
+    "Should have selected correct item (" + itemType + ")"
+  );
+  let { preferredApplicationHandler } =
+    HandlerServiceTestUtils.getHandlerInfo(itemType);
+  preferredApplicationHandler.QueryInterface(Ci.nsIWebHandlerApp);
+  Assert.equal(
+    selectedItem.handlerApp.uriTemplate,
+    preferredApplicationHandler.uriTemplate,
+    "App should actually be selected in the backend. (" + itemType + ")"
+  );
+
+  // select the other web app item
+  selectedItem = await selectItemInPopup(webAppItems[1]);
+
+  // Test that the selected item label is the same as the label
+  // of the menu item
+  await win.document.l10n.translateFragment(selectedItem);
+  await win.document.l10n.translateFragment(itemToUse);
+  Assert.equal(
+    selectedItem.label,
+    itemToUse.querySelector(".actionContainer label").value,
+    "Should have selected correct item (" + itemType + ")"
+  );
+  preferredApplicationHandler =
+    HandlerServiceTestUtils.getHandlerInfo(
+      itemType
+    ).preferredApplicationHandler;
+  preferredApplicationHandler.QueryInterface(Ci.nsIWebHandlerApp);
+  Assert.equal(
+    selectedItem.handlerApp.uriTemplate,
+    preferredApplicationHandler.uriTemplate,
+    "App should actually be selected in the backend. (" + itemType + ")"
+  );
+}
+
+add_task(async function checkDropdownBehavior() {
+  let win = gBrowser.selectedBrowser.contentWindow;
+
+  let container = win.document.getElementById("handlersView");
+
+  // First check a protocol handler item.
+  let mailItem = container.querySelector("richlistitem[type='mailto']");
+  Assert.ok(mailItem, "mailItem is present in handlersView.");
+  await selectStandardOptions(mailItem);
+
+  // Then check a content menu item.
+  let pdfItem = container.querySelector("richlistitem[type='application/pdf']");
+  Assert.ok(pdfItem, "pdfItem is present in handlersView.");
+  await selectStandardOptions(pdfItem);
+});
+
+add_task(async function sortingCheck() {
+  let win = gBrowser.selectedBrowser.contentWindow;
+  const handlerView = win.document.getElementById("handlersView");
+  const typeColumn = win.document.getElementById("typeColumn");
+  Assert.ok(typeColumn, "typeColumn is present in handlersView.");
+
+  let expectedNumberOfItems =
+    handlerView.querySelectorAll("richlistitem").length;
+
+  // Test default sorting
+  assertSortByType("ascending");
+
+  const oldDir = typeColumn.getAttribute("sortDirection");
+
+  // click on an item and sort again:
+  let itemToUse = handlerView.querySelector("richlistitem[type=mailto]");
+  itemToUse.scrollIntoView({ block: "center" });
+  itemToUse.closest("richlistbox").selectItem(itemToUse);
+
+  // Test sorting on the type column
+  typeColumn.click();
+  assertSortByType("descending");
+  Assert.notEqual(
+    oldDir,
+    typeColumn.getAttribute("sortDirection"),
+    "Sort direction should change"
+  );
+
+  typeColumn.click();
+  assertSortByType("ascending");
+
+  const actionColumn = win.document.getElementById("actionColumn");
+  Assert.ok(actionColumn, "actionColumn is present in handlersView.");
+
+  // Test sorting on the action column
+  const oldActionDir = actionColumn.getAttribute("sortDirection");
+  actionColumn.click();
+  assertSortByAction("ascending");
+  Assert.notEqual(
+    oldActionDir,
+    actionColumn.getAttribute("sortDirection"),
+    "Sort direction should change"
+  );
+
+  actionColumn.click();
+  assertSortByAction("descending");
+
+  // Restore the default sort order
+  typeColumn.click();
+  assertSortByType("ascending");
+
+  function assertSortByAction(order) {
+    Assert.equal(
+      actionColumn.getAttribute("sortDirection"),
+      order,
+      `Sort direction should be ${order}`
+    );
+    let siteItems = handlerView.getElementsByTagName("richlistitem");
+    Assert.equal(
+      siteItems.length,
+      expectedNumberOfItems,
+      "Number of items should not change."
+    );
+    for (let i = 0; i < siteItems.length - 1; ++i) {
+      let aType = siteItems[i].getAttribute("actionDescription").toLowerCase();
+      let bType = siteItems[i + 1]
+        .getAttribute("actionDescription")
+        .toLowerCase();
+      let result = 0;
+      if (aType > bType) {
+        result = 1;
+      } else if (bType > aType) {
+        result = -1;
+      }
+      if (order == "ascending") {
+        Assert.lessOrEqual(
+          result,
+          0,
+          "Should sort applications in the ascending order by action"
+        );
+      } else {
+        Assert.greaterOrEqual(
+          result,
+          0,
+          "Should sort applications in the descending order by action"
+        );
+      }
+    }
+  }
+
+  function assertSortByType(order) {
+    Assert.equal(
+      typeColumn.getAttribute("sortDirection"),
+      order,
+      `Sort direction should be ${order}`
+    );
+
+    let siteItems = handlerView.getElementsByTagName("richlistitem");
+    Assert.equal(
+      siteItems.length,
+      expectedNumberOfItems,
+      "Number of items should not change."
+    );
+    for (let i = 0; i < siteItems.length - 1; ++i) {
+      let aType = siteItems[i].getAttribute("typeDescription").toLowerCase();
+      let bType = siteItems[i + 1]
+        .getAttribute("typeDescription")
+        .toLowerCase();
+      let result = 0;
+      if (aType > bType) {
+        result = 1;
+      } else if (bType > aType) {
+        result = -1;
+      }
+      if (order == "ascending") {
+        Assert.lessOrEqual(
+          result,
+          0,
+          "Should sort applications in the ascending order by type"
+        );
+      } else {
+        Assert.greaterOrEqual(
+          result,
+          0,
+          "Should sort applications in the descending order by type"
+        );
+      }
+    }
+  }
+});
diff --git a/browser/components/preferences/tests/browser_basic_rebuild_fonts_test.js b/browser/components/preferences/tests/browser_basic_rebuild_fonts_test.js
new file mode 100644
index 0000000000..51998db5a9
--- /dev/null
+++ b/browser/components/preferences/tests/browser_basic_rebuild_fonts_test.js
@@ -0,0 +1,235 @@
+add_task(async function () {
+  await openPreferencesViaOpenPreferencesAPI("general", { leaveOpen: true });
+  await gBrowser.contentWindow.gMainPane._selectDefaultLanguageGroupPromise;
+  await TestUtils.waitForCondition(
+    () => !gBrowser.contentWindow.Preferences.updateQueued
+  );
+
+  let doc = gBrowser.contentDocument;
+  let contentWindow = gBrowser.contentWindow;
+  var langGroup = Services.prefs.getComplexValue(
+    "font.language.group",
+    Ci.nsIPrefLocalizedString
+  ).data;
+  is(
+    contentWindow.Preferences.get("font.language.group").value,
+    langGroup,
+    "Language group should be set correctly."
+  );
+
+  let defaultFontType = Services.prefs.getCharPref("font.default." + langGroup);
+  let fontFamilyPref = "font.name." + defaultFontType + "." + langGroup;
+  let fontFamily = Services.prefs.getCharPref(fontFamilyPref);
+  let fontFamilyField = doc.getElementById("defaultFont");
+  is(fontFamilyField.value, fontFamily, "Font family should be set correctly.");
+
+  function dispatchMenuItemCommand(menuItem) {
+    const cmdEvent = doc.createEvent("xulcommandevent");
+    cmdEvent.initCommandEvent(
+      "command",
+      true,
+      true,
+      contentWindow,
+      0,
+      false,
+      false,
+      false,
+      false,
+      0,
+      null,
+      0
+    );
+    menuItem.dispatchEvent(cmdEvent);
+  }
+
+  /**
+   * Return a promise that resolves when the fontFamilyPref changes.
+   *
+   * Font prefs are the only ones whose form controls set "delayprefsave",
+   * which delays the pref change when a user specifies a new value
+   * for the pref.  Thus, in order to confirm that the pref gets changed
+   * when the test selects a new value in a font field, we need to await
+   * the change.  Awaiting this function does so for fontFamilyPref.
+   */
+  function fontFamilyPrefChanged() {
+    return new Promise(resolve => {
+      const observer = {
+        observe(aSubject, aTopic, aData) {
+          // Check for an exact match to avoid the ambiguity of nsIPrefBranch's
+          // prefix-matching algorithm for notifying pref observers.
+          if (aData == fontFamilyPref) {
+            Services.prefs.removeObserver(fontFamilyPref, observer);
+            resolve();
+          }
+        },
+      };
+      Services.prefs.addObserver(fontFamilyPref, observer);
+    });
+  }
+
+  const menuItems = fontFamilyField.querySelectorAll("menuitem");
+  Assert.greater(menuItems.length, 1, "There are multiple font menuitems.");
+  ok(menuItems[0].selected, "The first (default) font menuitem is selected.");
+
+  dispatchMenuItemCommand(menuItems[1]);
+  ok(menuItems[1].selected, "The second font menuitem is selected.");
+
+  await fontFamilyPrefChanged();
+  fontFamily = Services.prefs.getCharPref(fontFamilyPref);
+  is(fontFamilyField.value, fontFamily, "The font family has been updated.");
+
+  dispatchMenuItemCommand(menuItems[0]);
+  ok(
+    menuItems[0].selected,
+    "The first (default) font menuitem is selected again."
+  );
+
+  await fontFamilyPrefChanged();
+  fontFamily = Services.prefs.getCharPref(fontFamilyPref);
+  is(fontFamilyField.value, fontFamily, "The font family has been updated.");
+
+  let defaultFontSize = Services.prefs.getIntPref(
+    "font.size.variable." + langGroup
+  );
+  let fontSizeField = doc.getElementById("defaultFontSize");
+  is(
+    fontSizeField.value,
+    "" + defaultFontSize,
+    "Font size should be set correctly."
+  );
+
+  let promiseSubDialogLoaded = promiseLoadSubDialog(
+    "chrome://browser/content/preferences/dialogs/fonts.xhtml"
+  );
+  doc.getElementById("advancedFonts").click();
+  let win = await promiseSubDialogLoaded;
+  doc = win.document;
+
+  // Simulate a dumb font backend.
+  win.FontBuilder._enumerator = {
+    _list: ["MockedFont1", "MockedFont2", "MockedFont3"],
+    _defaultFont: null,
+    EnumerateFontsAsync(lang, type) {
+      return Promise.resolve(this._list);
+    },
+    EnumerateAllFontsAsync() {
+      return Promise.resolve(this._list);
+    },
+    getDefaultFont() {
+      return this._defaultFont;
+    },
+    getStandardFamilyName(name) {
+      return name;
+    },
+  };
+  win.FontBuilder._allFonts = null;
+  win.FontBuilder._langGroupSupported = false;
+
+  let langGroupElement = win.Preferences.get("font.language.group");
+  let selectLangsField = doc.getElementById("selectLangs");
+  let serifField = doc.getElementById("serif");
+  let armenian = "x-armn";
+  let western = "x-western";
+
+  // Await rebuilding of the font lists, which happens asynchronously in
+  // gFontsDialog._selectLanguageGroup.  Testing code needs to call this
+  // function and await its resolution after changing langGroupElement's value
+  // (or doing anything else that triggers a call to _selectLanguageGroup).
+  function fontListsRebuilt() {
+    return win.gFontsDialog._selectLanguageGroupPromise;
+  }
+
+  langGroupElement.value = armenian;
+  await fontListsRebuilt();
+  selectLangsField.value = armenian;
+  is(serifField.value, "", "Font family should not be set.");
+
+  let armenianSerifElement = win.Preferences.get("font.name.serif.x-armn");
+
+  langGroupElement.value = western;
+  await fontListsRebuilt();
+  selectLangsField.value = western;
+
+  // Simulate a font backend supporting language-specific enumeration.
+  // NB: FontBuilder has cached the return value from EnumerateAllFonts(),
+  // so _allFonts will always have 3 elements regardless of subsequent
+  // _list changes.
+  win.FontBuilder._enumerator._list = ["MockedFont2"];
+
+  langGroupElement.value = armenian;
+  await fontListsRebuilt();
+  selectLangsField.value = armenian;
+  is(
+    serifField.value,
+    "",
+    "Font family should still be empty for indicating using 'default' font."
+  );
+
+  langGroupElement.value = western;
+  await fontListsRebuilt();
+  selectLangsField.value = western;
+
+  // Simulate a system that has no fonts for the specified language.
+  win.FontBuilder._enumerator._list = [];
+
+  langGroupElement.value = armenian;
+  await fontListsRebuilt();
+  selectLangsField.value = armenian;
+  is(serifField.value, "", "Font family should not be set.");
+
+  // Setting default font to "MockedFont3".  Then, when serifField.value is
+  // empty, it should indicate using "MockedFont3" but it shouldn't be saved
+  // to "MockedFont3" in the pref.  It should be resolved at runtime.
+  win.FontBuilder._enumerator._list = [
+    "MockedFont1",
+    "MockedFont2",
+    "MockedFont3",
+  ];
+  win.FontBuilder._enumerator._defaultFont = "MockedFont3";
+  langGroupElement.value = armenian;
+  await fontListsRebuilt();
+  selectLangsField.value = armenian;
+  is(
+    serifField.value,
+    "",
+    "Font family should be empty even if there is a default font."
+  );
+
+  armenianSerifElement.value = "MockedFont2";
+  serifField.value = "MockedFont2";
+  is(
+    serifField.value,
+    "MockedFont2",
+    'Font family should be "MockedFont2" for now.'
+  );
+
+  langGroupElement.value = western;
+  await fontListsRebuilt();
+  selectLangsField.value = western;
+  is(serifField.value, "", "Font family of other language should not be set.");
+
+  langGroupElement.value = armenian;
+  await fontListsRebuilt();
+  selectLangsField.value = armenian;
+  is(
+    serifField.value,
+    "MockedFont2",
+    "Font family should not be changed even after switching the language."
+  );
+
+  // If MochedFont2 is removed from the system, the value should be treated
+  // as empty (i.e., 'default' font) after rebuilding the font list.
+  win.FontBuilder._enumerator._list = ["MockedFont1", "MockedFont3"];
+  win.FontBuilder._enumerator._allFonts = ["MockedFont1", "MockedFont3"];
+  serifField.removeAllItems(); // This will cause rebuilding the font list from available fonts.
+  langGroupElement.value = armenian;
+  await fontListsRebuilt();
+  selectLangsField.value = armenian;
+  is(
+    serifField.value,
+    "",
+    "Font family should become empty due to the font uninstalled."
+  );
+
+  gBrowser.removeCurrentTab();
+});
diff --git a/browser/components/preferences/tests/browser_browser_languages_subdialog.js b/browser/components/preferences/tests/browser_browser_languages_subdialog.js
new file mode 100644
index 0000000000..1941fb3502
--- /dev/null
+++ b/browser/components/preferences/tests/browser_browser_languages_subdialog.js
@@ -0,0 +1,1063 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+const { AddonTestUtils } = ChromeUtils.importESModule(
+  "resource://testing-common/AddonTestUtils.sys.mjs"
+);
+
+AddonTestUtils.initMochitest(this);
+
+const BROWSER_LANGUAGES_URL =
+  "chrome://browser/content/preferences/dialogs/browserLanguages.xhtml";
+const DICTIONARY_ID_PL = "pl@dictionaries.addons.mozilla.org";
+const TELEMETRY_CATEGORY = "intl.ui.browserLanguage";
+
+function langpackId(locale) {
+  return `langpack-${locale}@firefox.mozilla.org`;
+}
+
+function getManifestData(locale, version = "2.0") {
+  return {
+    langpack_id: locale,
+    name: `${locale} Language Pack`,
+    description: `${locale} Language pack`,
+    languages: {
+      [locale]: {
+        chrome_resources: {
+          branding: `browser/chrome/${locale}/locale/branding/`,
+        },
+        version: "1",
+      },
+    },
+    browser_specific_settings: {
+      gecko: {
+        id: langpackId(locale),
+        strict_min_version: AppConstants.MOZ_APP_VERSION,
+        strict_max_version: AppConstants.MOZ_APP_VERSION,
+      },
+    },
+    version,
+    manifest_version: 2,
+    sources: {
+      browser: {
+        base_path: "browser/",
+      },
+    },
+    author: "Mozilla",
+  };
+}
+
+let testLocales = ["fr", "pl", "he"];
+let testLangpacks;
+
+function createLangpack(locale, version) {
+  return AddonTestUtils.createTempXPIFile({
+    "manifest.json": getManifestData(locale, version),
+    [`browser/${locale}/branding/brand.ftl`]: "-brand-short-name = Firefox",
+  });
+}
+
+function createTestLangpacks() {
+  if (!testLangpacks) {
+    testLangpacks = Promise.all(
+      testLocales.map(async locale => [locale, await createLangpack(locale)])
+    );
+  }
+  return testLangpacks;
+}
+
+function createLocaleResult(target_locale, url) {
+  return {
+    guid: langpackId(target_locale),
+    type: "language",
+    target_locale,
+    current_compatible_version: {
+      files: [
+        {
+          platform: "all",
+          url,
+        },
+      ],
+    },
+  };
+}
+
+async function createLanguageToolsFile() {
+  let langpacks = await createTestLangpacks();
+  let results = langpacks.map(([locale, file]) =>
+    createLocaleResult(locale, Services.io.newFileURI(file).spec)
+  );
+
+  let filename = "language-tools.json";
+  let files = { [filename]: { results } };
+  let tempdir = AddonTestUtils.tempDir.clone();
+  let dir = await AddonTestUtils.promiseWriteFilesToDir(tempdir.path, files);
+  dir.append(filename);
+
+  return dir;
+}
+
+async function createDictionaryBrowseResults() {
+  let testDir = gTestPath.substr(0, gTestPath.lastIndexOf("/"));
+  let dictionaryPath = testDir + "/addons/pl-dictionary.xpi";
+  let filename = "dictionaries.json";
+  let response = {
+    page_size: 25,
+    page_count: 1,
+    count: 1,
+    results: [
+      {
+        current_version: {
+          id: 1823648,
+          compatibility: {
+            firefox: { max: "9999", min: "4.0" },
+          },
+          files: [
+            {
+              platform: "all",
+              url: dictionaryPath,
+            },
+          ],
+          version: "1.0.20160228",
+        },
+        default_locale: "pl",
+        description: "Polish spell-check",
+        guid: DICTIONARY_ID_PL,
+        name: "Polish Dictionary",
+        slug: "polish-spellchecker-dictionary",
+        status: "public",
+        summary: "Polish dictionary",
+        type: "dictionary",
+      },
+    ],
+  };
+
+  let files = { [filename]: response };
+  let dir = await AddonTestUtils.promiseWriteFilesToDir(
+    AddonTestUtils.tempDir.path,
+    files
+  );
+  dir.append(filename);
+
+  return dir;
+}
+
+function assertLocaleOrder(list, locales) {
+  is(
+    list.itemCount,
+    locales.split(",").length,
+    "The right number of locales are selected"
+  );
+  is(
+    Array.from(list.children)
+      .map(child => child.value)
+      .join(","),
+    locales,
+    "The selected locales are in order"
+  );
+}
+
+function assertAvailableLocales(list, locales) {
+  let items = Array.from(list.menupopup.children);
+  let listLocales = items.filter(item => item.value && item.value != "search");
+  is(
+    listLocales.length,
+    locales.length,
+    "The right number of locales are available"
+  );
+  is(
+    listLocales
+      .map(item => item.value)
+      .sort()
+      .join(","),
+    locales.sort().join(","),
+    "The available locales match"
+  );
+  is(items[0].getAttribute("class"), "label-item", "The first row is a label");
+}
+
+function getDialogId(dialogDoc) {
+  return dialogDoc.ownerGlobal.arguments[0].telemetryId;
+}
+
+function assertTelemetryRecorded(events) {
+  let snapshot = Services.telemetry.snapshotEvents(
+    Ci.nsITelemetry.DATASET_PRERELEASE_CHANNELS,
+    true
+  );
+
+  // Make sure we got some data.
+  ok(
+    snapshot.parent && !!snapshot.parent.length,
+    "Got parent telemetry events in the snapshot"
+  );
+
+  // Only look at the related events after stripping the timestamp and category.
+  let relatedEvents = snapshot.parent
+    .filter(([timestamp, category]) => category == TELEMETRY_CATEGORY)
+    .map(relatedEvent => relatedEvent.slice(2, 6));
+
+  // Events are now an array of: method, object[, value[, extra]] as expected.
+  Assert.deepEqual(relatedEvents, events, "The events are recorded correctly");
+}
+
+async function selectLocale(localeCode, available, selected, dialogDoc) {
+  let [locale] = Array.from(available.menupopup.children).filter(
+    item => item.value == localeCode
+  );
+  available.selectedItem = locale;
+
+  // Get ready for the selected list to change.
+  let added = waitForMutation(selected, { childList: true }, target =>
+    Array.from(target.children).some(el => el.value == localeCode)
+  );
+
+  // Add the locale.
+  dialogDoc.getElementById("add").doCommand();
+
+  // Wait for the list to update.
+  await added;
+}
+
+async function openDialog(doc, search = false) {
+  let dialogLoaded = promiseLoadSubDialog(BROWSER_LANGUAGES_URL);
+  if (search) {
+    doc.getElementById("primaryBrowserLocaleSearch").doCommand();
+    doc.getElementById("primaryBrowserLocale").menupopup.hidePopup();
+  } else {
+    doc.getElementById("manageBrowserLanguagesButton").doCommand();
+  }
+  let dialogWin = await dialogLoaded;
+  let dialogDoc = dialogWin.document;
+  return {
+    dialog: dialogDoc.getElementById("BrowserLanguagesDialog"),
+    dialogDoc,
+    available: dialogDoc.getElementById("availableLocales"),
+    selected: dialogDoc.getElementById("selectedLocales"),
+  };
+}
+
+add_task(async function testDisabledBrowserLanguages() {
+  let langpacksFile = await createLanguageToolsFile();
+  let langpacksUrl = Services.io.newFileURI(langpacksFile).spec;
+
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["intl.multilingual.enabled", true],
+      ["intl.multilingual.downloadEnabled", true],
+      ["intl.multilingual.liveReload", false],
+      ["intl.multilingual.liveReloadBidirectional", false],
+      ["intl.locale.requested", "en-US,pl,he,de"],
+      ["extensions.langpacks.signatures.required", false],
+      ["extensions.getAddons.langpacks.url", langpacksUrl],
+    ],
+  });
+
+  // Install an old pl langpack.
+  let oldLangpack = await createLangpack("pl", "1.0");
+  await AddonTestUtils.promiseInstallFile(oldLangpack);
+
+  // Install all the other available langpacks.
+  let pl;
+  let langpacks = await createTestLangpacks();
+  let addons = await Promise.all(
+    langpacks.map(async ([locale, file]) => {
+      if (locale == "pl") {
+        pl = await AddonManager.getAddonByID(langpackId("pl"));
+        // Disable pl so it's removed from selected.
+        await pl.disable();
+        return pl;
+      }
+      let install = await AddonTestUtils.promiseInstallFile(file);
+      return install.addon;
+    })
+  );
+
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+
+  let doc = gBrowser.contentDocument;
+  let { dialogDoc, available, selected } = await openDialog(doc);
+
+  // pl is not selected since it's disabled.
+  is(pl.userDisabled, true, "pl is disabled");
+  is(pl.version, "1.0", "pl is the old 1.0 version");
+  assertLocaleOrder(selected, "en-US,he");
+
+  // Wait for the children menu to be populated.
+  await BrowserTestUtils.waitForCondition(
+    () => !!available.children.length,
+    "Children list populated"
+  );
+
+  // Only fr is enabled and not selected, so it's the only locale available.
+  assertAvailableLocales(available, ["fr"]);
+
+  // Search for more languages.
+  available.menupopup.lastElementChild.doCommand();
+  available.menupopup.hidePopup();
+  await waitForMutation(available.menupopup, { childList: true }, target =>
+    Array.from(available.menupopup.children).some(
+      locale => locale.value == "pl"
+    )
+  );
+
+  // pl is now available since it is available remotely.
+  assertAvailableLocales(available, ["fr", "pl"]);
+
+  let installId = null;
+  AddonTestUtils.promiseInstallEvent("onInstallEnded").then(([install]) => {
+    installId = install.installId;
+  });
+
+  // Add pl.
+  await selectLocale("pl", available, selected, dialogDoc);
+  assertLocaleOrder(selected, "pl,en-US,he");
+
+  // Find pl again since it's been upgraded.
+  pl = await AddonManager.getAddonByID(langpackId("pl"));
+  is(pl.userDisabled, false, "pl is now enabled");
+  is(pl.version, "2.0", "pl is upgraded to version 2.0");
+
+  let dialogId = getDialogId(dialogDoc);
+  ok(dialogId, "There's a dialogId");
+  ok(installId, "There's an installId");
+
+  await Promise.all(addons.map(addon => addon.uninstall()));
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+
+  assertTelemetryRecorded([
+    ["manage", "main", dialogId],
+    ["search", "dialog", dialogId],
+    ["add", "dialog", dialogId, { installId }],
+
+    // Cancel is recorded when the tab is closed.
+    ["cancel", "dialog", dialogId],
+  ]);
+});
+
+add_task(async function testReorderingBrowserLanguages() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["intl.multilingual.enabled", true],
+      ["intl.multilingual.downloadEnabled", true],
+      ["intl.multilingual.liveReload", false],
+      ["intl.multilingual.liveReloadBidirectional", false],
+      ["intl.locale.requested", "en-US,pl,he,de"],
+      ["extensions.langpacks.signatures.required", false],
+    ],
+  });
+
+  // Install all the available langpacks.
+  let langpacks = await createTestLangpacks();
+  let addons = await Promise.all(
+    langpacks.map(async ([locale, file]) => {
+      let install = await AddonTestUtils.promiseInstallFile(file);
+      return install.addon;
+    })
+  );
+
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+
+  let doc = gBrowser.contentDocument;
+  let messageBar = doc.getElementById("confirmBrowserLanguage");
+  is(messageBar.hidden, true, "The message bar is hidden at first");
+
+  // Open the dialog.
+  let { dialog, dialogDoc, selected } = await openDialog(doc);
+  let firstDialogId = getDialogId(dialogDoc);
+
+  // The initial order is set by the pref, filtered by available.
+  assertLocaleOrder(selected, "en-US,pl,he");
+
+  // Moving pl down changes the order.
+  selected.selectedItem = selected.querySelector("[value='pl']");
+  dialogDoc.getElementById("down").doCommand();
+  assertLocaleOrder(selected, "en-US,he,pl");
+
+  // Accepting the change shows the confirm message bar.
+  let dialogClosed = BrowserTestUtils.waitForEvent(dialog, "dialogclosing");
+  dialog.acceptDialog();
+  await dialogClosed;
+
+  // The message bar uses async `formatValues` and that may resolve
+  // after the dialog is closed.
+  await BrowserTestUtils.waitForMutationCondition(
+    messageBar,
+    { attributes: true },
+    () => !messageBar.hidden
+  );
+  is(
+    messageBar.querySelector("button").getAttribute("locales"),
+    "en-US,he,pl",
+    "The locales are set on the message bar button"
+  );
+
+  // Open the dialog again.
+  let newDialog = await openDialog(doc);
+  dialog = newDialog.dialog;
+  dialogDoc = newDialog.dialogDoc;
+  let secondDialogId = getDialogId(dialogDoc);
+  selected = newDialog.selected;
+
+  // The initial order comes from the previous settings.
+  assertLocaleOrder(selected, "en-US,he,pl");
+
+  // Select pl in the list.
+  selected.selectedItem = selected.querySelector("[value='pl']");
+  // Move pl back up.
+  dialogDoc.getElementById("up").doCommand();
+  assertLocaleOrder(selected, "en-US,pl,he");
+
+  // Accepting the change hides the confirm message bar.
+  dialogClosed = BrowserTestUtils.waitForEvent(dialog, "dialogclosing");
+  dialog.acceptDialog();
+  await dialogClosed;
+  is(messageBar.hidden, true, "The message bar is hidden again");
+
+  ok(firstDialogId, "There was an id on the first dialog");
+  ok(secondDialogId, "There was an id on the second dialog");
+  Assert.notEqual(
+    firstDialogId,
+    secondDialogId,
+    "The dialog ids are different"
+  );
+  Assert.less(
+    parseInt(firstDialogId),
+    parseInt(secondDialogId),
+    "The second dialog id is larger than the first"
+  );
+
+  await Promise.all(addons.map(addon => addon.uninstall()));
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+
+  assertTelemetryRecorded([
+    ["manage", "main", firstDialogId],
+    ["reorder", "dialog", firstDialogId],
+    ["accept", "dialog", firstDialogId],
+    ["manage", "main", secondDialogId],
+    ["reorder", "dialog", secondDialogId],
+    ["accept", "dialog", secondDialogId],
+  ]);
+});
+
+add_task(async function testAddAndRemoveSelectedLanguages() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["intl.multilingual.enabled", true],
+      ["intl.multilingual.downloadEnabled", true],
+      ["intl.multilingual.liveReload", false],
+      ["intl.multilingual.liveReloadBidirectional", false],
+      ["intl.locale.requested", "en-US"],
+      ["extensions.langpacks.signatures.required", false],
+    ],
+  });
+
+  let langpacks = await createTestLangpacks();
+  let addons = await Promise.all(
+    langpacks.map(async ([locale, file]) => {
+      let install = await AddonTestUtils.promiseInstallFile(file);
+      return install.addon;
+    })
+  );
+
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+
+  let doc = gBrowser.contentDocument;
+  let messageBar = doc.getElementById("confirmBrowserLanguage");
+  is(messageBar.hidden, true, "The message bar is hidden at first");
+
+  // Open the dialog.
+  let { dialog, dialogDoc, available, selected } = await openDialog(doc);
+  let dialogId = getDialogId(dialogDoc);
+
+  // loadLocalesFromAMO is async but `initAvailableLocales` doesn't wait
+  // for it to be resolved, so we have to wait for the list to be populated
+  // before we test for its values.
+  await BrowserTestUtils.waitForMutationCondition(
+    available.menupopup,
+    { attributes: true, childList: true },
+    () => {
+      let listLocales = Array.from(available.menupopup.children).filter(
+        item => item.value && item.value != "search"
+      );
+      return listLocales.length == 3;
+    }
+  );
+  // The initial order is set by the pref.
+  assertLocaleOrder(selected, "en-US");
+  assertAvailableLocales(available, ["fr", "pl", "he"]);
+
+  // Add pl and fr to selected.
+  await selectLocale("pl", available, selected, dialogDoc);
+  await selectLocale("fr", available, selected, dialogDoc);
+
+  assertLocaleOrder(selected, "fr,pl,en-US");
+  assertAvailableLocales(available, ["he"]);
+
+  // Remove pl and fr from selected.
+  dialogDoc.getElementById("remove").doCommand();
+  dialogDoc.getElementById("remove").doCommand();
+  assertLocaleOrder(selected, "en-US");
+  assertAvailableLocales(available, ["fr", "pl", "he"]);
+
+  // Add he to selected.
+  await selectLocale("he", available, selected, dialogDoc);
+  assertLocaleOrder(selected, "he,en-US");
+  assertAvailableLocales(available, ["pl", "fr"]);
+
+  // Accepting the change shows the confirm message bar.
+  let dialogClosed = BrowserTestUtils.waitForEvent(dialog, "dialogclosing");
+  dialog.acceptDialog();
+  await dialogClosed;
+
+  await waitForMutation(
+    messageBar,
+    { attributes: true, attributeFilter: ["hidden"] },
+    target => !target.hidden
+  );
+
+  is(messageBar.hidden, false, "The message bar is now visible");
+  is(
+    messageBar.querySelector("button").getAttribute("locales"),
+    "he,en-US",
+    "The locales are set on the message bar button"
+  );
+
+  await Promise.all(addons.map(addon => addon.uninstall()));
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+
+  assertTelemetryRecorded([
+    ["manage", "main", dialogId],
+
+    // Install id is not recorded since it was already installed.
+    ["add", "dialog", dialogId],
+    ["add", "dialog", dialogId],
+
+    ["remove", "dialog", dialogId],
+    ["remove", "dialog", dialogId],
+
+    ["add", "dialog", dialogId],
+    ["accept", "dialog", dialogId],
+  ]);
+});
+
+add_task(async function testInstallFromAMO() {
+  let langpacks = await AddonManager.getAddonsByTypes(["locale"]);
+  is(langpacks.length, 0, "There are no langpacks installed");
+
+  let langpacksFile = await createLanguageToolsFile();
+  let langpacksUrl = Services.io.newFileURI(langpacksFile).spec;
+  let dictionaryBrowseFile = await createDictionaryBrowseResults();
+  let browseApiEndpoint = Services.io.newFileURI(dictionaryBrowseFile).spec;
+
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["intl.multilingual.enabled", true],
+      ["intl.multilingual.downloadEnabled", true],
+      ["intl.multilingual.liveReload", false],
+      ["intl.multilingual.liveReloadBidirectional", false],
+      ["intl.locale.requested", "en-US"],
+      ["extensions.getAddons.langpacks.url", langpacksUrl],
+      ["extensions.langpacks.signatures.required", false],
+      ["extensions.getAddons.get.url", browseApiEndpoint],
+    ],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+
+  let doc = gBrowser.contentDocument;
+  let messageBar = doc.getElementById("confirmBrowserLanguage");
+  is(messageBar.hidden, true, "The message bar is hidden at first");
+
+  // Verify only en-US is listed on the main pane.
+  let getMainPaneLocales = () => {
+    let available = doc.getElementById("primaryBrowserLocale");
+    let availableLocales = Array.from(available.menupopup.children);
+    return availableLocales
+      .map(item => item.value)
+      .sort()
+      .join(",");
+  };
+  is(getMainPaneLocales(), "en-US,search", "Only en-US installed to start");
+
+  // Open the dialog.
+  let { dialog, dialogDoc, available, selected } = await openDialog(doc, true);
+  let firstDialogId = getDialogId(dialogDoc);
+
+  // Make sure the message bar is still hidden.
+  is(
+    messageBar.hidden,
+    true,
+    "The message bar is still hidden after searching"
+  );
+
+  if (available.itemCount == 1) {
+    await waitForMutation(
+      available.menupopup,
+      { childList: true },
+      target => available.itemCount > 1
+    );
+  }
+
+  // The initial order is set by the pref.
+  assertLocaleOrder(selected, "en-US");
+  assertAvailableLocales(available, ["fr", "he", "pl"]);
+  is(
+    Services.locale.availableLocales.join(","),
+    "en-US",
+    "There is only one installed locale"
+  );
+
+  // Verify that there are no extra dictionaries.
+  let dicts = await AddonManager.getAddonsByTypes(["dictionary"]);
+  is(dicts.length, 0, "There are no installed dictionaries");
+
+  let installId = null;
+  AddonTestUtils.promiseInstallEvent("onInstallEnded").then(([install]) => {
+    installId = install.installId;
+  });
+
+  // Add Polish, this will install the langpack.
+  await selectLocale("pl", available, selected, dialogDoc);
+
+  ok(installId, "We got an installId for the langpack installation");
+
+  let langpack = await AddonManager.getAddonByID(langpackId("pl"));
+  Assert.deepEqual(
+    langpack.installTelemetryInfo,
+    { source: "about:preferences" },
+    "The source is set to preferences"
+  );
+
+  // Verify the list is correct.
+  assertLocaleOrder(selected, "pl,en-US");
+  assertAvailableLocales(available, ["fr", "he"]);
+  is(
+    Services.locale.availableLocales.sort().join(","),
+    "en-US,pl",
+    "Polish is now installed"
+  );
+
+  await BrowserTestUtils.waitForCondition(async () => {
+    let newDicts = await AddonManager.getAddonsByTypes(["dictionary"]);
+    let done = !!newDicts.length;
+
+    if (done) {
+      is(
+        newDicts[0].id,
+        DICTIONARY_ID_PL,
+        "The polish dictionary was installed"
+      );
+    }
+
+    return done;
+  });
+
+  // Move pl down the list, which prevents an error since it isn't valid.
+  dialogDoc.getElementById("down").doCommand();
+  assertLocaleOrder(selected, "en-US,pl");
+
+  // Test that disabling the langpack removes it from the list.
+  let dialogClosed = BrowserTestUtils.waitForEvent(dialog, "dialogclosing");
+  dialog.acceptDialog();
+  await dialogClosed;
+
+  // Verify pl is now available to select.
+  is(getMainPaneLocales(), "en-US,pl,search", "en-US and pl now available");
+
+  // Disable the Polish langpack.
+  langpack = await AddonManager.getAddonByID("langpack-pl@firefox.mozilla.org");
+  await langpack.disable();
+
+  ({ dialogDoc, available, selected } = await openDialog(doc, true));
+  let secondDialogId = getDialogId(dialogDoc);
+
+  // Wait for the available langpacks to load.
+  if (available.itemCount == 1) {
+    await waitForMutation(
+      available.menupopup,
+      { childList: true },
+      target => available.itemCount > 1
+    );
+  }
+  assertLocaleOrder(selected, "en-US");
+  assertAvailableLocales(available, ["fr", "he", "pl"]);
+
+  // Uninstall the langpack and dictionary.
+  let installs = await AddonManager.getAddonsByTypes(["locale", "dictionary"]);
+  is(installs.length, 2, "There is one langpack and one dictionary installed");
+  await Promise.all(installs.map(item => item.uninstall()));
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+
+  assertTelemetryRecorded([
+    // First dialog installs a locale and accepts.
+    ["search", "main", firstDialogId],
+    // It has an installId since it was downloaded.
+    ["add", "dialog", firstDialogId, { installId }],
+    // It got moved down to avoid errors with finding translations.
+    ["reorder", "dialog", firstDialogId],
+    ["accept", "dialog", firstDialogId],
+
+    // The second dialog just checks the state and is closed with the tab.
+    ["search", "main", secondDialogId],
+    ["cancel", "dialog", secondDialogId],
+  ]);
+});
+
+let hasSearchOption = popup =>
+  Array.from(popup.children).some(el => el.value == "search");
+
+add_task(async function testDownloadEnabled() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["intl.multilingual.enabled", true],
+      ["intl.multilingual.downloadEnabled", true],
+      ["intl.multilingual.liveReload", false],
+      ["intl.multilingual.liveReloadBidirectional", false],
+    ],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  let doc = gBrowser.contentDocument;
+
+  let defaultMenulist = doc.getElementById("primaryBrowserLocale");
+  ok(
+    hasSearchOption(defaultMenulist.menupopup),
+    "There's a search option in the General pane"
+  );
+
+  let { available } = await openDialog(doc, false);
+  ok(
+    hasSearchOption(available.menupopup),
+    "There's a search option in the dialog"
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function testDownloadDisabled() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["intl.multilingual.enabled", true],
+      ["intl.multilingual.downloadEnabled", false],
+      ["intl.multilingual.liveReload", false],
+      ["intl.multilingual.liveReloadBidirectional", false],
+    ],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  let doc = gBrowser.contentDocument;
+
+  let defaultMenulist = doc.getElementById("primaryBrowserLocale");
+  ok(
+    !hasSearchOption(defaultMenulist.menupopup),
+    "There's no search option in the General pane"
+  );
+
+  let { available } = await openDialog(doc, false);
+  ok(
+    !hasSearchOption(available.menupopup),
+    "There's no search option in the dialog"
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function testReorderMainPane() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["intl.multilingual.enabled", true],
+      ["intl.multilingual.downloadEnabled", false],
+      ["intl.multilingual.liveReload", false],
+      ["intl.multilingual.liveReloadBidirectional", false],
+      ["intl.locale.requested", "en-US"],
+      ["extensions.langpacks.signatures.required", false],
+    ],
+  });
+
+  // Clear the telemetry from other tests.
+  Services.telemetry.clearEvents();
+
+  let langpacks = await createTestLangpacks();
+  let addons = await Promise.all(
+    langpacks.map(async ([locale, file]) => {
+      let install = await AddonTestUtils.promiseInstallFile(file);
+      return install.addon;
+    })
+  );
+
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  let doc = gBrowser.contentDocument;
+
+  let messageBar = doc.getElementById("confirmBrowserLanguage");
+  is(messageBar.hidden, true, "The message bar is hidden at first");
+
+  let available = doc.getElementById("primaryBrowserLocale");
+  let availableLocales = Array.from(available.menupopup.children);
+  let availableCodes = availableLocales
+    .map(item => item.value)
+    .sort()
+    .join(",");
+  is(
+    availableCodes,
+    "en-US,fr,he,pl",
+    "All of the available locales are listed"
+  );
+
+  is(available.selectedItem.value, "en-US", "English is selected");
+
+  let hebrew = availableLocales.find(item => item.value == "he");
+  hebrew.click();
+  available.menupopup.hidePopup();
+
+  await BrowserTestUtils.waitForCondition(
+    () => !messageBar.hidden,
+    "Wait for message bar to show"
+  );
+
+  is(messageBar.hidden, false, "The message bar is now shown");
+  is(
+    messageBar.querySelector("button").getAttribute("locales"),
+    "he,en-US",
+    "The locales are set on the message bar button"
+  );
+
+  await Promise.all(addons.map(addon => addon.uninstall()));
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+
+  assertTelemetryRecorded([["reorder", "main"]]);
+});
+
+add_task(async function testLiveLanguageReloading() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["intl.multilingual.enabled", true],
+      ["intl.multilingual.downloadEnabled", true],
+      ["intl.multilingual.liveReload", true],
+      ["intl.multilingual.liveReloadBidirectional", false],
+      ["intl.locale.requested", "en-US,fr,he,de"],
+      ["extensions.langpacks.signatures.required", false],
+    ],
+  });
+
+  // Clear the telemetry from other tests.
+  Services.telemetry.clearEvents();
+
+  let langpacks = await createTestLangpacks();
+  let addons = await Promise.all(
+    langpacks.map(async ([locale, file]) => {
+      let install = await AddonTestUtils.promiseInstallFile(file);
+      return install.addon;
+    })
+  );
+
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+
+  let doc = gBrowser.contentDocument;
+
+  let available = doc.getElementById("primaryBrowserLocale");
+  let availableLocales = Array.from(available.menupopup.children);
+
+  is(
+    Services.locale.appLocaleAsBCP47,
+    "en-US",
+    "The app locale starts as English."
+  );
+
+  Assert.deepEqual(
+    Services.locale.requestedLocales,
+    ["en-US", "fr", "he", "de"],
+    "The locale order starts as what was initially requested."
+  );
+
+  // French and English are both LTR languages.
+  let french = availableLocales.find(item => item.value == "fr");
+
+  french.click();
+  available.menupopup.hidePopup();
+
+  is(
+    Services.locale.appLocaleAsBCP47,
+    "fr",
+    "The app locale was changed to French"
+  );
+
+  Assert.deepEqual(
+    Services.locale.requestedLocales,
+    ["fr", "en-US", "he", "de"],
+    "The locale order is switched to french first."
+  );
+
+  await Promise.all(addons.map(addon => addon.uninstall()));
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+
+  assertTelemetryRecorded([["reorder", "main"]]);
+});
+
+add_task(async function testLiveLanguageReloadingBidiOff() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["intl.multilingual.enabled", true],
+      ["intl.multilingual.downloadEnabled", true],
+      ["intl.multilingual.liveReload", true],
+      ["intl.multilingual.liveReloadBidirectional", false],
+      ["intl.locale.requested", "en-US,fr,he,de"],
+      ["extensions.langpacks.signatures.required", false],
+    ],
+  });
+
+  // Clear the telemetry from other tests.
+  Services.telemetry.clearEvents();
+
+  let langpacks = await createTestLangpacks();
+  let addons = await Promise.all(
+    langpacks.map(async ([locale, file]) => {
+      let install = await AddonTestUtils.promiseInstallFile(file);
+      return install.addon;
+    })
+  );
+
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+
+  let doc = gBrowser.contentDocument;
+
+  let available = doc.getElementById("primaryBrowserLocale");
+  let availableLocales = Array.from(available.menupopup.children);
+
+  is(
+    Services.locale.appLocaleAsBCP47,
+    "en-US",
+    "The app locale starts as English."
+  );
+
+  Assert.deepEqual(
+    Services.locale.requestedLocales,
+    ["en-US", "fr", "he", "de"],
+    "The locale order starts as what was initially requested."
+  );
+
+  let messageBar = doc.getElementById("confirmBrowserLanguage");
+  is(messageBar.hidden, true, "The message bar is hidden at first");
+
+  // English is LTR and Hebrew is RTL.
+  let hebrew = availableLocales.find(item => item.value == "he");
+
+  hebrew.click();
+  available.menupopup.hidePopup();
+
+  await BrowserTestUtils.waitForCondition(
+    () => !messageBar.hidden,
+    "Wait for message bar to show"
+  );
+
+  is(messageBar.hidden, false, "The message bar is now shown");
+
+  is(
+    Services.locale.appLocaleAsBCP47,
+    "en-US",
+    "The app locale remains in English"
+  );
+
+  Assert.deepEqual(
+    Services.locale.requestedLocales,
+    ["en-US", "fr", "he", "de"],
+    "The locale order did not change."
+  );
+
+  await Promise.all(addons.map(addon => addon.uninstall()));
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+
+  assertTelemetryRecorded([["reorder", "main"]]);
+});
+
+add_task(async function testLiveLanguageReloadingBidiOn() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["intl.multilingual.enabled", true],
+      ["intl.multilingual.downloadEnabled", true],
+      ["intl.multilingual.liveReload", true],
+      ["intl.multilingual.liveReloadBidirectional", true],
+      ["intl.locale.requested", "en-US,fr,he,de"],
+      ["extensions.langpacks.signatures.required", false],
+    ],
+  });
+
+  // Clear the telemetry from other tests.
+  Services.telemetry.clearEvents();
+
+  let langpacks = await createTestLangpacks();
+  let addons = await Promise.all(
+    langpacks.map(async ([locale, file]) => {
+      let install = await AddonTestUtils.promiseInstallFile(file);
+      return install.addon;
+    })
+  );
+
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+
+  let doc = gBrowser.contentDocument;
+
+  let available = doc.getElementById("primaryBrowserLocale");
+  let availableLocales = Array.from(available.menupopup.children);
+
+  is(
+    Services.locale.appLocaleAsBCP47,
+    "en-US",
+    "The app locale starts as English."
+  );
+
+  Assert.deepEqual(
+    Services.locale.requestedLocales,
+    ["en-US", "fr", "he", "de"],
+    "The locale order starts as what was initially requested."
+  );
+
+  let messageBar = doc.getElementById("confirmBrowserLanguage");
+  is(messageBar.hidden, true, "The message bar is hidden at first");
+
+  // English is LTR and Hebrew is RTL.
+  let hebrew = availableLocales.find(item => item.value == "he");
+
+  hebrew.click();
+  available.menupopup.hidePopup();
+
+  is(messageBar.hidden, true, "The message bar is still hidden");
+
+  is(
+    Services.locale.appLocaleAsBCP47,
+    "he",
+    "The app locale was changed to Hebrew."
+  );
+
+  Assert.deepEqual(
+    Services.locale.requestedLocales,
+    ["he", "en-US", "fr", "de"],
+    "The locale changed with Hebrew first."
+  );
+
+  await Promise.all(addons.map(addon => addon.uninstall()));
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+
+  assertTelemetryRecorded([["reorder", "main"]]);
+});
diff --git a/browser/components/preferences/tests/browser_bug1018066_resetScrollPosition.js b/browser/components/preferences/tests/browser_bug1018066_resetScrollPosition.js
new file mode 100644
index 0000000000..bc928656ab
--- /dev/null
+++ b/browser/components/preferences/tests/browser_bug1018066_resetScrollPosition.js
@@ -0,0 +1,30 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+var originalWindowHeight;
+registerCleanupFunction(function () {
+  window.resizeTo(window.outerWidth, originalWindowHeight);
+  while (gBrowser.tabs[1]) {
+    gBrowser.removeTab(gBrowser.tabs[1]);
+  }
+});
+
+add_task(async function () {
+  originalWindowHeight = window.outerHeight;
+  window.resizeTo(window.outerWidth, 300);
+  let prefs = await openPreferencesViaOpenPreferencesAPI("paneSearch", {
+    leaveOpen: true,
+  });
+  is(prefs.selectedPane, "paneSearch", "Search pane was selected");
+  let mainContent = gBrowser.contentDocument.querySelector(".main-content");
+  mainContent.scrollTop = 50;
+  is(mainContent.scrollTop, 50, "main-content should be scrolled 50 pixels");
+
+  await gBrowser.contentWindow.gotoPref("paneGeneral");
+
+  is(
+    mainContent.scrollTop,
+    0,
+    "Switching to a different category should reset the scroll position"
+  );
+});
diff --git a/browser/components/preferences/tests/browser_bug1020245_openPreferences_to_paneContent.js b/browser/components/preferences/tests/browser_bug1020245_openPreferences_to_paneContent.js
new file mode 100644
index 0000000000..26e79b648d
--- /dev/null
+++ b/browser/components/preferences/tests/browser_bug1020245_openPreferences_to_paneContent.js
@@ -0,0 +1,163 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+// Test opening to the differerent panes and subcategories in Preferences
+add_task(async function () {
+  let prefs = await openPreferencesViaOpenPreferencesAPI("panePrivacy");
+  is(prefs.selectedPane, "panePrivacy", "Privacy pane was selected");
+  prefs = await openPreferencesViaHash("privacy");
+  is(
+    prefs.selectedPane,
+    "panePrivacy",
+    "Privacy pane is selected when hash is 'privacy'"
+  );
+  prefs = await openPreferencesViaOpenPreferencesAPI("nonexistant-category");
+  is(
+    prefs.selectedPane,
+    "paneGeneral",
+    "General pane is selected by default when a nonexistant-category is requested"
+  );
+  prefs = await openPreferencesViaHash("nonexistant-category");
+  is(
+    prefs.selectedPane,
+    "paneGeneral",
+    "General pane is selected when hash is a nonexistant-category"
+  );
+  prefs = await openPreferencesViaHash();
+  is(prefs.selectedPane, "paneGeneral", "General pane is selected by default");
+  prefs = await openPreferencesViaOpenPreferencesAPI("privacy-reports", {
+    leaveOpen: true,
+  });
+  is(prefs.selectedPane, "panePrivacy", "Privacy pane is selected by default");
+  let doc = gBrowser.contentDocument;
+  is(
+    doc.location.hash,
+    "#privacy",
+    "The subcategory should be removed from the URI"
+  );
+  await TestUtils.waitForCondition(
+    () => doc.querySelector(".spotlight"),
+    "Wait for the reports section is spotlighted."
+  );
+  is(
+    doc.querySelector(".spotlight").getAttribute("data-subcategory"),
+    "reports",
+    "The reports section is spotlighted."
+  );
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+// Test opening Preferences with subcategory on an existing Preferences tab. See bug 1358475.
+add_task(async function () {
+  let prefs = await openPreferencesViaOpenPreferencesAPI("general", {
+    leaveOpen: true,
+  });
+  is(prefs.selectedPane, "paneGeneral", "General pane is selected by default");
+  let doc = gBrowser.contentDocument;
+  is(
+    doc.location.hash,
+    "#general",
+    "The subcategory should be removed from the URI"
+  );
+  // The reasons that here just call the `openPreferences` API without the helping function are
+  //   - already opened one about:preferences tab up there and
+  //   - the goal is to test on the existing tab and
+  //   - using `openPreferencesViaOpenPreferencesAPI` would introduce more handling of additional about:blank and unneccessary event
+  await openPreferences("privacy-reports");
+  let selectedPane = gBrowser.contentWindow.history.state;
+  is(selectedPane, "panePrivacy", "Privacy pane should be selected");
+  is(
+    doc.location.hash,
+    "#privacy",
+    "The subcategory should be removed from the URI"
+  );
+  await TestUtils.waitForCondition(
+    () => doc.querySelector(".spotlight"),
+    "Wait for the reports section is spotlighted."
+  );
+  is(
+    doc.querySelector(".spotlight").getAttribute("data-subcategory"),
+    "reports",
+    "The reports section is spotlighted."
+  );
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+// Test opening to a subcategory displays the correct values for preferences
+add_task(async function () {
+  // Skip if crash reporting isn't enabled since the checkbox will be missing.
+  if (!AppConstants.MOZ_CRASHREPORTER) {
+    return;
+  }
+
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.crashReports.unsubmittedCheck.autoSubmit2", true]],
+  });
+  await openPreferencesViaOpenPreferencesAPI("privacy-reports", {
+    leaveOpen: true,
+  });
+
+  let doc = gBrowser.contentDocument;
+  ok(
+    doc.querySelector("#automaticallySubmitCrashesBox").checked,
+    "Checkbox for automatically submitting crashes should be checked when the pref is true and only Reports are requested"
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  await SpecialPowers.popPrefEnv();
+});
+
+add_task(async function () {
+  // Skip if crash reporting isn't enabled since the checkbox will be missing.
+  if (!AppConstants.MOZ_CRASHREPORTER) {
+    return;
+  }
+
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.crashReports.unsubmittedCheck.autoSubmit2", false]],
+  });
+  await openPreferencesViaOpenPreferencesAPI("privacy-reports", {
+    leaveOpen: true,
+  });
+
+  let doc = gBrowser.contentDocument;
+  ok(
+    !doc.querySelector("#automaticallySubmitCrashesBox").checked,
+    "Checkbox for automatically submitting crashes should not be checked when the pref is false only Reports are requested"
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  await SpecialPowers.popPrefEnv();
+});
+
+function openPreferencesViaHash(aPane) {
+  return new Promise(resolve => {
+    let finalPrefPaneLoaded = TestUtils.topicObserved(
+      "sync-pane-loaded",
+      () => true
+    );
+    gBrowser.selectedTab = BrowserTestUtils.addTab(
+      gBrowser,
+      "about:preferences" + (aPane ? "#" + aPane : "")
+    );
+    let newTabBrowser = gBrowser.selectedBrowser;
+
+    newTabBrowser.addEventListener(
+      "Initialized",
+      function () {
+        newTabBrowser.contentWindow.addEventListener(
+          "load",
+          async function () {
+            let win = gBrowser.contentWindow;
+            let selectedPane = win.history.state;
+            await finalPrefPaneLoaded;
+            gBrowser.removeCurrentTab();
+            resolve({ selectedPane });
+          },
+          { once: true }
+        );
+      },
+      { capture: true, once: true }
+    );
+  });
+}
diff --git a/browser/components/preferences/tests/browser_bug1184989_prevent_scrolling_when_preferences_flipped.js b/browser/components/preferences/tests/browser_bug1184989_prevent_scrolling_when_preferences_flipped.js
new file mode 100644
index 0000000000..ef387f9a9d
--- /dev/null
+++ b/browser/components/preferences/tests/browser_bug1184989_prevent_scrolling_when_preferences_flipped.js
@@ -0,0 +1,116 @@
+const triggeringPrincipal_base64 = E10SUtils.SERIALIZED_SYSTEMPRINCIPAL;
+
+add_task(async function () {
+  waitForExplicitFinish();
+
+  const tabURL =
+    getRootDirectory(gTestPath) +
+    "browser_bug1184989_prevent_scrolling_when_preferences_flipped.xhtml";
+
+  await BrowserTestUtils.withNewTab(
+    { gBrowser, url: tabURL },
+    async function (browser) {
+      let doc = browser.contentDocument;
+      let container = doc.getElementById("container");
+
+      // Test button
+      let button = doc.getElementById("button");
+      button.focus();
+      let initialScrollTop = container.scrollTop;
+      EventUtils.sendString(" ");
+      await checkPageScrolling(container, "button", initialScrollTop);
+
+      // Test checkbox
+      let checkbox = doc.getElementById("checkbox");
+      checkbox.focus();
+      initialScrollTop = container.scrollTop;
+      EventUtils.sendString(" ");
+      ok(checkbox.checked, "Checkbox is checked");
+      await checkPageScrolling(container, "checkbox", initialScrollTop);
+
+      // Test radio
+      let radiogroup = doc.getElementById("radiogroup");
+      radiogroup.focus();
+      initialScrollTop = container.scrollTop;
+      EventUtils.sendString(" ");
+      await checkPageScrolling(container, "radio", initialScrollTop);
+    }
+  );
+
+  await BrowserTestUtils.withNewTab(
+    { gBrowser, url: "about:preferences#search" },
+    async function (browser) {
+      let doc = browser.contentDocument;
+      let container = doc.getElementsByClassName("main-content")[0];
+
+      // Test search
+      let engineList = doc.getElementById("engineList");
+      engineList.focus();
+      let initialScrollTop = container.scrollTop;
+      EventUtils.sendString(" ");
+      is(
+        engineList.view.selection.currentIndex,
+        0,
+        "Search engineList is selected"
+      );
+      EventUtils.sendString(" ");
+      await checkPageScrolling(
+        container,
+        "search engineList",
+        initialScrollTop
+      );
+    }
+  );
+
+  // Test session restore
+  const CRASH_URL = "about:mozilla";
+  const CRASH_FAVICON = "chrome://branding/content/icon32.png";
+  const CRASH_SHENTRY = { url: CRASH_URL };
+  const CRASH_TAB = { entries: [CRASH_SHENTRY], image: CRASH_FAVICON };
+  const CRASH_STATE = { windows: [{ tabs: [CRASH_TAB] }] };
+
+  const TAB_URL = "about:sessionrestore";
+  const TAB_FORMDATA = { url: TAB_URL, id: { sessionData: CRASH_STATE } };
+  const TAB_SHENTRY = { url: TAB_URL, triggeringPrincipal_base64 };
+  const TAB_STATE = { entries: [TAB_SHENTRY], formdata: TAB_FORMDATA };
+
+  let tab = (gBrowser.selectedTab = BrowserTestUtils.addTab(
+    gBrowser,
+    "about:blank"
+  ));
+
+  // Fake a post-crash tab
+  SessionStore.setTabState(tab, JSON.stringify(TAB_STATE));
+
+  await BrowserTestUtils.browserLoaded(tab.linkedBrowser);
+  let doc = tab.linkedBrowser.contentDocument;
+
+  // Make body scrollable
+  doc.body.style.height = doc.body.clientHeight + 100 + "px";
+
+  let tabsToggle = doc.getElementById("tabsToggle");
+  tabsToggle.focus();
+  let initialScrollTop = doc.documentElement.scrollTop;
+  EventUtils.sendString(" ");
+  await checkPageScrolling(
+    doc.documentElement,
+    "session restore",
+    initialScrollTop
+  );
+
+  gBrowser.removeCurrentTab();
+  finish();
+});
+
+function checkPageScrolling(container, type, initialScrollTop = 0) {
+  return new Promise(resolve => {
+    setTimeout(() => {
+      is(
+        container.scrollTop,
+        initialScrollTop,
+        "Page should not scroll when " + type + " flipped"
+      );
+      resolve();
+    }, 0);
+  });
+}
diff --git a/browser/components/preferences/tests/browser_bug1184989_prevent_scrolling_when_preferences_flipped.xhtml b/browser/components/preferences/tests/browser_bug1184989_prevent_scrolling_when_preferences_flipped.xhtml
new file mode 100644
index 0000000000..8b3e39a39c
--- /dev/null
+++ b/browser/components/preferences/tests/browser_bug1184989_prevent_scrolling_when_preferences_flipped.xhtml
@@ -0,0 +1,26 @@
+<?xml version="1.0"?>
+<!--
+  XUL Widget Test for Bug 1184989
+  -->
+<window title="Bug 1184989 Test"
+        xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul">
+
+<vbox id="container" style="height: 200px; overflow: auto;">
+  <vbox style="height: 500px;">
+    <hbox>
+      <button id="button" label="button" />
+    </hbox>
+
+    <hbox>
+      <checkbox id="checkbox" label="checkbox" />
+    </hbox>
+
+    <hbox>
+      <radiogroup id="radiogroup">
+        <radio id="radio" label="radio" />
+      </radiogroup>
+    </hbox>
+  </vbox>
+</vbox>
+
+</window>
diff --git a/browser/components/preferences/tests/browser_bug1547020_lockedDownloadDir.js b/browser/components/preferences/tests/browser_bug1547020_lockedDownloadDir.js
new file mode 100644
index 0000000000..cd5b00b5f2
--- /dev/null
+++ b/browser/components/preferences/tests/browser_bug1547020_lockedDownloadDir.js
@@ -0,0 +1,24 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+add_task(async function () {
+  Services.prefs.lockPref("browser.download.useDownloadDir");
+
+  await openPreferencesViaOpenPreferencesAPI("general", { leaveOpen: true });
+  let doc = gBrowser.selectedBrowser.contentDocument;
+
+  var downloadFolder = doc.getElementById("downloadFolder");
+  var chooseFolder = doc.getElementById("chooseFolder");
+  is(
+    downloadFolder.disabled,
+    false,
+    "Download folder field should not be disabled."
+  );
+  is(chooseFolder.disabled, false, "Choose folder should not be disabled.");
+
+  gBrowser.removeCurrentTab();
+
+  Services.prefs.unlockPref("browser.download.useDownloadDir");
+});
diff --git a/browser/components/preferences/tests/browser_bug1579418.js b/browser/components/preferences/tests/browser_bug1579418.js
new file mode 100644
index 0000000000..a179ae9936
--- /dev/null
+++ b/browser/components/preferences/tests/browser_bug1579418.js
@@ -0,0 +1,55 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+add_task(async function default_homepage_test() {
+  let oldHomepagePref = Services.prefs.getCharPref("browser.startup.homepage");
+  let oldStartpagePref = Services.prefs.getIntPref("browser.startup.page");
+
+  await openPreferencesViaOpenPreferencesAPI("paneHome", { leaveOpen: true });
+
+  let doc = gBrowser.contentDocument;
+  let homeMode = doc.getElementById("homeMode");
+  let customSettings = doc.getElementById("customSettings");
+
+  // HOME_MODE_FIREFOX_HOME
+  homeMode.value = 0;
+
+  homeMode.dispatchEvent(new Event("command"));
+
+  is(Services.prefs.getCharPref("browser.startup.homepage"), "about:home");
+
+  // HOME_MODE_BLANK
+  homeMode.value = 1;
+
+  homeMode.dispatchEvent(new Event("command"));
+
+  await TestUtils.waitForCondition(
+    () => customSettings.hidden === true,
+    "Wait for customSettings to be hidden."
+  );
+
+  is(
+    Services.prefs.getCharPref("browser.startup.homepage"),
+    "chrome://browser/content/blanktab.html"
+  );
+
+  // HOME_MODE_CUSTOM
+  homeMode.value = 2;
+
+  homeMode.dispatchEvent(new Event("command"));
+
+  await TestUtils.waitForCondition(
+    () => customSettings.hidden === false,
+    "Wait for customSettings to be shown."
+  );
+
+  is(customSettings.hidden, false, "homePageURL should be visible");
+
+  registerCleanupFunction(async () => {
+    Services.prefs.setCharPref("browser.startup.homepage", oldHomepagePref);
+    Services.prefs.setIntPref("browser.startup.page", oldStartpagePref);
+    BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  });
+});
diff --git a/browser/components/preferences/tests/browser_bug410900.js b/browser/components/preferences/tests/browser_bug410900.js
new file mode 100644
index 0000000000..4fd4bb21f5
--- /dev/null
+++ b/browser/components/preferences/tests/browser_bug410900.js
@@ -0,0 +1,47 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+function test() {
+  waitForExplicitFinish();
+
+  // Setup a phony handler to ensure the app pane will be populated.
+  var handler = Cc["@mozilla.org/uriloader/web-handler-app;1"].createInstance(
+    Ci.nsIWebHandlerApp
+  );
+  handler.name = "App pane alive test";
+  handler.uriTemplate = "http://test.mozilla.org/%s";
+
+  var extps = Cc[
+    "@mozilla.org/uriloader/external-protocol-service;1"
+  ].getService(Ci.nsIExternalProtocolService);
+  var info = extps.getProtocolHandlerInfo("apppanetest");
+  info.possibleApplicationHandlers.appendElement(handler);
+
+  var hserv = Cc["@mozilla.org/uriloader/handler-service;1"].getService(
+    Ci.nsIHandlerService
+  );
+  hserv.store(info);
+
+  openPreferencesViaOpenPreferencesAPI("general", { leaveOpen: true })
+    .then(() => gBrowser.selectedBrowser.contentWindow.promiseLoadHandlersList)
+    .then(() => runTest(gBrowser.selectedBrowser.contentWindow));
+}
+
+function runTest(win) {
+  var rbox = win.document.getElementById("handlersView");
+  ok(rbox, "handlersView is present");
+
+  var items = rbox && rbox.getElementsByTagName("richlistitem");
+  ok(items && !!items.length, "App handler list populated");
+
+  var handlerAdded = false;
+  for (let i = 0; i < items.length; i++) {
+    if (items[i].getAttribute("type") == "apppanetest") {
+      handlerAdded = true;
+    }
+  }
+  ok(handlerAdded, "apppanetest protocol handler was successfully added");
+
+  gBrowser.removeCurrentTab();
+  finish();
+}
diff --git a/browser/components/preferences/tests/browser_bug731866.js b/browser/components/preferences/tests/browser_bug731866.js
new file mode 100644
index 0000000000..b090535a49
--- /dev/null
+++ b/browser/components/preferences/tests/browser_bug731866.js
@@ -0,0 +1,95 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+const browserContainersGroupDisabled = !SpecialPowers.getBoolPref(
+  "privacy.userContext.ui.enabled"
+);
+const cookieBannerHandlingDisabled = !SpecialPowers.getBoolPref(
+  "cookiebanners.ui.desktop.enabled"
+);
+const updatePrefContainers = ["updatesCategory", "updateApp"];
+const updateContainersGroupDisabled =
+  AppConstants.platform === "win" &&
+  Services.sysinfo.getProperty("hasWinPackageId");
+
+function test() {
+  waitForExplicitFinish();
+  open_preferences(runTest);
+}
+
+var gElements;
+
+function checkElements(expectedPane) {
+  for (let element of gElements) {
+    // keyset elements fail is_element_visible checks because they are never visible.
+    // special-case the drmGroup item because its visibility depends on pref + OS version
+    if (element.nodeName == "keyset" || element.id === "drmGroup") {
+      continue;
+    }
+
+    // The browserContainersGroup is still only pref-on on Nightly
+    if (
+      element.id == "browserContainersGroup" &&
+      browserContainersGroupDisabled
+    ) {
+      is_element_hidden(
+        element,
+        "Disabled browserContainersGroup should be hidden"
+      );
+      continue;
+    }
+
+    // Cookie Banner Handling is currently disabled by default (bug 1800679)
+    if (
+      element.id == "cookieBannerHandlingGroup" &&
+      cookieBannerHandlingDisabled
+    ) {
+      is_element_hidden(
+        element,
+        "Disabled cookieBannerHandlingGroup should be hidden"
+      );
+      continue;
+    }
+
+    // Update prefs are hidden when running an MSIX build
+    if (
+      updatePrefContainers.includes(element.id) &&
+      updateContainersGroupDisabled
+    ) {
+      is_element_hidden(element, "Disabled " + element + " should be hidden");
+      continue;
+    }
+
+    let attributeValue = element.getAttribute("data-category");
+    let suffix = " (id=" + element.id + ")";
+    if (attributeValue == "pane" + expectedPane) {
+      is_element_visible(
+        element,
+        expectedPane + " elements should be visible" + suffix
+      );
+    } else {
+      is_element_hidden(
+        element,
+        "Elements not in " + expectedPane + " should be hidden" + suffix
+      );
+    }
+  }
+}
+
+async function runTest(win) {
+  is(gBrowser.currentURI.spec, "about:preferences", "about:preferences loaded");
+
+  let tab = win.document;
+  gElements = tab.getElementById("mainPrefPane").children;
+
+  let panes = ["General", "Search", "Privacy", "Sync"];
+
+  for (let pane of panes) {
+    await win.gotoPref("pane" + pane);
+    checkElements(pane);
+  }
+
+  gBrowser.removeCurrentTab();
+  win.close();
+  finish();
+}
diff --git a/browser/components/preferences/tests/browser_bug795764_cachedisabled.js b/browser/components/preferences/tests/browser_bug795764_cachedisabled.js
new file mode 100644
index 0000000000..97f5aaf48f
--- /dev/null
+++ b/browser/components/preferences/tests/browser_bug795764_cachedisabled.js
@@ -0,0 +1,62 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+function test() {
+  waitForExplicitFinish();
+
+  // Adding one fake site so that the SiteDataManager would run.
+  // Otherwise, without any site then it would just return so we would end up in not testing SiteDataManager.
+  let principal =
+    Services.scriptSecurityManager.createContentPrincipalFromOrigin(
+      "https://www.foo.com"
+    );
+  Services.perms.addFromPrincipal(
+    principal,
+    "persistent-storage",
+    Ci.nsIPermissionManager.ALLOW_ACTION
+  );
+  registerCleanupFunction(function () {
+    Services.perms.removeFromPrincipal(principal, "persistent-storage");
+  });
+
+  SpecialPowers.pushPrefEnv({
+    set: [["privacy.userContext.ui.enabled", true]],
+  }).then(() => open_preferences(runTest));
+}
+
+async function runTest(win) {
+  is(gBrowser.currentURI.spec, "about:preferences", "about:preferences loaded");
+
+  let tab = win.document;
+  let elements = tab.getElementById("mainPrefPane").children;
+
+  // Test if privacy pane is opened correctly
+  await win.gotoPref("panePrivacy");
+  for (let element of elements) {
+    let attributeValue = element.getAttribute("data-category");
+
+    // Ignore the cookie banner handling section, as it is currently preffed
+    // off by default (bug 1800679).
+    if (element.id === "cookieBannerHandlingGroup") {
+      continue;
+    }
+
+    if (attributeValue == "panePrivacy") {
+      is_element_visible(element, "HTTPSOnly should be visible");
+
+      is_element_visible(
+        element,
+        `Privacy element of id=${element.id} should be visible`
+      );
+    } else {
+      is_element_hidden(
+        element,
+        `Non-Privacy element of id=${element.id} should be hidden`
+      );
+    }
+  }
+
+  gBrowser.removeCurrentTab();
+  win.close();
+  finish();
+}
diff --git a/browser/components/preferences/tests/browser_cert_export.js b/browser/components/preferences/tests/browser_cert_export.js
new file mode 100644
index 0000000000..48769f84e6
--- /dev/null
+++ b/browser/components/preferences/tests/browser_cert_export.js
@@ -0,0 +1,161 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+var MockFilePicker = SpecialPowers.MockFilePicker;
+
+function createTemporarySaveDirectory() {
+  var saveDir = Services.dirsvc.get("TmpD", Ci.nsIFile);
+  saveDir.append("testsavedir");
+  if (!saveDir.exists()) {
+    info("create testsavedir!");
+    saveDir.create(Ci.nsIFile.DIRECTORY_TYPE, 0o755);
+  }
+  info("return from createTempSaveDir: " + saveDir.path);
+  return saveDir;
+}
+
+// Create the folder the certificates will be saved into.
+var destDir = createTemporarySaveDirectory();
+registerCleanupFunction(function () {
+  destDir.remove(true);
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+function stringOrArrayEquals(actual, expected, message) {
+  is(
+    typeof actual,
+    typeof expected,
+    "actual, expected should have the same type"
+  );
+  if (typeof expected == "string") {
+    is(actual, expected, message);
+  } else {
+    is(actual.toString(), expected.toString(), message);
+  }
+}
+
+var dialogWin;
+var exportButton;
+var expectedCert;
+
+async function setupTest() {
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  let certButton = gBrowser.selectedBrowser.contentDocument.getElementById(
+    "viewCertificatesButton"
+  );
+  certButton.scrollIntoView();
+  let certDialogLoaded = promiseLoadSubDialog(
+    "chrome://pippki/content/certManager.xhtml"
+  );
+  certButton.click();
+  dialogWin = await certDialogLoaded;
+  let doc = dialogWin.document;
+  doc.getElementById("certmanagertabs").selectedTab =
+    doc.getElementById("ca_tab");
+  let treeView = doc.getElementById("ca-tree").view;
+  // Select any which cert. Ignore parent rows (ie rows without certs):
+  for (let i = 0; i < treeView.rowCount; i++) {
+    treeView.selection.select(i);
+    dialogWin.getSelectedCerts();
+    let certs = dialogWin.selected_certs; // yuck... but this is how the dialog works.
+    if (certs && certs.length == 1 && certs[0]) {
+      expectedCert = certs[0];
+      // OK, we managed to select a cert!
+      break;
+    }
+  }
+
+  exportButton = doc.getElementById("ca_exportButton");
+  is(exportButton.disabled, false, "Should enable export button");
+}
+
+async function checkCertExportWorks(
+  exportType,
+  encoding,
+  expectedFileContents
+) {
+  MockFilePicker.displayDirectory = destDir;
+  var destFile = destDir.clone();
+  MockFilePicker.init(window);
+  MockFilePicker.filterIndex = exportType;
+  MockFilePicker.showCallback = function (fp) {
+    info("showCallback");
+    let fileName = fp.defaultString;
+    info("fileName: " + fileName);
+    destFile.append(fileName);
+    MockFilePicker.setFiles([destFile]);
+    info("done showCallback");
+  };
+  let finishedExporting = TestUtils.topicObserved("cert-export-finished");
+  exportButton.click();
+  await finishedExporting;
+  MockFilePicker.cleanup();
+  if (destFile && destFile.exists()) {
+    let contents;
+    if (encoding === "utf-8") {
+      contents = await IOUtils.readUTF8(destFile.path);
+    } else {
+      is(encoding, "", "expected either utf-8 or empty string for encoding");
+      contents = await IOUtils.read(destFile.path);
+    }
+    stringOrArrayEquals(
+      contents,
+      expectedFileContents,
+      "Should have written correct contents"
+    );
+    destFile.remove(false);
+  } else {
+    ok(false, "No cert saved!");
+  }
+}
+
+add_task(setupTest);
+
+add_task(async function checkCertPEMExportWorks() {
+  let expectedContents = dialogWin.getPEMString(expectedCert);
+  await checkCertExportWorks(0, /* 0 = PEM */ "utf-8", expectedContents);
+});
+
+add_task(async function checkCertPEMChainExportWorks() {
+  let expectedContents = dialogWin.getPEMString(expectedCert);
+  await checkCertExportWorks(
+    1, // 1 = PEM chain, but the chain is of length 1
+    "utf-8",
+    expectedContents
+  );
+});
+
+add_task(async function checkCertDERExportWorks() {
+  let expectedContents = Uint8Array.from(expectedCert.getRawDER());
+  await checkCertExportWorks(2, /* 2 = DER */ "", expectedContents);
+});
+
+function stringToTypedArray(str) {
+  let arr = new Uint8Array(str.length);
+  for (let i = 0; i < arr.length; i++) {
+    arr[i] = str.charCodeAt(i);
+  }
+  return arr;
+}
+
+add_task(async function checkCertPKCS7ExportWorks() {
+  let certdb = Cc["@mozilla.org/security/x509certdb;1"].getService(
+    Ci.nsIX509CertDB
+  );
+  let expectedContents = stringToTypedArray(certdb.asPKCS7Blob([expectedCert]));
+  await checkCertExportWorks(3, /* 3 = PKCS7 */ "", expectedContents);
+});
+
+add_task(async function checkCertPKCS7ChainExportWorks() {
+  let certdb = Cc["@mozilla.org/security/x509certdb;1"].getService(
+    Ci.nsIX509CertDB
+  );
+  let expectedContents = stringToTypedArray(certdb.asPKCS7Blob([expectedCert]));
+  await checkCertExportWorks(
+    4, // 4 = PKCS7 chain, but the chain is of length 1
+    "",
+    expectedContents
+  );
+});
diff --git a/browser/components/preferences/tests/browser_change_app_handler.js b/browser/components/preferences/tests/browser_change_app_handler.js
new file mode 100644
index 0000000000..b4ca92592f
--- /dev/null
+++ b/browser/components/preferences/tests/browser_change_app_handler.js
@@ -0,0 +1,155 @@
+var gMimeSvc = Cc["@mozilla.org/mime;1"].getService(Ci.nsIMIMEService);
+var gHandlerSvc = Cc["@mozilla.org/uriloader/handler-service;1"].getService(
+  Ci.nsIHandlerService
+);
+
+SimpleTest.requestCompleteLog();
+
+function setupFakeHandler() {
+  let info = gMimeSvc.getFromTypeAndExtension("text/plain", "foo.txt");
+  ok(
+    info.possibleLocalHandlers.length,
+    "Should have at least one known handler"
+  );
+  let handler = info.possibleLocalHandlers.queryElementAt(
+    0,
+    Ci.nsILocalHandlerApp
+  );
+
+  let infoToModify = gMimeSvc.getFromTypeAndExtension(
+    "text/x-test-handler",
+    null
+  );
+  infoToModify.possibleApplicationHandlers.appendElement(handler);
+
+  gHandlerSvc.store(infoToModify);
+}
+
+add_task(async function () {
+  setupFakeHandler();
+
+  let prefs = await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  is(prefs.selectedPane, "paneGeneral", "General pane was selected");
+  let win = gBrowser.selectedBrowser.contentWindow;
+
+  let container = win.document.getElementById("handlersView");
+  let ourItem = container.querySelector(
+    "richlistitem[type='text/x-test-handler']"
+  );
+  ok(ourItem, "handlersView is present");
+  ourItem.scrollIntoView();
+  container.selectItem(ourItem);
+  ok(ourItem.selected, "Should be able to select our item.");
+
+  let list = ourItem.querySelector(".actionsMenu");
+
+  let chooseItem = list.menupopup.querySelector(".choose-app-item");
+  let dialogLoadedPromise = promiseLoadSubDialog(
+    "chrome://global/content/appPicker.xhtml"
+  );
+  let cmdEvent = win.document.createEvent("xulcommandevent");
+  cmdEvent.initCommandEvent(
+    "command",
+    true,
+    true,
+    win,
+    0,
+    false,
+    false,
+    false,
+    false,
+    0,
+    null,
+    0
+  );
+  chooseItem.dispatchEvent(cmdEvent);
+
+  let dialog = await dialogLoadedPromise;
+  info("Dialog loaded");
+
+  let dialogDoc = dialog.document;
+  let dialogElement = dialogDoc.getElementById("app-picker");
+  let dialogList = dialogDoc.getElementById("app-picker-listbox");
+  dialogList.selectItem(dialogList.firstElementChild);
+  let selectedApp = dialogList.firstElementChild.handlerApp;
+  dialogElement.acceptDialog();
+
+  // Verify results are correct in mime service:
+  let mimeInfo = gMimeSvc.getFromTypeAndExtension("text/x-test-handler", null);
+  ok(
+    mimeInfo.preferredApplicationHandler.equals(selectedApp),
+    "App should be set as preferred."
+  );
+
+  // Check that we display this result:
+  ok(list.selectedItem, "Should have a selected item");
+  ok(
+    mimeInfo.preferredApplicationHandler.equals(list.selectedItem.handlerApp),
+    "App should be visible as preferred item."
+  );
+
+  // Now try to 'manage' this list:
+  dialogLoadedPromise = promiseLoadSubDialog(
+    "chrome://browser/content/preferences/dialogs/applicationManager.xhtml"
+  );
+
+  let manageItem = list.menupopup.querySelector(".manage-app-item");
+  cmdEvent = win.document.createEvent("xulcommandevent");
+  cmdEvent.initCommandEvent(
+    "command",
+    true,
+    true,
+    win,
+    0,
+    false,
+    false,
+    false,
+    false,
+    0,
+    null,
+    0
+  );
+  manageItem.dispatchEvent(cmdEvent);
+
+  dialog = await dialogLoadedPromise;
+  info("Dialog loaded the second time");
+
+  dialogDoc = dialog.document;
+  dialogElement = dialogDoc.getElementById("appManager");
+  dialogList = dialogDoc.getElementById("appList");
+  let itemToRemove = dialogList.querySelector(
+    'richlistitem > label[value="' + selectedApp.name + '"]'
+  ).parentNode;
+  dialogList.selectItem(itemToRemove);
+  let itemsBefore = dialogList.children.length;
+  dialogDoc.getElementById("remove").click();
+  ok(!itemToRemove.parentNode, "Item got removed from DOM");
+  is(dialogList.children.length, itemsBefore - 1, "Item got removed");
+  dialogElement.acceptDialog();
+
+  // Verify results are correct in mime service:
+  mimeInfo = gMimeSvc.getFromTypeAndExtension("text/x-test-handler", null);
+  ok(
+    !mimeInfo.preferredApplicationHandler,
+    "App should no longer be set as preferred."
+  );
+
+  // Check that we display this result:
+  ok(list.selectedItem, "Should have a selected item");
+  ok(
+    !list.selectedItem.handlerApp,
+    "No app should be visible as preferred item."
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+registerCleanupFunction(function () {
+  let infoToModify = gMimeSvc.getFromTypeAndExtension(
+    "text/x-test-handler",
+    null
+  );
+  gHandlerSvc.remove(infoToModify);
+});
diff --git a/browser/components/preferences/tests/browser_checkspelling.js b/browser/components/preferences/tests/browser_checkspelling.js
new file mode 100644
index 0000000000..a7895b4201
--- /dev/null
+++ b/browser/components/preferences/tests/browser_checkspelling.js
@@ -0,0 +1,34 @@
+add_task(async function () {
+  SpecialPowers.pushPrefEnv({ set: [["layout.spellcheckDefault", 2]] });
+
+  let prefs = await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  is(prefs.selectedPane, "paneGeneral", "General pane was selected");
+
+  let doc = gBrowser.contentDocument;
+  let checkbox = doc.querySelector("#checkSpelling");
+  is(
+    checkbox.checked,
+    Services.prefs.getIntPref("layout.spellcheckDefault") == 2,
+    "checkbox should represent pref value before clicking on checkbox"
+  );
+  ok(
+    checkbox.checked,
+    "checkbox should be checked before clicking on checkbox"
+  );
+
+  checkbox.click();
+
+  is(
+    checkbox.checked,
+    Services.prefs.getIntPref("layout.spellcheckDefault") == 2,
+    "checkbox should represent pref value after clicking on checkbox"
+  );
+  ok(
+    !checkbox.checked,
+    "checkbox should not be checked after clicking on checkbox"
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_connection.js b/browser/components/preferences/tests/browser_connection.js
new file mode 100644
index 0000000000..01cdf571f2
--- /dev/null
+++ b/browser/components/preferences/tests/browser_connection.js
@@ -0,0 +1,145 @@
+/* vim: set shiftwidth=2 tabstop=2 autoindent cindent expandtab: */
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this file,
+ * You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+function test() {
+  waitForExplicitFinish();
+
+  // network.proxy.type needs to be backed up and restored because mochitest
+  // changes this setting from the default
+  let oldNetworkProxyType = Services.prefs.getIntPref("network.proxy.type");
+  registerCleanupFunction(function () {
+    Services.prefs.setIntPref("network.proxy.type", oldNetworkProxyType);
+    Services.prefs.clearUserPref("network.proxy.no_proxies_on");
+    // On accepting the dialog, we also write TRR values, so we need to clear
+    // them. They are tested separately in browser_privacy_dnsoverhttps.js.
+    Services.prefs.clearUserPref("network.trr.mode");
+    Services.prefs.clearUserPref("network.trr.uri");
+  });
+
+  let connectionURL =
+    "chrome://browser/content/preferences/dialogs/connection.xhtml";
+
+  /*
+  The connection dialog alone won't save onaccept since it uses type="child",
+  so it has to be opened as a sub dialog of the main pref tab.
+  Open the main tab here.
+  */
+  open_preferences(async function tabOpened(aContentWindow) {
+    is(
+      gBrowser.currentURI.spec,
+      "about:preferences",
+      "about:preferences loaded"
+    );
+    let dialog = await openAndLoadSubDialog(connectionURL);
+    let dialogElement = dialog.document.getElementById("ConnectionsDialog");
+    let dialogClosingPromise = BrowserTestUtils.waitForEvent(
+      dialogElement,
+      "dialogclosing"
+    );
+
+    ok(dialog, "connection window opened");
+    runConnectionTests(dialog);
+    dialogElement.acceptDialog();
+
+    let dialogClosingEvent = await dialogClosingPromise;
+    ok(dialogClosingEvent, "connection window closed");
+    // runConnectionTests will have changed this pref - make sure it was
+    // sanitized correctly when the dialog was accepted
+    is(
+      Services.prefs.getCharPref("network.proxy.no_proxies_on"),
+      ".a.com,.b.com,.c.com",
+      "no_proxies_on pref has correct value"
+    );
+    gBrowser.removeCurrentTab();
+    finish();
+  });
+}
+
+// run a bunch of tests on the window containing connection.xul
+function runConnectionTests(win) {
+  let doc = win.document;
+  let networkProxyNone = doc.getElementById("networkProxyNone");
+  let networkProxyNonePref = win.Preferences.get("network.proxy.no_proxies_on");
+  let networkProxyTypePref = win.Preferences.get("network.proxy.type");
+
+  // make sure the networkProxyNone textbox is formatted properly
+  is(networkProxyNone.localName, "textarea", "networkProxyNone is a textarea");
+  is(
+    networkProxyNone.getAttribute("rows"),
+    "2",
+    "networkProxyNone textbox has two rows"
+  );
+
+  // make sure manual proxy controls are disabled when the window is opened
+  let networkProxyHTTP = doc.getElementById("networkProxyHTTP");
+  is(networkProxyHTTP.disabled, true, "networkProxyHTTP textbox is disabled");
+
+  // check if sanitizing the given input for the no_proxies_on pref results in
+  // expected string
+  function testSanitize(input, expected, errorMessage) {
+    networkProxyNonePref.value = input;
+    win.gConnectionsDialog.sanitizeNoProxiesPref();
+    is(networkProxyNonePref.value, expected, errorMessage);
+  }
+
+  // change this pref so proxy exceptions are actually configurable
+  networkProxyTypePref.value = 1;
+  is(networkProxyNone.disabled, false, "networkProxyNone textbox is enabled");
+
+  testSanitize(".a.com", ".a.com", "sanitize doesn't mess up single filter");
+  testSanitize(
+    ".a.com, .b.com, .c.com",
+    ".a.com, .b.com, .c.com",
+    "sanitize doesn't mess up multiple comma/space sep filters"
+  );
+  testSanitize(
+    ".a.com\n.b.com",
+    ".a.com,.b.com",
+    "sanitize turns line break into comma"
+  );
+  testSanitize(
+    ".a.com,\n.b.com",
+    ".a.com,.b.com",
+    "sanitize doesn't add duplicate comma after comma"
+  );
+  testSanitize(
+    ".a.com\n,.b.com",
+    ".a.com,.b.com",
+    "sanitize doesn't add duplicate comma before comma"
+  );
+  testSanitize(
+    ".a.com,\n,.b.com",
+    ".a.com,,.b.com",
+    "sanitize doesn't add duplicate comma surrounded by commas"
+  );
+  testSanitize(
+    ".a.com, \n.b.com",
+    ".a.com, .b.com",
+    "sanitize doesn't add comma after comma/space"
+  );
+  testSanitize(
+    ".a.com\n .b.com",
+    ".a.com, .b.com",
+    "sanitize adds comma before space"
+  );
+  testSanitize(
+    ".a.com\n\n\n;;\n;\n.b.com",
+    ".a.com,.b.com",
+    "sanitize only adds one comma per substring of bad chars"
+  );
+  testSanitize(
+    ".a.com,,.b.com",
+    ".a.com,,.b.com",
+    "duplicate commas from user are untouched"
+  );
+  testSanitize(
+    ".a.com\n.b.com\n.c.com,\n.d.com,\n.e.com",
+    ".a.com,.b.com,.c.com,.d.com,.e.com",
+    "sanitize replaces things globally"
+  );
+
+  // will check that this was sanitized properly after window closes
+  networkProxyNonePref.value = ".a.com;.b.com\n.c.com";
+}
diff --git a/browser/components/preferences/tests/browser_connection_bug1445991.js b/browser/components/preferences/tests/browser_connection_bug1445991.js
new file mode 100644
index 0000000000..ecb5068a26
--- /dev/null
+++ b/browser/components/preferences/tests/browser_connection_bug1445991.js
@@ -0,0 +1,31 @@
+/* vim: set ts=8 sts=2 et sw=2 tw=80: */
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+// Test the disabled status of the autoconfig Reload button when the proxy type
+// is autoconfig (network.proxy.type == 2).
+add_task(async function testAutoconfigReloadButton() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["network.proxy.type", 2],
+      ["network.proxy.autoconfig_url", "file:///nonexistent.pac"],
+    ],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("general", { leaveOpen: true });
+  const connectionURL =
+    "chrome://browser/content/preferences/dialogs/connection.xhtml";
+  const promiseDialogLoaded = promiseLoadSubDialog(connectionURL);
+  gBrowser.contentDocument.getElementById("connectionSettings").click();
+  const dialog = await promiseDialogLoaded;
+
+  ok(
+    !dialog.document.getElementById("autoReload").disabled,
+    "Reload button is enabled when proxy type is autoconfig"
+  );
+
+  dialog.close();
+  gBrowser.removeCurrentTab();
+});
diff --git a/browser/components/preferences/tests/browser_connection_bug1505330.js b/browser/components/preferences/tests/browser_connection_bug1505330.js
new file mode 100644
index 0000000000..94dfd4706e
--- /dev/null
+++ b/browser/components/preferences/tests/browser_connection_bug1505330.js
@@ -0,0 +1,31 @@
+/* vim: set ts=8 sts=2 et sw=2 tw=80: */
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+// Test the disabled status of the autoconfig Reload button when the proxy type
+// is autoconfig (network.proxy.type == 2).
+add_task(async function testAutoconfigReloadButton() {
+  Services.prefs.lockPref("signon.autologin.proxy");
+
+  await openPreferencesViaOpenPreferencesAPI("general", { leaveOpen: true });
+  const connectionURL =
+    "chrome://browser/content/preferences/dialogs/connection.xhtml";
+  const promiseDialogLoaded = promiseLoadSubDialog(connectionURL);
+  gBrowser.contentDocument.getElementById("connectionSettings").click();
+  const dialog = await promiseDialogLoaded;
+
+  ok(
+    !dialog.document.getElementById("networkProxyType").firstChild.disabled,
+    "Connection options should not be disabled"
+  );
+  ok(
+    dialog.document.getElementById("autologinProxy").disabled,
+    "Proxy autologin should be disabled"
+  );
+
+  dialog.close();
+  Services.prefs.unlockPref("signon.autologin.proxy");
+  gBrowser.removeCurrentTab();
+});
diff --git a/browser/components/preferences/tests/browser_connection_bug388287.js b/browser/components/preferences/tests/browser_connection_bug388287.js
new file mode 100644
index 0000000000..d6f0c3c9d0
--- /dev/null
+++ b/browser/components/preferences/tests/browser_connection_bug388287.js
@@ -0,0 +1,124 @@
+/* vim: set ts=8 sts=2 et sw=2 tw=80: */
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+function test() {
+  waitForExplicitFinish();
+  const connectionURL =
+    "chrome://browser/content/preferences/dialogs/connection.xhtml";
+  let closeable = false;
+  let finalTest = false;
+
+  // The changed preferences need to be backed up and restored because this mochitest
+  // changes them setting from the default
+  let oldNetworkProxyType = Services.prefs.getIntPref("network.proxy.type");
+  registerCleanupFunction(function () {
+    Services.prefs.setIntPref("network.proxy.type", oldNetworkProxyType);
+    Services.prefs.clearUserPref("network.proxy.share_proxy_settings");
+    for (let proxyType of ["http", "ssl", "socks"]) {
+      Services.prefs.clearUserPref("network.proxy." + proxyType);
+      Services.prefs.clearUserPref("network.proxy." + proxyType + "_port");
+      if (proxyType == "http") {
+        continue;
+      }
+      Services.prefs.clearUserPref("network.proxy.backup." + proxyType);
+      Services.prefs.clearUserPref(
+        "network.proxy.backup." + proxyType + "_port"
+      );
+    }
+    // On accepting the dialog, we also write TRR values, so we need to clear
+    // them. They are tested separately in browser_privacy_dnsoverhttps.js.
+    Services.prefs.clearUserPref("network.trr.mode");
+    Services.prefs.clearUserPref("network.trr.uri");
+  });
+
+  /*
+   The connection dialog alone won't save onaccept since it uses type="child",
+   so it has to be opened as a sub dialog of the main pref tab.
+   Open the main tab here.
+   */
+  open_preferences(async function tabOpened(aContentWindow) {
+    let dialog, dialogClosingPromise, dialogElement;
+    let proxyTypePref, sharePref, httpPref, httpPortPref;
+
+    // Convenient function to reset the variables for the new window
+    async function setDoc() {
+      if (closeable) {
+        let dialogClosingEvent = await dialogClosingPromise;
+        ok(dialogClosingEvent, "Connection dialog closed");
+      }
+
+      if (finalTest) {
+        gBrowser.removeCurrentTab();
+        finish();
+        return;
+      }
+
+      dialog = await openAndLoadSubDialog(connectionURL);
+      dialogElement = dialog.document.getElementById("ConnectionsDialog");
+      dialogClosingPromise = BrowserTestUtils.waitForEvent(
+        dialogElement,
+        "dialogclosing"
+      );
+
+      proxyTypePref = dialog.Preferences.get("network.proxy.type");
+      sharePref = dialog.Preferences.get("network.proxy.share_proxy_settings");
+      httpPref = dialog.Preferences.get("network.proxy.http");
+      httpPortPref = dialog.Preferences.get("network.proxy.http_port");
+    }
+
+    // This batch of tests should not close the dialog
+    await setDoc();
+
+    // Testing HTTP port 0 with share on
+    proxyTypePref.value = 1;
+    sharePref.value = true;
+    httpPref.value = "localhost";
+    httpPortPref.value = 0;
+    dialogElement.acceptDialog();
+
+    // Testing HTTP port 0 + FTP port 80 with share off
+    sharePref.value = false;
+    dialogElement.acceptDialog();
+
+    // Testing HTTP port 80 + FTP port 0 with share off
+    httpPortPref.value = 80;
+    dialogElement.acceptDialog();
+
+    // From now on, the dialog should close since we are giving it legitimate inputs.
+    // The test will timeout if the onbeforeaccept kicks in erroneously.
+    closeable = true;
+
+    // Both ports 80, share on
+    httpPortPref.value = 80;
+    dialogElement.acceptDialog();
+
+    // HTTP 80, FTP 0, with share on
+    await setDoc();
+    proxyTypePref.value = 1;
+    sharePref.value = true;
+    httpPref.value = "localhost";
+    httpPortPref.value = 80;
+    dialogElement.acceptDialog();
+
+    // HTTP host empty, port 0 with share on
+    await setDoc();
+    proxyTypePref.value = 1;
+    sharePref.value = true;
+    httpPref.value = "";
+    httpPortPref.value = 0;
+    dialogElement.acceptDialog();
+
+    // HTTP 0, but in no proxy mode
+    await setDoc();
+    proxyTypePref.value = 0;
+    sharePref.value = true;
+    httpPref.value = "localhost";
+    httpPortPref.value = 0;
+
+    // This is the final test, don't spawn another connection window
+    finalTest = true;
+    dialogElement.acceptDialog();
+    await setDoc();
+  });
+}
diff --git a/browser/components/preferences/tests/browser_connection_valid_hostname.js b/browser/components/preferences/tests/browser_connection_valid_hostname.js
new file mode 100644
index 0000000000..2e22122448
--- /dev/null
+++ b/browser/components/preferences/tests/browser_connection_valid_hostname.js
@@ -0,0 +1,55 @@
+/* Any copyright is dedicated to the Public Domain.
+   http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+add_task(async function test_valid_hostname() {
+  await openPreferencesViaOpenPreferencesAPI("general", { leaveOpen: true });
+  const connectionURL =
+    "chrome://browser/content/preferences/dialogs/connection.xhtml";
+  let dialog = await openAndLoadSubDialog(connectionURL);
+  let dialogElement = dialog.document.getElementById("ConnectionsDialog");
+
+  let oldNetworkProxyType = Services.prefs.getIntPref("network.proxy.type");
+  registerCleanupFunction(function () {
+    Services.prefs.setIntPref("network.proxy.type", oldNetworkProxyType);
+    Services.prefs.clearUserPref("network.proxy.share_proxy_settings");
+    for (let proxyType of ["http", "ssl", "socks"]) {
+      Services.prefs.clearUserPref("network.proxy." + proxyType);
+      Services.prefs.clearUserPref("network.proxy." + proxyType + "_port");
+      if (proxyType == "http") {
+        continue;
+      }
+      Services.prefs.clearUserPref("network.proxy.backup." + proxyType);
+      Services.prefs.clearUserPref(
+        "network.proxy.backup." + proxyType + "_port"
+      );
+    }
+  });
+
+  let proxyType = dialog.Preferences.get("network.proxy.type");
+  let httpPref = dialog.Preferences.get("network.proxy.http");
+  let httpPortPref = dialog.Preferences.get("network.proxy.http_port");
+  proxyType.value = 1;
+  httpPortPref.value = 1234;
+
+  httpPref.value = "bad://hostname";
+  let beforeAcceptCalled = BrowserTestUtils.waitForEvent(
+    dialogElement,
+    "beforeaccept"
+  );
+  dialogElement.acceptDialog();
+  let event = await beforeAcceptCalled;
+  Assert.ok(event.defaultPrevented, "The dialog was not accepted");
+
+  httpPref.value = "goodhostname";
+  beforeAcceptCalled = BrowserTestUtils.waitForEvent(
+    dialogElement,
+    "beforeaccept"
+  );
+  dialogElement.acceptDialog();
+  event = await beforeAcceptCalled;
+  Assert.ok(!event.defaultPrevented, "The dialog was accepted");
+
+  gBrowser.removeCurrentTab();
+});
diff --git a/browser/components/preferences/tests/browser_containers_name_input.js b/browser/components/preferences/tests/browser_containers_name_input.js
new file mode 100644
index 0000000000..38785d3cb0
--- /dev/null
+++ b/browser/components/preferences/tests/browser_containers_name_input.js
@@ -0,0 +1,72 @@
+const CONTAINERS_URL =
+  "chrome://browser/content/preferences/dialogs/containers.xhtml";
+
+add_setup(async function () {
+  await openPreferencesViaOpenPreferencesAPI("containers", { leaveOpen: true });
+  registerCleanupFunction(async function () {
+    BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  });
+});
+
+add_task(async function () {
+  async function openDialog() {
+    let doc = gBrowser.selectedBrowser.contentDocument;
+
+    let dialogPromise = promiseLoadSubDialog(CONTAINERS_URL);
+
+    let addButton = doc.getElementById("containersAdd");
+    addButton.doCommand();
+
+    let dialog = await dialogPromise;
+
+    return dialog.document;
+  }
+
+  let { contentDocument } = gBrowser.selectedBrowser;
+  let containerNodes = Array.from(
+    contentDocument.querySelectorAll("[data-category=paneContainers]")
+  );
+  ok(
+    containerNodes.find(node => node.getBoundingClientRect().width > 0),
+    "Should actually be showing the container nodes."
+  );
+
+  let doc = await openDialog();
+
+  let name = doc.getElementById("name");
+  let btnApplyChanges = doc.querySelector("dialog").getButton("accept");
+
+  Assert.equal(name.value, "", "The name textbox should initlally be empty");
+  Assert.ok(
+    btnApplyChanges.disabled,
+    "The done button should initially be disabled"
+  );
+
+  function setName(value) {
+    name.value = value;
+
+    let event = new doc.defaultView.InputEvent("input", { data: value });
+    SpecialPowers.dispatchEvent(doc.defaultView, name, event);
+  }
+
+  setName("test");
+
+  Assert.ok(
+    !btnApplyChanges.disabled,
+    "The done button should be enabled when the value is not empty"
+  );
+
+  setName("");
+
+  Assert.ok(
+    btnApplyChanges.disabled,
+    "The done button should be disabled when the value is empty"
+  );
+
+  setName("\u0009\u000B\u000C\u0020\u00A0\uFEFF\u000A\u000D\u2028\u2029");
+
+  Assert.ok(
+    btnApplyChanges.disabled,
+    "The done button should be disabled when the value contains only whitespaces"
+  );
+});
diff --git a/browser/components/preferences/tests/browser_contentblocking.js b/browser/components/preferences/tests/browser_contentblocking.js
new file mode 100644
index 0000000000..3d33f2ed7d
--- /dev/null
+++ b/browser/components/preferences/tests/browser_contentblocking.js
@@ -0,0 +1,1612 @@
+/* eslint-env webextensions */
+
+"use strict";
+
+const { Preferences } = ChromeUtils.importESModule(
+  "resource://gre/modules/Preferences.sys.mjs"
+);
+
+const TP_PREF = "privacy.trackingprotection.enabled";
+const TP_PBM_PREF = "privacy.trackingprotection.pbmode.enabled";
+const NCB_PREF = "network.cookie.cookieBehavior";
+const NCBP_PREF = "network.cookie.cookieBehavior.pbmode";
+const CAT_PREF = "browser.contentblocking.category";
+const FP_PREF = "privacy.trackingprotection.fingerprinting.enabled";
+const STP_PREF = "privacy.trackingprotection.socialtracking.enabled";
+const CM_PREF = "privacy.trackingprotection.cryptomining.enabled";
+const EMAIL_TP_PREF = "privacy.trackingprotection.emailtracking.enabled";
+const EMAIL_TP_PBM_PREF =
+  "privacy.trackingprotection.emailtracking.pbmode.enabled";
+const LEVEL2_PREF = "privacy.annotate_channels.strict_list.enabled";
+const REFERRER_PREF = "network.http.referer.disallowCrossSiteRelaxingDefault";
+const REFERRER_TOP_PREF =
+  "network.http.referer.disallowCrossSiteRelaxingDefault.top_navigation";
+const OCSP_PREF = "privacy.partition.network_state.ocsp_cache";
+const QUERY_PARAM_STRIP_PREF = "privacy.query_stripping.enabled";
+const QUERY_PARAM_STRIP_PBM_PREF = "privacy.query_stripping.enabled.pbmode";
+const PREF_TEST_NOTIFICATIONS =
+  "browser.safebrowsing.test-notifications.enabled";
+const STRICT_PREF = "browser.contentblocking.features.strict";
+const PRIVACY_PAGE = "about:preferences#privacy";
+const ISOLATE_UI_PREF =
+  "browser.contentblocking.reject-and-isolate-cookies.preferences.ui.enabled";
+const FPI_PREF = "privacy.firstparty.isolate";
+const FPP_PREF = "privacy.fingerprintingProtection";
+const FPP_PBM_PREF = "privacy.fingerprintingProtection.pbmode";
+
+const { EnterprisePolicyTesting, PoliciesPrefTracker } =
+  ChromeUtils.importESModule(
+    "resource://testing-common/EnterprisePolicyTesting.sys.mjs"
+  );
+
+requestLongerTimeout(2);
+
+add_task(async function testListUpdate() {
+  SpecialPowers.pushPrefEnv({ set: [[PREF_TEST_NOTIFICATIONS, true]] });
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  let doc = gBrowser.contentDocument;
+
+  let fingerprintersCheckbox = doc.getElementById(
+    "contentBlockingFingerprintersCheckbox"
+  );
+  let updateObserved = TestUtils.topicObserved("safebrowsing-update-attempt");
+  fingerprintersCheckbox.click();
+  let url = (await updateObserved)[1];
+
+  ok(true, "Has tried to update after the fingerprinting checkbox was toggled");
+  is(
+    url,
+    "http://127.0.0.1:8888/safebrowsing-dummy/update",
+    "Using the correct list url to update"
+  );
+
+  let cryptominersCheckbox = doc.getElementById(
+    "contentBlockingCryptominersCheckbox"
+  );
+  updateObserved = TestUtils.topicObserved("safebrowsing-update-attempt");
+  cryptominersCheckbox.click();
+  url = (await updateObserved)[1];
+
+  ok(true, "Has tried to update after the cryptomining checkbox was toggled");
+  is(
+    url,
+    "http://127.0.0.1:8888/safebrowsing-dummy/update",
+    "Using the correct list url to update"
+  );
+
+  gBrowser.removeCurrentTab();
+});
+
+// Tests that the content blocking main category checkboxes have the correct default state.
+add_task(async function testContentBlockingMainCategory() {
+  let prefs = [
+    [TP_PREF, false],
+    [TP_PBM_PREF, true],
+    [STP_PREF, false],
+    [NCB_PREF, Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER],
+    [
+      NCBP_PREF,
+      Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN,
+    ],
+    [ISOLATE_UI_PREF, true],
+    [FPI_PREF, false],
+    [FPP_PREF, false],
+    [FPP_PBM_PREF, true],
+  ];
+
+  for (let pref of prefs) {
+    switch (typeof pref[1]) {
+      case "boolean":
+        SpecialPowers.setBoolPref(pref[0], pref[1]);
+        break;
+      case "number":
+        SpecialPowers.setIntPref(pref[0], pref[1]);
+        break;
+    }
+  }
+
+  let checkboxes = [
+    "#contentBlockingTrackingProtectionCheckbox",
+    "#contentBlockingBlockCookiesCheckbox",
+    "#contentBlockingFingerprintingProtectionCheckbox",
+  ];
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  let doc = gBrowser.contentDocument;
+
+  for (let selector of checkboxes) {
+    let element = doc.querySelector(selector);
+    ok(element, "checkbox " + selector + " exists");
+    is(
+      element.getAttribute("checked"),
+      "true",
+      "checkbox " + selector + " is checked"
+    );
+  }
+
+  // Ensure the dependent controls of the tracking protection subsection behave properly.
+  let tpCheckbox = doc.querySelector(checkboxes[0]);
+
+  let dependentControls = ["#trackingProtectionMenu"];
+  let alwaysEnabledControls = [
+    "#trackingProtectionMenuDesc",
+    ".content-blocking-category-name",
+    "#changeBlockListLink",
+  ];
+
+  tpCheckbox.checked = true;
+
+  // Select "Always" under "All Detected Trackers".
+  let menu = doc.querySelector("#trackingProtectionMenu");
+  let always = doc.querySelector(
+    "#trackingProtectionMenu > menupopup > menuitem[value=always]"
+  );
+  let privateElement = doc.querySelector(
+    "#trackingProtectionMenu > menupopup > menuitem[value=private]"
+  );
+  menu.selectedItem = always;
+  ok(
+    !privateElement.selected,
+    "The Only in private windows item should not be selected"
+  );
+  ok(always.selected, "The Always item should be selected");
+
+  // The first time, privacy-pane-tp-ui-updated won't be dispatched since the
+  // assignment above is a no-op.
+
+  // Ensure the dependent controls are enabled
+  checkControlState(doc, dependentControls, true);
+  checkControlState(doc, alwaysEnabledControls, true);
+
+  let promise = TestUtils.topicObserved("privacy-pane-tp-ui-updated");
+  tpCheckbox.click();
+
+  await promise;
+  ok(!tpCheckbox.checked, "The checkbox should now be unchecked");
+
+  // Ensure the dependent controls are disabled
+  checkControlState(doc, dependentControls, false);
+  checkControlState(doc, alwaysEnabledControls, true);
+
+  // Make sure the selection in the tracking protection submenu persists after
+  // a few times of checking and unchecking All Detected Trackers.
+  // Doing this in a loop in order to avoid typing in the unrolled version manually.
+  // We need to go from the checked state of the checkbox to unchecked back to
+  // checked again...
+  for (let i = 0; i < 3; ++i) {
+    promise = TestUtils.topicObserved("privacy-pane-tp-ui-updated");
+    tpCheckbox.click();
+
+    await promise;
+    is(tpCheckbox.checked, i % 2 == 0, "The checkbox should now be unchecked");
+    is(
+      privateElement.selected,
+      i % 2 == 0,
+      "The Only in private windows item should be selected by default, when the checkbox is checked"
+    );
+    ok(!always.selected, "The Always item should no longer be selected");
+  }
+
+  let cookieMenu = doc.querySelector("#blockCookiesMenu");
+  let cookieMenuTrackers = cookieMenu.querySelector(
+    "menupopup > menuitem[value=trackers]"
+  );
+  let cookieMenuTrackersPlusIsolate = cookieMenu.querySelector(
+    "menupopup > menuitem[value=trackers-plus-isolate]"
+  );
+  let cookieMenuUnvisited = cookieMenu.querySelector(
+    "menupopup > menuitem[value=unvisited]"
+  );
+  let cookieMenuAllThirdParties = doc.querySelector(
+    "menupopup > menuitem[value=all-third-parties]"
+  );
+  let cookieMenuAll = cookieMenu.querySelector(
+    "menupopup > menuitem[value=always]"
+  );
+  // Select block trackers
+  cookieMenuTrackers.click();
+  ok(cookieMenuTrackers.selected, "The trackers item should be selected");
+  is(
+    Services.prefs.getIntPref(NCB_PREF),
+    Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER,
+    `${NCB_PREF} has been set to ${Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER}`
+  );
+  is(
+    Services.prefs.getIntPref(NCBP_PREF),
+    Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN,
+    `${NCBP_PREF} has been set to ${Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN}`
+  );
+  // Select block trackers and isolate
+  cookieMenuTrackersPlusIsolate.click();
+  ok(
+    cookieMenuTrackersPlusIsolate.selected,
+    "The trackers plus isolate item should be selected"
+  );
+  is(
+    Services.prefs.getIntPref(NCB_PREF),
+    Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN,
+    `${NCB_PREF} has been set to ${Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN}`
+  );
+  is(
+    Services.prefs.getIntPref(NCBP_PREF),
+    Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN,
+    `${NCBP_PREF} has been set to ${Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN}`
+  );
+  // Select block unvisited
+  cookieMenuUnvisited.click();
+  ok(cookieMenuUnvisited.selected, "The unvisited item should be selected");
+  is(
+    Services.prefs.getIntPref(NCB_PREF),
+    Ci.nsICookieService.BEHAVIOR_LIMIT_FOREIGN,
+    `${NCB_PREF} has been set to ${Ci.nsICookieService.BEHAVIOR_LIMIT_FOREIGN}`
+  );
+  is(
+    Services.prefs.getIntPref(NCBP_PREF),
+    Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN,
+    `${NCBP_PREF} has been set to ${Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN}`
+  );
+  // Select block all third party
+  cookieMenuAllThirdParties.click();
+  ok(
+    cookieMenuAllThirdParties.selected,
+    "The all-third-parties item should be selected"
+  );
+  is(
+    Services.prefs.getIntPref(NCB_PREF),
+    Ci.nsICookieService.BEHAVIOR_REJECT_FOREIGN,
+    `${NCB_PREF} has been set to ${Ci.nsICookieService.BEHAVIOR_REJECT_FOREIGN}`
+  );
+  is(
+    Services.prefs.getIntPref(NCBP_PREF),
+    Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN,
+    `${NCBP_PREF} has been set to ${Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN}`
+  );
+  // Select block all third party
+  cookieMenuAll.click();
+  ok(cookieMenuAll.selected, "The all cookies item should be selected");
+  is(
+    Services.prefs.getIntPref(NCB_PREF),
+    Ci.nsICookieService.BEHAVIOR_REJECT,
+    `${NCB_PREF} has been set to ${Ci.nsICookieService.BEHAVIOR_REJECT}`
+  );
+  is(
+    Services.prefs.getIntPref(NCBP_PREF),
+    Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN,
+    `${NCBP_PREF} has been set to ${Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN}`
+  );
+
+  gBrowser.removeCurrentTab();
+
+  // Ensure the block-trackers-plus-isolate option only shows in the dropdown if the UI pref is set.
+  Services.prefs.setBoolPref(ISOLATE_UI_PREF, false);
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  doc = gBrowser.contentDocument;
+  cookieMenuTrackersPlusIsolate = doc.querySelector(
+    "#blockCookiesMenu menupopup > menuitem[value=trackers-plus-isolate]"
+  );
+  ok(
+    cookieMenuTrackersPlusIsolate.hidden,
+    "Trackers plus isolate option is hidden from the dropdown if the ui pref is not set."
+  );
+
+  gBrowser.removeCurrentTab();
+
+  // Ensure the block-trackers-plus-isolate option only shows in the dropdown if FPI is disabled.
+  SpecialPowers.setIntPref(
+    NCB_PREF,
+    Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN
+  );
+  SpecialPowers.setBoolPref(FPI_PREF, true);
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  doc = gBrowser.contentDocument;
+  cookieMenuTrackers = doc.querySelector(
+    "#blockCookiesMenu menupopup > menuitem[value=trackers]"
+  );
+  cookieMenuTrackersPlusIsolate = doc.querySelector(
+    "#blockCookiesMenu menupopup > menuitem[value=trackers-plus-isolate]"
+  );
+  ok(cookieMenuTrackers.selected, "The trackers item should be selected");
+  ok(
+    cookieMenuTrackersPlusIsolate.hidden,
+    "Trackers plus isolate option is hidden from the dropdown if the FPI pref is set."
+  );
+  gBrowser.removeCurrentTab();
+
+  for (let pref of prefs) {
+    SpecialPowers.clearUserPref(pref[0]);
+  }
+});
+
+// Tests that the content blocking "Standard" category radio sets the prefs to their default values.
+add_task(async function testContentBlockingStandardCategory() {
+  let prefs = {
+    [TP_PREF]: null,
+    [TP_PBM_PREF]: null,
+    [NCB_PREF]: null,
+    [NCBP_PREF]: null,
+    [FP_PREF]: null,
+    [STP_PREF]: null,
+    [CM_PREF]: null,
+    [EMAIL_TP_PREF]: null,
+    [EMAIL_TP_PBM_PREF]: null,
+    [LEVEL2_PREF]: null,
+    [REFERRER_PREF]: null,
+    [REFERRER_TOP_PREF]: null,
+    [OCSP_PREF]: null,
+    [QUERY_PARAM_STRIP_PREF]: null,
+    [QUERY_PARAM_STRIP_PBM_PREF]: null,
+    [FPP_PREF]: null,
+    [FPP_PBM_PREF]: null,
+  };
+
+  for (let pref in prefs) {
+    Services.prefs.clearUserPref(pref);
+    switch (Services.prefs.getPrefType(pref)) {
+      case Services.prefs.PREF_BOOL:
+        prefs[pref] = Services.prefs.getBoolPref(pref);
+        break;
+      case Services.prefs.PREF_INT:
+        prefs[pref] = Services.prefs.getIntPref(pref);
+        break;
+      case Services.prefs.PREF_STRING:
+        prefs[pref] = Services.prefs.getCharPref(pref);
+        break;
+      default:
+        ok(false, `Unknown pref type for ${pref}`);
+    }
+  }
+
+  Services.prefs.setBoolPref(TP_PREF, true);
+  Services.prefs.setBoolPref(TP_PBM_PREF, false);
+  Services.prefs.setIntPref(
+    NCB_PREF,
+    Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER
+  );
+  Services.prefs.setIntPref(
+    NCBP_PREF,
+    Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER
+  );
+  Services.prefs.setBoolPref(STP_PREF, !Services.prefs.getBoolPref(STP_PREF));
+  Services.prefs.setBoolPref(FP_PREF, !Services.prefs.getBoolPref(FP_PREF));
+  Services.prefs.setBoolPref(CM_PREF, !Services.prefs.getBoolPref(CM_PREF));
+  Services.prefs.setBoolPref(
+    EMAIL_TP_PREF,
+    !Services.prefs.getBoolPref(EMAIL_TP_PREF)
+  );
+  Services.prefs.setBoolPref(
+    EMAIL_TP_PBM_PREF,
+    !Services.prefs.getBoolPref(EMAIL_TP_PBM_PREF)
+  );
+  Services.prefs.setBoolPref(
+    LEVEL2_PREF,
+    !Services.prefs.getBoolPref(LEVEL2_PREF)
+  );
+  Services.prefs.setBoolPref(
+    REFERRER_PREF,
+    !Services.prefs.getBoolPref(REFERRER_PREF)
+  );
+  Services.prefs.setBoolPref(
+    REFERRER_TOP_PREF,
+    !Services.prefs.getBoolPref(REFERRER_TOP_PREF)
+  );
+  Services.prefs.setBoolPref(OCSP_PREF, !Services.prefs.getBoolPref(OCSP_PREF));
+  Services.prefs.setBoolPref(
+    QUERY_PARAM_STRIP_PREF,
+    !Services.prefs.getBoolPref(QUERY_PARAM_STRIP_PREF)
+  );
+  Services.prefs.setBoolPref(
+    QUERY_PARAM_STRIP_PBM_PREF,
+    !Services.prefs.getBoolPref(QUERY_PARAM_STRIP_PBM_PREF)
+  );
+  Services.prefs.setBoolPref(FPP_PREF, !Services.prefs.getBoolPref(FPP_PREF));
+  Services.prefs.setBoolPref(
+    FPP_PBM_PREF,
+    !Services.prefs.getBoolPref(FPP_PBM_PREF)
+  );
+
+  for (let pref in prefs) {
+    switch (Services.prefs.getPrefType(pref)) {
+      case Services.prefs.PREF_BOOL:
+        // Account for prefs that may have retained their default value
+        if (Services.prefs.getBoolPref(pref) != prefs[pref]) {
+          ok(
+            Services.prefs.prefHasUserValue(pref),
+            `modified the pref ${pref}`
+          );
+        }
+        break;
+      case Services.prefs.PREF_INT:
+        if (Services.prefs.getIntPref(pref) != prefs[pref]) {
+          ok(
+            Services.prefs.prefHasUserValue(pref),
+            `modified the pref ${pref}`
+          );
+        }
+        break;
+      case Services.prefs.PREF_STRING:
+        if (Services.prefs.getCharPref(pref) != prefs[pref]) {
+          ok(
+            Services.prefs.prefHasUserValue(pref),
+            `modified the pref ${pref}`
+          );
+        }
+        break;
+      default:
+        ok(false, `Unknown pref type for ${pref}`);
+    }
+  }
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  let doc = gBrowser.contentDocument;
+
+  let standardRadioOption = doc.getElementById("standardRadio");
+  standardRadioOption.click();
+
+  // TP prefs are reset async to check for extensions controlling them.
+  await TestUtils.waitForCondition(
+    () => !Services.prefs.prefHasUserValue(TP_PREF)
+  );
+
+  for (let pref in prefs) {
+    ok(!Services.prefs.prefHasUserValue(pref), `reset the pref ${pref}`);
+  }
+  is(
+    Services.prefs.getStringPref(CAT_PREF),
+    "standard",
+    `${CAT_PREF} has been set to standard`
+  );
+
+  gBrowser.removeCurrentTab();
+});
+
+// Tests that the content blocking "Strict" category radio sets the prefs to the expected values.
+add_task(async function testContentBlockingStrictCategory() {
+  Services.prefs.setBoolPref(TP_PREF, false);
+  Services.prefs.setBoolPref(TP_PBM_PREF, false);
+  Services.prefs.setBoolPref(EMAIL_TP_PREF, false);
+  Services.prefs.setBoolPref(EMAIL_TP_PBM_PREF, false);
+  Services.prefs.setBoolPref(LEVEL2_PREF, false);
+  Services.prefs.setBoolPref(REFERRER_PREF, false);
+  Services.prefs.setBoolPref(REFERRER_TOP_PREF, false);
+  Services.prefs.setBoolPref(OCSP_PREF, false);
+  Services.prefs.setBoolPref(QUERY_PARAM_STRIP_PREF, false);
+  Services.prefs.setBoolPref(QUERY_PARAM_STRIP_PBM_PREF, false);
+  Services.prefs.setBoolPref(FPP_PREF, false);
+  Services.prefs.setBoolPref(FPP_PBM_PREF, false);
+  Services.prefs.setIntPref(
+    NCB_PREF,
+    Ci.nsICookieService.BEHAVIOR_LIMIT_FOREIGN
+  );
+  Services.prefs.setIntPref(
+    NCBP_PREF,
+    Ci.nsICookieService.BEHAVIOR_LIMIT_FOREIGN
+  );
+  let strict_pref = Services.prefs.getStringPref(STRICT_PREF).split(",");
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  let doc = gBrowser.contentDocument;
+
+  let strictRadioOption = doc.getElementById("strictRadio");
+  strictRadioOption.click();
+
+  // TP prefs are reset async to check for extensions controlling them.
+  await TestUtils.waitForCondition(
+    () => Services.prefs.getStringPref(CAT_PREF) == "strict"
+  );
+  // Depending on the definition of the STRICT_PREF, the dependant prefs may have been
+  // set to varying values. Ensure they have been set according to this definition.
+  for (let pref of strict_pref) {
+    switch (pref) {
+      case "tp":
+        is(
+          Services.prefs.getBoolPref(TP_PREF),
+          true,
+          `${TP_PREF} has been set to true`
+        );
+        break;
+      case "-tp":
+        is(
+          Services.prefs.getBoolPref(TP_PREF),
+          false,
+          `${TP_PREF} has been set to false`
+        );
+        break;
+      case "tpPrivate":
+        is(
+          Services.prefs.getBoolPref(TP_PBM_PREF),
+          true,
+          `${TP_PBM_PREF} has been set to true`
+        );
+        break;
+      case "-tpPrivate":
+        is(
+          Services.prefs.getBoolPref(TP_PBM_PREF),
+          false,
+          `${TP_PBM_PREF} has been set to false`
+        );
+        break;
+      case "fp":
+        is(
+          Services.prefs.getBoolPref(FP_PREF),
+          true,
+          `${FP_PREF} has been set to true`
+        );
+        break;
+      case "-fp":
+        is(
+          Services.prefs.getBoolPref(FP_PREF),
+          false,
+          `${FP_PREF} has been set to false`
+        );
+        break;
+      case "stp":
+        is(
+          Services.prefs.getBoolPref(STP_PREF),
+          true,
+          `${STP_PREF} has been set to true`
+        );
+        break;
+      case "-stp":
+        is(
+          Services.prefs.getBoolPref(STP_PREF),
+          false,
+          `${STP_PREF} has been set to false`
+        );
+        break;
+      case "cm":
+        is(
+          Services.prefs.getBoolPref(CM_PREF),
+          true,
+          `${CM_PREF} has been set to true`
+        );
+        break;
+      case "-cm":
+        is(
+          Services.prefs.getBoolPref(CM_PREF),
+          false,
+          `${CM_PREF} has been set to false`
+        );
+        break;
+      case "emailTP":
+        is(
+          Services.prefs.getBoolPref(EMAIL_TP_PREF),
+          true,
+          `${EMAIL_TP_PREF} has been set to true`
+        );
+        break;
+      case "-emailTP":
+        is(
+          Services.prefs.getBoolPref(EMAIL_TP_PREF),
+          false,
+          `${EMAIL_TP_PREF} has been set to false`
+        );
+        break;
+      case "emailTPPrivate":
+        is(
+          Services.prefs.getBoolPref(EMAIL_TP_PBM_PREF),
+          true,
+          `${EMAIL_TP_PBM_PREF} has been set to true`
+        );
+        break;
+      case "-emailTPPrivate":
+        is(
+          Services.prefs.getBoolPref(EMAIL_TP_PBM_PREF),
+          false,
+          `${EMAIL_TP_PBM_PREF} has been set to false`
+        );
+        break;
+      case "lvl2":
+        is(
+          Services.prefs.getBoolPref(LEVEL2_PREF),
+          true,
+          `${CM_PREF} has been set to true`
+        );
+        break;
+      case "-lvl2":
+        is(
+          Services.prefs.getBoolPref(LEVEL2_PREF),
+          false,
+          `${CM_PREF} has been set to false`
+        );
+        break;
+      case "rp":
+        is(
+          Services.prefs.getBoolPref(REFERRER_PREF),
+          true,
+          `${REFERRER_PREF} has been set to true`
+        );
+        break;
+      case "-rp":
+        is(
+          Services.prefs.getBoolPref(REFERRER_PREF),
+          false,
+          `${REFERRER_PREF} has been set to false`
+        );
+        break;
+      case "rpTop":
+        is(
+          Services.prefs.getBoolPref(REFERRER_TOP_PREF),
+          true,
+          `${REFERRER_TOP_PREF} has been set to true`
+        );
+        break;
+      case "-rpTop":
+        is(
+          Services.prefs.getBoolPref(REFERRER_TOP_PREF),
+          false,
+          `${REFERRER_TOP_PREF} has been set to false`
+        );
+        break;
+      case "ocsp":
+        is(
+          Services.prefs.getBoolPref(OCSP_PREF),
+          true,
+          `${OCSP_PREF} has been set to true`
+        );
+        break;
+      case "-ocsp":
+        is(
+          Services.prefs.getBoolPref(OCSP_PREF),
+          false,
+          `${OCSP_PREF} has been set to false`
+        );
+        break;
+      case "qps":
+        is(
+          Services.prefs.getBoolPref(QUERY_PARAM_STRIP_PREF),
+          true,
+          `${QUERY_PARAM_STRIP_PREF} has been set to true`
+        );
+        break;
+      case "-qps":
+        is(
+          Services.prefs.getBoolPref(QUERY_PARAM_STRIP_PREF),
+          false,
+          `${QUERY_PARAM_STRIP_PREF} has been set to false`
+        );
+        break;
+      case "qpsPBM":
+        is(
+          Services.prefs.getBoolPref(QUERY_PARAM_STRIP_PBM_PREF),
+          true,
+          `${QUERY_PARAM_STRIP_PBM_PREF} has been set to true`
+        );
+        break;
+      case "-qpsPBM":
+        is(
+          Services.prefs.getBoolPref(QUERY_PARAM_STRIP_PBM_PREF),
+          false,
+          `${QUERY_PARAM_STRIP_PBM_PREF} has been set to false`
+        );
+        break;
+      case "fpp":
+        is(
+          Services.prefs.getBoolPref(FPP_PREF),
+          true,
+          `${FPP_PREF} has been set to true`
+        );
+        break;
+      case "-fpp":
+        is(
+          Services.prefs.getBoolPref(FPP_PREF),
+          false,
+          `${FPP_PREF} has been set to false`
+        );
+        break;
+      case "fppPrivate":
+        is(
+          Services.prefs.getBoolPref(FPP_PBM_PREF),
+          true,
+          `${FPP_PBM_PREF} has been set to true`
+        );
+        break;
+      case "-fppPrivate":
+        is(
+          Services.prefs.getBoolPref(FPP_PBM_PREF),
+          false,
+          `${FPP_PBM_PREF} has been set to false`
+        );
+        break;
+      case "cookieBehavior0":
+        is(
+          Services.prefs.getIntPref(NCB_PREF),
+          Ci.nsICookieService.BEHAVIOR_ACCEPT,
+          `${NCB_PREF} has been set to ${Ci.nsICookieService.BEHAVIOR_ACCEPT}`
+        );
+        break;
+      case "cookieBehavior1":
+        is(
+          Services.prefs.getIntPref(NCB_PREF),
+          Ci.nsICookieService.BEHAVIOR_REJECT_FOREIGN,
+          `${NCB_PREF} has been set to ${Ci.nsICookieService.BEHAVIOR_REJECT_FOREIGN}`
+        );
+        break;
+      case "cookieBehavior2":
+        is(
+          Services.prefs.getIntPref(NCB_PREF),
+          Ci.nsICookieService.BEHAVIOR_REJECT,
+          `${NCB_PREF} has been set to ${Ci.nsICookieService.BEHAVIOR_REJECT}`
+        );
+        break;
+      case "cookieBehavior3":
+        is(
+          Services.prefs.getIntPref(NCB_PREF),
+          Ci.nsICookieService.BEHAVIOR_LIMIT_FOREIGN,
+          `${NCB_PREF} has been set to ${Ci.nsICookieService.BEHAVIOR_LIMIT_FOREIGN}`
+        );
+        break;
+      case "cookieBehavior4":
+        is(
+          Services.prefs.getIntPref(NCB_PREF),
+          Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER,
+          `${NCB_PREF} has been set to ${Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER}`
+        );
+        break;
+      case "cookieBehavior5":
+        is(
+          Services.prefs.getIntPref(NCB_PREF),
+          Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN,
+          `${NCB_PREF} has been set to ${Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN}`
+        );
+        break;
+      case "cookieBehaviorPBM0":
+        is(
+          Services.prefs.getIntPref(NCBP_PREF),
+          Ci.nsICookieService.BEHAVIOR_ACCEPT,
+          `${NCBP_PREF} has been set to ${Ci.nsICookieService.BEHAVIOR_ACCEPT}`
+        );
+        break;
+      case "cookieBehaviorPBM1":
+        is(
+          Services.prefs.getIntPref(NCBP_PREF),
+          Ci.nsICookieService.BEHAVIOR_REJECT_FOREIGN,
+          `${NCBP_PREF} has been set to ${Ci.nsICookieService.BEHAVIOR_REJECT_FOREIGN}`
+        );
+        break;
+      case "cookieBehaviorPBM2":
+        is(
+          Services.prefs.getIntPref(NCBP_PREF),
+          Ci.nsICookieService.BEHAVIOR_REJECT,
+          `${NCBP_PREF} has been set to ${Ci.nsICookieService.BEHAVIOR_REJECT}`
+        );
+        break;
+      case "cookieBehaviorPBM3":
+        is(
+          Services.prefs.getIntPref(NCBP_PREF),
+          Ci.nsICookieService.BEHAVIOR_LIMIT_FOREIGN,
+          `${NCBP_PREF} has been set to ${Ci.nsICookieService.BEHAVIOR_LIMIT_FOREIGN}`
+        );
+        break;
+      case "cookieBehaviorPBM4":
+        is(
+          Services.prefs.getIntPref(NCBP_PREF),
+          Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER,
+          `${NCBP_PREF} has been set to ${Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER}`
+        );
+        break;
+      case "cookieBehaviorPBM5":
+        is(
+          Services.prefs.getIntPref(NCBP_PREF),
+          Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN,
+          `${NCBP_PREF} has been set to ${Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN}`
+        );
+        break;
+      default:
+        ok(false, "unknown option was added to the strict pref");
+        break;
+    }
+  }
+
+  gBrowser.removeCurrentTab();
+});
+
+// Tests that the content blocking "Custom" category behaves as expected.
+add_task(async function testContentBlockingCustomCategory() {
+  let untouchedPrefs = [
+    TP_PREF,
+    TP_PBM_PREF,
+    NCB_PREF,
+    NCBP_PREF,
+    FP_PREF,
+    STP_PREF,
+    CM_PREF,
+    REFERRER_PREF,
+    REFERRER_TOP_PREF,
+    OCSP_PREF,
+    QUERY_PARAM_STRIP_PREF,
+    QUERY_PARAM_STRIP_PBM_PREF,
+  ];
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  let doc = gBrowser.contentDocument;
+  let strictRadioOption = doc.getElementById("strictRadio");
+  let standardRadioOption = doc.getElementById("standardRadio");
+  let customRadioOption = doc.getElementById("customRadio");
+  let defaults = new Preferences({ defaultBranch: true });
+
+  standardRadioOption.click();
+  await TestUtils.waitForCondition(
+    () => !Services.prefs.prefHasUserValue(TP_PREF)
+  );
+
+  customRadioOption.click();
+  await TestUtils.waitForCondition(
+    () => Services.prefs.getStringPref(CAT_PREF) == "custom"
+  );
+
+  // The custom option will only force change of some prefs, like CAT_PREF. All
+  // other prefs should remain as they were for standard.
+  for (let pref of untouchedPrefs) {
+    ok(
+      !Services.prefs.prefHasUserValue(pref),
+      `the pref ${pref} remains as default value`
+    );
+  }
+
+  is(
+    Services.prefs.getStringPref(CAT_PREF),
+    "custom",
+    `${CAT_PREF} has been set to custom`
+  );
+
+  strictRadioOption.click();
+  await TestUtils.waitForCondition(
+    () => Services.prefs.getStringPref(CAT_PREF) == "strict"
+  );
+
+  // Changing the following prefs should necessarily set CAT_PREF to "custom"
+  for (let pref of [
+    FP_PREF,
+    STP_PREF,
+    CM_PREF,
+    TP_PREF,
+    TP_PBM_PREF,
+    REFERRER_PREF,
+    REFERRER_TOP_PREF,
+    OCSP_PREF,
+    QUERY_PARAM_STRIP_PREF,
+    QUERY_PARAM_STRIP_PBM_PREF,
+  ]) {
+    Services.prefs.setBoolPref(pref, !Services.prefs.getBoolPref(pref));
+    await TestUtils.waitForCondition(
+      () => Services.prefs.getStringPref(CAT_PREF) == "custom"
+    );
+    is(
+      Services.prefs.getStringPref(CAT_PREF),
+      "custom",
+      `${CAT_PREF} has been set to custom`
+    );
+
+    strictRadioOption.click();
+    await TestUtils.waitForCondition(
+      () => Services.prefs.getStringPref(CAT_PREF) == "strict"
+    );
+  }
+
+  // Changing the NCB_PREF should necessarily set CAT_PREF to "custom"
+  let defaultNCB = defaults.get(NCB_PREF);
+  let nonDefaultNCB;
+  switch (defaultNCB) {
+    case Ci.nsICookieService.BEHAVIOR_ACCEPT:
+      nonDefaultNCB = Ci.nsICookieService.BEHAVIOR_REJECT;
+      break;
+    case Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER:
+    case Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN:
+      nonDefaultNCB = Ci.nsICookieService.BEHAVIOR_ACCEPT;
+      break;
+    default:
+      ok(
+        false,
+        "Unexpected default value found for " + NCB_PREF + ": " + defaultNCB
+      );
+      break;
+  }
+  Services.prefs.setIntPref(NCB_PREF, nonDefaultNCB);
+  await TestUtils.waitForCondition(() =>
+    Services.prefs.prefHasUserValue(NCB_PREF)
+  );
+  is(
+    Services.prefs.getStringPref(CAT_PREF),
+    "custom",
+    `${CAT_PREF} has been set to custom`
+  );
+
+  strictRadioOption.click();
+  await TestUtils.waitForCondition(
+    () => Services.prefs.getStringPref(CAT_PREF) == "strict"
+  );
+
+  // Changing the NCBP_PREF should necessarily set CAT_PREF to "custom"
+  let defaultNCBP = defaults.get(NCBP_PREF);
+  let nonDefaultNCBP;
+  switch (defaultNCBP) {
+    case Ci.nsICookieService.BEHAVIOR_ACCEPT:
+      nonDefaultNCBP = Ci.nsICookieService.BEHAVIOR_REJECT;
+      break;
+    case Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER:
+    case Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN:
+      nonDefaultNCBP = Ci.nsICookieService.BEHAVIOR_ACCEPT;
+      break;
+    default:
+      ok(
+        false,
+        "Unexpected default value found for " + NCBP_PREF + ": " + defaultNCBP
+      );
+      break;
+  }
+  Services.prefs.setIntPref(NCBP_PREF, nonDefaultNCBP);
+  await TestUtils.waitForCondition(() =>
+    Services.prefs.prefHasUserValue(NCBP_PREF)
+  );
+  is(
+    Services.prefs.getStringPref(CAT_PREF),
+    "custom",
+    `${CAT_PREF} has been set to custom`
+  );
+
+  for (let pref of untouchedPrefs) {
+    SpecialPowers.clearUserPref(pref);
+  }
+
+  gBrowser.removeCurrentTab();
+});
+
+function checkControlState(doc, controls, enabled) {
+  for (let selector of controls) {
+    for (let control of doc.querySelectorAll(selector)) {
+      if (enabled) {
+        ok(!control.hasAttribute("disabled"), `${selector} is enabled.`);
+      } else {
+        is(
+          control.getAttribute("disabled"),
+          "true",
+          `${selector} is disabled.`
+        );
+      }
+    }
+  }
+}
+
+// Checks that the menulists for tracking protection and cookie blocking are disabled when all TP prefs are off.
+add_task(async function testContentBlockingDependentTPControls() {
+  SpecialPowers.pushPrefEnv({
+    set: [
+      [TP_PREF, false],
+      [TP_PBM_PREF, false],
+      [NCB_PREF, Ci.nsICookieService.BEHAVIOR_ACCEPT],
+      [CAT_PREF, "custom"],
+    ],
+  });
+
+  let disabledControls = ["#trackingProtectionMenu", "#blockCookiesMenu"];
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  let doc = gBrowser.contentDocument;
+  checkControlState(doc, disabledControls, false);
+
+  gBrowser.removeCurrentTab();
+});
+
+// Checks that disabling tracking protection also disables email tracking protection.
+add_task(async function testDisableTPCheckBoxDisablesEmailTP() {
+  SpecialPowers.pushPrefEnv({
+    set: [
+      [TP_PREF, false],
+      [TP_PBM_PREF, true],
+      [EMAIL_TP_PREF, false],
+      [EMAIL_TP_PBM_PREF, true],
+      [CAT_PREF, "custom"],
+    ],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  let doc = gBrowser.contentDocument;
+
+  // Click the checkbox to disable TP and check if this disables Email TP.
+  let tpCheckbox = doc.getElementById(
+    "contentBlockingTrackingProtectionCheckbox"
+  );
+
+  // Verify the initial check state of the tracking protection checkbox.
+  is(
+    tpCheckbox.getAttribute("checked"),
+    "true",
+    "Tracking protection checkbox is checked initially"
+  );
+
+  tpCheckbox.click();
+
+  // Verify the checkbox is unchecked after clicking.
+  is(
+    tpCheckbox.getAttribute("checked"),
+    "",
+    "Tracking protection checkbox is unchecked"
+  );
+
+  // Verify the pref states.
+  is(
+    Services.prefs.getBoolPref(EMAIL_TP_PREF),
+    false,
+    `${EMAIL_TP_PREF} has been set to false`
+  );
+
+  is(
+    Services.prefs.getBoolPref(EMAIL_TP_PBM_PREF),
+    false,
+    `${EMAIL_TP_PBM_PREF} has been set to false`
+  );
+
+  gBrowser.removeCurrentTab();
+});
+
+// Checks that the email tracking prefs set properly with tracking protection
+// drop downs.
+add_task(async function testTPMenuForEmailTP() {
+  SpecialPowers.pushPrefEnv({
+    set: [
+      [TP_PREF, false],
+      [TP_PBM_PREF, true],
+      [EMAIL_TP_PREF, false],
+      [EMAIL_TP_PBM_PREF, true],
+      [CAT_PREF, "custom"],
+    ],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  let doc = gBrowser.contentDocument;
+
+  let menu = doc.querySelector("#trackingProtectionMenu");
+  let always = doc.querySelector(
+    "#trackingProtectionMenu > menupopup > menuitem[value=always]"
+  );
+  let privateElement = doc.querySelector(
+    "#trackingProtectionMenu > menupopup > menuitem[value=private]"
+  );
+
+  // Click the always option on the tracking protection drop down.
+  menu.selectedItem = always;
+  always.click();
+
+  // Verify the pref states.
+  is(
+    Services.prefs.getBoolPref(EMAIL_TP_PREF),
+    true,
+    `${EMAIL_TP_PREF} has been set to true`
+  );
+
+  is(
+    Services.prefs.getBoolPref(EMAIL_TP_PBM_PREF),
+    true,
+    `${EMAIL_TP_PBM_PREF} has been set to true`
+  );
+
+  // Click the private-only option on the tracking protection drop down.
+  menu.selectedItem = privateElement;
+  privateElement.click();
+
+  // Verify the pref states.
+  is(
+    Services.prefs.getBoolPref(EMAIL_TP_PREF),
+    false,
+    `${EMAIL_TP_PREF} has been set to false`
+  );
+
+  is(
+    Services.prefs.getBoolPref(EMAIL_TP_PBM_PREF),
+    true,
+    `${EMAIL_TP_PBM_PREF} has been set to true`
+  );
+
+  gBrowser.removeCurrentTab();
+});
+
+// Ensure the FPP checkbox in ETP custom works properly.
+add_task(async function testFPPCustomCheckBox() {
+  // Set the FPP prefs to the default state.
+  SpecialPowers.pushPrefEnv({
+    set: [
+      [FPP_PREF, false],
+      [FPP_PBM_PREF, true],
+      [CAT_PREF, "custom"],
+    ],
+  });
+
+  // Clear glean before testing.
+  Services.fog.testResetFOG();
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  let doc = gBrowser.contentDocument;
+
+  let fppCheckbox = doc.querySelector(
+    "#contentBlockingFingerprintingProtectionCheckbox"
+  );
+
+  // Verify the default state of the FPP checkbox.
+  ok(fppCheckbox, "FPP checkbox exists");
+  is(fppCheckbox.getAttribute("checked"), "true", "FPP checkbox is checked");
+
+  let menu = doc.querySelector("#fingerprintingProtectionMenu");
+  let alwaysMenuItem = doc.querySelector(
+    "#fingerprintingProtectionMenu > menupopup > menuitem[value=always]"
+  );
+  let privateMenuItem = doc.querySelector(
+    "#fingerprintingProtectionMenu > menupopup > menuitem[value=private]"
+  );
+
+  // Click the always option on the FPP drop down.
+  menu.selectedItem = alwaysMenuItem;
+  alwaysMenuItem.click();
+
+  // Verify the pref states and the telemetry.
+  is(
+    Services.prefs.getBoolPref(FPP_PREF),
+    true,
+    `${FPP_PREF} has been set to true`
+  );
+
+  is(
+    Services.prefs.getBoolPref(FPP_PBM_PREF),
+    true,
+    `${FPP_PBM_PREF} has been set to true`
+  );
+
+  let events = Glean.privacyUiFppClick.menu.testGetValue();
+  is(events.length, 1, "The event length is correct");
+  is(events[0].extra.value, "always", "The extra field is correct.");
+
+  // Click the private-only option on the FPP drop down.
+  menu.selectedItem = privateMenuItem;
+  privateMenuItem.click();
+
+  // Verify the pref states and the telemetry.
+  is(
+    Services.prefs.getBoolPref(FPP_PREF),
+    false,
+    `${FPP_PREF} has been set to true`
+  );
+
+  is(
+    Services.prefs.getBoolPref(FPP_PBM_PREF),
+    true,
+    `${FPP_PBM_PREF} has been set to true`
+  );
+
+  events = Glean.privacyUiFppClick.menu.testGetValue();
+  is(events.length, 2, "The event length is correct");
+  is(events[1].extra.value, "private", "The extra field is correct.");
+
+  // Uncheck the checkbox
+  fppCheckbox.click();
+
+  // Verify the pref states and the telemetry.
+  is(
+    Services.prefs.getBoolPref(FPP_PREF),
+    false,
+    `${FPP_PREF} has been set to true`
+  );
+
+  is(
+    Services.prefs.getBoolPref(FPP_PBM_PREF),
+    false,
+    `${FPP_PBM_PREF} has been set to true`
+  );
+  is(menu.disabled, true, "The menu is disabled as the checkbox is unchecked");
+
+  events = Glean.privacyUiFppClick.checkbox.testGetValue();
+  is(events.length, 1, "The event length is correct");
+  is(events[0].extra.checked, "false", "The extra field is correct.");
+
+  // Check the checkbox again.
+  fppCheckbox.click();
+
+  // Verify the pref states and telemetry.
+  is(
+    Services.prefs.getBoolPref(FPP_PREF),
+    false,
+    `${FPP_PREF} has been set to true`
+  );
+
+  is(
+    Services.prefs.getBoolPref(FPP_PBM_PREF),
+    true,
+    `${FPP_PBM_PREF} has been set to true`
+  );
+  is(menu.disabled, false, "The menu is enabled as the checkbox is checked");
+
+  events = Glean.privacyUiFppClick.checkbox.testGetValue();
+  is(events.length, 2, "The event length is correct");
+  is(events[1].extra.checked, "true", "The extra field is correct.");
+
+  gBrowser.removeCurrentTab();
+});
+
+// Checks that social media trackers, cryptomining and fingerprinting visibility
+// can be controlled via pref.
+add_task(async function testCustomOptionsVisibility() {
+  Services.prefs.setBoolPref(
+    "browser.contentblocking.cryptomining.preferences.ui.enabled",
+    false
+  );
+  Services.prefs.setBoolPref(
+    "browser.contentblocking.fingerprinting.preferences.ui.enabled",
+    false
+  );
+  Services.prefs.setBoolPref(
+    "privacy.socialtracking.block_cookies.enabled",
+    false
+  );
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+
+  let doc = gBrowser.contentDocument;
+  let cryptominersOption = doc.getElementById(
+    "contentBlockingCryptominersOption"
+  );
+  let fingerprintersOption = doc.getElementById(
+    "contentBlockingFingerprintersOption"
+  );
+
+  ok(cryptominersOption.hidden, "Cryptomining is hidden");
+  ok(fingerprintersOption.hidden, "Fingerprinting is hidden");
+
+  gBrowser.removeCurrentTab();
+
+  Services.prefs.setBoolPref(
+    "browser.contentblocking.cryptomining.preferences.ui.enabled",
+    true
+  );
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+
+  doc = gBrowser.contentDocument;
+  cryptominersOption = doc.getElementById("contentBlockingCryptominersOption");
+  fingerprintersOption = doc.getElementById(
+    "contentBlockingFingerprintersOption"
+  );
+
+  ok(!cryptominersOption.hidden, "Cryptomining is shown");
+  ok(fingerprintersOption.hidden, "Fingerprinting is hidden");
+
+  gBrowser.removeCurrentTab();
+
+  Services.prefs.setBoolPref(
+    "browser.contentblocking.fingerprinting.preferences.ui.enabled",
+    true
+  );
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+
+  doc = gBrowser.contentDocument;
+  cryptominersOption = doc.getElementById("contentBlockingCryptominersOption");
+  fingerprintersOption = doc.getElementById(
+    "contentBlockingFingerprintersOption"
+  );
+
+  ok(!cryptominersOption.hidden, "Cryptomining is shown");
+  ok(!fingerprintersOption.hidden, "Fingerprinting is shown");
+
+  gBrowser.removeCurrentTab();
+
+  // Social media trackers UI should be hidden
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+
+  doc = gBrowser.contentDocument;
+  let socialTrackingUI = [...doc.querySelectorAll(".social-media-option")];
+
+  ok(
+    socialTrackingUI.every(el => el.hidden),
+    "All Social media tracker UI instances are hidden"
+  );
+
+  gBrowser.removeCurrentTab();
+
+  // Social media trackers UI should be visible
+  Services.prefs.setBoolPref(
+    "privacy.socialtracking.block_cookies.enabled",
+    true
+  );
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+
+  doc = gBrowser.contentDocument;
+  socialTrackingUI = [...doc.querySelectorAll(".social-media-option")];
+
+  ok(
+    !socialTrackingUI.every(el => el.hidden),
+    "All Social media tracker UI instances are visible"
+  );
+
+  gBrowser.removeCurrentTab();
+
+  Services.prefs.clearUserPref(
+    "browser.contentblocking.cryptomining.preferences.ui.enabled"
+  );
+  Services.prefs.clearUserPref(
+    "browser.contentblocking.fingerprinting.preferences.ui.enabled"
+  );
+  Services.prefs.clearUserPref("privacy.socialtracking.block_cookies.enabled");
+});
+
+// Checks that adding a custom enterprise policy will put the user in the custom category.
+// Other categories will be disabled.
+add_task(async function testPolicyCategorization() {
+  Services.prefs.setStringPref(CAT_PREF, "standard");
+  is(
+    Services.prefs.getStringPref(CAT_PREF),
+    "standard",
+    `${CAT_PREF} starts on standard`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(TP_PREF),
+    `${TP_PREF} starts with the default value`
+  );
+  PoliciesPrefTracker.start();
+
+  await EnterprisePolicyTesting.setupPolicyEngineWithJson({
+    policies: {
+      EnableTrackingProtection: {
+        Value: true,
+      },
+    },
+  });
+  EnterprisePolicyTesting.checkPolicyPref(TP_PREF, true, false);
+  is(
+    Services.prefs.getStringPref(CAT_PREF),
+    "custom",
+    `${CAT_PREF} has been set to custom`
+  );
+
+  Services.prefs.setStringPref(CAT_PREF, "standard");
+  is(
+    Services.prefs.getStringPref(CAT_PREF),
+    "standard",
+    `${CAT_PREF} starts on standard`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(NCB_PREF),
+    `${NCB_PREF} starts with the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(NCBP_PREF),
+    `${NCBP_PREF} starts with the default value`
+  );
+
+  let uiUpdatedPromise = TestUtils.topicObserved("privacy-pane-tp-ui-updated");
+  await EnterprisePolicyTesting.setupPolicyEngineWithJson({
+    policies: {
+      Cookies: {
+        AcceptThirdParty: "never",
+        Locked: true,
+      },
+    },
+  });
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  await uiUpdatedPromise;
+
+  EnterprisePolicyTesting.checkPolicyPref(
+    NCB_PREF,
+    Ci.nsICookieService.BEHAVIOR_REJECT_FOREIGN,
+    true
+  );
+  EnterprisePolicyTesting.checkPolicyPref(
+    NCBP_PREF,
+    Ci.nsICookieService.BEHAVIOR_REJECT_FOREIGN,
+    true
+  );
+  is(
+    Services.prefs.getStringPref(CAT_PREF),
+    "custom",
+    `${CAT_PREF} has been set to custom`
+  );
+
+  let doc = gBrowser.contentDocument;
+  let strictRadioOption = doc.getElementById("strictRadio");
+  let standardRadioOption = doc.getElementById("standardRadio");
+  is(strictRadioOption.disabled, true, "the strict option is disabled");
+  is(standardRadioOption.disabled, true, "the standard option is disabled");
+
+  gBrowser.removeCurrentTab();
+
+  // Cleanup after this particular test.
+  if (Services.policies.status != Ci.nsIEnterprisePolicies.INACTIVE) {
+    await EnterprisePolicyTesting.setupPolicyEngineWithJson({
+      policies: {
+        Cookies: {
+          Locked: false,
+        },
+      },
+    });
+    await EnterprisePolicyTesting.setupPolicyEngineWithJson("");
+  }
+  is(
+    Services.policies.status,
+    Ci.nsIEnterprisePolicies.INACTIVE,
+    "Engine is inactive at the end of the test"
+  );
+
+  EnterprisePolicyTesting.resetRunOnceState();
+  PoliciesPrefTracker.stop();
+});
+
+// Tests that changing a content blocking pref shows the content blocking warning
+// to reload tabs to apply changes.
+add_task(async function testContentBlockingReloadWarning() {
+  Services.prefs.setStringPref(CAT_PREF, "standard");
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  let doc = gBrowser.contentDocument;
+  let reloadWarnings = [
+    ...doc.querySelectorAll(".content-blocking-warning.reload-tabs"),
+  ];
+  let allHidden = reloadWarnings.every(el => el.hidden);
+  ok(allHidden, "all of the warnings to reload tabs are initially hidden");
+
+  Services.prefs.setStringPref(CAT_PREF, "strict");
+
+  let strictWarning = doc.querySelector(
+    "#contentBlockingOptionStrict .content-blocking-warning.reload-tabs"
+  );
+  ok(
+    !BrowserTestUtils.isHidden(strictWarning),
+    "The warning in the strict section should be showing"
+  );
+
+  Services.prefs.setStringPref(CAT_PREF, "standard");
+  gBrowser.removeCurrentTab();
+});
+
+// Tests that changing a content blocking pref does not show the content blocking warning
+// if it is the only tab.
+add_task(async function testContentBlockingReloadWarningSingleTab() {
+  Services.prefs.setStringPref(CAT_PREF, "standard");
+  BrowserTestUtils.startLoadingURIString(
+    gBrowser.selectedBrowser,
+    PRIVACY_PAGE
+  );
+  await BrowserTestUtils.browserLoaded(
+    gBrowser.selectedBrowser,
+    false,
+    PRIVACY_PAGE
+  );
+
+  let reloadWarnings = [
+    ...gBrowser.contentDocument.querySelectorAll(
+      ".content-blocking-warning.reload-tabs"
+    ),
+  ];
+  ok(reloadWarnings.length, "must have at least one reload warning");
+  ok(
+    reloadWarnings.every(el => el.hidden),
+    "all of the warnings to reload tabs are initially hidden"
+  );
+
+  is(BrowserWindowTracker.windowCount, 1, "There is only one window open");
+  is(gBrowser.tabs.length, 1, "There is only one tab open");
+  Services.prefs.setStringPref(CAT_PREF, "strict");
+
+  ok(
+    reloadWarnings.every(el => el.hidden),
+    "all of the warnings to reload tabs are still hidden"
+  );
+  Services.prefs.setStringPref(CAT_PREF, "standard");
+  BrowserTestUtils.startLoadingURIString(
+    gBrowser.selectedBrowser,
+    "about:newtab"
+  );
+  await BrowserTestUtils.browserLoaded(gBrowser.selectedBrowser);
+});
+
+// Checks that the reload tabs message reloads all tabs except the active tab.
+add_task(async function testReloadTabsMessage() {
+  Services.prefs.setStringPref(CAT_PREF, "strict");
+  let exampleTab = await BrowserTestUtils.openNewForegroundTab(
+    gBrowser,
+    "http://example.com"
+  );
+  let examplePinnedTab = await BrowserTestUtils.openNewForegroundTab(
+    gBrowser,
+    "http://example.com"
+  );
+  gBrowser.pinTab(examplePinnedTab);
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  let doc = gBrowser.contentDocument;
+  let standardWarning = doc.querySelector(
+    "#contentBlockingOptionStandard .content-blocking-warning.reload-tabs"
+  );
+  let standardReloadButton = doc.querySelector(
+    "#contentBlockingOptionStandard .reload-tabs-button"
+  );
+
+  Services.prefs.setStringPref(CAT_PREF, "standard");
+  ok(
+    !BrowserTestUtils.isHidden(standardWarning),
+    "The warning in the standard section should be showing"
+  );
+
+  let exampleTabBrowserDiscardedPromise = BrowserTestUtils.waitForEvent(
+    exampleTab,
+    "TabBrowserDiscarded"
+  );
+  let examplePinnedTabLoadPromise = BrowserTestUtils.browserLoaded(
+    examplePinnedTab.linkedBrowser
+  );
+  standardReloadButton.click();
+  // The pinned example page had a load event
+  await examplePinnedTabLoadPromise;
+  // The other one had its browser discarded
+  await exampleTabBrowserDiscardedPromise;
+
+  ok(
+    BrowserTestUtils.isHidden(standardWarning),
+    "The warning in the standard section should have hidden after being clicked"
+  );
+
+  // cleanup
+  Services.prefs.setStringPref(CAT_PREF, "standard");
+  gBrowser.removeTab(exampleTab);
+  gBrowser.removeTab(examplePinnedTab);
+  gBrowser.removeCurrentTab();
+});
+
+// Checks that the RFP warning banner is properly shown when rfp prefs are enabled.
+add_task(async function testRFPWarningBanner() {
+  // Set the prefs to false before testing.
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["privacy.resistFingerprinting", false],
+      ["privacy.resistFingerprinting.pbmode", false],
+    ],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  let doc = gBrowser.contentDocument;
+  let rfpWarningBanner = doc.getElementById("rfpIncompatibilityWarning");
+
+  // Verify if the banner is hidden at the beginning.
+  ok(
+    !BrowserTestUtils.isVisible(rfpWarningBanner),
+    "The RFP warning banner is hidden at the beginning."
+  );
+
+  // Enable the RFP pref
+  await SpecialPowers.pushPrefEnv({
+    set: [["privacy.resistFingerprinting", true]],
+  });
+
+  // Verify if the banner is shown.
+  ok(
+    BrowserTestUtils.isVisible(rfpWarningBanner),
+    "The RFP warning banner is shown."
+  );
+
+  // Enable the RFP pref for private windows
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["privacy.resistFingerprinting", false],
+      ["privacy.resistFingerprinting.pbmode", true],
+    ],
+  });
+
+  // Verify if the banner is shown.
+  ok(
+    BrowserTestUtils.isVisible(rfpWarningBanner),
+    "The RFP warning banner is shown."
+  );
+
+  // Enable both RFP prefs.
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["privacy.resistFingerprinting", true],
+      ["privacy.resistFingerprinting.pbmode", true],
+    ],
+  });
+
+  // Verify if the banner is shown.
+  ok(
+    BrowserTestUtils.isVisible(rfpWarningBanner),
+    "The RFP warning banner is shown."
+  );
+
+  gBrowser.removeCurrentTab();
+});
diff --git a/browser/components/preferences/tests/browser_contentblocking_categories.js b/browser/components/preferences/tests/browser_contentblocking_categories.js
new file mode 100644
index 0000000000..9b9bbbb088
--- /dev/null
+++ b/browser/components/preferences/tests/browser_contentblocking_categories.js
@@ -0,0 +1,539 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+/* eslint-env webextensions */
+
+ChromeUtils.defineESModuleGetters(this, {
+  Preferences: "resource://gre/modules/Preferences.sys.mjs",
+});
+
+const TP_PREF = "privacy.trackingprotection.enabled";
+const TP_PBM_PREF = "privacy.trackingprotection.pbmode.enabled";
+const NCB_PREF = "network.cookie.cookieBehavior";
+const NCBP_PREF = "network.cookie.cookieBehavior.pbmode";
+const CAT_PREF = "browser.contentblocking.category";
+const FP_PREF = "privacy.trackingprotection.fingerprinting.enabled";
+const CM_PREF = "privacy.trackingprotection.cryptomining.enabled";
+const STP_PREF = "privacy.trackingprotection.socialtracking.enabled";
+const EMAIL_TP_PREF = "privacy.trackingprotection.emailtracking.enabled";
+const EMAIL_TP_PBM_PREF =
+  "privacy.trackingprotection.emailtracking.pbmode.enabled";
+const LEVEL2_PREF = "privacy.annotate_channels.strict_list.enabled";
+const REFERRER_PREF = "network.http.referer.disallowCrossSiteRelaxingDefault";
+const REFERRER_TOP_PREF =
+  "network.http.referer.disallowCrossSiteRelaxingDefault.top_navigation";
+const OCSP_PREF = "privacy.partition.network_state.ocsp_cache";
+const QUERY_PARAM_STRIP_PREF = "privacy.query_stripping.enabled";
+const QUERY_PARAM_STRIP_PBM_PREF = "privacy.query_stripping.enabled.pbmode";
+const FPP_PREF = "privacy.fingerprintingProtection";
+const FPP_PBM_PREF = "privacy.fingerprintingProtection.pbmode";
+const STRICT_DEF_PREF = "browser.contentblocking.features.strict";
+
+// Tests that the content blocking standard category definition is based on the default settings of
+// the content blocking prefs.
+// Changing the definition does not remove the user from the category.
+add_task(async function testContentBlockingStandardDefinition() {
+  Services.prefs.setStringPref(CAT_PREF, "strict");
+  Services.prefs.setStringPref(CAT_PREF, "standard");
+  is(
+    Services.prefs.getStringPref(CAT_PREF),
+    "standard",
+    `${CAT_PREF} starts on standard`
+  );
+
+  ok(
+    !Services.prefs.prefHasUserValue(TP_PREF),
+    `${TP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(TP_PBM_PREF),
+    `${TP_PBM_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(FP_PREF),
+    `${FP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(CM_PREF),
+    `${CM_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(STP_PREF),
+    `${STP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(EMAIL_TP_PREF),
+    `${EMAIL_TP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(EMAIL_TP_PBM_PREF),
+    `${EMAIL_TP_PBM_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(NCB_PREF),
+    `${NCB_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(NCBP_PREF),
+    `${NCBP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(LEVEL2_PREF),
+    `${LEVEL2_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(REFERRER_PREF),
+    `${REFERRER_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(REFERRER_TOP_PREF),
+    `${REFERRER_TOP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(OCSP_PREF),
+    `${OCSP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(QUERY_PARAM_STRIP_PREF),
+    `${QUERY_PARAM_STRIP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(QUERY_PARAM_STRIP_PBM_PREF),
+    `${QUERY_PARAM_STRIP_PBM_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(FPP_PREF),
+    `${FPP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(FPP_PBM_PREF),
+    `${FPP_PBM_PREF} pref has the default value`
+  );
+
+  let defaults = Services.prefs.getDefaultBranch("");
+  let originalTP = defaults.getBoolPref(TP_PREF);
+  let originalTPPBM = defaults.getBoolPref(TP_PBM_PREF);
+  let originalFP = defaults.getBoolPref(FP_PREF);
+  let originalCM = defaults.getBoolPref(CM_PREF);
+  let originalSTP = defaults.getBoolPref(STP_PREF);
+  let originalEmailTP = defaults.getBoolPref(EMAIL_TP_PREF);
+  let originalEmailTPPBM = defaults.getBoolPref(EMAIL_TP_PBM_PREF);
+  let originalNCB = defaults.getIntPref(NCB_PREF);
+  let originalNCBP = defaults.getIntPref(NCBP_PREF);
+  let originalLEVEL2 = defaults.getBoolPref(LEVEL2_PREF);
+  let originalREFERRER = defaults.getBoolPref(REFERRER_PREF);
+  let originalREFERRERTOP = defaults.getBoolPref(REFERRER_TOP_PREF);
+  let originalOCSP = defaults.getBoolPref(OCSP_PREF);
+  let originalQueryParamStrip = defaults.getBoolPref(QUERY_PARAM_STRIP_PREF);
+  let originalQueryParamStripPBM = defaults.getBoolPref(
+    QUERY_PARAM_STRIP_PBM_PREF
+  );
+  let originalFPP = defaults.getBoolPref(FPP_PREF);
+  let originalFPPPBM = defaults.getBoolPref(FPP_PBM_PREF);
+
+  let nonDefaultNCB;
+  switch (originalNCB) {
+    case Ci.nsICookieService.BEHAVIOR_ACCEPT:
+      nonDefaultNCB = Ci.nsICookieService.BEHAVIOR_REJECT;
+      break;
+    default:
+      nonDefaultNCB = Ci.nsICookieService.BEHAVIOR_ACCEPT;
+      break;
+  }
+  let nonDefaultNCBP;
+  switch (originalNCBP) {
+    case Ci.nsICookieService.BEHAVIOR_ACCEPT:
+      nonDefaultNCBP = Ci.nsICookieService.BEHAVIOR_REJECT;
+      break;
+    default:
+      nonDefaultNCBP = Ci.nsICookieService.BEHAVIOR_ACCEPT;
+      break;
+  }
+  defaults.setIntPref(NCB_PREF, nonDefaultNCB);
+  defaults.setIntPref(NCBP_PREF, nonDefaultNCBP);
+  defaults.setBoolPref(TP_PREF, !originalTP);
+  defaults.setBoolPref(TP_PBM_PREF, !originalTPPBM);
+  defaults.setBoolPref(FP_PREF, !originalFP);
+  defaults.setBoolPref(CM_PREF, !originalCM);
+  defaults.setBoolPref(CM_PREF, !originalSTP);
+  defaults.setBoolPref(EMAIL_TP_PREF, !originalEmailTP);
+  defaults.setBoolPref(EMAIL_TP_PBM_PREF, !originalEmailTPPBM);
+  defaults.setIntPref(NCB_PREF, !originalNCB);
+  defaults.setBoolPref(LEVEL2_PREF, !originalLEVEL2);
+  defaults.setBoolPref(REFERRER_PREF, !originalREFERRER);
+  defaults.setBoolPref(REFERRER_TOP_PREF, !originalREFERRERTOP);
+  defaults.setBoolPref(OCSP_PREF, !originalOCSP);
+  defaults.setBoolPref(QUERY_PARAM_STRIP_PREF, !originalQueryParamStrip);
+  defaults.setBoolPref(QUERY_PARAM_STRIP_PBM_PREF, !originalQueryParamStripPBM);
+  defaults.setBoolPref(FPP_PREF, !originalFPP);
+  defaults.setBoolPref(FPP_PBM_PREF, !originalFPPPBM);
+
+  ok(
+    !Services.prefs.prefHasUserValue(TP_PREF),
+    `${TP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(TP_PBM_PREF),
+    `${TP_PBM_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(FP_PREF),
+    `${FP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(CM_PREF),
+    `${CM_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(STP_PREF),
+    `${STP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(EMAIL_TP_PREF),
+    `${EMAIL_TP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(EMAIL_TP_PBM_PREF),
+    `${EMAIL_TP_PBM_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(NCB_PREF),
+    `${NCB_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(NCBP_PREF),
+    `${NCBP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(LEVEL2_PREF),
+    `${LEVEL2_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(REFERRER_PREF),
+    `${REFERRER_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(REFERRER_TOP_PREF),
+    `${REFERRER_TOP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(OCSP_PREF),
+    `${OCSP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(QUERY_PARAM_STRIP_PREF),
+    `${QUERY_PARAM_STRIP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(QUERY_PARAM_STRIP_PBM_PREF),
+    `${QUERY_PARAM_STRIP_PBM_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(FPP_PREF),
+    `${FPP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(FPP_PBM_PREF),
+    `${FPP_PBM_PREF} pref has the default value`
+  );
+
+  // cleanup
+  defaults.setIntPref(NCB_PREF, originalNCB);
+  defaults.setBoolPref(TP_PREF, originalTP);
+  defaults.setBoolPref(TP_PBM_PREF, originalTPPBM);
+  defaults.setBoolPref(FP_PREF, originalFP);
+  defaults.setBoolPref(CM_PREF, originalCM);
+  defaults.setBoolPref(STP_PREF, originalSTP);
+  defaults.setBoolPref(EMAIL_TP_PREF, originalEmailTP);
+  defaults.setBoolPref(EMAIL_TP_PBM_PREF, originalEmailTPPBM);
+  defaults.setIntPref(NCB_PREF, originalNCB);
+  defaults.setIntPref(NCBP_PREF, originalNCBP);
+  defaults.setBoolPref(LEVEL2_PREF, originalLEVEL2);
+  defaults.setBoolPref(REFERRER_PREF, originalREFERRER);
+  defaults.setBoolPref(REFERRER_TOP_PREF, originalREFERRERTOP);
+  defaults.setBoolPref(OCSP_PREF, originalOCSP);
+  defaults.setBoolPref(QUERY_PARAM_STRIP_PREF, originalQueryParamStrip);
+  defaults.setBoolPref(QUERY_PARAM_STRIP_PBM_PREF, originalQueryParamStripPBM);
+  defaults.setBoolPref(FPP_PREF, originalFPP);
+  defaults.setBoolPref(FPP_PBM_PREF, originalFPPPBM);
+});
+
+// Tests that the content blocking strict category definition changes the behavior
+// of the strict category pref and all prefs it controls.
+// Changing the definition does not remove the user from the category.
+add_task(async function testContentBlockingStrictDefinition() {
+  let defaults = Services.prefs.getDefaultBranch("");
+  let originalStrictPref = defaults.getStringPref(STRICT_DEF_PREF);
+  defaults.setStringPref(
+    STRICT_DEF_PREF,
+    "tp,tpPrivate,fp,cm,cookieBehavior0,cookieBehaviorPBM0,stp,emailTP,emailTPPrivate,lvl2,rp,rpTop,ocsp,qps,qpsPBM,fpp,fppPrivate"
+  );
+  Services.prefs.setStringPref(CAT_PREF, "strict");
+  is(
+    Services.prefs.getStringPref(CAT_PREF),
+    "strict",
+    `${CAT_PREF} has changed to strict`
+  );
+
+  ok(
+    !Services.prefs.prefHasUserValue(STRICT_DEF_PREF),
+    `We changed the default value of ${STRICT_DEF_PREF}`
+  );
+  is(
+    Services.prefs.getStringPref(STRICT_DEF_PREF),
+    "tp,tpPrivate,fp,cm,cookieBehavior0,cookieBehaviorPBM0,stp,emailTP,emailTPPrivate,lvl2,rp,rpTop,ocsp,qps,qpsPBM,fpp,fppPrivate",
+    `${STRICT_DEF_PREF} changed to what we set.`
+  );
+
+  is(
+    Services.prefs.getBoolPref(TP_PREF),
+    true,
+    `${TP_PREF} pref has been set to true`
+  );
+  is(
+    Services.prefs.getBoolPref(TP_PBM_PREF),
+    true,
+    `${TP_PBM_PREF} pref has been set to true`
+  );
+  is(
+    Services.prefs.getBoolPref(FP_PREF),
+    true,
+    `${CM_PREF} pref has been set to true`
+  );
+  is(
+    Services.prefs.getBoolPref(CM_PREF),
+    true,
+    `${CM_PREF} pref has been set to true`
+  );
+  is(
+    Services.prefs.getBoolPref(STP_PREF),
+    true,
+    `${STP_PREF} pref has been set to true`
+  );
+  is(
+    Services.prefs.getBoolPref(EMAIL_TP_PREF),
+    true,
+    `${EMAIL_TP_PREF} pref has been set to true`
+  );
+  is(
+    Services.prefs.getBoolPref(EMAIL_TP_PBM_PREF),
+    true,
+    `${EMAIL_TP_PBM_PREF} pref has been set to true`
+  );
+  is(
+    Services.prefs.getIntPref(NCB_PREF),
+    Ci.nsICookieService.BEHAVIOR_ACCEPT,
+    `${NCB_PREF} has been set to BEHAVIOR_ACCEPT`
+  );
+  is(
+    Services.prefs.getIntPref(NCBP_PREF),
+    Ci.nsICookieService.BEHAVIOR_ACCEPT,
+    `${NCBP_PREF} has been set to BEHAVIOR_ACCEPT`
+  );
+  is(
+    Services.prefs.getBoolPref(LEVEL2_PREF),
+    true,
+    `${LEVEL2_PREF} pref has been set to true`
+  );
+  is(
+    Services.prefs.getBoolPref(REFERRER_PREF),
+    true,
+    `${REFERRER_PREF} pref has been set to true`
+  );
+  is(
+    Services.prefs.getBoolPref(REFERRER_TOP_PREF),
+    true,
+    `${REFERRER_TOP_PREF} pref has been set to true`
+  );
+  is(
+    Services.prefs.getBoolPref(OCSP_PREF),
+    true,
+    `${OCSP_PREF} pref has been set to true`
+  );
+  is(
+    Services.prefs.getBoolPref(QUERY_PARAM_STRIP_PREF),
+    true,
+    `${QUERY_PARAM_STRIP_PREF} pref has been set to true`
+  );
+  is(
+    Services.prefs.getBoolPref(QUERY_PARAM_STRIP_PBM_PREF),
+    true,
+    `${QUERY_PARAM_STRIP_PBM_PREF} pref has been set to true`
+  );
+  is(
+    Services.prefs.getBoolPref(FPP_PREF),
+    true,
+    `${FPP_PREF} pref has been set to true`
+  );
+  is(
+    Services.prefs.getBoolPref(FPP_PBM_PREF),
+    true,
+    `${FPP_PBM_PREF} pref has been set to true`
+  );
+
+  // Note, if a pref is not listed it will use the default value, however this is only meant as a
+  // backup if a mistake is made. The UI will not respond correctly.
+  defaults.setStringPref(STRICT_DEF_PREF, "");
+  ok(
+    !Services.prefs.prefHasUserValue(TP_PREF),
+    `${TP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(TP_PBM_PREF),
+    `${TP_PBM_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(FP_PREF),
+    `${FP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(CM_PREF),
+    `${CM_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(STP_PREF),
+    `${STP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(EMAIL_TP_PREF),
+    `${EMAIL_TP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(EMAIL_TP_PBM_PREF),
+    `${EMAIL_TP_PBM_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(NCB_PREF),
+    `${NCB_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(NCBP_PREF),
+    `${NCBP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(LEVEL2_PREF),
+    `${LEVEL2_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(REFERRER_PREF),
+    `${REFERRER_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(REFERRER_TOP_PREF),
+    `${REFERRER_TOP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(OCSP_PREF),
+    `${OCSP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(QUERY_PARAM_STRIP_PREF),
+    `${QUERY_PARAM_STRIP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(QUERY_PARAM_STRIP_PBM_PREF),
+    `${QUERY_PARAM_STRIP_PBM_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(FPP_PREF),
+    `${FPP_PREF} pref has the default value`
+  );
+  ok(
+    !Services.prefs.prefHasUserValue(FPP_PBM_PREF),
+    `${FPP_PBM_PREF} pref has the default value`
+  );
+
+  defaults.setStringPref(
+    STRICT_DEF_PREF,
+    "-tpPrivate,-fp,-cm,-tp,cookieBehavior3,cookieBehaviorPBM2,-stp,-emailTP,-emailTPPrivate,-lvl2,-rp,-ocsp,-qps,-qpsPBM,-fpp,-fppPrivate"
+  );
+  is(
+    Services.prefs.getBoolPref(TP_PREF),
+    false,
+    `${TP_PREF} pref has been set to false`
+  );
+  is(
+    Services.prefs.getBoolPref(TP_PBM_PREF),
+    false,
+    `${TP_PBM_PREF} pref has been set to false`
+  );
+  is(
+    Services.prefs.getBoolPref(FP_PREF),
+    false,
+    `${FP_PREF} pref has been set to false`
+  );
+  is(
+    Services.prefs.getBoolPref(CM_PREF),
+    false,
+    `${CM_PREF} pref has been set to false`
+  );
+  is(
+    Services.prefs.getBoolPref(STP_PREF),
+    false,
+    `${STP_PREF} pref has been set to false`
+  );
+  is(
+    Services.prefs.getBoolPref(EMAIL_TP_PREF),
+    false,
+    `${EMAIL_TP_PREF} pref has been set to false`
+  );
+  is(
+    Services.prefs.getBoolPref(EMAIL_TP_PBM_PREF),
+    false,
+    `${EMAIL_TP_PBM_PREF} pref has been set to false`
+  );
+  is(
+    Services.prefs.getIntPref(NCB_PREF),
+    Ci.nsICookieService.BEHAVIOR_LIMIT_FOREIGN,
+    `${NCB_PREF} has been set to BEHAVIOR_REJECT_TRACKER`
+  );
+  is(
+    Services.prefs.getIntPref(NCBP_PREF),
+    Ci.nsICookieService.BEHAVIOR_REJECT,
+    `${NCBP_PREF} has been set to BEHAVIOR_REJECT`
+  );
+  is(
+    Services.prefs.getBoolPref(LEVEL2_PREF),
+    false,
+    `${LEVEL2_PREF} pref has been set to false`
+  );
+  is(
+    Services.prefs.getBoolPref(REFERRER_PREF),
+    false,
+    `${REFERRER_PREF} pref has been set to false`
+  );
+  is(
+    Services.prefs.getBoolPref(REFERRER_TOP_PREF),
+    false,
+    `${REFERRER_TOP_PREF} pref has been set to false`
+  );
+  is(
+    Services.prefs.getBoolPref(OCSP_PREF),
+    false,
+    `${OCSP_PREF} pref has been set to false`
+  );
+  is(
+    Services.prefs.getBoolPref(QUERY_PARAM_STRIP_PREF),
+    false,
+    `${QUERY_PARAM_STRIP_PREF} pref has been set to false`
+  );
+  is(
+    Services.prefs.getBoolPref(QUERY_PARAM_STRIP_PBM_PREF),
+    false,
+    `${QUERY_PARAM_STRIP_PBM_PREF} pref has been set to false`
+  );
+  is(
+    Services.prefs.getBoolPref(FPP_PREF),
+    false,
+    `${FPP_PREF} pref has been set to false`
+  );
+  is(
+    Services.prefs.getBoolPref(FPP_PBM_PREF),
+    false,
+    `${FPP_PBM_PREF} pref has been set to false`
+  );
+
+  // cleanup
+  defaults.setStringPref(STRICT_DEF_PREF, originalStrictPref);
+  Services.prefs.setStringPref(CAT_PREF, "standard");
+});
diff --git a/browser/components/preferences/tests/browser_contentblocking_standard_tcp_section.js b/browser/components/preferences/tests/browser_contentblocking_standard_tcp_section.js
new file mode 100644
index 0000000000..31881c47a1
--- /dev/null
+++ b/browser/components/preferences/tests/browser_contentblocking_standard_tcp_section.js
@@ -0,0 +1,148 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+/**
+ * Tests the TCP info box in the ETP standard section of about:preferences#privacy.
+ */
+
+ChromeUtils.defineESModuleGetters(this, {
+  Preferences: "resource://gre/modules/Preferences.sys.mjs",
+});
+
+const COOKIE_BEHAVIOR_PREF = "network.cookie.cookieBehavior";
+const CAT_PREF = "browser.contentblocking.category";
+
+const LEARN_MORE_URL =
+  Services.urlFormatter.formatURLPref("app.support.baseURL") +
+  "total-cookie-protection";
+
+const {
+  BEHAVIOR_REJECT_TRACKER,
+  BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN,
+} = Ci.nsICookieService;
+
+async function testTCPSection({ dFPIEnabled }) {
+  info(
+    "Testing TCP preferences section in standard " +
+      JSON.stringify({ dFPIEnabled })
+  );
+
+  // In order to test the "standard" category we need to set the default value
+  // for the cookie behavior pref. A user value would get cleared as soon as we
+  // switch to "standard".
+  Services.prefs
+    .getDefaultBranch("")
+    .setIntPref(
+      COOKIE_BEHAVIOR_PREF,
+      dFPIEnabled
+        ? BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN
+        : BEHAVIOR_REJECT_TRACKER
+    );
+
+  // Setting to standard category explicitly, since changing the default cookie
+  // behavior still switches us to custom initially.
+  await SpecialPowers.pushPrefEnv({
+    set: [[CAT_PREF, "standard"]],
+  });
+
+  const uiEnabled =
+    Services.prefs.getIntPref(COOKIE_BEHAVIOR_PREF) ==
+    BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN;
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  let doc = gBrowser.contentDocument;
+
+  let standardRadioOption = doc.getElementById("standardRadio");
+  let strictRadioOption = doc.getElementById("strictRadio");
+  let customRadioOption = doc.getElementById("customRadio");
+
+  ok(standardRadioOption.selected, "Standard category is selected");
+
+  let etpStandardTCPBox = doc.getElementById("etpStandardTCPBox");
+  is(
+    BrowserTestUtils.isVisible(etpStandardTCPBox),
+    uiEnabled,
+    `TCP section in standard is ${uiEnabled ? " " : "not "}visible.`
+  );
+
+  if (uiEnabled) {
+    // If visible, test the TCP section elements.
+    let learnMoreLink = etpStandardTCPBox.querySelector("#tcp-learn-more-link");
+    ok(learnMoreLink, "Should have a learn more link");
+    BrowserTestUtils.isVisible(
+      learnMoreLink,
+      "Learn more link should be visible."
+    );
+    ok(
+      learnMoreLink.href && !learnMoreLink.href.startsWith("about:blank"),
+      "Learn more link should be valid."
+    );
+    is(
+      learnMoreLink.href,
+      LEARN_MORE_URL,
+      "Learn more link should have the correct target."
+    );
+
+    let description = etpStandardTCPBox.querySelector(".tail-with-learn-more");
+    ok(description, "Should have a description element.");
+    BrowserTestUtils.isVisible(description, "Description should be visible.");
+
+    let title = etpStandardTCPBox.querySelector(
+      ".content-blocking-warning-title"
+    );
+    ok(title, "Should have a title element.");
+    BrowserTestUtils.isVisible(title, "Title should be visible.");
+  }
+
+  info("Switch to ETP strict.");
+  let categoryPrefChange = waitForAndAssertPrefState(CAT_PREF, "strict");
+  strictRadioOption.click();
+  await categoryPrefChange;
+  ok(
+    !BrowserTestUtils.isVisible(etpStandardTCPBox),
+    "When strict is selected TCP UI is not visible."
+  );
+
+  info("Switch to ETP custom.");
+  categoryPrefChange = waitForAndAssertPrefState(CAT_PREF, "custom");
+  customRadioOption.click();
+  await categoryPrefChange;
+  ok(
+    !BrowserTestUtils.isVisible(etpStandardTCPBox),
+    "When custom is selected TCP UI is not visible."
+  );
+
+  info("Switch back to standard and ensure we show the TCP UI again.");
+  categoryPrefChange = waitForAndAssertPrefState(CAT_PREF, "standard");
+  standardRadioOption.click();
+  await categoryPrefChange;
+  is(
+    BrowserTestUtils.isVisible(etpStandardTCPBox),
+    uiEnabled,
+    `TCP section in standard is ${uiEnabled ? " " : "not "}visible.`
+  );
+
+  gBrowser.removeCurrentTab();
+  await SpecialPowers.popPrefEnv();
+  Services.prefs.setStringPref(CAT_PREF, "standard");
+}
+
+add_setup(async function () {
+  // Register cleanup function to restore default cookie behavior.
+  const defaultPrefs = Services.prefs.getDefaultBranch("");
+  const previousDefaultCB = defaultPrefs.getIntPref(COOKIE_BEHAVIOR_PREF);
+
+  registerCleanupFunction(function () {
+    defaultPrefs.setIntPref(COOKIE_BEHAVIOR_PREF, previousDefaultCB);
+  });
+});
+
+// Clients which don't have dFPI enabled should not see the
+// preferences section.
+add_task(async function test_dfpi_disabled() {
+  await testTCPSection({ dFPIEnabled: false });
+});
+
+add_task(async function test_dfpi_enabled() {
+  await testTCPSection({ dFPIEnabled: true });
+});
diff --git a/browser/components/preferences/tests/browser_cookie_exceptions_addRemove.js b/browser/components/preferences/tests/browser_cookie_exceptions_addRemove.js
new file mode 100644
index 0000000000..1b70170ddc
--- /dev/null
+++ b/browser/components/preferences/tests/browser_cookie_exceptions_addRemove.js
@@ -0,0 +1,299 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+if (AppConstants.TSAN || AppConstants.DEBUG) {
+  requestLongerTimeout(2);
+}
+
+const PERMISSIONS_URL =
+  "chrome://browser/content/preferences/dialogs/permissions.xhtml";
+
+async function openCookiesDialog(doc) {
+  let cookieExceptionsButton = doc.getElementById("cookieExceptions");
+  ok(cookieExceptionsButton, "cookieExceptionsButton found");
+  let dialogPromise = promiseLoadSubDialog(PERMISSIONS_URL);
+  cookieExceptionsButton.click();
+  let dialog = await dialogPromise;
+  return dialog;
+}
+
+function checkCookiesDialog(dialog) {
+  ok(dialog, "dialog loaded");
+  let buttonIds = ["removePermission", "removeAllPermissions"];
+
+  for (let buttonId of buttonIds) {
+    let button = dialog.document.getElementById(buttonId);
+    ok(button, `${buttonId} found`);
+  }
+
+  let dialogEl = dialog.document.querySelector("dialog");
+  let acceptBtn = dialogEl.getButton("accept");
+  let cancelBtn = dialogEl.getButton("cancel");
+
+  ok(!acceptBtn.hidden, "acceptButton found");
+  ok(!cancelBtn.hidden, "cancelButton found");
+}
+
+function addNewPermission(websiteAddress, dialog) {
+  let url = dialog.document.getElementById("url");
+  let buttonDialog = dialog.document.getElementById("btnBlock");
+  let permissionsBox = dialog.document.getElementById("permissionsBox");
+  let currentPermissions = permissionsBox.itemCount;
+
+  url.value = websiteAddress;
+  url.dispatchEvent(new Event("input", { bubbles: true }));
+  is(
+    buttonDialog.hasAttribute("disabled"),
+    false,
+    "When the user add an url the button should be clickable"
+  );
+  buttonDialog.click();
+
+  is(
+    permissionsBox.itemCount,
+    currentPermissions + 1,
+    "Website added in url should be in the list"
+  );
+}
+
+async function cleanList(dialog) {
+  let removeAllButton = dialog.document.getElementById("removeAllPermissions");
+  if (!removeAllButton.hasAttribute("disabled")) {
+    removeAllButton.click();
+  }
+}
+
+function addData(websites, dialog) {
+  for (let website of websites) {
+    addNewPermission(website, dialog);
+  }
+}
+
+function deletePermission(permission, dialog) {
+  let permissionsBox = dialog.document.getElementById("permissionsBox");
+  let elements = permissionsBox.getElementsByAttribute("origin", permission);
+  is(elements.length, 1, "It should find only one entry");
+  permissionsBox.selectItem(elements[0]);
+  let removePermissionButton =
+    dialog.document.getElementById("removePermission");
+  is(
+    removePermissionButton.hasAttribute("disabled"),
+    false,
+    "The button should be clickable to remove selected item"
+  );
+  removePermissionButton.click();
+}
+
+function save(dialog) {
+  let saveButton = dialog.document.querySelector("dialog").getButton("accept");
+  saveButton.click();
+}
+
+function cancel(dialog) {
+  let cancelButton = dialog.document
+    .querySelector("dialog")
+    .getButton("cancel");
+  ok(!cancelButton.hidden, "cancelButton found");
+  cancelButton.click();
+}
+
+async function checkExpected(expected, doc) {
+  let dialog = await openCookiesDialog(doc);
+  let permissionsBox = dialog.document.getElementById("permissionsBox");
+
+  is(
+    permissionsBox.itemCount,
+    expected.length,
+    `There should be ${expected.length} elements in the list`
+  );
+
+  for (let website of expected) {
+    let elements = permissionsBox.getElementsByAttribute("origin", website);
+    is(elements.length, 1, "It should find only one entry");
+  }
+  return dialog;
+}
+
+async function runTest(test, websites, doc) {
+  let dialog = await openCookiesDialog(doc);
+  checkCookiesDialog(dialog);
+
+  if (test.needPreviousData) {
+    addData(websites, dialog);
+    save(dialog);
+    dialog = await openCookiesDialog(doc);
+  }
+
+  for (let step of test.steps) {
+    switch (step) {
+      case "addNewPermission":
+        addNewPermission(test.newData, dialog);
+        break;
+      case "deletePermission":
+        deletePermission(test.newData, dialog);
+        break;
+      case "deleteAllPermission":
+        await cleanList(dialog);
+        break;
+      case "save":
+        save(dialog);
+        break;
+      case "cancel":
+        cancel(dialog);
+        break;
+      case "openPane":
+        dialog = await openCookiesDialog(doc);
+        break;
+      default:
+      // code block
+    }
+  }
+  dialog = await checkExpected(test.expected, doc);
+  await cleanList(dialog);
+  save(dialog);
+}
+
+add_task(async function checkPermissions() {
+  await openPreferencesViaOpenPreferencesAPI("panePrivacy", {
+    leaveOpen: true,
+  });
+  let win = gBrowser.selectedBrowser.contentWindow;
+  let doc = win.document;
+  let websites = ["http://test1.com", "http://test2.com"];
+
+  let tests = [
+    {
+      needPreviousData: false,
+      newData: "https://mytest.com",
+      steps: ["addNewPermission", "save"],
+      expected: ["https://mytest.com"], // when open the pane again it should find this in the list
+    },
+    {
+      needPreviousData: false,
+      newData: "https://mytest.com",
+      steps: ["addNewPermission", "cancel"],
+      expected: [],
+    },
+    {
+      needPreviousData: false,
+      newData: "https://mytest.com",
+      steps: ["addNewPermission", "deletePermission", "save"],
+      expected: [],
+    },
+    {
+      needPreviousData: false,
+      newData: "https://mytest.com",
+      steps: ["addNewPermission", "deletePermission", "cancel"],
+      expected: [],
+    },
+    {
+      needPreviousData: false,
+      newData: "https://mytest.com",
+      steps: [
+        "addNewPermission",
+        "save",
+        "openPane",
+        "deletePermission",
+        "save",
+      ],
+      expected: [],
+    },
+    {
+      needPreviousData: false,
+      newData: "https://mytest.com",
+      steps: [
+        "addNewPermission",
+        "save",
+        "openPane",
+        "deletePermission",
+        "cancel",
+      ],
+      expected: ["https://mytest.com"],
+    },
+    {
+      needPreviousData: false,
+      newData: "https://mytest.com",
+      steps: ["addNewPermission", "deleteAllPermission", "save"],
+      expected: [],
+    },
+    {
+      needPreviousData: false,
+      newData: "https://mytest.com",
+      steps: ["addNewPermission", "deleteAllPermission", "cancel"],
+      expected: [],
+    },
+    {
+      needPreviousData: false,
+      newData: "https://mytest.com",
+      steps: [
+        "addNewPermission",
+        "save",
+        "openPane",
+        "deleteAllPermission",
+        "save",
+      ],
+      expected: [],
+    },
+    {
+      needPreviousData: false,
+      newData: "https://mytest.com",
+      steps: [
+        "addNewPermission",
+        "save",
+        "openPane",
+        "deleteAllPermission",
+        "cancel",
+      ],
+      expected: ["https://mytest.com"],
+    },
+    {
+      needPreviousData: true,
+      newData: "https://mytest.com",
+      steps: ["deleteAllPermission", "save"],
+      expected: [],
+    },
+    {
+      needPreviousData: true,
+      newData: "https://mytest.com",
+      steps: ["deleteAllPermission", "cancel"],
+      expected: websites,
+    },
+    {
+      needPreviousData: true,
+      newData: "https://mytest.com",
+      steps: ["addNewPermission", "save"],
+      expected: (function () {
+        let result = websites.slice();
+        result.push("https://mytest.com");
+        return result;
+      })(),
+    },
+    {
+      needPreviousData: true,
+      newData: "https://mytest.com",
+      steps: ["addNewPermission", "cancel"],
+      expected: websites,
+    },
+    {
+      needPreviousData: false,
+      newData: "https://mytest.com",
+      steps: [
+        "addNewPermission",
+        "save",
+        "openPane",
+        "deleteAllPermission",
+        "addNewPermission",
+        "save",
+      ],
+      expected: ["https://mytest.com"],
+    },
+  ];
+
+  for (let test of tests) {
+    await runTest(test, websites, doc);
+  }
+
+  gBrowser.removeCurrentTab();
+});
diff --git a/browser/components/preferences/tests/browser_cookies_exceptions.js b/browser/components/preferences/tests/browser_cookies_exceptions.js
new file mode 100644
index 0000000000..d2d538a48a
--- /dev/null
+++ b/browser/components/preferences/tests/browser_cookies_exceptions.js
@@ -0,0 +1,568 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+requestLongerTimeout(3);
+
+add_task(async function testAllow() {
+  await runTest(
+    async (params, observeAllPromise, apply) => {
+      assertListContents(params, []);
+
+      params.url.value = "test.com";
+      params.btnAllow.doCommand();
+
+      assertListContents(params, [
+        ["http://test.com", params.allowL10nId],
+        ["https://test.com", params.allowL10nId],
+      ]);
+
+      apply();
+      await observeAllPromise;
+    },
+    params => {
+      return [
+        {
+          type: "cookie",
+          origin: "http://test.com",
+          data: "added",
+          capability: Ci.nsIPermissionManager.ALLOW_ACTION,
+        },
+        {
+          type: "cookie",
+          origin: "https://test.com",
+          data: "added",
+          capability: Ci.nsIPermissionManager.ALLOW_ACTION,
+        },
+      ];
+    }
+  );
+});
+
+add_task(async function testBlock() {
+  await runTest(
+    async (params, observeAllPromise, apply) => {
+      params.url.value = "test.com";
+      params.btnBlock.doCommand();
+
+      assertListContents(params, [
+        ["http://test.com", params.denyL10nId],
+        ["https://test.com", params.denyL10nId],
+      ]);
+
+      apply();
+      await observeAllPromise;
+    },
+    params => {
+      return [
+        {
+          type: "cookie",
+          origin: "http://test.com",
+          data: "changed",
+          capability: Ci.nsIPermissionManager.DENY_ACTION,
+        },
+        {
+          type: "cookie",
+          origin: "https://test.com",
+          data: "changed",
+          capability: Ci.nsIPermissionManager.DENY_ACTION,
+        },
+      ];
+    }
+  );
+});
+
+add_task(async function testAllowAgain() {
+  await runTest(
+    async (params, observeAllPromise, apply) => {
+      params.url.value = "test.com";
+      params.btnAllow.doCommand();
+
+      assertListContents(params, [
+        ["http://test.com", params.allowL10nId],
+        ["https://test.com", params.allowL10nId],
+      ]);
+
+      apply();
+      await observeAllPromise;
+    },
+    params => {
+      return [
+        {
+          type: "cookie",
+          origin: "http://test.com",
+          data: "changed",
+          capability: Ci.nsIPermissionManager.ALLOW_ACTION,
+        },
+        {
+          type: "cookie",
+          origin: "https://test.com",
+          data: "changed",
+          capability: Ci.nsIPermissionManager.ALLOW_ACTION,
+        },
+      ];
+    }
+  );
+});
+
+add_task(async function testRemove() {
+  await runTest(
+    async (params, observeAllPromise, apply) => {
+      while (params.richlistbox.itemCount) {
+        params.richlistbox.selectedIndex = 0;
+        params.btnRemove.doCommand();
+      }
+      assertListContents(params, []);
+
+      apply();
+      await observeAllPromise;
+    },
+    params => {
+      let richlistItems = params.richlistbox.getElementsByAttribute(
+        "origin",
+        "*"
+      );
+      let observances = [];
+      for (let item of richlistItems) {
+        observances.push({
+          type: "cookie",
+          origin: item.getAttribute("origin"),
+          data: "deleted",
+        });
+      }
+      return observances;
+    }
+  );
+});
+
+add_task(async function testAdd() {
+  await runTest(
+    async (params, observeAllPromise, apply) => {
+      let uri = Services.io.newURI("http://test.com");
+      PermissionTestUtils.add(
+        uri,
+        "popup",
+        Ci.nsIPermissionManager.DENY_ACTION
+      );
+
+      info("Adding unrelated permission should not change display.");
+      assertListContents(params, []);
+
+      apply();
+      await observeAllPromise;
+
+      PermissionTestUtils.remove(uri, "popup");
+    },
+    params => {
+      return [
+        {
+          type: "popup",
+          origin: "http://test.com",
+          data: "added",
+          capability: Ci.nsIPermissionManager.DENY_ACTION,
+        },
+      ];
+    }
+  );
+});
+
+add_task(async function testAllowHTTPSWithPort() {
+  await runTest(
+    async (params, observeAllPromise, apply) => {
+      params.url.value = "https://test.com:12345";
+      params.btnAllow.doCommand();
+
+      assertListContents(params, [
+        ["https://test.com:12345", params.allowL10nId],
+      ]);
+
+      apply();
+      await observeAllPromise;
+    },
+    params => {
+      return [
+        {
+          type: "cookie",
+          origin: "https://test.com:12345",
+          data: "added",
+          capability: Ci.nsIPermissionManager.ALLOW_ACTION,
+        },
+      ];
+    }
+  );
+});
+
+add_task(async function testBlockHTTPSWithPort() {
+  await runTest(
+    async (params, observeAllPromise, apply) => {
+      params.url.value = "https://test.com:12345";
+      params.btnBlock.doCommand();
+
+      assertListContents(params, [
+        ["https://test.com:12345", params.denyL10nId],
+      ]);
+
+      apply();
+      await observeAllPromise;
+    },
+    params => {
+      return [
+        {
+          type: "cookie",
+          origin: "https://test.com:12345",
+          data: "changed",
+          capability: Ci.nsIPermissionManager.DENY_ACTION,
+        },
+      ];
+    }
+  );
+});
+
+add_task(async function testAllowAgainHTTPSWithPort() {
+  await runTest(
+    async (params, observeAllPromise, apply) => {
+      params.url.value = "https://test.com:12345";
+      params.btnAllow.doCommand();
+
+      assertListContents(params, [
+        ["https://test.com:12345", params.allowL10nId],
+      ]);
+
+      apply();
+      await observeAllPromise;
+    },
+    params => {
+      return [
+        {
+          type: "cookie",
+          origin: "https://test.com:12345",
+          data: "changed",
+          capability: Ci.nsIPermissionManager.ALLOW_ACTION,
+        },
+      ];
+    }
+  );
+});
+
+add_task(async function testRemoveHTTPSWithPort() {
+  await runTest(
+    async (params, observeAllPromise, apply) => {
+      while (params.richlistbox.itemCount) {
+        params.richlistbox.selectedIndex = 0;
+        params.btnRemove.doCommand();
+      }
+
+      assertListContents(params, []);
+
+      apply();
+      await observeAllPromise;
+    },
+    params => {
+      let richlistItems = params.richlistbox.getElementsByAttribute(
+        "origin",
+        "*"
+      );
+      let observances = [];
+      for (let item of richlistItems) {
+        observances.push({
+          type: "cookie",
+          origin: item.getAttribute("origin"),
+          data: "deleted",
+        });
+      }
+      return observances;
+    }
+  );
+});
+
+add_task(async function testAllowPort() {
+  await runTest(
+    async (params, observeAllPromise, apply) => {
+      params.url.value = "localhost:12345";
+      params.btnAllow.doCommand();
+
+      assertListContents(params, [
+        ["http://localhost:12345", params.allowL10nId],
+        ["https://localhost:12345", params.allowL10nId],
+      ]);
+
+      apply();
+      await observeAllPromise;
+    },
+    params => {
+      return [
+        {
+          type: "cookie",
+          origin: "http://localhost:12345",
+          data: "added",
+          capability: Ci.nsIPermissionManager.ALLOW_ACTION,
+        },
+        {
+          type: "cookie",
+          origin: "https://localhost:12345",
+          data: "added",
+          capability: Ci.nsIPermissionManager.ALLOW_ACTION,
+        },
+      ];
+    }
+  );
+});
+
+add_task(async function testBlockPort() {
+  await runTest(
+    async (params, observeAllPromise, apply) => {
+      params.url.value = "localhost:12345";
+      params.btnBlock.doCommand();
+
+      assertListContents(params, [
+        ["http://localhost:12345", params.denyL10nId],
+        ["https://localhost:12345", params.denyL10nId],
+      ]);
+
+      apply();
+      await observeAllPromise;
+    },
+    params => {
+      return [
+        {
+          type: "cookie",
+          origin: "http://localhost:12345",
+          data: "changed",
+          capability: Ci.nsIPermissionManager.DENY_ACTION,
+        },
+        {
+          type: "cookie",
+          origin: "https://localhost:12345",
+          data: "changed",
+          capability: Ci.nsIPermissionManager.DENY_ACTION,
+        },
+      ];
+    }
+  );
+});
+
+add_task(async function testAllowAgainPort() {
+  await runTest(
+    async (params, observeAllPromise, apply) => {
+      params.url.value = "localhost:12345";
+      params.btnAllow.doCommand();
+
+      assertListContents(params, [
+        ["http://localhost:12345", params.allowL10nId],
+        ["https://localhost:12345", params.allowL10nId],
+      ]);
+
+      apply();
+      await observeAllPromise;
+    },
+    params => {
+      return [
+        {
+          type: "cookie",
+          origin: "http://localhost:12345",
+          data: "changed",
+          capability: Ci.nsIPermissionManager.ALLOW_ACTION,
+        },
+        {
+          type: "cookie",
+          origin: "https://localhost:12345",
+          data: "changed",
+          capability: Ci.nsIPermissionManager.ALLOW_ACTION,
+        },
+      ];
+    }
+  );
+});
+
+add_task(async function testRemovePort() {
+  await runTest(
+    async (params, observeAllPromise, apply) => {
+      while (params.richlistbox.itemCount) {
+        params.richlistbox.selectedIndex = 0;
+        params.btnRemove.doCommand();
+      }
+
+      assertListContents(params, []);
+
+      apply();
+      await observeAllPromise;
+    },
+    params => {
+      let richlistItems = params.richlistbox.getElementsByAttribute(
+        "origin",
+        "*"
+      );
+      let observances = [];
+      for (let item of richlistItems) {
+        observances.push({
+          type: "cookie",
+          origin: item.getAttribute("origin"),
+          data: "deleted",
+        });
+      }
+      return observances;
+    }
+  );
+});
+
+add_task(async function testSort() {
+  await runTest(
+    async (params, observeAllPromise, apply) => {
+      // Sort by site name.
+      EventUtils.synthesizeMouseAtCenter(
+        params.doc.getElementById("siteCol"),
+        {},
+        params.doc.defaultView
+      );
+
+      for (let URL of ["http://a", "http://z", "http://b"]) {
+        let URI = Services.io.newURI(URL);
+        PermissionTestUtils.add(
+          URI,
+          "cookie",
+          Ci.nsIPermissionManager.ALLOW_ACTION
+        );
+      }
+
+      assertListContents(params, [
+        ["http://a", params.allowL10nId],
+        ["http://b", params.allowL10nId],
+        ["http://z", params.allowL10nId],
+      ]);
+
+      // Sort by site name in descending order.
+      EventUtils.synthesizeMouseAtCenter(
+        params.doc.getElementById("siteCol"),
+        {},
+        params.doc.defaultView
+      );
+
+      assertListContents(params, [
+        ["http://z", params.allowL10nId],
+        ["http://b", params.allowL10nId],
+        ["http://a", params.allowL10nId],
+      ]);
+
+      apply();
+      await observeAllPromise;
+
+      for (let URL of ["http://a", "http://z", "http://b"]) {
+        let uri = Services.io.newURI(URL);
+        PermissionTestUtils.remove(uri, "cookie");
+      }
+    },
+    params => {
+      return [
+        {
+          type: "cookie",
+          origin: "http://a",
+          data: "added",
+          capability: Ci.nsIPermissionManager.ALLOW_ACTION,
+        },
+        {
+          type: "cookie",
+          origin: "http://z",
+          data: "added",
+          capability: Ci.nsIPermissionManager.ALLOW_ACTION,
+        },
+        {
+          type: "cookie",
+          origin: "http://b",
+          data: "added",
+          capability: Ci.nsIPermissionManager.ALLOW_ACTION,
+        },
+      ];
+    }
+  );
+});
+
+add_task(async function testPrivateBrowsingSessionPermissionsAreHidden() {
+  await runTest(
+    async (params, observeAllPromise, apply) => {
+      assertListContents(params, []);
+
+      let uri = Services.io.newURI("http://test.com");
+      let privateBrowsingPrincipal =
+        Services.scriptSecurityManager.createContentPrincipal(uri, {
+          privateBrowsingId: 1,
+        });
+
+      // Add a session permission for private browsing.
+      PermissionTestUtils.add(
+        privateBrowsingPrincipal,
+        "cookie",
+        Services.perms.ALLOW_ACTION,
+        Services.perms.EXPIRE_SESSION
+      );
+
+      assertListContents(params, []);
+
+      PermissionTestUtils.remove(uri, "cookie");
+    },
+    params => {
+      return [];
+    }
+  );
+});
+
+function assertListContents(params, expected) {
+  Assert.equal(params.richlistbox.itemCount, expected.length);
+
+  for (let i = 0; i < expected.length; i++) {
+    let website = expected[i][0];
+    let elements = params.richlistbox.getElementsByAttribute("origin", website);
+    Assert.equal(elements.length, 1); // "It should find only one coincidence"
+    Assert.equal(
+      elements[0]
+        .querySelector(".website-capability-value")
+        .getAttribute("data-l10n-id"),
+      expected[i][1]
+    );
+  }
+}
+
+async function runTest(test, getObservances) {
+  registerCleanupFunction(function () {
+    Services.prefs.clearUserPref("privacy.history.custom");
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("panePrivacy", {
+    leaveOpen: true,
+  });
+
+  let doc = gBrowser.contentDocument;
+  let historyMode = doc.getElementById("historyMode");
+  historyMode.value = "custom";
+  historyMode.doCommand();
+
+  let promiseSubDialogLoaded = promiseLoadSubDialog(
+    "chrome://browser/content/preferences/dialogs/permissions.xhtml"
+  );
+  doc.getElementById("cookieExceptions").doCommand();
+
+  let win = await promiseSubDialogLoaded;
+
+  doc = win.document;
+  let params = {
+    doc,
+    richlistbox: doc.getElementById("permissionsBox"),
+    url: doc.getElementById("url"),
+    btnAllow: doc.getElementById("btnAllow"),
+    btnBlock: doc.getElementById("btnBlock"),
+    btnRemove: doc.getElementById("removePermission"),
+    allowL10nId: win.gPermissionManager._getCapabilityL10nId(
+      Ci.nsIPermissionManager.ALLOW_ACTION
+    ),
+    denyL10nId: win.gPermissionManager._getCapabilityL10nId(
+      Ci.nsIPermissionManager.DENY_ACTION
+    ),
+    allow: Ci.nsIPermissionManager.ALLOW_ACTION,
+    deny: Ci.nsIPermissionManager.DENY_ACTION,
+  };
+  let btnApplyChanges = doc.querySelector("dialog").getButton("accept");
+  let observances = getObservances(params);
+  let observeAllPromise = createObserveAllPromise(observances);
+
+  await test(params, observeAllPromise, () => btnApplyChanges.doCommand());
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+}
diff --git a/browser/components/preferences/tests/browser_defaultbrowser_alwayscheck.js b/browser/components/preferences/tests/browser_defaultbrowser_alwayscheck.js
new file mode 100644
index 0000000000..415217db78
--- /dev/null
+++ b/browser/components/preferences/tests/browser_defaultbrowser_alwayscheck.js
@@ -0,0 +1,185 @@
+"use strict";
+
+const CHECK_DEFAULT_INITIAL = Services.prefs.getBoolPref(
+  "browser.shell.checkDefaultBrowser"
+);
+
+add_task(async function clicking_make_default_checks_alwaysCheck_checkbox() {
+  await BrowserTestUtils.openNewForegroundTab(gBrowser, "about:preferences");
+
+  await test_with_mock_shellservice({ isDefault: false }, async function () {
+    let checkDefaultBrowserState = isDefault => {
+      let isDefaultPane = content.document.getElementById("isDefaultPane");
+      let isNotDefaultPane =
+        content.document.getElementById("isNotDefaultPane");
+      Assert.equal(
+        ContentTaskUtils.isHidden(isDefaultPane),
+        !isDefault,
+        "The 'browser is default' pane should be hidden when browser is not default"
+      );
+      Assert.equal(
+        ContentTaskUtils.isHidden(isNotDefaultPane),
+        isDefault,
+        "The 'make default' pane should be hidden when browser is default"
+      );
+    };
+
+    checkDefaultBrowserState(false);
+
+    let alwaysCheck = content.document.getElementById("alwaysCheckDefault");
+    Assert.ok(!alwaysCheck.checked, "Always Check is unchecked by default");
+    Assert.ok(
+      !Services.prefs.getBoolPref("browser.shell.checkDefaultBrowser"),
+      "alwaysCheck pref should be false by default in test runs"
+    );
+
+    let setDefaultButton = content.document.getElementById("setDefaultButton");
+    setDefaultButton.click();
+    content.window.gMainPane.updateSetDefaultBrowser();
+
+    await ContentTaskUtils.waitForCondition(
+      () => alwaysCheck.checked,
+      "'Always Check' checkbox should get checked after clicking the 'Set Default' button"
+    );
+
+    Assert.ok(
+      alwaysCheck.checked,
+      "Clicking 'Make Default' checks the 'Always Check' checkbox"
+    );
+    Assert.ok(
+      Services.prefs.getBoolPref("browser.shell.checkDefaultBrowser"),
+      "Checking the checkbox should set the pref to true"
+    );
+    Assert.ok(
+      alwaysCheck.disabled,
+      "'Always Check' checkbox is locked with default browser and alwaysCheck=true"
+    );
+    checkDefaultBrowserState(true);
+    Assert.ok(
+      Services.prefs.getBoolPref("browser.shell.checkDefaultBrowser"),
+      "checkDefaultBrowser pref is now enabled"
+    );
+  });
+
+  gBrowser.removeCurrentTab();
+  Services.prefs.clearUserPref("browser.shell.checkDefaultBrowser");
+});
+
+add_task(async function clicking_make_default_checks_alwaysCheck_checkbox() {
+  Services.prefs.lockPref("browser.shell.checkDefaultBrowser");
+  await BrowserTestUtils.openNewForegroundTab(gBrowser, "about:preferences");
+
+  await test_with_mock_shellservice({ isDefault: false }, async function () {
+    let isDefaultPane = content.document.getElementById("isDefaultPane");
+    let isNotDefaultPane = content.document.getElementById("isNotDefaultPane");
+    Assert.ok(
+      ContentTaskUtils.isHidden(isDefaultPane),
+      "The 'browser is default' pane should be hidden when not default"
+    );
+    Assert.ok(
+      ContentTaskUtils.isVisible(isNotDefaultPane),
+      "The 'make default' pane should be visible when not default"
+    );
+
+    let alwaysCheck = content.document.getElementById("alwaysCheckDefault");
+    Assert.ok(alwaysCheck.disabled, "Always Check is disabled when locked");
+    Assert.ok(
+      alwaysCheck.checked,
+      "Always Check is checked because defaultPref is true and pref is locked"
+    );
+    Assert.ok(
+      Services.prefs.getBoolPref("browser.shell.checkDefaultBrowser"),
+      "alwaysCheck pref should ship with 'true' by default"
+    );
+
+    let setDefaultButton = content.document.getElementById("setDefaultButton");
+    setDefaultButton.click();
+    content.window.gMainPane.updateSetDefaultBrowser();
+
+    await ContentTaskUtils.waitForCondition(
+      () => ContentTaskUtils.isVisible(isDefaultPane),
+      "Browser is now default"
+    );
+
+    Assert.ok(
+      alwaysCheck.checked,
+      "'Always Check' is still checked because it's locked"
+    );
+    Assert.ok(
+      alwaysCheck.disabled,
+      "'Always Check is disabled because it's locked"
+    );
+    Assert.ok(
+      Services.prefs.getBoolPref("browser.shell.checkDefaultBrowser"),
+      "The pref is locked and so doesn't get changed"
+    );
+  });
+
+  Services.prefs.unlockPref("browser.shell.checkDefaultBrowser");
+  gBrowser.removeCurrentTab();
+});
+
+add_task(async function make_default_disabled_until_prefs_are_loaded() {
+  // Testcase with Firefox not set as the default browser
+  await BrowserTestUtils.openNewForegroundTab(gBrowser, "about:preferences");
+  await test_with_mock_shellservice({ isDefault: false }, async function () {
+    let alwaysCheck = content.document.getElementById("alwaysCheckDefault");
+    Assert.ok(
+      !alwaysCheck.disabled,
+      "'Always Check' is enabled after default browser updated"
+    );
+  });
+  gBrowser.removeCurrentTab();
+
+  // Testcase with Firefox set as the default browser
+  await BrowserTestUtils.openNewForegroundTab(gBrowser, "about:preferences");
+  await test_with_mock_shellservice({ isDefault: true }, async function () {
+    let alwaysCheck = content.document.getElementById("alwaysCheckDefault");
+    Assert.ok(
+      alwaysCheck.disabled,
+      "'Always Check' is still disabled after default browser updated"
+    );
+  });
+  gBrowser.removeCurrentTab();
+});
+
+registerCleanupFunction(function () {
+  Services.prefs.unlockPref("browser.shell.checkDefaultBrowser");
+  Services.prefs.setBoolPref(
+    "browser.shell.checkDefaultBrowser",
+    CHECK_DEFAULT_INITIAL
+  );
+});
+
+async function test_with_mock_shellservice(options, testFn) {
+  await SpecialPowers.spawn(
+    gBrowser.selectedBrowser,
+    [options],
+    async function (contentOptions) {
+      let doc = content.document;
+      let win = doc.defaultView;
+      win.oldShellService = win.getShellService();
+      let mockShellService = {
+        _isDefault: false,
+        isDefaultBrowser() {
+          return this._isDefault;
+        },
+        async setDefaultBrowser() {
+          this._isDefault = true;
+        },
+      };
+      win.getShellService = function () {
+        return mockShellService;
+      };
+      mockShellService._isDefault = contentOptions.isDefault;
+      win.gMainPane.updateSetDefaultBrowser();
+    }
+  );
+
+  await SpecialPowers.spawn(gBrowser.selectedBrowser, [], testFn);
+
+  Services.prefs.setBoolPref(
+    "browser.shell.checkDefaultBrowser",
+    CHECK_DEFAULT_INITIAL
+  );
+}
diff --git a/browser/components/preferences/tests/browser_engines.js b/browser/components/preferences/tests/browser_engines.js
new file mode 100644
index 0000000000..aa681e7039
--- /dev/null
+++ b/browser/components/preferences/tests/browser_engines.js
@@ -0,0 +1,141 @@
+const { SearchTestUtils } = ChromeUtils.importESModule(
+  "resource://testing-common/SearchTestUtils.sys.mjs"
+);
+
+SearchTestUtils.init(this);
+
+function getCellText(tree, i, cellName) {
+  return tree.view.getCellText(i, tree.columns.getNamedColumn(cellName));
+}
+
+add_setup(async function () {
+  await SearchTestUtils.installSearchExtension({
+    keyword: ["testing", "customkeyword"],
+    search_url: "https://example.com/engine1",
+    search_url_get_params: "search={searchTerms}",
+  });
+});
+
+add_task(async function test_engine_list() {
+  let prefs = await openPreferencesViaOpenPreferencesAPI("search", {
+    leaveOpen: true,
+  });
+  is(prefs.selectedPane, "paneSearch", "Search pane is selected by default");
+  let doc = gBrowser.contentDocument;
+
+  let tree = doc.querySelector("#engineList");
+  ok(
+    !tree.hidden,
+    "The search engine list should be visible when Search is requested"
+  );
+
+  // Check for default search engines to be displayed in the engineList
+  let defaultEngines = await Services.search.getAppProvidedEngines();
+  for (let i = 0; i < defaultEngines.length; i++) {
+    let engine = defaultEngines[i];
+    is(
+      getCellText(tree, i, "engineName"),
+      engine.name,
+      "Default search engine " + engine.name + " displayed correctly"
+    );
+  }
+
+  let customEngineIndex = defaultEngines.length;
+  is(
+    getCellText(tree, customEngineIndex, "engineKeyword"),
+    "testing, customkeyword",
+    "Show internal aliases"
+  );
+
+  // Scroll the treeview into view since mouse operations
+  // off screen can act confusingly.
+  tree.scrollIntoView();
+  let rect = tree.getCoordsForCellItem(
+    customEngineIndex,
+    tree.columns.getNamedColumn("engineKeyword"),
+    "text"
+  );
+  let x = rect.x + rect.width / 2;
+  let y = rect.y + rect.height / 2;
+  let win = tree.ownerGlobal;
+
+  let promise = BrowserTestUtils.waitForEvent(tree, "dblclick");
+  EventUtils.synthesizeMouse(tree.body, x, y, { clickCount: 1 }, win);
+  EventUtils.synthesizeMouse(tree.body, x, y, { clickCount: 2 }, win);
+  await promise;
+
+  EventUtils.sendString("newkeyword");
+  EventUtils.sendKey("RETURN");
+
+  await TestUtils.waitForCondition(() => {
+    return (
+      getCellText(tree, customEngineIndex, "engineKeyword") ===
+      "newkeyword, testing, customkeyword"
+    );
+  });
+
+  // Avoid duplicated keywords
+  tree.view.setCellText(
+    0,
+    tree.columns.getNamedColumn("engineKeyword"),
+    "keyword"
+  );
+  tree.view.setCellText(
+    1,
+    tree.columns.getNamedColumn("engineKeyword"),
+    "keyword"
+  );
+  isnot(
+    getCellText(tree, 1, "engineKeyword"),
+    "keyword",
+    "Do not allow duplicated keywords"
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function test_remove_button_disabled_state() {
+  let prefs = await openPreferencesViaOpenPreferencesAPI("search", {
+    leaveOpen: true,
+  });
+  is(prefs.selectedPane, "paneSearch", "Search pane is selected by default");
+  let doc = gBrowser.contentDocument;
+
+  let tree = doc.querySelector("#engineList");
+  ok(
+    !tree.hidden,
+    "The search engine list should be visible when Search is requested"
+  );
+
+  let defaultEngines = await Services.search.getAppProvidedEngines();
+  for (let i = 0; i < defaultEngines.length; i++) {
+    let engine = defaultEngines[i];
+
+    let isDefaultSearchEngine =
+      engine.name == Services.search.defaultEngine.name ||
+      engine.name == Services.search.defaultPrivateEngine.name;
+
+    tree.scrollIntoView();
+    let rect = tree.getCoordsForCellItem(
+      i,
+      tree.columns.getNamedColumn("engineName"),
+      "text"
+    );
+    let x = rect.x + rect.width / 2;
+    let y = rect.y + rect.height / 2;
+    let win = tree.ownerGlobal;
+
+    let promise = BrowserTestUtils.waitForEvent(tree, "click");
+    EventUtils.synthesizeMouse(tree.body, x, y, { clickCount: 1 }, win);
+    await promise;
+
+    let removeButton = doc.querySelector("#removeEngineButton");
+    is(
+      removeButton.disabled,
+      isDefaultSearchEngine,
+      "Remove button is in correct disable state"
+    );
+  }
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_ensure_prefs_bindings_initted.js b/browser/components/preferences/tests/browser_ensure_prefs_bindings_initted.js
new file mode 100644
index 0000000000..e193181200
--- /dev/null
+++ b/browser/components/preferences/tests/browser_ensure_prefs_bindings_initted.js
@@ -0,0 +1,40 @@
+/* Any copyright is dedicated to the Public Domain.
+   http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+/*
+ * Check that panes that aren't the default have their bindings initialized
+ * and 'preference' attributes are processed correctly.
+ */
+add_task(async function test_prefs_bindings_initted() {
+  await openPreferencesViaOpenPreferencesAPI("general", { leaveOpen: true });
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let prefReader = doc.ownerGlobal.Preferences;
+  let prefBasedCheckboxes = Array.from(
+    doc.querySelectorAll("checkbox[preference]")
+  );
+
+  // Then check all the preferences:
+  for (let checkbox of prefBasedCheckboxes) {
+    let pref = checkbox.getAttribute("preference");
+    if (Services.prefs.getPrefType(pref) == Services.prefs.PREF_BOOL) {
+      info(`Waiting for checkbox to match pref ${pref}`);
+      // Ensure the task setting up prefs has run.
+      await BrowserTestUtils.waitForMutationCondition(
+        checkbox,
+        { attributeFilter: ["checked"] },
+        () => checkbox.checked == prefReader.get(pref).value
+      );
+      is(
+        checkbox.checked,
+        prefReader.get(pref).value,
+        `Checkbox value should match preference (${pref}).`
+      );
+      // Ignore all other types. The mapping is normally non-trivial and done
+      // using syncfrompreference handlers in JS.
+    }
+  }
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_etp_exceptions_dialog.js b/browser/components/preferences/tests/browser_etp_exceptions_dialog.js
new file mode 100644
index 0000000000..349223995c
--- /dev/null
+++ b/browser/components/preferences/tests/browser_etp_exceptions_dialog.js
@@ -0,0 +1,96 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+const PERMISSIONS_URL =
+  "chrome://browser/content/preferences/dialogs/permissions.xhtml";
+
+const TRACKING_URL = "https://example.com";
+
+async function openETPExceptionsDialog(doc) {
+  let exceptionsButton = doc.getElementById("trackingProtectionExceptions");
+  ok(exceptionsButton, "trackingProtectionExceptions button found");
+  let dialogPromise = promiseLoadSubDialog(PERMISSIONS_URL);
+  exceptionsButton.click();
+  let dialog = await dialogPromise;
+  return dialog;
+}
+
+async function addETPPermission(doc) {
+  let dialog = await openETPExceptionsDialog(doc);
+  let url = dialog.document.getElementById("url");
+  let buttonDisableETP = dialog.document.getElementById("btnDisableETP");
+  let permissionsBox = dialog.document.getElementById("permissionsBox");
+  let currentPermissions = permissionsBox.itemCount;
+
+  url.value = TRACKING_URL;
+  url.dispatchEvent(new Event("input", { bubbles: true }));
+  is(
+    buttonDisableETP.hasAttribute("disabled"),
+    false,
+    "Disable ETP button is selectable after url is entered"
+  );
+  buttonDisableETP.click();
+
+  // Website is listed
+  is(
+    permissionsBox.itemCount,
+    currentPermissions + 1,
+    "Website added in url should be in the list"
+  );
+  let saveButton = dialog.document.querySelector("dialog").getButton("accept");
+  saveButton.click();
+  BrowserTestUtils.waitForEvent(dialog, "unload");
+}
+
+async function removeETPPermission(doc) {
+  let dialog = await openETPExceptionsDialog(doc);
+  let permissionsBox = dialog.document.getElementById("permissionsBox");
+  let elements = permissionsBox.getElementsByAttribute("origin", TRACKING_URL);
+  // Website is listed
+  ok(permissionsBox.itemCount, "List is not empty");
+  permissionsBox.selectItem(elements[0]);
+  let removePermissionButton =
+    dialog.document.getElementById("removePermission");
+  is(
+    removePermissionButton.hasAttribute("disabled"),
+    false,
+    "The button should be clickable to remove selected item"
+  );
+  removePermissionButton.click();
+
+  let saveButton = dialog.document.querySelector("dialog").getButton("accept");
+  saveButton.click();
+  BrowserTestUtils.waitForEvent(dialog, "unload");
+}
+
+async function checkShieldIcon(shieldIcon) {
+  // Open the website and check that the tracking protection icon is enabled/disabled
+  let tab = await BrowserTestUtils.openNewForegroundTab(gBrowser, TRACKING_URL);
+  let icon = document.getElementById("tracking-protection-icon");
+  is(
+    gBrowser.ownerGlobal
+      .getComputedStyle(icon)
+      .getPropertyValue("list-style-image"),
+    shieldIcon,
+    `The tracking protection icon shows the icon ${shieldIcon}`
+  );
+  BrowserTestUtils.removeTab(tab);
+}
+
+// test adds and removes an ETP permission via the about:preferences#privacy and checks if the ProtectionsUI shield icon resembles the state
+add_task(async function ETPPermissionSyncedFromPrivacyPane() {
+  await openPreferencesViaOpenPreferencesAPI("panePrivacy", {
+    leaveOpen: true,
+  });
+  let win = gBrowser.selectedBrowser.contentWindow;
+  let doc = win.document;
+  await addETPPermission(doc);
+  await checkShieldIcon(
+    `url("chrome://browser/skin/tracking-protection-disabled.svg")`
+  );
+  await removeETPPermission(doc);
+  await checkShieldIcon(`url("chrome://browser/skin/tracking-protection.svg")`);
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_experimental_features.js b/browser/components/preferences/tests/browser_experimental_features.js
new file mode 100644
index 0000000000..cecbb60893
--- /dev/null
+++ b/browser/components/preferences/tests/browser_experimental_features.js
@@ -0,0 +1,74 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+add_task(async function testPrefRequired() {
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.preferences.experimental", false]],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("paneHome", { leaveOpen: true });
+  let doc = gBrowser.contentDocument;
+
+  let experimentalCategory = doc.getElementById("category-experimental");
+  ok(experimentalCategory, "The category exists");
+  ok(experimentalCategory.hidden, "The category is hidden");
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function testCanOpenWithPref() {
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.preferences.experimental", true]],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("paneHome", { leaveOpen: true });
+  let doc = gBrowser.contentDocument;
+
+  let experimentalCategory = doc.getElementById("category-experimental");
+  ok(experimentalCategory, "The category exists");
+  ok(!experimentalCategory.hidden, "The category is not hidden");
+
+  let categoryHeader = await TestUtils.waitForCondition(
+    () => doc.getElementById("firefoxExperimentalCategory"),
+    "Waiting for experimental features category to get initialized"
+  );
+  ok(
+    categoryHeader.hidden,
+    "The category header should be hidden when Home is selected"
+  );
+
+  EventUtils.synthesizeMouseAtCenter(experimentalCategory, {}, doc.ownerGlobal);
+  await TestUtils.waitForCondition(
+    () => !categoryHeader.hidden,
+    "Waiting until category is visible"
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function testSearchFindsExperiments() {
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.preferences.experimental", true]],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("paneHome", { leaveOpen: true });
+  let doc = gBrowser.contentDocument;
+
+  let experimentalCategory = doc.getElementById("category-experimental");
+  ok(experimentalCategory, "The category exists");
+  ok(!experimentalCategory.hidden, "The category is not hidden");
+
+  await TestUtils.waitForCondition(
+    () => doc.getElementById("firefoxExperimentalCategory"),
+    "Waiting for experimental features category to get initialized"
+  );
+  await evaluateSearchResults(
+    "advanced configuration",
+    ["pane-experimental-featureGates"],
+    /* include experiments */ true
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_experimental_features_filter.js b/browser/components/preferences/tests/browser_experimental_features_filter.js
new file mode 100644
index 0000000000..d3ed10d1a9
--- /dev/null
+++ b/browser/components/preferences/tests/browser_experimental_features_filter.js
@@ -0,0 +1,193 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+// This test verifies that searching filters the features to just that subset that
+// contains the search terms.
+add_task(async function testFilterFeatures() {
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.preferences.experimental", true]],
+  });
+
+  // Add a number of test features.
+  const server = new DefinitionServer();
+  let definitions = [
+    {
+      id: "test-featureA",
+      preference: "test.featureA",
+      title: "Experimental Feature 1",
+      description: "This is a fun experimental feature you can enable",
+      result: true,
+    },
+    {
+      id: "test-featureB",
+      preference: "test.featureB",
+      title: "Experimental Thing 2",
+      description: "This is a very boring experimental tool",
+      result: false,
+    },
+    {
+      id: "test-featureC",
+      preference: "test.featureC",
+      title: "Experimental Thing 3",
+      description: "This is a fun experimental feature for you can enable",
+      result: true,
+    },
+    {
+      id: "test-featureD",
+      preference: "test.featureD",
+      title: "Experimental Thing 4",
+      description: "This is a not a checkbox that you should be enabling",
+      result: false,
+    },
+  ];
+  for (let { id, preference } of definitions) {
+    server.addDefinition({ id, preference, isPublic: true });
+  }
+
+  await BrowserTestUtils.openNewForegroundTab(
+    gBrowser,
+    `about:preferences?definitionsUrl=${encodeURIComponent(
+      server.definitionsUrl
+    )}#paneExperimental`
+  );
+  let doc = gBrowser.contentDocument;
+
+  await TestUtils.waitForCondition(
+    () => doc.getElementById(definitions[definitions.length - 1].id),
+    "wait for the first public feature to get added to the DOM"
+  );
+
+  // Manually modify the labels of the features that were just added, so that the test
+  // can rely on consistent search terms.
+  for (let definition of definitions) {
+    let mainItem = doc.getElementById(definition.id);
+    mainItem.label = definition.title;
+    mainItem.removeAttribute("data-l10n-id");
+    let descItem = doc.getElementById(definition.id + "-description");
+    descItem.textContent = definition.description;
+    descItem.removeAttribute("data-l10n-id");
+  }
+
+  // First, check that all of the items are visible by default.
+  for (let definition of definitions) {
+    checkVisibility(
+      doc.getElementById(definition.id),
+      true,
+      `${definition.id} should be initially visible`
+    );
+  }
+
+  // After searching, only a subset should be visible.
+  await enterSearch(doc, "feature");
+
+  for (let definition of definitions) {
+    checkVisibility(
+      doc.getElementById(definition.id),
+      definition.result,
+      `${definition.id} should be ${
+        definition.result ? "visible" : "hidden"
+      } after first search`
+    );
+    info("Text for item was: " + doc.getElementById(definition.id).textContent);
+  }
+
+  // Further restrict the search to only a single item.
+  await enterSearch(doc, " you");
+
+  let shouldBeVisible = true;
+  for (let definition of definitions) {
+    checkVisibility(
+      doc.getElementById(definition.id),
+      shouldBeVisible,
+      `${definition.id} should be ${
+        shouldBeVisible ? "visible" : "hidden"
+      } after further search`
+    );
+    shouldBeVisible = false;
+  }
+
+  // Reset the search entirely.
+  let searchInput = doc.getElementById("searchInput");
+  searchInput.value = "";
+  searchInput.doCommand();
+
+  // Clearing the search will go to the general pane so switch back to the experimental pane.
+  EventUtils.synthesizeMouseAtCenter(
+    doc.getElementById("category-experimental"),
+    {},
+    gBrowser.contentWindow
+  );
+
+  for (let definition of definitions) {
+    checkVisibility(
+      doc.getElementById(definition.id),
+      true,
+      `${definition.id} should be visible after search cleared`
+    );
+  }
+
+  // Simulate entering a search and then clicking one of the category labels. The search
+  // should reset each time.
+  for (let category of ["category-search", "category-experimental"]) {
+    await enterSearch(doc, "feature");
+
+    for (let definition of definitions) {
+      checkVisibility(
+        doc.getElementById(definition.id),
+        definition.result,
+        `${definition.id} should be ${
+          definition.result ? "visible" : "hidden"
+        } after next search`
+      );
+    }
+
+    // Check that switching to a non-find-in-page category changes item
+    // visibility appropriately.
+    EventUtils.synthesizeMouseAtCenter(
+      doc.getElementById(category),
+      {},
+      gBrowser.contentWindow
+    );
+
+    // Ensure that async passes of localization and any code waiting for
+    // those passes have finished running.
+    await new Promise(r =>
+      requestAnimationFrame(() => requestAnimationFrame(r))
+    );
+    let shouldShow = category == "category-experimental";
+    for (let definition of definitions) {
+      checkVisibility(
+        doc.getElementById(definition.id),
+        shouldShow,
+        `${definition.id} should be ${
+          shouldShow ? "visible" : "hidden"
+        } after category change to ${category}`
+      );
+    }
+  }
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+function checkVisibility(element, expected, desc) {
+  return expected
+    ? is_element_visible(element, desc)
+    : is_element_hidden(element, desc);
+}
+
+function enterSearch(doc, query) {
+  let searchInput = doc.getElementById("searchInput");
+  searchInput.focus();
+
+  let searchCompletedPromise = BrowserTestUtils.waitForEvent(
+    gBrowser.contentWindow,
+    "PreferencesSearchCompleted",
+    evt => evt.detail == query
+  );
+
+  EventUtils.sendString(query);
+
+  return searchCompletedPromise;
+}
diff --git a/browser/components/preferences/tests/browser_experimental_features_hidden_when_not_public.js b/browser/components/preferences/tests/browser_experimental_features_hidden_when_not_public.js
new file mode 100644
index 0000000000..e1e2adced9
--- /dev/null
+++ b/browser/components/preferences/tests/browser_experimental_features_hidden_when_not_public.js
@@ -0,0 +1,86 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+add_task(async function testNonPublicFeaturesShouldntGetDisplayed() {
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.preferences.experimental", true]],
+  });
+
+  const server = new DefinitionServer();
+  let definitions = [
+    { id: "test-featureA", isPublic: true, preference: "test.feature.a" },
+    { id: "test-featureB", isPublic: false, preference: "test.feature.b" },
+    { id: "test-featureC", isPublic: true, preference: "test.feature.c" },
+  ];
+  for (let { id, isPublic, preference } of definitions) {
+    server.addDefinition({ id, isPublic, preference });
+  }
+  await BrowserTestUtils.openNewForegroundTab(
+    gBrowser,
+    `about:preferences?definitionsUrl=${encodeURIComponent(
+      server.definitionsUrl
+    )}#paneExperimental`
+  );
+  let doc = gBrowser.contentDocument;
+
+  await TestUtils.waitForCondition(
+    () => doc.getElementById(definitions.find(d => d.isPublic).id),
+    "wait for the first public feature to get added to the DOM"
+  );
+
+  for (let definition of definitions) {
+    is(
+      !!doc.getElementById(definition.id),
+      definition.isPublic,
+      "feature should only be in DOM if it's public: " + definition.id
+    );
+  }
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function testNonPublicFeaturesShouldntGetDisplayed() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.preferences.experimental", true],
+      ["browser.preferences.experimental.hidden", false],
+    ],
+  });
+
+  const server = new DefinitionServer();
+  server.addDefinition({
+    id: "test-hidden",
+    isPublic: false,
+    preference: "test.feature.hidden",
+  });
+  await BrowserTestUtils.openNewForegroundTab(
+    gBrowser,
+    `about:preferences?definitionsUrl=${encodeURIComponent(
+      server.definitionsUrl
+    )}#paneExperimental`
+  );
+  let doc = gBrowser.contentDocument;
+
+  await TestUtils.waitForCondition(
+    () => doc.getElementById("category-experimental").hidden,
+    "Wait for Experimental Features section to get hidden"
+  );
+
+  ok(
+    doc.getElementById("category-experimental").hidden,
+    "Experimental Features section should be hidden when all features are hidden"
+  );
+  ok(
+    !doc.getElementById("firefoxExperimentalCategory"),
+    "Experimental Features header should not exist when all features are hidden"
+  );
+  is(
+    doc.querySelector(".category[selected]").id,
+    "category-general",
+    "When the experimental features section is hidden, navigating to #experimental should redirect to #general"
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_experimental_features_resetall.js b/browser/components/preferences/tests/browser_experimental_features_resetall.js
new file mode 100644
index 0000000000..5f19ba5a0c
--- /dev/null
+++ b/browser/components/preferences/tests/browser_experimental_features_resetall.js
@@ -0,0 +1,112 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+// It doesn't matter what two preferences are used here, as long as the first is a built-in
+// one that defaults to false and the second defaults to true.
+const KNOWN_PREF_1 = "browser.display.use_system_colors";
+const KNOWN_PREF_2 = "browser.autofocus";
+
+// This test verifies that pressing the reset all button for experimental features
+// resets all of the checkboxes to their default state.
+add_task(async function testResetAll() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.preferences.experimental", true],
+      ["test.featureA", false],
+      ["test.featureB", true],
+      [KNOWN_PREF_1, false],
+      [KNOWN_PREF_2, true],
+    ],
+  });
+
+  // Add a number of test features.
+  const server = new DefinitionServer();
+  let definitions = [
+    {
+      id: "test-featureA",
+      preference: "test.featureA",
+      defaultValue: false,
+    },
+    {
+      id: "test-featureB",
+      preference: "test.featureB",
+      defaultValue: true,
+    },
+    {
+      id: "test-featureC",
+      preference: KNOWN_PREF_1,
+      defaultValue: false,
+    },
+    {
+      id: "test-featureD",
+      preference: KNOWN_PREF_2,
+      defaultValue: true,
+    },
+  ];
+  for (let { id, preference, defaultValue } of definitions) {
+    server.addDefinition({ id, preference, defaultValue, isPublic: true });
+  }
+
+  await BrowserTestUtils.openNewForegroundTab(
+    gBrowser,
+    `about:preferences?definitionsUrl=${encodeURIComponent(
+      server.definitionsUrl
+    )}#paneExperimental`
+  );
+  let doc = gBrowser.contentDocument;
+
+  await TestUtils.waitForCondition(
+    () => doc.getElementById(definitions[definitions.length - 1].id),
+    "wait for the first public feature to get added to the DOM"
+  );
+
+  // Check the initial state of each feature.
+  ok(!Services.prefs.getBoolPref("test.featureA"), "initial state A");
+  ok(Services.prefs.getBoolPref("test.featureB"), "initial state B");
+  ok(!Services.prefs.getBoolPref(KNOWN_PREF_1), "initial state C");
+  ok(Services.prefs.getBoolPref(KNOWN_PREF_2), "initial state D");
+
+  // Modify the state of some of the features.
+  doc.getElementById("test-featureC").click();
+  doc.getElementById("test-featureD").click();
+  ok(!Services.prefs.getBoolPref("test.featureA"), "modified state A");
+  ok(Services.prefs.getBoolPref("test.featureB"), "modified state B");
+  ok(Services.prefs.getBoolPref(KNOWN_PREF_1), "modified state C");
+  ok(!Services.prefs.getBoolPref(KNOWN_PREF_2), "modified state D");
+
+  // State after reset.
+  let prefChangedPromise = new Promise(resolve => {
+    Services.prefs.addObserver(KNOWN_PREF_2, function observer() {
+      Services.prefs.removeObserver(KNOWN_PREF_2, observer);
+      resolve();
+    });
+  });
+  doc.getElementById("experimentalCategory-reset").click();
+  await prefChangedPromise;
+
+  // The preferences will be reset to the default value for the feature.
+  ok(!Services.prefs.getBoolPref("test.featureA"), "after reset state A");
+  ok(Services.prefs.getBoolPref("test.featureB"), "after reset state B");
+  ok(!Services.prefs.getBoolPref(KNOWN_PREF_1), "after reset state C");
+  ok(Services.prefs.getBoolPref(KNOWN_PREF_2), "after reset state D");
+  ok(
+    !doc.getElementById("test-featureA").checked,
+    "after reset checkbox state A"
+  );
+  ok(
+    doc.getElementById("test-featureB").checked,
+    "after reset checkbox state B"
+  );
+  ok(
+    !doc.getElementById("test-featureC").checked,
+    "after reset checkbox state C"
+  );
+  ok(
+    doc.getElementById("test-featureD").checked,
+    "after reset checkbox state D"
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_extension_controlled.js b/browser/components/preferences/tests/browser_extension_controlled.js
new file mode 100644
index 0000000000..d187af5b7d
--- /dev/null
+++ b/browser/components/preferences/tests/browser_extension_controlled.js
@@ -0,0 +1,1443 @@
+/* eslint-env webextensions */
+
+const PROXY_PREF = "network.proxy.type";
+const HOMEPAGE_URL_PREF = "browser.startup.homepage";
+const HOMEPAGE_OVERRIDE_KEY = "homepage_override";
+const URL_OVERRIDES_TYPE = "url_overrides";
+const NEW_TAB_KEY = "newTabURL";
+const PREF_SETTING_TYPE = "prefs";
+
+ChromeUtils.defineESModuleGetters(this, {
+  AboutNewTab: "resource:///modules/AboutNewTab.sys.mjs",
+  ExtensionSettingsStore:
+    "resource://gre/modules/ExtensionSettingsStore.sys.mjs",
+});
+
+XPCOMUtils.defineLazyPreferenceGetter(this, "proxyType", PROXY_PREF);
+
+const { AddonTestUtils } = ChromeUtils.importESModule(
+  "resource://testing-common/AddonTestUtils.sys.mjs"
+);
+AddonTestUtils.initMochitest(this);
+
+const { ExtensionPreferencesManager } = ChromeUtils.importESModule(
+  "resource://gre/modules/ExtensionPreferencesManager.sys.mjs"
+);
+
+const TEST_DIR = gTestPath.substr(0, gTestPath.lastIndexOf("/"));
+const CHROME_URL_ROOT = TEST_DIR + "/";
+const PERMISSIONS_URL =
+  "chrome://browser/content/preferences/dialogs/sitePermissions.xhtml";
+let sitePermissionsDialog;
+
+function getSupportsFile(path) {
+  let cr = Cc["@mozilla.org/chrome/chrome-registry;1"].getService(
+    Ci.nsIChromeRegistry
+  );
+  let uri = Services.io.newURI(CHROME_URL_ROOT + path);
+  let fileurl = cr.convertChromeURL(uri);
+  return fileurl.QueryInterface(Ci.nsIFileURL);
+}
+
+function waitForMessageChange(
+  element,
+  cb,
+  opts = { attributes: true, attributeFilter: ["hidden"] }
+) {
+  return waitForMutation(element, opts, cb);
+}
+
+function getElement(id, doc = gBrowser.contentDocument) {
+  return doc.getElementById(id);
+}
+
+function waitForMessageHidden(messageId, doc) {
+  return waitForMessageChange(
+    getElement(messageId, doc),
+    target => target.hidden
+  );
+}
+
+function waitForMessageShown(messageId, doc) {
+  return waitForMessageChange(
+    getElement(messageId, doc),
+    target => !target.hidden
+  );
+}
+
+function waitForEnableMessage(messageId, doc) {
+  return waitForMessageChange(
+    getElement(messageId, doc),
+    target => target.classList.contains("extension-controlled-disabled"),
+    { attributeFilter: ["class"], attributes: true }
+  );
+}
+
+function waitForMessageContent(messageId, l10nId, doc) {
+  return waitForMessageChange(
+    getElement(messageId, doc),
+    target => doc.l10n.getAttributes(target).id === l10nId,
+    { childList: true }
+  );
+}
+
+async function openNotificationsPermissionDialog() {
+  let dialogOpened = promiseLoadSubDialog(PERMISSIONS_URL);
+
+  await SpecialPowers.spawn(gBrowser.selectedBrowser, [], function () {
+    let doc = content.document;
+    let settingsButton = doc.getElementById("notificationSettingsButton");
+    settingsButton.click();
+  });
+
+  sitePermissionsDialog = await dialogOpened;
+  await sitePermissionsDialog.document.mozSubdialogReady;
+}
+
+async function disableExtensionViaClick(labelId, disableButtonId, doc) {
+  let controlledLabel = doc.getElementById(labelId);
+
+  let enableMessageShown = waitForEnableMessage(labelId, doc);
+  doc.getElementById(disableButtonId).click();
+  await enableMessageShown;
+
+  let controlledDescription = controlledLabel.querySelector("description");
+  is(
+    doc.l10n.getAttributes(controlledDescription.querySelector("label")).id,
+    "extension-controlled-enable",
+    "The user is notified of how to enable the extension again."
+  );
+
+  // The user can dismiss the enable instructions.
+  let hidden = waitForMessageHidden(labelId, doc);
+  controlledLabel.querySelector("image:last-of-type").click();
+  await hidden;
+}
+
+async function reEnableExtension(addon, labelId) {
+  let controlledMessageShown = waitForMessageShown(labelId);
+  await addon.enable();
+  await controlledMessageShown;
+}
+
+add_task(async function testExtensionControlledHomepage() {
+  const ADDON_ID = "@set_homepage";
+  const SECOND_ADDON_ID = "@second_set_homepage";
+
+  await openPreferencesViaOpenPreferencesAPI("paneHome", { leaveOpen: true });
+  let homepagePref = () => Services.prefs.getCharPref(HOMEPAGE_URL_PREF);
+  let originalHomepagePref = homepagePref();
+  is(
+    gBrowser.currentURI.spec,
+    "about:preferences#home",
+    "#home should be in the URI for about:preferences"
+  );
+  let doc = gBrowser.contentDocument;
+  let homeModeEl = doc.getElementById("homeMode");
+  let customSettingsSection = doc.getElementById("customSettings");
+
+  is(homeModeEl.itemCount, 3, "The menu list starts with 3 options");
+
+  let promise = TestUtils.waitForCondition(
+    () => homeModeEl.itemCount === 4,
+    "wait for the addon option to be added as an option in the menu list"
+  );
+  let extension = ExtensionTestUtils.loadExtension({
+    useAddonManager: "permanent",
+    manifest: {
+      version: "1.0",
+      name: "set_homepage",
+      browser_specific_settings: {
+        gecko: {
+          id: ADDON_ID,
+        },
+      },
+      chrome_settings_overrides: { homepage: "/home.html" },
+    },
+  });
+  await extension.startup();
+  await promise;
+
+  // The homepage is set to the default and the custom settings section is hidden
+  is(homeModeEl.disabled, false, "The homepage menulist is enabled");
+  is(
+    customSettingsSection.hidden,
+    true,
+    "The custom settings element is hidden"
+  );
+
+  let addon = await AddonManager.getAddonByID(ADDON_ID);
+  is(
+    homeModeEl.value,
+    addon.id,
+    "the home select menu's value is set to the addon"
+  );
+
+  promise = TestUtils.waitForPrefChange(HOMEPAGE_URL_PREF);
+  // Set the Menu to the default value
+  homeModeEl.value = "0";
+  homeModeEl.dispatchEvent(new Event("command"));
+  await promise;
+  is(homepagePref(), originalHomepagePref, "homepage is set back to default");
+  let levelOfControl = await ExtensionPreferencesManager.getLevelOfControl(
+    addon.id,
+    HOMEPAGE_OVERRIDE_KEY,
+    PREF_SETTING_TYPE
+  );
+  is(
+    levelOfControl,
+    "not_controllable",
+    "getLevelOfControl returns not_controllable."
+  );
+  let setting = await ExtensionPreferencesManager.getSetting(
+    HOMEPAGE_OVERRIDE_KEY
+  );
+  ok(!setting.value, "the setting is not set.");
+
+  promise = TestUtils.waitForPrefChange(HOMEPAGE_URL_PREF);
+  // Set the menu to the addon value
+  homeModeEl.value = ADDON_ID;
+  homeModeEl.dispatchEvent(new Event("command"));
+  await promise;
+  ok(
+    homepagePref().startsWith("moz-extension") &&
+      homepagePref().endsWith("home.html"),
+    "Home url should be provided by the extension."
+  );
+  levelOfControl = await ExtensionPreferencesManager.getLevelOfControl(
+    addon.id,
+    HOMEPAGE_OVERRIDE_KEY,
+    PREF_SETTING_TYPE
+  );
+  is(
+    levelOfControl,
+    "controlled_by_this_extension",
+    "getLevelOfControl returns controlled_by_this_extension."
+  );
+  setting = await ExtensionPreferencesManager.getSetting(HOMEPAGE_OVERRIDE_KEY);
+  ok(
+    setting.value.startsWith("moz-extension") &&
+      setting.value.endsWith("home.html"),
+    "The setting value is the same as the extension."
+  );
+
+  // Add a second extension, ensure it is added to the menulist and selected.
+  promise = TestUtils.waitForCondition(
+    () => homeModeEl.itemCount == 5,
+    "addon option is added as an option in the menu list"
+  );
+  let secondExtension = ExtensionTestUtils.loadExtension({
+    useAddonManager: "permanent",
+    manifest: {
+      version: "1.0",
+      name: "second_set_homepage",
+      browser_specific_settings: {
+        gecko: {
+          id: SECOND_ADDON_ID,
+        },
+      },
+      chrome_settings_overrides: { homepage: "/home2.html" },
+    },
+  });
+  await secondExtension.startup();
+  await promise;
+
+  let secondAddon = await AddonManager.getAddonByID(SECOND_ADDON_ID);
+  is(homeModeEl.value, SECOND_ADDON_ID, "home menulist is set to the add-on");
+
+  levelOfControl = await ExtensionPreferencesManager.getLevelOfControl(
+    secondAddon.id,
+    HOMEPAGE_OVERRIDE_KEY,
+    PREF_SETTING_TYPE
+  );
+  is(
+    levelOfControl,
+    "controlled_by_this_extension",
+    "getLevelOfControl returns controlled_by_this_extension."
+  );
+  setting = await ExtensionPreferencesManager.getSetting(HOMEPAGE_OVERRIDE_KEY);
+  ok(
+    setting.value.startsWith("moz-extension") &&
+      setting.value.endsWith("home2.html"),
+    "The setting value is the same as the extension."
+  );
+
+  promise = TestUtils.waitForCondition(
+    () => homeModeEl.itemCount == 4,
+    "addon option is no longer an option in the menu list after disable, even if it was not selected"
+  );
+  await addon.disable();
+  await promise;
+
+  // Ensure that re-enabling an addon adds it back to the menulist
+  promise = TestUtils.waitForCondition(
+    () => homeModeEl.itemCount == 5,
+    "addon option is added again to the menulist when enabled"
+  );
+  await addon.enable();
+  await promise;
+
+  promise = TestUtils.waitForCondition(
+    () => homeModeEl.itemCount == 4,
+    "addon option is no longer an option in the menu list after disable"
+  );
+  await secondAddon.disable();
+  await promise;
+
+  promise = TestUtils.waitForCondition(
+    () => homeModeEl.itemCount == 5,
+    "addon option is added again to the menulist when enabled"
+  );
+  await secondAddon.enable();
+  await promise;
+
+  promise = TestUtils.waitForCondition(
+    () => homeModeEl.itemCount == 3,
+    "addon options are no longer an option in the menu list after disabling all addons"
+  );
+  await secondAddon.disable();
+  await addon.disable();
+  await promise;
+
+  is(homeModeEl.value, "0", "addon option is not selected in the menu list");
+
+  levelOfControl = await ExtensionPreferencesManager.getLevelOfControl(
+    secondAddon.id,
+    HOMEPAGE_OVERRIDE_KEY,
+    PREF_SETTING_TYPE
+  );
+  is(
+    levelOfControl,
+    "controllable_by_this_extension",
+    "getLevelOfControl returns controllable_by_this_extension."
+  );
+  setting = await ExtensionPreferencesManager.getSetting(HOMEPAGE_OVERRIDE_KEY);
+  ok(!setting.value, "The setting value is back to default.");
+
+  // The homepage elements are reset to their original state.
+  is(homepagePref(), originalHomepagePref, "homepage is set back to default");
+  is(homeModeEl.disabled, false, "The homepage menulist is enabled");
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  await extension.unload();
+  await secondExtension.unload();
+});
+
+add_task(async function testPrefLockedHomepage() {
+  const ADDON_ID = "@set_homepage";
+  await openPreferencesViaOpenPreferencesAPI("paneHome", { leaveOpen: true });
+  let doc = gBrowser.contentDocument;
+  is(
+    gBrowser.currentURI.spec,
+    "about:preferences#home",
+    "#home should be in the URI for about:preferences"
+  );
+
+  let homePagePref = "browser.startup.homepage";
+  let buttonPrefs = [
+    "pref.browser.homepage.disable_button.current_page",
+    "pref.browser.homepage.disable_button.bookmark_page",
+    "pref.browser.homepage.disable_button.restore_default",
+  ];
+  let homeModeEl = doc.getElementById("homeMode");
+  let homePageInput = doc.getElementById("homePageUrl");
+  let prefs = Services.prefs.getDefaultBranch(null);
+  let mutationOpts = { attributes: true, attributeFilter: ["disabled"] };
+
+  // Helper functions.
+  let getButton = pref =>
+    doc.querySelector(`.homepage-button[preference="${pref}"`);
+  let waitForAllMutations = () =>
+    Promise.all(
+      buttonPrefs
+        .map(pref => waitForMutation(getButton(pref), mutationOpts))
+        .concat([
+          waitForMutation(homeModeEl, mutationOpts),
+          waitForMutation(homePageInput, mutationOpts),
+        ])
+    );
+  let getHomepage = () =>
+    Services.prefs.getCharPref("browser.startup.homepage");
+
+  let originalHomepage = getHomepage();
+  let extensionHomepage = "https://developer.mozilla.org/";
+  let lockedHomepage = "http://www.yahoo.com";
+
+  let lockPrefs = () => {
+    buttonPrefs.forEach(pref => {
+      prefs.setBoolPref(pref, true);
+      prefs.lockPref(pref);
+    });
+    // Do the homepage last since that's the only pref that triggers a UI update.
+    prefs.setCharPref(homePagePref, lockedHomepage);
+    prefs.lockPref(homePagePref);
+  };
+  let unlockPrefs = () => {
+    buttonPrefs.forEach(pref => {
+      prefs.unlockPref(pref);
+      prefs.setBoolPref(pref, false);
+    });
+    // Do the homepage last since that's the only pref that triggers a UI update.
+    prefs.unlockPref(homePagePref);
+    prefs.setCharPref(homePagePref, originalHomepage);
+  };
+
+  // Lock or unlock prefs then wait for all mutations to finish.
+  // Expects a bool indicating if we should lock or unlock.
+  let waitForLockMutations = lock => {
+    let mutationsDone = waitForAllMutations();
+    if (lock) {
+      lockPrefs();
+    } else {
+      unlockPrefs();
+    }
+    return mutationsDone;
+  };
+
+  Assert.notEqual(
+    originalHomepage,
+    extensionHomepage,
+    "The extension will change the homepage"
+  );
+
+  // Install an extension that sets the homepage to MDN.
+  let promise = TestUtils.waitForPrefChange(HOMEPAGE_URL_PREF);
+  let extension = ExtensionTestUtils.loadExtension({
+    useAddonManager: "permanent",
+    manifest: {
+      version: "1.0",
+      name: "set_homepage",
+      browser_specific_settings: {
+        gecko: {
+          id: ADDON_ID,
+        },
+      },
+      chrome_settings_overrides: { homepage: "https://developer.mozilla.org/" },
+    },
+  });
+  await extension.startup();
+  await promise;
+
+  // Check that everything is still disabled, homepage didn't change.
+  is(
+    getHomepage(),
+    extensionHomepage,
+    "The reported homepage is set by the extension"
+  );
+  is(
+    homePageInput.value,
+    extensionHomepage,
+    "The homepage is set by the extension"
+  );
+
+  // Lock all of the prefs, wait for the UI to update.
+  await waitForLockMutations(true);
+
+  // Check that everything is now disabled.
+  is(getHomepage(), lockedHomepage, "The reported homepage is set by the pref");
+  is(homePageInput.value, lockedHomepage, "The homepage is set by the pref");
+  is(
+    homePageInput.disabled,
+    true,
+    "The homepage is disabed when the pref is locked"
+  );
+
+  buttonPrefs.forEach(pref => {
+    is(
+      getButton(pref).disabled,
+      true,
+      `The ${pref} button is disabled when locked`
+    );
+  });
+
+  let levelOfControl = await ExtensionPreferencesManager.getLevelOfControl(
+    ADDON_ID,
+    HOMEPAGE_OVERRIDE_KEY,
+    PREF_SETTING_TYPE
+  );
+  is(
+    levelOfControl,
+    "not_controllable",
+    "getLevelOfControl returns not_controllable, the pref is locked."
+  );
+
+  // Verify that the UI is selecting the extension's Id in the menulist
+  let unlockedPromise = TestUtils.waitForCondition(
+    () => homeModeEl.value == ADDON_ID,
+    "Homepage menulist value is equal to the extension ID"
+  );
+  // Unlock the prefs, wait for the UI to update.
+  unlockPrefs();
+  await unlockedPromise;
+
+  is(
+    homeModeEl.disabled,
+    false,
+    "the home select element is not disabled when the pref is not locked"
+  );
+  is(
+    homePageInput.disabled,
+    false,
+    "The homepage is enabled when the pref is unlocked"
+  );
+  is(
+    getHomepage(),
+    extensionHomepage,
+    "The homepage is reset to extension page"
+  );
+
+  levelOfControl = await ExtensionPreferencesManager.getLevelOfControl(
+    ADDON_ID,
+    HOMEPAGE_OVERRIDE_KEY,
+    PREF_SETTING_TYPE
+  );
+  is(
+    levelOfControl,
+    "controlled_by_this_extension",
+    "getLevelOfControl returns controlled_by_this_extension after prefs are unlocked."
+  );
+  let setting = await ExtensionPreferencesManager.getSetting(
+    HOMEPAGE_OVERRIDE_KEY
+  );
+  is(
+    setting.value,
+    extensionHomepage,
+    "The setting value is equal to the extensionHomepage."
+  );
+
+  // Uninstall the add-on.
+  promise = TestUtils.waitForPrefChange(HOMEPAGE_URL_PREF);
+  await extension.unload();
+  await promise;
+
+  setting = await ExtensionPreferencesManager.getSetting(HOMEPAGE_OVERRIDE_KEY);
+  ok(!setting, "The setting is gone after the addon is uninstalled.");
+
+  // Check that everything is now enabled again.
+  is(
+    getHomepage(),
+    originalHomepage,
+    "The reported homepage is reset to original value"
+  );
+  is(homePageInput.value, "", "The homepage is empty");
+  is(
+    homePageInput.disabled,
+    false,
+    "The homepage is enabled after clearing lock"
+  );
+  is(
+    homeModeEl.disabled,
+    false,
+    "Homepage menulist is enabled after clearing lock"
+  );
+  buttonPrefs.forEach(pref => {
+    is(
+      getButton(pref).disabled,
+      false,
+      `The ${pref} button is enabled when unlocked`
+    );
+  });
+
+  // Lock the prefs without an extension.
+  await waitForLockMutations(true);
+
+  // Check that everything is now disabled.
+  is(getHomepage(), lockedHomepage, "The reported homepage is set by the pref");
+  is(homePageInput.value, lockedHomepage, "The homepage is set by the pref");
+  is(
+    homePageInput.disabled,
+    true,
+    "The homepage is disabed when the pref is locked"
+  );
+  is(
+    homeModeEl.disabled,
+    true,
+    "Homepage menulist is disabled when pref is locked"
+  );
+  buttonPrefs.forEach(pref => {
+    is(
+      getButton(pref).disabled,
+      true,
+      `The ${pref} button is disabled when locked`
+    );
+  });
+
+  // Unlock the prefs without an extension.
+  await waitForLockMutations(false);
+
+  // Check that everything is enabled again.
+  is(
+    getHomepage(),
+    originalHomepage,
+    "The homepage is reset to the original value"
+  );
+  is(homePageInput.value, "", "The homepage is clear after being unlocked");
+  is(
+    homePageInput.disabled,
+    false,
+    "The homepage is enabled after clearing lock"
+  );
+  is(
+    homeModeEl.disabled,
+    false,
+    "Homepage menulist is enabled after clearing lock"
+  );
+  buttonPrefs.forEach(pref => {
+    is(
+      getButton(pref).disabled,
+      false,
+      `The ${pref} button is enabled when unlocked`
+    );
+  });
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function testExtensionControlledNewTab() {
+  const ADDON_ID = "@set_newtab";
+  const SECOND_ADDON_ID = "@second_set_newtab";
+  const DEFAULT_NEWTAB = "about:newtab";
+  const NEWTAB_CONTROLLED_PREF = "browser.newtab.extensionControlled";
+
+  await openPreferencesViaOpenPreferencesAPI("paneHome", { leaveOpen: true });
+  is(
+    gBrowser.currentURI.spec,
+    "about:preferences#home",
+    "#home should be in the URI for about:preferences"
+  );
+
+  let doc = gBrowser.contentDocument;
+  let newTabMenuList = doc.getElementById("newTabMode");
+  // The new tab page is set to the default.
+  is(AboutNewTab.newTabURL, DEFAULT_NEWTAB, "new tab is set to default");
+
+  let promise = TestUtils.waitForCondition(
+    () => newTabMenuList.itemCount == 3,
+    "addon option is added as an option in the menu list"
+  );
+  // Install an extension that will set the new tab page.
+  let extension = ExtensionTestUtils.loadExtension({
+    useAddonManager: "permanent",
+    manifest: {
+      version: "1.0",
+      name: "set_newtab",
+      browser_specific_settings: {
+        gecko: {
+          id: ADDON_ID,
+        },
+      },
+      chrome_url_overrides: { newtab: "/newtab.html" },
+    },
+  });
+  await extension.startup();
+
+  await promise;
+  let addon = await AddonManager.getAddonByID(ADDON_ID);
+
+  is(newTabMenuList.value, ADDON_ID, "New tab menulist is set to the add-on");
+
+  let levelOfControl = await ExtensionPreferencesManager.getLevelOfControl(
+    addon.id,
+    NEW_TAB_KEY,
+    URL_OVERRIDES_TYPE
+  );
+  is(
+    levelOfControl,
+    "controlled_by_this_extension",
+    "getLevelOfControl returns controlled_by_this_extension."
+  );
+  let setting = ExtensionSettingsStore.getSetting(
+    URL_OVERRIDES_TYPE,
+    NEW_TAB_KEY
+  );
+  ok(
+    setting.value.startsWith("moz-extension") &&
+      setting.value.endsWith("newtab.html"),
+    "The url_overrides is set by this extension"
+  );
+
+  promise = TestUtils.waitForPrefChange(NEWTAB_CONTROLLED_PREF);
+  // Set the menu to the default value
+  newTabMenuList.value = "0";
+  newTabMenuList.dispatchEvent(new Event("command"));
+  await promise;
+  let newTabPref = Services.prefs.getBoolPref(NEWTAB_CONTROLLED_PREF, false);
+  is(newTabPref, false, "the new tab is not controlled");
+
+  levelOfControl = await ExtensionPreferencesManager.getLevelOfControl(
+    addon.id,
+    NEW_TAB_KEY,
+    URL_OVERRIDES_TYPE
+  );
+  is(
+    levelOfControl,
+    "not_controllable",
+    "getLevelOfControl returns not_controllable."
+  );
+  setting = ExtensionSettingsStore.getSetting(URL_OVERRIDES_TYPE, NEW_TAB_KEY);
+  ok(!setting.value, "The url_overrides is not set by this extension");
+
+  promise = TestUtils.waitForPrefChange(NEWTAB_CONTROLLED_PREF);
+  // Set the menu to a the addon value
+  newTabMenuList.value = ADDON_ID;
+  newTabMenuList.dispatchEvent(new Event("command"));
+  await promise;
+  newTabPref = Services.prefs.getBoolPref(NEWTAB_CONTROLLED_PREF, false);
+  is(newTabPref, true, "the new tab is controlled");
+
+  // Add a second extension, ensure it is added to the menulist and selected.
+  promise = TestUtils.waitForCondition(
+    () => newTabMenuList.itemCount == 4,
+    "addon option is added as an option in the menu list"
+  );
+  let secondExtension = ExtensionTestUtils.loadExtension({
+    useAddonManager: "permanent",
+    manifest: {
+      version: "1.0",
+      name: "second_set_newtab",
+      browser_specific_settings: {
+        gecko: {
+          id: SECOND_ADDON_ID,
+        },
+      },
+      chrome_url_overrides: { newtab: "/newtab2.html" },
+    },
+  });
+  await secondExtension.startup();
+  await promise;
+  let secondAddon = await AddonManager.getAddonByID(SECOND_ADDON_ID);
+  is(
+    newTabMenuList.value,
+    SECOND_ADDON_ID,
+    "New tab menulist is set to the add-on"
+  );
+
+  levelOfControl = await ExtensionPreferencesManager.getLevelOfControl(
+    secondAddon.id,
+    NEW_TAB_KEY,
+    URL_OVERRIDES_TYPE
+  );
+  is(
+    levelOfControl,
+    "controlled_by_this_extension",
+    "getLevelOfControl returns controlled_by_this_extension."
+  );
+  setting = ExtensionSettingsStore.getSetting(URL_OVERRIDES_TYPE, NEW_TAB_KEY);
+  ok(
+    setting.value.startsWith("moz-extension") &&
+      setting.value.endsWith("newtab2.html"),
+    "The url_overrides is set by the second extension"
+  );
+
+  promise = TestUtils.waitForCondition(
+    () => newTabMenuList.itemCount == 3,
+    "addon option is no longer an option in the menu list after disable, even if it was not selected"
+  );
+  await addon.disable();
+  await promise;
+
+  // Ensure that re-enabling an addon adds it back to the menulist
+  promise = TestUtils.waitForCondition(
+    () => newTabMenuList.itemCount == 4,
+    "addon option is added again to the menulist when enabled"
+  );
+  await addon.enable();
+  await promise;
+
+  promise = TestUtils.waitForCondition(
+    () => newTabMenuList.itemCount == 3,
+    "addon option is no longer an option in the menu list after disable"
+  );
+  await secondAddon.disable();
+  await promise;
+
+  promise = TestUtils.waitForCondition(
+    () => newTabMenuList.itemCount == 4,
+    "addon option is added again to the menulist when enabled"
+  );
+  await secondAddon.enable();
+  await promise;
+
+  promise = TestUtils.waitForCondition(
+    () => newTabMenuList.itemCount == 2,
+    "addon options are all removed after disabling all"
+  );
+  await addon.disable();
+  await secondAddon.disable();
+  await promise;
+  is(
+    AboutNewTab.newTabURL,
+    DEFAULT_NEWTAB,
+    "new tab page is set back to default"
+  );
+
+  // Cleanup the tabs and add-on.
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  await extension.unload();
+  await secondExtension.unload();
+});
+
+add_task(async function testExtensionControlledWebNotificationsPermission() {
+  let manifest = {
+    manifest_version: 2,
+    name: "TestExtension",
+    version: "1.0",
+    description: "Testing WebNotificationsDisable",
+    browser_specific_settings: { gecko: { id: "@web_notifications_disable" } },
+    permissions: ["browserSettings"],
+    browser_action: {
+      default_title: "Testing",
+    },
+  };
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  await openNotificationsPermissionDialog();
+
+  let doc = sitePermissionsDialog.document;
+  let extensionControlledContent = doc.getElementById(
+    "browserNotificationsPermissionExtensionContent"
+  );
+
+  // Test that extension content is initially hidden.
+  ok(
+    extensionControlledContent.hidden,
+    "Extension content is initially hidden"
+  );
+
+  // Install an extension that will disable web notifications permission.
+  let messageShown = waitForMessageShown(
+    "browserNotificationsPermissionExtensionContent",
+    doc
+  );
+  let extension = ExtensionTestUtils.loadExtension({
+    manifest,
+    useAddonManager: "permanent",
+    background() {
+      browser.browserSettings.webNotificationsDisabled.set({ value: true });
+      browser.test.sendMessage("load-extension");
+    },
+  });
+  await extension.startup();
+  await extension.awaitMessage("load-extension");
+  await messageShown;
+
+  let controlledDesc = extensionControlledContent.querySelector("description");
+  Assert.deepEqual(
+    doc.l10n.getAttributes(controlledDesc),
+    {
+      id: "extension-controlling-web-notifications",
+      args: {
+        name: "TestExtension",
+      },
+    },
+    "The user is notified that an extension is controlling the web notifications permission"
+  );
+  is(
+    extensionControlledContent.hidden,
+    false,
+    "The extension controlled row is not hidden"
+  );
+
+  // Disable the extension.
+  doc.getElementById("disableNotificationsPermissionExtension").click();
+
+  // Verify the user is notified how to enable the extension.
+  await waitForEnableMessage(extensionControlledContent.id, doc);
+  is(
+    doc.l10n.getAttributes(controlledDesc.querySelector("label")).id,
+    "extension-controlled-enable",
+    "The user is notified of how to enable the extension again"
+  );
+
+  // Verify the enable message can be dismissed.
+  let hidden = waitForMessageHidden(extensionControlledContent.id, doc);
+  let dismissButton = controlledDesc.querySelector("image:last-of-type");
+  dismissButton.click();
+  await hidden;
+
+  // Verify that the extension controlled content in hidden again.
+  is(
+    extensionControlledContent.hidden,
+    true,
+    "The extension controlled row is now hidden"
+  );
+
+  await extension.unload();
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function testExtensionControlledHomepageUninstalledAddon() {
+  async function checkHomepageEnabled() {
+    await openPreferencesViaOpenPreferencesAPI("paneHome", { leaveOpen: true });
+    let doc = gBrowser.contentDocument;
+    is(
+      gBrowser.currentURI.spec,
+      "about:preferences#home",
+      "#home should be in the URI for about:preferences"
+    );
+
+    // The homepage is enabled.
+    let homepageInput = doc.getElementById("homePageUrl");
+    is(homepageInput.disabled, false, "The homepage input is enabled");
+    is(homepageInput.value, "", "The homepage input is empty");
+
+    BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  }
+
+  await ExtensionSettingsStore.initialize();
+
+  // Verify the setting isn't reported as controlled and the inputs are enabled.
+  is(
+    ExtensionSettingsStore.getSetting("prefs", "homepage_override"),
+    null,
+    "The homepage_override is not set"
+  );
+  await checkHomepageEnabled();
+
+  // Disarm any pending writes before we modify the JSONFile directly.
+  await ExtensionSettingsStore._reloadFile(false);
+
+  // Write out a bad store file.
+  let storeData = {
+    prefs: {
+      homepage_override: {
+        initialValue: "",
+        precedenceList: [
+          {
+            id: "bad@mochi.test",
+            installDate: 1508802672,
+            value: "https://developer.mozilla.org",
+            enabled: true,
+          },
+        ],
+      },
+    },
+  };
+  let jsonFileName = "extension-settings.json";
+  let storePath = PathUtils.join(PathUtils.profileDir, jsonFileName);
+
+  await IOUtils.writeUTF8(storePath, JSON.stringify(storeData));
+
+  // Reload the ExtensionSettingsStore so it will read the file on disk. Don't
+  // finalize the current store since it will overwrite our file.
+  await ExtensionSettingsStore._reloadFile(false);
+
+  // Verify that the setting is reported as set, but the homepage is still enabled
+  // since there is no matching installed extension.
+  is(
+    ExtensionSettingsStore.getSetting("prefs", "homepage_override").value,
+    "https://developer.mozilla.org",
+    "The homepage_override appears to be set"
+  );
+  await checkHomepageEnabled();
+
+  // Remove the bad store file that we used.
+  await IOUtils.remove(storePath);
+
+  // Reload the ExtensionSettingsStore again so it clears the data we added.
+  // Don't finalize the current store since it will write out the bad data.
+  await ExtensionSettingsStore._reloadFile(false);
+
+  is(
+    ExtensionSettingsStore.getSetting("prefs", "homepage_override"),
+    null,
+    "The ExtensionSettingsStore is left empty."
+  );
+});
+
+add_task(async function testExtensionControlledTrackingProtection() {
+  const TP_PREF = "privacy.trackingprotection.enabled";
+  const TP_DEFAULT = false;
+  const EXTENSION_ID = "@set_tp";
+  const CONTROLLED_LABEL_ID =
+    "contentBlockingTrackingProtectionExtensionContentLabel";
+  const CONTROLLED_BUTTON_ID =
+    "contentBlockingDisableTrackingProtectionExtension";
+
+  let tpEnabledPref = () => Services.prefs.getBoolPref(TP_PREF);
+
+  await SpecialPowers.pushPrefEnv({ set: [[TP_PREF, TP_DEFAULT]] });
+
+  function background() {
+    browser.privacy.websites.trackingProtectionMode.set({ value: "always" });
+  }
+
+  function verifyState(isControlled) {
+    is(tpEnabledPref(), isControlled, "TP pref is set to the expected value.");
+
+    let controlledLabel = doc.getElementById(CONTROLLED_LABEL_ID);
+    let controlledButton = doc.getElementById(CONTROLLED_BUTTON_ID);
+
+    is(
+      controlledLabel.hidden,
+      !isControlled,
+      "The extension controlled row's visibility is as expected."
+    );
+    is(
+      controlledButton.hidden,
+      !isControlled,
+      "The disable extension button's visibility is as expected."
+    );
+    if (isControlled) {
+      let controlledDesc = controlledLabel.querySelector("description");
+      Assert.deepEqual(
+        doc.l10n.getAttributes(controlledDesc),
+        {
+          id: "extension-controlling-websites-content-blocking-all-trackers",
+          args: {
+            name: "set_tp",
+          },
+        },
+        "The user is notified that an extension is controlling TP."
+      );
+    }
+
+    is(
+      doc.getElementById("trackingProtectionMenu").disabled,
+      isControlled,
+      "TP control is enabled."
+    );
+  }
+
+  await openPreferencesViaOpenPreferencesAPI("panePrivacy", {
+    leaveOpen: true,
+  });
+  let doc = gBrowser.contentDocument;
+
+  is(
+    gBrowser.currentURI.spec,
+    "about:preferences#privacy",
+    "#privacy should be in the URI for about:preferences"
+  );
+
+  verifyState(false);
+
+  // Install an extension that sets Tracking Protection.
+  let extension = ExtensionTestUtils.loadExtension({
+    useAddonManager: "permanent",
+    manifest: {
+      name: "set_tp",
+      browser_specific_settings: { gecko: { id: EXTENSION_ID } },
+      permissions: ["privacy"],
+    },
+    background,
+  });
+
+  let messageShown = waitForMessageShown(CONTROLLED_LABEL_ID);
+  await extension.startup();
+  await messageShown;
+  let addon = await AddonManager.getAddonByID(EXTENSION_ID);
+
+  verifyState(true);
+
+  await disableExtensionViaClick(
+    CONTROLLED_LABEL_ID,
+    CONTROLLED_BUTTON_ID,
+    doc
+  );
+
+  verifyState(false);
+
+  // Enable the extension so we get the UNINSTALL event, which is needed by
+  // ExtensionPreferencesManager to clean up properly.
+  // TODO: BUG 1408226
+  await reEnableExtension(addon, CONTROLLED_LABEL_ID);
+
+  await extension.unload();
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function testExtensionControlledPasswordManager() {
+  const PASSWORD_MANAGER_ENABLED_PREF = "signon.rememberSignons";
+  const PASSWORD_MANAGER_ENABLED_DEFAULT = true;
+  const CONTROLLED_BUTTON_ID = "disablePasswordManagerExtension";
+  const CONTROLLED_LABEL_ID = "passwordManagerExtensionContent";
+  const EXTENSION_ID = "@remember_signons";
+  let manifest = {
+    manifest_version: 2,
+    name: "testPasswordManagerExtension",
+    version: "1.0",
+    description: "Testing rememberSignons",
+    browser_specific_settings: { gecko: { id: EXTENSION_ID } },
+    permissions: ["privacy"],
+    browser_action: {
+      default_title: "Testing rememberSignons",
+    },
+  };
+
+  let passwordManagerEnabledPref = () =>
+    Services.prefs.getBoolPref(PASSWORD_MANAGER_ENABLED_PREF);
+
+  await SpecialPowers.pushPrefEnv({
+    set: [[PASSWORD_MANAGER_ENABLED_PREF, PASSWORD_MANAGER_ENABLED_DEFAULT]],
+  });
+  is(
+    passwordManagerEnabledPref(),
+    true,
+    "Password manager is enabled by default."
+  );
+
+  function verifyState(isControlled) {
+    is(
+      passwordManagerEnabledPref(),
+      !isControlled,
+      "Password manager pref is set to the expected value."
+    );
+    let controlledLabel =
+      gBrowser.contentDocument.getElementById(CONTROLLED_LABEL_ID);
+    let controlledButton =
+      gBrowser.contentDocument.getElementById(CONTROLLED_BUTTON_ID);
+    is(
+      controlledLabel.hidden,
+      !isControlled,
+      "The extension's controlled row visibility is as expected."
+    );
+    is(
+      controlledButton.hidden,
+      !isControlled,
+      "The extension's controlled button visibility is as expected."
+    );
+    if (isControlled) {
+      let controlledDesc = controlledLabel.querySelector("description");
+      Assert.deepEqual(
+        gBrowser.contentDocument.l10n.getAttributes(controlledDesc),
+        {
+          id: "extension-controlling-password-saving",
+          args: {
+            name: "testPasswordManagerExtension",
+          },
+        },
+        "The user is notified that an extension is controlling the remember signons pref."
+      );
+    }
+  }
+
+  await openPreferencesViaOpenPreferencesAPI("panePrivacy", {
+    leaveOpen: true,
+  });
+
+  info("Verify that no extension is controlling the password manager pref.");
+  verifyState(false);
+
+  let extension = ExtensionTestUtils.loadExtension({
+    manifest,
+    useAddonManager: "permanent",
+    background() {
+      browser.privacy.services.passwordSavingEnabled.set({ value: false });
+    },
+  });
+  let messageShown = waitForMessageShown(CONTROLLED_LABEL_ID);
+  await extension.startup();
+  await messageShown;
+
+  info(
+    "Verify that the test extension is controlling the password manager pref."
+  );
+  verifyState(true);
+
+  info("Verify that the extension shows as controlled when loaded again.");
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  await openPreferencesViaOpenPreferencesAPI("panePrivacy", {
+    leaveOpen: true,
+  });
+  verifyState(true);
+
+  await disableExtensionViaClick(
+    CONTROLLED_LABEL_ID,
+    CONTROLLED_BUTTON_ID,
+    gBrowser.contentDocument
+  );
+
+  info(
+    "Verify that disabling the test extension removes the lock on the password manager pref."
+  );
+  verifyState(false);
+
+  await extension.unload();
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function testExtensionControlledProxyConfig() {
+  const proxySvc = Ci.nsIProtocolProxyService;
+  const PROXY_DEFAULT = proxySvc.PROXYCONFIG_SYSTEM;
+  const EXTENSION_ID = "@set_proxy";
+  const CONTROLLED_SECTION_ID = "proxyExtensionContent";
+  const CONTROLLED_BUTTON_ID = "disableProxyExtension";
+  const CONNECTION_SETTINGS_DESC_ID = "connectionSettingsDescription";
+  const PANEL_URL =
+    "chrome://browser/content/preferences/dialogs/connection.xhtml";
+
+  await SpecialPowers.pushPrefEnv({ set: [[PROXY_PREF, PROXY_DEFAULT]] });
+
+  function background() {
+    browser.proxy.settings.set({ value: { proxyType: "none" } });
+  }
+
+  function expectedConnectionSettingsMessage(doc, isControlled) {
+    return isControlled
+      ? "extension-controlling-proxy-config"
+      : "network-proxy-connection-description";
+  }
+
+  function connectionSettingsMessagePromise(doc, isControlled) {
+    return waitForMessageContent(
+      CONNECTION_SETTINGS_DESC_ID,
+      expectedConnectionSettingsMessage(doc, isControlled),
+      doc
+    );
+  }
+
+  function verifyProxyState(doc, isControlled) {
+    let isPanel = doc.getElementById(CONTROLLED_BUTTON_ID);
+    is(
+      proxyType === proxySvc.PROXYCONFIG_DIRECT,
+      isControlled,
+      "Proxy pref is set to the expected value."
+    );
+
+    if (isPanel) {
+      let controlledSection = doc.getElementById(CONTROLLED_SECTION_ID);
+
+      is(
+        controlledSection.hidden,
+        !isControlled,
+        "The extension controlled row's visibility is as expected."
+      );
+      if (isPanel) {
+        is(
+          doc.getElementById(CONTROLLED_BUTTON_ID).hidden,
+          !isControlled,
+          "The disable extension button's visibility is as expected."
+        );
+      }
+      if (isControlled) {
+        let controlledDesc = controlledSection.querySelector("description");
+        Assert.deepEqual(
+          doc.l10n.getAttributes(controlledDesc),
+          {
+            id: "extension-controlling-proxy-config",
+            args: {
+              name: "set_proxy",
+            },
+          },
+          "The user is notified that an extension is controlling proxy settings."
+        );
+      }
+      function getProxyControls() {
+        let controlGroup = doc.getElementById("networkProxyType");
+        let manualControlContainer = controlGroup.querySelector("#proxy-grid");
+        return {
+          manualControls: [
+            ...manualControlContainer.querySelectorAll(
+              "label[data-l10n-id]:not([control=networkProxyNone])"
+            ),
+            ...manualControlContainer.querySelectorAll("input"),
+            ...manualControlContainer.querySelectorAll("checkbox"),
+            ...doc.querySelectorAll("#networkProxySOCKSVersion > radio"),
+          ],
+          pacControls: [doc.getElementById("networkProxyAutoconfigURL")],
+          otherControls: [
+            doc.querySelector("label[control=networkProxyNone]"),
+            doc.getElementById("networkProxyNone"),
+            ...controlGroup.querySelectorAll(":scope > radio"),
+            ...doc.querySelectorAll("#ConnectionsDialogPane > checkbox"),
+          ],
+        };
+      }
+      let controlState = isControlled ? "disabled" : "enabled";
+      let controls = getProxyControls();
+      for (let element of controls.manualControls) {
+        let disabled =
+          isControlled || proxyType !== proxySvc.PROXYCONFIG_MANUAL;
+        is(
+          element.disabled,
+          disabled,
+          `Manual proxy controls should be ${controlState} - control: ${element.outerHTML}.`
+        );
+      }
+      for (let element of controls.pacControls) {
+        let disabled = isControlled || proxyType !== proxySvc.PROXYCONFIG_PAC;
+        is(
+          element.disabled,
+          disabled,
+          `PAC proxy controls should be ${controlState} - control: ${element.outerHTML}.`
+        );
+      }
+      for (let element of controls.otherControls) {
+        is(
+          element.disabled,
+          isControlled,
+          `Other proxy controls should be ${controlState} - control: ${element.outerHTML}.`
+        );
+      }
+    } else {
+      let elem = doc.getElementById(CONNECTION_SETTINGS_DESC_ID);
+      is(
+        doc.l10n.getAttributes(elem).id,
+        expectedConnectionSettingsMessage(doc, isControlled),
+        "The connection settings description is as expected."
+      );
+    }
+  }
+
+  async function reEnableProxyExtension(addon) {
+    let messageChanged = connectionSettingsMessagePromise(mainDoc, true);
+    await addon.enable();
+    await messageChanged;
+  }
+
+  async function openProxyPanel() {
+    let panel = await openAndLoadSubDialog(PANEL_URL);
+    let closingPromise = BrowserTestUtils.waitForEvent(
+      panel.document.getElementById("ConnectionsDialog"),
+      "dialogclosing"
+    );
+    ok(panel, "Proxy panel opened.");
+    return { panel, closingPromise };
+  }
+
+  async function closeProxyPanel(panelObj) {
+    let dialog = panelObj.panel.document.getElementById("ConnectionsDialog");
+    dialog.cancelDialog();
+    let panelClosingEvent = await panelObj.closingPromise;
+    ok(panelClosingEvent, "Proxy panel closed.");
+  }
+
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  let mainDoc = gBrowser.contentDocument;
+
+  is(
+    gBrowser.currentURI.spec,
+    "about:preferences#general",
+    "#general should be in the URI for about:preferences"
+  );
+
+  verifyProxyState(mainDoc, false);
+
+  // Open the connections panel.
+  let panelObj = await openProxyPanel();
+  let panelDoc = panelObj.panel.document;
+
+  verifyProxyState(panelDoc, false);
+
+  await closeProxyPanel(panelObj);
+
+  verifyProxyState(mainDoc, false);
+
+  // Install an extension that controls proxy settings. The extension needs
+  // incognitoOverride because controlling the proxy.settings requires private
+  // browsing access.
+  let extension = ExtensionTestUtils.loadExtension({
+    incognitoOverride: "spanning",
+    useAddonManager: "permanent",
+    manifest: {
+      name: "set_proxy",
+      browser_specific_settings: { gecko: { id: EXTENSION_ID } },
+      permissions: ["proxy"],
+    },
+    background,
+  });
+
+  let messageChanged = connectionSettingsMessagePromise(mainDoc, true);
+  await extension.startup();
+  await messageChanged;
+  let addon = await AddonManager.getAddonByID(EXTENSION_ID);
+
+  verifyProxyState(mainDoc, true);
+  messageChanged = connectionSettingsMessagePromise(mainDoc, false);
+
+  panelObj = await openProxyPanel();
+  panelDoc = panelObj.panel.document;
+
+  verifyProxyState(panelDoc, true);
+
+  await disableExtensionViaClick(
+    CONTROLLED_SECTION_ID,
+    CONTROLLED_BUTTON_ID,
+    panelDoc
+  );
+
+  verifyProxyState(panelDoc, false);
+
+  await closeProxyPanel(panelObj);
+  await messageChanged;
+
+  verifyProxyState(mainDoc, false);
+
+  await reEnableProxyExtension(addon);
+
+  verifyProxyState(mainDoc, true);
+  messageChanged = connectionSettingsMessagePromise(mainDoc, false);
+
+  panelObj = await openProxyPanel();
+  panelDoc = panelObj.panel.document;
+
+  verifyProxyState(panelDoc, true);
+
+  await disableExtensionViaClick(
+    CONTROLLED_SECTION_ID,
+    CONTROLLED_BUTTON_ID,
+    panelDoc
+  );
+
+  verifyProxyState(panelDoc, false);
+
+  await closeProxyPanel(panelObj);
+  await messageChanged;
+
+  verifyProxyState(mainDoc, false);
+
+  // Enable the extension so we get the UNINSTALL event, which is needed by
+  // ExtensionPreferencesManager to clean up properly.
+  // TODO: BUG 1408226
+  await reEnableProxyExtension(addon);
+
+  await extension.unload();
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+// Test that the newtab menu selection is correct when loading about:preferences
+add_task(async function testMenuSyncFromPrefs() {
+  const DEFAULT_NEWTAB = "about:newtab";
+
+  await openPreferencesViaOpenPreferencesAPI("paneHome", { leaveOpen: true });
+  is(
+    gBrowser.currentURI.spec,
+    "about:preferences#home",
+    "#home should be in the URI for about:preferences"
+  );
+
+  let doc = gBrowser.contentDocument;
+  let newTabMenuList = doc.getElementById("newTabMode");
+  // The new tab page is set to the default.
+  is(AboutNewTab.newTabURL, DEFAULT_NEWTAB, "new tab is set to default");
+
+  is(newTabMenuList.value, "0", "New tab menulist is set to the default");
+
+  newTabMenuList.value = "1";
+  newTabMenuList.dispatchEvent(new Event("command"));
+  is(newTabMenuList.value, "1", "New tab menulist is set to blank");
+
+  gBrowser.reloadTab(gBrowser.selectedTab);
+
+  await TestUtils.waitForCondition(
+    () => gBrowser.contentDocument.getElementById("newTabMode"),
+    "wait until element exists in new contentDoc"
+  );
+
+  is(
+    gBrowser.contentDocument.getElementById("newTabMode").value,
+    "1",
+    "New tab menulist is still set to blank"
+  );
+
+  // Cleanup
+  newTabMenuList.value = "0";
+  newTabMenuList.dispatchEvent(new Event("command"));
+  is(AboutNewTab.newTabURL, DEFAULT_NEWTAB, "new tab is set to default");
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_filetype_dialog.js b/browser/components/preferences/tests/browser_filetype_dialog.js
new file mode 100644
index 0000000000..0e5ac036c4
--- /dev/null
+++ b/browser/components/preferences/tests/browser_filetype_dialog.js
@@ -0,0 +1,189 @@
+/* Any copyright is dedicated to the Public Domain.
+   http://creativecommons.org/publicdomain/zero/1.0/ */
+
+SimpleTest.requestCompleteLog();
+const { HandlerServiceTestUtils } = ChromeUtils.importESModule(
+  "resource://testing-common/HandlerServiceTestUtils.sys.mjs"
+);
+
+let gHandlerService = Cc["@mozilla.org/uriloader/handler-service;1"].getService(
+  Ci.nsIHandlerService
+);
+
+let gOldMailHandlers = [];
+let gDummyHandlers = [];
+let gOriginalPreferredMailHandler;
+let gOriginalPreferredPDFHandler;
+
+registerCleanupFunction(function () {
+  function removeDummyHandlers(handlers) {
+    // Remove any of the dummy handlers we created.
+    for (let i = handlers.Count() - 1; i >= 0; i--) {
+      try {
+        if (
+          gDummyHandlers.some(
+            h =>
+              h.uriTemplate ==
+              handlers.queryElementAt(i, Ci.nsIWebHandlerApp).uriTemplate
+          )
+        ) {
+          handlers.removeElementAt(i);
+        }
+      } catch (ex) {
+        /* ignore non-web-app handlers */
+      }
+    }
+  }
+  // Re-add the original protocol handlers:
+  let mailHandlerInfo = HandlerServiceTestUtils.getHandlerInfo("mailto");
+  let mailHandlers = mailHandlerInfo.possibleApplicationHandlers;
+  for (let h of gOldMailHandlers) {
+    mailHandlers.appendElement(h);
+  }
+  removeDummyHandlers(mailHandlers);
+  mailHandlerInfo.preferredApplicationHandler = gOriginalPreferredMailHandler;
+  gHandlerService.store(mailHandlerInfo);
+
+  let pdfHandlerInfo =
+    HandlerServiceTestUtils.getHandlerInfo("application/pdf");
+  pdfHandlerInfo.preferredAction = Ci.nsIHandlerInfo.handleInternally;
+  pdfHandlerInfo.preferredApplicationHandler = gOriginalPreferredPDFHandler;
+  let handlers = pdfHandlerInfo.possibleApplicationHandlers;
+  for (let i = handlers.Count() - 1; i >= 0; i--) {
+    let app = handlers.queryElementAt(i, Ci.nsIHandlerApp);
+    if (app.name == "Foopydoopydoo") {
+      handlers.removeElementAt(i);
+    }
+  }
+  gHandlerService.store(pdfHandlerInfo);
+
+  gBrowser.removeCurrentTab();
+});
+
+function scrubMailtoHandlers(handlerInfo) {
+  // Remove extant web handlers because they have icons that
+  // we fetch from the web, which isn't allowed in tests.
+  let handlers = handlerInfo.possibleApplicationHandlers;
+  for (let i = handlers.Count() - 1; i >= 0; i--) {
+    try {
+      let handler = handlers.queryElementAt(i, Ci.nsIWebHandlerApp);
+      gOldMailHandlers.push(handler);
+      // If we get here, this is a web handler app. Remove it:
+      handlers.removeElementAt(i);
+    } catch (ex) {}
+  }
+}
+
+("use strict");
+
+add_setup(async function () {
+  // Create our dummy handlers
+  let handler1 = Cc["@mozilla.org/uriloader/web-handler-app;1"].createInstance(
+    Ci.nsIWebHandlerApp
+  );
+  handler1.name = "Handler 1";
+  handler1.uriTemplate = "https://example.com/first/%s";
+
+  let handler2 = Cc["@mozilla.org/uriloader/web-handler-app;1"].createInstance(
+    Ci.nsIWebHandlerApp
+  );
+  handler2.name = "Handler 2";
+  handler2.uriTemplate = "http://example.org/second/%s";
+  gDummyHandlers.push(handler1, handler2);
+
+  function substituteWebHandlers(handlerInfo) {
+    // Append the dummy handlers to replace them:
+    let handlers = handlerInfo.possibleApplicationHandlers;
+    handlers.appendElement(handler1);
+    handlers.appendElement(handler2);
+    gHandlerService.store(handlerInfo);
+  }
+  // Set up our mailto handler test infrastructure.
+  let mailtoHandlerInfo = HandlerServiceTestUtils.getHandlerInfo("mailto");
+  scrubMailtoHandlers(mailtoHandlerInfo);
+  gOriginalPreferredMailHandler = mailtoHandlerInfo.preferredApplicationHandler;
+  substituteWebHandlers(mailtoHandlerInfo);
+
+  // Now add a pdf handler:
+  let pdfHandlerInfo =
+    HandlerServiceTestUtils.getHandlerInfo("application/pdf");
+  // PDF doesn't have built-in web handlers, so no need to scrub.
+  gOriginalPreferredPDFHandler = pdfHandlerInfo.preferredApplicationHandler;
+  let handlers = pdfHandlerInfo.possibleApplicationHandlers;
+  let appHandler = Cc[
+    "@mozilla.org/uriloader/local-handler-app;1"
+  ].createInstance(Ci.nsILocalHandlerApp);
+  appHandler.name = "Foopydoopydoo";
+  appHandler.executable = Services.dirsvc.get("ProfD", Ci.nsIFile);
+  appHandler.executable.append("dummy.exe");
+  // Prefs are picky and want this to exist and be executable (bug 1626009):
+  if (!appHandler.executable.exists()) {
+    appHandler.executable.create(Ci.nsIFile.NORMAL_FILE_TYPE, 0o777);
+  }
+
+  handlers.appendElement(appHandler);
+
+  pdfHandlerInfo.preferredApplicationHandler = appHandler;
+  pdfHandlerInfo.preferredAction = Ci.nsIHandlerInfo.useHelperApp;
+  gHandlerService.store(pdfHandlerInfo);
+
+  await openPreferencesViaOpenPreferencesAPI("general", { leaveOpen: true });
+  info("Preferences page opened on the general pane.");
+
+  await gBrowser.selectedBrowser.contentWindow.promiseLoadHandlersList;
+  info("Apps list loaded.");
+});
+
+add_task(async function dialogShowsCorrectContent() {
+  let win = gBrowser.selectedBrowser.contentWindow;
+
+  let container = win.document.getElementById("handlersView");
+
+  // First, find the PDF item.
+  let pdfItem = container.querySelector("richlistitem[type='application/pdf']");
+  Assert.ok(pdfItem, "pdfItem is present in handlersView.");
+  pdfItem.scrollIntoView({ block: "center" });
+  pdfItem.closest("richlistbox").selectItem(pdfItem);
+
+  // Open its menu
+  let list = pdfItem.querySelector(".actionsMenu");
+  let popup = list.menupopup;
+  let popupShown = BrowserTestUtils.waitForEvent(popup, "popupshown");
+  EventUtils.synthesizeMouseAtCenter(list, {}, win);
+  await popupShown;
+
+  // Then open the dialog
+  const promiseDialogLoaded = promiseLoadSubDialog(
+    "chrome://browser/content/preferences/dialogs/applicationManager.xhtml"
+  );
+  EventUtils.synthesizeMouseAtCenter(
+    popup.querySelector(".manage-app-item"),
+    {},
+    win
+  );
+  let dialogWin = await promiseDialogLoaded;
+
+  // Then verify that the description is correct.
+  let desc = dialogWin.document.getElementById("appDescription");
+  let descL10n = dialogWin.document.l10n.getAttributes(desc);
+  is(descL10n.id, "app-manager-handle-file", "Should have right string");
+  let stringBundle = Services.strings.createBundle(
+    "chrome://mozapps/locale/downloads/unknownContentType.properties"
+  );
+  is(
+    descL10n.args.type,
+    stringBundle.GetStringFromName("pdfExtHandlerDescription"),
+    "Should have PDF string bits."
+  );
+
+  // And that there's one item in the list, with the correct name:
+  let appList = dialogWin.document.getElementById("appList");
+  is(appList.itemCount, 1, "Should have 1 item in the list");
+  is(
+    appList.selectedItem.querySelector("label").getAttribute("value"),
+    "Foopydoopydoo",
+    "Should have the right executable label"
+  );
+
+  dialogWin.close();
+});
diff --git a/browser/components/preferences/tests/browser_fluent.js b/browser/components/preferences/tests/browser_fluent.js
new file mode 100644
index 0000000000..db2daecc4f
--- /dev/null
+++ b/browser/components/preferences/tests/browser_fluent.js
@@ -0,0 +1,40 @@
+function whenMainPaneLoadedFinished() {
+  return new Promise(function (resolve, reject) {
+    const topic = "main-pane-loaded";
+    Services.obs.addObserver(function observer(aSubject) {
+      Services.obs.removeObserver(observer, topic);
+      resolve();
+    }, topic);
+  });
+}
+
+// Temporary test for an experimental new localization API.
+// See bug 1402069 for details.
+add_task(async function () {
+  // The string is used only when `browserTabsRemoteAutostart` is true
+  if (!Services.appinfo.browserTabsRemoteAutostart) {
+    ok(true, "fake test to avoid harness complaining");
+    return;
+  }
+
+  await Promise.all([
+    openPreferencesViaOpenPreferencesAPI("general", { leaveOpen: true }),
+    whenMainPaneLoadedFinished(),
+  ]);
+
+  let doc = gBrowser.contentDocument;
+  await doc.l10n.ready;
+
+  let [msg] = await doc.l10n.formatMessages([{ id: "category-general" }]);
+
+  let elem = doc.querySelector(`#category-general`);
+
+  Assert.deepEqual(msg, {
+    value: null,
+    attributes: [
+      { name: "tooltiptext", value: elem.getAttribute("tooltiptext") },
+    ],
+  });
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_homepage_default.js b/browser/components/preferences/tests/browser_homepage_default.js
new file mode 100644
index 0000000000..e3fcdcec5e
--- /dev/null
+++ b/browser/components/preferences/tests/browser_homepage_default.js
@@ -0,0 +1,31 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+add_task(async function default_homepage_test() {
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.startup.page", 1]],
+  });
+  let defaults = Services.prefs.getDefaultBranch("");
+  // Simulate a homepage set via policy or a distribution.
+  defaults.setStringPref("browser.startup.homepage", "https://example.com");
+
+  await openPreferencesViaOpenPreferencesAPI("paneHome", { leaveOpen: true });
+
+  let doc = gBrowser.contentDocument;
+  let homeMode = doc.getElementById("homeMode");
+  Assert.equal(homeMode.value, 2, "homeMode should be 2 (Custom URL)");
+
+  let homePageUrl = doc.getElementById("homePageUrl");
+  Assert.equal(
+    homePageUrl.value,
+    "https://example.com",
+    "homePageUrl should be example.com"
+  );
+
+  registerCleanupFunction(async () => {
+    defaults.setStringPref("browser.startup.homepage", "about:home");
+    BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  });
+});
diff --git a/browser/components/preferences/tests/browser_homepages_filter_aboutpreferences.js b/browser/components/preferences/tests/browser_homepages_filter_aboutpreferences.js
new file mode 100644
index 0000000000..f54d0edaaa
--- /dev/null
+++ b/browser/components/preferences/tests/browser_homepages_filter_aboutpreferences.js
@@ -0,0 +1,33 @@
+add_task(async function testSetHomepageUseCurrent() {
+  is(
+    gBrowser.currentURI.spec,
+    "about:blank",
+    "Test starts with about:blank open"
+  );
+  await BrowserTestUtils.openNewForegroundTab(gBrowser, "about:home");
+  await openPreferencesViaOpenPreferencesAPI("paneHome", { leaveOpen: true });
+  let doc = gBrowser.contentDocument;
+  is(
+    gBrowser.currentURI.spec,
+    "about:preferences#home",
+    "#home should be in the URI for about:preferences"
+  );
+  let oldHomepage = HomePage.get();
+
+  let useCurrent = doc.getElementById("useCurrentBtn");
+  useCurrent.click();
+
+  is(gBrowser.tabs.length, 3, "Three tabs should be open");
+  await TestUtils.waitForCondition(
+    () => HomePage.get() == "about:blank|about:home"
+  );
+  is(
+    HomePage.get(),
+    "about:blank|about:home",
+    "about:blank and about:home should be the only homepages set"
+  );
+
+  HomePage.safeSet(oldHomepage);
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_homepages_use_bookmark.js b/browser/components/preferences/tests/browser_homepages_use_bookmark.js
new file mode 100644
index 0000000000..572783481d
--- /dev/null
+++ b/browser/components/preferences/tests/browser_homepages_use_bookmark.js
@@ -0,0 +1,94 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+const TEST_URL1 = "http://example.com/1";
+const TEST_URL2 = "http://example.com/2";
+
+add_setup(async function () {
+  let oldHomepagePref = Services.prefs.getCharPref("browser.startup.homepage");
+
+  await openPreferencesViaOpenPreferencesAPI("paneHome", { leaveOpen: true });
+
+  Assert.equal(
+    gBrowser.currentURI.spec,
+    "about:preferences#home",
+    "#home should be in the URI for about:preferences"
+  );
+
+  registerCleanupFunction(async () => {
+    Services.prefs.setCharPref("browser.startup.homepage", oldHomepagePref);
+    BrowserTestUtils.removeTab(gBrowser.selectedTab);
+    await PlacesUtils.bookmarks.eraseEverything();
+  });
+});
+
+add_task(async function testSetHomepageFromBookmark() {
+  let bm = await PlacesUtils.bookmarks.insert({
+    parentGuid: PlacesUtils.bookmarks.menuGuid,
+    title: "TestHomepage",
+    url: TEST_URL1,
+  });
+
+  let doc = gBrowser.contentDocument;
+  // Select the custom URLs option.
+  doc.getElementById("homeMode").value = 2;
+
+  let promiseSubDialogLoaded = promiseLoadSubDialog(
+    "chrome://browser/content/preferences/dialogs/selectBookmark.xhtml"
+  );
+  doc.getElementById("useBookmarkBtn").click();
+
+  let dialog = await promiseSubDialogLoaded;
+  dialog.document.getElementById("bookmarks").selectItems([bm.guid]);
+  dialog.document
+    .getElementById("selectBookmarkDialog")
+    .getButton("accept")
+    .click();
+
+  await TestUtils.waitForCondition(() => HomePage.get() == TEST_URL1);
+
+  Assert.equal(
+    HomePage.get(),
+    TEST_URL1,
+    "Should have set the homepage to the same as the bookmark."
+  );
+});
+
+add_task(async function testSetHomepageFromTopLevelFolder() {
+  // Insert a second item into the menu folder
+  await PlacesUtils.bookmarks.insert({
+    parentGuid: PlacesUtils.bookmarks.menuGuid,
+    title: "TestHomepage",
+    url: TEST_URL2,
+  });
+
+  let doc = gBrowser.contentDocument;
+  // Select the custom URLs option.
+  doc.getElementById("homeMode").value = 2;
+
+  let promiseSubDialogLoaded = promiseLoadSubDialog(
+    "chrome://browser/content/preferences/dialogs/selectBookmark.xhtml"
+  );
+  doc.getElementById("useBookmarkBtn").click();
+
+  let dialog = await promiseSubDialogLoaded;
+  dialog.document
+    .getElementById("bookmarks")
+    .selectItems([PlacesUtils.bookmarks.menuGuid]);
+  dialog.document
+    .getElementById("selectBookmarkDialog")
+    .getButton("accept")
+    .click();
+
+  await TestUtils.waitForCondition(
+    () => HomePage.get() == `${TEST_URL1}|${TEST_URL2}`
+  );
+
+  Assert.equal(
+    HomePage.get(),
+    `${TEST_URL1}|${TEST_URL2}`,
+    "Should have set the homepage to the same as the bookmark."
+  );
+});
diff --git a/browser/components/preferences/tests/browser_hometab_restore_defaults.js b/browser/components/preferences/tests/browser_hometab_restore_defaults.js
new file mode 100644
index 0000000000..55a9a974b2
--- /dev/null
+++ b/browser/components/preferences/tests/browser_hometab_restore_defaults.js
@@ -0,0 +1,220 @@
+add_task(async function testRestoreDefaultsBtn_visible() {
+  const before = SpecialPowers.Services.prefs.getStringPref(
+    "browser.newtabpage.activity-stream.feeds.section.topstories.options",
+    ""
+  );
+
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      // Hide Pocket prefs so we don't trigger network requests when we reset all preferences
+      [
+        "browser.newtabpage.activity-stream.feeds.section.topstories.options",
+        JSON.stringify(Object.assign({}, JSON.parse(before), { hidden: true })),
+      ],
+      [
+        "browser.newtabpage.activity-stream.discoverystream.endpointSpocsClear",
+        "",
+      ],
+      // Set a user pref to false to force the Restore Defaults button to be visible
+      ["browser.newtabpage.activity-stream.feeds.topsites", false],
+    ],
+  });
+
+  let tab = await BrowserTestUtils.openNewForegroundTab(
+    gBrowser,
+    "about:preferences#home",
+    false
+  );
+  let browser = tab.linkedBrowser;
+
+  await BrowserTestUtils.waitForCondition(
+    () =>
+      SpecialPowers.spawn(
+        browser,
+        [],
+        () =>
+          content.document.getElementById("restoreDefaultHomePageBtn") !== null
+      ),
+    "Wait for the button to be added to the page"
+  );
+
+  await BrowserTestUtils.waitForCondition(
+    () =>
+      SpecialPowers.spawn(
+        browser,
+        [],
+        () =>
+          content.document.querySelector(
+            "[data-subcategory='topsites'] checkbox"
+          ) !== null
+      ),
+    "Wait for the preference checkbox to load"
+  );
+
+  await BrowserTestUtils.waitForCondition(
+    () =>
+      SpecialPowers.spawn(
+        browser,
+        [],
+        () =>
+          content.document.getElementById("restoreDefaultHomePageBtn")
+            .hidden === false
+      ),
+    "Should show the Restore Defaults btn because pref is changed"
+  );
+
+  await SpecialPowers.spawn(browser, [], () =>
+    content.document.getElementById("restoreDefaultHomePageBtn").click()
+  );
+
+  await BrowserTestUtils.waitForCondition(
+    () =>
+      SpecialPowers.spawn(
+        browser,
+        [],
+        () =>
+          content.document.querySelector(
+            "[data-subcategory='topsites'] checkbox"
+          ).checked
+      ),
+    "Should have checked preference"
+  );
+
+  await BrowserTestUtils.waitForCondition(
+    () =>
+      SpecialPowers.spawn(
+        browser,
+        [],
+        () =>
+          content.document.getElementById("restoreDefaultHomePageBtn").style
+            .visibility === "hidden"
+      ),
+    "Should not show the Restore Defaults btn if prefs were reset"
+  );
+
+  const topsitesPref = await SpecialPowers.Services.prefs.getBoolPref(
+    "browser.newtabpage.activity-stream.feeds.topsites"
+  );
+  Assert.ok(topsitesPref, "Topsites pref should have the default value");
+
+  await SpecialPowers.popPrefEnv();
+  BrowserTestUtils.removeTab(tab);
+});
+
+add_task(async function testRestoreDefaultsBtn_hidden() {
+  const before = SpecialPowers.Services.prefs.getStringPref(
+    "browser.newtabpage.activity-stream.feeds.section.topstories.options",
+    ""
+  );
+
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      // Hide Pocket pref so we don't trigger network requests when we reset all preferences
+      [
+        "browser.newtabpage.activity-stream.feeds.section.topstories.options",
+        JSON.stringify(Object.assign({}, JSON.parse(before), { hidden: true })),
+      ],
+      [
+        "browser.newtabpage.activity-stream.discoverystream.endpointSpocsClear",
+        "",
+      ],
+    ],
+  });
+
+  let tab = await BrowserTestUtils.openNewForegroundTab(
+    gBrowser,
+    "about:preferences#home",
+    false
+  );
+  let browser = tab.linkedBrowser;
+
+  await BrowserTestUtils.waitForCondition(
+    () =>
+      SpecialPowers.spawn(
+        browser,
+        [],
+        () =>
+          content.document.getElementById("restoreDefaultHomePageBtn") !== null
+      ),
+    "Wait for the button to be added to the page"
+  );
+
+  await BrowserTestUtils.waitForCondition(
+    () =>
+      SpecialPowers.spawn(
+        browser,
+        [],
+        () =>
+          content.document.querySelector(
+            "[data-subcategory='topsites'] checkbox"
+          ) !== null
+      ),
+    "Wait for the preference checkbox to load"
+  );
+
+  const btnDefault = await SpecialPowers.spawn(
+    browser,
+    [],
+    () =>
+      content.document.getElementById("restoreDefaultHomePageBtn").style
+        .visibility
+  );
+  Assert.equal(
+    btnDefault,
+    "hidden",
+    "When no prefs are changed button should not show up"
+  );
+
+  await BrowserTestUtils.waitForCondition(
+    () =>
+      SpecialPowers.spawn(
+        browser,
+        [],
+        () =>
+          content.document.querySelector(
+            "[data-subcategory='topsites'] checkbox"
+          ).checked
+      ),
+    "Should have checked preference"
+  );
+
+  // Uncheck a pref
+  await SpecialPowers.spawn(browser, [], () =>
+    content.document
+      .querySelector("[data-subcategory='topsites'] checkbox")
+      .click()
+  );
+
+  await BrowserTestUtils.waitForCondition(
+    () =>
+      SpecialPowers.spawn(
+        browser,
+        [],
+        () =>
+          !content.document.querySelector(
+            "[data-subcategory='topsites'] checkbox"
+          ).checked
+      ),
+    "Should have unchecked preference"
+  );
+
+  await BrowserTestUtils.waitForCondition(
+    () =>
+      SpecialPowers.spawn(
+        browser,
+        [],
+        () =>
+          content.document.getElementById("restoreDefaultHomePageBtn").style
+            .visibility === ""
+      ),
+    "Should show the Restore Defaults btn if prefs were changed"
+  );
+
+  // Reset the pref
+  await SpecialPowers.Services.prefs.clearUserPref(
+    "browser.newtabpage.activity-stream.feeds.topsites"
+  );
+
+  await SpecialPowers.popPrefEnv();
+  BrowserTestUtils.removeTab(tab);
+});
diff --git a/browser/components/preferences/tests/browser_https_only_exceptions.js b/browser/components/preferences/tests/browser_https_only_exceptions.js
new file mode 100644
index 0000000000..34534ed5f8
--- /dev/null
+++ b/browser/components/preferences/tests/browser_https_only_exceptions.js
@@ -0,0 +1,377 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+/**
+ * First Test
+ * Checks if buttons are disabled/enabled and visible/hidden correctly.
+ */
+add_task(async function testButtons() {
+  // Let's make sure HTTPS-Only and HTTPS-First Mode is off.
+  await setHttpsOnlyPref("off");
+  await setHttpsFirstPref("off");
+
+  // Open the privacy-pane in about:preferences
+  await openPreferencesViaOpenPreferencesAPI("panePrivacy", {
+    leaveOpen: true,
+  });
+
+  // Get button-element to open the exceptions-dialog
+  const exceptionButton = gBrowser.contentDocument.getElementById(
+    "httpsOnlyExceptionButton"
+  );
+
+  is(
+    exceptionButton.disabled,
+    true,
+    "HTTPS-Only exception button should be disabled when HTTPS-Only Mode is disabled."
+  );
+
+  await setHttpsOnlyPref("private");
+  is(
+    exceptionButton.disabled,
+    false,
+    "HTTPS-Only exception button should be enabled when HTTPS-Only Mode is only enabled in private browsing."
+  );
+
+  await setHttpsOnlyPref("everywhere");
+  is(
+    exceptionButton.disabled,
+    false,
+    "HTTPS-Only exception button should be enabled when HTTPS-Only Mode enabled everywhere."
+  );
+
+  await setHttpsOnlyPref("off");
+  is(
+    exceptionButton.disabled,
+    true,
+    "Turning off HTTPS-Only should disable the exception button again."
+  );
+
+  await setHttpsFirstPref("private");
+  is(
+    exceptionButton.disabled,
+    false,
+    "HTTPS-Only exception button should be enabled when HTTPS-Only Mode is disabled and HTTPS-First Mode is only enabled in private browsing."
+  );
+
+  await setHttpsFirstPref("everywhere");
+  is(
+    exceptionButton.disabled,
+    false,
+    "HTTPS-Only exception button should be enabled when HTTPS-Only Mode is disabled and HTTPS-First Mode enabled everywhere."
+  );
+
+  // Now that the button is clickable, we open the dialog
+  // to check if the correct buttons are visible
+  let promiseSubDialogLoaded = promiseLoadSubDialog(
+    "chrome://browser/content/preferences/dialogs/permissions.xhtml"
+  );
+  exceptionButton.doCommand();
+
+  let win = await promiseSubDialogLoaded;
+
+  const dialogDoc = win.document;
+
+  is(
+    dialogDoc.getElementById("btnBlock").hidden,
+    true,
+    "Block button should not be visible in HTTPS-Only Dialog."
+  );
+  is(
+    dialogDoc.getElementById("btnCookieSession").hidden,
+    true,
+    "Cookie specific allow button should not be visible in HTTPS-Only Dialog."
+  );
+  is(
+    dialogDoc.getElementById("btnAllow").hidden,
+    true,
+    "Allow button should not be visible in HTTPS-Only Dialog."
+  );
+  is(
+    dialogDoc.getElementById("btnHttpsOnlyOff").hidden,
+    false,
+    "HTTPS-Only off button should be visible in HTTPS-Only Dialog."
+  );
+  is(
+    dialogDoc.getElementById("btnHttpsOnlyOffTmp").hidden,
+    false,
+    "HTTPS-Only temporary off button should be visible in HTTPS-Only Dialog."
+  );
+
+  // Reset prefs and close the tab
+  await SpecialPowers.flushPrefEnv();
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+/**
+ * Second Test
+ * Checks permissions are added and removed correctly.
+ *
+ * Each test opens a new dialog, performs an action (second argument),
+ * then closes the dialog and checks if the changes were made (third argument).
+ */
+add_task(async function checkDialogFunctionality() {
+  // Enable HTTPS-Only Mode for every window, so the exceptions dialog is accessible.
+  await setHttpsOnlyPref("everywhere");
+
+  // Open the privacy-pane in about:preferences
+  await openPreferencesViaOpenPreferencesAPI("panePrivacy", {
+    leaveOpen: true,
+  });
+  const preferencesDoc = gBrowser.contentDocument;
+
+  // Test if we can add permanent exceptions
+  await runTest(
+    preferencesDoc,
+    elements => {
+      assertListContents(elements, []);
+
+      elements.url.value = "test.com";
+      elements.btnAllow.doCommand();
+
+      assertListContents(elements, [["http://test.com", elements.allowL10nId]]);
+    },
+    () => [
+      {
+        type: "https-only-load-insecure",
+        origin: "http://test.com",
+        data: "added",
+        capability: Ci.nsIPermissionManager.ALLOW_ACTION,
+        expireType: Ci.nsIPermissionManager.EXPIRE_NEVER,
+      },
+    ]
+  );
+
+  // Test if items are retained, and if temporary exceptions are added correctly
+  await runTest(
+    preferencesDoc,
+    elements => {
+      assertListContents(elements, [["http://test.com", elements.allowL10nId]]);
+
+      elements.url.value = "1.1.1.1:8080";
+      elements.btnAllowSession.doCommand();
+
+      assertListContents(elements, [
+        ["http://test.com", elements.allowL10nId],
+        ["http://1.1.1.1:8080", elements.allowSessionL10nId],
+      ]);
+    },
+    () => [
+      {
+        type: "https-only-load-insecure",
+        origin: "http://1.1.1.1:8080",
+        data: "added",
+        capability: Ci.nsIHttpsOnlyModePermission.LOAD_INSECURE_ALLOW_SESSION,
+        expireType: Ci.nsIPermissionManager.EXPIRE_SESSION,
+      },
+    ]
+  );
+
+  // Test if we can remove the permissions one-by-one
+  await runTest(
+    preferencesDoc,
+    elements => {
+      while (elements.richlistbox.itemCount) {
+        elements.richlistbox.selectedIndex = 0;
+        elements.btnRemove.doCommand();
+      }
+      assertListContents(elements, []);
+    },
+    elements => {
+      let richlistItems = elements.richlistbox.getElementsByAttribute(
+        "origin",
+        "*"
+      );
+      let observances = [];
+      for (let item of richlistItems) {
+        observances.push({
+          type: "https-only-load-insecure",
+          origin: item.getAttribute("origin"),
+          data: "deleted",
+        });
+      }
+      return observances;
+    }
+  );
+
+  // Test if all inputs with an https scheme are added with an http scheme,
+  // while other schemes are kept as they are. (Bug 1757297)
+  await runTest(
+    preferencesDoc,
+    elements => {
+      assertListContents(elements, []);
+
+      elements.url.value = "http://test.com";
+      elements.btnAllow.doCommand();
+
+      assertListContents(elements, [["http://test.com", elements.allowL10nId]]);
+
+      elements.url.value = "https://test.com";
+      elements.btnAllow.doCommand();
+
+      assertListContents(elements, [["http://test.com", elements.allowL10nId]]);
+
+      elements.url.value = "https://test.org";
+      elements.btnAllow.doCommand();
+
+      assertListContents(elements, [
+        ["http://test.com", elements.allowL10nId],
+        ["http://test.org", elements.allowL10nId],
+      ]);
+
+      elements.url.value = "moz-extension://test";
+      elements.btnAllow.doCommand();
+
+      assertListContents(elements, [
+        ["http://test.com", elements.allowL10nId],
+        ["http://test.org", elements.allowL10nId],
+        ["moz-extension://test", elements.allowL10nId],
+      ]);
+    },
+    () => [
+      {
+        type: "https-only-load-insecure",
+        origin: "http://test.com",
+        data: "added",
+        capability: Ci.nsIPermissionManager.ALLOW_ACTION,
+        expireType: Ci.nsIPermissionManager.EXPIRE_NEVER,
+      },
+      {
+        type: "https-only-load-insecure",
+        origin: "http://test.org",
+        data: "added",
+        capability: Ci.nsIPermissionManager.ALLOW_ACTION,
+        expireType: Ci.nsIPermissionManager.EXPIRE_NEVER,
+      },
+      {
+        type: "https-only-load-insecure",
+        origin: "moz-extension://test",
+        data: "added",
+        capability: Ci.nsIPermissionManager.ALLOW_ACTION,
+        expireType: Ci.nsIPermissionManager.EXPIRE_NEVER,
+      },
+    ]
+  );
+
+  // Test if we can remove all permissions at once
+  await runTest(
+    preferencesDoc,
+    elements => {
+      elements.btnRemoveAll.doCommand();
+      assertListContents(elements, []);
+    },
+    elements => {
+      let richlistItems = elements.richlistbox.getElementsByAttribute(
+        "origin",
+        "*"
+      );
+      let observances = [];
+      for (let item of richlistItems) {
+        observances.push({
+          type: "https-only-load-insecure",
+          origin: item.getAttribute("origin"),
+          data: "deleted",
+        });
+      }
+      return observances;
+    }
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+/**
+ * Changes HTTPS-Only Mode pref
+ * @param {string} state "everywhere", "private", "off"
+ */
+async function setHttpsOnlyPref(state) {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["dom.security.https_only_mode", state === "everywhere"],
+      ["dom.security.https_only_mode_pbm", state === "private"],
+    ],
+  });
+}
+
+/**
+ * Changes HTTPS-First Mode pref
+ * @param {string} state "everywhere", "private", "off"
+ */
+async function setHttpsFirstPref(state) {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["dom.security.https_first", state === "everywhere"],
+      ["dom.security.https_first_pbm", state === "private"],
+    ],
+  });
+}
+
+/**
+ * Opens new exceptions dialog, runs test function
+ * @param {HTMLElement} preferencesDoc document of about:preferences tab
+ * @param {function} test function to call when dialog is open
+ * @param {Array} observances permission changes to observe (order is important)
+ */
+async function runTest(preferencesDoc, test, observancesFn) {
+  // Click on exception-button and wait for dialog to open
+  let promiseSubDialogLoaded = promiseLoadSubDialog(
+    "chrome://browser/content/preferences/dialogs/permissions.xhtml"
+  );
+  preferencesDoc.getElementById("httpsOnlyExceptionButton").doCommand();
+
+  let win = await promiseSubDialogLoaded;
+
+  // Create a bunch of references to UI-elements for the test-function
+  const doc = win.document;
+  let elements = {
+    richlistbox: doc.getElementById("permissionsBox"),
+    url: doc.getElementById("url"),
+    btnAllow: doc.getElementById("btnHttpsOnlyOff"),
+    btnAllowSession: doc.getElementById("btnHttpsOnlyOffTmp"),
+    btnRemove: doc.getElementById("removePermission"),
+    btnRemoveAll: doc.getElementById("removeAllPermissions"),
+    allowL10nId: win.gPermissionManager._getCapabilityL10nId(
+      Ci.nsIPermissionManager.ALLOW_ACTION
+    ),
+    allowSessionL10nId: win.gPermissionManager._getCapabilityL10nId(
+      Ci.nsIHttpsOnlyModePermission.LOAD_INSECURE_ALLOW_SESSION
+    ),
+  };
+
+  // Some observances need to be computed based on the current state.
+  const observances = observancesFn(elements);
+
+  // Run test function
+  await test(elements);
+
+  // Click on "Save changes" and wait for permission changes.
+  let btnApplyChanges = doc.querySelector("dialog").getButton("accept");
+  let observeAllPromise = createObserveAllPromise(observances);
+
+  btnApplyChanges.doCommand();
+  await observeAllPromise;
+}
+
+function assertListContents(elements, expected) {
+  is(
+    elements.richlistbox.itemCount,
+    expected.length,
+    "Richlistbox should match the expected amount of exceptions."
+  );
+
+  for (let i = 0; i < expected.length; i++) {
+    let website = expected[i][0];
+    let listItem = elements.richlistbox.getElementsByAttribute(
+      "origin",
+      website
+    );
+    is(listItem.length, 1, "Each origin should be unique");
+    is(
+      listItem[0]
+        .querySelector(".website-capability-value")
+        .getAttribute("data-l10n-id"),
+      expected[i][1],
+      "List item capability should match expected l10n-id"
+    );
+  }
+}
diff --git a/browser/components/preferences/tests/browser_https_only_section.js b/browser/components/preferences/tests/browser_https_only_section.js
new file mode 100644
index 0000000000..a43448adf5
--- /dev/null
+++ b/browser/components/preferences/tests/browser_https_only_section.js
@@ -0,0 +1,74 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+// Bug 1671122 - Fixed bug where second click on HTTPS-Only Mode enable-checkbox disables it again.
+// https://bugzilla.mozilla.org/bug/1671122
+"use strict";
+
+const HTTPS_ONLY_ENABLED = "enabled";
+const HTTPS_ONLY_PBM_ONLY = "privateOnly";
+const HTTPS_ONLY_DISABLED = "disabled";
+
+add_task(async function httpsOnlyRadioGroupIsWorking() {
+  // Make sure HTTPS-Only mode is only enabled for PBM
+
+  registerCleanupFunction(async function () {
+    Services.prefs.clearUserPref("dom.security.https_only_mode");
+    Services.prefs.clearUserPref("dom.security.https_only_mode_pbm");
+  });
+
+  await SpecialPowers.setBoolPref("dom.security.https_only_mode", false);
+  await SpecialPowers.setBoolPref("dom.security.https_only_mode_pbm", true);
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+
+  const doc = gBrowser.selectedBrowser.contentDocument;
+  const radioGroup = doc.getElementById("httpsOnlyRadioGroup");
+  const enableAllRadio = doc.getElementById("httpsOnlyRadioEnabled");
+  const enablePbmRadio = doc.getElementById("httpsOnlyRadioEnabledPBM");
+  const disableRadio = doc.getElementById("httpsOnlyRadioDisabled");
+
+  // Check if UI
+  check(radioGroup, HTTPS_ONLY_PBM_ONLY);
+
+  // Check if UI updated on pref-change
+  await SpecialPowers.setBoolPref("dom.security.https_only_mode_pbm", false);
+  check(radioGroup, HTTPS_ONLY_DISABLED);
+
+  // Check if prefs change if clicked on radio button
+  enableAllRadio.click();
+  check(radioGroup, HTTPS_ONLY_ENABLED);
+
+  // Check if prefs stay the same if clicked on same
+  // radio button again (see bug 1671122)
+  enableAllRadio.click();
+  check(radioGroup, HTTPS_ONLY_ENABLED);
+
+  // Check if prefs are set correctly for PBM-only mode.
+  enablePbmRadio.click();
+  check(radioGroup, HTTPS_ONLY_PBM_ONLY);
+
+  // Check if prefs are set correctly when disabled again.
+  disableRadio.click();
+  check(radioGroup, HTTPS_ONLY_DISABLED);
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+function check(radioGroupElement, expectedValue) {
+  is(
+    radioGroupElement.value,
+    expectedValue,
+    "Radio Group value should match expected value"
+  );
+  is(
+    SpecialPowers.getBoolPref("dom.security.https_only_mode"),
+    expectedValue === HTTPS_ONLY_ENABLED,
+    "HTTPS-Only pref should match expected value."
+  );
+  is(
+    SpecialPowers.getBoolPref("dom.security.https_only_mode_pbm"),
+    expectedValue === HTTPS_ONLY_PBM_ONLY,
+    "HTTPS-Only PBM pref should match expected value."
+  );
+}
diff --git a/browser/components/preferences/tests/browser_ignore_invalid_capability.js b/browser/components/preferences/tests/browser_ignore_invalid_capability.js
new file mode 100644
index 0000000000..35b2679ffc
--- /dev/null
+++ b/browser/components/preferences/tests/browser_ignore_invalid_capability.js
@@ -0,0 +1,40 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+add_task(async function testInvalidCapabilityIgnored() {
+  info(
+    "Test to make sure that invalid combinations of type and capability are ignored \
+     so the cookieExceptions management popup does not crash"
+  );
+  PermissionTestUtils.add(
+    "https://mozilla.org",
+    "cookie",
+    Ci.nsICookiePermission.ACCESS_ALLOW
+  );
+
+  // This is an invalid combination of type & capability and should be ignored
+  PermissionTestUtils.add(
+    "https://foobar.org",
+    "cookie",
+    Ci.nsIHttpsOnlyModePermission.LOAD_INSECURE_ALLOW_SESSION
+  );
+
+  await openPreferencesViaOpenPreferencesAPI("panePrivacy", {
+    leaveOpen: true,
+  });
+  let doc = gBrowser.contentDocument;
+  let promiseSubDialogLoaded = promiseLoadSubDialog(
+    "chrome://browser/content/preferences/dialogs/permissions.xhtml"
+  );
+  doc.getElementById("cookieExceptions").doCommand();
+
+  let win = await promiseSubDialogLoaded;
+  doc = win.document;
+
+  is(
+    doc.getElementById("permissionsBox").itemCount,
+    1,
+    "We only display the permission that is valid for the type cookie"
+  );
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_keyboardfocus.js b/browser/components/preferences/tests/browser_keyboardfocus.js
new file mode 100644
index 0000000000..bed452b679
--- /dev/null
+++ b/browser/components/preferences/tests/browser_keyboardfocus.js
@@ -0,0 +1,80 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+async function launchPreferences() {
+  let prefs = await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  Assert.equal(prefs.selectedPane, "paneGeneral", "General pane was selected");
+}
+
+add_task(async function () {
+  await launchPreferences();
+  let checkbox = gBrowser.contentDocument.querySelector(
+    "#useFullKeyboardNavigation"
+  );
+  Assert.ok(
+    !Services.prefs.getIntPref("accessibility.tabfocus", undefined),
+    "no pref value should exist"
+  );
+  Assert.ok(
+    !checkbox.checked,
+    "checkbox should be unchecked before clicking on checkbox"
+  );
+
+  checkbox.click();
+
+  Assert.equal(
+    Services.prefs.getIntPref("accessibility.tabfocus"),
+    7,
+    "Prefstore should reflect checkbox's associated numeric value"
+  );
+  Assert.ok(
+    checkbox.checked,
+    "checkbox should be checked after clicking on checkbox"
+  );
+
+  checkbox.click();
+
+  Assert.ok(
+    !checkbox.checked,
+    "checkbox should be unchecked after clicking on checkbox"
+  );
+  Assert.ok(
+    !Services.prefs.getIntPref("accessibility.tabfocus", undefined),
+    "No pref value should exist"
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  SpecialPowers.pushPrefEnv({ set: [["accessibility.tabfocus", 4]] });
+  await launchPreferences();
+  checkbox = gBrowser.contentDocument.querySelector(
+    "#useFullKeyboardNavigation"
+  );
+
+  Assert.ok(
+    !checkbox.checked,
+    "checkbox should stay unchecked after setting non-7 pref value"
+  );
+  Assert.equal(
+    Services.prefs.getIntPref("accessibility.tabfocus", 0),
+    4,
+    "pref should have value in store"
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  SpecialPowers.pushPrefEnv({ set: [["accessibility.tabfocus", 7]] });
+  await launchPreferences();
+  checkbox = gBrowser.contentDocument.querySelector(
+    "#useFullKeyboardNavigation"
+  );
+
+  Assert.equal(
+    Services.prefs.getIntPref("accessibility.tabfocus", 0),
+    7,
+    "Pref value should update after modification"
+  );
+  Assert.ok(checkbox.checked, "checkbox should be checked");
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_languages_subdialog.js b/browser/components/preferences/tests/browser_languages_subdialog.js
new file mode 100644
index 0000000000..5be6e5d907
--- /dev/null
+++ b/browser/components/preferences/tests/browser_languages_subdialog.js
@@ -0,0 +1,172 @@
+add_task(async function () {
+  await openPreferencesViaOpenPreferencesAPI("general", { leaveOpen: true });
+  const contentDocument = gBrowser.contentDocument;
+  let dialogOverlay = content.gSubDialog._preloadDialog._overlay;
+
+  async function languagesSubdialogOpened() {
+    const promiseSubDialogLoaded = promiseLoadSubDialog(
+      "chrome://browser/content/preferences/dialogs/languages.xhtml"
+    );
+    contentDocument.getElementById("chooseLanguage").click();
+    const win = await promiseSubDialogLoaded;
+    dialogOverlay = content.gSubDialog._topDialog._overlay;
+    ok(!BrowserTestUtils.isHidden(dialogOverlay), "The dialog is visible.");
+    return win;
+  }
+
+  function acceptLanguagesSubdialog(win) {
+    const button = win.document.querySelector("dialog").getButton("accept");
+    button.doCommand();
+  }
+
+  ok(BrowserTestUtils.isHidden(dialogOverlay), "The dialog is invisible.");
+  let win = await languagesSubdialogOpened();
+  ok(
+    win.document.getElementById("spoofEnglish").hidden,
+    "The 'Request English' checkbox is hidden."
+  );
+  acceptLanguagesSubdialog(win);
+  ok(BrowserTestUtils.isHidden(dialogOverlay), "The dialog is invisible.");
+
+  await SpecialPowers.pushPrefEnv({
+    set: [["intl.accept_languages", "en-US,en-XX,foo"]],
+  });
+  win = await languagesSubdialogOpened();
+  let activeLanguages = win.document.getElementById("activeLanguages").children;
+  Assert.equal(
+    activeLanguages[0].id,
+    "en-us",
+    "The ID for 'en-US' locale code is correctly set."
+  );
+  Assert.equal(
+    activeLanguages[0].firstChild.value,
+    "English (United States) [en-us]",
+    "The name for known 'en-US' locale code is correctly resolved."
+  );
+  Assert.equal(
+    activeLanguages[1].id,
+    "en-xx",
+    "The ID for 'en-XX' locale code is correctly set."
+  );
+  Assert.equal(
+    activeLanguages[1].firstChild.value,
+    "English [en-xx]",
+    "The name for unknown 'en-XX' locale code is resolved using 'en'."
+  );
+  Assert.equal(
+    activeLanguages[2].firstChild.value,
+    " [foo]",
+    "The name for unknown 'foo' locale code is empty."
+  );
+  acceptLanguagesSubdialog(win);
+  await SpecialPowers.popPrefEnv();
+
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["privacy.resistFingerprinting", true],
+      ["privacy.spoof_english", 0],
+    ],
+  });
+
+  win = await languagesSubdialogOpened();
+  ok(
+    !win.document.getElementById("spoofEnglish").hidden,
+    "The 'Request English' checkbox isn't hidden."
+  );
+  ok(
+    !win.document.getElementById("spoofEnglish").checked,
+    "The 'Request English' checkbox isn't checked."
+  );
+  is(
+    win.Preferences.get("privacy.spoof_english").value,
+    0,
+    "The privacy.spoof_english pref is set to 0."
+  );
+
+  win.document.getElementById("spoofEnglish").checked = true;
+  win.document.getElementById("spoofEnglish").doCommand();
+  ok(
+    win.document.getElementById("spoofEnglish").checked,
+    "The 'Request English' checkbox is checked."
+  );
+  is(
+    win.Preferences.get("privacy.spoof_english").value,
+    2,
+    "The privacy.spoof_english pref is set to 2."
+  );
+  acceptLanguagesSubdialog(win);
+
+  win = await languagesSubdialogOpened();
+  ok(
+    !win.document.getElementById("spoofEnglish").hidden,
+    "The 'Request English' checkbox isn't hidden."
+  );
+  ok(
+    win.document.getElementById("spoofEnglish").checked,
+    "The 'Request English' checkbox is checked."
+  );
+  is(
+    win.Preferences.get("privacy.spoof_english").value,
+    2,
+    "The privacy.spoof_english pref is set to 2."
+  );
+
+  win.document.getElementById("spoofEnglish").checked = false;
+  win.document.getElementById("spoofEnglish").doCommand();
+  ok(
+    !win.document.getElementById("spoofEnglish").checked,
+    "The 'Request English' checkbox isn't checked."
+  );
+  is(
+    win.Preferences.get("privacy.spoof_english").value,
+    1,
+    "The privacy.spoof_english pref is set to 1."
+  );
+  acceptLanguagesSubdialog(win);
+
+  win = await languagesSubdialogOpened();
+  ok(
+    !win.document.getElementById("spoofEnglish").hidden,
+    "The 'Request English' checkbox isn't hidden."
+  );
+  ok(
+    !win.document.getElementById("spoofEnglish").checked,
+    "The 'Request English' checkbox isn't checked."
+  );
+  is(
+    win.Preferences.get("privacy.spoof_english").value,
+    1,
+    "The privacy.spoof_english pref is set to 1."
+  );
+  acceptLanguagesSubdialog(win);
+  await SpecialPowers.popPrefEnv();
+
+  await SpecialPowers.pushPrefEnv({
+    set: [["intl.accept_languages", "en-US"]],
+  });
+  win = await languagesSubdialogOpened();
+  is(
+    win.document.getElementById("remove").disabled,
+    false,
+    "The Remove button is enabled when any language is selected on the list"
+  );
+
+  win.document.getElementById("remove").doCommand();
+  is(
+    win.Preferences.get("intl.accept_languages").value,
+    "",
+    "Accepted language has been removed from the preference"
+  );
+  is(
+    win.document.getElementById("activeLanguages").itemCount,
+    0,
+    "Accepted languages list is empty"
+  );
+  ok(
+    win.document.getElementById("remove").disabled,
+    "The Remove button is disabled when there is no language on the list"
+  );
+  acceptLanguagesSubdialog(win);
+
+  gBrowser.removeCurrentTab();
+});
diff --git a/browser/components/preferences/tests/browser_layersacceleration.js b/browser/components/preferences/tests/browser_layersacceleration.js
new file mode 100644
index 0000000000..982a32c94d
--- /dev/null
+++ b/browser/components/preferences/tests/browser_layersacceleration.js
@@ -0,0 +1,36 @@
+add_task(async function () {
+  // We must temporarily disable `Once` StaticPrefs check for the duration of
+  // this test (see bug 1556131). We must do so in a separate operation as
+  // pushPrefEnv doesn't set the preferences in the order one could expect.
+  await SpecialPowers.pushPrefEnv({
+    set: [["preferences.force-disable.check.once.policy", true]],
+  });
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["gfx.direct2d.disabled", false],
+      ["layers.acceleration.disabled", false],
+    ],
+  });
+
+  let prefs = await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  is(prefs.selectedPane, "paneGeneral", "General pane was selected");
+
+  let doc = gBrowser.contentDocument;
+  let checkbox = doc.querySelector("#allowHWAccel");
+  is(
+    !checkbox.checked,
+    Services.prefs.getBoolPref("layers.acceleration.disabled"),
+    "checkbox should represent inverted pref value before clicking on checkbox"
+  );
+
+  checkbox.click();
+
+  is(
+    !checkbox.checked,
+    Services.prefs.getBoolPref("layers.acceleration.disabled"),
+    "checkbox should represent inverted pref value after clicking on checkbox"
+  );
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_localSearchShortcuts.js b/browser/components/preferences/tests/browser_localSearchShortcuts.js
new file mode 100644
index 0000000000..0b8e170cc1
--- /dev/null
+++ b/browser/components/preferences/tests/browser_localSearchShortcuts.js
@@ -0,0 +1,309 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+/**
+ * Checks the local shortcut rows in the engines list of the search pane.
+ */
+
+"use strict";
+
+ChromeUtils.defineESModuleGetters(this, {
+  UrlbarPrefs: "resource:///modules/UrlbarPrefs.sys.mjs",
+  UrlbarUtils: "resource:///modules/UrlbarUtils.sys.mjs",
+});
+
+let gTree;
+
+add_setup(async function () {
+  let prefs = await openPreferencesViaOpenPreferencesAPI("search", {
+    leaveOpen: true,
+  });
+  registerCleanupFunction(() => {
+    BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  });
+
+  Assert.equal(
+    prefs.selectedPane,
+    "paneSearch",
+    "Sanity check: Search pane is selected by default"
+  );
+
+  gTree = gBrowser.contentDocument.querySelector("#engineList");
+  gTree.scrollIntoView();
+  gTree.focus();
+});
+
+// The rows should be visible and checked by default.
+add_task(async function visible() {
+  await checkRowVisibility(true);
+  await forEachLocalShortcutRow(async (row, shortcut) => {
+    Assert.equal(
+      gTree.view.getCellValue(row, gTree.columns.getNamedColumn("engineShown")),
+      "true",
+      "Row is checked initially"
+    );
+  });
+});
+
+// Toggling the browser.urlbar.shortcuts.* prefs should toggle the corresponding
+// checkboxes in the rows.
+add_task(async function syncFromPrefs() {
+  let col = gTree.columns.getNamedColumn("engineShown");
+  await forEachLocalShortcutRow(async (row, shortcut) => {
+    Assert.equal(
+      gTree.view.getCellValue(row, col),
+      "true",
+      "Row is checked initially"
+    );
+    await SpecialPowers.pushPrefEnv({
+      set: [[getUrlbarPrefName(shortcut.pref), false]],
+    });
+    Assert.equal(
+      gTree.view.getCellValue(row, col),
+      "false",
+      "Row is unchecked after disabling pref"
+    );
+    await SpecialPowers.popPrefEnv();
+    Assert.equal(
+      gTree.view.getCellValue(row, col),
+      "true",
+      "Row is checked after re-enabling pref"
+    );
+  });
+});
+
+// Pressing the space key while a row is selected should toggle its checkbox
+// and pref.
+add_task(async function syncToPrefs_spaceKey() {
+  let col = gTree.columns.getNamedColumn("engineShown");
+  await forEachLocalShortcutRow(async (row, shortcut) => {
+    Assert.ok(
+      UrlbarPrefs.get(shortcut.pref),
+      "Sanity check: Pref is enabled initially"
+    );
+    Assert.equal(
+      gTree.view.getCellValue(row, col),
+      "true",
+      "Row is checked initially"
+    );
+    gTree.view.selection.select(row);
+    EventUtils.synthesizeKey(" ", {}, gTree.ownerGlobal);
+    Assert.ok(
+      !UrlbarPrefs.get(shortcut.pref),
+      "Pref is disabled after pressing space key"
+    );
+    Assert.equal(
+      gTree.view.getCellValue(row, col),
+      "false",
+      "Row is unchecked after pressing space key"
+    );
+    Services.prefs.clearUserPref(getUrlbarPrefName(shortcut.pref));
+  });
+});
+
+// Clicking the checkbox in a local shortcut row should toggle the checkbox and
+// pref.
+add_task(async function syncToPrefs_click() {
+  let col = gTree.columns.getNamedColumn("engineShown");
+  await forEachLocalShortcutRow(async (row, shortcut) => {
+    Assert.ok(
+      UrlbarPrefs.get(shortcut.pref),
+      "Sanity check: Pref is enabled initially"
+    );
+    Assert.equal(
+      gTree.view.getCellValue(row, col),
+      "true",
+      "Row is checked initially"
+    );
+
+    let rect = gTree.getCoordsForCellItem(row, col, "cell");
+    let x = rect.x + rect.width / 2;
+    let y = rect.y + rect.height / 2;
+    EventUtils.synthesizeMouse(gTree.body, x, y, {}, gTree.ownerGlobal);
+
+    Assert.ok(
+      !UrlbarPrefs.get(shortcut.pref),
+      "Pref is disabled after clicking checkbox"
+    );
+    Assert.equal(
+      gTree.view.getCellValue(row, col),
+      "false",
+      "Row is unchecked after clicking checkbox"
+    );
+    Services.prefs.clearUserPref(getUrlbarPrefName(shortcut.pref));
+  });
+});
+
+// The keyword column should not be editable according to isEditable().
+add_task(async function keywordNotEditable_isEditable() {
+  await forEachLocalShortcutRow(async (row, shortcut) => {
+    Assert.ok(
+      !gTree.view.isEditable(
+        row,
+        gTree.columns.getNamedColumn("engineKeyword")
+      ),
+      "Keyword column is not editable"
+    );
+  });
+});
+
+// Pressing the enter key while a row is selected shouldn't allow the keyword to
+// be edited.
+add_task(async function keywordNotEditable_enterKey() {
+  let col = gTree.columns.getNamedColumn("engineKeyword");
+  await forEachLocalShortcutRow(async (row, shortcut) => {
+    Assert.ok(
+      shortcut.restrict,
+      "Sanity check: Shortcut restriction char is non-empty"
+    );
+    Assert.equal(
+      gTree.view.getCellText(row, col),
+      shortcut.restrict,
+      "Sanity check: Keyword column has correct restriction char initially"
+    );
+
+    gTree.view.selection.select(row);
+    EventUtils.synthesizeKey("KEY_Enter", {}, gTree.ownerGlobal);
+    EventUtils.sendString("newkeyword");
+    EventUtils.synthesizeKey("KEY_Enter", {}, gTree.ownerGlobal);
+
+    // Wait a moment to allow for any possible asynchronicity.
+    // eslint-disable-next-line mozilla/no-arbitrary-setTimeout
+    await new Promise(r => setTimeout(r, 500));
+
+    Assert.equal(
+      gTree.view.getCellText(row, col),
+      shortcut.restrict,
+      "Keyword column is still restriction char"
+    );
+  });
+});
+
+// Double-clicking the keyword column shouldn't allow the keyword to be edited.
+add_task(async function keywordNotEditable_click() {
+  let col = gTree.columns.getNamedColumn("engineKeyword");
+  await forEachLocalShortcutRow(async (row, shortcut) => {
+    Assert.ok(
+      shortcut.restrict,
+      "Sanity check: Shortcut restriction char is non-empty"
+    );
+    Assert.equal(
+      gTree.view.getCellText(row, col),
+      shortcut.restrict,
+      "Sanity check: Keyword column has correct restriction char initially"
+    );
+
+    let rect = gTree.getCoordsForCellItem(row, col, "text");
+    let x = rect.x + rect.width / 2;
+    let y = rect.y + rect.height / 2;
+
+    let promise = BrowserTestUtils.waitForEvent(gTree, "dblclick");
+
+    // Click once to select the row.
+    EventUtils.synthesizeMouse(
+      gTree.body,
+      x,
+      y,
+      { clickCount: 1 },
+      gTree.ownerGlobal
+    );
+
+    // Now double-click the keyword column.
+    EventUtils.synthesizeMouse(
+      gTree.body,
+      x,
+      y,
+      { clickCount: 2 },
+      gTree.ownerGlobal
+    );
+
+    await promise;
+
+    EventUtils.sendString("newkeyword");
+    EventUtils.synthesizeKey("KEY_Enter", {}, gTree.ownerGlobal);
+
+    // Wait a moment to allow for any possible asynchronicity.
+    // eslint-disable-next-line mozilla/no-arbitrary-setTimeout
+    await new Promise(r => setTimeout(r, 500));
+
+    Assert.equal(
+      gTree.view.getCellText(row, col),
+      shortcut.restrict,
+      "Keyword column is still restriction char"
+    );
+  });
+});
+
+/**
+ * Asserts that the engine and local shortcut rows are present in the tree.
+ */
+async function checkRowVisibility() {
+  let engines = await Services.search.getVisibleEngines();
+
+  Assert.equal(
+    gTree.view.rowCount,
+    engines.length + UrlbarUtils.LOCAL_SEARCH_MODES.length,
+    "Expected number of tree rows"
+  );
+
+  // Check the engine rows.
+  for (let row = 0; row < engines.length; row++) {
+    let engine = engines[row];
+    let text = gTree.view.getCellText(
+      row,
+      gTree.columns.getNamedColumn("engineName")
+    );
+    Assert.equal(
+      text,
+      engine.name,
+      `Sanity check: Tree row ${row} has expected engine name`
+    );
+  }
+
+  // Check the shortcut rows.
+  await forEachLocalShortcutRow(async (row, shortcut) => {
+    let text = gTree.view.getCellText(
+      row,
+      gTree.columns.getNamedColumn("engineName")
+    );
+    let name = UrlbarUtils.getResultSourceName(shortcut.source);
+    let l10nName = await gTree.ownerDocument.l10n.formatValue(
+      `urlbar-search-mode-${name}`
+    );
+    Assert.ok(l10nName, "Sanity check: l10n name is non-empty");
+    Assert.equal(text, l10nName, `Tree row ${row} has expected shortcut name`);
+  });
+}
+
+/**
+ * Calls a callback for each local shortcut row in the tree.
+ *
+ * @param {function} callback
+ *   Called for each local shortcut row like: callback(rowIndex, shortcutObject)
+ */
+async function forEachLocalShortcutRow(callback) {
+  let engines = await Services.search.getVisibleEngines();
+  for (let i = 0; i < UrlbarUtils.LOCAL_SEARCH_MODES.length; i++) {
+    let shortcut = UrlbarUtils.LOCAL_SEARCH_MODES[i];
+    let row = engines.length + i;
+    // These tests assume LOCAL_SEARCH_MODES are enabled, this can be removed
+    // when we enable QuickActions. We cant just enable the pref in browser.ini
+    // as this test calls clearUserPref.
+    if (shortcut.pref == "shortcuts.quickactions") {
+      continue;
+    }
+    await callback(row, shortcut);
+  }
+}
+
+/**
+ * Prepends the `browser.urlbar.` branch to the given relative pref.
+ *
+ * @param {string} relativePref
+ *   A pref name relative to the `browser.urlbar.`.
+ * @returns {string}
+ *   The full pref name with `browser.urlbar.` prepended.
+ */
+function getUrlbarPrefName(relativePref) {
+  return `browser.urlbar.${relativePref}`;
+}
diff --git a/browser/components/preferences/tests/browser_moreFromMozilla.js b/browser/components/preferences/tests/browser_moreFromMozilla.js
new file mode 100644
index 0000000000..6cb6d9e119
--- /dev/null
+++ b/browser/components/preferences/tests/browser_moreFromMozilla.js
@@ -0,0 +1,395 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+const { EnterprisePolicyTesting } = ChromeUtils.importESModule(
+  "resource://testing-common/EnterprisePolicyTesting.sys.mjs"
+);
+
+let { TelemetryTestUtils } = ChromeUtils.importESModule(
+  "resource://testing-common/TelemetryTestUtils.sys.mjs"
+);
+
+const TOTAL_PROMO_CARDS_COUNT = 4;
+
+async function clearPolicies() {
+  // Ensure no active policies are set
+  await EnterprisePolicyTesting.setupPolicyEngineWithJson("");
+}
+
+// The Relay promo is only shown if the default FxA instance is detected, and
+// tests override it to a dummy address, so we need to make the dummy address
+// appear like it's the default (using the actual default instance might cause a
+// remote connection, crashing the test harness).
+add_setup(mockDefaultFxAInstance);
+
+add_task(async function testDefaultUIWithoutTemplatePref() {
+  await clearPolicies();
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  let doc = gBrowser.contentDocument;
+  let tab = gBrowser.selectedTab;
+
+  let moreFromMozillaCategory = doc.getElementById(
+    "category-more-from-mozilla"
+  );
+  ok(moreFromMozillaCategory, "The category exists");
+  ok(!moreFromMozillaCategory.hidden, "The category is not hidden");
+
+  moreFromMozillaCategory.click();
+
+  let productCards = doc.querySelectorAll(".mozilla-product-item.simple");
+  Assert.ok(productCards, "Default UI uses simple template");
+  Assert.equal(
+    productCards.length,
+    TOTAL_PROMO_CARDS_COUNT,
+    "All product cards displayed"
+  );
+
+  const expectedUrl = "https://www.mozilla.org/firefox/browsers/mobile/";
+  let tabOpened = BrowserTestUtils.waitForNewTab(gBrowser, url =>
+    url.startsWith(expectedUrl)
+  );
+  let mobileLink = doc.getElementById("default-fxMobile");
+  mobileLink.click();
+  let openedTab = await tabOpened;
+  Assert.ok(gBrowser.selectedBrowser.documentURI.spec.startsWith(expectedUrl));
+
+  let searchParams = new URL(gBrowser.selectedBrowser.documentURI.spec)
+    .searchParams;
+  Assert.equal(
+    searchParams.get("utm_source"),
+    "about-prefs",
+    "expected utm_source sent"
+  );
+  Assert.equal(
+    searchParams.get("utm_campaign"),
+    "morefrommozilla",
+    "utm_campaign set"
+  );
+  Assert.equal(
+    searchParams.get("utm_medium"),
+    "firefox-desktop",
+    "utm_medium set"
+  );
+  Assert.equal(
+    searchParams.get("utm_content"),
+    "default-global",
+    "default utm_content set"
+  );
+  Assert.ok(
+    !searchParams.has("entrypoint_variation"),
+    "entrypoint_variation should not be set"
+  );
+  Assert.ok(
+    !searchParams.has("entrypoint_experiment"),
+    "entrypoint_experiment should not be set"
+  );
+  BrowserTestUtils.removeTab(openedTab);
+  BrowserTestUtils.removeTab(tab);
+});
+
+add_task(async function testDefaulEmailClick() {
+  await clearPolicies();
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  let doc = gBrowser.contentDocument;
+  let tab = gBrowser.selectedTab;
+
+  let moreFromMozillaCategory = doc.getElementById(
+    "category-more-from-mozilla"
+  );
+  moreFromMozillaCategory.click();
+
+  const expectedUrl = "https://www.mozilla.org/firefox/mobile/get-app/?v=mfm";
+  let sendEmailLink = doc.getElementById("default-qr-code-send-email");
+
+  Assert.ok(
+    sendEmailLink.href.startsWith(expectedUrl),
+    `Expected URL ${sendEmailLink.href}`
+  );
+
+  let searchParams = new URL(sendEmailLink.href).searchParams;
+  Assert.equal(searchParams.get("v"), "mfm", "expected send email param set");
+  BrowserTestUtils.removeTab(tab);
+});
+
+/**
+ * Test that we don't show moreFromMozilla pane when it's disabled.
+ */
+add_task(async function testwhenPrefDisabled() {
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.preferences.moreFromMozilla", false]],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  let doc = gBrowser.contentDocument;
+
+  let moreFromMozillaCategory = doc.getElementById(
+    "category-more-from-mozilla"
+  );
+  ok(moreFromMozillaCategory, "The category exists");
+  ok(moreFromMozillaCategory.hidden, "The category is hidden");
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function test_aboutpreferences_event_telemetry() {
+  Services.telemetry.clearEvents();
+  Services.telemetry.setEventRecordingEnabled("aboutpreferences", true);
+
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.preferences.moreFromMozilla", true]],
+  });
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+
+  let doc = gBrowser.contentDocument;
+  let moreFromMozillaCategory = doc.getElementById(
+    "category-more-from-mozilla"
+  );
+
+  let clickedPromise = BrowserTestUtils.waitForEvent(
+    moreFromMozillaCategory,
+    "click"
+  );
+  moreFromMozillaCategory.click();
+  await clickedPromise;
+
+  TelemetryTestUtils.assertEvents(
+    [["aboutpreferences", "show", "initial", "paneGeneral"]],
+    { category: "aboutpreferences", method: "show", object: "initial" },
+    { clear: false }
+  );
+  TelemetryTestUtils.assertEvents(
+    [["aboutpreferences", "show", "click", "paneMoreFromMozilla"]],
+    { category: "aboutpreferences", method: "show", object: "click" },
+    { clear: false }
+  );
+  TelemetryTestUtils.assertNumberOfEvents(2);
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function test_aboutpreferences_simple_template() {
+  await clearPolicies();
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.preferences.moreFromMozilla", true],
+      ["browser.preferences.moreFromMozilla.template", "simple"],
+    ],
+  });
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+
+  let doc = gBrowser.contentDocument;
+  let moreFromMozillaCategory = doc.getElementById(
+    "category-more-from-mozilla"
+  );
+
+  moreFromMozillaCategory.click();
+
+  let productCards = doc.querySelectorAll(".mozilla-product-item");
+  Assert.ok(productCards, "The product cards from simple template found");
+  Assert.equal(
+    productCards.length,
+    TOTAL_PROMO_CARDS_COUNT,
+    "All product cards displayed"
+  );
+
+  let qrCodeButtons = doc.querySelectorAll('.qr-code-box[hidden="false"]');
+  Assert.equal(qrCodeButtons.length, 1, "1 qr-code box displayed");
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function test_aboutpreferences_clickBtnVPN() {
+  await clearPolicies();
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.preferences.moreFromMozilla", true],
+      ["browser.preferences.moreFromMozilla.template", "simple"],
+    ],
+  });
+  await openPreferencesViaOpenPreferencesAPI("paneMoreFromMozilla", {
+    leaveOpen: true,
+  });
+
+  let doc = gBrowser.contentDocument;
+  let tab = gBrowser.selectedTab;
+
+  let productCards = doc.querySelectorAll(".mozilla-product-item.simple");
+  Assert.ok(productCards, "Simple template loaded");
+
+  const expectedUrl = "https://www.mozilla.org/products/vpn/";
+  let tabOpened = BrowserTestUtils.waitForNewTab(gBrowser, url =>
+    url.startsWith(expectedUrl)
+  );
+
+  let vpnButton = doc.getElementById("simple-mozillaVPN");
+  vpnButton.click();
+
+  let openedTab = await tabOpened;
+  Assert.ok(gBrowser.selectedBrowser.documentURI.spec.startsWith(expectedUrl));
+
+  let searchParams = new URL(gBrowser.selectedBrowser.documentURI.spec)
+    .searchParams;
+  Assert.equal(
+    searchParams.get("utm_source"),
+    "about-prefs",
+    "expected utm_source sent"
+  );
+  Assert.equal(
+    searchParams.get("utm_campaign"),
+    "morefrommozilla",
+    "utm_campaign set"
+  );
+  Assert.equal(
+    searchParams.get("utm_medium"),
+    "firefox-desktop",
+    "utm_medium set"
+  );
+  Assert.equal(
+    searchParams.get("utm_content"),
+    "fxvt-113-a-global",
+    "utm_content set"
+  );
+  Assert.equal(
+    searchParams.get("entrypoint_experiment"),
+    "morefrommozilla-experiment-1846",
+    "entrypoint_experiment set"
+  );
+  Assert.equal(
+    searchParams.get("entrypoint_variation"),
+    "treatment-simple",
+    "entrypoint_variation set"
+  );
+  BrowserTestUtils.removeTab(openedTab);
+  BrowserTestUtils.removeTab(tab);
+});
+
+add_task(async function test_aboutpreferences_clickBtnMobile() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.preferences.moreFromMozilla", true],
+      ["browser.preferences.moreFromMozilla.template", "simple"],
+    ],
+  });
+  await openPreferencesViaOpenPreferencesAPI("paneMoreFromMozilla", {
+    leaveOpen: true,
+  });
+
+  let doc = gBrowser.contentDocument;
+  let tab = gBrowser.selectedTab;
+
+  let productCards = doc.querySelectorAll("vbox.simple");
+  Assert.ok(productCards, "Simple template loaded");
+
+  const expectedUrl = "https://www.mozilla.org/firefox/browsers/mobile/";
+
+  let mobileUrl = new URL(doc.getElementById("simple-fxMobile").href);
+
+  Assert.ok(mobileUrl.href.startsWith(expectedUrl));
+
+  let searchParams = mobileUrl.searchParams;
+  Assert.equal(
+    searchParams.get("utm_source"),
+    "about-prefs",
+    "expected utm_source sent"
+  );
+  Assert.equal(
+    searchParams.get("utm_campaign"),
+    "morefrommozilla",
+    "utm_campaign set"
+  );
+  Assert.equal(
+    searchParams.get("utm_medium"),
+    "firefox-desktop",
+    "utm_medium set"
+  );
+  Assert.equal(
+    searchParams.get("utm_content"),
+    "fxvt-113-a-global",
+    "default-global",
+    "utm_content set"
+  );
+
+  BrowserTestUtils.removeTab(tab);
+});
+
+add_task(async function test_aboutpreferences_search() {
+  await clearPolicies();
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.preferences.moreFromMozilla", true]],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI(null, {
+    leaveOpen: true,
+  });
+
+  await runSearchInput("Relay");
+
+  let doc = gBrowser.contentDocument;
+  let tab = gBrowser.selectedTab;
+
+  let productCards = doc.querySelectorAll(".mozilla-product-item");
+  Assert.equal(
+    productCards.length,
+    TOTAL_PROMO_CARDS_COUNT,
+    "All products in the group are found"
+  );
+  let [mobile, monitor, vpn, relay] = productCards;
+  Assert.ok(BrowserTestUtils.isHidden(mobile), "Mobile hidden");
+  Assert.ok(BrowserTestUtils.isHidden(monitor), "Monitor hidden");
+  Assert.ok(BrowserTestUtils.isHidden(vpn), "VPN hidden");
+  Assert.ok(BrowserTestUtils.isVisible(relay), "Relay shown");
+
+  BrowserTestUtils.removeTab(tab);
+});
+
+add_task(async function test_aboutpreferences_clickBtnRelay() {
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.preferences.moreFromMozilla", true]],
+  });
+  await openPreferencesViaOpenPreferencesAPI("paneMoreFromMozilla", {
+    leaveOpen: true,
+  });
+
+  let doc = gBrowser.contentDocument;
+  let tab = gBrowser.selectedTab;
+
+  let expectedUrl = new URL("https://relay.firefox.com");
+  expectedUrl.searchParams.set("utm_source", "about-prefs");
+  expectedUrl.searchParams.set("utm_campaign", "morefrommozilla");
+  expectedUrl.searchParams.set("utm_medium", "firefox-desktop");
+  expectedUrl.searchParams.set("utm_content", "fxvt-113-a-global");
+  expectedUrl.searchParams.set(
+    "entrypoint_experiment",
+    "morefrommozilla-experiment-1846"
+  );
+  expectedUrl.searchParams.set("entrypoint_variation", "treatment-simple");
+
+  let tabOpened = BrowserTestUtils.waitForDocLoadAndStopIt(
+    expectedUrl.toString(),
+    gBrowser,
+    channel => {
+      Assert.equal(
+        channel.originalURI.spec,
+        expectedUrl.toString(),
+        "URL matched"
+      );
+      return true;
+    }
+  );
+  doc.getElementById("simple-firefoxRelay").click();
+
+  await tabOpened;
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  BrowserTestUtils.removeTab(tab);
+});
diff --git a/browser/components/preferences/tests/browser_moreFromMozilla_locales.js b/browser/components/preferences/tests/browser_moreFromMozilla_locales.js
new file mode 100644
index 0000000000..348fd155a0
--- /dev/null
+++ b/browser/components/preferences/tests/browser_moreFromMozilla_locales.js
@@ -0,0 +1,371 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+const { EnterprisePolicyTesting } = ChromeUtils.importESModule(
+  "resource://testing-common/EnterprisePolicyTesting.sys.mjs"
+);
+
+let { Region } = ChromeUtils.importESModule(
+  "resource://gre/modules/Region.sys.mjs"
+);
+
+const initialHomeRegion = Region._home;
+const initialCurrentRegion = Region._current;
+
+// Helper to run tests for specific regions
+async function setupRegions(home, current) {
+  Region._setHomeRegion(home || "");
+  Region._setCurrentRegion(current || "");
+}
+
+function setLocale(language) {
+  Services.locale.availableLocales = [language];
+  Services.locale.requestedLocales = [language];
+}
+
+async function clearPolicies() {
+  // Ensure no active policies are set
+  await EnterprisePolicyTesting.setupPolicyEngineWithJson("");
+}
+
+async function getPromoCards() {
+  await openPreferencesViaOpenPreferencesAPI("paneMoreFromMozilla", {
+    leaveOpen: true,
+  });
+
+  let doc = gBrowser.contentDocument;
+  let vpnPromoCard = doc.getElementById("mozilla-vpn");
+  let monitorPromoCard = doc.getElementById("mozilla-monitor");
+  let mobileCard = doc.getElementById("firefox-mobile");
+  let relayPromoCard = doc.getElementById("firefox-relay");
+
+  return {
+    vpnPromoCard,
+    monitorPromoCard,
+    mobileCard,
+    relayPromoCard,
+  };
+}
+
+let mockFxA, unmockFxA;
+
+// The Relay promo is only shown if the default FxA instance is detected, and
+// tests override it to a dummy address, so we need to make the dummy address
+// appear like it's the default (using the actual default instance might cause a
+// remote connection, crashing the test harness).
+add_setup(async function () {
+  let { mock, unmock } = await mockDefaultFxAInstance();
+  mockFxA = mock;
+  unmockFxA = unmock;
+});
+
+add_task(async function test_VPN_promo_enabled() {
+  await clearPolicies();
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.preferences.moreFromMozilla", true],
+      ["browser.vpn_promo.enabled", true],
+    ],
+  });
+
+  let { vpnPromoCard, mobileCard } = await getPromoCards();
+
+  ok(vpnPromoCard, "The VPN promo is visible");
+  ok(mobileCard, "The Mobile promo is visible");
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function test_VPN_promo_disabled() {
+  await clearPolicies();
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.vpn_promo.enabled", false]],
+  });
+
+  let { vpnPromoCard, mobileCard } = await getPromoCards();
+
+  ok(!vpnPromoCard, "The VPN promo is not visible");
+  ok(mobileCard, "The Mobile promo is visible");
+
+  Services.prefs.clearUserPref("browser.vpn_promo.enabled");
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function test_VPN_promo_in_disallowed_home_region() {
+  await clearPolicies();
+  const disallowedRegion = "SY";
+
+  setupRegions(disallowedRegion);
+
+  // Promo should not show in disallowed regions even when vpn_promo pref is enabled
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.vpn_promo.enabled", true]],
+  });
+
+  let { vpnPromoCard, mobileCard } = await getPromoCards();
+
+  ok(!vpnPromoCard, "The VPN promo is not visible");
+  ok(mobileCard, "The Mobile promo is visible");
+
+  setupRegions(initialHomeRegion, initialCurrentRegion); // revert changes to regions
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function test_VPN_promo_in_illegal_home_region() {
+  await clearPolicies();
+  const illegalRegion = "CN";
+
+  setupRegions(illegalRegion);
+
+  // Promo should not show in illegal regions even if the list of disallowed regions is somehow altered (though changing this preference is blocked)
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.vpn_promo.disallowedRegions", "SY, CU"]],
+  });
+
+  let { vpnPromoCard, mobileCard } = await getPromoCards();
+
+  ok(!vpnPromoCard, "The VPN promo is not visible");
+  ok(mobileCard, "The Mobile promo is visible");
+
+  setupRegions(initialHomeRegion, initialCurrentRegion); // revert changes to regions
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function test_VPN_promo_in_disallowed_current_region() {
+  await clearPolicies();
+  const allowedRegion = "US";
+  const disallowedRegion = "SY";
+
+  setupRegions(allowedRegion, disallowedRegion);
+
+  // Promo should not show in disallowed regions even when vpn_promo pref is enabled
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.vpn_promo.enabled", true]],
+  });
+
+  let { vpnPromoCard, mobileCard } = await getPromoCards();
+
+  ok(!vpnPromoCard, "The VPN promo is not visible");
+  ok(mobileCard, "The Mobile promo is visible");
+
+  setupRegions(initialHomeRegion, initialCurrentRegion); // revert changes to regions
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function test_VPN_promo_in_illegal_current_region() {
+  await clearPolicies();
+  const allowedRegion = "US";
+  const illegalRegion = "CN";
+
+  setupRegions(allowedRegion, illegalRegion);
+
+  // Promo should not show in illegal regions even if the list of disallowed regions is somehow altered (though changing this preference is blocked)
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.vpn_promo.disallowedRegions", "SY, CU"]],
+  });
+
+  let { vpnPromoCard, mobileCard } = await getPromoCards();
+
+  ok(!vpnPromoCard, "The VPN promo is not visible");
+  ok(mobileCard, "The Mobile promo is visible");
+
+  setupRegions(initialHomeRegion, initialCurrentRegion); // revert changes to regions
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function test_aboutpreferences_partnerCNRepack() {
+  let defaultBranch = Services.prefs.getDefaultBranch(null);
+  defaultBranch.setCharPref("distribution.id", "MozillaOnline");
+
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.preferences.moreFromMozilla", true],
+      ["browser.preferences.moreFromMozilla.template", "simple"],
+    ],
+  });
+  await openPreferencesViaOpenPreferencesAPI("paneMoreFromMozilla", {
+    leaveOpen: true,
+  });
+
+  let doc = gBrowser.contentDocument;
+  let tab = gBrowser.selectedTab;
+
+  let productCards = doc.querySelectorAll("vbox.simple");
+  Assert.ok(productCards, "Simple template loaded");
+
+  const expectedUrl = "https://www.firefox.com.cn/browsers/mobile/";
+
+  let link = doc.getElementById("simple-fxMobile");
+  Assert.ok(link.getAttribute("href").startsWith(expectedUrl));
+
+  defaultBranch.setCharPref("distribution.id", "");
+  BrowserTestUtils.removeTab(tab);
+});
+
+add_task(async function test_send_to_device_email_link_for_supported_locale() {
+  // Email is supported for Brazilian Portuguese
+  const supportedLocale = "pt-BR";
+  const initialLocale = Services.locale.appLocaleAsBCP47;
+  setLocale(supportedLocale);
+
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.preferences.moreFromMozilla.template", "simple"]],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("paneMoreFromMozilla", {
+    leaveOpen: true,
+  });
+
+  let doc = gBrowser.contentDocument;
+  let emailLink = doc.getElementById("simple-qr-code-send-email");
+
+  ok(!BrowserTestUtils.isHidden(emailLink), "Email link should be visible");
+
+  await SpecialPowers.popPrefEnv();
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  setLocale(initialLocale); // revert changes to language
+});
+
+add_task(
+  async function test_send_to_device_email_link_for_unsupported_locale() {
+    // Email is not supported for Afrikaans
+    const unsupportedLocale = "af";
+    const initialLocale = Services.locale.appLocaleAsBCP47;
+    setLocale(unsupportedLocale);
+
+    await SpecialPowers.pushPrefEnv({
+      set: [["browser.preferences.moreFromMozilla.template", "simple"]],
+    });
+
+    await openPreferencesViaOpenPreferencesAPI("paneMoreFromMozilla", {
+      leaveOpen: true,
+    });
+
+    let doc = gBrowser.contentDocument;
+    let emailLink = doc.getElementById("simple-qr-code-send-email");
+
+    ok(BrowserTestUtils.isHidden(emailLink), "Email link should be hidden");
+
+    await SpecialPowers.popPrefEnv();
+    BrowserTestUtils.removeTab(gBrowser.selectedTab);
+    setLocale(initialLocale); // revert changes to language
+  }
+);
+
+add_task(
+  async function test_VPN_promo_in_unsupported_current_region_with_supported_home_region() {
+    await clearPolicies();
+    const supportedRegion = "US";
+    const unsupportedRegion = "LY";
+
+    setupRegions(supportedRegion, unsupportedRegion);
+
+    let { vpnPromoCard, mobileCard } = await getPromoCards();
+
+    ok(vpnPromoCard, "The VPN promo is visible");
+    ok(mobileCard, "The Mobile promo is visible");
+
+    setupRegions(initialHomeRegion, initialCurrentRegion); // revert changes to regions
+    BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  }
+);
+
+add_task(
+  async function test_VPN_promo_in_supported_current_region_with_unsupported_home_region() {
+    await clearPolicies();
+    const supportedRegion = "US";
+    const unsupportedRegion = "LY";
+
+    setupRegions(unsupportedRegion, supportedRegion);
+
+    let { vpnPromoCard, mobileCard } = await getPromoCards();
+
+    ok(vpnPromoCard, "The VPN promo is visible");
+    ok(mobileCard, "The Mobile promo is visible");
+
+    setupRegions(initialHomeRegion, initialCurrentRegion); // revert changes to regions
+    BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  }
+);
+
+add_task(async function test_VPN_promo_with_active_enterprise_policy() {
+  // set up an arbitrary enterprise policy
+  await EnterprisePolicyTesting.setupPolicyEngineWithJson({
+    policies: {
+      EnableTrackingProtection: {
+        Value: true,
+      },
+    },
+  });
+
+  let { vpnPromoCard, mobileCard } = await getPromoCards();
+  ok(!vpnPromoCard, "The VPN promo is not visible");
+  ok(mobileCard, "The Mobile promo is visible");
+
+  setupRegions(initialHomeRegion, initialCurrentRegion); // revert changes to regions
+  await clearPolicies();
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function test_relay_promo_with_supported_fxa_server() {
+  await clearPolicies();
+
+  let { relayPromoCard } = await getPromoCards();
+  ok(relayPromoCard, "The Relay promo is visible");
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function test_relay_promo_with_unsupported_fxa_server() {
+  await clearPolicies();
+  // Set the default pref value to something other than the current value so it
+  // will appear to be user-set and treated as invalid (actually setting the
+  // pref would cause a remote connection and crash the test harness)
+  unmockFxA();
+
+  let { relayPromoCard } = await getPromoCards();
+  ok(!relayPromoCard, "The Relay promo is not visible");
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  mockFxA();
+});
+
+add_task(async function test_Monitor_US_region_desc() {
+  const supportedRegion = "US";
+  setupRegions(supportedRegion);
+
+  let { monitorPromoCard } = await getPromoCards();
+  ok(monitorPromoCard, "The Monitor promo is visible");
+
+  let monitorDescElement =
+    monitorPromoCard.nextElementSibling.querySelector(".description");
+  is(
+    monitorDescElement.getAttribute("data-l10n-id"),
+    "more-from-moz-mozilla-monitor-us-description",
+    "US Region desc set"
+  );
+
+  setupRegions(initialHomeRegion, initialCurrentRegion); // revert changes to regions
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function test_Monitor_global_region_desc() {
+  const supportedRegion = "UK";
+  setupRegions(supportedRegion);
+
+  let { monitorPromoCard } = await getPromoCards();
+  ok(monitorPromoCard, "The Monitor promo is visible");
+
+  let monitorDescElement =
+    monitorPromoCard.nextElementSibling.querySelector(".description");
+  is(
+    monitorDescElement.getAttribute("data-l10n-id"),
+    "more-from-moz-mozilla-monitor-global-description",
+    "Global Region desc set"
+  );
+
+  setupRegions(initialHomeRegion, initialCurrentRegion); // revert changes to regions
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_newtab_menu.js b/browser/components/preferences/tests/browser_newtab_menu.js
new file mode 100644
index 0000000000..774c9dd756
--- /dev/null
+++ b/browser/components/preferences/tests/browser_newtab_menu.js
@@ -0,0 +1,38 @@
+add_task(async function newtabPreloaded() {
+  await openPreferencesViaOpenPreferencesAPI("paneHome", { leaveOpen: true });
+
+  const { contentDocument: doc, contentWindow } = gBrowser;
+  function dispatchMenuItemCommand(menuItem) {
+    const cmdEvent = doc.createEvent("xulcommandevent");
+    cmdEvent.initCommandEvent(
+      "command",
+      true,
+      true,
+      contentWindow,
+      0,
+      false,
+      false,
+      false,
+      false,
+      0,
+      null,
+      0
+    );
+    menuItem.dispatchEvent(cmdEvent);
+  }
+
+  const menuHome = doc.querySelector(`#newTabMode menuitem[value="0"]`);
+  const menuBlank = doc.querySelector(`#newTabMode menuitem[value="1"]`);
+  ok(menuHome.selected, "The first item, Home (default), is selected.");
+  ok(NewTabPagePreloading.enabled, "Default Home allows preloading.");
+
+  dispatchMenuItemCommand(menuBlank);
+  ok(menuBlank.selected, "The second item, Blank, is selected.");
+  ok(!NewTabPagePreloading.enabled, "Non-Home prevents preloading.");
+
+  dispatchMenuItemCommand(menuHome);
+  ok(menuHome.selected, "The first item, Home, is selected again.");
+  ok(NewTabPagePreloading.enabled, "Default Home allows preloading again.");
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_notifications_do_not_disturb.js b/browser/components/preferences/tests/browser_notifications_do_not_disturb.js
new file mode 100644
index 0000000000..afc31b9041
--- /dev/null
+++ b/browser/components/preferences/tests/browser_notifications_do_not_disturb.js
@@ -0,0 +1,57 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+registerCleanupFunction(function () {
+  while (gBrowser.tabs[1]) {
+    gBrowser.removeTab(gBrowser.tabs[1]);
+  }
+});
+
+add_task(async function () {
+  let prefs = await openPreferencesViaOpenPreferencesAPI("panePrivacy", {
+    leaveOpen: true,
+  });
+  is(prefs.selectedPane, "panePrivacy", "Privacy pane was selected");
+
+  let doc = gBrowser.contentDocument;
+  let notificationsDoNotDisturbBox = doc.getElementById(
+    "notificationsDoNotDisturbBox"
+  );
+  if (notificationsDoNotDisturbBox.hidden) {
+    todo(false, "Do not disturb is not available on this platform");
+    return;
+  }
+
+  let alertService;
+  try {
+    alertService = Cc["@mozilla.org/alerts-service;1"]
+      .getService(Ci.nsIAlertsService)
+      .QueryInterface(Ci.nsIAlertsDoNotDisturb);
+  } catch (ex) {
+    ok(true, "Do not disturb is not available on this platform: " + ex.message);
+    return;
+  }
+
+  let checkbox = doc.getElementById("notificationsDoNotDisturb");
+  ok(!checkbox.checked, "Checkbox should not be checked by default");
+  ok(
+    !alertService.manualDoNotDisturb,
+    "Do not disturb should be off by default"
+  );
+
+  let checkboxChanged = BrowserTestUtils.waitForEvent(checkbox, "command");
+  checkbox.click();
+  await checkboxChanged;
+  ok(
+    alertService.manualDoNotDisturb,
+    "Do not disturb should be enabled when checked"
+  );
+
+  checkboxChanged = BrowserTestUtils.waitForEvent(checkbox, "command");
+  checkbox.click();
+  await checkboxChanged;
+  ok(
+    !alertService.manualDoNotDisturb,
+    "Do not disturb should be disabled when unchecked"
+  );
+});
diff --git a/browser/components/preferences/tests/browser_open_download_preferences.js b/browser/components/preferences/tests/browser_open_download_preferences.js
new file mode 100644
index 0000000000..794d2ebb05
--- /dev/null
+++ b/browser/components/preferences/tests/browser_open_download_preferences.js
@@ -0,0 +1,288 @@
+/* Any copyright is dedicated to the Public Domain.
+   http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+const { HandlerServiceTestUtils } = ChromeUtils.importESModule(
+  "resource://testing-common/HandlerServiceTestUtils.sys.mjs"
+);
+
+const TEST_PATH = getRootDirectory(gTestPath).replace(
+  "chrome://mochitests/content",
+  "https://example.com"
+);
+
+async function selectPdfCategoryItem() {
+  await openPreferencesViaOpenPreferencesAPI("general", { leaveOpen: true });
+  info("Preferences page opened on the general pane.");
+
+  await gBrowser.selectedBrowser.contentWindow.promiseLoadHandlersList;
+  info("Apps list loaded.");
+
+  let win = gBrowser.selectedBrowser.contentWindow;
+  let container = win.document.getElementById("handlersView");
+  let pdfCategory = container.querySelector(
+    "richlistitem[type='application/pdf']"
+  );
+
+  pdfCategory.closest("richlistbox").selectItem(pdfCategory);
+  Assert.ok(pdfCategory.selected, "Should be able to select our item.");
+
+  return pdfCategory;
+}
+
+async function selectItemInPopup(item, list) {
+  let popup = list.menupopup;
+  let popupShown = BrowserTestUtils.waitForEvent(popup, "popupshown");
+  // Synthesizing the mouse on the .actionsMenu menulist somehow just selects
+  // the top row. Probably something to do with the multiple layers of anon
+  // content - workaround by using the `.open` setter instead.
+  list.open = true;
+  await popupShown;
+  let popupHidden = BrowserTestUtils.waitForEvent(popup, "popuphidden");
+
+  item.click();
+  popup.hidePopup();
+  await popupHidden;
+  return item;
+}
+
+function downloadHadFinished(publicList) {
+  return new Promise(resolve => {
+    publicList.addView({
+      onDownloadChanged(download) {
+        if (download.succeeded || download.error) {
+          publicList.removeView(this);
+          resolve(download);
+        }
+      },
+    });
+  });
+}
+
+async function removeTheFile(download) {
+  Assert.ok(
+    await IOUtils.exists(download.target.path),
+    "The file should have been downloaded."
+  );
+
+  try {
+    info("removing " + download.target.path);
+    if (Services.appinfo.OS === "WINNT") {
+      // We need to make the file writable to delete it on Windows.
+      await IOUtils.setPermissions(download.target.path, 0o600);
+    }
+    await IOUtils.remove(download.target.path);
+  } catch (ex) {
+    info("The file " + download.target.path + " is not removed, " + ex);
+  }
+}
+
+add_task(async function alwaysAskPreferenceWorks() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.download.always_ask_before_handling_new_types", false],
+      ["browser.download.useDownloadDir", true],
+    ],
+  });
+
+  let pdfCategory = await selectPdfCategoryItem();
+  let list = pdfCategory.querySelector(".actionsMenu");
+
+  let alwaysAskItem = list.querySelector(
+    `menuitem[action='${Ci.nsIHandlerInfo.alwaysAsk}']`
+  );
+
+  await selectItemInPopup(alwaysAskItem, list);
+  Assert.equal(
+    list.selectedItem,
+    alwaysAskItem,
+    "Should have selected 'always ask' for pdf"
+  );
+  let alwaysAskBeforeHandling = HandlerServiceTestUtils.getHandlerInfo(
+    pdfCategory.getAttribute("type")
+  ).alwaysAskBeforeHandling;
+  Assert.ok(
+    alwaysAskBeforeHandling,
+    "Should have turned on 'always asking before handling'"
+  );
+
+  let domWindowPromise = BrowserTestUtils.domWindowOpenedAndLoaded();
+  let loadingTab = await BrowserTestUtils.openNewForegroundTab({
+    gBrowser,
+    opening: TEST_PATH + "empty_pdf_file.pdf",
+    waitForLoad: false,
+    waitForStateStop: true,
+  });
+
+  let domWindow = await domWindowPromise;
+  let dialog = domWindow.document.querySelector("#unknownContentType");
+  let button = dialog.getButton("cancel");
+
+  await TestUtils.waitForCondition(
+    () => !button.disabled,
+    "Wait for Cancel button to get enabled"
+  );
+  Assert.ok(dialog, "Dialog should be shown");
+  dialog.cancelDialog();
+  BrowserTestUtils.removeTab(loadingTab);
+
+  gBrowser.removeCurrentTab();
+});
+
+add_task(async function handleInternallyPreferenceWorks() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.download.always_ask_before_handling_new_types", false],
+      ["browser.download.useDownloadDir", true],
+    ],
+  });
+
+  let pdfCategory = await selectPdfCategoryItem();
+  let list = pdfCategory.querySelector(".actionsMenu");
+
+  let handleInternallyItem = list.querySelector(
+    `menuitem[action='${Ci.nsIHandlerInfo.handleInternally}']`
+  );
+
+  await selectItemInPopup(handleInternallyItem, list);
+  Assert.equal(
+    list.selectedItem,
+    handleInternallyItem,
+    "Should have selected 'handle internally' for pdf"
+  );
+
+  let loadingTab = await BrowserTestUtils.openNewForegroundTab({
+    gBrowser,
+    opening: TEST_PATH + "empty_pdf_file.pdf",
+    waitForLoad: false,
+    waitForStateStop: true,
+  });
+
+  await ContentTask.spawn(loadingTab.linkedBrowser, null, async () => {
+    await ContentTaskUtils.waitForCondition(
+      () => content.document.readyState == "complete"
+    );
+    Assert.ok(
+      content.document.querySelector("div#viewer"),
+      "document content has viewer UI"
+    );
+  });
+
+  BrowserTestUtils.removeTab(loadingTab);
+
+  gBrowser.removeCurrentTab();
+});
+
+add_task(async function saveToDiskPreferenceWorks() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.download.always_ask_before_handling_new_types", false],
+      ["browser.download.useDownloadDir", true],
+    ],
+  });
+
+  let pdfCategory = await selectPdfCategoryItem();
+  let list = pdfCategory.querySelector(".actionsMenu");
+
+  let saveToDiskItem = list.querySelector(
+    `menuitem[action='${Ci.nsIHandlerInfo.saveToDisk}']`
+  );
+
+  await selectItemInPopup(saveToDiskItem, list);
+  Assert.equal(
+    list.selectedItem,
+    saveToDiskItem,
+    "Should have selected 'save to disk' for pdf"
+  );
+
+  let publicList = await Downloads.getList(Downloads.PUBLIC);
+  registerCleanupFunction(async () => {
+    await publicList.removeFinished();
+  });
+
+  let downloadFinishedPromise = downloadHadFinished(publicList);
+
+  let loadingTab = await BrowserTestUtils.openNewForegroundTab({
+    gBrowser,
+    opening: TEST_PATH + "empty_pdf_file.pdf",
+    waitForLoad: false,
+    waitForStateStop: true,
+  });
+
+  let download = await downloadFinishedPromise;
+  BrowserTestUtils.removeTab(loadingTab);
+
+  await removeTheFile(download);
+
+  gBrowser.removeCurrentTab();
+});
+
+add_task(async function useSystemDefaultPreferenceWorks() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.download.always_ask_before_handling_new_types", false],
+      ["browser.download.useDownloadDir", true],
+    ],
+  });
+
+  let pdfCategory = await selectPdfCategoryItem();
+  let list = pdfCategory.querySelector(".actionsMenu");
+
+  let useSystemDefaultItem = list.querySelector(
+    `menuitem[action='${Ci.nsIHandlerInfo.useSystemDefault}']`
+  );
+
+  // Whether there's a "use default" item depends on the OS, there might not be a system default viewer.
+  if (!useSystemDefaultItem) {
+    info(
+      "No 'Use default' item, so no testing for setting 'use system default' preference"
+    );
+    gBrowser.removeCurrentTab();
+    return;
+  }
+
+  await selectItemInPopup(useSystemDefaultItem, list);
+  Assert.equal(
+    list.selectedItem,
+    useSystemDefaultItem,
+    "Should have selected 'use system default' for pdf"
+  );
+
+  let oldLaunchFile = DownloadIntegration.launchFile;
+
+  let waitForLaunchFileCalled = new Promise(resolve => {
+    DownloadIntegration.launchFile = () => {
+      ok(true, "The file should be launched with an external application");
+      resolve();
+    };
+  });
+
+  let publicList = await Downloads.getList(Downloads.PUBLIC);
+  registerCleanupFunction(async () => {
+    await publicList.removeFinished();
+  });
+
+  let downloadFinishedPromise = downloadHadFinished(publicList);
+
+  let loadingTab = await BrowserTestUtils.openNewForegroundTab({
+    gBrowser,
+    opening: TEST_PATH + "empty_pdf_file.pdf",
+    waitForLoad: false,
+    waitForStateStop: true,
+  });
+
+  info("Downloading had finished");
+  let download = await downloadFinishedPromise;
+
+  info("Waiting until DownloadIntegration.launchFile is called");
+  await waitForLaunchFileCalled;
+
+  DownloadIntegration.launchFile = oldLaunchFile;
+
+  await removeTheFile(download);
+
+  BrowserTestUtils.removeTab(loadingTab);
+
+  gBrowser.removeCurrentTab();
+});
diff --git a/browser/components/preferences/tests/browser_open_migration_wizard.js b/browser/components/preferences/tests/browser_open_migration_wizard.js
new file mode 100644
index 0000000000..9191f80078
--- /dev/null
+++ b/browser/components/preferences/tests/browser_open_migration_wizard.js
@@ -0,0 +1,27 @@
+/* Any copyright is dedicated to the Public Domain.
+   http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+/**
+ * Tests the "Import Data" button in the "Import Browser Data" section of
+ * the General pane of about:preferences launches the Migration Wizard.
+ */
+add_task(async function test_open_migration_wizard() {
+  const BUTTON_ID = "data-migration";
+
+  await BrowserTestUtils.withNewTab(
+    { gBrowser, url: "about:preferences#general" },
+    async function (browser) {
+      let button = browser.contentDocument.getElementById(BUTTON_ID);
+
+      let wizardReady = BrowserTestUtils.waitForEvent(
+        browser.contentWindow,
+        "MigrationWizard:Ready"
+      );
+      button.click();
+      await wizardReady;
+      Assert.ok(true, "Saw the new Migration Wizard dialog open.");
+    }
+  );
+});
diff --git a/browser/components/preferences/tests/browser_password_management.js b/browser/components/preferences/tests/browser_password_management.js
new file mode 100644
index 0000000000..d84c88dc08
--- /dev/null
+++ b/browser/components/preferences/tests/browser_password_management.js
@@ -0,0 +1,43 @@
+"use strict";
+
+const { LoginTestUtils } = ChromeUtils.importESModule(
+  "resource://testing-common/LoginTestUtils.sys.mjs"
+);
+const { TelemetryTestUtils } = ChromeUtils.importESModule(
+  "resource://testing-common/TelemetryTestUtils.sys.mjs"
+);
+
+var passwordsDialog;
+
+add_task(async function test_openPasswordManagement() {
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+
+  let tabOpenPromise = BrowserTestUtils.waitForNewTab(gBrowser, "about:logins");
+
+  await SpecialPowers.spawn(gBrowser.selectedBrowser, [], function () {
+    let doc = content.document;
+
+    let savePasswordCheckBox = doc.getElementById("savePasswords");
+    Assert.ok(
+      !savePasswordCheckBox.checked,
+      "Save Password CheckBox should be unchecked by default"
+    );
+
+    let showPasswordsButton = doc.getElementById("showPasswords");
+    showPasswordsButton.click();
+  });
+
+  let tab = await tabOpenPromise;
+  ok(tab, "Tab opened");
+
+  // check telemetry events while we are in here
+  await LoginTestUtils.telemetry.waitForEventCount(1);
+  TelemetryTestUtils.assertEvents(
+    [["pwmgr", "open_management", "preferences"]],
+    { category: "pwmgr", method: "open_management" },
+    { clear: true, process: "content" }
+  );
+
+  BrowserTestUtils.removeTab(tab);
+  gBrowser.removeCurrentTab();
+});
diff --git a/browser/components/preferences/tests/browser_pdf_disabled.js b/browser/components/preferences/tests/browser_pdf_disabled.js
new file mode 100644
index 0000000000..5b814b39e9
--- /dev/null
+++ b/browser/components/preferences/tests/browser_pdf_disabled.js
@@ -0,0 +1,49 @@
+/* Any copyright is dedicated to the Public Domain.
+   http://creativecommons.org/publicdomain/zero/1.0/ */
+
+// This test checks that pdf always appears in the applications list even
+// both a customized handler doesn't exist and when the internal viewer is
+// not enabled.
+add_task(async function pdfIsAlwaysPresent() {
+  // Try again with the pdf viewer enabled and disabled.
+  for (let test of ["enabled", "disabled"]) {
+    await SpecialPowers.pushPrefEnv({
+      set: [["pdfjs.disabled", test == "disabled"]],
+    });
+
+    await openPreferencesViaOpenPreferencesAPI("general", { leaveOpen: true });
+
+    let win = gBrowser.selectedBrowser.contentWindow;
+
+    let container = win.document.getElementById("handlersView");
+
+    // First, find the PDF item.
+    let pdfItem = container.querySelector(
+      "richlistitem[type='application/pdf']"
+    );
+    Assert.ok(pdfItem, "pdfItem is present in handlersView when " + test);
+    if (pdfItem) {
+      pdfItem.scrollIntoView({ block: "center" });
+      pdfItem.closest("richlistbox").selectItem(pdfItem);
+
+      // Open its menu
+      let list = pdfItem.querySelector(".actionsMenu");
+      let popup = list.menupopup;
+      let popupShown = BrowserTestUtils.waitForEvent(popup, "popupshown");
+      EventUtils.synthesizeMouseAtCenter(list, {}, win);
+      await popupShown;
+
+      let handleInternallyItem = list.querySelector(
+        `menuitem[action='${Ci.nsIHandlerInfo.handleInternally}']`
+      );
+
+      is(
+        test == "enabled",
+        !!handleInternallyItem,
+        "handle internally is present when " + test
+      );
+    }
+
+    gBrowser.removeCurrentTab();
+  }
+});
diff --git a/browser/components/preferences/tests/browser_performance.js b/browser/components/preferences/tests/browser_performance.js
new file mode 100644
index 0000000000..bd7ff70c51
--- /dev/null
+++ b/browser/components/preferences/tests/browser_performance.js
@@ -0,0 +1,300 @@
+const DEFAULT_HW_ACCEL_PREF = Services.prefs
+  .getDefaultBranch(null)
+  .getBoolPref("layers.acceleration.disabled");
+const DEFAULT_PROCESS_COUNT = Services.prefs
+  .getDefaultBranch(null)
+  .getIntPref("dom.ipc.processCount");
+
+add_task(async function () {
+  // We must temporarily disable `Once` StaticPrefs check for the duration of
+  // this test (see bug 1556131). We must do so in a separate operation as
+  // pushPrefEnv doesn't set the preferences in the order one could expect.
+  await SpecialPowers.pushPrefEnv({
+    set: [["preferences.force-disable.check.once.policy", true]],
+  });
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["layers.acceleration.disabled", DEFAULT_HW_ACCEL_PREF],
+      ["dom.ipc.processCount", DEFAULT_PROCESS_COUNT],
+      ["browser.preferences.defaultPerformanceSettings.enabled", true],
+    ],
+  });
+});
+
+add_task(async function () {
+  let prefs = await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  is(prefs.selectedPane, "paneGeneral", "General pane was selected");
+
+  let doc = gBrowser.contentDocument;
+  let useRecommendedPerformanceSettings = doc.querySelector(
+    "#useRecommendedPerformanceSettings"
+  );
+
+  is(
+    Services.prefs.getBoolPref(
+      "browser.preferences.defaultPerformanceSettings.enabled"
+    ),
+    true,
+    "pref value should be true before clicking on checkbox"
+  );
+  ok(
+    useRecommendedPerformanceSettings.checked,
+    "checkbox should be checked before clicking on checkbox"
+  );
+
+  useRecommendedPerformanceSettings.click();
+
+  let performanceSettings = doc.querySelector("#performanceSettings");
+  is(
+    performanceSettings.hidden,
+    false,
+    "performance settings section is shown"
+  );
+
+  is(
+    Services.prefs.getBoolPref(
+      "browser.preferences.defaultPerformanceSettings.enabled"
+    ),
+    false,
+    "pref value should be false after clicking on checkbox"
+  );
+  ok(
+    !useRecommendedPerformanceSettings.checked,
+    "checkbox should not be checked after clicking on checkbox"
+  );
+
+  let allowHWAccel = doc.querySelector("#allowHWAccel");
+  let allowHWAccelPref = Services.prefs.getBoolPref(
+    "layers.acceleration.disabled"
+  );
+  is(
+    allowHWAccelPref,
+    DEFAULT_HW_ACCEL_PREF,
+    "pref value should be the default value before clicking on checkbox"
+  );
+  is(
+    allowHWAccel.checked,
+    !DEFAULT_HW_ACCEL_PREF,
+    "checkbox should show the invert of the default value"
+  );
+
+  let contentProcessCount = doc.querySelector("#contentProcessCount");
+  is(
+    contentProcessCount.disabled,
+    false,
+    "process count control should be enabled"
+  );
+  is(
+    Services.prefs.getIntPref("dom.ipc.processCount"),
+    DEFAULT_PROCESS_COUNT,
+    "default pref value should be default value"
+  );
+  is(
+    contentProcessCount.selectedItem.value,
+    "" + DEFAULT_PROCESS_COUNT,
+    "selected item should be the default one"
+  );
+
+  allowHWAccel.click();
+  allowHWAccelPref = Services.prefs.getBoolPref("layers.acceleration.disabled");
+  is(
+    allowHWAccelPref,
+    !DEFAULT_HW_ACCEL_PREF,
+    "pref value should be opposite of the default value after clicking on checkbox"
+  );
+  is(
+    allowHWAccel.checked,
+    !allowHWAccelPref,
+    "checkbox should show the invert of the current value"
+  );
+
+  contentProcessCount.value = 7;
+  contentProcessCount.doCommand();
+  is(
+    Services.prefs.getIntPref("dom.ipc.processCount"),
+    7,
+    "pref value should be 7"
+  );
+  is(contentProcessCount.selectedItem.value, "7", "selected item should be 7");
+
+  allowHWAccel.click();
+  allowHWAccelPref = Services.prefs.getBoolPref("layers.acceleration.disabled");
+  is(
+    allowHWAccelPref,
+    DEFAULT_HW_ACCEL_PREF,
+    "pref value should be the default value after clicking on checkbox"
+  );
+  is(
+    allowHWAccel.checked,
+    !allowHWAccelPref,
+    "checkbox should show the invert of the current value"
+  );
+
+  contentProcessCount.value = DEFAULT_PROCESS_COUNT;
+  contentProcessCount.doCommand();
+  is(
+    Services.prefs.getIntPref("dom.ipc.processCount"),
+    DEFAULT_PROCESS_COUNT,
+    "pref value should be default value"
+  );
+  is(
+    contentProcessCount.selectedItem.value,
+    "" + DEFAULT_PROCESS_COUNT,
+    "selected item should be default one"
+  );
+
+  is(
+    performanceSettings.hidden,
+    false,
+    "performance settings section should be still shown"
+  );
+
+  Services.prefs.setBoolPref(
+    "browser.preferences.defaultPerformanceSettings.enabled",
+    true
+  );
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function () {
+  let prefs = await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  is(prefs.selectedPane, "paneGeneral", "General pane was selected");
+
+  let doc = gBrowser.contentDocument;
+  let useRecommendedPerformanceSettings = doc.querySelector(
+    "#useRecommendedPerformanceSettings"
+  );
+  let allowHWAccel = doc.querySelector("#allowHWAccel");
+  let contentProcessCount = doc.querySelector("#contentProcessCount");
+  let performanceSettings = doc.querySelector("#performanceSettings");
+
+  useRecommendedPerformanceSettings.click();
+  allowHWAccel.click();
+  contentProcessCount.value = 7;
+  contentProcessCount.doCommand();
+  useRecommendedPerformanceSettings.click();
+
+  is(
+    Services.prefs.getBoolPref(
+      "browser.preferences.defaultPerformanceSettings.enabled"
+    ),
+    true,
+    "pref value should be true before clicking on checkbox"
+  );
+  ok(
+    useRecommendedPerformanceSettings.checked,
+    "checkbox should be checked before clicking on checkbox"
+  );
+  is(
+    performanceSettings.hidden,
+    true,
+    "performance settings section should be still shown"
+  );
+
+  Services.prefs.setBoolPref(
+    "browser.preferences.defaultPerformanceSettings.enabled",
+    true
+  );
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function () {
+  let prefs = await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  is(prefs.selectedPane, "paneGeneral", "General pane was selected");
+
+  let doc = gBrowser.contentDocument;
+  let performanceSettings = doc.querySelector("#performanceSettings");
+
+  is(
+    performanceSettings.hidden,
+    true,
+    "performance settings section should not be shown"
+  );
+
+  Services.prefs.setBoolPref(
+    "browser.preferences.defaultPerformanceSettings.enabled",
+    false
+  );
+
+  is(
+    performanceSettings.hidden,
+    false,
+    "performance settings section should be shown"
+  );
+
+  Services.prefs.setBoolPref(
+    "browser.preferences.defaultPerformanceSettings.enabled",
+    true
+  );
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function () {
+  Services.prefs.setIntPref("dom.ipc.processCount", 7);
+
+  let prefs = await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  is(prefs.selectedPane, "paneGeneral", "General pane was selected");
+
+  let doc = gBrowser.contentDocument;
+
+  let performanceSettings = doc.querySelector("#performanceSettings");
+  is(
+    performanceSettings.hidden,
+    false,
+    "performance settings section should be shown"
+  );
+
+  let contentProcessCount = doc.querySelector("#contentProcessCount");
+  is(
+    Services.prefs.getIntPref("dom.ipc.processCount"),
+    7,
+    "pref value should be 7"
+  );
+  is(contentProcessCount.selectedItem.value, "7", "selected item should be 7");
+
+  Services.prefs.setBoolPref(
+    "browser.preferences.defaultPerformanceSettings.enabled",
+    true
+  );
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function () {
+  Services.prefs.setBoolPref("layers.acceleration.disabled", true);
+
+  let prefs = await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  is(prefs.selectedPane, "paneGeneral", "General pane was selected");
+
+  let doc = gBrowser.contentDocument;
+
+  let performanceSettings = doc.querySelector("#performanceSettings");
+  is(
+    performanceSettings.hidden,
+    false,
+    "performance settings section should be shown"
+  );
+
+  let allowHWAccel = doc.querySelector("#allowHWAccel");
+  is(
+    Services.prefs.getBoolPref("layers.acceleration.disabled"),
+    true,
+    "pref value is false"
+  );
+  ok(!allowHWAccel.checked, "checkbox should not be checked");
+
+  Services.prefs.setBoolPref(
+    "browser.preferences.defaultPerformanceSettings.enabled",
+    true
+  );
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_performance_content_process_limit.js b/browser/components/preferences/tests/browser_performance_content_process_limit.js
new file mode 100644
index 0000000000..7ac5c354bd
--- /dev/null
+++ b/browser/components/preferences/tests/browser_performance_content_process_limit.js
@@ -0,0 +1,52 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+add_task(async function () {
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.preferences.defaultPerformanceSettings.enabled", false]],
+  });
+
+  let prefs = await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  is(prefs.selectedPane, "paneGeneral", "General pane was selected");
+
+  let doc = gBrowser.contentDocument;
+
+  let limitContentProcess = doc.querySelector("#limitContentProcess");
+  is(
+    limitContentProcess.hidden,
+    Services.appinfo.fissionAutostart,
+    "Limit Content Process should be hidden if fission is enabled and shown if it is not."
+  );
+
+  let contentProcessCount = doc.querySelector("#contentProcessCount");
+  is(
+    contentProcessCount.hidden,
+    Services.appinfo.fissionAutostart,
+    "Limit Content Count should be hidden if fission is enabled and shown if it is not."
+  );
+
+  let contentProcessCountEnabledDescription = doc.querySelector(
+    "#contentProcessCountEnabledDescription"
+  );
+  is(
+    contentProcessCountEnabledDescription.hidden,
+    Services.appinfo.fissionAutostart,
+    "Limit Content Process Enabled Description should be hidden if fission is enabled and shown if it is not."
+  );
+
+  let contentProcessCountDisabledDescription = doc.querySelector(
+    "#contentProcessCountDisabledDescription"
+  );
+  is(
+    contentProcessCountDisabledDescription.hidden,
+    Services.appinfo.fissionAutostart ||
+      Services.appinfo.browserTabsRemoteAutostart,
+    "Limit Content Process Disabled Description should be shown if e10s is disabled, and hidden otherwise."
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_performance_e10srollout.js b/browser/components/preferences/tests/browser_performance_e10srollout.js
new file mode 100644
index 0000000000..1c2c57b6e7
--- /dev/null
+++ b/browser/components/preferences/tests/browser_performance_e10srollout.js
@@ -0,0 +1,164 @@
+const DEFAULT_HW_ACCEL_PREF = Services.prefs
+  .getDefaultBranch(null)
+  .getBoolPref("layers.acceleration.disabled");
+const DEFAULT_PROCESS_COUNT = Services.prefs
+  .getDefaultBranch(null)
+  .getIntPref("dom.ipc.processCount");
+
+add_task(async function () {
+  // We must temporarily disable `Once` StaticPrefs check for the duration of
+  // this test (see bug 1556131). We must do so in a separate operation as
+  // pushPrefEnv doesn't set the preferences in the order one could expect.
+  await SpecialPowers.pushPrefEnv({
+    set: [["preferences.force-disable.check.once.policy", true]],
+  });
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["layers.acceleration.disabled", DEFAULT_HW_ACCEL_PREF],
+      ["dom.ipc.processCount", DEFAULT_PROCESS_COUNT],
+      ["browser.preferences.defaultPerformanceSettings.enabled", true],
+    ],
+  });
+});
+
+add_task(async function testPrefsAreDefault() {
+  Services.prefs.setIntPref("dom.ipc.processCount", DEFAULT_PROCESS_COUNT);
+  Services.prefs.setBoolPref(
+    "browser.preferences.defaultPerformanceSettings.enabled",
+    true
+  );
+
+  let prefs = await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  is(prefs.selectedPane, "paneGeneral", "General pane was selected");
+
+  let doc = gBrowser.contentDocument;
+  let useRecommendedPerformanceSettings = doc.querySelector(
+    "#useRecommendedPerformanceSettings"
+  );
+
+  is(
+    Services.prefs.getBoolPref(
+      "browser.preferences.defaultPerformanceSettings.enabled"
+    ),
+    true,
+    "pref value should be true before clicking on checkbox"
+  );
+  ok(
+    useRecommendedPerformanceSettings.checked,
+    "checkbox should be checked before clicking on checkbox"
+  );
+
+  useRecommendedPerformanceSettings.click();
+
+  let performanceSettings = doc.querySelector("#performanceSettings");
+  is(
+    performanceSettings.hidden,
+    false,
+    "performance settings section is shown"
+  );
+
+  is(
+    Services.prefs.getBoolPref(
+      "browser.preferences.defaultPerformanceSettings.enabled"
+    ),
+    false,
+    "pref value should be false after clicking on checkbox"
+  );
+  ok(
+    !useRecommendedPerformanceSettings.checked,
+    "checkbox should not be checked after clicking on checkbox"
+  );
+
+  let contentProcessCount = doc.querySelector("#contentProcessCount");
+  is(
+    contentProcessCount.disabled,
+    false,
+    "process count control should be enabled"
+  );
+  is(
+    Services.prefs.getIntPref("dom.ipc.processCount"),
+    DEFAULT_PROCESS_COUNT,
+    "default pref should be default value"
+  );
+  is(
+    contentProcessCount.selectedItem.value,
+    "" + DEFAULT_PROCESS_COUNT,
+    "selected item should be the default one"
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+
+  Services.prefs.clearUserPref("dom.ipc.processCount");
+  Services.prefs.setBoolPref(
+    "browser.preferences.defaultPerformanceSettings.enabled",
+    true
+  );
+});
+
+add_task(async function testPrefsSetByUser() {
+  const kNewCount = DEFAULT_PROCESS_COUNT - 2;
+
+  Services.prefs.setIntPref("dom.ipc.processCount", kNewCount);
+  Services.prefs.setBoolPref(
+    "browser.preferences.defaultPerformanceSettings.enabled",
+    false
+  );
+
+  let prefs = await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  is(prefs.selectedPane, "paneGeneral", "General pane was selected");
+
+  let doc = gBrowser.contentDocument;
+  let performanceSettings = doc.querySelector("#performanceSettings");
+  is(
+    performanceSettings.hidden,
+    false,
+    "performance settings section is shown"
+  );
+
+  let contentProcessCount = doc.querySelector("#contentProcessCount");
+  is(
+    contentProcessCount.disabled,
+    false,
+    "process count control should be enabled"
+  );
+  is(
+    Services.prefs.getIntPref("dom.ipc.processCount"),
+    kNewCount,
+    "process count should be the set value"
+  );
+  is(
+    contentProcessCount.selectedItem.value,
+    "" + kNewCount,
+    "selected item should be the set one"
+  );
+
+  let useRecommendedPerformanceSettings = doc.querySelector(
+    "#useRecommendedPerformanceSettings"
+  );
+  useRecommendedPerformanceSettings.click();
+
+  is(
+    Services.prefs.getBoolPref(
+      "browser.preferences.defaultPerformanceSettings.enabled"
+    ),
+    true,
+    "pref value should be true after clicking on checkbox"
+  );
+  is(
+    Services.prefs.getIntPref("dom.ipc.processCount"),
+    DEFAULT_PROCESS_COUNT,
+    "process count should be default value"
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+
+  Services.prefs.clearUserPref("dom.ipc.processCount");
+  Services.prefs.setBoolPref(
+    "browser.preferences.defaultPerformanceSettings.enabled",
+    true
+  );
+});
diff --git a/browser/components/preferences/tests/browser_performance_non_e10s.js b/browser/components/preferences/tests/browser_performance_non_e10s.js
new file mode 100644
index 0000000000..169afcaaa6
--- /dev/null
+++ b/browser/components/preferences/tests/browser_performance_non_e10s.js
@@ -0,0 +1,210 @@
+const DEFAULT_HW_ACCEL_PREF = Services.prefs
+  .getDefaultBranch(null)
+  .getBoolPref("layers.acceleration.disabled");
+const DEFAULT_PROCESS_COUNT = Services.prefs
+  .getDefaultBranch(null)
+  .getIntPref("dom.ipc.processCount");
+
+add_task(async function () {
+  // We must temporarily disable `Once` StaticPrefs check for the duration of
+  // this test (see bug 1556131). We must do so in a separate operation as
+  // pushPrefEnv doesn't set the preferences in the order one could expect.
+  await SpecialPowers.pushPrefEnv({
+    set: [["preferences.force-disable.check.once.policy", true]],
+  });
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["layers.acceleration.disabled", DEFAULT_HW_ACCEL_PREF],
+      ["dom.ipc.processCount", DEFAULT_PROCESS_COUNT],
+      ["browser.preferences.defaultPerformanceSettings.enabled", true],
+    ],
+  });
+});
+
+add_task(async function () {
+  let prefs = await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  is(prefs.selectedPane, "paneGeneral", "General pane was selected");
+
+  let doc = gBrowser.contentDocument;
+  let useRecommendedPerformanceSettings = doc.querySelector(
+    "#useRecommendedPerformanceSettings"
+  );
+
+  is(
+    Services.prefs.getBoolPref(
+      "browser.preferences.defaultPerformanceSettings.enabled"
+    ),
+    true,
+    "pref value should be true before clicking on checkbox"
+  );
+  ok(
+    useRecommendedPerformanceSettings.checked,
+    "checkbox should be checked before clicking on checkbox"
+  );
+
+  useRecommendedPerformanceSettings.click();
+
+  let performanceSettings = doc.querySelector("#performanceSettings");
+  is(
+    performanceSettings.hidden,
+    false,
+    "performance settings section is shown"
+  );
+
+  is(
+    Services.prefs.getBoolPref(
+      "browser.preferences.defaultPerformanceSettings.enabled"
+    ),
+    false,
+    "pref value should be false after clicking on checkbox"
+  );
+  ok(
+    !useRecommendedPerformanceSettings.checked,
+    "checkbox should not be checked after clicking on checkbox"
+  );
+
+  let allowHWAccel = doc.querySelector("#allowHWAccel");
+  let allowHWAccelPref = Services.prefs.getBoolPref(
+    "layers.acceleration.disabled"
+  );
+  is(
+    allowHWAccelPref,
+    DEFAULT_HW_ACCEL_PREF,
+    "pref value should be the default value before clicking on checkbox"
+  );
+  is(
+    allowHWAccel.checked,
+    !DEFAULT_HW_ACCEL_PREF,
+    "checkbox should show the invert of the default value"
+  );
+
+  let contentProcessCount = doc.querySelector("#contentProcessCount");
+  is(
+    contentProcessCount.disabled,
+    true,
+    "process count control should be disabled"
+  );
+
+  let contentProcessCountEnabledDescription = doc.querySelector(
+    "#contentProcessCountEnabledDescription"
+  );
+  is(
+    contentProcessCountEnabledDescription.hidden,
+    true,
+    "process count enabled description should be hidden"
+  );
+
+  let contentProcessCountDisabledDescription = doc.querySelector(
+    "#contentProcessCountDisabledDescription"
+  );
+  is(
+    contentProcessCountDisabledDescription.hidden,
+    false,
+    "process count enabled description should be shown"
+  );
+
+  allowHWAccel.click();
+  allowHWAccelPref = Services.prefs.getBoolPref("layers.acceleration.disabled");
+  is(
+    allowHWAccelPref,
+    !DEFAULT_HW_ACCEL_PREF,
+    "pref value should be opposite of the default value after clicking on checkbox"
+  );
+  is(
+    allowHWAccel.checked,
+    !allowHWAccelPref,
+    "checkbox should show the invert of the current value"
+  );
+
+  allowHWAccel.click();
+  allowHWAccelPref = Services.prefs.getBoolPref("layers.acceleration.disabled");
+  is(
+    allowHWAccelPref,
+    DEFAULT_HW_ACCEL_PREF,
+    "pref value should be the default value after clicking on checkbox"
+  );
+  is(
+    allowHWAccel.checked,
+    !allowHWAccelPref,
+    "checkbox should show the invert of the current value"
+  );
+
+  is(
+    performanceSettings.hidden,
+    false,
+    "performance settings section should be still shown"
+  );
+
+  Services.prefs.setBoolPref(
+    "browser.preferences.defaultPerformanceSettings.enabled",
+    true
+  );
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function () {
+  let prefs = await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  is(prefs.selectedPane, "paneGeneral", "General pane was selected");
+
+  let doc = gBrowser.contentDocument;
+  let performanceSettings = doc.querySelector("#performanceSettings");
+
+  is(
+    performanceSettings.hidden,
+    true,
+    "performance settings section should not be shown"
+  );
+
+  Services.prefs.setBoolPref(
+    "browser.preferences.defaultPerformanceSettings.enabled",
+    false
+  );
+
+  is(
+    performanceSettings.hidden,
+    false,
+    "performance settings section should be shown"
+  );
+
+  Services.prefs.setBoolPref(
+    "browser.preferences.defaultPerformanceSettings.enabled",
+    true
+  );
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function () {
+  Services.prefs.setBoolPref("layers.acceleration.disabled", true);
+
+  let prefs = await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  is(prefs.selectedPane, "paneGeneral", "General pane was selected");
+
+  let doc = gBrowser.contentDocument;
+
+  let performanceSettings = doc.querySelector("#performanceSettings");
+  is(
+    performanceSettings.hidden,
+    false,
+    "performance settings section should be shown"
+  );
+
+  let allowHWAccel = doc.querySelector("#allowHWAccel");
+  is(
+    Services.prefs.getBoolPref("layers.acceleration.disabled"),
+    true,
+    "pref value is false"
+  );
+  ok(!allowHWAccel.checked, "checkbox should not be checked");
+
+  Services.prefs.setBoolPref(
+    "browser.preferences.defaultPerformanceSettings.enabled",
+    true
+  );
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_permissions_checkPermissionsWereAdded.js b/browser/components/preferences/tests/browser_permissions_checkPermissionsWereAdded.js
new file mode 100644
index 0000000000..c56c32222d
--- /dev/null
+++ b/browser/components/preferences/tests/browser_permissions_checkPermissionsWereAdded.js
@@ -0,0 +1,149 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+const PERMISSIONS_URL =
+  "chrome://browser/content/preferences/dialogs/permissions.xhtml";
+
+const _checkAndOpenCookiesDialog = async doc => {
+  let cookieExceptionsButton = doc.getElementById("cookieExceptions");
+  ok(cookieExceptionsButton, "cookieExceptionsButton found");
+  let dialogPromise = promiseLoadSubDialog(PERMISSIONS_URL);
+  cookieExceptionsButton.click();
+  let dialog = await dialogPromise;
+  return dialog;
+};
+
+const _checkCookiesDialog = (dialog, buttonIds) => {
+  ok(dialog, "dialog loaded");
+  let urlLabel = dialog.document.getElementById("urlLabel");
+  ok(!urlLabel.hidden, "urlLabel should be visible");
+  let url = dialog.document.getElementById("url");
+  ok(!url.hidden, "url should be visible");
+  for (let buttonId of buttonIds) {
+    let buttonDialog = dialog.document.getElementById(buttonId);
+    ok(buttonDialog, "blockButtonDialog found");
+    is(
+      buttonDialog.hasAttribute("disabled"),
+      true,
+      "If the user hasn't added an url the button shouldn't be clickable"
+    );
+  }
+  return dialog;
+};
+
+const _addWebsiteAddressToPermissionBox = (
+  websiteAddress,
+  dialog,
+  buttonId,
+  expectError
+) => {
+  let url = dialog.document.getElementById("url");
+  let buttonDialog = dialog.document.getElementById(buttonId);
+  url.value = websiteAddress;
+  url.dispatchEvent(new Event("input", { bubbles: true }));
+  is(
+    buttonDialog.hasAttribute("disabled"),
+    false,
+    "When the user add an url the button should be clickable"
+  );
+  buttonDialog.click();
+  let permissionsBox = dialog.document.getElementById("permissionsBox");
+  let children = permissionsBox.getElementsByAttribute("origin", "*");
+  is(
+    !!children.length,
+    !expectError,
+    "Website added in url should be in the list"
+  );
+};
+
+const _checkIfPermissionsWereAdded = (dialog, expectedResult) => {
+  let permissionsBox = dialog.document.getElementById("permissionsBox");
+  for (let website of expectedResult) {
+    let elements = permissionsBox.getElementsByAttribute("origin", website);
+    is(elements.length, 1, "It should find only one coincidence");
+  }
+};
+
+const _removesAllSitesInPermissionBox = (dialog, shouldBePossible) => {
+  let removeAllWebsitesButton = dialog.document.getElementById(
+    "removeAllPermissions"
+  );
+  ok(removeAllWebsitesButton, "removeAllWebsitesButton found");
+  const isDisabled = removeAllWebsitesButton.hasAttribute("disabled");
+  is(
+    !removeAllWebsitesButton.hasAttribute("disabled"),
+    shouldBePossible,
+    "There should be websites in the list"
+  );
+  if (!isDisabled) {
+    removeAllWebsitesButton.click();
+  }
+};
+
+add_task(async function checkCookiePermissions() {
+  await openPreferencesViaOpenPreferencesAPI("panePrivacy", {
+    leaveOpen: true,
+  });
+  let win = gBrowser.selectedBrowser.contentWindow;
+  let doc = win.document;
+  let buttonIds = ["btnBlock", "btnCookieSession", "btnAllow"];
+
+  let dialog = await _checkAndOpenCookiesDialog(doc);
+  _checkCookiesDialog(dialog, buttonIds);
+
+  let tests = [
+    {
+      inputWebsite: "google.com",
+      expectedResult: ["http://google.com", "https://google.com"],
+    },
+    {
+      inputWebsite: "https://google.com",
+      expectedResult: ["https://google.com"],
+    },
+    {
+      inputWebsite: "s3.eu-central-1.amazonaws.com",
+      expectedResult: [
+        "http://s3.eu-central-1.amazonaws.com",
+        "https://s3.eu-central-1.amazonaws.com",
+      ],
+    },
+    {
+      inputWebsite: "file://",
+      expectedResult: ["file:///"],
+    },
+    {
+      inputWebsite: "about:config",
+      expectedResult: ["about:config"],
+    },
+    // Invalid inputs, expected to not be added
+    {
+      inputWebsite: "http://",
+      expectedResult: [],
+    },
+    {
+      inputWebsite: "*.example.com",
+      expectedResult: [],
+    },
+    {
+      inputWebsite: "http://*.example.com",
+      expectedResult: [],
+    },
+  ];
+
+  for (let buttonId of buttonIds) {
+    for (let test of tests) {
+      _addWebsiteAddressToPermissionBox(
+        test.inputWebsite,
+        dialog,
+        buttonId,
+        test.expectedResult.length === 0
+      );
+      _checkIfPermissionsWereAdded(dialog, test.expectedResult);
+      _removesAllSitesInPermissionBox(dialog, !!test.expectedResult.length);
+    }
+  }
+
+  gBrowser.removeCurrentTab();
+});
diff --git a/browser/components/preferences/tests/browser_permissions_dialog.js b/browser/components/preferences/tests/browser_permissions_dialog.js
new file mode 100644
index 0000000000..097c2f15aa
--- /dev/null
+++ b/browser/components/preferences/tests/browser_permissions_dialog.js
@@ -0,0 +1,641 @@
+"use strict";
+
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+const PERMISSIONS_URL =
+  "chrome://browser/content/preferences/dialogs/sitePermissions.xhtml";
+const URL = "http://www.example.com";
+const URI = Services.io.newURI(URL);
+var sitePermissionsDialog;
+let settingsButtonMap = {
+  "desktop-notification": "notificationSettingsButton",
+  speaker: "speakerSettingsButton",
+};
+
+function checkMenulistPermissionItem(origin, state) {
+  let doc = sitePermissionsDialog.document;
+
+  let label = doc.getElementsByTagName("label")[3];
+  Assert.equal(label.textContent, origin);
+
+  let menulist = doc.getElementsByTagName("menulist")[0];
+  Assert.equal(menulist.value, state);
+}
+
+async function openPermissionsDialog(permissionType) {
+  let dialogOpened = promiseLoadSubDialog(PERMISSIONS_URL);
+  await SpecialPowers.spawn(
+    gBrowser.selectedBrowser,
+    [settingsButtonMap[permissionType]],
+    function (settingsButtonId) {
+      let doc = content.document;
+      let settingsButton = doc.getElementById(settingsButtonId);
+      settingsButton.click();
+    }
+  );
+
+  sitePermissionsDialog = await dialogOpened;
+  await sitePermissionsDialog.document.mozSubdialogReady;
+}
+
+add_task(async function openSitePermissionsDialog() {
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  await openPermissionsDialog("desktop-notification");
+});
+
+add_task(async function addPermission() {
+  let doc = sitePermissionsDialog.document;
+  let richlistbox = doc.getElementById("permissionsBox");
+
+  // First item in the richlistbox contains column headers.
+  Assert.equal(
+    richlistbox.itemCount,
+    0,
+    "Number of permission items is 0 initially"
+  );
+
+  // Add notification permission for a website.
+  PermissionTestUtils.add(
+    URI,
+    "desktop-notification",
+    Services.perms.ALLOW_ACTION
+  );
+
+  // Observe the added permission changes in the dialog UI.
+  Assert.equal(richlistbox.itemCount, 1);
+  checkMenulistPermissionItem(URL, Services.perms.ALLOW_ACTION);
+
+  PermissionTestUtils.remove(URI, "desktop-notification");
+});
+
+add_task(async function addPermissionPrivateBrowsing() {
+  let privateBrowsingPrincipal =
+    Services.scriptSecurityManager.createContentPrincipal(URI, {
+      privateBrowsingId: 1,
+    });
+  let doc = sitePermissionsDialog.document;
+  let richlistbox = doc.getElementById("permissionsBox");
+
+  Assert.equal(
+    richlistbox.itemCount,
+    0,
+    "Number of permission items is 0 initially"
+  );
+
+  // Add a session permission for private browsing.
+  PermissionTestUtils.add(
+    privateBrowsingPrincipal,
+    "desktop-notification",
+    Services.perms.ALLOW_ACTION,
+    Services.perms.EXPIRE_SESSION
+  );
+
+  // The permission should not show in the dialog UI.
+  Assert.equal(richlistbox.itemCount, 0);
+
+  PermissionTestUtils.remove(privateBrowsingPrincipal, "desktop-notification");
+
+  // Add a permanent permission for private browsing
+  // The permission manager will store it as EXPIRE_SESSION
+  PermissionTestUtils.add(
+    privateBrowsingPrincipal,
+    "desktop-notification",
+    Services.perms.ALLOW_ACTION
+  );
+
+  // The permission should not show in the dialog UI.
+  Assert.equal(richlistbox.itemCount, 0);
+
+  PermissionTestUtils.remove(privateBrowsingPrincipal, "desktop-notification");
+});
+
+add_task(async function observePermissionChange() {
+  PermissionTestUtils.add(
+    URI,
+    "desktop-notification",
+    Services.perms.ALLOW_ACTION
+  );
+
+  // Change the permission.
+  PermissionTestUtils.add(
+    URI,
+    "desktop-notification",
+    Services.perms.DENY_ACTION
+  );
+
+  checkMenulistPermissionItem(URL, Services.perms.DENY_ACTION);
+
+  PermissionTestUtils.remove(URI, "desktop-notification");
+});
+
+add_task(async function observePermissionDelete() {
+  let doc = sitePermissionsDialog.document;
+  let richlistbox = doc.getElementById("permissionsBox");
+
+  PermissionTestUtils.add(
+    URI,
+    "desktop-notification",
+    Services.perms.ALLOW_ACTION
+  );
+
+  Assert.equal(
+    richlistbox.itemCount,
+    1,
+    "The box contains one permission item initially"
+  );
+
+  PermissionTestUtils.remove(URI, "desktop-notification");
+
+  Assert.equal(richlistbox.itemCount, 0);
+});
+
+add_task(async function onPermissionChange() {
+  let doc = sitePermissionsDialog.document;
+  PermissionTestUtils.add(
+    URI,
+    "desktop-notification",
+    Services.perms.ALLOW_ACTION
+  );
+
+  // Change the permission state in the UI.
+  doc.getElementsByAttribute("value", SitePermissions.BLOCK)[0].click();
+
+  Assert.equal(
+    PermissionTestUtils.getPermissionObject(URI, "desktop-notification")
+      .capability,
+    Services.perms.ALLOW_ACTION,
+    "Permission state does not change before saving changes"
+  );
+
+  doc.querySelector("dialog").getButton("accept").click();
+
+  await TestUtils.waitForCondition(
+    () =>
+      PermissionTestUtils.getPermissionObject(URI, "desktop-notification")
+        .capability == Services.perms.DENY_ACTION
+  );
+
+  PermissionTestUtils.remove(URI, "desktop-notification");
+});
+
+add_task(async function onPermissionDelete() {
+  await openPermissionsDialog("desktop-notification");
+
+  let doc = sitePermissionsDialog.document;
+  let richlistbox = doc.getElementById("permissionsBox");
+
+  PermissionTestUtils.add(
+    URI,
+    "desktop-notification",
+    Services.perms.ALLOW_ACTION
+  );
+
+  richlistbox.selectItem(richlistbox.getItemAtIndex(0));
+  doc.getElementById("removePermission").click();
+
+  await TestUtils.waitForCondition(() => richlistbox.itemCount == 0);
+
+  Assert.equal(
+    PermissionTestUtils.getPermissionObject(URI, "desktop-notification")
+      .capability,
+    Services.perms.ALLOW_ACTION,
+    "Permission is not deleted before saving changes"
+  );
+
+  doc.querySelector("dialog").getButton("accept").click();
+
+  await TestUtils.waitForCondition(
+    () =>
+      PermissionTestUtils.getPermissionObject(URI, "desktop-notification") ==
+      null
+  );
+});
+
+add_task(async function onAllPermissionsDelete() {
+  await openPermissionsDialog("desktop-notification");
+
+  let doc = sitePermissionsDialog.document;
+  let richlistbox = doc.getElementById("permissionsBox");
+
+  PermissionTestUtils.add(
+    URI,
+    "desktop-notification",
+    Services.perms.ALLOW_ACTION
+  );
+  let u = Services.io.newURI("http://www.test.com");
+  PermissionTestUtils.add(
+    u,
+    "desktop-notification",
+    Services.perms.ALLOW_ACTION
+  );
+
+  doc.getElementById("removeAllPermissions").click();
+  await TestUtils.waitForCondition(() => richlistbox.itemCount == 0);
+
+  Assert.equal(
+    PermissionTestUtils.getPermissionObject(URI, "desktop-notification")
+      .capability,
+    Services.perms.ALLOW_ACTION
+  );
+  Assert.equal(
+    PermissionTestUtils.getPermissionObject(u, "desktop-notification")
+      .capability,
+    Services.perms.ALLOW_ACTION,
+    "Permissions are not deleted before saving changes"
+  );
+
+  doc.querySelector("dialog").getButton("accept").click();
+
+  await TestUtils.waitForCondition(
+    () =>
+      PermissionTestUtils.getPermissionObject(URI, "desktop-notification") ==
+        null &&
+      PermissionTestUtils.getPermissionObject(u, "desktop-notification") == null
+  );
+});
+
+add_task(async function onPermissionChangeAndDelete() {
+  await openPermissionsDialog("desktop-notification");
+
+  let doc = sitePermissionsDialog.document;
+  let richlistbox = doc.getElementById("permissionsBox");
+
+  PermissionTestUtils.add(
+    URI,
+    "desktop-notification",
+    Services.perms.ALLOW_ACTION
+  );
+
+  // Change the permission state in the UI.
+  doc.getElementsByAttribute("value", SitePermissions.BLOCK)[0].click();
+
+  // Remove that permission by clicking the "Remove" button.
+  richlistbox.selectItem(richlistbox.getItemAtIndex(0));
+  doc.getElementById("removePermission").click();
+
+  await TestUtils.waitForCondition(() => richlistbox.itemCount == 0);
+
+  doc.querySelector("dialog").getButton("accept").click();
+
+  await TestUtils.waitForCondition(
+    () =>
+      PermissionTestUtils.getPermissionObject(URI, "desktop-notification") ==
+      null
+  );
+});
+
+add_task(async function onPermissionChangeCancel() {
+  await openPermissionsDialog("desktop-notification");
+
+  let doc = sitePermissionsDialog.document;
+  PermissionTestUtils.add(
+    URI,
+    "desktop-notification",
+    Services.perms.ALLOW_ACTION
+  );
+
+  // Change the permission state in the UI.
+  doc.getElementsByAttribute("value", SitePermissions.BLOCK)[0].click();
+
+  doc.querySelector("dialog").getButton("cancel").click();
+
+  Assert.equal(
+    PermissionTestUtils.getPermissionObject(URI, "desktop-notification")
+      .capability,
+    Services.perms.ALLOW_ACTION,
+    "Permission state does not change on clicking cancel"
+  );
+
+  PermissionTestUtils.remove(URI, "desktop-notification");
+});
+
+add_task(async function onPermissionDeleteCancel() {
+  await openPermissionsDialog("desktop-notification");
+
+  let doc = sitePermissionsDialog.document;
+  let richlistbox = doc.getElementById("permissionsBox");
+  PermissionTestUtils.add(
+    URI,
+    "desktop-notification",
+    Services.perms.ALLOW_ACTION
+  );
+
+  // Remove that permission by clicking the "Remove" button.
+  richlistbox.selectItem(richlistbox.getItemAtIndex(0));
+  doc.getElementById("removePermission").click();
+
+  await TestUtils.waitForCondition(() => richlistbox.itemCount == 0);
+
+  doc.querySelector("dialog").getButton("cancel").click();
+
+  Assert.equal(
+    PermissionTestUtils.getPermissionObject(URI, "desktop-notification")
+      .capability,
+    Services.perms.ALLOW_ACTION,
+    "Permission state does not change on clicking cancel"
+  );
+
+  PermissionTestUtils.remove(URI, "desktop-notification");
+});
+
+add_task(async function onSearch() {
+  await openPermissionsDialog("desktop-notification");
+  let doc = sitePermissionsDialog.document;
+  let richlistbox = doc.getElementById("permissionsBox");
+  let searchBox = doc.getElementById("searchBox");
+
+  PermissionTestUtils.add(
+    URI,
+    "desktop-notification",
+    Services.perms.ALLOW_ACTION
+  );
+  searchBox.value = "www.example.com";
+
+  let u = Services.io.newURI("http://www.test.com");
+  PermissionTestUtils.add(
+    u,
+    "desktop-notification",
+    Services.perms.ALLOW_ACTION
+  );
+
+  Assert.equal(
+    doc.getElementsByAttribute("origin", "http://www.test.com")[0],
+    null
+  );
+  Assert.equal(
+    doc.getElementsByAttribute("origin", "http://www.example.com")[0],
+    richlistbox.getItemAtIndex(0)
+  );
+
+  PermissionTestUtils.remove(URI, "desktop-notification");
+  PermissionTestUtils.remove(u, "desktop-notification");
+
+  doc.querySelector("dialog").getButton("cancel").click();
+});
+
+add_task(async function onPermissionsSort() {
+  PermissionTestUtils.add(
+    URI,
+    "desktop-notification",
+    Services.perms.ALLOW_ACTION
+  );
+  let u = Services.io.newURI("http://www.test.com");
+  PermissionTestUtils.add(
+    u,
+    "desktop-notification",
+    Services.perms.DENY_ACTION
+  );
+
+  await openPermissionsDialog("desktop-notification");
+  let doc = sitePermissionsDialog.document;
+  let richlistbox = doc.getElementById("permissionsBox");
+
+  // Test default arrangement(Allow followed by Block).
+  Assert.equal(
+    richlistbox.getItemAtIndex(0).getAttribute("origin"),
+    "http://www.example.com"
+  );
+  Assert.equal(
+    richlistbox.getItemAtIndex(1).getAttribute("origin"),
+    "http://www.test.com"
+  );
+
+  doc.getElementById("statusCol").click();
+
+  // Test the rearrangement(Block followed by Allow).
+  Assert.equal(
+    richlistbox.getItemAtIndex(0).getAttribute("origin"),
+    "http://www.test.com"
+  );
+  Assert.equal(
+    richlistbox.getItemAtIndex(1).getAttribute("origin"),
+    "http://www.example.com"
+  );
+
+  doc.getElementById("siteCol").click();
+
+  // Test the rearrangement(Website names arranged in alphabhetical order).
+  Assert.equal(
+    richlistbox.getItemAtIndex(0).getAttribute("origin"),
+    "http://www.example.com"
+  );
+  Assert.equal(
+    richlistbox.getItemAtIndex(1).getAttribute("origin"),
+    "http://www.test.com"
+  );
+
+  doc.getElementById("siteCol").click();
+
+  // Test the rearrangement(Website names arranged in reverse alphabhetical order).
+  Assert.equal(
+    richlistbox.getItemAtIndex(0).getAttribute("origin"),
+    "http://www.test.com"
+  );
+  Assert.equal(
+    richlistbox.getItemAtIndex(1).getAttribute("origin"),
+    "http://www.example.com"
+  );
+
+  PermissionTestUtils.remove(URI, "desktop-notification");
+  PermissionTestUtils.remove(u, "desktop-notification");
+
+  doc.querySelector("dialog").getButton("cancel").click();
+});
+
+add_task(async function onPermissionDisable() {
+  // Enable desktop-notification permission prompts.
+  Services.prefs.setIntPref(
+    "permissions.default.desktop-notification",
+    SitePermissions.UNKNOWN
+  );
+
+  await openPermissionsDialog("desktop-notification");
+  let doc = sitePermissionsDialog.document;
+
+  // Check if the enabled state is reflected in the checkbox.
+  let checkbox = doc.getElementById("permissionsDisableCheckbox");
+  Assert.equal(checkbox.checked, false);
+
+  // Disable permission and click on "Cancel".
+  checkbox.checked = true;
+  doc.querySelector("dialog").getButton("cancel").click();
+
+  // Check that the permission is not disabled yet.
+  let perm = Services.prefs.getIntPref(
+    "permissions.default.desktop-notification"
+  );
+  Assert.equal(perm, SitePermissions.UNKNOWN);
+
+  // Open the dialog once again.
+  await openPermissionsDialog("desktop-notification");
+  doc = sitePermissionsDialog.document;
+
+  // Disable permission and save changes.
+  checkbox = doc.getElementById("permissionsDisableCheckbox");
+  checkbox.checked = true;
+  doc.querySelector("dialog").getButton("accept").click();
+
+  // Check if the permission is now disabled.
+  perm = Services.prefs.getIntPref("permissions.default.desktop-notification");
+  Assert.equal(perm, SitePermissions.BLOCK);
+
+  // Open the dialog once again and check if the disabled state is still reflected in the checkbox.
+  await openPermissionsDialog("desktop-notification");
+  doc = sitePermissionsDialog.document;
+  checkbox = doc.getElementById("permissionsDisableCheckbox");
+  Assert.equal(checkbox.checked, true);
+
+  // Close the dialog and clean up.
+  doc.querySelector("dialog").getButton("cancel").click();
+  Services.prefs.setIntPref(
+    "permissions.default.desktop-notification",
+    SitePermissions.UNKNOWN
+  );
+});
+
+add_task(async function checkDefaultPermissionState() {
+  // Set default permission state to ALLOW.
+  Services.prefs.setIntPref(
+    "permissions.default.desktop-notification",
+    SitePermissions.ALLOW
+  );
+
+  await openPermissionsDialog("desktop-notification");
+  let doc = sitePermissionsDialog.document;
+
+  // Check if the enabled state is reflected in the checkbox.
+  let checkbox = doc.getElementById("permissionsDisableCheckbox");
+  Assert.equal(checkbox.checked, false);
+
+  // Check the checkbox and then uncheck it.
+  checkbox.checked = true;
+  checkbox.checked = false;
+
+  // Save changes.
+  doc.querySelector("dialog").getButton("accept").click();
+
+  // Check if the default permission state is retained (and not automatically set to SitePermissions.UNKNOWN).
+  let state = Services.prefs.getIntPref(
+    "permissions.default.desktop-notification"
+  );
+  Assert.equal(state, SitePermissions.ALLOW);
+
+  // Clean up.
+  Services.prefs.setIntPref(
+    "permissions.default.desktop-notification",
+    SitePermissions.UNKNOWN
+  );
+});
+
+add_task(async function testTabBehaviour() {
+  // Test tab behaviour inside the permissions setting dialog when site permissions are selected.
+  // Only selected items in the richlistbox should be tabable for accessibility reasons.
+
+  // Force tabfocus for all elements on OSX.
+  SpecialPowers.pushPrefEnv({ set: [["accessibility.tabfocus", 7]] });
+
+  PermissionTestUtils.add(
+    URI,
+    "desktop-notification",
+    Services.perms.ALLOW_ACTION
+  );
+  let u = Services.io.newURI("http://www.test.com");
+  PermissionTestUtils.add(
+    u,
+    "desktop-notification",
+    Services.perms.ALLOW_ACTION
+  );
+
+  await openPermissionsDialog("desktop-notification");
+  let doc = sitePermissionsDialog.document;
+
+  EventUtils.synthesizeKey("KEY_Tab", {}, sitePermissionsDialog);
+  let richlistbox = doc.getElementById("permissionsBox");
+  is(
+    richlistbox,
+    doc.activeElement.closest("#permissionsBox"),
+    "The richlistbox is focused after pressing tab once."
+  );
+
+  EventUtils.synthesizeKey("KEY_ArrowDown", {}, sitePermissionsDialog);
+  EventUtils.synthesizeKey("KEY_Tab", {}, sitePermissionsDialog);
+  let menulist = doc
+    .getElementById("permissionsBox")
+    .itemChildren[1].getElementsByTagName("menulist")[0];
+  is(
+    menulist,
+    doc.activeElement,
+    "The menulist inside the selected richlistitem is focused now"
+  );
+
+  EventUtils.synthesizeKey("KEY_Tab", {}, sitePermissionsDialog);
+  let removeButton = doc.getElementById("removePermission");
+  is(
+    removeButton,
+    doc.activeElement,
+    "The focus moves outside the richlistbox and onto the remove button"
+  );
+
+  PermissionTestUtils.remove(URI, "desktop-notification");
+  PermissionTestUtils.remove(u, "desktop-notification");
+
+  doc.querySelector("dialog").getButton("cancel").click();
+});
+
+add_task(async function addSpeakerPermission() {
+  let enabled = Services.prefs.getBoolPref("media.setsinkid.enabled", false);
+  let speakerRow =
+    gBrowser.contentDocument.getElementById("speakerSettingsRow");
+  Assert.equal(
+    BrowserTestUtils.isVisible(speakerRow),
+    enabled,
+    "speakerRow visible"
+  );
+  if (!enabled) {
+    return;
+  }
+
+  await openPermissionsDialog("speaker");
+  let doc = sitePermissionsDialog.document;
+  let richlistbox = doc.getElementById("permissionsBox");
+  Assert.equal(
+    richlistbox.itemCount,
+    0,
+    "Number of permission items is 0 initially"
+  );
+  // Add an allow permission for a device.
+  let deviceId = "DEVICE-ID";
+  let devicePermissionId = `speaker^${deviceId}`;
+  PermissionTestUtils.add(URI, devicePermissionId, Services.perms.ALLOW_ACTION);
+
+  // Observe the added permission changes in the dialog UI.
+  Assert.equal(richlistbox.itemCount, 1, "itemCount with allow");
+  checkMenulistPermissionItem(URL, Services.perms.ALLOW_ACTION);
+
+  // Check that an all-device deny permission overrides the device-specific
+  // allow permission.
+  PermissionTestUtils.add(URI, "speaker", Services.perms.DENY_ACTION);
+
+  Assert.equal(richlistbox.itemCount, 1, "itemCount with deny and allow");
+  let richlistitem = richlistbox.itemChildren[0];
+  let siteStatus = richlistitem.querySelector(".website-status");
+  Assert.equal(
+    siteStatus.value,
+    Services.perms.DENY_ACTION,
+    "website status with deny and allow"
+  );
+  // The website status element is not a menulist because all-device allow is
+  // not an option.
+  Assert.equal(siteStatus.tagName, "label");
+
+  PermissionTestUtils.remove(URI, devicePermissionId);
+  PermissionTestUtils.remove(URI, "speaker");
+
+  doc.querySelector("dialog").getButton("cancel").click();
+});
+
+add_task(async function removeTab() {
+  gBrowser.removeCurrentTab();
+});
diff --git a/browser/components/preferences/tests/browser_permissions_dialog_default_perm.js b/browser/components/preferences/tests/browser_permissions_dialog_default_perm.js
new file mode 100644
index 0000000000..37bde1a275
--- /dev/null
+++ b/browser/components/preferences/tests/browser_permissions_dialog_default_perm.js
@@ -0,0 +1,145 @@
+"use strict";
+
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this
+ * file, You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+const PERMISSIONS_URL =
+  "chrome://browser/content/preferences/dialogs/permissions.xhtml";
+
+let sitePermissionsDialog;
+
+let principal = Services.scriptSecurityManager.createContentPrincipal(
+  Services.io.newURI("http://www.example.com"),
+  {}
+);
+let pbPrincipal = Services.scriptSecurityManager.principalWithOA(principal, {
+  privateBrowsingId: 1,
+});
+let principalB = Services.scriptSecurityManager.createContentPrincipal(
+  Services.io.newURI("https://example.org"),
+  {}
+);
+
+/**
+ * Replaces the default permissions defined in browser/app/permissions with our
+ * own test-only permissions and instructs the permission manager to import
+ * them.
+ */
+async function addDefaultTestPermissions() {
+  // create a file in the temp directory with the defaults.
+  let file = Services.dirsvc.get("TmpD", Ci.nsIFile);
+  file.append("test_default_permissions");
+
+  await IOUtils.writeUTF8(
+    file.path,
+    `origin\tinstall\t1\t${principal.origin}\norigin\tinstall\t1\t${pbPrincipal.origin}\n`
+  );
+
+  // Change the default permission file path.
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["permissions.manager.defaultsUrl", Services.io.newFileURI(file).spec],
+    ],
+  });
+
+  // Call the permission manager to reload default permissions from file.
+  Services.obs.notifyObservers(null, "testonly-reload-permissions-from-disk");
+
+  registerCleanupFunction(async () => {
+    // Clean up temporary default permission file.
+    await IOUtils.remove(file.path);
+
+    // Restore non-test default permissions.
+    await SpecialPowers.popPrefEnv();
+    Services.obs.notifyObservers(null, "testonly-reload-permissions-from-disk");
+  });
+}
+
+async function openPermissionsDialog() {
+  let dialogOpened = promiseLoadSubDialog(PERMISSIONS_URL);
+
+  await SpecialPowers.spawn(gBrowser.selectedBrowser, [], function () {
+    let doc = content.document;
+    let settingsButton = doc.getElementById("addonExceptions");
+    settingsButton.click();
+  });
+
+  sitePermissionsDialog = await dialogOpened;
+  await sitePermissionsDialog.document.mozSubdialogReady;
+}
+
+add_setup(async function () {
+  await addDefaultTestPermissions();
+});
+
+/**
+ * Tests that default (persistent) private browsing permissions can be removed.
+ */
+add_task(async function removeAll() {
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  await openPermissionsDialog();
+
+  let doc = sitePermissionsDialog.document;
+  let richlistbox = doc.getElementById("permissionsBox");
+
+  // First item in the richlistbox contains column headers.
+  Assert.equal(
+    richlistbox.itemCount,
+    2,
+    "Should have the two default permission entries initially."
+  );
+
+  info("Adding a new non-default install permission");
+  PermissionTestUtils.add(principalB, "install", Services.perms.ALLOW_ACTION);
+
+  info("Waiting for the permission to appear in the list.");
+  await BrowserTestUtils.waitForMutationCondition(
+    richlistbox,
+    { childList: true },
+    () => richlistbox.itemCount == 3
+  );
+
+  info("Clicking remove all.");
+  doc.getElementById("removeAllPermissions").click();
+
+  info("Waiting for all list items to be cleared.");
+  await BrowserTestUtils.waitForMutationCondition(
+    richlistbox,
+    { childList: true },
+    () => richlistbox.itemCount == 0
+  );
+
+  let dialogClosePromise = BrowserTestUtils.waitForEvent(
+    sitePermissionsDialog,
+    "dialogclosing",
+    true
+  );
+
+  info("Accepting dialog to apply the changes.");
+  doc.querySelector("dialog").getButton("accept").click();
+
+  info("Waiting for dialog to close.");
+  await dialogClosePromise;
+
+  info("Waiting for all permissions to be removed.");
+  await TestUtils.waitForCondition(
+    () =>
+      PermissionTestUtils.getPermissionObject(principal, "install") == null &&
+      PermissionTestUtils.getPermissionObject(pbPrincipal, "install") == null &&
+      PermissionTestUtils.getPermissionObject(principalB, "install") == null
+  );
+
+  info("Opening the permissions dialog again.");
+  await openPermissionsDialog();
+
+  Assert.equal(
+    richlistbox.itemCount,
+    0,
+    "Permission list should still be empty."
+  );
+
+  // Cleanup
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  Services.perms.removeAll();
+});
diff --git a/browser/components/preferences/tests/browser_permissions_urlFieldHidden.js b/browser/components/preferences/tests/browser_permissions_urlFieldHidden.js
new file mode 100644
index 0000000000..537ee3db72
--- /dev/null
+++ b/browser/components/preferences/tests/browser_permissions_urlFieldHidden.js
@@ -0,0 +1,38 @@
+"use strict";
+
+const PERMISSIONS_URL =
+  "chrome://browser/content/preferences/dialogs/permissions.xhtml";
+
+add_task(async function urlFieldVisibleForPopupPermissions(finish) {
+  await openPreferencesViaOpenPreferencesAPI("panePrivacy", {
+    leaveOpen: true,
+  });
+  let win = gBrowser.selectedBrowser.contentWindow;
+  let doc = win.document;
+  let popupPolicyCheckbox = doc.getElementById("popupPolicy");
+  ok(
+    !popupPolicyCheckbox.checked,
+    "popupPolicyCheckbox should be unchecked by default"
+  );
+  popupPolicyCheckbox.click();
+  let popupPolicyButton = doc.getElementById("popupPolicyButton");
+  ok(popupPolicyButton, "popupPolicyButton found");
+  let dialogPromise = promiseLoadSubDialog(PERMISSIONS_URL);
+  popupPolicyButton.click();
+  let dialog = await dialogPromise;
+  ok(dialog, "dialog loaded");
+
+  let urlLabel = dialog.document.getElementById("urlLabel");
+  ok(
+    !urlLabel.hidden,
+    "urlLabel should be visible when one of block/session/allow visible"
+  );
+  let url = dialog.document.getElementById("url");
+  ok(
+    !url.hidden,
+    "url should be visible when one of block/session/allow visible"
+  );
+
+  popupPolicyCheckbox.click();
+  gBrowser.removeCurrentTab();
+});
diff --git a/browser/components/preferences/tests/browser_primaryPassword.js b/browser/components/preferences/tests/browser_primaryPassword.js
new file mode 100644
index 0000000000..1162ca1290
--- /dev/null
+++ b/browser/components/preferences/tests/browser_primaryPassword.js
@@ -0,0 +1,130 @@
+const { OSKeyStoreTestUtils } = ChromeUtils.importESModule(
+  "resource://testing-common/OSKeyStoreTestUtils.sys.mjs"
+);
+const { OSKeyStore } = ChromeUtils.importESModule(
+  "resource://gre/modules/OSKeyStore.sys.mjs"
+);
+
+add_task(async function () {
+  let prefs = await openPreferencesViaOpenPreferencesAPI("panePrivacy", {
+    leaveOpen: true,
+  });
+  is(prefs.selectedPane, "panePrivacy", "Privacy pane was selected");
+
+  let doc = gBrowser.contentDocument;
+  // Fake the subdialog and LoginHelper
+  let win = doc.defaultView;
+  let dialogURL = "";
+  let dialogOpened = false;
+  ChromeUtils.defineLazyGetter(win, "gSubDialog", () => ({
+    open(aDialogURL, { closingCallback: aCallback }) {
+      dialogOpened = true;
+      dialogURL = aDialogURL;
+      primaryPasswordSet = primaryPasswordNextState;
+      aCallback();
+    },
+  }));
+
+  let primaryPasswordSet = false;
+  win.LoginHelper = {
+    isPrimaryPasswordSet() {
+      return primaryPasswordSet;
+    },
+  };
+
+  let checkbox = doc.querySelector("#useMasterPassword");
+  checkbox.scrollIntoView();
+  ok(
+    !checkbox.checked,
+    "primary password checkbox should be unchecked by default"
+  );
+  let button = doc.getElementById("changeMasterPassword");
+  ok(button.disabled, "primary password button should be disabled by default");
+
+  let primaryPasswordNextState = false;
+  if (OSKeyStoreTestUtils.canTestOSKeyStoreLogin() && OSKeyStore.canReauth()) {
+    let osAuthDialogShown = OSKeyStoreTestUtils.waitForOSKeyStoreLogin(false);
+    checkbox.click();
+    info("waiting for os auth dialog to appear and get canceled");
+    await osAuthDialogShown;
+    await TestUtils.waitForCondition(
+      () => !checkbox.checked,
+      "wait for checkbox to get unchecked"
+    );
+    ok(!dialogOpened, "the dialog should not have opened");
+    ok(
+      !dialogURL,
+      "the changemp dialog should not have been opened when the os auth dialog is canceled"
+    );
+    ok(
+      !checkbox.checked,
+      "primary password checkbox should be unchecked after canceling os auth dialog"
+    );
+    ok(button.disabled, "button should be disabled after canceling os auth");
+  }
+
+  primaryPasswordNextState = true;
+  if (OSKeyStoreTestUtils.canTestOSKeyStoreLogin() && OSKeyStore.canReauth()) {
+    let osAuthDialogShown = OSKeyStoreTestUtils.waitForOSKeyStoreLogin(true);
+    checkbox.click();
+    info("waiting for os auth dialog to appear");
+    await osAuthDialogShown;
+    info("waiting for dialogURL to get set");
+    await TestUtils.waitForCondition(
+      () => dialogURL,
+      "wait for open to get called asynchronously"
+    );
+    is(
+      dialogURL,
+      "chrome://mozapps/content/preferences/changemp.xhtml",
+      "clicking on the checkbox should open the primary password dialog"
+    );
+  } else {
+    primaryPasswordSet = true;
+    doc.defaultView.gPrivacyPane._initMasterPasswordUI();
+    await TestUtils.waitForCondition(
+      () => !button.disabled,
+      "waiting for primary password button to get enabled"
+    );
+  }
+  ok(!button.disabled, "primary password button should now be enabled");
+  ok(checkbox.checked, "primary password checkbox should be checked now");
+
+  dialogURL = "";
+  button.doCommand();
+  await TestUtils.waitForCondition(
+    () => dialogURL,
+    "wait for open to get called asynchronously"
+  );
+  is(
+    dialogURL,
+    "chrome://mozapps/content/preferences/changemp.xhtml",
+    "clicking on the button should open the primary password dialog"
+  );
+  ok(!button.disabled, "primary password button should still be enabled");
+  ok(checkbox.checked, "primary password checkbox should be checked still");
+
+  // Confirm that we won't automatically respond to the dialog,
+  // since we don't expect a dialog here, we want the test to fail if one appears.
+  is(
+    Services.prefs.getStringPref(
+      "toolkit.osKeyStore.unofficialBuildOnlyLogin",
+      ""
+    ),
+    "",
+    "Pref should be set to an empty string"
+  );
+
+  primaryPasswordNextState = false;
+  dialogURL = "";
+  checkbox.click();
+  is(
+    dialogURL,
+    "chrome://mozapps/content/preferences/removemp.xhtml",
+    "clicking on the checkbox to uncheck primary password should show the removal dialog"
+  );
+  ok(button.disabled, "primary password button should now be disabled");
+  ok(!checkbox.checked, "primary password checkbox should now be unchecked");
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_privacy_cookieBannerHandling.js b/browser/components/preferences/tests/browser_privacy_cookieBannerHandling.js
new file mode 100644
index 0000000000..37ea14d430
--- /dev/null
+++ b/browser/components/preferences/tests/browser_privacy_cookieBannerHandling.js
@@ -0,0 +1,160 @@
+/* Any copyright is dedicated to the Public Domain.
+ * https://creativecommons.org/publicdomain/zero/1.0/ */
+
+// This file tests the Privacy pane's Cookie Banner Handling UI.
+
+"use strict";
+
+const FEATURE_PREF = "cookiebanners.ui.desktop.enabled";
+const MODE_PREF = "cookiebanners.service.mode";
+const PBM_MODE_PREF = "cookiebanners.service.mode.privateBrowsing";
+
+const GROUPBOX_ID = "cookieBannerHandlingGroup";
+const CHECKBOX_ID = "handleCookieBanners";
+
+// Test the section is hidden on page load if the feature pref is disabled.
+add_task(async function test_section_hidden_when_feature_flag_disabled() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      [FEATURE_PREF, false],
+      [PBM_MODE_PREF, Ci.nsICookieBannerService.MODE_DISABLED],
+    ],
+  });
+
+  await BrowserTestUtils.withNewTab(
+    { gBrowser, url: "about:preferences#privacy" },
+    async function (browser) {
+      let groupbox = browser.contentDocument.getElementById(GROUPBOX_ID);
+      is_element_hidden(groupbox, "#cookieBannerHandlingGroup is hidden");
+    }
+  );
+
+  await SpecialPowers.popPrefEnv();
+});
+
+// Test the section is shown on page load if the feature pref is enabled.
+add_task(async function test_section_shown_when_feature_flag_enabled() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      [FEATURE_PREF, true],
+      [PBM_MODE_PREF, Ci.nsICookieBannerService.MODE_DISABLED],
+    ],
+  });
+
+  await BrowserTestUtils.withNewTab(
+    { gBrowser, url: "about:preferences#privacy" },
+    async function (browser) {
+      let groupbox = browser.contentDocument.getElementById(GROUPBOX_ID);
+      is_element_visible(groupbox, "#cookieBannerHandlingGroup is visible");
+    }
+  );
+
+  await SpecialPowers.popPrefEnv();
+});
+
+// Test the checkbox is unchecked in DISABLED mode.
+add_task(async function test_checkbox_unchecked_disabled_mode() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      [FEATURE_PREF, true],
+      [PBM_MODE_PREF, Ci.nsICookieBannerService.MODE_DISABLED],
+    ],
+  });
+
+  await BrowserTestUtils.withNewTab(
+    { gBrowser, url: "about:preferences#privacy" },
+    async function (browser) {
+      let checkbox = browser.contentDocument.getElementById(CHECKBOX_ID);
+      ok(!checkbox.checked, "checkbox is not checked in DISABLED mode");
+    }
+  );
+
+  await SpecialPowers.popPrefEnv();
+});
+
+// Test the checkbox is checked in REJECT mode.
+add_task(async function test_checkbox_checked_reject_mode() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      [FEATURE_PREF, true],
+      [PBM_MODE_PREF, Ci.nsICookieBannerService.MODE_REJECT],
+    ],
+  });
+
+  await BrowserTestUtils.withNewTab(
+    { gBrowser, url: "about:preferences#privacy" },
+    async function (browser) {
+      let checkbox = browser.contentDocument.getElementById(CHECKBOX_ID);
+      ok(checkbox.checked, "checkbox is checked in REJECT mode");
+    }
+  );
+
+  await SpecialPowers.popPrefEnv();
+});
+
+// Test that toggling the checkbox toggles the mode pref value as expected
+add_task(async function test_checkbox_modifies_prefs() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      [FEATURE_PREF, true],
+      [MODE_PREF, Ci.nsICookieBannerService.MODE_DISABLED],
+      [PBM_MODE_PREF, Ci.nsICookieBannerService.MODE_DISABLED],
+    ],
+  });
+
+  await BrowserTestUtils.withNewTab(
+    { gBrowser, url: "about:preferences#privacy" },
+    async function (browser) {
+      let checkboxSelector = "#" + CHECKBOX_ID;
+      let checkbox = browser.contentDocument.querySelector(checkboxSelector);
+      let section = browser.contentDocument.getElementById(GROUPBOX_ID);
+
+      section.scrollIntoView();
+
+      Assert.ok(
+        !checkbox.checked,
+        "initially, the checkbox should be unchecked"
+      );
+
+      await BrowserTestUtils.synthesizeMouseAtCenter(
+        checkboxSelector,
+        {},
+        browser
+      );
+      Assert.ok(checkbox.checked, "checkbox should be checked");
+
+      Assert.equal(
+        Ci.nsICookieBannerService.MODE_REJECT,
+        Services.prefs.getIntPref(PBM_MODE_PREF),
+        "cookie banner handling mode for PBM should be set to REJECT after checking the checkbox"
+      );
+
+      Assert.equal(
+        Ci.nsICookieBannerService.MODE_DISABLED,
+        Services.prefs.getIntPref(MODE_PREF),
+        "non-PBM cookie banner handling mode should be unchanged after checking the checkbox"
+      );
+
+      await BrowserTestUtils.synthesizeMouseAtCenter(
+        checkboxSelector,
+        {},
+        browser
+      );
+      Assert.ok(!checkbox.checked, "checkbox should be unchecked");
+      Assert.equal(
+        Ci.nsICookieBannerService.MODE_DISABLED,
+        Services.prefs.getIntPref(PBM_MODE_PREF),
+        "cookie banner handling mode for PBM should be set to DISABLED after unchecking the checkbox"
+      );
+
+      // this ensures the off-ramp for non-PBM pref is working
+      Assert.equal(
+        Ci.nsICookieBannerService.MODE_DISABLED,
+        Services.prefs.getIntPref(MODE_PREF),
+        "non-PBM cookie banner handling mode should be set to DISABLED after unchecking the checkbox"
+      );
+    }
+  );
+
+  await SpecialPowers.popPrefEnv();
+});
diff --git a/browser/components/preferences/tests/browser_privacy_dnsoverhttps.js b/browser/components/preferences/tests/browser_privacy_dnsoverhttps.js
new file mode 100644
index 0000000000..48469cfce4
--- /dev/null
+++ b/browser/components/preferences/tests/browser_privacy_dnsoverhttps.js
@@ -0,0 +1,844 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+requestLongerTimeout(4);
+
+const { EnterprisePolicyTesting, PoliciesPrefTracker } =
+  ChromeUtils.importESModule(
+    "resource://testing-common/EnterprisePolicyTesting.sys.mjs"
+  );
+
+ChromeUtils.defineESModuleGetters(this, {
+  DoHConfigController: "resource:///modules/DoHConfig.sys.mjs",
+  DoHController: "resource:///modules/DoHController.sys.mjs",
+  DoHTestUtils: "resource://testing-common/DoHTestUtils.sys.mjs",
+});
+
+const TRR_MODE_PREF = "network.trr.mode";
+const TRR_URI_PREF = "network.trr.uri";
+const TRR_CUSTOM_URI_PREF = "network.trr.custom_uri";
+const ROLLOUT_ENABLED_PREF = "doh-rollout.enabled";
+const ROLLOUT_SELF_ENABLED_PREF = "doh-rollout.self-enabled";
+const HEURISTICS_DISABLED_PREF = "doh-rollout.disable-heuristics";
+const FIRST_RESOLVER_VALUE = DoHTestUtils.providers[0].uri;
+const SECOND_RESOLVER_VALUE = DoHTestUtils.providers[1].uri;
+const DEFAULT_RESOLVER_VALUE = FIRST_RESOLVER_VALUE;
+
+const defaultPrefValues = Object.freeze({
+  [TRR_MODE_PREF]: 0,
+  [TRR_CUSTOM_URI_PREF]: "",
+});
+
+// See bug 1741554. This test should not actually try to create a connection to
+// the real DoH endpoint. But a background request could do that while the test
+// is in progress, before we've actually disabled TRR, and would cause a crash
+// due to connecting to a non-local IP.
+// To prevent that we override the IP to a local address.
+Cc["@mozilla.org/network/native-dns-override;1"]
+  .getService(Ci.nsINativeDNSResolverOverride)
+  .addIPOverride("mozilla.cloudflare-dns.com", "127.0.0.1");
+
+async function clearEvents() {
+  Services.telemetry.clearEvents();
+  await TestUtils.waitForCondition(() => {
+    let events = Services.telemetry.snapshotEvents(
+      Ci.nsITelemetry.DATASET_ALL_CHANNELS,
+      true
+    ).parent;
+    return !events || !events.length;
+  });
+}
+
+async function getEvent(filter1, filter2) {
+  let event = await TestUtils.waitForCondition(() => {
+    let events = Services.telemetry.snapshotEvents(
+      Ci.nsITelemetry.DATASET_ALL_CHANNELS,
+      true
+    ).parent;
+    return events?.find(e => e[1] == filter1 && e[2] == filter2);
+  }, "recorded telemetry for the load");
+  event.shift();
+  return event;
+}
+
+async function resetPrefs() {
+  await DoHTestUtils.resetRemoteSettingsConfig();
+  await DoHController._uninit();
+  Services.prefs.clearUserPref(TRR_MODE_PREF);
+  Services.prefs.clearUserPref(TRR_URI_PREF);
+  Services.prefs.clearUserPref(TRR_CUSTOM_URI_PREF);
+  Services.prefs.getChildList("doh-rollout.").forEach(pref => {
+    Services.prefs.clearUserPref(pref);
+  });
+  // Clear out any telemetry events generated by DoHController so that we don't
+  // confuse tests running after this one that are looking at those.
+  Services.telemetry.clearEvents();
+  await DoHController.init();
+}
+Services.prefs.setStringPref("network.trr.confirmationNS", "skip");
+
+registerCleanupFunction(async () => {
+  await resetPrefs();
+  Services.prefs.clearUserPref("network.trr.confirmationNS");
+});
+
+add_setup(async function setup() {
+  await SpecialPowers.pushPrefEnv({
+    set: [["toolkit.telemetry.testing.overrideProductsCheck", true]],
+  });
+
+  await DoHTestUtils.resetRemoteSettingsConfig();
+});
+
+function waitForPrefObserver(name) {
+  return new Promise(resolve => {
+    const observer = {
+      observe(aSubject, aTopic, aData) {
+        if (aData == name) {
+          Services.prefs.removeObserver(name, observer);
+          resolve();
+        }
+      },
+    };
+    Services.prefs.addObserver(name, observer);
+  });
+}
+
+async function testWithProperties(props, startTime) {
+  info(
+    Date.now() -
+      startTime +
+      ": testWithProperties: testing with " +
+      JSON.stringify(props)
+  );
+
+  // There are two different signals that the DoHController is ready, depending
+  // on the config being tested. If we're setting the TRR mode pref, we should
+  // expect the disable-heuristics pref to be set as the signal. Else, we can
+  // expect the self-enabled pref as the signal.
+  let rolloutReadyPromise;
+  if (props.hasOwnProperty(TRR_MODE_PREF)) {
+    if (
+      [2, 3, 5].includes(props[TRR_MODE_PREF]) &&
+      props.hasOwnProperty(ROLLOUT_ENABLED_PREF)
+    ) {
+      // Only initialize the promise if we're going to enable the rollout -
+      // otherwise we will never await it, which could cause a leak if it doesn't
+      // end up resolving.
+      rolloutReadyPromise = waitForPrefObserver(HEURISTICS_DISABLED_PREF);
+    }
+    Services.prefs.setIntPref(TRR_MODE_PREF, props[TRR_MODE_PREF]);
+  }
+  if (props.hasOwnProperty(ROLLOUT_ENABLED_PREF)) {
+    if (!rolloutReadyPromise) {
+      rolloutReadyPromise = waitForPrefObserver(ROLLOUT_SELF_ENABLED_PREF);
+    }
+    Services.prefs.setBoolPref(
+      ROLLOUT_ENABLED_PREF,
+      props[ROLLOUT_ENABLED_PREF]
+    );
+    await rolloutReadyPromise;
+  }
+  if (props.hasOwnProperty(TRR_CUSTOM_URI_PREF)) {
+    Services.prefs.setStringPref(
+      TRR_CUSTOM_URI_PREF,
+      props[TRR_CUSTOM_URI_PREF]
+    );
+  }
+  if (props.hasOwnProperty(TRR_URI_PREF)) {
+    Services.prefs.setStringPref(TRR_URI_PREF, props[TRR_URI_PREF]);
+  }
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  let doc = gBrowser.selectedBrowser.contentDocument;
+
+  info(Date.now() - startTime + ": testWithProperties: tab now open");
+  let modeRadioGroup = doc.getElementById("dohCategoryRadioGroup");
+  let uriTextbox = doc.getElementById("dohEnabledInputField");
+  let resolverMenulist = doc.getElementById("dohStrictResolverChoices");
+  let modePrefChangedPromise;
+  let uriPrefChangedPromise;
+  let disableHeuristicsPrefChangedPromise;
+
+  modeRadioGroup.scrollIntoView();
+
+  if (props.hasOwnProperty("expectedSelectedIndex")) {
+    await TestUtils.waitForCondition(
+      () => modeRadioGroup.selectedIndex === props.expectedSelectedIndex
+    );
+    is(
+      modeRadioGroup.selectedIndex,
+      props.expectedSelectedIndex,
+      "dohCategoryRadioGroup has expected selected index"
+    );
+  }
+  if (props.hasOwnProperty("expectedUriValue")) {
+    await TestUtils.waitForCondition(
+      () => uriTextbox.value === props.expectedUriValue
+    );
+    is(
+      uriTextbox.value,
+      props.expectedUriValue,
+      "URI textbox has expected value"
+    );
+  }
+  if (props.hasOwnProperty("expectedResolverListValue")) {
+    await TestUtils.waitForCondition(
+      () => resolverMenulist.value === props.expectedResolverListValue
+    );
+    is(
+      resolverMenulist.value,
+      props.expectedResolverListValue,
+      "resolver menulist has expected value"
+    );
+  }
+
+  if (props.clickMode) {
+    await clearEvents();
+    info(
+      Date.now() -
+        startTime +
+        ": testWithProperties: clickMode, waiting for the pref observer"
+    );
+    modePrefChangedPromise = waitForPrefObserver(TRR_MODE_PREF);
+    if (props.hasOwnProperty("expectedDisabledHeuristics")) {
+      disableHeuristicsPrefChangedPromise = waitForPrefObserver(
+        HEURISTICS_DISABLED_PREF
+      );
+    }
+    info(
+      Date.now() - startTime + ": testWithProperties: clickMode, pref changed"
+    );
+    let option = doc.getElementById(props.clickMode);
+    option.scrollIntoView();
+    let win = doc.ownerGlobal;
+    EventUtils.synthesizeMouseAtCenter(option, {}, win);
+    info(
+      `${Date.now() - startTime} : testWithProperties: clickMode=${
+        props.clickMode
+      }, mouse click synthesized`
+    );
+    let clickEvent = await getEvent("security.doh.settings", "mode_changed");
+    Assert.deepEqual(clickEvent, [
+      "security.doh.settings",
+      "mode_changed",
+      "button",
+      props.clickMode,
+    ]);
+  }
+  if (props.hasOwnProperty("selectResolver")) {
+    await clearEvents();
+    info(
+      Date.now() -
+        startTime +
+        ": testWithProperties: selectResolver, creating change event"
+    );
+    resolverMenulist.focus();
+    resolverMenulist.value = props.selectResolver;
+    resolverMenulist.dispatchEvent(new Event("input", { bubbles: true }));
+    resolverMenulist.dispatchEvent(new Event("command", { bubbles: true }));
+    info(
+      Date.now() -
+        startTime +
+        ": testWithProperties: selectResolver, item value set and events dispatched"
+    );
+    let choiceEvent = await getEvent(
+      "security.doh.settings",
+      "provider_choice"
+    );
+    Assert.deepEqual(choiceEvent, [
+      "security.doh.settings",
+      "provider_choice",
+      "value",
+      props.selectResolver,
+    ]);
+  }
+  if (props.hasOwnProperty("inputUriKeys")) {
+    info(
+      Date.now() -
+        startTime +
+        ": testWithProperties: inputUriKeys, waiting for the pref observer"
+    );
+    uriPrefChangedPromise = waitForPrefObserver(TRR_CUSTOM_URI_PREF);
+    info(
+      Date.now() -
+        startTime +
+        ": testWithProperties: inputUriKeys, pref changed, now enter the new value"
+    );
+    let win = doc.ownerGlobal;
+    uriTextbox.focus();
+    uriTextbox.value = props.inputUriKeys;
+    uriTextbox.dispatchEvent(new win.Event("input", { bubbles: true }));
+    uriTextbox.dispatchEvent(new win.Event("change", { bubbles: true }));
+    info(
+      Date.now() -
+        startTime +
+        ": testWithProperties: inputUriKeys, input and change events dispatched"
+    );
+  }
+
+  info(
+    Date.now() -
+      startTime +
+      ": testWithProperties: waiting for any of uri and mode prefs to change"
+  );
+  await Promise.all([
+    uriPrefChangedPromise,
+    modePrefChangedPromise,
+    disableHeuristicsPrefChangedPromise,
+  ]);
+  info(Date.now() - startTime + ": testWithProperties: prefs changed");
+
+  if (props.hasOwnProperty("expectedFinalUriPref")) {
+    if (props.expectedFinalUriPref) {
+      let uriPref = Services.prefs.getStringPref(TRR_URI_PREF);
+      is(
+        uriPref,
+        props.expectedFinalUriPref,
+        "uri pref ended up with the expected value"
+      );
+    } else {
+      ok(
+        !Services.prefs.prefHasUserValue(TRR_URI_PREF),
+        `uri pref ended up with the expected value (unset) got ${Services.prefs.getStringPref(
+          TRR_URI_PREF
+        )}`
+      );
+    }
+  }
+
+  if (props.hasOwnProperty("expectedModePref")) {
+    let modePref = Services.prefs.getIntPref(TRR_MODE_PREF);
+    is(
+      modePref,
+      props.expectedModePref,
+      "mode pref ended up with the expected value"
+    );
+  }
+
+  if (props.hasOwnProperty("expectedDisabledHeuristics")) {
+    let disabledHeuristicsPref = Services.prefs.getBoolPref(
+      HEURISTICS_DISABLED_PREF
+    );
+    is(
+      disabledHeuristicsPref,
+      props.expectedDisabledHeuristics,
+      "disable-heuristics pref ended up with the expected value"
+    );
+  }
+
+  if (props.hasOwnProperty("expectedFinalCustomUriPref")) {
+    let customUriPref = Services.prefs.getStringPref(TRR_CUSTOM_URI_PREF);
+    is(
+      customUriPref,
+      props.expectedFinalCustomUriPref,
+      "custom_uri pref ended up with the expected value"
+    );
+  }
+
+  if (props.hasOwnProperty("expectedModeValue")) {
+    let modeValue = Services.prefs.getIntPref(TRR_MODE_PREF);
+    is(modeValue, props.expectedModeValue, "mode pref has expected value");
+  }
+
+  gBrowser.removeCurrentTab();
+  info(Date.now() - startTime + ": testWithProperties: fin");
+}
+
+add_task(async function default_values() {
+  let customUriPref = Services.prefs.getStringPref(TRR_CUSTOM_URI_PREF);
+  let uriPrefHasUserValue = Services.prefs.prefHasUserValue(TRR_URI_PREF);
+  let modePref = Services.prefs.getIntPref(TRR_MODE_PREF);
+  is(
+    modePref,
+    defaultPrefValues[TRR_MODE_PREF],
+    `Actual value of ${TRR_MODE_PREF} matches expected default value`
+  );
+  ok(
+    !uriPrefHasUserValue,
+    `Actual value of ${TRR_URI_PREF} matches expected default value (unset)`
+  );
+  is(
+    customUriPref,
+    defaultPrefValues[TRR_CUSTOM_URI_PREF],
+    `Actual value of ${TRR_CUSTOM_URI_PREF} matches expected default value`
+  );
+});
+
+const DEFAULT_OPTION_INDEX = 0;
+const ENABLED_OPTION_INDEX = 1;
+const STRICT_OPTION_INDEX = 2;
+const OFF_OPTION_INDEX = 3;
+
+let testVariations = [
+  // verify state with defaults
+  {
+    name: "default",
+    expectedModePref: 0,
+    expectedSelectedIndex: DEFAULT_OPTION_INDEX,
+    expectedUriValue: "",
+  },
+
+  // verify each of the modes maps to the correct checked state
+  {
+    name: "mode 0",
+    [TRR_MODE_PREF]: 0,
+    expectedSelectedIndex: DEFAULT_OPTION_INDEX,
+  },
+  {
+    name: "mode 1",
+    [TRR_MODE_PREF]: 1,
+    expectedSelectedIndex: OFF_OPTION_INDEX,
+  },
+  {
+    name: "mode 2",
+    [TRR_MODE_PREF]: 2,
+    expectedSelectedIndex: ENABLED_OPTION_INDEX,
+    expectedFinalUriPref: "",
+  },
+  {
+    name: "mode 3",
+    [TRR_MODE_PREF]: 3,
+    expectedSelectedIndex: STRICT_OPTION_INDEX,
+    expectedFinalUriPref: "",
+  },
+  {
+    name: "mode 4",
+    [TRR_MODE_PREF]: 4,
+    expectedSelectedIndex: OFF_OPTION_INDEX,
+  },
+  {
+    name: "mode 5",
+    [TRR_MODE_PREF]: 5,
+    expectedSelectedIndex: OFF_OPTION_INDEX,
+  },
+  // verify an out of bounds mode value maps to the correct checked state
+  {
+    name: "mode out-of-bounds",
+    [TRR_MODE_PREF]: 77,
+    expectedSelectedIndex: OFF_OPTION_INDEX,
+  },
+
+  // verify automatic heuristics states
+  {
+    name: "heuristics on and mode unset",
+    [TRR_MODE_PREF]: 0,
+    [ROLLOUT_ENABLED_PREF]: true,
+    expectedSelectedIndex: DEFAULT_OPTION_INDEX,
+  },
+  {
+    name: "heuristics on and mode set to 2",
+    [TRR_MODE_PREF]: 2,
+    [ROLLOUT_ENABLED_PREF]: true,
+    expectedSelectedIndex: ENABLED_OPTION_INDEX,
+  },
+  {
+    name: "heuristics on but disabled, mode unset",
+    [TRR_MODE_PREF]: 5,
+    [ROLLOUT_ENABLED_PREF]: true,
+    expectedSelectedIndex: OFF_OPTION_INDEX,
+  },
+  {
+    name: "heuristics on but disabled, mode set to 2",
+    [TRR_MODE_PREF]: 2,
+    [ROLLOUT_ENABLED_PREF]: true,
+    expectedSelectedIndex: ENABLED_OPTION_INDEX,
+  },
+
+  // verify picking each radio button option gives the right outcomes
+  {
+    name: "toggle mode on",
+    clickMode: "dohEnabledRadio",
+    expectedModeValue: 2,
+    expectedUriValue: "",
+    expectedFinalUriPref: "",
+  },
+  {
+    name: "toggle mode off",
+    [TRR_MODE_PREF]: 2,
+    expectedSelectedIndex: ENABLED_OPTION_INDEX,
+    clickMode: "dohOffRadio",
+    expectedModePref: 5,
+  },
+  {
+    name: "toggle mode off when on due to heuristics",
+    [TRR_MODE_PREF]: 0,
+    [ROLLOUT_ENABLED_PREF]: true,
+    expectedSelectedIndex: DEFAULT_OPTION_INDEX,
+    clickMode: "dohOffRadio",
+    expectedModePref: 5,
+    expectedDisabledHeuristics: true,
+  },
+  // Test selecting non-default, non-custom TRR provider, NextDNS.
+  {
+    name: "Select NextDNS as TRR provider",
+    [TRR_MODE_PREF]: 2,
+    selectResolver: SECOND_RESOLVER_VALUE,
+    expectedFinalUriPref: SECOND_RESOLVER_VALUE,
+  },
+  // Test selecting non-default, non-custom TRR provider, NextDNS,
+  // with DoH not enabled. The provider selection should stick.
+  {
+    name: "Select NextDNS as TRR provider in mode 0",
+    [TRR_MODE_PREF]: 0,
+    selectResolver: SECOND_RESOLVER_VALUE,
+    expectedFinalUriPref: SECOND_RESOLVER_VALUE,
+  },
+  {
+    name: "return to default from NextDNS",
+    [TRR_MODE_PREF]: 2,
+    [TRR_URI_PREF]: SECOND_RESOLVER_VALUE,
+    expectedResolverListValue: SECOND_RESOLVER_VALUE,
+    selectResolver: DEFAULT_RESOLVER_VALUE,
+    expectedFinalUriPref: FIRST_RESOLVER_VALUE,
+  },
+  // test that selecting Custom, when we have a TRR_CUSTOM_URI_PREF subsequently changes TRR_URI_PREF
+  {
+    name: "select custom with existing custom_uri pref value",
+    [TRR_MODE_PREF]: 2,
+    [TRR_CUSTOM_URI_PREF]: "https://example.com",
+    expectedModeValue: 2,
+    expectedSelectedIndex: ENABLED_OPTION_INDEX,
+    selectResolver: "custom",
+    expectedUriValue: "https://example.com",
+    expectedFinalUriPref: "https://example.com",
+    expectedFinalCustomUriPref: "https://example.com",
+  },
+  {
+    name: "select custom and enter new custom_uri pref value",
+    [TRR_URI_PREF]: "",
+    [TRR_CUSTOM_URI_PREF]: "",
+    clickMode: "dohEnabledRadio",
+    selectResolver: "custom",
+    inputUriKeys: "https://custom.com",
+    expectedModePref: 2,
+    expectedFinalUriPref: "https://custom.com",
+    expectedFinalCustomUriPref: "https://custom.com",
+  },
+
+  {
+    name: "return to default from custom",
+    [TRR_MODE_PREF]: 2,
+    [TRR_URI_PREF]: "https://example.com",
+    [TRR_CUSTOM_URI_PREF]: "https://custom.com",
+    expectedUriValue: "https://example.com",
+    expectedResolverListValue: "custom",
+    selectResolver: DEFAULT_RESOLVER_VALUE,
+    expectedFinalUriPref: DEFAULT_RESOLVER_VALUE,
+    expectedFinalCustomUriPref: "https://example.com",
+  },
+  {
+    name: "clear the custom uri",
+    [TRR_MODE_PREF]: 2,
+    [TRR_URI_PREF]: "https://example.com",
+    [TRR_CUSTOM_URI_PREF]: "https://example.com",
+    expectedUriValue: "https://example.com",
+    expectedResolverListValue: "custom",
+    inputUriKeys: "",
+    expectedFinalUriPref: " ",
+    expectedFinalCustomUriPref: "",
+  },
+  {
+    name: "empty default resolver list",
+    [TRR_MODE_PREF]: 2,
+    [TRR_URI_PREF]: "https://example.com",
+    [TRR_CUSTOM_URI_PREF]: "",
+    expectedUriValue: "https://example.com",
+    expectedResolverListValue: "custom",
+    expectedFinalUriPref: "https://example.com",
+    expectedFinalCustomUriPref: "https://example.com",
+  },
+];
+
+for (let props of testVariations) {
+  add_task(async function testVariation() {
+    let startTime = Date.now();
+    info("starting test: " + props.name);
+    await testWithProperties(props, startTime);
+    await resetPrefs();
+  });
+}
+
+add_task(async function testRemoteSettingsEnable() {
+  let startTime = Date.now();
+  // Enable the rollout.
+  await DoHTestUtils.loadRemoteSettingsConfig({
+    providers: "example-1, example-2",
+    rolloutEnabled: true,
+    steeringEnabled: false,
+    steeringProviders: "",
+    autoDefaultEnabled: false,
+    autoDefaultProviders: "",
+    id: "global",
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  let doc = gBrowser.selectedBrowser.contentDocument;
+
+  info(Date.now() - startTime + ": testWithProperties: tab now open");
+  let modeRadioGroup = doc.getElementById("dohCategoryRadioGroup");
+
+  is(modeRadioGroup.value, "0", "expecting default mode");
+
+  let status = doc.getElementById("dohStatus");
+  await TestUtils.waitForCondition(
+    () => document.l10n.getAttributes(status).args.status == "Active"
+  );
+  is(
+    document.l10n.getAttributes(status).args.status,
+    "Active",
+    "expecting status active"
+  );
+
+  let provider = doc.getElementById("dohResolver");
+  is(
+    provider.hidden,
+    false,
+    "Provider should not be hidden when status is active"
+  );
+  await TestUtils.waitForCondition(
+    () =>
+      document.l10n.getAttributes(provider).args.name ==
+      DoHConfigController.currentConfig.providerList[0].UIName
+  );
+  is(
+    document.l10n.getAttributes(provider).args.name,
+    DoHConfigController.currentConfig.providerList[0].UIName,
+    "expecting the right provider name"
+  );
+
+  let option = doc.getElementById("dohEnabledRadio");
+  option.scrollIntoView();
+  let win = doc.ownerGlobal;
+  EventUtils.synthesizeMouseAtCenter(option, {}, win);
+
+  await TestUtils.waitForCondition(() =>
+    Services.prefs.prefHasUserValue("doh-rollout.disable-heuristics")
+  );
+  is(provider.hidden, false);
+  await TestUtils.waitForCondition(
+    () =>
+      document.l10n.getAttributes(provider).args.name ==
+      DoHConfigController.currentConfig.providerList[0].UIName
+  );
+  is(
+    document.l10n.getAttributes(provider).args.name,
+    DoHConfigController.currentConfig.providerList[0].UIName,
+    "expecting the right provider name"
+  );
+  is(
+    Services.prefs.getIntPref("network.trr.mode"),
+    Ci.nsIDNSService.MODE_TRRFIRST
+  );
+
+  option = doc.getElementById("dohOffRadio");
+  option.scrollIntoView();
+  win = doc.ownerGlobal;
+  EventUtils.synthesizeMouseAtCenter(option, {}, win);
+  await TestUtils.waitForCondition(() => status.innerHTML == "Status: Off");
+  is(
+    Services.prefs.getIntPref("network.trr.mode"),
+    Ci.nsIDNSService.MODE_TRROFF
+  );
+  is(provider.hidden, true, "Expecting provider to be hidden when DoH is off");
+
+  gBrowser.removeCurrentTab();
+});
+
+add_task(async function testEnterprisePolicy() {
+  async function withPolicy(policy, fn, preFn = () => {}) {
+    await resetPrefs();
+    PoliciesPrefTracker.start();
+    await EnterprisePolicyTesting.setupPolicyEngineWithJson(policy);
+    await preFn();
+
+    await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+    let doc = gBrowser.selectedBrowser.contentDocument;
+
+    let modeRadioGroup = doc.getElementById("dohCategoryRadioGroup");
+    let resolverMenulist = doc.getElementById("dohEnabledResolverChoices");
+    let uriTextbox = doc.getElementById("dohEnabledInputField");
+
+    await fn({
+      modeRadioGroup,
+      resolverMenulist,
+      doc,
+      uriTextbox,
+    });
+
+    gBrowser.removeCurrentTab();
+    EnterprisePolicyTesting.resetRunOnceState();
+    PoliciesPrefTracker.stop();
+  }
+
+  info("Check that a locked policy does not allow any changes in the UI");
+  await withPolicy(
+    {
+      policies: {
+        DNSOverHTTPS: {
+          Enabled: true,
+          ProviderURL: "https://examplelocked.com/provider",
+          ExcludedDomains: ["examplelocked.com", "example.org"],
+          Locked: true,
+        },
+      },
+    },
+    async res => {
+      is(res.modeRadioGroup.disabled, true, "The mode menu should be locked.");
+      is(res.modeRadioGroup.value, "2", "Should be enabled");
+      is(res.resolverMenulist.value, "custom", "Resolver list shows custom");
+      is(
+        res.uriTextbox.value,
+        "https://examplelocked.com/provider",
+        "Custom URI should be set"
+      );
+    }
+  );
+
+  info("Check that an unlocked policy has editable fields in the dialog");
+  await withPolicy(
+    {
+      policies: {
+        DNSOverHTTPS: {
+          Enabled: true,
+          ProviderURL: "https://example.com/provider",
+          ExcludedDomains: ["example.com", "example.org"],
+        },
+      },
+    },
+    async res => {
+      is(
+        res.modeRadioGroup.disabled,
+        false,
+        "The mode menu should not be locked."
+      );
+      is(res.modeRadioGroup.value, "2", "Should be enabled");
+      is(res.resolverMenulist.value, "custom", "Resolver list shows custom");
+      is(
+        res.uriTextbox.value,
+        "https://example.com/provider",
+        "Expected custom resolver"
+      );
+    }
+  );
+
+  info("Check that a locked disabled policy disables the buttons");
+  await withPolicy(
+    {
+      policies: {
+        DNSOverHTTPS: {
+          Enabled: false,
+          ProviderURL: "https://example.com/provider",
+          ExcludedDomains: ["example.com", "example.org"],
+          Locked: true,
+        },
+      },
+    },
+    async res => {
+      is(res.modeRadioGroup.disabled, true, "The mode menu should be locked.");
+      is(res.modeRadioGroup.value, "5", "Should be disabled");
+    }
+  );
+
+  info("Check that an unlocked disabled policy has editable fields");
+  await withPolicy(
+    {
+      policies: {
+        DNSOverHTTPS: {
+          Enabled: false,
+          ProviderURL: "https://example.com/provider",
+          ExcludedDomains: ["example.com", "example.org"],
+        },
+      },
+    },
+    async res => {
+      is(
+        res.modeRadioGroup.disabled,
+        false,
+        "The mode menu should not be locked."
+      );
+      is(res.modeRadioGroup.value, "5", "Should be disabled");
+    }
+  );
+
+  info("Check that the remote settings config doesn't override the policy");
+  await withPolicy(
+    {
+      policies: {
+        DNSOverHTTPS: {
+          Enabled: true,
+          ProviderURL: "https://example.com/provider",
+          ExcludedDomains: ["example.com", "example.org"],
+        },
+      },
+    },
+    async res => {
+      is(
+        res.modeRadioGroup.disabled,
+        false,
+        "The mode menu should not be locked."
+      );
+      is(res.resolverMenulist.value, "custom", "Resolver list shows custom");
+      is(
+        res.uriTextbox.value,
+        "https://example.com/provider",
+        "Expected custom resolver"
+      );
+    },
+    async function runAfterSettingPolicy() {
+      await DoHTestUtils.loadRemoteSettingsConfig({
+        providers: "example-1, example-2",
+        rolloutEnabled: true,
+        steeringEnabled: false,
+        steeringProviders: "",
+        autoDefaultEnabled: false,
+        autoDefaultProviders: "",
+        id: "global",
+      });
+    }
+  );
+});
+
+add_task(async function clickWarnButton() {
+  Services.prefs.setBoolPref(
+    "network.trr_ui.show_fallback_warning_option",
+    true
+  );
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  let doc = gBrowser.selectedBrowser.contentDocument;
+
+  await clearEvents();
+  let checkbox = doc.getElementById("dohWarnCheckbox1");
+  checkbox.click();
+
+  let event = await getEvent("security.doh.settings", "warn_checkbox");
+  Assert.deepEqual(event, [
+    "security.doh.settings",
+    "warn_checkbox",
+    "checkbox",
+    "true",
+  ]);
+  Assert.equal(
+    Services.prefs.getBoolPref("network.trr.display_fallback_warning"),
+    true,
+    "Clicking the checkbox should change the pref"
+  );
+
+  checkbox.click();
+  event = await getEvent("security.doh.settings", "warn_checkbox");
+  Assert.deepEqual(event, [
+    "security.doh.settings",
+    "warn_checkbox",
+    "checkbox",
+    "false",
+  ]);
+  Assert.equal(
+    Services.prefs.getBoolPref("network.trr.display_fallback_warning"),
+    false,
+    "Clicking the checkbox should change the pref"
+  );
+  gBrowser.removeCurrentTab();
+});
diff --git a/browser/components/preferences/tests/browser_privacy_firefoxSuggest.js b/browser/components/preferences/tests/browser_privacy_firefoxSuggest.js
new file mode 100644
index 0000000000..c5fc24206b
--- /dev/null
+++ b/browser/components/preferences/tests/browser_privacy_firefoxSuggest.js
@@ -0,0 +1,140 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+// This tests the Privacy pane's Firefox Suggest UI.
+
+"use strict";
+
+ChromeUtils.defineESModuleGetters(this, {
+  QuickSuggest: "resource:///modules/QuickSuggest.sys.mjs",
+});
+
+const CONTAINER_ID = "dataCollectionGroup";
+const DATA_COLLECTION_TOGGLE_ID = "firefoxSuggestDataCollectionPrivacyToggle";
+const LEARN_MORE_CLASS = "firefoxSuggestLearnMore";
+
+// This test can take a while due to the many permutations some of these tasks
+// run through, so request a longer timeout.
+requestLongerTimeout(10);
+
+// Clicks each of the checkboxes and toggles and makes sure the prefs and info box are updated.
+add_task(async function clickCheckboxesOrToggle() {
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let dataCollectionSection = doc.getElementById(CONTAINER_ID);
+  dataCollectionSection.scrollIntoView();
+
+  async function clickElement(id, eventName) {
+    let element = doc.getElementById(id);
+    let changed = BrowserTestUtils.waitForEvent(element, eventName);
+
+    if (eventName == "toggle") {
+      element = element.buttonEl;
+    }
+
+    EventUtils.synthesizeMouseAtCenter(
+      element,
+      {},
+      gBrowser.selectedBrowser.contentWindow
+    );
+    await changed;
+  }
+
+  // Set initial state.
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.urlbar.quicksuggest.dataCollection.enabled", true]],
+  });
+  assertPrefUIState({
+    [DATA_COLLECTION_TOGGLE_ID]: true,
+  });
+
+  // data collection toggle
+  await clickElement(DATA_COLLECTION_TOGGLE_ID, "toggle");
+  Assert.ok(
+    !Services.prefs.getBoolPref(
+      "browser.urlbar.quicksuggest.dataCollection.enabled"
+    ),
+    "quicksuggest.dataCollection.enabled is false after clicking data collection toggle"
+  );
+  assertPrefUIState({
+    [DATA_COLLECTION_TOGGLE_ID]: false,
+  });
+
+  gBrowser.removeCurrentTab();
+  await SpecialPowers.popPrefEnv();
+});
+
+// Clicks the learn-more links and checks the help page is opened in a new tab.
+add_task(async function clickLearnMore() {
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let dataCollectionSection = doc.getElementById(CONTAINER_ID);
+  dataCollectionSection.scrollIntoView();
+
+  // Set initial state so that the info box and learn more link are shown.
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.urlbar.quicksuggest.dataCollection.enabled", true]],
+  });
+
+  let learnMoreLinks = doc.querySelectorAll(
+    `#${CONTAINER_ID} .` + LEARN_MORE_CLASS
+  );
+  Assert.equal(
+    learnMoreLinks.length,
+    1,
+    "Expected number of learn-more links are present"
+  );
+  for (let link of learnMoreLinks) {
+    Assert.ok(
+      BrowserTestUtils.isVisible(link),
+      "Learn-more link is visible: " + link.id
+    );
+  }
+
+  let prefsTab = gBrowser.selectedTab;
+  for (let link of learnMoreLinks) {
+    let tabPromise = BrowserTestUtils.waitForNewTab(
+      gBrowser,
+      QuickSuggest.HELP_URL
+    );
+    info("Clicking learn-more link: " + link.id);
+    Assert.ok(link.id, "Sanity check: Learn-more link has an ID");
+    await BrowserTestUtils.synthesizeMouseAtCenter(
+      "#" + link.id,
+      {},
+      gBrowser.selectedBrowser
+    );
+    info("Waiting for help page to load in a new tab");
+    await tabPromise;
+    gBrowser.removeCurrentTab();
+    gBrowser.selectedTab = prefsTab;
+  }
+
+  gBrowser.removeCurrentTab();
+  await SpecialPowers.popPrefEnv();
+});
+
+/**
+ * Verifies the state of pref related to checkboxes or toggles.
+ *
+ * @param {object} stateByElementID
+ *   Maps checkbox or toggle element IDs to booleans. Each boolean
+ *   is the expected state of the corresponding ID.
+ */
+function assertPrefUIState(stateByElementID) {
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let container = doc.getElementById(CONTAINER_ID);
+  let attr;
+  Assert.ok(BrowserTestUtils.isVisible(container), "The container is visible");
+  for (let [id, state] of Object.entries(stateByElementID)) {
+    let element = doc.getElementById(id);
+    if (element.tagName === "checkbox") {
+      attr = "checked";
+    } else if (element.tagName === "html:moz-toggle") {
+      attr = "pressed";
+    }
+    Assert.equal(element[attr], state, "Expected state for ID: " + id);
+  }
+}
diff --git a/browser/components/preferences/tests/browser_privacy_gpc.js b/browser/components/preferences/tests/browser_privacy_gpc.js
new file mode 100644
index 0000000000..0bdd9d6dae
--- /dev/null
+++ b/browser/components/preferences/tests/browser_privacy_gpc.js
@@ -0,0 +1,182 @@
+/* Any copyright is dedicated to the Public Domain.
+ * https://creativecommons.org/publicdomain/zero/1.0/ */
+
+// This file tests the Privacy pane's Cookie Banner Handling UI.
+
+"use strict";
+
+const FEATURE_PREF = "privacy.globalprivacycontrol.functionality.enabled";
+const MODE_PREF = "privacy.globalprivacycontrol.enabled";
+const DNT_PREF = "privacy.donottrackheader.enabled";
+
+const SECTION_ID = "nonTechnicalPrivacyBox";
+const GPC_ID = "globalPrivacyControlBox";
+const GPC_CHECKBOX_ID = "globalPrivacyControlCheckbox";
+const OLD_DNT_ID = "legacyDoNotTrackBox";
+const NEW_DNT_ID = "doNotTrackBox";
+const DNT_CHECKBOX_ID = "doNotTrackCheckbox";
+
+// Test the section is hidden on page load if the feature pref is disabled.
+// Also make sure we keep the old DNT interface.
+add_task(async function test_section_hidden_when_feature_flag_disabled() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      [FEATURE_PREF, false],
+      [MODE_PREF, false],
+    ],
+  });
+
+  await BrowserTestUtils.withNewTab(
+    { gBrowser, url: "about:preferences#privacy" },
+    async function (browser) {
+      let gpc = browser.contentDocument.getElementById(GPC_ID);
+      is_element_hidden(gpc, "#globalPrivacyControlBox is hidden");
+      let new_dnt = browser.contentDocument.getElementById(NEW_DNT_ID);
+      is_element_hidden(new_dnt, "#doNotTrackBox is hidden");
+      let old_dnt = browser.contentDocument.getElementById(OLD_DNT_ID);
+      is_element_visible(old_dnt, "#doNotTrackBox is shown");
+    }
+  );
+
+  await SpecialPowers.popPrefEnv();
+});
+
+// Test the section is shown on page load if the feature pref is enabled.
+// Also make sure we show the new DNT interface.
+add_task(async function test_section_shown_when_feature_flag_enabled() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      [FEATURE_PREF, true],
+      [MODE_PREF, false],
+    ],
+  });
+
+  await BrowserTestUtils.withNewTab(
+    { gBrowser, url: "about:preferences#privacy" },
+    async function (browser) {
+      let gpc = browser.contentDocument.getElementById(GPC_ID);
+      is_element_visible(gpc, "#globalPrivacyControlBox is shown");
+      let new_dnt = browser.contentDocument.getElementById(NEW_DNT_ID);
+      is_element_visible(new_dnt, "#doNotTrackBox is shown");
+      let old_dnt = browser.contentDocument.getElementById(OLD_DNT_ID);
+      is_element_hidden(old_dnt, "#doNotTrackBox is hidden");
+    }
+  );
+
+  await SpecialPowers.popPrefEnv();
+});
+
+// Test the checkbox is unchecked in DISABLED mode.
+add_task(async function test_checkbox_unchecked_disabled_mode() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      [FEATURE_PREF, true],
+      [MODE_PREF, false],
+    ],
+  });
+
+  await BrowserTestUtils.withNewTab(
+    { gBrowser, url: "about:preferences#privacy" },
+    async function (browser) {
+      let checkbox = browser.contentDocument.getElementById(GPC_CHECKBOX_ID);
+      ok(!checkbox.checked, "checkbox is not checked in DISABLED mode");
+    }
+  );
+
+  await SpecialPowers.popPrefEnv();
+});
+
+// Test that toggling the checkbox toggles the mode pref value as expected
+add_task(async function test_checkbox_modifies_prefs() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      [FEATURE_PREF, true],
+      [MODE_PREF, false],
+    ],
+  });
+
+  await BrowserTestUtils.withNewTab(
+    { gBrowser, url: "about:preferences#privacy" },
+    async function (browser) {
+      let gpc_checkbox =
+        browser.contentDocument.getElementById(GPC_CHECKBOX_ID);
+      let dnt_checkbox =
+        browser.contentDocument.getElementById(DNT_CHECKBOX_ID);
+      let section = browser.contentDocument.getElementById(SECTION_ID);
+
+      section.scrollIntoView();
+
+      Assert.ok(
+        !gpc_checkbox.checked && !dnt_checkbox.checked,
+        "initially, the checkbox should be unchecked"
+      );
+
+      await BrowserTestUtils.synthesizeMouseAtCenter(
+        "#" + GPC_CHECKBOX_ID,
+        {},
+        browser
+      );
+      Assert.ok(
+        gpc_checkbox.checked && !dnt_checkbox.checked,
+        "gpc checkbox should be checked"
+      );
+      Assert.equal(
+        true,
+        Services.prefs.getBoolPref(MODE_PREF),
+        "GPC should be on after checking the checkbox"
+      );
+      Assert.equal(
+        false,
+        Services.prefs.getBoolPref(DNT_PREF),
+        "DNT should still be disabled after checking the checkbox"
+      );
+
+      await BrowserTestUtils.synthesizeMouseAtCenter(
+        "#" + DNT_CHECKBOX_ID,
+        {},
+        browser
+      );
+      Assert.ok(
+        gpc_checkbox.checked && dnt_checkbox.checked,
+        "both checkboxes are enabled"
+      );
+      Assert.equal(
+        true,
+        Services.prefs.getBoolPref(MODE_PREF),
+        "GPC should still be on after checking the DNT checkbox"
+      );
+      Assert.equal(
+        true,
+        Services.prefs.getBoolPref(DNT_PREF),
+        "DNT should still be enabled after checking the checkbox"
+      );
+
+      await BrowserTestUtils.synthesizeMouseAtCenter(
+        "#" + DNT_CHECKBOX_ID,
+        {},
+        browser
+      );
+      await BrowserTestUtils.synthesizeMouseAtCenter(
+        "#" + GPC_CHECKBOX_ID,
+        {},
+        browser
+      );
+      Assert.ok(
+        !gpc_checkbox.checked && !dnt_checkbox.checked,
+        "both checkboxes are disabled"
+      );
+      Assert.equal(
+        false,
+        Services.prefs.getBoolPref(MODE_PREF),
+        "GPC should be unchecked"
+      );
+      Assert.equal(
+        false,
+        Services.prefs.getBoolPref(DNT_PREF),
+        "DNT should be unchecked"
+      );
+    }
+  );
+
+  await SpecialPowers.popPrefEnv();
+});
diff --git a/browser/components/preferences/tests/browser_privacy_passwordGenerationAndAutofill.js b/browser/components/preferences/tests/browser_privacy_passwordGenerationAndAutofill.js
new file mode 100644
index 0000000000..6a6e419229
--- /dev/null
+++ b/browser/components/preferences/tests/browser_privacy_passwordGenerationAndAutofill.js
@@ -0,0 +1,199 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+add_task(async function initialState() {
+  // check pref permutations to verify the UI opens in the correct state
+  const prefTests = [
+    {
+      initialPrefs: [
+        ["signon.rememberSignons", true],
+        ["signon.generation.available", true],
+        ["signon.generation.enabled", true],
+        ["signon.autofillForms", true],
+      ],
+      expected: "checked",
+    },
+    {
+      initialPrefs: [
+        ["signon.rememberSignons", true],
+        ["signon.generation.available", true],
+        ["signon.generation.enabled", false],
+        ["signon.autofillForms", false],
+      ],
+      expected: "unchecked",
+    },
+    {
+      initialPrefs: [
+        ["signon.rememberSignons", true],
+        ["signon.generation.available", false],
+        ["signon.generation.enabled", false],
+      ],
+      expected: "hidden",
+    },
+    {
+      initialPrefs: [
+        ["signon.rememberSignons", false],
+        ["signon.generation.available", true],
+        ["signon.generation.enabled", true],
+        ["signon.autofillForms", true],
+      ],
+      expected: "disabled",
+    },
+  ];
+  for (let test of prefTests) {
+    // set initial pref values
+    info("initialState, testing with: " + JSON.stringify(test));
+    await SpecialPowers.pushPrefEnv({ set: test.initialPrefs });
+
+    // open about:privacy in a tab
+    // verify expected conditions
+    await BrowserTestUtils.withNewTab(
+      {
+        gBrowser,
+        url: "about:preferences#privacy",
+      },
+      async function (browser) {
+        let doc = browser.contentDocument;
+        let generatePasswordsCheckbox = doc.getElementById("generatePasswords");
+        let autofillFormsCheckbox = doc.getElementById(
+          "passwordAutofillCheckbox"
+        );
+        doc.getElementById("passwordSettings").scrollIntoView();
+
+        info("initialState, assert on expected state:" + test.expected);
+        switch (test.expected) {
+          case "hidden":
+            is_element_hidden(
+              generatePasswordsCheckbox,
+              "#generatePasswords checkbox is hidden"
+            );
+            break;
+          case "checked":
+            is_element_visible(
+              generatePasswordsCheckbox,
+              "#generatePasswords checkbox is visible"
+            );
+            ok(
+              generatePasswordsCheckbox.checked,
+              "#generatePasswords checkbox is checked"
+            );
+            ok(
+              autofillFormsCheckbox.checked,
+              "#passwordAutofillCheckbox is checked"
+            );
+            break;
+          case "unchecked":
+            ok(
+              !generatePasswordsCheckbox.checked,
+              "#generatePasswords checkbox is un-checked"
+            );
+            ok(
+              !autofillFormsCheckbox.checked,
+              "#passwordAutofillCheckbox is un-checked"
+            );
+            break;
+          case "disabled":
+            ok(
+              generatePasswordsCheckbox.disabled,
+              "#generatePasswords checkbox is disabled"
+            );
+            ok(
+              autofillFormsCheckbox.disabled,
+              "#passwordAutofillCheckbox is disabled"
+            );
+            break;
+          default:
+            ok(false, "Unknown expected state: " + test.expected);
+        }
+      }
+    );
+    await SpecialPowers.popPrefEnv();
+  }
+});
+
+add_task(async function toggleGenerationEnabled() {
+  // clicking the checkbox should toggle the pref
+  SpecialPowers.pushPrefEnv({
+    set: [
+      ["signon.generation.available", true],
+      ["signon.generation.enabled", false],
+      ["signon.rememberSignons", true],
+    ],
+  });
+
+  await BrowserTestUtils.withNewTab(
+    {
+      gBrowser,
+      url: "about:preferences#privacy",
+    },
+    async function (browser) {
+      let doc = browser.contentDocument;
+      let checkbox = doc.getElementById("generatePasswords");
+
+      info("waiting for the browser to have focus");
+      await SimpleTest.promiseFocus(browser);
+      let prefChanged = TestUtils.waitForPrefChange(
+        "signon.generation.enabled"
+      );
+
+      // the preferences "Search" bar obscures the checkbox if we scrollIntoView and try to click on it
+      // so use keyboard events instead
+      checkbox.focus();
+      is(doc.activeElement, checkbox, "checkbox is focused");
+      EventUtils.synthesizeKey(" ");
+
+      info("waiting for pref to change");
+      await prefChanged;
+      ok(checkbox.checked, "#generatePasswords checkbox is checked");
+      ok(
+        Services.prefs.getBoolPref("signon.generation.enabled"),
+        "enabled pref is now true"
+      );
+    }
+  );
+  await SpecialPowers.popPrefEnv();
+});
+
+add_task(async function toggleRememberSignon() {
+  // toggling rememberSignons checkbox should make generation checkbox disabled
+  SpecialPowers.pushPrefEnv({
+    set: [
+      ["signon.generation.available", true],
+      ["signon.generation.enabled", true],
+      ["signon.rememberSignons", true],
+    ],
+  });
+
+  await BrowserTestUtils.withNewTab(
+    {
+      gBrowser,
+      url: "about:preferences#privacy",
+    },
+    async function (browser) {
+      let doc = browser.contentDocument;
+      let checkbox = doc.getElementById("savePasswords");
+      let generationCheckbox = doc.getElementById("generatePasswords");
+
+      ok(
+        !generationCheckbox.disabled,
+        "generation checkbox is not initially disabled"
+      );
+
+      info("waiting for the browser to have focus");
+      await SimpleTest.promiseFocus(browser);
+      let prefChanged = TestUtils.waitForPrefChange("signon.rememberSignons");
+
+      // the preferences "Search" bar obscures the checkbox if we scrollIntoView and try to click on it
+      // so use keyboard events instead
+      checkbox.focus();
+      is(doc.activeElement, checkbox, "checkbox is focused");
+      EventUtils.synthesizeKey(" ");
+
+      info("waiting for pref to change");
+      await prefChanged;
+      ok(!checkbox.checked, "#savePasswords checkbox is un-checked");
+      ok(generationCheckbox.disabled, "generation checkbox becomes disabled");
+    }
+  );
+  await SpecialPowers.popPrefEnv();
+});
diff --git a/browser/components/preferences/tests/browser_privacy_relayIntegration.js b/browser/components/preferences/tests/browser_privacy_relayIntegration.js
new file mode 100644
index 0000000000..23d62f38bd
--- /dev/null
+++ b/browser/components/preferences/tests/browser_privacy_relayIntegration.js
@@ -0,0 +1,251 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+add_task(async function initialState() {
+  // check pref permutations to verify the UI opens in the correct state
+  const prefTests = [
+    {
+      initialPrefs: [
+        ["signon.firefoxRelay.feature", undefined],
+        ["signon.rememberSignons", true],
+      ],
+      expected: "hidden",
+    },
+    {
+      initialPrefs: [
+        ["signon.firefoxRelay.feature", "available"],
+        ["signon.rememberSignons", true],
+      ],
+      expected: "checked",
+    },
+    {
+      initialPrefs: [
+        ["signon.firefoxRelay.feature", "enabled"],
+        ["signon.rememberSignons", true],
+      ],
+      expected: "checked",
+    },
+    {
+      initialPrefs: [
+        ["signon.firefoxRelay.feature", "disabled"],
+        ["signon.rememberSignons", true],
+      ],
+      expected: "unchecked",
+    },
+    {
+      initialPrefs: [
+        ["signon.firefoxRelay.feature", undefined],
+        ["signon.rememberSignons", false],
+      ],
+      expected: "hidden",
+    },
+    {
+      initialPrefs: [
+        ["signon.firefoxRelay.feature", "available"],
+        ["signon.rememberSignons", false],
+      ],
+      expected: "checked",
+    },
+    {
+      initialPrefs: [
+        ["signon.firefoxRelay.feature", "enabled"],
+        ["signon.rememberSignons", false],
+      ],
+      expected: "checked",
+    },
+    {
+      initialPrefs: [
+        ["signon.firefoxRelay.feature", "disabled"],
+        ["signon.rememberSignons", false],
+      ],
+      expected: "unchecked",
+    },
+  ];
+  for (let test of prefTests) {
+    // set initial pref values
+    info("initialState, testing with: " + JSON.stringify(test));
+    await SpecialPowers.pushPrefEnv({ set: test.initialPrefs });
+
+    // open about:privacy in a tab
+    // verify expected conditions
+    await BrowserTestUtils.withNewTab(
+      {
+        gBrowser,
+        url: "about:preferences#privacy",
+      },
+      async function (browser) {
+        const doc = browser.contentDocument;
+        const relayGroup = doc.getElementById("relayIntegrationBox");
+        const checkbox = doc.getElementById("relayIntegration");
+        const savePasswords = doc.getElementById("savePasswords");
+        doc.getElementById("passwordSettings").scrollIntoView();
+
+        Assert.equal(
+          checkbox.disabled,
+          !savePasswords.checked,
+          "#relayIntegration checkbox disabled when #passwordAutofillCheckbox is unchecked"
+        );
+
+        switch (test.expected) {
+          case "hidden":
+            is_element_hidden(relayGroup, "#relayIntegrationBox is hidden");
+            break;
+          case "checked":
+            is_element_visible(relayGroup, "#relayIntegrationBox is visible");
+            Assert.ok(
+              checkbox.checked,
+              "#relayIntegration checkbox is checked"
+            );
+            break;
+          case "unchecked":
+            is_element_visible(relayGroup, "#relayIntegrationBox is visible");
+            Assert.ok(
+              !checkbox.checked,
+              "#relayIntegration checkbox is un-checked"
+            );
+            break;
+          default:
+            Assert.ok(false, "Unknown expected state: " + test.expected);
+            break;
+        }
+      }
+    );
+    await SpecialPowers.popPrefEnv();
+  }
+});
+
+add_task(async function toggleRelayIntegration() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["signon.firefoxRelay.feature", "enabled"],
+      ["signon.rememberSignons", true],
+    ],
+  });
+
+  await BrowserTestUtils.withNewTab(
+    {
+      gBrowser,
+      url: "about:preferences#privacy",
+    },
+    async browser => {
+      await SimpleTest.promiseFocus(browser);
+
+      // the preferences "Search" bar obscures the checkbox if we scrollIntoView and try to click on it
+      // so use keyboard events instead
+      const doc = browser.contentDocument;
+      const relayCheckbox = doc.getElementById("relayIntegration");
+      relayCheckbox.focus();
+      Assert.equal(doc.activeElement, relayCheckbox, "checkbox is focused");
+      Assert.equal(
+        relayCheckbox.checked,
+        true,
+        "#relayIntegration checkbox is not checked"
+      );
+
+      async function clickOnFeatureCheckbox(
+        expectedPrefValue,
+        expectedCheckValue,
+        message
+      ) {
+        const prefChanged = TestUtils.waitForPrefChange(
+          "signon.firefoxRelay.feature"
+        );
+        EventUtils.synthesizeKey(" ");
+        await prefChanged;
+        Assert.equal(
+          Services.prefs.getStringPref("signon.firefoxRelay.feature"),
+          expectedPrefValue,
+          message
+        );
+        Assert.equal(
+          relayCheckbox.checked,
+          expectedCheckValue,
+          `#relayIntegration checkbox is ${
+            expectedCheckValue ? "checked" : "unchecked"
+          }`
+        );
+      }
+
+      await clickOnFeatureCheckbox(
+        "disabled",
+        false,
+        'Turn integration off from "enabled" feature state'
+      );
+      await clickOnFeatureCheckbox(
+        "available",
+        true,
+        'Turn integration on from "enabled" feature state'
+      );
+      await clickOnFeatureCheckbox(
+        "disabled",
+        false,
+        'Turn integration off from "enabled" feature state'
+      );
+    }
+  );
+  await SpecialPowers.popPrefEnv();
+});
+
+add_task(async function toggleRememberSignon() {
+  // toggling rememberSignons checkbox should make generation checkbox disabled
+  SpecialPowers.pushPrefEnv({
+    set: [
+      ["signon.firefoxRelay.feature", "available"],
+      ["signon.rememberSignons", true],
+    ],
+  });
+
+  await BrowserTestUtils.withNewTab(
+    {
+      gBrowser,
+      url: "about:preferences#privacy",
+    },
+    async function (browser) {
+      const doc = browser.contentDocument;
+      const checkbox = doc.getElementById("savePasswords");
+      const relayCheckbox = doc.getElementById("relayIntegration");
+
+      Assert.ok(
+        !relayCheckbox.disabled,
+        "generation checkbox is not initially disabled"
+      );
+
+      await SimpleTest.promiseFocus(browser);
+      const prefChanged = TestUtils.waitForPrefChange("signon.rememberSignons");
+
+      // the preferences "Search" bar obscures the checkbox if we scrollIntoView and try to click on it
+      // so use keyboard events instead
+      checkbox.focus();
+      Assert.equal(doc.activeElement, checkbox, "checkbox is focused");
+      EventUtils.synthesizeKey(" ");
+
+      await prefChanged;
+      Assert.ok(!checkbox.checked, "#savePasswords checkbox is un-checked");
+      Assert.ok(
+        relayCheckbox.disabled,
+        "Relay integration checkbox becomes disabled"
+      );
+    }
+  );
+  await SpecialPowers.popPrefEnv();
+});
+
+add_task(async function testLockedRelayPreference() {
+  // Locking relay preference should disable checkbox
+  Services.prefs.lockPref("signon.firefoxRelay.feature");
+
+  await BrowserTestUtils.withNewTab(
+    {
+      gBrowser,
+      url: "about:preferences#privacy",
+    },
+    async function (browser) {
+      const doc = browser.contentDocument;
+      const relayCheckbox = doc.getElementById("relayIntegration");
+
+      Assert.ok(relayCheckbox.disabled, "Relay checkbox should be disabled");
+    }
+  );
+
+  Services.prefs.unlockPref("signon.firefoxRelay.feature");
+});
diff --git a/browser/components/preferences/tests/browser_privacy_segmentation_pref.js b/browser/components/preferences/tests/browser_privacy_segmentation_pref.js
new file mode 100644
index 0000000000..43a6af2e53
--- /dev/null
+++ b/browser/components/preferences/tests/browser_privacy_segmentation_pref.js
@@ -0,0 +1,131 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+// Test the privacy segmentation pref and preferences UI.
+
+"use strict";
+
+const PREF = "browser.dataFeatureRecommendations.enabled";
+const PREF_VISIBILITY = "browser.privacySegmentation.preferences.show";
+
+add_task(async function test_preferences_section() {
+  if (!AppConstants.MOZ_DATA_REPORTING) {
+    ok(true, "Skipping test because data reporting is disabled");
+    return;
+  }
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let section = doc.getElementById("privacySegmentationSection");
+  let sectionHeader = section.querySelector("h2");
+  let sectionDescription = section.querySelector("label");
+  let radioGroup = section.querySelector(
+    "#privacyDataFeatureRecommendationRadioGroup"
+  );
+  let radioEnabled = radioGroup.querySelector(
+    "#privacyDataFeatureRecommendationEnabled"
+  );
+  let radioDisabled = radioGroup.querySelector(
+    "#privacyDataFeatureRecommendationDisabled"
+  );
+
+  for (let show of [false, true]) {
+    Services.prefs.setBoolPref(PREF_VISIBILITY, show);
+    let showStr = show ? "visible" : "hidden";
+
+    is(
+      BrowserTestUtils.isVisible(section),
+      show,
+      `Privacy Segmentation section should be ${showStr}.`
+    );
+    is(
+      BrowserTestUtils.isVisible(sectionHeader),
+      show,
+      `Privacy Segmentation section header should be ${showStr}.`
+    );
+    is(
+      BrowserTestUtils.isVisible(sectionDescription),
+      show,
+      `Privacy Segmentation section description should be ${showStr}.`
+    );
+    is(
+      BrowserTestUtils.isVisible(radioGroup),
+      show,
+      `Privacy Segmentation radio group should be ${showStr}.`
+    );
+
+    // The section is visible, test radio buttons.
+    if (show) {
+      Services.prefs.setBoolPref(PREF, false);
+
+      is(
+        radioGroup.value,
+        "false",
+        "Radio group should reflect initial pref state of false."
+      );
+
+      info("Selecting radio on.");
+      radioEnabled.click();
+      is(
+        Services.prefs.getBoolPref(PREF),
+        true,
+        "Privacy Segmentation should be enabled."
+      );
+
+      info("Selecting radio off.");
+      radioDisabled.click();
+      is(
+        Services.prefs.getBoolPref(PREF),
+        false,
+        "Privacy Segmentation should be disabled."
+      );
+
+      info("Updating pref externally");
+      is(
+        radioGroup.value,
+        "false",
+        "Radio group should reflect initial pref state of false."
+      );
+      Services.prefs.setBoolPref(PREF, true);
+      await BrowserTestUtils.waitForMutationCondition(
+        radioGroup,
+        { attributeFilter: ["value"] },
+        () => radioGroup.value == "true"
+      );
+      is(
+        radioGroup.value,
+        "true",
+        "Updating Privacy Segmentation pref also updates radio group."
+      );
+    }
+  }
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  Services.prefs.clearUserPref(PREF_VISIBILITY);
+  Services.prefs.clearUserPref(PREF);
+});
+
+add_task(async function test_preferences_section_data_reporting_disabled() {
+  if (AppConstants.MOZ_DATA_REPORTING) {
+    ok(true, "Skipping test because data reporting is enabled");
+    return;
+  }
+
+  for (let show of [false, true]) {
+    Services.prefs.setBoolPref(PREF_VISIBILITY, show);
+    await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+
+    let doc = gBrowser.selectedBrowser.contentDocument;
+    let section = doc.getElementById("privacySegmentationSection");
+    is(
+      !!section,
+      show,
+      "Section should only exist when privacy segmentation section is enabled."
+    );
+
+    BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  }
+
+  Services.prefs.clearUserPref(PREF_VISIBILITY);
+});
diff --git a/browser/components/preferences/tests/browser_privacy_syncDataClearing.js b/browser/components/preferences/tests/browser_privacy_syncDataClearing.js
new file mode 100644
index 0000000000..d5b6b904ab
--- /dev/null
+++ b/browser/components/preferences/tests/browser_privacy_syncDataClearing.js
@@ -0,0 +1,287 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+/*
+ * With no custom cleaning categories set and sanitizeOnShutdown disabled,
+ * the checkboxes "alwaysClear" and "deleteOnClose" should share the same state.
+ * The state of the cleaning categories cookies, cache and offlineApps should be in the state of the "deleteOnClose" box.
+ */
+add_task(async function test_syncWithoutCustomPrefs() {
+  await openPreferencesViaOpenPreferencesAPI("panePrivacy", {
+    leaveOpen: true,
+  });
+
+  let document = gBrowser.contentDocument;
+  let deleteOnCloseBox = document.getElementById("deleteOnClose");
+  let alwaysClearBox = document.getElementById("alwaysClear");
+
+  ok(!deleteOnCloseBox.checked, "DeleteOnClose initial state is deselected");
+  ok(!alwaysClearBox.checked, "AlwaysClear initial state is deselected");
+
+  deleteOnCloseBox.click();
+
+  ok(deleteOnCloseBox.checked, "DeleteOnClose is selected");
+  is(
+    deleteOnCloseBox.checked,
+    alwaysClearBox.checked,
+    "DeleteOnClose sets alwaysClear in the same state, selected"
+  );
+  ok(
+    Services.prefs.getBoolPref("privacy.clearOnShutdown.cookies"),
+    "Cookie cleaning pref is set"
+  );
+  ok(
+    Services.prefs.getBoolPref("privacy.clearOnShutdown.cache"),
+    "Cache cleaning pref is set"
+  );
+  ok(
+    Services.prefs.getBoolPref("privacy.clearOnShutdown.offlineApps"),
+    "OfflineApps cleaning pref is set"
+  );
+  ok(
+    !Services.prefs.getBoolPref("privacy.clearOnShutdown.downloads"),
+    "Downloads cleaning pref is not set"
+  );
+
+  deleteOnCloseBox.click();
+
+  ok(!deleteOnCloseBox.checked, "DeleteOnClose is deselected");
+  is(
+    deleteOnCloseBox.checked,
+    alwaysClearBox.checked,
+    "DeleteOnclose sets alwaysClear in the same state, deselected"
+  );
+
+  ok(
+    !Services.prefs.getBoolPref("privacy.clearOnShutdown.cookies"),
+    "Cookie cleaning pref is reset"
+  );
+  ok(
+    !Services.prefs.getBoolPref("privacy.clearOnShutdown.cache"),
+    "Cache cleaning pref is reset"
+  );
+  ok(
+    !Services.prefs.getBoolPref("privacy.clearOnShutdown.offlineApps"),
+    "OfflineApps cleaning pref is reset"
+  );
+  ok(
+    !Services.prefs.getBoolPref("privacy.clearOnShutdown.downloads"),
+    "Downloads cleaning pref is not set"
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  Services.prefs.clearUserPref("privacy.clearOnShutdown.downloads");
+  Services.prefs.clearUserPref("privacy.clearOnShutdown.offlineApps");
+  Services.prefs.clearUserPref("privacy.clearOnShutdown.cache");
+  Services.prefs.clearUserPref("privacy.clearOnShutdown.cookies");
+  Services.prefs.clearUserPref("privacy.sanitize.sanitizeOnShutdown");
+});
+
+/*
+ * With custom cleaning category already set and SanitizeOnShutdown enabled,
+ * deselecting "deleteOnClose" should not change the state of "alwaysClear".
+ * The state of the cleaning categories cookies, cache and offlineApps should be in the state of the "deleteOnClose" box.
+ */
+add_task(async function test_syncWithCustomPrefs() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["privacy.clearOnShutdown.history", true],
+      ["privacy.sanitize.sanitizeOnShutdown", true],
+    ],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("panePrivacy", {
+    leaveOpen: true,
+  });
+
+  let document = gBrowser.contentDocument;
+  let deleteOnCloseBox = document.getElementById("deleteOnClose");
+  let alwaysClearBox = document.getElementById("alwaysClear");
+
+  ok(!deleteOnCloseBox.checked, "DeleteOnClose initial state is deselected");
+  ok(alwaysClearBox.checked, "AlwaysClear initial state is selected");
+
+  deleteOnCloseBox.click();
+
+  ok(deleteOnCloseBox.checked, "DeleteOnClose is selected");
+  is(
+    deleteOnCloseBox.checked,
+    alwaysClearBox.checked,
+    "AlwaysClear and deleteOnClose are in the same state, selected"
+  );
+  ok(
+    Services.prefs.getBoolPref("privacy.clearOnShutdown.history"),
+    "History cleaning pref is still set"
+  );
+
+  ok(
+    Services.prefs.getBoolPref("privacy.clearOnShutdown.cookies"),
+    "Cookie cleaning pref is set"
+  );
+  ok(
+    Services.prefs.getBoolPref("privacy.clearOnShutdown.cache"),
+    "Cache cleaning pref is set"
+  );
+  ok(
+    Services.prefs.getBoolPref("privacy.clearOnShutdown.offlineApps"),
+    "OfflineApps cleaning pref is set"
+  );
+
+  deleteOnCloseBox.click();
+
+  ok(!deleteOnCloseBox.checked, "DeleteOnClose is deselected");
+  is(
+    !deleteOnCloseBox.checked,
+    alwaysClearBox.checked,
+    "AlwaysClear is not synced with deleteOnClose, only deleteOnClose is deselected"
+  );
+
+  ok(
+    !Services.prefs.getBoolPref("privacy.clearOnShutdown.cookies"),
+    "Cookie cleaning pref is reset"
+  );
+  ok(
+    !Services.prefs.getBoolPref("privacy.clearOnShutdown.cache"),
+    "Cache cleaning pref is reset"
+  );
+  ok(
+    !Services.prefs.getBoolPref("privacy.clearOnShutdown.offlineApps"),
+    "OfflineApps cleaning pref is reset"
+  );
+  ok(
+    Services.prefs.getBoolPref("privacy.clearOnShutdown.history"),
+    "History cleaning pref is still set"
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  await SpecialPowers.popPrefEnv();
+});
+
+/*
+ * Setting/resetting cleaning prefs for cookies, cache, offline apps
+ * and selecting/deselecting the "alwaysClear" Box, also selects/deselects
+ * the "deleteOnClose" box.
+ */
+
+add_task(async function test_syncWithCustomPrefs() {
+  await openPreferencesViaOpenPreferencesAPI("panePrivacy", {
+    leaveOpen: true,
+  });
+
+  let document = gBrowser.contentDocument;
+  let deleteOnCloseBox = document.getElementById("deleteOnClose");
+  let alwaysClearBox = document.getElementById("alwaysClear");
+
+  ok(!deleteOnCloseBox.checked, "DeleteOnClose initial state is deselected");
+  ok(!alwaysClearBox.checked, "AlwaysClear initial state is deselected");
+
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["privacy.clearOnShutdown.cookies", true],
+      ["privacy.clearOnShutdown.cache", true],
+      ["privacy.clearOnShutdown.offlineApps", true],
+      ["privacy.sanitize.sanitizeOnShutdown", true],
+    ],
+  });
+
+  ok(alwaysClearBox.checked, "AlwaysClear is selected");
+  is(
+    deleteOnCloseBox.checked,
+    alwaysClearBox.checked,
+    "AlwaysClear and deleteOnClose are in the same state, selected"
+  );
+
+  alwaysClearBox.click();
+
+  ok(!alwaysClearBox.checked, "AlwaysClear is deselected");
+  is(
+    deleteOnCloseBox.checked,
+    alwaysClearBox.checked,
+    "AlwaysClear and deleteOnClose are in the same state, deselected"
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  await SpecialPowers.popPrefEnv();
+});
+
+/*
+ * On loading the page, the ClearOnClose box should be set according to the pref selection
+ */
+add_task(async function test_initialState() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["privacy.clearOnShutdown.cookies", true],
+      ["privacy.clearOnShutdown.cache", true],
+      ["privacy.clearOnShutdown.offlineApps", true],
+      ["privacy.sanitize.sanitizeOnShutdown", true],
+    ],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("panePrivacy", {
+    leaveOpen: true,
+  });
+
+  let document = gBrowser.contentDocument;
+  let deleteOnCloseBox = document.getElementById("deleteOnClose");
+
+  ok(
+    deleteOnCloseBox.checked,
+    "DeleteOnClose is set accordingly to the prefs, selected"
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["privacy.clearOnShutdown.cookies", false],
+      ["privacy.clearOnShutdown.cache", false],
+      ["privacy.clearOnShutdown.offlineApps", false],
+      ["privacy.sanitize.sanitizeOnShutdown", true],
+      ["privacy.clearOnShutdown.history", true],
+    ],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("panePrivacy", {
+    leaveOpen: true,
+  });
+
+  document = gBrowser.contentDocument;
+  deleteOnCloseBox = document.getElementById("deleteOnClose");
+
+  ok(
+    !deleteOnCloseBox.checked,
+    "DeleteOnClose is set accordingly to the prefs, deselected"
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+
+  // When private browsing mode autostart is selected, the deleteOnClose Box is selected always
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["privacy.clearOnShutdown.cookies", false],
+      ["privacy.clearOnShutdown.cache", false],
+      ["privacy.clearOnShutdown.offlineApps", false],
+      ["privacy.sanitize.sanitizeOnShutdown", false],
+      ["browser.privatebrowsing.autostart", true],
+    ],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("panePrivacy", {
+    leaveOpen: true,
+  });
+
+  document = gBrowser.contentDocument;
+  deleteOnCloseBox = document.getElementById("deleteOnClose");
+
+  ok(
+    deleteOnCloseBox.checked,
+    "DeleteOnClose is set accordingly to the private Browsing autostart pref, selected"
+  );
+
+  // Reset history mode
+  let historyMode = document.getElementById("historyMode");
+  historyMode.value = "remember";
+  historyMode.doCommand();
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  await SpecialPowers.popPrefEnv();
+});
diff --git a/browser/components/preferences/tests/browser_privacypane_2.js b/browser/components/preferences/tests/browser_privacypane_2.js
new file mode 100644
index 0000000000..46fb3347c8
--- /dev/null
+++ b/browser/components/preferences/tests/browser_privacypane_2.js
@@ -0,0 +1,19 @@
+let rootDir = getRootDirectory(gTestPath);
+let jar = getJar(rootDir);
+if (jar) {
+  let tmpdir = extractJarToTmp(jar);
+  rootDir = "file://" + tmpdir.path + "/";
+}
+/* import-globals-from privacypane_tests_perwindow.js */
+Services.scriptloader.loadSubScript(
+  rootDir + "privacypane_tests_perwindow.js",
+  this
+);
+
+run_test_subset([
+  test_pane_visibility,
+  test_dependent_elements,
+  test_dependent_cookie_elements,
+  test_dependent_clearonclose_elements,
+  test_dependent_prefs,
+]);
diff --git a/browser/components/preferences/tests/browser_privacypane_3.js b/browser/components/preferences/tests/browser_privacypane_3.js
new file mode 100644
index 0000000000..e88a6059eb
--- /dev/null
+++ b/browser/components/preferences/tests/browser_privacypane_3.js
@@ -0,0 +1,21 @@
+let rootDir = getRootDirectory(gTestPath);
+let jar = getJar(rootDir);
+if (jar) {
+  let tmpdir = extractJarToTmp(jar);
+  rootDir = "file://" + tmpdir.path + "/";
+}
+/* import-globals-from privacypane_tests_perwindow.js */
+Services.scriptloader.loadSubScript(
+  rootDir + "privacypane_tests_perwindow.js",
+  this
+);
+
+run_test_subset([
+  test_custom_retention("rememberHistory", "remember"),
+  test_custom_retention("rememberHistory", "custom"),
+  test_custom_retention("rememberForms", "custom"),
+  test_custom_retention("rememberForms", "custom"),
+  test_historymode_retention("remember", "custom"),
+  test_custom_retention("alwaysClear", "remember"),
+  test_custom_retention("alwaysClear", "custom"),
+]);
diff --git a/browser/components/preferences/tests/browser_proxy_backup.js b/browser/components/preferences/tests/browser_proxy_backup.js
new file mode 100644
index 0000000000..fc05e19ada
--- /dev/null
+++ b/browser/components/preferences/tests/browser_proxy_backup.js
@@ -0,0 +1,84 @@
+/* vim: set shiftwidth=2 tabstop=2 autoindent cindent expandtab: */
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this file,
+ * You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+function test() {
+  waitForExplicitFinish();
+
+  // network.proxy.type needs to be backed up and restored because mochitest
+  // changes this setting from the default
+  let oldNetworkProxyType = Services.prefs.getIntPref("network.proxy.type");
+  registerCleanupFunction(function () {
+    Services.prefs.setIntPref("network.proxy.type", oldNetworkProxyType);
+    Services.prefs.clearUserPref("network.proxy.share_proxy_settings");
+    for (let proxyType of ["http", "ssl", "socks"]) {
+      Services.prefs.clearUserPref("network.proxy." + proxyType);
+      Services.prefs.clearUserPref("network.proxy." + proxyType + "_port");
+      if (proxyType == "http") {
+        continue;
+      }
+      Services.prefs.clearUserPref("network.proxy.backup." + proxyType);
+      Services.prefs.clearUserPref(
+        "network.proxy.backup." + proxyType + "_port"
+      );
+    }
+    // On accepting the dialog, we also write TRR values, so we need to clear
+    // them. They are tested separately in browser_privacy_dnsoverhttps.js.
+    Services.prefs.clearUserPref("network.trr.mode");
+    Services.prefs.clearUserPref("network.trr.uri");
+  });
+
+  let connectionURL =
+    "chrome://browser/content/preferences/dialogs/connection.xhtml";
+
+  // Set a shared proxy and an SSL backup
+  Services.prefs.setIntPref("network.proxy.type", 1);
+  Services.prefs.setBoolPref("network.proxy.share_proxy_settings", true);
+  Services.prefs.setCharPref("network.proxy.http", "example.com");
+  Services.prefs.setIntPref("network.proxy.http_port", 1200);
+  Services.prefs.setCharPref("network.proxy.ssl", "example.com");
+  Services.prefs.setIntPref("network.proxy.ssl_port", 1200);
+  Services.prefs.setCharPref("network.proxy.backup.ssl", "127.0.0.1");
+  Services.prefs.setIntPref("network.proxy.backup.ssl_port", 9050);
+
+  /*
+  The connection dialog alone won't save onaccept since it uses type="child",
+  so it has to be opened as a sub dialog of the main pref tab.
+  Open the main tab here.
+  */
+  open_preferences(async function tabOpened(aContentWindow) {
+    is(
+      gBrowser.currentURI.spec,
+      "about:preferences",
+      "about:preferences loaded"
+    );
+    let dialog = await openAndLoadSubDialog(connectionURL);
+    let dialogElement = dialog.document.getElementById("ConnectionsDialog");
+    let dialogClosingPromise = BrowserTestUtils.waitForEvent(
+      dialogElement,
+      "dialogclosing"
+    );
+
+    ok(dialog, "connection window opened");
+    dialogElement.acceptDialog();
+
+    let dialogClosingEvent = await dialogClosingPromise;
+    ok(dialogClosingEvent, "connection window closed");
+
+    // The SSL backup should not be replaced by the shared value
+    is(
+      Services.prefs.getCharPref("network.proxy.backup.ssl"),
+      "127.0.0.1",
+      "Shared proxy backup shouldn't be replaced"
+    );
+    is(
+      Services.prefs.getIntPref("network.proxy.backup.ssl_port"),
+      9050,
+      "Shared proxy port backup shouldn't be replaced"
+    );
+
+    gBrowser.removeCurrentTab();
+    finish();
+  });
+}
diff --git a/browser/components/preferences/tests/browser_sanitizeOnShutdown_prefLocked.js b/browser/components/preferences/tests/browser_sanitizeOnShutdown_prefLocked.js
new file mode 100644
index 0000000000..2a7cb2d10e
--- /dev/null
+++ b/browser/components/preferences/tests/browser_sanitizeOnShutdown_prefLocked.js
@@ -0,0 +1,47 @@
+"use strict";
+
+function switchToCustomHistoryMode(doc) {
+  // Select the last item in the menulist.
+  let menulist = doc.getElementById("historyMode");
+  menulist.focus();
+  EventUtils.sendKey("UP");
+}
+
+function testPrefStateMatchesLockedState() {
+  let win = gBrowser.contentWindow;
+  let doc = win.document;
+  switchToCustomHistoryMode(doc);
+
+  let checkbox = doc.getElementById("alwaysClear");
+  let preference = win.Preferences.get("privacy.sanitize.sanitizeOnShutdown");
+  is(
+    checkbox.disabled,
+    preference.locked,
+    "Always Clear checkbox should be enabled when preference is not locked."
+  );
+
+  Services.prefs.clearUserPref("privacy.history.custom");
+  gBrowser.removeCurrentTab();
+}
+
+add_setup(function () {
+  registerCleanupFunction(function resetPreferences() {
+    Services.prefs.unlockPref("privacy.sanitize.sanitizeOnShutdown");
+    Services.prefs.clearUserPref("privacy.history.custom");
+  });
+});
+
+add_task(async function test_preference_enabled_when_unlocked() {
+  await openPreferencesViaOpenPreferencesAPI("panePrivacy", {
+    leaveOpen: true,
+  });
+  testPrefStateMatchesLockedState();
+});
+
+add_task(async function test_preference_disabled_when_locked() {
+  Services.prefs.lockPref("privacy.sanitize.sanitizeOnShutdown");
+  await openPreferencesViaOpenPreferencesAPI("panePrivacy", {
+    leaveOpen: true,
+  });
+  testPrefStateMatchesLockedState();
+});
diff --git a/browser/components/preferences/tests/browser_searchChangedEngine.js b/browser/components/preferences/tests/browser_searchChangedEngine.js
new file mode 100644
index 0000000000..0882c9775e
--- /dev/null
+++ b/browser/components/preferences/tests/browser_searchChangedEngine.js
@@ -0,0 +1,90 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+const { AddonTestUtils } = ChromeUtils.importESModule(
+  "resource://testing-common/AddonTestUtils.sys.mjs"
+);
+const { SearchTestUtils } = ChromeUtils.importESModule(
+  "resource://testing-common/SearchTestUtils.sys.mjs"
+);
+const { SearchUtils } = ChromeUtils.importESModule(
+  "resource://gre/modules/SearchUtils.sys.mjs"
+);
+
+AddonTestUtils.initMochitest(this);
+SearchTestUtils.init(this);
+
+function findRow(tree, expectedName) {
+  for (let i = 0; i < tree.view.rowCount; i++) {
+    let name = tree.view.getCellText(
+      i,
+      tree.columns.getNamedColumn("engineName")
+    );
+
+    if (name == expectedName) {
+      return i;
+    }
+  }
+  return -1;
+}
+
+add_task(async function test_change_engine() {
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+
+  let doc = gBrowser.selectedBrowser.contentDocument;
+
+  await SearchTestUtils.installSearchExtension({
+    id: "example@tests.mozilla.org",
+    name: "Example",
+    version: "1.0",
+    keyword: "foo",
+    favicon_url: "img123.png",
+  });
+
+  let tree = doc.querySelector("#engineList");
+
+  let row = findRow(tree, "Example");
+
+  Assert.notEqual(row, -1, "Should have found the entry");
+  Assert.ok(
+    tree.view
+      .getImageSrc(row, tree.columns.getNamedColumn("engineName"))
+      .includes("img123.png"),
+    "Should have the correct image URL"
+  );
+  Assert.equal(
+    tree.view.getCellText(row, tree.columns.getNamedColumn("engineKeyword")),
+    "foo",
+    "Should show the correct keyword"
+  );
+
+  let updatedPromise = SearchTestUtils.promiseSearchNotification(
+    SearchUtils.MODIFIED_TYPE.CHANGED,
+    SearchUtils.TOPIC_ENGINE_MODIFIED
+  );
+  await SearchTestUtils.installSearchExtension({
+    id: "example@tests.mozilla.org",
+    name: "Example 2",
+    version: "2.0",
+    keyword: "bar",
+    favicon_url: "img456.png",
+  });
+  await updatedPromise;
+
+  row = findRow(tree, "Example 2");
+
+  Assert.notEqual(row, -1, "Should have found the updated entry");
+  Assert.ok(
+    tree.view
+      .getImageSrc(row, tree.columns.getNamedColumn("engineName"))
+      .includes("img456.png"),
+    "Should have the correct image URL"
+  );
+  Assert.equal(
+    tree.view.getCellText(row, tree.columns.getNamedColumn("engineKeyword")),
+    "bar",
+    "Should show the correct keyword"
+  );
+
+  gBrowser.removeCurrentTab();
+});
diff --git a/browser/components/preferences/tests/browser_searchDefaultEngine.js b/browser/components/preferences/tests/browser_searchDefaultEngine.js
new file mode 100644
index 0000000000..e64f88fab3
--- /dev/null
+++ b/browser/components/preferences/tests/browser_searchDefaultEngine.js
@@ -0,0 +1,372 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+const { SearchTestUtils } = ChromeUtils.importESModule(
+  "resource://testing-common/SearchTestUtils.sys.mjs"
+);
+
+ChromeUtils.defineESModuleGetters(this, {
+  TelemetryTestUtils: "resource://testing-common/TelemetryTestUtils.sys.mjs",
+});
+
+SearchTestUtils.init(this);
+
+add_setup(async function () {
+  await SearchTestUtils.installSearchExtension({
+    name: "engine1",
+    search_url: "https://example.com/engine1",
+    search_url_get_params: "search={searchTerms}",
+  });
+  await SearchTestUtils.installSearchExtension({
+    name: "engine2",
+    search_url: "https://example.com/engine2",
+    search_url_get_params: "search={searchTerms}",
+  });
+
+  const defaultEngine = await Services.search.getDefault();
+  const defaultPrivateEngine = await Services.search.getDefaultPrivate();
+
+  registerCleanupFunction(async () => {
+    await Services.search.setDefault(
+      defaultEngine,
+      Ci.nsISearchService.CHANGE_REASON_UNKNOWN
+    );
+    await Services.search.setDefaultPrivate(
+      defaultPrivateEngine,
+      Ci.nsISearchService.CHANGE_REASON_UNKNOWN
+    );
+  });
+});
+
+add_task(async function test_openWithPrivateDefaultNotEnabledFirst() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.search.separatePrivateDefault.ui.enabled", false],
+      ["browser.search.separatePrivateDefault", false],
+    ],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+
+  const doc = gBrowser.selectedBrowser.contentDocument;
+  const separateEngineCheckbox = doc.getElementById(
+    "browserSeparateDefaultEngine"
+  );
+  const privateDefaultVbox = doc.getElementById(
+    "browserPrivateEngineSelection"
+  );
+
+  Assert.ok(
+    separateEngineCheckbox.hidden,
+    "Should have hidden the separate search engine checkbox"
+  );
+  Assert.ok(
+    privateDefaultVbox.hidden,
+    "Should have hidden the private engine selection box"
+  );
+
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.search.separatePrivateDefault.ui.enabled", true]],
+  });
+
+  Assert.ok(
+    !separateEngineCheckbox.hidden,
+    "Should have displayed the separate search engine checkbox"
+  );
+  Assert.ok(
+    privateDefaultVbox.hidden,
+    "Should not have displayed the private engine selection box"
+  );
+
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.search.separatePrivateDefault", true]],
+  });
+
+  Assert.ok(
+    !separateEngineCheckbox.hidden,
+    "Should still be displaying the separate search engine checkbox"
+  );
+  Assert.ok(
+    !privateDefaultVbox.hidden,
+    "Should have displayed the private engine selection box"
+  );
+
+  gBrowser.removeCurrentTab();
+});
+
+add_task(async function test_openWithPrivateDefaultEnabledFirst() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.search.separatePrivateDefault.ui.enabled", true],
+      ["browser.search.separatePrivateDefault", true],
+    ],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+
+  const doc = gBrowser.selectedBrowser.contentDocument;
+  const separateEngineCheckbox = doc.getElementById(
+    "browserSeparateDefaultEngine"
+  );
+  const privateDefaultVbox = doc.getElementById(
+    "browserPrivateEngineSelection"
+  );
+
+  Assert.ok(
+    !separateEngineCheckbox.hidden,
+    "Should not have hidden the separate search engine checkbox"
+  );
+  Assert.ok(
+    !privateDefaultVbox.hidden,
+    "Should not have hidden the private engine selection box"
+  );
+
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.search.separatePrivateDefault", false]],
+  });
+
+  Assert.ok(
+    !separateEngineCheckbox.hidden,
+    "Should not have hidden the separate search engine checkbox"
+  );
+  Assert.ok(
+    privateDefaultVbox.hidden,
+    "Should have hidden the private engine selection box"
+  );
+
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.search.separatePrivateDefault.ui.enabled", false]],
+  });
+
+  Assert.ok(
+    separateEngineCheckbox.hidden,
+    "Should have hidden the separate private engine checkbox"
+  );
+  Assert.ok(
+    privateDefaultVbox.hidden,
+    "Should still be hiding the private engine selection box"
+  );
+
+  gBrowser.removeCurrentTab();
+});
+
+add_task(async function test_separatePrivateDefault() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.search.separatePrivateDefault.ui.enabled", true],
+      ["browser.search.separatePrivateDefault", false],
+    ],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+
+  const doc = gBrowser.selectedBrowser.contentDocument;
+  const separateEngineCheckbox = doc.getElementById(
+    "browserSeparateDefaultEngine"
+  );
+  const privateDefaultVbox = doc.getElementById(
+    "browserPrivateEngineSelection"
+  );
+
+  Assert.ok(
+    privateDefaultVbox.hidden,
+    "Should not be displaying the private engine selection box"
+  );
+
+  separateEngineCheckbox.checked = false;
+  separateEngineCheckbox.doCommand();
+
+  Assert.ok(
+    Services.prefs.getBoolPref("browser.search.separatePrivateDefault"),
+    "Should have correctly set the pref"
+  );
+
+  Assert.ok(
+    !privateDefaultVbox.hidden,
+    "Should be displaying the private engine selection box"
+  );
+
+  separateEngineCheckbox.checked = true;
+  separateEngineCheckbox.doCommand();
+
+  Assert.ok(
+    !Services.prefs.getBoolPref("browser.search.separatePrivateDefault"),
+    "Should have correctly turned the pref off"
+  );
+
+  Assert.ok(
+    privateDefaultVbox.hidden,
+    "Should have hidden the private engine selection box"
+  );
+
+  gBrowser.removeCurrentTab();
+});
+
+async function setDefaultEngine(
+  testPrivate,
+  currentEngineName,
+  expectedEngineName
+) {
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+
+  const doc = gBrowser.selectedBrowser.contentDocument;
+  const defaultEngineSelector = doc.getElementById(
+    testPrivate ? "defaultPrivateEngine" : "defaultEngine"
+  );
+
+  Assert.equal(
+    defaultEngineSelector.selectedItem.engine.name,
+    currentEngineName,
+    "Should have the correct engine as default on first open"
+  );
+
+  const popup = defaultEngineSelector.menupopup;
+  const popupShown = BrowserTestUtils.waitForEvent(popup, "popupshown");
+  EventUtils.synthesizeMouseAtCenter(
+    defaultEngineSelector,
+    {},
+    defaultEngineSelector.ownerGlobal
+  );
+  await popupShown;
+
+  const items = Array.from(popup.children);
+  const engine2Item = items.find(
+    item => item.engine.name == expectedEngineName
+  );
+
+  const defaultChanged = SearchTestUtils.promiseSearchNotification(
+    testPrivate ? "engine-default-private" : "engine-default",
+    "browser-search-engine-modified"
+  );
+  // Waiting for popupHiding here seemed to cause a race condition, however
+  // as we're really just interested in the notification, we'll just use
+  // that here.
+  EventUtils.synthesizeMouseAtCenter(engine2Item, {}, engine2Item.ownerGlobal);
+  await defaultChanged;
+
+  const newDefault = testPrivate
+    ? await Services.search.getDefaultPrivate()
+    : await Services.search.getDefault();
+  Assert.equal(
+    newDefault.name,
+    expectedEngineName,
+    "Should have changed the default engine to engine2"
+  );
+}
+
+add_task(async function test_setDefaultEngine() {
+  const engine1 = Services.search.getEngineByName("engine1");
+
+  // Set an initial default so we have a known engine.
+  await Services.search.setDefault(
+    engine1,
+    Ci.nsISearchService.CHANGE_REASON_UNKNOWN
+  );
+
+  Services.telemetry.clearEvents();
+  Services.fog.testResetFOG();
+
+  await setDefaultEngine(false, "engine1", "engine2");
+
+  TelemetryTestUtils.assertEvents(
+    [
+      {
+        object: "change_default",
+        value: "user",
+        extra: {
+          prev_id: engine1.telemetryId,
+          new_id: "other-engine2",
+          new_name: "engine2",
+          new_load_path: "[addon]engine2@tests.mozilla.org",
+          new_sub_url: "",
+        },
+      },
+    ],
+    { category: "search", method: "engine" }
+  );
+
+  let snapshot = await Glean.searchEngineDefault.changed.testGetValue();
+  delete snapshot[0].timestamp;
+  Assert.deepEqual(
+    snapshot[0],
+    {
+      category: "search.engine.default",
+      name: "changed",
+      extra: {
+        change_source: "user",
+        previous_engine_id: engine1.telemetryId,
+        new_engine_id: "other-engine2",
+        new_display_name: "engine2",
+        new_load_path: "[addon]engine2@tests.mozilla.org",
+        new_submission_url: "",
+      },
+    },
+    "Should have received the correct event details"
+  );
+
+  gBrowser.removeCurrentTab();
+});
+
+add_task(async function test_setPrivateDefaultEngine() {
+  Services.telemetry.clearEvents();
+  Services.fog.testResetFOG();
+
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.search.separatePrivateDefault.ui.enabled", true],
+      ["browser.search.separatePrivateDefault", true],
+    ],
+  });
+
+  const engine2 = Services.search.getEngineByName("engine2");
+
+  // Set an initial default so we have a known engine.
+  await Services.search.setDefaultPrivate(
+    engine2,
+    Ci.nsISearchService.CHANGE_REASON_UNKNOWN
+  );
+
+  Services.telemetry.clearEvents();
+  Services.fog.testResetFOG();
+
+  await setDefaultEngine(true, "engine2", "engine1");
+
+  TelemetryTestUtils.assertEvents(
+    [
+      {
+        object: "change_private",
+        value: "user",
+        extra: {
+          prev_id: engine2.telemetryId,
+          new_id: "other-engine1",
+          new_name: "engine1",
+          new_load_path: "[addon]engine1@tests.mozilla.org",
+          new_sub_url: "",
+        },
+      },
+    ],
+    { category: "search", method: "engine" }
+  );
+
+  let snapshot = await Glean.searchEnginePrivate.changed.testGetValue();
+  delete snapshot[0].timestamp;
+  console.log(snapshot);
+  Assert.deepEqual(
+    snapshot[0],
+    {
+      category: "search.engine.private",
+      name: "changed",
+      extra: {
+        change_source: "user",
+        previous_engine_id: engine2.telemetryId,
+        new_engine_id: "other-engine1",
+        new_display_name: "engine1",
+        new_load_path: "[addon]engine1@tests.mozilla.org",
+        new_submission_url: "",
+      },
+    },
+    "Should have received the correct event details"
+  );
+
+  gBrowser.removeCurrentTab();
+});
diff --git a/browser/components/preferences/tests/browser_searchFindMoreLink.js b/browser/components/preferences/tests/browser_searchFindMoreLink.js
new file mode 100644
index 0000000000..92864c9f54
--- /dev/null
+++ b/browser/components/preferences/tests/browser_searchFindMoreLink.js
@@ -0,0 +1,36 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+const TEST_URL = "https://example.org/";
+
+add_setup(async () => {
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.search.searchEnginesURL", TEST_URL]],
+  });
+});
+
+add_task(async function test_click_find_more_link() {
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+
+  let promiseNewTab = BrowserTestUtils.waitForNewTab(gBrowser);
+
+  gBrowser.selectedBrowser.contentDocument
+    .getElementById("addEngines")
+    .scrollIntoView();
+  await BrowserTestUtils.synthesizeMouseAtCenter(
+    "#addEngines",
+    {},
+    gBrowser.selectedBrowser.browsingContext
+  );
+
+  let tab = await promiseNewTab;
+  Assert.equal(
+    tab.linkedBrowser.documentURI.spec,
+    TEST_URL,
+    "Should have loaded the expected page"
+  );
+
+  // Close both tabs.
+  gBrowser.removeCurrentTab();
+  gBrowser.removeCurrentTab();
+});
diff --git a/browser/components/preferences/tests/browser_searchRestoreDefaults.js b/browser/components/preferences/tests/browser_searchRestoreDefaults.js
new file mode 100644
index 0000000000..80588d0cce
--- /dev/null
+++ b/browser/components/preferences/tests/browser_searchRestoreDefaults.js
@@ -0,0 +1,259 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+const { SearchTestUtils } = ChromeUtils.importESModule(
+  "resource://testing-common/SearchTestUtils.sys.mjs"
+);
+const { SearchUtils } = ChromeUtils.importESModule(
+  "resource://gre/modules/SearchUtils.sys.mjs"
+);
+add_task(async function test_restore_functionality() {
+  // Ensure no engines are hidden to begin with.
+  for (let engine of await Services.search.getAppProvidedEngines()) {
+    if (engine.hidden) {
+      engine.hidden = false;
+    }
+  }
+
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let restoreDefaultsButton = doc.getElementById("restoreDefaultSearchEngines");
+
+  Assert.ok(
+    restoreDefaultsButton.disabled,
+    "Should have disabled the restore default search engines button on open"
+  );
+
+  let updatedPromise = SearchTestUtils.promiseSearchNotification(
+    SearchUtils.MODIFIED_TYPE.CHANGED,
+    SearchUtils.TOPIC_ENGINE_MODIFIED
+  );
+
+  let tree = doc.querySelector("#engineList");
+  // Check for default search engines to be displayed in the engineList
+  let defaultEngines = await Services.search.getAppProvidedEngines();
+  for (let i = 0; i < defaultEngines.length; i++) {
+    let cellName = tree.view.getCellText(
+      i,
+      tree.columns.getNamedColumn("engineName")
+    );
+    if (cellName == "DuckDuckGo") {
+      tree.view.selection.select(i);
+      break;
+    }
+  }
+  doc.getElementById("removeEngineButton").click();
+  await updatedPromise;
+
+  let engine = await Services.search.getEngineByName("DuckDuckGo");
+
+  Assert.ok(engine.hidden, "Should have hidden the engine");
+  Assert.ok(
+    !restoreDefaultsButton.disabled,
+    "Should have enabled the restore default search engines button"
+  );
+
+  updatedPromise = SearchTestUtils.promiseSearchNotification(
+    SearchUtils.MODIFIED_TYPE.CHANGED,
+    SearchUtils.TOPIC_ENGINE_MODIFIED
+  );
+  restoreDefaultsButton.click();
+  await updatedPromise;
+  // Let the stack unwind so that the restore defaults button can update its
+  // state.
+  await new Promise(resolve => Services.tm.dispatchToMainThread(resolve));
+
+  Assert.ok(!engine.hidden, "Should have re-enabled the disabled engine");
+  Assert.ok(
+    restoreDefaultsButton.disabled,
+    "Should have disabled the restore default search engines button after use"
+  );
+
+  gBrowser.removeCurrentTab();
+});
+
+add_task(async function test_restoreEnabledOnOpenWithEngineHidden() {
+  let engine = await Services.search.getEngineByName("DuckDuckGo");
+  engine.hidden = true;
+
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let restoreDefaultsButton = doc.getElementById("restoreDefaultSearchEngines");
+
+  Assert.ok(
+    !restoreDefaultsButton.disabled,
+    "Should have enabled the restore default search engines button on open"
+  );
+
+  let updatedPromise = SearchTestUtils.promiseSearchNotification(
+    SearchUtils.MODIFIED_TYPE.CHANGED,
+    SearchUtils.TOPIC_ENGINE_MODIFIED
+  );
+  restoreDefaultsButton.click();
+  await updatedPromise;
+  // Let the stack unwind so that the restore defaults button can update its
+  // state.
+  await new Promise(resolve => Services.tm.dispatchToMainThread(resolve));
+
+  Assert.ok(!engine.hidden, "Should have re-enabled the disabled engine");
+  Assert.ok(
+    restoreDefaultsButton.disabled,
+    "Should have disabled the restore default search engines button after use"
+  );
+
+  gBrowser.removeCurrentTab();
+});
+
+// This removes the last two engines and then the remaining engines from top to
+// bottom, and then it restores the default engines.  See bug 1681818.
+add_task(async function test_removeOutOfOrder() {
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let restoreDefaultsButton = doc.getElementById("restoreDefaultSearchEngines");
+  Assert.ok(
+    restoreDefaultsButton.disabled,
+    "The restore-defaults button is disabled initially"
+  );
+
+  let tree = doc.querySelector("#engineList");
+  let removeEngineButton = doc.getElementById("removeEngineButton");
+  removeEngineButton.scrollIntoView();
+
+  let defaultEngines = await Services.search.getAppProvidedEngines();
+
+  // Remove the last two engines.  After each removal, the selection should move
+  // to the first local shortcut.
+  for (let i = 0; i < 2; i++) {
+    tree.view.selection.select(defaultEngines.length - i - 1);
+    let updatedPromise = SearchTestUtils.promiseSearchNotification(
+      SearchUtils.MODIFIED_TYPE.CHANGED,
+      SearchUtils.TOPIC_ENGINE_MODIFIED
+    );
+    removeEngineButton.click();
+    await updatedPromise;
+    Assert.ok(
+      removeEngineButton.disabled,
+      "The remove-engine button is disabled because a local shortcut is selected"
+    );
+    Assert.ok(
+      !restoreDefaultsButton.disabled,
+      "The restore-defaults button is enabled after removing an engine"
+    );
+  }
+
+  // Remove the remaining engines from top to bottom except for the default engine
+  // which can't be removed.
+  for (let i = 0; i < defaultEngines.length - 3; i++) {
+    tree.view.selection.select(0);
+
+    if (defaultEngines[0].name == Services.search.defaultEngine.name) {
+      tree.view.selection.select(1);
+    }
+
+    let updatedPromise = SearchTestUtils.promiseSearchNotification(
+      SearchUtils.MODIFIED_TYPE.CHANGED,
+      SearchUtils.TOPIC_ENGINE_MODIFIED
+    );
+    removeEngineButton.click();
+    await updatedPromise;
+    Assert.ok(
+      !restoreDefaultsButton.disabled,
+      "The restore-defaults button is enabled after removing an engine"
+    );
+  }
+  Assert.ok(
+    removeEngineButton.disabled,
+    "The remove-engine button is disabled because only one engine remains"
+  );
+
+  // Click the restore-defaults button.
+  let updatedPromise = SearchTestUtils.promiseSearchNotification(
+    SearchUtils.MODIFIED_TYPE.CHANGED,
+    SearchUtils.TOPIC_ENGINE_MODIFIED
+  );
+  restoreDefaultsButton.click();
+  await updatedPromise;
+
+  // Wait for the restore-defaults button to update its state.
+  await TestUtils.waitForCondition(
+    () => restoreDefaultsButton.disabled,
+    "Waiting for the restore-defaults button to become disabled"
+  );
+
+  Assert.ok(
+    restoreDefaultsButton.disabled,
+    "The restore-defaults button is disabled after restoring defaults"
+  );
+  Assert.equal(
+    tree.view.rowCount,
+    defaultEngines.length + UrlbarUtils.LOCAL_SEARCH_MODES.length,
+    "All engines are restored"
+  );
+
+  gBrowser.removeCurrentTab();
+});
+
+add_task(async function test_removeAndRestoreMultiple() {
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let restoreDefaultsButton = doc.getElementById("restoreDefaultSearchEngines");
+  let tree = doc.querySelector("#engineList");
+  let removeEngineButton = doc.getElementById("removeEngineButton");
+  removeEngineButton.scrollIntoView();
+
+  let defaultEngines = await Services.search.getAppProvidedEngines();
+
+  // Remove the second and fourth engines.
+  for (let i = 0; i < 2; i++) {
+    tree.view.selection.select(i * 2 + 1);
+    let updatedPromise = SearchTestUtils.promiseSearchNotification(
+      SearchUtils.MODIFIED_TYPE.CHANGED,
+      SearchUtils.TOPIC_ENGINE_MODIFIED
+    );
+    removeEngineButton.click();
+    await updatedPromise;
+  }
+
+  // Click the restore-defaults button.
+  let updatedPromise = SearchTestUtils.promiseSearchNotification(
+    SearchUtils.MODIFIED_TYPE.CHANGED,
+    SearchUtils.TOPIC_ENGINE_MODIFIED
+  );
+  restoreDefaultsButton.click();
+  await updatedPromise;
+
+  // Remove the third engine.
+  tree.view.selection.select(3);
+  updatedPromise = SearchTestUtils.promiseSearchNotification(
+    SearchUtils.MODIFIED_TYPE.CHANGED,
+    SearchUtils.TOPIC_ENGINE_MODIFIED
+  );
+  removeEngineButton.click();
+  await updatedPromise;
+
+  // Now restore again.
+  updatedPromise = SearchTestUtils.promiseSearchNotification(
+    SearchUtils.MODIFIED_TYPE.CHANGED,
+    SearchUtils.TOPIC_ENGINE_MODIFIED
+  );
+  restoreDefaultsButton.click();
+  await updatedPromise;
+
+  // Wait for the restore-defaults button to update its state.
+  await TestUtils.waitForCondition(
+    () => restoreDefaultsButton.disabled,
+    "Waiting for the restore-defaults button to become disabled"
+  );
+
+  Assert.equal(
+    tree.view.rowCount,
+    defaultEngines.length + UrlbarUtils.LOCAL_SEARCH_MODES.length,
+    "Should have the correct amount of engines"
+  );
+
+  gBrowser.removeCurrentTab();
+});
diff --git a/browser/components/preferences/tests/browser_searchScroll.js b/browser/components/preferences/tests/browser_searchScroll.js
new file mode 100644
index 0000000000..ef3af646e9
--- /dev/null
+++ b/browser/components/preferences/tests/browser_searchScroll.js
@@ -0,0 +1,66 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+Services.scriptloader.loadSubScript(
+  "chrome://mochitests/content/browser/gfx/layers/apz/test/mochitest/apz_test_native_event_utils.js",
+  this
+);
+
+const { AddonTestUtils } = ChromeUtils.importESModule(
+  "resource://testing-common/AddonTestUtils.sys.mjs"
+);
+const { SearchTestUtils } = ChromeUtils.importESModule(
+  "resource://testing-common/SearchTestUtils.sys.mjs"
+);
+const { SearchUtils } = ChromeUtils.importESModule(
+  "resource://gre/modules/SearchUtils.sys.mjs"
+);
+
+AddonTestUtils.initMochitest(this);
+SearchTestUtils.init(this);
+
+add_setup(async function () {
+  await SpecialPowers.pushPrefEnv({
+    set: [["dom.w3c_touch_events.enabled", 0]],
+  });
+});
+
+add_task(async function test_scroll() {
+  info("Open preferences page for search");
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+
+  const doc = gBrowser.selectedBrowser.contentDocument;
+  const tree = doc.querySelector("#engineList");
+
+  info("Add engines to make the tree scrollable");
+  for (let i = 0, n = parseInt(tree.getAttribute("rows")); i < n; i++) {
+    let extension = await SearchTestUtils.installSearchExtension({
+      id: `${i}@tests.mozilla.org`,
+      name: `example${i}`,
+      version: "1.0",
+      keyword: `example${i}`,
+    });
+    await AddonTestUtils.waitForSearchProviderStartup(extension);
+  }
+
+  info("Make tree element move into viewport");
+  const mainContent = doc.querySelector(".main-content");
+  const readyForScrollIntoView = new Promise(r => {
+    mainContent.addEventListener("scroll", r, { once: true });
+  });
+  tree.scrollIntoView();
+  await readyForScrollIntoView;
+
+  const previousScroll = mainContent.scrollTop;
+
+  await promiseMoveMouseAndScrollWheelOver(tree, 1, 1, false);
+
+  Assert.equal(
+    previousScroll,
+    mainContent.scrollTop,
+    "Container element does not scroll"
+  );
+
+  info("Clean up");
+  gBrowser.removeCurrentTab();
+});
diff --git a/browser/components/preferences/tests/browser_searchShowSuggestionsFirst.js b/browser/components/preferences/tests/browser_searchShowSuggestionsFirst.js
new file mode 100644
index 0000000000..cd7f5528f1
--- /dev/null
+++ b/browser/components/preferences/tests/browser_searchShowSuggestionsFirst.js
@@ -0,0 +1,244 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+const MAIN_PREF = "browser.search.suggest.enabled";
+const URLBAR_PREF = "browser.urlbar.suggest.searches";
+const FIRST_PREF = "browser.urlbar.showSearchSuggestionsFirst";
+const SEARCHBAR_PREF = "browser.search.widget.inNavBar";
+const FIRST_CHECKBOX_ID = "showSearchSuggestionsFirstCheckbox";
+
+add_setup(async function () {
+  // Make sure the main and urlbar suggestion prefs are enabled.
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      [MAIN_PREF, true],
+      [URLBAR_PREF, true],
+    ],
+  });
+});
+
+// Open preferences with search suggestions shown first (the default).
+add_task(async function openWithSearchSuggestionsShownFirst() {
+  // Initially the pref should be true so search suggestions are shown first.
+  Assert.ok(
+    Services.prefs.getBoolPref(FIRST_PREF),
+    "Pref should be true initially"
+  );
+
+  // Open preferences.  The checkbox should be checked.
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let checkbox = doc.getElementById(FIRST_CHECKBOX_ID);
+  Assert.ok(checkbox.checked, "Checkbox should be checked");
+  Assert.ok(!checkbox.disabled, "Checkbox should be enabled");
+
+  // Uncheck the checkbox.
+  checkbox.checked = false;
+  checkbox.doCommand();
+
+  // The pref should now be false so that history is shown first.
+  Assert.ok(
+    !Services.prefs.getBoolPref(FIRST_PREF),
+    "Pref should now be false to show history first"
+  );
+
+  // Make sure the checkbox state didn't change.
+  Assert.ok(!checkbox.checked, "Checkbox should remain unchecked");
+  Assert.ok(!checkbox.disabled, "Checkbox should remain enabled");
+
+  // Clear the pref.
+  Services.prefs.clearUserPref(FIRST_PREF);
+
+  // The checkbox should have become checked again.
+  Assert.ok(
+    checkbox.checked,
+    "Checkbox should become checked after clearing pref"
+  );
+  Assert.ok(
+    !checkbox.disabled,
+    "Checkbox should remain enabled after clearing pref"
+  );
+
+  // Clean up.
+  gBrowser.removeCurrentTab();
+});
+
+// Open preferences with history shown first.
+add_task(async function openWithHistoryShownFirst() {
+  // Set the pref to show history first.
+  Services.prefs.setBoolPref(FIRST_PREF, false);
+
+  // Open preferences.  The checkbox should be unchecked.
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let checkbox = doc.getElementById(FIRST_CHECKBOX_ID);
+  Assert.ok(!checkbox.checked, "Checkbox should be unchecked");
+  Assert.ok(!checkbox.disabled, "Checkbox should be enabled");
+
+  // Check the checkbox.
+  checkbox.checked = true;
+  checkbox.doCommand();
+
+  // Make sure the checkbox state didn't change.
+  Assert.ok(checkbox.checked, "Checkbox should remain checked");
+  Assert.ok(!checkbox.disabled, "Checkbox should remain enabled");
+
+  // The pref should now be true so that search suggestions are shown first.
+  Assert.ok(
+    Services.prefs.getBoolPref(FIRST_PREF),
+    "Pref should now be true to show search suggestions first"
+  );
+
+  // Set the pref to false again.
+  Services.prefs.setBoolPref(FIRST_PREF, false);
+
+  // The checkbox should have become unchecked again.
+  Assert.ok(
+    !checkbox.checked,
+    "Checkbox should become unchecked after setting pref to false"
+  );
+  Assert.ok(
+    !checkbox.disabled,
+    "Checkbox should remain enabled after setting pref to false"
+  );
+
+  // Clean up.
+  gBrowser.removeCurrentTab();
+  Services.prefs.clearUserPref(FIRST_PREF);
+});
+
+// Checks how the show-suggestions-first pref and checkbox reacts to updates to
+// URLBAR_PREF and MAIN_PREF.
+add_task(async function superprefInteraction() {
+  // Initially the pref should be true so search suggestions are shown first.
+  Assert.ok(
+    Services.prefs.getBoolPref(FIRST_PREF),
+    "Pref should be true initially"
+  );
+
+  // Open preferences.  The checkbox should be checked.
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let checkbox = doc.getElementById(FIRST_CHECKBOX_ID);
+  Assert.ok(checkbox.checked, "Checkbox should be checked");
+  Assert.ok(!checkbox.disabled, "Checkbox should be enabled");
+
+  Services.prefs.setBoolPref(SEARCHBAR_PREF, true);
+
+  // Two superior prefs control the show-suggestion-first pref: URLBAR_PREF and
+  // MAIN_PREF.  Toggle each and make sure the show-suggestion-first checkbox
+  // reacts appropriately.
+  for (let superiorPref of [URLBAR_PREF, MAIN_PREF]) {
+    info(`Testing superior pref ${superiorPref}`);
+
+    // Set the superior pref to false.
+    Services.prefs.setBoolPref(superiorPref, false);
+
+    // The pref should remain true.
+    Assert.ok(
+      Services.prefs.getBoolPref(FIRST_PREF),
+      "Pref should remain true"
+    );
+
+    // The checkbox should have become unchecked and disabled.
+    Assert.ok(
+      !checkbox.checked,
+      "Checkbox should become unchecked after disabling urlbar suggestions"
+    );
+    Assert.ok(
+      checkbox.disabled,
+      "Checkbox should become disabled after disabling urlbar suggestions"
+    );
+
+    // Set the superior pref to true.
+    Services.prefs.setBoolPref(superiorPref, true);
+
+    // The pref should remain true.
+    Assert.ok(
+      Services.prefs.getBoolPref(FIRST_PREF),
+      "Pref should remain true"
+    );
+
+    // The checkbox should have become checked and enabled again.
+    Assert.ok(
+      checkbox.checked,
+      "Checkbox should become checked after re-enabling urlbar suggestions"
+    );
+    Assert.ok(
+      !checkbox.disabled,
+      "Checkbox should become enabled after re-enabling urlbar suggestions"
+    );
+
+    // Set the pref to false.
+    Services.prefs.setBoolPref(FIRST_PREF, false);
+
+    // The checkbox should have become unchecked.
+    Assert.ok(
+      !checkbox.checked,
+      "Checkbox should become unchecked after setting pref to false"
+    );
+    Assert.ok(
+      !checkbox.disabled,
+      "Checkbox should remain enabled after setting pref to false"
+    );
+
+    // Set the superior pref to false again.
+    Services.prefs.setBoolPref(superiorPref, false);
+
+    // The pref should remain false.
+    Assert.ok(
+      !Services.prefs.getBoolPref(FIRST_PREF),
+      "Pref should remain false"
+    );
+
+    // The checkbox should remain unchecked and become disabled.
+    Assert.ok(
+      !checkbox.checked,
+      "Checkbox should remain unchecked after disabling urlbar suggestions"
+    );
+    Assert.ok(
+      checkbox.disabled,
+      "Checkbox should become disabled after disabling urlbar suggestions"
+    );
+
+    // Set the superior pref to true.
+    Services.prefs.setBoolPref(superiorPref, true);
+
+    // The pref should remain false.
+    Assert.ok(
+      !Services.prefs.getBoolPref(FIRST_PREF),
+      "Pref should remain false"
+    );
+
+    // The checkbox should remain unchecked and become enabled.
+    Assert.ok(
+      !checkbox.checked,
+      "Checkbox should remain unchecked after re-enabling urlbar suggestions"
+    );
+    Assert.ok(
+      !checkbox.disabled,
+      "Checkbox should become enabled after re-enabling urlbar suggestions"
+    );
+
+    // Finally, set the pref back to true.
+    Services.prefs.setBoolPref(FIRST_PREF, true);
+
+    // The checkbox should have become checked.
+    Assert.ok(
+      checkbox.checked,
+      "Checkbox should become checked after setting pref back to true"
+    );
+    Assert.ok(
+      !checkbox.disabled,
+      "Checkbox should remain enabled after setting pref back to true"
+    );
+  }
+
+  // Clean up.
+  gBrowser.removeCurrentTab();
+
+  Services.prefs.clearUserPref(FIRST_PREF);
+  Services.prefs.clearUserPref(URLBAR_PREF);
+  Services.prefs.clearUserPref(MAIN_PREF);
+  Services.prefs.clearUserPref(SEARCHBAR_PREF);
+});
diff --git a/browser/components/preferences/tests/browser_search_firefoxSuggest.js b/browser/components/preferences/tests/browser_search_firefoxSuggest.js
new file mode 100644
index 0000000000..eb4dc1880a
--- /dev/null
+++ b/browser/components/preferences/tests/browser_search_firefoxSuggest.js
@@ -0,0 +1,628 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+// This tests the Search pane's Firefox Suggest UI.
+
+"use strict";
+
+ChromeUtils.defineESModuleGetters(this, {
+  QuickSuggest: "resource:///modules/QuickSuggest.sys.mjs",
+});
+
+ChromeUtils.defineLazyGetter(this, "QuickSuggestTestUtils", () => {
+  const { QuickSuggestTestUtils: module } = ChromeUtils.importESModule(
+    "resource://testing-common/QuickSuggestTestUtils.sys.mjs"
+  );
+  module.init(this);
+  return module;
+});
+
+const CONTAINER_ID = "firefoxSuggestContainer";
+const NONSPONSORED_CHECKBOX_ID = "firefoxSuggestNonsponsored";
+const SPONSORED_CHECKBOX_ID = "firefoxSuggestSponsored";
+const DATA_COLLECTION_TOGGLE_ID = "firefoxSuggestDataCollectionSearchToggle";
+const INFO_BOX_ID = "firefoxSuggestInfoBox";
+const INFO_TEXT_ID = "firefoxSuggestInfoText";
+const LEARN_MORE_CLASS = "firefoxSuggestLearnMore";
+const BUTTON_RESTORE_DISMISSED_ID = "restoreDismissedSuggestions";
+const PREF_URLBAR_QUICKSUGGEST_BLOCKLIST =
+  "browser.urlbar.quicksuggest.blockedDigests";
+const PREF_URLBAR_WEATHER_USER_ENABLED = "browser.urlbar.suggest.weather";
+
+// Maps text element IDs to `{ enabled, disabled }`, where `enabled` is the
+// expected l10n ID when the Firefox Suggest feature is enabled, and `disabled`
+// is when disabled.
+const EXPECTED_L10N_IDS = {
+  locationBarGroupHeader: {
+    enabled: "addressbar-header-firefox-suggest",
+    disabled: "addressbar-header",
+  },
+  locationBarSuggestionLabel: {
+    enabled: "addressbar-suggest-firefox-suggest",
+    disabled: "addressbar-suggest",
+  },
+};
+
+// This test can take a while due to the many permutations some of these tasks
+// run through, so request a longer timeout.
+requestLongerTimeout(10);
+
+// The following tasks check the visibility of the Firefox Suggest UI based on
+// the value of the feature pref. See doVisibilityTest().
+
+add_task(async function historyToOffline() {
+  await doVisibilityTest({
+    initialScenario: "history",
+    initialExpectedVisibility: false,
+    newScenario: "offline",
+    newExpectedVisibility: true,
+  });
+});
+
+add_task(async function historyToOnline() {
+  await doVisibilityTest({
+    initialScenario: "history",
+    initialExpectedVisibility: false,
+    newScenario: "online",
+    newExpectedVisibility: true,
+  });
+});
+
+add_task(async function offlineToHistory() {
+  await doVisibilityTest({
+    initialScenario: "offline",
+    initialExpectedVisibility: true,
+    newScenario: "history",
+    newExpectedVisibility: false,
+  });
+});
+
+add_task(async function offlineToOnline() {
+  await doVisibilityTest({
+    initialScenario: "offline",
+    initialExpectedVisibility: true,
+    newScenario: "online",
+    newExpectedVisibility: true,
+  });
+});
+
+add_task(async function onlineToHistory() {
+  await doVisibilityTest({
+    initialScenario: "online",
+    initialExpectedVisibility: true,
+    newScenario: "history",
+    newExpectedVisibility: false,
+  });
+});
+
+add_task(async function onlineToOffline() {
+  await doVisibilityTest({
+    initialScenario: "online",
+    initialExpectedVisibility: true,
+    newScenario: "offline",
+    newExpectedVisibility: true,
+  });
+});
+
+/**
+ * Runs a test that checks the visibility of the Firefox Suggest preferences UI
+ * based on scenario pref.
+ *
+ * @param {string} initialScenario
+ *   The initial scenario.
+ * @param {boolean} initialExpectedVisibility
+ *   Whether the UI should be visible with the initial scenario.
+ * @param {string} newScenario
+ *   The updated scenario.
+ * @param {boolean} newExpectedVisibility
+ *   Whether the UI should be visible after setting the new scenario.
+ */
+async function doVisibilityTest({
+  initialScenario,
+  initialExpectedVisibility,
+  newScenario,
+  newExpectedVisibility,
+}) {
+  info(
+    "Running visibility test: " +
+      JSON.stringify(
+        {
+          initialScenario,
+          initialExpectedVisibility,
+          newScenario,
+          newExpectedVisibility,
+        },
+        null,
+        2
+      )
+  );
+
+  // Set the initial scenario.
+  await QuickSuggestTestUtils.setScenario(initialScenario);
+
+  Assert.equal(
+    Services.prefs.getBoolPref("browser.urlbar.quicksuggest.enabled"),
+    initialExpectedVisibility,
+    `quicksuggest.enabled is correct after setting initial scenario, initialExpectedVisibility=${initialExpectedVisibility}`
+  );
+
+  // Open prefs and check the initial visibility.
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let container = doc.getElementById(CONTAINER_ID);
+  Assert.equal(
+    BrowserTestUtils.isVisible(container),
+    initialExpectedVisibility,
+    `The container has the expected initial visibility, initialExpectedVisibility=${initialExpectedVisibility}`
+  );
+
+  // Check the text elements' l10n IDs.
+  for (let [id, { enabled, disabled }] of Object.entries(EXPECTED_L10N_IDS)) {
+    Assert.equal(
+      doc.getElementById(id).dataset.l10nId,
+      initialExpectedVisibility ? enabled : disabled,
+      `Initial l10n ID for element with ID ${id}, initialExpectedVisibility=${initialExpectedVisibility}`
+    );
+  }
+
+  // Set the new scenario.
+  await QuickSuggestTestUtils.setScenario(newScenario);
+
+  Assert.equal(
+    Services.prefs.getBoolPref("browser.urlbar.quicksuggest.enabled"),
+    newExpectedVisibility,
+    `quicksuggest.enabled is correct after setting new scenario, newExpectedVisibility=${newExpectedVisibility}`
+  );
+
+  // Check visibility again.
+  Assert.equal(
+    BrowserTestUtils.isVisible(container),
+    newExpectedVisibility,
+    `The container has the expected visibility after setting new scenario, newExpectedVisibility=${newExpectedVisibility}`
+  );
+
+  // Check the text elements' l10n IDs again.
+  for (let [id, { enabled, disabled }] of Object.entries(EXPECTED_L10N_IDS)) {
+    Assert.equal(
+      doc.getElementById(id).dataset.l10nId,
+      newExpectedVisibility ? enabled : disabled,
+      `New l10n ID for element with ID ${id}, newExpectedVisibility=${newExpectedVisibility}`
+    );
+  }
+
+  // Clean up.
+  gBrowser.removeCurrentTab();
+  await QuickSuggestTestUtils.setScenario(null);
+}
+
+// Verifies all 8 states of the 3 checkboxes and their related info box states.
+add_task(async function checkboxesAndInfoBox() {
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+
+  // suggest.quicksuggest.nonsponsored = true
+  // suggest.quicksuggest.sponsored = true
+  // quicksuggest.dataCollection.enabled = true
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.urlbar.suggest.quicksuggest.nonsponsored", true],
+      ["browser.urlbar.suggest.quicksuggest.sponsored", true],
+      ["browser.urlbar.quicksuggest.dataCollection.enabled", true],
+    ],
+  });
+  assertPrefUIState({
+    [NONSPONSORED_CHECKBOX_ID]: true,
+    [SPONSORED_CHECKBOX_ID]: true,
+    [DATA_COLLECTION_TOGGLE_ID]: true,
+  });
+  await assertInfoBox("addressbar-firefox-suggest-info-all");
+  await SpecialPowers.popPrefEnv();
+
+  // suggest.quicksuggest.nonsponsored = true
+  // suggest.quicksuggest.sponsored = true
+  // quicksuggest.dataCollection.enabled = false
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.urlbar.suggest.quicksuggest.nonsponsored", true],
+      ["browser.urlbar.suggest.quicksuggest.sponsored", true],
+      ["browser.urlbar.quicksuggest.dataCollection.enabled", false],
+    ],
+  });
+  assertPrefUIState({
+    [NONSPONSORED_CHECKBOX_ID]: true,
+    [SPONSORED_CHECKBOX_ID]: true,
+    [DATA_COLLECTION_TOGGLE_ID]: false,
+  });
+  await assertInfoBox("addressbar-firefox-suggest-info-nonsponsored-sponsored");
+  await SpecialPowers.popPrefEnv();
+
+  // suggest.quicksuggest.nonsponsored = true
+  // suggest.quicksuggest.sponsored = false
+  // quicksuggest.dataCollection.enabled = true
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.urlbar.suggest.quicksuggest.nonsponsored", true],
+      ["browser.urlbar.suggest.quicksuggest.sponsored", false],
+      ["browser.urlbar.quicksuggest.dataCollection.enabled", true],
+    ],
+  });
+  assertPrefUIState({
+    [NONSPONSORED_CHECKBOX_ID]: true,
+    [SPONSORED_CHECKBOX_ID]: false,
+    [DATA_COLLECTION_TOGGLE_ID]: true,
+  });
+  await assertInfoBox("addressbar-firefox-suggest-info-nonsponsored-data");
+  await SpecialPowers.popPrefEnv();
+
+  // suggest.quicksuggest.nonsponsored = true
+  // suggest.quicksuggest.sponsored = false
+  // quicksuggest.dataCollection.enabled = false
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.urlbar.suggest.quicksuggest.nonsponsored", true],
+      ["browser.urlbar.suggest.quicksuggest.sponsored", false],
+      ["browser.urlbar.quicksuggest.dataCollection.enabled", false],
+    ],
+  });
+  assertPrefUIState({
+    [NONSPONSORED_CHECKBOX_ID]: true,
+    [SPONSORED_CHECKBOX_ID]: false,
+    [DATA_COLLECTION_TOGGLE_ID]: false,
+  });
+  await assertInfoBox("addressbar-firefox-suggest-info-nonsponsored");
+  await SpecialPowers.popPrefEnv();
+
+  // suggest.quicksuggest.nonsponsored = false
+  // suggest.quicksuggest.sponsored = true
+  // quicksuggest.dataCollection.enabled = true
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.urlbar.suggest.quicksuggest.nonsponsored", false],
+      ["browser.urlbar.suggest.quicksuggest.sponsored", true],
+      ["browser.urlbar.quicksuggest.dataCollection.enabled", true],
+    ],
+  });
+  assertPrefUIState({
+    [NONSPONSORED_CHECKBOX_ID]: false,
+    [SPONSORED_CHECKBOX_ID]: true,
+    [DATA_COLLECTION_TOGGLE_ID]: true,
+  });
+  await assertInfoBox("addressbar-firefox-suggest-info-sponsored-data");
+  await SpecialPowers.popPrefEnv();
+
+  // suggest.quicksuggest.nonsponsored = false
+  // suggest.quicksuggest.sponsored = true
+  // quicksuggest.dataCollection.enabled = false
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.urlbar.suggest.quicksuggest.nonsponsored", false],
+      ["browser.urlbar.suggest.quicksuggest.sponsored", true],
+      ["browser.urlbar.quicksuggest.dataCollection.enabled", false],
+    ],
+  });
+  assertPrefUIState({
+    [NONSPONSORED_CHECKBOX_ID]: false,
+    [SPONSORED_CHECKBOX_ID]: true,
+    [DATA_COLLECTION_TOGGLE_ID]: false,
+  });
+  await assertInfoBox("addressbar-firefox-suggest-info-sponsored");
+  await SpecialPowers.popPrefEnv();
+
+  // suggest.quicksuggest.nonsponsored = false
+  // suggest.quicksuggest.sponsored = false
+  // quicksuggest.dataCollection.enabled = true
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.urlbar.suggest.quicksuggest.nonsponsored", false],
+      ["browser.urlbar.suggest.quicksuggest.sponsored", false],
+      ["browser.urlbar.quicksuggest.dataCollection.enabled", true],
+    ],
+  });
+  assertPrefUIState({
+    [NONSPONSORED_CHECKBOX_ID]: false,
+    [SPONSORED_CHECKBOX_ID]: false,
+    [DATA_COLLECTION_TOGGLE_ID]: true,
+  });
+  await assertInfoBox("addressbar-firefox-suggest-info-data");
+  await SpecialPowers.popPrefEnv();
+
+  // suggest.quicksuggest.nonsponsored = false
+  // suggest.quicksuggest.sponsored = false
+  // quicksuggest.dataCollection.enabled = false
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.urlbar.suggest.quicksuggest.nonsponsored", false],
+      ["browser.urlbar.suggest.quicksuggest.sponsored", false],
+      ["browser.urlbar.quicksuggest.dataCollection.enabled", false],
+    ],
+  });
+  assertPrefUIState({
+    [NONSPONSORED_CHECKBOX_ID]: false,
+    [SPONSORED_CHECKBOX_ID]: false,
+    [DATA_COLLECTION_TOGGLE_ID]: false,
+  });
+  await assertInfoBox(null);
+  await SpecialPowers.popPrefEnv();
+
+  gBrowser.removeCurrentTab();
+});
+
+// Clicks each of the checkboxes and toggles and makes sure the prefs and info box are updated.
+add_task(async function clickCheckboxesOrToggle() {
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let addressBarSection = doc.getElementById("locationBarGroup");
+  addressBarSection.scrollIntoView();
+
+  async function clickElement(id, eventName) {
+    let element = doc.getElementById(id);
+    let changed = BrowserTestUtils.waitForEvent(element, eventName);
+
+    if (eventName == "toggle") {
+      element = element.buttonEl;
+    }
+
+    EventUtils.synthesizeMouseAtCenter(
+      element,
+      {},
+      gBrowser.selectedBrowser.contentWindow
+    );
+    await changed;
+  }
+
+  // Set initial state.
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.urlbar.suggest.quicksuggest.nonsponsored", true],
+      ["browser.urlbar.suggest.quicksuggest.sponsored", true],
+      ["browser.urlbar.quicksuggest.dataCollection.enabled", true],
+    ],
+  });
+  assertPrefUIState({
+    [NONSPONSORED_CHECKBOX_ID]: true,
+    [SPONSORED_CHECKBOX_ID]: true,
+    [DATA_COLLECTION_TOGGLE_ID]: true,
+  });
+  await assertInfoBox("addressbar-firefox-suggest-info-all");
+
+  // non-sponsored checkbox
+  await clickElement(NONSPONSORED_CHECKBOX_ID, "command");
+  Assert.ok(
+    !Services.prefs.getBoolPref(
+      "browser.urlbar.suggest.quicksuggest.nonsponsored"
+    ),
+    "suggest.quicksuggest.nonsponsored is false after clicking non-sponsored checkbox"
+  );
+  assertPrefUIState({
+    [NONSPONSORED_CHECKBOX_ID]: false,
+    [SPONSORED_CHECKBOX_ID]: true,
+    [DATA_COLLECTION_TOGGLE_ID]: true,
+  });
+  await assertInfoBox("addressbar-firefox-suggest-info-sponsored-data");
+
+  // sponsored checkbox
+  await clickElement(SPONSORED_CHECKBOX_ID, "command");
+  Assert.ok(
+    !Services.prefs.getBoolPref(
+      "browser.urlbar.suggest.quicksuggest.nonsponsored"
+    ),
+    "suggest.quicksuggest.nonsponsored remains false after clicking sponsored checkbox"
+  );
+  Assert.ok(
+    !Services.prefs.getBoolPref(
+      "browser.urlbar.suggest.quicksuggest.sponsored"
+    ),
+    "suggest.quicksuggest.sponsored is false after clicking sponsored checkbox"
+  );
+  assertPrefUIState({
+    [NONSPONSORED_CHECKBOX_ID]: false,
+    [SPONSORED_CHECKBOX_ID]: false,
+    [DATA_COLLECTION_TOGGLE_ID]: true,
+  });
+  await assertInfoBox("addressbar-firefox-suggest-info-data");
+
+  // data collection toggle
+  await clickElement(DATA_COLLECTION_TOGGLE_ID, "toggle");
+  Assert.ok(
+    !Services.prefs.getBoolPref(
+      "browser.urlbar.suggest.quicksuggest.nonsponsored"
+    ),
+    "suggest.quicksuggest.nonsponsored remains false after clicking sponsored checkbox"
+  );
+  Assert.ok(
+    !Services.prefs.getBoolPref(
+      "browser.urlbar.suggest.quicksuggest.sponsored"
+    ),
+    "suggest.quicksuggest.sponsored remains false after clicking data collection toggle"
+  );
+  Assert.ok(
+    !Services.prefs.getBoolPref(
+      "browser.urlbar.quicksuggest.dataCollection.enabled"
+    ),
+    "quicksuggest.dataCollection.enabled is false after clicking data collection toggle"
+  );
+  assertPrefUIState({
+    [NONSPONSORED_CHECKBOX_ID]: false,
+    [SPONSORED_CHECKBOX_ID]: false,
+    [DATA_COLLECTION_TOGGLE_ID]: false,
+  });
+  await assertInfoBox(null);
+
+  gBrowser.removeCurrentTab();
+  await SpecialPowers.popPrefEnv();
+});
+
+// Clicks the learn-more links and checks the help page is opened in a new tab.
+add_task(async function clickLearnMore() {
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let addressBarSection = doc.getElementById("locationBarGroup");
+  addressBarSection.scrollIntoView();
+
+  // Set initial state so that the info box and learn more link are shown.
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.urlbar.suggest.quicksuggest.nonsponsored", true],
+      ["browser.urlbar.suggest.quicksuggest.sponsored", true],
+      ["browser.urlbar.quicksuggest.dataCollection.enabled", true],
+    ],
+  });
+  await assertInfoBox("addressbar-firefox-suggest-info-all");
+
+  let learnMoreLinks = doc.querySelectorAll(
+    "#locationBarGroup ." + LEARN_MORE_CLASS
+  );
+  Assert.equal(
+    learnMoreLinks.length,
+    3,
+    "Expected number of learn-more links are present"
+  );
+  for (let link of learnMoreLinks) {
+    Assert.ok(
+      BrowserTestUtils.isVisible(link),
+      "Learn-more link is visible: " + link.id
+    );
+  }
+
+  let prefsTab = gBrowser.selectedTab;
+  for (let link of learnMoreLinks) {
+    let tabPromise = BrowserTestUtils.waitForNewTab(
+      gBrowser,
+      QuickSuggest.HELP_URL
+    );
+    info("Clicking learn-more link: " + link.id);
+    Assert.ok(link.id, "Sanity check: Learn-more link has an ID");
+    await BrowserTestUtils.synthesizeMouseAtCenter(
+      "#" + link.id,
+      {},
+      gBrowser.selectedBrowser
+    );
+    info("Waiting for help page to load in a new tab");
+    await tabPromise;
+    gBrowser.removeCurrentTab();
+    gBrowser.selectedTab = prefsTab;
+  }
+
+  gBrowser.removeCurrentTab();
+  await SpecialPowers.popPrefEnv();
+});
+
+// Tests the "Restore" button for dismissed suggestions.
+add_task(async function restoreDismissedSuggestions() {
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let addressBarSection = doc.getElementById("locationBarGroup");
+  addressBarSection.scrollIntoView();
+
+  let button = doc.getElementById(BUTTON_RESTORE_DISMISSED_ID);
+  Assert.equal(
+    Services.prefs.getStringPref(PREF_URLBAR_QUICKSUGGEST_BLOCKLIST, ""),
+    "",
+    "Block list is empty initially"
+  );
+  Assert.ok(
+    Services.prefs.getBoolPref(PREF_URLBAR_WEATHER_USER_ENABLED),
+    "Weather suggestions are enabled initially"
+  );
+  Assert.ok(button.disabled, "Restore button is disabled initially.");
+
+  await QuickSuggest.blockedSuggestions.add("https://example.com/");
+  Assert.notEqual(
+    Services.prefs.getStringPref(PREF_URLBAR_QUICKSUGGEST_BLOCKLIST, ""),
+    "",
+    "Block list is non-empty after adding URL"
+  );
+  Assert.ok(!button.disabled, "Restore button is enabled after blocking URL.");
+  button.click();
+  Assert.equal(
+    Services.prefs.getStringPref(PREF_URLBAR_QUICKSUGGEST_BLOCKLIST, ""),
+    "",
+    "Block list is empty clicking Restore button"
+  );
+  Assert.ok(button.disabled, "Restore button is disabled after clicking it.");
+
+  Services.prefs.setBoolPref(PREF_URLBAR_WEATHER_USER_ENABLED, false);
+  Assert.ok(
+    !button.disabled,
+    "Restore button is enabled after disabling weather suggestions."
+  );
+  button.click();
+  Assert.ok(
+    Services.prefs.getBoolPref(PREF_URLBAR_WEATHER_USER_ENABLED),
+    "Weather suggestions are enabled after clicking Restore button"
+  );
+  Assert.ok(
+    button.disabled,
+    "Restore button is disabled after clicking it again."
+  );
+
+  gBrowser.removeCurrentTab();
+  await SpecialPowers.popPrefEnv();
+});
+
+/**
+ * Verifies the state of pref related to checkboxes or toggles.
+ *
+ * @param {object} stateByElementID
+ *   Maps checkbox or toggle element IDs to booleans. Each boolean
+ *   is the expected state of the corresponding ID.
+ */
+function assertPrefUIState(stateByElementID) {
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let container = doc.getElementById(CONTAINER_ID);
+  let attr;
+  Assert.ok(BrowserTestUtils.isVisible(container), "The container is visible");
+  for (let [id, state] of Object.entries(stateByElementID)) {
+    let element = doc.getElementById(id);
+    if (element.tagName === "checkbox") {
+      attr = "checked";
+    } else if (element.tagName === "html:moz-toggle") {
+      attr = "pressed";
+    }
+    Assert.equal(element[attr], state, "Expected state for ID: " + id);
+  }
+}
+
+/**
+ * Verifies the state of the info box.
+ *
+ * @param {string} expectedL10nID
+ *   The l10n ID of the string that should be visible in the info box, null if
+ *   the info box should be hidden.
+ */
+async function assertInfoBox(expectedL10nID) {
+  info("Checking info box with expected l10n ID: " + expectedL10nID);
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let infoBox = doc.getElementById(INFO_BOX_ID);
+  await TestUtils.waitForCondition(
+    () => BrowserTestUtils.isVisible(infoBox) == !!expectedL10nID,
+    "Waiting for expected info box visibility: " + !!expectedL10nID
+  );
+
+  let infoIcon = infoBox.querySelector(".info-icon");
+  Assert.equal(
+    BrowserTestUtils.isVisible(infoIcon),
+    !!expectedL10nID,
+    "The info icon is visible iff a description should be shown"
+  );
+
+  let learnMore = infoBox.querySelector("." + LEARN_MORE_CLASS);
+  Assert.ok(learnMore, "Found the info box learn more link");
+  Assert.equal(
+    BrowserTestUtils.isVisible(learnMore),
+    !!expectedL10nID,
+    "The info box learn more link is visible iff a description should be shown"
+  );
+
+  if (expectedL10nID) {
+    let infoText = doc.getElementById(INFO_TEXT_ID);
+    Assert.equal(
+      infoText.dataset.l10nId,
+      expectedL10nID,
+      "Info text has expected l10n ID"
+    );
+  }
+}
diff --git a/browser/components/preferences/tests/browser_search_no_results_change_category.js b/browser/components/preferences/tests/browser_search_no_results_change_category.js
new file mode 100644
index 0000000000..131492632e
--- /dev/null
+++ b/browser/components/preferences/tests/browser_search_no_results_change_category.js
@@ -0,0 +1,44 @@
+"use strict";
+
+add_task(async function () {
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.preferences.search", true]],
+  });
+});
+
+add_task(async function () {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+
+  let searchInput = gBrowser.contentDocument.getElementById("searchInput");
+  is(
+    searchInput,
+    gBrowser.contentDocument.activeElement.closest("#searchInput"),
+    "Search input should be focused when visiting preferences"
+  );
+  let query = "ffff____noresults____ffff";
+  let searchCompletedPromise = BrowserTestUtils.waitForEvent(
+    gBrowser.contentWindow,
+    "PreferencesSearchCompleted",
+    evt => evt.detail == query
+  );
+  EventUtils.sendString(query);
+  await searchCompletedPromise;
+
+  let noResultsEl = gBrowser.contentDocument.querySelector(
+    "#no-results-message"
+  );
+  is_element_visible(
+    noResultsEl,
+    "Should be reporting no results for this query"
+  );
+
+  await gBrowser.contentWindow.gotoPref("panePrivacy");
+  is_element_hidden(
+    noResultsEl,
+    "Should not be showing the 'no results' message after selecting a category"
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_search_quickactions.js b/browser/components/preferences/tests/browser_search_quickactions.js
new file mode 100644
index 0000000000..db938035ae
--- /dev/null
+++ b/browser/components/preferences/tests/browser_search_quickactions.js
@@ -0,0 +1,110 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+// This tests the Privacy pane's Firefox QuickActions UI.
+
+"use strict";
+
+ChromeUtils.defineESModuleGetters(this, {
+  UrlbarProviderQuickActions:
+    "resource:///modules/UrlbarProviderQuickActions.sys.mjs",
+  UrlbarTestUtils: "resource://testing-common/UrlbarTestUtils.sys.mjs",
+});
+
+add_setup(async function setup() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.urlbar.suggest.quickactions", true],
+      ["browser.urlbar.quickactions.enabled", true],
+    ],
+  });
+
+  UrlbarProviderQuickActions.addAction("testaction", {
+    commands: ["testaction"],
+    label: "quickactions-downloads2",
+  });
+
+  registerCleanupFunction(() => {
+    UrlbarProviderQuickActions.removeAction("testaction");
+  });
+});
+
+async function isGroupHidden(tab) {
+  return SpecialPowers.spawn(
+    tab.linkedBrowser,
+    [],
+    async () => content.document.getElementById("quickActionsBox").hidden
+  );
+}
+
+add_task(async function test_show_prefs() {
+  Services.prefs.setBoolPref("browser.urlbar.quickactions.showPrefs", false);
+
+  let tab = await BrowserTestUtils.openNewForegroundTab(
+    gBrowser,
+    "about:preferences#search"
+  );
+
+  Assert.ok(
+    await isGroupHidden(tab),
+    "The preferences are hidden when pref disabled"
+  );
+
+  Services.prefs.setBoolPref("browser.urlbar.quickactions.showPrefs", true);
+
+  Assert.ok(
+    !(await isGroupHidden(tab)),
+    "The preferences are shown when pref enabled"
+  );
+
+  Services.prefs.clearUserPref("browser.urlbar.quickactions.showPrefs");
+  await BrowserTestUtils.removeTab(tab);
+});
+
+async function testActionIsShown(window) {
+  await UrlbarTestUtils.promiseAutocompleteResultPopup({
+    window,
+    value: "testact",
+    waitForFocus: SimpleTest.waitForFocus,
+  });
+  try {
+    let { result } = await UrlbarTestUtils.getDetailsOfResultAt(window, 1);
+    return result.providerName == "quickactions";
+  } catch (e) {
+    return false;
+  }
+}
+
+add_task(async function test_prefs() {
+  Services.prefs.setBoolPref("browser.urlbar.quickactions.showPrefs", true);
+  Services.prefs.setBoolPref("browser.urlbar.suggest.quickactions", false);
+
+  let tab = await BrowserTestUtils.openNewForegroundTab(
+    gBrowser,
+    "about:preferences#search"
+  );
+
+  Assert.ok(
+    !(await testActionIsShown(window)),
+    "Actions are not shown while pref disabled"
+  );
+
+  await SpecialPowers.spawn(tab.linkedBrowser, [], async () => {
+    let checkbox = content.document.getElementById("enableQuickActions");
+    is(
+      checkbox.checked,
+      false,
+      "Checkbox is not checked while feature is disabled"
+    );
+    checkbox.click();
+  });
+
+  Assert.ok(
+    await testActionIsShown(window),
+    "Actions are shown after user clicks checkbox"
+  );
+
+  Services.prefs.clearUserPref("browser.urlbar.quickactions.showPrefs");
+  Services.prefs.clearUserPref("browser.urlbar.suggest.quickactions");
+  await BrowserTestUtils.removeTab(tab);
+});
diff --git a/browser/components/preferences/tests/browser_search_searchTerms.js b/browser/components/preferences/tests/browser_search_searchTerms.js
new file mode 100644
index 0000000000..03593d1c6c
--- /dev/null
+++ b/browser/components/preferences/tests/browser_search_searchTerms.js
@@ -0,0 +1,199 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+/*
+  Tests the showSearchTerms option on the about:preferences#search page.
+*/
+
+"use strict";
+
+ChromeUtils.defineLazyGetter(this, "QuickSuggestTestUtils", () => {
+  const { QuickSuggestTestUtils: module } = ChromeUtils.importESModule(
+    "resource://testing-common/QuickSuggestTestUtils.sys.mjs"
+  );
+  module.init(this);
+  return module;
+});
+
+const CHECKBOX_ID = "searchShowSearchTermCheckbox";
+const PREF_SEARCHTERMS = "browser.urlbar.showSearchTerms.enabled";
+const PREF_FEATUREGATE = "browser.urlbar.showSearchTerms.featureGate";
+
+/*
+  If Nimbus experiment is enabled, check option visibility.
+*/
+add_task(async function showSearchTermsVisibility_experiment_beforeOpen() {
+  await SpecialPowers.pushPrefEnv({
+    set: [[PREF_FEATUREGATE, false]],
+  });
+  await QuickSuggestTestUtils.withExperiment({
+    valueOverrides: {
+      showSearchTermsFeatureGate: true,
+    },
+    callback: async () => {
+      await openPreferencesViaOpenPreferencesAPI("search", {
+        leaveOpen: true,
+      });
+      let doc = gBrowser.selectedBrowser.contentDocument;
+      let container = doc.getElementById(CHECKBOX_ID);
+      Assert.ok(
+        BrowserTestUtils.isVisible(container),
+        "The option box is visible"
+      );
+      gBrowser.removeCurrentTab();
+    },
+  });
+  await SpecialPowers.popPrefEnv();
+});
+
+/*
+  If Nimbus experiment is not enabled initially but eventually enabled,
+  check option visibility on Preferences page.
+*/
+add_task(async function showSearchTermsVisibility_experiment_afterOpen() {
+  await SpecialPowers.pushPrefEnv({
+    set: [[PREF_FEATUREGATE, false]],
+  });
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let container = doc.getElementById(CHECKBOX_ID);
+  Assert.ok(
+    BrowserTestUtils.isHidden(container),
+    "The option box is initially hidden."
+  );
+
+  // Install experiment.
+  await QuickSuggestTestUtils.withExperiment({
+    valueOverrides: {
+      showSearchTermsFeatureGate: true,
+    },
+    callback: async () => {
+      Assert.ok(
+        BrowserTestUtils.isVisible(container),
+        "The option box is visible"
+      );
+    },
+  });
+
+  Assert.ok(
+    BrowserTestUtils.isHidden(container),
+    "The option box is hidden again after the experiment is uninstalled."
+  );
+
+  gBrowser.removeCurrentTab();
+  await SpecialPowers.popPrefEnv();
+});
+
+/*
+  Check using the checkbox modifies the preference.
+*/
+add_task(async function showSearchTerms_checkbox() {
+  // Enable the feature.
+  await SpecialPowers.pushPrefEnv({
+    set: [[PREF_FEATUREGATE, true]],
+  });
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+  let doc = gBrowser.selectedBrowser.contentDocument;
+
+  let option = doc.getElementById(CHECKBOX_ID);
+
+  // Evaluate checkbox pref is true.
+  Assert.ok(option.checked, "Option box should be checked.");
+
+  // Evaluate checkbox when pref is false.
+  await SpecialPowers.pushPrefEnv({
+    set: [[PREF_SEARCHTERMS, false]],
+  });
+  Assert.ok(!option.checked, "Option box should not be checked.");
+  await SpecialPowers.popPrefEnv();
+
+  // Evaluate pref when checkbox is un-checked.
+  await BrowserTestUtils.synthesizeMouseAtCenter(
+    "#" + CHECKBOX_ID,
+    {},
+    gBrowser.selectedBrowser
+  );
+  Assert.equal(
+    Services.prefs.getBoolPref(PREF_SEARCHTERMS),
+    false,
+    "Preference should be false if un-checked."
+  );
+
+  // Evaluate pref when checkbox is checked.
+  await BrowserTestUtils.synthesizeMouseAtCenter(
+    "#" + CHECKBOX_ID,
+    {},
+    gBrowser.selectedBrowser
+  );
+  Assert.equal(
+    Services.prefs.getBoolPref(PREF_SEARCHTERMS),
+    true,
+    "Preference should be true if checked."
+  );
+
+  // Clean-up.
+  Services.prefs.clearUserPref(PREF_SEARCHTERMS);
+  gBrowser.removeCurrentTab();
+  await SpecialPowers.popPrefEnv();
+});
+
+/*
+  When loading the search preferences panel, the
+  showSearchTerms checkbox should be hidden if
+  the search bar is enabled.
+*/
+add_task(async function showSearchTerms_and_searchBar_preference_load() {
+  // Enable the feature.
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      [PREF_FEATUREGATE, true],
+      ["browser.search.widget.inNavBar", true],
+    ],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+  let doc = gBrowser.selectedBrowser.contentDocument;
+
+  let checkbox = doc.getElementById(CHECKBOX_ID);
+  Assert.ok(
+    checkbox.hidden,
+    "showSearchTerms checkbox should be hidden when search bar is enabled."
+  );
+
+  // Clean-up.
+  gBrowser.removeCurrentTab();
+  await SpecialPowers.popPrefEnv();
+});
+
+/*
+  If the search bar is enabled while the search
+  preferences panel is open, the showSearchTerms
+  checkbox should not be clickable.
+*/
+add_task(async function showSearchTerms_and_searchBar_preference_change() {
+  // Enable the feature.
+  await SpecialPowers.pushPrefEnv({
+    set: [[PREF_FEATUREGATE, true]],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+  let doc = gBrowser.selectedBrowser.contentDocument;
+
+  let checkbox = doc.getElementById(CHECKBOX_ID);
+  Assert.ok(!checkbox.hidden, "showSearchTerms checkbox should be shown.");
+
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.search.widget.inNavBar", true]],
+  });
+  Assert.ok(
+    checkbox.hidden,
+    "showSearchTerms checkbox should be hidden when search bar is enabled."
+  );
+
+  // Clean-up.
+  await SpecialPowers.popPrefEnv();
+  Assert.ok(!checkbox.hidden, "showSearchTerms checkbox should be shown.");
+
+  gBrowser.removeCurrentTab();
+  await SpecialPowers.popPrefEnv();
+});
diff --git a/browser/components/preferences/tests/browser_search_subdialog_tooltip_saved_addresses.js b/browser/components/preferences/tests/browser_search_subdialog_tooltip_saved_addresses.js
new file mode 100644
index 0000000000..8235f8dd19
--- /dev/null
+++ b/browser/components/preferences/tests/browser_search_subdialog_tooltip_saved_addresses.js
@@ -0,0 +1,39 @@
+"use strict";
+
+add_task(async function () {
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.preferences.search", true]],
+  });
+});
+
+add_task(async function test_show_search_term_tooltip_in_subdialog() {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+
+  let keyword = "organization";
+  await runSearchInput(keyword);
+
+  let formAutofillGroupBox = gBrowser.contentDocument.getElementById(
+    "formAutofillGroupBox"
+  );
+  let savedAddressesButton =
+    formAutofillGroupBox.querySelector(".accessory-button");
+
+  info("Clicking saved addresses button to open subdialog");
+  savedAddressesButton.click();
+  info("Waiting for addresses subdialog to appear");
+  await BrowserTestUtils.waitForCondition(() => {
+    let dialogBox = gBrowser.contentDocument.querySelector(".dialogBox");
+    return !!dialogBox;
+  });
+  let tooltip = gBrowser.contentDocument.querySelector(".search-tooltip");
+
+  is_element_visible(
+    tooltip,
+    "Tooltip with search term should be visible in subdialog"
+  );
+  is(tooltip.textContent, keyword, "Tooltip should have correct search term");
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_1.js b/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_1.js
new file mode 100644
index 0000000000..e676de0a6c
--- /dev/null
+++ b/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_1.js
@@ -0,0 +1,48 @@
+/*
+ * This file contains tests for the Preferences search bar.
+ */
+
+// Enabling Searching functionatily. Will display search bar form this testcase forward.
+add_task(async function () {
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.preferences.search", true]],
+  });
+});
+
+/**
+ * Test for searching for the "Set Home Page" subdialog.
+ */
+add_task(async function () {
+  // Set custom URL so bookmark button will be shown on the page (otherwise it is hidden)
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      ["browser.startup.homepage", "about:robots"],
+      ["browser.startup.page", 1],
+    ],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("paneHome", { leaveOpen: true });
+
+  // Wait for Activity Stream to add its panels
+  await BrowserTestUtils.waitForCondition(() =>
+    SpecialPowers.spawn(
+      gBrowser.selectedTab.linkedBrowser,
+      [],
+      () => !!content.document.getElementById("homeContentsGroup")
+    )
+  );
+
+  await evaluateSearchResults("Set Home Page", "homepageGroup");
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+/**
+ * Test for searching for the "Languages" subdialog.
+ */
+add_task(async function () {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  await evaluateSearchResults("Choose languages", "languagesGroup");
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_2.js b/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_2.js
new file mode 100644
index 0000000000..6ff05dee29
--- /dev/null
+++ b/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_2.js
@@ -0,0 +1,36 @@
+/*
+ * This file contains tests for the Preferences search bar.
+ */
+
+// Enabling Searching functionatily. Will display search bar form this testcase forward.
+add_task(async function () {
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.preferences.search", true]],
+  });
+});
+
+/**
+ * Test for searching for the "Saved Logins" subdialog.
+ */
+add_task(async function () {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  await evaluateSearchResults("sites are stored", "passwordsGroup");
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+/**
+ * Test for searching for the "Exceptions - Enhanced Tracking Protection" subdialog:
+ * "You can specify which websites have Enhanced Tracking Protection turned off." #permissions-exceptions-manage-etp-desc
+ */
+add_task(async function () {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  await evaluateSearchResults(
+    "Enhanced Tracking Protection turned off",
+    "trackingGroup"
+  );
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_3.js b/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_3.js
new file mode 100644
index 0000000000..45f8774d73
--- /dev/null
+++ b/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_3.js
@@ -0,0 +1,35 @@
+/*
+ * This file contains tests for the Preferences search bar.
+ */
+
+// Enabling Searching functionatily. Will display search bar form this testcase forward.
+add_task(async function () {
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.preferences.search", true]],
+  });
+});
+
+/**
+ * Test for searching for the "Allowed Sites - Add-ons Installation" subdialog.
+ */
+add_task(async function () {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  await evaluateSearchResults("allowed to install add-ons", "permissionsGroup");
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+/**
+ * Test for searching for the "Certificate Manager" subdialog.
+ */
+add_task(async function () {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  await evaluateSearchResults(
+    "identify these certificate authorities",
+    "certSelection"
+  );
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_4.js b/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_4.js
new file mode 100644
index 0000000000..9cfcb51f1b
--- /dev/null
+++ b/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_4.js
@@ -0,0 +1,39 @@
+/*
+ * This file contains tests for the Preferences search bar.
+ */
+
+// Enabling Searching functionatily. Will display search bar form this testcase forward.
+add_task(async function () {
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.preferences.search", true]],
+  });
+});
+
+/**
+ * Test for searching for the "Update History" subdialog.
+ */
+add_task(async function () {
+  // The updates panel is disabled in MSIX builds.
+  if (
+    AppConstants.platform === "win" &&
+    Services.sysinfo.getProperty("hasWinPackageId")
+  ) {
+    return;
+  }
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  await evaluateSearchResults("updates have been installed", "updateApp");
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+/**
+ * Test for searching for the "Location Permissions" subdialog.
+ */
+add_task(async function () {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  await evaluateSearchResults("location permissions", "permissionsGroup");
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_5.js b/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_5.js
new file mode 100644
index 0000000000..4c0e67bb8a
--- /dev/null
+++ b/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_5.js
@@ -0,0 +1,49 @@
+/*
+ * This file contains tests for the Preferences search bar.
+ */
+
+requestLongerTimeout(2);
+
+// Enabling Searching functionatily. Will display search bar form this testcase forward.
+add_task(async function () {
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.preferences.search", true]],
+  });
+});
+
+/**
+ * Test for searching for the "Fonts" subdialog.
+ */
+add_task(async function () {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  // Oh, Canada:
+  await evaluateSearchResults("Unified Canadian Syllabary", "fontsGroup");
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+/**
+ * Test for searching for the "Colors" subdialog.
+ */
+add_task(async function () {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  await evaluateSearchResults("Link Colors", "colorsGroup");
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+/**
+ * Test for searching for the "Exceptions - Saved Logins" subdialog.
+ */
+add_task(async function () {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  await evaluateSearchResults(
+    "won’t save passwords for sites listed here",
+    "passwordsGroup"
+  );
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_6.js b/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_6.js
new file mode 100644
index 0000000000..1091dd2dd4
--- /dev/null
+++ b/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_6.js
@@ -0,0 +1,35 @@
+/*
+ * This file contains tests for the Preferences search bar.
+ */
+
+// Enabling Searching functionatily. Will display search bar form this testcase forward.
+add_task(async function () {
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.preferences.search", true]],
+  });
+});
+
+/**
+ * Test for searching for the "Block Lists" subdialog.
+ */
+add_task(async function () {
+  async function doTest() {
+    await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+      leaveOpen: true,
+    });
+    await evaluateSearchResults("block online trackers", "trackingGroup");
+    BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  }
+  await doTest();
+});
+
+/**
+ * Test for searching for the "Allowed Sites - Pop-ups" subdialog.
+ */
+add_task(async function () {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  await evaluateSearchResults("open pop-up windows", "permissionsGroup");
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_7.js b/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_7.js
new file mode 100644
index 0000000000..1c4a923f06
--- /dev/null
+++ b/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_7.js
@@ -0,0 +1,34 @@
+/*
+ * This file contains tests for the Preferences search bar.
+ */
+
+requestLongerTimeout(2);
+
+// Enabling Searching functionatily. Will display search bar form this testcase forward.
+add_task(async function () {
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.preferences.search", true]],
+  });
+});
+
+/**
+ * Test for searching for the "Device Manager" subdialog.
+ */
+add_task(async function () {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  await evaluateSearchResults("Security Modules and Devices", "certSelection");
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+/**
+ * Test for searching for the "Connection Settings" subdialog.
+ */
+add_task(async function () {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  await evaluateSearchResults("Use system proxy settings", "connectionGroup");
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_8.js b/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_8.js
new file mode 100644
index 0000000000..9827e89239
--- /dev/null
+++ b/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_8.js
@@ -0,0 +1,45 @@
+/*
+ * This file contains tests for the Preferences search bar.
+ */
+
+requestLongerTimeout(2);
+
+// Enabling Searching functionatily. Will display search bar form this testcase forward.
+add_task(async function () {
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.preferences.search", true]],
+  });
+});
+
+/**
+ * Test for searching for the "Camera Permissions" subdialog.
+ */
+add_task(async function () {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  await evaluateSearchResults("camera permissions", "permissionsGroup");
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+/**
+ * Test for searching for the "Microphone Permissions" subdialog.
+ */
+add_task(async function () {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  await evaluateSearchResults("microphone permissions", "permissionsGroup");
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+/**
+ * Test for searching for the "Notification Permissions" subdialog.
+ */
+add_task(async function () {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  await evaluateSearchResults("notification permissions", "permissionsGroup");
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_site_data.js b/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_site_data.js
new file mode 100644
index 0000000000..a46b7545ff
--- /dev/null
+++ b/browser/components/preferences/tests/browser_search_subdialogs_within_preferences_site_data.js
@@ -0,0 +1,48 @@
+/*
+ * This file contains tests for the Preferences search bar.
+ */
+
+// Enabling Searching functionatily. Will display search bar form this testcase forward.
+add_task(async function () {
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.preferences.search", true]],
+  });
+});
+
+/**
+ * Test for searching for the "Settings - Site Data" subdialog.
+ */
+add_task(async function () {
+  await SpecialPowers.pushPrefEnv({
+    set: [["cookiebanners.ui.desktop.enabled", false]],
+  });
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  await evaluateSearchResults("cookies", ["siteDataGroup", "trackingGroup"]);
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function () {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  await evaluateSearchResults("site data", ["siteDataGroup"]);
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function () {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  await evaluateSearchResults("cache", ["siteDataGroup"]);
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+add_task(async function () {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  await evaluateSearchResults("cross-site", ["trackingGroup"]);
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_search_within_preferences_1.js b/browser/components/preferences/tests/browser_search_within_preferences_1.js
new file mode 100644
index 0000000000..504191ecb5
--- /dev/null
+++ b/browser/components/preferences/tests/browser_search_within_preferences_1.js
@@ -0,0 +1,344 @@
+"use strict";
+/**
+ * This file contains tests for the Preferences search bar.
+ */
+
+requestLongerTimeout(6);
+
+/**
+ * Tests to see if search bar is being shown when pref is turned on
+ */
+add_task(async function show_search_bar_when_pref_is_enabled() {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  let searchInput = gBrowser.contentDocument.getElementById("searchInput");
+  is_element_visible(searchInput, "Search box should be shown");
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+/**
+ * Test for "Search Result" panel.
+ * After it runs a search, it tests if the "Search Results" panel is the only selected category.
+ * The search is then cleared, it then tests if the "General" panel is the only selected category.
+ */
+add_task(async function show_search_results_pane_only_then_revert_to_general() {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+
+  // Performs search
+  let searchInput = gBrowser.contentDocument.getElementById("searchInput");
+
+  is(
+    searchInput,
+    gBrowser.contentDocument.activeElement.closest("#searchInput"),
+    "Search input should be focused when visiting preferences"
+  );
+
+  let query = "password";
+  let searchCompletedPromise = BrowserTestUtils.waitForEvent(
+    gBrowser.contentWindow,
+    "PreferencesSearchCompleted",
+    evt => evt.detail == query
+  );
+  EventUtils.sendString(query);
+  await searchCompletedPromise;
+
+  let categoriesList = gBrowser.contentDocument.getElementById("categories");
+
+  for (let i = 0; i < categoriesList.childElementCount; i++) {
+    let child = categoriesList.itemChildren[i];
+    is(child.selected, false, "No other panel should be selected");
+  }
+  // Takes search off
+  searchCompletedPromise = BrowserTestUtils.waitForEvent(
+    gBrowser.contentWindow,
+    "PreferencesSearchCompleted",
+    evt => evt.detail == ""
+  );
+  let count = query.length;
+  while (count--) {
+    EventUtils.sendKey("BACK_SPACE");
+  }
+  await searchCompletedPromise;
+
+  // Checks if back to generalPane
+  for (let i = 0; i < categoriesList.childElementCount; i++) {
+    let child = categoriesList.itemChildren[i];
+    if (child.id == "category-general") {
+      is(child.selected, true, "General panel should be selected");
+    } else if (child.id) {
+      is(child.selected, false, "No other panel should be selected");
+    }
+  }
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+/**
+ * Test for "password" case. When we search "password", it should show the "passwordGroup"
+ */
+add_task(async function search_for_password_show_passwordGroup() {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+
+  // Performs search
+  let searchInput = gBrowser.contentDocument.getElementById("searchInput");
+
+  is(
+    searchInput,
+    gBrowser.contentDocument.activeElement.closest("#searchInput"),
+    "Search input should be focused when visiting preferences"
+  );
+
+  let query = "password";
+  let searchCompletedPromise = BrowserTestUtils.waitForEvent(
+    gBrowser.contentWindow,
+    "PreferencesSearchCompleted",
+    evt => evt.detail == query
+  );
+  EventUtils.sendString(query);
+  await searchCompletedPromise;
+
+  let mainPrefTag = gBrowser.contentDocument.getElementById("mainPrefPane");
+
+  for (let i = 0; i < mainPrefTag.childElementCount; i++) {
+    let child = mainPrefTag.children[i];
+    if (
+      child.id == "passwordsGroup" ||
+      child.id == "weavePrefsDeck" ||
+      child.id == "header-searchResults" ||
+      child.id == "certSelection" ||
+      child.id == "connectionGroup" ||
+      child.id == "dataMigrationGroup"
+    ) {
+      is_element_visible(child, "Should be in search results");
+    } else if (child.id) {
+      is_element_hidden(child, "Should not be in search results");
+    }
+  }
+
+  // Takes search off
+  searchCompletedPromise = BrowserTestUtils.waitForEvent(
+    gBrowser.contentWindow,
+    "PreferencesSearchCompleted",
+    evt => evt.detail == ""
+  );
+  let count = query.length;
+  while (count--) {
+    EventUtils.sendKey("BACK_SPACE");
+  }
+  await searchCompletedPromise;
+
+  let expectedChildren = [
+    "paneGeneral",
+    "startupGroup",
+    "languagesGroup",
+    "webAppearanceGroup",
+    "colorsGroup",
+    "fontsGroup",
+    "zoomGroup",
+    "downloadsGroup",
+    "applicationsGroup",
+    "drmGroup",
+    "browsingGroup",
+    "performanceGroup",
+    "connectionGroup",
+    "generalCategory",
+    "languageAndAppearanceCategory",
+    "filesAndApplicationsCategory",
+    "performanceCategory",
+    "browsingCategory",
+    "networkProxyCategory",
+    "dataMigrationGroup",
+    "translationsGroup",
+  ];
+  // Only visible for non-MSIX builds
+  if (
+    AppConstants.platform !== "win" ||
+    !Services.sysinfo.getProperty("hasWinPackageId", false)
+  ) {
+    expectedChildren.push("updatesCategory");
+    expectedChildren.push("updateApp");
+  }
+  // Checks if back to generalPane
+  for (let i = 0; i < mainPrefTag.childElementCount; i++) {
+    let child = mainPrefTag.children[i];
+    if (expectedChildren.includes(child.id)) {
+      is_element_visible(child, `Should be in general tab: ${child.id}`);
+    } else if (child.id) {
+      is_element_hidden(child, `Should not be in general tab: ${child.id}`);
+    }
+  }
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+/**
+ * Test for if nothing is found
+ */
+add_task(async function search_with_nothing_found() {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+
+  let noResultsEl = gBrowser.contentDocument.querySelector(
+    "#no-results-message"
+  );
+  let sorryMsgQueryEl = gBrowser.contentDocument.getElementById(
+    "sorry-message-query"
+  );
+
+  is_element_hidden(noResultsEl, "Should not be in search results yet");
+
+  // Performs search
+  let searchInput = gBrowser.contentDocument.getElementById("searchInput");
+
+  is(
+    searchInput,
+    gBrowser.contentDocument.activeElement.closest("#searchInput"),
+    "Search input should be focused when visiting preferences"
+  );
+
+  let query = "coach";
+  let searchCompletedPromise = BrowserTestUtils.waitForEvent(
+    gBrowser.contentWindow,
+    "PreferencesSearchCompleted",
+    evt => evt.detail == query
+  );
+  EventUtils.sendString(query);
+  await searchCompletedPromise;
+
+  is_element_visible(noResultsEl, "Should be in search results");
+  is(
+    sorryMsgQueryEl.textContent,
+    query,
+    "sorry-message-query should contain the query"
+  );
+
+  // Takes search off
+  searchCompletedPromise = BrowserTestUtils.waitForEvent(
+    gBrowser.contentWindow,
+    "PreferencesSearchCompleted",
+    evt => evt.detail == ""
+  );
+  let count = query.length;
+  while (count--) {
+    EventUtils.sendKey("BACK_SPACE");
+  }
+  await searchCompletedPromise;
+
+  is_element_hidden(noResultsEl, "Should not be in search results");
+  is(
+    sorryMsgQueryEl.textContent.length,
+    0,
+    "sorry-message-query should be empty"
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+/**
+ * Test for if we go back to general tab after search case
+ */
+add_task(async function exiting_search_reverts_to_general_pane() {
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  let generalPane = gBrowser.contentDocument.getElementById("generalCategory");
+
+  is_element_hidden(generalPane, "Should not be in general");
+
+  // Performs search
+  let searchInput = gBrowser.contentDocument.getElementById("searchInput");
+
+  is(
+    searchInput,
+    gBrowser.contentDocument.activeElement.closest("#searchInput"),
+    "Search input should be focused when visiting preferences"
+  );
+
+  let query = "password";
+  let searchCompletedPromise = BrowserTestUtils.waitForEvent(
+    gBrowser.contentWindow,
+    "PreferencesSearchCompleted",
+    evt => evt.detail == query
+  );
+  EventUtils.sendString(query);
+  await searchCompletedPromise;
+
+  // Takes search off
+  searchCompletedPromise = BrowserTestUtils.waitForEvent(
+    gBrowser.contentWindow,
+    "PreferencesSearchCompleted",
+    evt => evt.detail == ""
+  );
+  let count = query.length;
+  while (count--) {
+    EventUtils.sendKey("BACK_SPACE");
+  }
+  await searchCompletedPromise;
+
+  // Checks if back to normal
+  is_element_visible(generalPane, "Should be in generalPane");
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+/**
+ * Test for if we go to another tab after searching
+ */
+add_task(async function changing_tabs_after_searching() {
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  let searchInput = gBrowser.contentDocument.getElementById("searchInput");
+
+  is(
+    searchInput,
+    gBrowser.contentDocument.activeElement.closest("#searchInput"),
+    "Search input should be focused when visiting preferences"
+  );
+
+  let query = "permission";
+  let searchCompletedPromise = BrowserTestUtils.waitForEvent(
+    gBrowser.contentWindow,
+    "PreferencesSearchCompleted",
+    evt => evt.detail == query
+  );
+  EventUtils.sendString(query);
+  await searchCompletedPromise;
+
+  // Search header should be shown for the permissions group
+  let permissionsSearchHeader = gBrowser.contentDocument.querySelector(
+    "#permissionsGroup .search-header"
+  );
+  is(
+    permissionsSearchHeader.hidden,
+    false,
+    "Permissions search-header should be visible"
+  );
+
+  let privacyCategory =
+    gBrowser.contentDocument.getElementById("category-privacy");
+  privacyCategory.click();
+  is(searchInput.value, "", "search input should be empty");
+  let categoriesList = gBrowser.contentDocument.getElementById("categories");
+  for (let i = 0; i < categoriesList.childElementCount; i++) {
+    let child = categoriesList.itemChildren[i];
+    if (child.id == "category-privacy") {
+      is(child.selected, true, "Privacy panel should be selected");
+    } else if (child.id) {
+      is(child.selected, false, "No other panel should be selected");
+    }
+  }
+
+  // Search header should now be hidden when viewing the permissions group not through a search
+  is(
+    permissionsSearchHeader.hidden,
+    true,
+    "Permissions search-header should be hidden"
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_search_within_preferences_2.js b/browser/components/preferences/tests/browser_search_within_preferences_2.js
new file mode 100644
index 0000000000..6de068fbe4
--- /dev/null
+++ b/browser/components/preferences/tests/browser_search_within_preferences_2.js
@@ -0,0 +1,180 @@
+"use strict";
+/**
+ * This file contains tests for the Preferences search bar.
+ */
+
+/**
+ * Enabling searching functionality. Will display search bar from this testcase forward.
+ */
+add_task(async function () {
+  await SpecialPowers.pushPrefEnv({
+    set: [["browser.preferences.search", true]],
+  });
+});
+
+/**
+ * Test that we only search the selected child of a XUL deck.
+ * When we search "Remove Account",
+ * it should not show the "Remove Account" button if the Firefox account is not logged in yet.
+ */
+add_task(async function () {
+  await openPreferencesViaOpenPreferencesAPI("paneSync", { leaveOpen: true });
+
+  let weavePrefsDeck =
+    gBrowser.contentDocument.getElementById("weavePrefsDeck");
+  is(
+    weavePrefsDeck.selectedIndex,
+    0,
+    "Should select the #noFxaAccount child node"
+  );
+
+  // Performs search.
+  let searchInput = gBrowser.contentDocument.getElementById("searchInput");
+
+  is(
+    searchInput,
+    gBrowser.contentDocument.activeElement.closest("#searchInput"),
+    "Search input should be focused when visiting preferences"
+  );
+
+  let query = "Sync";
+  let searchCompletedPromise = BrowserTestUtils.waitForEvent(
+    gBrowser.contentWindow,
+    "PreferencesSearchCompleted",
+    evt => evt.detail == query
+  );
+  EventUtils.sendString(query);
+  await searchCompletedPromise;
+
+  let mainPrefTag = gBrowser.contentDocument.getElementById("mainPrefPane");
+  for (let i = 0; i < mainPrefTag.childElementCount; i++) {
+    let child = mainPrefTag.children[i];
+    if (child.id == "header-searchResults" || child.id == "weavePrefsDeck") {
+      is_element_visible(child, "Should be in search results");
+    } else if (child.id) {
+      is_element_hidden(child, "Should not be in search results");
+    }
+  }
+
+  // Ensure the "Remove Account" button exists in the hidden child of the <xul:deck>.
+  let unlinkFxaAccount = weavePrefsDeck.children[1].querySelector(
+    "#unverifiedUnlinkFxaAccount"
+  );
+  is(
+    unlinkFxaAccount.label,
+    "Remove Account",
+    "The Remove Account button should exist"
+  );
+
+  // Performs search.
+  searchInput.focus();
+  query = "Remove Account";
+  searchCompletedPromise = BrowserTestUtils.waitForEvent(
+    gBrowser.contentWindow,
+    "PreferencesSearchCompleted",
+    evt => evt.detail == query
+  );
+  EventUtils.sendString(query);
+  await searchCompletedPromise;
+
+  let noResultsEl = gBrowser.contentDocument.querySelector(
+    "#no-results-message"
+  );
+  is_element_visible(noResultsEl, "Should be reporting no results");
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+/**
+ * Test that we search using `search-l10n-ids`.
+ *
+ * The test uses element `showUpdateHistory` and
+ * l10n id `language-and-appearance-header` and expects the element
+ * to be matched on the first word from the l10n id value ("Language" in en-US).
+ */
+add_task(async function () {
+  let l10nId = "language-and-appearance-header";
+
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+
+  // First, lets make sure that the element is not matched without
+  // `search-l10n-ids`.
+  {
+    let searchInput = gBrowser.contentDocument.getElementById("searchInput");
+    let suhElem = gBrowser.contentDocument.getElementById("showUpdateHistory");
+
+    is(
+      searchInput,
+      gBrowser.contentDocument.activeElement.closest("#searchInput"),
+      "Search input should be focused when visiting preferences"
+    );
+
+    ok(
+      !suhElem.getAttribute("search-l10n-ids").includes(l10nId),
+      "showUpdateHistory element should not contain the l10n id here."
+    );
+
+    let query = "Language";
+    let searchCompletedPromise = BrowserTestUtils.waitForEvent(
+      gBrowser.contentWindow,
+      "PreferencesSearchCompleted",
+      evt => evt.detail == query
+    );
+    EventUtils.sendString(query);
+    await searchCompletedPromise;
+
+    is_element_hidden(
+      suhElem,
+      "showUpdateHistory should not be in search results"
+    );
+  }
+
+  await BrowserTestUtils.removeTab(gBrowser.selectedTab);
+
+  // Now, let's add the l10n id to the element and perform the same search again.
+
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+
+  {
+    let searchInput = gBrowser.contentDocument.getElementById("searchInput");
+
+    is(
+      searchInput,
+      gBrowser.contentDocument.activeElement.closest("#searchInput"),
+      "Search input should be focused when visiting preferences"
+    );
+
+    let suhElem = gBrowser.contentDocument.getElementById("showUpdateHistory");
+    suhElem.setAttribute("search-l10n-ids", l10nId);
+
+    let query = "Language";
+    let searchCompletedPromise = BrowserTestUtils.waitForEvent(
+      gBrowser.contentWindow,
+      "PreferencesSearchCompleted",
+      evt => evt.detail == query
+    );
+    EventUtils.sendString(query);
+    await searchCompletedPromise;
+
+    if (
+      AppConstants.platform === "win" &&
+      Services.sysinfo.getProperty("hasWinPackageId")
+    ) {
+      is_element_hidden(
+        suhElem,
+        "showUpdateHistory should not be in search results"
+      );
+    } else {
+      is_element_visible(
+        suhElem,
+        "showUpdateHistory should be in search results"
+      );
+    }
+  }
+
+  await BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_search_within_preferences_command.js b/browser/components/preferences/tests/browser_search_within_preferences_command.js
new file mode 100644
index 0000000000..736493b418
--- /dev/null
+++ b/browser/components/preferences/tests/browser_search_within_preferences_command.js
@@ -0,0 +1,45 @@
+"use strict";
+
+/**
+ * Test for "command" event on search input (when user clicks the x button)
+ */
+add_task(async function () {
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  let generalPane = gBrowser.contentDocument.getElementById("generalCategory");
+
+  is_element_hidden(generalPane, "Should not be in general");
+
+  // Performs search
+  let searchInput = gBrowser.contentDocument.getElementById("searchInput");
+  is(
+    searchInput,
+    gBrowser.contentDocument.activeElement.closest("#searchInput"),
+    "Search input should be focused when visiting preferences"
+  );
+
+  let query = "x";
+  let searchCompletedPromise = BrowserTestUtils.waitForEvent(
+    gBrowser.contentWindow,
+    "PreferencesSearchCompleted",
+    evt => evt.detail == query
+  );
+  EventUtils.sendString(query);
+  await searchCompletedPromise;
+
+  is_element_hidden(generalPane, "Should not be in generalPane");
+
+  // Takes search off with "command"
+  searchCompletedPromise = BrowserTestUtils.waitForEvent(
+    gBrowser.contentWindow,
+    "PreferencesSearchCompleted",
+    evt => evt.detail == ""
+  );
+  searchInput.value = "";
+  searchInput.doCommand();
+  await searchCompletedPromise;
+
+  // Checks if back to normal
+  is_element_visible(generalPane, "Should be in generalPane");
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_searchsuggestions.js b/browser/components/preferences/tests/browser_searchsuggestions.js
new file mode 100644
index 0000000000..6aca310eb2
--- /dev/null
+++ b/browser/components/preferences/tests/browser_searchsuggestions.js
@@ -0,0 +1,231 @@
+const SUGGEST_PREF_NAME = "browser.search.suggest.enabled";
+const URLBAR_SUGGEST_PREF_NAME = "browser.urlbar.suggest.searches";
+const PRIVATE_PREF_NAME = "browser.search.suggest.enabled.private";
+const SEARCHBAR_PREF_NAME = "browser.search.widget.inNavBar";
+
+let initialUrlbarSuggestValue;
+let initialSuggestionsInPrivateValue;
+
+add_setup(async function () {
+  const originalSuggest = Services.prefs.getBoolPref(SUGGEST_PREF_NAME);
+  initialUrlbarSuggestValue = Services.prefs.getBoolPref(
+    URLBAR_SUGGEST_PREF_NAME
+  );
+  initialSuggestionsInPrivateValue =
+    Services.prefs.getBoolPref(PRIVATE_PREF_NAME);
+
+  registerCleanupFunction(() => {
+    Services.prefs.setBoolPref(SUGGEST_PREF_NAME, originalSuggest);
+    Services.prefs.setBoolPref(
+      PRIVATE_PREF_NAME,
+      initialSuggestionsInPrivateValue
+    );
+  });
+});
+
+async function toggleElement(
+  id,
+  prefName,
+  element,
+  initialCheckboxValue,
+  initialPrefValue,
+  descCheckbox,
+  descPref,
+  shouldUpdatePref = false
+) {
+  await BrowserTestUtils.synthesizeMouseAtCenter(
+    `#${id}`,
+    {},
+    gBrowser.selectedBrowser
+  );
+  is(
+    element.checked,
+    !initialCheckboxValue,
+    `Should have flipped the ${descCheckbox} checkbox`
+  );
+  let expectedPrefValue = shouldUpdatePref
+    ? !initialPrefValue
+    : initialPrefValue;
+  let prefValue = Services.prefs.getBoolPref(prefName);
+
+  is(
+    prefValue,
+    expectedPrefValue,
+    `Should ${
+      shouldUpdatePref ? "" : "not"
+    } have updated the ${descPref} preference value`
+  );
+
+  await BrowserTestUtils.synthesizeMouseAtCenter(
+    `#${id}`,
+    {},
+    gBrowser.selectedBrowser
+  );
+  is(
+    element.checked,
+    initialCheckboxValue,
+    `Should have flipped the ${descCheckbox} checkbox back to the original value`
+  );
+  prefValue = Services.prefs.getBoolPref(prefName);
+  expectedPrefValue = shouldUpdatePref ? !expectedPrefValue : initialPrefValue;
+  is(
+    prefValue,
+    expectedPrefValue,
+    `Should ${
+      shouldUpdatePref ? "" : "not"
+    } have updated the ${descPref} preference value`
+  );
+}
+
+// Open with suggestions enabled
+add_task(async function test_suggestions_start_enabled() {
+  Services.prefs.setBoolPref(SUGGEST_PREF_NAME, true);
+  Services.prefs.setBoolPref(SEARCHBAR_PREF_NAME, true);
+
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let urlbarBox = doc.getElementById("urlBarSuggestion");
+  let privateBox = doc.getElementById("showSearchSuggestionsPrivateWindows");
+  ok(!urlbarBox.disabled, "Should have enabled the urlbar checkbox");
+  ok(
+    !privateBox.disabled,
+    "Should have enabled the private mode suggestions checkbox"
+  );
+  is(
+    urlbarBox.checked,
+    initialUrlbarSuggestValue,
+    "Should have the correct value for the urlbar checkbox"
+  );
+  is(
+    privateBox.checked,
+    initialSuggestionsInPrivateValue,
+    "Should have the correct value for the private mode suggestions checkbox"
+  );
+
+  await toggleElement(
+    "urlBarSuggestion",
+    URLBAR_SUGGEST_PREF_NAME,
+    urlbarBox,
+    initialUrlbarSuggestValue,
+    initialUrlbarSuggestValue,
+    "urlbar",
+    "urlbar",
+    true
+  );
+
+  await toggleElement(
+    "showSearchSuggestionsPrivateWindows",
+    PRIVATE_PREF_NAME,
+    privateBox,
+    initialSuggestionsInPrivateValue,
+    initialSuggestionsInPrivateValue,
+    "private suggestion",
+    "private suggestion",
+    true
+  );
+
+  Services.prefs.setBoolPref(SUGGEST_PREF_NAME, false);
+  ok(!urlbarBox.checked, "Should have unchecked the urlbar box");
+  ok(urlbarBox.disabled, "Should have disabled the urlbar box");
+  Services.prefs.setBoolPref(SEARCHBAR_PREF_NAME, false);
+  ok(urlbarBox.hidden, "Should have hidden the urlbar box");
+  ok(!privateBox.checked, "Should have unchecked the private suggestions box");
+  ok(privateBox.disabled, "Should have disabled the private suggestions box");
+
+  gBrowser.removeCurrentTab();
+});
+
+// Open with suggestions disabled
+add_task(async function test_suggestions_start_disabled() {
+  Services.prefs.setBoolPref(SUGGEST_PREF_NAME, false);
+
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let urlbarBox = doc.getElementById("urlBarSuggestion");
+  ok(urlbarBox.disabled, "Should have the urlbar box disabled");
+  let privateBox = doc.getElementById("showSearchSuggestionsPrivateWindows");
+  ok(privateBox.disabled, "Should have the private suggestions box disabled");
+
+  Services.prefs.setBoolPref(SUGGEST_PREF_NAME, true);
+
+  ok(!urlbarBox.disabled, "Should have enabled the urlbar box");
+  ok(!privateBox.disabled, "Should have enabled the private suggestions box");
+
+  gBrowser.removeCurrentTab();
+});
+
+add_task(async function test_sync_search_suggestions_prefs() {
+  info("Adding the search bar to the toolbar");
+  Services.prefs.setBoolPref(SEARCHBAR_PREF_NAME, true);
+  Services.prefs.setBoolPref(SUGGEST_PREF_NAME, true);
+  Services.prefs.setBoolPref(URLBAR_SUGGEST_PREF_NAME, false);
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let suggestionsInSearchFieldsCheckbox = doc.getElementById(
+    "suggestionsInSearchFieldsCheckbox"
+  );
+
+  is(
+    suggestionsInSearchFieldsCheckbox.checked,
+    true,
+    "Should have the correct value for the search suggestions checkbox"
+  );
+
+  is(
+    Services.prefs.getBoolPref(SUGGEST_PREF_NAME),
+    true,
+    `${SUGGEST_PREF_NAME} should be enabled`
+  );
+  is(
+    Services.prefs.getBoolPref(URLBAR_SUGGEST_PREF_NAME),
+    false,
+    `${URLBAR_SUGGEST_PREF_NAME} should be disabled`
+  );
+
+  await toggleElement(
+    "suggestionsInSearchFieldsCheckbox",
+    URLBAR_SUGGEST_PREF_NAME,
+    suggestionsInSearchFieldsCheckbox,
+    suggestionsInSearchFieldsCheckbox.checked,
+    false,
+    "search suggestion",
+    "urlbar suggest"
+  );
+
+  info("Removing the search bar from the toolbar");
+  Services.prefs.setBoolPref(SEARCHBAR_PREF_NAME, false);
+
+  const suggestsPref = [true, false];
+  const urlbarSuggestsPref = [true, false];
+
+  for (let suggestState of suggestsPref) {
+    for (let urlbarSuggestsState of urlbarSuggestsPref) {
+      Services.prefs.setBoolPref(SUGGEST_PREF_NAME, suggestState);
+      Services.prefs.setBoolPref(URLBAR_SUGGEST_PREF_NAME, urlbarSuggestsState);
+
+      if (suggestState && urlbarSuggestsState) {
+        ok(
+          suggestionsInSearchFieldsCheckbox.checked,
+          "Should have checked the suggestions checkbox"
+        );
+      } else {
+        ok(
+          !suggestionsInSearchFieldsCheckbox.checked,
+          "Should have unchecked the suggestions checkbox"
+        );
+      }
+      ok(
+        !suggestionsInSearchFieldsCheckbox.disabled,
+        "Should have the suggestions checkbox enabled"
+      );
+    }
+  }
+
+  gBrowser.removeCurrentTab();
+  Services.prefs.clearUserPref(SEARCHBAR_PREF_NAME);
+  Services.prefs.clearUserPref(URLBAR_SUGGEST_PREF_NAME);
+  Services.prefs.clearUserPref(SUGGEST_PREF_NAME);
+});
diff --git a/browser/components/preferences/tests/browser_security-1.js b/browser/components/preferences/tests/browser_security-1.js
new file mode 100644
index 0000000000..80f3e6902b
--- /dev/null
+++ b/browser/components/preferences/tests/browser_security-1.js
@@ -0,0 +1,106 @@
+const PREFS = [
+  "browser.safebrowsing.phishing.enabled",
+  "browser.safebrowsing.malware.enabled",
+
+  "browser.safebrowsing.downloads.enabled",
+
+  "browser.safebrowsing.downloads.remote.block_potentially_unwanted",
+  "browser.safebrowsing.downloads.remote.block_uncommon",
+];
+
+let originals = PREFS.map(pref => [pref, Services.prefs.getBoolPref(pref)]);
+let originalMalwareTable = Services.prefs.getCharPref(
+  "urlclassifier.malwareTable"
+);
+registerCleanupFunction(function () {
+  originals.forEach(([pref, val]) => Services.prefs.setBoolPref(pref, val));
+  Services.prefs.setCharPref(
+    "urlclassifier.malwareTable",
+    originalMalwareTable
+  );
+});
+
+// This test only opens the Preferences once, and then reloads the page
+// each time that it wants to test various preference combinations. We
+// only use one tab (instead of opening/closing for each test) for all
+// to help improve test times on debug builds.
+add_setup(async function () {
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  registerCleanupFunction(async function () {
+    BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  });
+});
+
+// test the safebrowsing preference
+add_task(async function () {
+  async function checkPrefSwitch(val1, val2) {
+    Services.prefs.setBoolPref("browser.safebrowsing.phishing.enabled", val1);
+    Services.prefs.setBoolPref("browser.safebrowsing.malware.enabled", val2);
+
+    gBrowser.reload();
+    await BrowserTestUtils.browserLoaded(gBrowser.selectedBrowser);
+
+    let doc = gBrowser.selectedBrowser.contentDocument;
+    let checkbox = doc.getElementById("enableSafeBrowsing");
+    let blockDownloads = doc.getElementById("blockDownloads");
+    let blockUncommon = doc.getElementById("blockUncommonUnwanted");
+    let checked = checkbox.checked;
+    is(
+      blockDownloads.hasAttribute("disabled"),
+      !checked,
+      "block downloads checkbox is set correctly"
+    );
+
+    is(
+      checked,
+      val1 && val2,
+      "safebrowsing preference is initialized correctly"
+    );
+    // should be disabled when checked is false (= pref is turned off)
+    is(
+      blockUncommon.hasAttribute("disabled"),
+      !checked,
+      "block uncommon checkbox is set correctly"
+    );
+
+    // scroll the checkbox into the viewport and click checkbox
+    checkbox.scrollIntoView();
+    EventUtils.synthesizeMouseAtCenter(
+      checkbox,
+      {},
+      gBrowser.selectedBrowser.contentWindow
+    );
+
+    // check that both settings are now turned on or off
+    is(
+      Services.prefs.getBoolPref("browser.safebrowsing.phishing.enabled"),
+      !checked,
+      "safebrowsing.enabled is set correctly"
+    );
+    is(
+      Services.prefs.getBoolPref("browser.safebrowsing.malware.enabled"),
+      !checked,
+      "safebrowsing.malware.enabled is set correctly"
+    );
+
+    // check if the other checkboxes have updated
+    checked = checkbox.checked;
+    if (blockDownloads) {
+      is(
+        blockDownloads.hasAttribute("disabled"),
+        !checked,
+        "block downloads checkbox is set correctly"
+      );
+      is(
+        blockUncommon.hasAttribute("disabled"),
+        !checked || !blockDownloads.checked,
+        "block uncommon checkbox is set correctly"
+      );
+    }
+  }
+
+  await checkPrefSwitch(true, true);
+  await checkPrefSwitch(false, true);
+  await checkPrefSwitch(true, false);
+  await checkPrefSwitch(false, false);
+});
diff --git a/browser/components/preferences/tests/browser_security-2.js b/browser/components/preferences/tests/browser_security-2.js
new file mode 100644
index 0000000000..88be366810
--- /dev/null
+++ b/browser/components/preferences/tests/browser_security-2.js
@@ -0,0 +1,177 @@
+const PREFS = [
+  "browser.safebrowsing.phishing.enabled",
+  "browser.safebrowsing.malware.enabled",
+
+  "browser.safebrowsing.downloads.enabled",
+
+  "browser.safebrowsing.downloads.remote.block_potentially_unwanted",
+  "browser.safebrowsing.downloads.remote.block_uncommon",
+];
+
+let originals = PREFS.map(pref => [pref, Services.prefs.getBoolPref(pref)]);
+let originalMalwareTable = Services.prefs.getCharPref(
+  "urlclassifier.malwareTable"
+);
+registerCleanupFunction(function () {
+  originals.forEach(([pref, val]) => Services.prefs.setBoolPref(pref, val));
+  Services.prefs.setCharPref(
+    "urlclassifier.malwareTable",
+    originalMalwareTable
+  );
+});
+
+// This test only opens the Preferences once, and then reloads the page
+// each time that it wants to test various preference combinations. We
+// only use one tab (instead of opening/closing for each test) for all
+// to help improve test times on debug builds.
+add_setup(async function () {
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  registerCleanupFunction(async function () {
+    BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  });
+});
+
+// test the download protection preference
+add_task(async function () {
+  async function checkPrefSwitch(val) {
+    Services.prefs.setBoolPref("browser.safebrowsing.downloads.enabled", val);
+
+    gBrowser.reload();
+    await BrowserTestUtils.browserLoaded(gBrowser.selectedBrowser);
+
+    let doc = gBrowser.selectedBrowser.contentDocument;
+    let checkbox = doc.getElementById("blockDownloads");
+
+    let blockUncommon = doc.getElementById("blockUncommonUnwanted");
+    let checked = checkbox.checked;
+    is(checked, val, "downloads preference is initialized correctly");
+    // should be disabled when val is false (= pref is turned off)
+    is(
+      blockUncommon.hasAttribute("disabled"),
+      !val,
+      "block uncommon checkbox is set correctly"
+    );
+
+    // scroll the checkbox into view, otherwise the synthesizeMouseAtCenter will be ignored, and click it
+    checkbox.scrollIntoView();
+    EventUtils.synthesizeMouseAtCenter(
+      checkbox,
+      {},
+      gBrowser.selectedBrowser.contentWindow
+    );
+
+    // check that setting is now turned on or off
+    is(
+      Services.prefs.getBoolPref("browser.safebrowsing.downloads.enabled"),
+      !checked,
+      "safebrowsing.downloads preference is set correctly"
+    );
+
+    // check if the uncommon warning checkbox has updated
+    is(
+      blockUncommon.hasAttribute("disabled"),
+      val,
+      "block uncommon checkbox is set correctly"
+    );
+  }
+
+  await checkPrefSwitch(true);
+  await checkPrefSwitch(false);
+});
+
+requestLongerTimeout(2);
+// test the unwanted/uncommon software warning preference
+add_task(async function () {
+  async function checkPrefSwitch(val1, val2, isV2) {
+    Services.prefs.setBoolPref(
+      "browser.safebrowsing.downloads.remote.block_potentially_unwanted",
+      val1
+    );
+    Services.prefs.setBoolPref(
+      "browser.safebrowsing.downloads.remote.block_uncommon",
+      val2
+    );
+    let testMalwareTable = "goog-malware-" + (isV2 ? "shavar" : "proto");
+    testMalwareTable += ",test-malware-simple";
+    if (val1 && val2) {
+      testMalwareTable += ",goog-unwanted-" + (isV2 ? "shavar" : "proto");
+      testMalwareTable += ",moztest-unwanted-simple";
+    }
+    Services.prefs.setCharPref("urlclassifier.malwareTable", testMalwareTable);
+
+    gBrowser.reload();
+    await BrowserTestUtils.browserLoaded(gBrowser.selectedBrowser);
+
+    let doc = gBrowser.selectedBrowser.contentDocument;
+    let checkbox = doc.getElementById("blockUncommonUnwanted");
+    let checked = checkbox.checked;
+    is(
+      checked,
+      val1 && val2,
+      "unwanted/uncommon preference is initialized correctly"
+    );
+
+    // scroll the checkbox into view, otherwise the synthesizeMouseAtCenter will be ignored, and click it
+    checkbox.scrollIntoView();
+    EventUtils.synthesizeMouseAtCenter(
+      checkbox,
+      {},
+      gBrowser.selectedBrowser.contentWindow
+    );
+
+    // check that both settings are now turned on or off
+    is(
+      Services.prefs.getBoolPref(
+        "browser.safebrowsing.downloads.remote.block_potentially_unwanted"
+      ),
+      !checked,
+      "block_potentially_unwanted is set correctly"
+    );
+    is(
+      Services.prefs.getBoolPref(
+        "browser.safebrowsing.downloads.remote.block_uncommon"
+      ),
+      !checked,
+      "block_uncommon is set correctly"
+    );
+
+    // when the preference is on, the malware table should include these ids
+    let malwareTable = Services.prefs
+      .getCharPref("urlclassifier.malwareTable")
+      .split(",");
+    if (isV2) {
+      is(
+        malwareTable.includes("goog-unwanted-shavar"),
+        !checked,
+        "malware table doesn't include goog-unwanted-shavar"
+      );
+    } else {
+      is(
+        malwareTable.includes("goog-unwanted-proto"),
+        !checked,
+        "malware table doesn't include goog-unwanted-proto"
+      );
+    }
+    is(
+      malwareTable.includes("moztest-unwanted-simple"),
+      !checked,
+      "malware table doesn't include moztest-unwanted-simple"
+    );
+    let sortedMalware = malwareTable.slice(0);
+    sortedMalware.sort();
+    Assert.deepEqual(
+      malwareTable,
+      sortedMalware,
+      "malware table has been sorted"
+    );
+  }
+
+  await checkPrefSwitch(true, true, false);
+  await checkPrefSwitch(false, true, false);
+  await checkPrefSwitch(true, false, false);
+  await checkPrefSwitch(false, false, false);
+  await checkPrefSwitch(true, true, true);
+  await checkPrefSwitch(false, true, true);
+  await checkPrefSwitch(true, false, true);
+  await checkPrefSwitch(false, false, true);
+});
diff --git a/browser/components/preferences/tests/browser_security-3.js b/browser/components/preferences/tests/browser_security-3.js
new file mode 100644
index 0000000000..75872d6629
--- /dev/null
+++ b/browser/components/preferences/tests/browser_security-3.js
@@ -0,0 +1,130 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+add_setup(async function () {
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  registerCleanupFunction(async function () {
+    Services.prefs.unlockPref("browser.safebrowsing.phishing.enabled");
+    Services.prefs.unlockPref("browser.safebrowsing.malware.enabled");
+    Services.prefs.unlockPref("browser.safebrowsing.downloads.enabled");
+    Services.prefs.unlockPref(
+      "browser.safebrowsing.downloads.remote.block_potentially_unwanted"
+    );
+    Services.prefs.unlockPref(
+      "browser.safebrowsing.downloads.remote.block_uncommon"
+    );
+    BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  });
+});
+
+// This test just reloads the preferences page for the various tests.
+add_task(async function () {
+  Services.prefs.lockPref("browser.safebrowsing.phishing.enabled");
+  Services.prefs.lockPref("browser.safebrowsing.malware.enabled");
+  Services.prefs.lockPref("browser.safebrowsing.downloads.enabled");
+  Services.prefs.lockPref(
+    "browser.safebrowsing.downloads.remote.block_potentially_unwanted"
+  );
+  Services.prefs.lockPref(
+    "browser.safebrowsing.downloads.remote.block_uncommon"
+  );
+
+  gBrowser.reload();
+  await BrowserTestUtils.browserLoaded(gBrowser.selectedBrowser);
+
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  is(
+    doc.getElementById("enableSafeBrowsing").disabled,
+    true,
+    "Safe browsing should be disabled"
+  );
+  is(
+    doc.getElementById("blockDownloads").disabled,
+    true,
+    "Block downloads should be disabled"
+  );
+  is(
+    doc.getElementById("blockUncommonUnwanted").disabled,
+    true,
+    "Block common unwanted should be disabled"
+  );
+
+  Services.prefs.unlockPref("browser.safebrowsing.phishing.enabled");
+  Services.prefs.unlockPref("browser.safebrowsing.malware.enabled");
+
+  gBrowser.reload();
+  await BrowserTestUtils.browserLoaded(gBrowser.selectedBrowser);
+
+  doc = gBrowser.selectedBrowser.contentDocument;
+
+  let checkbox = doc.getElementById("enableSafeBrowsing");
+  checkbox.scrollIntoView();
+  EventUtils.synthesizeMouseAtCenter(
+    checkbox,
+    {},
+    gBrowser.selectedBrowser.contentWindow
+  );
+
+  is(
+    doc.getElementById("blockDownloads").disabled,
+    true,
+    "Block downloads should be disabled"
+  );
+  is(
+    doc.getElementById("blockUncommonUnwanted").disabled,
+    true,
+    "Block common unwanted should be disabled"
+  );
+
+  EventUtils.synthesizeMouseAtCenter(
+    checkbox,
+    {},
+    gBrowser.selectedBrowser.contentWindow
+  );
+
+  is(
+    doc.getElementById("blockDownloads").disabled,
+    true,
+    "Block downloads should be disabled"
+  );
+  is(
+    doc.getElementById("blockUncommonUnwanted").disabled,
+    true,
+    "Block common unwanted should be disabled"
+  );
+
+  Services.prefs.unlockPref("browser.safebrowsing.downloads.enabled");
+
+  gBrowser.reload();
+  await BrowserTestUtils.browserLoaded(gBrowser.selectedBrowser);
+
+  doc = gBrowser.selectedBrowser.contentDocument;
+
+  checkbox = doc.getElementById("blockDownloads");
+  checkbox.scrollIntoView();
+  EventUtils.synthesizeMouseAtCenter(
+    checkbox,
+    {},
+    gBrowser.selectedBrowser.contentWindow
+  );
+
+  is(
+    doc.getElementById("blockUncommonUnwanted").disabled,
+    true,
+    "Block common unwanted should be disabled"
+  );
+
+  EventUtils.synthesizeMouseAtCenter(
+    checkbox,
+    {},
+    gBrowser.selectedBrowser.contentWindow
+  );
+
+  is(
+    doc.getElementById("blockUncommonUnwanted").disabled,
+    true,
+    "Block common unwanted should be disabled"
+  );
+});
diff --git a/browser/components/preferences/tests/browser_site_login_exceptions.js b/browser/components/preferences/tests/browser_site_login_exceptions.js
new file mode 100644
index 0000000000..508232b234
--- /dev/null
+++ b/browser/components/preferences/tests/browser_site_login_exceptions.js
@@ -0,0 +1,101 @@
+"use strict";
+const PERMISSIONS_URL =
+  "chrome://browser/content/preferences/dialogs/permissions.xhtml";
+
+var exceptionsDialog;
+
+add_task(async function openLoginExceptionsSubDialog() {
+  // ensure rememberSignons is off for this test;
+  ok(
+    !Services.prefs.getBoolPref("signon.rememberSignons"),
+    "Check initial value of signon.rememberSignons pref"
+  );
+
+  // Undo the save password change.
+  registerCleanupFunction(async function () {
+    await SpecialPowers.spawn(gBrowser.selectedBrowser, [], function () {
+      let doc = content.document;
+      let savePasswordCheckBox = doc.getElementById("savePasswords");
+      if (savePasswordCheckBox.checked) {
+        savePasswordCheckBox.click();
+      }
+    });
+
+    gBrowser.removeCurrentTab();
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+
+  let dialogOpened = promiseLoadSubDialog(PERMISSIONS_URL);
+
+  await SpecialPowers.spawn(gBrowser.selectedBrowser, [], function () {
+    let doc = content.document;
+    let savePasswordCheckBox = doc.getElementById("savePasswords");
+    Assert.ok(
+      !savePasswordCheckBox.checked,
+      "Save Password CheckBox should be unchecked by default"
+    );
+    savePasswordCheckBox.click();
+
+    let loginExceptionsButton = doc.getElementById("passwordExceptions");
+    loginExceptionsButton.click();
+  });
+
+  exceptionsDialog = await dialogOpened;
+});
+
+add_task(async function addALoginException() {
+  let doc = exceptionsDialog.document;
+
+  let richlistbox = doc.getElementById("permissionsBox");
+  Assert.equal(richlistbox.itemCount, 0, "Row count should initially be 0");
+
+  let inputBox = doc.getElementById("url");
+  inputBox.focus();
+
+  EventUtils.sendString("www.example.com", exceptionsDialog);
+
+  let btnBlock = doc.getElementById("btnBlock");
+  btnBlock.click();
+
+  await TestUtils.waitForCondition(() => richlistbox.itemCount == 2);
+
+  let expectedResult = ["http://www.example.com", "https://www.example.com"];
+  for (let website of expectedResult) {
+    let elements = richlistbox.getElementsByAttribute("origin", website);
+    is(elements.length, 1, "It should find only one coincidence");
+  }
+});
+
+add_task(async function deleteALoginException() {
+  let doc = exceptionsDialog.document;
+
+  let richlistbox = doc.getElementById("permissionsBox");
+  let currentItems = 2;
+  Assert.equal(
+    richlistbox.itemCount,
+    currentItems,
+    `Row count should initially be ${currentItems}`
+  );
+  richlistbox.focus();
+
+  while (richlistbox.itemCount) {
+    richlistbox.selectedIndex = 0;
+
+    if (AppConstants.platform == "macosx") {
+      EventUtils.synthesizeKey("KEY_Backspace");
+    } else {
+      EventUtils.synthesizeKey("KEY_Delete");
+    }
+
+    currentItems -= 1;
+
+    await TestUtils.waitForCondition(
+      () => richlistbox.itemCount == currentItems
+    );
+    is_element_visible(
+      content.gSubDialog._dialogs[0]._box,
+      "Subdialog is visible after deleting an element"
+    );
+  }
+});
diff --git a/browser/components/preferences/tests/browser_site_login_exceptions_policy.js b/browser/components/preferences/tests/browser_site_login_exceptions_policy.js
new file mode 100644
index 0000000000..10f5039c6f
--- /dev/null
+++ b/browser/components/preferences/tests/browser_site_login_exceptions_policy.js
@@ -0,0 +1,65 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+const { EnterprisePolicyTesting } = ChromeUtils.importESModule(
+  "resource://testing-common/EnterprisePolicyTesting.sys.mjs"
+);
+
+const PERMISSIONS_URL =
+  "chrome://browser/content/preferences/dialogs/permissions.xhtml";
+
+var exceptionsDialog;
+
+add_task(async function openLoginExceptionsSubDialog() {
+  // ensure rememberSignons is off for this test;
+  ok(
+    !Services.prefs.getBoolPref("signon.rememberSignons"),
+    "Check initial value of signon.rememberSignons pref"
+  );
+
+  // Undo the save password change.
+  registerCleanupFunction(async function () {
+    await SpecialPowers.spawn(gBrowser.selectedBrowser, [], function () {
+      let doc = content.document;
+      let savePasswordCheckBox = doc.getElementById("savePasswords");
+      if (savePasswordCheckBox.checked) {
+        savePasswordCheckBox.click();
+      }
+    });
+
+    gBrowser.removeCurrentTab();
+    await EnterprisePolicyTesting.setupPolicyEngineWithJson("");
+  });
+
+  await EnterprisePolicyTesting.setupPolicyEngineWithJson({
+    policies: {
+      PasswordManagerExceptions: ["https://pwexception.example.com"],
+    },
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+
+  let dialogOpened = promiseLoadSubDialog(PERMISSIONS_URL);
+
+  await SpecialPowers.spawn(gBrowser.selectedBrowser, [], function () {
+    let doc = content.document;
+    let savePasswordCheckBox = doc.getElementById("savePasswords");
+    savePasswordCheckBox.click();
+
+    let loginExceptionsButton = doc.getElementById("passwordExceptions");
+    loginExceptionsButton.click();
+  });
+
+  exceptionsDialog = await dialogOpened;
+
+  let doc = exceptionsDialog.document;
+
+  let richlistbox = doc.getElementById("permissionsBox");
+  Assert.equal(richlistbox.itemCount, 1, `Row count should initially be 1`);
+
+  richlistbox.focus();
+  richlistbox.selectedIndex = 0;
+  Assert.ok(doc.getElementById("removePermission").disabled);
+});
diff --git a/browser/components/preferences/tests/browser_spotlight.js b/browser/components/preferences/tests/browser_spotlight.js
new file mode 100644
index 0000000000..4a1aae7ec1
--- /dev/null
+++ b/browser/components/preferences/tests/browser_spotlight.js
@@ -0,0 +1,72 @@
+add_task(async function test_openPreferences_spotlight() {
+  for (let [arg, expectedPane, expectedHash, expectedSubcategory] of [
+    ["privacy-reports", "panePrivacy", "#privacy", "reports"],
+    ["privacy-address-autofill", "panePrivacy", "#privacy", "address-autofill"],
+    [
+      "privacy-credit-card-autofill",
+      "panePrivacy",
+      "#privacy",
+      "credit-card-autofill",
+    ],
+    ["privacy-form-autofill", "panePrivacy", "#privacy", "form-autofill"],
+    ["privacy-logins", "panePrivacy", "#privacy", "logins"],
+    [
+      "privacy-trackingprotection",
+      "panePrivacy",
+      "#privacy",
+      "trackingprotection",
+    ],
+    [
+      "privacy-permissions-block-popups",
+      "panePrivacy",
+      "#privacy",
+      "permissions-block-popups",
+    ],
+  ]) {
+    if (
+      arg == "privacy-credit-card-autofill" &&
+      Services.prefs.getCharPref(
+        "extensions.formautofill.creditCards.supported"
+      ) == "off"
+    ) {
+      continue;
+    }
+    if (
+      arg == "privacy-address-autofill" &&
+      Services.prefs.getCharPref(
+        "extensions.formautofill.addresses.supported"
+      ) == "off"
+    ) {
+      continue;
+    }
+
+    let prefs = await openPreferencesViaOpenPreferencesAPI(arg, {
+      leaveOpen: true,
+    });
+    is(prefs.selectedPane, expectedPane, "The right pane is selected");
+    let doc = gBrowser.contentDocument;
+    is(
+      doc.location.hash,
+      expectedHash,
+      "The subcategory should be removed from the URI"
+    );
+    await TestUtils.waitForCondition(
+      () => doc.querySelector(".spotlight"),
+      "Wait for the spotlight"
+    );
+    is(
+      doc.querySelector(".spotlight").getAttribute("data-subcategory"),
+      expectedSubcategory,
+      "The right subcategory is spotlighted"
+    );
+
+    doc.defaultView.spotlight(null);
+    is(
+      doc.querySelector(".spotlight"),
+      null,
+      "The spotlighted section is cleared"
+    );
+
+    BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  }
+});
diff --git a/browser/components/preferences/tests/browser_statePartitioning_PBM_strings.js b/browser/components/preferences/tests/browser_statePartitioning_PBM_strings.js
new file mode 100644
index 0000000000..d941333f8f
--- /dev/null
+++ b/browser/components/preferences/tests/browser_statePartitioning_PBM_strings.js
@@ -0,0 +1,124 @@
+"use strict";
+
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+const COOKIE_BEHAVIOR_PREF = "network.cookie.cookieBehavior";
+const COOKIE_BEHAVIOR_PBM_PREF = "network.cookie.cookieBehavior.pbmode";
+
+const CB_STRICT_FEATURES_PREF = "browser.contentblocking.features.strict";
+const FPI_PREF = "privacy.firstparty.isolate";
+
+async function testCookieBlockingInfoStandard(
+  cookieBehavior,
+  cookieBehaviorPBM,
+  isShown
+) {
+  let defaults = Services.prefs.getDefaultBranch("");
+  defaults.setIntPref(COOKIE_BEHAVIOR_PREF, cookieBehavior);
+  defaults.setIntPref(COOKIE_BEHAVIOR_PBM_PREF, cookieBehaviorPBM);
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+
+  let doc = gBrowser.contentDocument;
+
+  // Select standard mode.
+  let standardRadioOption = doc.getElementById("standardRadio");
+  standardRadioOption.click();
+
+  // Check the cookie blocking info for private windows for standard mode.
+  let elts = doc.querySelectorAll(
+    "#contentBlockingOptionStandard .extra-information-label.all-third-party-cookies-private-windows-option"
+  );
+  for (let elt of elts) {
+    is(
+      elt.hidden,
+      !isShown,
+      `The visibility of cookie blocking info for standard mode is correct`
+    );
+  }
+
+  gBrowser.removeCurrentTab();
+}
+
+async function testCookieBlockingInfoStrict(
+  contentBlockingStrictFeatures,
+  isShown
+) {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      [CB_STRICT_FEATURES_PREF, contentBlockingStrictFeatures],
+      [FPI_PREF, false],
+    ],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+
+  let doc = gBrowser.contentDocument;
+
+  // Select strict mode.
+  let strictRadioOption = doc.getElementById("strictRadio");
+  strictRadioOption.click();
+
+  // Check the cookie blocking info for private windows for strict mode.
+  let elts = doc.querySelectorAll(
+    "#contentBlockingOptionStrict .extra-information-label.all-third-party-cookies-private-windows-option"
+  );
+  for (let elt of elts) {
+    is(
+      elt.hidden,
+      !isShown,
+      `The cookie blocking info is hidden for strict mode`
+    );
+  }
+
+  gBrowser.removeCurrentTab();
+}
+
+add_task(async function runTests() {
+  await SpecialPowers.pushPrefEnv({
+    set: [[FPI_PREF, false]],
+  });
+
+  let defaults = Services.prefs.getDefaultBranch("");
+  let originalCookieBehavior = defaults.getIntPref(COOKIE_BEHAVIOR_PREF);
+  let originalCookieBehaviorPBM = defaults.getIntPref(COOKIE_BEHAVIOR_PBM_PREF);
+
+  // Test if the cookie blocking info for state partitioning in PBM is
+  // shown in standard mode if the regular cookieBehavior is
+  // BEHAVIOR_REJECT_TRACKER and the private cookieBehavior is
+  // BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN
+  await testCookieBlockingInfoStandard(
+    Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER,
+    Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN,
+    true
+  );
+
+  // Test if the cookie blocking info is hidden in standard mode if both
+  // cookieBehaviors are the same.
+  await testCookieBlockingInfoStandard(
+    Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN,
+    Ci.nsICookieService.BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN,
+    false
+  );
+
+  // Test if the cookie blocking info is hidden for strict mode if
+  // cookieBehaviors both are BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN in
+  // the strict feature value.
+  await testCookieBlockingInfoStrict(
+    "tp,tpPrivate,cookieBehavior5,cookieBehaviorPBM5,cm,fp,stp,emailTP,emailTPPrivate,lvl2,rp,rpTop,ocsp,fpp,fppPrivate",
+    false
+  );
+
+  // Test if the cookie blocking info is shown for strict mode if the regular
+  // cookieBehavior is BEHAVIOR_REJECT_TRACKER and the private cookieBehavior is
+  // BEHAVIOR_REJECT_TRACKER_AND_PARTITION_FOREIGN
+  await testCookieBlockingInfoStrict(
+    "tp,tpPrivate,cookieBehavior4,cookieBehaviorPBM5,cm,fp,stp,emailTP,emailTPPrivate,lvl2,rp,rpTop,ocsp,fpp,fppPrivate",
+    true
+  );
+
+  defaults.setIntPref(COOKIE_BEHAVIOR_PREF, originalCookieBehavior);
+  defaults.setIntPref(COOKIE_BEHAVIOR_PBM_PREF, originalCookieBehaviorPBM);
+  await SpecialPowers.popPrefEnv();
+});
diff --git a/browser/components/preferences/tests/browser_statePartitioning_strings.js b/browser/components/preferences/tests/browser_statePartitioning_strings.js
new file mode 100644
index 0000000000..aed7e26977
--- /dev/null
+++ b/browser/components/preferences/tests/browser_statePartitioning_strings.js
@@ -0,0 +1,79 @@
+"use strict";
+
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+const CB_STRICT_FEATURES_PREF = "browser.contentblocking.features.strict";
+const CB_STRICT_FEATURES_VALUE = "tp,tpPrivate,cookieBehavior5,cm,fp,stp,lvl2";
+const FPI_PREF = "privacy.firstparty.isolate";
+const COOKIE_BEHAVIOR_PREF = "network.cookie.cookieBehavior";
+const COOKIE_BEHAVIOR_VALUE = 5;
+
+async function testStrings() {
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+
+  let doc = gBrowser.contentDocument;
+
+  // Check the cookie blocking info strings
+  let elts = doc.querySelectorAll(
+    ".extra-information-label.cross-site-cookies-option"
+  );
+  for (let elt of elts) {
+    ok(!elt.hidden, "The new cross-site cookies info label is visible");
+  }
+
+  // Check the learn more strings
+  elts = doc.querySelectorAll(
+    ".tail-with-learn-more.content-blocking-warning-description"
+  );
+  for (let elt of elts) {
+    let id = doc.l10n.getAttributes(elt).id;
+    is(
+      id,
+      "content-blocking-and-isolating-etp-warning-description-2",
+      "The correct warning description string is in use"
+    );
+  }
+
+  // Check the cookie blocking mode menu option string
+  let elt = doc.querySelector("#isolateCookiesSocialMedia");
+  let id = doc.l10n.getAttributes(elt).id;
+  is(
+    id,
+    "sitedata-option-block-cross-site-cookies",
+    "The correct string is in use for the cookie blocking option"
+  );
+
+  // Check the FPI warning is hidden with FPI off
+  let warningElt = doc.getElementById("fpiIncompatibilityWarning");
+  is(warningElt.hidden, true, "The FPI warning is hidden");
+
+  gBrowser.removeCurrentTab();
+
+  // Check the FPI warning is shown only if MVP UI is enabled when FPI is on
+  await SpecialPowers.pushPrefEnv({ set: [[FPI_PREF, true]] });
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  doc = gBrowser.contentDocument;
+  warningElt = doc.getElementById("fpiIncompatibilityWarning");
+  ok(!warningElt.hidden, `The FPI warning is visible`);
+  await SpecialPowers.popPrefEnv();
+
+  gBrowser.removeCurrentTab();
+}
+
+add_task(async function runTests() {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      [CB_STRICT_FEATURES_PREF, CB_STRICT_FEATURES_VALUE],
+      [FPI_PREF, false],
+    ],
+  });
+  let defaults = Services.prefs.getDefaultBranch("");
+  let originalCookieBehavior = defaults.getIntPref(COOKIE_BEHAVIOR_PREF);
+  defaults.setIntPref(COOKIE_BEHAVIOR_PREF, COOKIE_BEHAVIOR_VALUE);
+  registerCleanupFunction(() => {
+    defaults.setIntPref(COOKIE_BEHAVIOR_PREF, originalCookieBehavior);
+  });
+
+  await testStrings();
+});
diff --git a/browser/components/preferences/tests/browser_subdialogs.js b/browser/components/preferences/tests/browser_subdialogs.js
new file mode 100644
index 0000000000..8763ae9146
--- /dev/null
+++ b/browser/components/preferences/tests/browser_subdialogs.js
@@ -0,0 +1,659 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+/**
+ * Tests for the sub-dialog infrastructure, not for actual sub-dialog functionality.
+ */
+
+const gDialogURL = getRootDirectory(gTestPath) + "subdialog.xhtml";
+const gDialogURL2 = getRootDirectory(gTestPath) + "subdialog2.xhtml";
+
+function open_subdialog_and_test_generic_start_state(
+  browser,
+  domcontentloadedFn,
+  url = gDialogURL
+) {
+  let domcontentloadedFnStr = domcontentloadedFn
+    ? "(" + domcontentloadedFn.toString() + ")()"
+    : "";
+  return SpecialPowers.spawn(
+    browser,
+    [{ url, domcontentloadedFnStr }],
+    async function (args) {
+      let rv = { acceptCount: 0 };
+      let win = content.window;
+      content.gSubDialog.open(args.url, undefined, rv);
+      let subdialog = content.gSubDialog._topDialog;
+
+      info("waiting for subdialog DOMFrameContentLoaded");
+      let dialogOpenPromise;
+      await new Promise(resolve => {
+        win.addEventListener(
+          "DOMFrameContentLoaded",
+          function frameContentLoaded(ev) {
+            // We can get events for loads in other frames, so we have to filter
+            // those out.
+            if (ev.target != subdialog._frame) {
+              return;
+            }
+            win.removeEventListener(
+              "DOMFrameContentLoaded",
+              frameContentLoaded
+            );
+            dialogOpenPromise = ContentTaskUtils.waitForEvent(
+              subdialog._overlay,
+              "dialogopen"
+            );
+            resolve();
+          },
+          { capture: true }
+        );
+      });
+      let result;
+      if (args.domcontentloadedFnStr) {
+        // eslint-disable-next-line no-eval
+        result = eval(args.domcontentloadedFnStr);
+      }
+
+      info("waiting for subdialog load");
+      await dialogOpenPromise;
+      info("subdialog window is loaded");
+
+      let expectedStyleSheetURLs = subdialog._injectedStyleSheets;
+      let foundStyleSheetURLs = Array.from(
+        subdialog._frame.contentDocument.styleSheets,
+        s => s.href
+      );
+
+      Assert.greaterOrEqual(
+        expectedStyleSheetURLs.length,
+        0,
+        "Should be at least one injected stylesheet."
+      );
+      // We can't test that the injected stylesheets come later if those are
+      // the only ones. If this test fails it indicates the test needs to be
+      // changed somehow.
+      Assert.greater(
+        foundStyleSheetURLs.length,
+        expectedStyleSheetURLs.length,
+        "Should see at least all one additional stylesheet from the document."
+      );
+
+      // The expected stylesheets should be at the end of the list of loaded
+      // stylesheets.
+      foundStyleSheetURLs = foundStyleSheetURLs.slice(
+        foundStyleSheetURLs.length - expectedStyleSheetURLs.length
+      );
+
+      Assert.deepEqual(
+        foundStyleSheetURLs,
+        expectedStyleSheetURLs,
+        "Should have seen the injected stylesheets in the correct order"
+      );
+
+      Assert.ok(
+        !!subdialog._frame.contentWindow,
+        "The dialog should be non-null"
+      );
+      Assert.notEqual(
+        subdialog._frame.contentWindow.location.toString(),
+        "about:blank",
+        "Subdialog URL should not be about:blank"
+      );
+      Assert.equal(
+        win.getComputedStyle(subdialog._overlay).visibility,
+        "visible",
+        "Overlay should be visible"
+      );
+
+      return result;
+    }
+  );
+}
+
+async function close_subdialog_and_test_generic_end_state(
+  browser,
+  closingFn,
+  closingButton,
+  acceptCount,
+  options
+) {
+  let getDialogsCount = () => {
+    return SpecialPowers.spawn(
+      browser,
+      [],
+      () => content.window.gSubDialog._dialogs.length
+    );
+  };
+  let getStackChildrenCount = () => {
+    return SpecialPowers.spawn(
+      browser,
+      [],
+      () => content.window.gSubDialog._dialogStack.children.length
+    );
+  };
+  let dialogclosingPromise = SpecialPowers.spawn(
+    browser,
+    [{ closingButton, acceptCount }],
+    async function (expectations) {
+      let win = content.window;
+      let subdialog = win.gSubDialog._topDialog;
+      let frame = subdialog._frame;
+
+      let frameWinUnload = ContentTaskUtils.waitForEvent(
+        frame.contentWindow,
+        "unload",
+        true
+      );
+
+      let actualAcceptCount;
+      info("waiting for dialogclosing");
+      info("URI " + frame.currentURI?.spec);
+      let closingEvent = await ContentTaskUtils.waitForEvent(
+        frame.contentWindow,
+        "dialogclosing",
+        true,
+        () => {
+          actualAcceptCount = frame.contentWindow?.arguments[0].acceptCount;
+          return true;
+        }
+      );
+
+      info("Waiting for subdialog unload");
+      await frameWinUnload;
+
+      let contentClosingButton = closingEvent.detail.button;
+
+      Assert.notEqual(
+        win.getComputedStyle(subdialog._overlay).visibility,
+        "visible",
+        "overlay is not visible"
+      );
+      Assert.equal(
+        frame.getAttribute("style"),
+        "",
+        "inline styles should be cleared"
+      );
+      Assert.equal(
+        contentClosingButton,
+        expectations.closingButton,
+        "closing event should indicate button was '" +
+          expectations.closingButton +
+          "'"
+      );
+      Assert.equal(
+        actualAcceptCount,
+        expectations.acceptCount,
+        "should be 1 if accepted, 0 if canceled, undefined if closed w/out button"
+      );
+    }
+  );
+  let initialDialogsCount = await getDialogsCount();
+  let initialStackChildrenCount = await getStackChildrenCount();
+  if (options && options.runClosingFnOutsideOfContentTask) {
+    await closingFn();
+  } else {
+    SpecialPowers.spawn(browser, [], closingFn);
+  }
+
+  await dialogclosingPromise;
+  let endDialogsCount = await getDialogsCount();
+  let endStackChildrenCount = await getStackChildrenCount();
+  Assert.equal(
+    initialDialogsCount - 1,
+    endDialogsCount,
+    "dialog count should decrease by 1"
+  );
+  Assert.equal(
+    initialStackChildrenCount - 1,
+    endStackChildrenCount,
+    "stack children count should decrease by 1"
+  );
+}
+
+let tab;
+
+add_task(async function test_initialize() {
+  tab = await BrowserTestUtils.openNewForegroundTab(
+    gBrowser,
+    "about:preferences"
+  );
+});
+
+add_task(
+  async function check_titlebar_focus_returnval_titlechanges_accepting() {
+    await open_subdialog_and_test_generic_start_state(tab.linkedBrowser);
+
+    let domtitlechangedPromise = BrowserTestUtils.waitForEvent(
+      tab.linkedBrowser,
+      "DOMTitleChanged"
+    );
+    await SpecialPowers.spawn(tab.linkedBrowser, [], async function () {
+      let dialog = content.window.gSubDialog._topDialog;
+      let dialogWin = dialog._frame.contentWindow;
+      let dialogTitleElement = dialog._titleElement;
+      Assert.equal(
+        dialogTitleElement.textContent,
+        "Sample sub-dialog",
+        "Title should be correct initially"
+      );
+      Assert.equal(
+        dialogWin.document.activeElement.value,
+        "Default text",
+        "Textbox with correct text is focused"
+      );
+      dialogWin.document.title = "Updated title";
+    });
+
+    info("waiting for DOMTitleChanged event");
+    await domtitlechangedPromise;
+
+    SpecialPowers.spawn(tab.linkedBrowser, [], async function () {
+      let dialogTitleElement =
+        content.window.gSubDialog._topDialog._titleElement;
+      Assert.equal(
+        dialogTitleElement.textContent,
+        "Updated title",
+        "subdialog should have updated title"
+      );
+    });
+
+    // Accept the dialog
+    await close_subdialog_and_test_generic_end_state(
+      tab.linkedBrowser,
+      function () {
+        content.window.gSubDialog._topDialog._frame.contentDocument
+          .getElementById("subDialog")
+          .acceptDialog();
+      },
+      "accept",
+      1
+    );
+  }
+);
+
+add_task(async function check_canceling_dialog() {
+  await open_subdialog_and_test_generic_start_state(tab.linkedBrowser);
+
+  info("canceling the dialog");
+  await close_subdialog_and_test_generic_end_state(
+    tab.linkedBrowser,
+    function () {
+      content.window.gSubDialog._topDialog._frame.contentDocument
+        .getElementById("subDialog")
+        .cancelDialog();
+    },
+    "cancel",
+    0
+  );
+});
+
+add_task(async function check_reopening_dialog() {
+  await open_subdialog_and_test_generic_start_state(tab.linkedBrowser);
+  info("opening another dialog which will close the first");
+  await open_subdialog_and_test_generic_start_state(
+    tab.linkedBrowser,
+    "",
+    gDialogURL2
+  );
+
+  SpecialPowers.spawn(tab.linkedBrowser, [], async function () {
+    let win = content.window;
+    let dialogs = win.gSubDialog._dialogs;
+    let lowerDialog = dialogs[0];
+    let topDialog = dialogs[1];
+    Assert.equal(dialogs.length, 2, "There should be two visible dialogs");
+    Assert.equal(
+      win.getComputedStyle(topDialog._overlay).visibility,
+      "visible",
+      "The top dialog should be visible"
+    );
+    Assert.equal(
+      win.getComputedStyle(lowerDialog._overlay).visibility,
+      "visible",
+      "The lower dialog should be visible"
+    );
+    Assert.equal(
+      win.getComputedStyle(topDialog._overlay).backgroundColor,
+      "rgba(0, 0, 0, 0.5)",
+      "The top dialog should have a semi-transparent overlay"
+    );
+    Assert.equal(
+      win.getComputedStyle(lowerDialog._overlay).backgroundColor,
+      "rgba(0, 0, 0, 0)",
+      "The lower dialog should not have an overlay"
+    );
+  });
+
+  info("closing two dialogs");
+  await close_subdialog_and_test_generic_end_state(
+    tab.linkedBrowser,
+    function () {
+      content.window.gSubDialog._topDialog._frame.contentDocument
+        .getElementById("subDialog")
+        .acceptDialog();
+    },
+    "accept",
+    1
+  );
+  await close_subdialog_and_test_generic_end_state(
+    tab.linkedBrowser,
+    function () {
+      content.window.gSubDialog._topDialog._frame.contentDocument
+        .getElementById("subDialog")
+        .acceptDialog();
+    },
+    "accept",
+    1
+  );
+});
+
+add_task(async function check_opening_while_closing() {
+  await open_subdialog_and_test_generic_start_state(tab.linkedBrowser);
+  info("closing");
+  content.window.gSubDialog._topDialog.close();
+  info("reopening immediately after calling .close()");
+  await open_subdialog_and_test_generic_start_state(tab.linkedBrowser);
+  await close_subdialog_and_test_generic_end_state(
+    tab.linkedBrowser,
+    function () {
+      content.window.gSubDialog._topDialog._frame.contentDocument
+        .getElementById("subDialog")
+        .acceptDialog();
+    },
+    "accept",
+    1
+  );
+});
+
+add_task(async function window_close_on_dialog() {
+  await open_subdialog_and_test_generic_start_state(tab.linkedBrowser);
+
+  info("canceling the dialog");
+  await close_subdialog_and_test_generic_end_state(
+    tab.linkedBrowser,
+    function () {
+      content.window.gSubDialog._topDialog._frame.contentWindow.close();
+    },
+    null,
+    0
+  );
+});
+
+add_task(async function click_close_button_on_dialog() {
+  await open_subdialog_and_test_generic_start_state(tab.linkedBrowser);
+
+  info("canceling the dialog");
+  await close_subdialog_and_test_generic_end_state(
+    tab.linkedBrowser,
+    function () {
+      return BrowserTestUtils.synthesizeMouseAtCenter(
+        ".dialogClose",
+        {},
+        tab.linkedBrowser
+      );
+    },
+    null,
+    0,
+    { runClosingFnOutsideOfContentTask: true }
+  );
+});
+
+add_task(async function background_click_should_close_dialog() {
+  await open_subdialog_and_test_generic_start_state(tab.linkedBrowser);
+
+  // Clicking on an inactive part of dialog itself should not close the dialog.
+  // Click the dialog title bar here to make sure nothing happens.
+  info("clicking the dialog title bar");
+  BrowserTestUtils.synthesizeMouseAtCenter(
+    ".dialogTitle",
+    {},
+    tab.linkedBrowser
+  );
+
+  // Close the dialog by clicking on the overlay background. Simulate a click
+  // at point (2,2) instead of (0,0) so we are sure we're clicking on the
+  // overlay background instead of some boundary condition that a real user
+  // would never click.
+  info("clicking the overlay background");
+  await close_subdialog_and_test_generic_end_state(
+    tab.linkedBrowser,
+    function () {
+      return BrowserTestUtils.synthesizeMouseAtPoint(
+        2,
+        2,
+        {},
+        tab.linkedBrowser
+      );
+    },
+    null,
+    0,
+    { runClosingFnOutsideOfContentTask: true }
+  );
+});
+
+add_task(async function escape_should_close_dialog() {
+  await open_subdialog_and_test_generic_start_state(tab.linkedBrowser);
+
+  info("canceling the dialog");
+  await close_subdialog_and_test_generic_end_state(
+    tab.linkedBrowser,
+    function () {
+      return BrowserTestUtils.synthesizeKey("VK_ESCAPE", {}, tab.linkedBrowser);
+    },
+    "cancel",
+    0,
+    { runClosingFnOutsideOfContentTask: true }
+  );
+});
+
+add_task(async function correct_width_and_height_should_be_used_for_dialog() {
+  await open_subdialog_and_test_generic_start_state(tab.linkedBrowser);
+
+  await SpecialPowers.spawn(tab.linkedBrowser, [], async function () {
+    function fuzzyEqual(value, expectedValue, fuzz, msg) {
+      Assert.greaterOrEqual(expectedValue + fuzz, value, msg);
+      Assert.lessOrEqual(expectedValue - fuzz, value, msg);
+    }
+    let topDialog = content.gSubDialog._topDialog;
+    let frameStyle = content.getComputedStyle(topDialog._frame);
+    let dialogStyle = topDialog.frameContentWindow.getComputedStyle(
+      topDialog.frameContentWindow.document.documentElement
+    );
+    let fontSize = parseFloat(dialogStyle.fontSize);
+    let height = parseFloat(frameStyle.height);
+    let width = parseFloat(frameStyle.width);
+
+    fuzzyEqual(
+      width,
+      fontSize * 32,
+      2,
+      "Width should be set on the frame from the dialog"
+    );
+    fuzzyEqual(
+      height,
+      fontSize * 5,
+      2,
+      "Height should be set on the frame from the dialog"
+    );
+  });
+
+  await close_subdialog_and_test_generic_end_state(
+    tab.linkedBrowser,
+    function () {
+      content.window.gSubDialog._topDialog._frame.contentWindow.close();
+    },
+    null,
+    0
+  );
+});
+
+add_task(
+  async function wrapped_text_in_dialog_should_have_expected_scrollHeight() {
+    let oldHeight = await open_subdialog_and_test_generic_start_state(
+      tab.linkedBrowser,
+      function domcontentloadedFn() {
+        let frame = content.window.gSubDialog._topDialog._frame;
+        let doc = frame.contentDocument;
+        let scrollHeight = doc.documentElement.scrollHeight;
+        doc.documentElement.style.removeProperty("height");
+        doc.getElementById("desc").textContent = `
+      Sed ut perspiciatis unde omnis iste natus error sit voluptatem accusantium doloremque
+      laudantium, totam rem aperiam, eaque ipsa quae ab illo inventore veritatis et quasi
+      architecto beatae vitae dicta sunt explicabo. Nemo enim ipsam voluptatem quia voluptas
+      sit aspernatur aut odit aut fugit, sed quia consequuntur magni dolores eos qui ratione
+      laudantium, totam rem aperiam, eaque ipsa quae ab illo inventore veritatis et quasi
+      architecto beatae vitae dicta sunt explicabo. Nemo enim ipsam voluptatem quia voluptas
+      sit aspernatur aut odit aut fugit, sed quia consequuntur magni dolores eos qui ratione
+      laudantium, totam rem aperiam, eaque ipsa quae ab illo inventore veritatis et quasi
+      architecto beatae vitae dicta sunt explicabo. Nemo enim ipsam voluptatem quia voluptas
+      sit aspernatur aut odit aut fugit, sed quia consequuntur magni dolores eos qui ratione
+      voluptatem sequi nesciunt.`;
+        return scrollHeight;
+      }
+    );
+
+    await SpecialPowers.spawn(
+      tab.linkedBrowser,
+      [oldHeight],
+      async function (contentOldHeight) {
+        function fuzzyEqual(value, expectedValue, fuzz, msg) {
+          Assert.greaterOrEqual(expectedValue + fuzz, value, msg);
+          Assert.lessOrEqual(expectedValue - fuzz, value, msg);
+        }
+        let topDialog = content.gSubDialog._topDialog;
+        let frame = topDialog._frame;
+        let frameStyle = content.getComputedStyle(frame);
+        let docEl = frame.contentDocument.documentElement;
+        let dialogStyle = topDialog.frameContentWindow.getComputedStyle(docEl);
+        let fontSize = parseFloat(dialogStyle.fontSize);
+        let height = parseFloat(frameStyle.height);
+        let width = parseFloat(frameStyle.width);
+
+        fuzzyEqual(
+          width,
+          32 * fontSize,
+          2,
+          "Width should be set on the frame from the dialog"
+        );
+        Assert.ok(
+          docEl.scrollHeight > contentOldHeight,
+          "Content height increased (from " +
+            contentOldHeight +
+            " to " +
+            docEl.scrollHeight +
+            ")."
+        );
+        fuzzyEqual(
+          height,
+          docEl.scrollHeight,
+          2,
+          "Height on the frame should be higher now. " +
+            "This test may fail on certain screen resoluition. " +
+            "See bug 1420576 and bug 1205717."
+        );
+      }
+    );
+
+    await close_subdialog_and_test_generic_end_state(
+      tab.linkedBrowser,
+      function () {
+        content.window.gSubDialog._topDialog._frame.contentWindow.window.close();
+      },
+      null,
+      0
+    );
+  }
+);
+
+add_task(async function dialog_too_tall_should_get_reduced_in_height() {
+  await open_subdialog_and_test_generic_start_state(
+    tab.linkedBrowser,
+    function domcontentloadedFn() {
+      let frame = content.window.gSubDialog._topDialog._frame;
+      frame.contentDocument.documentElement.style.height = "100000px";
+    }
+  );
+
+  await SpecialPowers.spawn(tab.linkedBrowser, [], async function () {
+    function fuzzyEqual(value, expectedValue, fuzz, msg) {
+      Assert.greaterOrEqual(expectedValue + fuzz, value, msg);
+      Assert.lessOrEqual(expectedValue - fuzz, value, msg);
+    }
+    let topDialog = content.gSubDialog._topDialog;
+    let frame = topDialog._frame;
+    let frameStyle = content.getComputedStyle(frame);
+    let dialogStyle = topDialog.frameContentWindow.getComputedStyle(
+      frame.contentDocument.documentElement
+    );
+    let fontSize = parseFloat(dialogStyle.fontSize);
+    let height = parseFloat(frameStyle.height);
+    let width = parseFloat(frameStyle.width);
+    fuzzyEqual(
+      width,
+      32 * fontSize,
+      2,
+      "Width should be set on the frame from the dialog"
+    );
+    Assert.less(
+      height,
+      content.window.innerHeight,
+      "Height on the frame should be smaller than window's innerHeight"
+    );
+  });
+
+  await close_subdialog_and_test_generic_end_state(
+    tab.linkedBrowser,
+    function () {
+      content.window.gSubDialog._topDialog._frame.contentWindow.window.close();
+    },
+    null,
+    0
+  );
+});
+
+add_task(
+  async function scrollWidth_and_scrollHeight_from_subdialog_should_size_the_browser() {
+    await open_subdialog_and_test_generic_start_state(
+      tab.linkedBrowser,
+      function domcontentloadedFn() {
+        let frame = content.window.gSubDialog._topDialog._frame;
+        frame.contentDocument.documentElement.style.removeProperty("height");
+        frame.contentDocument.documentElement.style.removeProperty("width");
+      }
+    );
+
+    await SpecialPowers.spawn(tab.linkedBrowser, [], async function () {
+      let frame = content.window.gSubDialog._topDialog._frame;
+      Assert.ok(
+        frame.style.width.endsWith("px"),
+        "Width (" +
+          frame.style.width +
+          ") should be set to a px value of the scrollWidth from the dialog"
+      );
+      let cs = content.getComputedStyle(frame);
+      Assert.stringMatches(
+        cs.getPropertyValue("--subdialog-inner-height"),
+        /px$/,
+        "Height (" +
+          cs.getPropertyValue("--subdialog-inner-height") +
+          ") should be set to a px value of the scrollHeight from the dialog"
+      );
+    });
+
+    await close_subdialog_and_test_generic_end_state(
+      tab.linkedBrowser,
+      function () {
+        content.window.gSubDialog._topDialog._frame.contentWindow.window.close();
+      },
+      null,
+      0
+    );
+  }
+);
+
+add_task(async function test_shutdown() {
+  gBrowser.removeTab(tab);
+});
diff --git a/browser/components/preferences/tests/browser_sync_chooseWhatToSync.js b/browser/components/preferences/tests/browser_sync_chooseWhatToSync.js
new file mode 100644
index 0000000000..b36d9ecea3
--- /dev/null
+++ b/browser/components/preferences/tests/browser_sync_chooseWhatToSync.js
@@ -0,0 +1,178 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+const { UIState } = ChromeUtils.importESModule(
+  "resource://services-sync/UIState.sys.mjs"
+);
+
+// This obj will be used in both tests
+// First test makes sure accepting the preferences matches these values
+// Second test makes sure the cancel dialog STILL matches these values
+const syncPrefs = {
+  "services.sync.engine.addons": false,
+  "services.sync.engine.bookmarks": true,
+  "services.sync.engine.history": true,
+  "services.sync.engine.tabs": false,
+  "services.sync.engine.prefs": false,
+  "services.sync.engine.passwords": false,
+  "services.sync.engine.addresses": false,
+  "services.sync.engine.creditcards": false,
+};
+
+add_setup(async () => {
+  UIState._internal.notifyStateUpdated = () => {};
+  const origNotifyStateUpdated = UIState._internal.notifyStateUpdated;
+  const origGet = UIState.get;
+  UIState.get = () => {
+    return { status: UIState.STATUS_SIGNED_IN, email: "foo@bar.com" };
+  };
+
+  registerCleanupFunction(() => {
+    UIState._internal.notifyStateUpdated = origNotifyStateUpdated;
+    UIState.get = origGet;
+  });
+});
+
+/**
+ * We don't actually enable sync here, but we just check that the preferences are correct
+ * when the callback gets hit (accepting/cancelling the dialog)
+ * See https://bugzilla.mozilla.org/show_bug.cgi?id=1584132.
+ */
+
+add_task(async function testDialogAccept() {
+  await SpecialPowers.pushPrefEnv({
+    set: [["identity.fxaccounts.enabled", true]],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+
+  // This will check if the callback was actually called during the test
+  let callbackCalled = false;
+
+  // Enabling all the sync UI is painful in tests, so we just open the dialog manually
+  let syncWindow = await openAndLoadSubDialog(
+    "chrome://browser/content/preferences/dialogs/syncChooseWhatToSync.xhtml",
+    null,
+    {},
+    () => {
+      for (const [prefKey, prefValue] of Object.entries(syncPrefs)) {
+        Assert.equal(
+          Services.prefs.getBoolPref(prefKey),
+          prefValue,
+          `${prefValue} is expected value`
+        );
+      }
+      callbackCalled = true;
+    }
+  );
+
+  Assert.ok(syncWindow, "Choose what to sync window opened");
+  let syncChooseDialog =
+    syncWindow.document.getElementById("syncChooseOptions");
+  let syncCheckboxes = syncChooseDialog.querySelectorAll(
+    "checkbox[preference]"
+  );
+
+  // Adjust the checkbox values to the expectedValues in the list
+  [...syncCheckboxes].forEach(checkbox => {
+    if (syncPrefs[checkbox.getAttribute("preference")] !== checkbox.checked) {
+      checkbox.click();
+    }
+  });
+
+  syncChooseDialog.acceptDialog();
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  Assert.ok(callbackCalled, "Accept callback was called");
+});
+
+add_task(async function testDialogCancel() {
+  const cancelSyncPrefs = {
+    "services.sync.engine.addons": true,
+    "services.sync.engine.bookmarks": false,
+    "services.sync.engine.history": true,
+    "services.sync.engine.tabs": true,
+    "services.sync.engine.prefs": false,
+    "services.sync.engine.passwords": true,
+    "services.sync.engine.addresses": true,
+    "services.sync.engine.creditcards": false,
+  };
+
+  await SpecialPowers.pushPrefEnv({
+    set: [["identity.fxaccounts.enabled", true]],
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+
+  // This will check if the callback was actually called during the test
+  let callbackCalled = false;
+
+  // Enabling all the sync UI is painful in tests, so we just open the dialog manually
+  let syncWindow = await openAndLoadSubDialog(
+    "chrome://browser/content/preferences/dialogs/syncChooseWhatToSync.xhtml",
+    null,
+    {},
+    () => {
+      // We want to test against our previously accepted values in the last test
+      for (const [prefKey, prefValue] of Object.entries(syncPrefs)) {
+        Assert.equal(
+          Services.prefs.getBoolPref(prefKey),
+          prefValue,
+          `${prefValue} is expected value`
+        );
+      }
+      callbackCalled = true;
+    }
+  );
+
+  ok(syncWindow, "Choose what to sync window opened");
+  let syncChooseDialog =
+    syncWindow.document.getElementById("syncChooseOptions");
+  let syncCheckboxes = syncChooseDialog.querySelectorAll(
+    "checkbox[preference]"
+  );
+
+  // This time we're adjusting to the cancel list
+  [...syncCheckboxes].forEach(checkbox => {
+    if (
+      cancelSyncPrefs[checkbox.getAttribute("preference")] !== checkbox.checked
+    ) {
+      checkbox.click();
+    }
+  });
+
+  syncChooseDialog.cancelDialog();
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  Assert.ok(callbackCalled, "Cancel callback was called");
+});
+
+/**
+ * Tests that this subdialog can be opened via
+ * about:preferences?action=choose-what-to-sync#sync
+ */
+add_task(async function testDialogLaunchFromURI() {
+  await SpecialPowers.pushPrefEnv({
+    set: [["identity.fxaccounts.enabled", true]],
+  });
+
+  let dialogEventPromise = BrowserTestUtils.waitForEvent(
+    window,
+    "dialogopen",
+    true
+  );
+  await BrowserTestUtils.withNewTab(
+    "about:preferences?action=choose-what-to-sync#sync",
+    async browser => {
+      let dialogEvent = await dialogEventPromise;
+      Assert.equal(
+        dialogEvent.detail.dialog._frame.contentWindow.location,
+        "chrome://browser/content/preferences/dialogs/syncChooseWhatToSync.xhtml"
+      );
+    }
+  );
+});
diff --git a/browser/components/preferences/tests/browser_sync_disabled.js b/browser/components/preferences/tests/browser_sync_disabled.js
new file mode 100644
index 0000000000..1f8518a1e4
--- /dev/null
+++ b/browser/components/preferences/tests/browser_sync_disabled.js
@@ -0,0 +1,26 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+/**
+ * Test that we don't show sync pane when it's disabled.
+ * See https://bugzilla.mozilla.org/show_bug.cgi?id=1536752.
+ */
+add_task(async function () {
+  await SpecialPowers.pushPrefEnv({
+    set: [["identity.fxaccounts.enabled", false]],
+  });
+  await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+    leaveOpen: true,
+  });
+  ok(
+    gBrowser.contentDocument.getElementById("category-sync").hidden,
+    "sync category hidden"
+  );
+
+  // Check that we don't get any results in sync when searching:
+  await evaluateSearchResults("sync", "no-results-message");
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/browser_sync_pairing.js b/browser/components/preferences/tests/browser_sync_pairing.js
new file mode 100644
index 0000000000..6491007a38
--- /dev/null
+++ b/browser/components/preferences/tests/browser_sync_pairing.js
@@ -0,0 +1,149 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+const { UIState } = ChromeUtils.importESModule(
+  "resource://services-sync/UIState.sys.mjs"
+);
+const { FxAccountsPairingFlow } = ChromeUtils.importESModule(
+  "resource://gre/modules/FxAccountsPairing.sys.mjs"
+);
+
+// Use sinon for mocking.
+const { sinon } = ChromeUtils.importESModule(
+  "resource://testing-common/Sinon.sys.mjs"
+);
+
+let flowCounter = 0;
+
+add_setup(async function () {
+  Services.prefs.setBoolPref("identity.fxaccounts.pairing.enabled", true);
+  // Sync start-up might interfere with our tests, don't let UIState send UI updates.
+  const origNotifyStateUpdated = UIState._internal.notifyStateUpdated;
+  UIState._internal.notifyStateUpdated = () => {};
+
+  const origGet = UIState.get;
+  UIState.get = () => {
+    return { status: UIState.STATUS_SIGNED_IN, email: "foo@bar.com" };
+  };
+
+  const origStart = FxAccountsPairingFlow.start;
+  FxAccountsPairingFlow.start = ({ emitter: e }) => {
+    return `https://foo.bar/${flowCounter++}`;
+  };
+
+  registerCleanupFunction(() => {
+    UIState._internal.notifyStateUpdated = origNotifyStateUpdated;
+    UIState.get = origGet;
+    FxAccountsPairingFlow.start = origStart;
+  });
+});
+
+add_task(async function testShowsQRCode() {
+  await runWithPairingDialog(async win => {
+    let doc = win.document;
+    let qrContainer = doc.getElementById("qrContainer");
+    let qrWrapper = doc.getElementById("qrWrapper");
+
+    await TestUtils.waitForCondition(
+      () => qrWrapper.getAttribute("pairing-status") == "ready"
+    );
+
+    // Verify that a QRcode is being shown.
+    Assert.ok(
+      qrContainer.style.backgroundImage.startsWith(
+        `url("data:image/gif;base64,R0lGODdhOgA6AIAAAAAAAP///ywAAAAAOgA6AAAC/4yPqcvtD6OctNqLs968+w+G4gKU5nkiJYO2JuW6KsDGKEw3a7AbPZ+r4Ry7nzFIQkKKN6Avlzowo78`
+      )
+    );
+
+    // Close the dialog.
+    let promiseUnloaded = BrowserTestUtils.waitForEvent(win, "unload");
+    gBrowser.contentDocument.querySelector(".dialogClose").click();
+
+    info("waiting for dialog to unload");
+    await promiseUnloaded;
+  });
+});
+
+add_task(async function testCantShowQrCode() {
+  const origStart = FxAccountsPairingFlow.start;
+  FxAccountsPairingFlow.start = async () => {
+    throw new Error("boom");
+  };
+  await runWithPairingDialog(async win => {
+    let doc = win.document;
+    let qrWrapper = doc.getElementById("qrWrapper");
+
+    await TestUtils.waitForCondition(
+      () => qrWrapper.getAttribute("pairing-status") == "error"
+    );
+
+    // Close the dialog.
+    let promiseUnloaded = BrowserTestUtils.waitForEvent(win, "unload");
+    gBrowser.contentDocument.querySelector(".dialogClose").click();
+
+    info("waiting for dialog to unload");
+    await promiseUnloaded;
+  });
+  FxAccountsPairingFlow.start = origStart;
+});
+
+add_task(async function testSwitchToWebContent() {
+  await runWithPairingDialog(async win => {
+    let doc = win.document;
+    let qrWrapper = doc.getElementById("qrWrapper");
+
+    await TestUtils.waitForCondition(
+      () => qrWrapper.getAttribute("pairing-status") == "ready"
+    );
+
+    const spySwitchURL = sinon.spy(win.gFxaPairDeviceDialog, "_switchToUrl");
+    const emitter = win.gFxaPairDeviceDialog._emitter;
+    emitter.emit("view:SwitchToWebContent", "about:robots");
+
+    Assert.equal(spySwitchURL.callCount, 1);
+  });
+});
+
+add_task(async function testError() {
+  await runWithPairingDialog(async win => {
+    let doc = win.document;
+    let qrWrapper = doc.getElementById("qrWrapper");
+
+    await TestUtils.waitForCondition(
+      () => qrWrapper.getAttribute("pairing-status") == "ready"
+    );
+
+    const emitter = win.gFxaPairDeviceDialog._emitter;
+    emitter.emit("view:Error");
+
+    await TestUtils.waitForCondition(
+      () => qrWrapper.getAttribute("pairing-status") == "error"
+    );
+
+    // Close the dialog.
+    let promiseUnloaded = BrowserTestUtils.waitForEvent(win, "unload");
+    gBrowser.contentDocument.querySelector(".dialogClose").click();
+
+    info("waiting for dialog to unload");
+    await promiseUnloaded;
+  });
+});
+
+async function runWithPairingDialog(test) {
+  await openPreferencesViaOpenPreferencesAPI("paneSync", { leaveOpen: true });
+
+  let promiseSubDialogLoaded = promiseLoadSubDialog(
+    "chrome://browser/content/preferences/fxaPairDevice.xhtml"
+  );
+  gBrowser.contentWindow.gSyncPane.pairAnotherDevice();
+
+  let win = await promiseSubDialogLoaded;
+
+  await test(win);
+
+  sinon.restore();
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+}
diff --git a/browser/components/preferences/tests/browser_trendingsuggestions.js b/browser/components/preferences/tests/browser_trendingsuggestions.js
new file mode 100644
index 0000000000..1cfae387cf
--- /dev/null
+++ b/browser/components/preferences/tests/browser_trendingsuggestions.js
@@ -0,0 +1,80 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+const { SearchTestUtils } = ChromeUtils.importESModule(
+  "resource://testing-common/SearchTestUtils.sys.mjs"
+);
+
+const MAIN_PREF = "browser.search.suggest.enabled";
+const URLBAR_PREF = "browser.urlbar.suggest.searches";
+const TRENDING_PREF = "browser.urlbar.trending.featureGate";
+
+const TRENDING_CHECKBOX_ID = "showTrendingSuggestions";
+const SUGGESTIONED_CHECKBOX_ID = "suggestionsInSearchFieldsCheckbox";
+
+SearchTestUtils.init(this);
+
+add_setup(async function () {
+  await SpecialPowers.pushPrefEnv({
+    set: [
+      [MAIN_PREF, true],
+      [URLBAR_PREF, true],
+      [TRENDING_PREF, true],
+    ],
+  });
+
+  await SearchTestUtils.installSearchExtension({
+    name: "engine1",
+    search_url: "https://example.com/engine1",
+    search_url_get_params: "search={searchTerms}",
+  });
+  const defaultEngine = await Services.search.getDefault();
+
+  registerCleanupFunction(async () => {
+    await Services.search.setDefault(
+      defaultEngine,
+      Ci.nsISearchService.CHANGE_REASON_UNKNOWN
+    );
+  });
+});
+
+add_task(async function testSuggestionsDisabled() {
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let trendingCheckbox = doc.getElementById(TRENDING_CHECKBOX_ID);
+  let suggestionsCheckbox = doc.getElementById(SUGGESTIONED_CHECKBOX_ID);
+
+  Assert.ok(trendingCheckbox.checked, "Checkbox should be visible and checked");
+  Assert.ok(!trendingCheckbox.disabled, "Checkbox should not be disabled");
+
+  // Disable search suggestions.
+  suggestionsCheckbox.checked = false;
+  suggestionsCheckbox.doCommand();
+
+  await BrowserTestUtils.waitForCondition(
+    () => trendingCheckbox.disabled,
+    "Trending checkbox should be disabled when search suggestions are disabled"
+  );
+
+  // Clean up.
+  Services.prefs.clearUserPref(MAIN_PREF);
+  gBrowser.removeCurrentTab();
+});
+
+add_task(async function testNonTrendingEngine() {
+  // Set engine that does not support trending suggestions as default.
+  const engine1 = Services.search.getEngineByName("engine1");
+  Services.search.setDefault(
+    engine1,
+    Ci.nsISearchService.CHANGE_REASON_UNKNOWN
+  );
+  await openPreferencesViaOpenPreferencesAPI("search", { leaveOpen: true });
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let trendingCheckbox = doc.getElementById(TRENDING_CHECKBOX_ID);
+
+  Assert.ok(
+    trendingCheckbox.disabled,
+    "Checkbox should be disabled when an engine that doesnt support trending suggestions is default"
+  );
+  gBrowser.removeCurrentTab();
+});
diff --git a/browser/components/preferences/tests/browser_warning_permanent_private_browsing.js b/browser/components/preferences/tests/browser_warning_permanent_private_browsing.js
new file mode 100644
index 0000000000..8d1fa3c80b
--- /dev/null
+++ b/browser/components/preferences/tests/browser_warning_permanent_private_browsing.js
@@ -0,0 +1,57 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+function checkForPrompt(prefVal) {
+  return async function () {
+    await SpecialPowers.pushPrefEnv({
+      set: [
+        ["privacy.history.custom", true],
+        ["browser.privatebrowsing.autostart", !prefVal],
+      ],
+    });
+
+    await openPreferencesViaOpenPreferencesAPI("panePrivacy", {
+      leaveOpen: true,
+    });
+    let doc = gBrowser.contentDocument;
+    is(
+      doc.getElementById("historyMode").value,
+      "custom",
+      "Expect custom history mode"
+    );
+
+    // Stub out the prompt method as an easy way to check it was shown. We throw away
+    // the tab straight after so don't need to bother restoring it.
+    let promptFired = false;
+    doc.defaultView.confirmRestartPrompt = () => {
+      promptFired = true;
+      return doc.defaultView.CONFIRM_RESTART_PROMPT_RESTART_NOW;
+    };
+    // Tick the checkbox and pretend the user did it:
+    let checkbox = doc.getElementById("privateBrowsingAutoStart");
+    checkbox.checked = prefVal;
+    checkbox.doCommand();
+
+    // Now the prompt should have shown.
+    ok(
+      promptFired,
+      `Expect a prompt when turning permanent private browsing ${
+        prefVal ? "on" : "off"
+      }!`
+    );
+    BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  };
+}
+
+/**
+ * Check we show the prompt if the permanent private browsing pref is false
+ * and we flip the checkbox to true.
+ */
+add_task(checkForPrompt(true));
+
+/**
+ * Check it works in the other direction:
+ */
+add_task(checkForPrompt(false));
diff --git a/browser/components/preferences/tests/browser_windows_launch_on_login.js b/browser/components/preferences/tests/browser_windows_launch_on_login.js
new file mode 100644
index 0000000000..72a9e65ba9
--- /dev/null
+++ b/browser/components/preferences/tests/browser_windows_launch_on_login.js
@@ -0,0 +1,145 @@
+/* Any copyright is dedicated to the Public Domain.
+   http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+ChromeUtils.defineESModuleGetters(this, {
+  BackgroundUpdate: "resource://gre/modules/BackgroundUpdate.sys.mjs",
+  MigrationUtils: "resource:///modules/MigrationUtils.sys.mjs",
+  PermissionTestUtils: "resource://testing-common/PermissionTestUtils.sys.mjs",
+  WindowsLaunchOnLogin: "resource://gre/modules/WindowsLaunchOnLogin.sys.mjs",
+});
+
+const { ExperimentAPI } = ChromeUtils.importESModule(
+  "resource://nimbus/ExperimentAPI.sys.mjs"
+);
+
+const { ExperimentFakes } = ChromeUtils.importESModule(
+  "resource://testing-common/NimbusTestUtils.sys.mjs"
+);
+
+add_task(async function test_check_checkbox() {
+  await ExperimentAPI.ready();
+  let doCleanup = await ExperimentFakes.enrollWithFeatureConfig({
+    featureId: "windowsLaunchOnLogin",
+    value: { enabled: true },
+  });
+  await WindowsLaunchOnLogin.withLaunchOnLoginRegistryKey(async wrk => {
+    // Open preferences to general pane
+    await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+      leaveOpen: true,
+    });
+    let doc = gBrowser.contentDocument;
+
+    let launchOnLoginCheckbox = doc.getElementById("windowsLaunchOnLogin");
+    launchOnLoginCheckbox.click();
+    ok(launchOnLoginCheckbox.checked, "Autostart checkbox checked");
+
+    ok(
+      wrk.hasValue(WindowsLaunchOnLogin.getLaunchOnLoginRegistryName()),
+      "Key exists"
+    );
+
+    gBrowser.removeCurrentTab();
+  });
+  await doCleanup();
+});
+
+add_task(async function test_uncheck_checkbox() {
+  await ExperimentAPI.ready();
+  let doCleanup = await ExperimentFakes.enrollWithFeatureConfig({
+    featureId: "windowsLaunchOnLogin",
+    value: { enabled: true },
+  });
+  await WindowsLaunchOnLogin.withLaunchOnLoginRegistryKey(async wrk => {
+    // Open preferences to general pane
+    await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+      leaveOpen: true,
+    });
+    let doc = gBrowser.contentDocument;
+
+    let launchOnLoginCheckbox = doc.getElementById("windowsLaunchOnLogin");
+    launchOnLoginCheckbox.click();
+    ok(!launchOnLoginCheckbox.checked, "Autostart checkbox unchecked");
+
+    ok(
+      !wrk.hasValue(WindowsLaunchOnLogin.getLaunchOnLoginRegistryName()),
+      "Autostart registry key does not exist"
+    );
+
+    gBrowser.removeCurrentTab();
+  });
+  await doCleanup();
+});
+
+add_task(async function create_external_regkey() {
+  await ExperimentAPI.ready();
+  let doCleanup = await ExperimentFakes.enrollWithFeatureConfig({
+    featureId: "windowsLaunchOnLogin",
+    value: { enabled: true },
+  });
+  await WindowsLaunchOnLogin.withLaunchOnLoginRegistryKey(async wrk => {
+    // Create registry key without using settings pane to check if
+    // this is reflected in the settings
+    let autostartPath =
+      WindowsLaunchOnLogin.quoteString(
+        Services.dirsvc.get("XREExeF", Ci.nsIFile).path
+      ) + " -os-autostart";
+    wrk.writeStringValue(
+      WindowsLaunchOnLogin.getLaunchOnLoginRegistryName(),
+      autostartPath
+    );
+
+    // Open preferences to general pane
+    await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+      leaveOpen: true,
+    });
+    let doc = gBrowser.contentDocument;
+
+    let launchOnLoginCheckbox = doc.getElementById("windowsLaunchOnLogin");
+    ok(
+      launchOnLoginCheckbox.checked,
+      "Autostart checkbox automatically checked"
+    );
+
+    gBrowser.removeCurrentTab();
+  });
+  await doCleanup();
+});
+
+add_task(async function delete_external_regkey() {
+  await ExperimentAPI.ready();
+  let doCleanup = await ExperimentFakes.enrollWithFeatureConfig({
+    featureId: "windowsLaunchOnLogin",
+    value: { enabled: true },
+  });
+  await WindowsLaunchOnLogin.withLaunchOnLoginRegistryKey(async wrk => {
+    // Delete registry key without using settings pane to check if
+    // this is reflected in the settings
+    wrk.removeValue(WindowsLaunchOnLogin.getLaunchOnLoginRegistryName());
+
+    // Open preferences to general pane
+    await openPreferencesViaOpenPreferencesAPI("paneGeneral", {
+      leaveOpen: true,
+    });
+    let doc = gBrowser.contentDocument;
+
+    let launchOnLoginCheckbox = doc.getElementById("windowsLaunchOnLogin");
+    ok(
+      !launchOnLoginCheckbox.checked,
+      "Launch on login checkbox automatically unchecked"
+    );
+
+    gBrowser.removeCurrentTab();
+  });
+  await doCleanup();
+});
+
+registerCleanupFunction(async function () {
+  await WindowsLaunchOnLogin.withLaunchOnLoginRegistryKey(async wrk => {
+    let registryName = WindowsLaunchOnLogin.getLaunchOnLoginRegistryName();
+    if (wrk.hasValue(registryName)) {
+      wrk.removeValue(registryName);
+    }
+  });
+});
diff --git a/browser/components/preferences/tests/empty_pdf_file.pdf b/browser/components/preferences/tests/empty_pdf_file.pdf
new file mode 100644
index 0000000000..e69de29bb2
--- /dev/null
+++ b/browser/components/preferences/tests/empty_pdf_file.pdf
diff --git a/browser/components/preferences/tests/engine1/manifest.json b/browser/components/preferences/tests/engine1/manifest.json
new file mode 100644
index 0000000000..5fa44ea692
--- /dev/null
+++ b/browser/components/preferences/tests/engine1/manifest.json
@@ -0,0 +1,27 @@
+{
+  "name": "engine1",
+  "manifest_version": 2,
+  "version": "1.0",
+  "browser_specific_settings": {
+    "gecko": {
+      "id": "engine1@search.mozilla.org"
+    }
+  },
+  "hidden": true,
+  "description": "A small test engine",
+  "icons": {
+    "16": "favicon.ico"
+  },
+  "chrome_settings_overrides": {
+    "search_provider": {
+      "name": "engine1",
+      "search_url": "https://1.example.com/search",
+      "params": [
+        {
+          "name": "q",
+          "value": "{searchTerms}"
+        }
+      ]
+    }
+  }
+}
diff --git a/browser/components/preferences/tests/engine2/manifest.json b/browser/components/preferences/tests/engine2/manifest.json
new file mode 100644
index 0000000000..7ab094198b
--- /dev/null
+++ b/browser/components/preferences/tests/engine2/manifest.json
@@ -0,0 +1,27 @@
+{
+  "name": "engine2",
+  "manifest_version": 2,
+  "version": "1.0",
+  "browser_specific_settings": {
+    "gecko": {
+      "id": "engine2@search.mozilla.org"
+    }
+  },
+  "hidden": true,
+  "description": "A small test engine",
+  "icons": {
+    "16": "favicon.ico"
+  },
+  "chrome_settings_overrides": {
+    "search_provider": {
+      "name": "engine2",
+      "search_url": "https://2.example.com/search",
+      "params": [
+        {
+          "name": "q",
+          "value": "{searchTerms}"
+        }
+      ]
+    }
+  }
+}
diff --git a/browser/components/preferences/tests/head.js b/browser/components/preferences/tests/head.js
new file mode 100644
index 0000000000..1861c040e5
--- /dev/null
+++ b/browser/components/preferences/tests/head.js
@@ -0,0 +1,334 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+const { PermissionTestUtils } = ChromeUtils.importESModule(
+  "resource://testing-common/PermissionTestUtils.sys.mjs"
+);
+
+const kDefaultWait = 2000;
+
+function is_element_visible(aElement, aMsg) {
+  isnot(aElement, null, "Element should not be null, when checking visibility");
+  ok(!BrowserTestUtils.isHidden(aElement), aMsg);
+}
+
+function is_element_hidden(aElement, aMsg) {
+  isnot(aElement, null, "Element should not be null, when checking visibility");
+  ok(BrowserTestUtils.isHidden(aElement), aMsg);
+}
+
+function open_preferences(aCallback) {
+  gBrowser.selectedTab = BrowserTestUtils.addTab(gBrowser, "about:preferences");
+  let newTabBrowser = gBrowser.getBrowserForTab(gBrowser.selectedTab);
+  newTabBrowser.addEventListener(
+    "Initialized",
+    function () {
+      aCallback(gBrowser.contentWindow);
+    },
+    { capture: true, once: true }
+  );
+}
+
+function openAndLoadSubDialog(
+  aURL,
+  aFeatures = null,
+  aParams = null,
+  aClosingCallback = null
+) {
+  let promise = promiseLoadSubDialog(aURL);
+  content.gSubDialog.open(
+    aURL,
+    { features: aFeatures, closingCallback: aClosingCallback },
+    aParams
+  );
+  return promise;
+}
+
+function promiseLoadSubDialog(aURL) {
+  return new Promise((resolve, reject) => {
+    content.gSubDialog._dialogStack.addEventListener(
+      "dialogopen",
+      function dialogopen(aEvent) {
+        if (
+          aEvent.detail.dialog._frame.contentWindow.location == "about:blank"
+        ) {
+          return;
+        }
+        content.gSubDialog._dialogStack.removeEventListener(
+          "dialogopen",
+          dialogopen
+        );
+
+        is(
+          aEvent.detail.dialog._frame.contentWindow.location.toString(),
+          aURL,
+          "Check the proper URL is loaded"
+        );
+
+        // Check visibility
+        is_element_visible(aEvent.detail.dialog._overlay, "Overlay is visible");
+
+        // Check that stylesheets were injected
+        let expectedStyleSheetURLs =
+          aEvent.detail.dialog._injectedStyleSheets.slice(0);
+        for (let styleSheet of aEvent.detail.dialog._frame.contentDocument
+          .styleSheets) {
+          let i = expectedStyleSheetURLs.indexOf(styleSheet.href);
+          if (i >= 0) {
+            info("found " + styleSheet.href);
+            expectedStyleSheetURLs.splice(i, 1);
+          }
+        }
+        is(
+          expectedStyleSheetURLs.length,
+          0,
+          "All expectedStyleSheetURLs should have been found"
+        );
+
+        // Wait for the next event tick to make sure the remaining part of the
+        // testcase runs after the dialog gets ready for input.
+        executeSoon(() => resolve(aEvent.detail.dialog._frame.contentWindow));
+      }
+    );
+  });
+}
+
+async function openPreferencesViaOpenPreferencesAPI(aPane, aOptions) {
+  let finalPaneEvent = Services.prefs.getBoolPref("identity.fxaccounts.enabled")
+    ? "sync-pane-loaded"
+    : "privacy-pane-loaded";
+  let finalPrefPaneLoaded = TestUtils.topicObserved(finalPaneEvent, () => true);
+  gBrowser.selectedTab = BrowserTestUtils.addTab(gBrowser, "about:blank");
+  openPreferences(aPane, aOptions);
+  let newTabBrowser = gBrowser.selectedBrowser;
+
+  if (!newTabBrowser.contentWindow) {
+    await BrowserTestUtils.waitForEvent(newTabBrowser, "Initialized", true);
+    await BrowserTestUtils.waitForEvent(newTabBrowser.contentWindow, "load");
+    await finalPrefPaneLoaded;
+  }
+
+  let win = gBrowser.contentWindow;
+  let selectedPane = win.history.state;
+  if (!aOptions || !aOptions.leaveOpen) {
+    gBrowser.removeCurrentTab();
+  }
+  return { selectedPane };
+}
+
+async function runSearchInput(input) {
+  let searchInput = gBrowser.contentDocument.getElementById("searchInput");
+  searchInput.focus();
+  let searchCompletedPromise = BrowserTestUtils.waitForEvent(
+    gBrowser.contentWindow,
+    "PreferencesSearchCompleted",
+    evt => evt.detail == input
+  );
+  EventUtils.sendString(input);
+  await searchCompletedPromise;
+}
+
+async function evaluateSearchResults(
+  keyword,
+  searchResults,
+  includeExperiments = false
+) {
+  searchResults = Array.isArray(searchResults)
+    ? searchResults
+    : [searchResults];
+  searchResults.push("header-searchResults");
+
+  await runSearchInput(keyword);
+
+  let mainPrefTag = gBrowser.contentDocument.getElementById("mainPrefPane");
+  for (let i = 0; i < mainPrefTag.childElementCount; i++) {
+    let child = mainPrefTag.children[i];
+    if (!includeExperiments && child.id?.startsWith("pane-experimental")) {
+      continue;
+    }
+    if (searchResults.includes(child.id)) {
+      is_element_visible(child, `${child.id} should be in search results`);
+    } else if (child.id) {
+      is_element_hidden(child, `${child.id} should not be in search results`);
+    }
+  }
+}
+
+function waitForMutation(target, opts, cb) {
+  return new Promise(resolve => {
+    let observer = new MutationObserver(() => {
+      if (!cb || cb(target)) {
+        observer.disconnect();
+        resolve();
+      }
+    });
+    observer.observe(target, opts);
+  });
+}
+
+// Used to add sample experimental features for testing. To use, create
+// a DefinitionServer, then call addDefinition as needed.
+class DefinitionServer {
+  constructor(definitionOverrides = []) {
+    let { HttpServer } = ChromeUtils.importESModule(
+      "resource://testing-common/httpd.sys.mjs"
+    );
+
+    this.server = new HttpServer();
+    this.server.registerPathHandler("/definitions.json", this);
+    this.definitions = {};
+
+    for (const override of definitionOverrides) {
+      this.addDefinition(override);
+    }
+
+    this.server.start();
+    registerCleanupFunction(
+      () => new Promise(resolve => this.server.stop(resolve))
+    );
+  }
+
+  // for nsIHttpRequestHandler
+  handle(request, response) {
+    response.write(JSON.stringify(this.definitions));
+  }
+
+  get definitionsUrl() {
+    const { primaryScheme, primaryHost, primaryPort } = this.server.identity;
+    return `${primaryScheme}://${primaryHost}:${primaryPort}/definitions.json`;
+  }
+
+  addDefinition(overrides = {}) {
+    const definition = {
+      id: "test-feature",
+      // These l10n IDs are just random so we have some text to display
+      title: "experimental-features-media-jxl",
+      description: "pane-experimental-description2",
+      restartRequired: false,
+      type: "boolean",
+      preference: "test.feature",
+      defaultValue: false,
+      isPublic: false,
+      ...overrides,
+    };
+    // convert targeted values, used by fromId
+    definition.isPublic = { default: definition.isPublic };
+    definition.defaultValue = { default: definition.defaultValue };
+    this.definitions[definition.id] = definition;
+    return definition;
+  }
+}
+
+/**
+ * Creates observer that waits for and then compares all perm-changes with the observances in order.
+ * @param {Array} observances permission changes to observe (order is important)
+ * @returns {Promise} Promise object that resolves once all permission changes have been observed
+ */
+function createObserveAllPromise(observances) {
+  // Create new promise that resolves once all items
+  // in observances array have been observed.
+  return new Promise(resolve => {
+    let permObserver = {
+      observe(aSubject, aTopic, aData) {
+        if (aTopic != "perm-changed") {
+          return;
+        }
+
+        if (!observances.length) {
+          // See bug 1063410
+          return;
+        }
+
+        let permission = aSubject.QueryInterface(Ci.nsIPermission);
+        let expected = observances.shift();
+
+        info(
+          `observed perm-changed for ${permission.principal.origin} (remaining ${observances.length})`
+        );
+
+        is(aData, expected.data, "type of message should be the same");
+        for (let prop of ["type", "capability", "expireType"]) {
+          if (expected[prop]) {
+            is(
+              permission[prop],
+              expected[prop],
+              `property: "${prop}" should be equal (${permission.principal.origin})`
+            );
+          }
+        }
+
+        if (expected.origin) {
+          is(
+            permission.principal.origin,
+            expected.origin,
+            `property: "origin" should be equal (${permission.principal.origin})`
+          );
+        }
+
+        if (!observances.length) {
+          Services.obs.removeObserver(permObserver, "perm-changed");
+          executeSoon(resolve);
+        }
+      },
+    };
+    Services.obs.addObserver(permObserver, "perm-changed");
+  });
+}
+
+/**
+ * Waits for preference to be set and asserts the value.
+ * @param {string} pref - Preference key.
+ * @param {*} expectedValue - Expected value of the preference.
+ * @param {string} message - Assertion message.
+ */
+async function waitForAndAssertPrefState(pref, expectedValue, message) {
+  await TestUtils.waitForPrefChange(pref, value => {
+    if (value != expectedValue) {
+      return false;
+    }
+    is(value, expectedValue, message);
+    return true;
+  });
+}
+
+/**
+ * The Relay promo is not shown for distributions with a custom FxA instance,
+ * since Relay requires an account on our own server. These prefs are set to a
+ * dummy address by the test harness, filling the prefs with a "user value."
+ * This temporarily sets the default value equal to the dummy value, so that
+ * Firefox thinks we've configured the correct FxA server.
+ * @returns {Promise<MockFxAUtilityFunctions>} { mock, unmock }
+ */
+async function mockDefaultFxAInstance() {
+  /**
+   * @typedef {Object} MockFxAUtilityFunctions
+   * @property {function():void} mock - Makes the dummy values default, creating
+   *                             the illusion of a production FxA instance.
+   * @property {function():void} unmock - Restores the true defaults, creating
+   *                             the illusion of a custom FxA instance.
+   */
+
+  const defaultPrefs = Services.prefs.getDefaultBranch("");
+  const userPrefs = Services.prefs.getBranch("");
+  const realAuth = defaultPrefs.getCharPref("identity.fxaccounts.auth.uri");
+  const realRoot = defaultPrefs.getCharPref("identity.fxaccounts.remote.root");
+  const mockAuth = userPrefs.getCharPref("identity.fxaccounts.auth.uri");
+  const mockRoot = userPrefs.getCharPref("identity.fxaccounts.remote.root");
+  const mock = () => {
+    defaultPrefs.setCharPref("identity.fxaccounts.auth.uri", mockAuth);
+    defaultPrefs.setCharPref("identity.fxaccounts.remote.root", mockRoot);
+    userPrefs.clearUserPref("identity.fxaccounts.auth.uri");
+    userPrefs.clearUserPref("identity.fxaccounts.remote.root");
+  };
+  const unmock = () => {
+    defaultPrefs.setCharPref("identity.fxaccounts.auth.uri", realAuth);
+    defaultPrefs.setCharPref("identity.fxaccounts.remote.root", realRoot);
+    userPrefs.setCharPref("identity.fxaccounts.auth.uri", mockAuth);
+    userPrefs.setCharPref("identity.fxaccounts.remote.root", mockRoot);
+  };
+
+  mock();
+  registerCleanupFunction(unmock);
+
+  return { mock, unmock };
+}
diff --git a/browser/components/preferences/tests/privacypane_tests_perwindow.js b/browser/components/preferences/tests/privacypane_tests_perwindow.js
new file mode 100644
index 0000000000..8c376d1705
--- /dev/null
+++ b/browser/components/preferences/tests/privacypane_tests_perwindow.js
@@ -0,0 +1,388 @@
+// This file gets imported into the same scope as head.js.
+/* import-globals-from head.js */
+
+async function runTestOnPrivacyPrefPane(testFunc) {
+  info("runTestOnPrivacyPrefPane entered");
+  let tab = await BrowserTestUtils.openNewForegroundTab(
+    gBrowser,
+    "about:preferences",
+    true,
+    true
+  );
+  let browser = tab.linkedBrowser;
+  info("loaded about:preferences");
+  await browser.contentWindow.gotoPref("panePrivacy");
+  info("viewing privacy pane, executing testFunc");
+  await testFunc(browser.contentWindow);
+  BrowserTestUtils.removeTab(tab);
+}
+
+function controlChanged(element) {
+  element.doCommand();
+}
+
+// We can only test the panes that don't trigger a preference update
+function test_pane_visibility(win) {
+  let modes = {
+    remember: "historyRememberPane",
+    custom: "historyCustomPane",
+  };
+
+  let historymode = win.document.getElementById("historyMode");
+  ok(historymode, "history mode menulist should exist");
+  let historypane = win.document.getElementById("historyPane");
+  ok(historypane, "history mode pane should exist");
+
+  for (let mode in modes) {
+    historymode.value = mode;
+    controlChanged(historymode);
+    is(
+      historypane.selectedPanel,
+      win.document.getElementById(modes[mode]),
+      "The correct pane should be selected for the " + mode + " mode"
+    );
+    is_element_visible(
+      historypane.selectedPanel,
+      "Correct pane should be visible for the " + mode + " mode"
+    );
+  }
+}
+
+function test_dependent_elements(win) {
+  let historymode = win.document.getElementById("historyMode");
+  ok(historymode, "history mode menulist should exist");
+  let pbautostart = win.document.getElementById("privateBrowsingAutoStart");
+  ok(pbautostart, "the private browsing auto-start checkbox should exist");
+  let controls = [
+    win.document.getElementById("rememberHistory"),
+    win.document.getElementById("rememberForms"),
+    win.document.getElementById("deleteOnClose"),
+    win.document.getElementById("alwaysClear"),
+  ];
+  controls.forEach(function (control) {
+    ok(control, "the dependent controls should exist");
+  });
+  let independents = [
+    win.document.getElementById("contentBlockingBlockCookiesCheckbox"),
+  ];
+  independents.forEach(function (control) {
+    ok(control, "the independent controls should exist");
+  });
+  let cookieexceptions = win.document.getElementById("cookieExceptions");
+  ok(cookieexceptions, "the cookie exceptions button should exist");
+  let deleteOnCloseCheckbox = win.document.getElementById("deleteOnClose");
+  ok(deleteOnCloseCheckbox, "the delete on close checkbox should exist");
+  let alwaysclear = win.document.getElementById("alwaysClear");
+  ok(alwaysclear, "the clear data on close checkbox should exist");
+  let rememberhistory = win.document.getElementById("rememberHistory");
+  ok(rememberhistory, "the remember history checkbox should exist");
+  let rememberforms = win.document.getElementById("rememberForms");
+  ok(rememberforms, "the remember forms checkbox should exist");
+  let alwaysclearsettings = win.document.getElementById("clearDataSettings");
+  ok(alwaysclearsettings, "the clear data settings button should exist");
+
+  function expect_disabled(disabled) {
+    controls.forEach(function (control) {
+      is(
+        control.disabled,
+        disabled,
+        control.getAttribute("id") +
+          " should " +
+          (disabled ? "" : "not ") +
+          "be disabled"
+      );
+    });
+    if (disabled) {
+      ok(
+        !alwaysclear.checked,
+        "the clear data on close checkbox value should be as expected"
+      );
+      ok(
+        !rememberhistory.checked,
+        "the remember history checkbox value should be as expected"
+      );
+      ok(
+        !rememberforms.checked,
+        "the remember forms checkbox value should be as expected"
+      );
+    }
+  }
+  function check_independents(expected) {
+    independents.forEach(function (control) {
+      is(
+        control.disabled,
+        expected,
+        control.getAttribute("id") +
+          " should " +
+          (expected ? "" : "not ") +
+          "be disabled"
+      );
+    });
+
+    ok(
+      !cookieexceptions.disabled,
+      "the cookie exceptions button should never be disabled"
+    );
+    ok(
+      alwaysclearsettings.disabled,
+      "the clear data settings button should always be disabled"
+    );
+  }
+
+  // controls should only change in custom mode
+  historymode.value = "remember";
+  controlChanged(historymode);
+  expect_disabled(false);
+  check_independents(false);
+
+  // setting the mode to custom shouldn't change anything
+  historymode.value = "custom";
+  controlChanged(historymode);
+  expect_disabled(false);
+  check_independents(false);
+}
+
+function test_dependent_cookie_elements(win) {
+  let deleteOnCloseCheckbox = win.document.getElementById("deleteOnClose");
+  let deleteOnCloseNote = win.document.getElementById("deleteOnCloseNote");
+  let blockCookiesMenu = win.document.getElementById("blockCookiesMenu");
+
+  let controls = [blockCookiesMenu, deleteOnCloseCheckbox];
+  controls.forEach(function (control) {
+    ok(control, "the dependent cookie controls should exist");
+  });
+  let blockCookiesCheckbox = win.document.getElementById(
+    "contentBlockingBlockCookiesCheckbox"
+  );
+  ok(blockCookiesCheckbox, "the block cookies checkbox should exist");
+
+  function expect_disabled(disabled, c = controls) {
+    c.forEach(function (control) {
+      is(
+        control.disabled,
+        disabled,
+        control.getAttribute("id") +
+          " should " +
+          (disabled ? "" : "not ") +
+          "be disabled"
+      );
+    });
+  }
+
+  blockCookiesCheckbox.checked = true;
+  controlChanged(blockCookiesCheckbox);
+  expect_disabled(false);
+
+  blockCookiesCheckbox.checked = false;
+  controlChanged(blockCookiesCheckbox);
+  expect_disabled(true, [blockCookiesMenu]);
+  expect_disabled(false, [deleteOnCloseCheckbox]);
+  is_element_hidden(
+    deleteOnCloseNote,
+    "The notice for delete on close in permanent private browsing mode should be hidden."
+  );
+
+  blockCookiesMenu.value = "always";
+  controlChanged(blockCookiesMenu);
+  expect_disabled(true, [deleteOnCloseCheckbox]);
+  expect_disabled(false, [blockCookiesMenu]);
+  is_element_hidden(
+    deleteOnCloseNote,
+    "The notice for delete on close in permanent private browsing mode should be hidden."
+  );
+
+  if (win.contentBlockingCookiesAndSiteDataRejectTrackersEnabled) {
+    blockCookiesMenu.value = "trackers";
+  } else {
+    blockCookiesMenu.value = "unvisited";
+  }
+  controlChanged(blockCookiesMenu);
+  expect_disabled(false);
+
+  let historymode = win.document.getElementById("historyMode");
+
+  // The History mode setting for "never remember history" should still
+  // disable the "keep cookies until..." menu.
+  historymode.value = "dontremember";
+  controlChanged(historymode);
+  expect_disabled(true, [deleteOnCloseCheckbox]);
+  is_element_visible(
+    deleteOnCloseNote,
+    "The notice for delete on close in permanent private browsing mode should be visible."
+  );
+  expect_disabled(false, [blockCookiesMenu]);
+
+  historymode.value = "remember";
+  controlChanged(historymode);
+  expect_disabled(false);
+  is_element_hidden(
+    deleteOnCloseNote,
+    "The notice for delete on close in permanent private browsing mode should be hidden."
+  );
+}
+
+function test_dependent_clearonclose_elements(win) {
+  let historymode = win.document.getElementById("historyMode");
+  ok(historymode, "history mode menulist should exist");
+  let pbautostart = win.document.getElementById("privateBrowsingAutoStart");
+  ok(pbautostart, "the private browsing auto-start checkbox should exist");
+  let alwaysclear = win.document.getElementById("alwaysClear");
+  ok(alwaysclear, "the clear data on close checkbox should exist");
+  let alwaysclearsettings = win.document.getElementById("clearDataSettings");
+  ok(alwaysclearsettings, "the clear data settings button should exist");
+
+  function expect_disabled(disabled) {
+    is(
+      alwaysclearsettings.disabled,
+      disabled,
+      "the clear data settings should " +
+        (disabled ? "" : "not ") +
+        "be disabled"
+    );
+  }
+
+  historymode.value = "custom";
+  controlChanged(historymode);
+  pbautostart.checked = false;
+  controlChanged(pbautostart);
+  alwaysclear.checked = false;
+  controlChanged(alwaysclear);
+  expect_disabled(true);
+
+  alwaysclear.checked = true;
+  controlChanged(alwaysclear);
+  expect_disabled(false);
+
+  alwaysclear.checked = false;
+  controlChanged(alwaysclear);
+  expect_disabled(true);
+}
+
+async function test_dependent_prefs(win) {
+  let historymode = win.document.getElementById("historyMode");
+  ok(historymode, "history mode menulist should exist");
+  let controls = [
+    win.document.getElementById("rememberHistory"),
+    win.document.getElementById("rememberForms"),
+  ];
+  controls.forEach(function (control) {
+    ok(control, "the micro-management controls should exist");
+  });
+
+  function expect_checked(checked) {
+    controls.forEach(function (control) {
+      is(
+        control.checked,
+        checked,
+        control.getAttribute("id") +
+          " should " +
+          (checked ? "" : "not ") +
+          "be checked"
+      );
+    });
+  }
+
+  // controls should be checked in remember mode
+  historymode.value = "remember";
+  controlChanged(historymode);
+  // Initial updates from prefs are not sync, so wait:
+  await TestUtils.waitForCondition(
+    () => controls[0].getAttribute("checked") == "true"
+  );
+  expect_checked(true);
+
+  // even if they're unchecked in custom mode
+  historymode.value = "custom";
+  controlChanged(historymode);
+  controls.forEach(function (control) {
+    control.checked = false;
+    controlChanged(control);
+  });
+  expect_checked(false);
+  historymode.value = "remember";
+  controlChanged(historymode);
+  expect_checked(true);
+}
+
+function test_historymode_retention(mode, expect) {
+  return function test_historymode_retention_fn(win) {
+    let historymode = win.document.getElementById("historyMode");
+    ok(historymode, "history mode menulist should exist");
+
+    if (
+      (historymode.value == "remember" && mode == "dontremember") ||
+      (historymode.value == "dontremember" && mode == "remember") ||
+      (historymode.value == "custom" && mode == "dontremember")
+    ) {
+      return;
+    }
+
+    if (expect !== undefined) {
+      is(
+        historymode.value,
+        expect,
+        "history mode is expected to remain " + expect
+      );
+    }
+
+    historymode.value = mode;
+    controlChanged(historymode);
+  };
+}
+
+function test_custom_retention(controlToChange, expect, valueIncrement) {
+  return function test_custom_retention_fn(win) {
+    let historymode = win.document.getElementById("historyMode");
+    ok(historymode, "history mode menulist should exist");
+
+    if (expect !== undefined) {
+      is(
+        historymode.value,
+        expect,
+        "history mode is expected to remain " + expect
+      );
+    }
+
+    historymode.value = "custom";
+    controlChanged(historymode);
+
+    controlToChange = win.document.getElementById(controlToChange);
+    ok(controlToChange, "the control to change should exist");
+    switch (controlToChange.localName) {
+      case "checkbox":
+        controlToChange.checked = !controlToChange.checked;
+        break;
+      case "menulist":
+        controlToChange.value = valueIncrement;
+        break;
+    }
+    controlChanged(controlToChange);
+  };
+}
+
+const gPrefCache = new Map();
+
+function cache_preferences(win) {
+  let prefs = win.Preferences.getAll();
+  for (let pref of prefs) {
+    gPrefCache.set(pref.id, pref.value);
+  }
+}
+
+function reset_preferences(win) {
+  let prefs = win.Preferences.getAll();
+  // Avoid assigning undefined, which means clearing a "user"/test pref value
+  for (let pref of prefs) {
+    if (gPrefCache.has(pref.id)) {
+      pref.value = gPrefCache.get(pref.id);
+    }
+  }
+}
+
+function run_test_subset(subset) {
+  info("subset: " + Array.from(subset, x => x.name).join(",") + "\n");
+  let tests = [cache_preferences, ...subset, reset_preferences];
+  for (let test of tests) {
+    add_task(runTestOnPrivacyPrefPane.bind(undefined, test));
+  }
+}
diff --git a/browser/components/preferences/tests/siteData/browser.toml b/browser/components/preferences/tests/siteData/browser.toml
new file mode 100644
index 0000000000..9f4f8306e1
--- /dev/null
+++ b/browser/components/preferences/tests/siteData/browser.toml
@@ -0,0 +1,24 @@
+[DEFAULT]
+support-files = [
+  "head.js",
+  "site_data_test.html",
+  "service_worker_test.html",
+  "service_worker_test.js",
+  "offline/offline.html",
+  "offline/manifest.appcache",
+]
+
+["browser_clearSiteData.js"]
+
+["browser_siteData.js"]
+
+["browser_siteData2.js"]
+skip-if = [
+  "win11_2009 && (!debug && !asan)", # Bug 1797751
+  "apple_catalina && debug", # Bug 1775910
+]
+
+["browser_siteData3.js"]
+
+["browser_siteData_multi_select.js"]
+skip-if = ["tsan"] # Bug 1683730
diff --git a/browser/components/preferences/tests/siteData/browser_clearSiteData.js b/browser/components/preferences/tests/siteData/browser_clearSiteData.js
new file mode 100644
index 0000000000..ad1d27bfe2
--- /dev/null
+++ b/browser/components/preferences/tests/siteData/browser_clearSiteData.js
@@ -0,0 +1,243 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+const { PermissionTestUtils } = ChromeUtils.importESModule(
+  "resource://testing-common/PermissionTestUtils.sys.mjs"
+);
+
+let useOldClearHistoryDialog = Services.prefs.getBoolPref(
+  "privacy.sanitize.useOldClearHistoryDialog"
+);
+
+async function testClearData(clearSiteData, clearCache) {
+  PermissionTestUtils.add(
+    TEST_QUOTA_USAGE_ORIGIN,
+    "persistent-storage",
+    Services.perms.ALLOW_ACTION
+  );
+
+  // Open a test site which saves into appcache.
+  await BrowserTestUtils.openNewForegroundTab(gBrowser, TEST_OFFLINE_URL);
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+
+  // Fill indexedDB with test data.
+  // Don't wait for the page to load, to register the content event handler as quickly as possible.
+  // If this test goes intermittent, we might have to tell the page to wait longer before
+  // firing the event.
+  BrowserTestUtils.openNewForegroundTab(gBrowser, TEST_QUOTA_USAGE_URL, false);
+  await BrowserTestUtils.waitForContentEvent(
+    gBrowser.selectedBrowser,
+    "test-indexedDB-done",
+    false,
+    null,
+    true
+  );
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+
+  // Register some service workers.
+  await loadServiceWorkerTestPage(TEST_SERVICE_WORKER_URL);
+  await promiseServiceWorkerRegisteredFor(TEST_SERVICE_WORKER_URL);
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+
+  // Test the initial states.
+  let cacheUsage = await SiteDataManager.getCacheSize();
+  let quotaUsage = await SiteDataTestUtils.getQuotaUsage(
+    TEST_QUOTA_USAGE_ORIGIN
+  );
+  let totalUsage = await SiteDataManager.getTotalUsage();
+  Assert.greater(cacheUsage, 0, "The cache usage should not be 0");
+  Assert.greater(quotaUsage, 0, "The quota usage should not be 0");
+  Assert.greater(totalUsage, 0, "The total usage should not be 0");
+
+  let initialSizeLabelValue = await SpecialPowers.spawn(
+    gBrowser.selectedBrowser,
+    [],
+    async function () {
+      let sizeLabel = content.document.getElementById("totalSiteDataSize");
+      return sizeLabel.textContent;
+    }
+  );
+
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let clearSiteDataButton = doc.getElementById("clearSiteDataButton");
+
+  let url = useOldClearHistoryDialog
+    ? "chrome://browser/content/preferences/dialogs/clearSiteData.xhtml"
+    : "chrome://browser/content/sanitize_v2.xhtml";
+  let dialogOpened = promiseLoadSubDialog(url);
+  clearSiteDataButton.doCommand();
+  let dialogWin = await dialogOpened;
+
+  // Convert the usage numbers in the same way the UI does it to assert
+  // that they're displayed in the dialog.
+  let [convertedTotalUsage] = DownloadUtils.convertByteUnits(totalUsage);
+  // For cache we just assert that the right unit (KB, probably) is displayed,
+  // since we've had cache intermittently changing under our feet.
+  let [, convertedCacheUnit] = DownloadUtils.convertByteUnits(cacheUsage);
+
+  let cookiesCheckboxId = useOldClearHistoryDialog
+    ? "clearSiteData"
+    : "cookiesAndStorage";
+  let cacheCheckboxId = useOldClearHistoryDialog ? "clearCache" : "cache";
+  let clearSiteDataCheckbox =
+    dialogWin.document.getElementById(cookiesCheckboxId);
+  let clearCacheCheckbox = dialogWin.document.getElementById(cacheCheckboxId);
+  // The usage details are filled asynchronously, so we assert that they're present by
+  // waiting for them to be filled in.
+  await Promise.all([
+    TestUtils.waitForCondition(
+      () =>
+        clearSiteDataCheckbox.label &&
+        clearSiteDataCheckbox.label.includes(convertedTotalUsage),
+      "Should show the quota usage"
+    ),
+    TestUtils.waitForCondition(
+      () =>
+        clearCacheCheckbox.label &&
+        clearCacheCheckbox.label.includes(convertedCacheUnit),
+      "Should show the cache usage"
+    ),
+  ]);
+
+  // Check the boxes according to our test input.
+  clearSiteDataCheckbox.checked = clearSiteData;
+  clearCacheCheckbox.checked = clearCache;
+
+  if (!useOldClearHistoryDialog) {
+    // The new clear history dialog has a seperate checkbox for site settings
+    let siteSettingsCheckbox =
+      dialogWin.document.getElementById("siteSettings");
+    siteSettingsCheckbox.checked = clearSiteData;
+    // select clear everything to match the old dialog boxes behaviour for this test
+    let timespanSelection = dialogWin.document.getElementById(
+      "sanitizeDurationChoice"
+    );
+    timespanSelection.value = 0;
+  }
+  // Some additional promises/assertions to wait for
+  // when deleting site data.
+  let acceptPromise;
+  let updatePromise;
+  let cookiesClearedPromise;
+  if (clearSiteData) {
+    // the new clear history dialog does not have a extra prompt
+    // to clear site data after clicking clear
+    if (useOldClearHistoryDialog) {
+      acceptPromise = BrowserTestUtils.promiseAlertDialogOpen("accept");
+    }
+    updatePromise = promiseSiteDataManagerSitesUpdated();
+    cookiesClearedPromise = promiseCookiesCleared();
+  }
+
+  let dialogClosed = BrowserTestUtils.waitForEvent(dialogWin, "unload");
+
+  let clearButton = dialogWin.document
+    .querySelector("dialog")
+    .getButton("accept");
+  if (!clearSiteData && !clearCache) {
+    // Simulate user input on one of the checkboxes to trigger the event listener for
+    // disabling the clearButton.
+    clearCacheCheckbox.doCommand();
+    // Check that the clearButton gets disabled by unchecking both options.
+    await TestUtils.waitForCondition(
+      () => clearButton.disabled,
+      "Clear button should be disabled"
+    );
+    let cancelButton = dialogWin.document
+      .querySelector("dialog")
+      .getButton("cancel");
+    // Cancel, since we can't delete anything.
+    cancelButton.click();
+  } else {
+    // Delete stuff!
+    clearButton.click();
+  }
+
+  // For site data we display an extra warning dialog, make sure
+  // to accept it.
+  if (clearSiteData && useOldClearHistoryDialog) {
+    await acceptPromise;
+  }
+
+  await dialogClosed;
+
+  if (clearCache) {
+    TestUtils.waitForCondition(async function () {
+      let usage = await SiteDataManager.getCacheSize();
+      return usage == 0;
+    }, "The cache usage should be removed");
+  } else {
+    Assert.greater(
+      await SiteDataManager.getCacheSize(),
+      0,
+      "The cache usage should not be 0"
+    );
+  }
+
+  if (clearSiteData) {
+    await updatePromise;
+    await cookiesClearedPromise;
+    await promiseServiceWorkersCleared();
+
+    TestUtils.waitForCondition(async function () {
+      let usage = await SiteDataManager.getTotalUsage();
+      return usage == 0;
+    }, "The total usage should be removed");
+  } else {
+    quotaUsage = await SiteDataTestUtils.getQuotaUsage(TEST_QUOTA_USAGE_ORIGIN);
+    totalUsage = await SiteDataManager.getTotalUsage();
+    Assert.greater(quotaUsage, 0, "The quota usage should not be 0");
+    Assert.greater(totalUsage, 0, "The total usage should not be 0");
+  }
+
+  if (clearCache || clearSiteData) {
+    // Check that the size label in about:preferences updates after we cleared data.
+    await SpecialPowers.spawn(
+      gBrowser.selectedBrowser,
+      [{ initialSizeLabelValue }],
+      async function (opts) {
+        let sizeLabel = content.document.getElementById("totalSiteDataSize");
+        await ContentTaskUtils.waitForCondition(
+          () => sizeLabel.textContent != opts.initialSizeLabelValue,
+          "Site data size label should have updated."
+        );
+      }
+    );
+  }
+
+  let permission = PermissionTestUtils.getPermissionObject(
+    TEST_QUOTA_USAGE_ORIGIN,
+    "persistent-storage"
+  );
+  is(
+    clearSiteData ? permission : permission.capability,
+    clearSiteData ? null : Services.perms.ALLOW_ACTION,
+    "Should have the correct permission state."
+  );
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+  await SiteDataManager.removeAll();
+}
+
+// Test opening the "Clear All Data" dialog and cancelling.
+add_task(async function () {
+  await testClearData(false, false);
+});
+
+// Test opening the "Clear All Data" dialog and removing all site data.
+add_task(async function () {
+  await testClearData(true, false);
+});
+
+// Test opening the "Clear All Data" dialog and removing all cache.
+add_task(async function () {
+  await testClearData(false, true);
+});
+
+// Test opening the "Clear All Data" dialog and removing everything.
+add_task(async function () {
+  await testClearData(true, true);
+});
diff --git a/browser/components/preferences/tests/siteData/browser_siteData.js b/browser/components/preferences/tests/siteData/browser_siteData.js
new file mode 100644
index 0000000000..9c421ed295
--- /dev/null
+++ b/browser/components/preferences/tests/siteData/browser_siteData.js
@@ -0,0 +1,395 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+function getPersistentStoragePermStatus(origin) {
+  let uri = Services.io.newURI(origin);
+  let principal = Services.scriptSecurityManager.createContentPrincipal(
+    uri,
+    {}
+  );
+  return Services.perms.testExactPermissionFromPrincipal(
+    principal,
+    "persistent-storage"
+  );
+}
+
+// Test listing site using quota usage or site using appcache
+// This is currently disabled because of bug 1414751.
+add_task(async function () {
+  // Open a test site which would save into appcache
+  await BrowserTestUtils.openNewForegroundTab(gBrowser, TEST_OFFLINE_URL);
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+
+  // Open a test site which would save into quota manager
+  BrowserTestUtils.openNewForegroundTab(gBrowser, TEST_QUOTA_USAGE_URL);
+  await BrowserTestUtils.waitForContentEvent(
+    gBrowser.selectedBrowser,
+    "test-indexedDB-done",
+    false,
+    null,
+    true
+  );
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+
+  let updatedPromise = promiseSiteDataManagerSitesUpdated();
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  await updatedPromise;
+  await openSiteDataSettingsDialog();
+  let dialog = content.gSubDialog._topDialog;
+  let dialogFrame = dialog._frame;
+  let frameDoc = dialogFrame.contentDocument;
+
+  let siteItems = frameDoc.getElementsByTagName("richlistitem");
+  is(siteItems.length, 2, "Should list sites using quota usage or appcache");
+
+  let appcacheSite = frameDoc.querySelector(
+    `richlistitem[host="${TEST_OFFLINE_HOST}"]`
+  );
+  ok(appcacheSite, "Should list site using appcache");
+
+  let qoutaUsageSite = frameDoc.querySelector(
+    `richlistitem[host="${TEST_QUOTA_USAGE_HOST}"]`
+  );
+  ok(qoutaUsageSite, "Should list site using quota usage");
+
+  // Always remember to clean up
+  await new Promise(resolve => {
+    let principal =
+      Services.scriptSecurityManager.createContentPrincipalFromOrigin(
+        TEST_QUOTA_USAGE_ORIGIN
+      );
+    let request = Services.qms.clearStoragesForOriginPrefix(principal);
+    request.callback = resolve;
+  });
+
+  await SiteDataManager.removeAll();
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+}).skip(); // Bug 1414751
+
+// Test buttons are disabled and loading message shown while updating sites
+add_task(async function () {
+  let updatedPromise = promiseSiteDataManagerSitesUpdated();
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  await updatedPromise;
+  let cacheSize = await SiteDataManager.getCacheSize();
+
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let clearBtn = doc.getElementById("clearSiteDataButton");
+  let settingsButton = doc.getElementById("siteDataSettings");
+  let totalSiteDataSizeLabel = doc.getElementById("totalSiteDataSize");
+  is(
+    clearBtn.disabled,
+    false,
+    "Should enable clear button after sites updated"
+  );
+  is(
+    settingsButton.disabled,
+    false,
+    "Should enable settings button after sites updated"
+  );
+  await SiteDataManager.getTotalUsage().then(usage => {
+    let [value, unit] = DownloadUtils.convertByteUnits(usage + cacheSize);
+    Assert.deepEqual(
+      doc.l10n.getAttributes(totalSiteDataSizeLabel),
+      {
+        id: "sitedata-total-size",
+        args: { value, unit },
+      },
+      "Should show the right total site data size"
+    );
+  });
+
+  Services.obs.notifyObservers(null, "sitedatamanager:updating-sites");
+  is(
+    clearBtn.disabled,
+    true,
+    "Should disable clear button while updating sites"
+  );
+  is(
+    settingsButton.disabled,
+    true,
+    "Should disable settings button while updating sites"
+  );
+  Assert.deepEqual(
+    doc.l10n.getAttributes(totalSiteDataSizeLabel),
+    {
+      id: "sitedata-total-size-calculating",
+      args: null,
+    },
+    "Should show the loading message while updating"
+  );
+
+  Services.obs.notifyObservers(null, "sitedatamanager:sites-updated");
+  is(
+    clearBtn.disabled,
+    false,
+    "Should enable clear button after sites updated"
+  );
+  is(
+    settingsButton.disabled,
+    false,
+    "Should enable settings button after sites updated"
+  );
+  cacheSize = await SiteDataManager.getCacheSize();
+  await SiteDataManager.getTotalUsage().then(usage => {
+    let [value, unit] = DownloadUtils.convertByteUnits(usage + cacheSize);
+    Assert.deepEqual(
+      doc.l10n.getAttributes(totalSiteDataSizeLabel),
+      {
+        id: "sitedata-total-size",
+        args: { value, unit },
+      },
+      "Should show the right total site data size"
+    );
+  });
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+// Test clearing service worker through the settings panel
+add_task(async function () {
+  // Register a test service worker
+  await loadServiceWorkerTestPage(TEST_SERVICE_WORKER_URL);
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  // Test the initial states
+  await promiseServiceWorkerRegisteredFor(TEST_SERVICE_WORKER_URL);
+  // Open the Site Data Settings panel and remove the site
+  await openSiteDataSettingsDialog();
+  let acceptRemovePromise = BrowserTestUtils.promiseAlertDialogOpen("accept");
+  let updatePromise = promiseSiteDataManagerSitesUpdated();
+  SpecialPowers.spawn(
+    gBrowser.selectedBrowser,
+    [{ TEST_OFFLINE_HOST }],
+    args => {
+      let host = args.TEST_OFFLINE_HOST;
+      let frameDoc = content.gSubDialog._topDialog._frame.contentDocument;
+      let sitesList = frameDoc.getElementById("sitesList");
+      let site = sitesList.querySelector(`richlistitem[host="${host}"]`);
+      if (site) {
+        let removeBtn = frameDoc.getElementById("removeSelected");
+        let saveBtn = frameDoc.querySelector("dialog").getButton("accept");
+        site.click();
+        removeBtn.doCommand();
+        saveBtn.doCommand();
+      } else {
+        ok(false, `Should have one site of ${host}`);
+      }
+    }
+  );
+  await acceptRemovePromise;
+  await updatePromise;
+  await promiseServiceWorkersCleared();
+  await SiteDataManager.removeAll();
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+// Test showing and removing sites with cookies.
+add_task(async function () {
+  // Add some test cookies.
+  let uri = Services.io.newURI("https://example.com");
+  let uri2 = Services.io.newURI("https://example.org");
+  Services.cookies.add(
+    uri.host,
+    uri.pathQueryRef,
+    "test1",
+    "1",
+    false,
+    false,
+    false,
+    Date.now() + 1000 * 60 * 60,
+    {},
+    Ci.nsICookie.SAMESITE_NONE,
+    Ci.nsICookie.SCHEME_HTTPS
+  );
+  Services.cookies.add(
+    uri.host,
+    uri.pathQueryRef,
+    "test2",
+    "2",
+    false,
+    false,
+    false,
+    Date.now() + 1000 * 60 * 60,
+    {},
+    Ci.nsICookie.SAMESITE_NONE,
+    Ci.nsICookie.SCHEME_HTTPS
+  );
+  Services.cookies.add(
+    uri2.host,
+    uri2.pathQueryRef,
+    "test1",
+    "1",
+    false,
+    false,
+    false,
+    Date.now() + 1000 * 60 * 60,
+    {},
+    Ci.nsICookie.SAMESITE_NONE,
+    Ci.nsICookie.SCHEME_HTTPS
+  );
+
+  // Ensure that private browsing cookies are ignored.
+  Services.cookies.add(
+    uri.host,
+    uri.pathQueryRef,
+    "test3",
+    "3",
+    false,
+    false,
+    false,
+    Date.now() + 1000 * 60 * 60,
+    { privateBrowsingId: 1 },
+    Ci.nsICookie.SAMESITE_NONE,
+    Ci.nsICookie.SCHEME_HTTPS
+  );
+
+  // Get the exact creation date from the cookies (to avoid intermittents
+  // from minimal time differences, since we round up to minutes).
+  let cookies1 = Services.cookies.getCookiesFromHost(uri.host, {});
+  let cookies2 = Services.cookies.getCookiesFromHost(uri2.host, {});
+  // We made two valid cookies for example.com.
+  let cookie1 = cookies1[1];
+  let cookie2 = cookies2[0];
+
+  let fullFormatter = new Services.intl.DateTimeFormat(undefined, {
+    dateStyle: "short",
+    timeStyle: "short",
+  });
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+
+  // Open the site data manager and remove one site.
+  await openSiteDataSettingsDialog();
+  let creationDate1 = new Date(cookie1.lastAccessed / 1000);
+  let creationDate1Formatted = fullFormatter.format(creationDate1);
+  let creationDate2 = new Date(cookie2.lastAccessed / 1000);
+  let creationDate2Formatted = fullFormatter.format(creationDate2);
+  let removeDialogOpenPromise = BrowserTestUtils.promiseAlertDialogOpen(
+    "accept",
+    REMOVE_DIALOG_URL
+  );
+  await SpecialPowers.spawn(
+    gBrowser.selectedBrowser,
+    [
+      {
+        creationDate1Formatted,
+        creationDate2Formatted,
+      },
+    ],
+    function (args) {
+      let frameDoc = content.gSubDialog._topDialog._frame.contentDocument;
+
+      let siteItems = frameDoc.getElementsByTagName("richlistitem");
+      is(siteItems.length, 2, "Should list two sites with cookies");
+      let sitesList = frameDoc.getElementById("sitesList");
+      let site1 = sitesList.querySelector(`richlistitem[host="example.com"]`);
+      let site2 = sitesList.querySelector(`richlistitem[host="example.org"]`);
+
+      let columns = site1.querySelectorAll(".item-box > label");
+      let boxes = site1.querySelectorAll(".item-box");
+      is(columns[0].value, "example.com", "Should show the correct host.");
+      is(columns[1].value, "2", "Should show the correct number of cookies.");
+      is(columns[2].value, "", "Should show no site data.");
+      is(
+        /(now|second)/.test(columns[3].value),
+        true,
+        "Should show the relative date."
+      );
+      is(
+        boxes[3].getAttribute("tooltiptext"),
+        args.creationDate1Formatted,
+        "Should show the correct date."
+      );
+
+      columns = site2.querySelectorAll(".item-box > label");
+      boxes = site2.querySelectorAll(".item-box");
+      is(columns[0].value, "example.org", "Should show the correct host.");
+      is(columns[1].value, "1", "Should show the correct number of cookies.");
+      is(columns[2].value, "", "Should show no site data.");
+      is(
+        /(now|second)/.test(columns[3].value),
+        true,
+        "Should show the relative date."
+      );
+      is(
+        boxes[3].getAttribute("tooltiptext"),
+        args.creationDate2Formatted,
+        "Should show the correct date."
+      );
+
+      let removeBtn = frameDoc.getElementById("removeSelected");
+      let saveBtn = frameDoc.querySelector("dialog").getButton("accept");
+      site2.click();
+      removeBtn.doCommand();
+      saveBtn.doCommand();
+    }
+  );
+  await removeDialogOpenPromise;
+
+  await TestUtils.waitForCondition(
+    () => Services.cookies.countCookiesFromHost(uri2.host) == 0,
+    "Cookies from the first host should be cleared"
+  );
+  is(
+    Services.cookies.countCookiesFromHost(uri.host),
+    2,
+    "Cookies from the second host should not be cleared"
+  );
+
+  // Open the site data manager and remove another site.
+  await openSiteDataSettingsDialog();
+  let acceptRemovePromise = BrowserTestUtils.promiseAlertDialogOpen("accept");
+  await SpecialPowers.spawn(
+    gBrowser.selectedBrowser,
+    [{ creationDate1Formatted }],
+    function (args) {
+      let frameDoc = content.gSubDialog._topDialog._frame.contentDocument;
+
+      let siteItems = frameDoc.getElementsByTagName("richlistitem");
+      is(siteItems.length, 1, "Should list one site with cookies");
+      let sitesList = frameDoc.getElementById("sitesList");
+      let site1 = sitesList.querySelector(`richlistitem[host="example.com"]`);
+
+      let columns = site1.querySelectorAll(".item-box > label");
+      let boxes = site1.querySelectorAll(".item-box");
+      is(columns[0].value, "example.com", "Should show the correct host.");
+      is(columns[1].value, "2", "Should show the correct number of cookies.");
+      is(columns[2].value, "", "Should show no site data.");
+      is(
+        /(now|second)/.test(columns[3].value),
+        true,
+        "Should show the relative date."
+      );
+      is(
+        boxes[3].getAttribute("tooltiptext"),
+        args.creationDate1Formatted,
+        "Should show the correct date."
+      );
+
+      let removeBtn = frameDoc.getElementById("removeSelected");
+      let saveBtn = frameDoc.querySelector("dialog").getButton("accept");
+      site1.click();
+      removeBtn.doCommand();
+      saveBtn.doCommand();
+    }
+  );
+  await acceptRemovePromise;
+
+  await TestUtils.waitForCondition(
+    () => Services.cookies.countCookiesFromHost(uri.host) == 0,
+    "Cookies from the second host should be cleared"
+  );
+
+  await openSiteDataSettingsDialog();
+
+  await SpecialPowers.spawn(gBrowser.selectedBrowser, [], function () {
+    let frameDoc = content.gSubDialog._topDialog._frame.contentDocument;
+
+    let siteItems = frameDoc.getElementsByTagName("richlistitem");
+    is(siteItems.length, 0, "Should list no sites with cookies");
+  });
+
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/siteData/browser_siteData2.js b/browser/components/preferences/tests/siteData/browser_siteData2.js
new file mode 100644
index 0000000000..863a8dcefe
--- /dev/null
+++ b/browser/components/preferences/tests/siteData/browser_siteData2.js
@@ -0,0 +1,475 @@
+"use strict";
+
+function assertAllSitesNotListed(win) {
+  let frameDoc = win.gSubDialog._topDialog._frame.contentDocument;
+  let removeBtn = frameDoc.getElementById("removeSelected");
+  let removeAllBtn = frameDoc.getElementById("removeAll");
+  let sitesList = frameDoc.getElementById("sitesList");
+  let sites = sitesList.getElementsByTagName("richlistitem");
+  is(sites.length, 0, "Should not list all sites");
+  is(removeBtn.disabled, true, "Should disable the removeSelected button");
+  is(removeAllBtn.disabled, true, "Should disable the removeAllBtn button");
+}
+
+// Test selecting and removing all sites one by one
+add_task(async function test_selectRemove() {
+  let hosts = await addTestData([
+    {
+      usage: 1024,
+      origin: "https://account.xyz.com",
+      persisted: true,
+    },
+    {
+      usage: 1024,
+      origin: "https://shopping.xyz.com",
+    },
+    {
+      usage: 1024,
+      origin: "http://cinema.bar.com",
+      persisted: true,
+    },
+    {
+      usage: 1024,
+      origin: "http://email.bar.com",
+    },
+  ]);
+
+  let updatePromise = promiseSiteDataManagerSitesUpdated();
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  await updatePromise;
+  await openSiteDataSettingsDialog();
+
+  let win = gBrowser.selectedBrowser.contentWindow;
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let frameDoc = null;
+  let saveBtn = null;
+  let cancelBtn = null;
+  let settingsDialogClosePromise = null;
+
+  // Test the initial state
+  assertSitesListed(doc, hosts);
+
+  // Test the "Cancel" button
+  settingsDialogClosePromise = promiseSettingsDialogClose();
+  frameDoc = win.gSubDialog._topDialog._frame.contentDocument;
+  cancelBtn = frameDoc.querySelector("dialog").getButton("cancel");
+  removeAllSitesOneByOne();
+  assertAllSitesNotListed(win);
+  cancelBtn.doCommand();
+  await settingsDialogClosePromise;
+  await openSiteDataSettingsDialog();
+  assertSitesListed(doc, hosts);
+
+  // Test the "Save Changes" button but cancelling save
+  let cancelPromise = BrowserTestUtils.promiseAlertDialogOpen("cancel");
+  settingsDialogClosePromise = promiseSettingsDialogClose();
+  frameDoc = win.gSubDialog._topDialog._frame.contentDocument;
+  saveBtn = frameDoc.querySelector("dialog").getButton("accept");
+  cancelBtn = frameDoc.querySelector("dialog").getButton("cancel");
+  removeAllSitesOneByOne();
+  assertAllSitesNotListed(win);
+  saveBtn.doCommand();
+  await cancelPromise;
+  cancelBtn.doCommand();
+  await settingsDialogClosePromise;
+  await openSiteDataSettingsDialog();
+  assertSitesListed(doc, hosts);
+
+  // Test the "Save Changes" button and accepting save
+  let acceptPromise = BrowserTestUtils.promiseAlertDialogOpen("accept");
+  settingsDialogClosePromise = promiseSettingsDialogClose();
+  updatePromise = promiseSiteDataManagerSitesUpdated();
+  frameDoc = win.gSubDialog._topDialog._frame.contentDocument;
+  saveBtn = frameDoc.querySelector("dialog").getButton("accept");
+  removeAllSitesOneByOne();
+  assertAllSitesNotListed(win);
+  saveBtn.doCommand();
+  await acceptPromise;
+  await settingsDialogClosePromise;
+  await updatePromise;
+  await openSiteDataSettingsDialog();
+  assertAllSitesNotListed(win);
+
+  await SiteDataTestUtils.clear();
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+
+  function removeAllSitesOneByOne() {
+    frameDoc = win.gSubDialog._topDialog._frame.contentDocument;
+    let removeBtn = frameDoc.getElementById("removeSelected");
+    let sitesList = frameDoc.getElementById("sitesList");
+    let sites = sitesList.getElementsByTagName("richlistitem");
+    for (let i = sites.length - 1; i >= 0; --i) {
+      sites[i].click();
+      removeBtn.doCommand();
+    }
+  }
+});
+
+// Test selecting and removing partial sites
+add_task(async function test_removePartialSites() {
+  let hosts = await addTestData([
+    {
+      usage: 1024,
+      origin: "https://account.xyz.com",
+      persisted: true,
+    },
+    {
+      usage: 1024,
+      origin: "https://shopping.xyz.com",
+      persisted: false,
+    },
+    {
+      usage: 1024,
+      origin: "http://cinema.bar.com",
+      persisted: true,
+    },
+    {
+      usage: 1024,
+      origin: "http://email.bar.com",
+      persisted: false,
+    },
+    {
+      usage: 1024,
+      origin: "https://s3-us-west-2.amazonaws.com",
+      persisted: true,
+    },
+    {
+      usage: 1024,
+      origin: "https://127.0.0.1",
+      persisted: false,
+    },
+  ]);
+
+  let updatePromise = promiseSiteDataManagerSitesUpdated();
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  await updatePromise;
+  await openSiteDataSettingsDialog();
+
+  let win = gBrowser.selectedBrowser.contentWindow;
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let frameDoc = null;
+  let saveBtn = null;
+  let cancelBtn = null;
+  let removeDialogOpenPromise = null;
+  let settingsDialogClosePromise = null;
+
+  // Test the initial state
+  assertSitesListed(doc, hosts);
+
+  // Test the "Cancel" button
+  settingsDialogClosePromise = promiseSettingsDialogClose();
+  frameDoc = win.gSubDialog._topDialog._frame.contentDocument;
+  cancelBtn = frameDoc.querySelector("dialog").getButton("cancel");
+  await removeSelectedSite(hosts.slice(0, 2));
+  assertSitesListed(doc, hosts.slice(2));
+  cancelBtn.doCommand();
+  await settingsDialogClosePromise;
+  await openSiteDataSettingsDialog();
+  assertSitesListed(doc, hosts);
+
+  // Test the "Save Changes" button but canceling save
+  removeDialogOpenPromise = BrowserTestUtils.promiseAlertDialogOpen(
+    "cancel",
+    REMOVE_DIALOG_URL
+  );
+  settingsDialogClosePromise = promiseSettingsDialogClose();
+  frameDoc = win.gSubDialog._topDialog._frame.contentDocument;
+  saveBtn = frameDoc.querySelector("dialog").getButton("accept");
+  cancelBtn = frameDoc.querySelector("dialog").getButton("cancel");
+  await removeSelectedSite(hosts.slice(0, 2));
+  assertSitesListed(doc, hosts.slice(2));
+  saveBtn.doCommand();
+  await removeDialogOpenPromise;
+  cancelBtn.doCommand();
+  await settingsDialogClosePromise;
+  await openSiteDataSettingsDialog();
+  assertSitesListed(doc, hosts);
+
+  // Test the "Save Changes" button and accepting save
+  removeDialogOpenPromise = BrowserTestUtils.promiseAlertDialogOpen(
+    "accept",
+    REMOVE_DIALOG_URL
+  );
+  settingsDialogClosePromise = promiseSettingsDialogClose();
+  frameDoc = win.gSubDialog._topDialog._frame.contentDocument;
+  saveBtn = frameDoc.querySelector("dialog").getButton("accept");
+  await removeSelectedSite(hosts.slice(0, 2));
+  assertSitesListed(doc, hosts.slice(2));
+  saveBtn.doCommand();
+  await removeDialogOpenPromise;
+  await settingsDialogClosePromise;
+  await openSiteDataSettingsDialog();
+  assertSitesListed(doc, hosts.slice(2));
+
+  await SiteDataTestUtils.clear();
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+
+  function removeSelectedSite(removeHosts) {
+    frameDoc = win.gSubDialog._topDialog._frame.contentDocument;
+    let removeBtn = frameDoc.getElementById("removeSelected");
+    is(
+      removeBtn.disabled,
+      true,
+      "Should start with disabled removeSelected button"
+    );
+    let sitesList = frameDoc.getElementById("sitesList");
+    removeHosts.forEach(host => {
+      let site = sitesList.querySelector(`richlistitem[host="${host}"]`);
+      if (site) {
+        site.click();
+        let currentSelectedIndex = sitesList.selectedIndex;
+        is(
+          removeBtn.disabled,
+          false,
+          "Should enable the removeSelected button"
+        );
+        removeBtn.doCommand();
+        let newSelectedIndex = sitesList.selectedIndex;
+        if (currentSelectedIndex >= sitesList.itemCount) {
+          is(newSelectedIndex, currentSelectedIndex - 1);
+        } else {
+          is(newSelectedIndex, currentSelectedIndex);
+        }
+      } else {
+        ok(false, `Should not select and remove inexistent site of ${host}`);
+      }
+    });
+  }
+});
+
+// Test searching and then removing only visible sites
+add_task(async function () {
+  let hosts = await addTestData([
+    {
+      usage: 1024,
+      origin: "https://account.xyz.com",
+      persisted: true,
+    },
+    {
+      usage: 1024,
+      origin: "https://shopping.xyz.com",
+      persisted: false,
+    },
+    {
+      usage: 1024,
+      origin: "http://cinema.bar.com",
+      persisted: true,
+    },
+    {
+      usage: 1024,
+      origin: "http://email.bar.com",
+      persisted: false,
+    },
+  ]);
+
+  let updatePromise = promiseSiteDataManagerSitesUpdated();
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  await updatePromise;
+  await openSiteDataSettingsDialog();
+
+  // Search "foo" to only list foo.com sites
+  let win = gBrowser.selectedBrowser.contentWindow;
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let frameDoc = win.gSubDialog._topDialog._frame.contentDocument;
+  let searchBox = frameDoc.getElementById("searchBox");
+  searchBox.value = "xyz";
+  searchBox.doCommand();
+  assertSitesListed(
+    doc,
+    hosts.filter(host => host.includes("xyz"))
+  );
+
+  // Test only removing all visible sites listed
+  updatePromise = promiseSiteDataManagerSitesUpdated();
+  let acceptRemovePromise = BrowserTestUtils.promiseAlertDialogOpen(
+    "accept",
+    REMOVE_DIALOG_URL
+  );
+  let settingsDialogClosePromise = promiseSettingsDialogClose();
+  let removeAllBtn = frameDoc.getElementById("removeAll");
+  let saveBtn = frameDoc.querySelector("dialog").getButton("accept");
+  removeAllBtn.doCommand();
+  saveBtn.doCommand();
+  await acceptRemovePromise;
+  await settingsDialogClosePromise;
+  await updatePromise;
+  await openSiteDataSettingsDialog();
+  assertSitesListed(
+    doc,
+    hosts.filter(host => !host.includes("xyz"))
+  );
+
+  await SiteDataTestUtils.clear();
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+// Test dynamically clearing all site data
+add_task(async function () {
+  let hosts = await addTestData([
+    {
+      usage: 1024,
+      origin: "https://account.xyz.com",
+      persisted: true,
+    },
+    {
+      usage: 1024,
+      origin: "https://shopping.xyz.com",
+      persisted: false,
+    },
+  ]);
+
+  let updatePromise = promiseSiteDataManagerSitesUpdated();
+
+  // Test the initial state
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  await updatePromise;
+  await openSiteDataSettingsDialog();
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  assertSitesListed(doc, hosts);
+
+  await addTestData([
+    {
+      usage: 1024,
+      origin: "http://cinema.bar.com",
+      persisted: true,
+    },
+    {
+      usage: 1024,
+      origin: "http://email.bar.com",
+      persisted: false,
+    },
+  ]);
+
+  // Test clearing all site data dynamically
+  let win = gBrowser.selectedBrowser.contentWindow;
+  let frameDoc = win.gSubDialog._topDialog._frame.contentDocument;
+  updatePromise = promiseSiteDataManagerSitesUpdated();
+  let acceptRemovePromise = BrowserTestUtils.promiseAlertDialogOpen("accept");
+  let settingsDialogClosePromise = promiseSettingsDialogClose();
+  let removeAllBtn = frameDoc.getElementById("removeAll");
+  let saveBtn = frameDoc.querySelector("dialog").getButton("accept");
+  removeAllBtn.doCommand();
+  saveBtn.doCommand();
+  await acceptRemovePromise;
+  await settingsDialogClosePromise;
+  await updatePromise;
+  await openSiteDataSettingsDialog();
+  assertAllSitesNotListed(win);
+
+  await SiteDataTestUtils.clear();
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+// Tests clearing search box content via backspace does not delete site data
+add_task(async function () {
+  let hosts = await addTestData([
+    {
+      usage: 1024,
+      origin: "https://account.xyz.com",
+      persisted: true,
+    },
+    {
+      usage: 1024,
+      origin: "https://shopping.xyz.com",
+      persisted: false,
+    },
+    {
+      usage: 1024,
+      origin: "http://cinema.bar.com",
+      persisted: true,
+    },
+    {
+      usage: 1024,
+      origin: "http://email.bar.com",
+      persisted: false,
+    },
+  ]);
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  await openSiteDataSettingsDialog();
+
+  let win = gBrowser.selectedBrowser.contentWindow;
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let frameDoc = win.gSubDialog._topDialog._frame.contentDocument;
+  let searchBox = frameDoc.getElementById("searchBox");
+  searchBox.value = "xyz";
+  searchBox.doCommand();
+  assertSitesListed(
+    doc,
+    hosts.filter(host => host.includes("xyz"))
+  );
+
+  // Make sure the focus is on the search box
+  searchBox.focus();
+  if (AppConstants.platform == "macosx") {
+    EventUtils.synthesizeKey("VK_BACK_SPACE", {}, win);
+  } else {
+    EventUtils.synthesizeKey("VK_DELETE", {}, win);
+  }
+  assertSitesListed(
+    doc,
+    hosts.filter(host => host.includes("xyz"))
+  );
+
+  await SiteDataTestUtils.clear();
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+// Tests remove site data via backspace
+add_task(async function () {
+  let hosts = await addTestData([
+    {
+      usage: 1024,
+      origin: "https://account.xyz.com",
+      persisted: true,
+    },
+    {
+      usage: 1024,
+      origin: "https://shopping.xyz.com",
+      persisted: false,
+    },
+    {
+      usage: 1024,
+      origin: "http://cinema.bar.com",
+      persisted: true,
+    },
+    {
+      usage: 1024,
+      origin: "http://email.bar.com",
+      persisted: false,
+    },
+  ]);
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  await openSiteDataSettingsDialog();
+
+  let win = gBrowser.selectedBrowser.contentWindow;
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let frameDoc = win.gSubDialog._topDialog._frame.contentDocument;
+  // Test initial state
+  assertSitesListed(doc, hosts);
+
+  let sitesList = frameDoc.getElementById("sitesList");
+  let site = sitesList.querySelector(`richlistitem[host="xyz.com"]`);
+  if (site) {
+    // Move the focus from the search box to the list and select an item
+    sitesList.focus();
+    site.click();
+    if (AppConstants.platform == "macosx") {
+      EventUtils.synthesizeKey("VK_BACK_SPACE", {}, win);
+    } else {
+      EventUtils.synthesizeKey("VK_DELETE", {}, win);
+    }
+  }
+
+  assertSitesListed(
+    doc,
+    hosts.filter(host => !host.includes("xyz"))
+  );
+
+  await SiteDataTestUtils.clear();
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/siteData/browser_siteData3.js b/browser/components/preferences/tests/siteData/browser_siteData3.js
new file mode 100644
index 0000000000..9a4aa4cd0a
--- /dev/null
+++ b/browser/components/preferences/tests/siteData/browser_siteData3.js
@@ -0,0 +1,328 @@
+"use strict";
+
+// Test not displaying sites which store 0 byte and don't have persistent storage.
+add_task(async function test_exclusions() {
+  let hosts = await addTestData([
+    {
+      usage: 0,
+      origin: "https://account.xyz.com",
+      persisted: true,
+    },
+    {
+      usage: 0,
+      origin: "https://shopping.xyz.com",
+      persisted: false,
+    },
+    {
+      usage: 1024,
+      origin: "http://cinema.bar.com",
+      persisted: true,
+    },
+    {
+      usage: 1024,
+      origin: "http://email.bar.com",
+      persisted: false,
+    },
+    {
+      usage: 0,
+      origin: "http://cookies.bar.com",
+      cookies: 5,
+      persisted: false,
+    },
+  ]);
+
+  let updatePromise = promiseSiteDataManagerSitesUpdated();
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  await updatePromise;
+  await openSiteDataSettingsDialog();
+  assertSitesListed(
+    doc,
+    hosts.filter(host => host != "shopping.xyz.com")
+  );
+
+  await SiteDataTestUtils.clear();
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+// Test grouping and listing sites across scheme, port and origin attributes by base domain.
+add_task(async function test_grouping() {
+  let quotaUsage = 7000000;
+  let testData = [
+    {
+      usage: quotaUsage,
+      origin: "https://account.xyz.com^userContextId=1",
+      cookies: 2,
+      persisted: true,
+    },
+    {
+      usage: quotaUsage,
+      origin: "https://account.xyz.com",
+      cookies: 1,
+      persisted: false,
+    },
+    {
+      usage: quotaUsage,
+      origin: "https://account.xyz.com:123",
+      cookies: 1,
+      persisted: false,
+    },
+    {
+      usage: quotaUsage,
+      origin: "http://account.xyz.com",
+      cookies: 1,
+      persisted: false,
+    },
+    {
+      usage: quotaUsage,
+      origin: "http://search.xyz.com",
+      cookies: 3,
+      persisted: false,
+    },
+    {
+      usage: quotaUsage,
+      origin: "http://advanced.search.xyz.com",
+      cookies: 3,
+      persisted: true,
+    },
+    {
+      usage: quotaUsage,
+      origin: "http://xyz.com",
+      cookies: 1,
+      persisted: false,
+    },
+  ];
+  await addTestData(testData);
+
+  let updatedPromise = promiseSiteDataManagerSitesUpdated();
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  await updatedPromise;
+  await openSiteDataSettingsDialog();
+  let win = gBrowser.selectedBrowser.contentWindow;
+  let dialogFrame = win.gSubDialog._topDialog._frame;
+  let frameDoc = dialogFrame.contentDocument;
+
+  let siteItems = frameDoc.getElementsByTagName("richlistitem");
+  is(
+    siteItems.length,
+    1,
+    "Should group sites across scheme, port and origin attributes"
+  );
+
+  let columns = siteItems[0].querySelectorAll(".item-box > label");
+
+  let expected = "xyz.com";
+  is(columns[0].value, expected, "Should group and list sites by host");
+
+  let cookieCount = testData.reduce((count, { cookies }) => count + cookies, 0);
+  is(
+    columns[1].value,
+    cookieCount.toString(),
+    "Should group cookies across scheme, port and origin attributes"
+  );
+
+  let [value, unit] = DownloadUtils.convertByteUnits(quotaUsage * 4);
+  let l10nAttributes = frameDoc.l10n.getAttributes(columns[2]);
+  is(
+    l10nAttributes.id,
+    "site-storage-persistent",
+    "Should show the site as persistent if one origin is persistent."
+  );
+  // The shown quota can be slightly larger than the raw data we put in (though it should
+  // never be smaller), but that doesn't really matter to us since we only want to test that
+  // the site data dialog accumulates this into a single column.
+  Assert.greaterOrEqual(
+    parseFloat(l10nAttributes.args.value),
+    parseFloat(value),
+    "Should show the correct accumulated quota size."
+  );
+  is(
+    l10nAttributes.args.unit,
+    unit,
+    "Should show the correct quota size unit."
+  );
+
+  await SiteDataTestUtils.clear();
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+// Test sorting
+add_task(async function test_sorting() {
+  let testData = [
+    {
+      usage: 1024,
+      origin: "https://account.xyz.com",
+      cookies: 6,
+      persisted: true,
+    },
+    {
+      usage: 1024 * 2,
+      origin: "https://books.foo.com",
+      cookies: 0,
+      persisted: false,
+    },
+    {
+      usage: 1024 * 3,
+      origin: "http://cinema.bar.com",
+      cookies: 3,
+      persisted: true,
+    },
+    {
+      usage: 1024 * 3,
+      origin: "http://vod.bar.com",
+      cookies: 2,
+      persisted: false,
+    },
+  ];
+
+  await addTestData(testData);
+
+  let updatePromise = promiseSiteDataManagerSitesUpdated();
+
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  await updatePromise;
+  await openSiteDataSettingsDialog();
+
+  let dialog = content.gSubDialog._topDialog;
+  let dialogFrame = dialog._frame;
+  let frameDoc = dialogFrame.contentDocument;
+  let hostCol = frameDoc.getElementById("hostCol");
+  let usageCol = frameDoc.getElementById("usageCol");
+  let cookiesCol = frameDoc.getElementById("cookiesCol");
+  let sitesList = frameDoc.getElementById("sitesList");
+
+  function getHostOrder() {
+    let siteItems = sitesList.getElementsByTagName("richlistitem");
+    return Array.from(siteItems).map(item => item.getAttribute("host"));
+  }
+
+  // Test default sorting by usage, descending.
+  Assert.deepEqual(
+    getHostOrder(),
+    ["bar.com", "foo.com", "xyz.com"],
+    "Has sorted descending by usage"
+  );
+
+  // Test sorting on the usage column
+  usageCol.click();
+  Assert.deepEqual(
+    getHostOrder(),
+    ["xyz.com", "foo.com", "bar.com"],
+    "Has sorted ascending by usage"
+  );
+  usageCol.click();
+  Assert.deepEqual(
+    getHostOrder(),
+    ["bar.com", "foo.com", "xyz.com"],
+    "Has sorted descending by usage"
+  );
+
+  // Test sorting on the host column
+  hostCol.click();
+  Assert.deepEqual(
+    getHostOrder(),
+    ["bar.com", "foo.com", "xyz.com"],
+    "Has sorted ascending by base domain"
+  );
+  hostCol.click();
+  Assert.deepEqual(
+    getHostOrder(),
+    ["xyz.com", "foo.com", "bar.com"],
+    "Has sorted descending by base domain"
+  );
+
+  // Test sorting on the cookies column
+  cookiesCol.click();
+  Assert.deepEqual(
+    getHostOrder(),
+    ["foo.com", "bar.com", "xyz.com"],
+    "Has sorted ascending by cookies"
+  );
+  cookiesCol.click();
+  Assert.deepEqual(
+    getHostOrder(),
+    ["xyz.com", "bar.com", "foo.com"],
+    "Has sorted descending by cookies"
+  );
+
+  await SiteDataTestUtils.clear();
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
+
+// Test single entry removal
+add_task(async function test_single_entry_removal() {
+  let testData = await addTestData([
+    {
+      usage: 1024,
+      origin: "https://xyz.com",
+      cookies: 6,
+      persisted: true,
+    },
+    {
+      usage: 1024 * 3,
+      origin: "http://bar.com",
+      cookies: 2,
+      persisted: false,
+    },
+  ]);
+
+  let updatePromise = promiseSiteDataManagerSitesUpdated();
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  await updatePromise;
+  await openSiteDataSettingsDialog();
+
+  let dialog = content.gSubDialog._topDialog;
+  let dialogFrame = dialog._frame;
+  let frameDoc = dialogFrame.contentDocument;
+
+  let sitesList = frameDoc.getElementById("sitesList");
+  let host = testData[0];
+  let site = sitesList.querySelector(`richlistitem[host="${host}"]`);
+  sitesList.addItemToSelection(site);
+  frameDoc.getElementById("removeSelected").doCommand();
+  let saveChangesButton = frameDoc.querySelector("dialog").getButton("accept");
+  let dialogOpened = BrowserTestUtils.promiseAlertDialogOpen(
+    null,
+    REMOVE_DIALOG_URL
+  );
+  setTimeout(() => saveChangesButton.doCommand(), 0);
+  let dialogWin = await dialogOpened;
+  let rootElement = dialogWin.document.getElementById(
+    "SiteDataRemoveSelectedDialog"
+  );
+  is(rootElement.classList.length, 1, "There should only be one class set");
+  is(
+    rootElement.classList[0],
+    "single-entry",
+    "The only class set should be single-entry (to hide the list)"
+  );
+  let description = dialogWin.document.getElementById("removing-description");
+  is(
+    description.getAttribute("data-l10n-id"),
+    "site-data-removing-single-desc",
+    "The description for single site should be selected"
+  );
+
+  let removalList = dialogWin.document.getElementById("removalList");
+  is(
+    BrowserTestUtils.isVisible(removalList),
+    false,
+    "The removal list should be invisible"
+  );
+  let removeButton = dialogWin.document
+    .querySelector("dialog")
+    .getButton("accept");
+  let dialogClosed = BrowserTestUtils.waitForEvent(dialogWin, "unload");
+  updatePromise = promiseSiteDataManagerSitesUpdated();
+  removeButton.doCommand();
+  await dialogClosed;
+  await updatePromise;
+  await openSiteDataSettingsDialog();
+
+  dialog = content.gSubDialog._topDialog;
+  dialogFrame = dialog._frame;
+  frameDoc = dialogFrame.contentDocument;
+  assertSitesListed(frameDoc, testData.slice(1));
+  await SiteDataTestUtils.clear();
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/siteData/browser_siteData_multi_select.js b/browser/components/preferences/tests/siteData/browser_siteData_multi_select.js
new file mode 100644
index 0000000000..5ce9d7e1e1
--- /dev/null
+++ b/browser/components/preferences/tests/siteData/browser_siteData_multi_select.js
@@ -0,0 +1,119 @@
+"use strict";
+
+// Test selecting and removing partial sites
+add_task(async function () {
+  await SiteDataTestUtils.clear();
+
+  let hosts = await addTestData([
+    {
+      usage: 1024,
+      origin: "https://127.0.0.1",
+      persisted: false,
+    },
+    {
+      usage: 1024 * 4,
+      origin: "http://cinema.bar.com",
+      persisted: true,
+    },
+    {
+      usage: 1024 * 3,
+      origin: "http://email.bar.com",
+      persisted: false,
+    },
+    {
+      usage: 1024 * 2,
+      origin: "https://s3-us-west-2.amazonaws.com",
+      persisted: true,
+    },
+    {
+      usage: 1024 * 6,
+      origin: "https://account.xyz.com",
+      persisted: true,
+    },
+    {
+      usage: 1024 * 5,
+      origin: "https://shopping.xyz.com",
+      persisted: false,
+    },
+    {
+      usage: 1024 * 5,
+      origin: "https://example.com",
+      persisted: false,
+    },
+    {
+      usage: 1024 * 5,
+      origin: "https://example.net",
+      persisted: false,
+    },
+  ]);
+
+  // Align the order of test hosts with the order of the site data table.
+  hosts.sort();
+
+  let updatePromise = promiseSiteDataManagerSitesUpdated();
+  await openPreferencesViaOpenPreferencesAPI("privacy", { leaveOpen: true });
+  await updatePromise;
+  await openSiteDataSettingsDialog();
+
+  let doc = gBrowser.selectedBrowser.contentDocument;
+
+  // Test the initial state
+  assertSitesListed(doc, hosts);
+  let win = gBrowser.selectedBrowser.contentWindow;
+  let frameDoc = win.gSubDialog._topDialog._frame.contentDocument;
+  let removeBtn = frameDoc.getElementById("removeSelected");
+  is(
+    removeBtn.disabled,
+    true,
+    "Should start with disabled removeSelected button"
+  );
+
+  let hostCol = frameDoc.getElementById("hostCol");
+  hostCol.click();
+
+  let removeDialogOpenPromise = BrowserTestUtils.promiseAlertDialogOpen(
+    "accept",
+    REMOVE_DIALOG_URL
+  );
+  let settingsDialogClosePromise = promiseSettingsDialogClose();
+
+  // Select some sites to remove.
+  let sitesList = frameDoc.getElementById("sitesList");
+  hosts.slice(0, 2).forEach(host => {
+    let site = sitesList.querySelector(`richlistitem[host="${host}"]`);
+    sitesList.addItemToSelection(site);
+  });
+
+  is(removeBtn.disabled, false, "Should enable the removeSelected button");
+  removeBtn.doCommand();
+  is(sitesList.selectedIndex, 0, "Should select next item");
+  assertSitesListed(doc, hosts.slice(2));
+
+  // Select some other sites to remove with Delete.
+  hosts.slice(2, 4).forEach(host => {
+    let site = sitesList.querySelector(`richlistitem[host="${host}"]`);
+    sitesList.addItemToSelection(site);
+  });
+
+  is(removeBtn.disabled, false, "Should enable the removeSelected button");
+  // Move the focus from the search box to the list
+  sitesList.focus();
+  EventUtils.synthesizeKey("VK_DELETE");
+  is(sitesList.selectedIndex, 0, "Should select next item");
+  assertSitesListed(doc, hosts.slice(4));
+
+  updatePromise = promiseSiteDataManagerSitesUpdated();
+  let saveBtn = frameDoc.querySelector("dialog").getButton("accept");
+  saveBtn.doCommand();
+
+  await removeDialogOpenPromise;
+  await settingsDialogClosePromise;
+
+  await updatePromise;
+  await openSiteDataSettingsDialog();
+
+  assertSitesListed(doc, hosts.slice(4));
+
+  await SiteDataTestUtils.clear();
+  BrowserTestUtils.removeTab(gBrowser.selectedTab);
+});
diff --git a/browser/components/preferences/tests/siteData/head.js b/browser/components/preferences/tests/siteData/head.js
new file mode 100644
index 0000000000..2b8a9984a6
--- /dev/null
+++ b/browser/components/preferences/tests/siteData/head.js
@@ -0,0 +1,283 @@
+/* Any copyright is dedicated to the Public Domain.
+ * http://creativecommons.org/publicdomain/zero/1.0/ */
+
+"use strict";
+
+const TEST_QUOTA_USAGE_HOST = "example.com";
+const TEST_QUOTA_USAGE_ORIGIN = "https://" + TEST_QUOTA_USAGE_HOST;
+const TEST_QUOTA_USAGE_URL =
+  getRootDirectory(gTestPath).replace(
+    "chrome://mochitests/content",
+    TEST_QUOTA_USAGE_ORIGIN
+  ) + "/site_data_test.html";
+const TEST_OFFLINE_HOST = "example.org";
+const TEST_OFFLINE_ORIGIN = "https://" + TEST_OFFLINE_HOST;
+const TEST_OFFLINE_URL =
+  getRootDirectory(gTestPath).replace(
+    "chrome://mochitests/content",
+    TEST_OFFLINE_ORIGIN
+  ) + "/offline/offline.html";
+const TEST_SERVICE_WORKER_URL =
+  getRootDirectory(gTestPath).replace(
+    "chrome://mochitests/content",
+    TEST_OFFLINE_ORIGIN
+  ) + "/service_worker_test.html";
+
+const REMOVE_DIALOG_URL =
+  "chrome://browser/content/preferences/dialogs/siteDataRemoveSelected.xhtml";
+
+ChromeUtils.defineESModuleGetters(this, {
+  SiteDataTestUtils: "resource://testing-common/SiteDataTestUtils.sys.mjs",
+});
+
+XPCOMUtils.defineLazyServiceGetter(
+  this,
+  "serviceWorkerManager",
+  "@mozilla.org/serviceworkers/manager;1",
+  "nsIServiceWorkerManager"
+);
+
+function promiseSiteDataManagerSitesUpdated() {
+  return TestUtils.topicObserved("sitedatamanager:sites-updated", () => true);
+}
+
+function is_element_visible(aElement, aMsg) {
+  isnot(aElement, null, "Element should not be null, when checking visibility");
+  ok(!BrowserTestUtils.isHidden(aElement), aMsg);
+}
+
+function is_element_hidden(aElement, aMsg) {
+  isnot(aElement, null, "Element should not be null, when checking visibility");
+  ok(BrowserTestUtils.isHidden(aElement), aMsg);
+}
+
+function promiseLoadSubDialog(aURL) {
+  return new Promise((resolve, reject) => {
+    content.gSubDialog._dialogStack.addEventListener(
+      "dialogopen",
+      function dialogopen(aEvent) {
+        if (
+          aEvent.detail.dialog._frame.contentWindow.location == "about:blank"
+        ) {
+          return;
+        }
+        content.gSubDialog._dialogStack.removeEventListener(
+          "dialogopen",
+          dialogopen
+        );
+
+        is(
+          aEvent.detail.dialog._frame.contentWindow.location.toString(),
+          aURL,
+          "Check the proper URL is loaded"
+        );
+
+        // Check visibility
+        is_element_visible(aEvent.detail.dialog._overlay, "Overlay is visible");
+
+        // Check that stylesheets were injected
+        let expectedStyleSheetURLs =
+          aEvent.detail.dialog._injectedStyleSheets.slice(0);
+        for (let styleSheet of aEvent.detail.dialog._frame.contentDocument
+          .styleSheets) {
+          let i = expectedStyleSheetURLs.indexOf(styleSheet.href);
+          if (i >= 0) {
+            info("found " + styleSheet.href);
+            expectedStyleSheetURLs.splice(i, 1);
+          }
+        }
+        is(
+          expectedStyleSheetURLs.length,
+          0,
+          "All expectedStyleSheetURLs should have been found"
+        );
+
+        // Wait for the next event tick to make sure the remaining part of the
+        // testcase runs after the dialog gets ready for input.
+        executeSoon(() => resolve(aEvent.detail.dialog._frame.contentWindow));
+      }
+    );
+  });
+}
+
+function openPreferencesViaOpenPreferencesAPI(aPane, aOptions) {
+  return new Promise(resolve => {
+    let finalPrefPaneLoaded = TestUtils.topicObserved(
+      "sync-pane-loaded",
+      () => true
+    );
+    gBrowser.selectedTab = BrowserTestUtils.addTab(gBrowser, "about:blank");
+    openPreferences(aPane);
+    let newTabBrowser = gBrowser.selectedBrowser;
+
+    newTabBrowser.addEventListener(
+      "Initialized",
+      function () {
+        newTabBrowser.contentWindow.addEventListener(
+          "load",
+          async function () {
+            let win = gBrowser.contentWindow;
+            let selectedPane = win.history.state;
+            await finalPrefPaneLoaded;
+            if (!aOptions || !aOptions.leaveOpen) {
+              gBrowser.removeCurrentTab();
+            }
+            resolve({ selectedPane });
+          },
+          { once: true }
+        );
+      },
+      { capture: true, once: true }
+    );
+  });
+}
+
+function openSiteDataSettingsDialog() {
+  let doc = gBrowser.selectedBrowser.contentDocument;
+  let settingsBtn = doc.getElementById("siteDataSettings");
+  let dialogOverlay = content.gSubDialog._preloadDialog._overlay;
+  let dialogLoadPromise = promiseLoadSubDialog(
+    "chrome://browser/content/preferences/dialogs/siteDataSettings.xhtml"
+  );
+  let dialogInitPromise = TestUtils.topicObserved(
+    "sitedata-settings-init",
+    () => true
+  );
+  let fullyLoadPromise = Promise.all([
+    dialogLoadPromise,
+    dialogInitPromise,
+  ]).then(() => {
+    is_element_visible(dialogOverlay, "The Settings dialog should be visible");
+  });
+  settingsBtn.doCommand();
+  return fullyLoadPromise;
+}
+
+function promiseSettingsDialogClose() {
+  return new Promise(resolve => {
+    let win = gBrowser.selectedBrowser.contentWindow;
+    let dialogOverlay = win.gSubDialog._topDialog._overlay;
+    let dialogWin = win.gSubDialog._topDialog._frame.contentWindow;
+    dialogWin.addEventListener(
+      "unload",
+      function unload() {
+        if (
+          dialogWin.document.documentURI ===
+          "chrome://browser/content/preferences/dialogs/siteDataSettings.xhtml"
+        ) {
+          is_element_hidden(
+            dialogOverlay,
+            "The Settings dialog should be hidden"
+          );
+          resolve();
+        }
+      },
+      { once: true }
+    );
+  });
+}
+
+function assertSitesListed(doc, hosts) {
+  let frameDoc = content.gSubDialog._topDialog._frame.contentDocument;
+  let removeAllBtn = frameDoc.getElementById("removeAll");
+  let sitesList = frameDoc.getElementById("sitesList");
+  let totalSitesNumber = sitesList.getElementsByTagName("richlistitem").length;
+  is(totalSitesNumber, hosts.length, "Should list the right sites number");
+  hosts.forEach(host => {
+    let site = sitesList.querySelector(`richlistitem[host="${host}"]`);
+    ok(site, `Should list the site of ${host}`);
+  });
+  is(removeAllBtn.disabled, false, "Should enable the removeAllBtn button");
+}
+
+// Counter used by addTestData to generate unique cookie names across function
+// calls.
+let cookieID = 0;
+
+async function addTestData(data) {
+  let hosts = new Set();
+
+  for (let site of data) {
+    is(
+      typeof site.origin,
+      "string",
+      "Passed an origin string into addTestData."
+    );
+    if (site.persisted) {
+      await SiteDataTestUtils.persist(site.origin);
+    }
+
+    if (site.usage) {
+      await SiteDataTestUtils.addToIndexedDB(site.origin, site.usage);
+    }
+
+    for (let i = 0; i < (site.cookies || 0); i++) {
+      SiteDataTestUtils.addToCookies({
+        origin: site.origin,
+        name: `cookie${cookieID++}`,
+      });
+    }
+
+    let principal =
+      Services.scriptSecurityManager.createContentPrincipalFromOrigin(
+        site.origin
+      );
+
+    hosts.add(principal.baseDomain || principal.host);
+  }
+
+  return Array.from(hosts);
+}
+
+function promiseCookiesCleared() {
+  return TestUtils.topicObserved("cookie-changed", subj => {
+    return (
+      subj.QueryInterface(Ci.nsICookieNotification).action ==
+      Ci.nsICookieNotification.ALL_COOKIES_CLEARED
+    );
+  });
+}
+
+async function loadServiceWorkerTestPage(url) {
+  let tab = await BrowserTestUtils.openNewForegroundTab(gBrowser, url);
+  await TestUtils.waitForCondition(() => {
+    return SpecialPowers.spawn(
+      tab.linkedBrowser,
+      [],
+      () =>
+        content.document.body.getAttribute(
+          "data-test-service-worker-registered"
+        ) === "true"
+    );
+  }, `Fail to load service worker test ${url}`);
+  BrowserTestUtils.removeTab(tab);
+}
+
+function promiseServiceWorkersCleared() {
+  return TestUtils.waitForCondition(() => {
+    let serviceWorkers = serviceWorkerManager.getAllRegistrations();
+    if (!serviceWorkers.length) {
+      ok(true, "Cleared all service workers");
+      return true;
+    }
+    return false;
+  }, "Should clear all service workers");
+}
+
+function promiseServiceWorkerRegisteredFor(url) {
+  return TestUtils.waitForCondition(() => {
+    try {
+      let principal =
+        Services.scriptSecurityManager.createContentPrincipalFromOrigin(url);
+      let sw = serviceWorkerManager.getRegistrationByPrincipal(
+        principal,
+        principal.spec
+      );
+      if (sw) {
+        ok(true, `Found the service worker registered for ${url}`);
+        return true;
+      }
+    } catch (e) {}
+    return false;
+  }, `Should register service worker for ${url}`);
+}
diff --git a/browser/components/preferences/tests/siteData/offline/manifest.appcache b/browser/components/preferences/tests/siteData/offline/manifest.appcache
new file mode 100644
index 0000000000..a9287c64e6
--- /dev/null
+++ b/browser/components/preferences/tests/siteData/offline/manifest.appcache
@@ -0,0 +1,3 @@
+CACHE MANIFEST
+# V1
+offline.html
diff --git a/browser/components/preferences/tests/siteData/offline/offline.html b/browser/components/preferences/tests/siteData/offline/offline.html
new file mode 100644
index 0000000000..f76b8a2bce
--- /dev/null
+++ b/browser/components/preferences/tests/siteData/offline/offline.html
@@ -0,0 +1,13 @@
+<!DOCTYPE html>
+<html manifest="manifest.appcache">>
+  <head>
+    <meta charset="utf-8">
+    <meta http-equiv="Cache-Control" content="public" />
+    <meta name="viewport" content="width=device-width, user-scalable=no, initial-scale=1, maximum-scale=1">
+
+  </head>
+
+  <body>
+    <h1>Set up offline appcache Test</h1>
+  </body>
+</html>
diff --git a/browser/components/preferences/tests/siteData/service_worker_test.html b/browser/components/preferences/tests/siteData/service_worker_test.html
new file mode 100644
index 0000000000..56f5173481
--- /dev/null
+++ b/browser/components/preferences/tests/siteData/service_worker_test.html
@@ -0,0 +1,19 @@
+<!DOCTYPE html>
+<html>
+  <head>
+    <meta charset="utf-8">
+    <meta http-equiv="Cache-Control" content="public" />
+    <meta name="viewport" content="width=device-width, user-scalable=no, initial-scale=1, maximum-scale=1">
+
+    <title>Service Worker Test</title>
+
+  </head>
+
+  <body>
+    <h1>Service Worker Test</h1>
+    <script type="text/javascript">
+      navigator.serviceWorker.register("service_worker_test.js")
+               .then(regis => document.body.setAttribute("data-test-service-worker-registered", "true"));
+    </script>
+  </body>
+</html>
diff --git a/browser/components/preferences/tests/siteData/service_worker_test.js b/browser/components/preferences/tests/siteData/service_worker_test.js
new file mode 100644
index 0000000000..2aba167d18
--- /dev/null
+++ b/browser/components/preferences/tests/siteData/service_worker_test.js
@@ -0,0 +1 @@
+// empty worker, always succeed!
diff --git a/browser/components/preferences/tests/siteData/site_data_test.html b/browser/components/preferences/tests/siteData/site_data_test.html
new file mode 100644
index 0000000000..758106b0a5
--- /dev/null
+++ b/browser/components/preferences/tests/siteData/site_data_test.html
@@ -0,0 +1,29 @@
+<!DOCTYPE html>
+<html>
+  <head>
+    <meta charset="utf-8">
+    <meta http-equiv="Cache-Control" content="public" />
+    <meta name="viewport" content="width=device-width, user-scalable=no, initial-scale=1, maximum-scale=1">
+
+    <title>Site Data Test</title>
+
+  </head>
+
+  <body>
+    <h1>Site Data Test</h1>
+    <script type="text/javascript">
+      let request = indexedDB.open("TestDatabase", 1);
+      request.onupgradeneeded = function(e) {
+        let db = e.target.result;
+        db.createObjectStore("TestStore", { keyPath: "id" });
+      };
+      request.onsuccess = function(e) {
+        let db = e.target.result;
+        let tx = db.transaction("TestStore", "readwrite");
+        let store = tx.objectStore("TestStore");
+        tx.oncomplete = () => document.dispatchEvent(new CustomEvent("test-indexedDB-done", {bubbles: true, cancelable: false}));
+        store.put({ id: "test_id", description: "Site Data Test"});
+      };
+    </script>
+  </body>
+</html>
diff --git a/browser/components/preferences/tests/subdialog.xhtml b/browser/components/preferences/tests/subdialog.xhtml
new file mode 100644
index 0000000000..3d5402b4e5
--- /dev/null
+++ b/browser/components/preferences/tests/subdialog.xhtml
@@ -0,0 +1,31 @@
+<?xml version="1.0"?>
+
+<!-- Any copyright is dedicated to the Public Domain.
+   - http://creativecommons.org/publicdomain/zero/1.0/ -->
+
+<window xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+        xmlns:html="http://www.w3.org/1999/xhtml"
+        title="Sample sub-dialog" style="width: 32em; height: 5em;"
+        onload="document.getElementById('textbox').focus();">
+<dialog id="subDialog">
+  <script>
+    document.addEventListener("dialogaccept", acceptSubdialog);
+    function acceptSubdialog() {
+      window.arguments[0].acceptCount++;
+    }
+  </script>
+
+  <linkset>
+    <html:link rel="stylesheet" href="chrome://global/skin/global.css" />
+  </linkset>
+
+  <description id="desc">A sample sub-dialog for testing</description>
+
+  <html:input id="textbox" value="Default text" />
+
+  <separator class="thin"/>
+
+  <button oncommand="window.close();" label="Close" />
+
+</dialog>
+</window>
diff --git a/browser/components/preferences/tests/subdialog2.xhtml b/browser/components/preferences/tests/subdialog2.xhtml
new file mode 100644
index 0000000000..9ae04d5675
--- /dev/null
+++ b/browser/components/preferences/tests/subdialog2.xhtml
@@ -0,0 +1,29 @@
+<?xml version="1.0"?>
+
+<!-- Any copyright is dedicated to the Public Domain.
+   - http://creativecommons.org/publicdomain/zero/1.0/ -->
+
+<?xml-stylesheet href="chrome://global/skin/global.css" type="text/css"?>
+
+<window xmlns="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+        xmlns:html="http://www.w3.org/1999/xhtml"
+        title="Sample sub-dialog #2" style="width: 32em; height: 5em;"
+        onload="document.getElementById('textbox').focus();">
+<dialog id="subDialog">
+  <script>
+    document.addEventListener("dialogaccept", acceptSubdialog);
+    function acceptSubdialog() {
+      window.arguments[0].acceptCount++;
+    }
+  </script>
+
+  <description id="desc">A sample sub-dialog for testing</description>
+
+  <html:input id="textbox" value="Default text" />
+
+  <separator class="thin"/>
+
+  <button oncommand="window.close();" label="Close" />
+
+</dialog>
+</window>
diff --git a/browser/components/preferences/translations.inc.xhtml b/browser/components/preferences/translations.inc.xhtml
new file mode 100644
index 0000000000..5fed03da9b
--- /dev/null
+++ b/browser/components/preferences/translations.inc.xhtml
@@ -0,0 +1,60 @@
+# This Source Code Form is subject to the terms of the Mozilla Public
+# License, v. 2.0. If a copy of the MPL was not distributed with this
+# file, You can obtain one at http://mozilla.org/MPL/2.0/.
+
+<script src="chrome://browser/content/preferences/translations.js"/>
+
+<div xmlns="http://www.w3.org/1999/xhtml"
+     xmlns:xul="http://www.mozilla.org/keymaster/gatekeeper/there.is.only.xul"
+     data-category="paneTranslations">
+
+  <button id="translations-settings-back-button" class="back-button"
+          data-l10n-id="translations-settings-back-button"/>
+
+  <h1 id="translations-settings-header"
+      data-l10n-id="translations-settings-header"/>
+
+  <p id="translations-settings-description" data-l10n-id="translations-settings-description"/>
+
+  <div class="translations-settings-manage-list"
+       id="translations-settings-manage-always-translate-list">
+    <div class="translations-settings-manage-language">
+      <h2 id="translations-settings-always-translate" data-l10n-id="translations-settings-always-translate"/>
+      <xul:menulist id="translations-settings-always-translate-list"
+                    data-l10n-id="translations-settings-add-language-button">
+        <xul:menupopup/>
+      </xul:menulist>
+    </div>
+  </div>
+
+  <div id="translations-settings-manage-never-translate-list"
+       class="translations-settings-manage-list">
+    <div class="translations-settings-manage-language">
+      <h2 id="translations-settings-never-translate" data-l10n-id="translations-settings-never-translate"/>
+      <xul:menulist id="translations-settings-never-translate-list"
+                    data-l10n-id="translations-settings-add-language-button">
+        <xul:menupopup/>
+      </xul:menulist>
+    </div>
+  </div>
+
+  <div id="translations-settings-never-sites-list" class="translations-settings-manage-list" >
+    <div class="translations-settings-manage-list-info" >
+      <h2 id="translations-settings-never-sites-header"
+          data-l10n-id="translations-settings-never-sites-header"/>
+      <p id="translations-settings-never-sites"
+         data-l10n-id="translations-settings-never-sites-description"/>
+    </div>
+  </div>
+
+  <div id="translations-settings-manage-install-list" class="translations-settings-manage-list">
+    <div class="translations-settings-manage-list-info">
+      <h2 id="translations-settings-download-languages"
+          data-l10n-id="translations-settings-download-languages"/>
+      <a is="moz-support-link" class="learnMore"
+          id="download-languages-learn-more"
+          data-l10n-id="translations-settings-download-languages-link"
+          support-page="website-translation"/>
+    </div>
+  </div>
+</div>
diff --git a/browser/components/preferences/translations.js b/browser/components/preferences/translations.js
new file mode 100644
index 0000000000..c9cfe472ac
--- /dev/null
+++ b/browser/components/preferences/translations.js
@@ -0,0 +1,15 @@
+/* This Source Code Form is subject to the terms of the Mozilla Public
+ * License, v. 2.0. If a copy of the MPL was not distributed with this file,
+ * You can obtain one at http://mozilla.org/MPL/2.0/. */
+
+/* import-globals-from preferences.js */
+
+let gTranslationsPane = {
+  init() {
+    document
+      .getElementById("translations-settings-back-button")
+      .addEventListener("click", function () {
+        gotoPref("general");
+      });
+  },
+};
diff --git a/browser/components/preferences/web-appearance-dark.svg b/browser/components/preferences/web-appearance-dark.svg
new file mode 100644
index 0000000000..1f4c1d81c2
--- /dev/null
+++ b/browser/components/preferences/web-appearance-dark.svg
@@ -0,0 +1,17 @@
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+<svg viewBox="0 0 54 42" xmlns="http://www.w3.org/2000/svg">
+<rect width="54" height="42" fill="white"/>
+<rect width="54" height="11" fill="#F9F9FB"/>
+<rect width="54" height="5" fill="#F0F0F4"/>
+<rect x="5" y="2" width="12" height="2" rx="1" fill="#5B5B66"/>
+<rect x="50" y="7" width="2" height="2" rx="1" fill="#5B5B66"/>
+<rect x="2" y="7" width="2" height="2" rx="1" fill="#5B5B66"/>
+<rect x="6" y="7" width="2" height="2" rx="1" fill="#5B5B66"/>
+<rect x="10" y="7" width="38" height="2" rx="1" fill="#5B5B66"/>
+<rect y="11" width="54" height="31" fill="#42414D"/>
+<rect x="4" y="28" width="27" height="2" rx="1" fill="#CFCFD8"/>
+<rect x="4" y="32" width="16" height="2" rx="1" fill="#CFCFD8"/>
+<rect x="4" y="36" width="31" height="2" rx="1" fill="#CFCFD8"/>
+</svg>
diff --git a/browser/components/preferences/web-appearance-light.svg b/browser/components/preferences/web-appearance-light.svg
new file mode 100644
index 0000000000..6d6af7e397
--- /dev/null
+++ b/browser/components/preferences/web-appearance-light.svg
@@ -0,0 +1,17 @@
+<!-- This Source Code Form is subject to the terms of the Mozilla Public
+   - License, v. 2.0. If a copy of the MPL was not distributed with this
+   - file, You can obtain one at http://mozilla.org/MPL/2.0/. -->
+<svg viewBox="0 0 54 42" xmlns="http://www.w3.org/2000/svg">
+<rect width="54" height="42" fill="white"/>
+<rect width="54" height="11" fill="#F9F9FB"/>
+<rect width="54" height="5" fill="#F0F0F4"/>
+<rect x="5" y="2" width="12" height="2" rx="1" fill="#5B5B66"/>
+<rect x="50" y="7" width="2" height="2" rx="1" fill="#5B5B66"/>
+<rect x="2" y="7" width="2" height="2" rx="1" fill="#5B5B66"/>
+<rect x="6" y="7" width="2" height="2" rx="1" fill="#5B5B66"/>
+<rect x="10" y="7" width="38" height="2" rx="1" fill="#5B5B66"/>
+<rect y="11" width="54" height="31" fill="white"/>
+<rect x="4" y="28" width="27" height="2" rx="1" fill="#5B5B66"/>
+<rect x="4" y="32" width="16" height="2" rx="1" fill="#5B5B66"/>
+<rect x="4" y="36" width="31" height="2" rx="1" fill="#5B5B66"/>
+</svg>